sample jsdraw

gistfile1.txt

"<problem>\n  <p>\n    A JSDraw problem lets the user use the JSDraw editor component to draw a\n    new molecule or update an existing drawing and then submit their work.  \n    Answers are specified as SMILES strings.\n  </p>\n  <p>\n    I was trying to draw my favorite molecule, caffeine. Unfortunately,\n    I'm not a very good biochemist. Can you correct my molecule?\n  </p>\n  <jsdrawresponse>\n    <!-- You can set initial state of the editor by including a molfile\n         inside of the jsdraw tag. Take care that indentation is preserved.\n         The molfile format is sensitive to whitespace. -->\n    <jsdraw>\n        JSDraw201081410342D\n\n         12 13  0  0  0  0              0 V2000\n           12.0000   -6.7600    0.0000 N   0  0  0  0  0  0  0\n           10.6490   -5.9800    0.0000 C   0  0  0  0  0  0  0\n           10.6490   -4.4200    0.0000 N   0  0  0  0  0  0  0\n           12.0000   -3.6400    0.0000 C   0  0  0  0  0  0  0\n           13.3510   -4.4200    0.0000 C   0  0  0  0  0  0  0\n           13.3510   -5.9800    0.0000 C   0  0  0  0  0  0  0\n           14.8347   -6.4620    0.0000 N   0  0  0  0  0  0  0\n           15.7515   -5.1998    0.0000 C   0  0  0  0  0  0  0\n           14.8346   -3.9379    0.0000 N   0  0  0  0  0  0  0\n           15.3166   -2.4542    0.0000 C   0  0  0  0  0  0  0\n            9.2980   -3.6400    0.0000 C   0  0  0  0  0  0  0\n            9.2980   -6.7600    0.0000 O   0  0  0  0  0  0  0\n          1  2  1  0  0  0  0\n          2  3  1  0  0  0  0\n          3  4  1  0  0  0  0\n          4  5  1  0  0  0  0\n          5  6  2  0  0  0  0\n          6  1  1  0  0  0  0\n          6  7  1  0  0  0  0\n          7  8  1  0  0  0  0\n          8  9  1  0  0  0  0\n          9  5  1  0  0  0  0\n          9 10  1  0  0  0  0\n          3 11  1  0  0  0  0\n          2 12  1  0  0  0  0\n        M  END\n    </jsdraw>\n    <!-- Multiple answer elements may be specified.  Student's answer will\n         be considered correct if it matches one of the answers. -->\n    <answer>N(C(N(C1=O)C)=O)(C(=C1N2C)N=C2)C</answer>\n  </jsdrawresponse>\n  <solution>\n    <div class=\"detailed-solution\">\n      <p>Explanation</p>\n      <p>\n        Some scholars have hypothesized that the renaissance was made possible\n        by the introduction of coffee to Italy.  Likewise scholars have linked\n        the Enlightenment with the rise of coffee houses in England.  \n      </p>\n    </div>\n  </solution>\n</problem>\n"