qalter -ac tag1=test 18458303
qalter -ac tag2=test 18458303
qalter -ac -ac tag1=test tag2=test 18458303
# -*- coding: utf-8 -*- | |
""" | |
Created on Fri Oct 25 23:16:39 2019 | |
rdkit.Chem.rdFingerprintGenerator.GetRDKitFPGenerator([(int)minPath=1[, (int)maxPath=7[, (bool)useHs=True[, (bool)branchedPaths=True[, (bool)useBondOrder=True[, (bool)countSimulation=False[, (AtomPairsParameters)countBounds=None[, (int)fpSize=2048[, (int)numBitsPerFeature=2[, (AtomPairsParameters)atomInvariantsGenerator=None]]]]]]]]]]) → FingerprintGenerator64 : | |
Get an RDKit fingerprint generator | |
ARGUMENTS: | |
minPath: the minimum path length (in bonds) to be included |
from rdkit import Chem | |
from rdkit.Chem.MolStandardize import rdMolStandardize | |
# works | |
smiles_charged = '[CH2-][Fe++][CH2-]' | |
# does not work | |
smiles_charged = 'CCCC(=O)c1ccc[c-]1[Fe++][c-]1cccc1C(=O)CCC' | |
smiles_charged = 'Cc1ccc(C(=O)C=Cc2ccc[c-]2[Fe++][c-]2cccc2)c(O)c1' |
import numpy as np | |
import pandas as pd | |
from bokeh.models import HoverTool | |
import holoviews as hv | |
hv.notebook_extension("bokeh") |
import numpy as np | |
import pandas as pd | |
from rdkit import Chem | |
from rdkit.Chem import Draw | |
from bokeh.models import HoverTool | |
import holoviews as hv |
Ki_identifier = [ | |
"Adjusted Ki", | |
"Ki", | |
"ki", | |
"Ki app (inact)", | |
"Ki app", | |
"Ki(app)", | |
"Ki_app", | |
u"Ki’", | |
u"Ki”", |
def get_matching_buildingblocks( | |
db: Session, | |
smarts: str, | |
limit: int, | |
) -> List[BuildingBlock]: | |
r = db.query(BBSelect) \ | |
.filter(func.arthor.matches(column('atdb'), smarts)) \ | |
.limit(limit) \ | |
.all() | |
return [ |
<?xml version="1.0" encoding="UTF-8"?><cml xmlns="http://www.chemaxon.com" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:schemaLocation="http://www.chemaxon.com/marvin/help/formats/schema/mrvSchema_6_2_0.xsd" version="ChemAxon file format v6.2, generated by v6.3.0"> | |
<MDocument><MChemicalStruct><reaction><arrow type="DEFAULT" x1="-7.259480881745031" y1="1.3737404197296181" x2="-1.0587105901089497" y2="1.3539927419708107"></arrow><propertyList><property dictRef="NAME" title="NAME"><scalar><![CDATA[Suzuki coupling]]></scalar></property><property dictRef="EXPLAIN_REACTIVITY" title="EXPLAIN_REACTIVITY"><scalar><![CDATA[First reactant is boronic acid, boronic ester, borane, trifluoroborate salt or boronic acid anhydride. Second reactant may be halogenide or organosulfonate or methyl sulfide as these compounds behave as pseudohalogen compounds.]]></scalar></property><property dictRef="EXPLAIN_EXCLUDE" title="EXPLAIN_EXCLUDE"><scalar><![CDATA[Second reactant may not contain such functional groups which co |
import time | |
import numpy as np | |
import pandas as pd | |
from dask.distributed import Client | |
from dask_jobqueue import SGECluster | |
from distributed.deploy.local import LocalCluster | |
from math import sqrt | |
from joblib import Parallel, delayed | |
N_CORES = 2 |
-bash-4.2$ ./Miniconda3-latest-Linux-x86_64.sh -b -p ~/m3_centos7 | |
PREFIX=/home/username/m3_centos7 | |
installing: python-3.7.0-hc3d631a_0 ... | |
Python 3.7.0 (default, Jun 28 2018, 13:15:42) | |
[GCC 7.2.0] | |
installing: ca-certificates-2018.03.07-0 ... | |
installing: conda-env-2.6.0-1 ... | |
installing: libgcc-ng-8.2.0-hdf63c60_1 ... |