Created
November 1, 2022 11:57
-
-
Save harisonmg/47bd5fcce4087fc61e60cac3e7cae3a9 to your computer and use it in GitHub Desktop.
eda-tutorial.ipynb
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| { | |
| "cells": [ | |
| { | |
| "cell_type": "markdown", | |
| "metadata": { | |
| "id": "view-in-github", | |
| "colab_type": "text" | |
| }, | |
| "source": [ | |
| "<a href=\"https://colab.research.google.com/gist/harisonmg/47bd5fcce4087fc61e60cac3e7cae3a9/eda-tutorial.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>" | |
| ] | |
| }, | |
| { | |
| "cell_type": "markdown", | |
| "source": [ | |
| "# Introduction\n", | |
| "The problem at hand is a binary classification problem where we are required to\n", | |
| "predict whether a person will default on a loan, given certain characteristics." | |
| ], | |
| "metadata": { | |
| "id": "26azBfia8KTj" | |
| }, | |
| "id": "26azBfia8KTj" | |
| }, | |
| { | |
| "cell_type": "code", | |
| "source": [ | |
| "# @title Download and extract the data\n", | |
| "%%bash\n", | |
| "rm -rf input && mkdir -p input/icea-lion-credit-risk\n", | |
| "wget --no-check-certificate \"https://docs.google.com/uc?export=download&id=1KM3MnRLpOxUKESUbqFXBmiDoU_cna927\" \\\n", | |
| " -O input/icea-lion-credit-risk.zip\n", | |
| "unzip input/*.zip -d input/icea-lion-credit-risk" | |
| ], | |
| "metadata": { | |
| "cellView": "form", | |
| "colab": { | |
| "base_uri": "https://localhost:8080/" | |
| }, | |
| "id": "rGFLxnbW8PdI", | |
| "outputId": "b91c7438-a35f-4b5c-e4a7-def5df12d137" | |
| }, | |
| "id": "rGFLxnbW8PdI", | |
| "execution_count": 1, | |
| "outputs": [ | |
| { | |
| "output_type": "stream", | |
| "name": "stdout", | |
| "text": [ | |
| "Archive: input/icea-lion-credit-risk.zip\n", | |
| " inflating: input/icea-lion-credit-risk/test.csv \n", | |
| " inflating: input/icea-lion-credit-risk/train.csv \n" | |
| ] | |
| }, | |
| { | |
| "output_type": "stream", | |
| "name": "stderr", | |
| "text": [ | |
| "--2022-11-01 11:51:59-- https://docs.google.com/uc?export=download&id=1KM3MnRLpOxUKESUbqFXBmiDoU_cna927\n", | |
| "Resolving docs.google.com (docs.google.com)... 108.177.126.138, 108.177.126.113, 108.177.126.100, ...\n", | |
| "Connecting to docs.google.com (docs.google.com)|108.177.126.138|:443... connected.\n", | |
| "HTTP request sent, awaiting response... 303 See Other\n", | |
| "Location: https://doc-04-2s-docs.googleusercontent.com/docs/securesc/ha0ro937gcuc7l7deffksulhg5h7mbp1/1c71l1bqd13nk214462lko7uejc94org/1667303475000/13037866814700494090/*/1KM3MnRLpOxUKESUbqFXBmiDoU_cna927?e=download&uuid=b2a94485-215e-4ae8-9516-ee8f805fed3f [following]\n", | |
| "Warning: wildcards not supported in HTTP.\n", | |
| "--2022-11-01 11:52:00-- https://doc-04-2s-docs.googleusercontent.com/docs/securesc/ha0ro937gcuc7l7deffksulhg5h7mbp1/1c71l1bqd13nk214462lko7uejc94org/1667303475000/13037866814700494090/*/1KM3MnRLpOxUKESUbqFXBmiDoU_cna927?e=download&uuid=b2a94485-215e-4ae8-9516-ee8f805fed3f\n", | |
| "Resolving doc-04-2s-docs.googleusercontent.com (doc-04-2s-docs.googleusercontent.com)... 108.177.119.132, 2a00:1450:4013:c00::84\n", | |
| "Connecting to doc-04-2s-docs.googleusercontent.com (doc-04-2s-docs.googleusercontent.com)|108.177.119.132|:443... connected.\n", | |
| "HTTP request sent, awaiting response... 200 OK\n", | |
| "Length: 375610 (367K) [application/zip]\n", | |
| "Saving to: ‘input/icea-lion-credit-risk.zip’\n", | |
| "\n", | |
| " 0K .......... .......... .......... .......... .......... 13% 86.8M 0s\n", | |
| " 50K .......... .......... .......... .......... .......... 27% 41.6M 0s\n", | |
| " 100K .......... .......... .......... .......... .......... 40% 46.3M 0s\n", | |
| " 150K .......... .......... .......... .......... .......... 54% 50.7M 0s\n", | |
| " 200K .......... .......... .......... .......... .......... 68% 60.3M 0s\n", | |
| " 250K .......... .......... .......... .......... .......... 81% 68.4M 0s\n", | |
| " 300K .......... .......... .......... .......... .......... 95% 72.6M 0s\n", | |
| " 350K .......... ...... 100% 43.4M=0.006s\n", | |
| "\n", | |
| "2022-11-01 11:52:00 (56.6 MB/s) - ‘input/icea-lion-credit-risk.zip’ saved [375610/375610]\n", | |
| "\n" | |
| ] | |
| } | |
| ] | |
| }, | |
| { | |
| "cell_type": "code", | |
| "execution_count": 2, | |
| "id": "bd74b3ef", | |
| "metadata": { | |
| "execution": { | |
| "iopub.execute_input": "2022-09-12T05:59:45.196232Z", | |
| "iopub.status.busy": "2022-09-12T05:59:45.195198Z", | |
| "iopub.status.idle": "2022-09-12T05:59:46.298253Z", | |
| "shell.execute_reply": "2022-09-12T05:59:46.297176Z" | |
| }, | |
| "papermill": { | |
| "duration": 1.114627, | |
| "end_time": "2022-09-12T05:59:46.301341", | |
| "exception": false, | |
| "start_time": "2022-09-12T05:59:45.186714", | |
| "status": "completed" | |
| }, | |
| "tags": [], | |
| "cellView": "form", | |
| "id": "bd74b3ef" | |
| }, | |
| "outputs": [], | |
| "source": [ | |
| "# @title Imports\n", | |
| "from pathlib import Path\n", | |
| "\n", | |
| "import numpy as np\n", | |
| "import pandas as pd\n", | |
| "import matplotlib.pyplot as plt\n", | |
| "import seaborn as sns" | |
| ] | |
| }, | |
| { | |
| "cell_type": "code", | |
| "execution_count": 3, | |
| "id": "af126672", | |
| "metadata": { | |
| "execution": { | |
| "iopub.execute_input": "2022-09-12T05:59:46.329591Z", | |
| "iopub.status.busy": "2022-09-12T05:59:46.328846Z", | |
| "iopub.status.idle": "2022-09-12T05:59:46.335768Z", | |
| "shell.execute_reply": "2022-09-12T05:59:46.334500Z" | |
| }, | |
| "papermill": { | |
| "duration": 0.016802, | |
| "end_time": "2022-09-12T05:59:46.337879", | |
| "exception": false, | |
| "start_time": "2022-09-12T05:59:46.321077", | |
| "status": "completed" | |
| }, | |
| "tags": [], | |
| "cellView": "form", | |
| "id": "af126672" | |
| }, | |
| "outputs": [], | |
| "source": [ | |
| "# @title Config\n", | |
| "# file paths\n", | |
| "DATA_DIR = Path(\"./input/icea-lion-credit-risk\")\n", | |
| "\n", | |
| "# data\n", | |
| "TRAIN_DATA = DATA_DIR / \"train.csv\"\n", | |
| "\n", | |
| "# columns in the data\n", | |
| "INDEX_COL = None\n", | |
| "\n", | |
| "TARGET_COL = \"loan_status\"\n", | |
| "\n", | |
| "# random state\n", | |
| "RANDOM_SEED = 42\n", | |
| "\n", | |
| "# plots\n", | |
| "sns.set_theme(context=\"notebook\", style=\"whitegrid\", rc={\"figure.figsize\": (14, 8)})" | |
| ] | |
| }, | |
| { | |
| "cell_type": "code", | |
| "execution_count": 4, | |
| "id": "2ebd5097", | |
| "metadata": { | |
| "execution": { | |
| "iopub.execute_input": "2022-09-12T05:59:46.366153Z", | |
| "iopub.status.busy": "2022-09-12T05:59:46.365461Z", | |
| "iopub.status.idle": "2022-09-12T05:59:46.453095Z", | |
| "shell.execute_reply": "2022-09-12T05:59:46.452146Z" | |
| }, | |
| "papermill": { | |
| "duration": 0.099062, | |
| "end_time": "2022-09-12T05:59:46.456444", | |
| "exception": false, | |
| "start_time": "2022-09-12T05:59:46.357382", | |
| "status": "completed" | |
| }, | |
| "tags": [], | |
| "colab": { | |
| "base_uri": "https://localhost:8080/" | |
| }, | |
| "cellView": "form", | |
| "id": "2ebd5097", | |
| "outputId": "bd3e3c3d-0313-4ac0-a95a-d8354b566d17" | |
| }, | |
| "outputs": [ | |
| { | |
| "output_type": "stream", | |
| "name": "stdout", | |
| "text": [ | |
| "<class 'pandas.core.frame.DataFrame'>\n", | |
| "RangeIndex: 22850 entries, 0 to 22849\n", | |
| "Data columns (total 12 columns):\n", | |
| " # Column Non-Null Count Dtype \n", | |
| "--- ------ -------------- ----- \n", | |
| " 0 person_age 22850 non-null int64 \n", | |
| " 1 person_income 22850 non-null int64 \n", | |
| " 2 person_home_ownership 22850 non-null object \n", | |
| " 3 person_emp_length 22237 non-null float64\n", | |
| " 4 loan_intent 22850 non-null object \n", | |
| " 5 loan_grade 22850 non-null object \n", | |
| " 6 loan_amnt 22850 non-null int64 \n", | |
| " 7 loan_int_rate 20703 non-null float64\n", | |
| " 8 loan_status 22850 non-null int64 \n", | |
| " 9 loan_percent_income 22850 non-null float64\n", | |
| " 10 cb_person_default_on_file 22850 non-null object \n", | |
| " 11 cb_person_cred_hist_length 22850 non-null int64 \n", | |
| "dtypes: float64(3), int64(5), object(4)\n", | |
| "memory usage: 2.1+ MB\n" | |
| ] | |
| } | |
| ], | |
| "source": [ | |
| "# @title Loading the data\n", | |
| "df = pd.read_csv(TRAIN_DATA, index_col=INDEX_COL)\n", | |
| "df.info()" | |
| ] | |
| }, | |
| { | |
| "cell_type": "markdown", | |
| "source": [ | |
| "# Handling duplicate values" | |
| ], | |
| "metadata": { | |
| "id": "gPDYEiw78-vc" | |
| }, | |
| "id": "gPDYEiw78-vc" | |
| }, | |
| { | |
| "cell_type": "code", | |
| "execution_count": 5, | |
| "id": "4c40eb85", | |
| "metadata": { | |
| "execution": { | |
| "iopub.execute_input": "2022-09-12T05:59:46.486563Z", | |
| "iopub.status.busy": "2022-09-12T05:59:46.486092Z", | |
| "iopub.status.idle": "2022-09-12T05:59:46.532654Z", | |
| "shell.execute_reply": "2022-09-12T05:59:46.531657Z" | |
| }, | |
| "papermill": { | |
| "duration": 0.057368, | |
| "end_time": "2022-09-12T05:59:46.534928", | |
| "exception": false, | |
| "start_time": "2022-09-12T05:59:46.477560", | |
| "status": "completed" | |
| }, | |
| "tags": [], | |
| "colab": { | |
| "base_uri": "https://localhost:8080/", | |
| "height": 487 | |
| }, | |
| "cellView": "form", | |
| "id": "4c40eb85", | |
| "outputId": "e7e16c56-5fe2-4b33-f5e7-2c0828802ac2" | |
| }, | |
| "outputs": [ | |
| { | |
| "output_type": "execute_result", | |
| "data": { | |
| "text/plain": [ | |
| " person_age person_income person_home_ownership person_emp_length \\\n", | |
| "11212 23 90000 MORTGAGE 7.0 \n", | |
| "11242 24 10000 RENT 8.0 \n", | |
| "11250 26 20000 MORTGAGE 5.0 \n", | |
| "11267 22 130000 MORTGAGE 3.0 \n", | |
| "11286 23 50000 MORTGAGE 3.0 \n", | |
| "... ... ... ... ... \n", | |
| "20434 30 25000 MORTGAGE NaN \n", | |
| "20441 27 78000 MORTGAGE 1.0 \n", | |
| "20443 32 89000 RENT 0.0 \n", | |
| "22448 42 39996 MORTGAGE 2.0 \n", | |
| "22633 43 11340 RENT 4.0 \n", | |
| "\n", | |
| " loan_intent loan_grade loan_amnt loan_int_rate loan_status \\\n", | |
| "11212 EDUCATION B 8000 10.36 0 \n", | |
| "11242 PERSONAL A 3000 7.90 1 \n", | |
| "11250 MEDICAL A 4800 5.99 0 \n", | |
| "11267 VENTURE B 24250 12.18 0 \n", | |
| "11286 EDUCATION A 10000 6.03 0 \n", | |
| "... ... ... ... ... ... \n", | |
| "20434 DEBTCONSOLIDATION B 7000 10.99 0 \n", | |
| "20441 VENTURE A 5125 8.59 0 \n", | |
| "20443 MEDICAL A 12000 8.94 0 \n", | |
| "22448 HOMEIMPROVEMENT A 2500 5.42 0 \n", | |
| "22633 EDUCATION C 1950 NaN 1 \n", | |
| "\n", | |
| " loan_percent_income cb_person_default_on_file \\\n", | |
| "11212 0.09 N \n", | |
| "11242 0.30 N \n", | |
| "11250 0.24 N \n", | |
| "11267 0.19 N \n", | |
| "11286 0.20 N \n", | |
| "... ... ... \n", | |
| "20434 0.28 N \n", | |
| "20441 0.07 N \n", | |
| "20443 0.13 N \n", | |
| "22448 0.06 N \n", | |
| "22633 0.17 N \n", | |
| "\n", | |
| " cb_person_cred_hist_length \n", | |
| "11212 3 \n", | |
| "11242 3 \n", | |
| "11250 3 \n", | |
| "11267 4 \n", | |
| "11286 4 \n", | |
| "... ... \n", | |
| "20434 10 \n", | |
| "20441 8 \n", | |
| "20443 6 \n", | |
| "22448 12 \n", | |
| "22633 11 \n", | |
| "\n", | |
| "[85 rows x 12 columns]" | |
| ], | |
| "text/html": [ | |
| "\n", | |
| " <div id=\"df-4d4f842f-a7cd-4685-aa9c-995d4230d3df\">\n", | |
| " <div class=\"colab-df-container\">\n", | |
| " <div>\n", | |
| "<style scoped>\n", | |
| " .dataframe tbody tr th:only-of-type {\n", | |
| " vertical-align: middle;\n", | |
| " }\n", | |
| "\n", | |
| " .dataframe tbody tr th {\n", | |
| " vertical-align: top;\n", | |
| " }\n", | |
| "\n", | |
| " .dataframe thead th {\n", | |
| " text-align: right;\n", | |
| " }\n", | |
| "</style>\n", | |
| "<table border=\"1\" class=\"dataframe\">\n", | |
| " <thead>\n", | |
| " <tr style=\"text-align: right;\">\n", | |
| " <th></th>\n", | |
| " <th>person_age</th>\n", | |
| " <th>person_income</th>\n", | |
| " <th>person_home_ownership</th>\n", | |
| " <th>person_emp_length</th>\n", | |
| " <th>loan_intent</th>\n", | |
| " <th>loan_grade</th>\n", | |
| " <th>loan_amnt</th>\n", | |
| " <th>loan_int_rate</th>\n", | |
| " <th>loan_status</th>\n", | |
| " <th>loan_percent_income</th>\n", | |
| " <th>cb_person_default_on_file</th>\n", | |
| " <th>cb_person_cred_hist_length</th>\n", | |
| " </tr>\n", | |
| " </thead>\n", | |
| " <tbody>\n", | |
| " <tr>\n", | |
| " <th>11212</th>\n", | |
| " <td>23</td>\n", | |
| " <td>90000</td>\n", | |
| " <td>MORTGAGE</td>\n", | |
| " <td>7.0</td>\n", | |
| " <td>EDUCATION</td>\n", | |
| " <td>B</td>\n", | |
| " <td>8000</td>\n", | |
| " <td>10.36</td>\n", | |
| " <td>0</td>\n", | |
| " <td>0.09</td>\n", | |
| " <td>N</td>\n", | |
| " <td>3</td>\n", | |
| " </tr>\n", | |
| " <tr>\n", | |
| " <th>11242</th>\n", | |
| " <td>24</td>\n", | |
| " <td>10000</td>\n", | |
| " <td>RENT</td>\n", | |
| " <td>8.0</td>\n", | |
| " <td>PERSONAL</td>\n", | |
| " <td>A</td>\n", | |
| " <td>3000</td>\n", | |
| " <td>7.90</td>\n", | |
| " <td>1</td>\n", | |
| " <td>0.30</td>\n", | |
| " <td>N</td>\n", | |
| " <td>3</td>\n", | |
| " </tr>\n", | |
| " <tr>\n", | |
| " <th>11250</th>\n", | |
| " <td>26</td>\n", | |
| " <td>20000</td>\n", | |
| " <td>MORTGAGE</td>\n", | |
| " <td>5.0</td>\n", | |
| " <td>MEDICAL</td>\n", | |
| " <td>A</td>\n", | |
| " <td>4800</td>\n", | |
| " <td>5.99</td>\n", | |
| " <td>0</td>\n", | |
| " <td>0.24</td>\n", | |
| " <td>N</td>\n", | |
| " <td>3</td>\n", | |
| " </tr>\n", | |
| " <tr>\n", | |
| " <th>11267</th>\n", | |
| " <td>22</td>\n", | |
| " <td>130000</td>\n", | |
| " <td>MORTGAGE</td>\n", | |
| " <td>3.0</td>\n", | |
| " <td>VENTURE</td>\n", | |
| " <td>B</td>\n", | |
| " <td>24250</td>\n", | |
| " <td>12.18</td>\n", | |
| " <td>0</td>\n", | |
| " <td>0.19</td>\n", | |
| " <td>N</td>\n", | |
| " <td>4</td>\n", | |
| " </tr>\n", | |
| " <tr>\n", | |
| " <th>11286</th>\n", | |
| " <td>23</td>\n", | |
| " <td>50000</td>\n", | |
| " <td>MORTGAGE</td>\n", | |
| " <td>3.0</td>\n", | |
| " <td>EDUCATION</td>\n", | |
| " <td>A</td>\n", | |
| " <td>10000</td>\n", | |
| " <td>6.03</td>\n", | |
| " <td>0</td>\n", | |
| " <td>0.20</td>\n", | |
| " <td>N</td>\n", | |
| " <td>4</td>\n", | |
| " </tr>\n", | |
| " <tr>\n", | |
| " <th>...</th>\n", | |
| " <td>...</td>\n", | |
| " <td>...</td>\n", | |
| " <td>...</td>\n", | |
| " <td>...</td>\n", | |
| " <td>...</td>\n", | |
| " <td>...</td>\n", | |
| " <td>...</td>\n", | |
| " <td>...</td>\n", | |
| " <td>...</td>\n", | |
| " <td>...</td>\n", | |
| " <td>...</td>\n", | |
| " <td>...</td>\n", | |
| " </tr>\n", | |
| " <tr>\n", | |
| " <th>20434</th>\n", | |
| " <td>30</td>\n", | |
| " <td>25000</td>\n", | |
| " <td>MORTGAGE</td>\n", | |
| " <td>NaN</td>\n", | |
| " <td>DEBTCONSOLIDATION</td>\n", | |
| " <td>B</td>\n", | |
| " <td>7000</td>\n", | |
| " <td>10.99</td>\n", | |
| " <td>0</td>\n", | |
| " <td>0.28</td>\n", | |
| " <td>N</td>\n", | |
| " <td>10</td>\n", | |
| " </tr>\n", | |
| " <tr>\n", | |
| " <th>20441</th>\n", | |
| " <td>27</td>\n", | |
| " <td>78000</td>\n", | |
| " <td>MORTGAGE</td>\n", | |
| " <td>1.0</td>\n", | |
| " <td>VENTURE</td>\n", | |
| " <td>A</td>\n", | |
| " <td>5125</td>\n", | |
| " <td>8.59</td>\n", | |
| " <td>0</td>\n", | |
| " <td>0.07</td>\n", | |
| " <td>N</td>\n", | |
| " <td>8</td>\n", | |
| " </tr>\n", | |
| " <tr>\n", | |
| " <th>20443</th>\n", | |
| " <td>32</td>\n", | |
| " <td>89000</td>\n", | |
| " <td>RENT</td>\n", | |
| " <td>0.0</td>\n", | |
| " <td>MEDICAL</td>\n", | |
| " <td>A</td>\n", | |
| " <td>12000</td>\n", | |
| " <td>8.94</td>\n", | |
| " <td>0</td>\n", | |
| " <td>0.13</td>\n", | |
| " <td>N</td>\n", | |
| " <td>6</td>\n", | |
| " </tr>\n", | |
| " <tr>\n", | |
| " <th>22448</th>\n", | |
| " <td>42</td>\n", | |
| " <td>39996</td>\n", | |
| " <td>MORTGAGE</td>\n", | |
| " <td>2.0</td>\n", | |
| " <td>HOMEIMPROVEMENT</td>\n", | |
| " <td>A</td>\n", | |
| " <td>2500</td>\n", | |
| " <td>5.42</td>\n", | |
| " <td>0</td>\n", | |
| " <td>0.06</td>\n", | |
| " <td>N</td>\n", | |
| " <td>12</td>\n", | |
| " </tr>\n", | |
| " <tr>\n", | |
| " <th>22633</th>\n", | |
| " <td>43</td>\n", | |
| " <td>11340</td>\n", | |
| " <td>RENT</td>\n", | |
| " <td>4.0</td>\n", | |
| " <td>EDUCATION</td>\n", | |
| " <td>C</td>\n", | |
| " <td>1950</td>\n", | |
| " <td>NaN</td>\n", | |
| " <td>1</td>\n", | |
| " <td>0.17</td>\n", | |
| " <td>N</td>\n", | |
| " <td>11</td>\n", | |
| " </tr>\n", | |
| " </tbody>\n", | |
| "</table>\n", | |
| "<p>85 rows × 12 columns</p>\n", | |
| "</div>\n", | |
| " <button class=\"colab-df-convert\" onclick=\"convertToInteractive('df-4d4f842f-a7cd-4685-aa9c-995d4230d3df')\"\n", | |
| " title=\"Convert this dataframe to an interactive table.\"\n", | |
| " style=\"display:none;\">\n", | |
| " \n", | |
| " <svg xmlns=\"http://www.w3.org/2000/svg\" height=\"24px\"viewBox=\"0 0 24 24\"\n", | |
| " width=\"24px\">\n", | |
| " <path d=\"M0 0h24v24H0V0z\" fill=\"none\"/>\n", | |
| " <path d=\"M18.56 5.44l.94 2.06.94-2.06 2.06-.94-2.06-.94-.94-2.06-.94 2.06-2.06.94zm-11 1L8.5 8.5l.94-2.06 2.06-.94-2.06-.94L8.5 2.5l-.94 2.06-2.06.94zm10 10l.94 2.06.94-2.06 2.06-.94-2.06-.94-.94-2.06-.94 2.06-2.06.94z\"/><path d=\"M17.41 7.96l-1.37-1.37c-.4-.4-.92-.59-1.43-.59-.52 0-1.04.2-1.43.59L10.3 9.45l-7.72 7.72c-.78.78-.78 2.05 0 2.83L4 21.41c.39.39.9.59 1.41.59.51 0 1.02-.2 1.41-.59l7.78-7.78 2.81-2.81c.8-.78.8-2.07 0-2.86zM5.41 20L4 18.59l7.72-7.72 1.47 1.35L5.41 20z\"/>\n", | |
| " </svg>\n", | |
| " </button>\n", | |
| " \n", | |
| " <style>\n", | |
| " .colab-df-container {\n", | |
| " display:flex;\n", | |
| " flex-wrap:wrap;\n", | |
| " gap: 12px;\n", | |
| " }\n", | |
| "\n", | |
| " .colab-df-convert {\n", | |
| " background-color: #E8F0FE;\n", | |
| " border: none;\n", | |
| " border-radius: 50%;\n", | |
| " cursor: pointer;\n", | |
| " display: none;\n", | |
| " fill: #1967D2;\n", | |
| " height: 32px;\n", | |
| " padding: 0 0 0 0;\n", | |
| " width: 32px;\n", | |
| " }\n", | |
| "\n", | |
| " .colab-df-convert:hover {\n", | |
| " background-color: #E2EBFA;\n", | |
| " box-shadow: 0px 1px 2px rgba(60, 64, 67, 0.3), 0px 1px 3px 1px rgba(60, 64, 67, 0.15);\n", | |
| " fill: #174EA6;\n", | |
| " }\n", | |
| "\n", | |
| " [theme=dark] .colab-df-convert {\n", | |
| " background-color: #3B4455;\n", | |
| " fill: #D2E3FC;\n", | |
| " }\n", | |
| "\n", | |
| " [theme=dark] .colab-df-convert:hover {\n", | |
| " background-color: #434B5C;\n", | |
| " box-shadow: 0px 1px 3px 1px rgba(0, 0, 0, 0.15);\n", | |
| " filter: drop-shadow(0px 1px 2px rgba(0, 0, 0, 0.3));\n", | |
| " fill: #FFFFFF;\n", | |
| " }\n", | |
| " </style>\n", | |
| "\n", | |
| " <script>\n", | |
| " const buttonEl =\n", | |
| " document.querySelector('#df-4d4f842f-a7cd-4685-aa9c-995d4230d3df button.colab-df-convert');\n", | |
| " buttonEl.style.display =\n", | |
| " google.colab.kernel.accessAllowed ? 'block' : 'none';\n", | |
| "\n", | |
| " async function convertToInteractive(key) {\n", | |
| " const element = document.querySelector('#df-4d4f842f-a7cd-4685-aa9c-995d4230d3df');\n", | |
| " const dataTable =\n", | |
| " await google.colab.kernel.invokeFunction('convertToInteractive',\n", | |
| " [key], {});\n", | |
| " if (!dataTable) return;\n", | |
| "\n", | |
| " const docLinkHtml = 'Like what you see? Visit the ' +\n", | |
| " '<a target=\"_blank\" href=https://colab.research.google.com/notebooks/data_table.ipynb>data table notebook</a>'\n", | |
| " + ' to learn more about interactive tables.';\n", | |
| " element.innerHTML = '';\n", | |
| " dataTable['output_type'] = 'display_data';\n", | |
| " await google.colab.output.renderOutput(dataTable, element);\n", | |
| " const docLink = document.createElement('div');\n", | |
| " docLink.innerHTML = docLinkHtml;\n", | |
| " element.appendChild(docLink);\n", | |
| " }\n", | |
| " </script>\n", | |
| " </div>\n", | |
| " </div>\n", | |
| " " | |
| ] | |
| }, | |
| "metadata": {}, | |
| "execution_count": 5 | |
| } | |
| ], | |
| "source": [ | |
| "# @title View duplicates\n", | |
| "df.loc[df.duplicated()]" | |
| ] | |
| }, | |
| { | |
| "cell_type": "code", | |
| "execution_count": 6, | |
| "id": "b720563e", | |
| "metadata": { | |
| "execution": { | |
| "iopub.execute_input": "2022-09-12T05:59:46.552344Z", | |
| "iopub.status.busy": "2022-09-12T05:59:46.551661Z", | |
| "iopub.status.idle": "2022-09-12T05:59:46.586018Z", | |
| "shell.execute_reply": "2022-09-12T05:59:46.584779Z" | |
| }, | |
| "papermill": { | |
| "duration": 0.045601, | |
| "end_time": "2022-09-12T05:59:46.588597", | |
| "exception": false, | |
| "start_time": "2022-09-12T05:59:46.542996", | |
| "status": "completed" | |
| }, | |
| "tags": [], | |
| "colab": { | |
| "base_uri": "https://localhost:8080/" | |
| }, | |
| "cellView": "form", | |
| "id": "b720563e", | |
| "outputId": "d49713da-ae92-4750-b0a9-787ab783bf96" | |
| }, | |
| "outputs": [ | |
| { | |
| "output_type": "stream", | |
| "name": "stdout", | |
| "text": [ | |
| "Duplicate rows: 0\n" | |
| ] | |
| } | |
| ], | |
| "source": [ | |
| "# @title Remove duplicates\n", | |
| "df.drop_duplicates(inplace=True)\n", | |
| "print(f\"Duplicate rows: {df.duplicated().sum()}\")" | |
| ] | |
| }, | |
| { | |
| "cell_type": "markdown", | |
| "id": "ae0d20ca", | |
| "metadata": { | |
| "papermill": { | |
| "duration": 0.007598, | |
| "end_time": "2022-09-12T05:59:46.603719", | |
| "exception": false, | |
| "start_time": "2022-09-12T05:59:46.596121", | |
| "status": "completed" | |
| }, | |
| "tags": [], | |
| "id": "ae0d20ca" | |
| }, | |
| "source": [ | |
| "# Pandas profiling report" | |
| ] | |
| }, | |
| { | |
| "cell_type": "code", | |
| "source": [ | |
| "# @title Update `pandas-profiling`\n", | |
| "import sys\n", | |
| "!{sys.executable} -m pip install -U -q pandas-profiling" | |
| ], | |
| "metadata": { | |
| "colab": { | |
| "base_uri": "https://localhost:8080/" | |
| }, | |
| "cellView": "form", | |
| "id": "eehWypa8AA2n", | |
| "outputId": "222cd310-d7d3-413d-df96-fd6db131c856" | |
| }, | |
| "id": "eehWypa8AA2n", | |
| "execution_count": 7, | |
| "outputs": [ | |
| { | |
| "output_type": "stream", | |
| "name": "stdout", | |
| "text": [ | |
| "\u001b[K |████████████████████████████████| 315 kB 15.5 MB/s \n", | |
| "\u001b[K |████████████████████████████████| 102 kB 59.8 MB/s \n", | |
| "\u001b[K |████████████████████████████████| 9.8 MB 57.7 MB/s \n", | |
| "\u001b[K |████████████████████████████████| 62 kB 1.5 MB/s \n", | |
| "\u001b[K |████████████████████████████████| 690 kB 60.0 MB/s \n", | |
| "\u001b[K |████████████████████████████████| 4.7 MB 43.0 MB/s \n", | |
| "\u001b[K |████████████████████████████████| 296 kB 82.6 MB/s \n", | |
| "\u001b[?25h Building wheel for htmlmin (setup.py) ... \u001b[?25l\u001b[?25hdone\n" | |
| ] | |
| } | |
| ] | |
| }, | |
| { | |
| "cell_type": "code", | |
| "execution_count": 8, | |
| "id": "122000c8", | |
| "metadata": { | |
| "execution": { | |
| "iopub.execute_input": "2022-09-12T05:59:46.620249Z", | |
| "iopub.status.busy": "2022-09-12T05:59:46.619873Z", | |
| "iopub.status.idle": "2022-09-12T06:00:18.907654Z", | |
| "shell.execute_reply": "2022-09-12T06:00:18.906694Z" | |
| }, | |
| "papermill": { | |
| "duration": 32.428354, | |
| "end_time": "2022-09-12T06:00:19.039481", | |
| "exception": false, | |
| "start_time": "2022-09-12T05:59:46.611127", | |
| "status": "completed" | |
| }, | |
| "tags": [], | |
| "colab": { | |
| "base_uri": "https://localhost:8080/", | |
| "height": 917, | |
| "referenced_widgets": [ | |
| "d445b31947904736b4b7061d4ed3e521", | |
| "331bcf65f31a4349920274b927d6b2ea", | |
| "072f40704d6f4ab1977bb284b45c6ef1", | |
| "e8d36102b888491d9d3d269411a468a8", | |
| "a3828c5ba178446fb885c46a334052c1", | |
| "ff3a5f7422ff4d83a5b476a84333eb99", | |
| "aee060ebbe094ba19cb778a1b103a040", | |
| "80f5feb15e0943ca90a285246d84595c", | |
| "e197bfb531b2481dbbf834336073cb6b", | |
| "f2a2d9f6c3424075bdf81f8b17c0c643", | |
| "e4d0797138954d239d305926650489c1", | |
| "6019871eed00462b9e019fe9d11427d3", | |
| "655450d9229c461c8bf97e2f1130b044", | |
| "7ab11a849341445f97aed9eec7e1d793", | |
| "9114aa3e93e44474beda5fbb8bf6c501", | |
| "861fe9fd1d7c4859a458d3c4fc738adb", | |
| "af13f05ccef34398bca6899bd0cf9b6f", | |
| "528ee518274d4358ad88fce5f9386a06", | |
| "6409d9a65fef47be9daacefd99ded690", | |
| "767de48ea00b4fe09c373e2cb81f30d3", | |
| "c2450693068141a9a2a5f5348f3dd511", | |
| "4c9b2e4003e845ac99fbf4ee7c952d46", | |
| "83d5bcb417fb4f47b435c8cd8f02482e", | |
| "97a1f04425db49fca907b4575a20e81d", | |
| "5a3e444535104a7c91158840d2a14004", | |
| "c8b1146d1c174c7f91e114134ab484dc", | |
| "e9bd369f7854419aaa80c8728eb8d1eb", | |
| "eb7bcfe90a8c483284fe52c64618803b", | |
| "a034bdfdc7c74498b7e0fd0cba3d76a5", | |
| "a75f7c1b230741dea991c742c452036d", | |
| "3ed7dfceff554d7e962c49a547bc2ae6", | |
| "e1fd038310814e71aae8379e034399d6", | |
| "aab1ed9d64f342d0a495b5c1743744af" | |
| ] | |
| }, | |
| "cellView": "form", | |
| "id": "122000c8", | |
| "outputId": "668da640-ed92-4508-8013-8b836bb0a830" | |
| }, | |
| "outputs": [ | |
| { | |
| "output_type": "display_data", | |
| "data": { | |
| "text/plain": [ | |
| "Summarize dataset: 0%| | 0/5 [00:00<?, ?it/s]" | |
| ], | |
| "application/vnd.jupyter.widget-view+json": { | |
| "version_major": 2, | |
| "version_minor": 0, | |
| "model_id": "d445b31947904736b4b7061d4ed3e521" | |
| } | |
| }, | |
| "metadata": {} | |
| }, | |
| { | |
| "output_type": "display_data", | |
| "data": { | |
| "text/plain": [ | |
| "Generate report structure: 0%| | 0/1 [00:00<?, ?it/s]" | |
| ], | |
| "application/vnd.jupyter.widget-view+json": { | |
| "version_major": 2, | |
| "version_minor": 0, | |
| "model_id": "6019871eed00462b9e019fe9d11427d3" | |
| } | |
| }, | |
| "metadata": {} | |
| }, | |
| { | |
| "output_type": "display_data", | |
| "data": { | |
| "text/plain": [ | |
| "Render HTML: 0%| | 0/1 [00:00<?, ?it/s]" | |
| ], | |
| "application/vnd.jupyter.widget-view+json": { | |
| "version_major": 2, | |
| "version_minor": 0, | |
| "model_id": "83d5bcb417fb4f47b435c8cd8f02482e" | |
| } | |
| }, | |
| "metadata": {} | |
| }, | |
| { | |
| "output_type": "display_data", | |
| "data": { | |
| "text/plain": [ | |
| "<IPython.core.display.HTML object>" | |
| ], | |
| "text/html": [ | |
| "<iframe width=\"100%\" height=\"800px\" srcdoc=\"<!doctype html><html lang=en><head><meta charset=utf-8><meta name=viewport content="width=device-width, initial-scale=1, shrink-to-fit=no"><meta name=description content="Profile report generated by YData! Visit us at https://ydata.ai"><meta name=author content="YData and the open source community."><meta name=generator content="Pandas Profiling v3.4.0"><meta name=url content=https://github.com/ydataai/pandas-profiling><meta name=date content="2022-11-01 11:52:34.986518"><title>Pandas Profiling Report</title><style>\n", | |
| "/*!\n", | |
| " * Bootstrap v3.3.7 (http://getbootstrap.com)\n", | |
| " * Copyright 2011-2016 Twitter, Inc.\n", | |
| " * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n", | |
| " *//*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */html{font-family:sans-serif;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%}body{margin:0}article,aside,details,figcaption,figure,footer,header,hgroup,main,menu,nav,section,summary{display:block}audio,canvas,progress,video{display:inline-block;vertical-align:baseline}audio:not([controls]){display:none;height:0}[hidden],template{display:none}a{background-color:transparent}a:active,a:hover{outline:0}abbr[title]{border-bottom:1px dotted}b,strong{font-weight:700}dfn{font-style:italic}h1{margin:.67em 0;font-size:2em}mark{color:#000;background:#ff0}small{font-size:80%}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sup{top:-.5em}sub{bottom:-.25em}img{border:0}svg:not(:root){overflow:hidden}figure{margin:1em 40px}hr{height:0;-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box}pre{overflow:auto}code,kbd,pre,samp{font-family:monospace,monospace;font-size:1em}button,input,optgroup,select,textarea{margin:0;font:inherit;color:inherit}button{overflow:visible}button,select{text-transform:none}button,html input[type=button],input[type=reset],input[type=submit]{-webkit-appearance:button;cursor:pointer}button[disabled],html input[disabled]{cursor:default}button::-moz-focus-inner,input::-moz-focus-inner{padding:0;border:0}input{line-height:normal}input[type=checkbox],input[type=radio]{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;padding:0}input[type=number]::-webkit-inner-spin-button,input[type=number]::-webkit-outer-spin-button{height:auto}input[type=search]{-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;-webkit-appearance:textfield}input[type=search]::-webkit-search-cancel-button,input[type=search]::-webkit-search-decoration{-webkit-appearance:none}fieldset{padding:.35em .625em .75em;margin:0 2px;border:1px solid silver}legend{padding:0;border:0}textarea{overflow:auto}optgroup{font-weight:700}table{border-spacing:0;border-collapse:collapse}td,th{padding:0}/*! Source: https://github.com/h5bp/html5-boilerplate/blob/master/src/css/main.css */@media print{*,:after,:before{color:#000!important;text-shadow:none!important;background:0 0!important;-webkit-box-shadow:none!important;box-shadow:none!important}a,a:visited{text-decoration:underline}a[href]:after{content:" (" attr(href) ")"}abbr[title]:after{content:" (" attr(title) ")"}a[href^="javascript:"]:after,a[href^="#"]:after{content:""}blockquote,pre{border:1px solid #999;page-break-inside:avoid}thead{display:table-header-group}img,tr{page-break-inside:avoid}img{max-width:100%!important}h2,h3,p{orphans:3;widows:3}h2,h3{page-break-after:avoid}.navbar{display:none}.btn>.caret,.dropup>.btn>.caret{border-top-color:#000!important}.label{border:1px solid #000}.table{border-collapse:collapse!important}.table td,.table th{background-color:#fff!important}.table-bordered td,.table-bordered th{border:1px solid #ddd!important}}@font-face{font-family:'Glyphicons Halflings';src:url(../fonts/glyphicons-halflings-regular.eot);src:url(../fonts/glyphicons-halflings-regular.eot?#iefix) format('embedded-opentype'),url(../fonts/glyphicons-halflings-regular.woff2) format('woff2'),url(../fonts/glyphicons-halflings-regular.woff) format('woff'),url(../fonts/glyphicons-halflings-regular.ttf) format('truetype'),url(../fonts/glyphicons-halflings-regular.svg#glyphicons_halflingsregular) format('svg')}.glyphicon{position:relative;top:1px;display:inline-block;font-family:'Glyphicons Halflings';font-style:normal;font-weight:400;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.glyphicon-asterisk:before{content:"\\002a"}.glyphicon-plus:before{content:"\\002b"}.glyphicon-eur:before,.glyphicon-euro:before{content:"\\20ac"}.glyphicon-minus:before{content:"\\2212"}.glyphicon-cloud:before{content:"\\2601"}.glyphicon-envelope:before{content:"\\2709"}.glyphicon-pencil:before{content:"\\270f"}.glyphicon-glass:before{content:"\\e001"}.glyphicon-music:before{content:"\\e002"}.glyphicon-search:before{content:"\\e003"}.glyphicon-heart:before{content:"\\e005"}.glyphicon-star:before{content:"\\e006"}.glyphicon-star-empty:before{content:"\\e007"}.glyphicon-user:before{content:"\\e008"}.glyphicon-film:before{content:"\\e009"}.glyphicon-th-large:before{content:"\\e010"}.glyphicon-th:before{content:"\\e011"}.glyphicon-th-list:before{content:"\\e012"}.glyphicon-ok:before{content:"\\e013"}.glyphicon-remove:before{content:"\\e014"}.glyphicon-zoom-in:before{content:"\\e015"}.glyphicon-zoom-out:before{content:"\\e016"}.glyphicon-off:before{content:"\\e017"}.glyphicon-signal:before{content:"\\e018"}.glyphicon-cog:before{content:"\\e019"}.glyphicon-trash:before{content:"\\e020"}.glyphicon-home:before{content:"\\e021"}.glyphicon-file:before{content:"\\e022"}.glyphicon-time:before{content:"\\e023"}.glyphicon-road:before{content:"\\e024"}.glyphicon-download-alt:before{content:"\\e025"}.glyphicon-download:before{content:"\\e026"}.glyphicon-upload:before{content:"\\e027"}.glyphicon-inbox:before{content:"\\e028"}.glyphicon-play-circle:before{content:"\\e029"}.glyphicon-repeat:before{content:"\\e030"}.glyphicon-refresh:before{content:"\\e031"}.glyphicon-list-alt:before{content:"\\e032"}.glyphicon-lock:before{content:"\\e033"}.glyphicon-flag:before{content:"\\e034"}.glyphicon-headphones:before{content:"\\e035"}.glyphicon-volume-off:before{content:"\\e036"}.glyphicon-volume-down:before{content:"\\e037"}.glyphicon-volume-up:before{content:"\\e038"}.glyphicon-qrcode:before{content:"\\e039"}.glyphicon-barcode:before{content:"\\e040"}.glyphicon-tag:before{content:"\\e041"}.glyphicon-tags:before{content:"\\e042"}.glyphicon-book:before{content:"\\e043"}.glyphicon-bookmark:before{content:"\\e044"}.glyphicon-print:before{content:"\\e045"}.glyphicon-camera:before{content:"\\e046"}.glyphicon-font:before{content:"\\e047"}.glyphicon-bold:before{content:"\\e048"}.glyphicon-italic:before{content:"\\e049"}.glyphicon-text-height:before{content:"\\e050"}.glyphicon-text-width:before{content:"\\e051"}.glyphicon-align-left:before{content:"\\e052"}.glyphicon-align-center:before{content:"\\e053"}.glyphicon-align-right:before{content:"\\e054"}.glyphicon-align-justify:before{content:"\\e055"}.glyphicon-list:before{content:"\\e056"}.glyphicon-indent-left:before{content:"\\e057"}.glyphicon-indent-right:before{content:"\\e058"}.glyphicon-facetime-video:before{content:"\\e059"}.glyphicon-picture:before{content:"\\e060"}.glyphicon-map-marker:before{content:"\\e062"}.glyphicon-adjust:before{content:"\\e063"}.glyphicon-tint:before{content:"\\e064"}.glyphicon-edit:before{content:"\\e065"}.glyphicon-share:before{content:"\\e066"}.glyphicon-check:before{content:"\\e067"}.glyphicon-move:before{content:"\\e068"}.glyphicon-step-backward:before{content:"\\e069"}.glyphicon-fast-backward:before{content:"\\e070"}.glyphicon-backward:before{content:"\\e071"}.glyphicon-play:before{content:"\\e072"}.glyphicon-pause:before{content:"\\e073"}.glyphicon-stop:before{content:"\\e074"}.glyphicon-forward:before{content:"\\e075"}.glyphicon-fast-forward:before{content:"\\e076"}.glyphicon-step-forward:before{content:"\\e077"}.glyphicon-eject:before{content:"\\e078"}.glyphicon-chevron-left:before{content:"\\e079"}.glyphicon-chevron-right:before{content:"\\e080"}.glyphicon-plus-sign:before{content:"\\e081"}.glyphicon-minus-sign:before{content:"\\e082"}.glyphicon-remove-sign:before{content:"\\e083"}.glyphicon-ok-sign:before{content:"\\e084"}.glyphicon-question-sign:before{content:"\\e085"}.glyphicon-info-sign:before{content:"\\e086"}.glyphicon-screenshot:before{content:"\\e087"}.glyphicon-remove-circle:before{content:"\\e088"}.glyphicon-ok-circle:before{content:"\\e089"}.glyphicon-ban-circle:before{content:"\\e090"}.glyphicon-arrow-left:before{content:"\\e091"}.glyphicon-arrow-right:before{content:"\\e092"}.glyphicon-arrow-up:before{content:"\\e093"}.glyphicon-arrow-down:before{content:"\\e094"}.glyphicon-share-alt:before{content:"\\e095"}.glyphicon-resize-full:before{content:"\\e096"}.glyphicon-resize-small:before{content:"\\e097"}.glyphicon-exclamation-sign:before{content:"\\e101"}.glyphicon-gift:before{content:"\\e102"}.glyphicon-leaf:before{content:"\\e103"}.glyphicon-fire:before{content:"\\e104"}.glyphicon-eye-open:before{content:"\\e105"}.glyphicon-eye-close:before{content:"\\e106"}.glyphicon-warning-sign:before{content:"\\e107"}.glyphicon-plane:before{content:"\\e108"}.glyphicon-calendar:before{content:"\\e109"}.glyphicon-random:before{content:"\\e110"}.glyphicon-comment:before{content:"\\e111"}.glyphicon-magnet:before{content:"\\e112"}.glyphicon-chevron-up:before{content:"\\e113"}.glyphicon-chevron-down:before{content:"\\e114"}.glyphicon-retweet:before{content:"\\e115"}.glyphicon-shopping-cart:before{content:"\\e116"}.glyphicon-folder-close:before{content:"\\e117"}.glyphicon-folder-open:before{content:"\\e118"}.glyphicon-resize-vertical:before{content:"\\e119"}.glyphicon-resize-horizontal:before{content:"\\e120"}.glyphicon-hdd:before{content:"\\e121"}.glyphicon-bullhorn:before{content:"\\e122"}.glyphicon-bell:before{content:"\\e123"}.glyphicon-certificate:before{content:"\\e124"}.glyphicon-thumbs-up:before{content:"\\e125"}.glyphicon-thumbs-down:before{content:"\\e126"}.glyphicon-hand-right:before{content:"\\e127"}.glyphicon-hand-left:before{content:"\\e128"}.glyphicon-hand-up:before{content:"\\e129"}.glyphicon-hand-down:before{content:"\\e130"}.glyphicon-circle-arrow-right:before{content:"\\e131"}.glyphicon-circle-arrow-left:before{content:"\\e132"}.glyphicon-circle-arrow-up:before{content:"\\e133"}.glyphicon-circle-arrow-down:before{content:"\\e134"}.glyphicon-globe:before{content:"\\e135"}.glyphicon-wrench:before{content:"\\e136"}.glyphicon-tasks:before{content:"\\e137"}.glyphicon-filter:before{content:"\\e138"}.glyphicon-briefcase:before{content:"\\e139"}.glyphicon-fullscreen:before{content:"\\e140"}.glyphicon-dashboard:before{content:"\\e141"}.glyphicon-paperclip:before{content:"\\e142"}.glyphicon-heart-empty:before{content:"\\e143"}.glyphicon-link:before{content:"\\e144"}.glyphicon-phone:before{content:"\\e145"}.glyphicon-pushpin:before{content:"\\e146"}.glyphicon-usd:before{content:"\\e148"}.glyphicon-gbp:before{content:"\\e149"}.glyphicon-sort:before{content:"\\e150"}.glyphicon-sort-by-alphabet:before{content:"\\e151"}.glyphicon-sort-by-alphabet-alt:before{content:"\\e152"}.glyphicon-sort-by-order:before{content:"\\e153"}.glyphicon-sort-by-order-alt:before{content:"\\e154"}.glyphicon-sort-by-attributes:before{content:"\\e155"}.glyphicon-sort-by-attributes-alt:before{content:"\\e156"}.glyphicon-unchecked:before{content:"\\e157"}.glyphicon-expand:before{content:"\\e158"}.glyphicon-collapse-down:before{content:"\\e159"}.glyphicon-collapse-up:before{content:"\\e160"}.glyphicon-log-in:before{content:"\\e161"}.glyphicon-flash:before{content:"\\e162"}.glyphicon-log-out:before{content:"\\e163"}.glyphicon-new-window:before{content:"\\e164"}.glyphicon-record:before{content:"\\e165"}.glyphicon-save:before{content:"\\e166"}.glyphicon-open:before{content:"\\e167"}.glyphicon-saved:before{content:"\\e168"}.glyphicon-import:before{content:"\\e169"}.glyphicon-export:before{content:"\\e170"}.glyphicon-send:before{content:"\\e171"}.glyphicon-floppy-disk:before{content:"\\e172"}.glyphicon-floppy-saved:before{content:"\\e173"}.glyphicon-floppy-remove:before{content:"\\e174"}.glyphicon-floppy-save:before{content:"\\e175"}.glyphicon-floppy-open:before{content:"\\e176"}.glyphicon-credit-card:before{content:"\\e177"}.glyphicon-transfer:before{content:"\\e178"}.glyphicon-cutlery:before{content:"\\e179"}.glyphicon-header:before{content:"\\e180"}.glyphicon-compressed:before{content:"\\e181"}.glyphicon-earphone:before{content:"\\e182"}.glyphicon-phone-alt:before{content:"\\e183"}.glyphicon-tower:before{content:"\\e184"}.glyphicon-stats:before{content:"\\e185"}.glyphicon-sd-video:before{content:"\\e186"}.glyphicon-hd-video:before{content:"\\e187"}.glyphicon-subtitles:before{content:"\\e188"}.glyphicon-sound-stereo:before{content:"\\e189"}.glyphicon-sound-dolby:before{content:"\\e190"}.glyphicon-sound-5-1:before{content:"\\e191"}.glyphicon-sound-6-1:before{content:"\\e192"}.glyphicon-sound-7-1:before{content:"\\e193"}.glyphicon-copyright-mark:before{content:"\\e194"}.glyphicon-registration-mark:before{content:"\\e195"}.glyphicon-cloud-download:before{content:"\\e197"}.glyphicon-cloud-upload:before{content:"\\e198"}.glyphicon-tree-conifer:before{content:"\\e199"}.glyphicon-tree-deciduous:before{content:"\\e200"}.glyphicon-cd:before{content:"\\e201"}.glyphicon-save-file:before{content:"\\e202"}.glyphicon-open-file:before{content:"\\e203"}.glyphicon-level-up:before{content:"\\e204"}.glyphicon-copy:before{content:"\\e205"}.glyphicon-paste:before{content:"\\e206"}.glyphicon-alert:before{content:"\\e209"}.glyphicon-equalizer:before{content:"\\e210"}.glyphicon-king:before{content:"\\e211"}.glyphicon-queen:before{content:"\\e212"}.glyphicon-pawn:before{content:"\\e213"}.glyphicon-bishop:before{content:"\\e214"}.glyphicon-knight:before{content:"\\e215"}.glyphicon-baby-formula:before{content:"\\e216"}.glyphicon-tent:before{content:"\\26fa"}.glyphicon-blackboard:before{content:"\\e218"}.glyphicon-bed:before{content:"\\e219"}.glyphicon-apple:before{content:"\\f8ff"}.glyphicon-erase:before{content:"\\e221"}.glyphicon-hourglass:before{content:"\\231b"}.glyphicon-lamp:before{content:"\\e223"}.glyphicon-duplicate:before{content:"\\e224"}.glyphicon-piggy-bank:before{content:"\\e225"}.glyphicon-scissors:before{content:"\\e226"}.glyphicon-bitcoin:before{content:"\\e227"}.glyphicon-btc:before{content:"\\e227"}.glyphicon-xbt:before{content:"\\e227"}.glyphicon-yen:before{content:"\\00a5"}.glyphicon-jpy:before{content:"\\00a5"}.glyphicon-ruble:before{content:"\\20bd"}.glyphicon-rub:before{content:"\\20bd"}.glyphicon-scale:before{content:"\\e230"}.glyphicon-ice-lolly:before{content:"\\e231"}.glyphicon-ice-lolly-tasted:before{content:"\\e232"}.glyphicon-education:before{content:"\\e233"}.glyphicon-option-horizontal:before{content:"\\e234"}.glyphicon-option-vertical:before{content:"\\e235"}.glyphicon-menu-hamburger:before{content:"\\e236"}.glyphicon-modal-window:before{content:"\\e237"}.glyphicon-oil:before{content:"\\e238"}.glyphicon-grain:before{content:"\\e239"}.glyphicon-sunglasses:before{content:"\\e240"}.glyphicon-text-size:before{content:"\\e241"}.glyphicon-text-color:before{content:"\\e242"}.glyphicon-text-background:before{content:"\\e243"}.glyphicon-object-align-top:before{content:"\\e244"}.glyphicon-object-align-bottom:before{content:"\\e245"}.glyphicon-object-align-horizontal:before{content:"\\e246"}.glyphicon-object-align-left:before{content:"\\e247"}.glyphicon-object-align-vertical:before{content:"\\e248"}.glyphicon-object-align-right:before{content:"\\e249"}.glyphicon-triangle-right:before{content:"\\e250"}.glyphicon-triangle-left:before{content:"\\e251"}.glyphicon-triangle-bottom:before{content:"\\e252"}.glyphicon-triangle-top:before{content:"\\e253"}.glyphicon-console:before{content:"\\e254"}.glyphicon-superscript:before{content:"\\e255"}.glyphicon-subscript:before{content:"\\e256"}.glyphicon-menu-left:before{content:"\\e257"}.glyphicon-menu-right:before{content:"\\e258"}.glyphicon-menu-down:before{content:"\\e259"}.glyphicon-menu-up:before{content:"\\e260"}*{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}:after,:before{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}html{font-size:10px;-webkit-tap-highlight-color:rgba(0,0,0,0)}body{font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:14px;line-height:1.42857143;color:#333;background-color:#fff}button,input,select,textarea{font-family:inherit;font-size:inherit;line-height:inherit}a{color:#337ab7;text-decoration:none}a:focus,a:hover{color:#23527c;text-decoration:underline}a:focus{outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}figure{margin:0}img{vertical-align:middle}.carousel-inner>.item>a>img,.carousel-inner>.item>img,.img-responsive,.thumbnail a>img,.thumbnail>img{display:block;max-width:100%;height:auto}.img-rounded{border-radius:6px}.img-thumbnail{display:inline-block;max-width:100%;height:auto;padding:4px;line-height:1.42857143;background-color:#fff;border:1px solid #ddd;border-radius:4px;-webkit-transition:all .2s ease-in-out;-o-transition:all .2s ease-in-out;transition:all .2s ease-in-out}.img-circle{border-radius:50%}hr{margin-top:20px;margin-bottom:20px;border:0;border-top:1px solid #eee}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto}[role=button]{cursor:pointer}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{font-family:inherit;font-weight:500;line-height:1.1;color:inherit}.h1 .small,.h1 small,.h2 .small,.h2 small,.h3 .small,.h3 small,.h4 .small,.h4 small,.h5 .small,.h5 small,.h6 .small,.h6 small,h1 .small,h1 small,h2 .small,h2 small,h3 .small,h3 small,h4 .small,h4 small,h5 .small,h5 small,h6 .small,h6 small{font-weight:400;line-height:1;color:#777}.h1,.h2,.h3,h1,h2,h3{margin-top:20px;margin-bottom:10px}.h1 .small,.h1 small,.h2 .small,.h2 small,.h3 .small,.h3 small,h1 .small,h1 small,h2 .small,h2 small,h3 .small,h3 small{font-size:65%}.h4,.h5,.h6,h4,h5,h6{margin-top:10px;margin-bottom:10px}.h4 .small,.h4 small,.h5 .small,.h5 small,.h6 .small,.h6 small,h4 .small,h4 small,h5 .small,h5 small,h6 .small,h6 small{font-size:75%}.h1,h1{font-size:36px}.h2,h2{font-size:30px}.h3,h3{font-size:24px}.h4,h4{font-size:18px}.h5,h5{font-size:14px}.h6,h6{font-size:12px}p{margin:0 0 10px}.lead{margin-bottom:20px;font-size:16px;font-weight:300;line-height:1.4}@media (min-width:768px){.lead{font-size:21px}}.small,small{font-size:85%}.mark,mark{padding:.2em;background-color:#fcf8e3}.text-left{text-align:left}.text-right{text-align:right}.text-center{text-align:center}.text-justify{text-align:justify}.text-nowrap{white-space:nowrap}.text-lowercase{text-transform:lowercase}.text-uppercase{text-transform:uppercase}.text-capitalize{text-transform:capitalize}.text-muted{color:#777}.text-primary{color:#337ab7}a.text-primary:focus,a.text-primary:hover{color:#286090}.text-success{color:#3c763d}a.text-success:focus,a.text-success:hover{color:#2b542c}.text-info{color:#31708f}a.text-info:focus,a.text-info:hover{color:#245269}.text-warning{color:#8a6d3b}a.text-warning:focus,a.text-warning:hover{color:#66512c}.text-danger{color:#a94442}a.text-danger:focus,a.text-danger:hover{color:#843534}.bg-primary{color:#fff;background-color:#337ab7}a.bg-primary:focus,a.bg-primary:hover{background-color:#286090}.bg-success{background-color:#dff0d8}a.bg-success:focus,a.bg-success:hover{background-color:#c1e2b3}.bg-info{background-color:#d9edf7}a.bg-info:focus,a.bg-info:hover{background-color:#afd9ee}.bg-warning{background-color:#fcf8e3}a.bg-warning:focus,a.bg-warning:hover{background-color:#f7ecb5}.bg-danger{background-color:#f2dede}a.bg-danger:focus,a.bg-danger:hover{background-color:#e4b9b9}.page-header{padding-bottom:9px;margin:40px 0 20px;border-bottom:1px solid #eee}ol,ul{margin-top:0;margin-bottom:10px}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;margin-left:-5px;list-style:none}.list-inline>li{display:inline-block;padding-right:5px;padding-left:5px}dl{margin-top:0;margin-bottom:20px}dd,dt{line-height:1.42857143}dt{font-weight:700}dd{margin-left:0}@media (min-width:768px){.dl-horizontal dt{float:left;width:160px;overflow:hidden;clear:left;text-align:right;text-overflow:ellipsis;white-space:nowrap}.dl-horizontal dd{margin-left:180px}}abbr[data-original-title],abbr[title]{cursor:help;border-bottom:1px dotted #777}.initialism{font-size:90%;text-transform:uppercase}blockquote{padding:10px 20px;margin:0 0 20px;font-size:17.5px;border-left:5px solid #eee}blockquote ol:last-child,blockquote p:last-child,blockquote ul:last-child{margin-bottom:0}blockquote .small,blockquote footer,blockquote small{display:block;font-size:80%;line-height:1.42857143;color:#777}blockquote .small:before,blockquote footer:before,blockquote small:before{content:'\\2014 \\00A0'}.blockquote-reverse,blockquote.pull-right{padding-right:15px;padding-left:0;text-align:right;border-right:5px solid #eee;border-left:0}.blockquote-reverse .small:before,.blockquote-reverse footer:before,.blockquote-reverse small:before,blockquote.pull-right .small:before,blockquote.pull-right footer:before,blockquote.pull-right small:before{content:''}.blockquote-reverse .small:after,.blockquote-reverse footer:after,.blockquote-reverse small:after,blockquote.pull-right .small:after,blockquote.pull-right footer:after,blockquote.pull-right small:after{content:'\\00A0 \\2014'}address{margin-bottom:20px;font-style:normal;line-height:1.42857143}code,kbd,pre,samp{font-family:Menlo,Monaco,Consolas,"Courier New",monospace}code{padding:2px 4px;font-size:90%;color:#c7254e;background-color:#f9f2f4;border-radius:4px}kbd{padding:2px 4px;font-size:90%;color:#fff;background-color:#333;border-radius:3px;-webkit-box-shadow:inset 0 -1px 0 rgba(0,0,0,.25);box-shadow:inset 0 -1px 0 rgba(0,0,0,.25)}kbd kbd{padding:0;font-size:100%;font-weight:700;-webkit-box-shadow:none;box-shadow:none}pre{display:block;padding:9.5px;margin:0 0 10px;font-size:13px;line-height:1.42857143;color:#333;word-break:break-all;word-wrap:break-word;background-color:#f5f5f5;border:1px solid #ccc;border-radius:4px}pre code{padding:0;font-size:inherit;color:inherit;white-space:pre-wrap;background-color:transparent;border-radius:0}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width:768px){.container{width:750px}}@media (min-width:992px){.container{width:970px}}@media (min-width:1200px){.container{width:1170px}}.container-fluid{padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}.row{margin-right:-15px;margin-left:-15px}.col-lg-1,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-md-1,.col-md-10,.col-md-11,.col-md-12,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-sm-1,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-xs-1,.col-xs-10,.col-xs-11,.col-xs-12,.col-xs-2,.col-xs-3,.col-xs-4,.col-xs-5,.col-xs-6,.col-xs-7,.col-xs-8,.col-xs-9{position:relative;min-height:1px;padding-right:15px;padding-left:15px}.col-xs-1,.col-xs-10,.col-xs-11,.col-xs-12,.col-xs-2,.col-xs-3,.col-xs-4,.col-xs-5,.col-xs-6,.col-xs-7,.col-xs-8,.col-xs-9{float:left}.col-xs-12{width:100%}.col-xs-11{width:91.66666667%}.col-xs-10{width:83.33333333%}.col-xs-9{width:75%}.col-xs-8{width:66.66666667%}.col-xs-7{width:58.33333333%}.col-xs-6{width:50%}.col-xs-5{width:41.66666667%}.col-xs-4{width:33.33333333%}.col-xs-3{width:25%}.col-xs-2{width:16.66666667%}.col-xs-1{width:8.33333333%}.col-xs-pull-12{right:100%}.col-xs-pull-11{right:91.66666667%}.col-xs-pull-10{right:83.33333333%}.col-xs-pull-9{right:75%}.col-xs-pull-8{right:66.66666667%}.col-xs-pull-7{right:58.33333333%}.col-xs-pull-6{right:50%}.col-xs-pull-5{right:41.66666667%}.col-xs-pull-4{right:33.33333333%}.col-xs-pull-3{right:25%}.col-xs-pull-2{right:16.66666667%}.col-xs-pull-1{right:8.33333333%}.col-xs-pull-0{right:auto}.col-xs-push-12{left:100%}.col-xs-push-11{left:91.66666667%}.col-xs-push-10{left:83.33333333%}.col-xs-push-9{left:75%}.col-xs-push-8{left:66.66666667%}.col-xs-push-7{left:58.33333333%}.col-xs-push-6{left:50%}.col-xs-push-5{left:41.66666667%}.col-xs-push-4{left:33.33333333%}.col-xs-push-3{left:25%}.col-xs-push-2{left:16.66666667%}.col-xs-push-1{left:8.33333333%}.col-xs-push-0{left:auto}.col-xs-offset-12{margin-left:100%}.col-xs-offset-11{margin-left:91.66666667%}.col-xs-offset-10{margin-left:83.33333333%}.col-xs-offset-9{margin-left:75%}.col-xs-offset-8{margin-left:66.66666667%}.col-xs-offset-7{margin-left:58.33333333%}.col-xs-offset-6{margin-left:50%}.col-xs-offset-5{margin-left:41.66666667%}.col-xs-offset-4{margin-left:33.33333333%}.col-xs-offset-3{margin-left:25%}.col-xs-offset-2{margin-left:16.66666667%}.col-xs-offset-1{margin-left:8.33333333%}.col-xs-offset-0{margin-left:0}@media (min-width:768px){.col-sm-1,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9{float:left}.col-sm-12{width:100%}.col-sm-11{width:91.66666667%}.col-sm-10{width:83.33333333%}.col-sm-9{width:75%}.col-sm-8{width:66.66666667%}.col-sm-7{width:58.33333333%}.col-sm-6{width:50%}.col-sm-5{width:41.66666667%}.col-sm-4{width:33.33333333%}.col-sm-3{width:25%}.col-sm-2{width:16.66666667%}.col-sm-1{width:8.33333333%}.col-sm-pull-12{right:100%}.col-sm-pull-11{right:91.66666667%}.col-sm-pull-10{right:83.33333333%}.col-sm-pull-9{right:75%}.col-sm-pull-8{right:66.66666667%}.col-sm-pull-7{right:58.33333333%}.col-sm-pull-6{right:50%}.col-sm-pull-5{right:41.66666667%}.col-sm-pull-4{right:33.33333333%}.col-sm-pull-3{right:25%}.col-sm-pull-2{right:16.66666667%}.col-sm-pull-1{right:8.33333333%}.col-sm-pull-0{right:auto}.col-sm-push-12{left:100%}.col-sm-push-11{left:91.66666667%}.col-sm-push-10{left:83.33333333%}.col-sm-push-9{left:75%}.col-sm-push-8{left:66.66666667%}.col-sm-push-7{left:58.33333333%}.col-sm-push-6{left:50%}.col-sm-push-5{left:41.66666667%}.col-sm-push-4{left:33.33333333%}.col-sm-push-3{left:25%}.col-sm-push-2{left:16.66666667%}.col-sm-push-1{left:8.33333333%}.col-sm-push-0{left:auto}.col-sm-offset-12{margin-left:100%}.col-sm-offset-11{margin-left:91.66666667%}.col-sm-offset-10{margin-left:83.33333333%}.col-sm-offset-9{margin-left:75%}.col-sm-offset-8{margin-left:66.66666667%}.col-sm-offset-7{margin-left:58.33333333%}.col-sm-offset-6{margin-left:50%}.col-sm-offset-5{margin-left:41.66666667%}.col-sm-offset-4{margin-left:33.33333333%}.col-sm-offset-3{margin-left:25%}.col-sm-offset-2{margin-left:16.66666667%}.col-sm-offset-1{margin-left:8.33333333%}.col-sm-offset-0{margin-left:0}}@media (min-width:992px){.col-md-1,.col-md-10,.col-md-11,.col-md-12,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9{float:left}.col-md-12{width:100%}.col-md-11{width:91.66666667%}.col-md-10{width:83.33333333%}.col-md-9{width:75%}.col-md-8{width:66.66666667%}.col-md-7{width:58.33333333%}.col-md-6{width:50%}.col-md-5{width:41.66666667%}.col-md-4{width:33.33333333%}.col-md-3{width:25%}.col-md-2{width:16.66666667%}.col-md-1{width:8.33333333%}.col-md-pull-12{right:100%}.col-md-pull-11{right:91.66666667%}.col-md-pull-10{right:83.33333333%}.col-md-pull-9{right:75%}.col-md-pull-8{right:66.66666667%}.col-md-pull-7{right:58.33333333%}.col-md-pull-6{right:50%}.col-md-pull-5{right:41.66666667%}.col-md-pull-4{right:33.33333333%}.col-md-pull-3{right:25%}.col-md-pull-2{right:16.66666667%}.col-md-pull-1{right:8.33333333%}.col-md-pull-0{right:auto}.col-md-push-12{left:100%}.col-md-push-11{left:91.66666667%}.col-md-push-10{left:83.33333333%}.col-md-push-9{left:75%}.col-md-push-8{left:66.66666667%}.col-md-push-7{left:58.33333333%}.col-md-push-6{left:50%}.col-md-push-5{left:41.66666667%}.col-md-push-4{left:33.33333333%}.col-md-push-3{left:25%}.col-md-push-2{left:16.66666667%}.col-md-push-1{left:8.33333333%}.col-md-push-0{left:auto}.col-md-offset-12{margin-left:100%}.col-md-offset-11{margin-left:91.66666667%}.col-md-offset-10{margin-left:83.33333333%}.col-md-offset-9{margin-left:75%}.col-md-offset-8{margin-left:66.66666667%}.col-md-offset-7{margin-left:58.33333333%}.col-md-offset-6{margin-left:50%}.col-md-offset-5{margin-left:41.66666667%}.col-md-offset-4{margin-left:33.33333333%}.col-md-offset-3{margin-left:25%}.col-md-offset-2{margin-left:16.66666667%}.col-md-offset-1{margin-left:8.33333333%}.col-md-offset-0{margin-left:0}}@media (min-width:1200px){.col-lg-1,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9{float:left}.col-lg-12{width:100%}.col-lg-11{width:91.66666667%}.col-lg-10{width:83.33333333%}.col-lg-9{width:75%}.col-lg-8{width:66.66666667%}.col-lg-7{width:58.33333333%}.col-lg-6{width:50%}.col-lg-5{width:41.66666667%}.col-lg-4{width:33.33333333%}.col-lg-3{width:25%}.col-lg-2{width:16.66666667%}.col-lg-1{width:8.33333333%}.col-lg-pull-12{right:100%}.col-lg-pull-11{right:91.66666667%}.col-lg-pull-10{right:83.33333333%}.col-lg-pull-9{right:75%}.col-lg-pull-8{right:66.66666667%}.col-lg-pull-7{right:58.33333333%}.col-lg-pull-6{right:50%}.col-lg-pull-5{right:41.66666667%}.col-lg-pull-4{right:33.33333333%}.col-lg-pull-3{right:25%}.col-lg-pull-2{right:16.66666667%}.col-lg-pull-1{right:8.33333333%}.col-lg-pull-0{right:auto}.col-lg-push-12{left:100%}.col-lg-push-11{left:91.66666667%}.col-lg-push-10{left:83.33333333%}.col-lg-push-9{left:75%}.col-lg-push-8{left:66.66666667%}.col-lg-push-7{left:58.33333333%}.col-lg-push-6{left:50%}.col-lg-push-5{left:41.66666667%}.col-lg-push-4{left:33.33333333%}.col-lg-push-3{left:25%}.col-lg-push-2{left:16.66666667%}.col-lg-push-1{left:8.33333333%}.col-lg-push-0{left:auto}.col-lg-offset-12{margin-left:100%}.col-lg-offset-11{margin-left:91.66666667%}.col-lg-offset-10{margin-left:83.33333333%}.col-lg-offset-9{margin-left:75%}.col-lg-offset-8{margin-left:66.66666667%}.col-lg-offset-7{margin-left:58.33333333%}.col-lg-offset-6{margin-left:50%}.col-lg-offset-5{margin-left:41.66666667%}.col-lg-offset-4{margin-left:33.33333333%}.col-lg-offset-3{margin-left:25%}.col-lg-offset-2{margin-left:16.66666667%}.col-lg-offset-1{margin-left:8.33333333%}.col-lg-offset-0{margin-left:0}}table{background-color:transparent}caption{padding-top:8px;padding-bottom:8px;color:#777;text-align:left}th{text-align:left}.table{width:100%;max-width:100%;margin-bottom:20px}.table>tbody>tr>td,.table>tbody>tr>th,.table>tfoot>tr>td,.table>tfoot>tr>th,.table>thead>tr>td,.table>thead>tr>th{padding:8px;line-height:1.42857143;vertical-align:top;border-top:1px solid #ddd}.table>thead>tr>th{vertical-align:bottom;border-bottom:2px solid #ddd}.table>caption+thead>tr:first-child>td,.table>caption+thead>tr:first-child>th,.table>colgroup+thead>tr:first-child>td,.table>colgroup+thead>tr:first-child>th,.table>thead:first-child>tr:first-child>td,.table>thead:first-child>tr:first-child>th{border-top:0}.table>tbody+tbody{border-top:2px solid #ddd}.table .table{background-color:#fff}.table-condensed>tbody>tr>td,.table-condensed>tbody>tr>th,.table-condensed>tfoot>tr>td,.table-condensed>tfoot>tr>th,.table-condensed>thead>tr>td,.table-condensed>thead>tr>th{padding:5px}.table-bordered{border:1px solid #ddd}.table-bordered>tbody>tr>td,.table-bordered>tbody>tr>th,.table-bordered>tfoot>tr>td,.table-bordered>tfoot>tr>th,.table-bordered>thead>tr>td,.table-bordered>thead>tr>th{border:1px solid #ddd}.table-bordered>thead>tr>td,.table-bordered>thead>tr>th{border-bottom-width:2px}.table-striped>tbody>tr:nth-of-type(odd){background-color:#f9f9f9}.table-hover>tbody>tr:hover{background-color:#f5f5f5}table col[class*=col-]{position:static;display:table-column;float:none}table td[class*=col-],table th[class*=col-]{position:static;display:table-cell;float:none}.table>tbody>tr.active>td,.table>tbody>tr.active>th,.table>tbody>tr>td.active,.table>tbody>tr>th.active,.table>tfoot>tr.active>td,.table>tfoot>tr.active>th,.table>tfoot>tr>td.active,.table>tfoot>tr>th.active,.table>thead>tr.active>td,.table>thead>tr.active>th,.table>thead>tr>td.active,.table>thead>tr>th.active{background-color:#f5f5f5}.table-hover>tbody>tr.active:hover>td,.table-hover>tbody>tr.active:hover>th,.table-hover>tbody>tr:hover>.active,.table-hover>tbody>tr>td.active:hover,.table-hover>tbody>tr>th.active:hover{background-color:#e8e8e8}.table>tbody>tr.success>td,.table>tbody>tr.success>th,.table>tbody>tr>td.success,.table>tbody>tr>th.success,.table>tfoot>tr.success>td,.table>tfoot>tr.success>th,.table>tfoot>tr>td.success,.table>tfoot>tr>th.success,.table>thead>tr.success>td,.table>thead>tr.success>th,.table>thead>tr>td.success,.table>thead>tr>th.success{background-color:#dff0d8}.table-hover>tbody>tr.success:hover>td,.table-hover>tbody>tr.success:hover>th,.table-hover>tbody>tr:hover>.success,.table-hover>tbody>tr>td.success:hover,.table-hover>tbody>tr>th.success:hover{background-color:#d0e9c6}.table>tbody>tr.info>td,.table>tbody>tr.info>th,.table>tbody>tr>td.info,.table>tbody>tr>th.info,.table>tfoot>tr.info>td,.table>tfoot>tr.info>th,.table>tfoot>tr>td.info,.table>tfoot>tr>th.info,.table>thead>tr.info>td,.table>thead>tr.info>th,.table>thead>tr>td.info,.table>thead>tr>th.info{background-color:#d9edf7}.table-hover>tbody>tr.info:hover>td,.table-hover>tbody>tr.info:hover>th,.table-hover>tbody>tr:hover>.info,.table-hover>tbody>tr>td.info:hover,.table-hover>tbody>tr>th.info:hover{background-color:#c4e3f3}.table>tbody>tr.warning>td,.table>tbody>tr.warning>th,.table>tbody>tr>td.warning,.table>tbody>tr>th.warning,.table>tfoot>tr.warning>td,.table>tfoot>tr.warning>th,.table>tfoot>tr>td.warning,.table>tfoot>tr>th.warning,.table>thead>tr.warning>td,.table>thead>tr.warning>th,.table>thead>tr>td.warning,.table>thead>tr>th.warning{background-color:#fcf8e3}.table-hover>tbody>tr.warning:hover>td,.table-hover>tbody>tr.warning:hover>th,.table-hover>tbody>tr:hover>.warning,.table-hover>tbody>tr>td.warning:hover,.table-hover>tbody>tr>th.warning:hover{background-color:#faf2cc}.table>tbody>tr.danger>td,.table>tbody>tr.danger>th,.table>tbody>tr>td.danger,.table>tbody>tr>th.danger,.table>tfoot>tr.danger>td,.table>tfoot>tr.danger>th,.table>tfoot>tr>td.danger,.table>tfoot>tr>th.danger,.table>thead>tr.danger>td,.table>thead>tr.danger>th,.table>thead>tr>td.danger,.table>thead>tr>th.danger{background-color:#f2dede}.table-hover>tbody>tr.danger:hover>td,.table-hover>tbody>tr.danger:hover>th,.table-hover>tbody>tr:hover>.danger,.table-hover>tbody>tr>td.danger:hover,.table-hover>tbody>tr>th.danger:hover{background-color:#ebcccc}.table-responsive{min-height:.01%;overflow-x:auto}@media screen and (max-width:767px){.table-responsive{width:100%;margin-bottom:15px;overflow-y:hidden;-ms-overflow-style:-ms-autohiding-scrollbar;border:1px solid #ddd}.table-responsive>.table{margin-bottom:0}.table-responsive>.table>tbody>tr>td,.table-responsive>.table>tbody>tr>th,.table-responsive>.table>tfoot>tr>td,.table-responsive>.table>tfoot>tr>th,.table-responsive>.table>thead>tr>td,.table-responsive>.table>thead>tr>th{white-space:nowrap}.table-responsive>.table-bordered{border:0}.table-responsive>.table-bordered>tbody>tr>td:first-child,.table-responsive>.table-bordered>tbody>tr>th:first-child,.table-responsive>.table-bordered>tfoot>tr>td:first-child,.table-responsive>.table-bordered>tfoot>tr>th:first-child,.table-responsive>.table-bordered>thead>tr>td:first-child,.table-responsive>.table-bordered>thead>tr>th:first-child{border-left:0}.table-responsive>.table-bordered>tbody>tr>td:last-child,.table-responsive>.table-bordered>tbody>tr>th:last-child,.table-responsive>.table-bordered>tfoot>tr>td:last-child,.table-responsive>.table-bordered>tfoot>tr>th:last-child,.table-responsive>.table-bordered>thead>tr>td:last-child,.table-responsive>.table-bordered>thead>tr>th:last-child{border-right:0}.table-responsive>.table-bordered>tbody>tr:last-child>td,.table-responsive>.table-bordered>tbody>tr:last-child>th,.table-responsive>.table-bordered>tfoot>tr:last-child>td,.table-responsive>.table-bordered>tfoot>tr:last-child>th{border-bottom:0}}fieldset{min-width:0;padding:0;margin:0;border:0}legend{display:block;width:100%;padding:0;margin-bottom:20px;font-size:21px;line-height:inherit;color:#333;border:0;border-bottom:1px solid #e5e5e5}label{display:inline-block;max-width:100%;margin-bottom:5px;font-weight:700}input[type=search]{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}input[type=checkbox],input[type=radio]{margin:4px 0 0;margin-top:1px\\9;line-height:normal}input[type=file]{display:block}input[type=range]{display:block;width:100%}select[multiple],select[size]{height:auto}input[type=file]:focus,input[type=checkbox]:focus,input[type=radio]:focus{outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}output{display:block;padding-top:7px;font-size:14px;line-height:1.42857143;color:#555}.form-control{display:block;width:100%;height:34px;padding:6px 12px;font-size:14px;line-height:1.42857143;color:#555;background-color:#fff;background-image:none;border:1px solid #ccc;border-radius:4px;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 1px rgba(0,0,0,.075);-webkit-transition:border-color ease-in-out .15s,-webkit-box-shadow ease-in-out .15s;-o-transition:border-color ease-in-out .15s,box-shadow ease-in-out .15s;transition:border-color ease-in-out .15s,box-shadow ease-in-out .15s}.form-control:focus{border-color:#66afe9;outline:0;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 8px rgba(102,175,233,.6);box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 8px rgba(102,175,233,.6)}.form-control::-moz-placeholder{color:#999;opacity:1}.form-control:-ms-input-placeholder{color:#999}.form-control::-webkit-input-placeholder{color:#999}.form-control::-ms-expand{background-color:transparent;border:0}.form-control[disabled],.form-control[readonly],fieldset[disabled] .form-control{background-color:#eee;opacity:1}.form-control[disabled],fieldset[disabled] .form-control{cursor:not-allowed}textarea.form-control{height:auto}input[type=search]{-webkit-appearance:none}@media screen and (-webkit-min-device-pixel-ratio:0){input[type=date].form-control,input[type=time].form-control,input[type=datetime-local].form-control,input[type=month].form-control{line-height:34px}.input-group-sm input[type=date],.input-group-sm input[type=time],.input-group-sm input[type=datetime-local],.input-group-sm input[type=month],input[type=date].input-sm,input[type=time].input-sm,input[type=datetime-local].input-sm,input[type=month].input-sm{line-height:30px}.input-group-lg input[type=date],.input-group-lg input[type=time],.input-group-lg input[type=datetime-local],.input-group-lg input[type=month],input[type=date].input-lg,input[type=time].input-lg,input[type=datetime-local].input-lg,input[type=month].input-lg{line-height:46px}}.form-group{margin-bottom:15px}.checkbox,.radio{position:relative;display:block;margin-top:10px;margin-bottom:10px}.checkbox label,.radio label{min-height:20px;padding-left:20px;margin-bottom:0;font-weight:400;cursor:pointer}.checkbox input[type=checkbox],.checkbox-inline input[type=checkbox],.radio input[type=radio],.radio-inline input[type=radio]{position:absolute;margin-top:4px\\9;margin-left:-20px}.checkbox+.checkbox,.radio+.radio{margin-top:-5px}.checkbox-inline,.radio-inline{position:relative;display:inline-block;padding-left:20px;margin-bottom:0;font-weight:400;vertical-align:middle;cursor:pointer}.checkbox-inline+.checkbox-inline,.radio-inline+.radio-inline{margin-top:0;margin-left:10px}fieldset[disabled] input[type=checkbox],fieldset[disabled] input[type=radio],input[type=checkbox].disabled,input[type=checkbox][disabled],input[type=radio].disabled,input[type=radio][disabled]{cursor:not-allowed}.checkbox-inline.disabled,.radio-inline.disabled,fieldset[disabled] .checkbox-inline,fieldset[disabled] .radio-inline{cursor:not-allowed}.checkbox.disabled label,.radio.disabled label,fieldset[disabled] .checkbox label,fieldset[disabled] .radio label{cursor:not-allowed}.form-control-static{min-height:34px;padding-top:7px;padding-bottom:7px;margin-bottom:0}.form-control-static.input-lg,.form-control-static.input-sm{padding-right:0;padding-left:0}.input-sm{height:30px;padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}select.input-sm{height:30px;line-height:30px}select[multiple].input-sm,textarea.input-sm{height:auto}.form-group-sm .form-control{height:30px;padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}.form-group-sm select.form-control{height:30px;line-height:30px}.form-group-sm select[multiple].form-control,.form-group-sm textarea.form-control{height:auto}.form-group-sm .form-control-static{height:30px;min-height:32px;padding:6px 10px;font-size:12px;line-height:1.5}.input-lg{height:46px;padding:10px 16px;font-size:18px;line-height:1.3333333;border-radius:6px}select.input-lg{height:46px;line-height:46px}select[multiple].input-lg,textarea.input-lg{height:auto}.form-group-lg .form-control{height:46px;padding:10px 16px;font-size:18px;line-height:1.3333333;border-radius:6px}.form-group-lg select.form-control{height:46px;line-height:46px}.form-group-lg select[multiple].form-control,.form-group-lg textarea.form-control{height:auto}.form-group-lg .form-control-static{height:46px;min-height:38px;padding:11px 16px;font-size:18px;line-height:1.3333333}.has-feedback{position:relative}.has-feedback .form-control{padding-right:42.5px}.form-control-feedback{position:absolute;top:0;right:0;z-index:2;display:block;width:34px;height:34px;line-height:34px;text-align:center;pointer-events:none}.form-group-lg .form-control+.form-control-feedback,.input-group-lg+.form-control-feedback,.input-lg+.form-control-feedback{width:46px;height:46px;line-height:46px}.form-group-sm .form-control+.form-control-feedback,.input-group-sm+.form-control-feedback,.input-sm+.form-control-feedback{width:30px;height:30px;line-height:30px}.has-success .checkbox,.has-success .checkbox-inline,.has-success .control-label,.has-success .help-block,.has-success .radio,.has-success .radio-inline,.has-success.checkbox label,.has-success.checkbox-inline label,.has-success.radio label,.has-success.radio-inline label{color:#3c763d}.has-success .form-control{border-color:#3c763d;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 1px rgba(0,0,0,.075)}.has-success .form-control:focus{border-color:#2b542c;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #67b168;box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #67b168}.has-success .input-group-addon{color:#3c763d;background-color:#dff0d8;border-color:#3c763d}.has-success .form-control-feedback{color:#3c763d}.has-warning .checkbox,.has-warning .checkbox-inline,.has-warning .control-label,.has-warning .help-block,.has-warning .radio,.has-warning .radio-inline,.has-warning.checkbox label,.has-warning.checkbox-inline label,.has-warning.radio label,.has-warning.radio-inline label{color:#8a6d3b}.has-warning .form-control{border-color:#8a6d3b;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 1px rgba(0,0,0,.075)}.has-warning .form-control:focus{border-color:#66512c;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #c0a16b;box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #c0a16b}.has-warning .input-group-addon{color:#8a6d3b;background-color:#fcf8e3;border-color:#8a6d3b}.has-warning .form-control-feedback{color:#8a6d3b}.has-error .checkbox,.has-error .checkbox-inline,.has-error .control-label,.has-error .help-block,.has-error .radio,.has-error .radio-inline,.has-error.checkbox label,.has-error.checkbox-inline label,.has-error.radio label,.has-error.radio-inline label{color:#a94442}.has-error .form-control{border-color:#a94442;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 1px rgba(0,0,0,.075)}.has-error .form-control:focus{border-color:#843534;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #ce8483;box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #ce8483}.has-error .input-group-addon{color:#a94442;background-color:#f2dede;border-color:#a94442}.has-error .form-control-feedback{color:#a94442}.has-feedback label~.form-control-feedback{top:25px}.has-feedback label.sr-only~.form-control-feedback{top:0}.help-block{display:block;margin-top:5px;margin-bottom:10px;color:#737373}@media (min-width:768px){.form-inline .form-group{display:inline-block;margin-bottom:0;vertical-align:middle}.form-inline .form-control{display:inline-block;width:auto;vertical-align:middle}.form-inline .form-control-static{display:inline-block}.form-inline .input-group{display:inline-table;vertical-align:middle}.form-inline .input-group .form-control,.form-inline .input-group .input-group-addon,.form-inline .input-group .input-group-btn{width:auto}.form-inline .input-group>.form-control{width:100%}.form-inline .control-label{margin-bottom:0;vertical-align:middle}.form-inline .checkbox,.form-inline .radio{display:inline-block;margin-top:0;margin-bottom:0;vertical-align:middle}.form-inline .checkbox label,.form-inline .radio label{padding-left:0}.form-inline .checkbox input[type=checkbox],.form-inline .radio input[type=radio]{position:relative;margin-left:0}.form-inline .has-feedback .form-control-feedback{top:0}}.form-horizontal .checkbox,.form-horizontal .checkbox-inline,.form-horizontal .radio,.form-horizontal .radio-inline{padding-top:7px;margin-top:0;margin-bottom:0}.form-horizontal .checkbox,.form-horizontal .radio{min-height:27px}.form-horizontal .form-group{margin-right:-15px;margin-left:-15px}@media (min-width:768px){.form-horizontal .control-label{padding-top:7px;margin-bottom:0;text-align:right}}.form-horizontal .has-feedback .form-control-feedback{right:15px}@media (min-width:768px){.form-horizontal .form-group-lg .control-label{padding-top:11px;font-size:18px}}@media (min-width:768px){.form-horizontal .form-group-sm .control-label{padding-top:6px;font-size:12px}}.btn{display:inline-block;padding:6px 12px;margin-bottom:0;font-size:14px;font-weight:400;line-height:1.42857143;text-align:center;white-space:nowrap;vertical-align:middle;-ms-touch-action:manipulation;touch-action:manipulation;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;background-image:none;border:1px solid transparent;border-radius:4px}.btn.active.focus,.btn.active:focus,.btn.focus,.btn:active.focus,.btn:active:focus,.btn:focus{outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}.btn.focus,.btn:focus,.btn:hover{color:#333;text-decoration:none}.btn.active,.btn:active{background-image:none;outline:0;-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125);box-shadow:inset 0 3px 5px rgba(0,0,0,.125)}.btn.disabled,.btn[disabled],fieldset[disabled] .btn{cursor:not-allowed;filter:alpha(opacity=65);-webkit-box-shadow:none;box-shadow:none;opacity:.65}a.btn.disabled,fieldset[disabled] a.btn{pointer-events:none}.btn-default{color:#333;background-color:#fff;border-color:#ccc}.btn-default.focus,.btn-default:focus{color:#333;background-color:#e6e6e6;border-color:#8c8c8c}.btn-default:hover{color:#333;background-color:#e6e6e6;border-color:#adadad}.btn-default.active,.btn-default:active,.open>.dropdown-toggle.btn-default{color:#333;background-color:#e6e6e6;border-color:#adadad}.btn-default.active.focus,.btn-default.active:focus,.btn-default.active:hover,.btn-default:active.focus,.btn-default:active:focus,.btn-default:active:hover,.open>.dropdown-toggle.btn-default.focus,.open>.dropdown-toggle.btn-default:focus,.open>.dropdown-toggle.btn-default:hover{color:#333;background-color:#d4d4d4;border-color:#8c8c8c}.btn-default.active,.btn-default:active,.open>.dropdown-toggle.btn-default{background-image:none}.btn-default.disabled.focus,.btn-default.disabled:focus,.btn-default.disabled:hover,.btn-default[disabled].focus,.btn-default[disabled]:focus,.btn-default[disabled]:hover,fieldset[disabled] .btn-default.focus,fieldset[disabled] .btn-default:focus,fieldset[disabled] .btn-default:hover{background-color:#fff;border-color:#ccc}.btn-default .badge{color:#fff;background-color:#333}.btn-primary{color:#fff;background-color:#337ab7;border-color:#2e6da4}.btn-primary.focus,.btn-primary:focus{color:#fff;background-color:#286090;border-color:#122b40}.btn-primary:hover{color:#fff;background-color:#286090;border-color:#204d74}.btn-primary.active,.btn-primary:active,.open>.dropdown-toggle.btn-primary{color:#fff;background-color:#286090;border-color:#204d74}.btn-primary.active.focus,.btn-primary.active:focus,.btn-primary.active:hover,.btn-primary:active.focus,.btn-primary:active:focus,.btn-primary:active:hover,.open>.dropdown-toggle.btn-primary.focus,.open>.dropdown-toggle.btn-primary:focus,.open>.dropdown-toggle.btn-primary:hover{color:#fff;background-color:#204d74;border-color:#122b40}.btn-primary.active,.btn-primary:active,.open>.dropdown-toggle.btn-primary{background-image:none}.btn-primary.disabled.focus,.btn-primary.disabled:focus,.btn-primary.disabled:hover,.btn-primary[disabled].focus,.btn-primary[disabled]:focus,.btn-primary[disabled]:hover,fieldset[disabled] .btn-primary.focus,fieldset[disabled] .btn-primary:focus,fieldset[disabled] .btn-primary:hover{background-color:#337ab7;border-color:#2e6da4}.btn-primary .badge{color:#337ab7;background-color:#fff}.btn-success{color:#fff;background-color:#5cb85c;border-color:#4cae4c}.btn-success.focus,.btn-success:focus{color:#fff;background-color:#449d44;border-color:#255625}.btn-success:hover{color:#fff;background-color:#449d44;border-color:#398439}.btn-success.active,.btn-success:active,.open>.dropdown-toggle.btn-success{color:#fff;background-color:#449d44;border-color:#398439}.btn-success.active.focus,.btn-success.active:focus,.btn-success.active:hover,.btn-success:active.focus,.btn-success:active:focus,.btn-success:active:hover,.open>.dropdown-toggle.btn-success.focus,.open>.dropdown-toggle.btn-success:focus,.open>.dropdown-toggle.btn-success:hover{color:#fff;background-color:#398439;border-color:#255625}.btn-success.active,.btn-success:active,.open>.dropdown-toggle.btn-success{background-image:none}.btn-success.disabled.focus,.btn-success.disabled:focus,.btn-success.disabled:hover,.btn-success[disabled].focus,.btn-success[disabled]:focus,.btn-success[disabled]:hover,fieldset[disabled] .btn-success.focus,fieldset[disabled] .btn-success:focus,fieldset[disabled] .btn-success:hover{background-color:#5cb85c;border-color:#4cae4c}.btn-success .badge{color:#5cb85c;background-color:#fff}.btn-info{color:#fff;background-color:#5bc0de;border-color:#46b8da}.btn-info.focus,.btn-info:focus{color:#fff;background-color:#31b0d5;border-color:#1b6d85}.btn-info:hover{color:#fff;background-color:#31b0d5;border-color:#269abc}.btn-info.active,.btn-info:active,.open>.dropdown-toggle.btn-info{color:#fff;background-color:#31b0d5;border-color:#269abc}.btn-info.active.focus,.btn-info.active:focus,.btn-info.active:hover,.btn-info:active.focus,.btn-info:active:focus,.btn-info:active:hover,.open>.dropdown-toggle.btn-info.focus,.open>.dropdown-toggle.btn-info:focus,.open>.dropdown-toggle.btn-info:hover{color:#fff;background-color:#269abc;border-color:#1b6d85}.btn-info.active,.btn-info:active,.open>.dropdown-toggle.btn-info{background-image:none}.btn-info.disabled.focus,.btn-info.disabled:focus,.btn-info.disabled:hover,.btn-info[disabled].focus,.btn-info[disabled]:focus,.btn-info[disabled]:hover,fieldset[disabled] .btn-info.focus,fieldset[disabled] .btn-info:focus,fieldset[disabled] .btn-info:hover{background-color:#5bc0de;border-color:#46b8da}.btn-info .badge{color:#5bc0de;background-color:#fff}.btn-warning{color:#fff;background-color:#f0ad4e;border-color:#eea236}.btn-warning.focus,.btn-warning:focus{color:#fff;background-color:#ec971f;border-color:#985f0d}.btn-warning:hover{color:#fff;background-color:#ec971f;border-color:#d58512}.btn-warning.active,.btn-warning:active,.open>.dropdown-toggle.btn-warning{color:#fff;background-color:#ec971f;border-color:#d58512}.btn-warning.active.focus,.btn-warning.active:focus,.btn-warning.active:hover,.btn-warning:active.focus,.btn-warning:active:focus,.btn-warning:active:hover,.open>.dropdown-toggle.btn-warning.focus,.open>.dropdown-toggle.btn-warning:focus,.open>.dropdown-toggle.btn-warning:hover{color:#fff;background-color:#d58512;border-color:#985f0d}.btn-warning.active,.btn-warning:active,.open>.dropdown-toggle.btn-warning{background-image:none}.btn-warning.disabled.focus,.btn-warning.disabled:focus,.btn-warning.disabled:hover,.btn-warning[disabled].focus,.btn-warning[disabled]:focus,.btn-warning[disabled]:hover,fieldset[disabled] .btn-warning.focus,fieldset[disabled] .btn-warning:focus,fieldset[disabled] .btn-warning:hover{background-color:#f0ad4e;border-color:#eea236}.btn-warning .badge{color:#f0ad4e;background-color:#fff}.btn-danger{color:#fff;background-color:#d9534f;border-color:#d43f3a}.btn-danger.focus,.btn-danger:focus{color:#fff;background-color:#c9302c;border-color:#761c19}.btn-danger:hover{color:#fff;background-color:#c9302c;border-color:#ac2925}.btn-danger.active,.btn-danger:active,.open>.dropdown-toggle.btn-danger{color:#fff;background-color:#c9302c;border-color:#ac2925}.btn-danger.active.focus,.btn-danger.active:focus,.btn-danger.active:hover,.btn-danger:active.focus,.btn-danger:active:focus,.btn-danger:active:hover,.open>.dropdown-toggle.btn-danger.focus,.open>.dropdown-toggle.btn-danger:focus,.open>.dropdown-toggle.btn-danger:hover{color:#fff;background-color:#ac2925;border-color:#761c19}.btn-danger.active,.btn-danger:active,.open>.dropdown-toggle.btn-danger{background-image:none}.btn-danger.disabled.focus,.btn-danger.disabled:focus,.btn-danger.disabled:hover,.btn-danger[disabled].focus,.btn-danger[disabled]:focus,.btn-danger[disabled]:hover,fieldset[disabled] .btn-danger.focus,fieldset[disabled] .btn-danger:focus,fieldset[disabled] .btn-danger:hover{background-color:#d9534f;border-color:#d43f3a}.btn-danger .badge{color:#d9534f;background-color:#fff}.btn-link{font-weight:400;color:#337ab7;border-radius:0}.btn-link,.btn-link.active,.btn-link:active,.btn-link[disabled],fieldset[disabled] .btn-link{background-color:transparent;-webkit-box-shadow:none;box-shadow:none}.btn-link,.btn-link:active,.btn-link:focus,.btn-link:hover{border-color:transparent}.btn-link:focus,.btn-link:hover{color:#23527c;text-decoration:underline;background-color:transparent}.btn-link[disabled]:focus,.btn-link[disabled]:hover,fieldset[disabled] .btn-link:focus,fieldset[disabled] .btn-link:hover{color:#777;text-decoration:none}.btn-group-lg>.btn,.btn-lg{padding:10px 16px;font-size:18px;line-height:1.3333333;border-radius:6px}.btn-group-sm>.btn,.btn-sm{padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}.btn-group-xs>.btn,.btn-xs{padding:1px 5px;font-size:12px;line-height:1.5;border-radius:3px}.btn-block{display:block;width:100%}.btn-block+.btn-block{margin-top:5px}input[type=button].btn-block,input[type=reset].btn-block,input[type=submit].btn-block{width:100%}.fade{opacity:0;-webkit-transition:opacity .15s linear;-o-transition:opacity .15s linear;transition:opacity .15s linear}.fade.in{opacity:1}.collapse{display:none}.collapse.in{display:block}tr.collapse.in{display:table-row}tbody.collapse.in{display:table-row-group}.collapsing{position:relative;height:0;overflow:hidden;-webkit-transition-timing-function:ease;-o-transition-timing-function:ease;transition-timing-function:ease;-webkit-transition-duration:.35s;-o-transition-duration:.35s;transition-duration:.35s;-webkit-transition-property:height,visibility;-o-transition-property:height,visibility;transition-property:height,visibility}.caret{display:inline-block;width:0;height:0;margin-left:2px;vertical-align:middle;border-top:4px dashed;border-top:4px solid\\9;border-right:4px solid transparent;border-left:4px solid transparent}.dropdown,.dropup{position:relative}.dropdown-toggle:focus{outline:0}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:160px;padding:5px 0;margin:2px 0 0;font-size:14px;text-align:left;list-style:none;background-color:#fff;-webkit-background-clip:padding-box;background-clip:padding-box;border:1px solid #ccc;border:1px solid rgba(0,0,0,.15);border-radius:4px;-webkit-box-shadow:0 6px 12px rgba(0,0,0,.175);box-shadow:0 6px 12px rgba(0,0,0,.175)}.dropdown-menu.pull-right{right:0;left:auto}.dropdown-menu .divider{height:1px;margin:9px 0;overflow:hidden;background-color:#e5e5e5}.dropdown-menu>li>a{display:block;padding:3px 20px;clear:both;font-weight:400;line-height:1.42857143;color:#333;white-space:nowrap}.dropdown-menu>li>a:focus,.dropdown-menu>li>a:hover{color:#262626;text-decoration:none;background-color:#f5f5f5}.dropdown-menu>.active>a,.dropdown-menu>.active>a:focus,.dropdown-menu>.active>a:hover{color:#fff;text-decoration:none;background-color:#337ab7;outline:0}.dropdown-menu>.disabled>a,.dropdown-menu>.disabled>a:focus,.dropdown-menu>.disabled>a:hover{color:#777}.dropdown-menu>.disabled>a:focus,.dropdown-menu>.disabled>a:hover{text-decoration:none;cursor:not-allowed;background-color:transparent;background-image:none;filter:progid:DXImageTransform.Microsoft.gradient(enabled=false)}.open>.dropdown-menu{display:block}.open>a{outline:0}.dropdown-menu-right{right:0;left:auto}.dropdown-menu-left{right:auto;left:0}.dropdown-header{display:block;padding:3px 20px;font-size:12px;line-height:1.42857143;color:#777;white-space:nowrap}.dropdown-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:990}.pull-right>.dropdown-menu{right:0;left:auto}.dropup .caret,.navbar-fixed-bottom .dropdown .caret{content:"";border-top:0;border-bottom:4px dashed;border-bottom:4px solid\\9}.dropup .dropdown-menu,.navbar-fixed-bottom .dropdown .dropdown-menu{top:auto;bottom:100%;margin-bottom:2px}@media (min-width:768px){.navbar-right .dropdown-menu{right:0;left:auto}.navbar-right .dropdown-menu-left{right:auto;left:0}}.btn-group,.btn-group-vertical{position:relative;display:inline-block;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;float:left}.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:2}.btn-group .btn+.btn,.btn-group .btn+.btn-group,.btn-group .btn-group+.btn,.btn-group .btn-group+.btn-group{margin-left:-1px}.btn-toolbar{margin-left:-5px}.btn-toolbar .btn,.btn-toolbar .btn-group,.btn-toolbar .input-group{float:left}.btn-toolbar>.btn,.btn-toolbar>.btn-group,.btn-toolbar>.input-group{margin-left:5px}.btn-group>.btn:not(:first-child):not(:last-child):not(.dropdown-toggle){border-radius:0}.btn-group>.btn:first-child{margin-left:0}.btn-group>.btn:first-child:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn:last-child:not(:first-child),.btn-group>.dropdown-toggle:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.btn-group>.btn-group{float:left}.btn-group>.btn-group:not(:first-child):not(:last-child)>.btn{border-radius:0}.btn-group>.btn-group:first-child:not(:last-child)>.btn:last-child,.btn-group>.btn-group:first-child:not(:last-child)>.dropdown-toggle{border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:last-child:not(:first-child)>.btn:first-child{border-top-left-radius:0;border-bottom-left-radius:0}.btn-group .dropdown-toggle:active,.btn-group.open .dropdown-toggle{outline:0}.btn-group>.btn+.dropdown-toggle{padding-right:8px;padding-left:8px}.btn-group>.btn-lg+.dropdown-toggle{padding-right:12px;padding-left:12px}.btn-group.open .dropdown-toggle{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125);box-shadow:inset 0 3px 5px rgba(0,0,0,.125)}.btn-group.open .dropdown-toggle.btn-link{-webkit-box-shadow:none;box-shadow:none}.btn .caret{margin-left:0}.btn-lg .caret{border-width:5px 5px 0;border-bottom-width:0}.dropup .btn-lg .caret{border-width:0 5px 5px}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group,.btn-group-vertical>.btn-group>.btn{display:block;float:none;width:100%;max-width:100%}.btn-group-vertical>.btn-group>.btn{float:none}.btn-group-vertical>.btn+.btn,.btn-group-vertical>.btn+.btn-group,.btn-group-vertical>.btn-group+.btn,.btn-group-vertical>.btn-group+.btn-group{margin-top:-1px;margin-left:0}.btn-group-vertical>.btn:not(:first-child):not(:last-child){border-radius:0}.btn-group-vertical>.btn:first-child:not(:last-child){border-top-left-radius:4px;border-top-right-radius:4px;border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn:last-child:not(:first-child){border-top-left-radius:0;border-top-right-radius:0;border-bottom-right-radius:4px;border-bottom-left-radius:4px}.btn-group-vertical>.btn-group:not(:first-child):not(:last-child)>.btn{border-radius:0}.btn-group-vertical>.btn-group:first-child:not(:last-child)>.btn:last-child,.btn-group-vertical>.btn-group:first-child:not(:last-child)>.dropdown-toggle{border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:last-child:not(:first-child)>.btn:first-child{border-top-left-radius:0;border-top-right-radius:0}.btn-group-justified{display:table;width:100%;table-layout:fixed;border-collapse:separate}.btn-group-justified>.btn,.btn-group-justified>.btn-group{display:table-cell;float:none;width:1%}.btn-group-justified>.btn-group .btn{width:100%}.btn-group-justified>.btn-group .dropdown-menu{left:auto}[data-toggle=buttons]>.btn input[type=checkbox],[data-toggle=buttons]>.btn input[type=radio],[data-toggle=buttons]>.btn-group>.btn input[type=checkbox],[data-toggle=buttons]>.btn-group>.btn input[type=radio]{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.input-group{position:relative;display:table;border-collapse:separate}.input-group[class*=col-]{float:none;padding-right:0;padding-left:0}.input-group .form-control{position:relative;z-index:2;float:left;width:100%;margin-bottom:0}.input-group .form-control:focus{z-index:3}.input-group-lg>.form-control,.input-group-lg>.input-group-addon,.input-group-lg>.input-group-btn>.btn{height:46px;padding:10px 16px;font-size:18px;line-height:1.3333333;border-radius:6px}select.input-group-lg>.form-control,select.input-group-lg>.input-group-addon,select.input-group-lg>.input-group-btn>.btn{height:46px;line-height:46px}select[multiple].input-group-lg>.form-control,select[multiple].input-group-lg>.input-group-addon,select[multiple].input-group-lg>.input-group-btn>.btn,textarea.input-group-lg>.form-control,textarea.input-group-lg>.input-group-addon,textarea.input-group-lg>.input-group-btn>.btn{height:auto}.input-group-sm>.form-control,.input-group-sm>.input-group-addon,.input-group-sm>.input-group-btn>.btn{height:30px;padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}select.input-group-sm>.form-control,select.input-group-sm>.input-group-addon,select.input-group-sm>.input-group-btn>.btn{height:30px;line-height:30px}select[multiple].input-group-sm>.form-control,select[multiple].input-group-sm>.input-group-addon,select[multiple].input-group-sm>.input-group-btn>.btn,textarea.input-group-sm>.form-control,textarea.input-group-sm>.input-group-addon,textarea.input-group-sm>.input-group-btn>.btn{height:auto}.input-group .form-control,.input-group-addon,.input-group-btn{display:table-cell}.input-group .form-control:not(:first-child):not(:last-child),.input-group-addon:not(:first-child):not(:last-child),.input-group-btn:not(:first-child):not(:last-child){border-radius:0}.input-group-addon,.input-group-btn{width:1%;white-space:nowrap;vertical-align:middle}.input-group-addon{padding:6px 12px;font-size:14px;font-weight:400;line-height:1;color:#555;text-align:center;background-color:#eee;border:1px solid #ccc;border-radius:4px}.input-group-addon.input-sm{padding:5px 10px;font-size:12px;border-radius:3px}.input-group-addon.input-lg{padding:10px 16px;font-size:18px;border-radius:6px}.input-group-addon input[type=checkbox],.input-group-addon input[type=radio]{margin-top:0}.input-group .form-control:first-child,.input-group-addon:first-child,.input-group-btn:first-child>.btn,.input-group-btn:first-child>.btn-group>.btn,.input-group-btn:first-child>.dropdown-toggle,.input-group-btn:last-child>.btn-group:not(:last-child)>.btn,.input-group-btn:last-child>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.input-group-addon:first-child{border-right:0}.input-group .form-control:last-child,.input-group-addon:last-child,.input-group-btn:first-child>.btn-group:not(:first-child)>.btn,.input-group-btn:first-child>.btn:not(:first-child),.input-group-btn:last-child>.btn,.input-group-btn:last-child>.btn-group>.btn,.input-group-btn:last-child>.dropdown-toggle{border-top-left-radius:0;border-bottom-left-radius:0}.input-group-addon:last-child{border-left:0}.input-group-btn{position:relative;font-size:0;white-space:nowrap}.input-group-btn>.btn{position:relative}.input-group-btn>.btn+.btn{margin-left:-1px}.input-group-btn>.btn:active,.input-group-btn>.btn:focus,.input-group-btn>.btn:hover{z-index:2}.input-group-btn:first-child>.btn,.input-group-btn:first-child>.btn-group{margin-right:-1px}.input-group-btn:last-child>.btn,.input-group-btn:last-child>.btn-group{z-index:2;margin-left:-1px}.nav{padding-left:0;margin-bottom:0;list-style:none}.nav>li{position:relative;display:block}.nav>li>a{position:relative;display:block;padding:10px 15px}.nav>li>a:focus,.nav>li>a:hover{text-decoration:none;background-color:#eee}.nav>li.disabled>a{color:#777}.nav>li.disabled>a:focus,.nav>li.disabled>a:hover{color:#777;text-decoration:none;cursor:not-allowed;background-color:transparent}.nav .open>a,.nav .open>a:focus,.nav .open>a:hover{background-color:#eee;border-color:#337ab7}.nav .nav-divider{height:1px;margin:9px 0;overflow:hidden;background-color:#e5e5e5}.nav>li>a>img{max-width:none}.nav-tabs{border-bottom:1px solid #ddd}.nav-tabs>li{float:left;margin-bottom:-1px}.nav-tabs>li>a{margin-right:2px;line-height:1.42857143;border:1px solid transparent;border-radius:4px 4px 0 0}.nav-tabs>li>a:hover{border-color:#eee #eee #ddd}.nav-tabs>li.active>a,.nav-tabs>li.active>a:focus,.nav-tabs>li.active>a:hover{color:#555;cursor:default;background-color:#fff;border:1px solid #ddd;border-bottom-color:transparent}.nav-tabs.nav-justified{width:100%;border-bottom:0}.nav-tabs.nav-justified>li{float:none}.nav-tabs.nav-justified>li>a{margin-bottom:5px;text-align:center}.nav-tabs.nav-justified>.dropdown .dropdown-menu{top:auto;left:auto}@media (min-width:768px){.nav-tabs.nav-justified>li{display:table-cell;width:1%}.nav-tabs.nav-justified>li>a{margin-bottom:0}}.nav-tabs.nav-justified>li>a{margin-right:0;border-radius:4px}.nav-tabs.nav-justified>.active>a,.nav-tabs.nav-justified>.active>a:focus,.nav-tabs.nav-justified>.active>a:hover{border:1px solid #ddd}@media (min-width:768px){.nav-tabs.nav-justified>li>a{border-bottom:1px solid #ddd;border-radius:4px 4px 0 0}.nav-tabs.nav-justified>.active>a,.nav-tabs.nav-justified>.active>a:focus,.nav-tabs.nav-justified>.active>a:hover{border-bottom-color:#fff}}.nav-pills>li{float:left}.nav-pills>li>a{border-radius:4px}.nav-pills>li+li{margin-left:2px}.nav-pills>li.active>a,.nav-pills>li.active>a:focus,.nav-pills>li.active>a:hover{color:#fff;background-color:#337ab7}.nav-stacked>li{float:none}.nav-stacked>li+li{margin-top:2px;margin-left:0}.nav-justified{width:100%}.nav-justified>li{float:none}.nav-justified>li>a{margin-bottom:5px;text-align:center}.nav-justified>.dropdown .dropdown-menu{top:auto;left:auto}@media (min-width:768px){.nav-justified>li{display:table-cell;width:1%}.nav-justified>li>a{margin-bottom:0}}.nav-tabs-justified{border-bottom:0}.nav-tabs-justified>li>a{margin-right:0;border-radius:4px}.nav-tabs-justified>.active>a,.nav-tabs-justified>.active>a:focus,.nav-tabs-justified>.active>a:hover{border:1px solid #ddd}@media (min-width:768px){.nav-tabs-justified>li>a{border-bottom:1px solid #ddd;border-radius:4px 4px 0 0}.nav-tabs-justified>.active>a,.nav-tabs-justified>.active>a:focus,.nav-tabs-justified>.active>a:hover{border-bottom-color:#fff}}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.nav-tabs .dropdown-menu{margin-top:-1px;border-top-left-radius:0;border-top-right-radius:0}.navbar{position:relative;min-height:50px;margin-bottom:20px;border:1px solid transparent}@media (min-width:768px){.navbar{border-radius:4px}}@media (min-width:768px){.navbar-header{float:left}}.navbar-collapse{padding-right:15px;padding-left:15px;overflow-x:visible;-webkit-overflow-scrolling:touch;border-top:1px solid transparent;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.1);box-shadow:inset 0 1px 0 rgba(255,255,255,.1)}.navbar-collapse.in{overflow-y:auto}@media (min-width:768px){.navbar-collapse{width:auto;border-top:0;-webkit-box-shadow:none;box-shadow:none}.navbar-collapse.collapse{display:block!important;height:auto!important;padding-bottom:0;overflow:visible!important}.navbar-collapse.in{overflow-y:visible}.navbar-fixed-bottom .navbar-collapse,.navbar-fixed-top .navbar-collapse,.navbar-static-top .navbar-collapse{padding-right:0;padding-left:0}}.navbar-fixed-bottom .navbar-collapse,.navbar-fixed-top .navbar-collapse{max-height:340px}@media (max-device-width:480px) and (orientation:landscape){.navbar-fixed-bottom .navbar-collapse,.navbar-fixed-top .navbar-collapse{max-height:200px}}.container-fluid>.navbar-collapse,.container-fluid>.navbar-header,.container>.navbar-collapse,.container>.navbar-header{margin-right:-15px;margin-left:-15px}@media (min-width:768px){.container-fluid>.navbar-collapse,.container-fluid>.navbar-header,.container>.navbar-collapse,.container>.navbar-header{margin-right:0;margin-left:0}}.navbar-static-top{z-index:1000;border-width:0 0 1px}@media (min-width:768px){.navbar-static-top{border-radius:0}}.navbar-fixed-bottom,.navbar-fixed-top{position:fixed;right:0;left:0;z-index:1030}@media (min-width:768px){.navbar-fixed-bottom,.navbar-fixed-top{border-radius:0}}.navbar-fixed-top{top:0;border-width:0 0 1px}.navbar-fixed-bottom{bottom:0;margin-bottom:0;border-width:1px 0 0}.navbar-brand{float:left;height:50px;padding:15px 15px;font-size:18px;line-height:20px}.navbar-brand:focus,.navbar-brand:hover{text-decoration:none}.navbar-brand>img{display:block}@media (min-width:768px){.navbar>.container .navbar-brand,.navbar>.container-fluid .navbar-brand{margin-left:-15px}}.navbar-toggle{position:relative;float:right;padding:9px 10px;margin-top:8px;margin-right:15px;margin-bottom:8px;background-color:transparent;background-image:none;border:1px solid transparent;border-radius:4px}.navbar-toggle:focus{outline:0}.navbar-toggle .icon-bar{display:block;width:22px;height:2px;border-radius:1px}.navbar-toggle .icon-bar+.icon-bar{margin-top:4px}@media (min-width:768px){.navbar-toggle{display:none}}.navbar-nav{margin:7.5px -15px}.navbar-nav>li>a{padding-top:10px;padding-bottom:10px;line-height:20px}@media (max-width:767px){.navbar-nav .open .dropdown-menu{position:static;float:none;width:auto;margin-top:0;background-color:transparent;border:0;-webkit-box-shadow:none;box-shadow:none}.navbar-nav .open .dropdown-menu .dropdown-header,.navbar-nav .open .dropdown-menu>li>a{padding:5px 15px 5px 25px}.navbar-nav .open .dropdown-menu>li>a{line-height:20px}.navbar-nav .open .dropdown-menu>li>a:focus,.navbar-nav .open .dropdown-menu>li>a:hover{background-image:none}}@media (min-width:768px){.navbar-nav{float:left;margin:0}.navbar-nav>li{float:left}.navbar-nav>li>a{padding-top:15px;padding-bottom:15px}}.navbar-form{padding:10px 15px;margin-top:8px;margin-right:-15px;margin-bottom:8px;margin-left:-15px;border-top:1px solid transparent;border-bottom:1px solid transparent;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.1),0 1px 0 rgba(255,255,255,.1);box-shadow:inset 0 1px 0 rgba(255,255,255,.1),0 1px 0 rgba(255,255,255,.1)}@media (min-width:768px){.navbar-form .form-group{display:inline-block;margin-bottom:0;vertical-align:middle}.navbar-form .form-control{display:inline-block;width:auto;vertical-align:middle}.navbar-form .form-control-static{display:inline-block}.navbar-form .input-group{display:inline-table;vertical-align:middle}.navbar-form .input-group .form-control,.navbar-form .input-group .input-group-addon,.navbar-form .input-group .input-group-btn{width:auto}.navbar-form .input-group>.form-control{width:100%}.navbar-form .control-label{margin-bottom:0;vertical-align:middle}.navbar-form .checkbox,.navbar-form .radio{display:inline-block;margin-top:0;margin-bottom:0;vertical-align:middle}.navbar-form .checkbox label,.navbar-form .radio label{padding-left:0}.navbar-form .checkbox input[type=checkbox],.navbar-form .radio input[type=radio]{position:relative;margin-left:0}.navbar-form .has-feedback .form-control-feedback{top:0}}@media (max-width:767px){.navbar-form .form-group{margin-bottom:5px}.navbar-form .form-group:last-child{margin-bottom:0}}@media (min-width:768px){.navbar-form{width:auto;padding-top:0;padding-bottom:0;margin-right:0;margin-left:0;border:0;-webkit-box-shadow:none;box-shadow:none}}.navbar-nav>li>.dropdown-menu{margin-top:0;border-top-left-radius:0;border-top-right-radius:0}.navbar-fixed-bottom .navbar-nav>li>.dropdown-menu{margin-bottom:0;border-top-left-radius:4px;border-top-right-radius:4px;border-bottom-right-radius:0;border-bottom-left-radius:0}.navbar-btn{margin-top:8px;margin-bottom:8px}.navbar-btn.btn-sm{margin-top:10px;margin-bottom:10px}.navbar-btn.btn-xs{margin-top:14px;margin-bottom:14px}.navbar-text{margin-top:15px;margin-bottom:15px}@media (min-width:768px){.navbar-text{float:left;margin-right:15px;margin-left:15px}}@media (min-width:768px){.navbar-left{float:left!important}.navbar-right{float:right!important;margin-right:-15px}.navbar-right~.navbar-right{margin-right:0}}.navbar-default{background-color:#f8f8f8;border-color:#e7e7e7}.navbar-default .navbar-brand{color:#777}.navbar-default .navbar-brand:focus,.navbar-default .navbar-brand:hover{color:#5e5e5e;background-color:transparent}.navbar-default .navbar-text{color:#777}.navbar-default .navbar-nav>li>a{color:#777}.navbar-default .navbar-nav>li>a:focus,.navbar-default .navbar-nav>li>a:hover{color:#333;background-color:transparent}.navbar-default .navbar-nav>.active>a,.navbar-default .navbar-nav>.active>a:focus,.navbar-default .navbar-nav>.active>a:hover{color:#555;background-color:#e7e7e7}.navbar-default .navbar-nav>.disabled>a,.navbar-default .navbar-nav>.disabled>a:focus,.navbar-default .navbar-nav>.disabled>a:hover{color:#ccc;background-color:transparent}.navbar-default .navbar-toggle{border-color:#ddd}.navbar-default .navbar-toggle:focus,.navbar-default .navbar-toggle:hover{background-color:#ddd}.navbar-default .navbar-toggle .icon-bar{background-color:#888}.navbar-default .navbar-collapse,.navbar-default .navbar-form{border-color:#e7e7e7}.navbar-default .navbar-nav>.open>a,.navbar-default .navbar-nav>.open>a:focus,.navbar-default .navbar-nav>.open>a:hover{color:#555;background-color:#e7e7e7}@media (max-width:767px){.navbar-default .navbar-nav .open .dropdown-menu>li>a{color:#777}.navbar-default .navbar-nav .open .dropdown-menu>li>a:focus,.navbar-default .navbar-nav .open .dropdown-menu>li>a:hover{color:#333;background-color:transparent}.navbar-default .navbar-nav .open .dropdown-menu>.active>a,.navbar-default .navbar-nav .open .dropdown-menu>.active>a:focus,.navbar-default .navbar-nav .open .dropdown-menu>.active>a:hover{color:#555;background-color:#e7e7e7}.navbar-default .navbar-nav .open .dropdown-menu>.disabled>a,.navbar-default .navbar-nav .open .dropdown-menu>.disabled>a:focus,.navbar-default .navbar-nav .open .dropdown-menu>.disabled>a:hover{color:#ccc;background-color:transparent}}.navbar-default .navbar-link{color:#777}.navbar-default .navbar-link:hover{color:#333}.navbar-default .btn-link{color:#777}.navbar-default .btn-link:focus,.navbar-default .btn-link:hover{color:#333}.navbar-default .btn-link[disabled]:focus,.navbar-default .btn-link[disabled]:hover,fieldset[disabled] .navbar-default .btn-link:focus,fieldset[disabled] .navbar-default .btn-link:hover{color:#ccc}.navbar-inverse{background-color:#222;border-color:#080808}.navbar-inverse .navbar-brand{color:#9d9d9d}.navbar-inverse .navbar-brand:focus,.navbar-inverse .navbar-brand:hover{color:#fff;background-color:transparent}.navbar-inverse .navbar-text{color:#9d9d9d}.navbar-inverse .navbar-nav>li>a{color:#9d9d9d}.navbar-inverse .navbar-nav>li>a:focus,.navbar-inverse .navbar-nav>li>a:hover{color:#fff;background-color:transparent}.navbar-inverse .navbar-nav>.active>a,.navbar-inverse .navbar-nav>.active>a:focus,.navbar-inverse .navbar-nav>.active>a:hover{color:#fff;background-color:#080808}.navbar-inverse .navbar-nav>.disabled>a,.navbar-inverse .navbar-nav>.disabled>a:focus,.navbar-inverse .navbar-nav>.disabled>a:hover{color:#444;background-color:transparent}.navbar-inverse .navbar-toggle{border-color:#333}.navbar-inverse .navbar-toggle:focus,.navbar-inverse .navbar-toggle:hover{background-color:#333}.navbar-inverse .navbar-toggle .icon-bar{background-color:#fff}.navbar-inverse .navbar-collapse,.navbar-inverse .navbar-form{border-color:#101010}.navbar-inverse .navbar-nav>.open>a,.navbar-inverse .navbar-nav>.open>a:focus,.navbar-inverse .navbar-nav>.open>a:hover{color:#fff;background-color:#080808}@media (max-width:767px){.navbar-inverse .navbar-nav .open .dropdown-menu>.dropdown-header{border-color:#080808}.navbar-inverse .navbar-nav .open .dropdown-menu .divider{background-color:#080808}.navbar-inverse .navbar-nav .open .dropdown-menu>li>a{color:#9d9d9d}.navbar-inverse .navbar-nav .open .dropdown-menu>li>a:focus,.navbar-inverse .navbar-nav .open .dropdown-menu>li>a:hover{color:#fff;background-color:transparent}.navbar-inverse .navbar-nav .open .dropdown-menu>.active>a,.navbar-inverse .navbar-nav .open .dropdown-menu>.active>a:focus,.navbar-inverse .navbar-nav .open .dropdown-menu>.active>a:hover{color:#fff;background-color:#080808}.navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a,.navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a:focus,.navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a:hover{color:#444;background-color:transparent}}.navbar-inverse .navbar-link{color:#9d9d9d}.navbar-inverse .navbar-link:hover{color:#fff}.navbar-inverse .btn-link{color:#9d9d9d}.navbar-inverse .btn-link:focus,.navbar-inverse .btn-link:hover{color:#fff}.navbar-inverse .btn-link[disabled]:focus,.navbar-inverse .btn-link[disabled]:hover,fieldset[disabled] .navbar-inverse .btn-link:focus,fieldset[disabled] .navbar-inverse .btn-link:hover{color:#444}.breadcrumb{padding:8px 15px;margin-bottom:20px;list-style:none;background-color:#f5f5f5;border-radius:4px}.breadcrumb>li{display:inline-block}.breadcrumb>li+li:before{padding:0 5px;color:#ccc;content:"/\\00a0"}.breadcrumb>.active{color:#777}.pagination{display:inline-block;padding-left:0;margin:20px 0;border-radius:4px}.pagination>li{display:inline}.pagination>li>a,.pagination>li>span{position:relative;float:left;padding:6px 12px;margin-left:-1px;line-height:1.42857143;color:#337ab7;text-decoration:none;background-color:#fff;border:1px solid #ddd}.pagination>li:first-child>a,.pagination>li:first-child>span{margin-left:0;border-top-left-radius:4px;border-bottom-left-radius:4px}.pagination>li:last-child>a,.pagination>li:last-child>span{border-top-right-radius:4px;border-bottom-right-radius:4px}.pagination>li>a:focus,.pagination>li>a:hover,.pagination>li>span:focus,.pagination>li>span:hover{z-index:2;color:#23527c;background-color:#eee;border-color:#ddd}.pagination>.active>a,.pagination>.active>a:focus,.pagination>.active>a:hover,.pagination>.active>span,.pagination>.active>span:focus,.pagination>.active>span:hover{z-index:3;color:#fff;cursor:default;background-color:#337ab7;border-color:#337ab7}.pagination>.disabled>a,.pagination>.disabled>a:focus,.pagination>.disabled>a:hover,.pagination>.disabled>span,.pagination>.disabled>span:focus,.pagination>.disabled>span:hover{color:#777;cursor:not-allowed;background-color:#fff;border-color:#ddd}.pagination-lg>li>a,.pagination-lg>li>span{padding:10px 16px;font-size:18px;line-height:1.3333333}.pagination-lg>li:first-child>a,.pagination-lg>li:first-child>span{border-top-left-radius:6px;border-bottom-left-radius:6px}.pagination-lg>li:last-child>a,.pagination-lg>li:last-child>span{border-top-right-radius:6px;border-bottom-right-radius:6px}.pagination-sm>li>a,.pagination-sm>li>span{padding:5px 10px;font-size:12px;line-height:1.5}.pagination-sm>li:first-child>a,.pagination-sm>li:first-child>span{border-top-left-radius:3px;border-bottom-left-radius:3px}.pagination-sm>li:last-child>a,.pagination-sm>li:last-child>span{border-top-right-radius:3px;border-bottom-right-radius:3px}.pager{padding-left:0;margin:20px 0;text-align:center;list-style:none}.pager li{display:inline}.pager li>a,.pager li>span{display:inline-block;padding:5px 14px;background-color:#fff;border:1px solid #ddd;border-radius:15px}.pager li>a:focus,.pager li>a:hover{text-decoration:none;background-color:#eee}.pager .next>a,.pager .next>span{float:right}.pager .previous>a,.pager .previous>span{float:left}.pager .disabled>a,.pager .disabled>a:focus,.pager .disabled>a:hover,.pager .disabled>span{color:#777;cursor:not-allowed;background-color:#fff}.label{display:inline;padding:.2em .6em .3em;font-size:75%;font-weight:700;line-height:1;color:#fff;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25em}a.label:focus,a.label:hover{color:#fff;text-decoration:none;cursor:pointer}.label:empty{display:none}.btn .label{position:relative;top:-1px}.label-default{background-color:#777}.label-default[href]:focus,.label-default[href]:hover{background-color:#5e5e5e}.label-primary{background-color:#337ab7}.label-primary[href]:focus,.label-primary[href]:hover{background-color:#286090}.label-success{background-color:#5cb85c}.label-success[href]:focus,.label-success[href]:hover{background-color:#449d44}.label-info{background-color:#5bc0de}.label-info[href]:focus,.label-info[href]:hover{background-color:#31b0d5}.label-warning{background-color:#f0ad4e}.label-warning[href]:focus,.label-warning[href]:hover{background-color:#ec971f}.label-danger{background-color:#d9534f}.label-danger[href]:focus,.label-danger[href]:hover{background-color:#c9302c}.badge{display:inline-block;min-width:10px;padding:3px 7px;font-size:12px;font-weight:700;line-height:1;color:#fff;text-align:center;white-space:nowrap;vertical-align:middle;background-color:#777;border-radius:10px}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.btn-group-xs>.btn .badge,.btn-xs .badge{top:0;padding:1px 5px}a.badge:focus,a.badge:hover{color:#fff;text-decoration:none;cursor:pointer}.list-group-item.active>.badge,.nav-pills>.active>a>.badge{color:#337ab7;background-color:#fff}.list-group-item>.badge{float:right}.list-group-item>.badge+.badge{margin-right:5px}.nav-pills>li>a>.badge{margin-left:3px}.jumbotron{padding-top:30px;padding-bottom:30px;margin-bottom:30px;color:inherit;background-color:#eee}.jumbotron .h1,.jumbotron h1{color:inherit}.jumbotron p{margin-bottom:15px;font-size:21px;font-weight:200}.jumbotron>hr{border-top-color:#d5d5d5}.container .jumbotron,.container-fluid .jumbotron{padding-right:15px;padding-left:15px;border-radius:6px}.jumbotron .container{max-width:100%}@media screen and (min-width:768px){.jumbotron{padding-top:48px;padding-bottom:48px}.container .jumbotron,.container-fluid .jumbotron{padding-right:60px;padding-left:60px}.jumbotron .h1,.jumbotron h1{font-size:63px}}.thumbnail{display:block;padding:4px;margin-bottom:20px;line-height:1.42857143;background-color:#fff;border:1px solid #ddd;border-radius:4px;-webkit-transition:border .2s ease-in-out;-o-transition:border .2s ease-in-out;transition:border .2s ease-in-out}.thumbnail a>img,.thumbnail>img{margin-right:auto;margin-left:auto}a.thumbnail.active,a.thumbnail:focus,a.thumbnail:hover{border-color:#337ab7}.thumbnail .caption{padding:9px;color:#333}.alert{padding:15px;margin-bottom:20px;border:1px solid transparent;border-radius:4px}.alert h4{margin-top:0;color:inherit}.alert .alert-link{font-weight:700}.alert>p,.alert>ul{margin-bottom:0}.alert>p+p{margin-top:5px}.alert-dismissable,.alert-dismissible{padding-right:35px}.alert-dismissable .close,.alert-dismissible .close{position:relative;top:-2px;right:-21px;color:inherit}.alert-success{color:#3c763d;background-color:#dff0d8;border-color:#d6e9c6}.alert-success hr{border-top-color:#c9e2b3}.alert-success .alert-link{color:#2b542c}.alert-info{color:#31708f;background-color:#d9edf7;border-color:#bce8f1}.alert-info hr{border-top-color:#a6e1ec}.alert-info .alert-link{color:#245269}.alert-warning{color:#8a6d3b;background-color:#fcf8e3;border-color:#faebcc}.alert-warning hr{border-top-color:#f7e1b5}.alert-warning .alert-link{color:#66512c}.alert-danger{color:#a94442;background-color:#f2dede;border-color:#ebccd1}.alert-danger hr{border-top-color:#e4b9c0}.alert-danger .alert-link{color:#843534}@-webkit-keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}@-o-keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}@keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}.progress{height:20px;margin-bottom:20px;overflow:hidden;background-color:#f5f5f5;border-radius:4px;-webkit-box-shadow:inset 0 1px 2px rgba(0,0,0,.1);box-shadow:inset 0 1px 2px rgba(0,0,0,.1)}.progress-bar{float:left;width:0;height:100%;font-size:12px;line-height:20px;color:#fff;text-align:center;background-color:#337ab7;-webkit-box-shadow:inset 0 -1px 0 rgba(0,0,0,.15);box-shadow:inset 0 -1px 0 rgba(0,0,0,.15);-webkit-transition:width .6s ease;-o-transition:width .6s ease;transition:width .6s ease}.progress-bar-striped,.progress-striped .progress-bar{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);-webkit-background-size:40px 40px;background-size:40px 40px}.progress-bar.active,.progress.active .progress-bar{-webkit-animation:progress-bar-stripes 2s linear infinite;-o-animation:progress-bar-stripes 2s linear infinite;animation:progress-bar-stripes 2s linear infinite}.progress-bar-success{background-color:#5cb85c}.progress-striped .progress-bar-success{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.progress-bar-info{background-color:#5bc0de}.progress-striped .progress-bar-info{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.progress-bar-warning{background-color:#f0ad4e}.progress-striped .progress-bar-warning{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.progress-bar-danger{background-color:#d9534f}.progress-striped .progress-bar-danger{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.media{margin-top:15px}.media:first-child{margin-top:0}.media,.media-body{overflow:hidden;zoom:1}.media-body{width:10000px}.media-object{display:block}.media-object.img-thumbnail{max-width:none}.media-right,.media>.pull-right{padding-left:10px}.media-left,.media>.pull-left{padding-right:10px}.media-body,.media-left,.media-right{display:table-cell;vertical-align:top}.media-middle{vertical-align:middle}.media-bottom{vertical-align:bottom}.media-heading{margin-top:0;margin-bottom:5px}.media-list{padding-left:0;list-style:none}.list-group{padding-left:0;margin-bottom:20px}.list-group-item{position:relative;display:block;padding:10px 15px;margin-bottom:-1px;background-color:#fff;border:1px solid #ddd}.list-group-item:first-child{border-top-left-radius:4px;border-top-right-radius:4px}.list-group-item:last-child{margin-bottom:0;border-bottom-right-radius:4px;border-bottom-left-radius:4px}a.list-group-item,button.list-group-item{color:#555}a.list-group-item .list-group-item-heading,button.list-group-item .list-group-item-heading{color:#333}a.list-group-item:focus,a.list-group-item:hover,button.list-group-item:focus,button.list-group-item:hover{color:#555;text-decoration:none;background-color:#f5f5f5}button.list-group-item{width:100%;text-align:left}.list-group-item.disabled,.list-group-item.disabled:focus,.list-group-item.disabled:hover{color:#777;cursor:not-allowed;background-color:#eee}.list-group-item.disabled .list-group-item-heading,.list-group-item.disabled:focus .list-group-item-heading,.list-group-item.disabled:hover .list-group-item-heading{color:inherit}.list-group-item.disabled .list-group-item-text,.list-group-item.disabled:focus .list-group-item-text,.list-group-item.disabled:hover .list-group-item-text{color:#777}.list-group-item.active,.list-group-item.active:focus,.list-group-item.active:hover{z-index:2;color:#fff;background-color:#337ab7;border-color:#337ab7}.list-group-item.active .list-group-item-heading,.list-group-item.active .list-group-item-heading>.small,.list-group-item.active .list-group-item-heading>small,.list-group-item.active:focus .list-group-item-heading,.list-group-item.active:focus .list-group-item-heading>.small,.list-group-item.active:focus .list-group-item-heading>small,.list-group-item.active:hover .list-group-item-heading,.list-group-item.active:hover .list-group-item-heading>.small,.list-group-item.active:hover .list-group-item-heading>small{color:inherit}.list-group-item.active .list-group-item-text,.list-group-item.active:focus .list-group-item-text,.list-group-item.active:hover .list-group-item-text{color:#c7ddef}.list-group-item-success{color:#3c763d;background-color:#dff0d8}a.list-group-item-success,button.list-group-item-success{color:#3c763d}a.list-group-item-success .list-group-item-heading,button.list-group-item-success .list-group-item-heading{color:inherit}a.list-group-item-success:focus,a.list-group-item-success:hover,button.list-group-item-success:focus,button.list-group-item-success:hover{color:#3c763d;background-color:#d0e9c6}a.list-group-item-success.active,a.list-group-item-success.active:focus,a.list-group-item-success.active:hover,button.list-group-item-success.active,button.list-group-item-success.active:focus,button.list-group-item-success.active:hover{color:#fff;background-color:#3c763d;border-color:#3c763d}.list-group-item-info{color:#31708f;background-color:#d9edf7}a.list-group-item-info,button.list-group-item-info{color:#31708f}a.list-group-item-info .list-group-item-heading,button.list-group-item-info .list-group-item-heading{color:inherit}a.list-group-item-info:focus,a.list-group-item-info:hover,button.list-group-item-info:focus,button.list-group-item-info:hover{color:#31708f;background-color:#c4e3f3}a.list-group-item-info.active,a.list-group-item-info.active:focus,a.list-group-item-info.active:hover,button.list-group-item-info.active,button.list-group-item-info.active:focus,button.list-group-item-info.active:hover{color:#fff;background-color:#31708f;border-color:#31708f}.list-group-item-warning{color:#8a6d3b;background-color:#fcf8e3}a.list-group-item-warning,button.list-group-item-warning{color:#8a6d3b}a.list-group-item-warning .list-group-item-heading,button.list-group-item-warning .list-group-item-heading{color:inherit}a.list-group-item-warning:focus,a.list-group-item-warning:hover,button.list-group-item-warning:focus,button.list-group-item-warning:hover{color:#8a6d3b;background-color:#faf2cc}a.list-group-item-warning.active,a.list-group-item-warning.active:focus,a.list-group-item-warning.active:hover,button.list-group-item-warning.active,button.list-group-item-warning.active:focus,button.list-group-item-warning.active:hover{color:#fff;background-color:#8a6d3b;border-color:#8a6d3b}.list-group-item-danger{color:#a94442;background-color:#f2dede}a.list-group-item-danger,button.list-group-item-danger{color:#a94442}a.list-group-item-danger .list-group-item-heading,button.list-group-item-danger .list-group-item-heading{color:inherit}a.list-group-item-danger:focus,a.list-group-item-danger:hover,button.list-group-item-danger:focus,button.list-group-item-danger:hover{color:#a94442;background-color:#ebcccc}a.list-group-item-danger.active,a.list-group-item-danger.active:focus,a.list-group-item-danger.active:hover,button.list-group-item-danger.active,button.list-group-item-danger.active:focus,button.list-group-item-danger.active:hover{color:#fff;background-color:#a94442;border-color:#a94442}.list-group-item-heading{margin-top:0;margin-bottom:5px}.list-group-item-text{margin-bottom:0;line-height:1.3}.panel{margin-bottom:20px;background-color:#fff;border:1px solid transparent;border-radius:4px;-webkit-box-shadow:0 1px 1px rgba(0,0,0,.05);box-shadow:0 1px 1px rgba(0,0,0,.05)}.panel-body{padding:15px}.panel-heading{padding:10px 15px;border-bottom:1px solid transparent;border-top-left-radius:3px;border-top-right-radius:3px}.panel-heading>.dropdown .dropdown-toggle{color:inherit}.panel-title{margin-top:0;margin-bottom:0;font-size:16px;color:inherit}.panel-title>.small,.panel-title>.small>a,.panel-title>a,.panel-title>small,.panel-title>small>a{color:inherit}.panel-footer{padding:10px 15px;background-color:#f5f5f5;border-top:1px solid #ddd;border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel>.list-group,.panel>.panel-collapse>.list-group{margin-bottom:0}.panel>.list-group .list-group-item,.panel>.panel-collapse>.list-group .list-group-item{border-width:1px 0;border-radius:0}.panel>.list-group:first-child .list-group-item:first-child,.panel>.panel-collapse>.list-group:first-child .list-group-item:first-child{border-top:0;border-top-left-radius:3px;border-top-right-radius:3px}.panel>.list-group:last-child .list-group-item:last-child,.panel>.panel-collapse>.list-group:last-child .list-group-item:last-child{border-bottom:0;border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel>.panel-heading+.panel-collapse>.list-group .list-group-item:first-child{border-top-left-radius:0;border-top-right-radius:0}.panel-heading+.list-group .list-group-item:first-child{border-top-width:0}.list-group+.panel-footer{border-top-width:0}.panel>.panel-collapse>.table,.panel>.table,.panel>.table-responsive>.table{margin-bottom:0}.panel>.panel-collapse>.table caption,.panel>.table caption,.panel>.table-responsive>.table caption{padding-right:15px;padding-left:15px}.panel>.table-responsive:first-child>.table:first-child,.panel>.table:first-child{border-top-left-radius:3px;border-top-right-radius:3px}.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child,.panel>.table:first-child>tbody:first-child>tr:first-child,.panel>.table:first-child>thead:first-child>tr:first-child{border-top-left-radius:3px;border-top-right-radius:3px}.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child td:first-child,.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child th:first-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child td:first-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child th:first-child,.panel>.table:first-child>tbody:first-child>tr:first-child td:first-child,.panel>.table:first-child>tbody:first-child>tr:first-child th:first-child,.panel>.table:first-child>thead:first-child>tr:first-child td:first-child,.panel>.table:first-child>thead:first-child>tr:first-child th:first-child{border-top-left-radius:3px}.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child td:last-child,.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child th:last-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child td:last-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child th:last-child,.panel>.table:first-child>tbody:first-child>tr:first-child td:last-child,.panel>.table:first-child>tbody:first-child>tr:first-child th:last-child,.panel>.table:first-child>thead:first-child>tr:first-child td:last-child,.panel>.table:first-child>thead:first-child>tr:first-child th:last-child{border-top-right-radius:3px}.panel>.table-responsive:last-child>.table:last-child,.panel>.table:last-child{border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child,.panel>.table:last-child>tbody:last-child>tr:last-child,.panel>.table:last-child>tfoot:last-child>tr:last-child{border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child td:first-child,.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child th:first-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child td:first-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child th:first-child,.panel>.table:last-child>tbody:last-child>tr:last-child td:first-child,.panel>.table:last-child>tbody:last-child>tr:last-child th:first-child,.panel>.table:last-child>tfoot:last-child>tr:last-child td:first-child,.panel>.table:last-child>tfoot:last-child>tr:last-child th:first-child{border-bottom-left-radius:3px}.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child td:last-child,.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child th:last-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child td:last-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child th:last-child,.panel>.table:last-child>tbody:last-child>tr:last-child td:last-child,.panel>.table:last-child>tbody:last-child>tr:last-child th:last-child,.panel>.table:last-child>tfoot:last-child>tr:last-child td:last-child,.panel>.table:last-child>tfoot:last-child>tr:last-child th:last-child{border-bottom-right-radius:3px}.panel>.panel-body+.table,.panel>.panel-body+.table-responsive,.panel>.table+.panel-body,.panel>.table-responsive+.panel-body{border-top:1px solid #ddd}.panel>.table>tbody:first-child>tr:first-child td,.panel>.table>tbody:first-child>tr:first-child th{border-top:0}.panel>.table-bordered,.panel>.table-responsive>.table-bordered{border:0}.panel>.table-bordered>tbody>tr>td:first-child,.panel>.table-bordered>tbody>tr>th:first-child,.panel>.table-bordered>tfoot>tr>td:first-child,.panel>.table-bordered>tfoot>tr>th:first-child,.panel>.table-bordered>thead>tr>td:first-child,.panel>.table-bordered>thead>tr>th:first-child,.panel>.table-responsive>.table-bordered>tbody>tr>td:first-child,.panel>.table-responsive>.table-bordered>tbody>tr>th:first-child,.panel>.table-responsive>.table-bordered>tfoot>tr>td:first-child,.panel>.table-responsive>.table-bordered>tfoot>tr>th:first-child,.panel>.table-responsive>.table-bordered>thead>tr>td:first-child,.panel>.table-responsive>.table-bordered>thead>tr>th:first-child{border-left:0}.panel>.table-bordered>tbody>tr>td:last-child,.panel>.table-bordered>tbody>tr>th:last-child,.panel>.table-bordered>tfoot>tr>td:last-child,.panel>.table-bordered>tfoot>tr>th:last-child,.panel>.table-bordered>thead>tr>td:last-child,.panel>.table-bordered>thead>tr>th:last-child,.panel>.table-responsive>.table-bordered>tbody>tr>td:last-child,.panel>.table-responsive>.table-bordered>tbody>tr>th:last-child,.panel>.table-responsive>.table-bordered>tfoot>tr>td:last-child,.panel>.table-responsive>.table-bordered>tfoot>tr>th:last-child,.panel>.table-responsive>.table-bordered>thead>tr>td:last-child,.panel>.table-responsive>.table-bordered>thead>tr>th:last-child{border-right:0}.panel>.table-bordered>tbody>tr:first-child>td,.panel>.table-bordered>tbody>tr:first-child>th,.panel>.table-bordered>thead>tr:first-child>td,.panel>.table-bordered>thead>tr:first-child>th,.panel>.table-responsive>.table-bordered>tbody>tr:first-child>td,.panel>.table-responsive>.table-bordered>tbody>tr:first-child>th,.panel>.table-responsive>.table-bordered>thead>tr:first-child>td,.panel>.table-responsive>.table-bordered>thead>tr:first-child>th{border-bottom:0}.panel>.table-bordered>tbody>tr:last-child>td,.panel>.table-bordered>tbody>tr:last-child>th,.panel>.table-bordered>tfoot>tr:last-child>td,.panel>.table-bordered>tfoot>tr:last-child>th,.panel>.table-responsive>.table-bordered>tbody>tr:last-child>td,.panel>.table-responsive>.table-bordered>tbody>tr:last-child>th,.panel>.table-responsive>.table-bordered>tfoot>tr:last-child>td,.panel>.table-responsive>.table-bordered>tfoot>tr:last-child>th{border-bottom:0}.panel>.table-responsive{margin-bottom:0;border:0}.panel-group{margin-bottom:20px}.panel-group .panel{margin-bottom:0;border-radius:4px}.panel-group .panel+.panel{margin-top:5px}.panel-group .panel-heading{border-bottom:0}.panel-group .panel-heading+.panel-collapse>.list-group,.panel-group .panel-heading+.panel-collapse>.panel-body{border-top:1px solid #ddd}.panel-group .panel-footer{border-top:0}.panel-group .panel-footer+.panel-collapse .panel-body{border-bottom:1px solid #ddd}.panel-default{border-color:#ddd}.panel-default>.panel-heading{color:#333;background-color:#f5f5f5;border-color:#ddd}.panel-default>.panel-heading+.panel-collapse>.panel-body{border-top-color:#ddd}.panel-default>.panel-heading .badge{color:#f5f5f5;background-color:#333}.panel-default>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#ddd}.panel-primary{border-color:#337ab7}.panel-primary>.panel-heading{color:#fff;background-color:#337ab7;border-color:#337ab7}.panel-primary>.panel-heading+.panel-collapse>.panel-body{border-top-color:#337ab7}.panel-primary>.panel-heading .badge{color:#337ab7;background-color:#fff}.panel-primary>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#337ab7}.panel-success{border-color:#d6e9c6}.panel-success>.panel-heading{color:#3c763d;background-color:#dff0d8;border-color:#d6e9c6}.panel-success>.panel-heading+.panel-collapse>.panel-body{border-top-color:#d6e9c6}.panel-success>.panel-heading .badge{color:#dff0d8;background-color:#3c763d}.panel-success>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#d6e9c6}.panel-info{border-color:#bce8f1}.panel-info>.panel-heading{color:#31708f;background-color:#d9edf7;border-color:#bce8f1}.panel-info>.panel-heading+.panel-collapse>.panel-body{border-top-color:#bce8f1}.panel-info>.panel-heading .badge{color:#d9edf7;background-color:#31708f}.panel-info>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#bce8f1}.panel-warning{border-color:#faebcc}.panel-warning>.panel-heading{color:#8a6d3b;background-color:#fcf8e3;border-color:#faebcc}.panel-warning>.panel-heading+.panel-collapse>.panel-body{border-top-color:#faebcc}.panel-warning>.panel-heading .badge{color:#fcf8e3;background-color:#8a6d3b}.panel-warning>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#faebcc}.panel-danger{border-color:#ebccd1}.panel-danger>.panel-heading{color:#a94442;background-color:#f2dede;border-color:#ebccd1}.panel-danger>.panel-heading+.panel-collapse>.panel-body{border-top-color:#ebccd1}.panel-danger>.panel-heading .badge{color:#f2dede;background-color:#a94442}.panel-danger>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#ebccd1}.embed-responsive{position:relative;display:block;height:0;padding:0;overflow:hidden}.embed-responsive .embed-responsive-item,.embed-responsive embed,.embed-responsive iframe,.embed-responsive object,.embed-responsive video{position:absolute;top:0;bottom:0;left:0;width:100%;height:100%;border:0}.embed-responsive-16by9{padding-bottom:56.25%}.embed-responsive-4by3{padding-bottom:75%}.well{min-height:20px;padding:19px;margin-bottom:20px;background-color:#f5f5f5;border:1px solid #e3e3e3;border-radius:4px;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.05);box-shadow:inset 0 1px 1px rgba(0,0,0,.05)}.well blockquote{border-color:#ddd;border-color:rgba(0,0,0,.15)}.well-lg{padding:24px;border-radius:6px}.well-sm{padding:9px;border-radius:3px}.close{float:right;font-size:21px;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;filter:alpha(opacity=20);opacity:.2}.close:focus,.close:hover{color:#000;text-decoration:none;cursor:pointer;filter:alpha(opacity=50);opacity:.5}button.close{-webkit-appearance:none;padding:0;cursor:pointer;background:0 0;border:0}.modal-open{overflow:hidden}.modal{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1050;display:none;overflow:hidden;-webkit-overflow-scrolling:touch;outline:0}.modal.fade .modal-dialog{-webkit-transition:-webkit-transform .3s ease-out;-o-transition:-o-transform .3s ease-out;transition:transform .3s ease-out;-webkit-transform:translate(0,-25%);-ms-transform:translate(0,-25%);-o-transform:translate(0,-25%);transform:translate(0,-25%)}.modal.in .modal-dialog{-webkit-transform:translate(0,0);-ms-transform:translate(0,0);-o-transform:translate(0,0);transform:translate(0,0)}.modal-open .modal{overflow-x:hidden;overflow-y:auto}.modal-dialog{position:relative;width:auto;margin:10px}.modal-content{position:relative;background-color:#fff;-webkit-background-clip:padding-box;background-clip:padding-box;border:1px solid #999;border:1px solid rgba(0,0,0,.2);border-radius:6px;outline:0;-webkit-box-shadow:0 3px 9px rgba(0,0,0,.5);box-shadow:0 3px 9px rgba(0,0,0,.5)}.modal-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1040;background-color:#000}.modal-backdrop.fade{filter:alpha(opacity=0);opacity:0}.modal-backdrop.in{filter:alpha(opacity=50);opacity:.5}.modal-header{padding:15px;border-bottom:1px solid #e5e5e5}.modal-header .close{margin-top:-2px}.modal-title{margin:0;line-height:1.42857143}.modal-body{position:relative;padding:15px}.modal-footer{padding:15px;text-align:right;border-top:1px solid #e5e5e5}.modal-footer .btn+.btn{margin-bottom:0;margin-left:5px}.modal-footer .btn-group .btn+.btn{margin-left:-1px}.modal-footer .btn-block+.btn-block{margin-left:0}.modal-scrollbar-measure{position:absolute;top:-9999px;width:50px;height:50px;overflow:scroll}@media (min-width:768px){.modal-dialog{width:600px;margin:30px auto}.modal-content{-webkit-box-shadow:0 5px 15px rgba(0,0,0,.5);box-shadow:0 5px 15px rgba(0,0,0,.5)}.modal-sm{width:300px}}@media (min-width:992px){.modal-lg{width:900px}}.tooltip{position:absolute;z-index:1070;display:block;font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:12px;font-style:normal;font-weight:400;line-height:1.42857143;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;word-wrap:normal;white-space:normal;filter:alpha(opacity=0);opacity:0;line-break:auto}.tooltip.in{filter:alpha(opacity=90);opacity:.9}.tooltip.top{padding:5px 0;margin-top:-3px}.tooltip.right{padding:0 5px;margin-left:3px}.tooltip.bottom{padding:5px 0;margin-top:3px}.tooltip.left{padding:0 5px;margin-left:-3px}.tooltip-inner{max-width:200px;padding:3px 8px;color:#fff;text-align:center;background-color:#000;border-radius:4px}.tooltip-arrow{position:absolute;width:0;height:0;border-color:transparent;border-style:solid}.tooltip.top .tooltip-arrow{bottom:0;left:50%;margin-left:-5px;border-width:5px 5px 0;border-top-color:#000}.tooltip.top-left .tooltip-arrow{right:5px;bottom:0;margin-bottom:-5px;border-width:5px 5px 0;border-top-color:#000}.tooltip.top-right .tooltip-arrow{bottom:0;left:5px;margin-bottom:-5px;border-width:5px 5px 0;border-top-color:#000}.tooltip.right .tooltip-arrow{top:50%;left:0;margin-top:-5px;border-width:5px 5px 5px 0;border-right-color:#000}.tooltip.left .tooltip-arrow{top:50%;right:0;margin-top:-5px;border-width:5px 0 5px 5px;border-left-color:#000}.tooltip.bottom .tooltip-arrow{top:0;left:50%;margin-left:-5px;border-width:0 5px 5px;border-bottom-color:#000}.tooltip.bottom-left .tooltip-arrow{top:0;right:5px;margin-top:-5px;border-width:0 5px 5px;border-bottom-color:#000}.tooltip.bottom-right .tooltip-arrow{top:0;left:5px;margin-top:-5px;border-width:0 5px 5px;border-bottom-color:#000}.popover{position:absolute;top:0;left:0;z-index:1060;display:none;max-width:276px;padding:1px;font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:14px;font-style:normal;font-weight:400;line-height:1.42857143;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;word-wrap:normal;white-space:normal;background-color:#fff;-webkit-background-clip:padding-box;background-clip:padding-box;border:1px solid #ccc;border:1px solid rgba(0,0,0,.2);border-radius:6px;-webkit-box-shadow:0 5px 10px rgba(0,0,0,.2);box-shadow:0 5px 10px rgba(0,0,0,.2);line-break:auto}.popover.top{margin-top:-10px}.popover.right{margin-left:10px}.popover.bottom{margin-top:10px}.popover.left{margin-left:-10px}.popover-title{padding:8px 14px;margin:0;font-size:14px;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-radius:5px 5px 0 0}.popover-content{padding:9px 14px}.popover>.arrow,.popover>.arrow:after{position:absolute;display:block;width:0;height:0;border-color:transparent;border-style:solid}.popover>.arrow{border-width:11px}.popover>.arrow:after{content:"";border-width:10px}.popover.top>.arrow{bottom:-11px;left:50%;margin-left:-11px;border-top-color:#999;border-top-color:rgba(0,0,0,.25);border-bottom-width:0}.popover.top>.arrow:after{bottom:1px;margin-left:-10px;content:" ";border-top-color:#fff;border-bottom-width:0}.popover.right>.arrow{top:50%;left:-11px;margin-top:-11px;border-right-color:#999;border-right-color:rgba(0,0,0,.25);border-left-width:0}.popover.right>.arrow:after{bottom:-10px;left:1px;content:" ";border-right-color:#fff;border-left-width:0}.popover.bottom>.arrow{top:-11px;left:50%;margin-left:-11px;border-top-width:0;border-bottom-color:#999;border-bottom-color:rgba(0,0,0,.25)}.popover.bottom>.arrow:after{top:1px;margin-left:-10px;content:" ";border-top-width:0;border-bottom-color:#fff}.popover.left>.arrow{top:50%;right:-11px;margin-top:-11px;border-right-width:0;border-left-color:#999;border-left-color:rgba(0,0,0,.25)}.popover.left>.arrow:after{right:1px;bottom:-10px;content:" ";border-right-width:0;border-left-color:#fff}.carousel{position:relative}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner>.item{position:relative;display:none;-webkit-transition:.6s ease-in-out left;-o-transition:.6s ease-in-out left;transition:.6s ease-in-out left}.carousel-inner>.item>a>img,.carousel-inner>.item>img{line-height:1}@media all and (transform-3d),(-webkit-transform-3d){.carousel-inner>.item{-webkit-transition:-webkit-transform .6s ease-in-out;-o-transition:-o-transform .6s ease-in-out;transition:transform .6s ease-in-out;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-perspective:1000px;perspective:1000px}.carousel-inner>.item.active.right,.carousel-inner>.item.next{left:0;-webkit-transform:translate3d(100%,0,0);transform:translate3d(100%,0,0)}.carousel-inner>.item.active.left,.carousel-inner>.item.prev{left:0;-webkit-transform:translate3d(-100%,0,0);transform:translate3d(-100%,0,0)}.carousel-inner>.item.active,.carousel-inner>.item.next.left,.carousel-inner>.item.prev.right{left:0;-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}.carousel-inner>.active,.carousel-inner>.next,.carousel-inner>.prev{display:block}.carousel-inner>.active{left:0}.carousel-inner>.next,.carousel-inner>.prev{position:absolute;top:0;width:100%}.carousel-inner>.next{left:100%}.carousel-inner>.prev{left:-100%}.carousel-inner>.next.left,.carousel-inner>.prev.right{left:0}.carousel-inner>.active.left{left:-100%}.carousel-inner>.active.right{left:100%}.carousel-control{position:absolute;top:0;bottom:0;left:0;width:15%;font-size:20px;color:#fff;text-align:center;text-shadow:0 1px 2px rgba(0,0,0,.6);background-color:rgba(0,0,0,0);filter:alpha(opacity=50);opacity:.5}.carousel-control.left{background-image:-webkit-linear-gradient(left,rgba(0,0,0,.5) 0,rgba(0,0,0,.0001) 100%);background-image:-o-linear-gradient(left,rgba(0,0,0,.5) 0,rgba(0,0,0,.0001) 100%);background-image:-webkit-gradient(linear,left top,right top,from(rgba(0,0,0,.5)),to(rgba(0,0,0,.0001)));background-image:linear-gradient(to right,rgba(0,0,0,.5) 0,rgba(0,0,0,.0001) 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#80000000', endColorstr='#00000000', GradientType=1);background-repeat:repeat-x}.carousel-control.right{right:0;left:auto;background-image:-webkit-linear-gradient(left,rgba(0,0,0,.0001) 0,rgba(0,0,0,.5) 100%);background-image:-o-linear-gradient(left,rgba(0,0,0,.0001) 0,rgba(0,0,0,.5) 100%);background-image:-webkit-gradient(linear,left top,right top,from(rgba(0,0,0,.0001)),to(rgba(0,0,0,.5)));background-image:linear-gradient(to right,rgba(0,0,0,.0001) 0,rgba(0,0,0,.5) 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#00000000', endColorstr='#80000000', GradientType=1);background-repeat:repeat-x}.carousel-control:focus,.carousel-control:hover{color:#fff;text-decoration:none;filter:alpha(opacity=90);outline:0;opacity:.9}.carousel-control .glyphicon-chevron-left,.carousel-control .glyphicon-chevron-right,.carousel-control .icon-next,.carousel-control .icon-prev{position:absolute;top:50%;z-index:5;display:inline-block;margin-top:-10px}.carousel-control .glyphicon-chevron-left,.carousel-control .icon-prev{left:50%;margin-left:-10px}.carousel-control .glyphicon-chevron-right,.carousel-control .icon-next{right:50%;margin-right:-10px}.carousel-control .icon-next,.carousel-control .icon-prev{width:20px;height:20px;font-family:serif;line-height:1}.carousel-control .icon-prev:before{content:'\\2039'}.carousel-control .icon-next:before{content:'\\203a'}.carousel-indicators{position:absolute;bottom:10px;left:50%;z-index:15;width:60%;padding-left:0;margin-left:-30%;text-align:center;list-style:none}.carousel-indicators li{display:inline-block;width:10px;height:10px;margin:1px;text-indent:-999px;cursor:pointer;background-color:#000\\9;background-color:rgba(0,0,0,0);border:1px solid #fff;border-radius:10px}.carousel-indicators .active{width:12px;height:12px;margin:0;background-color:#fff}.carousel-caption{position:absolute;right:15%;bottom:20px;left:15%;z-index:10;padding-top:20px;padding-bottom:20px;color:#fff;text-align:center;text-shadow:0 1px 2px rgba(0,0,0,.6)}.carousel-caption .btn{text-shadow:none}@media screen and (min-width:768px){.carousel-control .glyphicon-chevron-left,.carousel-control .glyphicon-chevron-right,.carousel-control .icon-next,.carousel-control .icon-prev{width:30px;height:30px;margin-top:-10px;font-size:30px}.carousel-control .glyphicon-chevron-left,.carousel-control .icon-prev{margin-left:-10px}.carousel-control .glyphicon-chevron-right,.carousel-control .icon-next{margin-right:-10px}.carousel-caption{right:20%;left:20%;padding-bottom:30px}.carousel-indicators{bottom:20px}}.btn-group-vertical>.btn-group:after,.btn-group-vertical>.btn-group:before,.btn-toolbar:after,.btn-toolbar:before,.clearfix:after,.clearfix:before,.container-fluid:after,.container-fluid:before,.container:after,.container:before,.dl-horizontal dd:after,.dl-horizontal dd:before,.form-horizontal .form-group:after,.form-horizontal .form-group:before,.modal-footer:after,.modal-footer:before,.modal-header:after,.modal-header:before,.nav:after,.nav:before,.navbar-collapse:after,.navbar-collapse:before,.navbar-header:after,.navbar-header:before,.navbar:after,.navbar:before,.pager:after,.pager:before,.panel-body:after,.panel-body:before,.row:after,.row:before{display:table;content:" "}.btn-group-vertical>.btn-group:after,.btn-toolbar:after,.clearfix:after,.container-fluid:after,.container:after,.dl-horizontal dd:after,.form-horizontal .form-group:after,.modal-footer:after,.modal-header:after,.nav:after,.navbar-collapse:after,.navbar-header:after,.navbar:after,.pager:after,.panel-body:after,.row:after{clear:both}.center-block{display:block;margin-right:auto;margin-left:auto}.pull-right{float:right!important}.pull-left{float:left!important}.hide{display:none!important}.show{display:block!important}.invisible{visibility:hidden}.text-hide{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.hidden{display:none!important}.affix{position:fixed}@-ms-viewport{width:device-width}.visible-lg,.visible-md,.visible-sm,.visible-xs{display:none!important}.visible-lg-block,.visible-lg-inline,.visible-lg-inline-block,.visible-md-block,.visible-md-inline,.visible-md-inline-block,.visible-sm-block,.visible-sm-inline,.visible-sm-inline-block,.visible-xs-block,.visible-xs-inline,.visible-xs-inline-block{display:none!important}@media (max-width:767px){.visible-xs{display:block!important}table.visible-xs{display:table!important}tr.visible-xs{display:table-row!important}td.visible-xs,th.visible-xs{display:table-cell!important}}@media (max-width:767px){.visible-xs-block{display:block!important}}@media (max-width:767px){.visible-xs-inline{display:inline!important}}@media (max-width:767px){.visible-xs-inline-block{display:inline-block!important}}@media (min-width:768px) and (max-width:991px){.visible-sm{display:block!important}table.visible-sm{display:table!important}tr.visible-sm{display:table-row!important}td.visible-sm,th.visible-sm{display:table-cell!important}}@media (min-width:768px) and (max-width:991px){.visible-sm-block{display:block!important}}@media (min-width:768px) and (max-width:991px){.visible-sm-inline{display:inline!important}}@media (min-width:768px) and (max-width:991px){.visible-sm-inline-block{display:inline-block!important}}@media (min-width:992px) and (max-width:1199px){.visible-md{display:block!important}table.visible-md{display:table!important}tr.visible-md{display:table-row!important}td.visible-md,th.visible-md{display:table-cell!important}}@media (min-width:992px) and (max-width:1199px){.visible-md-block{display:block!important}}@media (min-width:992px) and (max-width:1199px){.visible-md-inline{display:inline!important}}@media (min-width:992px) and (max-width:1199px){.visible-md-inline-block{display:inline-block!important}}@media (min-width:1200px){.visible-lg{display:block!important}table.visible-lg{display:table!important}tr.visible-lg{display:table-row!important}td.visible-lg,th.visible-lg{display:table-cell!important}}@media (min-width:1200px){.visible-lg-block{display:block!important}}@media (min-width:1200px){.visible-lg-inline{display:inline!important}}@media (min-width:1200px){.visible-lg-inline-block{display:inline-block!important}}@media (max-width:767px){.hidden-xs{display:none!important}}@media (min-width:768px) and (max-width:991px){.hidden-sm{display:none!important}}@media (min-width:992px) and (max-width:1199px){.hidden-md{display:none!important}}@media (min-width:1200px){.hidden-lg{display:none!important}}.visible-print{display:none!important}@media print{.visible-print{display:block!important}table.visible-print{display:table!important}tr.visible-print{display:table-row!important}td.visible-print,th.visible-print{display:table-cell!important}}.visible-print-block{display:none!important}@media print{.visible-print-block{display:block!important}}.visible-print-inline{display:none!important}@media print{.visible-print-inline{display:inline!important}}.visible-print-inline-block{display:none!important}@media print{.visible-print-inline-block{display:inline-block!important}}@media print{.hidden-print{display:none!important}}\n", | |
| "/*# sourceMappingURL=bootstrap.min.css.map *//*!\n", | |
| " * Bootstrap v3.3.7 (http://getbootstrap.com)\n", | |
| " * Copyright 2011-2016 Twitter, Inc.\n", | |
| " * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n", | |
| " */.btn-danger,.btn-default,.btn-info,.btn-primary,.btn-success,.btn-warning{text-shadow:0 -1px 0 rgba(0,0,0,.2);-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075)}.btn-danger.active,.btn-danger:active,.btn-default.active,.btn-default:active,.btn-info.active,.btn-info:active,.btn-primary.active,.btn-primary:active,.btn-success.active,.btn-success:active,.btn-warning.active,.btn-warning:active{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125);box-shadow:inset 0 3px 5px rgba(0,0,0,.125)}.btn-danger.disabled,.btn-danger[disabled],.btn-default.disabled,.btn-default[disabled],.btn-info.disabled,.btn-info[disabled],.btn-primary.disabled,.btn-primary[disabled],.btn-success.disabled,.btn-success[disabled],.btn-warning.disabled,.btn-warning[disabled],fieldset[disabled] .btn-danger,fieldset[disabled] .btn-default,fieldset[disabled] .btn-info,fieldset[disabled] .btn-primary,fieldset[disabled] .btn-success,fieldset[disabled] .btn-warning{-webkit-box-shadow:none;box-shadow:none}.btn-danger .badge,.btn-default .badge,.btn-info .badge,.btn-primary .badge,.btn-success .badge,.btn-warning .badge{text-shadow:none}.btn.active,.btn:active{background-image:none}.btn-default{text-shadow:0 1px 0 #fff;background-image:-webkit-linear-gradient(top,#fff 0,#e0e0e0 100%);background-image:-o-linear-gradient(top,#fff 0,#e0e0e0 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#fff),to(#e0e0e0));background-image:linear-gradient(to bottom,#fff 0,#e0e0e0 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff', endColorstr='#ffe0e0e0', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#dbdbdb;border-color:#ccc}.btn-default:focus,.btn-default:hover{background-color:#e0e0e0;background-position:0 -15px}.btn-default.active,.btn-default:active{background-color:#e0e0e0;border-color:#dbdbdb}.btn-default.disabled,.btn-default.disabled.active,.btn-default.disabled.focus,.btn-default.disabled:active,.btn-default.disabled:focus,.btn-default.disabled:hover,.btn-default[disabled],.btn-default[disabled].active,.btn-default[disabled].focus,.btn-default[disabled]:active,.btn-default[disabled]:focus,.btn-default[disabled]:hover,fieldset[disabled] .btn-default,fieldset[disabled] .btn-default.active,fieldset[disabled] .btn-default.focus,fieldset[disabled] .btn-default:active,fieldset[disabled] .btn-default:focus,fieldset[disabled] .btn-default:hover{background-color:#e0e0e0;background-image:none}.btn-primary{background-image:-webkit-linear-gradient(top,#337ab7 0,#265a88 100%);background-image:-o-linear-gradient(top,#337ab7 0,#265a88 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#265a88));background-image:linear-gradient(to bottom,#337ab7 0,#265a88 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff265a88', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#245580}.btn-primary:focus,.btn-primary:hover{background-color:#265a88;background-position:0 -15px}.btn-primary.active,.btn-primary:active{background-color:#265a88;border-color:#245580}.btn-primary.disabled,.btn-primary.disabled.active,.btn-primary.disabled.focus,.btn-primary.disabled:active,.btn-primary.disabled:focus,.btn-primary.disabled:hover,.btn-primary[disabled],.btn-primary[disabled].active,.btn-primary[disabled].focus,.btn-primary[disabled]:active,.btn-primary[disabled]:focus,.btn-primary[disabled]:hover,fieldset[disabled] .btn-primary,fieldset[disabled] .btn-primary.active,fieldset[disabled] .btn-primary.focus,fieldset[disabled] .btn-primary:active,fieldset[disabled] .btn-primary:focus,fieldset[disabled] .btn-primary:hover{background-color:#265a88;background-image:none}.btn-success{background-image:-webkit-linear-gradient(top,#5cb85c 0,#419641 100%);background-image:-o-linear-gradient(top,#5cb85c 0,#419641 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#5cb85c),to(#419641));background-image:linear-gradient(to bottom,#5cb85c 0,#419641 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5cb85c', endColorstr='#ff419641', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#3e8f3e}.btn-success:focus,.btn-success:hover{background-color:#419641;background-position:0 -15px}.btn-success.active,.btn-success:active{background-color:#419641;border-color:#3e8f3e}.btn-success.disabled,.btn-success.disabled.active,.btn-success.disabled.focus,.btn-success.disabled:active,.btn-success.disabled:focus,.btn-success.disabled:hover,.btn-success[disabled],.btn-success[disabled].active,.btn-success[disabled].focus,.btn-success[disabled]:active,.btn-success[disabled]:focus,.btn-success[disabled]:hover,fieldset[disabled] .btn-success,fieldset[disabled] .btn-success.active,fieldset[disabled] .btn-success.focus,fieldset[disabled] .btn-success:active,fieldset[disabled] .btn-success:focus,fieldset[disabled] .btn-success:hover{background-color:#419641;background-image:none}.btn-info{background-image:-webkit-linear-gradient(top,#5bc0de 0,#2aabd2 100%);background-image:-o-linear-gradient(top,#5bc0de 0,#2aabd2 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#5bc0de),to(#2aabd2));background-image:linear-gradient(to bottom,#5bc0de 0,#2aabd2 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5bc0de', endColorstr='#ff2aabd2', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#28a4c9}.btn-info:focus,.btn-info:hover{background-color:#2aabd2;background-position:0 -15px}.btn-info.active,.btn-info:active{background-color:#2aabd2;border-color:#28a4c9}.btn-info.disabled,.btn-info.disabled.active,.btn-info.disabled.focus,.btn-info.disabled:active,.btn-info.disabled:focus,.btn-info.disabled:hover,.btn-info[disabled],.btn-info[disabled].active,.btn-info[disabled].focus,.btn-info[disabled]:active,.btn-info[disabled]:focus,.btn-info[disabled]:hover,fieldset[disabled] .btn-info,fieldset[disabled] .btn-info.active,fieldset[disabled] .btn-info.focus,fieldset[disabled] .btn-info:active,fieldset[disabled] .btn-info:focus,fieldset[disabled] .btn-info:hover{background-color:#2aabd2;background-image:none}.btn-warning{background-image:-webkit-linear-gradient(top,#f0ad4e 0,#eb9316 100%);background-image:-o-linear-gradient(top,#f0ad4e 0,#eb9316 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f0ad4e),to(#eb9316));background-image:linear-gradient(to bottom,#f0ad4e 0,#eb9316 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff0ad4e', endColorstr='#ffeb9316', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#e38d13}.btn-warning:focus,.btn-warning:hover{background-color:#eb9316;background-position:0 -15px}.btn-warning.active,.btn-warning:active{background-color:#eb9316;border-color:#e38d13}.btn-warning.disabled,.btn-warning.disabled.active,.btn-warning.disabled.focus,.btn-warning.disabled:active,.btn-warning.disabled:focus,.btn-warning.disabled:hover,.btn-warning[disabled],.btn-warning[disabled].active,.btn-warning[disabled].focus,.btn-warning[disabled]:active,.btn-warning[disabled]:focus,.btn-warning[disabled]:hover,fieldset[disabled] .btn-warning,fieldset[disabled] .btn-warning.active,fieldset[disabled] .btn-warning.focus,fieldset[disabled] .btn-warning:active,fieldset[disabled] .btn-warning:focus,fieldset[disabled] .btn-warning:hover{background-color:#eb9316;background-image:none}.btn-danger{background-image:-webkit-linear-gradient(top,#d9534f 0,#c12e2a 100%);background-image:-o-linear-gradient(top,#d9534f 0,#c12e2a 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#d9534f),to(#c12e2a));background-image:linear-gradient(to bottom,#d9534f 0,#c12e2a 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffd9534f', endColorstr='#ffc12e2a', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#b92c28}.btn-danger:focus,.btn-danger:hover{background-color:#c12e2a;background-position:0 -15px}.btn-danger.active,.btn-danger:active{background-color:#c12e2a;border-color:#b92c28}.btn-danger.disabled,.btn-danger.disabled.active,.btn-danger.disabled.focus,.btn-danger.disabled:active,.btn-danger.disabled:focus,.btn-danger.disabled:hover,.btn-danger[disabled],.btn-danger[disabled].active,.btn-danger[disabled].focus,.btn-danger[disabled]:active,.btn-danger[disabled]:focus,.btn-danger[disabled]:hover,fieldset[disabled] .btn-danger,fieldset[disabled] .btn-danger.active,fieldset[disabled] .btn-danger.focus,fieldset[disabled] .btn-danger:active,fieldset[disabled] .btn-danger:focus,fieldset[disabled] .btn-danger:hover{background-color:#c12e2a;background-image:none}.img-thumbnail,.thumbnail{-webkit-box-shadow:0 1px 2px rgba(0,0,0,.075);box-shadow:0 1px 2px rgba(0,0,0,.075)}.dropdown-menu>li>a:focus,.dropdown-menu>li>a:hover{background-color:#e8e8e8;background-image:-webkit-linear-gradient(top,#f5f5f5 0,#e8e8e8 100%);background-image:-o-linear-gradient(top,#f5f5f5 0,#e8e8e8 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f5f5f5),to(#e8e8e8));background-image:linear-gradient(to bottom,#f5f5f5 0,#e8e8e8 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff5f5f5', endColorstr='#ffe8e8e8', GradientType=0);background-repeat:repeat-x}.dropdown-menu>.active>a,.dropdown-menu>.active>a:focus,.dropdown-menu>.active>a:hover{background-color:#2e6da4;background-image:-webkit-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-o-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#2e6da4));background-image:linear-gradient(to bottom,#337ab7 0,#2e6da4 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff2e6da4', GradientType=0);background-repeat:repeat-x}.navbar-default{background-image:-webkit-linear-gradient(top,#fff 0,#f8f8f8 100%);background-image:-o-linear-gradient(top,#fff 0,#f8f8f8 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#fff),to(#f8f8f8));background-image:linear-gradient(to bottom,#fff 0,#f8f8f8 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff', endColorstr='#fff8f8f8', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-radius:4px;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 5px rgba(0,0,0,.075);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 5px rgba(0,0,0,.075)}.navbar-default .navbar-nav>.active>a,.navbar-default .navbar-nav>.open>a{background-image:-webkit-linear-gradient(top,#dbdbdb 0,#e2e2e2 100%);background-image:-o-linear-gradient(top,#dbdbdb 0,#e2e2e2 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#dbdbdb),to(#e2e2e2));background-image:linear-gradient(to bottom,#dbdbdb 0,#e2e2e2 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffdbdbdb', endColorstr='#ffe2e2e2', GradientType=0);background-repeat:repeat-x;-webkit-box-shadow:inset 0 3px 9px rgba(0,0,0,.075);box-shadow:inset 0 3px 9px rgba(0,0,0,.075)}.navbar-brand,.navbar-nav>li>a{text-shadow:0 1px 0 rgba(255,255,255,.25)}.navbar-inverse{background-image:-webkit-linear-gradient(top,#3c3c3c 0,#222 100%);background-image:-o-linear-gradient(top,#3c3c3c 0,#222 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#3c3c3c),to(#222));background-image:linear-gradient(to bottom,#3c3c3c 0,#222 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff3c3c3c', endColorstr='#ff222222', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-radius:4px}.navbar-inverse .navbar-nav>.active>a,.navbar-inverse .navbar-nav>.open>a{background-image:-webkit-linear-gradient(top,#080808 0,#0f0f0f 100%);background-image:-o-linear-gradient(top,#080808 0,#0f0f0f 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#080808),to(#0f0f0f));background-image:linear-gradient(to bottom,#080808 0,#0f0f0f 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff080808', endColorstr='#ff0f0f0f', GradientType=0);background-repeat:repeat-x;-webkit-box-shadow:inset 0 3px 9px rgba(0,0,0,.25);box-shadow:inset 0 3px 9px rgba(0,0,0,.25)}.navbar-inverse .navbar-brand,.navbar-inverse .navbar-nav>li>a{text-shadow:0 -1px 0 rgba(0,0,0,.25)}.navbar-fixed-bottom,.navbar-fixed-top,.navbar-static-top{border-radius:0}@media (max-width:767px){.navbar .navbar-nav .open .dropdown-menu>.active>a,.navbar .navbar-nav .open .dropdown-menu>.active>a:focus,.navbar .navbar-nav .open .dropdown-menu>.active>a:hover{color:#fff;background-image:-webkit-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-o-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#2e6da4));background-image:linear-gradient(to bottom,#337ab7 0,#2e6da4 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff2e6da4', GradientType=0);background-repeat:repeat-x}}.alert{text-shadow:0 1px 0 rgba(255,255,255,.2);-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 2px rgba(0,0,0,.05);box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 2px rgba(0,0,0,.05)}.alert-success{background-image:-webkit-linear-gradient(top,#dff0d8 0,#c8e5bc 100%);background-image:-o-linear-gradient(top,#dff0d8 0,#c8e5bc 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#dff0d8),to(#c8e5bc));background-image:linear-gradient(to bottom,#dff0d8 0,#c8e5bc 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffdff0d8', endColorstr='#ffc8e5bc', GradientType=0);background-repeat:repeat-x;border-color:#b2dba1}.alert-info{background-image:-webkit-linear-gradient(top,#d9edf7 0,#b9def0 100%);background-image:-o-linear-gradient(top,#d9edf7 0,#b9def0 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#d9edf7),to(#b9def0));background-image:linear-gradient(to bottom,#d9edf7 0,#b9def0 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffd9edf7', endColorstr='#ffb9def0', GradientType=0);background-repeat:repeat-x;border-color:#9acfea}.alert-warning{background-image:-webkit-linear-gradient(top,#fcf8e3 0,#f8efc0 100%);background-image:-o-linear-gradient(top,#fcf8e3 0,#f8efc0 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#fcf8e3),to(#f8efc0));background-image:linear-gradient(to bottom,#fcf8e3 0,#f8efc0 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fffcf8e3', endColorstr='#fff8efc0', GradientType=0);background-repeat:repeat-x;border-color:#f5e79e}.alert-danger{background-image:-webkit-linear-gradient(top,#f2dede 0,#e7c3c3 100%);background-image:-o-linear-gradient(top,#f2dede 0,#e7c3c3 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f2dede),to(#e7c3c3));background-image:linear-gradient(to bottom,#f2dede 0,#e7c3c3 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff2dede', endColorstr='#ffe7c3c3', GradientType=0);background-repeat:repeat-x;border-color:#dca7a7}.progress{background-image:-webkit-linear-gradient(top,#ebebeb 0,#f5f5f5 100%);background-image:-o-linear-gradient(top,#ebebeb 0,#f5f5f5 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#ebebeb),to(#f5f5f5));background-image:linear-gradient(to bottom,#ebebeb 0,#f5f5f5 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffebebeb', endColorstr='#fff5f5f5', GradientType=0);background-repeat:repeat-x}.progress-bar{background-image:-webkit-linear-gradient(top,#337ab7 0,#286090 100%);background-image:-o-linear-gradient(top,#337ab7 0,#286090 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#286090));background-image:linear-gradient(to bottom,#337ab7 0,#286090 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff286090', GradientType=0);background-repeat:repeat-x}.progress-bar-success{background-image:-webkit-linear-gradient(top,#5cb85c 0,#449d44 100%);background-image:-o-linear-gradient(top,#5cb85c 0,#449d44 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#5cb85c),to(#449d44));background-image:linear-gradient(to bottom,#5cb85c 0,#449d44 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5cb85c', endColorstr='#ff449d44', GradientType=0);background-repeat:repeat-x}.progress-bar-info{background-image:-webkit-linear-gradient(top,#5bc0de 0,#31b0d5 100%);background-image:-o-linear-gradient(top,#5bc0de 0,#31b0d5 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#5bc0de),to(#31b0d5));background-image:linear-gradient(to bottom,#5bc0de 0,#31b0d5 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5bc0de', endColorstr='#ff31b0d5', GradientType=0);background-repeat:repeat-x}.progress-bar-warning{background-image:-webkit-linear-gradient(top,#f0ad4e 0,#ec971f 100%);background-image:-o-linear-gradient(top,#f0ad4e 0,#ec971f 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f0ad4e),to(#ec971f));background-image:linear-gradient(to bottom,#f0ad4e 0,#ec971f 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff0ad4e', endColorstr='#ffec971f', GradientType=0);background-repeat:repeat-x}.progress-bar-danger{background-image:-webkit-linear-gradient(top,#d9534f 0,#c9302c 100%);background-image:-o-linear-gradient(top,#d9534f 0,#c9302c 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#d9534f),to(#c9302c));background-image:linear-gradient(to bottom,#d9534f 0,#c9302c 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffd9534f', endColorstr='#ffc9302c', GradientType=0);background-repeat:repeat-x}.progress-bar-striped{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.list-group{border-radius:4px;-webkit-box-shadow:0 1px 2px rgba(0,0,0,.075);box-shadow:0 1px 2px rgba(0,0,0,.075)}.list-group-item.active,.list-group-item.active:focus,.list-group-item.active:hover{text-shadow:0 -1px 0 #286090;background-image:-webkit-linear-gradient(top,#337ab7 0,#2b669a 100%);background-image:-o-linear-gradient(top,#337ab7 0,#2b669a 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#2b669a));background-image:linear-gradient(to bottom,#337ab7 0,#2b669a 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff2b669a', GradientType=0);background-repeat:repeat-x;border-color:#2b669a}.list-group-item.active .badge,.list-group-item.active:focus .badge,.list-group-item.active:hover .badge{text-shadow:none}.panel{-webkit-box-shadow:0 1px 2px rgba(0,0,0,.05);box-shadow:0 1px 2px rgba(0,0,0,.05)}.panel-default>.panel-heading{background-image:-webkit-linear-gradient(top,#f5f5f5 0,#e8e8e8 100%);background-image:-o-linear-gradient(top,#f5f5f5 0,#e8e8e8 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f5f5f5),to(#e8e8e8));background-image:linear-gradient(to bottom,#f5f5f5 0,#e8e8e8 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff5f5f5', endColorstr='#ffe8e8e8', GradientType=0);background-repeat:repeat-x}.panel-primary>.panel-heading{background-image:-webkit-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-o-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#2e6da4));background-image:linear-gradient(to bottom,#337ab7 0,#2e6da4 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff2e6da4', GradientType=0);background-repeat:repeat-x}.panel-success>.panel-heading{background-image:-webkit-linear-gradient(top,#dff0d8 0,#d0e9c6 100%);background-image:-o-linear-gradient(top,#dff0d8 0,#d0e9c6 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#dff0d8),to(#d0e9c6));background-image:linear-gradient(to bottom,#dff0d8 0,#d0e9c6 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffdff0d8', endColorstr='#ffd0e9c6', GradientType=0);background-repeat:repeat-x}.panel-info>.panel-heading{background-image:-webkit-linear-gradient(top,#d9edf7 0,#c4e3f3 100%);background-image:-o-linear-gradient(top,#d9edf7 0,#c4e3f3 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#d9edf7),to(#c4e3f3));background-image:linear-gradient(to bottom,#d9edf7 0,#c4e3f3 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffd9edf7', endColorstr='#ffc4e3f3', GradientType=0);background-repeat:repeat-x}.panel-warning>.panel-heading{background-image:-webkit-linear-gradient(top,#fcf8e3 0,#faf2cc 100%);background-image:-o-linear-gradient(top,#fcf8e3 0,#faf2cc 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#fcf8e3),to(#faf2cc));background-image:linear-gradient(to bottom,#fcf8e3 0,#faf2cc 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fffcf8e3', endColorstr='#fffaf2cc', GradientType=0);background-repeat:repeat-x}.panel-danger>.panel-heading{background-image:-webkit-linear-gradient(top,#f2dede 0,#ebcccc 100%);background-image:-o-linear-gradient(top,#f2dede 0,#ebcccc 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f2dede),to(#ebcccc));background-image:linear-gradient(to bottom,#f2dede 0,#ebcccc 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff2dede', endColorstr='#ffebcccc', GradientType=0);background-repeat:repeat-x}.well{background-image:-webkit-linear-gradient(top,#e8e8e8 0,#f5f5f5 100%);background-image:-o-linear-gradient(top,#e8e8e8 0,#f5f5f5 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#e8e8e8),to(#f5f5f5));background-image:linear-gradient(to bottom,#e8e8e8 0,#f5f5f5 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffe8e8e8', endColorstr='#fff5f5f5', GradientType=0);background-repeat:repeat-x;border-color:#dcdcdc;-webkit-box-shadow:inset 0 1px 3px rgba(0,0,0,.05),0 1px 0 rgba(255,255,255,.1);box-shadow:inset 0 1px 3px rgba(0,0,0,.05),0 1px 0 rgba(255,255,255,.1)}\n", | |
| "/*# sourceMappingURL=bootstrap-theme.min.css.map */ </style><style>body {\n", | |
| " padding-top: 80px;\n", | |
| "}\n", | |
| ".content .container-fluid{\n", | |
| " margin-left: 20px !important;\n", | |
| " margin-right: 20px !important;\n", | |
| " margin-bottom: 20px;\n", | |
| "}\n", | |
| "\n", | |
| ".page-header{\n", | |
| " border:0 !important;\n", | |
| "}\n", | |
| "\n", | |
| ".row.variable, .section-items > .row {\n", | |
| " border: 1px solid #e1e1e8;\n", | |
| " border-top: hidden;\n", | |
| "}\n", | |
| "\n", | |
| ".row.spacing{\n", | |
| " padding: 2em 1em;\n", | |
| "}\n", | |
| "\n", | |
| ".row.header {\n", | |
| " border-bottom: 1px solid #e1e1e8;\n", | |
| " /*background-color: #f5f5f5;*/\n", | |
| " padding-left: 2em;\n", | |
| "}\n", | |
| "\n", | |
| "\n", | |
| ".dl-horizontal dt {\n", | |
| " text-align: left;\n", | |
| " padding-right: 1em;\n", | |
| " white-space: normal;\n", | |
| "}\n", | |
| "\n", | |
| ".dl-horizontal dd {\n", | |
| " margin-left: 0;\n", | |
| "}\n", | |
| "\n", | |
| ".col-md-12 {\n", | |
| " padding-left: 2em;\n", | |
| "}\n", | |
| "\n", | |
| ".indent {\n", | |
| " margin-left: 1em;\n", | |
| "}\n", | |
| "\n", | |
| ".center-img {\n", | |
| " margin-left: auto !important;\n", | |
| " margin-right: auto !important;\n", | |
| " display: block;\n", | |
| "}\n", | |
| "\n", | |
| "/* Table example_values */\n", | |
| "table.example_values {\n", | |
| " border: 0;\n", | |
| "}\n", | |
| "\n", | |
| ".example_values th {\n", | |
| " border: 0;\n", | |
| " padding: 0;\n", | |
| " color: #555;\n", | |
| " font-weight: 600;\n", | |
| "}\n", | |
| "\n", | |
| ".example_values tr, .example_values td {\n", | |
| " border: 0;\n", | |
| " padding: 0;\n", | |
| " color: #555;\n", | |
| "}\n", | |
| "\n", | |
| "/* STATS */\n", | |
| "table.stats, table.sample, table.duplicate{\n", | |
| " border: 0;\n", | |
| "}\n", | |
| "\n", | |
| ".stats tr, .sample tr, .duplicate tr {\n", | |
| " border: 0;\n", | |
| "}\n", | |
| "\n", | |
| ".stats th, .stats td{\n", | |
| " color: #555;\n", | |
| " border: 0;\n", | |
| "}\n", | |
| "\n", | |
| ".stats th {\n", | |
| " padding: 0 2em 0 0;\n", | |
| " font-weight: 600;\n", | |
| "}\n", | |
| "\n", | |
| ".stats td {\n", | |
| " padding: 1px;\n", | |
| "}\n", | |
| "\n", | |
| "\n", | |
| "/* Sample table */\n", | |
| "table.sample, table.duplicate{\n", | |
| " margin-bottom: 2em;\n", | |
| " margin-left: 1em;\n", | |
| "}\n", | |
| "\n", | |
| ".sample td, .sample th, .duplicate td, .duplicate th {\n", | |
| " padding: 0.5em;\n", | |
| " white-space: nowrap;\n", | |
| " border: 0;\n", | |
| "\n", | |
| "}\n", | |
| "\n", | |
| ".sample thead, .duplicate thead {\n", | |
| " border-top: 0;\n", | |
| " border-bottom: 2px solid #ddd;\n", | |
| "}\n", | |
| "\n", | |
| ".sample td, .duplicate td {\n", | |
| " width: 100%;\n", | |
| "}\n", | |
| "\n", | |
| "\n", | |
| "/* There is no good solution available to make the divs equal height and then center ... */\n", | |
| ".histogram {\n", | |
| " margin-top: 3em;\n", | |
| "}\n", | |
| "\n", | |
| "/* Freq table */\n", | |
| "table.freq {\n", | |
| " margin-bottom: 2em;\n", | |
| " border: 0;\n", | |
| "}\n", | |
| "\n", | |
| "table.freq th, table.freq tr, table.freq td {\n", | |
| " border: 0;\n", | |
| " padding: 0;\n", | |
| "}\n", | |
| "\n", | |
| ".freq thead {\n", | |
| " font-weight: 600;\n", | |
| " white-space: nowrap;\n", | |
| " overflow: hidden;\n", | |
| " text-overflow: ellipsis;\n", | |
| "\n", | |
| "}\n", | |
| "\n", | |
| "/* Freq mini */\n", | |
| ".freq.mini td {\n", | |
| " width: 50%;\n", | |
| " padding: 1px;\n", | |
| " font-size: 12px;\n", | |
| "\n", | |
| "}\n", | |
| "\n", | |
| "table.freq.mini {\n", | |
| " width: 100%;\n", | |
| "}\n", | |
| "\n", | |
| ".freq.mini th {\n", | |
| " overflow: hidden;\n", | |
| " text-overflow: ellipsis;\n", | |
| " white-space: nowrap;\n", | |
| " max-width: 5em;\n", | |
| " font-weight: 400;\n", | |
| " text-align: right;\n", | |
| " padding-right: 0.5em;\n", | |
| "}\n", | |
| "\n", | |
| "/* Message classes */\n", | |
| ".missing {\n", | |
| " color: #a94442;\n", | |
| "}\n", | |
| "\n", | |
| ".alert, .alert > th, .alert > td {\n", | |
| " color: #a94442;\n", | |
| "}\n", | |
| "\n", | |
| ".ignore {\n", | |
| " opacity: 0.4;\n", | |
| "}\n", | |
| "\n", | |
| "/* Bars in tables */\n", | |
| ".freq.table{\n", | |
| " table-layout: fixed;\n", | |
| "}\n", | |
| "\n", | |
| ".freq:not(.mini) tr td:nth-child(1), .freq:not(.mini) tr th:nth-child(1){\n", | |
| " width: auto;\n", | |
| " max-width: none;\n", | |
| "\n", | |
| " white-space: nowrap;\n", | |
| " overflow: hidden;\n", | |
| " text-overflow: ellipsis;\n", | |
| "}\n", | |
| "\n", | |
| ".freq:not(.mini) tr td:nth-child(2), .freq:not(.mini) tr td:nth-child(3), .freq:not(.mini) tr th:nth-child(2), .freq:not(.mini) tr th:nth-child(3){\n", | |
| " width: 100px;\n", | |
| " text-align: right;\n", | |
| "}\n", | |
| ".freq:not(.mini) tr td:nth-child(4), .freq:not(.mini) tr th:nth-child(4){\n", | |
| " width:200px;\n", | |
| "}\n", | |
| "\n", | |
| ".freq .bar {\n", | |
| " float: left;\n", | |
| " width: 0;\n", | |
| " height: 100%;\n", | |
| " line-height: 20px;\n", | |
| " color: #fff;\n", | |
| " text-align: center;\n", | |
| " background-color: #337ab7;\n", | |
| " border-radius: 3px;\n", | |
| " margin-right: 4px;\n", | |
| "}\n", | |
| "\n", | |
| ".other .bar {\n", | |
| " background-color: #999;\n", | |
| "}\n", | |
| "\n", | |
| ".missing .bar {\n", | |
| " background-color: #a94442;\n", | |
| "}\n", | |
| "\n", | |
| ".tooltip-inner {\n", | |
| " width: 100%;\n", | |
| " white-space: nowrap;\n", | |
| " text-align: left;\n", | |
| "}\n", | |
| "\n", | |
| ".extrapadding {\n", | |
| " padding: 2em;\n", | |
| "}\n", | |
| "\n", | |
| ".variable .h4 {\n", | |
| " text-overflow: ellipsis;\n", | |
| " display:inline-block;\n", | |
| " width: calc(90%); /* The trick is here! */\n", | |
| " overflow:hidden;\n", | |
| "}\n", | |
| "\n", | |
| ".variable.ignore .h4{\n", | |
| " text-decoration: line-through;\n", | |
| "}\n", | |
| "\n", | |
| ".table-responsive{\n", | |
| " overflow: scroll;\n", | |
| " width: 100%;\n", | |
| " overflow-y: hidden;\n", | |
| "}\n", | |
| ".img-responsive{\n", | |
| " max-width: 99%;\n", | |
| "}\n", | |
| ".footer-text{\n", | |
| " padding:20px;\n", | |
| "}\n", | |
| "\n", | |
| "table.list-warnings td{\n", | |
| " padding-right:10px;\n", | |
| "}\n", | |
| "\n", | |
| "a.anchor-pos {\n", | |
| " display: block;\n", | |
| " position: relative;\n", | |
| " top: -70px;\n", | |
| " visibility: hidden;\n", | |
| "}\n", | |
| "\n", | |
| "a.anchor-pos-variable{\n", | |
| " /*top: -70px;*/\n", | |
| "}\n", | |
| "\n", | |
| "#sample-container, #duplicate-container{\n", | |
| " overflow: auto;\n", | |
| " width: 100%;\n", | |
| " overflow-y: hidden;\n", | |
| "}\n", | |
| "\n", | |
| "#overview-content td, #overview-content th{\n", | |
| " border-top: 0;\n", | |
| " line-height: 1;\n", | |
| "}\n", | |
| "\n", | |
| ".variable-description{\n", | |
| " color: #777;\n", | |
| " font-size: 10pt;\n", | |
| " margin-top: 10px;\n", | |
| " font-style: italic;\n", | |
| "}\n", | |
| "\n", | |
| "select.multiple{\n", | |
| " width: 180px;\n", | |
| " height: 500px;\n", | |
| " margin: 10px 0;\n", | |
| "}\n", | |
| "\n", | |
| ".named-list-item{\n", | |
| " padding: 1em;\n", | |
| "}\n", | |
| "\n", | |
| "/* not printing tabs */\n", | |
| "@media print {\n", | |
| " .tab-content > .tab-pane, .collapse {\n", | |
| " display: block !important;\n", | |
| " opacity: 1 !important;\n", | |
| " visibility: visible !important;\n", | |
| " /*page-break-after: always;*/\n", | |
| " page-break-after: right;\n", | |
| " page-break-before: avoid;\n", | |
| " }\n", | |
| "\n", | |
| " .nav-pills, .nav-tabs, button[data-toggle="collapse"], .mini, .col-sm-3 img {\n", | |
| " display:none !important;\n", | |
| " }\n", | |
| "\n", | |
| " a[download="config.yml"]:after {\n", | |
| " content: none !important;\n", | |
| " }\n", | |
| "\n", | |
| " .row {\n", | |
| " border: 0 !important;\n", | |
| " }\n", | |
| "}\n", | |
| "\n", | |
| ".text-placeholder {\n", | |
| " display: inline-block;\n", | |
| " background-color: #444;\n", | |
| " height: 12px;\n", | |
| " border-radius: 100px;\n", | |
| " margin: 5px 0;\n", | |
| " min-width: 200px;\n", | |
| " opacity: .1;\n", | |
| "}</style></head><body><a class=anchor-pos id=top></a><nav class="navbar navbar-default navbar-fixed-top"><div class=container-fluid><div class=navbar-header><button type=button class="navbar-toggle collapsed" data-toggle=collapse data-target=#navbar aria-expanded=false aria-controls=navbar><span class=sr-only>Toggle navigation</span><span class=icon-bar></span><span class=icon-bar></span><span class=icon-bar></span></button><a class="navbar-brand anchor" href=#top>Pandas Profiling Report</a></div><div id=navbar class="navbar-collapse collapse"><ul class="nav navbar-nav navbar-right"><li><a class=anchor href=#overview>Overview</a></li><li><a class=anchor href=#variables-dropdown>Variables</a></li><li><a class=anchor href=#interactions>Interactions</a></li><li><a class=anchor href=#correlations>Correlations</a></li><li><a class=anchor href=#missing>Missing values</a></li><li><a class=anchor href=#sample>Sample</a></li></ul></div></div></nav><div class=content><div class=container><div class="row header"><a class=anchor-pos id=overview></a><h1 class=page-header>Overview</h1></div><div class=section-items><div class="row spacing"><ul class="nav nav-pills" role=tablist><li role=presentation class=active><a href=#overview-dataset_overview aria-controls=overview-dataset_overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#overview-alerts aria-controls=overview-alerts role=tab data-toggle=tab>Alerts <span class=badge>16</span></a></li><li role=presentation><a href=#overview-reproduction aria-controls=overview-reproduction role=tab data-toggle=tab>Reproduction</a></li></ul><div class=tab-content style="padding-top: 10px;"><div role=tabpanel class="tab-pane col-sm-12 active" id=overview-dataset_overview><div class=col-sm-6><p class=h4>Dataset statistics</p><table class="table table-condensed stats"><tbody><tr><th>Number of variables</th><td>13</td></tr><tr><th>Number of observations</th><td>22765</td></tr><tr><th>Missing cells</th><td>2745</td></tr><tr><th>Missing cells (%)</th><td>0.9%</td></tr><tr><th>Duplicate rows</th><td>0</td></tr><tr><th>Duplicate rows (%)</th><td>0.0%</td></tr><tr><th>Total size in memory</th><td>2.3 MiB</td></tr><tr><th>Average record size in memory</th><td>104.0 B</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Variable types</p><table class="table table-condensed stats"><tbody><tr><th>Numeric</th><td>8</td></tr><tr><th>Categorical</th><td>4</td></tr><tr><th>Boolean</th><td>1</td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=overview-alerts><table class="table table-condensed list-warnings"><p class=h4>Alerts</p><tr style=border-top:0><td><a class=anchor href=#pp_var_5162937004965893282><code>df_index</code></a> is highly correlated with <code>person_age</code> and <abbr title="person_age, loan_amnt, cb_person_cred_hist_length">2 other fields</abbr></td><td><span class="label label-default">High correlation</span></td></tr><tr><td><a class=anchor href=#pp_var_3648593978865241518><code>person_age</code></a> is highly correlated with <code>df_index</code> and <abbr title="df_index, person_income, cb_person_cred_hist_length">2 other fields</abbr></td><td><span class="label label-default">High correlation</span></td></tr><tr><td><a class=anchor href=#pp_var_-8566384954619091435><code>loan_amnt</code></a> is highly correlated with <code>df_index</code> and <abbr title="df_index, loan_percent_income">1 other fields</abbr></td><td><span class="label label-default">High correlation</span></td></tr><tr><td><a class=anchor href=#pp_var_-3082778655817027807><code>loan_int_rate</code></a> is highly correlated with <code>loan_grade</code> and <abbr title="loan_grade, cb_person_default_on_file">1 other fields</abbr></td><td><span class="label label-default">High correlation</span></td></tr><tr><td><a class=anchor href=#pp_var_1933020516444870489><code>loan_percent_income</code></a> is highly correlated with <code>loan_amnt</code> and <abbr title="loan_amnt, loan_status">1 other fields</abbr></td><td><span class="label label-default">High correlation</span></td></tr><tr><td><a class=anchor href=#pp_var_6015296105522506010><code>cb_person_cred_hist_length</code></a> is highly correlated with <code>df_index</code> and <abbr title="df_index, person_age">1 other fields</abbr></td><td><span class="label label-default">High correlation</span></td></tr><tr><td><a class=anchor href=#pp_var_-1844550963840207900><code>loan_grade</code></a> is highly correlated with <code>loan_int_rate</code> and <abbr title="loan_int_rate, cb_person_default_on_file">1 other fields</abbr></td><td><span class="label label-default">High correlation</span></td></tr><tr><td><a class=anchor href=#pp_var_2514225404829765331><code>cb_person_default_on_file</code></a> is highly correlated with <code>loan_grade</code> and <abbr title="loan_grade, loan_int_rate">1 other fields</abbr></td><td><span class="label label-default">High correlation</span></td></tr><tr><td><a class=anchor href=#pp_var_-4229765111913678491><code>person_income</code></a> is highly correlated with <code>person_age</code></td><td><span class="label label-default">High correlation</span></td></tr><tr><td><a class=anchor href=#pp_var_-748713880617476083><code>loan_status</code></a> is highly correlated with <code>loan_percent_income</code></td><td><span class="label label-default">High correlation</span></td></tr><tr><td><a class=anchor href=#pp_var_-872180076173548104><code>person_emp_length</code></a> has 609 (2.7%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_-3082778655817027807><code>loan_int_rate</code></a> has 2136 (9.4%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_-4229765111913678491><code>person_income</code></a> is highly skewed (γ1 = 39.11051507) </td><td><span class="label label-info">Skewed</span></td></tr><tr><td><a class=anchor href=#pp_var_5162937004965893282><code>df_index</code></a> is uniformly distributed </td><td><span class="label label-primary">Uniform</span></td></tr><tr><td><a class=anchor href=#pp_var_5162937004965893282><code>df_index</code></a> has unique values </td><td><span class="label label-primary">Unique</span></td></tr><tr><td><a class=anchor href=#pp_var_-872180076173548104><code>person_emp_length</code></a> has 2821 (12.4%) zeros </td><td><span class="label label-info">Zeros</span></td></tr></table></div><div role=tabpanel class="tab-pane col-sm-12" id=overview-reproduction><div class=col-sm-12><p class=h4>Reproduction</p><table class="table table-condensed stats"><tbody><tr><th>Analysis started</th><td>2022-11-01 11:52:34.986518</td></tr><tr><th>Analysis finished</th><td>2022-11-01 11:53:01.808702</td></tr><tr><th>Duration</th><td>26.82 seconds</td></tr><tr><th>Software version</th><td><a href=https://github.com/pandas-profiling/pandas-profiling>pandas-profiling v3.4.0</a></td></tr><tr><th>Download configuration</th><td><a download=config.json href="data:text/plain;charset=utf-8,%7B%22title%22%3A%20%22Pandas%20Profiling%20Report%22%2C%20%22dataset%22%3A%20%7B%22description%22%3A%20%22%22%2C%20%22creator%22%3A%20%22%22%2C%20%22author%22%3A%20%22%22%2C%20%22copyright_holder%22%3A%20%22%22%2C%20%22copyright_year%22%3A%20%22%22%2C%20%22url%22%3A%20%22%22%7D%2C%20%22variables%22%3A%20%7B%22descriptions%22%3A%20%7B%7D%7D%2C%20%22infer_dtypes%22%3A%20true%2C%20%22show_variable_description%22%3A%20true%2C%20%22pool_size%22%3A%200%2C%20%22progress_bar%22%3A%20true%2C%20%22vars%22%3A%20%7B%22num%22%3A%20%7B%22quantiles%22%3A%20%5B0.05%2C%200.25%2C%200.5%2C%200.75%2C%200.95%5D%2C%20%22skewness_threshold%22%3A%2020%2C%20%22low_categorical_threshold%22%3A%205%2C%20%22chi_squared_threshold%22%3A%200.999%7D%2C%20%22cat%22%3A%20%7B%22length%22%3A%20true%2C%20%22characters%22%3A%20true%2C%20%22words%22%3A%20true%2C%20%22cardinality_threshold%22%3A%2050%2C%20%22n_obs%22%3A%205%2C%20%22chi_squared_threshold%22%3A%200.999%2C%20%22coerce_str_to_date%22%3A%20false%2C%20%22redact%22%3A%20false%2C%20%22histogram_largest%22%3A%2050%2C%20%22stop_words%22%3A%20%5B%5D%7D%2C%20%22image%22%3A%20%7B%22active%22%3A%20false%2C%20%22exif%22%3A%20true%2C%20%22hash%22%3A%20true%7D%2C%20%22bool%22%3A%20%7B%22n_obs%22%3A%203%2C%20%22mappings%22%3A%20%7B%22t%22%3A%20true%2C%20%22f%22%3A%20false%2C%20%22yes%22%3A%20true%2C%20%22no%22%3A%20false%2C%20%22y%22%3A%20true%2C%20%22n%22%3A%20false%2C%20%22true%22%3A%20true%2C%20%22false%22%3A%20false%7D%7D%2C%20%22path%22%3A%20%7B%22active%22%3A%20false%7D%2C%20%22file%22%3A%20%7B%22active%22%3A%20false%7D%2C%20%22url%22%3A%20%7B%22active%22%3A%20false%7D%2C%20%22timeseries%22%3A%20%7B%22active%22%3A%20false%2C%20%22sortby%22%3A%20null%2C%20%22autocorrelation%22%3A%200.7%2C%20%22lags%22%3A%20%5B1%2C%207%2C%2012%2C%2024%2C%2030%5D%2C%20%22significance%22%3A%200.05%2C%20%22pacf_acf_lag%22%3A%20100%7D%7D%2C%20%22sort%22%3A%20null%2C%20%22missing_diagrams%22%3A%20%7B%22bar%22%3A%20true%2C%20%22matrix%22%3A%20true%2C%20%22dendrogram%22%3A%20true%2C%20%22heatmap%22%3A%20true%7D%2C%20%22correlations%22%3A%20%7B%22auto%22%3A%20%7B%22key%22%3A%20%22auto%22%2C%20%22calculate%22%3A%20true%2C%20%22warn_high_correlations%22%3A%2010%2C%20%22threshold%22%3A%200.5%2C%20%22n_bins%22%3A%2010%7D%2C%20%22spearman%22%3A%20%7B%22key%22%3A%20%22spearman%22%2C%20%22calculate%22%3A%20true%2C%20%22warn_high_correlations%22%3A%2010%2C%20%22threshold%22%3A%200.5%2C%20%22n_bins%22%3A%2010%7D%2C%20%22pearson%22%3A%20%7B%22key%22%3A%20%22pearson%22%2C%20%22calculate%22%3A%20true%2C%20%22warn_high_correlations%22%3A%2010%2C%20%22threshold%22%3A%200.5%2C%20%22n_bins%22%3A%2010%7D%2C%20%22kendall%22%3A%20%7B%22key%22%3A%20%22kendall%22%2C%20%22calculate%22%3A%20true%2C%20%22warn_high_correlations%22%3A%2010%2C%20%22threshold%22%3A%200.5%2C%20%22n_bins%22%3A%2010%7D%2C%20%22cramers%22%3A%20%7B%22key%22%3A%20%22cramers%22%2C%20%22calculate%22%3A%20true%2C%20%22warn_high_correlations%22%3A%2010%2C%20%22threshold%22%3A%200.5%2C%20%22n_bins%22%3A%2010%7D%2C%20%22phi_k%22%3A%20%7B%22key%22%3A%20%22phi_k%22%2C%20%22calculate%22%3A%20true%2C%20%22warn_high_correlations%22%3A%2010%2C%20%22threshold%22%3A%200.5%2C%20%22n_bins%22%3A%2010%7D%7D%2C%20%22interactions%22%3A%20%7B%22continuous%22%3A%20true%2C%20%22targets%22%3A%20%5B%5D%7D%2C%20%22categorical_maximum_correlation_distinct%22%3A%20100%2C%20%22memory_deep%22%3A%20false%2C%20%22plot%22%3A%20%7B%22missing%22%3A%20%7B%22force_labels%22%3A%20true%2C%20%22cmap%22%3A%20%22RdBu%22%7D%2C%20%22image_format%22%3A%20%22svg%22%2C%20%22correlation%22%3A%20%7B%22cmap%22%3A%20%22RdBu%22%2C%20%22bad%22%3A%20%22%23000000%22%7D%2C%20%22dpi%22%3A%20800%2C%20%22histogram%22%3A%20%7B%22bins%22%3A%2050%2C%20%22max_bins%22%3A%20250%2C%20%22x_axis_labels%22%3A%20true%7D%2C%20%22scatter_threshold%22%3A%201000%2C%20%22cat_freq%22%3A%20%7B%22show%22%3A%20true%2C%20%22type%22%3A%20%22bar%22%2C%20%22max_unique%22%3A%2010%2C%20%22colors%22%3A%20null%7D%7D%2C%20%22duplicates%22%3A%20%7B%22head%22%3A%2010%2C%20%22key%22%3A%20%22%23%20duplicates%22%7D%2C%20%22samples%22%3A%20%7B%22head%22%3A%2010%2C%20%22tail%22%3A%2010%2C%20%22random%22%3A%200%7D%2C%20%22reject_variables%22%3A%20true%2C%20%22n_obs_unique%22%3A%2010%2C%20%22n_freq_table_max%22%3A%2010%2C%20%22n_extreme_obs%22%3A%2010%2C%20%22report%22%3A%20%7B%22precision%22%3A%2010%7D%2C%20%22html%22%3A%20%7B%22style%22%3A%20%7B%22primary_color%22%3A%20%22%23337ab7%22%2C%20%22logo%22%3A%20%22%22%2C%20%22theme%22%3A%20null%7D%2C%20%22navbar_show%22%3A%20true%2C%20%22minify_html%22%3A%20true%2C%20%22use_local_assets%22%3A%20true%2C%20%22inline%22%3A%20true%2C%20%22assets_prefix%22%3A%20null%2C%20%22assets_path%22%3A%20null%2C%20%22full_width%22%3A%20false%7D%2C%20%22notebook%22%3A%20%7B%22iframe%22%3A%20%7B%22height%22%3A%20%22800px%22%2C%20%22width%22%3A%20%22100%25%22%2C%20%22attribute%22%3A%20%22srcdoc%22%7D%7D%7D">config.json</a></td></tr></tbody></table></div></div></div></div></div><div class="row header"><a class=anchor-pos id=variables-dropdown></a><h1 class=page-header>Variables</h1></div><div class=section-items><select name=Variables id=variables-dropdown><option value>Select Columns</option><option value=df_index>df_index</option><option value=person_age>person_age</option><option value=person_income>person_income</option><option value=person_home_ownership>person_home_ownership</option><option value=person_emp_length>person_emp_length</option><option value=loan_intent>loan_intent</option><option value=loan_grade>loan_grade</option><option value=loan_amnt>loan_amnt</option><option value=loan_int_rate>loan_int_rate</option><option value=loan_status>loan_status</option><option value=loan_percent_income>loan_percent_income</option><option value=cb_person_default_on_file>cb_person_default_on_file</option><option value=cb_person_cred_hist_length>cb_person_cred_hist_length</option></select><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_5162937004965893282></a><div class=variable><div class=col-sm-3><p class=h4 title=df_index><a href=#pp_var_5162937004965893282>df_index</a><br><small>Real number (&Ropf;<sub>&ge;0</sub>)</small></p><code><abbr title="This variable has a high correlation with 3 fields: person_age, loan_amnt, cb_person_cred_hist_length">HIGH CORRELATION</abbr></code><br><code>UNIFORM</code><br><code>UNIQUE</code><br><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr class=alert><th>Distinct</th><td>22765</td></tr><tr class=alert><th>Distinct (%)</th><td>100.0%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Infinite</th><td>0</td></tr><tr><th>Infinite (%)</th><td>0.0%</td></tr><tr><th>Mean</th><td>11416.17927</td></tr></tbody></table></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>0</td></tr><tr><th>Maximum</th><td>22849</td></tr><tr><th>Zeros</th><td>1</td></tr><tr><th>Zeros (%)</th><td>< 0.1%</td></tr><tr><th>Negative</th><td>0</td></tr><tr><th>Negative (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>178.0 KiB</td></tr></tbody></table></div><div class=col-sm-3><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=162pt version=1.1 viewbox="0 0 216 162" width=216pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 162 \n", | |
| "L 216 162 \n", | |
| "L 216 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 10.8 114.069981 \n", | |
| "L 205.2 114.069981 \n", | |
| "L 205.2 10.8 \n", | |
| "L 10.8 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(19.397715 134.96748)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
| "L 49.515625 72.90625 \n", | |
| "L 49.515625 64.59375 \n", | |
| "L 19.828125 64.59375 \n", | |
| "L 19.828125 46.734375 \n", | |
| "Q 21.96875 47.46875 24.109375 47.828125 \n", | |
| "Q 26.265625 48.1875 28.421875 48.1875 \n", | |
| "Q 40.625 48.1875 47.75 41.5 \n", | |
| "Q 54.890625 34.8125 54.890625 23.390625 \n", | |
| "Q 54.890625 11.625 47.5625 5.09375 \n", | |
| "Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
| "Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
| "Q 12.796875 0.140625 7.71875 1.703125 \n", | |
| "L 7.71875 11.625 \n", | |
| "Q 12.109375 9.234375 16.796875 8.0625 \n", | |
| "Q 21.484375 6.890625 26.703125 6.890625 \n", | |
| "Q 35.15625 6.890625 40.078125 11.328125 \n", | |
| "Q 45.015625 15.765625 45.015625 23.390625 \n", | |
| "Q 45.015625 31 40.078125 35.4375 \n", | |
| "Q 35.15625 39.890625 26.703125 39.890625 \n", | |
| "Q 22.75 39.890625 18.8125 39.015625 \n", | |
| "Q 14.890625 38.140625 10.796875 36.28125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(52.671823 145.765001)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(89.545104 149.364174)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><g style=fill:#262626; transform="translate(128.217972 149.364174)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(166.890841 149.364174)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=patch_3><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 19.636364 114.069981 \n", | |
| "L 23.170909 114.069981 \n", | |
| "L 23.170909 15.717618 \n", | |
| "L 19.636364 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 23.170909 114.069981 \n", | |
| "L 26.705455 114.069981 \n", | |
| "L 26.705455 15.717618 \n", | |
| "L 23.170909 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 26.705455 114.069981 \n", | |
| "L 30.24 114.069981 \n", | |
| "L 30.24 15.717618 \n", | |
| "L 26.705455 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 30.24 114.069981 \n", | |
| "L 33.774545 114.069981 \n", | |
| "L 33.774545 15.717618 \n", | |
| "L 30.24 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 33.774545 114.069981 \n", | |
| "L 37.309091 114.069981 \n", | |
| "L 37.309091 15.717618 \n", | |
| "L 33.774545 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 37.309091 114.069981 \n", | |
| "L 40.843636 114.069981 \n", | |
| "L 40.843636 15.717618 \n", | |
| "L 37.309091 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_9><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 40.843636 114.069981 \n", | |
| "L 44.378182 114.069981 \n", | |
| "L 44.378182 15.717618 \n", | |
| "L 40.843636 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_10><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 44.378182 114.069981 \n", | |
| "L 47.912727 114.069981 \n", | |
| "L 47.912727 15.717618 \n", | |
| "L 44.378182 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_11><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 47.912727 114.069981 \n", | |
| "L 51.447273 114.069981 \n", | |
| "L 51.447273 15.717618 \n", | |
| "L 47.912727 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_12><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 51.447273 114.069981 \n", | |
| "L 54.981818 114.069981 \n", | |
| "L 54.981818 15.717618 \n", | |
| "L 51.447273 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_13><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 54.981818 114.069981 \n", | |
| "L 58.516364 114.069981 \n", | |
| "L 58.516364 15.717618 \n", | |
| "L 54.981818 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_14><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 58.516364 114.069981 \n", | |
| "L 62.050909 114.069981 \n", | |
| "L 62.050909 15.717618 \n", | |
| "L 58.516364 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_15><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 62.050909 114.069981 \n", | |
| "L 65.585455 114.069981 \n", | |
| "L 65.585455 15.717618 \n", | |
| "L 62.050909 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_16><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 65.585455 114.069981 \n", | |
| "L 69.12 114.069981 \n", | |
| "L 69.12 15.717618 \n", | |
| "L 65.585455 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_17><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 69.12 114.069981 \n", | |
| "L 72.654545 114.069981 \n", | |
| "L 72.654545 15.717618 \n", | |
| "L 69.12 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_18><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 72.654545 114.069981 \n", | |
| "L 76.189091 114.069981 \n", | |
| "L 76.189091 15.717618 \n", | |
| "L 72.654545 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_19><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 76.189091 114.069981 \n", | |
| "L 79.723636 114.069981 \n", | |
| "L 79.723636 15.717618 \n", | |
| "L 76.189091 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_20><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 79.723636 114.069981 \n", | |
| "L 83.258182 114.069981 \n", | |
| "L 83.258182 15.717618 \n", | |
| "L 79.723636 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_21><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 83.258182 114.069981 \n", | |
| "L 86.792727 114.069981 \n", | |
| "L 86.792727 15.717618 \n", | |
| "L 83.258182 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_22><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 86.792727 114.069981 \n", | |
| "L 90.327273 114.069981 \n", | |
| "L 90.327273 15.717618 \n", | |
| "L 86.792727 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_23><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 90.327273 114.069981 \n", | |
| "L 93.861818 114.069981 \n", | |
| "L 93.861818 15.717618 \n", | |
| "L 90.327273 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_24><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 93.861818 114.069981 \n", | |
| "L 97.396364 114.069981 \n", | |
| "L 97.396364 15.717618 \n", | |
| "L 93.861818 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_25><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 97.396364 114.069981 \n", | |
| "L 100.930909 114.069981 \n", | |
| "L 100.930909 15.717618 \n", | |
| "L 97.396364 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_26><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 100.930909 114.069981 \n", | |
| "L 104.465455 114.069981 \n", | |
| "L 104.465455 15.717618 \n", | |
| "L 100.930909 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_27><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 104.465455 114.069981 \n", | |
| "L 108 114.069981 \n", | |
| "L 108 18.515388 \n", | |
| "L 104.465455 18.515388 \n", | |
| "z\n", | |
| ""/></g><g id=patch_28><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 108 114.069981 \n", | |
| "L 111.534545 114.069981 \n", | |
| "L 111.534545 20.452305 \n", | |
| "L 108 20.452305 \n", | |
| "z\n", | |
| ""/></g><g id=patch_29><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 111.534545 114.069981 \n", | |
| "L 115.069091 114.069981 \n", | |
| "L 115.069091 20.452305 \n", | |
| "L 111.534545 20.452305 \n", | |
| "z\n", | |
| ""/></g><g id=patch_30><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 115.069091 114.069981 \n", | |
| "L 118.603636 114.069981 \n", | |
| "L 118.603636 17.869749 \n", | |
| "L 115.069091 17.869749 \n", | |
| "z\n", | |
| ""/></g><g id=patch_31><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 118.603636 114.069981 \n", | |
| "L 122.138182 114.069981 \n", | |
| "L 122.138182 15.717618 \n", | |
| "L 118.603636 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_32><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 122.138182 114.069981 \n", | |
| "L 125.672727 114.069981 \n", | |
| "L 125.672727 15.717618 \n", | |
| "L 122.138182 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_33><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 125.672727 114.069981 \n", | |
| "L 129.207273 114.069981 \n", | |
| "L 129.207273 15.717618 \n", | |
| "L 125.672727 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_34><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 129.207273 114.069981 \n", | |
| "L 132.741818 114.069981 \n", | |
| "L 132.741818 15.717618 \n", | |
| "L 129.207273 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_35><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 132.741818 114.069981 \n", | |
| "L 136.276364 114.069981 \n", | |
| "L 136.276364 15.717618 \n", | |
| "L 132.741818 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_36><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 136.276364 114.069981 \n", | |
| "L 139.810909 114.069981 \n", | |
| "L 139.810909 15.717618 \n", | |
| "L 136.276364 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_37><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 139.810909 114.069981 \n", | |
| "L 143.345455 114.069981 \n", | |
| "L 143.345455 15.717618 \n", | |
| "L 139.810909 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_38><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 143.345455 114.069981 \n", | |
| "L 146.88 114.069981 \n", | |
| "L 146.88 15.717618 \n", | |
| "L 143.345455 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_39><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 146.88 114.069981 \n", | |
| "L 150.414545 114.069981 \n", | |
| "L 150.414545 15.717618 \n", | |
| "L 146.88 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_40><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 150.414545 114.069981 \n", | |
| "L 153.949091 114.069981 \n", | |
| "L 153.949091 15.717618 \n", | |
| "L 150.414545 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_41><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 153.949091 114.069981 \n", | |
| "L 157.483636 114.069981 \n", | |
| "L 157.483636 15.717618 \n", | |
| "L 153.949091 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_42><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 157.483636 114.069981 \n", | |
| "L 161.018182 114.069981 \n", | |
| "L 161.018182 15.717618 \n", | |
| "L 157.483636 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_43><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 161.018182 114.069981 \n", | |
| "L 164.552727 114.069981 \n", | |
| "L 164.552727 15.717618 \n", | |
| "L 161.018182 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_44><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 164.552727 114.069981 \n", | |
| "L 168.087273 114.069981 \n", | |
| "L 168.087273 15.717618 \n", | |
| "L 164.552727 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_45><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 168.087273 114.069981 \n", | |
| "L 171.621818 114.069981 \n", | |
| "L 171.621818 15.932831 \n", | |
| "L 168.087273 15.932831 \n", | |
| "z\n", | |
| ""/></g><g id=patch_46><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 171.621818 114.069981 \n", | |
| "L 175.156364 114.069981 \n", | |
| "L 175.156364 17.224109 \n", | |
| "L 171.621818 17.224109 \n", | |
| "z\n", | |
| ""/></g><g id=patch_47><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 175.156364 114.069981 \n", | |
| "L 178.690909 114.069981 \n", | |
| "L 178.690909 17.439323 \n", | |
| "L 175.156364 17.439323 \n", | |
| "z\n", | |
| ""/></g><g id=patch_48><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 178.690909 114.069981 \n", | |
| "L 182.225455 114.069981 \n", | |
| "L 182.225455 15.717618 \n", | |
| "L 178.690909 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_49><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 182.225455 114.069981 \n", | |
| "L 185.76 114.069981 \n", | |
| "L 185.76 15.717618 \n", | |
| "L 182.225455 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_50><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 185.76 114.069981 \n", | |
| "L 189.294545 114.069981 \n", | |
| "L 189.294545 15.717618 \n", | |
| "L 185.76 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_51><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 189.294545 114.069981 \n", | |
| "L 192.829091 114.069981 \n", | |
| "L 192.829091 15.717618 \n", | |
| "L 189.294545 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_52><path clip-path=url(#p6a7ed9d87a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 192.829091 114.069981 \n", | |
| "L 196.363636 114.069981 \n", | |
| "L 196.363636 16.148044 \n", | |
| "L 192.829091 16.148044 \n", | |
| "z\n", | |
| ""/></g><g id=patch_53><path style=fill:none; d="M 10.8 114.069981 \n", | |
| "L 10.8 10.8 \n", | |
| ""/></g><g id=patch_54><path style=fill:none; d="M 205.2 114.069981 \n", | |
| "L 205.2 10.8 \n", | |
| ""/></g><g id=patch_55><path style=fill:none; d="M 10.8 114.069981 \n", | |
| "L 205.2 114.069981 \n", | |
| ""/></g><g id=patch_56><path style=fill:none; d="M 10.8 10.8 \n", | |
| "L 205.2 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=p6a7ed9d87a><rect height=103.269981 width=194.4 x=10.8 y=10.8 /></clippath></defs></svg></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-5162937004965893282, #minifreqtable5162937004965893282" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-5162937004965893282 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#5162937004965893282bottom-5162937004965893282statistics aria-controls=5162937004965893282bottom-5162937004965893282statistics role=tab data-toggle=tab>Statistics</a></li><li role=presentation><a href=#5162937004965893282bottom-5162937004965893282histogram aria-controls=5162937004965893282bottom-5162937004965893282histogram role=tab data-toggle=tab>Histogram</a></li><li role=presentation><a href=#5162937004965893282bottom-5162937004965893282common_values aria-controls=5162937004965893282bottom-5162937004965893282common_values role=tab data-toggle=tab>Common values</a></li><li role=presentation><a href=#5162937004965893282bottom-5162937004965893282extreme_values aria-controls=5162937004965893282bottom-5162937004965893282extreme_values role=tab data-toggle=tab>Extreme values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=5162937004965893282bottom-5162937004965893282statistics><div class=col-sm-6><p class=h4>Quantile statistics</p><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>0</td></tr><tr><th>5-th percentile</th><td>1138.2</td></tr><tr><th>Q1</th><td>5691</td></tr><tr><th>median</th><td>11392</td></tr><tr><th>Q3</th><td>17140</td></tr><tr><th>95-th percentile</th><td>21708.8</td></tr><tr><th>Maximum</th><td>22849</td></tr><tr><th>Range</th><td>22849</td></tr><tr><th>Interquartile range (IQR)</th><td>11449</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Descriptive statistics</p><table class="table table-condensed stats"><tbody><tr><th>Standard deviation</th><td>6603.779687</td></tr><tr><th>Coefficient of variation (CV)</th><td>0.5784579528</td></tr><tr><th>Kurtosis</th><td>-1.204176247</td></tr><tr><th>Mean</th><td>11416.17927</td></tr><tr><th>Median Absolute Deviation (MAD)</th><td>5725</td></tr><tr><th>Skewness</th><td>0.001765913708</td></tr><tr><th>Sum</th><td>259889321</td></tr><tr><th>Variance</th><td>43609906.16</td></tr><tr><th>Monotonicity</th><td>Strictly increasing</td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=5162937004965893282bottom-5162937004965893282histogram><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
| "L 432 288 \n", | |
| "L 432 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 56.675 234.855069 \n", | |
| "L 421.2 234.855069 \n", | |
| "L 421.2 10.8 \n", | |
| "L 56.675 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(72.946008 257.726942)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
| "L 49.515625 72.90625 \n", | |
| "L 49.515625 64.59375 \n", | |
| "L 19.828125 64.59375 \n", | |
| "L 19.828125 46.734375 \n", | |
| "Q 21.96875 47.46875 24.109375 47.828125 \n", | |
| "Q 26.265625 48.1875 28.421875 48.1875 \n", | |
| "Q 40.625 48.1875 47.75 41.5 \n", | |
| "Q 54.890625 34.8125 54.890625 23.390625 \n", | |
| "Q 54.890625 11.625 47.5625 5.09375 \n", | |
| "Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
| "Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
| "Q 12.796875 0.140625 7.71875 1.703125 \n", | |
| "L 7.71875 11.625 \n", | |
| "Q 12.109375 9.234375 16.796875 8.0625 \n", | |
| "Q 21.484375 6.890625 26.703125 6.890625 \n", | |
| "Q 35.15625 6.890625 40.078125 11.328125 \n", | |
| "Q 45.015625 15.765625 45.015625 23.390625 \n", | |
| "Q 45.015625 31 40.078125 35.4375 \n", | |
| "Q 35.15625 39.890625 26.703125 39.890625 \n", | |
| "Q 22.75 39.890625 18.8125 39.015625 \n", | |
| "Q 14.890625 38.140625 10.796875 36.28125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(138.714158 271.223843)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(208.981276 275.72281)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><g style=fill:#262626; transform="translate(281.497877 275.72281)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(354.014478 275.72281)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_6><g style=fill:#262626; transform="translate(37.3125 238.654287)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_7><g style=fill:#262626; transform="translate(24.5875 191.961557)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_3><g id=text_8><g style=fill:#262626; transform="translate(24.5875 145.268826)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_9><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
| "Q 47.65625 37.796875 51.625 33 \n", | |
| "Q 55.609375 28.21875 55.609375 21.1875 \n", | |
| "Q 55.609375 10.40625 48.1875 4.484375 \n", | |
| "Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
| "Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
| "Q 12.796875 0.390625 7.625 2.203125 \n", | |
| "L 7.625 11.71875 \n", | |
| "Q 11.71875 9.328125 16.59375 8.109375 \n", | |
| "Q 21.484375 6.890625 26.8125 6.890625 \n", | |
| "Q 36.078125 6.890625 40.9375 10.546875 \n", | |
| "Q 45.796875 14.203125 45.796875 21.1875 \n", | |
| "Q 45.796875 27.640625 41.28125 31.265625 \n", | |
| "Q 36.765625 34.90625 28.71875 34.90625 \n", | |
| "L 20.21875 34.90625 \n", | |
| "L 20.21875 43.015625 \n", | |
| "L 29.109375 43.015625 \n", | |
| "Q 36.375 43.015625 40.234375 45.921875 \n", | |
| "Q 44.09375 48.828125 44.09375 54.296875 \n", | |
| "Q 44.09375 59.90625 40.109375 62.90625 \n", | |
| "Q 36.140625 65.921875 28.71875 65.921875 \n", | |
| "Q 24.65625 65.921875 20.015625 65.03125 \n", | |
| "Q 15.375 64.15625 9.8125 62.3125 \n", | |
| "L 9.8125 71.09375 \n", | |
| "Q 15.4375 72.65625 20.34375 73.4375 \n", | |
| "Q 25.25 74.21875 29.59375 74.21875 \n", | |
| "Q 40.828125 74.21875 47.359375 69.109375 \n", | |
| "Q 53.90625 64.015625 53.90625 55.328125 \n", | |
| "Q 53.90625 49.265625 50.4375 45.09375 \n", | |
| "Q 46.96875 40.921875 40.578125 39.3125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(24.5875 98.576095)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-51 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_5><g id=text_10><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
| "L 12.890625 25.390625 \n", | |
| "L 37.796875 25.390625 \n", | |
| "z\n", | |
| "M 35.203125 72.90625 \n", | |
| "L 47.609375 72.90625 \n", | |
| "L 47.609375 25.390625 \n", | |
| "L 58.015625 25.390625 \n", | |
| "L 58.015625 17.1875 \n", | |
| "L 47.609375 17.1875 \n", | |
| "L 47.609375 0 \n", | |
| "L 37.796875 0 \n", | |
| "L 37.796875 17.1875 \n", | |
| "L 4.890625 17.1875 \n", | |
| "L 4.890625 26.703125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(24.5875 51.883364)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_11><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
| "L 51.703125 72.90625 \n", | |
| "L 51.703125 64.59375 \n", | |
| "L 19.671875 64.59375 \n", | |
| "L 19.671875 43.109375 \n", | |
| "L 48.578125 43.109375 \n", | |
| "L 48.578125 34.8125 \n", | |
| "L 19.671875 34.8125 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
| "Q 39.59375 47.171875 37.8125 47.578125 \n", | |
| "Q 36.03125 48 33.890625 48 \n", | |
| "Q 26.265625 48 22.1875 43.046875 \n", | |
| "Q 18.109375 38.09375 18.109375 28.8125 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 20.953125 51.171875 25.484375 53.578125 \n", | |
| "Q 30.03125 56 36.53125 56 \n", | |
| "Q 37.453125 56 38.578125 55.875 \n", | |
| "Q 39.703125 55.765625 41.0625 55.515625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
| "L 56.203125 25.203125 \n", | |
| "L 14.890625 25.203125 \n", | |
| "Q 15.484375 15.921875 20.484375 11.0625 \n", | |
| "Q 25.484375 6.203125 34.421875 6.203125 \n", | |
| "Q 39.59375 6.203125 44.453125 7.46875 \n", | |
| "Q 49.3125 8.734375 54.109375 11.28125 \n", | |
| "L 54.109375 2.78125 \n", | |
| "Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
| "Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
| "Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
| "Q 5.515625 13.8125 5.515625 26.8125 \n", | |
| "Q 5.515625 40.234375 12.765625 48.109375 \n", | |
| "Q 20.015625 56 32.328125 56 \n", | |
| "Q 43.359375 56 49.78125 48.890625 \n", | |
| "Q 56.203125 41.796875 56.203125 29.59375 \n", | |
| "z\n", | |
| "M 47.21875 32.234375 \n", | |
| "Q 47.125 39.59375 43.09375 43.984375 \n", | |
| "Q 39.0625 48.390625 32.421875 48.390625 \n", | |
| "Q 24.90625 48.390625 20.390625 44.140625 \n", | |
| "Q 15.875 39.890625 15.1875 32.171875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
| "Q 14.796875 17.390625 18.875 11.75 \n", | |
| "Q 22.953125 6.109375 30.078125 6.109375 \n", | |
| "Q 37.203125 6.109375 41.296875 11.75 \n", | |
| "Q 45.40625 17.390625 45.40625 27.296875 \n", | |
| "Q 45.40625 37.203125 41.296875 42.84375 \n", | |
| "Q 37.203125 48.484375 30.078125 48.484375 \n", | |
| "Q 22.953125 48.484375 18.875 42.84375 \n", | |
| "Q 14.796875 37.203125 14.796875 27.296875 \n", | |
| "z\n", | |
| "M 45.40625 8.203125 \n", | |
| "Q 42.578125 3.328125 38.25 0.953125 \n", | |
| "Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
| "Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
| "Q 5.515625 14.40625 5.515625 27.296875 \n", | |
| "Q 5.515625 40.1875 11.734375 48.09375 \n", | |
| "Q 17.96875 56 27.875 56 \n", | |
| "Q 33.9375 56 38.25 53.625 \n", | |
| "Q 42.578125 51.265625 45.40625 46.390625 \n", | |
| "L 45.40625 54.6875 \n", | |
| "L 54.390625 54.6875 \n", | |
| "L 54.390625 -20.796875 \n", | |
| "L 45.40625 -20.796875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
| "L 8.5 54.6875 \n", | |
| "L 17.484375 54.6875 \n", | |
| "L 17.484375 21.921875 \n", | |
| "Q 17.484375 14.15625 20.5 10.265625 \n", | |
| "Q 23.53125 6.390625 29.59375 6.390625 \n", | |
| "Q 36.859375 6.390625 41.078125 11.03125 \n", | |
| "Q 45.3125 15.671875 45.3125 23.6875 \n", | |
| "L 45.3125 54.6875 \n", | |
| "L 54.296875 54.6875 \n", | |
| "L 54.296875 0 \n", | |
| "L 45.3125 0 \n", | |
| "L 45.3125 8.40625 \n", | |
| "Q 42.046875 3.421875 37.71875 1 \n", | |
| "Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
| "Q 18.265625 -1.421875 13.375 4.4375 \n", | |
| "Q 8.5 10.296875 8.5 21.578125 \n", | |
| "z\n", | |
| "M 31.109375 56 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
| "L 54.890625 0 \n", | |
| "L 45.90625 0 \n", | |
| "L 45.90625 32.71875 \n", | |
| "Q 45.90625 40.484375 42.875 44.328125 \n", | |
| "Q 39.84375 48.1875 33.796875 48.1875 \n", | |
| "Q 26.515625 48.1875 22.3125 43.546875 \n", | |
| "Q 18.109375 38.921875 18.109375 30.90625 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 21.34375 51.125 25.703125 53.5625 \n", | |
| "Q 30.078125 56 35.796875 56 \n", | |
| "Q 45.21875 56 50.046875 50.171875 \n", | |
| "Q 54.890625 44.34375 54.890625 33.015625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
| "L 48.78125 44.1875 \n", | |
| "Q 44.96875 46.296875 41.140625 47.34375 \n", | |
| "Q 37.3125 48.390625 33.40625 48.390625 \n", | |
| "Q 24.65625 48.390625 19.8125 42.84375 \n", | |
| "Q 14.984375 37.3125 14.984375 27.296875 \n", | |
| "Q 14.984375 17.28125 19.8125 11.734375 \n", | |
| "Q 24.65625 6.203125 33.40625 6.203125 \n", | |
| "Q 37.3125 6.203125 41.140625 7.25 \n", | |
| "Q 44.96875 8.296875 48.78125 10.40625 \n", | |
| "L 48.78125 2.09375 \n", | |
| "Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
| "Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
| "Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
| "Q 5.515625 14.109375 5.515625 27.296875 \n", | |
| "Q 5.515625 40.671875 12.859375 48.328125 \n", | |
| "Q 20.21875 56 33.015625 56 \n", | |
| "Q 37.15625 56 41.109375 55.140625 \n", | |
| "Q 45.0625 54.296875 48.78125 52.59375 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
| "Q 28.375 -14.84375 24.75 -17.8125 \n", | |
| "Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
| "L 7.90625 -20.796875 \n", | |
| "L 7.90625 -13.28125 \n", | |
| "L 13.1875 -13.28125 \n", | |
| "Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
| "Q 21 -9.765625 23.484375 -3.21875 \n", | |
| "L 25.09375 0.875 \n", | |
| "L 2.984375 54.6875 \n", | |
| "L 12.5 54.6875 \n", | |
| "L 29.59375 11.921875 \n", | |
| "L 46.6875 54.6875 \n", | |
| "L 56.203125 54.6875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(18.299844 151.240191)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 73.244318 234.855069 \n", | |
| "L 79.872045 234.855069 \n", | |
| "L 79.872045 21.469289 \n", | |
| "L 73.244318 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 79.872045 234.855069 \n", | |
| "L 86.499773 234.855069 \n", | |
| "L 86.499773 21.469289 \n", | |
| "L 79.872045 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 86.499773 234.855069 \n", | |
| "L 93.1275 234.855069 \n", | |
| "L 93.1275 21.469289 \n", | |
| "L 86.499773 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 93.1275 234.855069 \n", | |
| "L 99.755227 234.855069 \n", | |
| "L 99.755227 21.469289 \n", | |
| "L 93.1275 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 99.755227 234.855069 \n", | |
| "L 106.382955 234.855069 \n", | |
| "L 106.382955 21.469289 \n", | |
| "L 99.755227 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 106.382955 234.855069 \n", | |
| "L 113.010682 234.855069 \n", | |
| "L 113.010682 21.469289 \n", | |
| "L 106.382955 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_9><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 113.010682 234.855069 \n", | |
| "L 119.638409 234.855069 \n", | |
| "L 119.638409 21.469289 \n", | |
| "L 113.010682 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_10><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 119.638409 234.855069 \n", | |
| "L 126.266136 234.855069 \n", | |
| "L 126.266136 21.469289 \n", | |
| "L 119.638409 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_11><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 126.266136 234.855069 \n", | |
| "L 132.893864 234.855069 \n", | |
| "L 132.893864 21.469289 \n", | |
| "L 126.266136 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_12><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 132.893864 234.855069 \n", | |
| "L 139.521591 234.855069 \n", | |
| "L 139.521591 21.469289 \n", | |
| "L 132.893864 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_13><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 139.521591 234.855069 \n", | |
| "L 146.149318 234.855069 \n", | |
| "L 146.149318 21.469289 \n", | |
| "L 139.521591 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_14><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 146.149318 234.855069 \n", | |
| "L 152.777045 234.855069 \n", | |
| "L 152.777045 21.469289 \n", | |
| "L 146.149318 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_15><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 152.777045 234.855069 \n", | |
| "L 159.404773 234.855069 \n", | |
| "L 159.404773 21.469289 \n", | |
| "L 152.777045 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_16><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 159.404773 234.855069 \n", | |
| "L 166.0325 234.855069 \n", | |
| "L 166.0325 21.469289 \n", | |
| "L 159.404773 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_17><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 166.0325 234.855069 \n", | |
| "L 172.660227 234.855069 \n", | |
| "L 172.660227 21.469289 \n", | |
| "L 166.0325 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_18><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 172.660227 234.855069 \n", | |
| "L 179.287955 234.855069 \n", | |
| "L 179.287955 21.469289 \n", | |
| "L 172.660227 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_19><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 179.287955 234.855069 \n", | |
| "L 185.915682 234.855069 \n", | |
| "L 185.915682 21.469289 \n", | |
| "L 179.287955 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_20><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 185.915682 234.855069 \n", | |
| "L 192.543409 234.855069 \n", | |
| "L 192.543409 21.469289 \n", | |
| "L 185.915682 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_21><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 192.543409 234.855069 \n", | |
| "L 199.171136 234.855069 \n", | |
| "L 199.171136 21.469289 \n", | |
| "L 192.543409 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_22><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 199.171136 234.855069 \n", | |
| "L 205.798864 234.855069 \n", | |
| "L 205.798864 21.469289 \n", | |
| "L 199.171136 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_23><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 205.798864 234.855069 \n", | |
| "L 212.426591 234.855069 \n", | |
| "L 212.426591 21.469289 \n", | |
| "L 205.798864 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_24><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 212.426591 234.855069 \n", | |
| "L 219.054318 234.855069 \n", | |
| "L 219.054318 21.469289 \n", | |
| "L 212.426591 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_25><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 219.054318 234.855069 \n", | |
| "L 225.682045 234.855069 \n", | |
| "L 225.682045 21.469289 \n", | |
| "L 219.054318 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_26><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 225.682045 234.855069 \n", | |
| "L 232.309773 234.855069 \n", | |
| "L 232.309773 21.469289 \n", | |
| "L 225.682045 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_27><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 232.309773 234.855069 \n", | |
| "L 238.9375 234.855069 \n", | |
| "L 238.9375 27.539344 \n", | |
| "L 232.309773 27.539344 \n", | |
| "z\n", | |
| ""/></g><g id=patch_28><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 238.9375 234.855069 \n", | |
| "L 245.565227 234.855069 \n", | |
| "L 245.565227 31.74169 \n", | |
| "L 238.9375 31.74169 \n", | |
| "z\n", | |
| ""/></g><g id=patch_29><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 245.565227 234.855069 \n", | |
| "L 252.192955 234.855069 \n", | |
| "L 252.192955 31.74169 \n", | |
| "L 245.565227 31.74169 \n", | |
| "z\n", | |
| ""/></g><g id=patch_30><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 252.192955 234.855069 \n", | |
| "L 258.820682 234.855069 \n", | |
| "L 258.820682 26.138562 \n", | |
| "L 252.192955 26.138562 \n", | |
| "z\n", | |
| ""/></g><g id=patch_31><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 258.820682 234.855069 \n", | |
| "L 265.448409 234.855069 \n", | |
| "L 265.448409 21.469289 \n", | |
| "L 258.820682 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_32><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 265.448409 234.855069 \n", | |
| "L 272.076136 234.855069 \n", | |
| "L 272.076136 21.469289 \n", | |
| "L 265.448409 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_33><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 272.076136 234.855069 \n", | |
| "L 278.703864 234.855069 \n", | |
| "L 278.703864 21.469289 \n", | |
| "L 272.076136 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_34><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 278.703864 234.855069 \n", | |
| "L 285.331591 234.855069 \n", | |
| "L 285.331591 21.469289 \n", | |
| "L 278.703864 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_35><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 285.331591 234.855069 \n", | |
| "L 291.959318 234.855069 \n", | |
| "L 291.959318 21.469289 \n", | |
| "L 285.331591 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_36><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 291.959318 234.855069 \n", | |
| "L 298.587045 234.855069 \n", | |
| "L 298.587045 21.469289 \n", | |
| "L 291.959318 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_37><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 298.587045 234.855069 \n", | |
| "L 305.214773 234.855069 \n", | |
| "L 305.214773 21.469289 \n", | |
| "L 298.587045 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_38><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 305.214773 234.855069 \n", | |
| "L 311.8425 234.855069 \n", | |
| "L 311.8425 21.469289 \n", | |
| "L 305.214773 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_39><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 311.8425 234.855069 \n", | |
| "L 318.470227 234.855069 \n", | |
| "L 318.470227 21.469289 \n", | |
| "L 311.8425 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_40><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 318.470227 234.855069 \n", | |
| "L 325.097955 234.855069 \n", | |
| "L 325.097955 21.469289 \n", | |
| "L 318.470227 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_41><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 325.097955 234.855069 \n", | |
| "L 331.725682 234.855069 \n", | |
| "L 331.725682 21.469289 \n", | |
| "L 325.097955 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_42><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 331.725682 234.855069 \n", | |
| "L 338.353409 234.855069 \n", | |
| "L 338.353409 21.469289 \n", | |
| "L 331.725682 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_43><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 338.353409 234.855069 \n", | |
| "L 344.981136 234.855069 \n", | |
| "L 344.981136 21.469289 \n", | |
| "L 338.353409 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_44><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 344.981136 234.855069 \n", | |
| "L 351.608864 234.855069 \n", | |
| "L 351.608864 21.469289 \n", | |
| "L 344.981136 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_45><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 351.608864 234.855069 \n", | |
| "L 358.236591 234.855069 \n", | |
| "L 358.236591 21.936216 \n", | |
| "L 351.608864 21.936216 \n", | |
| "z\n", | |
| ""/></g><g id=patch_46><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 358.236591 234.855069 \n", | |
| "L 364.864318 234.855069 \n", | |
| "L 364.864318 24.73778 \n", | |
| "L 358.236591 24.73778 \n", | |
| "z\n", | |
| ""/></g><g id=patch_47><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 364.864318 234.855069 \n", | |
| "L 371.492045 234.855069 \n", | |
| "L 371.492045 25.204707 \n", | |
| "L 364.864318 25.204707 \n", | |
| "z\n", | |
| ""/></g><g id=patch_48><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 371.492045 234.855069 \n", | |
| "L 378.119773 234.855069 \n", | |
| "L 378.119773 21.469289 \n", | |
| "L 371.492045 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_49><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 378.119773 234.855069 \n", | |
| "L 384.7475 234.855069 \n", | |
| "L 384.7475 21.469289 \n", | |
| "L 378.119773 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_50><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 384.7475 234.855069 \n", | |
| "L 391.375227 234.855069 \n", | |
| "L 391.375227 21.469289 \n", | |
| "L 384.7475 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_51><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 391.375227 234.855069 \n", | |
| "L 398.002955 234.855069 \n", | |
| "L 398.002955 21.469289 \n", | |
| "L 391.375227 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_52><path clip-path=url(#p6b19a8a9c1) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 398.002955 234.855069 \n", | |
| "L 404.630682 234.855069 \n", | |
| "L 404.630682 22.403144 \n", | |
| "L 398.002955 22.403144 \n", | |
| "z\n", | |
| ""/></g><g id=patch_53><path style=fill:none; d="M 56.675 234.855069 \n", | |
| "L 56.675 10.8 \n", | |
| ""/></g><g id=patch_54><path style=fill:none; d="M 421.2 234.855069 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g><g id=patch_55><path style=fill:none; d="M 56.675 234.855069 \n", | |
| "L 421.2 234.855069 \n", | |
| ""/></g><g id=patch_56><path style=fill:none; d="M 56.675 10.8 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=p6b19a8a9c1><rect height=224.055069 width=364.525 x=56.675 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"><strong>Histogram with fixed size bins</strong> (bins=50) </div></div><div role=tabpanel class="tab-pane col-sm-12" id=5162937004965893282bottom-5162937004965893282common_values><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=0>0</td><td>1</td><td><div class=bar style=width:0.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=15273>15273</td><td>1</td><td><div class=bar style=width:0.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=15249>15249</td><td>1</td><td><div class=bar style=width:0.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=15248>15248</td><td>1</td><td><div class=bar style=width:0.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=15247>15247</td><td>1</td><td><div class=bar style=width:0.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=15246>15246</td><td>1</td><td><div class=bar style=width:0.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=15245>15245</td><td>1</td><td><div class=bar style=width:0.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=15244>15244</td><td>1</td><td><div class=bar style=width:0.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=15243>15243</td><td>1</td><td><div class=bar style=width:0.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=15242>15242</td><td>1</td><td><div class=bar style=width:0.0%> &nbsp; </div>< 0.1% </td></tr><tr class=other><td title="Other values (22755)">Other values (22755)</td><td>22755</td><td><div class=bar style=width:100.0%> > 99.9% </div></td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=5162937004965893282bottom-5162937004965893282extreme_values><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#5162937004965893282extreme_values-5162937004965893282firstn aria-controls=5162937004965893282extreme_values-5162937004965893282firstn role=tab data-toggle=tab>Minimum 10 values</a></li><li role=presentation><a href=#5162937004965893282extreme_values-5162937004965893282lastn aria-controls=5162937004965893282extreme_values-5162937004965893282lastn role=tab data-toggle=tab>Maximum 10 values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=5162937004965893282extreme_values-5162937004965893282firstn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=0>0</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=1>1</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=2>2</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=3>3</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=4>4</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=5>5</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=6>6</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=7>7</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=8>8</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=9>9</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=5162937004965893282extreme_values-5162937004965893282lastn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=22849>22849</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=22848>22848</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=22847>22847</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=22846>22846</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=22845>22845</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=22844>22844</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=22843>22843</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=22842>22842</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=22841>22841</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=22840>22840</td><td>1</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr></tbody></table></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_3648593978865241518></a><div class=variable><div class=col-sm-3><p class=h4 title=person_age><a href=#pp_var_3648593978865241518>person_age</a><br><small>Real number (&Ropf;<sub>&ge;0</sub>)</small></p><code><abbr title="This variable has a high correlation with 3 fields: df_index, person_income, cb_person_cred_hist_length">HIGH CORRELATION</abbr></code><br><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>56</td></tr><tr><th>Distinct (%)</th><td>0.2%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Infinite</th><td>0</td></tr><tr><th>Infinite (%)</th><td>0.0%</td></tr><tr><th>Mean</th><td>27.728311</td></tr></tbody></table></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>20</td></tr><tr><th>Maximum</th><td>144</td></tr><tr><th>Zeros</th><td>0</td></tr><tr><th>Zeros (%)</th><td>0.0%</td></tr><tr><th>Negative</th><td>0</td></tr><tr><th>Negative (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>178.0 KiB</td></tr></tbody></table></div><div class=col-sm-3><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=162pt version=1.1 viewbox="0 0 216 162" width=216pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 162 \n", | |
| "L 216 162 \n", | |
| "L 216 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 10.8 121.141049 \n", | |
| "L 196.915979 121.141049 \n", | |
| "L 196.915979 10.8 \n", | |
| "L 10.8 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
| "L 49.515625 72.90625 \n", | |
| "L 49.515625 64.59375 \n", | |
| "L 19.828125 64.59375 \n", | |
| "L 19.828125 46.734375 \n", | |
| "Q 21.96875 47.46875 24.109375 47.828125 \n", | |
| "Q 26.265625 48.1875 28.421875 48.1875 \n", | |
| "Q 40.625 48.1875 47.75 41.5 \n", | |
| "Q 54.890625 34.8125 54.890625 23.390625 \n", | |
| "Q 54.890625 11.625 47.5625 5.09375 \n", | |
| "Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
| "Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
| "Q 12.796875 0.140625 7.71875 1.703125 \n", | |
| "L 7.71875 11.625 \n", | |
| "Q 12.109375 9.234375 16.796875 8.0625 \n", | |
| "Q 21.484375 6.890625 26.703125 6.890625 \n", | |
| "Q 35.15625 6.890625 40.078125 11.328125 \n", | |
| "Q 45.015625 15.765625 45.015625 23.390625 \n", | |
| "Q 45.015625 31 40.078125 35.4375 \n", | |
| "Q 35.15625 39.890625 26.703125 39.890625 \n", | |
| "Q 22.75 39.890625 18.8125 39.015625 \n", | |
| "Q 14.890625 38.140625 10.796875 36.28125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(24.044015 145.637721)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(58.156181 145.637721)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-55 d="M 8.203125 72.90625 \n", | |
| "L 55.078125 72.90625 \n", | |
| "L 55.078125 68.703125 \n", | |
| "L 28.609375 0 \n", | |
| "L 18.3125 0 \n", | |
| "L 43.21875 64.59375 \n", | |
| "L 8.203125 64.59375 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(92.268348 145.637721)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-55 /><use x=63.623047 xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(124.580927 149.236895)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_5><g id=text_5><g style=fill:#262626; transform="translate(158.693093 149.236895)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-50 /><use x=127.246094 xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_6><g id=text_6><g style=fill:#262626; transform="translate(192.80526 149.236895)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=patch_3><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 19.259817 121.141049 \n", | |
| "L 22.643744 121.141049 \n", | |
| "L 22.643744 55.284111 \n", | |
| "L 19.259817 55.284111 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.643744 121.141049 \n", | |
| "L 26.027671 121.141049 \n", | |
| "L 26.027671 19.755258 \n", | |
| "L 22.643744 19.755258 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 26.027671 121.141049 \n", | |
| "L 29.411598 121.141049 \n", | |
| "L 29.411598 16.054336 \n", | |
| "L 26.027671 16.054336 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 29.411598 121.141049 \n", | |
| "L 32.795525 121.141049 \n", | |
| "L 32.795525 73.048538 \n", | |
| "L 29.411598 73.048538 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 32.795525 121.141049 \n", | |
| "L 36.179452 121.141049 \n", | |
| "L 36.179452 74.723693 \n", | |
| "L 32.795525 74.723693 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 36.179452 121.141049 \n", | |
| "L 39.563379 121.141049 \n", | |
| "L 39.563379 99.987356 \n", | |
| "L 36.179452 99.987356 \n", | |
| "z\n", | |
| ""/></g><g id=patch_9><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 39.563379 121.141049 \n", | |
| "L 42.947305 121.141049 \n", | |
| "L 42.947305 98.584902 \n", | |
| "L 39.563379 98.584902 \n", | |
| "z\n", | |
| ""/></g><g id=patch_10><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 42.947305 121.141049 \n", | |
| "L 46.331232 121.141049 \n", | |
| "L 46.331232 112.180921 \n", | |
| "L 42.947305 112.180921 \n", | |
| "z\n", | |
| ""/></g><g id=patch_11><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 46.331232 121.141049 \n", | |
| "L 49.715159 121.141049 \n", | |
| "L 49.715159 112.044572 \n", | |
| "L 46.331232 112.044572 \n", | |
| "z\n", | |
| ""/></g><g id=patch_12><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 49.715159 121.141049 \n", | |
| "L 53.099086 121.141049 \n", | |
| "L 53.099086 116.875249 \n", | |
| "L 49.715159 116.875249 \n", | |
| "z\n", | |
| ""/></g><g id=patch_13><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 53.099086 121.141049 \n", | |
| "L 56.483013 121.141049 \n", | |
| "L 56.483013 116.99212 \n", | |
| "L 53.099086 116.99212 \n", | |
| "z\n", | |
| ""/></g><g id=patch_14><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 56.483013 121.141049 \n", | |
| "L 59.86694 121.141049 \n", | |
| "L 59.86694 119.38798 \n", | |
| "L 56.483013 119.38798 \n", | |
| "z\n", | |
| ""/></g><g id=patch_15><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 59.86694 121.141049 \n", | |
| "L 63.250867 121.141049 \n", | |
| "L 63.250867 119.485373 \n", | |
| "L 59.86694 119.485373 \n", | |
| "z\n", | |
| ""/></g><g id=patch_16><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 63.250867 121.141049 \n", | |
| "L 66.634794 121.141049 \n", | |
| "L 66.634794 120.400864 \n", | |
| "L 63.250867 120.400864 \n", | |
| "z\n", | |
| ""/></g><g id=patch_17><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 66.634794 121.141049 \n", | |
| "L 70.018721 121.141049 \n", | |
| "L 70.018721 120.342429 \n", | |
| "L 66.634794 120.342429 \n", | |
| "z\n", | |
| ""/></g><g id=patch_18><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 70.018721 121.141049 \n", | |
| "L 73.402647 121.141049 \n", | |
| "L 73.402647 120.790435 \n", | |
| "L 70.018721 120.790435 \n", | |
| "z\n", | |
| ""/></g><g id=patch_19><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 73.402647 121.141049 \n", | |
| "L 76.786574 121.141049 \n", | |
| "L 76.786574 120.732 \n", | |
| "L 73.402647 120.732 \n", | |
| "z\n", | |
| ""/></g><g id=patch_20><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 76.786574 121.141049 \n", | |
| "L 80.170501 121.141049 \n", | |
| "L 80.170501 120.965742 \n", | |
| "L 76.786574 120.965742 \n", | |
| "z\n", | |
| ""/></g><g id=patch_21><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 80.170501 121.141049 \n", | |
| "L 83.554428 121.141049 \n", | |
| "L 83.554428 120.926785 \n", | |
| "L 80.170501 120.926785 \n", | |
| "z\n", | |
| ""/></g><g id=patch_22><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 83.554428 121.141049 \n", | |
| "L 86.938355 121.141049 \n", | |
| "L 86.938355 121.063135 \n", | |
| "L 83.554428 121.063135 \n", | |
| "z\n", | |
| ""/></g><g id=patch_23><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 86.938355 121.141049 \n", | |
| "L 90.322282 121.141049 \n", | |
| "L 90.322282 121.082613 \n", | |
| "L 86.938355 121.082613 \n", | |
| "z\n", | |
| ""/></g><g id=patch_24><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 90.322282 121.141049 \n", | |
| "L 93.706209 121.141049 \n", | |
| "L 93.706209 121.102092 \n", | |
| "L 90.322282 121.102092 \n", | |
| "z\n", | |
| ""/></g><g id=patch_25><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 93.706209 121.141049 \n", | |
| "L 97.090136 121.141049 \n", | |
| "L 97.090136 121.12157 \n", | |
| "L 93.706209 121.12157 \n", | |
| "z\n", | |
| ""/></g><g id=patch_26><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 97.090136 121.141049 \n", | |
| "L 100.474063 121.141049 \n", | |
| "L 100.474063 121.12157 \n", | |
| "L 97.090136 121.12157 \n", | |
| "z\n", | |
| ""/></g><g id=patch_27><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 100.474063 121.141049 \n", | |
| "L 103.857989 121.141049 \n", | |
| "L 103.857989 121.141049 \n", | |
| "L 100.474063 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_28><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 103.857989 121.141049 \n", | |
| "L 107.241916 121.141049 \n", | |
| "L 107.241916 121.12157 \n", | |
| "L 103.857989 121.12157 \n", | |
| "z\n", | |
| ""/></g><g id=patch_29><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 107.241916 121.141049 \n", | |
| "L 110.625843 121.141049 \n", | |
| "L 110.625843 121.141049 \n", | |
| "L 107.241916 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_30><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 110.625843 121.141049 \n", | |
| "L 114.00977 121.141049 \n", | |
| "L 114.00977 121.141049 \n", | |
| "L 110.625843 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_31><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 114.00977 121.141049 \n", | |
| "L 117.393697 121.141049 \n", | |
| "L 117.393697 121.141049 \n", | |
| "L 114.00977 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_32><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 117.393697 121.141049 \n", | |
| "L 120.777624 121.141049 \n", | |
| "L 120.777624 121.12157 \n", | |
| "L 117.393697 121.12157 \n", | |
| "z\n", | |
| ""/></g><g id=patch_33><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 120.777624 121.141049 \n", | |
| "L 124.161551 121.141049 \n", | |
| "L 124.161551 121.141049 \n", | |
| "L 120.777624 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_34><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 124.161551 121.141049 \n", | |
| "L 127.545478 121.141049 \n", | |
| "L 127.545478 121.141049 \n", | |
| "L 124.161551 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_35><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 127.545478 121.141049 \n", | |
| "L 130.929405 121.141049 \n", | |
| "L 130.929405 121.141049 \n", | |
| "L 127.545478 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_36><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 130.929405 121.141049 \n", | |
| "L 134.313332 121.141049 \n", | |
| "L 134.313332 121.141049 \n", | |
| "L 130.929405 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_37><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 134.313332 121.141049 \n", | |
| "L 137.697258 121.141049 \n", | |
| "L 137.697258 121.141049 \n", | |
| "L 134.313332 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_38><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 137.697258 121.141049 \n", | |
| "L 141.081185 121.141049 \n", | |
| "L 141.081185 121.141049 \n", | |
| "L 137.697258 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_39><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 141.081185 121.141049 \n", | |
| "L 144.465112 121.141049 \n", | |
| "L 144.465112 121.141049 \n", | |
| "L 141.081185 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_40><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 144.465112 121.141049 \n", | |
| "L 147.849039 121.141049 \n", | |
| "L 147.849039 121.141049 \n", | |
| "L 144.465112 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_41><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 147.849039 121.141049 \n", | |
| "L 151.232966 121.141049 \n", | |
| "L 151.232966 121.141049 \n", | |
| "L 147.849039 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_42><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 151.232966 121.141049 \n", | |
| "L 154.616893 121.141049 \n", | |
| "L 154.616893 121.141049 \n", | |
| "L 151.232966 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_43><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 154.616893 121.141049 \n", | |
| "L 158.00082 121.141049 \n", | |
| "L 158.00082 121.141049 \n", | |
| "L 154.616893 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_44><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 158.00082 121.141049 \n", | |
| "L 161.384747 121.141049 \n", | |
| "L 161.384747 121.12157 \n", | |
| "L 158.00082 121.12157 \n", | |
| "z\n", | |
| ""/></g><g id=patch_45><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 161.384747 121.141049 \n", | |
| "L 164.768674 121.141049 \n", | |
| "L 164.768674 121.141049 \n", | |
| "L 161.384747 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_46><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 164.768674 121.141049 \n", | |
| "L 168.1526 121.141049 \n", | |
| "L 168.1526 121.141049 \n", | |
| "L 164.768674 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_47><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 168.1526 121.141049 \n", | |
| "L 171.536527 121.141049 \n", | |
| "L 171.536527 121.141049 \n", | |
| "L 168.1526 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_48><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 171.536527 121.141049 \n", | |
| "L 174.920454 121.141049 \n", | |
| "L 174.920454 121.141049 \n", | |
| "L 171.536527 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_49><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 174.920454 121.141049 \n", | |
| "L 178.304381 121.141049 \n", | |
| "L 178.304381 121.141049 \n", | |
| "L 174.920454 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_50><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 178.304381 121.141049 \n", | |
| "L 181.688308 121.141049 \n", | |
| "L 181.688308 121.141049 \n", | |
| "L 178.304381 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_51><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 181.688308 121.141049 \n", | |
| "L 185.072235 121.141049 \n", | |
| "L 185.072235 121.141049 \n", | |
| "L 181.688308 121.141049 \n", | |
| "z\n", | |
| ""/></g><g id=patch_52><path clip-path=url(#p6c9c43b5d4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 185.072235 121.141049 \n", | |
| "L 188.456162 121.141049 \n", | |
| "L 188.456162 121.102092 \n", | |
| "L 185.072235 121.102092 \n", | |
| "z\n", | |
| ""/></g><g id=patch_53><path style=fill:none; d="M 10.8 121.141049 \n", | |
| "L 10.8 10.8 \n", | |
| ""/></g><g id=patch_54><path style=fill:none; d="M 196.915979 121.141049 \n", | |
| "L 196.915979 10.8 \n", | |
| ""/></g><g id=patch_55><path style=fill:none; d="M 10.8 121.141049 \n", | |
| "L 196.915979 121.141049 \n", | |
| ""/></g><g id=patch_56><path style=fill:none; d="M 10.8 10.8 \n", | |
| "L 196.915979 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=p6c9c43b5d4><rect height=110.341049 width=186.115979 x=10.8 y=10.8 /></clippath></defs></svg></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-3648593978865241518, #minifreqtable3648593978865241518" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-3648593978865241518 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#3648593978865241518bottom-3648593978865241518statistics aria-controls=3648593978865241518bottom-3648593978865241518statistics role=tab data-toggle=tab>Statistics</a></li><li role=presentation><a href=#3648593978865241518bottom-3648593978865241518histogram aria-controls=3648593978865241518bottom-3648593978865241518histogram role=tab data-toggle=tab>Histogram</a></li><li role=presentation><a href=#3648593978865241518bottom-3648593978865241518common_values aria-controls=3648593978865241518bottom-3648593978865241518common_values role=tab data-toggle=tab>Common values</a></li><li role=presentation><a href=#3648593978865241518bottom-3648593978865241518extreme_values aria-controls=3648593978865241518bottom-3648593978865241518extreme_values role=tab data-toggle=tab>Extreme values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=3648593978865241518bottom-3648593978865241518statistics><div class=col-sm-6><p class=h4>Quantile statistics</p><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>20</td></tr><tr><th>5-th percentile</th><td>22</td></tr><tr><th>Q1</th><td>23</td></tr><tr><th>median</th><td>26</td></tr><tr><th>Q3</th><td>30</td></tr><tr><th>95-th percentile</th><td>40</td></tr><tr><th>Maximum</th><td>144</td></tr><tr><th>Range</th><td>124</td></tr><tr><th>Interquartile range (IQR)</th><td>7</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Descriptive statistics</p><table class="table table-condensed stats"><tbody><tr><th>Standard deviation</th><td>6.333094969</td></tr><tr><th>Coefficient of variation (CV)</th><td>0.2283981512</td></tr><tr><th>Kurtosis</th><td>17.511767</td></tr><tr><th>Mean</th><td>27.728311</td></tr><tr><th>Median Absolute Deviation (MAD)</th><td>3</td></tr><tr><th>Skewness</th><td>2.530729342</td></tr><tr><th>Sum</th><td>631235</td></tr><tr><th>Variance</th><td>40.10809188</td></tr><tr><th>Monotonicity</th><td>Not monotonic</td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=3648593978865241518bottom-3648593978865241518histogram><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
| "L 432 288 \n", | |
| "L 432 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 62.925 243.693903 \n", | |
| "L 421.2 243.693903 \n", | |
| "L 421.2 10.8 \n", | |
| "L 62.925 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(76.662433 271.064744)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
| "L 12.890625 25.390625 \n", | |
| "L 37.796875 25.390625 \n", | |
| "z\n", | |
| "M 35.203125 72.90625 \n", | |
| "L 47.609375 72.90625 \n", | |
| "L 47.609375 25.390625 \n", | |
| "L 58.015625 25.390625 \n", | |
| "L 58.015625 17.1875 \n", | |
| "L 47.609375 17.1875 \n", | |
| "L 47.609375 0 \n", | |
| "L 37.796875 0 \n", | |
| "L 37.796875 17.1875 \n", | |
| "L 4.890625 17.1875 \n", | |
| "L 4.890625 26.703125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(129.195424 271.064744)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
| "Q 26.375 40.375 22.484375 35.828125 \n", | |
| "Q 18.609375 31.296875 18.609375 23.390625 \n", | |
| "Q 18.609375 15.53125 22.484375 10.953125 \n", | |
| "Q 26.375 6.390625 33.015625 6.390625 \n", | |
| "Q 39.65625 6.390625 43.53125 10.953125 \n", | |
| "Q 47.40625 15.53125 47.40625 23.390625 \n", | |
| "Q 47.40625 31.296875 43.53125 35.828125 \n", | |
| "Q 39.65625 40.375 33.015625 40.375 \n", | |
| "z\n", | |
| "M 52.59375 71.296875 \n", | |
| "L 52.59375 62.3125 \n", | |
| "Q 48.875 64.0625 45.09375 64.984375 \n", | |
| "Q 41.3125 65.921875 37.59375 65.921875 \n", | |
| "Q 27.828125 65.921875 22.671875 59.328125 \n", | |
| "Q 17.53125 52.734375 16.796875 39.40625 \n", | |
| "Q 19.671875 43.65625 24.015625 45.921875 \n", | |
| "Q 28.375 48.1875 33.59375 48.1875 \n", | |
| "Q 44.578125 48.1875 50.953125 41.515625 \n", | |
| "Q 57.328125 34.859375 57.328125 23.390625 \n", | |
| "Q 57.328125 12.15625 50.6875 5.359375 \n", | |
| "Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
| "Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
| "Q 6.984375 17.96875 6.984375 36.375 \n", | |
| "Q 6.984375 53.65625 15.1875 63.9375 \n", | |
| "Q 23.390625 74.21875 37.203125 74.21875 \n", | |
| "Q 40.921875 74.21875 44.703125 73.484375 \n", | |
| "Q 48.484375 72.75 52.59375 71.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(181.728416 271.064744)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-54 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-56 d="M 31.78125 34.625 \n", | |
| "Q 24.75 34.625 20.71875 30.859375 \n", | |
| "Q 16.703125 27.09375 16.703125 20.515625 \n", | |
| "Q 16.703125 13.921875 20.71875 10.15625 \n", | |
| "Q 24.75 6.390625 31.78125 6.390625 \n", | |
| "Q 38.8125 6.390625 42.859375 10.171875 \n", | |
| "Q 46.921875 13.96875 46.921875 20.515625 \n", | |
| "Q 46.921875 27.09375 42.890625 30.859375 \n", | |
| "Q 38.875 34.625 31.78125 34.625 \n", | |
| "z\n", | |
| "M 21.921875 38.8125 \n", | |
| "Q 15.578125 40.375 12.03125 44.71875 \n", | |
| "Q 8.5 49.078125 8.5 55.328125 \n", | |
| "Q 8.5 64.0625 14.71875 69.140625 \n", | |
| "Q 20.953125 74.21875 31.78125 74.21875 \n", | |
| "Q 42.671875 74.21875 48.875 69.140625 \n", | |
| "Q 55.078125 64.0625 55.078125 55.328125 \n", | |
| "Q 55.078125 49.078125 51.53125 44.71875 \n", | |
| "Q 48 40.375 41.703125 38.8125 \n", | |
| "Q 48.828125 37.15625 52.796875 32.3125 \n", | |
| "Q 56.78125 27.484375 56.78125 20.515625 \n", | |
| "Q 56.78125 9.90625 50.3125 4.234375 \n", | |
| "Q 43.84375 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.734375 -1.421875 13.25 4.234375 \n", | |
| "Q 6.78125 9.90625 6.78125 20.515625 \n", | |
| "Q 6.78125 27.484375 10.78125 32.3125 \n", | |
| "Q 14.796875 37.15625 21.921875 38.8125 \n", | |
| "z\n", | |
| "M 18.3125 54.390625 \n", | |
| "Q 18.3125 48.734375 21.84375 45.5625 \n", | |
| "Q 25.390625 42.390625 31.78125 42.390625 \n", | |
| "Q 38.140625 42.390625 41.71875 45.5625 \n", | |
| "Q 45.3125 48.734375 45.3125 54.390625 \n", | |
| "Q 45.3125 60.0625 41.71875 63.234375 \n", | |
| "Q 38.140625 66.40625 31.78125 66.40625 \n", | |
| "Q 25.390625 66.40625 21.84375 63.234375 \n", | |
| "Q 18.3125 60.0625 18.3125 54.390625 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(234.261407 271.064744)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-56 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(284.544915 275.563711)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_6><g id=text_6><g style=fill:#262626; transform="translate(337.077906 275.563711)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-50 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_7><g id=text_7><g style=fill:#262626; transform="translate(389.610897 275.563711)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-52 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_8><g style=fill:#262626; transform="translate(43.5625 247.493122)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_9><g style=fill:#262626; transform="translate(24.475 206.380292)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_3><g id=text_10><g style=fill:#262626; transform="translate(24.475 165.267462)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_11><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
| "Q 47.65625 37.796875 51.625 33 \n", | |
| "Q 55.609375 28.21875 55.609375 21.1875 \n", | |
| "Q 55.609375 10.40625 48.1875 4.484375 \n", | |
| "Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
| "Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
| "Q 12.796875 0.390625 7.625 2.203125 \n", | |
| "L 7.625 11.71875 \n", | |
| "Q 11.71875 9.328125 16.59375 8.109375 \n", | |
| "Q 21.484375 6.890625 26.8125 6.890625 \n", | |
| "Q 36.078125 6.890625 40.9375 10.546875 \n", | |
| "Q 45.796875 14.203125 45.796875 21.1875 \n", | |
| "Q 45.796875 27.640625 41.28125 31.265625 \n", | |
| "Q 36.765625 34.90625 28.71875 34.90625 \n", | |
| "L 20.21875 34.90625 \n", | |
| "L 20.21875 43.015625 \n", | |
| "L 29.109375 43.015625 \n", | |
| "Q 36.375 43.015625 40.234375 45.921875 \n", | |
| "Q 44.09375 48.828125 44.09375 54.296875 \n", | |
| "Q 44.09375 59.90625 40.109375 62.90625 \n", | |
| "Q 36.140625 65.921875 28.71875 65.921875 \n", | |
| "Q 24.65625 65.921875 20.015625 65.03125 \n", | |
| "Q 15.375 64.15625 9.8125 62.3125 \n", | |
| "L 9.8125 71.09375 \n", | |
| "Q 15.4375 72.65625 20.34375 73.4375 \n", | |
| "Q 25.25 74.21875 29.59375 74.21875 \n", | |
| "Q 40.828125 74.21875 47.359375 69.109375 \n", | |
| "Q 53.90625 64.015625 53.90625 55.328125 \n", | |
| "Q 53.90625 49.265625 50.4375 45.09375 \n", | |
| "Q 46.96875 40.921875 40.578125 39.3125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(24.475 124.154632)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-51 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_5><g id=text_12><g style=fill:#262626; transform="translate(24.475 83.041802)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_6><g id=text_13><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
| "L 49.515625 72.90625 \n", | |
| "L 49.515625 64.59375 \n", | |
| "L 19.828125 64.59375 \n", | |
| "L 19.828125 46.734375 \n", | |
| "Q 21.96875 47.46875 24.109375 47.828125 \n", | |
| "Q 26.265625 48.1875 28.421875 48.1875 \n", | |
| "Q 40.625 48.1875 47.75 41.5 \n", | |
| "Q 54.890625 34.8125 54.890625 23.390625 \n", | |
| "Q 54.890625 11.625 47.5625 5.09375 \n", | |
| "Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
| "Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
| "Q 12.796875 0.140625 7.71875 1.703125 \n", | |
| "L 7.71875 11.625 \n", | |
| "Q 12.109375 9.234375 16.796875 8.0625 \n", | |
| "Q 21.484375 6.890625 26.703125 6.890625 \n", | |
| "Q 35.15625 6.890625 40.078125 11.328125 \n", | |
| "Q 45.015625 15.765625 45.015625 23.390625 \n", | |
| "Q 45.015625 31 40.078125 35.4375 \n", | |
| "Q 35.15625 39.890625 26.703125 39.890625 \n", | |
| "Q 22.75 39.890625 18.8125 39.015625 \n", | |
| "Q 14.890625 38.140625 10.796875 36.28125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(24.475 41.928972)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_14><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
| "L 51.703125 72.90625 \n", | |
| "L 51.703125 64.59375 \n", | |
| "L 19.671875 64.59375 \n", | |
| "L 19.671875 43.109375 \n", | |
| "L 48.578125 43.109375 \n", | |
| "L 48.578125 34.8125 \n", | |
| "L 19.671875 34.8125 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
| "Q 39.59375 47.171875 37.8125 47.578125 \n", | |
| "Q 36.03125 48 33.890625 48 \n", | |
| "Q 26.265625 48 22.1875 43.046875 \n", | |
| "Q 18.109375 38.09375 18.109375 28.8125 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 20.953125 51.171875 25.484375 53.578125 \n", | |
| "Q 30.03125 56 36.53125 56 \n", | |
| "Q 37.453125 56 38.578125 55.875 \n", | |
| "Q 39.703125 55.765625 41.0625 55.515625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
| "L 56.203125 25.203125 \n", | |
| "L 14.890625 25.203125 \n", | |
| "Q 15.484375 15.921875 20.484375 11.0625 \n", | |
| "Q 25.484375 6.203125 34.421875 6.203125 \n", | |
| "Q 39.59375 6.203125 44.453125 7.46875 \n", | |
| "Q 49.3125 8.734375 54.109375 11.28125 \n", | |
| "L 54.109375 2.78125 \n", | |
| "Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
| "Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
| "Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
| "Q 5.515625 13.8125 5.515625 26.8125 \n", | |
| "Q 5.515625 40.234375 12.765625 48.109375 \n", | |
| "Q 20.015625 56 32.328125 56 \n", | |
| "Q 43.359375 56 49.78125 48.890625 \n", | |
| "Q 56.203125 41.796875 56.203125 29.59375 \n", | |
| "z\n", | |
| "M 47.21875 32.234375 \n", | |
| "Q 47.125 39.59375 43.09375 43.984375 \n", | |
| "Q 39.0625 48.390625 32.421875 48.390625 \n", | |
| "Q 24.90625 48.390625 20.390625 44.140625 \n", | |
| "Q 15.875 39.890625 15.1875 32.171875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
| "Q 14.796875 17.390625 18.875 11.75 \n", | |
| "Q 22.953125 6.109375 30.078125 6.109375 \n", | |
| "Q 37.203125 6.109375 41.296875 11.75 \n", | |
| "Q 45.40625 17.390625 45.40625 27.296875 \n", | |
| "Q 45.40625 37.203125 41.296875 42.84375 \n", | |
| "Q 37.203125 48.484375 30.078125 48.484375 \n", | |
| "Q 22.953125 48.484375 18.875 42.84375 \n", | |
| "Q 14.796875 37.203125 14.796875 27.296875 \n", | |
| "z\n", | |
| "M 45.40625 8.203125 \n", | |
| "Q 42.578125 3.328125 38.25 0.953125 \n", | |
| "Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
| "Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
| "Q 5.515625 14.40625 5.515625 27.296875 \n", | |
| "Q 5.515625 40.1875 11.734375 48.09375 \n", | |
| "Q 17.96875 56 27.875 56 \n", | |
| "Q 33.9375 56 38.25 53.625 \n", | |
| "Q 42.578125 51.265625 45.40625 46.390625 \n", | |
| "L 45.40625 54.6875 \n", | |
| "L 54.390625 54.6875 \n", | |
| "L 54.390625 -20.796875 \n", | |
| "L 45.40625 -20.796875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
| "L 8.5 54.6875 \n", | |
| "L 17.484375 54.6875 \n", | |
| "L 17.484375 21.921875 \n", | |
| "Q 17.484375 14.15625 20.5 10.265625 \n", | |
| "Q 23.53125 6.390625 29.59375 6.390625 \n", | |
| "Q 36.859375 6.390625 41.078125 11.03125 \n", | |
| "Q 45.3125 15.671875 45.3125 23.6875 \n", | |
| "L 45.3125 54.6875 \n", | |
| "L 54.296875 54.6875 \n", | |
| "L 54.296875 0 \n", | |
| "L 45.3125 0 \n", | |
| "L 45.3125 8.40625 \n", | |
| "Q 42.046875 3.421875 37.71875 1 \n", | |
| "Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
| "Q 18.265625 -1.421875 13.375 4.4375 \n", | |
| "Q 8.5 10.296875 8.5 21.578125 \n", | |
| "z\n", | |
| "M 31.109375 56 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
| "L 54.890625 0 \n", | |
| "L 45.90625 0 \n", | |
| "L 45.90625 32.71875 \n", | |
| "Q 45.90625 40.484375 42.875 44.328125 \n", | |
| "Q 39.84375 48.1875 33.796875 48.1875 \n", | |
| "Q 26.515625 48.1875 22.3125 43.546875 \n", | |
| "Q 18.109375 38.921875 18.109375 30.90625 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 21.34375 51.125 25.703125 53.5625 \n", | |
| "Q 30.078125 56 35.796875 56 \n", | |
| "Q 45.21875 56 50.046875 50.171875 \n", | |
| "Q 54.890625 44.34375 54.890625 33.015625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
| "L 48.78125 44.1875 \n", | |
| "Q 44.96875 46.296875 41.140625 47.34375 \n", | |
| "Q 37.3125 48.390625 33.40625 48.390625 \n", | |
| "Q 24.65625 48.390625 19.8125 42.84375 \n", | |
| "Q 14.984375 37.3125 14.984375 27.296875 \n", | |
| "Q 14.984375 17.28125 19.8125 11.734375 \n", | |
| "Q 24.65625 6.203125 33.40625 6.203125 \n", | |
| "Q 37.3125 6.203125 41.140625 7.25 \n", | |
| "Q 44.96875 8.296875 48.78125 10.40625 \n", | |
| "L 48.78125 2.09375 \n", | |
| "Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
| "Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
| "Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
| "Q 5.515625 14.109375 5.515625 27.296875 \n", | |
| "Q 5.515625 40.671875 12.859375 48.328125 \n", | |
| "Q 20.21875 56 33.015625 56 \n", | |
| "Q 37.15625 56 41.109375 55.140625 \n", | |
| "Q 45.0625 54.296875 48.78125 52.59375 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
| "Q 28.375 -14.84375 24.75 -17.8125 \n", | |
| "Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
| "L 7.90625 -20.796875 \n", | |
| "L 7.90625 -13.28125 \n", | |
| "L 13.1875 -13.28125 \n", | |
| "Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
| "Q 21 -9.765625 23.484375 -3.21875 \n", | |
| "L 25.09375 0.875 \n", | |
| "L 2.984375 54.6875 \n", | |
| "L 12.5 54.6875 \n", | |
| "L 29.59375 11.921875 \n", | |
| "L 46.6875 54.6875 \n", | |
| "L 56.203125 54.6875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(18.187344 155.659608)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 79.210227 243.693903 \n", | |
| "L 85.724318 243.693903 \n", | |
| "L 85.724318 104.691425 \n", | |
| "L 79.210227 104.691425 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 85.724318 243.693903 \n", | |
| "L 92.238409 243.693903 \n", | |
| "L 92.238409 29.701624 \n", | |
| "L 85.724318 29.701624 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 92.238409 243.693903 \n", | |
| "L 98.7525 243.693903 \n", | |
| "L 98.7525 21.890186 \n", | |
| "L 92.238409 21.890186 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 98.7525 243.693903 \n", | |
| "L 105.266591 243.693903 \n", | |
| "L 105.266591 142.186326 \n", | |
| "L 98.7525 142.186326 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 105.266591 243.693903 \n", | |
| "L 111.780682 243.693903 \n", | |
| "L 111.780682 145.72203 \n", | |
| "L 105.266591 145.72203 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 111.780682 243.693903 \n", | |
| "L 118.294773 243.693903 \n", | |
| "L 118.294773 199.04537 \n", | |
| "L 111.780682 199.04537 \n", | |
| "z\n", | |
| ""/></g><g id=patch_9><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 118.294773 243.693903 \n", | |
| "L 124.808864 243.693903 \n", | |
| "L 124.808864 196.085246 \n", | |
| "L 118.294773 196.085246 \n", | |
| "z\n", | |
| ""/></g><g id=patch_10><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 124.808864 243.693903 \n", | |
| "L 131.322955 243.693903 \n", | |
| "L 131.322955 224.782002 \n", | |
| "L 124.808864 224.782002 \n", | |
| "z\n", | |
| ""/></g><g id=patch_11><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 131.322955 243.693903 \n", | |
| "L 137.837045 243.693903 \n", | |
| "L 137.837045 224.494212 \n", | |
| "L 131.322955 224.494212 \n", | |
| "z\n", | |
| ""/></g><g id=patch_12><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 137.837045 243.693903 \n", | |
| "L 144.351136 243.693903 \n", | |
| "L 144.351136 234.690194 \n", | |
| "L 137.837045 234.690194 \n", | |
| "z\n", | |
| ""/></g><g id=patch_13><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 144.351136 243.693903 \n", | |
| "L 150.865227 243.693903 \n", | |
| "L 150.865227 234.936871 \n", | |
| "L 144.351136 234.936871 \n", | |
| "z\n", | |
| ""/></g><g id=patch_14><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 150.865227 243.693903 \n", | |
| "L 157.379318 243.693903 \n", | |
| "L 157.379318 239.993749 \n", | |
| "L 150.865227 239.993749 \n", | |
| "z\n", | |
| ""/></g><g id=patch_15><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 157.379318 243.693903 \n", | |
| "L 163.893409 243.693903 \n", | |
| "L 163.893409 240.199313 \n", | |
| "L 157.379318 240.199313 \n", | |
| "z\n", | |
| ""/></g><g id=patch_16><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 163.893409 243.693903 \n", | |
| "L 170.4075 243.693903 \n", | |
| "L 170.4075 242.131616 \n", | |
| "L 163.893409 242.131616 \n", | |
| "z\n", | |
| ""/></g><g id=patch_17><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 170.4075 243.693903 \n", | |
| "L 176.921591 243.693903 \n", | |
| "L 176.921591 242.008277 \n", | |
| "L 170.4075 242.008277 \n", | |
| "z\n", | |
| ""/></g><g id=patch_18><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 176.921591 243.693903 \n", | |
| "L 183.435682 243.693903 \n", | |
| "L 183.435682 242.953872 \n", | |
| "L 176.921591 242.953872 \n", | |
| "z\n", | |
| ""/></g><g id=patch_19><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 183.435682 243.693903 \n", | |
| "L 189.949773 243.693903 \n", | |
| "L 189.949773 242.830534 \n", | |
| "L 183.435682 242.830534 \n", | |
| "z\n", | |
| ""/></g><g id=patch_20><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 189.949773 243.693903 \n", | |
| "L 196.463864 243.693903 \n", | |
| "L 196.463864 243.323888 \n", | |
| "L 189.949773 243.323888 \n", | |
| "z\n", | |
| ""/></g><g id=patch_21><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 196.463864 243.693903 \n", | |
| "L 202.977955 243.693903 \n", | |
| "L 202.977955 243.241662 \n", | |
| "L 196.463864 243.241662 \n", | |
| "z\n", | |
| ""/></g><g id=patch_22><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 202.977955 243.693903 \n", | |
| "L 209.492045 243.693903 \n", | |
| "L 209.492045 243.529452 \n", | |
| "L 202.977955 243.529452 \n", | |
| "z\n", | |
| ""/></g><g id=patch_23><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 209.492045 243.693903 \n", | |
| "L 216.006136 243.693903 \n", | |
| "L 216.006136 243.570565 \n", | |
| "L 209.492045 243.570565 \n", | |
| "z\n", | |
| ""/></g><g id=patch_24><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 216.006136 243.693903 \n", | |
| "L 222.520227 243.693903 \n", | |
| "L 222.520227 243.611678 \n", | |
| "L 216.006136 243.611678 \n", | |
| "z\n", | |
| ""/></g><g id=patch_25><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 222.520227 243.693903 \n", | |
| "L 229.034318 243.693903 \n", | |
| "L 229.034318 243.652791 \n", | |
| "L 222.520227 243.652791 \n", | |
| "z\n", | |
| ""/></g><g id=patch_26><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 229.034318 243.693903 \n", | |
| "L 235.548409 243.693903 \n", | |
| "L 235.548409 243.652791 \n", | |
| "L 229.034318 243.652791 \n", | |
| "z\n", | |
| ""/></g><g id=patch_27><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 235.548409 243.693903 \n", | |
| "L 242.0625 243.693903 \n", | |
| "L 242.0625 243.693903 \n", | |
| "L 235.548409 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_28><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 242.0625 243.693903 \n", | |
| "L 248.576591 243.693903 \n", | |
| "L 248.576591 243.652791 \n", | |
| "L 242.0625 243.652791 \n", | |
| "z\n", | |
| ""/></g><g id=patch_29><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 248.576591 243.693903 \n", | |
| "L 255.090682 243.693903 \n", | |
| "L 255.090682 243.693903 \n", | |
| "L 248.576591 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_30><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 255.090682 243.693903 \n", | |
| "L 261.604773 243.693903 \n", | |
| "L 261.604773 243.693903 \n", | |
| "L 255.090682 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_31><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 261.604773 243.693903 \n", | |
| "L 268.118864 243.693903 \n", | |
| "L 268.118864 243.693903 \n", | |
| "L 261.604773 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_32><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 268.118864 243.693903 \n", | |
| "L 274.632955 243.693903 \n", | |
| "L 274.632955 243.652791 \n", | |
| "L 268.118864 243.652791 \n", | |
| "z\n", | |
| ""/></g><g id=patch_33><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 274.632955 243.693903 \n", | |
| "L 281.147045 243.693903 \n", | |
| "L 281.147045 243.693903 \n", | |
| "L 274.632955 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_34><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 281.147045 243.693903 \n", | |
| "L 287.661136 243.693903 \n", | |
| "L 287.661136 243.693903 \n", | |
| "L 281.147045 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_35><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 287.661136 243.693903 \n", | |
| "L 294.175227 243.693903 \n", | |
| "L 294.175227 243.693903 \n", | |
| "L 287.661136 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_36><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 294.175227 243.693903 \n", | |
| "L 300.689318 243.693903 \n", | |
| "L 300.689318 243.693903 \n", | |
| "L 294.175227 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_37><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 300.689318 243.693903 \n", | |
| "L 307.203409 243.693903 \n", | |
| "L 307.203409 243.693903 \n", | |
| "L 300.689318 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_38><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 307.203409 243.693903 \n", | |
| "L 313.7175 243.693903 \n", | |
| "L 313.7175 243.693903 \n", | |
| "L 307.203409 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_39><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 313.7175 243.693903 \n", | |
| "L 320.231591 243.693903 \n", | |
| "L 320.231591 243.693903 \n", | |
| "L 313.7175 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_40><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 320.231591 243.693903 \n", | |
| "L 326.745682 243.693903 \n", | |
| "L 326.745682 243.693903 \n", | |
| "L 320.231591 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_41><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 326.745682 243.693903 \n", | |
| "L 333.259773 243.693903 \n", | |
| "L 333.259773 243.693903 \n", | |
| "L 326.745682 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_42><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 333.259773 243.693903 \n", | |
| "L 339.773864 243.693903 \n", | |
| "L 339.773864 243.693903 \n", | |
| "L 333.259773 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_43><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 339.773864 243.693903 \n", | |
| "L 346.287955 243.693903 \n", | |
| "L 346.287955 243.693903 \n", | |
| "L 339.773864 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_44><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 346.287955 243.693903 \n", | |
| "L 352.802045 243.693903 \n", | |
| "L 352.802045 243.652791 \n", | |
| "L 346.287955 243.652791 \n", | |
| "z\n", | |
| ""/></g><g id=patch_45><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 352.802045 243.693903 \n", | |
| "L 359.316136 243.693903 \n", | |
| "L 359.316136 243.693903 \n", | |
| "L 352.802045 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_46><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 359.316136 243.693903 \n", | |
| "L 365.830227 243.693903 \n", | |
| "L 365.830227 243.693903 \n", | |
| "L 359.316136 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_47><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 365.830227 243.693903 \n", | |
| "L 372.344318 243.693903 \n", | |
| "L 372.344318 243.693903 \n", | |
| "L 365.830227 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_48><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 372.344318 243.693903 \n", | |
| "L 378.858409 243.693903 \n", | |
| "L 378.858409 243.693903 \n", | |
| "L 372.344318 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_49><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 378.858409 243.693903 \n", | |
| "L 385.3725 243.693903 \n", | |
| "L 385.3725 243.693903 \n", | |
| "L 378.858409 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_50><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 385.3725 243.693903 \n", | |
| "L 391.886591 243.693903 \n", | |
| "L 391.886591 243.693903 \n", | |
| "L 385.3725 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_51><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 391.886591 243.693903 \n", | |
| "L 398.400682 243.693903 \n", | |
| "L 398.400682 243.693903 \n", | |
| "L 391.886591 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_52><path clip-path=url(#peeb129eac2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 398.400682 243.693903 \n", | |
| "L 404.914773 243.693903 \n", | |
| "L 404.914773 243.611678 \n", | |
| "L 398.400682 243.611678 \n", | |
| "z\n", | |
| ""/></g><g id=patch_53><path style=fill:none; d="M 62.925 243.693903 \n", | |
| "L 62.925 10.8 \n", | |
| ""/></g><g id=patch_54><path style=fill:none; d="M 421.2 243.693903 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g><g id=patch_55><path style=fill:none; d="M 62.925 243.693903 \n", | |
| "L 421.2 243.693903 \n", | |
| ""/></g><g id=patch_56><path style=fill:none; d="M 62.925 10.8 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=peeb129eac2><rect height=232.893903 width=358.275 x=62.925 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"><strong>Histogram with fixed size bins</strong> (bins=50) </div></div><div role=tabpanel class="tab-pane col-sm-12" id=3648593978865241518bottom-3648593978865241518common_values><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=23>23</td><td>2738</td><td><div class=bar style=width:50.7%> 12.0% </div></td></tr><tr class><td title=22>22</td><td>2524</td><td><div class=bar style=width:46.8%> 11.1% </div></td></tr><tr class><td title=24>24</td><td>2467</td><td><div class=bar style=width:45.7%> 10.8% </div></td></tr><tr class><td title=25>25</td><td>2159</td><td><div class=bar style=width:40.0%> 9.5% </div></td></tr><tr class><td title=26>26</td><td>1712</td><td><div class=bar style=width:31.7%> &nbsp; </div> 7.5% </td></tr><tr class><td title=27>27</td><td>1524</td><td><div class=bar style=width:28.2%> &nbsp; </div> 6.7% </td></tr><tr class><td title=28>28</td><td>1281</td><td><div class=bar style=width:23.7%> &nbsp; </div> 5.6% </td></tr><tr class><td title=29>29</td><td>1188</td><td><div class=bar style=width:22.0%> &nbsp; </div> 5.2% </td></tr><tr class><td title=30>30</td><td>932</td><td><div class=bar style=width:17.3%> &nbsp; </div> 4.1% </td></tr><tr class><td title=21>21</td><td>843</td><td><div class=bar style=width:15.6%> &nbsp; </div> 3.7% </td></tr><tr class=other><td title="Other values (46)">Other values (46)</td><td>5397</td><td><div class=bar style=width:100.0%> 23.7% </div></td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=3648593978865241518bottom-3648593978865241518extreme_values><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#3648593978865241518extreme_values-3648593978865241518firstn aria-controls=3648593978865241518extreme_values-3648593978865241518firstn role=tab data-toggle=tab>Minimum 10 values</a></li><li role=presentation><a href=#3648593978865241518extreme_values-3648593978865241518lastn aria-controls=3648593978865241518extreme_values-3648593978865241518lastn role=tab data-toggle=tab>Maximum 10 values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=3648593978865241518extreme_values-3648593978865241518firstn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=20>20</td><td>14</td><td><div class=bar style=width:0.5%> &nbsp; </div> 0.1% </td></tr><tr class><td title=21>21</td><td>843</td><td><div class=bar style=width:30.8%> &nbsp; </div> 3.7% </td></tr><tr class><td title=22>22</td><td>2524</td><td><div class=bar style=width:92.2%> 11.1% </div></td></tr><tr class><td title=23>23</td><td>2738</td><td><div class=bar style=width:100.0%> 12.0% </div></td></tr><tr class><td title=24>24</td><td>2467</td><td><div class=bar style=width:90.1%> 10.8% </div></td></tr><tr class><td title=25>25</td><td>2159</td><td><div class=bar style=width:78.9%> 9.5% </div></td></tr><tr class><td title=26>26</td><td>1712</td><td><div class=bar style=width:62.5%> 7.5% </div></td></tr><tr class><td title=27>27</td><td>1524</td><td><div class=bar style=width:55.7%> 6.7% </div></td></tr><tr class><td title=28>28</td><td>1281</td><td><div class=bar style=width:46.8%> 5.6% </div></td></tr><tr class><td title=29>29</td><td>1188</td><td><div class=bar style=width:43.4%> 5.2% </div></td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=3648593978865241518extreme_values-3648593978865241518lastn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=144>144</td><td>2</td><td><div class=bar style=width:40.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=123>123</td><td>1</td><td><div class=bar style=width:20.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=94>94</td><td>1</td><td><div class=bar style=width:20.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=84>84</td><td>1</td><td><div class=bar style=width:20.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=78>78</td><td>1</td><td><div class=bar style=width:20.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=76>76</td><td>1</td><td><div class=bar style=width:20.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=73>73</td><td>2</td><td><div class=bar style=width:40.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=70>70</td><td>3</td><td><div class=bar style=width:60.0%>< 0.1% </div></td></tr><tr class><td title=69>69</td><td>4</td><td><div class=bar style=width:80.0%>< 0.1% </div></td></tr><tr class><td title=66>66</td><td>5</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr></tbody></table></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_-4229765111913678491></a><div class=variable><div class=col-sm-3><p class=h4 title=person_income><a href=#pp_var_-4229765111913678491>person_income</a><br><small>Real number (&Ropf;<sub>&ge;0</sub>)</small></p><code><abbr title="This variable has a high correlation with 1 fields: person_age">HIGH CORRELATION</abbr></code><br><code>SKEWED</code><br><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>3397</td></tr><tr><th>Distinct (%)</th><td>14.9%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Infinite</th><td>0</td></tr><tr><th>Infinite (%)</th><td>0.0%</td></tr><tr><th>Mean</th><td>66073.26945</td></tr></tbody></table></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>4000</td></tr><tr><th>Maximum</th><td>6000000</td></tr><tr><th>Zeros</th><td>0</td></tr><tr><th>Zeros (%)</th><td>0.0%</td></tr><tr><th>Negative</th><td>0</td></tr><tr><th>Negative (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>178.0 KiB</td></tr></tbody></table></div><div class=col-sm-3><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=162pt version=1.1 viewbox="0 0 216 162" width=216pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 162 \n", | |
| "L 216 162 \n", | |
| "L 216 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 10.8 115.212117 \n", | |
| "L 205.2 115.212117 \n", | |
| "L 205.2 10.8 \n", | |
| "L 10.8 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(19.279818 136.109616)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(78.228208 136.109616)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-50 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
| "L 12.890625 25.390625 \n", | |
| "L 37.796875 25.390625 \n", | |
| "z\n", | |
| "M 35.203125 72.90625 \n", | |
| "L 47.609375 72.90625 \n", | |
| "L 47.609375 25.390625 \n", | |
| "L 58.015625 25.390625 \n", | |
| "L 58.015625 17.1875 \n", | |
| "L 47.609375 17.1875 \n", | |
| "L 47.609375 0 \n", | |
| "L 37.796875 0 \n", | |
| "L 37.796875 17.1875 \n", | |
| "L 4.890625 17.1875 \n", | |
| "L 4.890625 26.703125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(137.176598 136.109616)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-52 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
| "Q 26.375 40.375 22.484375 35.828125 \n", | |
| "Q 18.609375 31.296875 18.609375 23.390625 \n", | |
| "Q 18.609375 15.53125 22.484375 10.953125 \n", | |
| "Q 26.375 6.390625 33.015625 6.390625 \n", | |
| "Q 39.65625 6.390625 43.53125 10.953125 \n", | |
| "Q 47.40625 15.53125 47.40625 23.390625 \n", | |
| "Q 47.40625 31.296875 43.53125 35.828125 \n", | |
| "Q 39.65625 40.375 33.015625 40.375 \n", | |
| "z\n", | |
| "M 52.59375 71.296875 \n", | |
| "L 52.59375 62.3125 \n", | |
| "Q 48.875 64.0625 45.09375 64.984375 \n", | |
| "Q 41.3125 65.921875 37.59375 65.921875 \n", | |
| "Q 27.828125 65.921875 22.671875 59.328125 \n", | |
| "Q 17.53125 52.734375 16.796875 39.40625 \n", | |
| "Q 19.671875 43.65625 24.015625 45.921875 \n", | |
| "Q 28.375 48.1875 33.59375 48.1875 \n", | |
| "Q 44.578125 48.1875 50.953125 41.515625 \n", | |
| "Q 57.328125 34.859375 57.328125 23.390625 \n", | |
| "Q 57.328125 12.15625 50.6875 5.359375 \n", | |
| "Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
| "Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
| "Q 6.984375 17.96875 6.984375 36.375 \n", | |
| "Q 6.984375 53.65625 15.1875 63.9375 \n", | |
| "Q 23.390625 74.21875 37.203125 74.21875 \n", | |
| "Q 40.921875 74.21875 44.703125 73.484375 \n", | |
| "Q 48.484375 72.75 52.59375 71.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(196.124988 136.109616)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-54 /></g></g></g><g id=text_5><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
| "L 56.203125 25.203125 \n", | |
| "L 14.890625 25.203125 \n", | |
| "Q 15.484375 15.921875 20.484375 11.0625 \n", | |
| "Q 25.484375 6.203125 34.421875 6.203125 \n", | |
| "Q 39.59375 6.203125 44.453125 7.46875 \n", | |
| "Q 49.3125 8.734375 54.109375 11.28125 \n", | |
| "L 54.109375 2.78125 \n", | |
| "Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
| "Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
| "Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
| "Q 5.515625 13.8125 5.515625 26.8125 \n", | |
| "Q 5.515625 40.234375 12.765625 48.109375 \n", | |
| "Q 20.015625 56 32.328125 56 \n", | |
| "Q 43.359375 56 49.78125 48.890625 \n", | |
| "Q 56.203125 41.796875 56.203125 29.59375 \n", | |
| "z\n", | |
| "M 47.21875 32.234375 \n", | |
| "Q 47.125 39.59375 43.09375 43.984375 \n", | |
| "Q 39.0625 48.390625 32.421875 48.390625 \n", | |
| "Q 24.90625 48.390625 20.390625 44.140625 \n", | |
| "Q 15.875 39.890625 15.1875 32.171875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(186.321875 147.884502)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-101 /><use x=125.146484 xlink:href=#DejaVuSans-54 /></g></g></g><g id=patch_3><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 19.636364 115.212117 \n", | |
| "L 23.170909 115.212117 \n", | |
| "L 23.170909 15.772006 \n", | |
| "L 19.636364 15.772006 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 23.170909 115.212117 \n", | |
| "L 26.705455 115.212117 \n", | |
| "L 26.705455 108.431895 \n", | |
| "L 23.170909 108.431895 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 26.705455 115.212117 \n", | |
| "L 30.24 115.212117 \n", | |
| "L 30.24 114.605143 \n", | |
| "L 26.705455 114.605143 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 30.24 115.212117 \n", | |
| "L 33.774545 115.212117 \n", | |
| "L 33.774545 115.094486 \n", | |
| "L 30.24 115.094486 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 33.774545 115.212117 \n", | |
| "L 37.309091 115.212117 \n", | |
| "L 37.309091 115.146244 \n", | |
| "L 33.774545 115.146244 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 37.309091 115.212117 \n", | |
| "L 40.843636 115.212117 \n", | |
| "L 40.843636 115.183885 \n", | |
| "L 37.309091 115.183885 \n", | |
| "z\n", | |
| ""/></g><g id=patch_9><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 40.843636 115.212117 \n", | |
| "L 44.378182 115.212117 \n", | |
| "L 44.378182 115.174475 \n", | |
| "L 40.843636 115.174475 \n", | |
| "z\n", | |
| ""/></g><g id=patch_10><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 44.378182 115.212117 \n", | |
| "L 47.912727 115.212117 \n", | |
| "L 47.912727 115.193296 \n", | |
| "L 44.378182 115.193296 \n", | |
| "z\n", | |
| ""/></g><g id=patch_11><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 47.912727 115.212117 \n", | |
| "L 51.447273 115.212117 \n", | |
| "L 51.447273 115.212117 \n", | |
| "L 47.912727 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_12><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 51.447273 115.212117 \n", | |
| "L 54.981818 115.212117 \n", | |
| "L 54.981818 115.212117 \n", | |
| "L 51.447273 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_13><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 54.981818 115.212117 \n", | |
| "L 58.516364 115.212117 \n", | |
| "L 58.516364 115.212117 \n", | |
| "L 54.981818 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_14><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 58.516364 115.212117 \n", | |
| "L 62.050909 115.212117 \n", | |
| "L 62.050909 115.207411 \n", | |
| "L 58.516364 115.207411 \n", | |
| "z\n", | |
| ""/></g><g id=patch_15><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 62.050909 115.212117 \n", | |
| "L 65.585455 115.212117 \n", | |
| "L 65.585455 115.212117 \n", | |
| "L 62.050909 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_16><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 65.585455 115.212117 \n", | |
| "L 69.12 115.212117 \n", | |
| "L 69.12 115.212117 \n", | |
| "L 65.585455 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_17><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 69.12 115.212117 \n", | |
| "L 72.654545 115.212117 \n", | |
| "L 72.654545 115.212117 \n", | |
| "L 69.12 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_18><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 72.654545 115.212117 \n", | |
| "L 76.189091 115.212117 \n", | |
| "L 76.189091 115.207411 \n", | |
| "L 72.654545 115.207411 \n", | |
| "z\n", | |
| ""/></g><g id=patch_19><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 76.189091 115.212117 \n", | |
| "L 79.723636 115.212117 \n", | |
| "L 79.723636 115.207411 \n", | |
| "L 76.189091 115.207411 \n", | |
| "z\n", | |
| ""/></g><g id=patch_20><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 79.723636 115.212117 \n", | |
| "L 83.258182 115.212117 \n", | |
| "L 83.258182 115.212117 \n", | |
| "L 79.723636 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_21><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 83.258182 115.212117 \n", | |
| "L 86.792727 115.212117 \n", | |
| "L 86.792727 115.212117 \n", | |
| "L 83.258182 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_22><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 86.792727 115.212117 \n", | |
| "L 90.327273 115.212117 \n", | |
| "L 90.327273 115.212117 \n", | |
| "L 86.792727 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_23><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 90.327273 115.212117 \n", | |
| "L 93.861818 115.212117 \n", | |
| "L 93.861818 115.212117 \n", | |
| "L 90.327273 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_24><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 93.861818 115.212117 \n", | |
| "L 97.396364 115.212117 \n", | |
| "L 97.396364 115.212117 \n", | |
| "L 93.861818 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_25><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 97.396364 115.212117 \n", | |
| "L 100.930909 115.212117 \n", | |
| "L 100.930909 115.212117 \n", | |
| "L 97.396364 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_26><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 100.930909 115.212117 \n", | |
| "L 104.465455 115.212117 \n", | |
| "L 104.465455 115.212117 \n", | |
| "L 100.930909 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_27><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 104.465455 115.212117 \n", | |
| "L 108 115.212117 \n", | |
| "L 108 115.212117 \n", | |
| "L 104.465455 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_28><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 108 115.212117 \n", | |
| "L 111.534545 115.212117 \n", | |
| "L 111.534545 115.212117 \n", | |
| "L 108 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_29><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 111.534545 115.212117 \n", | |
| "L 115.069091 115.212117 \n", | |
| "L 115.069091 115.212117 \n", | |
| "L 111.534545 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_30><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 115.069091 115.212117 \n", | |
| "L 118.603636 115.212117 \n", | |
| "L 118.603636 115.212117 \n", | |
| "L 115.069091 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_31><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 118.603636 115.212117 \n", | |
| "L 122.138182 115.212117 \n", | |
| "L 122.138182 115.212117 \n", | |
| "L 118.603636 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_32><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 122.138182 115.212117 \n", | |
| "L 125.672727 115.212117 \n", | |
| "L 125.672727 115.212117 \n", | |
| "L 122.138182 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_33><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 125.672727 115.212117 \n", | |
| "L 129.207273 115.212117 \n", | |
| "L 129.207273 115.212117 \n", | |
| "L 125.672727 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_34><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 129.207273 115.212117 \n", | |
| "L 132.741818 115.212117 \n", | |
| "L 132.741818 115.212117 \n", | |
| "L 129.207273 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_35><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 132.741818 115.212117 \n", | |
| "L 136.276364 115.212117 \n", | |
| "L 136.276364 115.212117 \n", | |
| "L 132.741818 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_36><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 136.276364 115.212117 \n", | |
| "L 139.810909 115.212117 \n", | |
| "L 139.810909 115.212117 \n", | |
| "L 136.276364 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_37><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 139.810909 115.212117 \n", | |
| "L 143.345455 115.212117 \n", | |
| "L 143.345455 115.212117 \n", | |
| "L 139.810909 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_38><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 143.345455 115.212117 \n", | |
| "L 146.88 115.212117 \n", | |
| "L 146.88 115.212117 \n", | |
| "L 143.345455 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_39><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 146.88 115.212117 \n", | |
| "L 150.414545 115.212117 \n", | |
| "L 150.414545 115.212117 \n", | |
| "L 146.88 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_40><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 150.414545 115.212117 \n", | |
| "L 153.949091 115.212117 \n", | |
| "L 153.949091 115.212117 \n", | |
| "L 150.414545 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_41><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 153.949091 115.212117 \n", | |
| "L 157.483636 115.212117 \n", | |
| "L 157.483636 115.212117 \n", | |
| "L 153.949091 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_42><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 157.483636 115.212117 \n", | |
| "L 161.018182 115.212117 \n", | |
| "L 161.018182 115.212117 \n", | |
| "L 157.483636 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_43><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 161.018182 115.212117 \n", | |
| "L 164.552727 115.212117 \n", | |
| "L 164.552727 115.212117 \n", | |
| "L 161.018182 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_44><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 164.552727 115.212117 \n", | |
| "L 168.087273 115.212117 \n", | |
| "L 168.087273 115.212117 \n", | |
| "L 164.552727 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_45><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 168.087273 115.212117 \n", | |
| "L 171.621818 115.212117 \n", | |
| "L 171.621818 115.212117 \n", | |
| "L 168.087273 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_46><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 171.621818 115.212117 \n", | |
| "L 175.156364 115.212117 \n", | |
| "L 175.156364 115.212117 \n", | |
| "L 171.621818 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_47><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 175.156364 115.212117 \n", | |
| "L 178.690909 115.212117 \n", | |
| "L 178.690909 115.212117 \n", | |
| "L 175.156364 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_48><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 178.690909 115.212117 \n", | |
| "L 182.225455 115.212117 \n", | |
| "L 182.225455 115.212117 \n", | |
| "L 178.690909 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_49><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 182.225455 115.212117 \n", | |
| "L 185.76 115.212117 \n", | |
| "L 185.76 115.212117 \n", | |
| "L 182.225455 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_50><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 185.76 115.212117 \n", | |
| "L 189.294545 115.212117 \n", | |
| "L 189.294545 115.212117 \n", | |
| "L 185.76 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_51><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 189.294545 115.212117 \n", | |
| "L 192.829091 115.212117 \n", | |
| "L 192.829091 115.212117 \n", | |
| "L 189.294545 115.212117 \n", | |
| "z\n", | |
| ""/></g><g id=patch_52><path clip-path=url(#pb00696ace2) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 192.829091 115.212117 \n", | |
| "L 196.363636 115.212117 \n", | |
| "L 196.363636 115.207411 \n", | |
| "L 192.829091 115.207411 \n", | |
| "z\n", | |
| ""/></g><g id=patch_53><path style=fill:none; d="M 10.8 115.212117 \n", | |
| "L 10.8 10.8 \n", | |
| ""/></g><g id=patch_54><path style=fill:none; d="M 205.2 115.212117 \n", | |
| "L 205.2 10.8 \n", | |
| ""/></g><g id=patch_55><path style=fill:none; d="M 10.8 115.212117 \n", | |
| "L 205.2 115.212117 \n", | |
| ""/></g><g id=patch_56><path style=fill:none; d="M 10.8 10.8 \n", | |
| "L 205.2 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=pb00696ace2><rect height=104.412117 width=194.4 x=10.8 y=10.8 /></clippath></defs></svg></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom--4229765111913678491, #minifreqtable-4229765111913678491" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom--4229765111913678491 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-4229765111913678491bottom--4229765111913678491statistics aria-controls=-4229765111913678491bottom--4229765111913678491statistics role=tab data-toggle=tab>Statistics</a></li><li role=presentation><a href=#-4229765111913678491bottom--4229765111913678491histogram aria-controls=-4229765111913678491bottom--4229765111913678491histogram role=tab data-toggle=tab>Histogram</a></li><li role=presentation><a href=#-4229765111913678491bottom--4229765111913678491common_values aria-controls=-4229765111913678491bottom--4229765111913678491common_values role=tab data-toggle=tab>Common values</a></li><li role=presentation><a href=#-4229765111913678491bottom--4229765111913678491extreme_values aria-controls=-4229765111913678491bottom--4229765111913678491extreme_values role=tab data-toggle=tab>Extreme values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-4229765111913678491bottom--4229765111913678491statistics><div class=col-sm-6><p class=h4>Quantile statistics</p><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>4000</td></tr><tr><th>5-th percentile</th><td>22884</td></tr><tr><th>Q1</th><td>38400</td></tr><tr><th>median</th><td>55000</td></tr><tr><th>Q3</th><td>79400</td></tr><tr><th>95-th percentile</th><td>140000</td></tr><tr><th>Maximum</th><td>6000000</td></tr><tr><th>Range</th><td>5996000</td></tr><tr><th>Interquartile range (IQR)</th><td>41000</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Descriptive statistics</p><table class="table table-condensed stats"><tbody><tr><th>Standard deviation</th><td>64318.0276</td></tr><tr><th>Coefficient of variation (CV)</th><td>0.9734349176</td></tr><tr><th>Kurtosis</th><td>3272.438494</td></tr><tr><th>Mean</th><td>66073.26945</td></tr><tr><th>Median Absolute Deviation (MAD)</th><td>19500</td></tr><tr><th>Skewness</th><td>39.11051507</td></tr><tr><th>Sum</th><td>1504157979</td></tr><tr><th>Variance</th><td>4136808674</td></tr><tr><th>Monotonicity</th><td>Not monotonic</td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-4229765111913678491bottom--4229765111913678491histogram><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
| "L 432 288 \n", | |
| "L 432 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 69.425 239.621126 \n", | |
| "L 421.2 239.621126 \n", | |
| "L 421.2 10.8 \n", | |
| "L 69.425 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(84.903123 262.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(138.237922 262.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(191.572721 262.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
| "Q 47.65625 37.796875 51.625 33 \n", | |
| "Q 55.609375 28.21875 55.609375 21.1875 \n", | |
| "Q 55.609375 10.40625 48.1875 4.484375 \n", | |
| "Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
| "Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
| "Q 12.796875 0.390625 7.625 2.203125 \n", | |
| "L 7.625 11.71875 \n", | |
| "Q 11.71875 9.328125 16.59375 8.109375 \n", | |
| "Q 21.484375 6.890625 26.8125 6.890625 \n", | |
| "Q 36.078125 6.890625 40.9375 10.546875 \n", | |
| "Q 45.796875 14.203125 45.796875 21.1875 \n", | |
| "Q 45.796875 27.640625 41.28125 31.265625 \n", | |
| "Q 36.765625 34.90625 28.71875 34.90625 \n", | |
| "L 20.21875 34.90625 \n", | |
| "L 20.21875 43.015625 \n", | |
| "L 29.109375 43.015625 \n", | |
| "Q 36.375 43.015625 40.234375 45.921875 \n", | |
| "Q 44.09375 48.828125 44.09375 54.296875 \n", | |
| "Q 44.09375 59.90625 40.109375 62.90625 \n", | |
| "Q 36.140625 65.921875 28.71875 65.921875 \n", | |
| "Q 24.65625 65.921875 20.015625 65.03125 \n", | |
| "Q 15.375 64.15625 9.8125 62.3125 \n", | |
| "L 9.8125 71.09375 \n", | |
| "Q 15.4375 72.65625 20.34375 73.4375 \n", | |
| "Q 25.25 74.21875 29.59375 74.21875 \n", | |
| "Q 40.828125 74.21875 47.359375 69.109375 \n", | |
| "Q 53.90625 64.015625 53.90625 55.328125 \n", | |
| "Q 53.90625 49.265625 50.4375 45.09375 \n", | |
| "Q 46.96875 40.921875 40.578125 39.3125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(244.90752 262.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-51 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
| "L 12.890625 25.390625 \n", | |
| "L 37.796875 25.390625 \n", | |
| "z\n", | |
| "M 35.203125 72.90625 \n", | |
| "L 47.609375 72.90625 \n", | |
| "L 47.609375 25.390625 \n", | |
| "L 58.015625 25.390625 \n", | |
| "L 58.015625 17.1875 \n", | |
| "L 47.609375 17.1875 \n", | |
| "L 47.609375 0 \n", | |
| "L 37.796875 0 \n", | |
| "L 37.796875 17.1875 \n", | |
| "L 4.890625 17.1875 \n", | |
| "L 4.890625 26.703125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(298.242319 262.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /></g></g></g><g id=xtick_6><g id=text_6><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
| "L 49.515625 72.90625 \n", | |
| "L 49.515625 64.59375 \n", | |
| "L 19.828125 64.59375 \n", | |
| "L 19.828125 46.734375 \n", | |
| "Q 21.96875 47.46875 24.109375 47.828125 \n", | |
| "Q 26.265625 48.1875 28.421875 48.1875 \n", | |
| "Q 40.625 48.1875 47.75 41.5 \n", | |
| "Q 54.890625 34.8125 54.890625 23.390625 \n", | |
| "Q 54.890625 11.625 47.5625 5.09375 \n", | |
| "Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
| "Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
| "Q 12.796875 0.140625 7.71875 1.703125 \n", | |
| "L 7.71875 11.625 \n", | |
| "Q 12.109375 9.234375 16.796875 8.0625 \n", | |
| "Q 21.484375 6.890625 26.703125 6.890625 \n", | |
| "Q 35.15625 6.890625 40.078125 11.328125 \n", | |
| "Q 45.015625 15.765625 45.015625 23.390625 \n", | |
| "Q 45.015625 31 40.078125 35.4375 \n", | |
| "Q 35.15625 39.890625 26.703125 39.890625 \n", | |
| "Q 22.75 39.890625 18.8125 39.015625 \n", | |
| "Q 14.890625 38.140625 10.796875 36.28125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(351.577118 262.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_7><g id=text_7><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
| "Q 26.375 40.375 22.484375 35.828125 \n", | |
| "Q 18.609375 31.296875 18.609375 23.390625 \n", | |
| "Q 18.609375 15.53125 22.484375 10.953125 \n", | |
| "Q 26.375 6.390625 33.015625 6.390625 \n", | |
| "Q 39.65625 6.390625 43.53125 10.953125 \n", | |
| "Q 47.40625 15.53125 47.40625 23.390625 \n", | |
| "Q 47.40625 31.296875 43.53125 35.828125 \n", | |
| "Q 39.65625 40.375 33.015625 40.375 \n", | |
| "z\n", | |
| "M 52.59375 71.296875 \n", | |
| "L 52.59375 62.3125 \n", | |
| "Q 48.875 64.0625 45.09375 64.984375 \n", | |
| "Q 41.3125 65.921875 37.59375 65.921875 \n", | |
| "Q 27.828125 65.921875 22.671875 59.328125 \n", | |
| "Q 17.53125 52.734375 16.796875 39.40625 \n", | |
| "Q 19.671875 43.65625 24.015625 45.921875 \n", | |
| "Q 28.375 48.1875 33.59375 48.1875 \n", | |
| "Q 44.578125 48.1875 50.953125 41.515625 \n", | |
| "Q 57.328125 34.859375 57.328125 23.390625 \n", | |
| "Q 57.328125 12.15625 50.6875 5.359375 \n", | |
| "Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
| "Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
| "Q 6.984375 17.96875 6.984375 36.375 \n", | |
| "Q 6.984375 53.65625 15.1875 63.9375 \n", | |
| "Q 23.390625 74.21875 37.203125 74.21875 \n", | |
| "Q 40.921875 74.21875 44.703125 73.484375 \n", | |
| "Q 48.484375 72.75 52.59375 71.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(404.911917 262.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-54 /></g></g></g><g id=text_8><defs><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
| "L 56.203125 25.203125 \n", | |
| "L 14.890625 25.203125 \n", | |
| "Q 15.484375 15.921875 20.484375 11.0625 \n", | |
| "Q 25.484375 6.203125 34.421875 6.203125 \n", | |
| "Q 39.59375 6.203125 44.453125 7.46875 \n", | |
| "Q 49.3125 8.734375 54.109375 11.28125 \n", | |
| "L 54.109375 2.78125 \n", | |
| "Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
| "Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
| "Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
| "Q 5.515625 13.8125 5.515625 26.8125 \n", | |
| "Q 5.515625 40.234375 12.765625 48.109375 \n", | |
| "Q 20.015625 56 32.328125 56 \n", | |
| "Q 43.359375 56 49.78125 48.890625 \n", | |
| "Q 56.203125 41.796875 56.203125 29.59375 \n", | |
| "z\n", | |
| "M 47.21875 32.234375 \n", | |
| "Q 47.125 39.59375 43.09375 43.984375 \n", | |
| "Q 39.0625 48.390625 32.421875 48.390625 \n", | |
| "Q 24.90625 48.390625 20.390625 44.140625 \n", | |
| "Q 15.875 39.890625 15.1875 32.171875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(402.321875 274.561999)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-101 /><use x=125.146484 xlink:href=#DejaVuSans-54 /></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_9><g style=fill:#262626; transform="translate(50.0625 243.420345)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_10><g style=fill:#262626; transform="translate(30.975 217.641401)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_3><g id=text_11><g style=fill:#262626; transform="translate(30.975 191.862457)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_12><defs><path id=DejaVuSans-55 d="M 8.203125 72.90625 \n", | |
| "L 55.078125 72.90625 \n", | |
| "L 55.078125 68.703125 \n", | |
| "L 28.609375 0 \n", | |
| "L 18.3125 0 \n", | |
| "L 43.21875 64.59375 \n", | |
| "L 8.203125 64.59375 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(30.975 166.083513)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-55 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_5><g id=text_13><g style=fill:#262626; transform="translate(24.6125 140.304569)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_6><g id=text_14><g style=fill:#262626; transform="translate(24.6125 114.525624)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-50 /><use x=127.246094 xlink:href=#DejaVuSans-53 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_7><g id=text_15><g style=fill:#262626; transform="translate(24.6125 88.74668)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_8><g id=text_16><g style=fill:#262626; transform="translate(24.6125 62.967736)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-55 /><use x=127.246094 xlink:href=#DejaVuSans-53 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_9><g id=text_17><g style=fill:#262626; transform="translate(24.6125 37.188792)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_18><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
| "L 51.703125 72.90625 \n", | |
| "L 51.703125 64.59375 \n", | |
| "L 19.671875 64.59375 \n", | |
| "L 19.671875 43.109375 \n", | |
| "L 48.578125 43.109375 \n", | |
| "L 48.578125 34.8125 \n", | |
| "L 19.671875 34.8125 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
| "Q 39.59375 47.171875 37.8125 47.578125 \n", | |
| "Q 36.03125 48 33.890625 48 \n", | |
| "Q 26.265625 48 22.1875 43.046875 \n", | |
| "Q 18.109375 38.09375 18.109375 28.8125 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 20.953125 51.171875 25.484375 53.578125 \n", | |
| "Q 30.03125 56 36.53125 56 \n", | |
| "Q 37.453125 56 38.578125 55.875 \n", | |
| "Q 39.703125 55.765625 41.0625 55.515625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
| "Q 14.796875 17.390625 18.875 11.75 \n", | |
| "Q 22.953125 6.109375 30.078125 6.109375 \n", | |
| "Q 37.203125 6.109375 41.296875 11.75 \n", | |
| "Q 45.40625 17.390625 45.40625 27.296875 \n", | |
| "Q 45.40625 37.203125 41.296875 42.84375 \n", | |
| "Q 37.203125 48.484375 30.078125 48.484375 \n", | |
| "Q 22.953125 48.484375 18.875 42.84375 \n", | |
| "Q 14.796875 37.203125 14.796875 27.296875 \n", | |
| "z\n", | |
| "M 45.40625 8.203125 \n", | |
| "Q 42.578125 3.328125 38.25 0.953125 \n", | |
| "Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
| "Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
| "Q 5.515625 14.40625 5.515625 27.296875 \n", | |
| "Q 5.515625 40.1875 11.734375 48.09375 \n", | |
| "Q 17.96875 56 27.875 56 \n", | |
| "Q 33.9375 56 38.25 53.625 \n", | |
| "Q 42.578125 51.265625 45.40625 46.390625 \n", | |
| "L 45.40625 54.6875 \n", | |
| "L 54.390625 54.6875 \n", | |
| "L 54.390625 -20.796875 \n", | |
| "L 45.40625 -20.796875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
| "L 8.5 54.6875 \n", | |
| "L 17.484375 54.6875 \n", | |
| "L 17.484375 21.921875 \n", | |
| "Q 17.484375 14.15625 20.5 10.265625 \n", | |
| "Q 23.53125 6.390625 29.59375 6.390625 \n", | |
| "Q 36.859375 6.390625 41.078125 11.03125 \n", | |
| "Q 45.3125 15.671875 45.3125 23.6875 \n", | |
| "L 45.3125 54.6875 \n", | |
| "L 54.296875 54.6875 \n", | |
| "L 54.296875 0 \n", | |
| "L 45.3125 0 \n", | |
| "L 45.3125 8.40625 \n", | |
| "Q 42.046875 3.421875 37.71875 1 \n", | |
| "Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
| "Q 18.265625 -1.421875 13.375 4.4375 \n", | |
| "Q 8.5 10.296875 8.5 21.578125 \n", | |
| "z\n", | |
| "M 31.109375 56 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
| "L 54.890625 0 \n", | |
| "L 45.90625 0 \n", | |
| "L 45.90625 32.71875 \n", | |
| "Q 45.90625 40.484375 42.875 44.328125 \n", | |
| "Q 39.84375 48.1875 33.796875 48.1875 \n", | |
| "Q 26.515625 48.1875 22.3125 43.546875 \n", | |
| "Q 18.109375 38.921875 18.109375 30.90625 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 21.34375 51.125 25.703125 53.5625 \n", | |
| "Q 30.078125 56 35.796875 56 \n", | |
| "Q 45.21875 56 50.046875 50.171875 \n", | |
| "Q 54.890625 44.34375 54.890625 33.015625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
| "L 48.78125 44.1875 \n", | |
| "Q 44.96875 46.296875 41.140625 47.34375 \n", | |
| "Q 37.3125 48.390625 33.40625 48.390625 \n", | |
| "Q 24.65625 48.390625 19.8125 42.84375 \n", | |
| "Q 14.984375 37.3125 14.984375 27.296875 \n", | |
| "Q 14.984375 17.28125 19.8125 11.734375 \n", | |
| "Q 24.65625 6.203125 33.40625 6.203125 \n", | |
| "Q 37.3125 6.203125 41.140625 7.25 \n", | |
| "Q 44.96875 8.296875 48.78125 10.40625 \n", | |
| "L 48.78125 2.09375 \n", | |
| "Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
| "Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
| "Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
| "Q 5.515625 14.109375 5.515625 27.296875 \n", | |
| "Q 5.515625 40.671875 12.859375 48.328125 \n", | |
| "Q 20.21875 56 33.015625 56 \n", | |
| "Q 37.15625 56 41.109375 55.140625 \n", | |
| "Q 45.0625 54.296875 48.78125 52.59375 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
| "Q 28.375 -14.84375 24.75 -17.8125 \n", | |
| "Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
| "L 7.90625 -20.796875 \n", | |
| "L 7.90625 -13.28125 \n", | |
| "L 13.1875 -13.28125 \n", | |
| "Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
| "Q 21 -9.765625 23.484375 -3.21875 \n", | |
| "L 25.09375 0.875 \n", | |
| "L 2.984375 54.6875 \n", | |
| "L 12.5 54.6875 \n", | |
| "L 29.59375 11.921875 \n", | |
| "L 46.6875 54.6875 \n", | |
| "L 56.203125 54.6875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(18.324844 153.623219)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 85.414773 239.621126 \n", | |
| "L 91.810682 239.621126 \n", | |
| "L 91.810682 21.696244 \n", | |
| "L 85.414773 21.696244 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 91.810682 239.621126 \n", | |
| "L 98.206591 239.621126 \n", | |
| "L 98.206591 224.762143 \n", | |
| "L 91.810682 224.762143 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 98.206591 239.621126 \n", | |
| "L 104.6025 239.621126 \n", | |
| "L 104.6025 238.290933 \n", | |
| "L 98.206591 238.290933 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 104.6025 239.621126 \n", | |
| "L 110.998409 239.621126 \n", | |
| "L 110.998409 239.363337 \n", | |
| "L 104.6025 239.363337 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 110.998409 239.621126 \n", | |
| "L 117.394318 239.621126 \n", | |
| "L 117.394318 239.476764 \n", | |
| "L 110.998409 239.476764 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 117.394318 239.621126 \n", | |
| "L 123.790227 239.621126 \n", | |
| "L 123.790227 239.559257 \n", | |
| "L 117.394318 239.559257 \n", | |
| "z\n", | |
| ""/></g><g id=patch_9><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 123.790227 239.621126 \n", | |
| "L 130.186136 239.621126 \n", | |
| "L 130.186136 239.538634 \n", | |
| "L 123.790227 239.538634 \n", | |
| "z\n", | |
| ""/></g><g id=patch_10><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 130.186136 239.621126 \n", | |
| "L 136.582045 239.621126 \n", | |
| "L 136.582045 239.57988 \n", | |
| "L 130.186136 239.57988 \n", | |
| "z\n", | |
| ""/></g><g id=patch_11><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 136.582045 239.621126 \n", | |
| "L 142.977955 239.621126 \n", | |
| "L 142.977955 239.621126 \n", | |
| "L 136.582045 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_12><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 142.977955 239.621126 \n", | |
| "L 149.373864 239.621126 \n", | |
| "L 149.373864 239.621126 \n", | |
| "L 142.977955 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_13><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 149.373864 239.621126 \n", | |
| "L 155.769773 239.621126 \n", | |
| "L 155.769773 239.621126 \n", | |
| "L 149.373864 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_14><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 155.769773 239.621126 \n", | |
| "L 162.165682 239.621126 \n", | |
| "L 162.165682 239.610815 \n", | |
| "L 155.769773 239.610815 \n", | |
| "z\n", | |
| ""/></g><g id=patch_15><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 162.165682 239.621126 \n", | |
| "L 168.561591 239.621126 \n", | |
| "L 168.561591 239.621126 \n", | |
| "L 162.165682 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_16><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 168.561591 239.621126 \n", | |
| "L 174.9575 239.621126 \n", | |
| "L 174.9575 239.621126 \n", | |
| "L 168.561591 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_17><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 174.9575 239.621126 \n", | |
| "L 181.353409 239.621126 \n", | |
| "L 181.353409 239.621126 \n", | |
| "L 174.9575 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_18><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 181.353409 239.621126 \n", | |
| "L 187.749318 239.621126 \n", | |
| "L 187.749318 239.610815 \n", | |
| "L 181.353409 239.610815 \n", | |
| "z\n", | |
| ""/></g><g id=patch_19><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 187.749318 239.621126 \n", | |
| "L 194.145227 239.621126 \n", | |
| "L 194.145227 239.610815 \n", | |
| "L 187.749318 239.610815 \n", | |
| "z\n", | |
| ""/></g><g id=patch_20><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 194.145227 239.621126 \n", | |
| "L 200.541136 239.621126 \n", | |
| "L 200.541136 239.621126 \n", | |
| "L 194.145227 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_21><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 200.541136 239.621126 \n", | |
| "L 206.937045 239.621126 \n", | |
| "L 206.937045 239.621126 \n", | |
| "L 200.541136 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_22><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 206.937045 239.621126 \n", | |
| "L 213.332955 239.621126 \n", | |
| "L 213.332955 239.621126 \n", | |
| "L 206.937045 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_23><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 213.332955 239.621126 \n", | |
| "L 219.728864 239.621126 \n", | |
| "L 219.728864 239.621126 \n", | |
| "L 213.332955 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_24><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 219.728864 239.621126 \n", | |
| "L 226.124773 239.621126 \n", | |
| "L 226.124773 239.621126 \n", | |
| "L 219.728864 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_25><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 226.124773 239.621126 \n", | |
| "L 232.520682 239.621126 \n", | |
| "L 232.520682 239.621126 \n", | |
| "L 226.124773 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_26><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 232.520682 239.621126 \n", | |
| "L 238.916591 239.621126 \n", | |
| "L 238.916591 239.621126 \n", | |
| "L 232.520682 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_27><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 238.916591 239.621126 \n", | |
| "L 245.3125 239.621126 \n", | |
| "L 245.3125 239.621126 \n", | |
| "L 238.916591 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_28><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 245.3125 239.621126 \n", | |
| "L 251.708409 239.621126 \n", | |
| "L 251.708409 239.621126 \n", | |
| "L 245.3125 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_29><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 251.708409 239.621126 \n", | |
| "L 258.104318 239.621126 \n", | |
| "L 258.104318 239.621126 \n", | |
| "L 251.708409 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_30><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 258.104318 239.621126 \n", | |
| "L 264.500227 239.621126 \n", | |
| "L 264.500227 239.621126 \n", | |
| "L 258.104318 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_31><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 264.500227 239.621126 \n", | |
| "L 270.896136 239.621126 \n", | |
| "L 270.896136 239.621126 \n", | |
| "L 264.500227 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_32><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 270.896136 239.621126 \n", | |
| "L 277.292045 239.621126 \n", | |
| "L 277.292045 239.621126 \n", | |
| "L 270.896136 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_33><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 277.292045 239.621126 \n", | |
| "L 283.687955 239.621126 \n", | |
| "L 283.687955 239.621126 \n", | |
| "L 277.292045 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_34><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 283.687955 239.621126 \n", | |
| "L 290.083864 239.621126 \n", | |
| "L 290.083864 239.621126 \n", | |
| "L 283.687955 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_35><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 290.083864 239.621126 \n", | |
| "L 296.479773 239.621126 \n", | |
| "L 296.479773 239.621126 \n", | |
| "L 290.083864 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_36><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 296.479773 239.621126 \n", | |
| "L 302.875682 239.621126 \n", | |
| "L 302.875682 239.621126 \n", | |
| "L 296.479773 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_37><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 302.875682 239.621126 \n", | |
| "L 309.271591 239.621126 \n", | |
| "L 309.271591 239.621126 \n", | |
| "L 302.875682 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_38><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 309.271591 239.621126 \n", | |
| "L 315.6675 239.621126 \n", | |
| "L 315.6675 239.621126 \n", | |
| "L 309.271591 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_39><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 315.6675 239.621126 \n", | |
| "L 322.063409 239.621126 \n", | |
| "L 322.063409 239.621126 \n", | |
| "L 315.6675 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_40><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 322.063409 239.621126 \n", | |
| "L 328.459318 239.621126 \n", | |
| "L 328.459318 239.621126 \n", | |
| "L 322.063409 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_41><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 328.459318 239.621126 \n", | |
| "L 334.855227 239.621126 \n", | |
| "L 334.855227 239.621126 \n", | |
| "L 328.459318 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_42><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 334.855227 239.621126 \n", | |
| "L 341.251136 239.621126 \n", | |
| "L 341.251136 239.621126 \n", | |
| "L 334.855227 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_43><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 341.251136 239.621126 \n", | |
| "L 347.647045 239.621126 \n", | |
| "L 347.647045 239.621126 \n", | |
| "L 341.251136 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_44><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 347.647045 239.621126 \n", | |
| "L 354.042955 239.621126 \n", | |
| "L 354.042955 239.621126 \n", | |
| "L 347.647045 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_45><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 354.042955 239.621126 \n", | |
| "L 360.438864 239.621126 \n", | |
| "L 360.438864 239.621126 \n", | |
| "L 354.042955 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_46><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 360.438864 239.621126 \n", | |
| "L 366.834773 239.621126 \n", | |
| "L 366.834773 239.621126 \n", | |
| "L 360.438864 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_47><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 366.834773 239.621126 \n", | |
| "L 373.230682 239.621126 \n", | |
| "L 373.230682 239.621126 \n", | |
| "L 366.834773 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_48><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 373.230682 239.621126 \n", | |
| "L 379.626591 239.621126 \n", | |
| "L 379.626591 239.621126 \n", | |
| "L 373.230682 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_49><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 379.626591 239.621126 \n", | |
| "L 386.0225 239.621126 \n", | |
| "L 386.0225 239.621126 \n", | |
| "L 379.626591 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_50><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 386.0225 239.621126 \n", | |
| "L 392.418409 239.621126 \n", | |
| "L 392.418409 239.621126 \n", | |
| "L 386.0225 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_51><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 392.418409 239.621126 \n", | |
| "L 398.814318 239.621126 \n", | |
| "L 398.814318 239.621126 \n", | |
| "L 392.418409 239.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_52><path clip-path=url(#p01c113408c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 398.814318 239.621126 \n", | |
| "L 405.210227 239.621126 \n", | |
| "L 405.210227 239.610815 \n", | |
| "L 398.814318 239.610815 \n", | |
| "z\n", | |
| ""/></g><g id=patch_53><path style=fill:none; d="M 69.425 239.621126 \n", | |
| "L 69.425 10.8 \n", | |
| ""/></g><g id=patch_54><path style=fill:none; d="M 421.2 239.621126 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g><g id=patch_55><path style=fill:none; d="M 69.425 239.621126 \n", | |
| "L 421.2 239.621126 \n", | |
| ""/></g><g id=patch_56><path style=fill:none; d="M 69.425 10.8 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=p01c113408c><rect height=228.821126 width=351.775 x=69.425 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"><strong>Histogram with fixed size bins</strong> (bins=50) </div></div><div role=tabpanel class="tab-pane col-sm-12" id=-4229765111913678491bottom--4229765111913678491common_values><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=60000>60000</td><td>719</td><td><div class=bar style=width:4.0%> &nbsp; </div> 3.2% </td></tr><tr class><td title=30000>30000</td><td>598</td><td><div class=bar style=width:3.3%> &nbsp; </div> 2.6% </td></tr><tr class><td title=50000>50000</td><td>560</td><td><div class=bar style=width:3.1%> &nbsp; </div> 2.5% </td></tr><tr class><td title=40000>40000</td><td>456</td><td><div class=bar style=width:2.5%> &nbsp; </div> 2.0% </td></tr><tr class><td title=75000>75000</td><td>418</td><td><div class=bar style=width:2.3%> &nbsp; </div> 1.8% </td></tr><tr class><td title=45000>45000</td><td>409</td><td><div class=bar style=width:2.3%> &nbsp; </div> 1.8% </td></tr><tr class><td title=65000>65000</td><td>388</td><td><div class=bar style=width:2.1%> &nbsp; </div> 1.7% </td></tr><tr class><td title=36000>36000</td><td>374</td><td><div class=bar style=width:2.1%> &nbsp; </div> 1.6% </td></tr><tr class><td title=48000>48000</td><td>369</td><td><div class=bar style=width:2.0%> &nbsp; </div> 1.6% </td></tr><tr class><td title=70000>70000</td><td>367</td><td><div class=bar style=width:2.0%> &nbsp; </div> 1.6% </td></tr><tr class=other><td title="Other values (3387)">Other values (3387)</td><td>18107</td><td><div class=bar style=width:100.0%> 79.5% </div></td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=-4229765111913678491bottom--4229765111913678491extreme_values><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-4229765111913678491extreme_values--4229765111913678491firstn aria-controls=-4229765111913678491extreme_values--4229765111913678491firstn role=tab data-toggle=tab>Minimum 10 values</a></li><li role=presentation><a href=#-4229765111913678491extreme_values--4229765111913678491lastn aria-controls=-4229765111913678491extreme_values--4229765111913678491lastn role=tab data-toggle=tab>Maximum 10 values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-4229765111913678491extreme_values--4229765111913678491firstn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=4000>4000</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=4200>4200</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=4800>4800</td><td>3</td><td><div class=bar style=width:75.0%>< 0.1% </div></td></tr><tr class><td title=4888>4888</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=5000>5000</td><td>2</td><td><div class=bar style=width:50.0%>< 0.1% </div></td></tr><tr class><td title=5500>5500</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=6000>6000</td><td>4</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=7000>7000</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=7200>7200</td><td>3</td><td><div class=bar style=width:75.0%>< 0.1% </div></td></tr><tr class><td title=7500>7500</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=-4229765111913678491extreme_values--4229765111913678491lastn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=6000000>6000000</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=2039784>2039784</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=1900000>1900000</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=1362000>1362000</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=948000>948000</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=900000>900000</td><td>3</td><td><div class=bar style=width:75.0%>< 0.1% </div></td></tr><tr class><td title=800000>800000</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=780000>780000</td><td>4</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=762000>762000</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=750000>750000</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr></tbody></table></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_5975278964108887654></a><div class=variable><div class=col-sm-3><p class=h4 title=person_home_ownership><a href=#pp_var_5975278964108887654>person_home_ownership</a><br><small>Categorical</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>4</td></tr><tr><th>Distinct (%)</th><td>< 0.1%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>178.0 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> RENT </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 11471&nbsp; </div></td></tr><tr class><th width=50%> MORTGAGE </th><td width=50%><div class=bar style=width:81.8% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 9387&nbsp; </div></td></tr><tr class><th width=50%> OWN </th><td width=50%><div class=bar style=width:16.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 1831&nbsp; </div></td></tr><tr class><th width=50%> OTHER </th><td width=50%><div class=bar style=width:0.7% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 76 </td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-5975278964108887654, #minifreqtable5975278964108887654" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-5975278964108887654 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#5975278964108887654bottom-5975278964108887654overview aria-controls=5975278964108887654bottom-5975278964108887654overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#5975278964108887654bottom-5975278964108887654string aria-controls=5975278964108887654bottom-5975278964108887654string role=tab data-toggle=tab>Categories</a></li><li role=presentation><a href=#5975278964108887654bottom-5975278964108887654word aria-controls=5975278964108887654bottom-5975278964108887654word role=tab data-toggle=tab>Words</a></li><li role=presentation><a href=#5975278964108887654bottom-5975278964108887654characters aria-controls=5975278964108887654bottom-5975278964108887654characters role=tab data-toggle=tab>Characters</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=5975278964108887654bottom-5975278964108887654overview><div class=row><div class=col-sm-3><p class=h4>Length</p><table class="table table-condensed stats"><tbody><tr><th>Max length</th><td>8</td></tr><tr><th>Median length</th><td>4</td></tr><tr><th>Mean length</th><td>5.572282012</td></tr><tr><th>Min length</th><td>3</td></tr></tbody></table></div><div class=col-sm-3><p class=h4>Characters and Unicode</p><table class="table table-condensed stats"><tbody><tr><th>Total characters</th><td>126853</td></tr><tr><th>Distinct characters</th><td>10</td></tr><tr><th>Distinct categories</th><td>1 <a title="Unicode categories (click for more information)" href=https://en.wikipedia.org/wiki/Unicode_character_property#General_Category target=_blank><span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="Unicode categories (click for more information)">?</span></a></td></tr><tr><th>Distinct scripts</th><td>1 <a title="Unicode scripts (click for more information)" href=https://en.wikipedia.org/wiki/Script_(Unicode)#List_of_scripts_in_Unicode target=_blank><span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="Unicode scripts (click for more information)">?</span></a></td></tr><tr><th>Distinct blocks</th><td>1 <a title="Unicode blocks (click for more information)" href=https://en.wikipedia.org/wiki/Unicode_block target=_blank><span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="Unicode blocks (click for more information)">?</span></a></td></tr></tbody></table><div class="caption text-center text-muted"> The Unicode Standard assigns character properties to each code point, which can be used to analyse textual variables. </div></div><div class=col-sm-3><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-3><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>RENT</td></tr><tr><th>2nd row</th><td>OWN</td></tr><tr><th>3rd row</th><td>RENT</td></tr><tr><th>4th row</th><td>OWN</td></tr><tr><th>5th row</th><td>RENT</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=5975278964108887654bottom-5975278964108887654string><div class=row><div class=col-sm-4><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=RENT>RENT</td><td>11471</td><td><div class=bar style=width:100.0%> 50.4% </div></td></tr><tr class><td title=MORTGAGE>MORTGAGE</td><td>9387</td><td><div class=bar style=width:81.8%> 41.2% </div></td></tr><tr class><td title=OWN>OWN</td><td>1831</td><td><div class=bar style=width:16.0%> &nbsp; </div> 8.0% </td></tr><tr class><td title=OTHER>OTHER</td><td>76</td><td><div class=bar style=width:0.7%> &nbsp; </div> 0.3% </td></tr></tbody></table></div><div class=col-sm-4><h4>Length</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
| "L 432 288 \n", | |
| "L 432 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 69.3 252.621126 \n", | |
| "L 421.2 252.621126 \n", | |
| "L 421.2 10.8 \n", | |
| "L 69.3 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
| "Q 47.65625 37.796875 51.625 33 \n", | |
| "Q 55.609375 28.21875 55.609375 21.1875 \n", | |
| "Q 55.609375 10.40625 48.1875 4.484375 \n", | |
| "Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
| "Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
| "Q 12.796875 0.390625 7.625 2.203125 \n", | |
| "L 7.625 11.71875 \n", | |
| "Q 11.71875 9.328125 16.59375 8.109375 \n", | |
| "Q 21.484375 6.890625 26.8125 6.890625 \n", | |
| "Q 36.078125 6.890625 40.9375 10.546875 \n", | |
| "Q 45.796875 14.203125 45.796875 21.1875 \n", | |
| "Q 45.796875 27.640625 41.28125 31.265625 \n", | |
| "Q 36.765625 34.90625 28.71875 34.90625 \n", | |
| "L 20.21875 34.90625 \n", | |
| "L 20.21875 43.015625 \n", | |
| "L 29.109375 43.015625 \n", | |
| "Q 36.375 43.015625 40.234375 45.921875 \n", | |
| "Q 44.09375 48.828125 44.09375 54.296875 \n", | |
| "Q 44.09375 59.90625 40.109375 62.90625 \n", | |
| "Q 36.140625 65.921875 28.71875 65.921875 \n", | |
| "Q 24.65625 65.921875 20.015625 65.03125 \n", | |
| "Q 15.375 64.15625 9.8125 62.3125 \n", | |
| "L 9.8125 71.09375 \n", | |
| "Q 15.4375 72.65625 20.34375 73.4375 \n", | |
| "Q 25.25 74.21875 29.59375 74.21875 \n", | |
| "Q 40.828125 74.21875 47.359375 69.109375 \n", | |
| "Q 53.90625 64.015625 53.90625 55.328125 \n", | |
| "Q 53.90625 49.265625 50.4375 45.09375 \n", | |
| "Q 46.96875 40.921875 40.578125 39.3125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(84.997144 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-51 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
| "L 12.890625 25.390625 \n", | |
| "L 37.796875 25.390625 \n", | |
| "z\n", | |
| "M 35.203125 72.90625 \n", | |
| "L 47.609375 72.90625 \n", | |
| "L 47.609375 25.390625 \n", | |
| "L 58.015625 25.390625 \n", | |
| "L 58.015625 17.1875 \n", | |
| "L 47.609375 17.1875 \n", | |
| "L 47.609375 0 \n", | |
| "L 37.796875 0 \n", | |
| "L 37.796875 17.1875 \n", | |
| "L 4.890625 17.1875 \n", | |
| "L 4.890625 26.703125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(148.978962 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
| "L 49.515625 72.90625 \n", | |
| "L 49.515625 64.59375 \n", | |
| "L 19.828125 64.59375 \n", | |
| "L 19.828125 46.734375 \n", | |
| "Q 21.96875 47.46875 24.109375 47.828125 \n", | |
| "Q 26.265625 48.1875 28.421875 48.1875 \n", | |
| "Q 40.625 48.1875 47.75 41.5 \n", | |
| "Q 54.890625 34.8125 54.890625 23.390625 \n", | |
| "Q 54.890625 11.625 47.5625 5.09375 \n", | |
| "Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
| "Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
| "Q 12.796875 0.140625 7.71875 1.703125 \n", | |
| "L 7.71875 11.625 \n", | |
| "Q 12.109375 9.234375 16.796875 8.0625 \n", | |
| "Q 21.484375 6.890625 26.703125 6.890625 \n", | |
| "Q 35.15625 6.890625 40.078125 11.328125 \n", | |
| "Q 45.015625 15.765625 45.015625 23.390625 \n", | |
| "Q 45.015625 31 40.078125 35.4375 \n", | |
| "Q 35.15625 39.890625 26.703125 39.890625 \n", | |
| "Q 22.75 39.890625 18.8125 39.015625 \n", | |
| "Q 14.890625 38.140625 10.796875 36.28125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(212.96078 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
| "Q 26.375 40.375 22.484375 35.828125 \n", | |
| "Q 18.609375 31.296875 18.609375 23.390625 \n", | |
| "Q 18.609375 15.53125 22.484375 10.953125 \n", | |
| "Q 26.375 6.390625 33.015625 6.390625 \n", | |
| "Q 39.65625 6.390625 43.53125 10.953125 \n", | |
| "Q 47.40625 15.53125 47.40625 23.390625 \n", | |
| "Q 47.40625 31.296875 43.53125 35.828125 \n", | |
| "Q 39.65625 40.375 33.015625 40.375 \n", | |
| "z\n", | |
| "M 52.59375 71.296875 \n", | |
| "L 52.59375 62.3125 \n", | |
| "Q 48.875 64.0625 45.09375 64.984375 \n", | |
| "Q 41.3125 65.921875 37.59375 65.921875 \n", | |
| "Q 27.828125 65.921875 22.671875 59.328125 \n", | |
| "Q 17.53125 52.734375 16.796875 39.40625 \n", | |
| "Q 19.671875 43.65625 24.015625 45.921875 \n", | |
| "Q 28.375 48.1875 33.59375 48.1875 \n", | |
| "Q 44.578125 48.1875 50.953125 41.515625 \n", | |
| "Q 57.328125 34.859375 57.328125 23.390625 \n", | |
| "Q 57.328125 12.15625 50.6875 5.359375 \n", | |
| "Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
| "Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
| "Q 6.984375 17.96875 6.984375 36.375 \n", | |
| "Q 6.984375 53.65625 15.1875 63.9375 \n", | |
| "Q 23.390625 74.21875 37.203125 74.21875 \n", | |
| "Q 40.921875 74.21875 44.703125 73.484375 \n", | |
| "Q 48.484375 72.75 52.59375 71.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(276.942598 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-54 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-55 d="M 8.203125 72.90625 \n", | |
| "L 55.078125 72.90625 \n", | |
| "L 55.078125 68.703125 \n", | |
| "L 28.609375 0 \n", | |
| "L 18.3125 0 \n", | |
| "L 43.21875 64.59375 \n", | |
| "L 8.203125 64.59375 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(340.924417 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-55 /></g></g></g><g id=xtick_6><g id=text_6><defs><path id=DejaVuSans-56 d="M 31.78125 34.625 \n", | |
| "Q 24.75 34.625 20.71875 30.859375 \n", | |
| "Q 16.703125 27.09375 16.703125 20.515625 \n", | |
| "Q 16.703125 13.921875 20.71875 10.15625 \n", | |
| "Q 24.75 6.390625 31.78125 6.390625 \n", | |
| "Q 38.8125 6.390625 42.859375 10.171875 \n", | |
| "Q 46.921875 13.96875 46.921875 20.515625 \n", | |
| "Q 46.921875 27.09375 42.890625 30.859375 \n", | |
| "Q 38.875 34.625 31.78125 34.625 \n", | |
| "z\n", | |
| "M 21.921875 38.8125 \n", | |
| "Q 15.578125 40.375 12.03125 44.71875 \n", | |
| "Q 8.5 49.078125 8.5 55.328125 \n", | |
| "Q 8.5 64.0625 14.71875 69.140625 \n", | |
| "Q 20.953125 74.21875 31.78125 74.21875 \n", | |
| "Q 42.671875 74.21875 48.875 69.140625 \n", | |
| "Q 55.078125 64.0625 55.078125 55.328125 \n", | |
| "Q 55.078125 49.078125 51.53125 44.71875 \n", | |
| "Q 48 40.375 41.703125 38.8125 \n", | |
| "Q 48.828125 37.15625 52.796875 32.3125 \n", | |
| "Q 56.78125 27.484375 56.78125 20.515625 \n", | |
| "Q 56.78125 9.90625 50.3125 4.234375 \n", | |
| "Q 43.84375 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.734375 -1.421875 13.25 4.234375 \n", | |
| "Q 6.78125 9.90625 6.78125 20.515625 \n", | |
| "Q 6.78125 27.484375 10.78125 32.3125 \n", | |
| "Q 14.796875 37.15625 21.921875 38.8125 \n", | |
| "z\n", | |
| "M 18.3125 54.390625 \n", | |
| "Q 18.3125 48.734375 21.84375 45.5625 \n", | |
| "Q 25.390625 42.390625 31.78125 42.390625 \n", | |
| "Q 38.140625 42.390625 41.71875 45.5625 \n", | |
| "Q 45.3125 48.734375 45.3125 54.390625 \n", | |
| "Q 45.3125 60.0625 41.71875 63.234375 \n", | |
| "Q 38.140625 66.40625 31.78125 66.40625 \n", | |
| "Q 25.390625 66.40625 21.84375 63.234375 \n", | |
| "Q 18.3125 60.0625 18.3125 54.390625 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(404.906235 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-56 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_7><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(49.9375 256.420345)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_8><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(30.85 221.793096)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_3><g id=text_9><g style=fill:#262626; transform="translate(30.85 187.165847)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_10><g style=fill:#262626; transform="translate(30.85 152.538597)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-54 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_5><g id=text_11><g style=fill:#262626; transform="translate(30.85 117.911348)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-56 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_6><g id=text_12><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(24.4875 83.284099)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_7><g id=text_13><g style=fill:#262626; transform="translate(24.4875 48.65685)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-50 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_14><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
| "L 51.703125 72.90625 \n", | |
| "L 51.703125 64.59375 \n", | |
| "L 19.671875 64.59375 \n", | |
| "L 19.671875 43.109375 \n", | |
| "L 48.578125 43.109375 \n", | |
| "L 48.578125 34.8125 \n", | |
| "L 19.671875 34.8125 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
| "Q 39.59375 47.171875 37.8125 47.578125 \n", | |
| "Q 36.03125 48 33.890625 48 \n", | |
| "Q 26.265625 48 22.1875 43.046875 \n", | |
| "Q 18.109375 38.09375 18.109375 28.8125 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 20.953125 51.171875 25.484375 53.578125 \n", | |
| "Q 30.03125 56 36.53125 56 \n", | |
| "Q 37.453125 56 38.578125 55.875 \n", | |
| "Q 39.703125 55.765625 41.0625 55.515625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
| "L 56.203125 25.203125 \n", | |
| "L 14.890625 25.203125 \n", | |
| "Q 15.484375 15.921875 20.484375 11.0625 \n", | |
| "Q 25.484375 6.203125 34.421875 6.203125 \n", | |
| "Q 39.59375 6.203125 44.453125 7.46875 \n", | |
| "Q 49.3125 8.734375 54.109375 11.28125 \n", | |
| "L 54.109375 2.78125 \n", | |
| "Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
| "Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
| "Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
| "Q 5.515625 13.8125 5.515625 26.8125 \n", | |
| "Q 5.515625 40.234375 12.765625 48.109375 \n", | |
| "Q 20.015625 56 32.328125 56 \n", | |
| "Q 43.359375 56 49.78125 48.890625 \n", | |
| "Q 56.203125 41.796875 56.203125 29.59375 \n", | |
| "z\n", | |
| "M 47.21875 32.234375 \n", | |
| "Q 47.125 39.59375 43.09375 43.984375 \n", | |
| "Q 39.0625 48.390625 32.421875 48.390625 \n", | |
| "Q 24.90625 48.390625 20.390625 44.140625 \n", | |
| "Q 15.875 39.890625 15.1875 32.171875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
| "Q 14.796875 17.390625 18.875 11.75 \n", | |
| "Q 22.953125 6.109375 30.078125 6.109375 \n", | |
| "Q 37.203125 6.109375 41.296875 11.75 \n", | |
| "Q 45.40625 17.390625 45.40625 27.296875 \n", | |
| "Q 45.40625 37.203125 41.296875 42.84375 \n", | |
| "Q 37.203125 48.484375 30.078125 48.484375 \n", | |
| "Q 22.953125 48.484375 18.875 42.84375 \n", | |
| "Q 14.796875 37.203125 14.796875 27.296875 \n", | |
| "z\n", | |
| "M 45.40625 8.203125 \n", | |
| "Q 42.578125 3.328125 38.25 0.953125 \n", | |
| "Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
| "Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
| "Q 5.515625 14.40625 5.515625 27.296875 \n", | |
| "Q 5.515625 40.1875 11.734375 48.09375 \n", | |
| "Q 17.96875 56 27.875 56 \n", | |
| "Q 33.9375 56 38.25 53.625 \n", | |
| "Q 42.578125 51.265625 45.40625 46.390625 \n", | |
| "L 45.40625 54.6875 \n", | |
| "L 54.390625 54.6875 \n", | |
| "L 54.390625 -20.796875 \n", | |
| "L 45.40625 -20.796875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
| "L 8.5 54.6875 \n", | |
| "L 17.484375 54.6875 \n", | |
| "L 17.484375 21.921875 \n", | |
| "Q 17.484375 14.15625 20.5 10.265625 \n", | |
| "Q 23.53125 6.390625 29.59375 6.390625 \n", | |
| "Q 36.859375 6.390625 41.078125 11.03125 \n", | |
| "Q 45.3125 15.671875 45.3125 23.6875 \n", | |
| "L 45.3125 54.6875 \n", | |
| "L 54.296875 54.6875 \n", | |
| "L 54.296875 0 \n", | |
| "L 45.3125 0 \n", | |
| "L 45.3125 8.40625 \n", | |
| "Q 42.046875 3.421875 37.71875 1 \n", | |
| "Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
| "Q 18.265625 -1.421875 13.375 4.4375 \n", | |
| "Q 8.5 10.296875 8.5 21.578125 \n", | |
| "z\n", | |
| "M 31.109375 56 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
| "L 54.890625 0 \n", | |
| "L 45.90625 0 \n", | |
| "L 45.90625 32.71875 \n", | |
| "Q 45.90625 40.484375 42.875 44.328125 \n", | |
| "Q 39.84375 48.1875 33.796875 48.1875 \n", | |
| "Q 26.515625 48.1875 22.3125 43.546875 \n", | |
| "Q 18.109375 38.921875 18.109375 30.90625 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 21.34375 51.125 25.703125 53.5625 \n", | |
| "Q 30.078125 56 35.796875 56 \n", | |
| "Q 45.21875 56 50.046875 50.171875 \n", | |
| "Q 54.890625 44.34375 54.890625 33.015625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
| "L 48.78125 44.1875 \n", | |
| "Q 44.96875 46.296875 41.140625 47.34375 \n", | |
| "Q 37.3125 48.390625 33.40625 48.390625 \n", | |
| "Q 24.65625 48.390625 19.8125 42.84375 \n", | |
| "Q 14.984375 37.3125 14.984375 27.296875 \n", | |
| "Q 14.984375 17.28125 19.8125 11.734375 \n", | |
| "Q 24.65625 6.203125 33.40625 6.203125 \n", | |
| "Q 37.3125 6.203125 41.140625 7.25 \n", | |
| "Q 44.96875 8.296875 48.78125 10.40625 \n", | |
| "L 48.78125 2.09375 \n", | |
| "Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
| "Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
| "Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
| "Q 5.515625 14.109375 5.515625 27.296875 \n", | |
| "Q 5.515625 40.671875 12.859375 48.328125 \n", | |
| "Q 20.21875 56 33.015625 56 \n", | |
| "Q 37.15625 56 41.109375 55.140625 \n", | |
| "Q 45.0625 54.296875 48.78125 52.59375 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
| "Q 28.375 -14.84375 24.75 -17.8125 \n", | |
| "Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
| "L 7.90625 -20.796875 \n", | |
| "L 7.90625 -13.28125 \n", | |
| "L 13.1875 -13.28125 \n", | |
| "Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
| "Q 21 -9.765625 23.484375 -3.21875 \n", | |
| "L 25.09375 0.875 \n", | |
| "L 2.984375 54.6875 \n", | |
| "L 12.5 54.6875 \n", | |
| "L 29.59375 11.921875 \n", | |
| "L 46.6875 54.6875 \n", | |
| "L 56.203125 54.6875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(18.199844 160.123219)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#pcbc796a58a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 85.295455 252.621126 \n", | |
| "L 165.272727 252.621126 \n", | |
| "L 165.272727 22.315292 \n", | |
| "L 85.295455 22.315292 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#pcbc796a58a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 165.272727 252.621126 \n", | |
| "L 245.25 252.621126 \n", | |
| "L 245.25 251.305291 \n", | |
| "L 165.272727 251.305291 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#pcbc796a58a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 245.25 252.621126 \n", | |
| "L 325.227273 252.621126 \n", | |
| "L 325.227273 252.621126 \n", | |
| "L 245.25 252.621126 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#pcbc796a58a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 325.227273 252.621126 \n", | |
| "L 405.204545 252.621126 \n", | |
| "L 405.204545 90.098132 \n", | |
| "L 325.227273 90.098132 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path style=fill:none; d="M 69.3 252.621126 \n", | |
| "L 69.3 10.8 \n", | |
| ""/></g><g id=patch_8><path style=fill:none; d="M 421.2 252.621126 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g><g id=patch_9><path style=fill:none; d="M 69.3 252.621126 \n", | |
| "L 421.2 252.621126 \n", | |
| ""/></g><g id=patch_10><path style=fill:none; d="M 69.3 10.8 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=pcbc796a58a><rect height=241.821126 width=351.9 x=69.3 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"> Histogram of lengths of the category </div></div><div class=col-sm-4><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=238.3992pt version=1.1 viewbox="0 0 405 238.3992" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 238.3992 \n", | |
| "L 405 238.3992 \n", | |
| "L 405 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#pbebf0db08e) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
| "L 204.018476 106.86 \n", | |
| "L 204.018476 16.26 \n", | |
| "L 7.2 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_3><path clip-path=url(#pbebf0db08e) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 204.018476 106.86 \n", | |
| "L 365.079851 106.86 \n", | |
| "L 365.079851 16.26 \n", | |
| "L 204.018476 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#pbebf0db08e) style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 365.079851 106.86 \n", | |
| "L 396.495998 106.86 \n", | |
| "L 396.495998 16.26 \n", | |
| "L 365.079851 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#pbebf0db08e) style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 396.495998 106.86 \n", | |
| "L 397.8 106.86 \n", | |
| "L 397.8 16.26 \n", | |
| "L 396.495998 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=legend_1><g id=patch_6><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 231.1992 \n", | |
| "L 173.628 231.1992 \n", | |
| "Q 177.084 231.1992 177.084 227.7432 \n", | |
| "L 177.084 128.016 \n", | |
| "Q 177.084 124.56 173.628 124.56 \n", | |
| "L 19.296 124.56 \n", | |
| "Q 15.84 124.56 15.84 128.016 \n", | |
| "L 15.84 227.7432 \n", | |
| "Q 15.84 231.1992 19.296 231.1992 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
| "L 57.312 144.6021 \n", | |
| "L 57.312 132.5061 \n", | |
| "L 22.752 132.5061 \n", | |
| "z\n", | |
| ""/></g><g id=text_1><defs><path id=DejaVuSans-82 d="M 44.390625 34.1875 \n", | |
| "Q 47.5625 33.109375 50.5625 29.59375 \n", | |
| "Q 53.5625 26.078125 56.59375 19.921875 \n", | |
| "L 66.609375 0 \n", | |
| "L 56 0 \n", | |
| "L 46.6875 18.703125 \n", | |
| "Q 43.0625 26.03125 39.671875 28.421875 \n", | |
| "Q 36.28125 30.8125 30.421875 30.8125 \n", | |
| "L 19.671875 30.8125 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "L 9.8125 72.90625 \n", | |
| "L 32.078125 72.90625 \n", | |
| "Q 44.578125 72.90625 50.734375 67.671875 \n", | |
| "Q 56.890625 62.453125 56.890625 51.90625 \n", | |
| "Q 56.890625 45.015625 53.6875 40.46875 \n", | |
| "Q 50.484375 35.9375 44.390625 34.1875 \n", | |
| "z\n", | |
| "M 19.671875 64.796875 \n", | |
| "L 19.671875 38.921875 \n", | |
| "L 32.078125 38.921875 \n", | |
| "Q 39.203125 38.921875 42.84375 42.21875 \n", | |
| "Q 46.484375 45.515625 46.484375 51.90625 \n", | |
| "Q 46.484375 58.296875 42.84375 61.546875 \n", | |
| "Q 39.203125 64.796875 32.078125 64.796875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-69 d="M 9.8125 72.90625 \n", | |
| "L 55.90625 72.90625 \n", | |
| "L 55.90625 64.59375 \n", | |
| "L 19.671875 64.59375 \n", | |
| "L 19.671875 43.015625 \n", | |
| "L 54.390625 43.015625 \n", | |
| "L 54.390625 34.71875 \n", | |
| "L 19.671875 34.71875 \n", | |
| "L 19.671875 8.296875 \n", | |
| "L 56.78125 8.296875 \n", | |
| "L 56.78125 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-78 d="M 9.8125 72.90625 \n", | |
| "L 23.09375 72.90625 \n", | |
| "L 55.421875 11.921875 \n", | |
| "L 55.421875 72.90625 \n", | |
| "L 64.984375 72.90625 \n", | |
| "L 64.984375 0 \n", | |
| "L 51.703125 0 \n", | |
| "L 19.390625 60.984375 \n", | |
| "L 19.390625 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-84 d="M -0.296875 72.90625 \n", | |
| "L 61.375 72.90625 \n", | |
| "L 61.375 64.59375 \n", | |
| "L 35.5 64.59375 \n", | |
| "L 35.5 0 \n", | |
| "L 25.59375 0 \n", | |
| "L 25.59375 64.59375 \n", | |
| "L -0.296875 64.59375 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-82 /><use x=69.482422 xlink:href=#DejaVuSans-69 /><use x=132.666016 xlink:href=#DejaVuSans-78 /><use x=207.470703 xlink:href=#DejaVuSans-84 /></g></g><g id=patch_8><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
| "L 57.312 169.9659 \n", | |
| "L 57.312 157.8699 \n", | |
| "L 22.752 157.8699 \n", | |
| "z\n", | |
| ""/></g><g id=text_2><defs><path id=DejaVuSans-77 d="M 9.8125 72.90625 \n", | |
| "L 24.515625 72.90625 \n", | |
| "L 43.109375 23.296875 \n", | |
| "L 61.8125 72.90625 \n", | |
| "L 76.515625 72.90625 \n", | |
| "L 76.515625 0 \n", | |
| "L 66.890625 0 \n", | |
| "L 66.890625 64.015625 \n", | |
| "L 48.09375 14.015625 \n", | |
| "L 38.1875 14.015625 \n", | |
| "L 19.390625 64.015625 \n", | |
| "L 19.390625 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-79 d="M 39.40625 66.21875 \n", | |
| "Q 28.65625 66.21875 22.328125 58.203125 \n", | |
| "Q 16.015625 50.203125 16.015625 36.375 \n", | |
| "Q 16.015625 22.609375 22.328125 14.59375 \n", | |
| "Q 28.65625 6.59375 39.40625 6.59375 \n", | |
| "Q 50.140625 6.59375 56.421875 14.59375 \n", | |
| "Q 62.703125 22.609375 62.703125 36.375 \n", | |
| "Q 62.703125 50.203125 56.421875 58.203125 \n", | |
| "Q 50.140625 66.21875 39.40625 66.21875 \n", | |
| "z\n", | |
| "M 39.40625 74.21875 \n", | |
| "Q 54.734375 74.21875 63.90625 63.9375 \n", | |
| "Q 73.09375 53.65625 73.09375 36.375 \n", | |
| "Q 73.09375 19.140625 63.90625 8.859375 \n", | |
| "Q 54.734375 -1.421875 39.40625 -1.421875 \n", | |
| "Q 24.03125 -1.421875 14.8125 8.828125 \n", | |
| "Q 5.609375 19.09375 5.609375 36.375 \n", | |
| "Q 5.609375 53.65625 14.8125 63.9375 \n", | |
| "Q 24.03125 74.21875 39.40625 74.21875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-71 d="M 59.515625 10.40625 \n", | |
| "L 59.515625 29.984375 \n", | |
| "L 43.40625 29.984375 \n", | |
| "L 43.40625 38.09375 \n", | |
| "L 69.28125 38.09375 \n", | |
| "L 69.28125 6.78125 \n", | |
| "Q 63.578125 2.734375 56.6875 0.65625 \n", | |
| "Q 49.8125 -1.421875 42 -1.421875 \n", | |
| "Q 24.90625 -1.421875 15.25 8.5625 \n", | |
| "Q 5.609375 18.5625 5.609375 36.375 \n", | |
| "Q 5.609375 54.25 15.25 64.234375 \n", | |
| "Q 24.90625 74.21875 42 74.21875 \n", | |
| "Q 49.125 74.21875 55.546875 72.453125 \n", | |
| "Q 61.96875 70.703125 67.390625 67.28125 \n", | |
| "L 67.390625 56.78125 \n", | |
| "Q 61.921875 61.421875 55.765625 63.765625 \n", | |
| "Q 49.609375 66.109375 42.828125 66.109375 \n", | |
| "Q 29.4375 66.109375 22.71875 58.640625 \n", | |
| "Q 16.015625 51.171875 16.015625 36.375 \n", | |
| "Q 16.015625 21.625 22.71875 14.15625 \n", | |
| "Q 29.4375 6.6875 42.828125 6.6875 \n", | |
| "Q 48.046875 6.6875 52.140625 7.59375 \n", | |
| "Q 56.25 8.5 59.515625 10.40625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-65 d="M 34.1875 63.1875 \n", | |
| "L 20.796875 26.90625 \n", | |
| "L 47.609375 26.90625 \n", | |
| "z\n", | |
| "M 28.609375 72.90625 \n", | |
| "L 39.796875 72.90625 \n", | |
| "L 67.578125 0 \n", | |
| "L 57.328125 0 \n", | |
| "L 50.6875 18.703125 \n", | |
| "L 17.828125 18.703125 \n", | |
| "L 11.1875 0 \n", | |
| "L 0.78125 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-77 /><use x=86.279297 xlink:href=#DejaVuSans-79 /><use x=164.990234 xlink:href=#DejaVuSans-82 /><use x=227.222656 xlink:href=#DejaVuSans-84 /><use x=288.306641 xlink:href=#DejaVuSans-71 /><use x=365.796875 xlink:href=#DejaVuSans-65 /><use x=432.455078 xlink:href=#DejaVuSans-71 /><use x=509.945312 xlink:href=#DejaVuSans-69 /></g></g><g id=patch_9><path style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 195.3297 \n", | |
| "L 57.312 195.3297 \n", | |
| "L 57.312 183.2337 \n", | |
| "L 22.752 183.2337 \n", | |
| "z\n", | |
| ""/></g><g id=text_3><defs><path id=DejaVuSans-87 d="M 3.328125 72.90625 \n", | |
| "L 13.28125 72.90625 \n", | |
| "L 28.609375 11.28125 \n", | |
| "L 43.890625 72.90625 \n", | |
| "L 54.984375 72.90625 \n", | |
| "L 70.3125 11.28125 \n", | |
| "L 85.59375 72.90625 \n", | |
| "L 95.609375 72.90625 \n", | |
| "L 77.296875 0 \n", | |
| "L 64.890625 0 \n", | |
| "L 49.515625 63.28125 \n", | |
| "L 33.984375 0 \n", | |
| "L 21.578125 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 195.3297)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-79 /><use x=78.710938 xlink:href=#DejaVuSans-87 /><use x=177.587891 xlink:href=#DejaVuSans-78 /></g></g><g id=patch_10><path style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 220.6935 \n", | |
| "L 57.312 220.6935 \n", | |
| "L 57.312 208.5975 \n", | |
| "L 22.752 208.5975 \n", | |
| "z\n", | |
| ""/></g><g id=text_4><defs><path id=DejaVuSans-72 d="M 9.8125 72.90625 \n", | |
| "L 19.671875 72.90625 \n", | |
| "L 19.671875 43.015625 \n", | |
| "L 55.515625 43.015625 \n", | |
| "L 55.515625 72.90625 \n", | |
| "L 65.375 72.90625 \n", | |
| "L 65.375 0 \n", | |
| "L 55.515625 0 \n", | |
| "L 55.515625 34.71875 \n", | |
| "L 19.671875 34.71875 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 220.6935)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-79 /><use x=78.710938 xlink:href=#DejaVuSans-84 /><use x=139.794922 xlink:href=#DejaVuSans-72 /><use x=214.990234 xlink:href=#DejaVuSans-69 /><use x=278.173828 xlink:href=#DejaVuSans-82 /></g></g></g></g></g><defs><clippath id=pbebf0db08e><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=5975278964108887654bottom-5975278964108887654word><div class=col-sm-12><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=rent>rent</td><td>11471</td><td><div class=bar style=width:100.0%> 50.4% </div></td></tr><tr class><td title=mortgage>mortgage</td><td>9387</td><td><div class=bar style=width:81.8%> 41.2% </div></td></tr><tr class><td title=own>own</td><td>1831</td><td><div class=bar style=width:16.0%> &nbsp; </div> 8.0% </td></tr><tr class><td title=other>other</td><td>76</td><td><div class=bar style=width:0.7%> &nbsp; </div> 0.3% </td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=5975278964108887654bottom-5975278964108887654characters><div class=col-sm-12><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#5975278964108887654unicode-5975278964108887654characters aria-controls=5975278964108887654unicode-5975278964108887654characters role=tab data-toggle=tab>Characters</a></li><li role=presentation><a href=#5975278964108887654unicode-5975278964108887654categories aria-controls=5975278964108887654unicode-5975278964108887654categories role=tab data-toggle=tab>Categories</a></li><li role=presentation><a href=#5975278964108887654unicode-5975278964108887654scripts aria-controls=5975278964108887654unicode-5975278964108887654scripts role=tab data-toggle=tab>Scripts</a></li><li role=presentation><a href=#5975278964108887654unicode-5975278964108887654blocks aria-controls=5975278964108887654unicode-5975278964108887654blocks role=tab data-toggle=tab>Blocks</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=5975278964108887654unicode-5975278964108887654characters><div class="row named-list-item"><h4>Most occurring characters</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=R>R</td><td>20934</td><td><div class=bar style=width:100.0%> 16.5% </div></td></tr><tr class><td title=E>E</td><td>20934</td><td><div class=bar style=width:100.0%> 16.5% </div></td></tr><tr class><td title=T>T</td><td>20934</td><td><div class=bar style=width:100.0%> 16.5% </div></td></tr><tr class><td title=G>G</td><td>18774</td><td><div class=bar style=width:89.7%> 14.8% </div></td></tr><tr class><td title=N>N</td><td>13302</td><td><div class=bar style=width:63.5%> 10.5% </div></td></tr><tr class><td title=O>O</td><td>11294</td><td><div class=bar style=width:54.0%> 8.9% </div></td></tr><tr class><td title=M>M</td><td>9387</td><td><div class=bar style=width:44.8%> 7.4% </div></td></tr><tr class><td title=A>A</td><td>9387</td><td><div class=bar style=width:44.8%> 7.4% </div></td></tr><tr class><td title=W>W</td><td>1831</td><td><div class=bar style=width:8.7%> &nbsp; </div> 1.4% </td></tr><tr class><td title=H>H</td><td>76</td><td><div class=bar style=width:0.4%> &nbsp; </div> 0.1% </td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=5975278964108887654unicode-5975278964108887654categories><div class="row named-list-item"><h4>Most occurring categories</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title="Uppercase Letter">Uppercase Letter</td><td>126853</td><td><div class=bar style=width:100.0%> 100.0% </div></td></tr></tbody></table></div><div class="row named-list-item"><h4>Most frequent character per category</h4><div class=row><div class=col-sm-6><h5><em>Uppercase Letter</em></h5><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=R>R</td><td>20934</td><td><div class=bar style=width:100.0%> 16.5% </div></td></tr><tr class><td title=E>E</td><td>20934</td><td><div class=bar style=width:100.0%> 16.5% </div></td></tr><tr class><td title=T>T</td><td>20934</td><td><div class=bar style=width:100.0%> 16.5% </div></td></tr><tr class><td title=G>G</td><td>18774</td><td><div class=bar style=width:89.7%> 14.8% </div></td></tr><tr class><td title=N>N</td><td>13302</td><td><div class=bar style=width:63.5%> 10.5% </div></td></tr><tr class><td title=O>O</td><td>11294</td><td><div class=bar style=width:54.0%> 8.9% </div></td></tr><tr class><td title=M>M</td><td>9387</td><td><div class=bar style=width:44.8%> 7.4% </div></td></tr><tr class><td title=A>A</td><td>9387</td><td><div class=bar style=width:44.8%> 7.4% </div></td></tr><tr class><td title=W>W</td><td>1831</td><td><div class=bar style=width:8.7%> &nbsp; </div> 1.4% </td></tr><tr class><td title=H>H</td><td>76</td><td><div class=bar style=width:0.4%> &nbsp; </div> 0.1% </td></tr></tbody></table></div></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=5975278964108887654unicode-5975278964108887654scripts><div class="row named-list-item"><h4>Most occurring scripts</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=Latin>Latin</td><td>126853</td><td><div class=bar style=width:100.0%> 100.0% </div></td></tr></tbody></table></div><div class="row named-list-item"><h4>Most frequent character per script</h4><div class=row><div class=col-sm-6><h5><em>Latin</em></h5><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=R>R</td><td>20934</td><td><div class=bar style=width:100.0%> 16.5% </div></td></tr><tr class><td title=E>E</td><td>20934</td><td><div class=bar style=width:100.0%> 16.5% </div></td></tr><tr class><td title=T>T</td><td>20934</td><td><div class=bar style=width:100.0%> 16.5% </div></td></tr><tr class><td title=G>G</td><td>18774</td><td><div class=bar style=width:89.7%> 14.8% </div></td></tr><tr class><td title=N>N</td><td>13302</td><td><div class=bar style=width:63.5%> 10.5% </div></td></tr><tr class><td title=O>O</td><td>11294</td><td><div class=bar style=width:54.0%> 8.9% </div></td></tr><tr class><td title=M>M</td><td>9387</td><td><div class=bar style=width:44.8%> 7.4% </div></td></tr><tr class><td title=A>A</td><td>9387</td><td><div class=bar style=width:44.8%> 7.4% </div></td></tr><tr class><td title=W>W</td><td>1831</td><td><div class=bar style=width:8.7%> &nbsp; </div> 1.4% </td></tr><tr class><td title=H>H</td><td>76</td><td><div class=bar style=width:0.4%> &nbsp; </div> 0.1% </td></tr></tbody></table></div></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=5975278964108887654unicode-5975278964108887654blocks><div class="row named-list-item"><h4>Most occurring blocks</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=ASCII>ASCII</td><td>126853</td><td><div class=bar style=width:100.0%> 100.0% </div></td></tr></tbody></table></div><div class="row named-list-item"><h4>Most frequent character per block</h4><div class=row><div class=col-sm-6><h5><em>ASCII</em></h5><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=R>R</td><td>20934</td><td><div class=bar style=width:100.0%> 16.5% </div></td></tr><tr class><td title=E>E</td><td>20934</td><td><div class=bar style=width:100.0%> 16.5% </div></td></tr><tr class><td title=T>T</td><td>20934</td><td><div class=bar style=width:100.0%> 16.5% </div></td></tr><tr class><td title=G>G</td><td>18774</td><td><div class=bar style=width:89.7%> 14.8% </div></td></tr><tr class><td title=N>N</td><td>13302</td><td><div class=bar style=width:63.5%> 10.5% </div></td></tr><tr class><td title=O>O</td><td>11294</td><td><div class=bar style=width:54.0%> 8.9% </div></td></tr><tr class><td title=M>M</td><td>9387</td><td><div class=bar style=width:44.8%> 7.4% </div></td></tr><tr class><td title=A>A</td><td>9387</td><td><div class=bar style=width:44.8%> 7.4% </div></td></tr><tr class><td title=W>W</td><td>1831</td><td><div class=bar style=width:8.7%> &nbsp; </div> 1.4% </td></tr><tr class><td title=H>H</td><td>76</td><td><div class=bar style=width:0.4%> &nbsp; </div> 0.1% </td></tr></tbody></table></div></div></div></div></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_-872180076173548104></a><div class=variable><div class=col-sm-3><p class=h4 title=person_emp_length><a href=#pp_var_-872180076173548104>person_emp_length</a><br><small>Real number (&Ropf;<sub>&ge;0</sub>)</small></p><code>MISSING</code><br><code>ZEROS</code><br><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>36</td></tr><tr><th>Distinct (%)</th><td>0.2%</td></tr><tr class=alert><th>Missing</th><td>609</td></tr><tr class=alert><th>Missing (%)</th><td>2.7%</td></tr><tr><th>Infinite</th><td>0</td></tr><tr><th>Infinite (%)</th><td>0.0%</td></tr><tr><th>Mean</th><td>4.802356021</td></tr></tbody></table></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>0</td></tr><tr><th>Maximum</th><td>123</td></tr><tr class=alert><th>Zeros</th><td>2821</td></tr><tr class=alert><th>Zeros (%)</th><td>12.4%</td></tr><tr><th>Negative</th><td>0</td></tr><tr><th>Negative (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>178.0 KiB</td></tr></tbody></table></div><div class=col-sm-3><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=162pt version=1.1 viewbox="0 0 216 162" width=216pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 162 \n", | |
| "L 216 162 \n", | |
| "L 216 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 10.8 121.229437 \n", | |
| "L 205.2 121.229437 \n", | |
| "L 205.2 10.8 \n", | |
| "L 10.8 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(19.397715 142.126936)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
| "L 49.515625 72.90625 \n", | |
| "L 49.515625 64.59375 \n", | |
| "L 19.828125 64.59375 \n", | |
| "L 19.828125 46.734375 \n", | |
| "Q 21.96875 47.46875 24.109375 47.828125 \n", | |
| "Q 26.265625 48.1875 28.421875 48.1875 \n", | |
| "Q 40.625 48.1875 47.75 41.5 \n", | |
| "Q 54.890625 34.8125 54.890625 23.390625 \n", | |
| "Q 54.890625 11.625 47.5625 5.09375 \n", | |
| "Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
| "Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
| "Q 12.796875 0.140625 7.71875 1.703125 \n", | |
| "L 7.71875 11.625 \n", | |
| "Q 12.109375 9.234375 16.796875 8.0625 \n", | |
| "Q 21.484375 6.890625 26.703125 6.890625 \n", | |
| "Q 35.15625 6.890625 40.078125 11.328125 \n", | |
| "Q 45.015625 15.765625 45.015625 23.390625 \n", | |
| "Q 45.015625 31 40.078125 35.4375 \n", | |
| "Q 35.15625 39.890625 26.703125 39.890625 \n", | |
| "Q 22.75 39.890625 18.8125 39.015625 \n", | |
| "Q 14.890625 38.140625 10.796875 36.28125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(53.518306 145.72611)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_3><g id=text_3><g style=fill:#262626; transform="translate(89.438483 145.72611)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-55 d="M 8.203125 72.90625 \n", | |
| "L 55.078125 72.90625 \n", | |
| "L 55.078125 68.703125 \n", | |
| "L 28.609375 0 \n", | |
| "L 18.3125 0 \n", | |
| "L 43.21875 64.59375 \n", | |
| "L 8.203125 64.59375 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(125.35866 145.72611)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-55 /><use x=63.623047 xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(159.479251 149.325283)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_6><g id=text_6><g style=fill:#262626; transform="translate(195.399428 149.325283)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-50 /><use x=127.246094 xlink:href=#DejaVuSans-53 /></g></g></g></g><g id=patch_3><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 19.636364 121.229437 \n", | |
| "L 24.545455 121.229437 \n", | |
| "L 24.545455 16.058545 \n", | |
| "L 19.636364 16.058545 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 24.545455 121.229437 \n", | |
| "L 29.454545 121.229437 \n", | |
| "L 29.454545 58.775663 \n", | |
| "L 24.545455 58.775663 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 29.454545 121.229437 \n", | |
| "L 34.363636 121.229437 \n", | |
| "L 34.363636 76.890417 \n", | |
| "L 29.454545 76.890417 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 34.363636 121.229437 \n", | |
| "L 39.272727 121.229437 \n", | |
| "L 39.272727 108.622832 \n", | |
| "L 34.363636 108.622832 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 39.272727 121.229437 \n", | |
| "L 44.181818 121.229437 \n", | |
| "L 44.181818 114.86821 \n", | |
| "L 39.272727 114.86821 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 44.181818 121.229437 \n", | |
| "L 49.090909 121.229437 \n", | |
| "L 49.090909 119.723385 \n", | |
| "L 44.181818 119.723385 \n", | |
| "z\n", | |
| ""/></g><g id=patch_9><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 49.090909 121.229437 \n", | |
| "L 54 121.229437 \n", | |
| "L 54 120.629123 \n", | |
| "L 49.090909 120.629123 \n", | |
| "z\n", | |
| ""/></g><g id=patch_10><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 54 121.229437 \n", | |
| "L 58.909091 121.229437 \n", | |
| "L 58.909091 121.039864 \n", | |
| "L 54 121.039864 \n", | |
| "z\n", | |
| ""/></g><g id=patch_11><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 58.909091 121.229437 \n", | |
| "L 63.818182 121.229437 \n", | |
| "L 63.818182 121.197842 \n", | |
| "L 58.909091 121.197842 \n", | |
| "z\n", | |
| ""/></g><g id=patch_12><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 63.818182 121.229437 \n", | |
| "L 68.727273 121.229437 \n", | |
| "L 68.727273 121.176778 \n", | |
| "L 63.818182 121.176778 \n", | |
| "z\n", | |
| ""/></g><g id=patch_13><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 68.727273 121.229437 \n", | |
| "L 73.636364 121.229437 \n", | |
| "L 73.636364 121.229437 \n", | |
| "L 68.727273 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_14><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 73.636364 121.229437 \n", | |
| "L 78.545455 121.229437 \n", | |
| "L 78.545455 121.218905 \n", | |
| "L 73.636364 121.218905 \n", | |
| "z\n", | |
| ""/></g><g id=patch_15><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 78.545455 121.229437 \n", | |
| "L 83.454545 121.229437 \n", | |
| "L 83.454545 121.218905 \n", | |
| "L 78.545455 121.218905 \n", | |
| "z\n", | |
| ""/></g><g id=patch_16><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 83.454545 121.229437 \n", | |
| "L 88.363636 121.229437 \n", | |
| "L 88.363636 121.229437 \n", | |
| "L 83.454545 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_17><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 88.363636 121.229437 \n", | |
| "L 93.272727 121.229437 \n", | |
| "L 93.272727 121.229437 \n", | |
| "L 88.363636 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_18><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 93.272727 121.229437 \n", | |
| "L 98.181818 121.229437 \n", | |
| "L 98.181818 121.229437 \n", | |
| "L 93.272727 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_19><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 98.181818 121.229437 \n", | |
| "L 103.090909 121.229437 \n", | |
| "L 103.090909 121.229437 \n", | |
| "L 98.181818 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_20><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 103.090909 121.229437 \n", | |
| "L 108 121.229437 \n", | |
| "L 108 121.229437 \n", | |
| "L 103.090909 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_21><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 108 121.229437 \n", | |
| "L 112.909091 121.229437 \n", | |
| "L 112.909091 121.229437 \n", | |
| "L 108 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_22><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 112.909091 121.229437 \n", | |
| "L 117.818182 121.229437 \n", | |
| "L 117.818182 121.229437 \n", | |
| "L 112.909091 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_23><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 117.818182 121.229437 \n", | |
| "L 122.727273 121.229437 \n", | |
| "L 122.727273 121.229437 \n", | |
| "L 117.818182 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_24><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 122.727273 121.229437 \n", | |
| "L 127.636364 121.229437 \n", | |
| "L 127.636364 121.229437 \n", | |
| "L 122.727273 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_25><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 127.636364 121.229437 \n", | |
| "L 132.545455 121.229437 \n", | |
| "L 132.545455 121.229437 \n", | |
| "L 127.636364 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_26><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 132.545455 121.229437 \n", | |
| "L 137.454545 121.229437 \n", | |
| "L 137.454545 121.229437 \n", | |
| "L 132.545455 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_27><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 137.454545 121.229437 \n", | |
| "L 142.363636 121.229437 \n", | |
| "L 142.363636 121.229437 \n", | |
| "L 137.454545 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_28><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 142.363636 121.229437 \n", | |
| "L 147.272727 121.229437 \n", | |
| "L 147.272727 121.229437 \n", | |
| "L 142.363636 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_29><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 147.272727 121.229437 \n", | |
| "L 152.181818 121.229437 \n", | |
| "L 152.181818 121.229437 \n", | |
| "L 147.272727 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_30><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 152.181818 121.229437 \n", | |
| "L 157.090909 121.229437 \n", | |
| "L 157.090909 121.229437 \n", | |
| "L 152.181818 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_31><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 157.090909 121.229437 \n", | |
| "L 162 121.229437 \n", | |
| "L 162 121.229437 \n", | |
| "L 157.090909 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_32><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 162 121.229437 \n", | |
| "L 166.909091 121.229437 \n", | |
| "L 166.909091 121.229437 \n", | |
| "L 162 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_33><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 166.909091 121.229437 \n", | |
| "L 171.818182 121.229437 \n", | |
| "L 171.818182 121.229437 \n", | |
| "L 166.909091 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_34><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 171.818182 121.229437 \n", | |
| "L 176.727273 121.229437 \n", | |
| "L 176.727273 121.229437 \n", | |
| "L 171.818182 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_35><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 176.727273 121.229437 \n", | |
| "L 181.636364 121.229437 \n", | |
| "L 181.636364 121.229437 \n", | |
| "L 176.727273 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_36><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 181.636364 121.229437 \n", | |
| "L 186.545455 121.229437 \n", | |
| "L 186.545455 121.229437 \n", | |
| "L 181.636364 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_37><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 186.545455 121.229437 \n", | |
| "L 191.454545 121.229437 \n", | |
| "L 191.454545 121.229437 \n", | |
| "L 186.545455 121.229437 \n", | |
| "z\n", | |
| ""/></g><g id=patch_38><path clip-path=url(#pfac33775ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 191.454545 121.229437 \n", | |
| "L 196.363636 121.229437 \n", | |
| "L 196.363636 121.218905 \n", | |
| "L 191.454545 121.218905 \n", | |
| "z\n", | |
| ""/></g><g id=patch_39><path style=fill:none; d="M 10.8 121.229437 \n", | |
| "L 10.8 10.8 \n", | |
| ""/></g><g id=patch_40><path style=fill:none; d="M 205.2 121.229437 \n", | |
| "L 205.2 10.8 \n", | |
| ""/></g><g id=patch_41><path style=fill:none; d="M 10.8 121.229437 \n", | |
| "L 205.2 121.229437 \n", | |
| ""/></g><g id=patch_42><path style=fill:none; d="M 10.8 10.8 \n", | |
| "L 205.2 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=pfac33775ac><rect height=110.429437 width=194.4 x=10.8 y=10.8 /></clippath></defs></svg></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom--872180076173548104, #minifreqtable-872180076173548104" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom--872180076173548104 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-872180076173548104bottom--872180076173548104statistics aria-controls=-872180076173548104bottom--872180076173548104statistics role=tab data-toggle=tab>Statistics</a></li><li role=presentation><a href=#-872180076173548104bottom--872180076173548104histogram aria-controls=-872180076173548104bottom--872180076173548104histogram role=tab data-toggle=tab>Histogram</a></li><li role=presentation><a href=#-872180076173548104bottom--872180076173548104common_values aria-controls=-872180076173548104bottom--872180076173548104common_values role=tab data-toggle=tab>Common values</a></li><li role=presentation><a href=#-872180076173548104bottom--872180076173548104extreme_values aria-controls=-872180076173548104bottom--872180076173548104extreme_values role=tab data-toggle=tab>Extreme values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-872180076173548104bottom--872180076173548104statistics><div class=col-sm-6><p class=h4>Quantile statistics</p><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>0</td></tr><tr><th>5-th percentile</th><td>0</td></tr><tr><th>Q1</th><td>2</td></tr><tr><th>median</th><td>4</td></tr><tr><th>Q3</th><td>7</td></tr><tr><th>95-th percentile</th><td>13</td></tr><tr><th>Maximum</th><td>123</td></tr><tr><th>Range</th><td>123</td></tr><tr><th>Interquartile range (IQR)</th><td>5</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Descriptive statistics</p><table class="table table-condensed stats"><tbody><tr><th>Standard deviation</th><td>4.115383435</td></tr><tr><th>Coefficient of variation (CV)</th><td>0.8569509252</td></tr><tr><th>Kurtosis</th><td>32.9373502</td></tr><tr><th>Mean</th><td>4.802356021</td></tr><tr><th>Median Absolute Deviation (MAD)</th><td>3</td></tr><tr><th>Skewness</th><td>2.268448737</td></tr><tr><th>Sum</th><td>106401</td></tr><tr><th>Variance</th><td>16.93638082</td></tr><tr><th>Monotonicity</th><td>Not monotonic</td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-872180076173548104bottom--872180076173548104histogram><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
| "L 432 288 \n", | |
| "L 432 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 69.175 243.693903 \n", | |
| "L 421.2 243.693903 \n", | |
| "L 421.2 10.8 \n", | |
| "L 69.175 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(84.877826 266.565777)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(134.664558 271.064744)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
| "L 12.890625 25.390625 \n", | |
| "L 37.796875 25.390625 \n", | |
| "z\n", | |
| "M 35.203125 72.90625 \n", | |
| "L 47.609375 72.90625 \n", | |
| "L 47.609375 25.390625 \n", | |
| "L 58.015625 25.390625 \n", | |
| "L 58.015625 17.1875 \n", | |
| "L 47.609375 17.1875 \n", | |
| "L 47.609375 0 \n", | |
| "L 37.796875 0 \n", | |
| "L 37.796875 17.1875 \n", | |
| "L 4.890625 17.1875 \n", | |
| "L 4.890625 26.703125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(186.700774 271.064744)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
| "Q 26.375 40.375 22.484375 35.828125 \n", | |
| "Q 18.609375 31.296875 18.609375 23.390625 \n", | |
| "Q 18.609375 15.53125 22.484375 10.953125 \n", | |
| "Q 26.375 6.390625 33.015625 6.390625 \n", | |
| "Q 39.65625 6.390625 43.53125 10.953125 \n", | |
| "Q 47.40625 15.53125 47.40625 23.390625 \n", | |
| "Q 47.40625 31.296875 43.53125 35.828125 \n", | |
| "Q 39.65625 40.375 33.015625 40.375 \n", | |
| "z\n", | |
| "M 52.59375 71.296875 \n", | |
| "L 52.59375 62.3125 \n", | |
| "Q 48.875 64.0625 45.09375 64.984375 \n", | |
| "Q 41.3125 65.921875 37.59375 65.921875 \n", | |
| "Q 27.828125 65.921875 22.671875 59.328125 \n", | |
| "Q 17.53125 52.734375 16.796875 39.40625 \n", | |
| "Q 19.671875 43.65625 24.015625 45.921875 \n", | |
| "Q 28.375 48.1875 33.59375 48.1875 \n", | |
| "Q 44.578125 48.1875 50.953125 41.515625 \n", | |
| "Q 57.328125 34.859375 57.328125 23.390625 \n", | |
| "Q 57.328125 12.15625 50.6875 5.359375 \n", | |
| "Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
| "Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
| "Q 6.984375 17.96875 6.984375 36.375 \n", | |
| "Q 6.984375 53.65625 15.1875 63.9375 \n", | |
| "Q 23.390625 74.21875 37.203125 74.21875 \n", | |
| "Q 40.921875 74.21875 44.703125 73.484375 \n", | |
| "Q 48.484375 72.75 52.59375 71.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(238.73699 271.064744)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-54 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-56 d="M 31.78125 34.625 \n", | |
| "Q 24.75 34.625 20.71875 30.859375 \n", | |
| "Q 16.703125 27.09375 16.703125 20.515625 \n", | |
| "Q 16.703125 13.921875 20.71875 10.15625 \n", | |
| "Q 24.75 6.390625 31.78125 6.390625 \n", | |
| "Q 38.8125 6.390625 42.859375 10.171875 \n", | |
| "Q 46.921875 13.96875 46.921875 20.515625 \n", | |
| "Q 46.921875 27.09375 42.890625 30.859375 \n", | |
| "Q 38.875 34.625 31.78125 34.625 \n", | |
| "z\n", | |
| "M 21.921875 38.8125 \n", | |
| "Q 15.578125 40.375 12.03125 44.71875 \n", | |
| "Q 8.5 49.078125 8.5 55.328125 \n", | |
| "Q 8.5 64.0625 14.71875 69.140625 \n", | |
| "Q 20.953125 74.21875 31.78125 74.21875 \n", | |
| "Q 42.671875 74.21875 48.875 69.140625 \n", | |
| "Q 55.078125 64.0625 55.078125 55.328125 \n", | |
| "Q 55.078125 49.078125 51.53125 44.71875 \n", | |
| "Q 48 40.375 41.703125 38.8125 \n", | |
| "Q 48.828125 37.15625 52.796875 32.3125 \n", | |
| "Q 56.78125 27.484375 56.78125 20.515625 \n", | |
| "Q 56.78125 9.90625 50.3125 4.234375 \n", | |
| "Q 43.84375 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.734375 -1.421875 13.25 4.234375 \n", | |
| "Q 6.78125 9.90625 6.78125 20.515625 \n", | |
| "Q 6.78125 27.484375 10.78125 32.3125 \n", | |
| "Q 14.796875 37.15625 21.921875 38.8125 \n", | |
| "z\n", | |
| "M 18.3125 54.390625 \n", | |
| "Q 18.3125 48.734375 21.84375 45.5625 \n", | |
| "Q 25.390625 42.390625 31.78125 42.390625 \n", | |
| "Q 38.140625 42.390625 41.71875 45.5625 \n", | |
| "Q 45.3125 48.734375 45.3125 54.390625 \n", | |
| "Q 45.3125 60.0625 41.71875 63.234375 \n", | |
| "Q 38.140625 66.40625 31.78125 66.40625 \n", | |
| "Q 25.390625 66.40625 21.84375 63.234375 \n", | |
| "Q 18.3125 60.0625 18.3125 54.390625 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(290.773206 271.064744)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-56 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_6><g id=text_6><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(340.559938 275.563711)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_7><g id=text_7><g style=fill:#262626; transform="translate(392.596154 275.563711)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-50 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_8><g style=fill:#262626; transform="translate(49.8125 247.493122)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_9><g style=fill:#262626; transform="translate(30.725 203.070186)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_3><g id=text_10><g style=fill:#262626; transform="translate(30.725 158.647251)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_11><g style=fill:#262626; transform="translate(30.725 114.224315)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-54 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_5><g id=text_12><g style=fill:#262626; transform="translate(30.725 69.80138)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-56 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_6><g id=text_13><g style=fill:#262626; transform="translate(24.3625 25.378444)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_14><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
| "L 51.703125 72.90625 \n", | |
| "L 51.703125 64.59375 \n", | |
| "L 19.671875 64.59375 \n", | |
| "L 19.671875 43.109375 \n", | |
| "L 48.578125 43.109375 \n", | |
| "L 48.578125 34.8125 \n", | |
| "L 19.671875 34.8125 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
| "Q 39.59375 47.171875 37.8125 47.578125 \n", | |
| "Q 36.03125 48 33.890625 48 \n", | |
| "Q 26.265625 48 22.1875 43.046875 \n", | |
| "Q 18.109375 38.09375 18.109375 28.8125 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 20.953125 51.171875 25.484375 53.578125 \n", | |
| "Q 30.03125 56 36.53125 56 \n", | |
| "Q 37.453125 56 38.578125 55.875 \n", | |
| "Q 39.703125 55.765625 41.0625 55.515625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
| "L 56.203125 25.203125 \n", | |
| "L 14.890625 25.203125 \n", | |
| "Q 15.484375 15.921875 20.484375 11.0625 \n", | |
| "Q 25.484375 6.203125 34.421875 6.203125 \n", | |
| "Q 39.59375 6.203125 44.453125 7.46875 \n", | |
| "Q 49.3125 8.734375 54.109375 11.28125 \n", | |
| "L 54.109375 2.78125 \n", | |
| "Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
| "Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
| "Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
| "Q 5.515625 13.8125 5.515625 26.8125 \n", | |
| "Q 5.515625 40.234375 12.765625 48.109375 \n", | |
| "Q 20.015625 56 32.328125 56 \n", | |
| "Q 43.359375 56 49.78125 48.890625 \n", | |
| "Q 56.203125 41.796875 56.203125 29.59375 \n", | |
| "z\n", | |
| "M 47.21875 32.234375 \n", | |
| "Q 47.125 39.59375 43.09375 43.984375 \n", | |
| "Q 39.0625 48.390625 32.421875 48.390625 \n", | |
| "Q 24.90625 48.390625 20.390625 44.140625 \n", | |
| "Q 15.875 39.890625 15.1875 32.171875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
| "Q 14.796875 17.390625 18.875 11.75 \n", | |
| "Q 22.953125 6.109375 30.078125 6.109375 \n", | |
| "Q 37.203125 6.109375 41.296875 11.75 \n", | |
| "Q 45.40625 17.390625 45.40625 27.296875 \n", | |
| "Q 45.40625 37.203125 41.296875 42.84375 \n", | |
| "Q 37.203125 48.484375 30.078125 48.484375 \n", | |
| "Q 22.953125 48.484375 18.875 42.84375 \n", | |
| "Q 14.796875 37.203125 14.796875 27.296875 \n", | |
| "z\n", | |
| "M 45.40625 8.203125 \n", | |
| "Q 42.578125 3.328125 38.25 0.953125 \n", | |
| "Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
| "Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
| "Q 5.515625 14.40625 5.515625 27.296875 \n", | |
| "Q 5.515625 40.1875 11.734375 48.09375 \n", | |
| "Q 17.96875 56 27.875 56 \n", | |
| "Q 33.9375 56 38.25 53.625 \n", | |
| "Q 42.578125 51.265625 45.40625 46.390625 \n", | |
| "L 45.40625 54.6875 \n", | |
| "L 54.390625 54.6875 \n", | |
| "L 54.390625 -20.796875 \n", | |
| "L 45.40625 -20.796875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
| "L 8.5 54.6875 \n", | |
| "L 17.484375 54.6875 \n", | |
| "L 17.484375 21.921875 \n", | |
| "Q 17.484375 14.15625 20.5 10.265625 \n", | |
| "Q 23.53125 6.390625 29.59375 6.390625 \n", | |
| "Q 36.859375 6.390625 41.078125 11.03125 \n", | |
| "Q 45.3125 15.671875 45.3125 23.6875 \n", | |
| "L 45.3125 54.6875 \n", | |
| "L 54.296875 54.6875 \n", | |
| "L 54.296875 0 \n", | |
| "L 45.3125 0 \n", | |
| "L 45.3125 8.40625 \n", | |
| "Q 42.046875 3.421875 37.71875 1 \n", | |
| "Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
| "Q 18.265625 -1.421875 13.375 4.4375 \n", | |
| "Q 8.5 10.296875 8.5 21.578125 \n", | |
| "z\n", | |
| "M 31.109375 56 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
| "L 54.890625 0 \n", | |
| "L 45.90625 0 \n", | |
| "L 45.90625 32.71875 \n", | |
| "Q 45.90625 40.484375 42.875 44.328125 \n", | |
| "Q 39.84375 48.1875 33.796875 48.1875 \n", | |
| "Q 26.515625 48.1875 22.3125 43.546875 \n", | |
| "Q 18.109375 38.921875 18.109375 30.90625 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 21.34375 51.125 25.703125 53.5625 \n", | |
| "Q 30.078125 56 35.796875 56 \n", | |
| "Q 45.21875 56 50.046875 50.171875 \n", | |
| "Q 54.890625 44.34375 54.890625 33.015625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
| "L 48.78125 44.1875 \n", | |
| "Q 44.96875 46.296875 41.140625 47.34375 \n", | |
| "Q 37.3125 48.390625 33.40625 48.390625 \n", | |
| "Q 24.65625 48.390625 19.8125 42.84375 \n", | |
| "Q 14.984375 37.3125 14.984375 27.296875 \n", | |
| "Q 14.984375 17.28125 19.8125 11.734375 \n", | |
| "Q 24.65625 6.203125 33.40625 6.203125 \n", | |
| "Q 37.3125 6.203125 41.140625 7.25 \n", | |
| "Q 44.96875 8.296875 48.78125 10.40625 \n", | |
| "L 48.78125 2.09375 \n", | |
| "Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
| "Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
| "Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
| "Q 5.515625 14.109375 5.515625 27.296875 \n", | |
| "Q 5.515625 40.671875 12.859375 48.328125 \n", | |
| "Q 20.21875 56 33.015625 56 \n", | |
| "Q 37.15625 56 41.109375 55.140625 \n", | |
| "Q 45.0625 54.296875 48.78125 52.59375 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
| "Q 28.375 -14.84375 24.75 -17.8125 \n", | |
| "Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
| "L 7.90625 -20.796875 \n", | |
| "L 7.90625 -13.28125 \n", | |
| "L 13.1875 -13.28125 \n", | |
| "Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
| "Q 21 -9.765625 23.484375 -3.21875 \n", | |
| "L 25.09375 0.875 \n", | |
| "L 2.984375 54.6875 \n", | |
| "L 12.5 54.6875 \n", | |
| "L 29.59375 11.921875 \n", | |
| "L 46.6875 54.6875 \n", | |
| "L 56.203125 54.6875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(18.074844 155.659608)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 85.176136 243.693903 \n", | |
| "L 94.065657 243.693903 \n", | |
| "L 94.065657 21.890186 \n", | |
| "L 85.176136 21.890186 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 94.065657 243.693903 \n", | |
| "L 102.955177 243.693903 \n", | |
| "L 102.955177 111.979899 \n", | |
| "L 94.065657 111.979899 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 102.955177 243.693903 \n", | |
| "L 111.844697 243.693903 \n", | |
| "L 111.844697 150.183624 \n", | |
| "L 102.955177 150.183624 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 111.844697 243.693903 \n", | |
| "L 120.734217 243.693903 \n", | |
| "L 120.734217 217.106776 \n", | |
| "L 111.844697 217.106776 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 120.734217 243.693903 \n", | |
| "L 129.623737 243.693903 \n", | |
| "L 129.623737 230.278177 \n", | |
| "L 120.734217 230.278177 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 129.623737 243.693903 \n", | |
| "L 138.513258 243.693903 \n", | |
| "L 138.513258 240.517663 \n", | |
| "L 129.623737 240.517663 \n", | |
| "z\n", | |
| ""/></g><g id=patch_9><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 138.513258 243.693903 \n", | |
| "L 147.402778 243.693903 \n", | |
| "L 147.402778 242.42785 \n", | |
| "L 138.513258 242.42785 \n", | |
| "z\n", | |
| ""/></g><g id=patch_10><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 147.402778 243.693903 \n", | |
| "L 156.292298 243.693903 \n", | |
| "L 156.292298 243.294097 \n", | |
| "L 147.402778 243.294097 \n", | |
| "z\n", | |
| ""/></g><g id=patch_11><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 156.292298 243.693903 \n", | |
| "L 165.181818 243.693903 \n", | |
| "L 165.181818 243.627269 \n", | |
| "L 156.292298 243.627269 \n", | |
| "z\n", | |
| ""/></g><g id=patch_12><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 165.181818 243.693903 \n", | |
| "L 174.071338 243.693903 \n", | |
| "L 174.071338 243.582846 \n", | |
| "L 165.181818 243.582846 \n", | |
| "z\n", | |
| ""/></g><g id=patch_13><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 174.071338 243.693903 \n", | |
| "L 182.960859 243.693903 \n", | |
| "L 182.960859 243.693903 \n", | |
| "L 174.071338 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_14><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 182.960859 243.693903 \n", | |
| "L 191.850379 243.693903 \n", | |
| "L 191.850379 243.671692 \n", | |
| "L 182.960859 243.671692 \n", | |
| "z\n", | |
| ""/></g><g id=patch_15><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 191.850379 243.693903 \n", | |
| "L 200.739899 243.693903 \n", | |
| "L 200.739899 243.671692 \n", | |
| "L 191.850379 243.671692 \n", | |
| "z\n", | |
| ""/></g><g id=patch_16><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 200.739899 243.693903 \n", | |
| "L 209.629419 243.693903 \n", | |
| "L 209.629419 243.693903 \n", | |
| "L 200.739899 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_17><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 209.629419 243.693903 \n", | |
| "L 218.518939 243.693903 \n", | |
| "L 218.518939 243.693903 \n", | |
| "L 209.629419 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_18><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 218.518939 243.693903 \n", | |
| "L 227.40846 243.693903 \n", | |
| "L 227.40846 243.693903 \n", | |
| "L 218.518939 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_19><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 227.40846 243.693903 \n", | |
| "L 236.29798 243.693903 \n", | |
| "L 236.29798 243.693903 \n", | |
| "L 227.40846 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_20><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 236.29798 243.693903 \n", | |
| "L 245.1875 243.693903 \n", | |
| "L 245.1875 243.693903 \n", | |
| "L 236.29798 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_21><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 245.1875 243.693903 \n", | |
| "L 254.07702 243.693903 \n", | |
| "L 254.07702 243.693903 \n", | |
| "L 245.1875 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_22><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 254.07702 243.693903 \n", | |
| "L 262.96654 243.693903 \n", | |
| "L 262.96654 243.693903 \n", | |
| "L 254.07702 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_23><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 262.96654 243.693903 \n", | |
| "L 271.856061 243.693903 \n", | |
| "L 271.856061 243.693903 \n", | |
| "L 262.96654 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_24><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 271.856061 243.693903 \n", | |
| "L 280.745581 243.693903 \n", | |
| "L 280.745581 243.693903 \n", | |
| "L 271.856061 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_25><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 280.745581 243.693903 \n", | |
| "L 289.635101 243.693903 \n", | |
| "L 289.635101 243.693903 \n", | |
| "L 280.745581 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_26><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 289.635101 243.693903 \n", | |
| "L 298.524621 243.693903 \n", | |
| "L 298.524621 243.693903 \n", | |
| "L 289.635101 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_27><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 298.524621 243.693903 \n", | |
| "L 307.414141 243.693903 \n", | |
| "L 307.414141 243.693903 \n", | |
| "L 298.524621 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_28><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 307.414141 243.693903 \n", | |
| "L 316.303662 243.693903 \n", | |
| "L 316.303662 243.693903 \n", | |
| "L 307.414141 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_29><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 316.303662 243.693903 \n", | |
| "L 325.193182 243.693903 \n", | |
| "L 325.193182 243.693903 \n", | |
| "L 316.303662 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_30><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 325.193182 243.693903 \n", | |
| "L 334.082702 243.693903 \n", | |
| "L 334.082702 243.693903 \n", | |
| "L 325.193182 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_31><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 334.082702 243.693903 \n", | |
| "L 342.972222 243.693903 \n", | |
| "L 342.972222 243.693903 \n", | |
| "L 334.082702 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_32><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 342.972222 243.693903 \n", | |
| "L 351.861742 243.693903 \n", | |
| "L 351.861742 243.693903 \n", | |
| "L 342.972222 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_33><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 351.861742 243.693903 \n", | |
| "L 360.751263 243.693903 \n", | |
| "L 360.751263 243.693903 \n", | |
| "L 351.861742 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_34><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 360.751263 243.693903 \n", | |
| "L 369.640783 243.693903 \n", | |
| "L 369.640783 243.693903 \n", | |
| "L 360.751263 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_35><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 369.640783 243.693903 \n", | |
| "L 378.530303 243.693903 \n", | |
| "L 378.530303 243.693903 \n", | |
| "L 369.640783 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_36><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 378.530303 243.693903 \n", | |
| "L 387.419823 243.693903 \n", | |
| "L 387.419823 243.693903 \n", | |
| "L 378.530303 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_37><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 387.419823 243.693903 \n", | |
| "L 396.309343 243.693903 \n", | |
| "L 396.309343 243.693903 \n", | |
| "L 387.419823 243.693903 \n", | |
| "z\n", | |
| ""/></g><g id=patch_38><path clip-path=url(#p1285b18f84) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 396.309343 243.693903 \n", | |
| "L 405.198864 243.693903 \n", | |
| "L 405.198864 243.671692 \n", | |
| "L 396.309343 243.671692 \n", | |
| "z\n", | |
| ""/></g><g id=patch_39><path style=fill:none; d="M 69.175 243.693903 \n", | |
| "L 69.175 10.8 \n", | |
| ""/></g><g id=patch_40><path style=fill:none; d="M 421.2 243.693903 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g><g id=patch_41><path style=fill:none; d="M 69.175 243.693903 \n", | |
| "L 421.2 243.693903 \n", | |
| ""/></g><g id=patch_42><path style=fill:none; d="M 69.175 10.8 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=p1285b18f84><rect height=232.893903 width=352.025 x=69.175 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"><strong>Histogram with fixed size bins</strong> (bins=36) </div></div><div role=tabpanel class="tab-pane col-sm-12" id=-872180076173548104bottom--872180076173548104common_values><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=0>0</td><td>2821</td><td><div class=bar style=width:100.0%> 12.4% </div></td></tr><tr class><td title=2>2</td><td>2689</td><td><div class=bar style=width:95.3%> 11.8% </div></td></tr><tr class><td title=3>3</td><td>2447</td><td><div class=bar style=width:86.7%> 10.7% </div></td></tr><tr class><td title=5>5</td><td>2058</td><td><div class=bar style=width:73.0%> 9.0% </div></td></tr><tr class><td title=1>1</td><td>2029</td><td><div class=bar style=width:71.9%> 8.9% </div></td></tr><tr class><td title=4>4</td><td>2015</td><td><div class=bar style=width:71.4%> 8.9% </div></td></tr><tr class><td title=6>6</td><td>1857</td><td><div class=bar style=width:65.8%> 8.2% </div></td></tr><tr class><td title=7>7</td><td>1540</td><td><div class=bar style=width:54.6%> 6.8% </div></td></tr><tr class><td title=8>8</td><td>1210</td><td><div class=bar style=width:42.9%> 5.3% </div></td></tr><tr class><td title=9>9</td><td>982</td><td><div class=bar style=width:34.8%> &nbsp; </div> 4.3% </td></tr><tr class=other><td title="Other values (26)">Other values (26)</td><td>2508</td><td><div class=bar style=width:88.9%> 11.0% </div></td></tr><tr class=missing><td title=(Missing)>(Missing)</td><td>609</td><td><div class=bar style=width:21.6%> &nbsp; </div> 2.7% </td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=-872180076173548104bottom--872180076173548104extreme_values><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-872180076173548104extreme_values--872180076173548104firstn aria-controls=-872180076173548104extreme_values--872180076173548104firstn role=tab data-toggle=tab>Minimum 10 values</a></li><li role=presentation><a href=#-872180076173548104extreme_values--872180076173548104lastn aria-controls=-872180076173548104extreme_values--872180076173548104lastn role=tab data-toggle=tab>Maximum 10 values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-872180076173548104extreme_values--872180076173548104firstn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=0>0</td><td>2821</td><td><div class=bar style=width:100.0%> 12.4% </div></td></tr><tr class><td title=1>1</td><td>2029</td><td><div class=bar style=width:71.9%> 8.9% </div></td></tr><tr class><td title=2>2</td><td>2689</td><td><div class=bar style=width:95.3%> 11.8% </div></td></tr><tr class><td title=3>3</td><td>2447</td><td><div class=bar style=width:86.7%> 10.7% </div></td></tr><tr class><td title=4>4</td><td>2015</td><td><div class=bar style=width:71.4%> 8.9% </div></td></tr><tr class><td title=5>5</td><td>2058</td><td><div class=bar style=width:73.0%> 9.0% </div></td></tr><tr class><td title=6>6</td><td>1857</td><td><div class=bar style=width:65.8%> 8.2% </div></td></tr><tr class><td title=7>7</td><td>1540</td><td><div class=bar style=width:54.6%> 6.8% </div></td></tr><tr class><td title=8>8</td><td>1210</td><td><div class=bar style=width:42.9%> 5.3% </div></td></tr><tr class><td title=9>9</td><td>982</td><td><div class=bar style=width:34.8%> &nbsp; </div> 4.3% </td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=-872180076173548104extreme_values--872180076173548104lastn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=123>123</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=41>41</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=38>38</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=34>34</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=31>31</td><td>4</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=30>30</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=29>29</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=28>28</td><td>1</td><td><div class=bar style=width:25.0%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=27>27</td><td>3</td><td><div class=bar style=width:75.0%>< 0.1% </div></td></tr><tr class><td title=26>26</td><td>4</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr></tbody></table></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_213319925741214013></a><div class=variable><div class=col-sm-3><p class=h4 title=loan_intent><a href=#pp_var_213319925741214013>loan_intent</a><br><small>Categorical</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>6</td></tr><tr><th>Distinct (%)</th><td>< 0.1%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>178.0 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> EDUCATION </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 4524&nbsp; </div></td></tr><tr class><th width=50%> MEDICAL </th><td width=50%><div class=bar style=width:92.5% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 4185&nbsp; </div></td></tr><tr class><th width=50%> VENTURE </th><td width=50%><div class=bar style=width:87.6% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 3962&nbsp; </div></td></tr><tr class><th width=50%> PERSONAL </th><td width=50%><div class=bar style=width:85.4% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 3863&nbsp; </div></td></tr><tr class><th width=50%> DEBTCONSOLIDATION </th><td width=50%><div class=bar style=width:80.9% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 3660&nbsp; </div></td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-213319925741214013, #minifreqtable213319925741214013" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-213319925741214013 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#213319925741214013bottom-213319925741214013overview aria-controls=213319925741214013bottom-213319925741214013overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#213319925741214013bottom-213319925741214013string aria-controls=213319925741214013bottom-213319925741214013string role=tab data-toggle=tab>Categories</a></li><li role=presentation><a href=#213319925741214013bottom-213319925741214013word aria-controls=213319925741214013bottom-213319925741214013word role=tab data-toggle=tab>Words</a></li><li role=presentation><a href=#213319925741214013bottom-213319925741214013characters aria-controls=213319925741214013bottom-213319925741214013characters role=tab data-toggle=tab>Characters</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=213319925741214013bottom-213319925741214013overview><div class=row><div class=col-sm-3><p class=h4>Length</p><table class="table table-condensed stats"><tbody><tr><th>Max length</th><td>17</td></tr><tr><th>Median length</th><td>15</td></tr><tr><th>Mean length</th><td>10.07836591</td></tr><tr><th>Min length</th><td>7</td></tr></tbody></table></div><div class=col-sm-3><p class=h4>Characters and Unicode</p><table class="table table-condensed stats"><tbody><tr><th>Total characters</th><td>229434</td></tr><tr><th>Distinct characters</th><td>17</td></tr><tr><th>Distinct categories</th><td>1 <a title="Unicode categories (click for more information)" href=https://en.wikipedia.org/wiki/Unicode_character_property#General_Category target=_blank><span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="Unicode categories (click for more information)">?</span></a></td></tr><tr><th>Distinct scripts</th><td>1 <a title="Unicode scripts (click for more information)" href=https://en.wikipedia.org/wiki/Script_(Unicode)#List_of_scripts_in_Unicode target=_blank><span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="Unicode scripts (click for more information)">?</span></a></td></tr><tr><th>Distinct blocks</th><td>1 <a title="Unicode blocks (click for more information)" href=https://en.wikipedia.org/wiki/Unicode_block target=_blank><span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="Unicode blocks (click for more information)">?</span></a></td></tr></tbody></table><div class="caption text-center text-muted"> The Unicode Standard assigns character properties to each code point, which can be used to analyse textual variables. </div></div><div class=col-sm-3><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-3><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>PERSONAL</td></tr><tr><th>2nd row</th><td>EDUCATION</td></tr><tr><th>3rd row</th><td>MEDICAL</td></tr><tr><th>4th row</th><td>VENTURE</td></tr><tr><th>5th row</th><td>EDUCATION</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=213319925741214013bottom-213319925741214013string><div class=row><div class=col-sm-4><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=EDUCATION>EDUCATION</td><td>4524</td><td><div class=bar style=width:100.0%> 19.9% </div></td></tr><tr class><td title=MEDICAL>MEDICAL</td><td>4185</td><td><div class=bar style=width:92.5%> 18.4% </div></td></tr><tr class><td title=VENTURE>VENTURE</td><td>3962</td><td><div class=bar style=width:87.6%> 17.4% </div></td></tr><tr class><td title=PERSONAL>PERSONAL</td><td>3863</td><td><div class=bar style=width:85.4%> 17.0% </div></td></tr><tr class><td title=DEBTCONSOLIDATION>DEBTCONSOLIDATION</td><td>3660</td><td><div class=bar style=width:80.9%> 16.1% </div></td></tr><tr class><td title=HOMEIMPROVEMENT>HOMEIMPROVEMENT</td><td>2571</td><td><div class=bar style=width:56.8%> 11.3% </div></td></tr></tbody></table></div><div class=col-sm-4><h4>Length</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
| "L 432 288 \n", | |
| "L 432 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 69.3 248.113321 \n", | |
| "L 421.2 248.113321 \n", | |
| "L 421.2 10.8 \n", | |
| "L 69.3 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-56 d="M 31.78125 34.625 \n", | |
| "Q 24.75 34.625 20.71875 30.859375 \n", | |
| "Q 16.703125 27.09375 16.703125 20.515625 \n", | |
| "Q 16.703125 13.921875 20.71875 10.15625 \n", | |
| "Q 24.75 6.390625 31.78125 6.390625 \n", | |
| "Q 38.8125 6.390625 42.859375 10.171875 \n", | |
| "Q 46.921875 13.96875 46.921875 20.515625 \n", | |
| "Q 46.921875 27.09375 42.890625 30.859375 \n", | |
| "Q 38.875 34.625 31.78125 34.625 \n", | |
| "z\n", | |
| "M 21.921875 38.8125 \n", | |
| "Q 15.578125 40.375 12.03125 44.71875 \n", | |
| "Q 8.5 49.078125 8.5 55.328125 \n", | |
| "Q 8.5 64.0625 14.71875 69.140625 \n", | |
| "Q 20.953125 74.21875 31.78125 74.21875 \n", | |
| "Q 42.671875 74.21875 48.875 69.140625 \n", | |
| "Q 55.078125 64.0625 55.078125 55.328125 \n", | |
| "Q 55.078125 49.078125 51.53125 44.71875 \n", | |
| "Q 48 40.375 41.703125 38.8125 \n", | |
| "Q 48.828125 37.15625 52.796875 32.3125 \n", | |
| "Q 56.78125 27.484375 56.78125 20.515625 \n", | |
| "Q 56.78125 9.90625 50.3125 4.234375 \n", | |
| "Q 43.84375 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.734375 -1.421875 13.25 4.234375 \n", | |
| "Q 6.78125 9.90625 6.78125 20.515625 \n", | |
| "Q 6.78125 27.484375 10.78125 32.3125 \n", | |
| "Q 14.796875 37.15625 21.921875 38.8125 \n", | |
| "z\n", | |
| "M 18.3125 54.390625 \n", | |
| "Q 18.3125 48.734375 21.84375 45.5625 \n", | |
| "Q 25.390625 42.390625 31.78125 42.390625 \n", | |
| "Q 38.140625 42.390625 41.71875 45.5625 \n", | |
| "Q 45.3125 48.734375 45.3125 54.390625 \n", | |
| "Q 45.3125 60.0625 41.71875 63.234375 \n", | |
| "Q 38.140625 66.40625 31.78125 66.40625 \n", | |
| "Q 25.390625 66.40625 21.84375 63.234375 \n", | |
| "Q 18.3125 60.0625 18.3125 54.390625 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(116.988053 270.985194)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-56 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(178.720388 275.484161)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(242.702206 275.484161)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-50 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
| "L 12.890625 25.390625 \n", | |
| "L 37.796875 25.390625 \n", | |
| "z\n", | |
| "M 35.203125 72.90625 \n", | |
| "L 47.609375 72.90625 \n", | |
| "L 47.609375 25.390625 \n", | |
| "L 58.015625 25.390625 \n", | |
| "L 58.015625 17.1875 \n", | |
| "L 47.609375 17.1875 \n", | |
| "L 47.609375 0 \n", | |
| "L 37.796875 0 \n", | |
| "L 37.796875 17.1875 \n", | |
| "L 4.890625 17.1875 \n", | |
| "L 4.890625 26.703125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(306.684024 275.484161)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-52 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
| "Q 26.375 40.375 22.484375 35.828125 \n", | |
| "Q 18.609375 31.296875 18.609375 23.390625 \n", | |
| "Q 18.609375 15.53125 22.484375 10.953125 \n", | |
| "Q 26.375 6.390625 33.015625 6.390625 \n", | |
| "Q 39.65625 6.390625 43.53125 10.953125 \n", | |
| "Q 47.40625 15.53125 47.40625 23.390625 \n", | |
| "Q 47.40625 31.296875 43.53125 35.828125 \n", | |
| "Q 39.65625 40.375 33.015625 40.375 \n", | |
| "z\n", | |
| "M 52.59375 71.296875 \n", | |
| "L 52.59375 62.3125 \n", | |
| "Q 48.875 64.0625 45.09375 64.984375 \n", | |
| "Q 41.3125 65.921875 37.59375 65.921875 \n", | |
| "Q 27.828125 65.921875 22.671875 59.328125 \n", | |
| "Q 17.53125 52.734375 16.796875 39.40625 \n", | |
| "Q 19.671875 43.65625 24.015625 45.921875 \n", | |
| "Q 28.375 48.1875 33.59375 48.1875 \n", | |
| "Q 44.578125 48.1875 50.953125 41.515625 \n", | |
| "Q 57.328125 34.859375 57.328125 23.390625 \n", | |
| "Q 57.328125 12.15625 50.6875 5.359375 \n", | |
| "Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
| "Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
| "Q 6.984375 17.96875 6.984375 36.375 \n", | |
| "Q 6.984375 53.65625 15.1875 63.9375 \n", | |
| "Q 23.390625 74.21875 37.203125 74.21875 \n", | |
| "Q 40.921875 74.21875 44.703125 73.484375 \n", | |
| "Q 48.484375 72.75 52.59375 71.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(370.665842 275.484161)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-54 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_6><g style=fill:#262626; transform="translate(49.9375 251.912539)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_7><g style=fill:#262626; transform="translate(30.85 214.275123)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_3><g id=text_8><g style=fill:#262626; transform="translate(30.85 176.637706)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_9><g style=fill:#262626; transform="translate(30.85 139.00029)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-54 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_5><g id=text_10><g style=fill:#262626; transform="translate(30.85 101.362873)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-56 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_6><g id=text_11><g style=fill:#262626; transform="translate(24.4875 63.725457)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_7><g id=text_12><g style=fill:#262626; transform="translate(24.4875 26.08804)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-50 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_13><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
| "L 51.703125 72.90625 \n", | |
| "L 51.703125 64.59375 \n", | |
| "L 19.671875 64.59375 \n", | |
| "L 19.671875 43.109375 \n", | |
| "L 48.578125 43.109375 \n", | |
| "L 48.578125 34.8125 \n", | |
| "L 19.671875 34.8125 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
| "Q 39.59375 47.171875 37.8125 47.578125 \n", | |
| "Q 36.03125 48 33.890625 48 \n", | |
| "Q 26.265625 48 22.1875 43.046875 \n", | |
| "Q 18.109375 38.09375 18.109375 28.8125 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 20.953125 51.171875 25.484375 53.578125 \n", | |
| "Q 30.03125 56 36.53125 56 \n", | |
| "Q 37.453125 56 38.578125 55.875 \n", | |
| "Q 39.703125 55.765625 41.0625 55.515625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
| "L 56.203125 25.203125 \n", | |
| "L 14.890625 25.203125 \n", | |
| "Q 15.484375 15.921875 20.484375 11.0625 \n", | |
| "Q 25.484375 6.203125 34.421875 6.203125 \n", | |
| "Q 39.59375 6.203125 44.453125 7.46875 \n", | |
| "Q 49.3125 8.734375 54.109375 11.28125 \n", | |
| "L 54.109375 2.78125 \n", | |
| "Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
| "Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
| "Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
| "Q 5.515625 13.8125 5.515625 26.8125 \n", | |
| "Q 5.515625 40.234375 12.765625 48.109375 \n", | |
| "Q 20.015625 56 32.328125 56 \n", | |
| "Q 43.359375 56 49.78125 48.890625 \n", | |
| "Q 56.203125 41.796875 56.203125 29.59375 \n", | |
| "z\n", | |
| "M 47.21875 32.234375 \n", | |
| "Q 47.125 39.59375 43.09375 43.984375 \n", | |
| "Q 39.0625 48.390625 32.421875 48.390625 \n", | |
| "Q 24.90625 48.390625 20.390625 44.140625 \n", | |
| "Q 15.875 39.890625 15.1875 32.171875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
| "Q 14.796875 17.390625 18.875 11.75 \n", | |
| "Q 22.953125 6.109375 30.078125 6.109375 \n", | |
| "Q 37.203125 6.109375 41.296875 11.75 \n", | |
| "Q 45.40625 17.390625 45.40625 27.296875 \n", | |
| "Q 45.40625 37.203125 41.296875 42.84375 \n", | |
| "Q 37.203125 48.484375 30.078125 48.484375 \n", | |
| "Q 22.953125 48.484375 18.875 42.84375 \n", | |
| "Q 14.796875 37.203125 14.796875 27.296875 \n", | |
| "z\n", | |
| "M 45.40625 8.203125 \n", | |
| "Q 42.578125 3.328125 38.25 0.953125 \n", | |
| "Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
| "Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
| "Q 5.515625 14.40625 5.515625 27.296875 \n", | |
| "Q 5.515625 40.1875 11.734375 48.09375 \n", | |
| "Q 17.96875 56 27.875 56 \n", | |
| "Q 33.9375 56 38.25 53.625 \n", | |
| "Q 42.578125 51.265625 45.40625 46.390625 \n", | |
| "L 45.40625 54.6875 \n", | |
| "L 54.390625 54.6875 \n", | |
| "L 54.390625 -20.796875 \n", | |
| "L 45.40625 -20.796875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
| "L 8.5 54.6875 \n", | |
| "L 17.484375 54.6875 \n", | |
| "L 17.484375 21.921875 \n", | |
| "Q 17.484375 14.15625 20.5 10.265625 \n", | |
| "Q 23.53125 6.390625 29.59375 6.390625 \n", | |
| "Q 36.859375 6.390625 41.078125 11.03125 \n", | |
| "Q 45.3125 15.671875 45.3125 23.6875 \n", | |
| "L 45.3125 54.6875 \n", | |
| "L 54.296875 54.6875 \n", | |
| "L 54.296875 0 \n", | |
| "L 45.3125 0 \n", | |
| "L 45.3125 8.40625 \n", | |
| "Q 42.046875 3.421875 37.71875 1 \n", | |
| "Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
| "Q 18.265625 -1.421875 13.375 4.4375 \n", | |
| "Q 8.5 10.296875 8.5 21.578125 \n", | |
| "z\n", | |
| "M 31.109375 56 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
| "L 54.890625 0 \n", | |
| "L 45.90625 0 \n", | |
| "L 45.90625 32.71875 \n", | |
| "Q 45.90625 40.484375 42.875 44.328125 \n", | |
| "Q 39.84375 48.1875 33.796875 48.1875 \n", | |
| "Q 26.515625 48.1875 22.3125 43.546875 \n", | |
| "Q 18.109375 38.921875 18.109375 30.90625 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 21.34375 51.125 25.703125 53.5625 \n", | |
| "Q 30.078125 56 35.796875 56 \n", | |
| "Q 45.21875 56 50.046875 50.171875 \n", | |
| "Q 54.890625 44.34375 54.890625 33.015625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
| "L 48.78125 44.1875 \n", | |
| "Q 44.96875 46.296875 41.140625 47.34375 \n", | |
| "Q 37.3125 48.390625 33.40625 48.390625 \n", | |
| "Q 24.65625 48.390625 19.8125 42.84375 \n", | |
| "Q 14.984375 37.3125 14.984375 27.296875 \n", | |
| "Q 14.984375 17.28125 19.8125 11.734375 \n", | |
| "Q 24.65625 6.203125 33.40625 6.203125 \n", | |
| "Q 37.3125 6.203125 41.140625 7.25 \n", | |
| "Q 44.96875 8.296875 48.78125 10.40625 \n", | |
| "L 48.78125 2.09375 \n", | |
| "Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
| "Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
| "Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
| "Q 5.515625 14.109375 5.515625 27.296875 \n", | |
| "Q 5.515625 40.671875 12.859375 48.328125 \n", | |
| "Q 20.21875 56 33.015625 56 \n", | |
| "Q 37.15625 56 41.109375 55.140625 \n", | |
| "Q 45.0625 54.296875 48.78125 52.59375 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
| "Q 28.375 -14.84375 24.75 -17.8125 \n", | |
| "Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
| "L 7.90625 -20.796875 \n", | |
| "L 7.90625 -13.28125 \n", | |
| "L 13.1875 -13.28125 \n", | |
| "Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
| "Q 21 -9.765625 23.484375 -3.21875 \n", | |
| "L 25.09375 0.875 \n", | |
| "L 2.984375 54.6875 \n", | |
| "L 12.5 54.6875 \n", | |
| "L 29.59375 11.921875 \n", | |
| "L 46.6875 54.6875 \n", | |
| "L 56.203125 54.6875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(18.199844 157.869317)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#pccac53d30c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 85.295455 248.113321 \n", | |
| "L 149.277273 248.113321 \n", | |
| "L 149.277273 22.100634 \n", | |
| "L 85.295455 22.100634 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#pccac53d30c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 149.277273 248.113321 \n", | |
| "L 213.259091 248.113321 \n", | |
| "L 213.259091 162.977484 \n", | |
| "L 149.277273 162.977484 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#pccac53d30c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 213.259091 248.113321 \n", | |
| "L 277.240909 248.113321 \n", | |
| "L 277.240909 248.113321 \n", | |
| "L 213.259091 248.113321 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#pccac53d30c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 277.240909 248.113321 \n", | |
| "L 341.222727 248.113321 \n", | |
| "L 341.222727 248.113321 \n", | |
| "L 277.240909 248.113321 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#pccac53d30c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 341.222727 248.113321 \n", | |
| "L 405.204545 248.113321 \n", | |
| "L 405.204545 130.853949 \n", | |
| "L 341.222727 130.853949 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path style=fill:none; d="M 69.3 248.113321 \n", | |
| "L 69.3 10.8 \n", | |
| ""/></g><g id=patch_9><path style=fill:none; d="M 421.2 248.113321 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g><g id=patch_10><path style=fill:none; d="M 69.3 248.113321 \n", | |
| "L 421.2 248.113321 \n", | |
| ""/></g><g id=patch_11><path style=fill:none; d="M 69.3 10.8 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=pccac53d30c><rect height=237.313321 width=351.9 x=69.3 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"> Histogram of lengths of the category </div></div><div class=col-sm-4><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=289.1268pt version=1.1 viewbox="0 0 405 289.1268" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 289.1268 \n", | |
| "L 405 289.1268 \n", | |
| "L 405 -0 \n", | |
| "L 0 -0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#p54d9efa18e) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
| "L 84.82242 106.86 \n", | |
| "L 84.82242 16.26 \n", | |
| "L 7.2 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_3><path clip-path=url(#p54d9efa18e) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 84.82242 106.86 \n", | |
| "L 156.628307 106.86 \n", | |
| "L 156.628307 16.26 \n", | |
| "L 84.82242 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#p54d9efa18e) style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 156.628307 106.86 \n", | |
| "L 224.607977 106.86 \n", | |
| "L 224.607977 16.26 \n", | |
| "L 156.628307 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#p54d9efa18e) style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 224.607977 106.86 \n", | |
| "L 290.889014 106.86 \n", | |
| "L 290.889014 16.26 \n", | |
| "L 224.607977 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#p54d9efa18e) style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 290.889014 106.86 \n", | |
| "L 353.686993 106.86 \n", | |
| "L 353.686993 16.26 \n", | |
| "L 290.889014 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#p54d9efa18e) style=fill:#937860;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 353.686993 106.86 \n", | |
| "L 397.8 106.86 \n", | |
| "L 397.8 16.26 \n", | |
| "L 353.686993 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=legend_1><g id=patch_8><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 281.9268 \n", | |
| "L 263.7729 281.9268 \n", | |
| "Q 267.2289 281.9268 267.2289 278.4708 \n", | |
| "L 267.2289 128.016 \n", | |
| "Q 267.2289 124.56 263.7729 124.56 \n", | |
| "L 19.296 124.56 \n", | |
| "Q 15.84 124.56 15.84 128.016 \n", | |
| "L 15.84 278.4708 \n", | |
| "Q 15.84 281.9268 19.296 281.9268 \n", | |
| "z\n", | |
| ""/></g><g id=patch_9><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
| "L 57.312 144.6021 \n", | |
| "L 57.312 132.5061 \n", | |
| "L 22.752 132.5061 \n", | |
| "z\n", | |
| ""/></g><g id=text_1><defs><path id=DejaVuSans-69 d="M 9.8125 72.90625 \n", | |
| "L 55.90625 72.90625 \n", | |
| "L 55.90625 64.59375 \n", | |
| "L 19.671875 64.59375 \n", | |
| "L 19.671875 43.015625 \n", | |
| "L 54.390625 43.015625 \n", | |
| "L 54.390625 34.71875 \n", | |
| "L 19.671875 34.71875 \n", | |
| "L 19.671875 8.296875 \n", | |
| "L 56.78125 8.296875 \n", | |
| "L 56.78125 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-68 d="M 19.671875 64.796875 \n", | |
| "L 19.671875 8.109375 \n", | |
| "L 31.59375 8.109375 \n", | |
| "Q 46.6875 8.109375 53.6875 14.9375 \n", | |
| "Q 60.6875 21.78125 60.6875 36.53125 \n", | |
| "Q 60.6875 51.171875 53.6875 57.984375 \n", | |
| "Q 46.6875 64.796875 31.59375 64.796875 \n", | |
| "z\n", | |
| "M 9.8125 72.90625 \n", | |
| "L 30.078125 72.90625 \n", | |
| "Q 51.265625 72.90625 61.171875 64.09375 \n", | |
| "Q 71.09375 55.28125 71.09375 36.53125 \n", | |
| "Q 71.09375 17.671875 61.125 8.828125 \n", | |
| "Q 51.171875 0 30.078125 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-85 d="M 8.6875 72.90625 \n", | |
| "L 18.609375 72.90625 \n", | |
| "L 18.609375 28.609375 \n", | |
| "Q 18.609375 16.890625 22.84375 11.734375 \n", | |
| "Q 27.09375 6.59375 36.625 6.59375 \n", | |
| "Q 46.09375 6.59375 50.34375 11.734375 \n", | |
| "Q 54.59375 16.890625 54.59375 28.609375 \n", | |
| "L 54.59375 72.90625 \n", | |
| "L 64.5 72.90625 \n", | |
| "L 64.5 27.390625 \n", | |
| "Q 64.5 13.140625 57.4375 5.859375 \n", | |
| "Q 50.390625 -1.421875 36.625 -1.421875 \n", | |
| "Q 22.796875 -1.421875 15.734375 5.859375 \n", | |
| "Q 8.6875 13.140625 8.6875 27.390625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-67 d="M 64.40625 67.28125 \n", | |
| "L 64.40625 56.890625 \n", | |
| "Q 59.421875 61.53125 53.78125 63.8125 \n", | |
| "Q 48.140625 66.109375 41.796875 66.109375 \n", | |
| "Q 29.296875 66.109375 22.65625 58.46875 \n", | |
| "Q 16.015625 50.828125 16.015625 36.375 \n", | |
| "Q 16.015625 21.96875 22.65625 14.328125 \n", | |
| "Q 29.296875 6.6875 41.796875 6.6875 \n", | |
| "Q 48.140625 6.6875 53.78125 8.984375 \n", | |
| "Q 59.421875 11.28125 64.40625 15.921875 \n", | |
| "L 64.40625 5.609375 \n", | |
| "Q 59.234375 2.09375 53.4375 0.328125 \n", | |
| "Q 47.65625 -1.421875 41.21875 -1.421875 \n", | |
| "Q 24.65625 -1.421875 15.125 8.703125 \n", | |
| "Q 5.609375 18.84375 5.609375 36.375 \n", | |
| "Q 5.609375 53.953125 15.125 64.078125 \n", | |
| "Q 24.65625 74.21875 41.21875 74.21875 \n", | |
| "Q 47.75 74.21875 53.53125 72.484375 \n", | |
| "Q 59.328125 70.75 64.40625 67.28125 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-65 d="M 34.1875 63.1875 \n", | |
| "L 20.796875 26.90625 \n", | |
| "L 47.609375 26.90625 \n", | |
| "z\n", | |
| "M 28.609375 72.90625 \n", | |
| "L 39.796875 72.90625 \n", | |
| "L 67.578125 0 \n", | |
| "L 57.328125 0 \n", | |
| "L 50.6875 18.703125 \n", | |
| "L 17.828125 18.703125 \n", | |
| "L 11.1875 0 \n", | |
| "L 0.78125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-84 d="M -0.296875 72.90625 \n", | |
| "L 61.375 72.90625 \n", | |
| "L 61.375 64.59375 \n", | |
| "L 35.5 64.59375 \n", | |
| "L 35.5 0 \n", | |
| "L 25.59375 0 \n", | |
| "L 25.59375 64.59375 \n", | |
| "L -0.296875 64.59375 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-73 d="M 9.8125 72.90625 \n", | |
| "L 19.671875 72.90625 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-79 d="M 39.40625 66.21875 \n", | |
| "Q 28.65625 66.21875 22.328125 58.203125 \n", | |
| "Q 16.015625 50.203125 16.015625 36.375 \n", | |
| "Q 16.015625 22.609375 22.328125 14.59375 \n", | |
| "Q 28.65625 6.59375 39.40625 6.59375 \n", | |
| "Q 50.140625 6.59375 56.421875 14.59375 \n", | |
| "Q 62.703125 22.609375 62.703125 36.375 \n", | |
| "Q 62.703125 50.203125 56.421875 58.203125 \n", | |
| "Q 50.140625 66.21875 39.40625 66.21875 \n", | |
| "z\n", | |
| "M 39.40625 74.21875 \n", | |
| "Q 54.734375 74.21875 63.90625 63.9375 \n", | |
| "Q 73.09375 53.65625 73.09375 36.375 \n", | |
| "Q 73.09375 19.140625 63.90625 8.859375 \n", | |
| "Q 54.734375 -1.421875 39.40625 -1.421875 \n", | |
| "Q 24.03125 -1.421875 14.8125 8.828125 \n", | |
| "Q 5.609375 19.09375 5.609375 36.375 \n", | |
| "Q 5.609375 53.65625 14.8125 63.9375 \n", | |
| "Q 24.03125 74.21875 39.40625 74.21875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-78 d="M 9.8125 72.90625 \n", | |
| "L 23.09375 72.90625 \n", | |
| "L 55.421875 11.921875 \n", | |
| "L 55.421875 72.90625 \n", | |
| "L 64.984375 72.90625 \n", | |
| "L 64.984375 0 \n", | |
| "L 51.703125 0 \n", | |
| "L 19.390625 60.984375 \n", | |
| "L 19.390625 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-69 /><use x=63.183594 xlink:href=#DejaVuSans-68 /><use x=140.185547 xlink:href=#DejaVuSans-85 /><use x=213.378906 xlink:href=#DejaVuSans-67 /><use x=283.203125 xlink:href=#DejaVuSans-65 /><use x=343.861328 xlink:href=#DejaVuSans-84 /><use x=404.945312 xlink:href=#DejaVuSans-73 /><use x=434.4375 xlink:href=#DejaVuSans-79 /><use x=513.148438 xlink:href=#DejaVuSans-78 /></g></g><g id=patch_10><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
| "L 57.312 169.9659 \n", | |
| "L 57.312 157.8699 \n", | |
| "L 22.752 157.8699 \n", | |
| "z\n", | |
| ""/></g><g id=text_2><defs><path id=DejaVuSans-77 d="M 9.8125 72.90625 \n", | |
| "L 24.515625 72.90625 \n", | |
| "L 43.109375 23.296875 \n", | |
| "L 61.8125 72.90625 \n", | |
| "L 76.515625 72.90625 \n", | |
| "L 76.515625 0 \n", | |
| "L 66.890625 0 \n", | |
| "L 66.890625 64.015625 \n", | |
| "L 48.09375 14.015625 \n", | |
| "L 38.1875 14.015625 \n", | |
| "L 19.390625 64.015625 \n", | |
| "L 19.390625 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-76 d="M 9.8125 72.90625 \n", | |
| "L 19.671875 72.90625 \n", | |
| "L 19.671875 8.296875 \n", | |
| "L 55.171875 8.296875 \n", | |
| "L 55.171875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-77 /><use x=86.279297 xlink:href=#DejaVuSans-69 /><use x=149.462891 xlink:href=#DejaVuSans-68 /><use x=226.464844 xlink:href=#DejaVuSans-73 /><use x=255.957031 xlink:href=#DejaVuSans-67 /><use x=325.78125 xlink:href=#DejaVuSans-65 /><use x=394.189453 xlink:href=#DejaVuSans-76 /></g></g><g id=patch_11><path style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 195.3297 \n", | |
| "L 57.312 195.3297 \n", | |
| "L 57.312 183.2337 \n", | |
| "L 22.752 183.2337 \n", | |
| "z\n", | |
| ""/></g><g id=text_3><defs><path id=DejaVuSans-86 d="M 28.609375 0 \n", | |
| "L 0.78125 72.90625 \n", | |
| "L 11.078125 72.90625 \n", | |
| "L 34.1875 11.53125 \n", | |
| "L 57.328125 72.90625 \n", | |
| "L 67.578125 72.90625 \n", | |
| "L 39.796875 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-82 d="M 44.390625 34.1875 \n", | |
| "Q 47.5625 33.109375 50.5625 29.59375 \n", | |
| "Q 53.5625 26.078125 56.59375 19.921875 \n", | |
| "L 66.609375 0 \n", | |
| "L 56 0 \n", | |
| "L 46.6875 18.703125 \n", | |
| "Q 43.0625 26.03125 39.671875 28.421875 \n", | |
| "Q 36.28125 30.8125 30.421875 30.8125 \n", | |
| "L 19.671875 30.8125 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "L 9.8125 72.90625 \n", | |
| "L 32.078125 72.90625 \n", | |
| "Q 44.578125 72.90625 50.734375 67.671875 \n", | |
| "Q 56.890625 62.453125 56.890625 51.90625 \n", | |
| "Q 56.890625 45.015625 53.6875 40.46875 \n", | |
| "Q 50.484375 35.9375 44.390625 34.1875 \n", | |
| "z\n", | |
| "M 19.671875 64.796875 \n", | |
| "L 19.671875 38.921875 \n", | |
| "L 32.078125 38.921875 \n", | |
| "Q 39.203125 38.921875 42.84375 42.21875 \n", | |
| "Q 46.484375 45.515625 46.484375 51.90625 \n", | |
| "Q 46.484375 58.296875 42.84375 61.546875 \n", | |
| "Q 39.203125 64.796875 32.078125 64.796875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 195.3297)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-86 /><use x=68.408203 xlink:href=#DejaVuSans-69 /><use x=131.591797 xlink:href=#DejaVuSans-78 /><use x=206.396484 xlink:href=#DejaVuSans-84 /><use x=267.480469 xlink:href=#DejaVuSans-85 /><use x=340.673828 xlink:href=#DejaVuSans-82 /><use x=410.15625 xlink:href=#DejaVuSans-69 /></g></g><g id=patch_12><path style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 220.6935 \n", | |
| "L 57.312 220.6935 \n", | |
| "L 57.312 208.5975 \n", | |
| "L 22.752 208.5975 \n", | |
| "z\n", | |
| ""/></g><g id=text_4><defs><path id=DejaVuSans-80 d="M 19.671875 64.796875 \n", | |
| "L 19.671875 37.40625 \n", | |
| "L 32.078125 37.40625 \n", | |
| "Q 38.96875 37.40625 42.71875 40.96875 \n", | |
| "Q 46.484375 44.53125 46.484375 51.125 \n", | |
| "Q 46.484375 57.671875 42.71875 61.234375 \n", | |
| "Q 38.96875 64.796875 32.078125 64.796875 \n", | |
| "z\n", | |
| "M 9.8125 72.90625 \n", | |
| "L 32.078125 72.90625 \n", | |
| "Q 44.34375 72.90625 50.609375 67.359375 \n", | |
| "Q 56.890625 61.8125 56.890625 51.125 \n", | |
| "Q 56.890625 40.328125 50.609375 34.8125 \n", | |
| "Q 44.34375 29.296875 32.078125 29.296875 \n", | |
| "L 19.671875 29.296875 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-83 d="M 53.515625 70.515625 \n", | |
| "L 53.515625 60.890625 \n", | |
| "Q 47.90625 63.578125 42.921875 64.890625 \n", | |
| "Q 37.9375 66.21875 33.296875 66.21875 \n", | |
| "Q 25.25 66.21875 20.875 63.09375 \n", | |
| "Q 16.5 59.96875 16.5 54.203125 \n", | |
| "Q 16.5 49.359375 19.40625 46.890625 \n", | |
| "Q 22.3125 44.4375 30.421875 42.921875 \n", | |
| "L 36.375 41.703125 \n", | |
| "Q 47.40625 39.59375 52.65625 34.296875 \n", | |
| "Q 57.90625 29 57.90625 20.125 \n", | |
| "Q 57.90625 9.515625 50.796875 4.046875 \n", | |
| "Q 43.703125 -1.421875 29.984375 -1.421875 \n", | |
| "Q 24.8125 -1.421875 18.96875 -0.25 \n", | |
| "Q 13.140625 0.921875 6.890625 3.21875 \n", | |
| "L 6.890625 13.375 \n", | |
| "Q 12.890625 10.015625 18.65625 8.296875 \n", | |
| "Q 24.421875 6.59375 29.984375 6.59375 \n", | |
| "Q 38.421875 6.59375 43.015625 9.90625 \n", | |
| "Q 47.609375 13.234375 47.609375 19.390625 \n", | |
| "Q 47.609375 24.75 44.3125 27.78125 \n", | |
| "Q 41.015625 30.8125 33.5 32.328125 \n", | |
| "L 27.484375 33.5 \n", | |
| "Q 16.453125 35.6875 11.515625 40.375 \n", | |
| "Q 6.59375 45.0625 6.59375 53.421875 \n", | |
| "Q 6.59375 63.09375 13.40625 68.65625 \n", | |
| "Q 20.21875 74.21875 32.171875 74.21875 \n", | |
| "Q 37.3125 74.21875 42.625 73.28125 \n", | |
| "Q 47.953125 72.359375 53.515625 70.515625 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 220.6935)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-80 /><use x=60.302734 xlink:href=#DejaVuSans-69 /><use x=123.486328 xlink:href=#DejaVuSans-82 /><use x=192.96875 xlink:href=#DejaVuSans-83 /><use x=256.445312 xlink:href=#DejaVuSans-79 /><use x=335.15625 xlink:href=#DejaVuSans-78 /><use x=409.960938 xlink:href=#DejaVuSans-65 /><use x=478.369141 xlink:href=#DejaVuSans-76 /></g></g><g id=patch_13><path style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 246.0573 \n", | |
| "L 57.312 246.0573 \n", | |
| "L 57.312 233.9613 \n", | |
| "L 22.752 233.9613 \n", | |
| "z\n", | |
| ""/></g><g id=text_5><defs><path id=DejaVuSans-66 d="M 19.671875 34.8125 \n", | |
| "L 19.671875 8.109375 \n", | |
| "L 35.5 8.109375 \n", | |
| "Q 43.453125 8.109375 47.28125 11.40625 \n", | |
| "Q 51.125 14.703125 51.125 21.484375 \n", | |
| "Q 51.125 28.328125 47.28125 31.5625 \n", | |
| "Q 43.453125 34.8125 35.5 34.8125 \n", | |
| "z\n", | |
| "M 19.671875 64.796875 \n", | |
| "L 19.671875 42.828125 \n", | |
| "L 34.28125 42.828125 \n", | |
| "Q 41.5 42.828125 45.03125 45.53125 \n", | |
| "Q 48.578125 48.25 48.578125 53.8125 \n", | |
| "Q 48.578125 59.328125 45.03125 62.0625 \n", | |
| "Q 41.5 64.796875 34.28125 64.796875 \n", | |
| "z\n", | |
| "M 9.8125 72.90625 \n", | |
| "L 35.015625 72.90625 \n", | |
| "Q 46.296875 72.90625 52.390625 68.21875 \n", | |
| "Q 58.5 63.53125 58.5 54.890625 \n", | |
| "Q 58.5 48.1875 55.375 44.234375 \n", | |
| "Q 52.25 40.28125 46.1875 39.3125 \n", | |
| "Q 53.46875 37.75 57.5 32.78125 \n", | |
| "Q 61.53125 27.828125 61.53125 20.40625 \n", | |
| "Q 61.53125 10.640625 54.890625 5.3125 \n", | |
| "Q 48.25 0 35.984375 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 246.0573)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-68 /><use x=77.001953 xlink:href=#DejaVuSans-69 /><use x=140.185547 xlink:href=#DejaVuSans-66 /><use x=208.789062 xlink:href=#DejaVuSans-84 /><use x=263.998047 xlink:href=#DejaVuSans-67 /><use x=333.822266 xlink:href=#DejaVuSans-79 /><use x=412.533203 xlink:href=#DejaVuSans-78 /><use x=487.337891 xlink:href=#DejaVuSans-83 /><use x=550.814453 xlink:href=#DejaVuSans-79 /><use x=629.525391 xlink:href=#DejaVuSans-76 /><use x=685.238281 xlink:href=#DejaVuSans-73 /><use x=714.730469 xlink:href=#DejaVuSans-68 /><use x=789.982422 xlink:href=#DejaVuSans-65 /><use x=850.640625 xlink:href=#DejaVuSans-84 /><use x=911.724609 xlink:href=#DejaVuSans-73 /><use x=941.216797 xlink:href=#DejaVuSans-79 /><use x=1019.927734 xlink:href=#DejaVuSans-78 /></g></g><g id=patch_14><path style=fill:#937860;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 271.4211 \n", | |
| "L 57.312 271.4211 \n", | |
| "L 57.312 259.3251 \n", | |
| "L 22.752 259.3251 \n", | |
| "z\n", | |
| ""/></g><g id=text_6><defs><path id=DejaVuSans-72 d="M 9.8125 72.90625 \n", | |
| "L 19.671875 72.90625 \n", | |
| "L 19.671875 43.015625 \n", | |
| "L 55.515625 43.015625 \n", | |
| "L 55.515625 72.90625 \n", | |
| "L 65.375 72.90625 \n", | |
| "L 65.375 0 \n", | |
| "L 55.515625 0 \n", | |
| "L 55.515625 34.71875 \n", | |
| "L 19.671875 34.71875 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 271.4211)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-72 /><use x=75.195312 xlink:href=#DejaVuSans-79 /><use x=153.90625 xlink:href=#DejaVuSans-77 /><use x=240.185547 xlink:href=#DejaVuSans-69 /><use x=303.369141 xlink:href=#DejaVuSans-73 /><use x=332.861328 xlink:href=#DejaVuSans-77 /><use x=419.140625 xlink:href=#DejaVuSans-80 /><use x=479.443359 xlink:href=#DejaVuSans-82 /><use x=548.925781 xlink:href=#DejaVuSans-79 /><use x=625.886719 xlink:href=#DejaVuSans-86 /><use x=694.294922 xlink:href=#DejaVuSans-69 /><use x=757.478516 xlink:href=#DejaVuSans-77 /><use x=843.757812 xlink:href=#DejaVuSans-69 /><use x=906.941406 xlink:href=#DejaVuSans-78 /><use x=981.746094 xlink:href=#DejaVuSans-84 /></g></g></g></g></g><defs><clippath id=p54d9efa18e><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=213319925741214013bottom-213319925741214013word><div class=col-sm-12><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=education>education</td><td>4524</td><td><div class=bar style=width:100.0%> 19.9% </div></td></tr><tr class><td title=medical>medical</td><td>4185</td><td><div class=bar style=width:92.5%> 18.4% </div></td></tr><tr class><td title=venture>venture</td><td>3962</td><td><div class=bar style=width:87.6%> 17.4% </div></td></tr><tr class><td title=personal>personal</td><td>3863</td><td><div class=bar style=width:85.4%> 17.0% </div></td></tr><tr class><td title=debtconsolidation>debtconsolidation</td><td>3660</td><td><div class=bar style=width:80.9%> 16.1% </div></td></tr><tr class><td title=homeimprovement>homeimprovement</td><td>2571</td><td><div class=bar style=width:56.8%> 11.3% </div></td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=213319925741214013bottom-213319925741214013characters><div class=col-sm-12><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#213319925741214013unicode-213319925741214013characters aria-controls=213319925741214013unicode-213319925741214013characters role=tab data-toggle=tab>Characters</a></li><li role=presentation><a href=#213319925741214013unicode-213319925741214013categories aria-controls=213319925741214013unicode-213319925741214013categories role=tab data-toggle=tab>Categories</a></li><li role=presentation><a href=#213319925741214013unicode-213319925741214013scripts aria-controls=213319925741214013unicode-213319925741214013scripts role=tab data-toggle=tab>Scripts</a></li><li role=presentation><a href=#213319925741214013unicode-213319925741214013blocks aria-controls=213319925741214013unicode-213319925741214013blocks role=tab data-toggle=tab>Blocks</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=213319925741214013unicode-213319925741214013characters><div class="row named-list-item"><h4>Most occurring characters</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=E>E</td><td>31869</td><td><div class=bar style=width:69.9%> 13.9% </div></td></tr><tr class><td title=O>O</td><td>24509</td><td><div class=bar style=width:53.7%> 10.7% </div></td></tr><tr class><td title=N>N</td><td>22240</td><td><div class=bar style=width:48.8%> 9.7% </div></td></tr><tr class><td title=I>I</td><td>18600</td><td><div class=bar style=width:40.8%> 8.1% </div></td></tr><tr class><td title=T>T</td><td>18377</td><td><div class=bar style=width:40.3%> 8.0% </div></td></tr><tr class><td title=A>A</td><td>16232</td><td><div class=bar style=width:35.6%> &nbsp; </div> 7.1% </td></tr><tr class><td title=D>D</td><td>16029</td><td><div class=bar style=width:35.1%> &nbsp; </div> 7.0% </td></tr><tr class><td title=C>C</td><td>12369</td><td><div class=bar style=width:27.1%> &nbsp; </div> 5.4% </td></tr><tr class><td title=M>M</td><td>11898</td><td><div class=bar style=width:26.1%> &nbsp; </div> 5.2% </td></tr><tr class><td title=L>L</td><td>11708</td><td><div class=bar style=width:25.7%> &nbsp; </div> 5.1% </td></tr><tr class=other><td title="Other values (7)">Other values (7)</td><td>45603</td><td><div class=bar style=width:100.0%> 19.9% </div></td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=213319925741214013unicode-213319925741214013categories><div class="row named-list-item"><h4>Most occurring categories</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title="Uppercase Letter">Uppercase Letter</td><td>229434</td><td><div class=bar style=width:100.0%> 100.0% </div></td></tr></tbody></table></div><div class="row named-list-item"><h4>Most frequent character per category</h4><div class=row><div class=col-sm-6><h5><em>Uppercase Letter</em></h5><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=E>E</td><td>31869</td><td><div class=bar style=width:69.9%> 13.9% </div></td></tr><tr class><td title=O>O</td><td>24509</td><td><div class=bar style=width:53.7%> 10.7% </div></td></tr><tr class><td title=N>N</td><td>22240</td><td><div class=bar style=width:48.8%> 9.7% </div></td></tr><tr class><td title=I>I</td><td>18600</td><td><div class=bar style=width:40.8%> 8.1% </div></td></tr><tr class><td title=T>T</td><td>18377</td><td><div class=bar style=width:40.3%> 8.0% </div></td></tr><tr class><td title=A>A</td><td>16232</td><td><div class=bar style=width:35.6%> &nbsp; </div> 7.1% </td></tr><tr class><td title=D>D</td><td>16029</td><td><div class=bar style=width:35.1%> &nbsp; </div> 7.0% </td></tr><tr class><td title=C>C</td><td>12369</td><td><div class=bar style=width:27.1%> &nbsp; </div> 5.4% </td></tr><tr class><td title=M>M</td><td>11898</td><td><div class=bar style=width:26.1%> &nbsp; </div> 5.2% </td></tr><tr class><td title=L>L</td><td>11708</td><td><div class=bar style=width:25.7%> &nbsp; </div> 5.1% </td></tr><tr class=other><td title="Other values (7)">Other values (7)</td><td>45603</td><td><div class=bar style=width:100.0%> 19.9% </div></td></tr></tbody></table></div></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=213319925741214013unicode-213319925741214013scripts><div class="row named-list-item"><h4>Most occurring scripts</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=Latin>Latin</td><td>229434</td><td><div class=bar style=width:100.0%> 100.0% </div></td></tr></tbody></table></div><div class="row named-list-item"><h4>Most frequent character per script</h4><div class=row><div class=col-sm-6><h5><em>Latin</em></h5><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=E>E</td><td>31869</td><td><div class=bar style=width:69.9%> 13.9% </div></td></tr><tr class><td title=O>O</td><td>24509</td><td><div class=bar style=width:53.7%> 10.7% </div></td></tr><tr class><td title=N>N</td><td>22240</td><td><div class=bar style=width:48.8%> 9.7% </div></td></tr><tr class><td title=I>I</td><td>18600</td><td><div class=bar style=width:40.8%> 8.1% </div></td></tr><tr class><td title=T>T</td><td>18377</td><td><div class=bar style=width:40.3%> 8.0% </div></td></tr><tr class><td title=A>A</td><td>16232</td><td><div class=bar style=width:35.6%> &nbsp; </div> 7.1% </td></tr><tr class><td title=D>D</td><td>16029</td><td><div class=bar style=width:35.1%> &nbsp; </div> 7.0% </td></tr><tr class><td title=C>C</td><td>12369</td><td><div class=bar style=width:27.1%> &nbsp; </div> 5.4% </td></tr><tr class><td title=M>M</td><td>11898</td><td><div class=bar style=width:26.1%> &nbsp; </div> 5.2% </td></tr><tr class><td title=L>L</td><td>11708</td><td><div class=bar style=width:25.7%> &nbsp; </div> 5.1% </td></tr><tr class=other><td title="Other values (7)">Other values (7)</td><td>45603</td><td><div class=bar style=width:100.0%> 19.9% </div></td></tr></tbody></table></div></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=213319925741214013unicode-213319925741214013blocks><div class="row named-list-item"><h4>Most occurring blocks</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=ASCII>ASCII</td><td>229434</td><td><div class=bar style=width:100.0%> 100.0% </div></td></tr></tbody></table></div><div class="row named-list-item"><h4>Most frequent character per block</h4><div class=row><div class=col-sm-6><h5><em>ASCII</em></h5><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=E>E</td><td>31869</td><td><div class=bar style=width:69.9%> 13.9% </div></td></tr><tr class><td title=O>O</td><td>24509</td><td><div class=bar style=width:53.7%> 10.7% </div></td></tr><tr class><td title=N>N</td><td>22240</td><td><div class=bar style=width:48.8%> 9.7% </div></td></tr><tr class><td title=I>I</td><td>18600</td><td><div class=bar style=width:40.8%> 8.1% </div></td></tr><tr class><td title=T>T</td><td>18377</td><td><div class=bar style=width:40.3%> 8.0% </div></td></tr><tr class><td title=A>A</td><td>16232</td><td><div class=bar style=width:35.6%> &nbsp; </div> 7.1% </td></tr><tr class><td title=D>D</td><td>16029</td><td><div class=bar style=width:35.1%> &nbsp; </div> 7.0% </td></tr><tr class><td title=C>C</td><td>12369</td><td><div class=bar style=width:27.1%> &nbsp; </div> 5.4% </td></tr><tr class><td title=M>M</td><td>11898</td><td><div class=bar style=width:26.1%> &nbsp; </div> 5.2% </td></tr><tr class><td title=L>L</td><td>11708</td><td><div class=bar style=width:25.7%> &nbsp; </div> 5.1% </td></tr><tr class=other><td title="Other values (7)">Other values (7)</td><td>45603</td><td><div class=bar style=width:100.0%> 19.9% </div></td></tr></tbody></table></div></div></div></div></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_-1844550963840207900></a><div class=variable><div class=col-sm-3><p class=h4 title=loan_grade><a href=#pp_var_-1844550963840207900>loan_grade</a><br><small>Categorical</small></p><code><abbr title="This variable has a high correlation with 2 fields: loan_int_rate, cb_person_default_on_file">HIGH CORRELATION</abbr></code><br><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>7</td></tr><tr><th>Distinct (%)</th><td>< 0.1%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>178.0 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> A </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 7497&nbsp; </div></td></tr><tr class><th width=50%> B </th><td width=50%><div class=bar style=width:97.7% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 7322&nbsp; </div></td></tr><tr class><th width=50%> C </th><td width=50%><div class=bar style=width:60.1% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 4503&nbsp; </div></td></tr><tr class><th width=50%> D </th><td width=50%><div class=bar style=width:34.1% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 2558&nbsp; </div></td></tr><tr class><th width=50%> E </th><td width=50%><div class=bar style=width:9.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 673 </td></tr><tr class=other><th width=50%> Other values (2) </th><td width=50%><div class=bar style=width:2.8% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 212 </td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom--1844550963840207900, #minifreqtable-1844550963840207900" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom--1844550963840207900 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-1844550963840207900bottom--1844550963840207900overview aria-controls=-1844550963840207900bottom--1844550963840207900overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#-1844550963840207900bottom--1844550963840207900string aria-controls=-1844550963840207900bottom--1844550963840207900string role=tab data-toggle=tab>Categories</a></li><li role=presentation><a href=#-1844550963840207900bottom--1844550963840207900word aria-controls=-1844550963840207900bottom--1844550963840207900word role=tab data-toggle=tab>Words</a></li><li role=presentation><a href=#-1844550963840207900bottom--1844550963840207900characters aria-controls=-1844550963840207900bottom--1844550963840207900characters role=tab data-toggle=tab>Characters</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-1844550963840207900bottom--1844550963840207900overview><div class=row><div class=col-sm-3><p class=h4>Length</p><table class="table table-condensed stats"><tbody><tr><th>Max length</th><td>1</td></tr><tr><th>Median length</th><td>1</td></tr><tr><th>Mean length</th><td>1</td></tr><tr><th>Min length</th><td>1</td></tr></tbody></table></div><div class=col-sm-3><p class=h4>Characters and Unicode</p><table class="table table-condensed stats"><tbody><tr><th>Total characters</th><td>22765</td></tr><tr><th>Distinct characters</th><td>7</td></tr><tr><th>Distinct categories</th><td>1 <a title="Unicode categories (click for more information)" href=https://en.wikipedia.org/wiki/Unicode_character_property#General_Category target=_blank><span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="Unicode categories (click for more information)">?</span></a></td></tr><tr><th>Distinct scripts</th><td>1 <a title="Unicode scripts (click for more information)" href=https://en.wikipedia.org/wiki/Script_(Unicode)#List_of_scripts_in_Unicode target=_blank><span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="Unicode scripts (click for more information)">?</span></a></td></tr><tr><th>Distinct blocks</th><td>1 <a title="Unicode blocks (click for more information)" href=https://en.wikipedia.org/wiki/Unicode_block target=_blank><span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="Unicode blocks (click for more information)">?</span></a></td></tr></tbody></table><div class="caption text-center text-muted"> The Unicode Standard assigns character properties to each code point, which can be used to analyse textual variables. </div></div><div class=col-sm-3><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-3><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>D</td></tr><tr><th>2nd row</th><td>B</td></tr><tr><th>3rd row</th><td>C</td></tr><tr><th>4th row</th><td>A</td></tr><tr><th>5th row</th><td>B</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-1844550963840207900bottom--1844550963840207900string><div class=row><div class=col-sm-4><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=A>A</td><td>7497</td><td><div class=bar style=width:100.0%> 32.9% </div></td></tr><tr class><td title=B>B</td><td>7322</td><td><div class=bar style=width:97.7%> 32.2% </div></td></tr><tr class><td title=C>C</td><td>4503</td><td><div class=bar style=width:60.1%> 19.8% </div></td></tr><tr class><td title=D>D</td><td>2558</td><td><div class=bar style=width:34.1%> &nbsp; </div> 11.2% </td></tr><tr class><td title=E>E</td><td>673</td><td><div class=bar style=width:9.0%> &nbsp; </div> 3.0% </td></tr><tr class><td title=F>F</td><td>172</td><td><div class=bar style=width:2.3%> &nbsp; </div> 0.8% </td></tr><tr class><td title=G>G</td><td>40</td><td><div class=bar style=width:0.5%> &nbsp; </div> 0.2% </td></tr></tbody></table></div><div class=col-sm-4><h4>Length</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
| "L 432 288 \n", | |
| "L 432 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 69.3 245.815224 \n", | |
| "L 421.2 245.815224 \n", | |
| "L 421.2 10.8 \n", | |
| "L 69.3 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-46 d="M 10.6875 12.40625 \n", | |
| "L 21 12.40625 \n", | |
| "L 21 0 \n", | |
| "L 10.6875 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
| "Q 26.375 40.375 22.484375 35.828125 \n", | |
| "Q 18.609375 31.296875 18.609375 23.390625 \n", | |
| "Q 18.609375 15.53125 22.484375 10.953125 \n", | |
| "Q 26.375 6.390625 33.015625 6.390625 \n", | |
| "Q 39.65625 6.390625 43.53125 10.953125 \n", | |
| "Q 47.40625 15.53125 47.40625 23.390625 \n", | |
| "Q 47.40625 31.296875 43.53125 35.828125 \n", | |
| "Q 39.65625 40.375 33.015625 40.375 \n", | |
| "z\n", | |
| "M 52.59375 71.296875 \n", | |
| "L 52.59375 62.3125 \n", | |
| "Q 48.875 64.0625 45.09375 64.984375 \n", | |
| "Q 41.3125 65.921875 37.59375 65.921875 \n", | |
| "Q 27.828125 65.921875 22.671875 59.328125 \n", | |
| "Q 17.53125 52.734375 16.796875 39.40625 \n", | |
| "Q 19.671875 43.65625 24.015625 45.921875 \n", | |
| "Q 28.375 48.1875 33.59375 48.1875 \n", | |
| "Q 44.578125 48.1875 50.953125 41.515625 \n", | |
| "Q 57.328125 34.859375 57.328125 23.390625 \n", | |
| "Q 57.328125 12.15625 50.6875 5.359375 \n", | |
| "Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
| "Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
| "Q 6.984375 17.96875 6.984375 36.375 \n", | |
| "Q 6.984375 53.65625 15.1875 63.9375 \n", | |
| "Q 23.390625 74.21875 37.203125 74.21875 \n", | |
| "Q 40.921875 74.21875 44.703125 73.484375 \n", | |
| "Q 48.484375 72.75 52.59375 71.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(113.614933 275.433338)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-54 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-56 d="M 31.78125 34.625 \n", | |
| "Q 24.75 34.625 20.71875 30.859375 \n", | |
| "Q 16.703125 27.09375 16.703125 20.515625 \n", | |
| "Q 16.703125 13.921875 20.71875 10.15625 \n", | |
| "Q 24.75 6.390625 31.78125 6.390625 \n", | |
| "Q 38.8125 6.390625 42.859375 10.171875 \n", | |
| "Q 46.921875 13.96875 46.921875 20.515625 \n", | |
| "Q 46.921875 27.09375 42.890625 30.859375 \n", | |
| "Q 38.875 34.625 31.78125 34.625 \n", | |
| "z\n", | |
| "M 21.921875 38.8125 \n", | |
| "Q 15.578125 40.375 12.03125 44.71875 \n", | |
| "Q 8.5 49.078125 8.5 55.328125 \n", | |
| "Q 8.5 64.0625 14.71875 69.140625 \n", | |
| "Q 20.953125 74.21875 31.78125 74.21875 \n", | |
| "Q 42.671875 74.21875 48.875 69.140625 \n", | |
| "Q 55.078125 64.0625 55.078125 55.328125 \n", | |
| "Q 55.078125 49.078125 51.53125 44.71875 \n", | |
| "Q 48 40.375 41.703125 38.8125 \n", | |
| "Q 48.828125 37.15625 52.796875 32.3125 \n", | |
| "Q 56.78125 27.484375 56.78125 20.515625 \n", | |
| "Q 56.78125 9.90625 50.3125 4.234375 \n", | |
| "Q 43.84375 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.734375 -1.421875 13.25 4.234375 \n", | |
| "Q 6.78125 9.90625 6.78125 20.515625 \n", | |
| "Q 6.78125 27.484375 10.78125 32.3125 \n", | |
| "Q 14.796875 37.15625 21.921875 38.8125 \n", | |
| "z\n", | |
| "M 18.3125 54.390625 \n", | |
| "Q 18.3125 48.734375 21.84375 45.5625 \n", | |
| "Q 25.390625 42.390625 31.78125 42.390625 \n", | |
| "Q 38.140625 42.390625 41.71875 45.5625 \n", | |
| "Q 45.3125 48.734375 45.3125 54.390625 \n", | |
| "Q 45.3125 60.0625 41.71875 63.234375 \n", | |
| "Q 38.140625 66.40625 31.78125 66.40625 \n", | |
| "Q 25.390625 66.40625 21.84375 63.234375 \n", | |
| "Q 18.3125 60.0625 18.3125 54.390625 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(177.596751 275.433338)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-56 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(241.578569 275.433338)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(305.560387 275.433338)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-50 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
| "L 12.890625 25.390625 \n", | |
| "L 37.796875 25.390625 \n", | |
| "z\n", | |
| "M 35.203125 72.90625 \n", | |
| "L 47.609375 72.90625 \n", | |
| "L 47.609375 25.390625 \n", | |
| "L 58.015625 25.390625 \n", | |
| "L 58.015625 17.1875 \n", | |
| "L 47.609375 17.1875 \n", | |
| "L 47.609375 0 \n", | |
| "L 37.796875 0 \n", | |
| "L 37.796875 17.1875 \n", | |
| "L 4.890625 17.1875 \n", | |
| "L 4.890625 26.703125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(369.542205 275.433338)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-52 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_6><g style=fill:#262626; transform="translate(49.9375 249.614442)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_7><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
| "L 49.515625 72.90625 \n", | |
| "L 49.515625 64.59375 \n", | |
| "L 19.828125 64.59375 \n", | |
| "L 19.828125 46.734375 \n", | |
| "Q 21.96875 47.46875 24.109375 47.828125 \n", | |
| "Q 26.265625 48.1875 28.421875 48.1875 \n", | |
| "Q 40.625 48.1875 47.75 41.5 \n", | |
| "Q 54.890625 34.8125 54.890625 23.390625 \n", | |
| "Q 54.890625 11.625 47.5625 5.09375 \n", | |
| "Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
| "Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
| "Q 12.796875 0.140625 7.71875 1.703125 \n", | |
| "L 7.71875 11.625 \n", | |
| "Q 12.109375 9.234375 16.796875 8.0625 \n", | |
| "Q 21.484375 6.890625 26.703125 6.890625 \n", | |
| "Q 35.15625 6.890625 40.078125 11.328125 \n", | |
| "Q 45.015625 15.765625 45.015625 23.390625 \n", | |
| "Q 45.015625 31 40.078125 35.4375 \n", | |
| "Q 35.15625 39.890625 26.703125 39.890625 \n", | |
| "Q 22.75 39.890625 18.8125 39.015625 \n", | |
| "Q 14.890625 38.140625 10.796875 36.28125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(30.85 200.454763)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_3><g id=text_8><g style=fill:#262626; transform="translate(24.4875 151.295083)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_9><g style=fill:#262626; transform="translate(24.4875 102.135403)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_5><g id=text_10><g style=fill:#262626; transform="translate(24.4875 52.975723)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_11><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
| "L 51.703125 72.90625 \n", | |
| "L 51.703125 64.59375 \n", | |
| "L 19.671875 64.59375 \n", | |
| "L 19.671875 43.109375 \n", | |
| "L 48.578125 43.109375 \n", | |
| "L 48.578125 34.8125 \n", | |
| "L 19.671875 34.8125 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
| "Q 39.59375 47.171875 37.8125 47.578125 \n", | |
| "Q 36.03125 48 33.890625 48 \n", | |
| "Q 26.265625 48 22.1875 43.046875 \n", | |
| "Q 18.109375 38.09375 18.109375 28.8125 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 20.953125 51.171875 25.484375 53.578125 \n", | |
| "Q 30.03125 56 36.53125 56 \n", | |
| "Q 37.453125 56 38.578125 55.875 \n", | |
| "Q 39.703125 55.765625 41.0625 55.515625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
| "L 56.203125 25.203125 \n", | |
| "L 14.890625 25.203125 \n", | |
| "Q 15.484375 15.921875 20.484375 11.0625 \n", | |
| "Q 25.484375 6.203125 34.421875 6.203125 \n", | |
| "Q 39.59375 6.203125 44.453125 7.46875 \n", | |
| "Q 49.3125 8.734375 54.109375 11.28125 \n", | |
| "L 54.109375 2.78125 \n", | |
| "Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
| "Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
| "Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
| "Q 5.515625 13.8125 5.515625 26.8125 \n", | |
| "Q 5.515625 40.234375 12.765625 48.109375 \n", | |
| "Q 20.015625 56 32.328125 56 \n", | |
| "Q 43.359375 56 49.78125 48.890625 \n", | |
| "Q 56.203125 41.796875 56.203125 29.59375 \n", | |
| "z\n", | |
| "M 47.21875 32.234375 \n", | |
| "Q 47.125 39.59375 43.09375 43.984375 \n", | |
| "Q 39.0625 48.390625 32.421875 48.390625 \n", | |
| "Q 24.90625 48.390625 20.390625 44.140625 \n", | |
| "Q 15.875 39.890625 15.1875 32.171875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
| "Q 14.796875 17.390625 18.875 11.75 \n", | |
| "Q 22.953125 6.109375 30.078125 6.109375 \n", | |
| "Q 37.203125 6.109375 41.296875 11.75 \n", | |
| "Q 45.40625 17.390625 45.40625 27.296875 \n", | |
| "Q 45.40625 37.203125 41.296875 42.84375 \n", | |
| "Q 37.203125 48.484375 30.078125 48.484375 \n", | |
| "Q 22.953125 48.484375 18.875 42.84375 \n", | |
| "Q 14.796875 37.203125 14.796875 27.296875 \n", | |
| "z\n", | |
| "M 45.40625 8.203125 \n", | |
| "Q 42.578125 3.328125 38.25 0.953125 \n", | |
| "Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
| "Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
| "Q 5.515625 14.40625 5.515625 27.296875 \n", | |
| "Q 5.515625 40.1875 11.734375 48.09375 \n", | |
| "Q 17.96875 56 27.875 56 \n", | |
| "Q 33.9375 56 38.25 53.625 \n", | |
| "Q 42.578125 51.265625 45.40625 46.390625 \n", | |
| "L 45.40625 54.6875 \n", | |
| "L 54.390625 54.6875 \n", | |
| "L 54.390625 -20.796875 \n", | |
| "L 45.40625 -20.796875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
| "L 8.5 54.6875 \n", | |
| "L 17.484375 54.6875 \n", | |
| "L 17.484375 21.921875 \n", | |
| "Q 17.484375 14.15625 20.5 10.265625 \n", | |
| "Q 23.53125 6.390625 29.59375 6.390625 \n", | |
| "Q 36.859375 6.390625 41.078125 11.03125 \n", | |
| "Q 45.3125 15.671875 45.3125 23.6875 \n", | |
| "L 45.3125 54.6875 \n", | |
| "L 54.296875 54.6875 \n", | |
| "L 54.296875 0 \n", | |
| "L 45.3125 0 \n", | |
| "L 45.3125 8.40625 \n", | |
| "Q 42.046875 3.421875 37.71875 1 \n", | |
| "Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
| "Q 18.265625 -1.421875 13.375 4.4375 \n", | |
| "Q 8.5 10.296875 8.5 21.578125 \n", | |
| "z\n", | |
| "M 31.109375 56 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
| "L 54.890625 0 \n", | |
| "L 45.90625 0 \n", | |
| "L 45.90625 32.71875 \n", | |
| "Q 45.90625 40.484375 42.875 44.328125 \n", | |
| "Q 39.84375 48.1875 33.796875 48.1875 \n", | |
| "Q 26.515625 48.1875 22.3125 43.546875 \n", | |
| "Q 18.109375 38.921875 18.109375 30.90625 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 21.34375 51.125 25.703125 53.5625 \n", | |
| "Q 30.078125 56 35.796875 56 \n", | |
| "Q 45.21875 56 50.046875 50.171875 \n", | |
| "Q 54.890625 44.34375 54.890625 33.015625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
| "L 48.78125 44.1875 \n", | |
| "Q 44.96875 46.296875 41.140625 47.34375 \n", | |
| "Q 37.3125 48.390625 33.40625 48.390625 \n", | |
| "Q 24.65625 48.390625 19.8125 42.84375 \n", | |
| "Q 14.984375 37.3125 14.984375 27.296875 \n", | |
| "Q 14.984375 17.28125 19.8125 11.734375 \n", | |
| "Q 24.65625 6.203125 33.40625 6.203125 \n", | |
| "Q 37.3125 6.203125 41.140625 7.25 \n", | |
| "Q 44.96875 8.296875 48.78125 10.40625 \n", | |
| "L 48.78125 2.09375 \n", | |
| "Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
| "Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
| "Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
| "Q 5.515625 14.109375 5.515625 27.296875 \n", | |
| "Q 5.515625 40.671875 12.859375 48.328125 \n", | |
| "Q 20.21875 56 33.015625 56 \n", | |
| "Q 37.15625 56 41.109375 55.140625 \n", | |
| "Q 45.0625 54.296875 48.78125 52.59375 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
| "Q 28.375 -14.84375 24.75 -17.8125 \n", | |
| "Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
| "L 7.90625 -20.796875 \n", | |
| "L 7.90625 -13.28125 \n", | |
| "L 13.1875 -13.28125 \n", | |
| "Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
| "Q 21 -9.765625 23.484375 -3.21875 \n", | |
| "L 25.09375 0.875 \n", | |
| "L 2.984375 54.6875 \n", | |
| "L 12.5 54.6875 \n", | |
| "L 29.59375 11.921875 \n", | |
| "L 46.6875 54.6875 \n", | |
| "L 56.203125 54.6875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(18.199844 156.720268)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#p8d6f16dca8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 85.295455 245.815224 \n", | |
| "L 405.204545 245.815224 \n", | |
| "L 405.204545 21.991201 \n", | |
| "L 85.295455 21.991201 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path style=fill:none; d="M 69.3 245.815224 \n", | |
| "L 69.3 10.8 \n", | |
| ""/></g><g id=patch_5><path style=fill:none; d="M 421.2 245.815224 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g><g id=patch_6><path style=fill:none; d="M 69.3 245.815224 \n", | |
| "L 421.2 245.815224 \n", | |
| ""/></g><g id=patch_7><path style=fill:none; d="M 69.3 10.8 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=p8d6f16dca8><rect height=235.015224 width=351.9 x=69.3 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"> Histogram of lengths of the category </div></div><div class=col-sm-4><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=314.4906pt version=1.1 viewbox="0 0 405 314.4906" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 314.4906 \n", | |
| "L 405 314.4906 \n", | |
| "L 405 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#pb23e69d76e) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
| "L 135.83291 106.86 \n", | |
| "L 135.83291 16.26 \n", | |
| "L 7.2 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_3><path clip-path=url(#pb23e69d76e) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 135.83291 106.86 \n", | |
| "L 261.463185 106.86 \n", | |
| "L 261.463185 16.26 \n", | |
| "L 135.83291 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#pb23e69d76e) style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 261.463185 106.86 \n", | |
| "L 338.725289 106.86 \n", | |
| "L 338.725289 16.26 \n", | |
| "L 261.463185 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#pb23e69d76e) style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 338.725289 106.86 \n", | |
| "L 382.615243 106.86 \n", | |
| "L 382.615243 16.26 \n", | |
| "L 338.725289 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#pb23e69d76e) style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 382.615243 106.86 \n", | |
| "L 394.162521 106.86 \n", | |
| "L 394.162521 16.26 \n", | |
| "L 382.615243 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#pb23e69d76e) style=fill:#937860;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 394.162521 106.86 \n", | |
| "L 397.113683 106.86 \n", | |
| "L 397.113683 16.26 \n", | |
| "L 394.162521 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path clip-path=url(#pb23e69d76e) style=fill:#da8bc3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 397.113683 106.86 \n", | |
| "L 397.8 106.86 \n", | |
| "L 397.8 16.26 \n", | |
| "L 397.113683 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=legend_1><g id=patch_9><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 307.2906 \n", | |
| "L 87.9813 307.2906 \n", | |
| "Q 91.4373 307.2906 91.4373 303.8346 \n", | |
| "L 91.4373 128.016 \n", | |
| "Q 91.4373 124.56 87.9813 124.56 \n", | |
| "L 19.296 124.56 \n", | |
| "Q 15.84 124.56 15.84 128.016 \n", | |
| "L 15.84 303.8346 \n", | |
| "Q 15.84 307.2906 19.296 307.2906 \n", | |
| "z\n", | |
| ""/></g><g id=patch_10><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
| "L 57.312 144.6021 \n", | |
| "L 57.312 132.5061 \n", | |
| "L 22.752 132.5061 \n", | |
| "z\n", | |
| ""/></g><g id=text_1><defs><path id=DejaVuSans-65 d="M 34.1875 63.1875 \n", | |
| "L 20.796875 26.90625 \n", | |
| "L 47.609375 26.90625 \n", | |
| "z\n", | |
| "M 28.609375 72.90625 \n", | |
| "L 39.796875 72.90625 \n", | |
| "L 67.578125 0 \n", | |
| "L 57.328125 0 \n", | |
| "L 50.6875 18.703125 \n", | |
| "L 17.828125 18.703125 \n", | |
| "L 11.1875 0 \n", | |
| "L 0.78125 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-65 /></g></g><g id=patch_11><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
| "L 57.312 169.9659 \n", | |
| "L 57.312 157.8699 \n", | |
| "L 22.752 157.8699 \n", | |
| "z\n", | |
| ""/></g><g id=text_2><defs><path id=DejaVuSans-66 d="M 19.671875 34.8125 \n", | |
| "L 19.671875 8.109375 \n", | |
| "L 35.5 8.109375 \n", | |
| "Q 43.453125 8.109375 47.28125 11.40625 \n", | |
| "Q 51.125 14.703125 51.125 21.484375 \n", | |
| "Q 51.125 28.328125 47.28125 31.5625 \n", | |
| "Q 43.453125 34.8125 35.5 34.8125 \n", | |
| "z\n", | |
| "M 19.671875 64.796875 \n", | |
| "L 19.671875 42.828125 \n", | |
| "L 34.28125 42.828125 \n", | |
| "Q 41.5 42.828125 45.03125 45.53125 \n", | |
| "Q 48.578125 48.25 48.578125 53.8125 \n", | |
| "Q 48.578125 59.328125 45.03125 62.0625 \n", | |
| "Q 41.5 64.796875 34.28125 64.796875 \n", | |
| "z\n", | |
| "M 9.8125 72.90625 \n", | |
| "L 35.015625 72.90625 \n", | |
| "Q 46.296875 72.90625 52.390625 68.21875 \n", | |
| "Q 58.5 63.53125 58.5 54.890625 \n", | |
| "Q 58.5 48.1875 55.375 44.234375 \n", | |
| "Q 52.25 40.28125 46.1875 39.3125 \n", | |
| "Q 53.46875 37.75 57.5 32.78125 \n", | |
| "Q 61.53125 27.828125 61.53125 20.40625 \n", | |
| "Q 61.53125 10.640625 54.890625 5.3125 \n", | |
| "Q 48.25 0 35.984375 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-66 /></g></g><g id=patch_12><path style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 195.3297 \n", | |
| "L 57.312 195.3297 \n", | |
| "L 57.312 183.2337 \n", | |
| "L 22.752 183.2337 \n", | |
| "z\n", | |
| ""/></g><g id=text_3><defs><path id=DejaVuSans-67 d="M 64.40625 67.28125 \n", | |
| "L 64.40625 56.890625 \n", | |
| "Q 59.421875 61.53125 53.78125 63.8125 \n", | |
| "Q 48.140625 66.109375 41.796875 66.109375 \n", | |
| "Q 29.296875 66.109375 22.65625 58.46875 \n", | |
| "Q 16.015625 50.828125 16.015625 36.375 \n", | |
| "Q 16.015625 21.96875 22.65625 14.328125 \n", | |
| "Q 29.296875 6.6875 41.796875 6.6875 \n", | |
| "Q 48.140625 6.6875 53.78125 8.984375 \n", | |
| "Q 59.421875 11.28125 64.40625 15.921875 \n", | |
| "L 64.40625 5.609375 \n", | |
| "Q 59.234375 2.09375 53.4375 0.328125 \n", | |
| "Q 47.65625 -1.421875 41.21875 -1.421875 \n", | |
| "Q 24.65625 -1.421875 15.125 8.703125 \n", | |
| "Q 5.609375 18.84375 5.609375 36.375 \n", | |
| "Q 5.609375 53.953125 15.125 64.078125 \n", | |
| "Q 24.65625 74.21875 41.21875 74.21875 \n", | |
| "Q 47.75 74.21875 53.53125 72.484375 \n", | |
| "Q 59.328125 70.75 64.40625 67.28125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 195.3297)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-67 /></g></g><g id=patch_13><path style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 220.6935 \n", | |
| "L 57.312 220.6935 \n", | |
| "L 57.312 208.5975 \n", | |
| "L 22.752 208.5975 \n", | |
| "z\n", | |
| ""/></g><g id=text_4><defs><path id=DejaVuSans-68 d="M 19.671875 64.796875 \n", | |
| "L 19.671875 8.109375 \n", | |
| "L 31.59375 8.109375 \n", | |
| "Q 46.6875 8.109375 53.6875 14.9375 \n", | |
| "Q 60.6875 21.78125 60.6875 36.53125 \n", | |
| "Q 60.6875 51.171875 53.6875 57.984375 \n", | |
| "Q 46.6875 64.796875 31.59375 64.796875 \n", | |
| "z\n", | |
| "M 9.8125 72.90625 \n", | |
| "L 30.078125 72.90625 \n", | |
| "Q 51.265625 72.90625 61.171875 64.09375 \n", | |
| "Q 71.09375 55.28125 71.09375 36.53125 \n", | |
| "Q 71.09375 17.671875 61.125 8.828125 \n", | |
| "Q 51.171875 0 30.078125 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 220.6935)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-68 /></g></g><g id=patch_14><path style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 246.0573 \n", | |
| "L 57.312 246.0573 \n", | |
| "L 57.312 233.9613 \n", | |
| "L 22.752 233.9613 \n", | |
| "z\n", | |
| ""/></g><g id=text_5><defs><path id=DejaVuSans-69 d="M 9.8125 72.90625 \n", | |
| "L 55.90625 72.90625 \n", | |
| "L 55.90625 64.59375 \n", | |
| "L 19.671875 64.59375 \n", | |
| "L 19.671875 43.015625 \n", | |
| "L 54.390625 43.015625 \n", | |
| "L 54.390625 34.71875 \n", | |
| "L 19.671875 34.71875 \n", | |
| "L 19.671875 8.296875 \n", | |
| "L 56.78125 8.296875 \n", | |
| "L 56.78125 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 246.0573)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-69 /></g></g><g id=patch_15><path style=fill:#937860;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 271.4211 \n", | |
| "L 57.312 271.4211 \n", | |
| "L 57.312 259.3251 \n", | |
| "L 22.752 259.3251 \n", | |
| "z\n", | |
| ""/></g><g id=text_6><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
| "L 51.703125 72.90625 \n", | |
| "L 51.703125 64.59375 \n", | |
| "L 19.671875 64.59375 \n", | |
| "L 19.671875 43.109375 \n", | |
| "L 48.578125 43.109375 \n", | |
| "L 48.578125 34.8125 \n", | |
| "L 19.671875 34.8125 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 271.4211)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-70 /></g></g><g id=patch_16><path style=fill:#da8bc3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 296.7849 \n", | |
| "L 57.312 296.7849 \n", | |
| "L 57.312 284.6889 \n", | |
| "L 22.752 284.6889 \n", | |
| "z\n", | |
| ""/></g><g id=text_7><defs><path id=DejaVuSans-71 d="M 59.515625 10.40625 \n", | |
| "L 59.515625 29.984375 \n", | |
| "L 43.40625 29.984375 \n", | |
| "L 43.40625 38.09375 \n", | |
| "L 69.28125 38.09375 \n", | |
| "L 69.28125 6.78125 \n", | |
| "Q 63.578125 2.734375 56.6875 0.65625 \n", | |
| "Q 49.8125 -1.421875 42 -1.421875 \n", | |
| "Q 24.90625 -1.421875 15.25 8.5625 \n", | |
| "Q 5.609375 18.5625 5.609375 36.375 \n", | |
| "Q 5.609375 54.25 15.25 64.234375 \n", | |
| "Q 24.90625 74.21875 42 74.21875 \n", | |
| "Q 49.125 74.21875 55.546875 72.453125 \n", | |
| "Q 61.96875 70.703125 67.390625 67.28125 \n", | |
| "L 67.390625 56.78125 \n", | |
| "Q 61.921875 61.421875 55.765625 63.765625 \n", | |
| "Q 49.609375 66.109375 42.828125 66.109375 \n", | |
| "Q 29.4375 66.109375 22.71875 58.640625 \n", | |
| "Q 16.015625 51.171875 16.015625 36.375 \n", | |
| "Q 16.015625 21.625 22.71875 14.15625 \n", | |
| "Q 29.4375 6.6875 42.828125 6.6875 \n", | |
| "Q 48.046875 6.6875 52.140625 7.59375 \n", | |
| "Q 56.25 8.5 59.515625 10.40625 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 296.7849)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-71 /></g></g></g></g></g><defs><clippath id=pb23e69d76e><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-1844550963840207900bottom--1844550963840207900word><div class=col-sm-12><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=a>a</td><td>7497</td><td><div class=bar style=width:100.0%> 32.9% </div></td></tr><tr class><td title=b>b</td><td>7322</td><td><div class=bar style=width:97.7%> 32.2% </div></td></tr><tr class><td title=c>c</td><td>4503</td><td><div class=bar style=width:60.1%> 19.8% </div></td></tr><tr class><td title=d>d</td><td>2558</td><td><div class=bar style=width:34.1%> &nbsp; </div> 11.2% </td></tr><tr class><td title=e>e</td><td>673</td><td><div class=bar style=width:9.0%> &nbsp; </div> 3.0% </td></tr><tr class><td title=f>f</td><td>172</td><td><div class=bar style=width:2.3%> &nbsp; </div> 0.8% </td></tr><tr class><td title=g>g</td><td>40</td><td><div class=bar style=width:0.5%> &nbsp; </div> 0.2% </td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-1844550963840207900bottom--1844550963840207900characters><div class=col-sm-12><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-1844550963840207900unicode--1844550963840207900characters aria-controls=-1844550963840207900unicode--1844550963840207900characters role=tab data-toggle=tab>Characters</a></li><li role=presentation><a href=#-1844550963840207900unicode--1844550963840207900categories aria-controls=-1844550963840207900unicode--1844550963840207900categories role=tab data-toggle=tab>Categories</a></li><li role=presentation><a href=#-1844550963840207900unicode--1844550963840207900scripts aria-controls=-1844550963840207900unicode--1844550963840207900scripts role=tab data-toggle=tab>Scripts</a></li><li role=presentation><a href=#-1844550963840207900unicode--1844550963840207900blocks aria-controls=-1844550963840207900unicode--1844550963840207900blocks role=tab data-toggle=tab>Blocks</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-1844550963840207900unicode--1844550963840207900characters><div class="row named-list-item"><h4>Most occurring characters</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=A>A</td><td>7497</td><td><div class=bar style=width:100.0%> 32.9% </div></td></tr><tr class><td title=B>B</td><td>7322</td><td><div class=bar style=width:97.7%> 32.2% </div></td></tr><tr class><td title=C>C</td><td>4503</td><td><div class=bar style=width:60.1%> 19.8% </div></td></tr><tr class><td title=D>D</td><td>2558</td><td><div class=bar style=width:34.1%> &nbsp; </div> 11.2% </td></tr><tr class><td title=E>E</td><td>673</td><td><div class=bar style=width:9.0%> &nbsp; </div> 3.0% </td></tr><tr class><td title=F>F</td><td>172</td><td><div class=bar style=width:2.3%> &nbsp; </div> 0.8% </td></tr><tr class><td title=G>G</td><td>40</td><td><div class=bar style=width:0.5%> &nbsp; </div> 0.2% </td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-1844550963840207900unicode--1844550963840207900categories><div class="row named-list-item"><h4>Most occurring categories</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title="Uppercase Letter">Uppercase Letter</td><td>22765</td><td><div class=bar style=width:100.0%> 100.0% </div></td></tr></tbody></table></div><div class="row named-list-item"><h4>Most frequent character per category</h4><div class=row><div class=col-sm-6><h5><em>Uppercase Letter</em></h5><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=A>A</td><td>7497</td><td><div class=bar style=width:100.0%> 32.9% </div></td></tr><tr class><td title=B>B</td><td>7322</td><td><div class=bar style=width:97.7%> 32.2% </div></td></tr><tr class><td title=C>C</td><td>4503</td><td><div class=bar style=width:60.1%> 19.8% </div></td></tr><tr class><td title=D>D</td><td>2558</td><td><div class=bar style=width:34.1%> &nbsp; </div> 11.2% </td></tr><tr class><td title=E>E</td><td>673</td><td><div class=bar style=width:9.0%> &nbsp; </div> 3.0% </td></tr><tr class><td title=F>F</td><td>172</td><td><div class=bar style=width:2.3%> &nbsp; </div> 0.8% </td></tr><tr class><td title=G>G</td><td>40</td><td><div class=bar style=width:0.5%> &nbsp; </div> 0.2% </td></tr></tbody></table></div></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-1844550963840207900unicode--1844550963840207900scripts><div class="row named-list-item"><h4>Most occurring scripts</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=Latin>Latin</td><td>22765</td><td><div class=bar style=width:100.0%> 100.0% </div></td></tr></tbody></table></div><div class="row named-list-item"><h4>Most frequent character per script</h4><div class=row><div class=col-sm-6><h5><em>Latin</em></h5><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=A>A</td><td>7497</td><td><div class=bar style=width:100.0%> 32.9% </div></td></tr><tr class><td title=B>B</td><td>7322</td><td><div class=bar style=width:97.7%> 32.2% </div></td></tr><tr class><td title=C>C</td><td>4503</td><td><div class=bar style=width:60.1%> 19.8% </div></td></tr><tr class><td title=D>D</td><td>2558</td><td><div class=bar style=width:34.1%> &nbsp; </div> 11.2% </td></tr><tr class><td title=E>E</td><td>673</td><td><div class=bar style=width:9.0%> &nbsp; </div> 3.0% </td></tr><tr class><td title=F>F</td><td>172</td><td><div class=bar style=width:2.3%> &nbsp; </div> 0.8% </td></tr><tr class><td title=G>G</td><td>40</td><td><div class=bar style=width:0.5%> &nbsp; </div> 0.2% </td></tr></tbody></table></div></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-1844550963840207900unicode--1844550963840207900blocks><div class="row named-list-item"><h4>Most occurring blocks</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=ASCII>ASCII</td><td>22765</td><td><div class=bar style=width:100.0%> 100.0% </div></td></tr></tbody></table></div><div class="row named-list-item"><h4>Most frequent character per block</h4><div class=row><div class=col-sm-6><h5><em>ASCII</em></h5><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=A>A</td><td>7497</td><td><div class=bar style=width:100.0%> 32.9% </div></td></tr><tr class><td title=B>B</td><td>7322</td><td><div class=bar style=width:97.7%> 32.2% </div></td></tr><tr class><td title=C>C</td><td>4503</td><td><div class=bar style=width:60.1%> 19.8% </div></td></tr><tr class><td title=D>D</td><td>2558</td><td><div class=bar style=width:34.1%> &nbsp; </div> 11.2% </td></tr><tr class><td title=E>E</td><td>673</td><td><div class=bar style=width:9.0%> &nbsp; </div> 3.0% </td></tr><tr class><td title=F>F</td><td>172</td><td><div class=bar style=width:2.3%> &nbsp; </div> 0.8% </td></tr><tr class><td title=G>G</td><td>40</td><td><div class=bar style=width:0.5%> &nbsp; </div> 0.2% </td></tr></tbody></table></div></div></div></div></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_-8566384954619091435></a><div class=variable><div class=col-sm-3><p class=h4 title=loan_amnt><a href=#pp_var_-8566384954619091435>loan_amnt</a><br><small>Real number (&Ropf;<sub>&ge;0</sub>)</small></p><code><abbr title="This variable has a high correlation with 2 fields: df_index, loan_percent_income">HIGH CORRELATION</abbr></code><br><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>695</td></tr><tr><th>Distinct (%)</th><td>3.1%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Infinite</th><td>0</td></tr><tr><th>Infinite (%)</th><td>0.0%</td></tr><tr><th>Mean</th><td>9599.48166</td></tr></tbody></table></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>500</td></tr><tr><th>Maximum</th><td>35000</td></tr><tr><th>Zeros</th><td>0</td></tr><tr><th>Zeros (%)</th><td>0.0%</td></tr><tr><th>Negative</th><td>0</td></tr><tr><th>Negative (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>178.0 KiB</td></tr></tbody></table></div><div class=col-sm-3><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=162pt version=1.1 viewbox="0 0 216 162" width=216pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 162 \n", | |
| "L 216 162 \n", | |
| "L 216 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 10.8 114.069981 \n", | |
| "L 205.2 114.069981 \n", | |
| "L 205.2 10.8 \n", | |
| "L 10.8 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(16.83645 134.96748)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(60.8634 149.364174)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(112.088696 149.364174)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
| "Q 47.65625 37.796875 51.625 33 \n", | |
| "Q 55.609375 28.21875 55.609375 21.1875 \n", | |
| "Q 55.609375 10.40625 48.1875 4.484375 \n", | |
| "Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
| "Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
| "Q 12.796875 0.390625 7.625 2.203125 \n", | |
| "L 7.625 11.71875 \n", | |
| "Q 11.71875 9.328125 16.59375 8.109375 \n", | |
| "Q 21.484375 6.890625 26.8125 6.890625 \n", | |
| "Q 36.078125 6.890625 40.9375 10.546875 \n", | |
| "Q 45.796875 14.203125 45.796875 21.1875 \n", | |
| "Q 45.796875 27.640625 41.28125 31.265625 \n", | |
| "Q 36.765625 34.90625 28.71875 34.90625 \n", | |
| "L 20.21875 34.90625 \n", | |
| "L 20.21875 43.015625 \n", | |
| "L 29.109375 43.015625 \n", | |
| "Q 36.375 43.015625 40.234375 45.921875 \n", | |
| "Q 44.09375 48.828125 44.09375 54.296875 \n", | |
| "Q 44.09375 59.90625 40.109375 62.90625 \n", | |
| "Q 36.140625 65.921875 28.71875 65.921875 \n", | |
| "Q 24.65625 65.921875 20.015625 65.03125 \n", | |
| "Q 15.375 64.15625 9.8125 62.3125 \n", | |
| "L 9.8125 71.09375 \n", | |
| "Q 15.4375 72.65625 20.34375 73.4375 \n", | |
| "Q 25.25 74.21875 29.59375 74.21875 \n", | |
| "Q 40.828125 74.21875 47.359375 69.109375 \n", | |
| "Q 53.90625 64.015625 53.90625 55.328125 \n", | |
| "Q 53.90625 49.265625 50.4375 45.09375 \n", | |
| "Q 46.96875 40.921875 40.578125 39.3125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(163.313993 149.364174)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-51 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=patch_3><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 19.636364 114.069981 \n", | |
| "L 23.170909 114.069981 \n", | |
| "L 23.170909 103.799557 \n", | |
| "L 19.636364 103.799557 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 23.170909 114.069981 \n", | |
| "L 26.705455 114.069981 \n", | |
| "L 26.705455 87.958734 \n", | |
| "L 23.170909 87.958734 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 26.705455 114.069981 \n", | |
| "L 30.24 114.069981 \n", | |
| "L 30.24 68.897524 \n", | |
| "L 26.705455 68.897524 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 30.24 114.069981 \n", | |
| "L 33.774545 114.069981 \n", | |
| "L 33.774545 65.807693 \n", | |
| "L 30.24 65.807693 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 33.774545 114.069981 \n", | |
| "L 37.309091 114.069981 \n", | |
| "L 37.309091 88.393922 \n", | |
| "L 33.774545 88.393922 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 37.309091 114.069981 \n", | |
| "L 40.843636 114.069981 \n", | |
| "L 40.843636 60.0197 \n", | |
| "L 37.309091 60.0197 \n", | |
| "z\n", | |
| ""/></g><g id=patch_9><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 40.843636 114.069981 \n", | |
| "L 44.378182 114.069981 \n", | |
| "L 44.378182 28.903798 \n", | |
| "L 40.843636 28.903798 \n", | |
| "z\n", | |
| ""/></g><g id=patch_10><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 44.378182 114.069981 \n", | |
| "L 47.912727 114.069981 \n", | |
| "L 47.912727 38.782553 \n", | |
| "L 44.378182 38.782553 \n", | |
| "z\n", | |
| ""/></g><g id=patch_11><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 47.912727 114.069981 \n", | |
| "L 51.447273 114.069981 \n", | |
| "L 51.447273 88.916147 \n", | |
| "L 47.912727 88.916147 \n", | |
| "z\n", | |
| ""/></g><g id=patch_12><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 51.447273 114.069981 \n", | |
| "L 54.981818 114.069981 \n", | |
| "L 54.981818 67.853074 \n", | |
| "L 51.447273 67.853074 \n", | |
| "z\n", | |
| ""/></g><g id=patch_13><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 54.981818 114.069981 \n", | |
| "L 58.516364 114.069981 \n", | |
| "L 58.516364 44.135358 \n", | |
| "L 54.981818 44.135358 \n", | |
| "z\n", | |
| ""/></g><g id=patch_14><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 58.516364 114.069981 \n", | |
| "L 62.050909 114.069981 \n", | |
| "L 62.050909 96.618964 \n", | |
| "L 58.516364 96.618964 \n", | |
| "z\n", | |
| ""/></g><g id=patch_15><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 62.050909 114.069981 \n", | |
| "L 65.585455 114.069981 \n", | |
| "L 65.585455 85.782797 \n", | |
| "L 62.050909 85.782797 \n", | |
| "z\n", | |
| ""/></g><g id=patch_16><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 65.585455 114.069981 \n", | |
| "L 69.12 114.069981 \n", | |
| "L 69.12 15.717618 \n", | |
| "L 65.585455 15.717618 \n", | |
| "z\n", | |
| ""/></g><g id=patch_17><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 69.12 114.069981 \n", | |
| "L 72.654545 114.069981 \n", | |
| "L 72.654545 102.102326 \n", | |
| "L 69.12 102.102326 \n", | |
| "z\n", | |
| ""/></g><g id=patch_18><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 72.654545 114.069981 \n", | |
| "L 76.189091 114.069981 \n", | |
| "L 76.189091 95.530996 \n", | |
| "L 72.654545 95.530996 \n", | |
| "z\n", | |
| ""/></g><g id=patch_19><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 76.189091 114.069981 \n", | |
| "L 79.723636 114.069981 \n", | |
| "L 79.723636 57.582651 \n", | |
| "L 76.189091 57.582651 \n", | |
| "z\n", | |
| ""/></g><g id=patch_20><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 79.723636 114.069981 \n", | |
| "L 83.258182 114.069981 \n", | |
| "L 83.258182 104.669932 \n", | |
| "L 79.723636 104.669932 \n", | |
| "z\n", | |
| ""/></g><g id=patch_21><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 83.258182 114.069981 \n", | |
| "L 86.792727 114.069981 \n", | |
| "L 86.792727 98.272677 \n", | |
| "L 83.258182 98.272677 \n", | |
| "z\n", | |
| ""/></g><g id=patch_22><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 86.792727 114.069981 \n", | |
| "L 90.327273 114.069981 \n", | |
| "L 90.327273 97.184708 \n", | |
| "L 86.792727 97.184708 \n", | |
| "z\n", | |
| ""/></g><g id=patch_23><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 90.327273 114.069981 \n", | |
| "L 93.861818 114.069981 \n", | |
| "L 93.861818 104.844007 \n", | |
| "L 90.327273 104.844007 \n", | |
| "z\n", | |
| ""/></g><g id=patch_24><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 93.861818 114.069981 \n", | |
| "L 97.396364 114.069981 \n", | |
| "L 97.396364 63.936387 \n", | |
| "L 93.861818 63.936387 \n", | |
| "z\n", | |
| ""/></g><g id=patch_25><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 97.396364 114.069981 \n", | |
| "L 100.930909 114.069981 \n", | |
| "L 100.930909 98.185639 \n", | |
| "L 97.396364 98.185639 \n", | |
| "z\n", | |
| ""/></g><g id=patch_26><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 100.930909 114.069981 \n", | |
| "L 104.465455 114.069981 \n", | |
| "L 104.465455 104.669932 \n", | |
| "L 100.930909 104.669932 \n", | |
| "z\n", | |
| ""/></g><g id=patch_27><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 104.465455 114.069981 \n", | |
| "L 108 114.069981 \n", | |
| "L 108 109.892182 \n", | |
| "L 104.465455 109.892182 \n", | |
| "z\n", | |
| ""/></g><g id=patch_28><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 108 114.069981 \n", | |
| "L 111.534545 114.069981 \n", | |
| "L 111.534545 99.18657 \n", | |
| "L 108 99.18657 \n", | |
| "z\n", | |
| ""/></g><g id=patch_29><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 111.534545 114.069981 \n", | |
| "L 115.069091 114.069981 \n", | |
| "L 115.069091 110.327369 \n", | |
| "L 111.534545 110.327369 \n", | |
| "z\n", | |
| ""/></g><g id=patch_30><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 115.069091 114.069981 \n", | |
| "L 118.603636 114.069981 \n", | |
| "L 118.603636 111.458856 \n", | |
| "L 115.069091 111.458856 \n", | |
| "z\n", | |
| ""/></g><g id=patch_31><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 118.603636 114.069981 \n", | |
| "L 122.138182 114.069981 \n", | |
| "L 122.138182 82.040185 \n", | |
| "L 118.603636 82.040185 \n", | |
| "z\n", | |
| ""/></g><g id=patch_32><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 122.138182 114.069981 \n", | |
| "L 125.672727 114.069981 \n", | |
| "L 125.672727 109.152363 \n", | |
| "L 122.138182 109.152363 \n", | |
| "z\n", | |
| ""/></g><g id=patch_33><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 125.672727 114.069981 \n", | |
| "L 129.207273 114.069981 \n", | |
| "L 129.207273 112.329231 \n", | |
| "L 125.672727 112.329231 \n", | |
| "z\n", | |
| ""/></g><g id=patch_34><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 129.207273 114.069981 \n", | |
| "L 132.741818 114.069981 \n", | |
| "L 132.741818 110.066257 \n", | |
| "L 129.207273 110.066257 \n", | |
| "z\n", | |
| ""/></g><g id=patch_35><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 132.741818 114.069981 \n", | |
| "L 136.276364 114.069981 \n", | |
| "L 136.276364 111.894044 \n", | |
| "L 132.741818 111.894044 \n", | |
| "z\n", | |
| ""/></g><g id=patch_36><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 136.276364 114.069981 \n", | |
| "L 139.810909 114.069981 \n", | |
| "L 139.810909 113.112569 \n", | |
| "L 136.276364 113.112569 \n", | |
| "z\n", | |
| ""/></g><g id=patch_37><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 139.810909 114.069981 \n", | |
| "L 143.345455 114.069981 \n", | |
| "L 143.345455 102.624551 \n", | |
| "L 139.810909 102.624551 \n", | |
| "z\n", | |
| ""/></g><g id=patch_38><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 143.345455 114.069981 \n", | |
| "L 146.88 114.069981 \n", | |
| "L 146.88 89.046703 \n", | |
| "L 143.345455 89.046703 \n", | |
| "z\n", | |
| ""/></g><g id=patch_39><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 146.88 114.069981 \n", | |
| "L 150.414545 114.069981 \n", | |
| "L 150.414545 113.373681 \n", | |
| "L 146.88 113.373681 \n", | |
| "z\n", | |
| ""/></g><g id=patch_40><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 150.414545 114.069981 \n", | |
| "L 153.949091 114.069981 \n", | |
| "L 153.949091 114.069981 \n", | |
| "L 150.414545 114.069981 \n", | |
| "z\n", | |
| ""/></g><g id=patch_41><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 153.949091 114.069981 \n", | |
| "L 157.483636 114.069981 \n", | |
| "L 157.483636 113.547756 \n", | |
| "L 153.949091 113.547756 \n", | |
| "z\n", | |
| ""/></g><g id=patch_42><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 157.483636 114.069981 \n", | |
| "L 161.018182 114.069981 \n", | |
| "L 161.018182 111.981081 \n", | |
| "L 157.483636 111.981081 \n", | |
| "z\n", | |
| ""/></g><g id=patch_43><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 161.018182 114.069981 \n", | |
| "L 164.552727 114.069981 \n", | |
| "L 164.552727 114.026462 \n", | |
| "L 161.018182 114.026462 \n", | |
| "z\n", | |
| ""/></g><g id=patch_44><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 164.552727 114.069981 \n", | |
| "L 168.087273 114.069981 \n", | |
| "L 168.087273 113.895906 \n", | |
| "L 164.552727 113.895906 \n", | |
| "z\n", | |
| ""/></g><g id=patch_45><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 168.087273 114.069981 \n", | |
| "L 171.621818 114.069981 \n", | |
| "L 171.621818 110.501444 \n", | |
| "L 168.087273 110.501444 \n", | |
| "z\n", | |
| ""/></g><g id=patch_46><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 171.621818 114.069981 \n", | |
| "L 175.156364 114.069981 \n", | |
| "L 175.156364 113.982944 \n", | |
| "L 171.621818 113.982944 \n", | |
| "z\n", | |
| ""/></g><g id=patch_47><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 175.156364 114.069981 \n", | |
| "L 178.690909 114.069981 \n", | |
| "L 178.690909 113.852387 \n", | |
| "L 175.156364 113.852387 \n", | |
| "z\n", | |
| ""/></g><g id=patch_48><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 178.690909 114.069981 \n", | |
| "L 182.225455 114.069981 \n", | |
| "L 182.225455 113.634794 \n", | |
| "L 178.690909 113.634794 \n", | |
| "z\n", | |
| ""/></g><g id=patch_49><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 182.225455 114.069981 \n", | |
| "L 185.76 114.069981 \n", | |
| "L 185.76 114.026462 \n", | |
| "L 182.225455 114.026462 \n", | |
| "z\n", | |
| ""/></g><g id=patch_50><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 185.76 114.069981 \n", | |
| "L 189.294545 114.069981 \n", | |
| "L 189.294545 113.852387 \n", | |
| "L 185.76 113.852387 \n", | |
| "z\n", | |
| ""/></g><g id=patch_51><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 189.294545 114.069981 \n", | |
| "L 192.829091 114.069981 \n", | |
| "L 192.829091 113.852387 \n", | |
| "L 189.294545 113.852387 \n", | |
| "z\n", | |
| ""/></g><g id=patch_52><path clip-path=url(#p76b124a483) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 192.829091 114.069981 \n", | |
| "L 196.363636 114.069981 \n", | |
| "L 196.363636 108.499582 \n", | |
| "L 192.829091 108.499582 \n", | |
| "z\n", | |
| ""/></g><g id=patch_53><path style=fill:none; d="M 10.8 114.069981 \n", | |
| "L 10.8 10.8 \n", | |
| ""/></g><g id=patch_54><path style=fill:none; d="M 205.2 114.069981 \n", | |
| "L 205.2 10.8 \n", | |
| ""/></g><g id=patch_55><path style=fill:none; d="M 10.8 114.069981 \n", | |
| "L 205.2 114.069981 \n", | |
| ""/></g><g id=patch_56><path style=fill:none; d="M 10.8 10.8 \n", | |
| "L 205.2 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=p76b124a483><rect height=103.269981 width=194.4 x=10.8 y=10.8 /></clippath></defs></svg></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom--8566384954619091435, #minifreqtable-8566384954619091435" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom--8566384954619091435 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-8566384954619091435bottom--8566384954619091435statistics aria-controls=-8566384954619091435bottom--8566384954619091435statistics role=tab data-toggle=tab>Statistics</a></li><li role=presentation><a href=#-8566384954619091435bottom--8566384954619091435histogram aria-controls=-8566384954619091435bottom--8566384954619091435histogram role=tab data-toggle=tab>Histogram</a></li><li role=presentation><a href=#-8566384954619091435bottom--8566384954619091435common_values aria-controls=-8566384954619091435bottom--8566384954619091435common_values role=tab data-toggle=tab>Common values</a></li><li role=presentation><a href=#-8566384954619091435bottom--8566384954619091435extreme_values aria-controls=-8566384954619091435bottom--8566384954619091435extreme_values role=tab data-toggle=tab>Extreme values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-8566384954619091435bottom--8566384954619091435statistics><div class=col-sm-6><p class=h4>Quantile statistics</p><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>500</td></tr><tr><th>5-th percentile</th><td>2000</td></tr><tr><th>Q1</th><td>5000</td></tr><tr><th>median</th><td>8000</td></tr><tr><th>Q3</th><td>12250</td></tr><tr><th>95-th percentile</th><td>24000</td></tr><tr><th>Maximum</th><td>35000</td></tr><tr><th>Range</th><td>34500</td></tr><tr><th>Interquartile range (IQR)</th><td>7250</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Descriptive statistics</p><table class="table table-condensed stats"><tbody><tr><th>Standard deviation</th><td>6330.482222</td></tr><tr><th>Coefficient of variation (CV)</th><td>0.6594608382</td></tr><tr><th>Kurtosis</th><td>1.417270577</td></tr><tr><th>Mean</th><td>9599.48166</td></tr><tr><th>Median Absolute Deviation (MAD)</th><td>3800</td></tr><tr><th>Skewness</th><td>1.191874139</td></tr><tr><th>Sum</th><td>218532200</td></tr><tr><th>Variance</th><td>40075005.17</td></tr><tr><th>Monotonicity</th><td>Not monotonic</td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-8566384954619091435bottom--8566384954619091435histogram><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
| "L 432 288 \n", | |
| "L 432 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 63.05 234.855069 \n", | |
| "L 421.2 234.855069 \n", | |
| "L 421.2 10.8 \n", | |
| "L 63.05 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(74.312526 257.726942)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
| "L 49.515625 72.90625 \n", | |
| "L 49.515625 64.59375 \n", | |
| "L 19.828125 64.59375 \n", | |
| "L 19.828125 46.734375 \n", | |
| "Q 21.96875 47.46875 24.109375 47.828125 \n", | |
| "Q 26.265625 48.1875 28.421875 48.1875 \n", | |
| "Q 40.625 48.1875 47.75 41.5 \n", | |
| "Q 54.890625 34.8125 54.890625 23.390625 \n", | |
| "Q 54.890625 11.625 47.5625 5.09375 \n", | |
| "Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
| "Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
| "Q 12.796875 0.140625 7.71875 1.703125 \n", | |
| "L 7.71875 11.625 \n", | |
| "Q 12.109375 9.234375 16.796875 8.0625 \n", | |
| "Q 21.484375 6.890625 26.703125 6.890625 \n", | |
| "Q 35.15625 6.890625 40.078125 11.328125 \n", | |
| "Q 45.015625 15.765625 45.015625 23.390625 \n", | |
| "Q 45.015625 31 40.078125 35.4375 \n", | |
| "Q 35.15625 39.890625 26.703125 39.890625 \n", | |
| "Q 22.75 39.890625 18.8125 39.015625 \n", | |
| "Q 14.890625 38.140625 10.796875 36.28125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(114.751164 271.223843)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(159.688769 275.72281)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><g style=fill:#262626; transform="translate(206.875857 275.72281)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(254.062945 275.72281)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_6><g id=text_6><g style=fill:#262626; transform="translate(301.250034 275.72281)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_7><g id=text_7><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
| "Q 47.65625 37.796875 51.625 33 \n", | |
| "Q 55.609375 28.21875 55.609375 21.1875 \n", | |
| "Q 55.609375 10.40625 48.1875 4.484375 \n", | |
| "Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
| "Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
| "Q 12.796875 0.390625 7.625 2.203125 \n", | |
| "L 7.625 11.71875 \n", | |
| "Q 11.71875 9.328125 16.59375 8.109375 \n", | |
| "Q 21.484375 6.890625 26.8125 6.890625 \n", | |
| "Q 36.078125 6.890625 40.9375 10.546875 \n", | |
| "Q 45.796875 14.203125 45.796875 21.1875 \n", | |
| "Q 45.796875 27.640625 41.28125 31.265625 \n", | |
| "Q 36.765625 34.90625 28.71875 34.90625 \n", | |
| "L 20.21875 34.90625 \n", | |
| "L 20.21875 43.015625 \n", | |
| "L 29.109375 43.015625 \n", | |
| "Q 36.375 43.015625 40.234375 45.921875 \n", | |
| "Q 44.09375 48.828125 44.09375 54.296875 \n", | |
| "Q 44.09375 59.90625 40.109375 62.90625 \n", | |
| "Q 36.140625 65.921875 28.71875 65.921875 \n", | |
| "Q 24.65625 65.921875 20.015625 65.03125 \n", | |
| "Q 15.375 64.15625 9.8125 62.3125 \n", | |
| "L 9.8125 71.09375 \n", | |
| "Q 15.4375 72.65625 20.34375 73.4375 \n", | |
| "Q 25.25 74.21875 29.59375 74.21875 \n", | |
| "Q 40.828125 74.21875 47.359375 69.109375 \n", | |
| "Q 53.90625 64.015625 53.90625 55.328125 \n", | |
| "Q 53.90625 49.265625 50.4375 45.09375 \n", | |
| "Q 46.96875 40.921875 40.578125 39.3125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(348.437122 275.72281)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-51 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_8><g id=text_8><g style=fill:#262626; transform="translate(395.62421 275.72281)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-51 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_9><g style=fill:#262626; transform="translate(43.6875 238.654287)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_10><g style=fill:#262626; transform="translate(30.9625 191.445044)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_3><g id=text_11><g style=fill:#262626; transform="translate(24.6 144.235801)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_12><g style=fill:#262626; transform="translate(24.6 97.026558)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_5><g id=text_13><g style=fill:#262626; transform="translate(24.6 49.817314)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_14><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
| "L 51.703125 72.90625 \n", | |
| "L 51.703125 64.59375 \n", | |
| "L 19.671875 64.59375 \n", | |
| "L 19.671875 43.109375 \n", | |
| "L 48.578125 43.109375 \n", | |
| "L 48.578125 34.8125 \n", | |
| "L 19.671875 34.8125 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
| "Q 39.59375 47.171875 37.8125 47.578125 \n", | |
| "Q 36.03125 48 33.890625 48 \n", | |
| "Q 26.265625 48 22.1875 43.046875 \n", | |
| "Q 18.109375 38.09375 18.109375 28.8125 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 20.953125 51.171875 25.484375 53.578125 \n", | |
| "Q 30.03125 56 36.53125 56 \n", | |
| "Q 37.453125 56 38.578125 55.875 \n", | |
| "Q 39.703125 55.765625 41.0625 55.515625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
| "L 56.203125 25.203125 \n", | |
| "L 14.890625 25.203125 \n", | |
| "Q 15.484375 15.921875 20.484375 11.0625 \n", | |
| "Q 25.484375 6.203125 34.421875 6.203125 \n", | |
| "Q 39.59375 6.203125 44.453125 7.46875 \n", | |
| "Q 49.3125 8.734375 54.109375 11.28125 \n", | |
| "L 54.109375 2.78125 \n", | |
| "Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
| "Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
| "Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
| "Q 5.515625 13.8125 5.515625 26.8125 \n", | |
| "Q 5.515625 40.234375 12.765625 48.109375 \n", | |
| "Q 20.015625 56 32.328125 56 \n", | |
| "Q 43.359375 56 49.78125 48.890625 \n", | |
| "Q 56.203125 41.796875 56.203125 29.59375 \n", | |
| "z\n", | |
| "M 47.21875 32.234375 \n", | |
| "Q 47.125 39.59375 43.09375 43.984375 \n", | |
| "Q 39.0625 48.390625 32.421875 48.390625 \n", | |
| "Q 24.90625 48.390625 20.390625 44.140625 \n", | |
| "Q 15.875 39.890625 15.1875 32.171875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
| "Q 14.796875 17.390625 18.875 11.75 \n", | |
| "Q 22.953125 6.109375 30.078125 6.109375 \n", | |
| "Q 37.203125 6.109375 41.296875 11.75 \n", | |
| "Q 45.40625 17.390625 45.40625 27.296875 \n", | |
| "Q 45.40625 37.203125 41.296875 42.84375 \n", | |
| "Q 37.203125 48.484375 30.078125 48.484375 \n", | |
| "Q 22.953125 48.484375 18.875 42.84375 \n", | |
| "Q 14.796875 37.203125 14.796875 27.296875 \n", | |
| "z\n", | |
| "M 45.40625 8.203125 \n", | |
| "Q 42.578125 3.328125 38.25 0.953125 \n", | |
| "Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
| "Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
| "Q 5.515625 14.40625 5.515625 27.296875 \n", | |
| "Q 5.515625 40.1875 11.734375 48.09375 \n", | |
| "Q 17.96875 56 27.875 56 \n", | |
| "Q 33.9375 56 38.25 53.625 \n", | |
| "Q 42.578125 51.265625 45.40625 46.390625 \n", | |
| "L 45.40625 54.6875 \n", | |
| "L 54.390625 54.6875 \n", | |
| "L 54.390625 -20.796875 \n", | |
| "L 45.40625 -20.796875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
| "L 8.5 54.6875 \n", | |
| "L 17.484375 54.6875 \n", | |
| "L 17.484375 21.921875 \n", | |
| "Q 17.484375 14.15625 20.5 10.265625 \n", | |
| "Q 23.53125 6.390625 29.59375 6.390625 \n", | |
| "Q 36.859375 6.390625 41.078125 11.03125 \n", | |
| "Q 45.3125 15.671875 45.3125 23.6875 \n", | |
| "L 45.3125 54.6875 \n", | |
| "L 54.296875 54.6875 \n", | |
| "L 54.296875 0 \n", | |
| "L 45.3125 0 \n", | |
| "L 45.3125 8.40625 \n", | |
| "Q 42.046875 3.421875 37.71875 1 \n", | |
| "Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
| "Q 18.265625 -1.421875 13.375 4.4375 \n", | |
| "Q 8.5 10.296875 8.5 21.578125 \n", | |
| "z\n", | |
| "M 31.109375 56 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
| "L 54.890625 0 \n", | |
| "L 45.90625 0 \n", | |
| "L 45.90625 32.71875 \n", | |
| "Q 45.90625 40.484375 42.875 44.328125 \n", | |
| "Q 39.84375 48.1875 33.796875 48.1875 \n", | |
| "Q 26.515625 48.1875 22.3125 43.546875 \n", | |
| "Q 18.109375 38.921875 18.109375 30.90625 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 21.34375 51.125 25.703125 53.5625 \n", | |
| "Q 30.078125 56 35.796875 56 \n", | |
| "Q 45.21875 56 50.046875 50.171875 \n", | |
| "Q 54.890625 44.34375 54.890625 33.015625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
| "L 48.78125 44.1875 \n", | |
| "Q 44.96875 46.296875 41.140625 47.34375 \n", | |
| "Q 37.3125 48.390625 33.40625 48.390625 \n", | |
| "Q 24.65625 48.390625 19.8125 42.84375 \n", | |
| "Q 14.984375 37.3125 14.984375 27.296875 \n", | |
| "Q 14.984375 17.28125 19.8125 11.734375 \n", | |
| "Q 24.65625 6.203125 33.40625 6.203125 \n", | |
| "Q 37.3125 6.203125 41.140625 7.25 \n", | |
| "Q 44.96875 8.296875 48.78125 10.40625 \n", | |
| "L 48.78125 2.09375 \n", | |
| "Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
| "Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
| "Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
| "Q 5.515625 14.109375 5.515625 27.296875 \n", | |
| "Q 5.515625 40.671875 12.859375 48.328125 \n", | |
| "Q 20.21875 56 33.015625 56 \n", | |
| "Q 37.15625 56 41.109375 55.140625 \n", | |
| "Q 45.0625 54.296875 48.78125 52.59375 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
| "Q 28.375 -14.84375 24.75 -17.8125 \n", | |
| "Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
| "L 7.90625 -20.796875 \n", | |
| "L 7.90625 -13.28125 \n", | |
| "L 13.1875 -13.28125 \n", | |
| "Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
| "Q 21 -9.765625 23.484375 -3.21875 \n", | |
| "L 25.09375 0.875 \n", | |
| "L 2.984375 54.6875 \n", | |
| "L 12.5 54.6875 \n", | |
| "L 29.59375 11.921875 \n", | |
| "L 46.6875 54.6875 \n", | |
| "L 56.203125 54.6875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(18.312344 151.240191)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 79.329545 234.855069 \n", | |
| "L 85.841364 234.855069 \n", | |
| "L 85.841364 212.572306 \n", | |
| "L 79.329545 212.572306 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 85.841364 234.855069 \n", | |
| "L 92.353182 234.855069 \n", | |
| "L 92.353182 178.203977 \n", | |
| "L 85.841364 178.203977 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 92.353182 234.855069 \n", | |
| "L 98.865 234.855069 \n", | |
| "L 98.865 136.84868 \n", | |
| "L 92.353182 136.84868 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 98.865 234.855069 \n", | |
| "L 105.376818 234.855069 \n", | |
| "L 105.376818 130.144967 \n", | |
| "L 98.865 130.144967 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 105.376818 234.855069 \n", | |
| "L 111.888636 234.855069 \n", | |
| "L 111.888636 179.148162 \n", | |
| "L 105.376818 179.148162 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 111.888636 234.855069 \n", | |
| "L 118.400455 234.855069 \n", | |
| "L 118.400455 117.587308 \n", | |
| "L 111.888636 117.587308 \n", | |
| "z\n", | |
| ""/></g><g id=patch_9><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 118.400455 234.855069 \n", | |
| "L 124.912273 234.855069 \n", | |
| "L 124.912273 50.07809 \n", | |
| "L 118.400455 50.07809 \n", | |
| "z\n", | |
| ""/></g><g id=patch_10><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 124.912273 234.855069 \n", | |
| "L 131.424091 234.855069 \n", | |
| "L 131.424091 71.511087 \n", | |
| "L 124.912273 71.511087 \n", | |
| "z\n", | |
| ""/></g><g id=patch_11><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 131.424091 234.855069 \n", | |
| "L 137.935909 234.855069 \n", | |
| "L 137.935909 180.281183 \n", | |
| "L 131.424091 180.281183 \n", | |
| "z\n", | |
| ""/></g><g id=patch_12><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 137.935909 234.855069 \n", | |
| "L 144.447727 234.855069 \n", | |
| "L 144.447727 134.582636 \n", | |
| "L 137.935909 134.582636 \n", | |
| "z\n", | |
| ""/></g><g id=patch_13><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 144.447727 234.855069 \n", | |
| "L 150.959545 234.855069 \n", | |
| "L 150.959545 83.124561 \n", | |
| "L 144.447727 83.124561 \n", | |
| "z\n", | |
| ""/></g><g id=patch_14><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 150.959545 234.855069 \n", | |
| "L 157.471364 234.855069 \n", | |
| "L 157.471364 196.993255 \n", | |
| "L 150.959545 196.993255 \n", | |
| "z\n", | |
| ""/></g><g id=patch_15><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 157.471364 234.855069 \n", | |
| "L 163.983182 234.855069 \n", | |
| "L 163.983182 173.483052 \n", | |
| "L 157.471364 173.483052 \n", | |
| "z\n", | |
| ""/></g><g id=patch_16><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 163.983182 234.855069 \n", | |
| "L 170.495 234.855069 \n", | |
| "L 170.495 21.469289 \n", | |
| "L 163.983182 21.469289 \n", | |
| "z\n", | |
| ""/></g><g id=patch_17><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 170.495 234.855069 \n", | |
| "L 177.006818 234.855069 \n", | |
| "L 177.006818 208.889985 \n", | |
| "L 170.495 208.889985 \n", | |
| "z\n", | |
| ""/></g><g id=patch_18><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 177.006818 234.855069 \n", | |
| "L 183.518636 234.855069 \n", | |
| "L 183.518636 194.632793 \n", | |
| "L 177.006818 194.632793 \n", | |
| "z\n", | |
| ""/></g><g id=patch_19><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 183.518636 234.855069 \n", | |
| "L 190.030455 234.855069 \n", | |
| "L 190.030455 112.299873 \n", | |
| "L 183.518636 112.299873 \n", | |
| "z\n", | |
| ""/></g><g id=patch_20><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 190.030455 234.855069 \n", | |
| "L 196.542273 234.855069 \n", | |
| "L 196.542273 214.460675 \n", | |
| "L 190.030455 214.460675 \n", | |
| "z\n", | |
| ""/></g><g id=patch_21><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 196.542273 234.855069 \n", | |
| "L 203.054091 234.855069 \n", | |
| "L 203.054091 200.581158 \n", | |
| "L 196.542273 200.581158 \n", | |
| "z\n", | |
| ""/></g><g id=patch_22><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 203.054091 234.855069 \n", | |
| "L 209.565909 234.855069 \n", | |
| "L 209.565909 198.220696 \n", | |
| "L 203.054091 198.220696 \n", | |
| "z\n", | |
| ""/></g><g id=patch_23><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 209.565909 234.855069 \n", | |
| "L 216.077727 234.855069 \n", | |
| "L 216.077727 214.838349 \n", | |
| "L 209.565909 214.838349 \n", | |
| "z\n", | |
| ""/></g><g id=patch_24><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 216.077727 234.855069 \n", | |
| "L 222.589545 234.855069 \n", | |
| "L 222.589545 126.084972 \n", | |
| "L 216.077727 126.084972 \n", | |
| "z\n", | |
| ""/></g><g id=patch_25><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 222.589545 234.855069 \n", | |
| "L 229.101364 234.855069 \n", | |
| "L 229.101364 200.392321 \n", | |
| "L 222.589545 200.392321 \n", | |
| "z\n", | |
| ""/></g><g id=patch_26><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 229.101364 234.855069 \n", | |
| "L 235.613182 234.855069 \n", | |
| "L 235.613182 214.460675 \n", | |
| "L 229.101364 214.460675 \n", | |
| "z\n", | |
| ""/></g><g id=patch_27><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 235.613182 234.855069 \n", | |
| "L 242.125 234.855069 \n", | |
| "L 242.125 225.790894 \n", | |
| "L 235.613182 225.790894 \n", | |
| "z\n", | |
| ""/></g><g id=patch_28><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 242.125 234.855069 \n", | |
| "L 248.636818 234.855069 \n", | |
| "L 248.636818 202.563946 \n", | |
| "L 242.125 202.563946 \n", | |
| "z\n", | |
| ""/></g><g id=patch_29><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 248.636818 234.855069 \n", | |
| "L 255.148636 234.855069 \n", | |
| "L 255.148636 226.735079 \n", | |
| "L 248.636818 226.735079 \n", | |
| "z\n", | |
| ""/></g><g id=patch_30><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 255.148636 234.855069 \n", | |
| "L 261.660455 234.855069 \n", | |
| "L 261.660455 229.189959 \n", | |
| "L 255.148636 229.189959 \n", | |
| "z\n", | |
| ""/></g><g id=patch_31><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 261.660455 234.855069 \n", | |
| "L 268.172273 234.855069 \n", | |
| "L 268.172273 165.363062 \n", | |
| "L 261.660455 165.363062 \n", | |
| "z\n", | |
| ""/></g><g id=patch_32><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 268.172273 234.855069 \n", | |
| "L 274.684091 234.855069 \n", | |
| "L 274.684091 224.18578 \n", | |
| "L 268.172273 224.18578 \n", | |
| "z\n", | |
| ""/></g><g id=patch_33><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 274.684091 234.855069 \n", | |
| "L 281.195909 234.855069 \n", | |
| "L 281.195909 231.078329 \n", | |
| "L 274.684091 231.078329 \n", | |
| "z\n", | |
| ""/></g><g id=patch_34><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 281.195909 234.855069 \n", | |
| "L 287.707727 234.855069 \n", | |
| "L 287.707727 226.168568 \n", | |
| "L 281.195909 226.168568 \n", | |
| "z\n", | |
| ""/></g><g id=patch_35><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 287.707727 234.855069 \n", | |
| "L 294.219545 234.855069 \n", | |
| "L 294.219545 230.134144 \n", | |
| "L 287.707727 230.134144 \n", | |
| "z\n", | |
| ""/></g><g id=patch_36><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 294.219545 234.855069 \n", | |
| "L 300.731364 234.855069 \n", | |
| "L 300.731364 232.777862 \n", | |
| "L 294.219545 232.777862 \n", | |
| "z\n", | |
| ""/></g><g id=patch_37><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 300.731364 234.855069 \n", | |
| "L 307.243182 234.855069 \n", | |
| "L 307.243182 210.023007 \n", | |
| "L 300.731364 210.023007 \n", | |
| "z\n", | |
| ""/></g><g id=patch_38><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 307.243182 234.855069 \n", | |
| "L 313.755 234.855069 \n", | |
| "L 313.755 180.564439 \n", | |
| "L 307.243182 180.564439 \n", | |
| "z\n", | |
| ""/></g><g id=patch_39><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 313.755 234.855069 \n", | |
| "L 320.266818 234.855069 \n", | |
| "L 320.266818 233.344373 \n", | |
| "L 313.755 233.344373 \n", | |
| "z\n", | |
| ""/></g><g id=patch_40><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 320.266818 234.855069 \n", | |
| "L 326.778636 234.855069 \n", | |
| "L 326.778636 234.855069 \n", | |
| "L 320.266818 234.855069 \n", | |
| "z\n", | |
| ""/></g><g id=patch_41><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 326.778636 234.855069 \n", | |
| "L 333.290455 234.855069 \n", | |
| "L 333.290455 233.722047 \n", | |
| "L 326.778636 233.722047 \n", | |
| "z\n", | |
| ""/></g><g id=patch_42><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 333.290455 234.855069 \n", | |
| "L 339.802273 234.855069 \n", | |
| "L 339.802273 230.322981 \n", | |
| "L 333.290455 230.322981 \n", | |
| "z\n", | |
| ""/></g><g id=patch_43><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 339.802273 234.855069 \n", | |
| "L 346.314091 234.855069 \n", | |
| "L 346.314091 234.76065 \n", | |
| "L 339.802273 234.76065 \n", | |
| "z\n", | |
| ""/></g><g id=patch_44><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 346.314091 234.855069 \n", | |
| "L 352.825909 234.855069 \n", | |
| "L 352.825909 234.477395 \n", | |
| "L 346.314091 234.477395 \n", | |
| "z\n", | |
| ""/></g><g id=patch_45><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 352.825909 234.855069 \n", | |
| "L 359.337727 234.855069 \n", | |
| "L 359.337727 227.112753 \n", | |
| "L 352.825909 227.112753 \n", | |
| "z\n", | |
| ""/></g><g id=patch_46><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 359.337727 234.855069 \n", | |
| "L 365.849545 234.855069 \n", | |
| "L 365.849545 234.666232 \n", | |
| "L 359.337727 234.666232 \n", | |
| "z\n", | |
| ""/></g><g id=patch_47><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 365.849545 234.855069 \n", | |
| "L 372.361364 234.855069 \n", | |
| "L 372.361364 234.382976 \n", | |
| "L 365.849545 234.382976 \n", | |
| "z\n", | |
| ""/></g><g id=patch_48><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 372.361364 234.855069 \n", | |
| "L 378.873182 234.855069 \n", | |
| "L 378.873182 233.910884 \n", | |
| "L 372.361364 233.910884 \n", | |
| "z\n", | |
| ""/></g><g id=patch_49><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 378.873182 234.855069 \n", | |
| "L 385.385 234.855069 \n", | |
| "L 385.385 234.76065 \n", | |
| "L 378.873182 234.76065 \n", | |
| "z\n", | |
| ""/></g><g id=patch_50><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 385.385 234.855069 \n", | |
| "L 391.896818 234.855069 \n", | |
| "L 391.896818 234.382976 \n", | |
| "L 385.385 234.382976 \n", | |
| "z\n", | |
| ""/></g><g id=patch_51><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 391.896818 234.855069 \n", | |
| "L 398.408636 234.855069 \n", | |
| "L 398.408636 234.382976 \n", | |
| "L 391.896818 234.382976 \n", | |
| "z\n", | |
| ""/></g><g id=patch_52><path clip-path=url(#p5d1cfc8602) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 398.408636 234.855069 \n", | |
| "L 404.920455 234.855069 \n", | |
| "L 404.920455 222.769502 \n", | |
| "L 398.408636 222.769502 \n", | |
| "z\n", | |
| ""/></g><g id=patch_53><path style=fill:none; d="M 63.05 234.855069 \n", | |
| "L 63.05 10.8 \n", | |
| ""/></g><g id=patch_54><path style=fill:none; d="M 421.2 234.855069 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g><g id=patch_55><path style=fill:none; d="M 63.05 234.855069 \n", | |
| "L 421.2 234.855069 \n", | |
| ""/></g><g id=patch_56><path style=fill:none; d="M 63.05 10.8 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=p5d1cfc8602><rect height=224.055069 width=358.15 x=63.05 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"><strong>Histogram with fixed size bins</strong> (bins=50) </div></div><div role=tabpanel class="tab-pane col-sm-12" id=-8566384954619091435bottom--8566384954619091435common_values><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=10000>10000</td><td>1878</td><td><div class=bar style=width:15.7%> &nbsp; </div> 8.2% </td></tr><tr class><td title=5000>5000</td><td>1431</td><td><div class=bar style=width:11.9%> &nbsp; </div> 6.3% </td></tr><tr class><td title=6000>6000</td><td>1249</td><td><div class=bar style=width:10.4%> &nbsp; </div> 5.5% </td></tr><tr class><td title=12000>12000</td><td>1241</td><td><div class=bar style=width:10.3%> &nbsp; </div> 5.5% </td></tr><tr class><td title=15000>15000</td><td>1064</td><td><div class=bar style=width:8.9%> &nbsp; </div> 4.7% </td></tr><tr class><td title=8000>8000</td><td>1040</td><td><div class=bar style=width:8.7%> &nbsp; </div> 4.6% </td></tr><tr class><td title=4000>4000</td><td>753</td><td><div class=bar style=width:6.3%> &nbsp; </div> 3.3% </td></tr><tr class><td title=3000>3000</td><td>722</td><td><div class=bar style=width:6.0%> &nbsp; </div> 3.2% </td></tr><tr class><td title=20000>20000</td><td>708</td><td><div class=bar style=width:5.9%> &nbsp; </div> 3.1% </td></tr><tr class><td title=7000>7000</td><td>686</td><td><div class=bar style=width:5.7%> &nbsp; </div> 3.0% </td></tr><tr class=other><td title="Other values (685)">Other values (685)</td><td>11993</td><td><div class=bar style=width:100.0%> 52.7% </div></td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=-8566384954619091435bottom--8566384954619091435extreme_values><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-8566384954619091435extreme_values--8566384954619091435firstn aria-controls=-8566384954619091435extreme_values--8566384954619091435firstn role=tab data-toggle=tab>Minimum 10 values</a></li><li role=presentation><a href=#-8566384954619091435extreme_values--8566384954619091435lastn aria-controls=-8566384954619091435extreme_values--8566384954619091435lastn role=tab data-toggle=tab>Maximum 10 values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-8566384954619091435extreme_values--8566384954619091435firstn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=500>500</td><td>4</td><td><div class=bar style=width:1.8%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=725>725</td><td>1</td><td><div class=bar style=width:0.5%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=750>750</td><td>1</td><td><div class=bar style=width:0.5%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=900>900</td><td>1</td><td><div class=bar style=width:0.5%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=950>950</td><td>1</td><td><div class=bar style=width:0.5%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=1000>1000</td><td>219</td><td><div class=bar style=width:100.0%> 1.0% </div></td></tr><tr class><td title=1050>1050</td><td>3</td><td><div class=bar style=width:1.4%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=1075>1075</td><td>1</td><td><div class=bar style=width:0.5%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=1100>1100</td><td>3</td><td><div class=bar style=width:1.4%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=1125>1125</td><td>1</td><td><div class=bar style=width:0.5%> &nbsp; </div>< 0.1% </td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=-8566384954619091435extreme_values--8566384954619091435lastn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=35000>35000</td><td>128</td><td><div class=bar style=width:100.0%> 0.6% </div></td></tr><tr class><td title=34000>34000</td><td>3</td><td><div class=bar style=width:2.3%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=33950>33950</td><td>2</td><td><div class=bar style=width:1.6%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=33250>33250</td><td>1</td><td><div class=bar style=width:0.8%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=33000>33000</td><td>4</td><td><div class=bar style=width:3.1%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=32400>32400</td><td>1</td><td><div class=bar style=width:0.8%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=32000>32000</td><td>8</td><td><div class=bar style=width:6.2%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=31825>31825</td><td>2</td><td><div class=bar style=width:1.6%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=31400>31400</td><td>1</td><td><div class=bar style=width:0.8%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=31300>31300</td><td>1</td><td><div class=bar style=width:0.8%> &nbsp; </div>< 0.1% </td></tr></tbody></table></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_-3082778655817027807></a><div class=variable><div class=col-sm-3><p class=h4 title=loan_int_rate><a href=#pp_var_-3082778655817027807>loan_int_rate</a><br><small>Real number (&Ropf;<sub>&ge;0</sub>)</small></p><code><abbr title="This variable has a high correlation with 2 fields: loan_grade, cb_person_default_on_file">HIGH CORRELATION</abbr></code><br><code>MISSING</code><br><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>339</td></tr><tr><th>Distinct (%)</th><td>1.6%</td></tr><tr class=alert><th>Missing</th><td>2136</td></tr><tr class=alert><th>Missing (%)</th><td>9.4%</td></tr><tr><th>Infinite</th><td>0</td></tr><tr><th>Infinite (%)</th><td>0.0%</td></tr><tr><th>Mean</th><td>11.01850211</td></tr></tbody></table></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>5.42</td></tr><tr><th>Maximum</th><td>23.22</td></tr><tr><th>Zeros</th><td>0</td></tr><tr><th>Zeros (%)</th><td>0.0%</td></tr><tr><th>Negative</th><td>0</td></tr><tr><th>Negative (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>178.0 KiB</td></tr></tbody></table></div><div class=col-sm-3><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=162pt version=1.1 viewbox="0 0 216 162" width=216pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 162 \n", | |
| "L 216 162 \n", | |
| "L 216 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 11.775658 124.676583 \n", | |
| "L 205.2 124.676583 \n", | |
| "L 205.2 10.8 \n", | |
| "L 11.775658 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
| "L 49.515625 72.90625 \n", | |
| "L 49.515625 64.59375 \n", | |
| "L 19.828125 64.59375 \n", | |
| "L 19.828125 46.734375 \n", | |
| "Q 21.96875 47.46875 24.109375 47.828125 \n", | |
| "Q 26.265625 48.1875 28.421875 48.1875 \n", | |
| "Q 40.625 48.1875 47.75 41.5 \n", | |
| "Q 54.890625 34.8125 54.890625 23.390625 \n", | |
| "Q 54.890625 11.625 47.5625 5.09375 \n", | |
| "Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
| "Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
| "Q 12.796875 0.140625 7.71875 1.703125 \n", | |
| "L 7.71875 11.625 \n", | |
| "Q 12.109375 9.234375 16.796875 8.0625 \n", | |
| "Q 21.484375 6.890625 26.703125 6.890625 \n", | |
| "Q 35.15625 6.890625 40.078125 11.328125 \n", | |
| "Q 45.015625 15.765625 45.015625 23.390625 \n", | |
| "Q 45.015625 31 40.078125 35.4375 \n", | |
| "Q 35.15625 39.890625 26.703125 39.890625 \n", | |
| "Q 22.75 39.890625 18.8125 39.015625 \n", | |
| "Q 14.890625 38.140625 10.796875 36.28125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(16.179984 145.574082)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(63.773743 149.173255)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><g style=fill:#262626; transform="translate(113.167089 149.173255)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(162.560434 149.173255)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=patch_3><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 20.567673 124.676583 \n", | |
| "L 24.084479 124.676583 \n", | |
| "L 24.084479 89.337675 \n", | |
| "L 20.567673 89.337675 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 24.084479 124.676583 \n", | |
| "L 27.601286 124.676583 \n", | |
| "L 27.601286 54.892395 \n", | |
| "L 24.084479 54.892395 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 27.601286 124.676583 \n", | |
| "L 31.118092 124.676583 \n", | |
| "L 31.118092 109.07872 \n", | |
| "L 27.601286 109.07872 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 31.118092 124.676583 \n", | |
| "L 34.634898 124.676583 \n", | |
| "L 34.634898 76.501934 \n", | |
| "L 31.118092 76.501934 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 34.634898 124.676583 \n", | |
| "L 38.151704 124.676583 \n", | |
| "L 38.151704 59.685489 \n", | |
| "L 34.634898 59.685489 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 38.151704 124.676583 \n", | |
| "L 41.668511 124.676583 \n", | |
| "L 41.668511 16.222694 \n", | |
| "L 38.151704 16.222694 \n", | |
| "z\n", | |
| ""/></g><g id=patch_9><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 41.668511 124.676583 \n", | |
| "L 45.185317 124.676583 \n", | |
| "L 45.185317 26.946225 \n", | |
| "L 41.668511 26.946225 \n", | |
| "z\n", | |
| ""/></g><g id=patch_10><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 45.185317 124.676583 \n", | |
| "L 48.702123 124.676583 \n", | |
| "L 48.702123 113.221902 \n", | |
| "L 45.185317 113.221902 \n", | |
| "z\n", | |
| ""/></g><g id=patch_11><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 48.702123 124.676583 \n", | |
| "L 52.218929 124.676583 \n", | |
| "L 52.218929 86.006882 \n", | |
| "L 48.702123 86.006882 \n", | |
| "z\n", | |
| ""/></g><g id=patch_12><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 52.218929 124.676583 \n", | |
| "L 55.735735 124.676583 \n", | |
| "L 55.735735 76.09574 \n", | |
| "L 52.218929 76.09574 \n", | |
| "z\n", | |
| ""/></g><g id=patch_13><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 55.735735 124.676583 \n", | |
| "L 59.252542 124.676583 \n", | |
| "L 59.252542 103.879433 \n", | |
| "L 55.735735 103.879433 \n", | |
| "z\n", | |
| ""/></g><g id=patch_14><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 59.252542 124.676583 \n", | |
| "L 62.769348 124.676583 \n", | |
| "L 62.769348 95.43059 \n", | |
| "L 59.252542 95.43059 \n", | |
| "z\n", | |
| ""/></g><g id=patch_15><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 62.769348 124.676583 \n", | |
| "L 66.286154 124.676583 \n", | |
| "L 66.286154 51.317885 \n", | |
| "L 62.769348 51.317885 \n", | |
| "z\n", | |
| ""/></g><g id=patch_16><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 66.286154 124.676583 \n", | |
| "L 69.80296 124.676583 \n", | |
| "L 69.80296 66.347076 \n", | |
| "L 66.286154 66.347076 \n", | |
| "z\n", | |
| ""/></g><g id=patch_17><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 69.80296 124.676583 \n", | |
| "L 73.319767 124.676583 \n", | |
| "L 73.319767 51.155408 \n", | |
| "L 69.80296 51.155408 \n", | |
| "z\n", | |
| ""/></g><g id=patch_18><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 73.319767 124.676583 \n", | |
| "L 76.836573 124.676583 \n", | |
| "L 76.836573 56.760889 \n", | |
| "L 73.319767 56.760889 \n", | |
| "z\n", | |
| ""/></g><g id=patch_19><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 76.836573 124.676583 \n", | |
| "L 80.353379 124.676583 \n", | |
| "L 80.353379 77.639278 \n", | |
| "L 76.836573 77.639278 \n", | |
| "z\n", | |
| ""/></g><g id=patch_20><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 80.353379 124.676583 \n", | |
| "L 83.870185 124.676583 \n", | |
| "L 83.870185 51.561602 \n", | |
| "L 80.353379 51.561602 \n", | |
| "z\n", | |
| ""/></g><g id=patch_21><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 83.870185 124.676583 \n", | |
| "L 87.386991 124.676583 \n", | |
| "L 87.386991 53.511335 \n", | |
| "L 83.870185 53.511335 \n", | |
| "z\n", | |
| ""/></g><g id=patch_22><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 87.386991 124.676583 \n", | |
| "L 90.903798 124.676583 \n", | |
| "L 90.903798 67.321942 \n", | |
| "L 87.386991 67.321942 \n", | |
| "z\n", | |
| ""/></g><g id=patch_23><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 90.903798 124.676583 \n", | |
| "L 94.420604 124.676583 \n", | |
| "L 94.420604 60.091683 \n", | |
| "L 90.903798 60.091683 \n", | |
| "z\n", | |
| ""/></g><g id=patch_24><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 94.420604 124.676583 \n", | |
| "L 97.93741 124.676583 \n", | |
| "L 97.93741 59.360533 \n", | |
| "L 94.420604 59.360533 \n", | |
| "z\n", | |
| ""/></g><g id=patch_25><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 97.93741 124.676583 \n", | |
| "L 101.454216 124.676583 \n", | |
| "L 101.454216 64.64106 \n", | |
| "L 97.93741 64.64106 \n", | |
| "z\n", | |
| ""/></g><g id=patch_26><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 101.454216 124.676583 \n", | |
| "L 104.971023 124.676583 \n", | |
| "L 104.971023 85.194493 \n", | |
| "L 101.454216 85.194493 \n", | |
| "z\n", | |
| ""/></g><g id=patch_27><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 104.971023 124.676583 \n", | |
| "L 108.487829 124.676583 \n", | |
| "L 108.487829 66.509554 \n", | |
| "L 104.971023 66.509554 \n", | |
| "z\n", | |
| ""/></g><g id=patch_28><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 108.487829 124.676583 \n", | |
| "L 112.004635 124.676583 \n", | |
| "L 112.004635 84.950777 \n", | |
| "L 108.487829 84.950777 \n", | |
| "z\n", | |
| ""/></g><g id=patch_29><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 112.004635 124.676583 \n", | |
| "L 115.521441 124.676583 \n", | |
| "L 115.521441 84.057149 \n", | |
| "L 112.004635 84.057149 \n", | |
| "z\n", | |
| ""/></g><g id=patch_30><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 115.521441 124.676583 \n", | |
| "L 119.038248 124.676583 \n", | |
| "L 119.038248 83.325999 \n", | |
| "L 115.521441 83.325999 \n", | |
| "z\n", | |
| ""/></g><g id=patch_31><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 119.038248 124.676583 \n", | |
| "L 122.555054 124.676583 \n", | |
| "L 122.555054 94.374485 \n", | |
| "L 119.038248 94.374485 \n", | |
| "z\n", | |
| ""/></g><g id=patch_32><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 122.555054 124.676583 \n", | |
| "L 126.07186 124.676583 \n", | |
| "L 126.07186 95.593068 \n", | |
| "L 122.555054 95.593068 \n", | |
| "z\n", | |
| ""/></g><g id=patch_33><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 126.07186 124.676583 \n", | |
| "L 129.588666 124.676583 \n", | |
| "L 129.588666 101.19855 \n", | |
| "L 126.07186 101.19855 \n", | |
| "z\n", | |
| ""/></g><g id=patch_34><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 129.588666 124.676583 \n", | |
| "L 133.105472 124.676583 \n", | |
| "L 133.105472 107.860137 \n", | |
| "L 129.588666 107.860137 \n", | |
| "z\n", | |
| ""/></g><g id=patch_35><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 133.105472 124.676583 \n", | |
| "L 136.622279 124.676583 \n", | |
| "L 136.622279 113.465619 \n", | |
| "L 133.105472 113.465619 \n", | |
| "z\n", | |
| ""/></g><g id=patch_36><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 136.622279 124.676583 \n", | |
| "L 140.139085 124.676583 \n", | |
| "L 140.139085 115.009158 \n", | |
| "L 136.622279 115.009158 \n", | |
| "z\n", | |
| ""/></g><g id=patch_37><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 140.139085 124.676583 \n", | |
| "L 143.655891 124.676583 \n", | |
| "L 143.655891 118.177473 \n", | |
| "L 140.139085 118.177473 \n", | |
| "z\n", | |
| ""/></g><g id=patch_38><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 143.655891 124.676583 \n", | |
| "L 147.172697 124.676583 \n", | |
| "L 147.172697 119.314818 \n", | |
| "L 143.655891 119.314818 \n", | |
| "z\n", | |
| ""/></g><g id=patch_39><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 147.172697 124.676583 \n", | |
| "L 150.689504 124.676583 \n", | |
| "L 150.689504 118.339951 \n", | |
| "L 147.172697 118.339951 \n", | |
| "z\n", | |
| ""/></g><g id=patch_40><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 150.689504 124.676583 \n", | |
| "L 154.20631 124.676583 \n", | |
| "L 154.20631 120.127206 \n", | |
| "L 150.689504 120.127206 \n", | |
| "z\n", | |
| ""/></g><g id=patch_41><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 154.20631 124.676583 \n", | |
| "L 157.723116 124.676583 \n", | |
| "L 157.723116 120.045967 \n", | |
| "L 154.20631 120.045967 \n", | |
| "z\n", | |
| ""/></g><g id=patch_42><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 157.723116 124.676583 \n", | |
| "L 161.239922 124.676583 \n", | |
| "L 161.239922 122.239417 \n", | |
| "L 157.723116 122.239417 \n", | |
| "z\n", | |
| ""/></g><g id=patch_43><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 161.239922 124.676583 \n", | |
| "L 164.756728 124.676583 \n", | |
| "L 164.756728 122.889328 \n", | |
| "L 161.239922 122.889328 \n", | |
| "z\n", | |
| ""/></g><g id=patch_44><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 164.756728 124.676583 \n", | |
| "L 168.273535 124.676583 \n", | |
| "L 168.273535 123.295522 \n", | |
| "L 164.756728 123.295522 \n", | |
| "z\n", | |
| ""/></g><g id=patch_45><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 168.273535 124.676583 \n", | |
| "L 171.790341 124.676583 \n", | |
| "L 171.790341 124.270388 \n", | |
| "L 168.273535 124.270388 \n", | |
| "z\n", | |
| ""/></g><g id=patch_46><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 171.790341 124.676583 \n", | |
| "L 175.307147 124.676583 \n", | |
| "L 175.307147 123.945433 \n", | |
| "L 171.790341 123.945433 \n", | |
| "z\n", | |
| ""/></g><g id=patch_47><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 175.307147 124.676583 \n", | |
| "L 178.823953 124.676583 \n", | |
| "L 178.823953 124.107911 \n", | |
| "L 175.307147 124.107911 \n", | |
| "z\n", | |
| ""/></g><g id=patch_48><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 178.823953 124.676583 \n", | |
| "L 182.34076 124.676583 \n", | |
| "L 182.34076 124.432866 \n", | |
| "L 178.823953 124.432866 \n", | |
| "z\n", | |
| ""/></g><g id=patch_49><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 182.34076 124.676583 \n", | |
| "L 185.857566 124.676583 \n", | |
| "L 185.857566 124.351627 \n", | |
| "L 182.34076 124.351627 \n", | |
| "z\n", | |
| ""/></g><g id=patch_50><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 185.857566 124.676583 \n", | |
| "L 189.374372 124.676583 \n", | |
| "L 189.374372 124.595344 \n", | |
| "L 185.857566 124.595344 \n", | |
| "z\n", | |
| ""/></g><g id=patch_51><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 189.374372 124.676583 \n", | |
| "L 192.891178 124.676583 \n", | |
| "L 192.891178 124.676583 \n", | |
| "L 189.374372 124.676583 \n", | |
| "z\n", | |
| ""/></g><g id=patch_52><path clip-path=url(#p2fb530a1c5) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 192.891178 124.676583 \n", | |
| "L 196.407984 124.676583 \n", | |
| "L 196.407984 124.595344 \n", | |
| "L 192.891178 124.595344 \n", | |
| "z\n", | |
| ""/></g><g id=patch_53><path style=fill:none; d="M 11.775658 124.676583 \n", | |
| "L 11.775658 10.8 \n", | |
| ""/></g><g id=patch_54><path style=fill:none; d="M 205.2 124.676583 \n", | |
| "L 205.2 10.8 \n", | |
| ""/></g><g id=patch_55><path style=fill:none; d="M 11.775658 124.676583 \n", | |
| "L 205.2 124.676583 \n", | |
| ""/></g><g id=patch_56><path style=fill:none; d="M 11.775658 10.8 \n", | |
| "L 205.2 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=p2fb530a1c5><rect height=113.876583 width=193.424342 x=11.775658 y=10.8 /></clippath></defs></svg></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom--3082778655817027807, #minifreqtable-3082778655817027807" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom--3082778655817027807 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-3082778655817027807bottom--3082778655817027807statistics aria-controls=-3082778655817027807bottom--3082778655817027807statistics role=tab data-toggle=tab>Statistics</a></li><li role=presentation><a href=#-3082778655817027807bottom--3082778655817027807histogram aria-controls=-3082778655817027807bottom--3082778655817027807histogram role=tab data-toggle=tab>Histogram</a></li><li role=presentation><a href=#-3082778655817027807bottom--3082778655817027807common_values aria-controls=-3082778655817027807bottom--3082778655817027807common_values role=tab data-toggle=tab>Common values</a></li><li role=presentation><a href=#-3082778655817027807bottom--3082778655817027807extreme_values aria-controls=-3082778655817027807bottom--3082778655817027807extreme_values role=tab data-toggle=tab>Extreme values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-3082778655817027807bottom--3082778655817027807statistics><div class=col-sm-6><p class=h4>Quantile statistics</p><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>5.42</td></tr><tr><th>5-th percentile</th><td>6.03</td></tr><tr><th>Q1</th><td>7.9</td></tr><tr><th>median</th><td>10.99</td></tr><tr><th>Q3</th><td>13.47</td></tr><tr><th>95-th percentile</th><td>16.32</td></tr><tr><th>Maximum</th><td>23.22</td></tr><tr><th>Range</th><td>17.8</td></tr><tr><th>Interquartile range (IQR)</th><td>5.57</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Descriptive statistics</p><table class="table table-condensed stats"><tbody><tr><th>Standard deviation</th><td>3.245142879</td></tr><tr><th>Coefficient of variation (CV)</th><td>0.2945176075</td></tr><tr><th>Kurtosis</th><td>-0.6744903598</td></tr><tr><th>Mean</th><td>11.01850211</td></tr><tr><th>Median Absolute Deviation (MAD)</th><td>2.58</td></tr><tr><th>Skewness</th><td>0.2019590876</td></tr><tr><th>Sum</th><td>227300.68</td></tr><tr><th>Variance</th><td>10.5309523</td></tr><tr><th>Monotonicity</th><td>Not monotonic</td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-3082778655817027807bottom--3082778655817027807histogram><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
| "L 432 288 \n", | |
| "L 432 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 63.05 241.307418 \n", | |
| "L 421.2 241.307418 \n", | |
| "L 421.2 14.528539 \n", | |
| "L 63.05 14.528539 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
| "L 49.515625 72.90625 \n", | |
| "L 49.515625 64.59375 \n", | |
| "L 19.828125 64.59375 \n", | |
| "L 19.828125 46.734375 \n", | |
| "Q 21.96875 47.46875 24.109375 47.828125 \n", | |
| "Q 26.265625 48.1875 28.421875 48.1875 \n", | |
| "Q 40.625 48.1875 47.75 41.5 \n", | |
| "Q 54.890625 34.8125 54.890625 23.390625 \n", | |
| "Q 54.890625 11.625 47.5625 5.09375 \n", | |
| "Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
| "Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
| "Q 12.796875 0.140625 7.71875 1.703125 \n", | |
| "L 7.71875 11.625 \n", | |
| "Q 12.109375 9.234375 16.796875 8.0625 \n", | |
| "Q 21.484375 6.890625 26.703125 6.890625 \n", | |
| "Q 35.15625 6.890625 40.078125 11.328125 \n", | |
| "Q 45.015625 15.765625 45.015625 23.390625 \n", | |
| "Q 45.015625 31 40.078125 35.4375 \n", | |
| "Q 35.15625 39.890625 26.703125 39.890625 \n", | |
| "Q 22.75 39.890625 18.8125 39.015625 \n", | |
| "Q 14.890625 38.140625 10.796875 36.28125 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-46 d="M 10.6875 12.40625 \n", | |
| "L 21 12.40625 \n", | |
| "L 21 0 \n", | |
| "L 10.6875 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(67.975632 270.925532)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-55 d="M 8.203125 72.90625 \n", | |
| "L 55.078125 72.90625 \n", | |
| "L 55.078125 68.703125 \n", | |
| "L 28.609375 0 \n", | |
| "L 18.3125 0 \n", | |
| "L 43.21875 64.59375 \n", | |
| "L 8.203125 64.59375 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(113.704693 270.925532)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-55 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(157.184269 275.424499)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-46 /><use x=159.033203 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(202.91333 275.424499)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-50 /><use x=127.246094 xlink:href=#DejaVuSans-46 /><use x=159.033203 xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_5><g id=text_5><g style=fill:#262626; transform="translate(248.64239 275.424499)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-46 /><use x=159.033203 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_6><g id=text_6><g style=fill:#262626; transform="translate(294.37145 275.424499)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-55 /><use x=127.246094 xlink:href=#DejaVuSans-46 /><use x=159.033203 xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_7><g id=text_7><g style=fill:#262626; transform="translate(340.10051 275.424499)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-46 /><use x=159.033203 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_8><g id=text_8><g style=fill:#262626; transform="translate(385.829571 275.424499)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-50 /><use x=127.246094 xlink:href=#DejaVuSans-46 /><use x=159.033203 xlink:href=#DejaVuSans-53 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_9><g style=fill:#262626; transform="translate(43.6875 245.106637)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_10><g style=fill:#262626; transform="translate(30.9625 212.7501)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_3><g id=text_11><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
| "L 12.890625 25.390625 \n", | |
| "L 37.796875 25.390625 \n", | |
| "z\n", | |
| "M 35.203125 72.90625 \n", | |
| "L 47.609375 72.90625 \n", | |
| "L 47.609375 25.390625 \n", | |
| "L 58.015625 25.390625 \n", | |
| "L 58.015625 17.1875 \n", | |
| "L 47.609375 17.1875 \n", | |
| "L 47.609375 0 \n", | |
| "L 37.796875 0 \n", | |
| "L 37.796875 17.1875 \n", | |
| "L 4.890625 17.1875 \n", | |
| "L 4.890625 26.703125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(30.9625 180.393563)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_12><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
| "Q 26.375 40.375 22.484375 35.828125 \n", | |
| "Q 18.609375 31.296875 18.609375 23.390625 \n", | |
| "Q 18.609375 15.53125 22.484375 10.953125 \n", | |
| "Q 26.375 6.390625 33.015625 6.390625 \n", | |
| "Q 39.65625 6.390625 43.53125 10.953125 \n", | |
| "Q 47.40625 15.53125 47.40625 23.390625 \n", | |
| "Q 47.40625 31.296875 43.53125 35.828125 \n", | |
| "Q 39.65625 40.375 33.015625 40.375 \n", | |
| "z\n", | |
| "M 52.59375 71.296875 \n", | |
| "L 52.59375 62.3125 \n", | |
| "Q 48.875 64.0625 45.09375 64.984375 \n", | |
| "Q 41.3125 65.921875 37.59375 65.921875 \n", | |
| "Q 27.828125 65.921875 22.671875 59.328125 \n", | |
| "Q 17.53125 52.734375 16.796875 39.40625 \n", | |
| "Q 19.671875 43.65625 24.015625 45.921875 \n", | |
| "Q 28.375 48.1875 33.59375 48.1875 \n", | |
| "Q 44.578125 48.1875 50.953125 41.515625 \n", | |
| "Q 57.328125 34.859375 57.328125 23.390625 \n", | |
| "Q 57.328125 12.15625 50.6875 5.359375 \n", | |
| "Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
| "Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
| "Q 6.984375 17.96875 6.984375 36.375 \n", | |
| "Q 6.984375 53.65625 15.1875 63.9375 \n", | |
| "Q 23.390625 74.21875 37.203125 74.21875 \n", | |
| "Q 40.921875 74.21875 44.703125 73.484375 \n", | |
| "Q 48.484375 72.75 52.59375 71.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(30.9625 148.037026)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-54 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_5><g id=text_13><defs><path id=DejaVuSans-56 d="M 31.78125 34.625 \n", | |
| "Q 24.75 34.625 20.71875 30.859375 \n", | |
| "Q 16.703125 27.09375 16.703125 20.515625 \n", | |
| "Q 16.703125 13.921875 20.71875 10.15625 \n", | |
| "Q 24.75 6.390625 31.78125 6.390625 \n", | |
| "Q 38.8125 6.390625 42.859375 10.171875 \n", | |
| "Q 46.921875 13.96875 46.921875 20.515625 \n", | |
| "Q 46.921875 27.09375 42.890625 30.859375 \n", | |
| "Q 38.875 34.625 31.78125 34.625 \n", | |
| "z\n", | |
| "M 21.921875 38.8125 \n", | |
| "Q 15.578125 40.375 12.03125 44.71875 \n", | |
| "Q 8.5 49.078125 8.5 55.328125 \n", | |
| "Q 8.5 64.0625 14.71875 69.140625 \n", | |
| "Q 20.953125 74.21875 31.78125 74.21875 \n", | |
| "Q 42.671875 74.21875 48.875 69.140625 \n", | |
| "Q 55.078125 64.0625 55.078125 55.328125 \n", | |
| "Q 55.078125 49.078125 51.53125 44.71875 \n", | |
| "Q 48 40.375 41.703125 38.8125 \n", | |
| "Q 48.828125 37.15625 52.796875 32.3125 \n", | |
| "Q 56.78125 27.484375 56.78125 20.515625 \n", | |
| "Q 56.78125 9.90625 50.3125 4.234375 \n", | |
| "Q 43.84375 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.734375 -1.421875 13.25 4.234375 \n", | |
| "Q 6.78125 9.90625 6.78125 20.515625 \n", | |
| "Q 6.78125 27.484375 10.78125 32.3125 \n", | |
| "Q 14.796875 37.15625 21.921875 38.8125 \n", | |
| "z\n", | |
| "M 18.3125 54.390625 \n", | |
| "Q 18.3125 48.734375 21.84375 45.5625 \n", | |
| "Q 25.390625 42.390625 31.78125 42.390625 \n", | |
| "Q 38.140625 42.390625 41.71875 45.5625 \n", | |
| "Q 45.3125 48.734375 45.3125 54.390625 \n", | |
| "Q 45.3125 60.0625 41.71875 63.234375 \n", | |
| "Q 38.140625 66.40625 31.78125 66.40625 \n", | |
| "Q 25.390625 66.40625 21.84375 63.234375 \n", | |
| "Q 18.3125 60.0625 18.3125 54.390625 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(30.9625 115.680489)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-56 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_6><g id=text_14><g style=fill:#262626; transform="translate(24.6 83.323952)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_7><g id=text_15><g style=fill:#262626; transform="translate(24.6 50.967415)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-50 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_8><g id=text_16><g style=fill:#262626; transform="translate(24.6 18.610878)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-52 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_17><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
| "L 51.703125 72.90625 \n", | |
| "L 51.703125 64.59375 \n", | |
| "L 19.671875 64.59375 \n", | |
| "L 19.671875 43.109375 \n", | |
| "L 48.578125 43.109375 \n", | |
| "L 48.578125 34.8125 \n", | |
| "L 19.671875 34.8125 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
| "Q 39.59375 47.171875 37.8125 47.578125 \n", | |
| "Q 36.03125 48 33.890625 48 \n", | |
| "Q 26.265625 48 22.1875 43.046875 \n", | |
| "Q 18.109375 38.09375 18.109375 28.8125 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 20.953125 51.171875 25.484375 53.578125 \n", | |
| "Q 30.03125 56 36.53125 56 \n", | |
| "Q 37.453125 56 38.578125 55.875 \n", | |
| "Q 39.703125 55.765625 41.0625 55.515625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
| "L 56.203125 25.203125 \n", | |
| "L 14.890625 25.203125 \n", | |
| "Q 15.484375 15.921875 20.484375 11.0625 \n", | |
| "Q 25.484375 6.203125 34.421875 6.203125 \n", | |
| "Q 39.59375 6.203125 44.453125 7.46875 \n", | |
| "Q 49.3125 8.734375 54.109375 11.28125 \n", | |
| "L 54.109375 2.78125 \n", | |
| "Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
| "Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
| "Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
| "Q 5.515625 13.8125 5.515625 26.8125 \n", | |
| "Q 5.515625 40.234375 12.765625 48.109375 \n", | |
| "Q 20.015625 56 32.328125 56 \n", | |
| "Q 43.359375 56 49.78125 48.890625 \n", | |
| "Q 56.203125 41.796875 56.203125 29.59375 \n", | |
| "z\n", | |
| "M 47.21875 32.234375 \n", | |
| "Q 47.125 39.59375 43.09375 43.984375 \n", | |
| "Q 39.0625 48.390625 32.421875 48.390625 \n", | |
| "Q 24.90625 48.390625 20.390625 44.140625 \n", | |
| "Q 15.875 39.890625 15.1875 32.171875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
| "Q 14.796875 17.390625 18.875 11.75 \n", | |
| "Q 22.953125 6.109375 30.078125 6.109375 \n", | |
| "Q 37.203125 6.109375 41.296875 11.75 \n", | |
| "Q 45.40625 17.390625 45.40625 27.296875 \n", | |
| "Q 45.40625 37.203125 41.296875 42.84375 \n", | |
| "Q 37.203125 48.484375 30.078125 48.484375 \n", | |
| "Q 22.953125 48.484375 18.875 42.84375 \n", | |
| "Q 14.796875 37.203125 14.796875 27.296875 \n", | |
| "z\n", | |
| "M 45.40625 8.203125 \n", | |
| "Q 42.578125 3.328125 38.25 0.953125 \n", | |
| "Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
| "Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
| "Q 5.515625 14.40625 5.515625 27.296875 \n", | |
| "Q 5.515625 40.1875 11.734375 48.09375 \n", | |
| "Q 17.96875 56 27.875 56 \n", | |
| "Q 33.9375 56 38.25 53.625 \n", | |
| "Q 42.578125 51.265625 45.40625 46.390625 \n", | |
| "L 45.40625 54.6875 \n", | |
| "L 54.390625 54.6875 \n", | |
| "L 54.390625 -20.796875 \n", | |
| "L 45.40625 -20.796875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
| "L 8.5 54.6875 \n", | |
| "L 17.484375 54.6875 \n", | |
| "L 17.484375 21.921875 \n", | |
| "Q 17.484375 14.15625 20.5 10.265625 \n", | |
| "Q 23.53125 6.390625 29.59375 6.390625 \n", | |
| "Q 36.859375 6.390625 41.078125 11.03125 \n", | |
| "Q 45.3125 15.671875 45.3125 23.6875 \n", | |
| "L 45.3125 54.6875 \n", | |
| "L 54.296875 54.6875 \n", | |
| "L 54.296875 0 \n", | |
| "L 45.3125 0 \n", | |
| "L 45.3125 8.40625 \n", | |
| "Q 42.046875 3.421875 37.71875 1 \n", | |
| "Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
| "Q 18.265625 -1.421875 13.375 4.4375 \n", | |
| "Q 8.5 10.296875 8.5 21.578125 \n", | |
| "z\n", | |
| "M 31.109375 56 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
| "L 54.890625 0 \n", | |
| "L 45.90625 0 \n", | |
| "L 45.90625 32.71875 \n", | |
| "Q 45.90625 40.484375 42.875 44.328125 \n", | |
| "Q 39.84375 48.1875 33.796875 48.1875 \n", | |
| "Q 26.515625 48.1875 22.3125 43.546875 \n", | |
| "Q 18.109375 38.921875 18.109375 30.90625 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 21.34375 51.125 25.703125 53.5625 \n", | |
| "Q 30.078125 56 35.796875 56 \n", | |
| "Q 45.21875 56 50.046875 50.171875 \n", | |
| "Q 54.890625 44.34375 54.890625 33.015625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
| "L 48.78125 44.1875 \n", | |
| "Q 44.96875 46.296875 41.140625 47.34375 \n", | |
| "Q 37.3125 48.390625 33.40625 48.390625 \n", | |
| "Q 24.65625 48.390625 19.8125 42.84375 \n", | |
| "Q 14.984375 37.3125 14.984375 27.296875 \n", | |
| "Q 14.984375 17.28125 19.8125 11.734375 \n", | |
| "Q 24.65625 6.203125 33.40625 6.203125 \n", | |
| "Q 37.3125 6.203125 41.140625 7.25 \n", | |
| "Q 44.96875 8.296875 48.78125 10.40625 \n", | |
| "L 48.78125 2.09375 \n", | |
| "Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
| "Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
| "Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
| "Q 5.515625 14.109375 5.515625 27.296875 \n", | |
| "Q 5.515625 40.671875 12.859375 48.328125 \n", | |
| "Q 20.21875 56 33.015625 56 \n", | |
| "Q 37.15625 56 41.109375 55.140625 \n", | |
| "Q 45.0625 54.296875 48.78125 52.59375 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
| "Q 28.375 -14.84375 24.75 -17.8125 \n", | |
| "Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
| "L 7.90625 -20.796875 \n", | |
| "L 7.90625 -13.28125 \n", | |
| "L 13.1875 -13.28125 \n", | |
| "Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
| "Q 21 -9.765625 23.484375 -3.21875 \n", | |
| "L 25.09375 0.875 \n", | |
| "L 2.984375 54.6875 \n", | |
| "L 12.5 54.6875 \n", | |
| "L 29.59375 11.921875 \n", | |
| "L 46.6875 54.6875 \n", | |
| "L 56.203125 54.6875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(18.312344 156.330635)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 79.329545 241.307418 \n", | |
| "L 85.841364 241.307418 \n", | |
| "L 85.841364 170.93195 \n", | |
| "L 79.329545 170.93195 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 85.841364 241.307418 \n", | |
| "L 92.353182 241.307418 \n", | |
| "L 92.353182 102.336092 \n", | |
| "L 85.841364 102.336092 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 92.353182 241.307418 \n", | |
| "L 98.865 241.307418 \n", | |
| "L 98.865 210.245142 \n", | |
| "L 92.353182 210.245142 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 98.865 241.307418 \n", | |
| "L 105.376818 241.307418 \n", | |
| "L 105.376818 145.370286 \n", | |
| "L 98.865 145.370286 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 105.376818 241.307418 \n", | |
| "L 111.888636 241.307418 \n", | |
| "L 111.888636 111.88127 \n", | |
| "L 105.376818 111.88127 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 111.888636 241.307418 \n", | |
| "L 118.400455 241.307418 \n", | |
| "L 118.400455 25.327534 \n", | |
| "L 111.888636 25.327534 \n", | |
| "z\n", | |
| ""/></g><g id=patch_9><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 118.400455 241.307418 \n", | |
| "L 124.912273 241.307418 \n", | |
| "L 124.912273 46.682848 \n", | |
| "L 118.400455 46.682848 \n", | |
| "z\n", | |
| ""/></g><g id=patch_10><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 124.912273 241.307418 \n", | |
| "L 131.424091 241.307418 \n", | |
| "L 131.424091 218.496059 \n", | |
| "L 124.912273 218.496059 \n", | |
| "z\n", | |
| ""/></g><g id=patch_11><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 131.424091 241.307418 \n", | |
| "L 137.935909 241.307418 \n", | |
| "L 137.935909 164.29886 \n", | |
| "L 131.424091 164.29886 \n", | |
| "z\n", | |
| ""/></g><g id=patch_12><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 137.935909 241.307418 \n", | |
| "L 144.447727 241.307418 \n", | |
| "L 144.447727 144.561372 \n", | |
| "L 137.935909 144.561372 \n", | |
| "z\n", | |
| ""/></g><g id=patch_13><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 144.447727 241.307418 \n", | |
| "L 150.959545 241.307418 \n", | |
| "L 150.959545 199.891051 \n", | |
| "L 144.447727 199.891051 \n", | |
| "z\n", | |
| ""/></g><g id=patch_14><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 150.959545 241.307418 \n", | |
| "L 157.471364 241.307418 \n", | |
| "L 157.471364 183.065651 \n", | |
| "L 150.959545 183.065651 \n", | |
| "z\n", | |
| ""/></g><g id=patch_15><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 157.471364 241.307418 \n", | |
| "L 163.983182 241.307418 \n", | |
| "L 163.983182 95.217653 \n", | |
| "L 157.471364 95.217653 \n", | |
| "z\n", | |
| ""/></g><g id=patch_16><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 163.983182 241.307418 \n", | |
| "L 170.495 241.307418 \n", | |
| "L 170.495 125.14745 \n", | |
| "L 163.983182 125.14745 \n", | |
| "z\n", | |
| ""/></g><g id=patch_17><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 170.495 241.307418 \n", | |
| "L 177.006818 241.307418 \n", | |
| "L 177.006818 94.894088 \n", | |
| "L 170.495 94.894088 \n", | |
| "z\n", | |
| ""/></g><g id=patch_18><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 177.006818 241.307418 \n", | |
| "L 183.518636 241.307418 \n", | |
| "L 183.518636 106.057093 \n", | |
| "L 177.006818 106.057093 \n", | |
| "z\n", | |
| ""/></g><g id=patch_19><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 183.518636 241.307418 \n", | |
| "L 190.030455 241.307418 \n", | |
| "L 190.030455 147.635243 \n", | |
| "L 183.518636 147.635243 \n", | |
| "z\n", | |
| ""/></g><g id=patch_20><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 190.030455 241.307418 \n", | |
| "L 196.542273 241.307418 \n", | |
| "L 196.542273 95.703002 \n", | |
| "L 190.030455 95.703002 \n", | |
| "z\n", | |
| ""/></g><g id=patch_21><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 196.542273 241.307418 \n", | |
| "L 203.054091 241.307418 \n", | |
| "L 203.054091 99.585786 \n", | |
| "L 196.542273 99.585786 \n", | |
| "z\n", | |
| ""/></g><g id=patch_22><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 203.054091 241.307418 \n", | |
| "L 209.565909 241.307418 \n", | |
| "L 209.565909 127.088842 \n", | |
| "L 203.054091 127.088842 \n", | |
| "z\n", | |
| ""/></g><g id=patch_23><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 209.565909 241.307418 \n", | |
| "L 216.077727 241.307418 \n", | |
| "L 216.077727 112.690183 \n", | |
| "L 209.565909 112.690183 \n", | |
| "z\n", | |
| ""/></g><g id=patch_24><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 216.077727 241.307418 \n", | |
| "L 222.589545 241.307418 \n", | |
| "L 222.589545 111.234139 \n", | |
| "L 216.077727 111.234139 \n", | |
| "z\n", | |
| ""/></g><g id=patch_25><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 222.589545 241.307418 \n", | |
| "L 229.101364 241.307418 \n", | |
| "L 229.101364 121.750014 \n", | |
| "L 222.589545 121.750014 \n", | |
| "z\n", | |
| ""/></g><g id=patch_26><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 229.101364 241.307418 \n", | |
| "L 235.613182 241.307418 \n", | |
| "L 235.613182 162.681033 \n", | |
| "L 229.101364 162.681033 \n", | |
| "z\n", | |
| ""/></g><g id=patch_27><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 235.613182 241.307418 \n", | |
| "L 242.125 241.307418 \n", | |
| "L 242.125 125.471016 \n", | |
| "L 235.613182 125.471016 \n", | |
| "z\n", | |
| ""/></g><g id=patch_28><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 242.125 241.307418 \n", | |
| "L 248.636818 241.307418 \n", | |
| "L 248.636818 162.195685 \n", | |
| "L 242.125 162.195685 \n", | |
| "z\n", | |
| ""/></g><g id=patch_29><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 248.636818 241.307418 \n", | |
| "L 255.148636 241.307418 \n", | |
| "L 255.148636 160.416075 \n", | |
| "L 248.636818 160.416075 \n", | |
| "z\n", | |
| ""/></g><g id=patch_30><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 255.148636 241.307418 \n", | |
| "L 261.660455 241.307418 \n", | |
| "L 261.660455 158.960031 \n", | |
| "L 255.148636 158.960031 \n", | |
| "z\n", | |
| ""/></g><g id=patch_31><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 261.660455 241.307418 \n", | |
| "L 268.172273 241.307418 \n", | |
| "L 268.172273 180.962476 \n", | |
| "L 261.660455 180.962476 \n", | |
| "z\n", | |
| ""/></g><g id=patch_32><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 268.172273 241.307418 \n", | |
| "L 274.684091 241.307418 \n", | |
| "L 274.684091 183.389217 \n", | |
| "L 268.172273 183.389217 \n", | |
| "z\n", | |
| ""/></g><g id=patch_33><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 274.684091 241.307418 \n", | |
| "L 281.195909 241.307418 \n", | |
| "L 281.195909 194.552222 \n", | |
| "L 274.684091 194.552222 \n", | |
| "z\n", | |
| ""/></g><g id=patch_34><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 281.195909 241.307418 \n", | |
| "L 287.707727 241.307418 \n", | |
| "L 287.707727 207.818402 \n", | |
| "L 281.195909 207.818402 \n", | |
| "z\n", | |
| ""/></g><g id=patch_35><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 287.707727 241.307418 \n", | |
| "L 294.219545 241.307418 \n", | |
| "L 294.219545 218.981407 \n", | |
| "L 287.707727 218.981407 \n", | |
| "z\n", | |
| ""/></g><g id=patch_36><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 294.219545 241.307418 \n", | |
| "L 300.731364 241.307418 \n", | |
| "L 300.731364 222.055278 \n", | |
| "L 294.219545 222.055278 \n", | |
| "z\n", | |
| ""/></g><g id=patch_37><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 300.731364 241.307418 \n", | |
| "L 307.243182 241.307418 \n", | |
| "L 307.243182 228.364803 \n", | |
| "L 300.731364 228.364803 \n", | |
| "z\n", | |
| ""/></g><g id=patch_38><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 307.243182 241.307418 \n", | |
| "L 313.755 241.307418 \n", | |
| "L 313.755 230.629761 \n", | |
| "L 307.243182 230.629761 \n", | |
| "z\n", | |
| ""/></g><g id=patch_39><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 313.755 241.307418 \n", | |
| "L 320.266818 241.307418 \n", | |
| "L 320.266818 228.688369 \n", | |
| "L 313.755 228.688369 \n", | |
| "z\n", | |
| ""/></g><g id=patch_40><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 320.266818 241.307418 \n", | |
| "L 326.778636 241.307418 \n", | |
| "L 326.778636 232.247588 \n", | |
| "L 320.266818 232.247588 \n", | |
| "z\n", | |
| ""/></g><g id=patch_41><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 326.778636 241.307418 \n", | |
| "L 333.290455 241.307418 \n", | |
| "L 333.290455 232.085805 \n", | |
| "L 326.778636 232.085805 \n", | |
| "z\n", | |
| ""/></g><g id=patch_42><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 333.290455 241.307418 \n", | |
| "L 339.802273 241.307418 \n", | |
| "L 339.802273 236.453937 \n", | |
| "L 333.290455 236.453937 \n", | |
| "z\n", | |
| ""/></g><g id=patch_43><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 339.802273 241.307418 \n", | |
| "L 346.314091 241.307418 \n", | |
| "L 346.314091 237.748199 \n", | |
| "L 339.802273 237.748199 \n", | |
| "z\n", | |
| ""/></g><g id=patch_44><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 346.314091 241.307418 \n", | |
| "L 352.825909 241.307418 \n", | |
| "L 352.825909 238.557112 \n", | |
| "L 346.314091 238.557112 \n", | |
| "z\n", | |
| ""/></g><g id=patch_45><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 352.825909 241.307418 \n", | |
| "L 359.337727 241.307418 \n", | |
| "L 359.337727 240.498505 \n", | |
| "L 352.825909 240.498505 \n", | |
| "z\n", | |
| ""/></g><g id=patch_46><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 359.337727 241.307418 \n", | |
| "L 365.849545 241.307418 \n", | |
| "L 365.849545 239.851374 \n", | |
| "L 359.337727 239.851374 \n", | |
| "z\n", | |
| ""/></g><g id=patch_47><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 365.849545 241.307418 \n", | |
| "L 372.361364 241.307418 \n", | |
| "L 372.361364 240.174939 \n", | |
| "L 365.849545 240.174939 \n", | |
| "z\n", | |
| ""/></g><g id=patch_48><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 372.361364 241.307418 \n", | |
| "L 378.873182 241.307418 \n", | |
| "L 378.873182 240.82207 \n", | |
| "L 372.361364 240.82207 \n", | |
| "z\n", | |
| ""/></g><g id=patch_49><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 378.873182 241.307418 \n", | |
| "L 385.385 241.307418 \n", | |
| "L 385.385 240.660287 \n", | |
| "L 378.873182 240.660287 \n", | |
| "z\n", | |
| ""/></g><g id=patch_50><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 385.385 241.307418 \n", | |
| "L 391.896818 241.307418 \n", | |
| "L 391.896818 241.145635 \n", | |
| "L 385.385 241.145635 \n", | |
| "z\n", | |
| ""/></g><g id=patch_51><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 391.896818 241.307418 \n", | |
| "L 398.408636 241.307418 \n", | |
| "L 398.408636 241.307418 \n", | |
| "L 391.896818 241.307418 \n", | |
| "z\n", | |
| ""/></g><g id=patch_52><path clip-path=url(#p9cbf1769b4) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 398.408636 241.307418 \n", | |
| "L 404.920455 241.307418 \n", | |
| "L 404.920455 241.145635 \n", | |
| "L 398.408636 241.145635 \n", | |
| "z\n", | |
| ""/></g><g id=patch_53><path style=fill:none; d="M 63.05 241.307418 \n", | |
| "L 63.05 14.528539 \n", | |
| ""/></g><g id=patch_54><path style=fill:none; d="M 421.2 241.307418 \n", | |
| "L 421.2 14.528539 \n", | |
| ""/></g><g id=patch_55><path style=fill:none; d="M 63.05 241.307418 \n", | |
| "L 421.2 241.307418 \n", | |
| ""/></g><g id=patch_56><path style=fill:none; d="M 63.05 14.528539 \n", | |
| "L 421.2 14.528539 \n", | |
| ""/></g></g></g><defs><clippath id=p9cbf1769b4><rect height=226.778879 width=358.15 x=63.05 y=14.528539 /></clippath></defs></svg><div class="caption text-center text-muted"><strong>Histogram with fixed size bins</strong> (bins=50) </div></div><div role=tabpanel class="tab-pane col-sm-12" id=-3082778655817027807bottom--3082778655817027807common_values><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=7.51>7.51</td><td>552</td><td><div class=bar style=width:3.3%> &nbsp; </div> 2.4% </td></tr><tr class><td title=10.99>10.99</td><td>532</td><td><div class=bar style=width:3.2%> &nbsp; </div> 2.3% </td></tr><tr class><td title=7.88>7.88</td><td>447</td><td><div class=bar style=width:2.7%> &nbsp; </div> 2.0% </td></tr><tr class><td title=7.49>7.49</td><td>436</td><td><div class=bar style=width:2.6%> &nbsp; </div> 1.9% </td></tr><tr class><td title=5.42>5.42</td><td>435</td><td><div class=bar style=width:2.6%> &nbsp; </div> 1.9% </td></tr><tr class><td title=7.9>7.9</td><td>392</td><td><div class=bar style=width:2.4%> &nbsp; </div> 1.7% </td></tr><tr class><td title=11.49>11.49</td><td>332</td><td><div class=bar style=width:2.0%> &nbsp; </div> 1.5% </td></tr><tr class><td title=9.99>9.99</td><td>312</td><td><div class=bar style=width:1.9%> &nbsp; </div> 1.4% </td></tr><tr class><td title=13.49>13.49</td><td>311</td><td><div class=bar style=width:1.9%> &nbsp; </div> 1.4% </td></tr><tr class><td title=6.03>6.03</td><td>302</td><td><div class=bar style=width:1.8%> &nbsp; </div> 1.3% </td></tr><tr class=other><td title="Other values (329)">Other values (329)</td><td>16578</td><td><div class=bar style=width:100.0%> 72.8% </div></td></tr><tr class=missing><td title=(Missing)>(Missing)</td><td>2136</td><td><div class=bar style=width:12.9%> &nbsp; </div> 9.4% </td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=-3082778655817027807bottom--3082778655817027807extreme_values><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-3082778655817027807extreme_values--3082778655817027807firstn aria-controls=-3082778655817027807extreme_values--3082778655817027807firstn role=tab data-toggle=tab>Minimum 10 values</a></li><li role=presentation><a href=#-3082778655817027807extreme_values--3082778655817027807lastn aria-controls=-3082778655817027807extreme_values--3082778655817027807lastn role=tab data-toggle=tab>Maximum 10 values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-3082778655817027807extreme_values--3082778655817027807firstn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=5.42>5.42</td><td>435</td><td><div class=bar style=width:100.0%> 1.9% </div></td></tr><tr class><td title=5.79>5.79</td><td>275</td><td><div class=bar style=width:63.2%> 1.2% </div></td></tr><tr class><td title=5.99>5.99</td><td>272</td><td><div class=bar style=width:62.5%> 1.2% </div></td></tr><tr class><td title=6>6</td><td>10</td><td><div class=bar style=width:2.3%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=6.03>6.03</td><td>302</td><td><div class=bar style=width:69.4%> 1.3% </div></td></tr><tr class><td title=6.17>6.17</td><td>146</td><td><div class=bar style=width:33.6%> &nbsp; </div> 0.6% </td></tr><tr class><td title=6.39>6.39</td><td>46</td><td><div class=bar style=width:10.6%> &nbsp; </div> 0.2% </td></tr><tr class><td title=6.54>6.54</td><td>177</td><td><div class=bar style=width:40.7%> 0.8% </div></td></tr><tr class><td title=6.62>6.62</td><td>300</td><td><div class=bar style=width:69.0%> 1.3% </div></td></tr><tr class><td title=6.76>6.76</td><td>116</td><td><div class=bar style=width:26.7%> &nbsp; </div> 0.5% </td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=-3082778655817027807extreme_values--3082778655817027807lastn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=23.22>23.22</td><td>1</td><td><div class=bar style=width:33.3%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=22.48>22.48</td><td>1</td><td><div class=bar style=width:33.3%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=22.11>22.11</td><td>3</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=22.06>22.06</td><td>1</td><td><div class=bar style=width:33.3%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=21.74>21.74</td><td>2</td><td><div class=bar style=width:66.7%>< 0.1% </div></td></tr><tr class><td title=21.64>21.64</td><td>1</td><td><div class=bar style=width:33.3%> &nbsp; </div>< 0.1% </td></tr><tr class><td title=21.36>21.36</td><td>2</td><td><div class=bar style=width:66.7%>< 0.1% </div></td></tr><tr class><td title=21.27>21.27</td><td>3</td><td><div class=bar style=width:100.0%>< 0.1% </div></td></tr><tr class><td title=21.21>21.21</td><td>2</td><td><div class=bar style=width:66.7%>< 0.1% </div></td></tr><tr class><td title=20.99>20.99</td><td>1</td><td><div class=bar style=width:33.3%> &nbsp; </div>< 0.1% </td></tr></tbody></table></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_-748713880617476083></a><div class=variable><div class=col-sm-3><p class=h4 title=loan_status><a href=#pp_var_-748713880617476083>loan_status</a><br><small>Categorical</small></p><code><abbr title="This variable has a high correlation with 1 fields: loan_percent_income">HIGH CORRELATION</abbr></code><br><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>2</td></tr><tr><th>Distinct (%)</th><td>< 0.1%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>178.0 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> 0 </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 17739&nbsp; </div></td></tr><tr class><th width=50%> 1 </th><td width=50%><div class=bar style=width:28.3% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 5026&nbsp; </div></td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom--748713880617476083, #minifreqtable-748713880617476083" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom--748713880617476083 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-748713880617476083bottom--748713880617476083overview aria-controls=-748713880617476083bottom--748713880617476083overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#-748713880617476083bottom--748713880617476083string aria-controls=-748713880617476083bottom--748713880617476083string role=tab data-toggle=tab>Categories</a></li><li role=presentation><a href=#-748713880617476083bottom--748713880617476083word aria-controls=-748713880617476083bottom--748713880617476083word role=tab data-toggle=tab>Words</a></li><li role=presentation><a href=#-748713880617476083bottom--748713880617476083characters aria-controls=-748713880617476083bottom--748713880617476083characters role=tab data-toggle=tab>Characters</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-748713880617476083bottom--748713880617476083overview><div class=row><div class=col-sm-3><p class=h4>Length</p><table class="table table-condensed stats"><tbody><tr><th>Max length</th><td>1</td></tr><tr><th>Median length</th><td>1</td></tr><tr><th>Mean length</th><td>1</td></tr><tr><th>Min length</th><td>1</td></tr></tbody></table></div><div class=col-sm-3><p class=h4>Characters and Unicode</p><table class="table table-condensed stats"><tbody><tr><th>Total characters</th><td>22765</td></tr><tr><th>Distinct characters</th><td>2</td></tr><tr><th>Distinct categories</th><td>1 <a title="Unicode categories (click for more information)" href=https://en.wikipedia.org/wiki/Unicode_character_property#General_Category target=_blank><span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="Unicode categories (click for more information)">?</span></a></td></tr><tr><th>Distinct scripts</th><td>1 <a title="Unicode scripts (click for more information)" href=https://en.wikipedia.org/wiki/Script_(Unicode)#List_of_scripts_in_Unicode target=_blank><span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="Unicode scripts (click for more information)">?</span></a></td></tr><tr><th>Distinct blocks</th><td>1 <a title="Unicode blocks (click for more information)" href=https://en.wikipedia.org/wiki/Unicode_block target=_blank><span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="Unicode blocks (click for more information)">?</span></a></td></tr></tbody></table><div class="caption text-center text-muted"> The Unicode Standard assigns character properties to each code point, which can be used to analyse textual variables. </div></div><div class=col-sm-3><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-3><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>1</td></tr><tr><th>2nd row</th><td>0</td></tr><tr><th>3rd row</th><td>1</td></tr><tr><th>4th row</th><td>1</td></tr><tr><th>5th row</th><td>1</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-748713880617476083bottom--748713880617476083string><div class=row><div class=col-sm-4><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=0>0</td><td>17739</td><td><div class=bar style=width:100.0%> 77.9% </div></td></tr><tr class><td title=1>1</td><td>5026</td><td><div class=bar style=width:28.3%> &nbsp; </div> 22.1% </td></tr></tbody></table></div><div class=col-sm-4><h4>Length</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
| "L 432 288 \n", | |
| "L 432 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 69.3 245.815224 \n", | |
| "L 421.2 245.815224 \n", | |
| "L 421.2 10.8 \n", | |
| "L 69.3 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-46 d="M 10.6875 12.40625 \n", | |
| "L 21 12.40625 \n", | |
| "L 21 0 \n", | |
| "L 10.6875 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
| "Q 26.375 40.375 22.484375 35.828125 \n", | |
| "Q 18.609375 31.296875 18.609375 23.390625 \n", | |
| "Q 18.609375 15.53125 22.484375 10.953125 \n", | |
| "Q 26.375 6.390625 33.015625 6.390625 \n", | |
| "Q 39.65625 6.390625 43.53125 10.953125 \n", | |
| "Q 47.40625 15.53125 47.40625 23.390625 \n", | |
| "Q 47.40625 31.296875 43.53125 35.828125 \n", | |
| "Q 39.65625 40.375 33.015625 40.375 \n", | |
| "z\n", | |
| "M 52.59375 71.296875 \n", | |
| "L 52.59375 62.3125 \n", | |
| "Q 48.875 64.0625 45.09375 64.984375 \n", | |
| "Q 41.3125 65.921875 37.59375 65.921875 \n", | |
| "Q 27.828125 65.921875 22.671875 59.328125 \n", | |
| "Q 17.53125 52.734375 16.796875 39.40625 \n", | |
| "Q 19.671875 43.65625 24.015625 45.921875 \n", | |
| "Q 28.375 48.1875 33.59375 48.1875 \n", | |
| "Q 44.578125 48.1875 50.953125 41.515625 \n", | |
| "Q 57.328125 34.859375 57.328125 23.390625 \n", | |
| "Q 57.328125 12.15625 50.6875 5.359375 \n", | |
| "Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
| "Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
| "Q 6.984375 17.96875 6.984375 36.375 \n", | |
| "Q 6.984375 53.65625 15.1875 63.9375 \n", | |
| "Q 23.390625 74.21875 37.203125 74.21875 \n", | |
| "Q 40.921875 74.21875 44.703125 73.484375 \n", | |
| "Q 48.484375 72.75 52.59375 71.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(113.614933 275.433338)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-54 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-56 d="M 31.78125 34.625 \n", | |
| "Q 24.75 34.625 20.71875 30.859375 \n", | |
| "Q 16.703125 27.09375 16.703125 20.515625 \n", | |
| "Q 16.703125 13.921875 20.71875 10.15625 \n", | |
| "Q 24.75 6.390625 31.78125 6.390625 \n", | |
| "Q 38.8125 6.390625 42.859375 10.171875 \n", | |
| "Q 46.921875 13.96875 46.921875 20.515625 \n", | |
| "Q 46.921875 27.09375 42.890625 30.859375 \n", | |
| "Q 38.875 34.625 31.78125 34.625 \n", | |
| "z\n", | |
| "M 21.921875 38.8125 \n", | |
| "Q 15.578125 40.375 12.03125 44.71875 \n", | |
| "Q 8.5 49.078125 8.5 55.328125 \n", | |
| "Q 8.5 64.0625 14.71875 69.140625 \n", | |
| "Q 20.953125 74.21875 31.78125 74.21875 \n", | |
| "Q 42.671875 74.21875 48.875 69.140625 \n", | |
| "Q 55.078125 64.0625 55.078125 55.328125 \n", | |
| "Q 55.078125 49.078125 51.53125 44.71875 \n", | |
| "Q 48 40.375 41.703125 38.8125 \n", | |
| "Q 48.828125 37.15625 52.796875 32.3125 \n", | |
| "Q 56.78125 27.484375 56.78125 20.515625 \n", | |
| "Q 56.78125 9.90625 50.3125 4.234375 \n", | |
| "Q 43.84375 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.734375 -1.421875 13.25 4.234375 \n", | |
| "Q 6.78125 9.90625 6.78125 20.515625 \n", | |
| "Q 6.78125 27.484375 10.78125 32.3125 \n", | |
| "Q 14.796875 37.15625 21.921875 38.8125 \n", | |
| "z\n", | |
| "M 18.3125 54.390625 \n", | |
| "Q 18.3125 48.734375 21.84375 45.5625 \n", | |
| "Q 25.390625 42.390625 31.78125 42.390625 \n", | |
| "Q 38.140625 42.390625 41.71875 45.5625 \n", | |
| "Q 45.3125 48.734375 45.3125 54.390625 \n", | |
| "Q 45.3125 60.0625 41.71875 63.234375 \n", | |
| "Q 38.140625 66.40625 31.78125 66.40625 \n", | |
| "Q 25.390625 66.40625 21.84375 63.234375 \n", | |
| "Q 18.3125 60.0625 18.3125 54.390625 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(177.596751 275.433338)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-56 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(241.578569 275.433338)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(305.560387 275.433338)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-50 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
| "L 12.890625 25.390625 \n", | |
| "L 37.796875 25.390625 \n", | |
| "z\n", | |
| "M 35.203125 72.90625 \n", | |
| "L 47.609375 72.90625 \n", | |
| "L 47.609375 25.390625 \n", | |
| "L 58.015625 25.390625 \n", | |
| "L 58.015625 17.1875 \n", | |
| "L 47.609375 17.1875 \n", | |
| "L 47.609375 0 \n", | |
| "L 37.796875 0 \n", | |
| "L 37.796875 17.1875 \n", | |
| "L 4.890625 17.1875 \n", | |
| "L 4.890625 26.703125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(369.542205 275.433338)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-52 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_6><g style=fill:#262626; transform="translate(49.9375 249.614442)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_7><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
| "L 49.515625 72.90625 \n", | |
| "L 49.515625 64.59375 \n", | |
| "L 19.828125 64.59375 \n", | |
| "L 19.828125 46.734375 \n", | |
| "Q 21.96875 47.46875 24.109375 47.828125 \n", | |
| "Q 26.265625 48.1875 28.421875 48.1875 \n", | |
| "Q 40.625 48.1875 47.75 41.5 \n", | |
| "Q 54.890625 34.8125 54.890625 23.390625 \n", | |
| "Q 54.890625 11.625 47.5625 5.09375 \n", | |
| "Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
| "Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
| "Q 12.796875 0.140625 7.71875 1.703125 \n", | |
| "L 7.71875 11.625 \n", | |
| "Q 12.109375 9.234375 16.796875 8.0625 \n", | |
| "Q 21.484375 6.890625 26.703125 6.890625 \n", | |
| "Q 35.15625 6.890625 40.078125 11.328125 \n", | |
| "Q 45.015625 15.765625 45.015625 23.390625 \n", | |
| "Q 45.015625 31 40.078125 35.4375 \n", | |
| "Q 35.15625 39.890625 26.703125 39.890625 \n", | |
| "Q 22.75 39.890625 18.8125 39.015625 \n", | |
| "Q 14.890625 38.140625 10.796875 36.28125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(30.85 200.454763)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_3><g id=text_8><g style=fill:#262626; transform="translate(24.4875 151.295083)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_9><g style=fill:#262626; transform="translate(24.4875 102.135403)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_5><g id=text_10><g style=fill:#262626; transform="translate(24.4875 52.975723)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_11><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
| "L 51.703125 72.90625 \n", | |
| "L 51.703125 64.59375 \n", | |
| "L 19.671875 64.59375 \n", | |
| "L 19.671875 43.109375 \n", | |
| "L 48.578125 43.109375 \n", | |
| "L 48.578125 34.8125 \n", | |
| "L 19.671875 34.8125 \n", | |
| "L 19.671875 0 \n", | |
| "L 9.8125 0 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
| "Q 39.59375 47.171875 37.8125 47.578125 \n", | |
| "Q 36.03125 48 33.890625 48 \n", | |
| "Q 26.265625 48 22.1875 43.046875 \n", | |
| "Q 18.109375 38.09375 18.109375 28.8125 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 20.953125 51.171875 25.484375 53.578125 \n", | |
| "Q 30.03125 56 36.53125 56 \n", | |
| "Q 37.453125 56 38.578125 55.875 \n", | |
| "Q 39.703125 55.765625 41.0625 55.515625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
| "L 56.203125 25.203125 \n", | |
| "L 14.890625 25.203125 \n", | |
| "Q 15.484375 15.921875 20.484375 11.0625 \n", | |
| "Q 25.484375 6.203125 34.421875 6.203125 \n", | |
| "Q 39.59375 6.203125 44.453125 7.46875 \n", | |
| "Q 49.3125 8.734375 54.109375 11.28125 \n", | |
| "L 54.109375 2.78125 \n", | |
| "Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
| "Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
| "Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
| "Q 5.515625 13.8125 5.515625 26.8125 \n", | |
| "Q 5.515625 40.234375 12.765625 48.109375 \n", | |
| "Q 20.015625 56 32.328125 56 \n", | |
| "Q 43.359375 56 49.78125 48.890625 \n", | |
| "Q 56.203125 41.796875 56.203125 29.59375 \n", | |
| "z\n", | |
| "M 47.21875 32.234375 \n", | |
| "Q 47.125 39.59375 43.09375 43.984375 \n", | |
| "Q 39.0625 48.390625 32.421875 48.390625 \n", | |
| "Q 24.90625 48.390625 20.390625 44.140625 \n", | |
| "Q 15.875 39.890625 15.1875 32.171875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
| "Q 14.796875 17.390625 18.875 11.75 \n", | |
| "Q 22.953125 6.109375 30.078125 6.109375 \n", | |
| "Q 37.203125 6.109375 41.296875 11.75 \n", | |
| "Q 45.40625 17.390625 45.40625 27.296875 \n", | |
| "Q 45.40625 37.203125 41.296875 42.84375 \n", | |
| "Q 37.203125 48.484375 30.078125 48.484375 \n", | |
| "Q 22.953125 48.484375 18.875 42.84375 \n", | |
| "Q 14.796875 37.203125 14.796875 27.296875 \n", | |
| "z\n", | |
| "M 45.40625 8.203125 \n", | |
| "Q 42.578125 3.328125 38.25 0.953125 \n", | |
| "Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
| "Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
| "Q 5.515625 14.40625 5.515625 27.296875 \n", | |
| "Q 5.515625 40.1875 11.734375 48.09375 \n", | |
| "Q 17.96875 56 27.875 56 \n", | |
| "Q 33.9375 56 38.25 53.625 \n", | |
| "Q 42.578125 51.265625 45.40625 46.390625 \n", | |
| "L 45.40625 54.6875 \n", | |
| "L 54.390625 54.6875 \n", | |
| "L 54.390625 -20.796875 \n", | |
| "L 45.40625 -20.796875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
| "L 8.5 54.6875 \n", | |
| "L 17.484375 54.6875 \n", | |
| "L 17.484375 21.921875 \n", | |
| "Q 17.484375 14.15625 20.5 10.265625 \n", | |
| "Q 23.53125 6.390625 29.59375 6.390625 \n", | |
| "Q 36.859375 6.390625 41.078125 11.03125 \n", | |
| "Q 45.3125 15.671875 45.3125 23.6875 \n", | |
| "L 45.3125 54.6875 \n", | |
| "L 54.296875 54.6875 \n", | |
| "L 54.296875 0 \n", | |
| "L 45.3125 0 \n", | |
| "L 45.3125 8.40625 \n", | |
| "Q 42.046875 3.421875 37.71875 1 \n", | |
| "Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
| "Q 18.265625 -1.421875 13.375 4.4375 \n", | |
| "Q 8.5 10.296875 8.5 21.578125 \n", | |
| "z\n", | |
| "M 31.109375 56 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
| "L 54.890625 0 \n", | |
| "L 45.90625 0 \n", | |
| "L 45.90625 32.71875 \n", | |
| "Q 45.90625 40.484375 42.875 44.328125 \n", | |
| "Q 39.84375 48.1875 33.796875 48.1875 \n", | |
| "Q 26.515625 48.1875 22.3125 43.546875 \n", | |
| "Q 18.109375 38.921875 18.109375 30.90625 \n", | |
| "L 18.109375 0 \n", | |
| "L 9.078125 0 \n", | |
| "L 9.078125 54.6875 \n", | |
| "L 18.109375 54.6875 \n", | |
| "L 18.109375 46.1875 \n", | |
| "Q 21.34375 51.125 25.703125 53.5625 \n", | |
| "Q 30.078125 56 35.796875 56 \n", | |
| "Q 45.21875 56 50.046875 50.171875 \n", | |
| "Q 54.890625 44.34375 54.890625 33.015625 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
| "L 48.78125 44.1875 \n", | |
| "Q 44.96875 46.296875 41.140625 47.34375 \n", | |
| "Q 37.3125 48.390625 33.40625 48.390625 \n", | |
| "Q 24.65625 48.390625 19.8125 42.84375 \n", | |
| "Q 14.984375 37.3125 14.984375 27.296875 \n", | |
| "Q 14.984375 17.28125 19.8125 11.734375 \n", | |
| "Q 24.65625 6.203125 33.40625 6.203125 \n", | |
| "Q 37.3125 6.203125 41.140625 7.25 \n", | |
| "Q 44.96875 8.296875 48.78125 10.40625 \n", | |
| "L 48.78125 2.09375 \n", | |
| "Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
| "Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
| "Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
| "Q 5.515625 14.109375 5.515625 27.296875 \n", | |
| "Q 5.515625 40.671875 12.859375 48.328125 \n", | |
| "Q 20.21875 56 33.015625 56 \n", | |
| "Q 37.15625 56 41.109375 55.140625 \n", | |
| "Q 45.0625 54.296875 48.78125 52.59375 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
| "Q 28.375 -14.84375 24.75 -17.8125 \n", | |
| "Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
| "L 7.90625 -20.796875 \n", | |
| "L 7.90625 -13.28125 \n", | |
| "L 13.1875 -13.28125 \n", | |
| "Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
| "Q 21 -9.765625 23.484375 -3.21875 \n", | |
| "L 25.09375 0.875 \n", | |
| "L 2.984375 54.6875 \n", | |
| "L 12.5 54.6875 \n", | |
| "L 29.59375 11.921875 \n", | |
| "L 46.6875 54.6875 \n", | |
| "L 56.203125 54.6875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(18.199844 156.720268)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#p74c6f7ebce) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 85.295455 245.815224 \n", | |
| "L 405.204545 245.815224 \n", | |
| "L 405.204545 21.991201 \n", | |
| "L 85.295455 21.991201 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path style=fill:none; d="M 69.3 245.815224 \n", | |
| "L 69.3 10.8 \n", | |
| ""/></g><g id=patch_5><path style=fill:none; d="M 421.2 245.815224 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g><g id=patch_6><path style=fill:none; d="M 69.3 245.815224 \n", | |
| "L 421.2 245.815224 \n", | |
| ""/></g><g id=patch_7><path style=fill:none; d="M 69.3 10.8 \n", | |
| "L 421.2 10.8 \n", | |
| ""/></g></g></g><defs><clippath id=p74c6f7ebce><rect height=235.015224 width=351.9 x=69.3 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"> Histogram of lengths of the category </div></div><div class=col-sm-4><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=187.6716pt version=1.1 viewbox="0 0 405 187.6716" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 187.6716 \n", | |
| "L 405 187.6716 \n", | |
| "L 405 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#p25fdc84c8e) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
| "L 311.564305 106.86 \n", | |
| "L 311.564305 16.26 \n", | |
| "L 7.2 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=patch_3><path clip-path=url(#p25fdc84c8e) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 311.564305 106.86 \n", | |
| "L 397.8 106.86 \n", | |
| "L 397.8 16.26 \n", | |
| "L 311.564305 16.26 \n", | |
| "z\n", | |
| ""/></g><g id=legend_1><g id=patch_4><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 180.4716 \n", | |
| "L 85.5864 180.4716 \n", | |
| "Q 89.0424 180.4716 89.0424 177.0156 \n", | |
| "L 89.0424 128.016 \n", | |
| "Q 89.0424 124.56 85.5864 124.56 \n", | |
| "L 19.296 124.56 \n", | |
| "Q 15.84 124.56 15.84 128.016 \n", | |
| "L 15.84 177.0156 \n", | |
| "Q 15.84 180.4716 19.296 180.4716 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
| "L 57.312 144.6021 \n", | |
| "L 57.312 132.5061 \n", | |
| "L 22.752 132.5061 \n", | |
| "z\n", | |
| ""/></g><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-48 /></g></g><g id=patch_6><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
| "L 57.312 169.9659 \n", | |
| "L 57.312 157.8699 \n", | |
| "L 22.752 157.8699 \n", | |
| "z\n", | |
| ""/></g><g id=text_2><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
| "L 28.515625 8.296875 \n", | |
| "L 28.515625 63.921875 \n", | |
| "L 10.984375 60.40625 \n", | |
| "L 10.984375 69.390625 \n", | |
| "L 28.421875 72.90625 \n", | |
| "L 38.28125 72.90625 \n", | |
| "L 38.28125 8.296875 \n", | |
| "L 54.390625 8.296875 \n", | |
| "L 54.390625 0 \n", | |
| "L 12.40625 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-49 /></g></g></g></g></g><defs><clippath id=p25fdc84c8e><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-748713880617476083bottom--748713880617476083word><div class=col-sm-12><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=0>0</td><td>17739</td><td><div class=bar style=width:100.0%> 77.9% </div></td></tr><tr class><td title=1>1</td><td>5026</td><td><div class=bar style=width:28.3%> &nbsp; </div> 22.1% </td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-748713880617476083bottom--748713880617476083characters><div class=col-sm-12><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-748713880617476083unicode--748713880617476083characters aria-controls=-748713880617476083unicode--748713880617476083characters role=tab data-toggle=tab>Characters</a></li><li role=presentation><a href=#-748713880617476083unicode--748713880617476083categories aria-controls=-748713880617476083unicode--748713880617476083categories role=tab data-toggle=tab>Categories</a></li><li role=presentation><a href=#-748713880617476083unicode--748713880617476083scripts aria-controls=-748713880617476083unicode--748713880617476083scripts role=tab data-toggle=tab>Scripts</a></li><li role=presentation><a href=#-748713880617476083unicode--748713880617476083blocks aria-controls=-748713880617476083unicode--748713880617476083blocks role=tab data-toggle=tab>Blocks</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-748713880617476083unicode--748713880617476083characters><div class="row named-list-item"><h4>Most occurring characters</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=0>0</td><td>17739</td><td><div class=bar style=width:100.0%> 77.9% </div></td></tr><tr class><td title=1>1</td><td>5026</td><td><div class=bar style=width:28.3%> &nbsp; </div> 22.1% </td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-748713880617476083unicode--748713880617476083categories><div class="row named-list-item"><h4>Most occurring categories</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title="Decimal Number">Decimal Number</td><td>22765</td><td><div class=bar style=width:100.0%> 100.0% </div></td></tr></tbody></table></div><div class="row named-list-item"><h4>Most frequent character per category</h4><div class=row><div class=col-sm-6><h5><em>Decimal Number</em></h5><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=0>0</td><td>17739</td><td><div class=bar style=width:100.0%> 77.9% </div></td></tr><tr class><td title=1>1</td><td>5026</td><td><div class=bar style=width:28.3%> &nbsp; </div> 22.1% </td></tr></tbody></table></div></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-748713880617476083unicode--748713880617476083scripts><div class="row named-list-item"><h4>Most occurring scripts</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=Common>Common</td><td>22765</td><td><div class=bar style=width:100.0%> 100.0% </div></td></tr></tbody></table></div><div class="row named-list-item"><h4>Most frequent character per script</h4><div class=row><div class=col-sm-6><h5><em>Common</em></h5><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=0>0</td><td>17739</td><td><div class=bar style=width:100.0%> 77.9% </div></td></tr><tr class><td title=1>1</td><td>5026</td><td><div class=bar style=width:28.3%> &nbsp; </div> 22.1% </td></tr></tbody></table></div></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-748713880617476083unicode--748713880617476083blocks><div class="row named-list-item"><h4>Most occurring blocks</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=ASCII>ASCII</td><td>22765</td><td><div class=bar style=width:100.0%> 100.0% </div></td></tr></tbody></table></div><div class="row named-list-item"><h4>Most frequent character per block</h4><div class=row><div class=col-sm-6><h5><em>ASCII</em></h5><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=0>0</td><td>17739</td><td><div class=bar style=width:100.0%> 77.9% </div></td></tr><tr class><td title=1>1</td><td>5026</td><td><div class=bar style=width:28.3%> &nbsp; </div> 22.1% </td></tr></tbody></table></div></div></div></div></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_1933020516444870489></a><div class=variable><div class=col-sm-3><p class=h4 title=loan_percent_income><a href=#pp_var_1933020516444870489>loan_percent_income</a><br><small>Real number (&Ropf;<sub>&ge;0</sub>)</small></p><code><abbr title="This variable has a high correlation with 2 fields: loan_amnt, loan_status">HIGH CORRELATION</abbr></code><br><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>74</td></tr><tr><th>Distinct (%)</th><td>0.3%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Infinite</th><td>0</td></tr><tr><th>Infinite (%)</th><td>0.0%</td></tr><tr><th>Mean</th><td>0.170231935</td></tr></tbody></table></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>0</td></tr><tr><th>Maximum</th><td>0.78</td></tr><tr><th>Zeros</th><td>7</td></tr><tr><th>Zeros (%)</th><td>< 0.1%</td></tr><tr><th>Negative</th><td>0</td></tr><tr><th>Negative (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>178.0 KiB</td></tr></tbody></table></div><div class=col-sm-3><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
| " "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=162pt version=1.1 viewbox="0 0 216 162" width=216pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
| "*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
| " </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 162 \n", | |
| "L 216 162 \n", | |
| "L 216 0 \n", | |
| "L 0 0 \n", | |
| "z\n", | |
| ""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 10.8 122.908816 \n", | |
| "L 201.305595 122.908816 \n", | |
| "L 201.305595 10.8 \n", | |
| "L 10.8 10.8 \n", | |
| "z\n", | |
| ""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
| "Q 24.171875 66.40625 20.328125 58.90625 \n", | |
| "Q 16.5 51.421875 16.5 36.375 \n", | |
| "Q 16.5 21.390625 20.328125 13.890625 \n", | |
| "Q 24.171875 6.390625 31.78125 6.390625 \n", | |
| "Q 39.453125 6.390625 43.28125 13.890625 \n", | |
| "Q 47.125 21.390625 47.125 36.375 \n", | |
| "Q 47.125 51.421875 43.28125 58.90625 \n", | |
| "Q 39.453125 66.40625 31.78125 66.40625 \n", | |
| "z\n", | |
| "M 31.78125 74.21875 \n", | |
| "Q 44.046875 74.21875 50.515625 64.515625 \n", | |
| "Q 56.984375 54.828125 56.984375 36.375 \n", | |
| "Q 56.984375 17.96875 50.515625 8.265625 \n", | |
| "Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
| "Q 6.59375 17.96875 6.59375 36.375 \n", | |
| "Q 6.59375 54.828125 13.0625 64.515625 \n", | |
| "Q 19.53125 74.21875 31.78125 74.21875 \n", | |
| "z\n", | |
| ""/><path id=DejaVuSans-46 d="M 10.6875 12.40625 \n", | |
| "L 21 12.40625 \n", | |
| "L 21 0 \n", | |
| "L 10.6875 0 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(16.5222 149.203307)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-48 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
| "L 53.609375 8.296875 \n", | |
| "L 53.609375 0 \n", | |
| "L 7.328125 0 \n", | |
| "L 7.328125 8.296875 \n", | |
| "Q 12.9375 14.109375 22.625 23.890625 \n", | |
| "Q 32.328125 33.6875 34.8125 36.53125 \n", | |
| "Q 39.546875 41.84375 41.421875 45.53125 \n", | |
| "Q 43.3125 49.21875 43.3125 52.78125 \n", | |
| "Q 43.3125 58.59375 39.234375 62.25 \n", | |
| "Q 35.15625 65.921875 28.609375 65.921875 \n", | |
| "Q 23.96875 65.921875 18.8125 64.3125 \n", | |
| "Q 13.671875 62.703125 7.8125 59.421875 \n", | |
| "L 7.8125 69.390625 \n", | |
| "Q 13.765625 71.78125 18.9375 73 \n", | |
| "Q 24.125 74.21875 28.421875 74.21875 \n", | |
| "Q 39.75 74.21875 46.484375 68.546875 \n", | |
| "Q 53.21875 62.890625 53.21875 53.421875 \n", | |
| "Q 53.21875 48.921875 51.53125 44.890625 \n", | |
| "Q 49.859375 40.875 45.40625 35.40625 \n", | |
| "Q 44.1875 33.984375 37.640625 27.21875 \n", | |
| "Q 31.109375 20.453125 19.1875 8.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(60.929099 149.203307)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-48 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-50 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
| "L 12.890625 25.390625 \n", | |
| "L 37.796875 25.390625 \n", | |
| "z\n", | |
| "M 35.203125 72.90625 \n", | |
| "L 47.609375 72.90625 \n", | |
| "L 47.609375 25.390625 \n", | |
| "L 58.015625 25.390625 \n", | |
| "L 58.015625 17.1875 \n", | |
| "L 47.609375 17.1875 \n", | |
| "L 47.609375 0 \n", | |
| "L 37.796875 0 \n", | |
| "L 37.796875 17.1875 \n", | |
| "L 4.890625 17.1875 \n", | |
| "L 4.890625 26.703125 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(105.335998 149.203307)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-48 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-52 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
| "Q 26.375 40.375 22.484375 35.828125 \n", | |
| "Q 18.609375 31.296875 18.609375 23.390625 \n", | |
| "Q 18.609375 15.53125 22.484375 10.953125 \n", | |
| "Q 26.375 6.390625 33.015625 6.390625 \n", | |
| "Q 39.65625 6.390625 43.53125 10.953125 \n", | |
| "Q 47.40625 15.53125 47.40625 23.390625 \n", | |
| "Q 47.40625 31.296875 43.53125 35.828125 \n", | |
| "Q 39.65625 40.375 33.015625 40.375 \n", | |
| "z\n", | |
| "M 52.59375 71.296875 \n", | |
| "L 52.59375 62.3125 \n", | |
| "Q 48.875 64.0625 45.09375 64.984375 \n", | |
| "Q 41.3125 65.921875 37.59375 65.921875 \n", | |
| "Q 27.828125 65.921875 22.671875 59.328125 \n", | |
| "Q 17.53125 52.734375 16.796875 39.40625 \n", | |
| "Q 19.671875 43.65625 24.015625 45.921875 \n", | |
| "Q 28.375 48.1875 33.59375 48.1875 \n", | |
| "Q 44.578125 48.1875 50.953125 41.515625 \n", | |
| "Q 57.328125 34.859375 57.328125 23.390625 \n", | |
| "Q 57.328125 12.15625 50.6875 5.359375 \n", | |
| "Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
| "Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
| "Q 6.984375 17.96875 6.984375 36.375 \n", | |
| "Q 6.984375 53.65625 15.1875 63.9375 \n", | |
| "Q 23.390625 74.21875 37.203125 74.21875 \n", | |
| "Q 40.921875 74.21875 44.703125 73.484375 \n", | |
| "Q 48.484375 72.75 52.59375 71.296875 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(149.742896 149.203307)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-48 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-54 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-56 d="M 31.78125 34.625 \n", | |
| "Q 24.75 34.625 20.71875 30.859375 \n", | |
| "Q 16.703125 27.09375 16.703125 20.515625 \n", | |
| "Q 16.703125 13.921875 20.71875 10.15625 \n", | |
| "Q 24.75 6.390625 31.78125 6.390625 \n", | |
| "Q 38.8125 6.390625 42.859375 10.171875 \n", | |
| "Q 46.921875 13.96875 46.921875 20.515625 \n", | |
| "Q 46.921875 27.09375 42.890625 30.859375 \n", | |
| "Q 38.875 34.625 31.78125 34.625 \n", | |
| "z\n", | |
| "M 21.921875 38.8125 \n", | |
| "Q 15.578125 40.375 12.03125 44.71875 \n", | |
| "Q 8.5 49.078125 8.5 55.328125 \n", | |
| "Q 8.5 64.0625 14.71875 69.140625 \n", | |
| "Q 20.953125 74.21875 31.78125 74.21875 \n", | |
| "Q 42.671875 74.21875 48.875 69.140625 \n", | |
| "Q 55.078125 64.0625 55.078125 55.328125 \n", | |
| "Q 55.078125 49.078125 51.53125 44.71875 \n", | |
| "Q 48 40.375 41.703125 38.8125 \n", | |
| "Q 48.828125 37.15625 52.796875 32.3125 \n", | |
| "Q 56.78125 27.484375 56.78125 20.515625 \n", | |
| "Q 56.78125 9.90625 50.3125 4.234375 \n", | |
| "Q 43.84375 -1.421875 31.78125 -1.421875 \n", | |
| "Q 19.734375 -1.421875 13.25 4.234375 \n", | |
| "Q 6.78125 9.90625 6.78125 20.515625 \n", | |
| "Q 6.78125 27.484375 10.78125 32.3125 \n", | |
| "Q 14.796875 37.15625 21.921875 38.8125 \n", | |
| "z\n", | |
| "M 18.3125 54.390625 \n", | |
| "Q 18.3125 48.734375 21.84375 45.5625 \n", | |
| "Q 25.390625 42.390625 31.78125 42.390625 \n", | |
| "Q 38.140625 42.390625 41.71875 45.5625 \n", | |
| "Q 45.3125 48.734375 45.3125 54.390625 \n", | |
| "Q 45.3125 60.0625 41.71875 63.234375 \n", | |
| "Q 38.140625 66.40625 31.78125 66.40625 \n", | |
| "Q 25.390625 66.40625 21.84375 63.234375 \n", | |
| "Q 18.3125 60.0625 18.3125 54.390625 \n", | |
| "z\n", | |
| ""/></defs><g style=fill:#262626; transform="translate(194.149795 149.203307)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-48 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-56 /></g></g></g></g><g id=patch_3><path clip-path=url(#p45318f2fbe) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 19.459345 122.908816 \n", | |
| "L 22.923083 122.908816 \n", | |
| "L 22.923083 117.616206 \n", | |
| "L 19.459345 117.616206 \n", | |
| "z\n", | |
| ""/></g><g id=patch_4><path clip-path=url(#p45318f2fbe) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.923083 122.908816 \n", | |
| "L 26.386821 122.908816 \n", | |
| "L 26.386821 80.405919 \n", | |
| "L 22.923083 80.405919 \n", | |
| "z\n", | |
| ""/></g><g id=patch_5><path clip-path=url(#p45318f2fbe) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 26.386821 122.908816 \n", | |
| "L 29.85056 122.908816 \n", | |
| "L 29.85056 85.482504 \n", | |
| "L 26.386821 85.482504 \n", | |
| "z\n", | |
| ""/></g><g id=patch_6><path clip-path=url(#p45318f2fbe) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 29.85056 122.908816 \n", | |
| "L 33.314298 122.908816 \n", | |
| "L 33.314298 29.694077 \n", | |
| "L 29.85056 29.694077 \n", | |
| "z\n", | |
| ""/></g><g id=patch_7><path clip-path=url(#p45318f2fbe) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 33.314298 122.908816 \n", | |
| "L 36.778036 122.908816 \n", | |
| "L 36.778036 70.684799 \n", | |
| "L 33.314298 70.684799 \n", | |
| "z\n", | |
| ""/></g><g id=patch_8><path clip-path=url(#p45318f2fbe) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 36.778036 122.908816 \n", | |
| "L 40.241774 122.908816 \n", | |
| "L 40.241774 16.138515 \n", | |
| "L 36.778036 16.138515 \n", | |
| "z\n", | |
| ""/></g><g id=patch_9><path clip-path=url(#p45318f2fbe) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 40.241774 122.908816 \n", | |
| "L 43.705512 122.908816 \n", | |
| "L 43.705512 64.312065 \n", | |
| "L 40.241774 64.312065 \n", | |
| "z\n", | |
| ""/></g><g id=patch_10><path clip-path=url(#p45318f2fbe) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 43.705512 122.908816 \n", | |
| "L 47.16925 122.908816 \n", | |
| "L 47.16925 22.78128 \n", | |
| "L 43.705512 22.78128 \n", | |
| "z\n", | |
| ""/></g><g id=patch_11><path clip-path=url(#p45318f2fbe) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 47.16925 122.908816 \n", | |
| "L 50.632988 122.908816 \n", | |
| "L 50.632988 19.918951 \n", | |
| "L 47.16925 19.918951 \n", | |
| "z\n", | |
| ""/></g><g id=patch_12><path clip-path=url(#p45318f2fbe) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 50.632988 122.908816 \n", | |
| "L 54.096726 122.908816 \n", | |
| "L 54.096726 74.357222 \n", | |
| "L 50.632988 74.357222 \n", | |
| "z\n", | |
| ""/></g><g id=patch_13><path clip-path=url(#p45318f2fbe) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:mit |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment