Created
November 22, 2022 14:06
-
-
Save harisonmg/b75ded889801c0188ba6ad2af9c8c3a6 to your computer and use it in GitHub Desktop.
ames-housing-prices-eda.ipynb
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
{ | |
"metadata": { | |
"kernelspec": { | |
"name": "python3", | |
"display_name": "Python 3", | |
"language": "python" | |
}, | |
"language_info": { | |
"name": "python", | |
"version": "3.7.10", | |
"mimetype": "text/x-python", | |
"codemirror_mode": { | |
"name": "ipython", | |
"version": 3 | |
}, | |
"pygments_lexer": "ipython3", | |
"nbconvert_exporter": "python", | |
"file_extension": ".py" | |
}, | |
"vscode": { | |
"interpreter": { | |
"hash": "b658e68f7fd19fceabf31fde8c262495762c33882a1a85aecd3ed0950e60800e" | |
} | |
}, | |
"colab": { | |
"provenance": [], | |
"include_colab_link": true | |
}, | |
"widgets": { | |
"application/vnd.jupyter.widget-state+json": { | |
"25360bfd888b45589d13391ae25152bf": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "HBoxModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_dom_classes": [], | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "HBoxModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/controls", | |
"_view_module_version": "1.5.0", | |
"_view_name": "HBoxView", | |
"box_style": "", | |
"children": [ | |
"IPY_MODEL_730e4c0ce7f04bb7811f05f4aa98c81d", | |
"IPY_MODEL_39861cb32ece4527ba26fd846ad43f1c", | |
"IPY_MODEL_8de6b015ad614fc2b87cae2018fa0d81" | |
], | |
"layout": "IPY_MODEL_9a368258af0b454eb2b516cd0b0bc14a" | |
} | |
}, | |
"730e4c0ce7f04bb7811f05f4aa98c81d": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "HTMLModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_dom_classes": [], | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "HTMLModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/controls", | |
"_view_module_version": "1.5.0", | |
"_view_name": "HTMLView", | |
"description": "", | |
"description_tooltip": null, | |
"layout": "IPY_MODEL_e29f6c9fb7894f70a3d80cd9b0945000", | |
"placeholder": "", | |
"style": "IPY_MODEL_10aad3c8404448cf9f702455e4fdd82e", | |
"value": "Summarize dataset: 100%" | |
} | |
}, | |
"39861cb32ece4527ba26fd846ad43f1c": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "FloatProgressModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_dom_classes": [], | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "FloatProgressModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/controls", | |
"_view_module_version": "1.5.0", | |
"_view_name": "ProgressView", | |
"bar_style": "success", | |
"description": "", | |
"description_tooltip": null, | |
"layout": "IPY_MODEL_0f8e47c1ed66415a817bad19d4c0902d", | |
"max": 5, | |
"min": 0, | |
"orientation": "horizontal", | |
"style": "IPY_MODEL_9e7346de49a64c3381e1c54263b051b8", | |
"value": 5 | |
} | |
}, | |
"8de6b015ad614fc2b87cae2018fa0d81": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "HTMLModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_dom_classes": [], | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "HTMLModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/controls", | |
"_view_module_version": "1.5.0", | |
"_view_name": "HTMLView", | |
"description": "", | |
"description_tooltip": null, | |
"layout": "IPY_MODEL_ce4a3c199e394a34933cc48f58ed4cc9", | |
"placeholder": "", | |
"style": "IPY_MODEL_24dad68d2f644f5cac54206b6fe9966b", | |
"value": " 87/87 [00:01<00:00, 70.20it/s, Completed]" | |
} | |
}, | |
"9a368258af0b454eb2b516cd0b0bc14a": { | |
"model_module": "@jupyter-widgets/base", | |
"model_name": "LayoutModel", | |
"model_module_version": "1.2.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/base", | |
"_model_module_version": "1.2.0", | |
"_model_name": "LayoutModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "LayoutView", | |
"align_content": null, | |
"align_items": null, | |
"align_self": null, | |
"border": null, | |
"bottom": null, | |
"display": null, | |
"flex": null, | |
"flex_flow": null, | |
"grid_area": null, | |
"grid_auto_columns": null, | |
"grid_auto_flow": null, | |
"grid_auto_rows": null, | |
"grid_column": null, | |
"grid_gap": null, | |
"grid_row": null, | |
"grid_template_areas": null, | |
"grid_template_columns": null, | |
"grid_template_rows": null, | |
"height": null, | |
"justify_content": null, | |
"justify_items": null, | |
"left": null, | |
"margin": null, | |
"max_height": null, | |
"max_width": null, | |
"min_height": null, | |
"min_width": null, | |
"object_fit": null, | |
"object_position": null, | |
"order": null, | |
"overflow": null, | |
"overflow_x": null, | |
"overflow_y": null, | |
"padding": null, | |
"right": null, | |
"top": null, | |
"visibility": null, | |
"width": null | |
} | |
}, | |
"e29f6c9fb7894f70a3d80cd9b0945000": { | |
"model_module": "@jupyter-widgets/base", | |
"model_name": "LayoutModel", | |
"model_module_version": "1.2.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/base", | |
"_model_module_version": "1.2.0", | |
"_model_name": "LayoutModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "LayoutView", | |
"align_content": null, | |
"align_items": null, | |
"align_self": null, | |
"border": null, | |
"bottom": null, | |
"display": null, | |
"flex": null, | |
"flex_flow": null, | |
"grid_area": null, | |
"grid_auto_columns": null, | |
"grid_auto_flow": null, | |
"grid_auto_rows": null, | |
"grid_column": null, | |
"grid_gap": null, | |
"grid_row": null, | |
"grid_template_areas": null, | |
"grid_template_columns": null, | |
"grid_template_rows": null, | |
"height": null, | |
"justify_content": null, | |
"justify_items": null, | |
"left": null, | |
"margin": null, | |
"max_height": null, | |
"max_width": null, | |
"min_height": null, | |
"min_width": null, | |
"object_fit": null, | |
"object_position": null, | |
"order": null, | |
"overflow": null, | |
"overflow_x": null, | |
"overflow_y": null, | |
"padding": null, | |
"right": null, | |
"top": null, | |
"visibility": null, | |
"width": null | |
} | |
}, | |
"10aad3c8404448cf9f702455e4fdd82e": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "DescriptionStyleModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "DescriptionStyleModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "StyleView", | |
"description_width": "" | |
} | |
}, | |
"0f8e47c1ed66415a817bad19d4c0902d": { | |
"model_module": "@jupyter-widgets/base", | |
"model_name": "LayoutModel", | |
"model_module_version": "1.2.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/base", | |
"_model_module_version": "1.2.0", | |
"_model_name": "LayoutModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "LayoutView", | |
"align_content": null, | |
"align_items": null, | |
"align_self": null, | |
"border": null, | |
"bottom": null, | |
"display": null, | |
"flex": null, | |
"flex_flow": null, | |
"grid_area": null, | |
"grid_auto_columns": null, | |
"grid_auto_flow": null, | |
"grid_auto_rows": null, | |
"grid_column": null, | |
"grid_gap": null, | |
"grid_row": null, | |
"grid_template_areas": null, | |
"grid_template_columns": null, | |
"grid_template_rows": null, | |
"height": null, | |
"justify_content": null, | |
"justify_items": null, | |
"left": null, | |
"margin": null, | |
"max_height": null, | |
"max_width": null, | |
"min_height": null, | |
"min_width": null, | |
"object_fit": null, | |
"object_position": null, | |
"order": null, | |
"overflow": null, | |
"overflow_x": null, | |
"overflow_y": null, | |
"padding": null, | |
"right": null, | |
"top": null, | |
"visibility": null, | |
"width": null | |
} | |
}, | |
"9e7346de49a64c3381e1c54263b051b8": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "ProgressStyleModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "ProgressStyleModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "StyleView", | |
"bar_color": null, | |
"description_width": "" | |
} | |
}, | |
"ce4a3c199e394a34933cc48f58ed4cc9": { | |
"model_module": "@jupyter-widgets/base", | |
"model_name": "LayoutModel", | |
"model_module_version": "1.2.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/base", | |
"_model_module_version": "1.2.0", | |
"_model_name": "LayoutModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "LayoutView", | |
"align_content": null, | |
"align_items": null, | |
"align_self": null, | |
"border": null, | |
"bottom": null, | |
"display": null, | |
"flex": null, | |
"flex_flow": null, | |
"grid_area": null, | |
"grid_auto_columns": null, | |
"grid_auto_flow": null, | |
"grid_auto_rows": null, | |
"grid_column": null, | |
"grid_gap": null, | |
"grid_row": null, | |
"grid_template_areas": null, | |
"grid_template_columns": null, | |
"grid_template_rows": null, | |
"height": null, | |
"justify_content": null, | |
"justify_items": null, | |
"left": null, | |
"margin": null, | |
"max_height": null, | |
"max_width": null, | |
"min_height": null, | |
"min_width": null, | |
"object_fit": null, | |
"object_position": null, | |
"order": null, | |
"overflow": null, | |
"overflow_x": null, | |
"overflow_y": null, | |
"padding": null, | |
"right": null, | |
"top": null, | |
"visibility": null, | |
"width": null | |
} | |
}, | |
"24dad68d2f644f5cac54206b6fe9966b": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "DescriptionStyleModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "DescriptionStyleModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "StyleView", | |
"description_width": "" | |
} | |
}, | |
"3b4d20ab6a0d471895b3b9a135e1bc2a": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "HBoxModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_dom_classes": [], | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "HBoxModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/controls", | |
"_view_module_version": "1.5.0", | |
"_view_name": "HBoxView", | |
"box_style": "", | |
"children": [ | |
"IPY_MODEL_a5650e9936c94360ba7d182bee7c994c", | |
"IPY_MODEL_451421f2856240cfb8c54477c0382e1d", | |
"IPY_MODEL_817f8ceede904034979eeda6e641de9b" | |
], | |
"layout": "IPY_MODEL_886b08b166064888a76c2f6e385ff3a1" | |
} | |
}, | |
"a5650e9936c94360ba7d182bee7c994c": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "HTMLModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_dom_classes": [], | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "HTMLModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/controls", | |
"_view_module_version": "1.5.0", | |
"_view_name": "HTMLView", | |
"description": "", | |
"description_tooltip": null, | |
"layout": "IPY_MODEL_1a3601a42c6c4f3d8dd387dbba9267cf", | |
"placeholder": "", | |
"style": "IPY_MODEL_0c81855d4ac74d0e9eec8bebc5c73e3f", | |
"value": "Generate report structure: 100%" | |
} | |
}, | |
"451421f2856240cfb8c54477c0382e1d": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "FloatProgressModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_dom_classes": [], | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "FloatProgressModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/controls", | |
"_view_module_version": "1.5.0", | |
"_view_name": "ProgressView", | |
"bar_style": "success", | |
"description": "", | |
"description_tooltip": null, | |
"layout": "IPY_MODEL_c603c016f94f46eca65bba09d4483320", | |
"max": 1, | |
"min": 0, | |
"orientation": "horizontal", | |
"style": "IPY_MODEL_ba644b0892f040deb87bc2ff6c67504c", | |
"value": 1 | |
} | |
}, | |
"817f8ceede904034979eeda6e641de9b": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "HTMLModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_dom_classes": [], | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "HTMLModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/controls", | |
"_view_module_version": "1.5.0", | |
"_view_name": "HTMLView", | |
"description": "", | |
"description_tooltip": null, | |
"layout": "IPY_MODEL_c598f64d182e4902a5d406db31cf97df", | |
"placeholder": "", | |
"style": "IPY_MODEL_f57831c0f5524caf8b732dacddef739a", | |
"value": " 1/1 [00:39<00:00, 39.84s/it]" | |
} | |
}, | |
"886b08b166064888a76c2f6e385ff3a1": { | |
"model_module": "@jupyter-widgets/base", | |
"model_name": "LayoutModel", | |
"model_module_version": "1.2.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/base", | |
"_model_module_version": "1.2.0", | |
"_model_name": "LayoutModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "LayoutView", | |
"align_content": null, | |
"align_items": null, | |
"align_self": null, | |
"border": null, | |
"bottom": null, | |
"display": null, | |
"flex": null, | |
"flex_flow": null, | |
"grid_area": null, | |
"grid_auto_columns": null, | |
"grid_auto_flow": null, | |
"grid_auto_rows": null, | |
"grid_column": null, | |
"grid_gap": null, | |
"grid_row": null, | |
"grid_template_areas": null, | |
"grid_template_columns": null, | |
"grid_template_rows": null, | |
"height": null, | |
"justify_content": null, | |
"justify_items": null, | |
"left": null, | |
"margin": null, | |
"max_height": null, | |
"max_width": null, | |
"min_height": null, | |
"min_width": null, | |
"object_fit": null, | |
"object_position": null, | |
"order": null, | |
"overflow": null, | |
"overflow_x": null, | |
"overflow_y": null, | |
"padding": null, | |
"right": null, | |
"top": null, | |
"visibility": null, | |
"width": null | |
} | |
}, | |
"1a3601a42c6c4f3d8dd387dbba9267cf": { | |
"model_module": "@jupyter-widgets/base", | |
"model_name": "LayoutModel", | |
"model_module_version": "1.2.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/base", | |
"_model_module_version": "1.2.0", | |
"_model_name": "LayoutModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "LayoutView", | |
"align_content": null, | |
"align_items": null, | |
"align_self": null, | |
"border": null, | |
"bottom": null, | |
"display": null, | |
"flex": null, | |
"flex_flow": null, | |
"grid_area": null, | |
"grid_auto_columns": null, | |
"grid_auto_flow": null, | |
"grid_auto_rows": null, | |
"grid_column": null, | |
"grid_gap": null, | |
"grid_row": null, | |
"grid_template_areas": null, | |
"grid_template_columns": null, | |
"grid_template_rows": null, | |
"height": null, | |
"justify_content": null, | |
"justify_items": null, | |
"left": null, | |
"margin": null, | |
"max_height": null, | |
"max_width": null, | |
"min_height": null, | |
"min_width": null, | |
"object_fit": null, | |
"object_position": null, | |
"order": null, | |
"overflow": null, | |
"overflow_x": null, | |
"overflow_y": null, | |
"padding": null, | |
"right": null, | |
"top": null, | |
"visibility": null, | |
"width": null | |
} | |
}, | |
"0c81855d4ac74d0e9eec8bebc5c73e3f": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "DescriptionStyleModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "DescriptionStyleModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "StyleView", | |
"description_width": "" | |
} | |
}, | |
"c603c016f94f46eca65bba09d4483320": { | |
"model_module": "@jupyter-widgets/base", | |
"model_name": "LayoutModel", | |
"model_module_version": "1.2.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/base", | |
"_model_module_version": "1.2.0", | |
"_model_name": "LayoutModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "LayoutView", | |
"align_content": null, | |
"align_items": null, | |
"align_self": null, | |
"border": null, | |
"bottom": null, | |
"display": null, | |
"flex": null, | |
"flex_flow": null, | |
"grid_area": null, | |
"grid_auto_columns": null, | |
"grid_auto_flow": null, | |
"grid_auto_rows": null, | |
"grid_column": null, | |
"grid_gap": null, | |
"grid_row": null, | |
"grid_template_areas": null, | |
"grid_template_columns": null, | |
"grid_template_rows": null, | |
"height": null, | |
"justify_content": null, | |
"justify_items": null, | |
"left": null, | |
"margin": null, | |
"max_height": null, | |
"max_width": null, | |
"min_height": null, | |
"min_width": null, | |
"object_fit": null, | |
"object_position": null, | |
"order": null, | |
"overflow": null, | |
"overflow_x": null, | |
"overflow_y": null, | |
"padding": null, | |
"right": null, | |
"top": null, | |
"visibility": null, | |
"width": null | |
} | |
}, | |
"ba644b0892f040deb87bc2ff6c67504c": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "ProgressStyleModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "ProgressStyleModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "StyleView", | |
"bar_color": null, | |
"description_width": "" | |
} | |
}, | |
"c598f64d182e4902a5d406db31cf97df": { | |
"model_module": "@jupyter-widgets/base", | |
"model_name": "LayoutModel", | |
"model_module_version": "1.2.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/base", | |
"_model_module_version": "1.2.0", | |
"_model_name": "LayoutModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "LayoutView", | |
"align_content": null, | |
"align_items": null, | |
"align_self": null, | |
"border": null, | |
"bottom": null, | |
"display": null, | |
"flex": null, | |
"flex_flow": null, | |
"grid_area": null, | |
"grid_auto_columns": null, | |
"grid_auto_flow": null, | |
"grid_auto_rows": null, | |
"grid_column": null, | |
"grid_gap": null, | |
"grid_row": null, | |
"grid_template_areas": null, | |
"grid_template_columns": null, | |
"grid_template_rows": null, | |
"height": null, | |
"justify_content": null, | |
"justify_items": null, | |
"left": null, | |
"margin": null, | |
"max_height": null, | |
"max_width": null, | |
"min_height": null, | |
"min_width": null, | |
"object_fit": null, | |
"object_position": null, | |
"order": null, | |
"overflow": null, | |
"overflow_x": null, | |
"overflow_y": null, | |
"padding": null, | |
"right": null, | |
"top": null, | |
"visibility": null, | |
"width": null | |
} | |
}, | |
"f57831c0f5524caf8b732dacddef739a": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "DescriptionStyleModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "DescriptionStyleModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "StyleView", | |
"description_width": "" | |
} | |
}, | |
"45f5cb1ca4be40899ffa0c5d28fa0408": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "HBoxModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_dom_classes": [], | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "HBoxModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/controls", | |
"_view_module_version": "1.5.0", | |
"_view_name": "HBoxView", | |
"box_style": "", | |
"children": [ | |
"IPY_MODEL_15443dbebe9340b49fab794380e19641", | |
"IPY_MODEL_a38c1e8630ef49819e56074a73ca2b19", | |
"IPY_MODEL_41ea76ce2ad04204ba90b4819f0fd88b" | |
], | |
"layout": "IPY_MODEL_a7b06fd8be684285bfc6b6d07f2aec18" | |
} | |
}, | |
"15443dbebe9340b49fab794380e19641": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "HTMLModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_dom_classes": [], | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "HTMLModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/controls", | |
"_view_module_version": "1.5.0", | |
"_view_name": "HTMLView", | |
"description": "", | |
"description_tooltip": null, | |
"layout": "IPY_MODEL_90cd617562564c60a22d32b6950b3750", | |
"placeholder": "", | |
"style": "IPY_MODEL_ee4bf42aff5e4d1588e10f07c35fd2c0", | |
"value": "Render HTML: 100%" | |
} | |
}, | |
"a38c1e8630ef49819e56074a73ca2b19": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "FloatProgressModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_dom_classes": [], | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "FloatProgressModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/controls", | |
"_view_module_version": "1.5.0", | |
"_view_name": "ProgressView", | |
"bar_style": "success", | |
"description": "", | |
"description_tooltip": null, | |
"layout": "IPY_MODEL_fc3ac9b155ad433884624e2096c6e6a5", | |
"max": 1, | |
"min": 0, | |
"orientation": "horizontal", | |
"style": "IPY_MODEL_8fa2a29fff23411daba62b82e31fe541", | |
"value": 1 | |
} | |
}, | |
"41ea76ce2ad04204ba90b4819f0fd88b": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "HTMLModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_dom_classes": [], | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "HTMLModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/controls", | |
"_view_module_version": "1.5.0", | |
"_view_name": "HTMLView", | |
"description": "", | |
"description_tooltip": null, | |
"layout": "IPY_MODEL_d3a99198b9a446f3a543b58517f9f76f", | |
"placeholder": "", | |
"style": "IPY_MODEL_5d4f15830f9b45bb8360ad5291242f7c", | |
"value": " 1/1 [00:01<00:00, 1.64s/it]" | |
} | |
}, | |
"a7b06fd8be684285bfc6b6d07f2aec18": { | |
"model_module": "@jupyter-widgets/base", | |
"model_name": "LayoutModel", | |
"model_module_version": "1.2.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/base", | |
"_model_module_version": "1.2.0", | |
"_model_name": "LayoutModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "LayoutView", | |
"align_content": null, | |
"align_items": null, | |
"align_self": null, | |
"border": null, | |
"bottom": null, | |
"display": null, | |
"flex": null, | |
"flex_flow": null, | |
"grid_area": null, | |
"grid_auto_columns": null, | |
"grid_auto_flow": null, | |
"grid_auto_rows": null, | |
"grid_column": null, | |
"grid_gap": null, | |
"grid_row": null, | |
"grid_template_areas": null, | |
"grid_template_columns": null, | |
"grid_template_rows": null, | |
"height": null, | |
"justify_content": null, | |
"justify_items": null, | |
"left": null, | |
"margin": null, | |
"max_height": null, | |
"max_width": null, | |
"min_height": null, | |
"min_width": null, | |
"object_fit": null, | |
"object_position": null, | |
"order": null, | |
"overflow": null, | |
"overflow_x": null, | |
"overflow_y": null, | |
"padding": null, | |
"right": null, | |
"top": null, | |
"visibility": null, | |
"width": null | |
} | |
}, | |
"90cd617562564c60a22d32b6950b3750": { | |
"model_module": "@jupyter-widgets/base", | |
"model_name": "LayoutModel", | |
"model_module_version": "1.2.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/base", | |
"_model_module_version": "1.2.0", | |
"_model_name": "LayoutModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "LayoutView", | |
"align_content": null, | |
"align_items": null, | |
"align_self": null, | |
"border": null, | |
"bottom": null, | |
"display": null, | |
"flex": null, | |
"flex_flow": null, | |
"grid_area": null, | |
"grid_auto_columns": null, | |
"grid_auto_flow": null, | |
"grid_auto_rows": null, | |
"grid_column": null, | |
"grid_gap": null, | |
"grid_row": null, | |
"grid_template_areas": null, | |
"grid_template_columns": null, | |
"grid_template_rows": null, | |
"height": null, | |
"justify_content": null, | |
"justify_items": null, | |
"left": null, | |
"margin": null, | |
"max_height": null, | |
"max_width": null, | |
"min_height": null, | |
"min_width": null, | |
"object_fit": null, | |
"object_position": null, | |
"order": null, | |
"overflow": null, | |
"overflow_x": null, | |
"overflow_y": null, | |
"padding": null, | |
"right": null, | |
"top": null, | |
"visibility": null, | |
"width": null | |
} | |
}, | |
"ee4bf42aff5e4d1588e10f07c35fd2c0": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "DescriptionStyleModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "DescriptionStyleModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "StyleView", | |
"description_width": "" | |
} | |
}, | |
"fc3ac9b155ad433884624e2096c6e6a5": { | |
"model_module": "@jupyter-widgets/base", | |
"model_name": "LayoutModel", | |
"model_module_version": "1.2.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/base", | |
"_model_module_version": "1.2.0", | |
"_model_name": "LayoutModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "LayoutView", | |
"align_content": null, | |
"align_items": null, | |
"align_self": null, | |
"border": null, | |
"bottom": null, | |
"display": null, | |
"flex": null, | |
"flex_flow": null, | |
"grid_area": null, | |
"grid_auto_columns": null, | |
"grid_auto_flow": null, | |
"grid_auto_rows": null, | |
"grid_column": null, | |
"grid_gap": null, | |
"grid_row": null, | |
"grid_template_areas": null, | |
"grid_template_columns": null, | |
"grid_template_rows": null, | |
"height": null, | |
"justify_content": null, | |
"justify_items": null, | |
"left": null, | |
"margin": null, | |
"max_height": null, | |
"max_width": null, | |
"min_height": null, | |
"min_width": null, | |
"object_fit": null, | |
"object_position": null, | |
"order": null, | |
"overflow": null, | |
"overflow_x": null, | |
"overflow_y": null, | |
"padding": null, | |
"right": null, | |
"top": null, | |
"visibility": null, | |
"width": null | |
} | |
}, | |
"8fa2a29fff23411daba62b82e31fe541": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "ProgressStyleModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "ProgressStyleModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "StyleView", | |
"bar_color": null, | |
"description_width": "" | |
} | |
}, | |
"d3a99198b9a446f3a543b58517f9f76f": { | |
"model_module": "@jupyter-widgets/base", | |
"model_name": "LayoutModel", | |
"model_module_version": "1.2.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/base", | |
"_model_module_version": "1.2.0", | |
"_model_name": "LayoutModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "LayoutView", | |
"align_content": null, | |
"align_items": null, | |
"align_self": null, | |
"border": null, | |
"bottom": null, | |
"display": null, | |
"flex": null, | |
"flex_flow": null, | |
"grid_area": null, | |
"grid_auto_columns": null, | |
"grid_auto_flow": null, | |
"grid_auto_rows": null, | |
"grid_column": null, | |
"grid_gap": null, | |
"grid_row": null, | |
"grid_template_areas": null, | |
"grid_template_columns": null, | |
"grid_template_rows": null, | |
"height": null, | |
"justify_content": null, | |
"justify_items": null, | |
"left": null, | |
"margin": null, | |
"max_height": null, | |
"max_width": null, | |
"min_height": null, | |
"min_width": null, | |
"object_fit": null, | |
"object_position": null, | |
"order": null, | |
"overflow": null, | |
"overflow_x": null, | |
"overflow_y": null, | |
"padding": null, | |
"right": null, | |
"top": null, | |
"visibility": null, | |
"width": null | |
} | |
}, | |
"5d4f15830f9b45bb8360ad5291242f7c": { | |
"model_module": "@jupyter-widgets/controls", | |
"model_name": "DescriptionStyleModel", | |
"model_module_version": "1.5.0", | |
"state": { | |
"_model_module": "@jupyter-widgets/controls", | |
"_model_module_version": "1.5.0", | |
"_model_name": "DescriptionStyleModel", | |
"_view_count": null, | |
"_view_module": "@jupyter-widgets/base", | |
"_view_module_version": "1.2.0", | |
"_view_name": "StyleView", | |
"description_width": "" | |
} | |
} | |
} | |
} | |
}, | |
"nbformat_minor": 5, | |
"nbformat": 4, | |
"cells": [ | |
{ | |
"cell_type": "markdown", | |
"metadata": { | |
"id": "view-in-github", | |
"colab_type": "text" | |
}, | |
"source": [ | |
"<a href=\"https://colab.research.google.com/gist/harisonmg/b75ded889801c0188ba6ad2af9c8c3a6/ames-housing-prices-eda.ipynb\" target=\"_parent\"><img src=\"https://colab.research.google.com/assets/colab-badge.svg\" alt=\"Open In Colab\"/></a>" | |
] | |
}, | |
{ | |
"cell_type": "markdown", | |
"source": [ | |
"# Introduction\n", | |
"The problem at hand is a regression problem where we are required to\n", | |
"predict the price of a house, given certain characteristics.\n", | |
"\n", | |
"Data source: [Kaggle](https://www.kaggle.com/competitions/house-prices-advanced-regression-techniques/data)" | |
], | |
"metadata": { | |
"id": "jOMFosariuuO" | |
}, | |
"id": "jOMFosariuuO" | |
}, | |
{ | |
"cell_type": "code", | |
"source": [ | |
"# @title Download and extract the data\n", | |
"%%bash\n", | |
"rm -rf input && mkdir -p input/ames-housing\n", | |
"wget --no-check-certificate \"https://docs.google.com/uc?export=download&id=1VyekZ6K5ZRXg61ihwZKSZaCNn-OGSpSE\" \\\n", | |
" -O input/ames-housing.zip\n", | |
"unzip input/*.zip -d input/ames-housing" | |
], | |
"metadata": { | |
"colab": { | |
"base_uri": "https://localhost:8080/" | |
}, | |
"cellView": "form", | |
"id": "GittntJBitqo", | |
"outputId": "3374ac21-9f6e-4ce5-beb6-0a4c2076be29" | |
}, | |
"id": "GittntJBitqo", | |
"execution_count": 1, | |
"outputs": [ | |
{ | |
"output_type": "stream", | |
"name": "stdout", | |
"text": [ | |
"Archive: input/ames-housing.zip\n", | |
" inflating: input/ames-housing/data_description.txt \n", | |
" inflating: input/ames-housing/sample_submission.csv \n", | |
" inflating: input/ames-housing/test.csv \n", | |
" inflating: input/ames-housing/train.csv \n" | |
] | |
}, | |
{ | |
"output_type": "stream", | |
"name": "stderr", | |
"text": [ | |
"--2022-11-22 14:01:46-- https://docs.google.com/uc?export=download&id=1VyekZ6K5ZRXg61ihwZKSZaCNn-OGSpSE\n", | |
"Resolving docs.google.com (docs.google.com)... 74.125.204.113, 74.125.204.138, 74.125.204.102, ...\n", | |
"Connecting to docs.google.com (docs.google.com)|74.125.204.113|:443... connected.\n", | |
"HTTP request sent, awaiting response... 303 See Other\n", | |
"Location: https://doc-00-2s-docs.googleusercontent.com/docs/securesc/ha0ro937gcuc7l7deffksulhg5h7mbp1/94tk8kvre9q30p5v1h31ekm2i7655623/1669125675000/13037866814700494090/*/1VyekZ6K5ZRXg61ihwZKSZaCNn-OGSpSE?e=download&uuid=9d88b6aa-ab2e-40fc-b88c-007cd5d366fc [following]\n", | |
"Warning: wildcards not supported in HTTP.\n", | |
"--2022-11-22 14:01:47-- https://doc-00-2s-docs.googleusercontent.com/docs/securesc/ha0ro937gcuc7l7deffksulhg5h7mbp1/94tk8kvre9q30p5v1h31ekm2i7655623/1669125675000/13037866814700494090/*/1VyekZ6K5ZRXg61ihwZKSZaCNn-OGSpSE?e=download&uuid=9d88b6aa-ab2e-40fc-b88c-007cd5d366fc\n", | |
"Resolving doc-00-2s-docs.googleusercontent.com (doc-00-2s-docs.googleusercontent.com)... 142.251.8.132, 2404:6800:4008:c15::84\n", | |
"Connecting to doc-00-2s-docs.googleusercontent.com (doc-00-2s-docs.googleusercontent.com)|142.251.8.132|:443... connected.\n", | |
"HTTP request sent, awaiting response... 200 OK\n", | |
"Length: 203809 (199K) [application/zip]\n", | |
"Saving to: ‘input/ames-housing.zip’\n", | |
"\n", | |
" 0K .......... .......... .......... .......... .......... 25% 41.3M 0s\n", | |
" 50K .......... .......... .......... .......... .......... 50% 45.3M 0s\n", | |
" 100K .......... .......... .......... .......... .......... 75% 48.7M 0s\n", | |
" 150K .......... .......... .......... .......... ......... 100% 40.5M=0.004s\n", | |
"\n", | |
"2022-11-22 14:01:47 (43.7 MB/s) - ‘input/ames-housing.zip’ saved [203809/203809]\n", | |
"\n" | |
] | |
} | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"source": [ | |
"# @title Imports\n", | |
"from pathlib import Path\n", | |
"\n", | |
"import numpy as np\n", | |
"import pandas as pd\n", | |
"import matplotlib.pyplot as plt\n", | |
"import seaborn as sns" | |
], | |
"metadata": { | |
"execution": { | |
"iopub.status.busy": "2022-11-22T13:18:52.016426Z", | |
"iopub.execute_input": "2022-11-22T13:18:52.016906Z", | |
"iopub.status.idle": "2022-11-22T13:18:52.403270Z", | |
"shell.execute_reply.started": "2022-11-22T13:18:52.016808Z", | |
"shell.execute_reply": "2022-11-22T13:18:52.402160Z" | |
}, | |
"trusted": true, | |
"cellView": "form", | |
"id": "kyEqH_5WiiXe" | |
}, | |
"execution_count": 2, | |
"outputs": [], | |
"id": "kyEqH_5WiiXe" | |
}, | |
{ | |
"cell_type": "code", | |
"source": [ | |
"# @title Config\n", | |
"# file paths\n", | |
"DATA_DIR = Path(\"./input/ames-housing\")\n", | |
"\n", | |
"# data\n", | |
"TRAIN_DATA = DATA_DIR / \"train.csv\"\n", | |
"\n", | |
"# columns in the data\n", | |
"INDEX_COL = \"Id\"\n", | |
"\n", | |
"TARGET_COL = \"SalePrice\"\n", | |
"\n", | |
"# random state\n", | |
"RANDOM_SEED = 42\n", | |
"\n", | |
"# plots\n", | |
"%matplotlib inline\n", | |
"sns.set_theme(context=\"notebook\", style=\"whitegrid\", rc={\"figure.figsize\": (14, 8)})" | |
], | |
"metadata": { | |
"execution": { | |
"iopub.status.busy": "2022-11-22T13:18:52.404933Z", | |
"iopub.execute_input": "2022-11-22T13:18:52.405544Z", | |
"iopub.status.idle": "2022-11-22T13:18:52.413607Z", | |
"shell.execute_reply.started": "2022-11-22T13:18:52.405506Z", | |
"shell.execute_reply": "2022-11-22T13:18:52.412533Z" | |
}, | |
"trusted": true, | |
"cellView": "form", | |
"id": "06ZsWdGQiiXg" | |
}, | |
"execution_count": 3, | |
"outputs": [], | |
"id": "06ZsWdGQiiXg" | |
}, | |
{ | |
"cell_type": "code", | |
"source": [ | |
"# @title Loading the data\n", | |
"df = pd.read_csv(TRAIN_DATA, index_col=INDEX_COL)\n", | |
"df.info()" | |
], | |
"metadata": { | |
"execution": { | |
"iopub.status.busy": "2022-11-22T13:18:52.415876Z", | |
"iopub.execute_input": "2022-11-22T13:18:52.416348Z", | |
"iopub.status.idle": "2022-11-22T13:18:52.483424Z", | |
"shell.execute_reply.started": "2022-11-22T13:18:52.416302Z", | |
"shell.execute_reply": "2022-11-22T13:18:52.482176Z" | |
}, | |
"trusted": true, | |
"colab": { | |
"base_uri": "https://localhost:8080/" | |
}, | |
"cellView": "form", | |
"id": "vXBlRFSdiiXh", | |
"outputId": "316a11a5-077b-4334-c469-c1eecc348d7c" | |
}, | |
"execution_count": 4, | |
"outputs": [ | |
{ | |
"output_type": "stream", | |
"name": "stdout", | |
"text": [ | |
"<class 'pandas.core.frame.DataFrame'>\n", | |
"Int64Index: 1460 entries, 1 to 1460\n", | |
"Data columns (total 80 columns):\n", | |
" # Column Non-Null Count Dtype \n", | |
"--- ------ -------------- ----- \n", | |
" 0 MSSubClass 1460 non-null int64 \n", | |
" 1 MSZoning 1460 non-null object \n", | |
" 2 LotFrontage 1201 non-null float64\n", | |
" 3 LotArea 1460 non-null int64 \n", | |
" 4 Street 1460 non-null object \n", | |
" 5 Alley 91 non-null object \n", | |
" 6 LotShape 1460 non-null object \n", | |
" 7 LandContour 1460 non-null object \n", | |
" 8 Utilities 1460 non-null object \n", | |
" 9 LotConfig 1460 non-null object \n", | |
" 10 LandSlope 1460 non-null object \n", | |
" 11 Neighborhood 1460 non-null object \n", | |
" 12 Condition1 1460 non-null object \n", | |
" 13 Condition2 1460 non-null object \n", | |
" 14 BldgType 1460 non-null object \n", | |
" 15 HouseStyle 1460 non-null object \n", | |
" 16 OverallQual 1460 non-null int64 \n", | |
" 17 OverallCond 1460 non-null int64 \n", | |
" 18 YearBuilt 1460 non-null int64 \n", | |
" 19 YearRemodAdd 1460 non-null int64 \n", | |
" 20 RoofStyle 1460 non-null object \n", | |
" 21 RoofMatl 1460 non-null object \n", | |
" 22 Exterior1st 1460 non-null object \n", | |
" 23 Exterior2nd 1460 non-null object \n", | |
" 24 MasVnrType 1452 non-null object \n", | |
" 25 MasVnrArea 1452 non-null float64\n", | |
" 26 ExterQual 1460 non-null object \n", | |
" 27 ExterCond 1460 non-null object \n", | |
" 28 Foundation 1460 non-null object \n", | |
" 29 BsmtQual 1423 non-null object \n", | |
" 30 BsmtCond 1423 non-null object \n", | |
" 31 BsmtExposure 1422 non-null object \n", | |
" 32 BsmtFinType1 1423 non-null object \n", | |
" 33 BsmtFinSF1 1460 non-null int64 \n", | |
" 34 BsmtFinType2 1422 non-null object \n", | |
" 35 BsmtFinSF2 1460 non-null int64 \n", | |
" 36 BsmtUnfSF 1460 non-null int64 \n", | |
" 37 TotalBsmtSF 1460 non-null int64 \n", | |
" 38 Heating 1460 non-null object \n", | |
" 39 HeatingQC 1460 non-null object \n", | |
" 40 CentralAir 1460 non-null object \n", | |
" 41 Electrical 1459 non-null object \n", | |
" 42 1stFlrSF 1460 non-null int64 \n", | |
" 43 2ndFlrSF 1460 non-null int64 \n", | |
" 44 LowQualFinSF 1460 non-null int64 \n", | |
" 45 GrLivArea 1460 non-null int64 \n", | |
" 46 BsmtFullBath 1460 non-null int64 \n", | |
" 47 BsmtHalfBath 1460 non-null int64 \n", | |
" 48 FullBath 1460 non-null int64 \n", | |
" 49 HalfBath 1460 non-null int64 \n", | |
" 50 BedroomAbvGr 1460 non-null int64 \n", | |
" 51 KitchenAbvGr 1460 non-null int64 \n", | |
" 52 KitchenQual 1460 non-null object \n", | |
" 53 TotRmsAbvGrd 1460 non-null int64 \n", | |
" 54 Functional 1460 non-null object \n", | |
" 55 Fireplaces 1460 non-null int64 \n", | |
" 56 FireplaceQu 770 non-null object \n", | |
" 57 GarageType 1379 non-null object \n", | |
" 58 GarageYrBlt 1379 non-null float64\n", | |
" 59 GarageFinish 1379 non-null object \n", | |
" 60 GarageCars 1460 non-null int64 \n", | |
" 61 GarageArea 1460 non-null int64 \n", | |
" 62 GarageQual 1379 non-null object \n", | |
" 63 GarageCond 1379 non-null object \n", | |
" 64 PavedDrive 1460 non-null object \n", | |
" 65 WoodDeckSF 1460 non-null int64 \n", | |
" 66 OpenPorchSF 1460 non-null int64 \n", | |
" 67 EnclosedPorch 1460 non-null int64 \n", | |
" 68 3SsnPorch 1460 non-null int64 \n", | |
" 69 ScreenPorch 1460 non-null int64 \n", | |
" 70 PoolArea 1460 non-null int64 \n", | |
" 71 PoolQC 7 non-null object \n", | |
" 72 Fence 281 non-null object \n", | |
" 73 MiscFeature 54 non-null object \n", | |
" 74 MiscVal 1460 non-null int64 \n", | |
" 75 MoSold 1460 non-null int64 \n", | |
" 76 YrSold 1460 non-null int64 \n", | |
" 77 SaleType 1460 non-null object \n", | |
" 78 SaleCondition 1460 non-null object \n", | |
" 79 SalePrice 1460 non-null int64 \n", | |
"dtypes: float64(3), int64(34), object(43)\n", | |
"memory usage: 923.9+ KB\n" | |
] | |
} | |
], | |
"id": "vXBlRFSdiiXh" | |
}, | |
{ | |
"cell_type": "markdown", | |
"source": [ | |
"# Pandas profiling report" | |
], | |
"metadata": { | |
"id": "SqcdB4afiiXi" | |
}, | |
"id": "SqcdB4afiiXi" | |
}, | |
{ | |
"cell_type": "code", | |
"source": [ | |
"# @title Update `pandas-profiling`\n", | |
"import sys\n", | |
"!{sys.executable} -m pip install -U -q pandas-profiling" | |
], | |
"metadata": { | |
"cellView": "form", | |
"colab": { | |
"base_uri": "https://localhost:8080/" | |
}, | |
"id": "EGKOqu_3lBqx", | |
"outputId": "dda9a137-fd49-4174-d478-ecb19f9e2822" | |
}, | |
"id": "EGKOqu_3lBqx", | |
"execution_count": 5, | |
"outputs": [ | |
{ | |
"output_type": "stream", | |
"name": "stdout", | |
"text": [ | |
"\u001b[K |████████████████████████████████| 315 kB 4.1 MB/s \n", | |
"\u001b[K |████████████████████████████████| 690 kB 50.2 MB/s \n", | |
"\u001b[K |████████████████████████████████| 62 kB 1.1 MB/s \n", | |
"\u001b[K |████████████████████████████████| 9.9 MB 40.9 MB/s \n", | |
"\u001b[K |████████████████████████████████| 102 kB 66.2 MB/s \n", | |
"\u001b[K |████████████████████████████████| 4.7 MB 28.9 MB/s \n", | |
"\u001b[K |████████████████████████████████| 296 kB 46.6 MB/s \n", | |
"\u001b[?25h Building wheel for htmlmin (setup.py) ... \u001b[?25l\u001b[?25hdone\n" | |
] | |
} | |
] | |
}, | |
{ | |
"cell_type": "code", | |
"source": [ | |
"# @title Generate the report\n", | |
"from pandas_profiling import ProfileReport\n", | |
"\n", | |
"report = ProfileReport(df, minimal=True)\n", | |
"report" | |
], | |
"metadata": { | |
"execution": { | |
"iopub.status.busy": "2022-11-22T13:18:52.485139Z", | |
"iopub.execute_input": "2022-11-22T13:18:52.485463Z", | |
"iopub.status.idle": "2022-11-22T13:19:20.890811Z", | |
"shell.execute_reply.started": "2022-11-22T13:18:52.485433Z", | |
"shell.execute_reply": "2022-11-22T13:19:20.889608Z" | |
}, | |
"trusted": true, | |
"colab": { | |
"base_uri": "https://localhost:8080/", | |
"height": 917, | |
"referenced_widgets": [ | |
"25360bfd888b45589d13391ae25152bf", | |
"730e4c0ce7f04bb7811f05f4aa98c81d", | |
"39861cb32ece4527ba26fd846ad43f1c", | |
"8de6b015ad614fc2b87cae2018fa0d81", | |
"9a368258af0b454eb2b516cd0b0bc14a", | |
"e29f6c9fb7894f70a3d80cd9b0945000", | |
"10aad3c8404448cf9f702455e4fdd82e", | |
"0f8e47c1ed66415a817bad19d4c0902d", | |
"9e7346de49a64c3381e1c54263b051b8", | |
"ce4a3c199e394a34933cc48f58ed4cc9", | |
"24dad68d2f644f5cac54206b6fe9966b", | |
"3b4d20ab6a0d471895b3b9a135e1bc2a", | |
"a5650e9936c94360ba7d182bee7c994c", | |
"451421f2856240cfb8c54477c0382e1d", | |
"817f8ceede904034979eeda6e641de9b", | |
"886b08b166064888a76c2f6e385ff3a1", | |
"1a3601a42c6c4f3d8dd387dbba9267cf", | |
"0c81855d4ac74d0e9eec8bebc5c73e3f", | |
"c603c016f94f46eca65bba09d4483320", | |
"ba644b0892f040deb87bc2ff6c67504c", | |
"c598f64d182e4902a5d406db31cf97df", | |
"f57831c0f5524caf8b732dacddef739a", | |
"45f5cb1ca4be40899ffa0c5d28fa0408", | |
"15443dbebe9340b49fab794380e19641", | |
"a38c1e8630ef49819e56074a73ca2b19", | |
"41ea76ce2ad04204ba90b4819f0fd88b", | |
"a7b06fd8be684285bfc6b6d07f2aec18", | |
"90cd617562564c60a22d32b6950b3750", | |
"ee4bf42aff5e4d1588e10f07c35fd2c0", | |
"fc3ac9b155ad433884624e2096c6e6a5", | |
"8fa2a29fff23411daba62b82e31fe541", | |
"d3a99198b9a446f3a543b58517f9f76f", | |
"5d4f15830f9b45bb8360ad5291242f7c" | |
] | |
}, | |
"cellView": "form", | |
"id": "b-zhwBUmiiXj", | |
"outputId": "a6e8fd62-8f12-4f77-decf-2c96656ad9c1" | |
}, | |
"execution_count": 6, | |
"outputs": [ | |
{ | |
"output_type": "display_data", | |
"data": { | |
"text/plain": [ | |
"Summarize dataset: 0%| | 0/5 [00:00<?, ?it/s]" | |
], | |
"application/vnd.jupyter.widget-view+json": { | |
"version_major": 2, | |
"version_minor": 0, | |
"model_id": "25360bfd888b45589d13391ae25152bf" | |
} | |
}, | |
"metadata": {} | |
}, | |
{ | |
"output_type": "display_data", | |
"data": { | |
"text/plain": [ | |
"Generate report structure: 0%| | 0/1 [00:00<?, ?it/s]" | |
], | |
"application/vnd.jupyter.widget-view+json": { | |
"version_major": 2, | |
"version_minor": 0, | |
"model_id": "3b4d20ab6a0d471895b3b9a135e1bc2a" | |
} | |
}, | |
"metadata": {} | |
}, | |
{ | |
"output_type": "display_data", | |
"data": { | |
"text/plain": [ | |
"Render HTML: 0%| | 0/1 [00:00<?, ?it/s]" | |
], | |
"application/vnd.jupyter.widget-view+json": { | |
"version_major": 2, | |
"version_minor": 0, | |
"model_id": "45f5cb1ca4be40899ffa0c5d28fa0408" | |
} | |
}, | |
"metadata": {} | |
}, | |
{ | |
"output_type": "display_data", | |
"data": { | |
"text/plain": [ | |
"<IPython.core.display.HTML object>" | |
], | |
"text/html": [ | |
"<iframe width=\"100%\" height=\"800px\" srcdoc=\"<!doctype html><html lang=en><head><meta charset=utf-8><meta name=viewport content="width=device-width, initial-scale=1, shrink-to-fit=no"><meta name=description content="Profile report generated by YData! Visit us at https://ydata.ai"><meta name=author content="YData and the open source community."><meta name=generator content="Pandas Profiling v3.4.0"><meta name=url content=https://github.com/ydataai/pandas-profiling><meta name=date content="2022-11-22 14:02:26.169935"><title>Pandas Profiling Report</title><style>\n", | |
"/*!\n", | |
" * Bootstrap v3.3.7 (http://getbootstrap.com)\n", | |
" * Copyright 2011-2016 Twitter, Inc.\n", | |
" * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n", | |
" *//*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */html{font-family:sans-serif;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%}body{margin:0}article,aside,details,figcaption,figure,footer,header,hgroup,main,menu,nav,section,summary{display:block}audio,canvas,progress,video{display:inline-block;vertical-align:baseline}audio:not([controls]){display:none;height:0}[hidden],template{display:none}a{background-color:transparent}a:active,a:hover{outline:0}abbr[title]{border-bottom:1px dotted}b,strong{font-weight:700}dfn{font-style:italic}h1{margin:.67em 0;font-size:2em}mark{color:#000;background:#ff0}small{font-size:80%}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sup{top:-.5em}sub{bottom:-.25em}img{border:0}svg:not(:root){overflow:hidden}figure{margin:1em 40px}hr{height:0;-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box}pre{overflow:auto}code,kbd,pre,samp{font-family:monospace,monospace;font-size:1em}button,input,optgroup,select,textarea{margin:0;font:inherit;color:inherit}button{overflow:visible}button,select{text-transform:none}button,html input[type=button],input[type=reset],input[type=submit]{-webkit-appearance:button;cursor:pointer}button[disabled],html input[disabled]{cursor:default}button::-moz-focus-inner,input::-moz-focus-inner{padding:0;border:0}input{line-height:normal}input[type=checkbox],input[type=radio]{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;padding:0}input[type=number]::-webkit-inner-spin-button,input[type=number]::-webkit-outer-spin-button{height:auto}input[type=search]{-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;-webkit-appearance:textfield}input[type=search]::-webkit-search-cancel-button,input[type=search]::-webkit-search-decoration{-webkit-appearance:none}fieldset{padding:.35em .625em .75em;margin:0 2px;border:1px solid silver}legend{padding:0;border:0}textarea{overflow:auto}optgroup{font-weight:700}table{border-spacing:0;border-collapse:collapse}td,th{padding:0}/*! Source: https://github.com/h5bp/html5-boilerplate/blob/master/src/css/main.css */@media print{*,:after,:before{color:#000!important;text-shadow:none!important;background:0 0!important;-webkit-box-shadow:none!important;box-shadow:none!important}a,a:visited{text-decoration:underline}a[href]:after{content:" (" attr(href) ")"}abbr[title]:after{content:" (" attr(title) ")"}a[href^="javascript:"]:after,a[href^="#"]:after{content:""}blockquote,pre{border:1px solid #999;page-break-inside:avoid}thead{display:table-header-group}img,tr{page-break-inside:avoid}img{max-width:100%!important}h2,h3,p{orphans:3;widows:3}h2,h3{page-break-after:avoid}.navbar{display:none}.btn>.caret,.dropup>.btn>.caret{border-top-color:#000!important}.label{border:1px solid #000}.table{border-collapse:collapse!important}.table td,.table th{background-color:#fff!important}.table-bordered td,.table-bordered th{border:1px solid #ddd!important}}@font-face{font-family:'Glyphicons Halflings';src:url(../fonts/glyphicons-halflings-regular.eot);src:url(../fonts/glyphicons-halflings-regular.eot?#iefix) format('embedded-opentype'),url(../fonts/glyphicons-halflings-regular.woff2) format('woff2'),url(../fonts/glyphicons-halflings-regular.woff) format('woff'),url(../fonts/glyphicons-halflings-regular.ttf) format('truetype'),url(../fonts/glyphicons-halflings-regular.svg#glyphicons_halflingsregular) format('svg')}.glyphicon{position:relative;top:1px;display:inline-block;font-family:'Glyphicons Halflings';font-style:normal;font-weight:400;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.glyphicon-asterisk:before{content:"\\002a"}.glyphicon-plus:before{content:"\\002b"}.glyphicon-eur:before,.glyphicon-euro:before{content:"\\20ac"}.glyphicon-minus:before{content:"\\2212"}.glyphicon-cloud:before{content:"\\2601"}.glyphicon-envelope:before{content:"\\2709"}.glyphicon-pencil:before{content:"\\270f"}.glyphicon-glass:before{content:"\\e001"}.glyphicon-music:before{content:"\\e002"}.glyphicon-search:before{content:"\\e003"}.glyphicon-heart:before{content:"\\e005"}.glyphicon-star:before{content:"\\e006"}.glyphicon-star-empty:before{content:"\\e007"}.glyphicon-user:before{content:"\\e008"}.glyphicon-film:before{content:"\\e009"}.glyphicon-th-large:before{content:"\\e010"}.glyphicon-th:before{content:"\\e011"}.glyphicon-th-list:before{content:"\\e012"}.glyphicon-ok:before{content:"\\e013"}.glyphicon-remove:before{content:"\\e014"}.glyphicon-zoom-in:before{content:"\\e015"}.glyphicon-zoom-out:before{content:"\\e016"}.glyphicon-off:before{content:"\\e017"}.glyphicon-signal:before{content:"\\e018"}.glyphicon-cog:before{content:"\\e019"}.glyphicon-trash:before{content:"\\e020"}.glyphicon-home:before{content:"\\e021"}.glyphicon-file:before{content:"\\e022"}.glyphicon-time:before{content:"\\e023"}.glyphicon-road:before{content:"\\e024"}.glyphicon-download-alt:before{content:"\\e025"}.glyphicon-download:before{content:"\\e026"}.glyphicon-upload:before{content:"\\e027"}.glyphicon-inbox:before{content:"\\e028"}.glyphicon-play-circle:before{content:"\\e029"}.glyphicon-repeat:before{content:"\\e030"}.glyphicon-refresh:before{content:"\\e031"}.glyphicon-list-alt:before{content:"\\e032"}.glyphicon-lock:before{content:"\\e033"}.glyphicon-flag:before{content:"\\e034"}.glyphicon-headphones:before{content:"\\e035"}.glyphicon-volume-off:before{content:"\\e036"}.glyphicon-volume-down:before{content:"\\e037"}.glyphicon-volume-up:before{content:"\\e038"}.glyphicon-qrcode:before{content:"\\e039"}.glyphicon-barcode:before{content:"\\e040"}.glyphicon-tag:before{content:"\\e041"}.glyphicon-tags:before{content:"\\e042"}.glyphicon-book:before{content:"\\e043"}.glyphicon-bookmark:before{content:"\\e044"}.glyphicon-print:before{content:"\\e045"}.glyphicon-camera:before{content:"\\e046"}.glyphicon-font:before{content:"\\e047"}.glyphicon-bold:before{content:"\\e048"}.glyphicon-italic:before{content:"\\e049"}.glyphicon-text-height:before{content:"\\e050"}.glyphicon-text-width:before{content:"\\e051"}.glyphicon-align-left:before{content:"\\e052"}.glyphicon-align-center:before{content:"\\e053"}.glyphicon-align-right:before{content:"\\e054"}.glyphicon-align-justify:before{content:"\\e055"}.glyphicon-list:before{content:"\\e056"}.glyphicon-indent-left:before{content:"\\e057"}.glyphicon-indent-right:before{content:"\\e058"}.glyphicon-facetime-video:before{content:"\\e059"}.glyphicon-picture:before{content:"\\e060"}.glyphicon-map-marker:before{content:"\\e062"}.glyphicon-adjust:before{content:"\\e063"}.glyphicon-tint:before{content:"\\e064"}.glyphicon-edit:before{content:"\\e065"}.glyphicon-share:before{content:"\\e066"}.glyphicon-check:before{content:"\\e067"}.glyphicon-move:before{content:"\\e068"}.glyphicon-step-backward:before{content:"\\e069"}.glyphicon-fast-backward:before{content:"\\e070"}.glyphicon-backward:before{content:"\\e071"}.glyphicon-play:before{content:"\\e072"}.glyphicon-pause:before{content:"\\e073"}.glyphicon-stop:before{content:"\\e074"}.glyphicon-forward:before{content:"\\e075"}.glyphicon-fast-forward:before{content:"\\e076"}.glyphicon-step-forward:before{content:"\\e077"}.glyphicon-eject:before{content:"\\e078"}.glyphicon-chevron-left:before{content:"\\e079"}.glyphicon-chevron-right:before{content:"\\e080"}.glyphicon-plus-sign:before{content:"\\e081"}.glyphicon-minus-sign:before{content:"\\e082"}.glyphicon-remove-sign:before{content:"\\e083"}.glyphicon-ok-sign:before{content:"\\e084"}.glyphicon-question-sign:before{content:"\\e085"}.glyphicon-info-sign:before{content:"\\e086"}.glyphicon-screenshot:before{content:"\\e087"}.glyphicon-remove-circle:before{content:"\\e088"}.glyphicon-ok-circle:before{content:"\\e089"}.glyphicon-ban-circle:before{content:"\\e090"}.glyphicon-arrow-left:before{content:"\\e091"}.glyphicon-arrow-right:before{content:"\\e092"}.glyphicon-arrow-up:before{content:"\\e093"}.glyphicon-arrow-down:before{content:"\\e094"}.glyphicon-share-alt:before{content:"\\e095"}.glyphicon-resize-full:before{content:"\\e096"}.glyphicon-resize-small:before{content:"\\e097"}.glyphicon-exclamation-sign:before{content:"\\e101"}.glyphicon-gift:before{content:"\\e102"}.glyphicon-leaf:before{content:"\\e103"}.glyphicon-fire:before{content:"\\e104"}.glyphicon-eye-open:before{content:"\\e105"}.glyphicon-eye-close:before{content:"\\e106"}.glyphicon-warning-sign:before{content:"\\e107"}.glyphicon-plane:before{content:"\\e108"}.glyphicon-calendar:before{content:"\\e109"}.glyphicon-random:before{content:"\\e110"}.glyphicon-comment:before{content:"\\e111"}.glyphicon-magnet:before{content:"\\e112"}.glyphicon-chevron-up:before{content:"\\e113"}.glyphicon-chevron-down:before{content:"\\e114"}.glyphicon-retweet:before{content:"\\e115"}.glyphicon-shopping-cart:before{content:"\\e116"}.glyphicon-folder-close:before{content:"\\e117"}.glyphicon-folder-open:before{content:"\\e118"}.glyphicon-resize-vertical:before{content:"\\e119"}.glyphicon-resize-horizontal:before{content:"\\e120"}.glyphicon-hdd:before{content:"\\e121"}.glyphicon-bullhorn:before{content:"\\e122"}.glyphicon-bell:before{content:"\\e123"}.glyphicon-certificate:before{content:"\\e124"}.glyphicon-thumbs-up:before{content:"\\e125"}.glyphicon-thumbs-down:before{content:"\\e126"}.glyphicon-hand-right:before{content:"\\e127"}.glyphicon-hand-left:before{content:"\\e128"}.glyphicon-hand-up:before{content:"\\e129"}.glyphicon-hand-down:before{content:"\\e130"}.glyphicon-circle-arrow-right:before{content:"\\e131"}.glyphicon-circle-arrow-left:before{content:"\\e132"}.glyphicon-circle-arrow-up:before{content:"\\e133"}.glyphicon-circle-arrow-down:before{content:"\\e134"}.glyphicon-globe:before{content:"\\e135"}.glyphicon-wrench:before{content:"\\e136"}.glyphicon-tasks:before{content:"\\e137"}.glyphicon-filter:before{content:"\\e138"}.glyphicon-briefcase:before{content:"\\e139"}.glyphicon-fullscreen:before{content:"\\e140"}.glyphicon-dashboard:before{content:"\\e141"}.glyphicon-paperclip:before{content:"\\e142"}.glyphicon-heart-empty:before{content:"\\e143"}.glyphicon-link:before{content:"\\e144"}.glyphicon-phone:before{content:"\\e145"}.glyphicon-pushpin:before{content:"\\e146"}.glyphicon-usd:before{content:"\\e148"}.glyphicon-gbp:before{content:"\\e149"}.glyphicon-sort:before{content:"\\e150"}.glyphicon-sort-by-alphabet:before{content:"\\e151"}.glyphicon-sort-by-alphabet-alt:before{content:"\\e152"}.glyphicon-sort-by-order:before{content:"\\e153"}.glyphicon-sort-by-order-alt:before{content:"\\e154"}.glyphicon-sort-by-attributes:before{content:"\\e155"}.glyphicon-sort-by-attributes-alt:before{content:"\\e156"}.glyphicon-unchecked:before{content:"\\e157"}.glyphicon-expand:before{content:"\\e158"}.glyphicon-collapse-down:before{content:"\\e159"}.glyphicon-collapse-up:before{content:"\\e160"}.glyphicon-log-in:before{content:"\\e161"}.glyphicon-flash:before{content:"\\e162"}.glyphicon-log-out:before{content:"\\e163"}.glyphicon-new-window:before{content:"\\e164"}.glyphicon-record:before{content:"\\e165"}.glyphicon-save:before{content:"\\e166"}.glyphicon-open:before{content:"\\e167"}.glyphicon-saved:before{content:"\\e168"}.glyphicon-import:before{content:"\\e169"}.glyphicon-export:before{content:"\\e170"}.glyphicon-send:before{content:"\\e171"}.glyphicon-floppy-disk:before{content:"\\e172"}.glyphicon-floppy-saved:before{content:"\\e173"}.glyphicon-floppy-remove:before{content:"\\e174"}.glyphicon-floppy-save:before{content:"\\e175"}.glyphicon-floppy-open:before{content:"\\e176"}.glyphicon-credit-card:before{content:"\\e177"}.glyphicon-transfer:before{content:"\\e178"}.glyphicon-cutlery:before{content:"\\e179"}.glyphicon-header:before{content:"\\e180"}.glyphicon-compressed:before{content:"\\e181"}.glyphicon-earphone:before{content:"\\e182"}.glyphicon-phone-alt:before{content:"\\e183"}.glyphicon-tower:before{content:"\\e184"}.glyphicon-stats:before{content:"\\e185"}.glyphicon-sd-video:before{content:"\\e186"}.glyphicon-hd-video:before{content:"\\e187"}.glyphicon-subtitles:before{content:"\\e188"}.glyphicon-sound-stereo:before{content:"\\e189"}.glyphicon-sound-dolby:before{content:"\\e190"}.glyphicon-sound-5-1:before{content:"\\e191"}.glyphicon-sound-6-1:before{content:"\\e192"}.glyphicon-sound-7-1:before{content:"\\e193"}.glyphicon-copyright-mark:before{content:"\\e194"}.glyphicon-registration-mark:before{content:"\\e195"}.glyphicon-cloud-download:before{content:"\\e197"}.glyphicon-cloud-upload:before{content:"\\e198"}.glyphicon-tree-conifer:before{content:"\\e199"}.glyphicon-tree-deciduous:before{content:"\\e200"}.glyphicon-cd:before{content:"\\e201"}.glyphicon-save-file:before{content:"\\e202"}.glyphicon-open-file:before{content:"\\e203"}.glyphicon-level-up:before{content:"\\e204"}.glyphicon-copy:before{content:"\\e205"}.glyphicon-paste:before{content:"\\e206"}.glyphicon-alert:before{content:"\\e209"}.glyphicon-equalizer:before{content:"\\e210"}.glyphicon-king:before{content:"\\e211"}.glyphicon-queen:before{content:"\\e212"}.glyphicon-pawn:before{content:"\\e213"}.glyphicon-bishop:before{content:"\\e214"}.glyphicon-knight:before{content:"\\e215"}.glyphicon-baby-formula:before{content:"\\e216"}.glyphicon-tent:before{content:"\\26fa"}.glyphicon-blackboard:before{content:"\\e218"}.glyphicon-bed:before{content:"\\e219"}.glyphicon-apple:before{content:"\\f8ff"}.glyphicon-erase:before{content:"\\e221"}.glyphicon-hourglass:before{content:"\\231b"}.glyphicon-lamp:before{content:"\\e223"}.glyphicon-duplicate:before{content:"\\e224"}.glyphicon-piggy-bank:before{content:"\\e225"}.glyphicon-scissors:before{content:"\\e226"}.glyphicon-bitcoin:before{content:"\\e227"}.glyphicon-btc:before{content:"\\e227"}.glyphicon-xbt:before{content:"\\e227"}.glyphicon-yen:before{content:"\\00a5"}.glyphicon-jpy:before{content:"\\00a5"}.glyphicon-ruble:before{content:"\\20bd"}.glyphicon-rub:before{content:"\\20bd"}.glyphicon-scale:before{content:"\\e230"}.glyphicon-ice-lolly:before{content:"\\e231"}.glyphicon-ice-lolly-tasted:before{content:"\\e232"}.glyphicon-education:before{content:"\\e233"}.glyphicon-option-horizontal:before{content:"\\e234"}.glyphicon-option-vertical:before{content:"\\e235"}.glyphicon-menu-hamburger:before{content:"\\e236"}.glyphicon-modal-window:before{content:"\\e237"}.glyphicon-oil:before{content:"\\e238"}.glyphicon-grain:before{content:"\\e239"}.glyphicon-sunglasses:before{content:"\\e240"}.glyphicon-text-size:before{content:"\\e241"}.glyphicon-text-color:before{content:"\\e242"}.glyphicon-text-background:before{content:"\\e243"}.glyphicon-object-align-top:before{content:"\\e244"}.glyphicon-object-align-bottom:before{content:"\\e245"}.glyphicon-object-align-horizontal:before{content:"\\e246"}.glyphicon-object-align-left:before{content:"\\e247"}.glyphicon-object-align-vertical:before{content:"\\e248"}.glyphicon-object-align-right:before{content:"\\e249"}.glyphicon-triangle-right:before{content:"\\e250"}.glyphicon-triangle-left:before{content:"\\e251"}.glyphicon-triangle-bottom:before{content:"\\e252"}.glyphicon-triangle-top:before{content:"\\e253"}.glyphicon-console:before{content:"\\e254"}.glyphicon-superscript:before{content:"\\e255"}.glyphicon-subscript:before{content:"\\e256"}.glyphicon-menu-left:before{content:"\\e257"}.glyphicon-menu-right:before{content:"\\e258"}.glyphicon-menu-down:before{content:"\\e259"}.glyphicon-menu-up:before{content:"\\e260"}*{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}:after,:before{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}html{font-size:10px;-webkit-tap-highlight-color:rgba(0,0,0,0)}body{font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:14px;line-height:1.42857143;color:#333;background-color:#fff}button,input,select,textarea{font-family:inherit;font-size:inherit;line-height:inherit}a{color:#337ab7;text-decoration:none}a:focus,a:hover{color:#23527c;text-decoration:underline}a:focus{outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}figure{margin:0}img{vertical-align:middle}.carousel-inner>.item>a>img,.carousel-inner>.item>img,.img-responsive,.thumbnail a>img,.thumbnail>img{display:block;max-width:100%;height:auto}.img-rounded{border-radius:6px}.img-thumbnail{display:inline-block;max-width:100%;height:auto;padding:4px;line-height:1.42857143;background-color:#fff;border:1px solid #ddd;border-radius:4px;-webkit-transition:all .2s ease-in-out;-o-transition:all .2s ease-in-out;transition:all .2s ease-in-out}.img-circle{border-radius:50%}hr{margin-top:20px;margin-bottom:20px;border:0;border-top:1px solid #eee}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto}[role=button]{cursor:pointer}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{font-family:inherit;font-weight:500;line-height:1.1;color:inherit}.h1 .small,.h1 small,.h2 .small,.h2 small,.h3 .small,.h3 small,.h4 .small,.h4 small,.h5 .small,.h5 small,.h6 .small,.h6 small,h1 .small,h1 small,h2 .small,h2 small,h3 .small,h3 small,h4 .small,h4 small,h5 .small,h5 small,h6 .small,h6 small{font-weight:400;line-height:1;color:#777}.h1,.h2,.h3,h1,h2,h3{margin-top:20px;margin-bottom:10px}.h1 .small,.h1 small,.h2 .small,.h2 small,.h3 .small,.h3 small,h1 .small,h1 small,h2 .small,h2 small,h3 .small,h3 small{font-size:65%}.h4,.h5,.h6,h4,h5,h6{margin-top:10px;margin-bottom:10px}.h4 .small,.h4 small,.h5 .small,.h5 small,.h6 .small,.h6 small,h4 .small,h4 small,h5 .small,h5 small,h6 .small,h6 small{font-size:75%}.h1,h1{font-size:36px}.h2,h2{font-size:30px}.h3,h3{font-size:24px}.h4,h4{font-size:18px}.h5,h5{font-size:14px}.h6,h6{font-size:12px}p{margin:0 0 10px}.lead{margin-bottom:20px;font-size:16px;font-weight:300;line-height:1.4}@media (min-width:768px){.lead{font-size:21px}}.small,small{font-size:85%}.mark,mark{padding:.2em;background-color:#fcf8e3}.text-left{text-align:left}.text-right{text-align:right}.text-center{text-align:center}.text-justify{text-align:justify}.text-nowrap{white-space:nowrap}.text-lowercase{text-transform:lowercase}.text-uppercase{text-transform:uppercase}.text-capitalize{text-transform:capitalize}.text-muted{color:#777}.text-primary{color:#337ab7}a.text-primary:focus,a.text-primary:hover{color:#286090}.text-success{color:#3c763d}a.text-success:focus,a.text-success:hover{color:#2b542c}.text-info{color:#31708f}a.text-info:focus,a.text-info:hover{color:#245269}.text-warning{color:#8a6d3b}a.text-warning:focus,a.text-warning:hover{color:#66512c}.text-danger{color:#a94442}a.text-danger:focus,a.text-danger:hover{color:#843534}.bg-primary{color:#fff;background-color:#337ab7}a.bg-primary:focus,a.bg-primary:hover{background-color:#286090}.bg-success{background-color:#dff0d8}a.bg-success:focus,a.bg-success:hover{background-color:#c1e2b3}.bg-info{background-color:#d9edf7}a.bg-info:focus,a.bg-info:hover{background-color:#afd9ee}.bg-warning{background-color:#fcf8e3}a.bg-warning:focus,a.bg-warning:hover{background-color:#f7ecb5}.bg-danger{background-color:#f2dede}a.bg-danger:focus,a.bg-danger:hover{background-color:#e4b9b9}.page-header{padding-bottom:9px;margin:40px 0 20px;border-bottom:1px solid #eee}ol,ul{margin-top:0;margin-bottom:10px}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;margin-left:-5px;list-style:none}.list-inline>li{display:inline-block;padding-right:5px;padding-left:5px}dl{margin-top:0;margin-bottom:20px}dd,dt{line-height:1.42857143}dt{font-weight:700}dd{margin-left:0}@media (min-width:768px){.dl-horizontal dt{float:left;width:160px;overflow:hidden;clear:left;text-align:right;text-overflow:ellipsis;white-space:nowrap}.dl-horizontal dd{margin-left:180px}}abbr[data-original-title],abbr[title]{cursor:help;border-bottom:1px dotted #777}.initialism{font-size:90%;text-transform:uppercase}blockquote{padding:10px 20px;margin:0 0 20px;font-size:17.5px;border-left:5px solid #eee}blockquote ol:last-child,blockquote p:last-child,blockquote ul:last-child{margin-bottom:0}blockquote .small,blockquote footer,blockquote small{display:block;font-size:80%;line-height:1.42857143;color:#777}blockquote .small:before,blockquote footer:before,blockquote small:before{content:'\\2014 \\00A0'}.blockquote-reverse,blockquote.pull-right{padding-right:15px;padding-left:0;text-align:right;border-right:5px solid #eee;border-left:0}.blockquote-reverse .small:before,.blockquote-reverse footer:before,.blockquote-reverse small:before,blockquote.pull-right .small:before,blockquote.pull-right footer:before,blockquote.pull-right small:before{content:''}.blockquote-reverse .small:after,.blockquote-reverse footer:after,.blockquote-reverse small:after,blockquote.pull-right .small:after,blockquote.pull-right footer:after,blockquote.pull-right small:after{content:'\\00A0 \\2014'}address{margin-bottom:20px;font-style:normal;line-height:1.42857143}code,kbd,pre,samp{font-family:Menlo,Monaco,Consolas,"Courier New",monospace}code{padding:2px 4px;font-size:90%;color:#c7254e;background-color:#f9f2f4;border-radius:4px}kbd{padding:2px 4px;font-size:90%;color:#fff;background-color:#333;border-radius:3px;-webkit-box-shadow:inset 0 -1px 0 rgba(0,0,0,.25);box-shadow:inset 0 -1px 0 rgba(0,0,0,.25)}kbd kbd{padding:0;font-size:100%;font-weight:700;-webkit-box-shadow:none;box-shadow:none}pre{display:block;padding:9.5px;margin:0 0 10px;font-size:13px;line-height:1.42857143;color:#333;word-break:break-all;word-wrap:break-word;background-color:#f5f5f5;border:1px solid #ccc;border-radius:4px}pre code{padding:0;font-size:inherit;color:inherit;white-space:pre-wrap;background-color:transparent;border-radius:0}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width:768px){.container{width:750px}}@media (min-width:992px){.container{width:970px}}@media (min-width:1200px){.container{width:1170px}}.container-fluid{padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}.row{margin-right:-15px;margin-left:-15px}.col-lg-1,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-md-1,.col-md-10,.col-md-11,.col-md-12,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-sm-1,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-xs-1,.col-xs-10,.col-xs-11,.col-xs-12,.col-xs-2,.col-xs-3,.col-xs-4,.col-xs-5,.col-xs-6,.col-xs-7,.col-xs-8,.col-xs-9{position:relative;min-height:1px;padding-right:15px;padding-left:15px}.col-xs-1,.col-xs-10,.col-xs-11,.col-xs-12,.col-xs-2,.col-xs-3,.col-xs-4,.col-xs-5,.col-xs-6,.col-xs-7,.col-xs-8,.col-xs-9{float:left}.col-xs-12{width:100%}.col-xs-11{width:91.66666667%}.col-xs-10{width:83.33333333%}.col-xs-9{width:75%}.col-xs-8{width:66.66666667%}.col-xs-7{width:58.33333333%}.col-xs-6{width:50%}.col-xs-5{width:41.66666667%}.col-xs-4{width:33.33333333%}.col-xs-3{width:25%}.col-xs-2{width:16.66666667%}.col-xs-1{width:8.33333333%}.col-xs-pull-12{right:100%}.col-xs-pull-11{right:91.66666667%}.col-xs-pull-10{right:83.33333333%}.col-xs-pull-9{right:75%}.col-xs-pull-8{right:66.66666667%}.col-xs-pull-7{right:58.33333333%}.col-xs-pull-6{right:50%}.col-xs-pull-5{right:41.66666667%}.col-xs-pull-4{right:33.33333333%}.col-xs-pull-3{right:25%}.col-xs-pull-2{right:16.66666667%}.col-xs-pull-1{right:8.33333333%}.col-xs-pull-0{right:auto}.col-xs-push-12{left:100%}.col-xs-push-11{left:91.66666667%}.col-xs-push-10{left:83.33333333%}.col-xs-push-9{left:75%}.col-xs-push-8{left:66.66666667%}.col-xs-push-7{left:58.33333333%}.col-xs-push-6{left:50%}.col-xs-push-5{left:41.66666667%}.col-xs-push-4{left:33.33333333%}.col-xs-push-3{left:25%}.col-xs-push-2{left:16.66666667%}.col-xs-push-1{left:8.33333333%}.col-xs-push-0{left:auto}.col-xs-offset-12{margin-left:100%}.col-xs-offset-11{margin-left:91.66666667%}.col-xs-offset-10{margin-left:83.33333333%}.col-xs-offset-9{margin-left:75%}.col-xs-offset-8{margin-left:66.66666667%}.col-xs-offset-7{margin-left:58.33333333%}.col-xs-offset-6{margin-left:50%}.col-xs-offset-5{margin-left:41.66666667%}.col-xs-offset-4{margin-left:33.33333333%}.col-xs-offset-3{margin-left:25%}.col-xs-offset-2{margin-left:16.66666667%}.col-xs-offset-1{margin-left:8.33333333%}.col-xs-offset-0{margin-left:0}@media (min-width:768px){.col-sm-1,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9{float:left}.col-sm-12{width:100%}.col-sm-11{width:91.66666667%}.col-sm-10{width:83.33333333%}.col-sm-9{width:75%}.col-sm-8{width:66.66666667%}.col-sm-7{width:58.33333333%}.col-sm-6{width:50%}.col-sm-5{width:41.66666667%}.col-sm-4{width:33.33333333%}.col-sm-3{width:25%}.col-sm-2{width:16.66666667%}.col-sm-1{width:8.33333333%}.col-sm-pull-12{right:100%}.col-sm-pull-11{right:91.66666667%}.col-sm-pull-10{right:83.33333333%}.col-sm-pull-9{right:75%}.col-sm-pull-8{right:66.66666667%}.col-sm-pull-7{right:58.33333333%}.col-sm-pull-6{right:50%}.col-sm-pull-5{right:41.66666667%}.col-sm-pull-4{right:33.33333333%}.col-sm-pull-3{right:25%}.col-sm-pull-2{right:16.66666667%}.col-sm-pull-1{right:8.33333333%}.col-sm-pull-0{right:auto}.col-sm-push-12{left:100%}.col-sm-push-11{left:91.66666667%}.col-sm-push-10{left:83.33333333%}.col-sm-push-9{left:75%}.col-sm-push-8{left:66.66666667%}.col-sm-push-7{left:58.33333333%}.col-sm-push-6{left:50%}.col-sm-push-5{left:41.66666667%}.col-sm-push-4{left:33.33333333%}.col-sm-push-3{left:25%}.col-sm-push-2{left:16.66666667%}.col-sm-push-1{left:8.33333333%}.col-sm-push-0{left:auto}.col-sm-offset-12{margin-left:100%}.col-sm-offset-11{margin-left:91.66666667%}.col-sm-offset-10{margin-left:83.33333333%}.col-sm-offset-9{margin-left:75%}.col-sm-offset-8{margin-left:66.66666667%}.col-sm-offset-7{margin-left:58.33333333%}.col-sm-offset-6{margin-left:50%}.col-sm-offset-5{margin-left:41.66666667%}.col-sm-offset-4{margin-left:33.33333333%}.col-sm-offset-3{margin-left:25%}.col-sm-offset-2{margin-left:16.66666667%}.col-sm-offset-1{margin-left:8.33333333%}.col-sm-offset-0{margin-left:0}}@media (min-width:992px){.col-md-1,.col-md-10,.col-md-11,.col-md-12,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9{float:left}.col-md-12{width:100%}.col-md-11{width:91.66666667%}.col-md-10{width:83.33333333%}.col-md-9{width:75%}.col-md-8{width:66.66666667%}.col-md-7{width:58.33333333%}.col-md-6{width:50%}.col-md-5{width:41.66666667%}.col-md-4{width:33.33333333%}.col-md-3{width:25%}.col-md-2{width:16.66666667%}.col-md-1{width:8.33333333%}.col-md-pull-12{right:100%}.col-md-pull-11{right:91.66666667%}.col-md-pull-10{right:83.33333333%}.col-md-pull-9{right:75%}.col-md-pull-8{right:66.66666667%}.col-md-pull-7{right:58.33333333%}.col-md-pull-6{right:50%}.col-md-pull-5{right:41.66666667%}.col-md-pull-4{right:33.33333333%}.col-md-pull-3{right:25%}.col-md-pull-2{right:16.66666667%}.col-md-pull-1{right:8.33333333%}.col-md-pull-0{right:auto}.col-md-push-12{left:100%}.col-md-push-11{left:91.66666667%}.col-md-push-10{left:83.33333333%}.col-md-push-9{left:75%}.col-md-push-8{left:66.66666667%}.col-md-push-7{left:58.33333333%}.col-md-push-6{left:50%}.col-md-push-5{left:41.66666667%}.col-md-push-4{left:33.33333333%}.col-md-push-3{left:25%}.col-md-push-2{left:16.66666667%}.col-md-push-1{left:8.33333333%}.col-md-push-0{left:auto}.col-md-offset-12{margin-left:100%}.col-md-offset-11{margin-left:91.66666667%}.col-md-offset-10{margin-left:83.33333333%}.col-md-offset-9{margin-left:75%}.col-md-offset-8{margin-left:66.66666667%}.col-md-offset-7{margin-left:58.33333333%}.col-md-offset-6{margin-left:50%}.col-md-offset-5{margin-left:41.66666667%}.col-md-offset-4{margin-left:33.33333333%}.col-md-offset-3{margin-left:25%}.col-md-offset-2{margin-left:16.66666667%}.col-md-offset-1{margin-left:8.33333333%}.col-md-offset-0{margin-left:0}}@media (min-width:1200px){.col-lg-1,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9{float:left}.col-lg-12{width:100%}.col-lg-11{width:91.66666667%}.col-lg-10{width:83.33333333%}.col-lg-9{width:75%}.col-lg-8{width:66.66666667%}.col-lg-7{width:58.33333333%}.col-lg-6{width:50%}.col-lg-5{width:41.66666667%}.col-lg-4{width:33.33333333%}.col-lg-3{width:25%}.col-lg-2{width:16.66666667%}.col-lg-1{width:8.33333333%}.col-lg-pull-12{right:100%}.col-lg-pull-11{right:91.66666667%}.col-lg-pull-10{right:83.33333333%}.col-lg-pull-9{right:75%}.col-lg-pull-8{right:66.66666667%}.col-lg-pull-7{right:58.33333333%}.col-lg-pull-6{right:50%}.col-lg-pull-5{right:41.66666667%}.col-lg-pull-4{right:33.33333333%}.col-lg-pull-3{right:25%}.col-lg-pull-2{right:16.66666667%}.col-lg-pull-1{right:8.33333333%}.col-lg-pull-0{right:auto}.col-lg-push-12{left:100%}.col-lg-push-11{left:91.66666667%}.col-lg-push-10{left:83.33333333%}.col-lg-push-9{left:75%}.col-lg-push-8{left:66.66666667%}.col-lg-push-7{left:58.33333333%}.col-lg-push-6{left:50%}.col-lg-push-5{left:41.66666667%}.col-lg-push-4{left:33.33333333%}.col-lg-push-3{left:25%}.col-lg-push-2{left:16.66666667%}.col-lg-push-1{left:8.33333333%}.col-lg-push-0{left:auto}.col-lg-offset-12{margin-left:100%}.col-lg-offset-11{margin-left:91.66666667%}.col-lg-offset-10{margin-left:83.33333333%}.col-lg-offset-9{margin-left:75%}.col-lg-offset-8{margin-left:66.66666667%}.col-lg-offset-7{margin-left:58.33333333%}.col-lg-offset-6{margin-left:50%}.col-lg-offset-5{margin-left:41.66666667%}.col-lg-offset-4{margin-left:33.33333333%}.col-lg-offset-3{margin-left:25%}.col-lg-offset-2{margin-left:16.66666667%}.col-lg-offset-1{margin-left:8.33333333%}.col-lg-offset-0{margin-left:0}}table{background-color:transparent}caption{padding-top:8px;padding-bottom:8px;color:#777;text-align:left}th{text-align:left}.table{width:100%;max-width:100%;margin-bottom:20px}.table>tbody>tr>td,.table>tbody>tr>th,.table>tfoot>tr>td,.table>tfoot>tr>th,.table>thead>tr>td,.table>thead>tr>th{padding:8px;line-height:1.42857143;vertical-align:top;border-top:1px solid #ddd}.table>thead>tr>th{vertical-align:bottom;border-bottom:2px solid #ddd}.table>caption+thead>tr:first-child>td,.table>caption+thead>tr:first-child>th,.table>colgroup+thead>tr:first-child>td,.table>colgroup+thead>tr:first-child>th,.table>thead:first-child>tr:first-child>td,.table>thead:first-child>tr:first-child>th{border-top:0}.table>tbody+tbody{border-top:2px solid #ddd}.table .table{background-color:#fff}.table-condensed>tbody>tr>td,.table-condensed>tbody>tr>th,.table-condensed>tfoot>tr>td,.table-condensed>tfoot>tr>th,.table-condensed>thead>tr>td,.table-condensed>thead>tr>th{padding:5px}.table-bordered{border:1px solid #ddd}.table-bordered>tbody>tr>td,.table-bordered>tbody>tr>th,.table-bordered>tfoot>tr>td,.table-bordered>tfoot>tr>th,.table-bordered>thead>tr>td,.table-bordered>thead>tr>th{border:1px solid #ddd}.table-bordered>thead>tr>td,.table-bordered>thead>tr>th{border-bottom-width:2px}.table-striped>tbody>tr:nth-of-type(odd){background-color:#f9f9f9}.table-hover>tbody>tr:hover{background-color:#f5f5f5}table col[class*=col-]{position:static;display:table-column;float:none}table td[class*=col-],table th[class*=col-]{position:static;display:table-cell;float:none}.table>tbody>tr.active>td,.table>tbody>tr.active>th,.table>tbody>tr>td.active,.table>tbody>tr>th.active,.table>tfoot>tr.active>td,.table>tfoot>tr.active>th,.table>tfoot>tr>td.active,.table>tfoot>tr>th.active,.table>thead>tr.active>td,.table>thead>tr.active>th,.table>thead>tr>td.active,.table>thead>tr>th.active{background-color:#f5f5f5}.table-hover>tbody>tr.active:hover>td,.table-hover>tbody>tr.active:hover>th,.table-hover>tbody>tr:hover>.active,.table-hover>tbody>tr>td.active:hover,.table-hover>tbody>tr>th.active:hover{background-color:#e8e8e8}.table>tbody>tr.success>td,.table>tbody>tr.success>th,.table>tbody>tr>td.success,.table>tbody>tr>th.success,.table>tfoot>tr.success>td,.table>tfoot>tr.success>th,.table>tfoot>tr>td.success,.table>tfoot>tr>th.success,.table>thead>tr.success>td,.table>thead>tr.success>th,.table>thead>tr>td.success,.table>thead>tr>th.success{background-color:#dff0d8}.table-hover>tbody>tr.success:hover>td,.table-hover>tbody>tr.success:hover>th,.table-hover>tbody>tr:hover>.success,.table-hover>tbody>tr>td.success:hover,.table-hover>tbody>tr>th.success:hover{background-color:#d0e9c6}.table>tbody>tr.info>td,.table>tbody>tr.info>th,.table>tbody>tr>td.info,.table>tbody>tr>th.info,.table>tfoot>tr.info>td,.table>tfoot>tr.info>th,.table>tfoot>tr>td.info,.table>tfoot>tr>th.info,.table>thead>tr.info>td,.table>thead>tr.info>th,.table>thead>tr>td.info,.table>thead>tr>th.info{background-color:#d9edf7}.table-hover>tbody>tr.info:hover>td,.table-hover>tbody>tr.info:hover>th,.table-hover>tbody>tr:hover>.info,.table-hover>tbody>tr>td.info:hover,.table-hover>tbody>tr>th.info:hover{background-color:#c4e3f3}.table>tbody>tr.warning>td,.table>tbody>tr.warning>th,.table>tbody>tr>td.warning,.table>tbody>tr>th.warning,.table>tfoot>tr.warning>td,.table>tfoot>tr.warning>th,.table>tfoot>tr>td.warning,.table>tfoot>tr>th.warning,.table>thead>tr.warning>td,.table>thead>tr.warning>th,.table>thead>tr>td.warning,.table>thead>tr>th.warning{background-color:#fcf8e3}.table-hover>tbody>tr.warning:hover>td,.table-hover>tbody>tr.warning:hover>th,.table-hover>tbody>tr:hover>.warning,.table-hover>tbody>tr>td.warning:hover,.table-hover>tbody>tr>th.warning:hover{background-color:#faf2cc}.table>tbody>tr.danger>td,.table>tbody>tr.danger>th,.table>tbody>tr>td.danger,.table>tbody>tr>th.danger,.table>tfoot>tr.danger>td,.table>tfoot>tr.danger>th,.table>tfoot>tr>td.danger,.table>tfoot>tr>th.danger,.table>thead>tr.danger>td,.table>thead>tr.danger>th,.table>thead>tr>td.danger,.table>thead>tr>th.danger{background-color:#f2dede}.table-hover>tbody>tr.danger:hover>td,.table-hover>tbody>tr.danger:hover>th,.table-hover>tbody>tr:hover>.danger,.table-hover>tbody>tr>td.danger:hover,.table-hover>tbody>tr>th.danger:hover{background-color:#ebcccc}.table-responsive{min-height:.01%;overflow-x:auto}@media screen and (max-width:767px){.table-responsive{width:100%;margin-bottom:15px;overflow-y:hidden;-ms-overflow-style:-ms-autohiding-scrollbar;border:1px solid #ddd}.table-responsive>.table{margin-bottom:0}.table-responsive>.table>tbody>tr>td,.table-responsive>.table>tbody>tr>th,.table-responsive>.table>tfoot>tr>td,.table-responsive>.table>tfoot>tr>th,.table-responsive>.table>thead>tr>td,.table-responsive>.table>thead>tr>th{white-space:nowrap}.table-responsive>.table-bordered{border:0}.table-responsive>.table-bordered>tbody>tr>td:first-child,.table-responsive>.table-bordered>tbody>tr>th:first-child,.table-responsive>.table-bordered>tfoot>tr>td:first-child,.table-responsive>.table-bordered>tfoot>tr>th:first-child,.table-responsive>.table-bordered>thead>tr>td:first-child,.table-responsive>.table-bordered>thead>tr>th:first-child{border-left:0}.table-responsive>.table-bordered>tbody>tr>td:last-child,.table-responsive>.table-bordered>tbody>tr>th:last-child,.table-responsive>.table-bordered>tfoot>tr>td:last-child,.table-responsive>.table-bordered>tfoot>tr>th:last-child,.table-responsive>.table-bordered>thead>tr>td:last-child,.table-responsive>.table-bordered>thead>tr>th:last-child{border-right:0}.table-responsive>.table-bordered>tbody>tr:last-child>td,.table-responsive>.table-bordered>tbody>tr:last-child>th,.table-responsive>.table-bordered>tfoot>tr:last-child>td,.table-responsive>.table-bordered>tfoot>tr:last-child>th{border-bottom:0}}fieldset{min-width:0;padding:0;margin:0;border:0}legend{display:block;width:100%;padding:0;margin-bottom:20px;font-size:21px;line-height:inherit;color:#333;border:0;border-bottom:1px solid #e5e5e5}label{display:inline-block;max-width:100%;margin-bottom:5px;font-weight:700}input[type=search]{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}input[type=checkbox],input[type=radio]{margin:4px 0 0;margin-top:1px\\9;line-height:normal}input[type=file]{display:block}input[type=range]{display:block;width:100%}select[multiple],select[size]{height:auto}input[type=file]:focus,input[type=checkbox]:focus,input[type=radio]:focus{outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}output{display:block;padding-top:7px;font-size:14px;line-height:1.42857143;color:#555}.form-control{display:block;width:100%;height:34px;padding:6px 12px;font-size:14px;line-height:1.42857143;color:#555;background-color:#fff;background-image:none;border:1px solid #ccc;border-radius:4px;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 1px rgba(0,0,0,.075);-webkit-transition:border-color ease-in-out .15s,-webkit-box-shadow ease-in-out .15s;-o-transition:border-color ease-in-out .15s,box-shadow ease-in-out .15s;transition:border-color ease-in-out .15s,box-shadow ease-in-out .15s}.form-control:focus{border-color:#66afe9;outline:0;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 8px rgba(102,175,233,.6);box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 8px rgba(102,175,233,.6)}.form-control::-moz-placeholder{color:#999;opacity:1}.form-control:-ms-input-placeholder{color:#999}.form-control::-webkit-input-placeholder{color:#999}.form-control::-ms-expand{background-color:transparent;border:0}.form-control[disabled],.form-control[readonly],fieldset[disabled] .form-control{background-color:#eee;opacity:1}.form-control[disabled],fieldset[disabled] .form-control{cursor:not-allowed}textarea.form-control{height:auto}input[type=search]{-webkit-appearance:none}@media screen and (-webkit-min-device-pixel-ratio:0){input[type=date].form-control,input[type=time].form-control,input[type=datetime-local].form-control,input[type=month].form-control{line-height:34px}.input-group-sm input[type=date],.input-group-sm input[type=time],.input-group-sm input[type=datetime-local],.input-group-sm input[type=month],input[type=date].input-sm,input[type=time].input-sm,input[type=datetime-local].input-sm,input[type=month].input-sm{line-height:30px}.input-group-lg input[type=date],.input-group-lg input[type=time],.input-group-lg input[type=datetime-local],.input-group-lg input[type=month],input[type=date].input-lg,input[type=time].input-lg,input[type=datetime-local].input-lg,input[type=month].input-lg{line-height:46px}}.form-group{margin-bottom:15px}.checkbox,.radio{position:relative;display:block;margin-top:10px;margin-bottom:10px}.checkbox label,.radio label{min-height:20px;padding-left:20px;margin-bottom:0;font-weight:400;cursor:pointer}.checkbox input[type=checkbox],.checkbox-inline input[type=checkbox],.radio input[type=radio],.radio-inline input[type=radio]{position:absolute;margin-top:4px\\9;margin-left:-20px}.checkbox+.checkbox,.radio+.radio{margin-top:-5px}.checkbox-inline,.radio-inline{position:relative;display:inline-block;padding-left:20px;margin-bottom:0;font-weight:400;vertical-align:middle;cursor:pointer}.checkbox-inline+.checkbox-inline,.radio-inline+.radio-inline{margin-top:0;margin-left:10px}fieldset[disabled] input[type=checkbox],fieldset[disabled] input[type=radio],input[type=checkbox].disabled,input[type=checkbox][disabled],input[type=radio].disabled,input[type=radio][disabled]{cursor:not-allowed}.checkbox-inline.disabled,.radio-inline.disabled,fieldset[disabled] .checkbox-inline,fieldset[disabled] .radio-inline{cursor:not-allowed}.checkbox.disabled label,.radio.disabled label,fieldset[disabled] .checkbox label,fieldset[disabled] .radio label{cursor:not-allowed}.form-control-static{min-height:34px;padding-top:7px;padding-bottom:7px;margin-bottom:0}.form-control-static.input-lg,.form-control-static.input-sm{padding-right:0;padding-left:0}.input-sm{height:30px;padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}select.input-sm{height:30px;line-height:30px}select[multiple].input-sm,textarea.input-sm{height:auto}.form-group-sm .form-control{height:30px;padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}.form-group-sm select.form-control{height:30px;line-height:30px}.form-group-sm select[multiple].form-control,.form-group-sm textarea.form-control{height:auto}.form-group-sm .form-control-static{height:30px;min-height:32px;padding:6px 10px;font-size:12px;line-height:1.5}.input-lg{height:46px;padding:10px 16px;font-size:18px;line-height:1.3333333;border-radius:6px}select.input-lg{height:46px;line-height:46px}select[multiple].input-lg,textarea.input-lg{height:auto}.form-group-lg .form-control{height:46px;padding:10px 16px;font-size:18px;line-height:1.3333333;border-radius:6px}.form-group-lg select.form-control{height:46px;line-height:46px}.form-group-lg select[multiple].form-control,.form-group-lg textarea.form-control{height:auto}.form-group-lg .form-control-static{height:46px;min-height:38px;padding:11px 16px;font-size:18px;line-height:1.3333333}.has-feedback{position:relative}.has-feedback .form-control{padding-right:42.5px}.form-control-feedback{position:absolute;top:0;right:0;z-index:2;display:block;width:34px;height:34px;line-height:34px;text-align:center;pointer-events:none}.form-group-lg .form-control+.form-control-feedback,.input-group-lg+.form-control-feedback,.input-lg+.form-control-feedback{width:46px;height:46px;line-height:46px}.form-group-sm .form-control+.form-control-feedback,.input-group-sm+.form-control-feedback,.input-sm+.form-control-feedback{width:30px;height:30px;line-height:30px}.has-success .checkbox,.has-success .checkbox-inline,.has-success .control-label,.has-success .help-block,.has-success .radio,.has-success .radio-inline,.has-success.checkbox label,.has-success.checkbox-inline label,.has-success.radio label,.has-success.radio-inline label{color:#3c763d}.has-success .form-control{border-color:#3c763d;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 1px rgba(0,0,0,.075)}.has-success .form-control:focus{border-color:#2b542c;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #67b168;box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #67b168}.has-success .input-group-addon{color:#3c763d;background-color:#dff0d8;border-color:#3c763d}.has-success .form-control-feedback{color:#3c763d}.has-warning .checkbox,.has-warning .checkbox-inline,.has-warning .control-label,.has-warning .help-block,.has-warning .radio,.has-warning .radio-inline,.has-warning.checkbox label,.has-warning.checkbox-inline label,.has-warning.radio label,.has-warning.radio-inline label{color:#8a6d3b}.has-warning .form-control{border-color:#8a6d3b;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 1px rgba(0,0,0,.075)}.has-warning .form-control:focus{border-color:#66512c;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #c0a16b;box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #c0a16b}.has-warning .input-group-addon{color:#8a6d3b;background-color:#fcf8e3;border-color:#8a6d3b}.has-warning .form-control-feedback{color:#8a6d3b}.has-error .checkbox,.has-error .checkbox-inline,.has-error .control-label,.has-error .help-block,.has-error .radio,.has-error .radio-inline,.has-error.checkbox label,.has-error.checkbox-inline label,.has-error.radio label,.has-error.radio-inline label{color:#a94442}.has-error .form-control{border-color:#a94442;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 1px rgba(0,0,0,.075)}.has-error .form-control:focus{border-color:#843534;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #ce8483;box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #ce8483}.has-error .input-group-addon{color:#a94442;background-color:#f2dede;border-color:#a94442}.has-error .form-control-feedback{color:#a94442}.has-feedback label~.form-control-feedback{top:25px}.has-feedback label.sr-only~.form-control-feedback{top:0}.help-block{display:block;margin-top:5px;margin-bottom:10px;color:#737373}@media (min-width:768px){.form-inline .form-group{display:inline-block;margin-bottom:0;vertical-align:middle}.form-inline .form-control{display:inline-block;width:auto;vertical-align:middle}.form-inline .form-control-static{display:inline-block}.form-inline .input-group{display:inline-table;vertical-align:middle}.form-inline .input-group .form-control,.form-inline .input-group .input-group-addon,.form-inline .input-group .input-group-btn{width:auto}.form-inline .input-group>.form-control{width:100%}.form-inline .control-label{margin-bottom:0;vertical-align:middle}.form-inline .checkbox,.form-inline .radio{display:inline-block;margin-top:0;margin-bottom:0;vertical-align:middle}.form-inline .checkbox label,.form-inline .radio label{padding-left:0}.form-inline .checkbox input[type=checkbox],.form-inline .radio input[type=radio]{position:relative;margin-left:0}.form-inline .has-feedback .form-control-feedback{top:0}}.form-horizontal .checkbox,.form-horizontal .checkbox-inline,.form-horizontal .radio,.form-horizontal .radio-inline{padding-top:7px;margin-top:0;margin-bottom:0}.form-horizontal .checkbox,.form-horizontal .radio{min-height:27px}.form-horizontal .form-group{margin-right:-15px;margin-left:-15px}@media (min-width:768px){.form-horizontal .control-label{padding-top:7px;margin-bottom:0;text-align:right}}.form-horizontal .has-feedback .form-control-feedback{right:15px}@media (min-width:768px){.form-horizontal .form-group-lg .control-label{padding-top:11px;font-size:18px}}@media (min-width:768px){.form-horizontal .form-group-sm .control-label{padding-top:6px;font-size:12px}}.btn{display:inline-block;padding:6px 12px;margin-bottom:0;font-size:14px;font-weight:400;line-height:1.42857143;text-align:center;white-space:nowrap;vertical-align:middle;-ms-touch-action:manipulation;touch-action:manipulation;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;background-image:none;border:1px solid transparent;border-radius:4px}.btn.active.focus,.btn.active:focus,.btn.focus,.btn:active.focus,.btn:active:focus,.btn:focus{outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}.btn.focus,.btn:focus,.btn:hover{color:#333;text-decoration:none}.btn.active,.btn:active{background-image:none;outline:0;-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125);box-shadow:inset 0 3px 5px rgba(0,0,0,.125)}.btn.disabled,.btn[disabled],fieldset[disabled] .btn{cursor:not-allowed;filter:alpha(opacity=65);-webkit-box-shadow:none;box-shadow:none;opacity:.65}a.btn.disabled,fieldset[disabled] a.btn{pointer-events:none}.btn-default{color:#333;background-color:#fff;border-color:#ccc}.btn-default.focus,.btn-default:focus{color:#333;background-color:#e6e6e6;border-color:#8c8c8c}.btn-default:hover{color:#333;background-color:#e6e6e6;border-color:#adadad}.btn-default.active,.btn-default:active,.open>.dropdown-toggle.btn-default{color:#333;background-color:#e6e6e6;border-color:#adadad}.btn-default.active.focus,.btn-default.active:focus,.btn-default.active:hover,.btn-default:active.focus,.btn-default:active:focus,.btn-default:active:hover,.open>.dropdown-toggle.btn-default.focus,.open>.dropdown-toggle.btn-default:focus,.open>.dropdown-toggle.btn-default:hover{color:#333;background-color:#d4d4d4;border-color:#8c8c8c}.btn-default.active,.btn-default:active,.open>.dropdown-toggle.btn-default{background-image:none}.btn-default.disabled.focus,.btn-default.disabled:focus,.btn-default.disabled:hover,.btn-default[disabled].focus,.btn-default[disabled]:focus,.btn-default[disabled]:hover,fieldset[disabled] .btn-default.focus,fieldset[disabled] .btn-default:focus,fieldset[disabled] .btn-default:hover{background-color:#fff;border-color:#ccc}.btn-default .badge{color:#fff;background-color:#333}.btn-primary{color:#fff;background-color:#337ab7;border-color:#2e6da4}.btn-primary.focus,.btn-primary:focus{color:#fff;background-color:#286090;border-color:#122b40}.btn-primary:hover{color:#fff;background-color:#286090;border-color:#204d74}.btn-primary.active,.btn-primary:active,.open>.dropdown-toggle.btn-primary{color:#fff;background-color:#286090;border-color:#204d74}.btn-primary.active.focus,.btn-primary.active:focus,.btn-primary.active:hover,.btn-primary:active.focus,.btn-primary:active:focus,.btn-primary:active:hover,.open>.dropdown-toggle.btn-primary.focus,.open>.dropdown-toggle.btn-primary:focus,.open>.dropdown-toggle.btn-primary:hover{color:#fff;background-color:#204d74;border-color:#122b40}.btn-primary.active,.btn-primary:active,.open>.dropdown-toggle.btn-primary{background-image:none}.btn-primary.disabled.focus,.btn-primary.disabled:focus,.btn-primary.disabled:hover,.btn-primary[disabled].focus,.btn-primary[disabled]:focus,.btn-primary[disabled]:hover,fieldset[disabled] .btn-primary.focus,fieldset[disabled] .btn-primary:focus,fieldset[disabled] .btn-primary:hover{background-color:#337ab7;border-color:#2e6da4}.btn-primary .badge{color:#337ab7;background-color:#fff}.btn-success{color:#fff;background-color:#5cb85c;border-color:#4cae4c}.btn-success.focus,.btn-success:focus{color:#fff;background-color:#449d44;border-color:#255625}.btn-success:hover{color:#fff;background-color:#449d44;border-color:#398439}.btn-success.active,.btn-success:active,.open>.dropdown-toggle.btn-success{color:#fff;background-color:#449d44;border-color:#398439}.btn-success.active.focus,.btn-success.active:focus,.btn-success.active:hover,.btn-success:active.focus,.btn-success:active:focus,.btn-success:active:hover,.open>.dropdown-toggle.btn-success.focus,.open>.dropdown-toggle.btn-success:focus,.open>.dropdown-toggle.btn-success:hover{color:#fff;background-color:#398439;border-color:#255625}.btn-success.active,.btn-success:active,.open>.dropdown-toggle.btn-success{background-image:none}.btn-success.disabled.focus,.btn-success.disabled:focus,.btn-success.disabled:hover,.btn-success[disabled].focus,.btn-success[disabled]:focus,.btn-success[disabled]:hover,fieldset[disabled] .btn-success.focus,fieldset[disabled] .btn-success:focus,fieldset[disabled] .btn-success:hover{background-color:#5cb85c;border-color:#4cae4c}.btn-success .badge{color:#5cb85c;background-color:#fff}.btn-info{color:#fff;background-color:#5bc0de;border-color:#46b8da}.btn-info.focus,.btn-info:focus{color:#fff;background-color:#31b0d5;border-color:#1b6d85}.btn-info:hover{color:#fff;background-color:#31b0d5;border-color:#269abc}.btn-info.active,.btn-info:active,.open>.dropdown-toggle.btn-info{color:#fff;background-color:#31b0d5;border-color:#269abc}.btn-info.active.focus,.btn-info.active:focus,.btn-info.active:hover,.btn-info:active.focus,.btn-info:active:focus,.btn-info:active:hover,.open>.dropdown-toggle.btn-info.focus,.open>.dropdown-toggle.btn-info:focus,.open>.dropdown-toggle.btn-info:hover{color:#fff;background-color:#269abc;border-color:#1b6d85}.btn-info.active,.btn-info:active,.open>.dropdown-toggle.btn-info{background-image:none}.btn-info.disabled.focus,.btn-info.disabled:focus,.btn-info.disabled:hover,.btn-info[disabled].focus,.btn-info[disabled]:focus,.btn-info[disabled]:hover,fieldset[disabled] .btn-info.focus,fieldset[disabled] .btn-info:focus,fieldset[disabled] .btn-info:hover{background-color:#5bc0de;border-color:#46b8da}.btn-info .badge{color:#5bc0de;background-color:#fff}.btn-warning{color:#fff;background-color:#f0ad4e;border-color:#eea236}.btn-warning.focus,.btn-warning:focus{color:#fff;background-color:#ec971f;border-color:#985f0d}.btn-warning:hover{color:#fff;background-color:#ec971f;border-color:#d58512}.btn-warning.active,.btn-warning:active,.open>.dropdown-toggle.btn-warning{color:#fff;background-color:#ec971f;border-color:#d58512}.btn-warning.active.focus,.btn-warning.active:focus,.btn-warning.active:hover,.btn-warning:active.focus,.btn-warning:active:focus,.btn-warning:active:hover,.open>.dropdown-toggle.btn-warning.focus,.open>.dropdown-toggle.btn-warning:focus,.open>.dropdown-toggle.btn-warning:hover{color:#fff;background-color:#d58512;border-color:#985f0d}.btn-warning.active,.btn-warning:active,.open>.dropdown-toggle.btn-warning{background-image:none}.btn-warning.disabled.focus,.btn-warning.disabled:focus,.btn-warning.disabled:hover,.btn-warning[disabled].focus,.btn-warning[disabled]:focus,.btn-warning[disabled]:hover,fieldset[disabled] .btn-warning.focus,fieldset[disabled] .btn-warning:focus,fieldset[disabled] .btn-warning:hover{background-color:#f0ad4e;border-color:#eea236}.btn-warning .badge{color:#f0ad4e;background-color:#fff}.btn-danger{color:#fff;background-color:#d9534f;border-color:#d43f3a}.btn-danger.focus,.btn-danger:focus{color:#fff;background-color:#c9302c;border-color:#761c19}.btn-danger:hover{color:#fff;background-color:#c9302c;border-color:#ac2925}.btn-danger.active,.btn-danger:active,.open>.dropdown-toggle.btn-danger{color:#fff;background-color:#c9302c;border-color:#ac2925}.btn-danger.active.focus,.btn-danger.active:focus,.btn-danger.active:hover,.btn-danger:active.focus,.btn-danger:active:focus,.btn-danger:active:hover,.open>.dropdown-toggle.btn-danger.focus,.open>.dropdown-toggle.btn-danger:focus,.open>.dropdown-toggle.btn-danger:hover{color:#fff;background-color:#ac2925;border-color:#761c19}.btn-danger.active,.btn-danger:active,.open>.dropdown-toggle.btn-danger{background-image:none}.btn-danger.disabled.focus,.btn-danger.disabled:focus,.btn-danger.disabled:hover,.btn-danger[disabled].focus,.btn-danger[disabled]:focus,.btn-danger[disabled]:hover,fieldset[disabled] .btn-danger.focus,fieldset[disabled] .btn-danger:focus,fieldset[disabled] .btn-danger:hover{background-color:#d9534f;border-color:#d43f3a}.btn-danger .badge{color:#d9534f;background-color:#fff}.btn-link{font-weight:400;color:#337ab7;border-radius:0}.btn-link,.btn-link.active,.btn-link:active,.btn-link[disabled],fieldset[disabled] .btn-link{background-color:transparent;-webkit-box-shadow:none;box-shadow:none}.btn-link,.btn-link:active,.btn-link:focus,.btn-link:hover{border-color:transparent}.btn-link:focus,.btn-link:hover{color:#23527c;text-decoration:underline;background-color:transparent}.btn-link[disabled]:focus,.btn-link[disabled]:hover,fieldset[disabled] .btn-link:focus,fieldset[disabled] .btn-link:hover{color:#777;text-decoration:none}.btn-group-lg>.btn,.btn-lg{padding:10px 16px;font-size:18px;line-height:1.3333333;border-radius:6px}.btn-group-sm>.btn,.btn-sm{padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}.btn-group-xs>.btn,.btn-xs{padding:1px 5px;font-size:12px;line-height:1.5;border-radius:3px}.btn-block{display:block;width:100%}.btn-block+.btn-block{margin-top:5px}input[type=button].btn-block,input[type=reset].btn-block,input[type=submit].btn-block{width:100%}.fade{opacity:0;-webkit-transition:opacity .15s linear;-o-transition:opacity .15s linear;transition:opacity .15s linear}.fade.in{opacity:1}.collapse{display:none}.collapse.in{display:block}tr.collapse.in{display:table-row}tbody.collapse.in{display:table-row-group}.collapsing{position:relative;height:0;overflow:hidden;-webkit-transition-timing-function:ease;-o-transition-timing-function:ease;transition-timing-function:ease;-webkit-transition-duration:.35s;-o-transition-duration:.35s;transition-duration:.35s;-webkit-transition-property:height,visibility;-o-transition-property:height,visibility;transition-property:height,visibility}.caret{display:inline-block;width:0;height:0;margin-left:2px;vertical-align:middle;border-top:4px dashed;border-top:4px solid\\9;border-right:4px solid transparent;border-left:4px solid transparent}.dropdown,.dropup{position:relative}.dropdown-toggle:focus{outline:0}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:160px;padding:5px 0;margin:2px 0 0;font-size:14px;text-align:left;list-style:none;background-color:#fff;-webkit-background-clip:padding-box;background-clip:padding-box;border:1px solid #ccc;border:1px solid rgba(0,0,0,.15);border-radius:4px;-webkit-box-shadow:0 6px 12px rgba(0,0,0,.175);box-shadow:0 6px 12px rgba(0,0,0,.175)}.dropdown-menu.pull-right{right:0;left:auto}.dropdown-menu .divider{height:1px;margin:9px 0;overflow:hidden;background-color:#e5e5e5}.dropdown-menu>li>a{display:block;padding:3px 20px;clear:both;font-weight:400;line-height:1.42857143;color:#333;white-space:nowrap}.dropdown-menu>li>a:focus,.dropdown-menu>li>a:hover{color:#262626;text-decoration:none;background-color:#f5f5f5}.dropdown-menu>.active>a,.dropdown-menu>.active>a:focus,.dropdown-menu>.active>a:hover{color:#fff;text-decoration:none;background-color:#337ab7;outline:0}.dropdown-menu>.disabled>a,.dropdown-menu>.disabled>a:focus,.dropdown-menu>.disabled>a:hover{color:#777}.dropdown-menu>.disabled>a:focus,.dropdown-menu>.disabled>a:hover{text-decoration:none;cursor:not-allowed;background-color:transparent;background-image:none;filter:progid:DXImageTransform.Microsoft.gradient(enabled=false)}.open>.dropdown-menu{display:block}.open>a{outline:0}.dropdown-menu-right{right:0;left:auto}.dropdown-menu-left{right:auto;left:0}.dropdown-header{display:block;padding:3px 20px;font-size:12px;line-height:1.42857143;color:#777;white-space:nowrap}.dropdown-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:990}.pull-right>.dropdown-menu{right:0;left:auto}.dropup .caret,.navbar-fixed-bottom .dropdown .caret{content:"";border-top:0;border-bottom:4px dashed;border-bottom:4px solid\\9}.dropup .dropdown-menu,.navbar-fixed-bottom .dropdown .dropdown-menu{top:auto;bottom:100%;margin-bottom:2px}@media (min-width:768px){.navbar-right .dropdown-menu{right:0;left:auto}.navbar-right .dropdown-menu-left{right:auto;left:0}}.btn-group,.btn-group-vertical{position:relative;display:inline-block;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;float:left}.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:2}.btn-group .btn+.btn,.btn-group .btn+.btn-group,.btn-group .btn-group+.btn,.btn-group .btn-group+.btn-group{margin-left:-1px}.btn-toolbar{margin-left:-5px}.btn-toolbar .btn,.btn-toolbar .btn-group,.btn-toolbar .input-group{float:left}.btn-toolbar>.btn,.btn-toolbar>.btn-group,.btn-toolbar>.input-group{margin-left:5px}.btn-group>.btn:not(:first-child):not(:last-child):not(.dropdown-toggle){border-radius:0}.btn-group>.btn:first-child{margin-left:0}.btn-group>.btn:first-child:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn:last-child:not(:first-child),.btn-group>.dropdown-toggle:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.btn-group>.btn-group{float:left}.btn-group>.btn-group:not(:first-child):not(:last-child)>.btn{border-radius:0}.btn-group>.btn-group:first-child:not(:last-child)>.btn:last-child,.btn-group>.btn-group:first-child:not(:last-child)>.dropdown-toggle{border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:last-child:not(:first-child)>.btn:first-child{border-top-left-radius:0;border-bottom-left-radius:0}.btn-group .dropdown-toggle:active,.btn-group.open .dropdown-toggle{outline:0}.btn-group>.btn+.dropdown-toggle{padding-right:8px;padding-left:8px}.btn-group>.btn-lg+.dropdown-toggle{padding-right:12px;padding-left:12px}.btn-group.open .dropdown-toggle{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125);box-shadow:inset 0 3px 5px rgba(0,0,0,.125)}.btn-group.open .dropdown-toggle.btn-link{-webkit-box-shadow:none;box-shadow:none}.btn .caret{margin-left:0}.btn-lg .caret{border-width:5px 5px 0;border-bottom-width:0}.dropup .btn-lg .caret{border-width:0 5px 5px}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group,.btn-group-vertical>.btn-group>.btn{display:block;float:none;width:100%;max-width:100%}.btn-group-vertical>.btn-group>.btn{float:none}.btn-group-vertical>.btn+.btn,.btn-group-vertical>.btn+.btn-group,.btn-group-vertical>.btn-group+.btn,.btn-group-vertical>.btn-group+.btn-group{margin-top:-1px;margin-left:0}.btn-group-vertical>.btn:not(:first-child):not(:last-child){border-radius:0}.btn-group-vertical>.btn:first-child:not(:last-child){border-top-left-radius:4px;border-top-right-radius:4px;border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn:last-child:not(:first-child){border-top-left-radius:0;border-top-right-radius:0;border-bottom-right-radius:4px;border-bottom-left-radius:4px}.btn-group-vertical>.btn-group:not(:first-child):not(:last-child)>.btn{border-radius:0}.btn-group-vertical>.btn-group:first-child:not(:last-child)>.btn:last-child,.btn-group-vertical>.btn-group:first-child:not(:last-child)>.dropdown-toggle{border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:last-child:not(:first-child)>.btn:first-child{border-top-left-radius:0;border-top-right-radius:0}.btn-group-justified{display:table;width:100%;table-layout:fixed;border-collapse:separate}.btn-group-justified>.btn,.btn-group-justified>.btn-group{display:table-cell;float:none;width:1%}.btn-group-justified>.btn-group .btn{width:100%}.btn-group-justified>.btn-group .dropdown-menu{left:auto}[data-toggle=buttons]>.btn input[type=checkbox],[data-toggle=buttons]>.btn input[type=radio],[data-toggle=buttons]>.btn-group>.btn input[type=checkbox],[data-toggle=buttons]>.btn-group>.btn input[type=radio]{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.input-group{position:relative;display:table;border-collapse:separate}.input-group[class*=col-]{float:none;padding-right:0;padding-left:0}.input-group .form-control{position:relative;z-index:2;float:left;width:100%;margin-bottom:0}.input-group .form-control:focus{z-index:3}.input-group-lg>.form-control,.input-group-lg>.input-group-addon,.input-group-lg>.input-group-btn>.btn{height:46px;padding:10px 16px;font-size:18px;line-height:1.3333333;border-radius:6px}select.input-group-lg>.form-control,select.input-group-lg>.input-group-addon,select.input-group-lg>.input-group-btn>.btn{height:46px;line-height:46px}select[multiple].input-group-lg>.form-control,select[multiple].input-group-lg>.input-group-addon,select[multiple].input-group-lg>.input-group-btn>.btn,textarea.input-group-lg>.form-control,textarea.input-group-lg>.input-group-addon,textarea.input-group-lg>.input-group-btn>.btn{height:auto}.input-group-sm>.form-control,.input-group-sm>.input-group-addon,.input-group-sm>.input-group-btn>.btn{height:30px;padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}select.input-group-sm>.form-control,select.input-group-sm>.input-group-addon,select.input-group-sm>.input-group-btn>.btn{height:30px;line-height:30px}select[multiple].input-group-sm>.form-control,select[multiple].input-group-sm>.input-group-addon,select[multiple].input-group-sm>.input-group-btn>.btn,textarea.input-group-sm>.form-control,textarea.input-group-sm>.input-group-addon,textarea.input-group-sm>.input-group-btn>.btn{height:auto}.input-group .form-control,.input-group-addon,.input-group-btn{display:table-cell}.input-group .form-control:not(:first-child):not(:last-child),.input-group-addon:not(:first-child):not(:last-child),.input-group-btn:not(:first-child):not(:last-child){border-radius:0}.input-group-addon,.input-group-btn{width:1%;white-space:nowrap;vertical-align:middle}.input-group-addon{padding:6px 12px;font-size:14px;font-weight:400;line-height:1;color:#555;text-align:center;background-color:#eee;border:1px solid #ccc;border-radius:4px}.input-group-addon.input-sm{padding:5px 10px;font-size:12px;border-radius:3px}.input-group-addon.input-lg{padding:10px 16px;font-size:18px;border-radius:6px}.input-group-addon input[type=checkbox],.input-group-addon input[type=radio]{margin-top:0}.input-group .form-control:first-child,.input-group-addon:first-child,.input-group-btn:first-child>.btn,.input-group-btn:first-child>.btn-group>.btn,.input-group-btn:first-child>.dropdown-toggle,.input-group-btn:last-child>.btn-group:not(:last-child)>.btn,.input-group-btn:last-child>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.input-group-addon:first-child{border-right:0}.input-group .form-control:last-child,.input-group-addon:last-child,.input-group-btn:first-child>.btn-group:not(:first-child)>.btn,.input-group-btn:first-child>.btn:not(:first-child),.input-group-btn:last-child>.btn,.input-group-btn:last-child>.btn-group>.btn,.input-group-btn:last-child>.dropdown-toggle{border-top-left-radius:0;border-bottom-left-radius:0}.input-group-addon:last-child{border-left:0}.input-group-btn{position:relative;font-size:0;white-space:nowrap}.input-group-btn>.btn{position:relative}.input-group-btn>.btn+.btn{margin-left:-1px}.input-group-btn>.btn:active,.input-group-btn>.btn:focus,.input-group-btn>.btn:hover{z-index:2}.input-group-btn:first-child>.btn,.input-group-btn:first-child>.btn-group{margin-right:-1px}.input-group-btn:last-child>.btn,.input-group-btn:last-child>.btn-group{z-index:2;margin-left:-1px}.nav{padding-left:0;margin-bottom:0;list-style:none}.nav>li{position:relative;display:block}.nav>li>a{position:relative;display:block;padding:10px 15px}.nav>li>a:focus,.nav>li>a:hover{text-decoration:none;background-color:#eee}.nav>li.disabled>a{color:#777}.nav>li.disabled>a:focus,.nav>li.disabled>a:hover{color:#777;text-decoration:none;cursor:not-allowed;background-color:transparent}.nav .open>a,.nav .open>a:focus,.nav .open>a:hover{background-color:#eee;border-color:#337ab7}.nav .nav-divider{height:1px;margin:9px 0;overflow:hidden;background-color:#e5e5e5}.nav>li>a>img{max-width:none}.nav-tabs{border-bottom:1px solid #ddd}.nav-tabs>li{float:left;margin-bottom:-1px}.nav-tabs>li>a{margin-right:2px;line-height:1.42857143;border:1px solid transparent;border-radius:4px 4px 0 0}.nav-tabs>li>a:hover{border-color:#eee #eee #ddd}.nav-tabs>li.active>a,.nav-tabs>li.active>a:focus,.nav-tabs>li.active>a:hover{color:#555;cursor:default;background-color:#fff;border:1px solid #ddd;border-bottom-color:transparent}.nav-tabs.nav-justified{width:100%;border-bottom:0}.nav-tabs.nav-justified>li{float:none}.nav-tabs.nav-justified>li>a{margin-bottom:5px;text-align:center}.nav-tabs.nav-justified>.dropdown .dropdown-menu{top:auto;left:auto}@media (min-width:768px){.nav-tabs.nav-justified>li{display:table-cell;width:1%}.nav-tabs.nav-justified>li>a{margin-bottom:0}}.nav-tabs.nav-justified>li>a{margin-right:0;border-radius:4px}.nav-tabs.nav-justified>.active>a,.nav-tabs.nav-justified>.active>a:focus,.nav-tabs.nav-justified>.active>a:hover{border:1px solid #ddd}@media (min-width:768px){.nav-tabs.nav-justified>li>a{border-bottom:1px solid #ddd;border-radius:4px 4px 0 0}.nav-tabs.nav-justified>.active>a,.nav-tabs.nav-justified>.active>a:focus,.nav-tabs.nav-justified>.active>a:hover{border-bottom-color:#fff}}.nav-pills>li{float:left}.nav-pills>li>a{border-radius:4px}.nav-pills>li+li{margin-left:2px}.nav-pills>li.active>a,.nav-pills>li.active>a:focus,.nav-pills>li.active>a:hover{color:#fff;background-color:#337ab7}.nav-stacked>li{float:none}.nav-stacked>li+li{margin-top:2px;margin-left:0}.nav-justified{width:100%}.nav-justified>li{float:none}.nav-justified>li>a{margin-bottom:5px;text-align:center}.nav-justified>.dropdown .dropdown-menu{top:auto;left:auto}@media (min-width:768px){.nav-justified>li{display:table-cell;width:1%}.nav-justified>li>a{margin-bottom:0}}.nav-tabs-justified{border-bottom:0}.nav-tabs-justified>li>a{margin-right:0;border-radius:4px}.nav-tabs-justified>.active>a,.nav-tabs-justified>.active>a:focus,.nav-tabs-justified>.active>a:hover{border:1px solid #ddd}@media (min-width:768px){.nav-tabs-justified>li>a{border-bottom:1px solid #ddd;border-radius:4px 4px 0 0}.nav-tabs-justified>.active>a,.nav-tabs-justified>.active>a:focus,.nav-tabs-justified>.active>a:hover{border-bottom-color:#fff}}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.nav-tabs .dropdown-menu{margin-top:-1px;border-top-left-radius:0;border-top-right-radius:0}.navbar{position:relative;min-height:50px;margin-bottom:20px;border:1px solid transparent}@media (min-width:768px){.navbar{border-radius:4px}}@media (min-width:768px){.navbar-header{float:left}}.navbar-collapse{padding-right:15px;padding-left:15px;overflow-x:visible;-webkit-overflow-scrolling:touch;border-top:1px solid transparent;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.1);box-shadow:inset 0 1px 0 rgba(255,255,255,.1)}.navbar-collapse.in{overflow-y:auto}@media (min-width:768px){.navbar-collapse{width:auto;border-top:0;-webkit-box-shadow:none;box-shadow:none}.navbar-collapse.collapse{display:block!important;height:auto!important;padding-bottom:0;overflow:visible!important}.navbar-collapse.in{overflow-y:visible}.navbar-fixed-bottom .navbar-collapse,.navbar-fixed-top .navbar-collapse,.navbar-static-top .navbar-collapse{padding-right:0;padding-left:0}}.navbar-fixed-bottom .navbar-collapse,.navbar-fixed-top .navbar-collapse{max-height:340px}@media (max-device-width:480px) and (orientation:landscape){.navbar-fixed-bottom .navbar-collapse,.navbar-fixed-top .navbar-collapse{max-height:200px}}.container-fluid>.navbar-collapse,.container-fluid>.navbar-header,.container>.navbar-collapse,.container>.navbar-header{margin-right:-15px;margin-left:-15px}@media (min-width:768px){.container-fluid>.navbar-collapse,.container-fluid>.navbar-header,.container>.navbar-collapse,.container>.navbar-header{margin-right:0;margin-left:0}}.navbar-static-top{z-index:1000;border-width:0 0 1px}@media (min-width:768px){.navbar-static-top{border-radius:0}}.navbar-fixed-bottom,.navbar-fixed-top{position:fixed;right:0;left:0;z-index:1030}@media (min-width:768px){.navbar-fixed-bottom,.navbar-fixed-top{border-radius:0}}.navbar-fixed-top{top:0;border-width:0 0 1px}.navbar-fixed-bottom{bottom:0;margin-bottom:0;border-width:1px 0 0}.navbar-brand{float:left;height:50px;padding:15px 15px;font-size:18px;line-height:20px}.navbar-brand:focus,.navbar-brand:hover{text-decoration:none}.navbar-brand>img{display:block}@media (min-width:768px){.navbar>.container .navbar-brand,.navbar>.container-fluid .navbar-brand{margin-left:-15px}}.navbar-toggle{position:relative;float:right;padding:9px 10px;margin-top:8px;margin-right:15px;margin-bottom:8px;background-color:transparent;background-image:none;border:1px solid transparent;border-radius:4px}.navbar-toggle:focus{outline:0}.navbar-toggle .icon-bar{display:block;width:22px;height:2px;border-radius:1px}.navbar-toggle .icon-bar+.icon-bar{margin-top:4px}@media (min-width:768px){.navbar-toggle{display:none}}.navbar-nav{margin:7.5px -15px}.navbar-nav>li>a{padding-top:10px;padding-bottom:10px;line-height:20px}@media (max-width:767px){.navbar-nav .open .dropdown-menu{position:static;float:none;width:auto;margin-top:0;background-color:transparent;border:0;-webkit-box-shadow:none;box-shadow:none}.navbar-nav .open .dropdown-menu .dropdown-header,.navbar-nav .open .dropdown-menu>li>a{padding:5px 15px 5px 25px}.navbar-nav .open .dropdown-menu>li>a{line-height:20px}.navbar-nav .open .dropdown-menu>li>a:focus,.navbar-nav .open .dropdown-menu>li>a:hover{background-image:none}}@media (min-width:768px){.navbar-nav{float:left;margin:0}.navbar-nav>li{float:left}.navbar-nav>li>a{padding-top:15px;padding-bottom:15px}}.navbar-form{padding:10px 15px;margin-top:8px;margin-right:-15px;margin-bottom:8px;margin-left:-15px;border-top:1px solid transparent;border-bottom:1px solid transparent;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.1),0 1px 0 rgba(255,255,255,.1);box-shadow:inset 0 1px 0 rgba(255,255,255,.1),0 1px 0 rgba(255,255,255,.1)}@media (min-width:768px){.navbar-form .form-group{display:inline-block;margin-bottom:0;vertical-align:middle}.navbar-form .form-control{display:inline-block;width:auto;vertical-align:middle}.navbar-form .form-control-static{display:inline-block}.navbar-form .input-group{display:inline-table;vertical-align:middle}.navbar-form .input-group .form-control,.navbar-form .input-group .input-group-addon,.navbar-form .input-group .input-group-btn{width:auto}.navbar-form .input-group>.form-control{width:100%}.navbar-form .control-label{margin-bottom:0;vertical-align:middle}.navbar-form .checkbox,.navbar-form .radio{display:inline-block;margin-top:0;margin-bottom:0;vertical-align:middle}.navbar-form .checkbox label,.navbar-form .radio label{padding-left:0}.navbar-form .checkbox input[type=checkbox],.navbar-form .radio input[type=radio]{position:relative;margin-left:0}.navbar-form .has-feedback .form-control-feedback{top:0}}@media (max-width:767px){.navbar-form .form-group{margin-bottom:5px}.navbar-form .form-group:last-child{margin-bottom:0}}@media (min-width:768px){.navbar-form{width:auto;padding-top:0;padding-bottom:0;margin-right:0;margin-left:0;border:0;-webkit-box-shadow:none;box-shadow:none}}.navbar-nav>li>.dropdown-menu{margin-top:0;border-top-left-radius:0;border-top-right-radius:0}.navbar-fixed-bottom .navbar-nav>li>.dropdown-menu{margin-bottom:0;border-top-left-radius:4px;border-top-right-radius:4px;border-bottom-right-radius:0;border-bottom-left-radius:0}.navbar-btn{margin-top:8px;margin-bottom:8px}.navbar-btn.btn-sm{margin-top:10px;margin-bottom:10px}.navbar-btn.btn-xs{margin-top:14px;margin-bottom:14px}.navbar-text{margin-top:15px;margin-bottom:15px}@media (min-width:768px){.navbar-text{float:left;margin-right:15px;margin-left:15px}}@media (min-width:768px){.navbar-left{float:left!important}.navbar-right{float:right!important;margin-right:-15px}.navbar-right~.navbar-right{margin-right:0}}.navbar-default{background-color:#f8f8f8;border-color:#e7e7e7}.navbar-default .navbar-brand{color:#777}.navbar-default .navbar-brand:focus,.navbar-default .navbar-brand:hover{color:#5e5e5e;background-color:transparent}.navbar-default .navbar-text{color:#777}.navbar-default .navbar-nav>li>a{color:#777}.navbar-default .navbar-nav>li>a:focus,.navbar-default .navbar-nav>li>a:hover{color:#333;background-color:transparent}.navbar-default .navbar-nav>.active>a,.navbar-default .navbar-nav>.active>a:focus,.navbar-default .navbar-nav>.active>a:hover{color:#555;background-color:#e7e7e7}.navbar-default .navbar-nav>.disabled>a,.navbar-default .navbar-nav>.disabled>a:focus,.navbar-default .navbar-nav>.disabled>a:hover{color:#ccc;background-color:transparent}.navbar-default .navbar-toggle{border-color:#ddd}.navbar-default .navbar-toggle:focus,.navbar-default .navbar-toggle:hover{background-color:#ddd}.navbar-default .navbar-toggle .icon-bar{background-color:#888}.navbar-default .navbar-collapse,.navbar-default .navbar-form{border-color:#e7e7e7}.navbar-default .navbar-nav>.open>a,.navbar-default .navbar-nav>.open>a:focus,.navbar-default .navbar-nav>.open>a:hover{color:#555;background-color:#e7e7e7}@media (max-width:767px){.navbar-default .navbar-nav .open .dropdown-menu>li>a{color:#777}.navbar-default .navbar-nav .open .dropdown-menu>li>a:focus,.navbar-default .navbar-nav .open .dropdown-menu>li>a:hover{color:#333;background-color:transparent}.navbar-default .navbar-nav .open .dropdown-menu>.active>a,.navbar-default .navbar-nav .open .dropdown-menu>.active>a:focus,.navbar-default .navbar-nav .open .dropdown-menu>.active>a:hover{color:#555;background-color:#e7e7e7}.navbar-default .navbar-nav .open .dropdown-menu>.disabled>a,.navbar-default .navbar-nav .open .dropdown-menu>.disabled>a:focus,.navbar-default .navbar-nav .open .dropdown-menu>.disabled>a:hover{color:#ccc;background-color:transparent}}.navbar-default .navbar-link{color:#777}.navbar-default .navbar-link:hover{color:#333}.navbar-default .btn-link{color:#777}.navbar-default .btn-link:focus,.navbar-default .btn-link:hover{color:#333}.navbar-default .btn-link[disabled]:focus,.navbar-default .btn-link[disabled]:hover,fieldset[disabled] .navbar-default .btn-link:focus,fieldset[disabled] .navbar-default .btn-link:hover{color:#ccc}.navbar-inverse{background-color:#222;border-color:#080808}.navbar-inverse .navbar-brand{color:#9d9d9d}.navbar-inverse .navbar-brand:focus,.navbar-inverse .navbar-brand:hover{color:#fff;background-color:transparent}.navbar-inverse .navbar-text{color:#9d9d9d}.navbar-inverse .navbar-nav>li>a{color:#9d9d9d}.navbar-inverse .navbar-nav>li>a:focus,.navbar-inverse .navbar-nav>li>a:hover{color:#fff;background-color:transparent}.navbar-inverse .navbar-nav>.active>a,.navbar-inverse .navbar-nav>.active>a:focus,.navbar-inverse .navbar-nav>.active>a:hover{color:#fff;background-color:#080808}.navbar-inverse .navbar-nav>.disabled>a,.navbar-inverse .navbar-nav>.disabled>a:focus,.navbar-inverse .navbar-nav>.disabled>a:hover{color:#444;background-color:transparent}.navbar-inverse .navbar-toggle{border-color:#333}.navbar-inverse .navbar-toggle:focus,.navbar-inverse .navbar-toggle:hover{background-color:#333}.navbar-inverse .navbar-toggle .icon-bar{background-color:#fff}.navbar-inverse .navbar-collapse,.navbar-inverse .navbar-form{border-color:#101010}.navbar-inverse .navbar-nav>.open>a,.navbar-inverse .navbar-nav>.open>a:focus,.navbar-inverse .navbar-nav>.open>a:hover{color:#fff;background-color:#080808}@media (max-width:767px){.navbar-inverse .navbar-nav .open .dropdown-menu>.dropdown-header{border-color:#080808}.navbar-inverse .navbar-nav .open .dropdown-menu .divider{background-color:#080808}.navbar-inverse .navbar-nav .open .dropdown-menu>li>a{color:#9d9d9d}.navbar-inverse .navbar-nav .open .dropdown-menu>li>a:focus,.navbar-inverse .navbar-nav .open .dropdown-menu>li>a:hover{color:#fff;background-color:transparent}.navbar-inverse .navbar-nav .open .dropdown-menu>.active>a,.navbar-inverse .navbar-nav .open .dropdown-menu>.active>a:focus,.navbar-inverse .navbar-nav .open .dropdown-menu>.active>a:hover{color:#fff;background-color:#080808}.navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a,.navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a:focus,.navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a:hover{color:#444;background-color:transparent}}.navbar-inverse .navbar-link{color:#9d9d9d}.navbar-inverse .navbar-link:hover{color:#fff}.navbar-inverse .btn-link{color:#9d9d9d}.navbar-inverse .btn-link:focus,.navbar-inverse .btn-link:hover{color:#fff}.navbar-inverse .btn-link[disabled]:focus,.navbar-inverse .btn-link[disabled]:hover,fieldset[disabled] .navbar-inverse .btn-link:focus,fieldset[disabled] .navbar-inverse .btn-link:hover{color:#444}.breadcrumb{padding:8px 15px;margin-bottom:20px;list-style:none;background-color:#f5f5f5;border-radius:4px}.breadcrumb>li{display:inline-block}.breadcrumb>li+li:before{padding:0 5px;color:#ccc;content:"/\\00a0"}.breadcrumb>.active{color:#777}.pagination{display:inline-block;padding-left:0;margin:20px 0;border-radius:4px}.pagination>li{display:inline}.pagination>li>a,.pagination>li>span{position:relative;float:left;padding:6px 12px;margin-left:-1px;line-height:1.42857143;color:#337ab7;text-decoration:none;background-color:#fff;border:1px solid #ddd}.pagination>li:first-child>a,.pagination>li:first-child>span{margin-left:0;border-top-left-radius:4px;border-bottom-left-radius:4px}.pagination>li:last-child>a,.pagination>li:last-child>span{border-top-right-radius:4px;border-bottom-right-radius:4px}.pagination>li>a:focus,.pagination>li>a:hover,.pagination>li>span:focus,.pagination>li>span:hover{z-index:2;color:#23527c;background-color:#eee;border-color:#ddd}.pagination>.active>a,.pagination>.active>a:focus,.pagination>.active>a:hover,.pagination>.active>span,.pagination>.active>span:focus,.pagination>.active>span:hover{z-index:3;color:#fff;cursor:default;background-color:#337ab7;border-color:#337ab7}.pagination>.disabled>a,.pagination>.disabled>a:focus,.pagination>.disabled>a:hover,.pagination>.disabled>span,.pagination>.disabled>span:focus,.pagination>.disabled>span:hover{color:#777;cursor:not-allowed;background-color:#fff;border-color:#ddd}.pagination-lg>li>a,.pagination-lg>li>span{padding:10px 16px;font-size:18px;line-height:1.3333333}.pagination-lg>li:first-child>a,.pagination-lg>li:first-child>span{border-top-left-radius:6px;border-bottom-left-radius:6px}.pagination-lg>li:last-child>a,.pagination-lg>li:last-child>span{border-top-right-radius:6px;border-bottom-right-radius:6px}.pagination-sm>li>a,.pagination-sm>li>span{padding:5px 10px;font-size:12px;line-height:1.5}.pagination-sm>li:first-child>a,.pagination-sm>li:first-child>span{border-top-left-radius:3px;border-bottom-left-radius:3px}.pagination-sm>li:last-child>a,.pagination-sm>li:last-child>span{border-top-right-radius:3px;border-bottom-right-radius:3px}.pager{padding-left:0;margin:20px 0;text-align:center;list-style:none}.pager li{display:inline}.pager li>a,.pager li>span{display:inline-block;padding:5px 14px;background-color:#fff;border:1px solid #ddd;border-radius:15px}.pager li>a:focus,.pager li>a:hover{text-decoration:none;background-color:#eee}.pager .next>a,.pager .next>span{float:right}.pager .previous>a,.pager .previous>span{float:left}.pager .disabled>a,.pager .disabled>a:focus,.pager .disabled>a:hover,.pager .disabled>span{color:#777;cursor:not-allowed;background-color:#fff}.label{display:inline;padding:.2em .6em .3em;font-size:75%;font-weight:700;line-height:1;color:#fff;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25em}a.label:focus,a.label:hover{color:#fff;text-decoration:none;cursor:pointer}.label:empty{display:none}.btn .label{position:relative;top:-1px}.label-default{background-color:#777}.label-default[href]:focus,.label-default[href]:hover{background-color:#5e5e5e}.label-primary{background-color:#337ab7}.label-primary[href]:focus,.label-primary[href]:hover{background-color:#286090}.label-success{background-color:#5cb85c}.label-success[href]:focus,.label-success[href]:hover{background-color:#449d44}.label-info{background-color:#5bc0de}.label-info[href]:focus,.label-info[href]:hover{background-color:#31b0d5}.label-warning{background-color:#f0ad4e}.label-warning[href]:focus,.label-warning[href]:hover{background-color:#ec971f}.label-danger{background-color:#d9534f}.label-danger[href]:focus,.label-danger[href]:hover{background-color:#c9302c}.badge{display:inline-block;min-width:10px;padding:3px 7px;font-size:12px;font-weight:700;line-height:1;color:#fff;text-align:center;white-space:nowrap;vertical-align:middle;background-color:#777;border-radius:10px}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.btn-group-xs>.btn .badge,.btn-xs .badge{top:0;padding:1px 5px}a.badge:focus,a.badge:hover{color:#fff;text-decoration:none;cursor:pointer}.list-group-item.active>.badge,.nav-pills>.active>a>.badge{color:#337ab7;background-color:#fff}.list-group-item>.badge{float:right}.list-group-item>.badge+.badge{margin-right:5px}.nav-pills>li>a>.badge{margin-left:3px}.jumbotron{padding-top:30px;padding-bottom:30px;margin-bottom:30px;color:inherit;background-color:#eee}.jumbotron .h1,.jumbotron h1{color:inherit}.jumbotron p{margin-bottom:15px;font-size:21px;font-weight:200}.jumbotron>hr{border-top-color:#d5d5d5}.container .jumbotron,.container-fluid .jumbotron{padding-right:15px;padding-left:15px;border-radius:6px}.jumbotron .container{max-width:100%}@media screen and (min-width:768px){.jumbotron{padding-top:48px;padding-bottom:48px}.container .jumbotron,.container-fluid .jumbotron{padding-right:60px;padding-left:60px}.jumbotron .h1,.jumbotron h1{font-size:63px}}.thumbnail{display:block;padding:4px;margin-bottom:20px;line-height:1.42857143;background-color:#fff;border:1px solid #ddd;border-radius:4px;-webkit-transition:border .2s ease-in-out;-o-transition:border .2s ease-in-out;transition:border .2s ease-in-out}.thumbnail a>img,.thumbnail>img{margin-right:auto;margin-left:auto}a.thumbnail.active,a.thumbnail:focus,a.thumbnail:hover{border-color:#337ab7}.thumbnail .caption{padding:9px;color:#333}.alert{padding:15px;margin-bottom:20px;border:1px solid transparent;border-radius:4px}.alert h4{margin-top:0;color:inherit}.alert .alert-link{font-weight:700}.alert>p,.alert>ul{margin-bottom:0}.alert>p+p{margin-top:5px}.alert-dismissable,.alert-dismissible{padding-right:35px}.alert-dismissable .close,.alert-dismissible .close{position:relative;top:-2px;right:-21px;color:inherit}.alert-success{color:#3c763d;background-color:#dff0d8;border-color:#d6e9c6}.alert-success hr{border-top-color:#c9e2b3}.alert-success .alert-link{color:#2b542c}.alert-info{color:#31708f;background-color:#d9edf7;border-color:#bce8f1}.alert-info hr{border-top-color:#a6e1ec}.alert-info .alert-link{color:#245269}.alert-warning{color:#8a6d3b;background-color:#fcf8e3;border-color:#faebcc}.alert-warning hr{border-top-color:#f7e1b5}.alert-warning .alert-link{color:#66512c}.alert-danger{color:#a94442;background-color:#f2dede;border-color:#ebccd1}.alert-danger hr{border-top-color:#e4b9c0}.alert-danger .alert-link{color:#843534}@-webkit-keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}@-o-keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}@keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}.progress{height:20px;margin-bottom:20px;overflow:hidden;background-color:#f5f5f5;border-radius:4px;-webkit-box-shadow:inset 0 1px 2px rgba(0,0,0,.1);box-shadow:inset 0 1px 2px rgba(0,0,0,.1)}.progress-bar{float:left;width:0;height:100%;font-size:12px;line-height:20px;color:#fff;text-align:center;background-color:#337ab7;-webkit-box-shadow:inset 0 -1px 0 rgba(0,0,0,.15);box-shadow:inset 0 -1px 0 rgba(0,0,0,.15);-webkit-transition:width .6s ease;-o-transition:width .6s ease;transition:width .6s ease}.progress-bar-striped,.progress-striped .progress-bar{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);-webkit-background-size:40px 40px;background-size:40px 40px}.progress-bar.active,.progress.active .progress-bar{-webkit-animation:progress-bar-stripes 2s linear infinite;-o-animation:progress-bar-stripes 2s linear infinite;animation:progress-bar-stripes 2s linear infinite}.progress-bar-success{background-color:#5cb85c}.progress-striped .progress-bar-success{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.progress-bar-info{background-color:#5bc0de}.progress-striped .progress-bar-info{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.progress-bar-warning{background-color:#f0ad4e}.progress-striped .progress-bar-warning{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.progress-bar-danger{background-color:#d9534f}.progress-striped .progress-bar-danger{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.media{margin-top:15px}.media:first-child{margin-top:0}.media,.media-body{overflow:hidden;zoom:1}.media-body{width:10000px}.media-object{display:block}.media-object.img-thumbnail{max-width:none}.media-right,.media>.pull-right{padding-left:10px}.media-left,.media>.pull-left{padding-right:10px}.media-body,.media-left,.media-right{display:table-cell;vertical-align:top}.media-middle{vertical-align:middle}.media-bottom{vertical-align:bottom}.media-heading{margin-top:0;margin-bottom:5px}.media-list{padding-left:0;list-style:none}.list-group{padding-left:0;margin-bottom:20px}.list-group-item{position:relative;display:block;padding:10px 15px;margin-bottom:-1px;background-color:#fff;border:1px solid #ddd}.list-group-item:first-child{border-top-left-radius:4px;border-top-right-radius:4px}.list-group-item:last-child{margin-bottom:0;border-bottom-right-radius:4px;border-bottom-left-radius:4px}a.list-group-item,button.list-group-item{color:#555}a.list-group-item .list-group-item-heading,button.list-group-item .list-group-item-heading{color:#333}a.list-group-item:focus,a.list-group-item:hover,button.list-group-item:focus,button.list-group-item:hover{color:#555;text-decoration:none;background-color:#f5f5f5}button.list-group-item{width:100%;text-align:left}.list-group-item.disabled,.list-group-item.disabled:focus,.list-group-item.disabled:hover{color:#777;cursor:not-allowed;background-color:#eee}.list-group-item.disabled .list-group-item-heading,.list-group-item.disabled:focus .list-group-item-heading,.list-group-item.disabled:hover .list-group-item-heading{color:inherit}.list-group-item.disabled .list-group-item-text,.list-group-item.disabled:focus .list-group-item-text,.list-group-item.disabled:hover .list-group-item-text{color:#777}.list-group-item.active,.list-group-item.active:focus,.list-group-item.active:hover{z-index:2;color:#fff;background-color:#337ab7;border-color:#337ab7}.list-group-item.active .list-group-item-heading,.list-group-item.active .list-group-item-heading>.small,.list-group-item.active .list-group-item-heading>small,.list-group-item.active:focus .list-group-item-heading,.list-group-item.active:focus .list-group-item-heading>.small,.list-group-item.active:focus .list-group-item-heading>small,.list-group-item.active:hover .list-group-item-heading,.list-group-item.active:hover .list-group-item-heading>.small,.list-group-item.active:hover .list-group-item-heading>small{color:inherit}.list-group-item.active .list-group-item-text,.list-group-item.active:focus .list-group-item-text,.list-group-item.active:hover .list-group-item-text{color:#c7ddef}.list-group-item-success{color:#3c763d;background-color:#dff0d8}a.list-group-item-success,button.list-group-item-success{color:#3c763d}a.list-group-item-success .list-group-item-heading,button.list-group-item-success .list-group-item-heading{color:inherit}a.list-group-item-success:focus,a.list-group-item-success:hover,button.list-group-item-success:focus,button.list-group-item-success:hover{color:#3c763d;background-color:#d0e9c6}a.list-group-item-success.active,a.list-group-item-success.active:focus,a.list-group-item-success.active:hover,button.list-group-item-success.active,button.list-group-item-success.active:focus,button.list-group-item-success.active:hover{color:#fff;background-color:#3c763d;border-color:#3c763d}.list-group-item-info{color:#31708f;background-color:#d9edf7}a.list-group-item-info,button.list-group-item-info{color:#31708f}a.list-group-item-info .list-group-item-heading,button.list-group-item-info .list-group-item-heading{color:inherit}a.list-group-item-info:focus,a.list-group-item-info:hover,button.list-group-item-info:focus,button.list-group-item-info:hover{color:#31708f;background-color:#c4e3f3}a.list-group-item-info.active,a.list-group-item-info.active:focus,a.list-group-item-info.active:hover,button.list-group-item-info.active,button.list-group-item-info.active:focus,button.list-group-item-info.active:hover{color:#fff;background-color:#31708f;border-color:#31708f}.list-group-item-warning{color:#8a6d3b;background-color:#fcf8e3}a.list-group-item-warning,button.list-group-item-warning{color:#8a6d3b}a.list-group-item-warning .list-group-item-heading,button.list-group-item-warning .list-group-item-heading{color:inherit}a.list-group-item-warning:focus,a.list-group-item-warning:hover,button.list-group-item-warning:focus,button.list-group-item-warning:hover{color:#8a6d3b;background-color:#faf2cc}a.list-group-item-warning.active,a.list-group-item-warning.active:focus,a.list-group-item-warning.active:hover,button.list-group-item-warning.active,button.list-group-item-warning.active:focus,button.list-group-item-warning.active:hover{color:#fff;background-color:#8a6d3b;border-color:#8a6d3b}.list-group-item-danger{color:#a94442;background-color:#f2dede}a.list-group-item-danger,button.list-group-item-danger{color:#a94442}a.list-group-item-danger .list-group-item-heading,button.list-group-item-danger .list-group-item-heading{color:inherit}a.list-group-item-danger:focus,a.list-group-item-danger:hover,button.list-group-item-danger:focus,button.list-group-item-danger:hover{color:#a94442;background-color:#ebcccc}a.list-group-item-danger.active,a.list-group-item-danger.active:focus,a.list-group-item-danger.active:hover,button.list-group-item-danger.active,button.list-group-item-danger.active:focus,button.list-group-item-danger.active:hover{color:#fff;background-color:#a94442;border-color:#a94442}.list-group-item-heading{margin-top:0;margin-bottom:5px}.list-group-item-text{margin-bottom:0;line-height:1.3}.panel{margin-bottom:20px;background-color:#fff;border:1px solid transparent;border-radius:4px;-webkit-box-shadow:0 1px 1px rgba(0,0,0,.05);box-shadow:0 1px 1px rgba(0,0,0,.05)}.panel-body{padding:15px}.panel-heading{padding:10px 15px;border-bottom:1px solid transparent;border-top-left-radius:3px;border-top-right-radius:3px}.panel-heading>.dropdown .dropdown-toggle{color:inherit}.panel-title{margin-top:0;margin-bottom:0;font-size:16px;color:inherit}.panel-title>.small,.panel-title>.small>a,.panel-title>a,.panel-title>small,.panel-title>small>a{color:inherit}.panel-footer{padding:10px 15px;background-color:#f5f5f5;border-top:1px solid #ddd;border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel>.list-group,.panel>.panel-collapse>.list-group{margin-bottom:0}.panel>.list-group .list-group-item,.panel>.panel-collapse>.list-group .list-group-item{border-width:1px 0;border-radius:0}.panel>.list-group:first-child .list-group-item:first-child,.panel>.panel-collapse>.list-group:first-child .list-group-item:first-child{border-top:0;border-top-left-radius:3px;border-top-right-radius:3px}.panel>.list-group:last-child .list-group-item:last-child,.panel>.panel-collapse>.list-group:last-child .list-group-item:last-child{border-bottom:0;border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel>.panel-heading+.panel-collapse>.list-group .list-group-item:first-child{border-top-left-radius:0;border-top-right-radius:0}.panel-heading+.list-group .list-group-item:first-child{border-top-width:0}.list-group+.panel-footer{border-top-width:0}.panel>.panel-collapse>.table,.panel>.table,.panel>.table-responsive>.table{margin-bottom:0}.panel>.panel-collapse>.table caption,.panel>.table caption,.panel>.table-responsive>.table caption{padding-right:15px;padding-left:15px}.panel>.table-responsive:first-child>.table:first-child,.panel>.table:first-child{border-top-left-radius:3px;border-top-right-radius:3px}.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child,.panel>.table:first-child>tbody:first-child>tr:first-child,.panel>.table:first-child>thead:first-child>tr:first-child{border-top-left-radius:3px;border-top-right-radius:3px}.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child td:first-child,.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child th:first-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child td:first-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child th:first-child,.panel>.table:first-child>tbody:first-child>tr:first-child td:first-child,.panel>.table:first-child>tbody:first-child>tr:first-child th:first-child,.panel>.table:first-child>thead:first-child>tr:first-child td:first-child,.panel>.table:first-child>thead:first-child>tr:first-child th:first-child{border-top-left-radius:3px}.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child td:last-child,.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child th:last-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child td:last-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child th:last-child,.panel>.table:first-child>tbody:first-child>tr:first-child td:last-child,.panel>.table:first-child>tbody:first-child>tr:first-child th:last-child,.panel>.table:first-child>thead:first-child>tr:first-child td:last-child,.panel>.table:first-child>thead:first-child>tr:first-child th:last-child{border-top-right-radius:3px}.panel>.table-responsive:last-child>.table:last-child,.panel>.table:last-child{border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child,.panel>.table:last-child>tbody:last-child>tr:last-child,.panel>.table:last-child>tfoot:last-child>tr:last-child{border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child td:first-child,.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child th:first-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child td:first-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child th:first-child,.panel>.table:last-child>tbody:last-child>tr:last-child td:first-child,.panel>.table:last-child>tbody:last-child>tr:last-child th:first-child,.panel>.table:last-child>tfoot:last-child>tr:last-child td:first-child,.panel>.table:last-child>tfoot:last-child>tr:last-child th:first-child{border-bottom-left-radius:3px}.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child td:last-child,.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child th:last-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child td:last-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child th:last-child,.panel>.table:last-child>tbody:last-child>tr:last-child td:last-child,.panel>.table:last-child>tbody:last-child>tr:last-child th:last-child,.panel>.table:last-child>tfoot:last-child>tr:last-child td:last-child,.panel>.table:last-child>tfoot:last-child>tr:last-child th:last-child{border-bottom-right-radius:3px}.panel>.panel-body+.table,.panel>.panel-body+.table-responsive,.panel>.table+.panel-body,.panel>.table-responsive+.panel-body{border-top:1px solid #ddd}.panel>.table>tbody:first-child>tr:first-child td,.panel>.table>tbody:first-child>tr:first-child th{border-top:0}.panel>.table-bordered,.panel>.table-responsive>.table-bordered{border:0}.panel>.table-bordered>tbody>tr>td:first-child,.panel>.table-bordered>tbody>tr>th:first-child,.panel>.table-bordered>tfoot>tr>td:first-child,.panel>.table-bordered>tfoot>tr>th:first-child,.panel>.table-bordered>thead>tr>td:first-child,.panel>.table-bordered>thead>tr>th:first-child,.panel>.table-responsive>.table-bordered>tbody>tr>td:first-child,.panel>.table-responsive>.table-bordered>tbody>tr>th:first-child,.panel>.table-responsive>.table-bordered>tfoot>tr>td:first-child,.panel>.table-responsive>.table-bordered>tfoot>tr>th:first-child,.panel>.table-responsive>.table-bordered>thead>tr>td:first-child,.panel>.table-responsive>.table-bordered>thead>tr>th:first-child{border-left:0}.panel>.table-bordered>tbody>tr>td:last-child,.panel>.table-bordered>tbody>tr>th:last-child,.panel>.table-bordered>tfoot>tr>td:last-child,.panel>.table-bordered>tfoot>tr>th:last-child,.panel>.table-bordered>thead>tr>td:last-child,.panel>.table-bordered>thead>tr>th:last-child,.panel>.table-responsive>.table-bordered>tbody>tr>td:last-child,.panel>.table-responsive>.table-bordered>tbody>tr>th:last-child,.panel>.table-responsive>.table-bordered>tfoot>tr>td:last-child,.panel>.table-responsive>.table-bordered>tfoot>tr>th:last-child,.panel>.table-responsive>.table-bordered>thead>tr>td:last-child,.panel>.table-responsive>.table-bordered>thead>tr>th:last-child{border-right:0}.panel>.table-bordered>tbody>tr:first-child>td,.panel>.table-bordered>tbody>tr:first-child>th,.panel>.table-bordered>thead>tr:first-child>td,.panel>.table-bordered>thead>tr:first-child>th,.panel>.table-responsive>.table-bordered>tbody>tr:first-child>td,.panel>.table-responsive>.table-bordered>tbody>tr:first-child>th,.panel>.table-responsive>.table-bordered>thead>tr:first-child>td,.panel>.table-responsive>.table-bordered>thead>tr:first-child>th{border-bottom:0}.panel>.table-bordered>tbody>tr:last-child>td,.panel>.table-bordered>tbody>tr:last-child>th,.panel>.table-bordered>tfoot>tr:last-child>td,.panel>.table-bordered>tfoot>tr:last-child>th,.panel>.table-responsive>.table-bordered>tbody>tr:last-child>td,.panel>.table-responsive>.table-bordered>tbody>tr:last-child>th,.panel>.table-responsive>.table-bordered>tfoot>tr:last-child>td,.panel>.table-responsive>.table-bordered>tfoot>tr:last-child>th{border-bottom:0}.panel>.table-responsive{margin-bottom:0;border:0}.panel-group{margin-bottom:20px}.panel-group .panel{margin-bottom:0;border-radius:4px}.panel-group .panel+.panel{margin-top:5px}.panel-group .panel-heading{border-bottom:0}.panel-group .panel-heading+.panel-collapse>.list-group,.panel-group .panel-heading+.panel-collapse>.panel-body{border-top:1px solid #ddd}.panel-group .panel-footer{border-top:0}.panel-group .panel-footer+.panel-collapse .panel-body{border-bottom:1px solid #ddd}.panel-default{border-color:#ddd}.panel-default>.panel-heading{color:#333;background-color:#f5f5f5;border-color:#ddd}.panel-default>.panel-heading+.panel-collapse>.panel-body{border-top-color:#ddd}.panel-default>.panel-heading .badge{color:#f5f5f5;background-color:#333}.panel-default>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#ddd}.panel-primary{border-color:#337ab7}.panel-primary>.panel-heading{color:#fff;background-color:#337ab7;border-color:#337ab7}.panel-primary>.panel-heading+.panel-collapse>.panel-body{border-top-color:#337ab7}.panel-primary>.panel-heading .badge{color:#337ab7;background-color:#fff}.panel-primary>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#337ab7}.panel-success{border-color:#d6e9c6}.panel-success>.panel-heading{color:#3c763d;background-color:#dff0d8;border-color:#d6e9c6}.panel-success>.panel-heading+.panel-collapse>.panel-body{border-top-color:#d6e9c6}.panel-success>.panel-heading .badge{color:#dff0d8;background-color:#3c763d}.panel-success>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#d6e9c6}.panel-info{border-color:#bce8f1}.panel-info>.panel-heading{color:#31708f;background-color:#d9edf7;border-color:#bce8f1}.panel-info>.panel-heading+.panel-collapse>.panel-body{border-top-color:#bce8f1}.panel-info>.panel-heading .badge{color:#d9edf7;background-color:#31708f}.panel-info>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#bce8f1}.panel-warning{border-color:#faebcc}.panel-warning>.panel-heading{color:#8a6d3b;background-color:#fcf8e3;border-color:#faebcc}.panel-warning>.panel-heading+.panel-collapse>.panel-body{border-top-color:#faebcc}.panel-warning>.panel-heading .badge{color:#fcf8e3;background-color:#8a6d3b}.panel-warning>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#faebcc}.panel-danger{border-color:#ebccd1}.panel-danger>.panel-heading{color:#a94442;background-color:#f2dede;border-color:#ebccd1}.panel-danger>.panel-heading+.panel-collapse>.panel-body{border-top-color:#ebccd1}.panel-danger>.panel-heading .badge{color:#f2dede;background-color:#a94442}.panel-danger>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#ebccd1}.embed-responsive{position:relative;display:block;height:0;padding:0;overflow:hidden}.embed-responsive .embed-responsive-item,.embed-responsive embed,.embed-responsive iframe,.embed-responsive object,.embed-responsive video{position:absolute;top:0;bottom:0;left:0;width:100%;height:100%;border:0}.embed-responsive-16by9{padding-bottom:56.25%}.embed-responsive-4by3{padding-bottom:75%}.well{min-height:20px;padding:19px;margin-bottom:20px;background-color:#f5f5f5;border:1px solid #e3e3e3;border-radius:4px;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.05);box-shadow:inset 0 1px 1px rgba(0,0,0,.05)}.well blockquote{border-color:#ddd;border-color:rgba(0,0,0,.15)}.well-lg{padding:24px;border-radius:6px}.well-sm{padding:9px;border-radius:3px}.close{float:right;font-size:21px;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;filter:alpha(opacity=20);opacity:.2}.close:focus,.close:hover{color:#000;text-decoration:none;cursor:pointer;filter:alpha(opacity=50);opacity:.5}button.close{-webkit-appearance:none;padding:0;cursor:pointer;background:0 0;border:0}.modal-open{overflow:hidden}.modal{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1050;display:none;overflow:hidden;-webkit-overflow-scrolling:touch;outline:0}.modal.fade .modal-dialog{-webkit-transition:-webkit-transform .3s ease-out;-o-transition:-o-transform .3s ease-out;transition:transform .3s ease-out;-webkit-transform:translate(0,-25%);-ms-transform:translate(0,-25%);-o-transform:translate(0,-25%);transform:translate(0,-25%)}.modal.in .modal-dialog{-webkit-transform:translate(0,0);-ms-transform:translate(0,0);-o-transform:translate(0,0);transform:translate(0,0)}.modal-open .modal{overflow-x:hidden;overflow-y:auto}.modal-dialog{position:relative;width:auto;margin:10px}.modal-content{position:relative;background-color:#fff;-webkit-background-clip:padding-box;background-clip:padding-box;border:1px solid #999;border:1px solid rgba(0,0,0,.2);border-radius:6px;outline:0;-webkit-box-shadow:0 3px 9px rgba(0,0,0,.5);box-shadow:0 3px 9px rgba(0,0,0,.5)}.modal-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1040;background-color:#000}.modal-backdrop.fade{filter:alpha(opacity=0);opacity:0}.modal-backdrop.in{filter:alpha(opacity=50);opacity:.5}.modal-header{padding:15px;border-bottom:1px solid #e5e5e5}.modal-header .close{margin-top:-2px}.modal-title{margin:0;line-height:1.42857143}.modal-body{position:relative;padding:15px}.modal-footer{padding:15px;text-align:right;border-top:1px solid #e5e5e5}.modal-footer .btn+.btn{margin-bottom:0;margin-left:5px}.modal-footer .btn-group .btn+.btn{margin-left:-1px}.modal-footer .btn-block+.btn-block{margin-left:0}.modal-scrollbar-measure{position:absolute;top:-9999px;width:50px;height:50px;overflow:scroll}@media (min-width:768px){.modal-dialog{width:600px;margin:30px auto}.modal-content{-webkit-box-shadow:0 5px 15px rgba(0,0,0,.5);box-shadow:0 5px 15px rgba(0,0,0,.5)}.modal-sm{width:300px}}@media (min-width:992px){.modal-lg{width:900px}}.tooltip{position:absolute;z-index:1070;display:block;font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:12px;font-style:normal;font-weight:400;line-height:1.42857143;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;word-wrap:normal;white-space:normal;filter:alpha(opacity=0);opacity:0;line-break:auto}.tooltip.in{filter:alpha(opacity=90);opacity:.9}.tooltip.top{padding:5px 0;margin-top:-3px}.tooltip.right{padding:0 5px;margin-left:3px}.tooltip.bottom{padding:5px 0;margin-top:3px}.tooltip.left{padding:0 5px;margin-left:-3px}.tooltip-inner{max-width:200px;padding:3px 8px;color:#fff;text-align:center;background-color:#000;border-radius:4px}.tooltip-arrow{position:absolute;width:0;height:0;border-color:transparent;border-style:solid}.tooltip.top .tooltip-arrow{bottom:0;left:50%;margin-left:-5px;border-width:5px 5px 0;border-top-color:#000}.tooltip.top-left .tooltip-arrow{right:5px;bottom:0;margin-bottom:-5px;border-width:5px 5px 0;border-top-color:#000}.tooltip.top-right .tooltip-arrow{bottom:0;left:5px;margin-bottom:-5px;border-width:5px 5px 0;border-top-color:#000}.tooltip.right .tooltip-arrow{top:50%;left:0;margin-top:-5px;border-width:5px 5px 5px 0;border-right-color:#000}.tooltip.left .tooltip-arrow{top:50%;right:0;margin-top:-5px;border-width:5px 0 5px 5px;border-left-color:#000}.tooltip.bottom .tooltip-arrow{top:0;left:50%;margin-left:-5px;border-width:0 5px 5px;border-bottom-color:#000}.tooltip.bottom-left .tooltip-arrow{top:0;right:5px;margin-top:-5px;border-width:0 5px 5px;border-bottom-color:#000}.tooltip.bottom-right .tooltip-arrow{top:0;left:5px;margin-top:-5px;border-width:0 5px 5px;border-bottom-color:#000}.popover{position:absolute;top:0;left:0;z-index:1060;display:none;max-width:276px;padding:1px;font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:14px;font-style:normal;font-weight:400;line-height:1.42857143;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;word-wrap:normal;white-space:normal;background-color:#fff;-webkit-background-clip:padding-box;background-clip:padding-box;border:1px solid #ccc;border:1px solid rgba(0,0,0,.2);border-radius:6px;-webkit-box-shadow:0 5px 10px rgba(0,0,0,.2);box-shadow:0 5px 10px rgba(0,0,0,.2);line-break:auto}.popover.top{margin-top:-10px}.popover.right{margin-left:10px}.popover.bottom{margin-top:10px}.popover.left{margin-left:-10px}.popover-title{padding:8px 14px;margin:0;font-size:14px;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-radius:5px 5px 0 0}.popover-content{padding:9px 14px}.popover>.arrow,.popover>.arrow:after{position:absolute;display:block;width:0;height:0;border-color:transparent;border-style:solid}.popover>.arrow{border-width:11px}.popover>.arrow:after{content:"";border-width:10px}.popover.top>.arrow{bottom:-11px;left:50%;margin-left:-11px;border-top-color:#999;border-top-color:rgba(0,0,0,.25);border-bottom-width:0}.popover.top>.arrow:after{bottom:1px;margin-left:-10px;content:" ";border-top-color:#fff;border-bottom-width:0}.popover.right>.arrow{top:50%;left:-11px;margin-top:-11px;border-right-color:#999;border-right-color:rgba(0,0,0,.25);border-left-width:0}.popover.right>.arrow:after{bottom:-10px;left:1px;content:" ";border-right-color:#fff;border-left-width:0}.popover.bottom>.arrow{top:-11px;left:50%;margin-left:-11px;border-top-width:0;border-bottom-color:#999;border-bottom-color:rgba(0,0,0,.25)}.popover.bottom>.arrow:after{top:1px;margin-left:-10px;content:" ";border-top-width:0;border-bottom-color:#fff}.popover.left>.arrow{top:50%;right:-11px;margin-top:-11px;border-right-width:0;border-left-color:#999;border-left-color:rgba(0,0,0,.25)}.popover.left>.arrow:after{right:1px;bottom:-10px;content:" ";border-right-width:0;border-left-color:#fff}.carousel{position:relative}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner>.item{position:relative;display:none;-webkit-transition:.6s ease-in-out left;-o-transition:.6s ease-in-out left;transition:.6s ease-in-out left}.carousel-inner>.item>a>img,.carousel-inner>.item>img{line-height:1}@media all and (transform-3d),(-webkit-transform-3d){.carousel-inner>.item{-webkit-transition:-webkit-transform .6s ease-in-out;-o-transition:-o-transform .6s ease-in-out;transition:transform .6s ease-in-out;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-perspective:1000px;perspective:1000px}.carousel-inner>.item.active.right,.carousel-inner>.item.next{left:0;-webkit-transform:translate3d(100%,0,0);transform:translate3d(100%,0,0)}.carousel-inner>.item.active.left,.carousel-inner>.item.prev{left:0;-webkit-transform:translate3d(-100%,0,0);transform:translate3d(-100%,0,0)}.carousel-inner>.item.active,.carousel-inner>.item.next.left,.carousel-inner>.item.prev.right{left:0;-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}.carousel-inner>.active,.carousel-inner>.next,.carousel-inner>.prev{display:block}.carousel-inner>.active{left:0}.carousel-inner>.next,.carousel-inner>.prev{position:absolute;top:0;width:100%}.carousel-inner>.next{left:100%}.carousel-inner>.prev{left:-100%}.carousel-inner>.next.left,.carousel-inner>.prev.right{left:0}.carousel-inner>.active.left{left:-100%}.carousel-inner>.active.right{left:100%}.carousel-control{position:absolute;top:0;bottom:0;left:0;width:15%;font-size:20px;color:#fff;text-align:center;text-shadow:0 1px 2px rgba(0,0,0,.6);background-color:rgba(0,0,0,0);filter:alpha(opacity=50);opacity:.5}.carousel-control.left{background-image:-webkit-linear-gradient(left,rgba(0,0,0,.5) 0,rgba(0,0,0,.0001) 100%);background-image:-o-linear-gradient(left,rgba(0,0,0,.5) 0,rgba(0,0,0,.0001) 100%);background-image:-webkit-gradient(linear,left top,right top,from(rgba(0,0,0,.5)),to(rgba(0,0,0,.0001)));background-image:linear-gradient(to right,rgba(0,0,0,.5) 0,rgba(0,0,0,.0001) 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#80000000', endColorstr='#00000000', GradientType=1);background-repeat:repeat-x}.carousel-control.right{right:0;left:auto;background-image:-webkit-linear-gradient(left,rgba(0,0,0,.0001) 0,rgba(0,0,0,.5) 100%);background-image:-o-linear-gradient(left,rgba(0,0,0,.0001) 0,rgba(0,0,0,.5) 100%);background-image:-webkit-gradient(linear,left top,right top,from(rgba(0,0,0,.0001)),to(rgba(0,0,0,.5)));background-image:linear-gradient(to right,rgba(0,0,0,.0001) 0,rgba(0,0,0,.5) 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#00000000', endColorstr='#80000000', GradientType=1);background-repeat:repeat-x}.carousel-control:focus,.carousel-control:hover{color:#fff;text-decoration:none;filter:alpha(opacity=90);outline:0;opacity:.9}.carousel-control .glyphicon-chevron-left,.carousel-control .glyphicon-chevron-right,.carousel-control .icon-next,.carousel-control .icon-prev{position:absolute;top:50%;z-index:5;display:inline-block;margin-top:-10px}.carousel-control .glyphicon-chevron-left,.carousel-control .icon-prev{left:50%;margin-left:-10px}.carousel-control .glyphicon-chevron-right,.carousel-control .icon-next{right:50%;margin-right:-10px}.carousel-control .icon-next,.carousel-control .icon-prev{width:20px;height:20px;font-family:serif;line-height:1}.carousel-control .icon-prev:before{content:'\\2039'}.carousel-control .icon-next:before{content:'\\203a'}.carousel-indicators{position:absolute;bottom:10px;left:50%;z-index:15;width:60%;padding-left:0;margin-left:-30%;text-align:center;list-style:none}.carousel-indicators li{display:inline-block;width:10px;height:10px;margin:1px;text-indent:-999px;cursor:pointer;background-color:#000\\9;background-color:rgba(0,0,0,0);border:1px solid #fff;border-radius:10px}.carousel-indicators .active{width:12px;height:12px;margin:0;background-color:#fff}.carousel-caption{position:absolute;right:15%;bottom:20px;left:15%;z-index:10;padding-top:20px;padding-bottom:20px;color:#fff;text-align:center;text-shadow:0 1px 2px rgba(0,0,0,.6)}.carousel-caption .btn{text-shadow:none}@media screen and (min-width:768px){.carousel-control .glyphicon-chevron-left,.carousel-control .glyphicon-chevron-right,.carousel-control .icon-next,.carousel-control .icon-prev{width:30px;height:30px;margin-top:-10px;font-size:30px}.carousel-control .glyphicon-chevron-left,.carousel-control .icon-prev{margin-left:-10px}.carousel-control .glyphicon-chevron-right,.carousel-control .icon-next{margin-right:-10px}.carousel-caption{right:20%;left:20%;padding-bottom:30px}.carousel-indicators{bottom:20px}}.btn-group-vertical>.btn-group:after,.btn-group-vertical>.btn-group:before,.btn-toolbar:after,.btn-toolbar:before,.clearfix:after,.clearfix:before,.container-fluid:after,.container-fluid:before,.container:after,.container:before,.dl-horizontal dd:after,.dl-horizontal dd:before,.form-horizontal .form-group:after,.form-horizontal .form-group:before,.modal-footer:after,.modal-footer:before,.modal-header:after,.modal-header:before,.nav:after,.nav:before,.navbar-collapse:after,.navbar-collapse:before,.navbar-header:after,.navbar-header:before,.navbar:after,.navbar:before,.pager:after,.pager:before,.panel-body:after,.panel-body:before,.row:after,.row:before{display:table;content:" "}.btn-group-vertical>.btn-group:after,.btn-toolbar:after,.clearfix:after,.container-fluid:after,.container:after,.dl-horizontal dd:after,.form-horizontal .form-group:after,.modal-footer:after,.modal-header:after,.nav:after,.navbar-collapse:after,.navbar-header:after,.navbar:after,.pager:after,.panel-body:after,.row:after{clear:both}.center-block{display:block;margin-right:auto;margin-left:auto}.pull-right{float:right!important}.pull-left{float:left!important}.hide{display:none!important}.show{display:block!important}.invisible{visibility:hidden}.text-hide{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.hidden{display:none!important}.affix{position:fixed}@-ms-viewport{width:device-width}.visible-lg,.visible-md,.visible-sm,.visible-xs{display:none!important}.visible-lg-block,.visible-lg-inline,.visible-lg-inline-block,.visible-md-block,.visible-md-inline,.visible-md-inline-block,.visible-sm-block,.visible-sm-inline,.visible-sm-inline-block,.visible-xs-block,.visible-xs-inline,.visible-xs-inline-block{display:none!important}@media (max-width:767px){.visible-xs{display:block!important}table.visible-xs{display:table!important}tr.visible-xs{display:table-row!important}td.visible-xs,th.visible-xs{display:table-cell!important}}@media (max-width:767px){.visible-xs-block{display:block!important}}@media (max-width:767px){.visible-xs-inline{display:inline!important}}@media (max-width:767px){.visible-xs-inline-block{display:inline-block!important}}@media (min-width:768px) and (max-width:991px){.visible-sm{display:block!important}table.visible-sm{display:table!important}tr.visible-sm{display:table-row!important}td.visible-sm,th.visible-sm{display:table-cell!important}}@media (min-width:768px) and (max-width:991px){.visible-sm-block{display:block!important}}@media (min-width:768px) and (max-width:991px){.visible-sm-inline{display:inline!important}}@media (min-width:768px) and (max-width:991px){.visible-sm-inline-block{display:inline-block!important}}@media (min-width:992px) and (max-width:1199px){.visible-md{display:block!important}table.visible-md{display:table!important}tr.visible-md{display:table-row!important}td.visible-md,th.visible-md{display:table-cell!important}}@media (min-width:992px) and (max-width:1199px){.visible-md-block{display:block!important}}@media (min-width:992px) and (max-width:1199px){.visible-md-inline{display:inline!important}}@media (min-width:992px) and (max-width:1199px){.visible-md-inline-block{display:inline-block!important}}@media (min-width:1200px){.visible-lg{display:block!important}table.visible-lg{display:table!important}tr.visible-lg{display:table-row!important}td.visible-lg,th.visible-lg{display:table-cell!important}}@media (min-width:1200px){.visible-lg-block{display:block!important}}@media (min-width:1200px){.visible-lg-inline{display:inline!important}}@media (min-width:1200px){.visible-lg-inline-block{display:inline-block!important}}@media (max-width:767px){.hidden-xs{display:none!important}}@media (min-width:768px) and (max-width:991px){.hidden-sm{display:none!important}}@media (min-width:992px) and (max-width:1199px){.hidden-md{display:none!important}}@media (min-width:1200px){.hidden-lg{display:none!important}}.visible-print{display:none!important}@media print{.visible-print{display:block!important}table.visible-print{display:table!important}tr.visible-print{display:table-row!important}td.visible-print,th.visible-print{display:table-cell!important}}.visible-print-block{display:none!important}@media print{.visible-print-block{display:block!important}}.visible-print-inline{display:none!important}@media print{.visible-print-inline{display:inline!important}}.visible-print-inline-block{display:none!important}@media print{.visible-print-inline-block{display:inline-block!important}}@media print{.hidden-print{display:none!important}}\n", | |
"/*# sourceMappingURL=bootstrap.min.css.map *//*!\n", | |
" * Bootstrap v3.3.7 (http://getbootstrap.com)\n", | |
" * Copyright 2011-2016 Twitter, Inc.\n", | |
" * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)\n", | |
" */.btn-danger,.btn-default,.btn-info,.btn-primary,.btn-success,.btn-warning{text-shadow:0 -1px 0 rgba(0,0,0,.2);-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075)}.btn-danger.active,.btn-danger:active,.btn-default.active,.btn-default:active,.btn-info.active,.btn-info:active,.btn-primary.active,.btn-primary:active,.btn-success.active,.btn-success:active,.btn-warning.active,.btn-warning:active{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125);box-shadow:inset 0 3px 5px rgba(0,0,0,.125)}.btn-danger.disabled,.btn-danger[disabled],.btn-default.disabled,.btn-default[disabled],.btn-info.disabled,.btn-info[disabled],.btn-primary.disabled,.btn-primary[disabled],.btn-success.disabled,.btn-success[disabled],.btn-warning.disabled,.btn-warning[disabled],fieldset[disabled] .btn-danger,fieldset[disabled] .btn-default,fieldset[disabled] .btn-info,fieldset[disabled] .btn-primary,fieldset[disabled] .btn-success,fieldset[disabled] .btn-warning{-webkit-box-shadow:none;box-shadow:none}.btn-danger .badge,.btn-default .badge,.btn-info .badge,.btn-primary .badge,.btn-success .badge,.btn-warning .badge{text-shadow:none}.btn.active,.btn:active{background-image:none}.btn-default{text-shadow:0 1px 0 #fff;background-image:-webkit-linear-gradient(top,#fff 0,#e0e0e0 100%);background-image:-o-linear-gradient(top,#fff 0,#e0e0e0 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#fff),to(#e0e0e0));background-image:linear-gradient(to bottom,#fff 0,#e0e0e0 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff', endColorstr='#ffe0e0e0', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#dbdbdb;border-color:#ccc}.btn-default:focus,.btn-default:hover{background-color:#e0e0e0;background-position:0 -15px}.btn-default.active,.btn-default:active{background-color:#e0e0e0;border-color:#dbdbdb}.btn-default.disabled,.btn-default.disabled.active,.btn-default.disabled.focus,.btn-default.disabled:active,.btn-default.disabled:focus,.btn-default.disabled:hover,.btn-default[disabled],.btn-default[disabled].active,.btn-default[disabled].focus,.btn-default[disabled]:active,.btn-default[disabled]:focus,.btn-default[disabled]:hover,fieldset[disabled] .btn-default,fieldset[disabled] .btn-default.active,fieldset[disabled] .btn-default.focus,fieldset[disabled] .btn-default:active,fieldset[disabled] .btn-default:focus,fieldset[disabled] .btn-default:hover{background-color:#e0e0e0;background-image:none}.btn-primary{background-image:-webkit-linear-gradient(top,#337ab7 0,#265a88 100%);background-image:-o-linear-gradient(top,#337ab7 0,#265a88 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#265a88));background-image:linear-gradient(to bottom,#337ab7 0,#265a88 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff265a88', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#245580}.btn-primary:focus,.btn-primary:hover{background-color:#265a88;background-position:0 -15px}.btn-primary.active,.btn-primary:active{background-color:#265a88;border-color:#245580}.btn-primary.disabled,.btn-primary.disabled.active,.btn-primary.disabled.focus,.btn-primary.disabled:active,.btn-primary.disabled:focus,.btn-primary.disabled:hover,.btn-primary[disabled],.btn-primary[disabled].active,.btn-primary[disabled].focus,.btn-primary[disabled]:active,.btn-primary[disabled]:focus,.btn-primary[disabled]:hover,fieldset[disabled] .btn-primary,fieldset[disabled] .btn-primary.active,fieldset[disabled] .btn-primary.focus,fieldset[disabled] .btn-primary:active,fieldset[disabled] .btn-primary:focus,fieldset[disabled] .btn-primary:hover{background-color:#265a88;background-image:none}.btn-success{background-image:-webkit-linear-gradient(top,#5cb85c 0,#419641 100%);background-image:-o-linear-gradient(top,#5cb85c 0,#419641 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#5cb85c),to(#419641));background-image:linear-gradient(to bottom,#5cb85c 0,#419641 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5cb85c', endColorstr='#ff419641', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#3e8f3e}.btn-success:focus,.btn-success:hover{background-color:#419641;background-position:0 -15px}.btn-success.active,.btn-success:active{background-color:#419641;border-color:#3e8f3e}.btn-success.disabled,.btn-success.disabled.active,.btn-success.disabled.focus,.btn-success.disabled:active,.btn-success.disabled:focus,.btn-success.disabled:hover,.btn-success[disabled],.btn-success[disabled].active,.btn-success[disabled].focus,.btn-success[disabled]:active,.btn-success[disabled]:focus,.btn-success[disabled]:hover,fieldset[disabled] .btn-success,fieldset[disabled] .btn-success.active,fieldset[disabled] .btn-success.focus,fieldset[disabled] .btn-success:active,fieldset[disabled] .btn-success:focus,fieldset[disabled] .btn-success:hover{background-color:#419641;background-image:none}.btn-info{background-image:-webkit-linear-gradient(top,#5bc0de 0,#2aabd2 100%);background-image:-o-linear-gradient(top,#5bc0de 0,#2aabd2 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#5bc0de),to(#2aabd2));background-image:linear-gradient(to bottom,#5bc0de 0,#2aabd2 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5bc0de', endColorstr='#ff2aabd2', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#28a4c9}.btn-info:focus,.btn-info:hover{background-color:#2aabd2;background-position:0 -15px}.btn-info.active,.btn-info:active{background-color:#2aabd2;border-color:#28a4c9}.btn-info.disabled,.btn-info.disabled.active,.btn-info.disabled.focus,.btn-info.disabled:active,.btn-info.disabled:focus,.btn-info.disabled:hover,.btn-info[disabled],.btn-info[disabled].active,.btn-info[disabled].focus,.btn-info[disabled]:active,.btn-info[disabled]:focus,.btn-info[disabled]:hover,fieldset[disabled] .btn-info,fieldset[disabled] .btn-info.active,fieldset[disabled] .btn-info.focus,fieldset[disabled] .btn-info:active,fieldset[disabled] .btn-info:focus,fieldset[disabled] .btn-info:hover{background-color:#2aabd2;background-image:none}.btn-warning{background-image:-webkit-linear-gradient(top,#f0ad4e 0,#eb9316 100%);background-image:-o-linear-gradient(top,#f0ad4e 0,#eb9316 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f0ad4e),to(#eb9316));background-image:linear-gradient(to bottom,#f0ad4e 0,#eb9316 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff0ad4e', endColorstr='#ffeb9316', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#e38d13}.btn-warning:focus,.btn-warning:hover{background-color:#eb9316;background-position:0 -15px}.btn-warning.active,.btn-warning:active{background-color:#eb9316;border-color:#e38d13}.btn-warning.disabled,.btn-warning.disabled.active,.btn-warning.disabled.focus,.btn-warning.disabled:active,.btn-warning.disabled:focus,.btn-warning.disabled:hover,.btn-warning[disabled],.btn-warning[disabled].active,.btn-warning[disabled].focus,.btn-warning[disabled]:active,.btn-warning[disabled]:focus,.btn-warning[disabled]:hover,fieldset[disabled] .btn-warning,fieldset[disabled] .btn-warning.active,fieldset[disabled] .btn-warning.focus,fieldset[disabled] .btn-warning:active,fieldset[disabled] .btn-warning:focus,fieldset[disabled] .btn-warning:hover{background-color:#eb9316;background-image:none}.btn-danger{background-image:-webkit-linear-gradient(top,#d9534f 0,#c12e2a 100%);background-image:-o-linear-gradient(top,#d9534f 0,#c12e2a 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#d9534f),to(#c12e2a));background-image:linear-gradient(to bottom,#d9534f 0,#c12e2a 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffd9534f', endColorstr='#ffc12e2a', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#b92c28}.btn-danger:focus,.btn-danger:hover{background-color:#c12e2a;background-position:0 -15px}.btn-danger.active,.btn-danger:active{background-color:#c12e2a;border-color:#b92c28}.btn-danger.disabled,.btn-danger.disabled.active,.btn-danger.disabled.focus,.btn-danger.disabled:active,.btn-danger.disabled:focus,.btn-danger.disabled:hover,.btn-danger[disabled],.btn-danger[disabled].active,.btn-danger[disabled].focus,.btn-danger[disabled]:active,.btn-danger[disabled]:focus,.btn-danger[disabled]:hover,fieldset[disabled] .btn-danger,fieldset[disabled] .btn-danger.active,fieldset[disabled] .btn-danger.focus,fieldset[disabled] .btn-danger:active,fieldset[disabled] .btn-danger:focus,fieldset[disabled] .btn-danger:hover{background-color:#c12e2a;background-image:none}.img-thumbnail,.thumbnail{-webkit-box-shadow:0 1px 2px rgba(0,0,0,.075);box-shadow:0 1px 2px rgba(0,0,0,.075)}.dropdown-menu>li>a:focus,.dropdown-menu>li>a:hover{background-color:#e8e8e8;background-image:-webkit-linear-gradient(top,#f5f5f5 0,#e8e8e8 100%);background-image:-o-linear-gradient(top,#f5f5f5 0,#e8e8e8 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f5f5f5),to(#e8e8e8));background-image:linear-gradient(to bottom,#f5f5f5 0,#e8e8e8 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff5f5f5', endColorstr='#ffe8e8e8', GradientType=0);background-repeat:repeat-x}.dropdown-menu>.active>a,.dropdown-menu>.active>a:focus,.dropdown-menu>.active>a:hover{background-color:#2e6da4;background-image:-webkit-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-o-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#2e6da4));background-image:linear-gradient(to bottom,#337ab7 0,#2e6da4 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff2e6da4', GradientType=0);background-repeat:repeat-x}.navbar-default{background-image:-webkit-linear-gradient(top,#fff 0,#f8f8f8 100%);background-image:-o-linear-gradient(top,#fff 0,#f8f8f8 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#fff),to(#f8f8f8));background-image:linear-gradient(to bottom,#fff 0,#f8f8f8 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff', endColorstr='#fff8f8f8', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-radius:4px;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 5px rgba(0,0,0,.075);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 5px rgba(0,0,0,.075)}.navbar-default .navbar-nav>.active>a,.navbar-default .navbar-nav>.open>a{background-image:-webkit-linear-gradient(top,#dbdbdb 0,#e2e2e2 100%);background-image:-o-linear-gradient(top,#dbdbdb 0,#e2e2e2 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#dbdbdb),to(#e2e2e2));background-image:linear-gradient(to bottom,#dbdbdb 0,#e2e2e2 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffdbdbdb', endColorstr='#ffe2e2e2', GradientType=0);background-repeat:repeat-x;-webkit-box-shadow:inset 0 3px 9px rgba(0,0,0,.075);box-shadow:inset 0 3px 9px rgba(0,0,0,.075)}.navbar-brand,.navbar-nav>li>a{text-shadow:0 1px 0 rgba(255,255,255,.25)}.navbar-inverse{background-image:-webkit-linear-gradient(top,#3c3c3c 0,#222 100%);background-image:-o-linear-gradient(top,#3c3c3c 0,#222 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#3c3c3c),to(#222));background-image:linear-gradient(to bottom,#3c3c3c 0,#222 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff3c3c3c', endColorstr='#ff222222', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-radius:4px}.navbar-inverse .navbar-nav>.active>a,.navbar-inverse .navbar-nav>.open>a{background-image:-webkit-linear-gradient(top,#080808 0,#0f0f0f 100%);background-image:-o-linear-gradient(top,#080808 0,#0f0f0f 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#080808),to(#0f0f0f));background-image:linear-gradient(to bottom,#080808 0,#0f0f0f 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff080808', endColorstr='#ff0f0f0f', GradientType=0);background-repeat:repeat-x;-webkit-box-shadow:inset 0 3px 9px rgba(0,0,0,.25);box-shadow:inset 0 3px 9px rgba(0,0,0,.25)}.navbar-inverse .navbar-brand,.navbar-inverse .navbar-nav>li>a{text-shadow:0 -1px 0 rgba(0,0,0,.25)}.navbar-fixed-bottom,.navbar-fixed-top,.navbar-static-top{border-radius:0}@media (max-width:767px){.navbar .navbar-nav .open .dropdown-menu>.active>a,.navbar .navbar-nav .open .dropdown-menu>.active>a:focus,.navbar .navbar-nav .open .dropdown-menu>.active>a:hover{color:#fff;background-image:-webkit-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-o-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#2e6da4));background-image:linear-gradient(to bottom,#337ab7 0,#2e6da4 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff2e6da4', GradientType=0);background-repeat:repeat-x}}.alert{text-shadow:0 1px 0 rgba(255,255,255,.2);-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 2px rgba(0,0,0,.05);box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 2px rgba(0,0,0,.05)}.alert-success{background-image:-webkit-linear-gradient(top,#dff0d8 0,#c8e5bc 100%);background-image:-o-linear-gradient(top,#dff0d8 0,#c8e5bc 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#dff0d8),to(#c8e5bc));background-image:linear-gradient(to bottom,#dff0d8 0,#c8e5bc 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffdff0d8', endColorstr='#ffc8e5bc', GradientType=0);background-repeat:repeat-x;border-color:#b2dba1}.alert-info{background-image:-webkit-linear-gradient(top,#d9edf7 0,#b9def0 100%);background-image:-o-linear-gradient(top,#d9edf7 0,#b9def0 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#d9edf7),to(#b9def0));background-image:linear-gradient(to bottom,#d9edf7 0,#b9def0 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffd9edf7', endColorstr='#ffb9def0', GradientType=0);background-repeat:repeat-x;border-color:#9acfea}.alert-warning{background-image:-webkit-linear-gradient(top,#fcf8e3 0,#f8efc0 100%);background-image:-o-linear-gradient(top,#fcf8e3 0,#f8efc0 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#fcf8e3),to(#f8efc0));background-image:linear-gradient(to bottom,#fcf8e3 0,#f8efc0 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fffcf8e3', endColorstr='#fff8efc0', GradientType=0);background-repeat:repeat-x;border-color:#f5e79e}.alert-danger{background-image:-webkit-linear-gradient(top,#f2dede 0,#e7c3c3 100%);background-image:-o-linear-gradient(top,#f2dede 0,#e7c3c3 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f2dede),to(#e7c3c3));background-image:linear-gradient(to bottom,#f2dede 0,#e7c3c3 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff2dede', endColorstr='#ffe7c3c3', GradientType=0);background-repeat:repeat-x;border-color:#dca7a7}.progress{background-image:-webkit-linear-gradient(top,#ebebeb 0,#f5f5f5 100%);background-image:-o-linear-gradient(top,#ebebeb 0,#f5f5f5 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#ebebeb),to(#f5f5f5));background-image:linear-gradient(to bottom,#ebebeb 0,#f5f5f5 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffebebeb', endColorstr='#fff5f5f5', GradientType=0);background-repeat:repeat-x}.progress-bar{background-image:-webkit-linear-gradient(top,#337ab7 0,#286090 100%);background-image:-o-linear-gradient(top,#337ab7 0,#286090 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#286090));background-image:linear-gradient(to bottom,#337ab7 0,#286090 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff286090', GradientType=0);background-repeat:repeat-x}.progress-bar-success{background-image:-webkit-linear-gradient(top,#5cb85c 0,#449d44 100%);background-image:-o-linear-gradient(top,#5cb85c 0,#449d44 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#5cb85c),to(#449d44));background-image:linear-gradient(to bottom,#5cb85c 0,#449d44 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5cb85c', endColorstr='#ff449d44', GradientType=0);background-repeat:repeat-x}.progress-bar-info{background-image:-webkit-linear-gradient(top,#5bc0de 0,#31b0d5 100%);background-image:-o-linear-gradient(top,#5bc0de 0,#31b0d5 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#5bc0de),to(#31b0d5));background-image:linear-gradient(to bottom,#5bc0de 0,#31b0d5 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5bc0de', endColorstr='#ff31b0d5', GradientType=0);background-repeat:repeat-x}.progress-bar-warning{background-image:-webkit-linear-gradient(top,#f0ad4e 0,#ec971f 100%);background-image:-o-linear-gradient(top,#f0ad4e 0,#ec971f 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f0ad4e),to(#ec971f));background-image:linear-gradient(to bottom,#f0ad4e 0,#ec971f 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff0ad4e', endColorstr='#ffec971f', GradientType=0);background-repeat:repeat-x}.progress-bar-danger{background-image:-webkit-linear-gradient(top,#d9534f 0,#c9302c 100%);background-image:-o-linear-gradient(top,#d9534f 0,#c9302c 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#d9534f),to(#c9302c));background-image:linear-gradient(to bottom,#d9534f 0,#c9302c 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffd9534f', endColorstr='#ffc9302c', GradientType=0);background-repeat:repeat-x}.progress-bar-striped{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.list-group{border-radius:4px;-webkit-box-shadow:0 1px 2px rgba(0,0,0,.075);box-shadow:0 1px 2px rgba(0,0,0,.075)}.list-group-item.active,.list-group-item.active:focus,.list-group-item.active:hover{text-shadow:0 -1px 0 #286090;background-image:-webkit-linear-gradient(top,#337ab7 0,#2b669a 100%);background-image:-o-linear-gradient(top,#337ab7 0,#2b669a 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#2b669a));background-image:linear-gradient(to bottom,#337ab7 0,#2b669a 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff2b669a', GradientType=0);background-repeat:repeat-x;border-color:#2b669a}.list-group-item.active .badge,.list-group-item.active:focus .badge,.list-group-item.active:hover .badge{text-shadow:none}.panel{-webkit-box-shadow:0 1px 2px rgba(0,0,0,.05);box-shadow:0 1px 2px rgba(0,0,0,.05)}.panel-default>.panel-heading{background-image:-webkit-linear-gradient(top,#f5f5f5 0,#e8e8e8 100%);background-image:-o-linear-gradient(top,#f5f5f5 0,#e8e8e8 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f5f5f5),to(#e8e8e8));background-image:linear-gradient(to bottom,#f5f5f5 0,#e8e8e8 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff5f5f5', endColorstr='#ffe8e8e8', GradientType=0);background-repeat:repeat-x}.panel-primary>.panel-heading{background-image:-webkit-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-o-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#2e6da4));background-image:linear-gradient(to bottom,#337ab7 0,#2e6da4 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff2e6da4', GradientType=0);background-repeat:repeat-x}.panel-success>.panel-heading{background-image:-webkit-linear-gradient(top,#dff0d8 0,#d0e9c6 100%);background-image:-o-linear-gradient(top,#dff0d8 0,#d0e9c6 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#dff0d8),to(#d0e9c6));background-image:linear-gradient(to bottom,#dff0d8 0,#d0e9c6 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffdff0d8', endColorstr='#ffd0e9c6', GradientType=0);background-repeat:repeat-x}.panel-info>.panel-heading{background-image:-webkit-linear-gradient(top,#d9edf7 0,#c4e3f3 100%);background-image:-o-linear-gradient(top,#d9edf7 0,#c4e3f3 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#d9edf7),to(#c4e3f3));background-image:linear-gradient(to bottom,#d9edf7 0,#c4e3f3 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffd9edf7', endColorstr='#ffc4e3f3', GradientType=0);background-repeat:repeat-x}.panel-warning>.panel-heading{background-image:-webkit-linear-gradient(top,#fcf8e3 0,#faf2cc 100%);background-image:-o-linear-gradient(top,#fcf8e3 0,#faf2cc 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#fcf8e3),to(#faf2cc));background-image:linear-gradient(to bottom,#fcf8e3 0,#faf2cc 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fffcf8e3', endColorstr='#fffaf2cc', GradientType=0);background-repeat:repeat-x}.panel-danger>.panel-heading{background-image:-webkit-linear-gradient(top,#f2dede 0,#ebcccc 100%);background-image:-o-linear-gradient(top,#f2dede 0,#ebcccc 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f2dede),to(#ebcccc));background-image:linear-gradient(to bottom,#f2dede 0,#ebcccc 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff2dede', endColorstr='#ffebcccc', GradientType=0);background-repeat:repeat-x}.well{background-image:-webkit-linear-gradient(top,#e8e8e8 0,#f5f5f5 100%);background-image:-o-linear-gradient(top,#e8e8e8 0,#f5f5f5 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#e8e8e8),to(#f5f5f5));background-image:linear-gradient(to bottom,#e8e8e8 0,#f5f5f5 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffe8e8e8', endColorstr='#fff5f5f5', GradientType=0);background-repeat:repeat-x;border-color:#dcdcdc;-webkit-box-shadow:inset 0 1px 3px rgba(0,0,0,.05),0 1px 0 rgba(255,255,255,.1);box-shadow:inset 0 1px 3px rgba(0,0,0,.05),0 1px 0 rgba(255,255,255,.1)}\n", | |
"/*# sourceMappingURL=bootstrap-theme.min.css.map */ </style><style>body {\n", | |
" padding-top: 80px;\n", | |
"}\n", | |
".content .container-fluid{\n", | |
" margin-left: 20px !important;\n", | |
" margin-right: 20px !important;\n", | |
" margin-bottom: 20px;\n", | |
"}\n", | |
"\n", | |
".page-header{\n", | |
" border:0 !important;\n", | |
"}\n", | |
"\n", | |
".row.variable, .section-items > .row {\n", | |
" border: 1px solid #e1e1e8;\n", | |
" border-top: hidden;\n", | |
"}\n", | |
"\n", | |
".row.spacing{\n", | |
" padding: 2em 1em;\n", | |
"}\n", | |
"\n", | |
".row.header {\n", | |
" border-bottom: 1px solid #e1e1e8;\n", | |
" /*background-color: #f5f5f5;*/\n", | |
" padding-left: 2em;\n", | |
"}\n", | |
"\n", | |
"\n", | |
".dl-horizontal dt {\n", | |
" text-align: left;\n", | |
" padding-right: 1em;\n", | |
" white-space: normal;\n", | |
"}\n", | |
"\n", | |
".dl-horizontal dd {\n", | |
" margin-left: 0;\n", | |
"}\n", | |
"\n", | |
".col-md-12 {\n", | |
" padding-left: 2em;\n", | |
"}\n", | |
"\n", | |
".indent {\n", | |
" margin-left: 1em;\n", | |
"}\n", | |
"\n", | |
".center-img {\n", | |
" margin-left: auto !important;\n", | |
" margin-right: auto !important;\n", | |
" display: block;\n", | |
"}\n", | |
"\n", | |
"/* Table example_values */\n", | |
"table.example_values {\n", | |
" border: 0;\n", | |
"}\n", | |
"\n", | |
".example_values th {\n", | |
" border: 0;\n", | |
" padding: 0;\n", | |
" color: #555;\n", | |
" font-weight: 600;\n", | |
"}\n", | |
"\n", | |
".example_values tr, .example_values td {\n", | |
" border: 0;\n", | |
" padding: 0;\n", | |
" color: #555;\n", | |
"}\n", | |
"\n", | |
"/* STATS */\n", | |
"table.stats, table.sample, table.duplicate{\n", | |
" border: 0;\n", | |
"}\n", | |
"\n", | |
".stats tr, .sample tr, .duplicate tr {\n", | |
" border: 0;\n", | |
"}\n", | |
"\n", | |
".stats th, .stats td{\n", | |
" color: #555;\n", | |
" border: 0;\n", | |
"}\n", | |
"\n", | |
".stats th {\n", | |
" padding: 0 2em 0 0;\n", | |
" font-weight: 600;\n", | |
"}\n", | |
"\n", | |
".stats td {\n", | |
" padding: 1px;\n", | |
"}\n", | |
"\n", | |
"\n", | |
"/* Sample table */\n", | |
"table.sample, table.duplicate{\n", | |
" margin-bottom: 2em;\n", | |
" margin-left: 1em;\n", | |
"}\n", | |
"\n", | |
".sample td, .sample th, .duplicate td, .duplicate th {\n", | |
" padding: 0.5em;\n", | |
" white-space: nowrap;\n", | |
" border: 0;\n", | |
"\n", | |
"}\n", | |
"\n", | |
".sample thead, .duplicate thead {\n", | |
" border-top: 0;\n", | |
" border-bottom: 2px solid #ddd;\n", | |
"}\n", | |
"\n", | |
".sample td, .duplicate td {\n", | |
" width: 100%;\n", | |
"}\n", | |
"\n", | |
"\n", | |
"/* There is no good solution available to make the divs equal height and then center ... */\n", | |
".histogram {\n", | |
" margin-top: 3em;\n", | |
"}\n", | |
"\n", | |
"/* Freq table */\n", | |
"table.freq {\n", | |
" margin-bottom: 2em;\n", | |
" border: 0;\n", | |
"}\n", | |
"\n", | |
"table.freq th, table.freq tr, table.freq td {\n", | |
" border: 0;\n", | |
" padding: 0;\n", | |
"}\n", | |
"\n", | |
".freq thead {\n", | |
" font-weight: 600;\n", | |
" white-space: nowrap;\n", | |
" overflow: hidden;\n", | |
" text-overflow: ellipsis;\n", | |
"\n", | |
"}\n", | |
"\n", | |
"/* Freq mini */\n", | |
".freq.mini td {\n", | |
" width: 50%;\n", | |
" padding: 1px;\n", | |
" font-size: 12px;\n", | |
"\n", | |
"}\n", | |
"\n", | |
"table.freq.mini {\n", | |
" width: 100%;\n", | |
"}\n", | |
"\n", | |
".freq.mini th {\n", | |
" overflow: hidden;\n", | |
" text-overflow: ellipsis;\n", | |
" white-space: nowrap;\n", | |
" max-width: 5em;\n", | |
" font-weight: 400;\n", | |
" text-align: right;\n", | |
" padding-right: 0.5em;\n", | |
"}\n", | |
"\n", | |
"/* Message classes */\n", | |
".missing {\n", | |
" color: #a94442;\n", | |
"}\n", | |
"\n", | |
".alert, .alert > th, .alert > td {\n", | |
" color: #a94442;\n", | |
"}\n", | |
"\n", | |
".ignore {\n", | |
" opacity: 0.4;\n", | |
"}\n", | |
"\n", | |
"/* Bars in tables */\n", | |
".freq.table{\n", | |
" table-layout: fixed;\n", | |
"}\n", | |
"\n", | |
".freq:not(.mini) tr td:nth-child(1), .freq:not(.mini) tr th:nth-child(1){\n", | |
" width: auto;\n", | |
" max-width: none;\n", | |
"\n", | |
" white-space: nowrap;\n", | |
" overflow: hidden;\n", | |
" text-overflow: ellipsis;\n", | |
"}\n", | |
"\n", | |
".freq:not(.mini) tr td:nth-child(2), .freq:not(.mini) tr td:nth-child(3), .freq:not(.mini) tr th:nth-child(2), .freq:not(.mini) tr th:nth-child(3){\n", | |
" width: 100px;\n", | |
" text-align: right;\n", | |
"}\n", | |
".freq:not(.mini) tr td:nth-child(4), .freq:not(.mini) tr th:nth-child(4){\n", | |
" width:200px;\n", | |
"}\n", | |
"\n", | |
".freq .bar {\n", | |
" float: left;\n", | |
" width: 0;\n", | |
" height: 100%;\n", | |
" line-height: 20px;\n", | |
" color: #fff;\n", | |
" text-align: center;\n", | |
" background-color: #337ab7;\n", | |
" border-radius: 3px;\n", | |
" margin-right: 4px;\n", | |
"}\n", | |
"\n", | |
".other .bar {\n", | |
" background-color: #999;\n", | |
"}\n", | |
"\n", | |
".missing .bar {\n", | |
" background-color: #a94442;\n", | |
"}\n", | |
"\n", | |
".tooltip-inner {\n", | |
" width: 100%;\n", | |
" white-space: nowrap;\n", | |
" text-align: left;\n", | |
"}\n", | |
"\n", | |
".extrapadding {\n", | |
" padding: 2em;\n", | |
"}\n", | |
"\n", | |
".variable .h4 {\n", | |
" text-overflow: ellipsis;\n", | |
" display:inline-block;\n", | |
" width: calc(90%); /* The trick is here! */\n", | |
" overflow:hidden;\n", | |
"}\n", | |
"\n", | |
".variable.ignore .h4{\n", | |
" text-decoration: line-through;\n", | |
"}\n", | |
"\n", | |
".table-responsive{\n", | |
" overflow: scroll;\n", | |
" width: 100%;\n", | |
" overflow-y: hidden;\n", | |
"}\n", | |
".img-responsive{\n", | |
" max-width: 99%;\n", | |
"}\n", | |
".footer-text{\n", | |
" padding:20px;\n", | |
"}\n", | |
"\n", | |
"table.list-warnings td{\n", | |
" padding-right:10px;\n", | |
"}\n", | |
"\n", | |
"a.anchor-pos {\n", | |
" display: block;\n", | |
" position: relative;\n", | |
" top: -70px;\n", | |
" visibility: hidden;\n", | |
"}\n", | |
"\n", | |
"a.anchor-pos-variable{\n", | |
" /*top: -70px;*/\n", | |
"}\n", | |
"\n", | |
"#sample-container, #duplicate-container{\n", | |
" overflow: auto;\n", | |
" width: 100%;\n", | |
" overflow-y: hidden;\n", | |
"}\n", | |
"\n", | |
"#overview-content td, #overview-content th{\n", | |
" border-top: 0;\n", | |
" line-height: 1;\n", | |
"}\n", | |
"\n", | |
".variable-description{\n", | |
" color: #777;\n", | |
" font-size: 10pt;\n", | |
" margin-top: 10px;\n", | |
" font-style: italic;\n", | |
"}\n", | |
"\n", | |
"select.multiple{\n", | |
" width: 180px;\n", | |
" height: 500px;\n", | |
" margin: 10px 0;\n", | |
"}\n", | |
"\n", | |
".named-list-item{\n", | |
" padding: 1em;\n", | |
"}\n", | |
"\n", | |
"/* not printing tabs */\n", | |
"@media print {\n", | |
" .tab-content > .tab-pane, .collapse {\n", | |
" display: block !important;\n", | |
" opacity: 1 !important;\n", | |
" visibility: visible !important;\n", | |
" /*page-break-after: always;*/\n", | |
" page-break-after: right;\n", | |
" page-break-before: avoid;\n", | |
" }\n", | |
"\n", | |
" .nav-pills, .nav-tabs, button[data-toggle="collapse"], .mini, .col-sm-3 img {\n", | |
" display:none !important;\n", | |
" }\n", | |
"\n", | |
" a[download="config.yml"]:after {\n", | |
" content: none !important;\n", | |
" }\n", | |
"\n", | |
" .row {\n", | |
" border: 0 !important;\n", | |
" }\n", | |
"}\n", | |
"\n", | |
".text-placeholder {\n", | |
" display: inline-block;\n", | |
" background-color: #444;\n", | |
" height: 12px;\n", | |
" border-radius: 100px;\n", | |
" margin: 5px 0;\n", | |
" min-width: 200px;\n", | |
" opacity: .1;\n", | |
"}</style></head><body><a class=anchor-pos id=top></a><nav class="navbar navbar-default navbar-fixed-top"><div class=container-fluid><div class=navbar-header><button type=button class="navbar-toggle collapsed" data-toggle=collapse data-target=#navbar aria-expanded=false aria-controls=navbar><span class=sr-only>Toggle navigation</span><span class=icon-bar></span><span class=icon-bar></span><span class=icon-bar></span></button><a class="navbar-brand anchor" href=#top>Pandas Profiling Report</a></div><div id=navbar class="navbar-collapse collapse"><ul class="nav navbar-nav navbar-right"><li><a class=anchor href=#overview>Overview</a></li><li><a class=anchor href=#variables-dropdown>Variables</a></li></ul></div></div></nav><div class=content><div class=container><div class="row header"><a class=anchor-pos id=overview></a><h1 class=page-header>Overview</h1></div><div class=section-items><div class="row spacing"><ul class="nav nav-pills" role=tablist><li role=presentation class=active><a href=#overview-dataset_overview aria-controls=overview-dataset_overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#overview-alerts aria-controls=overview-alerts role=tab data-toggle=tab>Alerts <span class=badge>38</span></a></li><li role=presentation><a href=#overview-reproduction aria-controls=overview-reproduction role=tab data-toggle=tab>Reproduction</a></li></ul><div class=tab-content style="padding-top: 10px;"><div role=tabpanel class="tab-pane col-sm-12 active" id=overview-dataset_overview><div class=col-sm-6><p class=h4>Dataset statistics</p><table class="table table-condensed stats"><tbody><tr><th>Number of variables</th><td>81</td></tr><tr><th>Number of observations</th><td>1460</td></tr><tr><th>Missing cells</th><td>6965</td></tr><tr><th>Missing cells (%)</th><td>5.9%</td></tr><tr><th>Total size in memory</th><td>924.0 KiB</td></tr><tr><th>Average record size in memory</th><td>648.1 B</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Variable types</p><table class="table table-condensed stats"><tbody><tr><th>Numeric</th><td>38</td></tr><tr><th>Categorical</th><td>43</td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=overview-alerts><table class="table table-condensed list-warnings"><p class=h4>Alerts</p><tr style=border-top:0><td><a class=anchor href=#pp_var_-4044077858387873843><code>LotFrontage</code></a> has 259 (17.7%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_258406018026027638><code>Alley</code></a> has 1369 (93.8%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_-2858849814570840190><code>BsmtQual</code></a> has 37 (2.5%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_6119403546867449275><code>BsmtCond</code></a> has 37 (2.5%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_-4963924125629159253><code>BsmtExposure</code></a> has 38 (2.6%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_6309851549413161248><code>BsmtFinType1</code></a> has 37 (2.5%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_-1266378276065602033><code>BsmtFinType2</code></a> has 38 (2.6%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_-7805914113439283279><code>FireplaceQu</code></a> has 690 (47.3%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_-9002985155993494212><code>GarageType</code></a> has 81 (5.5%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_-3292606403279478772><code>GarageYrBlt</code></a> has 81 (5.5%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_-3669064606432411652><code>GarageFinish</code></a> has 81 (5.5%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_9099992673762792408><code>GarageQual</code></a> has 81 (5.5%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_1090087254179405539><code>GarageCond</code></a> has 81 (5.5%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_4540491282612095237><code>PoolQC</code></a> has 1453 (99.5%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_1088612784519984643><code>Fence</code></a> has 1179 (80.8%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_-7326731601130060817><code>MiscFeature</code></a> has 1406 (96.3%) missing values </td><td><span class="label label-info">Missing</span></td></tr><tr><td><a class=anchor href=#pp_var_950183101935382672><code>MiscVal</code></a> is highly skewed (γ1 = 24.47679419) </td><td><span class="label label-info">Skewed</span></td></tr><tr><td><a class=anchor href=#pp_var_-721515842184382588><code>Id</code></a> has unique values </td><td><span class="label label-primary">Unique</span></td></tr><tr><td><a class=anchor href=#pp_var_-3866325343024943794><code>MasVnrArea</code></a> has 861 (59.0%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_8224717097615944133><code>BsmtFinSF1</code></a> has 467 (32.0%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_1709302172053000589><code>BsmtFinSF2</code></a> has 1293 (88.6%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_-1327757963434974413><code>BsmtUnfSF</code></a> has 118 (8.1%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_-455834921365763496><code>TotalBsmtSF</code></a> has 37 (2.5%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_8197690633779897473><code>2ndFlrSF</code></a> has 829 (56.8%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_-1362592608856367097><code>LowQualFinSF</code></a> has 1434 (98.2%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_-5973120491352219852><code>BsmtFullBath</code></a> has 856 (58.6%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_-758951824489329411><code>BsmtHalfBath</code></a> has 1378 (94.4%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_-560636293679163672><code>HalfBath</code></a> has 913 (62.5%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_7496303561124392373><code>Fireplaces</code></a> has 690 (47.3%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_4243338361972717254><code>GarageCars</code></a> has 81 (5.5%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_-7710755141285662556><code>GarageArea</code></a> has 81 (5.5%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_-6481823842736707903><code>WoodDeckSF</code></a> has 761 (52.1%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_410831913976555702><code>OpenPorchSF</code></a> has 656 (44.9%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_3982196820091903723><code>EnclosedPorch</code></a> has 1252 (85.8%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_-5001584332437709327><code>3SsnPorch</code></a> has 1436 (98.4%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_4957948012300892599><code>ScreenPorch</code></a> has 1344 (92.1%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_-5608958505286209371><code>PoolArea</code></a> has 1453 (99.5%) zeros </td><td><span class="label label-info">Zeros</span></td></tr><tr><td><a class=anchor href=#pp_var_950183101935382672><code>MiscVal</code></a> has 1408 (96.4%) zeros </td><td><span class="label label-info">Zeros</span></td></tr></table></div><div role=tabpanel class="tab-pane col-sm-12" id=overview-reproduction><div class=col-sm-12><p class=h4>Reproduction</p><table class="table table-condensed stats"><tbody><tr><th>Analysis started</th><td>2022-11-22 14:02:26.169935</td></tr><tr><th>Analysis finished</th><td>2022-11-22 14:02:27.349947</td></tr><tr><th>Duration</th><td>1.18 second</td></tr><tr><th>Software version</th><td><a href=https://github.com/pandas-profiling/pandas-profiling>pandas-profiling v3.4.0</a></td></tr><tr><th>Download configuration</th><td><a download=config.json href="data:text/plain;charset=utf-8,%7B%22title%22%3A%20%22Pandas%20Profiling%20Report%22%2C%20%22dataset%22%3A%20%7B%22description%22%3A%20%22%22%2C%20%22creator%22%3A%20%22%22%2C%20%22author%22%3A%20%22%22%2C%20%22copyright_holder%22%3A%20%22%22%2C%20%22copyright_year%22%3A%20%22%22%2C%20%22url%22%3A%20%22%22%7D%2C%20%22variables%22%3A%20%7B%22descriptions%22%3A%20%7B%7D%7D%2C%20%22infer_dtypes%22%3A%20false%2C%20%22show_variable_description%22%3A%20true%2C%20%22pool_size%22%3A%200%2C%20%22progress_bar%22%3A%20true%2C%20%22vars%22%3A%20%7B%22num%22%3A%20%7B%22quantiles%22%3A%20%5B0.05%2C%200.25%2C%200.5%2C%200.75%2C%200.95%5D%2C%20%22skewness_threshold%22%3A%2020%2C%20%22low_categorical_threshold%22%3A%205%2C%20%22chi_squared_threshold%22%3A%200.0%7D%2C%20%22cat%22%3A%20%7B%22length%22%3A%20false%2C%20%22characters%22%3A%20false%2C%20%22words%22%3A%20false%2C%20%22cardinality_threshold%22%3A%2050%2C%20%22n_obs%22%3A%205%2C%20%22chi_squared_threshold%22%3A%200.0%2C%20%22coerce_str_to_date%22%3A%20false%2C%20%22redact%22%3A%20false%2C%20%22histogram_largest%22%3A%2010%2C%20%22stop_words%22%3A%20%5B%5D%7D%2C%20%22image%22%3A%20%7B%22active%22%3A%20false%2C%20%22exif%22%3A%20false%2C%20%22hash%22%3A%20false%7D%2C%20%22bool%22%3A%20%7B%22n_obs%22%3A%203%2C%20%22mappings%22%3A%20%7B%22t%22%3A%20true%2C%20%22f%22%3A%20false%2C%20%22True%22%3A%20true%2C%20%22False%22%3A%20false%2C%20%22y%22%3A%20true%2C%20%22n%22%3A%20false%7D%7D%2C%20%22path%22%3A%20%7B%22active%22%3A%20false%7D%2C%20%22file%22%3A%20%7B%22active%22%3A%20false%7D%2C%20%22url%22%3A%20%7B%22active%22%3A%20false%7D%2C%20%22timeseries%22%3A%20%7B%22active%22%3A%20false%2C%20%22sortby%22%3A%20null%2C%20%22autocorrelation%22%3A%200.7%2C%20%22lags%22%3A%20%5B1%2C%207%2C%2012%2C%2024%2C%2030%5D%2C%20%22significance%22%3A%200.05%2C%20%22pacf_acf_lag%22%3A%20100%7D%7D%2C%20%22sort%22%3A%20null%2C%20%22missing_diagrams%22%3A%20%7B%22bar%22%3A%20false%2C%20%22matrix%22%3A%20false%2C%20%22heatmap%22%3A%20false%2C%20%22dendrogram%22%3A%20false%7D%2C%20%22correlations%22%3A%20%7B%22pearson%22%3A%20%7B%22key%22%3A%20%22%22%2C%20%22calculate%22%3A%20false%2C%20%22warn_high_correlations%22%3A%201%2C%20%22threshold%22%3A%200.9%2C%20%22n_bins%22%3A%2010%7D%2C%20%22spearman%22%3A%20%7B%22key%22%3A%20%22%22%2C%20%22calculate%22%3A%20false%2C%20%22warn_high_correlations%22%3A%200%2C%20%22threshold%22%3A%200.9%2C%20%22n_bins%22%3A%2010%7D%2C%20%22kendall%22%3A%20%7B%22key%22%3A%20%22%22%2C%20%22calculate%22%3A%20false%2C%20%22warn_high_correlations%22%3A%200%2C%20%22threshold%22%3A%200.9%2C%20%22n_bins%22%3A%2010%7D%2C%20%22phi_k%22%3A%20%7B%22key%22%3A%20%22%22%2C%20%22calculate%22%3A%20false%2C%20%22warn_high_correlations%22%3A%200%2C%20%22threshold%22%3A%200.9%2C%20%22n_bins%22%3A%2010%7D%2C%20%22cramers%22%3A%20%7B%22key%22%3A%20%22%22%2C%20%22calculate%22%3A%20false%2C%20%22warn_high_correlations%22%3A%201%2C%20%22threshold%22%3A%200.9%2C%20%22n_bins%22%3A%2010%7D%2C%20%22auto%22%3A%20%7B%22key%22%3A%20%22%22%2C%20%22calculate%22%3A%20false%2C%20%22warn_high_correlations%22%3A%201%2C%20%22threshold%22%3A%200.9%2C%20%22n_bins%22%3A%2010%7D%7D%2C%20%22interactions%22%3A%20%7B%22continuous%22%3A%20false%2C%20%22targets%22%3A%20%5B%5D%7D%2C%20%22categorical_maximum_correlation_distinct%22%3A%20100%2C%20%22memory_deep%22%3A%20false%2C%20%22plot%22%3A%20%7B%22missing%22%3A%20%7B%22force_labels%22%3A%20true%2C%20%22cmap%22%3A%20%22RdBu%22%7D%2C%20%22image_format%22%3A%20%22svg%22%2C%20%22correlation%22%3A%20%7B%22cmap%22%3A%20%22RdBu%22%2C%20%22bad%22%3A%20%22%23000000%22%7D%2C%20%22dpi%22%3A%20800%2C%20%22histogram%22%3A%20%7B%22bins%22%3A%2050%2C%20%22max_bins%22%3A%20250%2C%20%22x_axis_labels%22%3A%20true%7D%2C%20%22scatter_threshold%22%3A%201000%2C%20%22cat_freq%22%3A%20%7B%22show%22%3A%20true%2C%20%22type%22%3A%20%22bar%22%2C%20%22max_unique%22%3A%2010%2C%20%22colors%22%3A%20null%7D%7D%2C%20%22duplicates%22%3A%20%7B%22head%22%3A%200%2C%20%22key%22%3A%20%22%23%20duplicates%22%7D%2C%20%22samples%22%3A%20%7B%22head%22%3A%200%2C%20%22tail%22%3A%200%2C%20%22random%22%3A%200%7D%2C%20%22reject_variables%22%3A%20true%2C%20%22n_obs_unique%22%3A%205%2C%20%22n_freq_table_max%22%3A%2010%2C%20%22n_extreme_obs%22%3A%205%2C%20%22report%22%3A%20%7B%22precision%22%3A%2010%7D%2C%20%22html%22%3A%20%7B%22style%22%3A%20%7B%22primary_color%22%3A%20%22%23337ab7%22%2C%20%22logo%22%3A%20%22%22%2C%20%22theme%22%3A%20null%7D%2C%20%22navbar_show%22%3A%20true%2C%20%22minify_html%22%3A%20true%2C%20%22use_local_assets%22%3A%20true%2C%20%22inline%22%3A%20true%2C%20%22assets_prefix%22%3A%20null%2C%20%22assets_path%22%3A%20null%2C%20%22full_width%22%3A%20false%7D%2C%20%22notebook%22%3A%20%7B%22iframe%22%3A%20%7B%22height%22%3A%20%22800px%22%2C%20%22width%22%3A%20%22100%25%22%2C%20%22attribute%22%3A%20%22srcdoc%22%7D%7D%7D">config.json</a></td></tr></tbody></table></div></div></div></div></div><div class="row header"><a class=anchor-pos id=variables-dropdown></a><h1 class=page-header>Variables</h1></div><div class=section-items><select name=Variables id=variables-dropdown><option value>Select Columns</option><option value=Id>Id</option><option value=MSSubClass>MSSubClass</option><option value=MSZoning>MSZoning</option><option value=LotFrontage>LotFrontage</option><option value=LotArea>LotArea</option><option value=Street>Street</option><option value=Alley>Alley</option><option value=LotShape>LotShape</option><option value=LandContour>LandContour</option><option value=Utilities>Utilities</option><option value=LotConfig>LotConfig</option><option value=LandSlope>LandSlope</option><option value=Neighborhood>Neighborhood</option><option value=Condition1>Condition1</option><option value=Condition2>Condition2</option><option value=BldgType>BldgType</option><option value=HouseStyle>HouseStyle</option><option value=OverallQual>OverallQual</option><option value=OverallCond>OverallCond</option><option value=YearBuilt>YearBuilt</option><option value=YearRemodAdd>YearRemodAdd</option><option value=RoofStyle>RoofStyle</option><option value=RoofMatl>RoofMatl</option><option value=Exterior1st>Exterior1st</option><option value=Exterior2nd>Exterior2nd</option><option value=MasVnrType>MasVnrType</option><option value=MasVnrArea>MasVnrArea</option><option value=ExterQual>ExterQual</option><option value=ExterCond>ExterCond</option><option value=Foundation>Foundation</option><option value=BsmtQual>BsmtQual</option><option value=BsmtCond>BsmtCond</option><option value=BsmtExposure>BsmtExposure</option><option value=BsmtFinType1>BsmtFinType1</option><option value=BsmtFinSF1>BsmtFinSF1</option><option value=BsmtFinType2>BsmtFinType2</option><option value=BsmtFinSF2>BsmtFinSF2</option><option value=BsmtUnfSF>BsmtUnfSF</option><option value=TotalBsmtSF>TotalBsmtSF</option><option value=Heating>Heating</option><option value=HeatingQC>HeatingQC</option><option value=CentralAir>CentralAir</option><option value=Electrical>Electrical</option><option value=1stFlrSF>1stFlrSF</option><option value=2ndFlrSF>2ndFlrSF</option><option value=LowQualFinSF>LowQualFinSF</option><option value=GrLivArea>GrLivArea</option><option value=BsmtFullBath>BsmtFullBath</option><option value=BsmtHalfBath>BsmtHalfBath</option><option value=FullBath>FullBath</option><option value=HalfBath>HalfBath</option><option value=BedroomAbvGr>BedroomAbvGr</option><option value=KitchenAbvGr>KitchenAbvGr</option><option value=KitchenQual>KitchenQual</option><option value=TotRmsAbvGrd>TotRmsAbvGrd</option><option value=Functional>Functional</option><option value=Fireplaces>Fireplaces</option><option value=FireplaceQu>FireplaceQu</option><option value=GarageType>GarageType</option><option value=GarageYrBlt>GarageYrBlt</option><option value=GarageFinish>GarageFinish</option><option value=GarageCars>GarageCars</option><option value=GarageArea>GarageArea</option><option value=GarageQual>GarageQual</option><option value=GarageCond>GarageCond</option><option value=PavedDrive>PavedDrive</option><option value=WoodDeckSF>WoodDeckSF</option><option value=OpenPorchSF>OpenPorchSF</option><option value=EnclosedPorch>EnclosedPorch</option><option value=3SsnPorch>3SsnPorch</option><option value=ScreenPorch>ScreenPorch</option><option value=PoolArea>PoolArea</option><option value=PoolQC>PoolQC</option><option value=Fence>Fence</option><option value=MiscFeature>MiscFeature</option><option value=MiscVal>MiscVal</option><option value=MoSold>MoSold</option><option value=YrSold>YrSold</option><option value=SaleType>SaleType</option><option value=SaleCondition>SaleCondition</option><option value=SalePrice>SalePrice</option></select><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_-721515842184382588></a><div class=variable><div class=col-sm-3><p class=h4 title=Id><a href=#pp_var_-721515842184382588>Id</a><br><small>Real number (&Ropf;<sub>&ge;0</sub>)</small></p><code>UNIQUE</code><br><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr class=alert><th>Distinct</th><td>1460</td></tr><tr class=alert><th>Distinct (%)</th><td>100.0%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Infinite</th><td>0</td></tr><tr><th>Infinite (%)</th><td>0.0%</td></tr><tr><th>Mean</th><td>730.5</td></tr></tbody></table></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>1</td></tr><tr><th>Maximum</th><td>1460</td></tr><tr><th>Zeros</th><td>0</td></tr><tr><th>Zeros (%)</th><td>0.0%</td></tr><tr><th>Negative</th><td>0</td></tr><tr><th>Negative (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-3><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=162pt version=1.1 viewbox="0 0 216 162" width=216pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 162 \n", | |
"L 216 162 \n", | |
"L 216 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 10.8 117.605515 \n", | |
"L 198.339626 117.605515 \n", | |
"L 198.339626 10.8 \n", | |
"L 10.8 10.8 \n", | |
"z\n", | |
""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
"Q 24.171875 66.40625 20.328125 58.90625 \n", | |
"Q 16.5 51.421875 16.5 36.375 \n", | |
"Q 16.5 21.390625 20.328125 13.890625 \n", | |
"Q 24.171875 6.390625 31.78125 6.390625 \n", | |
"Q 39.453125 6.390625 43.28125 13.890625 \n", | |
"Q 47.125 21.390625 47.125 36.375 \n", | |
"Q 47.125 51.421875 43.28125 58.90625 \n", | |
"Q 39.453125 66.40625 31.78125 66.40625 \n", | |
"z\n", | |
"M 31.78125 74.21875 \n", | |
"Q 44.046875 74.21875 50.515625 64.515625 \n", | |
"Q 56.984375 54.828125 56.984375 36.375 \n", | |
"Q 56.984375 17.96875 50.515625 8.265625 \n", | |
"Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
"Q 6.59375 17.96875 6.59375 36.375 \n", | |
"Q 6.59375 54.828125 13.0625 64.515625 \n", | |
"Q 19.53125 74.21875 31.78125 74.21875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(18.969026 138.503014)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
"L 49.515625 72.90625 \n", | |
"L 49.515625 64.59375 \n", | |
"L 19.828125 64.59375 \n", | |
"L 19.828125 46.734375 \n", | |
"Q 21.96875 47.46875 24.109375 47.828125 \n", | |
"Q 26.265625 48.1875 28.421875 48.1875 \n", | |
"Q 40.625 48.1875 47.75 41.5 \n", | |
"Q 54.890625 34.8125 54.890625 23.390625 \n", | |
"Q 54.890625 11.625 47.5625 5.09375 \n", | |
"Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
"Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
"Q 12.796875 0.140625 7.71875 1.703125 \n", | |
"L 7.71875 11.625 \n", | |
"Q 12.109375 9.234375 16.796875 8.0625 \n", | |
"Q 21.484375 6.890625 26.703125 6.890625 \n", | |
"Q 35.15625 6.890625 40.078125 11.328125 \n", | |
"Q 45.015625 15.765625 45.015625 23.390625 \n", | |
"Q 45.015625 31 40.078125 35.4375 \n", | |
"Q 35.15625 39.890625 26.703125 39.890625 \n", | |
"Q 22.75 39.890625 18.8125 39.015625 \n", | |
"Q 14.890625 38.140625 10.796875 36.28125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(73.797052 145.701361)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(130.424665 149.300534)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><g style=fill:#262626; transform="translate(188.851865 149.300534)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=patch_3><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 19.324528 117.605515 \n", | |
"L 22.73434 117.605515 \n", | |
"L 22.73434 15.885977 \n", | |
"L 19.324528 15.885977 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.73434 117.605515 \n", | |
"L 26.144151 117.605515 \n", | |
"L 26.144151 19.276628 \n", | |
"L 22.73434 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 26.144151 117.605515 \n", | |
"L 29.553963 117.605515 \n", | |
"L 29.553963 19.276628 \n", | |
"L 26.144151 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 29.553963 117.605515 \n", | |
"L 32.963774 117.605515 \n", | |
"L 32.963774 19.276628 \n", | |
"L 29.553963 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 32.963774 117.605515 \n", | |
"L 36.373585 117.605515 \n", | |
"L 36.373585 19.276628 \n", | |
"L 32.963774 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 36.373585 117.605515 \n", | |
"L 39.783397 117.605515 \n", | |
"L 39.783397 15.885977 \n", | |
"L 36.373585 15.885977 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 39.783397 117.605515 \n", | |
"L 43.193208 117.605515 \n", | |
"L 43.193208 19.276628 \n", | |
"L 39.783397 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_10><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 43.193208 117.605515 \n", | |
"L 46.603019 117.605515 \n", | |
"L 46.603019 19.276628 \n", | |
"L 43.193208 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_11><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 46.603019 117.605515 \n", | |
"L 50.012831 117.605515 \n", | |
"L 50.012831 19.276628 \n", | |
"L 46.603019 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_12><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 50.012831 117.605515 \n", | |
"L 53.422642 117.605515 \n", | |
"L 53.422642 19.276628 \n", | |
"L 50.012831 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_13><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 53.422642 117.605515 \n", | |
"L 56.832454 117.605515 \n", | |
"L 56.832454 19.276628 \n", | |
"L 53.422642 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_14><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 56.832454 117.605515 \n", | |
"L 60.242265 117.605515 \n", | |
"L 60.242265 15.885977 \n", | |
"L 56.832454 15.885977 \n", | |
"z\n", | |
""/></g><g id=patch_15><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 60.242265 117.605515 \n", | |
"L 63.652076 117.605515 \n", | |
"L 63.652076 19.276628 \n", | |
"L 60.242265 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_16><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 63.652076 117.605515 \n", | |
"L 67.061888 117.605515 \n", | |
"L 67.061888 19.276628 \n", | |
"L 63.652076 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_17><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 67.061888 117.605515 \n", | |
"L 70.471699 117.605515 \n", | |
"L 70.471699 19.276628 \n", | |
"L 67.061888 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_18><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 70.471699 117.605515 \n", | |
"L 73.881511 117.605515 \n", | |
"L 73.881511 19.276628 \n", | |
"L 70.471699 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_19><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 73.881511 117.605515 \n", | |
"L 77.291322 117.605515 \n", | |
"L 77.291322 15.885977 \n", | |
"L 73.881511 15.885977 \n", | |
"z\n", | |
""/></g><g id=patch_20><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 77.291322 117.605515 \n", | |
"L 80.701133 117.605515 \n", | |
"L 80.701133 19.276628 \n", | |
"L 77.291322 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_21><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 80.701133 117.605515 \n", | |
"L 84.110945 117.605515 \n", | |
"L 84.110945 19.276628 \n", | |
"L 80.701133 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_22><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 84.110945 117.605515 \n", | |
"L 87.520756 117.605515 \n", | |
"L 87.520756 19.276628 \n", | |
"L 84.110945 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_23><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 87.520756 117.605515 \n", | |
"L 90.930567 117.605515 \n", | |
"L 90.930567 19.276628 \n", | |
"L 87.520756 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_24><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 90.930567 117.605515 \n", | |
"L 94.340379 117.605515 \n", | |
"L 94.340379 19.276628 \n", | |
"L 90.930567 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_25><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 94.340379 117.605515 \n", | |
"L 97.75019 117.605515 \n", | |
"L 97.75019 15.885977 \n", | |
"L 94.340379 15.885977 \n", | |
"z\n", | |
""/></g><g id=patch_26><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 97.75019 117.605515 \n", | |
"L 101.160002 117.605515 \n", | |
"L 101.160002 19.276628 \n", | |
"L 97.75019 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_27><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 101.160002 117.605515 \n", | |
"L 104.569813 117.605515 \n", | |
"L 104.569813 19.276628 \n", | |
"L 101.160002 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_28><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 104.569813 117.605515 \n", | |
"L 107.979624 117.605515 \n", | |
"L 107.979624 19.276628 \n", | |
"L 104.569813 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_29><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 107.979624 117.605515 \n", | |
"L 111.389436 117.605515 \n", | |
"L 111.389436 19.276628 \n", | |
"L 107.979624 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_30><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 111.389436 117.605515 \n", | |
"L 114.799247 117.605515 \n", | |
"L 114.799247 15.885977 \n", | |
"L 111.389436 15.885977 \n", | |
"z\n", | |
""/></g><g id=patch_31><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 114.799247 117.605515 \n", | |
"L 118.209058 117.605515 \n", | |
"L 118.209058 19.276628 \n", | |
"L 114.799247 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_32><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 118.209058 117.605515 \n", | |
"L 121.61887 117.605515 \n", | |
"L 121.61887 19.276628 \n", | |
"L 118.209058 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_33><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 121.61887 117.605515 \n", | |
"L 125.028681 117.605515 \n", | |
"L 125.028681 19.276628 \n", | |
"L 121.61887 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_34><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 125.028681 117.605515 \n", | |
"L 128.438493 117.605515 \n", | |
"L 128.438493 19.276628 \n", | |
"L 125.028681 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_35><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 128.438493 117.605515 \n", | |
"L 131.848304 117.605515 \n", | |
"L 131.848304 19.276628 \n", | |
"L 128.438493 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_36><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 131.848304 117.605515 \n", | |
"L 135.258115 117.605515 \n", | |
"L 135.258115 15.885977 \n", | |
"L 131.848304 15.885977 \n", | |
"z\n", | |
""/></g><g id=patch_37><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 135.258115 117.605515 \n", | |
"L 138.667927 117.605515 \n", | |
"L 138.667927 19.276628 \n", | |
"L 135.258115 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_38><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 138.667927 117.605515 \n", | |
"L 142.077738 117.605515 \n", | |
"L 142.077738 19.276628 \n", | |
"L 138.667927 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_39><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 142.077738 117.605515 \n", | |
"L 145.487549 117.605515 \n", | |
"L 145.487549 19.276628 \n", | |
"L 142.077738 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_40><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 145.487549 117.605515 \n", | |
"L 148.897361 117.605515 \n", | |
"L 148.897361 19.276628 \n", | |
"L 145.487549 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_41><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 148.897361 117.605515 \n", | |
"L 152.307172 117.605515 \n", | |
"L 152.307172 15.885977 \n", | |
"L 148.897361 15.885977 \n", | |
"z\n", | |
""/></g><g id=patch_42><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 152.307172 117.605515 \n", | |
"L 155.716984 117.605515 \n", | |
"L 155.716984 19.276628 \n", | |
"L 152.307172 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_43><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 155.716984 117.605515 \n", | |
"L 159.126795 117.605515 \n", | |
"L 159.126795 19.276628 \n", | |
"L 155.716984 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_44><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 159.126795 117.605515 \n", | |
"L 162.536606 117.605515 \n", | |
"L 162.536606 19.276628 \n", | |
"L 159.126795 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_45><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 162.536606 117.605515 \n", | |
"L 165.946418 117.605515 \n", | |
"L 165.946418 19.276628 \n", | |
"L 162.536606 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_46><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 165.946418 117.605515 \n", | |
"L 169.356229 117.605515 \n", | |
"L 169.356229 19.276628 \n", | |
"L 165.946418 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_47><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 169.356229 117.605515 \n", | |
"L 172.76604 117.605515 \n", | |
"L 172.76604 15.885977 \n", | |
"L 169.356229 15.885977 \n", | |
"z\n", | |
""/></g><g id=patch_48><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 172.76604 117.605515 \n", | |
"L 176.175852 117.605515 \n", | |
"L 176.175852 19.276628 \n", | |
"L 172.76604 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_49><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 176.175852 117.605515 \n", | |
"L 179.585663 117.605515 \n", | |
"L 179.585663 19.276628 \n", | |
"L 176.175852 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_50><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 179.585663 117.605515 \n", | |
"L 182.995475 117.605515 \n", | |
"L 182.995475 19.276628 \n", | |
"L 179.585663 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_51><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 182.995475 117.605515 \n", | |
"L 186.405286 117.605515 \n", | |
"L 186.405286 19.276628 \n", | |
"L 182.995475 19.276628 \n", | |
"z\n", | |
""/></g><g id=patch_52><path clip-path=url(#p9109b0b9ed) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 186.405286 117.605515 \n", | |
"L 189.815097 117.605515 \n", | |
"L 189.815097 15.885977 \n", | |
"L 186.405286 15.885977 \n", | |
"z\n", | |
""/></g><g id=patch_53><path style=fill:none; d="M 10.8 117.605515 \n", | |
"L 10.8 10.8 \n", | |
""/></g><g id=patch_54><path style=fill:none; d="M 198.339626 117.605515 \n", | |
"L 198.339626 10.8 \n", | |
""/></g><g id=patch_55><path style=fill:none; d="M 10.8 117.605515 \n", | |
"L 198.339626 117.605515 \n", | |
""/></g><g id=patch_56><path style=fill:none; d="M 10.8 10.8 \n", | |
"L 198.339626 10.8 \n", | |
""/></g></g></g><defs><clippath id=p9109b0b9ed><rect height=106.805515 width=187.539626 x=10.8 y=10.8 /></clippath></defs></svg></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom--721515842184382588, #minifreqtable-721515842184382588" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom--721515842184382588 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-721515842184382588bottom--721515842184382588statistics aria-controls=-721515842184382588bottom--721515842184382588statistics role=tab data-toggle=tab>Statistics</a></li><li role=presentation><a href=#-721515842184382588bottom--721515842184382588histogram aria-controls=-721515842184382588bottom--721515842184382588histogram role=tab data-toggle=tab>Histogram</a></li><li role=presentation><a href=#-721515842184382588bottom--721515842184382588common_values aria-controls=-721515842184382588bottom--721515842184382588common_values role=tab data-toggle=tab>Common values</a></li><li role=presentation><a href=#-721515842184382588bottom--721515842184382588extreme_values aria-controls=-721515842184382588bottom--721515842184382588extreme_values role=tab data-toggle=tab>Extreme values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-721515842184382588bottom--721515842184382588statistics><div class=col-sm-6><p class=h4>Quantile statistics</p><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>1</td></tr><tr><th>5-th percentile</th><td>73.95</td></tr><tr><th>Q1</th><td>365.75</td></tr><tr><th>median</th><td>730.5</td></tr><tr><th>Q3</th><td>1095.25</td></tr><tr><th>95-th percentile</th><td>1387.05</td></tr><tr><th>Maximum</th><td>1460</td></tr><tr><th>Range</th><td>1459</td></tr><tr><th>Interquartile range (IQR)</th><td>729.5</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Descriptive statistics</p><table class="table table-condensed stats"><tbody><tr><th>Standard deviation</th><td>421.6100094</td></tr><tr><th>Coefficient of variation (CV)</th><td>0.577152648</td></tr><tr><th>Kurtosis</th><td>-1.2</td></tr><tr><th>Mean</th><td>730.5</td></tr><tr><th>Median Absolute Deviation (MAD)</th><td>365</td></tr><tr><th>Skewness</th><td>0</td></tr><tr><th>Sum</th><td>1066530</td></tr><tr><th>Variance</th><td>177755</td></tr><tr><th>Monotonicity</th><td>Strictly increasing</td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-721515842184382588bottom--721515842184382588histogram><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
"L 432 288 \n", | |
"L 432 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 50.55 239.274486 \n", | |
"L 421.2 239.274486 \n", | |
"L 421.2 10.8 \n", | |
"L 50.55 10.8 \n", | |
"z\n", | |
""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
"Q 24.171875 66.40625 20.328125 58.90625 \n", | |
"Q 16.5 51.421875 16.5 36.375 \n", | |
"Q 16.5 21.390625 20.328125 13.890625 \n", | |
"Q 24.171875 6.390625 31.78125 6.390625 \n", | |
"Q 39.453125 6.390625 43.28125 13.890625 \n", | |
"Q 47.125 21.390625 47.125 36.375 \n", | |
"Q 47.125 51.421875 43.28125 58.90625 \n", | |
"Q 39.453125 66.40625 31.78125 66.40625 \n", | |
"z\n", | |
"M 31.78125 74.21875 \n", | |
"Q 44.046875 74.21875 50.515625 64.515625 \n", | |
"Q 56.984375 54.828125 56.984375 36.375 \n", | |
"Q 56.984375 17.96875 50.515625 8.265625 \n", | |
"Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
"Q 6.59375 17.96875 6.59375 36.375 \n", | |
"Q 6.59375 54.828125 13.0625 64.515625 \n", | |
"Q 19.53125 74.21875 31.78125 74.21875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(66.868468 262.14636)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(108.559294 271.144293)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
"L 12.890625 25.390625 \n", | |
"L 37.796875 25.390625 \n", | |
"z\n", | |
"M 35.203125 72.90625 \n", | |
"L 47.609375 72.90625 \n", | |
"L 47.609375 25.390625 \n", | |
"L 58.015625 25.390625 \n", | |
"L 58.015625 17.1875 \n", | |
"L 47.609375 17.1875 \n", | |
"L 47.609375 0 \n", | |
"L 37.796875 0 \n", | |
"L 37.796875 17.1875 \n", | |
"L 4.890625 17.1875 \n", | |
"L 4.890625 26.703125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(154.749088 271.144293)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
"Q 26.375 40.375 22.484375 35.828125 \n", | |
"Q 18.609375 31.296875 18.609375 23.390625 \n", | |
"Q 18.609375 15.53125 22.484375 10.953125 \n", | |
"Q 26.375 6.390625 33.015625 6.390625 \n", | |
"Q 39.65625 6.390625 43.53125 10.953125 \n", | |
"Q 47.40625 15.53125 47.40625 23.390625 \n", | |
"Q 47.40625 31.296875 43.53125 35.828125 \n", | |
"Q 39.65625 40.375 33.015625 40.375 \n", | |
"z\n", | |
"M 52.59375 71.296875 \n", | |
"L 52.59375 62.3125 \n", | |
"Q 48.875 64.0625 45.09375 64.984375 \n", | |
"Q 41.3125 65.921875 37.59375 65.921875 \n", | |
"Q 27.828125 65.921875 22.671875 59.328125 \n", | |
"Q 17.53125 52.734375 16.796875 39.40625 \n", | |
"Q 19.671875 43.65625 24.015625 45.921875 \n", | |
"Q 28.375 48.1875 33.59375 48.1875 \n", | |
"Q 44.578125 48.1875 50.953125 41.515625 \n", | |
"Q 57.328125 34.859375 57.328125 23.390625 \n", | |
"Q 57.328125 12.15625 50.6875 5.359375 \n", | |
"Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
"Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
"Q 6.984375 17.96875 6.984375 36.375 \n", | |
"Q 6.984375 53.65625 15.1875 63.9375 \n", | |
"Q 23.390625 74.21875 37.203125 74.21875 \n", | |
"Q 40.921875 74.21875 44.703125 73.484375 \n", | |
"Q 48.484375 72.75 52.59375 71.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(200.938882 271.144293)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-54 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-56 d="M 31.78125 34.625 \n", | |
"Q 24.75 34.625 20.71875 30.859375 \n", | |
"Q 16.703125 27.09375 16.703125 20.515625 \n", | |
"Q 16.703125 13.921875 20.71875 10.15625 \n", | |
"Q 24.75 6.390625 31.78125 6.390625 \n", | |
"Q 38.8125 6.390625 42.859375 10.171875 \n", | |
"Q 46.921875 13.96875 46.921875 20.515625 \n", | |
"Q 46.921875 27.09375 42.890625 30.859375 \n", | |
"Q 38.875 34.625 31.78125 34.625 \n", | |
"z\n", | |
"M 21.921875 38.8125 \n", | |
"Q 15.578125 40.375 12.03125 44.71875 \n", | |
"Q 8.5 49.078125 8.5 55.328125 \n", | |
"Q 8.5 64.0625 14.71875 69.140625 \n", | |
"Q 20.953125 74.21875 31.78125 74.21875 \n", | |
"Q 42.671875 74.21875 48.875 69.140625 \n", | |
"Q 55.078125 64.0625 55.078125 55.328125 \n", | |
"Q 55.078125 49.078125 51.53125 44.71875 \n", | |
"Q 48 40.375 41.703125 38.8125 \n", | |
"Q 48.828125 37.15625 52.796875 32.3125 \n", | |
"Q 56.78125 27.484375 56.78125 20.515625 \n", | |
"Q 56.78125 9.90625 50.3125 4.234375 \n", | |
"Q 43.84375 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.734375 -1.421875 13.25 4.234375 \n", | |
"Q 6.78125 9.90625 6.78125 20.515625 \n", | |
"Q 6.78125 27.484375 10.78125 32.3125 \n", | |
"Q 14.796875 37.15625 21.921875 38.8125 \n", | |
"z\n", | |
"M 18.3125 54.390625 \n", | |
"Q 18.3125 48.734375 21.84375 45.5625 \n", | |
"Q 25.390625 42.390625 31.78125 42.390625 \n", | |
"Q 38.140625 42.390625 41.71875 45.5625 \n", | |
"Q 45.3125 48.734375 45.3125 54.390625 \n", | |
"Q 45.3125 60.0625 41.71875 63.234375 \n", | |
"Q 38.140625 66.40625 31.78125 66.40625 \n", | |
"Q 25.390625 66.40625 21.84375 63.234375 \n", | |
"Q 18.3125 60.0625 18.3125 54.390625 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(247.128676 271.144293)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-56 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_6><g id=text_6><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(291.068986 275.64326)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_7><g id=text_7><g style=fill:#262626; transform="translate(337.25878 275.64326)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-50 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_8><g id=text_8><g style=fill:#262626; transform="translate(383.448574 275.64326)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-52 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_9><g style=fill:#262626; transform="translate(31.1875 243.073705)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_10><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
"L 49.515625 72.90625 \n", | |
"L 49.515625 64.59375 \n", | |
"L 19.828125 64.59375 \n", | |
"L 19.828125 46.734375 \n", | |
"Q 21.96875 47.46875 24.109375 47.828125 \n", | |
"Q 26.265625 48.1875 28.421875 48.1875 \n", | |
"Q 40.625 48.1875 47.75 41.5 \n", | |
"Q 54.890625 34.8125 54.890625 23.390625 \n", | |
"Q 54.890625 11.625 47.5625 5.09375 \n", | |
"Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
"Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
"Q 12.796875 0.140625 7.71875 1.703125 \n", | |
"L 7.71875 11.625 \n", | |
"Q 12.109375 9.234375 16.796875 8.0625 \n", | |
"Q 21.484375 6.890625 26.703125 6.890625 \n", | |
"Q 35.15625 6.890625 40.078125 11.328125 \n", | |
"Q 45.015625 15.765625 45.015625 23.390625 \n", | |
"Q 45.015625 31 40.078125 35.4375 \n", | |
"Q 35.15625 39.890625 26.703125 39.890625 \n", | |
"Q 22.75 39.890625 18.8125 39.015625 \n", | |
"Q 14.890625 38.140625 10.796875 36.28125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(31.1875 206.807913)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /></g></g></g><g id=ytick_3><g id=text_11><g style=fill:#262626; transform="translate(24.825 170.542122)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_12><g style=fill:#262626; transform="translate(24.825 134.27633)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /></g></g></g><g id=ytick_5><g id=text_13><g style=fill:#262626; transform="translate(24.825 98.010539)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_6><g id=text_14><g style=fill:#262626; transform="translate(24.825 61.744748)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-53 /></g></g></g><g id=ytick_7><g id=text_15><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
"Q 47.65625 37.796875 51.625 33 \n", | |
"Q 55.609375 28.21875 55.609375 21.1875 \n", | |
"Q 55.609375 10.40625 48.1875 4.484375 \n", | |
"Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
"Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
"Q 12.796875 0.390625 7.625 2.203125 \n", | |
"L 7.625 11.71875 \n", | |
"Q 11.71875 9.328125 16.59375 8.109375 \n", | |
"Q 21.484375 6.890625 26.8125 6.890625 \n", | |
"Q 36.078125 6.890625 40.9375 10.546875 \n", | |
"Q 45.796875 14.203125 45.796875 21.1875 \n", | |
"Q 45.796875 27.640625 41.28125 31.265625 \n", | |
"Q 36.765625 34.90625 28.71875 34.90625 \n", | |
"L 20.21875 34.90625 \n", | |
"L 20.21875 43.015625 \n", | |
"L 29.109375 43.015625 \n", | |
"Q 36.375 43.015625 40.234375 45.921875 \n", | |
"Q 44.09375 48.828125 44.09375 54.296875 \n", | |
"Q 44.09375 59.90625 40.109375 62.90625 \n", | |
"Q 36.140625 65.921875 28.71875 65.921875 \n", | |
"Q 24.65625 65.921875 20.015625 65.03125 \n", | |
"Q 15.375 64.15625 9.8125 62.3125 \n", | |
"L 9.8125 71.09375 \n", | |
"Q 15.4375 72.65625 20.34375 73.4375 \n", | |
"Q 25.25 74.21875 29.59375 74.21875 \n", | |
"Q 40.828125 74.21875 47.359375 69.109375 \n", | |
"Q 53.90625 64.015625 53.90625 55.328125 \n", | |
"Q 53.90625 49.265625 50.4375 45.09375 \n", | |
"Q 46.96875 40.921875 40.578125 39.3125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(24.825 25.478956)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-51 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_16><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
"L 51.703125 72.90625 \n", | |
"L 51.703125 64.59375 \n", | |
"L 19.671875 64.59375 \n", | |
"L 19.671875 43.109375 \n", | |
"L 48.578125 43.109375 \n", | |
"L 48.578125 34.8125 \n", | |
"L 19.671875 34.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
"Q 39.59375 47.171875 37.8125 47.578125 \n", | |
"Q 36.03125 48 33.890625 48 \n", | |
"Q 26.265625 48 22.1875 43.046875 \n", | |
"Q 18.109375 38.09375 18.109375 28.8125 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 20.953125 51.171875 25.484375 53.578125 \n", | |
"Q 30.03125 56 36.53125 56 \n", | |
"Q 37.453125 56 38.578125 55.875 \n", | |
"Q 39.703125 55.765625 41.0625 55.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
"Q 14.796875 17.390625 18.875 11.75 \n", | |
"Q 22.953125 6.109375 30.078125 6.109375 \n", | |
"Q 37.203125 6.109375 41.296875 11.75 \n", | |
"Q 45.40625 17.390625 45.40625 27.296875 \n", | |
"Q 45.40625 37.203125 41.296875 42.84375 \n", | |
"Q 37.203125 48.484375 30.078125 48.484375 \n", | |
"Q 22.953125 48.484375 18.875 42.84375 \n", | |
"Q 14.796875 37.203125 14.796875 27.296875 \n", | |
"z\n", | |
"M 45.40625 8.203125 \n", | |
"Q 42.578125 3.328125 38.25 0.953125 \n", | |
"Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
"Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
"Q 5.515625 14.40625 5.515625 27.296875 \n", | |
"Q 5.515625 40.1875 11.734375 48.09375 \n", | |
"Q 17.96875 56 27.875 56 \n", | |
"Q 33.9375 56 38.25 53.625 \n", | |
"Q 42.578125 51.265625 45.40625 46.390625 \n", | |
"L 45.40625 54.6875 \n", | |
"L 54.390625 54.6875 \n", | |
"L 54.390625 -20.796875 \n", | |
"L 45.40625 -20.796875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
"L 8.5 54.6875 \n", | |
"L 17.484375 54.6875 \n", | |
"L 17.484375 21.921875 \n", | |
"Q 17.484375 14.15625 20.5 10.265625 \n", | |
"Q 23.53125 6.390625 29.59375 6.390625 \n", | |
"Q 36.859375 6.390625 41.078125 11.03125 \n", | |
"Q 45.3125 15.671875 45.3125 23.6875 \n", | |
"L 45.3125 54.6875 \n", | |
"L 54.296875 54.6875 \n", | |
"L 54.296875 0 \n", | |
"L 45.3125 0 \n", | |
"L 45.3125 8.40625 \n", | |
"Q 42.046875 3.421875 37.71875 1 \n", | |
"Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
"Q 18.265625 -1.421875 13.375 4.4375 \n", | |
"Q 8.5 10.296875 8.5 21.578125 \n", | |
"z\n", | |
"M 31.109375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
"L 54.890625 0 \n", | |
"L 45.90625 0 \n", | |
"L 45.90625 32.71875 \n", | |
"Q 45.90625 40.484375 42.875 44.328125 \n", | |
"Q 39.84375 48.1875 33.796875 48.1875 \n", | |
"Q 26.515625 48.1875 22.3125 43.546875 \n", | |
"Q 18.109375 38.921875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.34375 51.125 25.703125 53.5625 \n", | |
"Q 30.078125 56 35.796875 56 \n", | |
"Q 45.21875 56 50.046875 50.171875 \n", | |
"Q 54.890625 44.34375 54.890625 33.015625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
"L 48.78125 44.1875 \n", | |
"Q 44.96875 46.296875 41.140625 47.34375 \n", | |
"Q 37.3125 48.390625 33.40625 48.390625 \n", | |
"Q 24.65625 48.390625 19.8125 42.84375 \n", | |
"Q 14.984375 37.3125 14.984375 27.296875 \n", | |
"Q 14.984375 17.28125 19.8125 11.734375 \n", | |
"Q 24.65625 6.203125 33.40625 6.203125 \n", | |
"Q 37.3125 6.203125 41.140625 7.25 \n", | |
"Q 44.96875 8.296875 48.78125 10.40625 \n", | |
"L 48.78125 2.09375 \n", | |
"Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
"Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
"Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
"Q 5.515625 14.109375 5.515625 27.296875 \n", | |
"Q 5.515625 40.671875 12.859375 48.328125 \n", | |
"Q 20.21875 56 33.015625 56 \n", | |
"Q 37.15625 56 41.109375 55.140625 \n", | |
"Q 45.0625 54.296875 48.78125 52.59375 \n", | |
"z\n", | |
""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
"Q 28.375 -14.84375 24.75 -17.8125 \n", | |
"Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
"L 7.90625 -20.796875 \n", | |
"L 7.90625 -13.28125 \n", | |
"L 13.1875 -13.28125 \n", | |
"Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
"Q 21 -9.765625 23.484375 -3.21875 \n", | |
"L 25.09375 0.875 \n", | |
"L 2.984375 54.6875 \n", | |
"L 12.5 54.6875 \n", | |
"L 29.59375 11.921875 \n", | |
"L 46.6875 54.6875 \n", | |
"L 56.203125 54.6875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(18.537344 153.449899)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 67.397727 239.274486 \n", | |
"L 74.136818 239.274486 \n", | |
"L 74.136818 21.679737 \n", | |
"L 67.397727 21.679737 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 74.136818 239.274486 \n", | |
"L 80.875909 239.274486 \n", | |
"L 80.875909 28.932896 \n", | |
"L 74.136818 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 80.875909 239.274486 \n", | |
"L 87.615 239.274486 \n", | |
"L 87.615 28.932896 \n", | |
"L 80.875909 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 87.615 239.274486 \n", | |
"L 94.354091 239.274486 \n", | |
"L 94.354091 28.932896 \n", | |
"L 87.615 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 94.354091 239.274486 \n", | |
"L 101.093182 239.274486 \n", | |
"L 101.093182 28.932896 \n", | |
"L 94.354091 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 101.093182 239.274486 \n", | |
"L 107.832273 239.274486 \n", | |
"L 107.832273 21.679737 \n", | |
"L 101.093182 21.679737 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 107.832273 239.274486 \n", | |
"L 114.571364 239.274486 \n", | |
"L 114.571364 28.932896 \n", | |
"L 107.832273 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_10><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 114.571364 239.274486 \n", | |
"L 121.310455 239.274486 \n", | |
"L 121.310455 28.932896 \n", | |
"L 114.571364 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_11><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 121.310455 239.274486 \n", | |
"L 128.049545 239.274486 \n", | |
"L 128.049545 28.932896 \n", | |
"L 121.310455 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_12><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 128.049545 239.274486 \n", | |
"L 134.788636 239.274486 \n", | |
"L 134.788636 28.932896 \n", | |
"L 128.049545 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_13><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 134.788636 239.274486 \n", | |
"L 141.527727 239.274486 \n", | |
"L 141.527727 28.932896 \n", | |
"L 134.788636 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_14><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 141.527727 239.274486 \n", | |
"L 148.266818 239.274486 \n", | |
"L 148.266818 21.679737 \n", | |
"L 141.527727 21.679737 \n", | |
"z\n", | |
""/></g><g id=patch_15><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 148.266818 239.274486 \n", | |
"L 155.005909 239.274486 \n", | |
"L 155.005909 28.932896 \n", | |
"L 148.266818 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_16><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 155.005909 239.274486 \n", | |
"L 161.745 239.274486 \n", | |
"L 161.745 28.932896 \n", | |
"L 155.005909 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_17><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 161.745 239.274486 \n", | |
"L 168.484091 239.274486 \n", | |
"L 168.484091 28.932896 \n", | |
"L 161.745 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_18><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 168.484091 239.274486 \n", | |
"L 175.223182 239.274486 \n", | |
"L 175.223182 28.932896 \n", | |
"L 168.484091 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_19><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 175.223182 239.274486 \n", | |
"L 181.962273 239.274486 \n", | |
"L 181.962273 21.679737 \n", | |
"L 175.223182 21.679737 \n", | |
"z\n", | |
""/></g><g id=patch_20><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 181.962273 239.274486 \n", | |
"L 188.701364 239.274486 \n", | |
"L 188.701364 28.932896 \n", | |
"L 181.962273 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_21><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 188.701364 239.274486 \n", | |
"L 195.440455 239.274486 \n", | |
"L 195.440455 28.932896 \n", | |
"L 188.701364 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_22><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 195.440455 239.274486 \n", | |
"L 202.179545 239.274486 \n", | |
"L 202.179545 28.932896 \n", | |
"L 195.440455 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_23><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 202.179545 239.274486 \n", | |
"L 208.918636 239.274486 \n", | |
"L 208.918636 28.932896 \n", | |
"L 202.179545 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_24><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 208.918636 239.274486 \n", | |
"L 215.657727 239.274486 \n", | |
"L 215.657727 28.932896 \n", | |
"L 208.918636 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_25><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 215.657727 239.274486 \n", | |
"L 222.396818 239.274486 \n", | |
"L 222.396818 21.679737 \n", | |
"L 215.657727 21.679737 \n", | |
"z\n", | |
""/></g><g id=patch_26><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 222.396818 239.274486 \n", | |
"L 229.135909 239.274486 \n", | |
"L 229.135909 28.932896 \n", | |
"L 222.396818 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_27><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 229.135909 239.274486 \n", | |
"L 235.875 239.274486 \n", | |
"L 235.875 28.932896 \n", | |
"L 229.135909 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_28><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 235.875 239.274486 \n", | |
"L 242.614091 239.274486 \n", | |
"L 242.614091 28.932896 \n", | |
"L 235.875 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_29><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 242.614091 239.274486 \n", | |
"L 249.353182 239.274486 \n", | |
"L 249.353182 28.932896 \n", | |
"L 242.614091 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_30><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 249.353182 239.274486 \n", | |
"L 256.092273 239.274486 \n", | |
"L 256.092273 21.679737 \n", | |
"L 249.353182 21.679737 \n", | |
"z\n", | |
""/></g><g id=patch_31><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 256.092273 239.274486 \n", | |
"L 262.831364 239.274486 \n", | |
"L 262.831364 28.932896 \n", | |
"L 256.092273 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_32><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 262.831364 239.274486 \n", | |
"L 269.570455 239.274486 \n", | |
"L 269.570455 28.932896 \n", | |
"L 262.831364 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_33><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 269.570455 239.274486 \n", | |
"L 276.309545 239.274486 \n", | |
"L 276.309545 28.932896 \n", | |
"L 269.570455 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_34><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 276.309545 239.274486 \n", | |
"L 283.048636 239.274486 \n", | |
"L 283.048636 28.932896 \n", | |
"L 276.309545 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_35><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 283.048636 239.274486 \n", | |
"L 289.787727 239.274486 \n", | |
"L 289.787727 28.932896 \n", | |
"L 283.048636 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_36><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 289.787727 239.274486 \n", | |
"L 296.526818 239.274486 \n", | |
"L 296.526818 21.679737 \n", | |
"L 289.787727 21.679737 \n", | |
"z\n", | |
""/></g><g id=patch_37><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 296.526818 239.274486 \n", | |
"L 303.265909 239.274486 \n", | |
"L 303.265909 28.932896 \n", | |
"L 296.526818 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_38><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 303.265909 239.274486 \n", | |
"L 310.005 239.274486 \n", | |
"L 310.005 28.932896 \n", | |
"L 303.265909 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_39><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 310.005 239.274486 \n", | |
"L 316.744091 239.274486 \n", | |
"L 316.744091 28.932896 \n", | |
"L 310.005 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_40><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 316.744091 239.274486 \n", | |
"L 323.483182 239.274486 \n", | |
"L 323.483182 28.932896 \n", | |
"L 316.744091 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_41><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 323.483182 239.274486 \n", | |
"L 330.222273 239.274486 \n", | |
"L 330.222273 21.679737 \n", | |
"L 323.483182 21.679737 \n", | |
"z\n", | |
""/></g><g id=patch_42><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 330.222273 239.274486 \n", | |
"L 336.961364 239.274486 \n", | |
"L 336.961364 28.932896 \n", | |
"L 330.222273 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_43><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 336.961364 239.274486 \n", | |
"L 343.700455 239.274486 \n", | |
"L 343.700455 28.932896 \n", | |
"L 336.961364 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_44><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 343.700455 239.274486 \n", | |
"L 350.439545 239.274486 \n", | |
"L 350.439545 28.932896 \n", | |
"L 343.700455 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_45><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 350.439545 239.274486 \n", | |
"L 357.178636 239.274486 \n", | |
"L 357.178636 28.932896 \n", | |
"L 350.439545 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_46><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 357.178636 239.274486 \n", | |
"L 363.917727 239.274486 \n", | |
"L 363.917727 28.932896 \n", | |
"L 357.178636 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_47><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 363.917727 239.274486 \n", | |
"L 370.656818 239.274486 \n", | |
"L 370.656818 21.679737 \n", | |
"L 363.917727 21.679737 \n", | |
"z\n", | |
""/></g><g id=patch_48><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 370.656818 239.274486 \n", | |
"L 377.395909 239.274486 \n", | |
"L 377.395909 28.932896 \n", | |
"L 370.656818 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_49><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 377.395909 239.274486 \n", | |
"L 384.135 239.274486 \n", | |
"L 384.135 28.932896 \n", | |
"L 377.395909 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_50><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 384.135 239.274486 \n", | |
"L 390.874091 239.274486 \n", | |
"L 390.874091 28.932896 \n", | |
"L 384.135 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_51><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 390.874091 239.274486 \n", | |
"L 397.613182 239.274486 \n", | |
"L 397.613182 28.932896 \n", | |
"L 390.874091 28.932896 \n", | |
"z\n", | |
""/></g><g id=patch_52><path clip-path=url(#p83610c4fc8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 397.613182 239.274486 \n", | |
"L 404.352273 239.274486 \n", | |
"L 404.352273 21.679737 \n", | |
"L 397.613182 21.679737 \n", | |
"z\n", | |
""/></g><g id=patch_53><path style=fill:none; d="M 50.55 239.274486 \n", | |
"L 50.55 10.8 \n", | |
""/></g><g id=patch_54><path style=fill:none; d="M 421.2 239.274486 \n", | |
"L 421.2 10.8 \n", | |
""/></g><g id=patch_55><path style=fill:none; d="M 50.55 239.274486 \n", | |
"L 421.2 239.274486 \n", | |
""/></g><g id=patch_56><path style=fill:none; d="M 50.55 10.8 \n", | |
"L 421.2 10.8 \n", | |
""/></g></g></g><defs><clippath id=p83610c4fc8><rect height=228.474486 width=370.65 x=50.55 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"><strong>Histogram with fixed size bins</strong> (bins=50) </div></div><div role=tabpanel class="tab-pane col-sm-12" id=-721515842184382588bottom--721515842184382588common_values><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=1>1</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=982>982</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=980>980</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=979>979</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=978>978</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=977>977</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=976>976</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=975>975</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=974>974</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=973>973</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class=other><td title="Other values (1450)">Other values (1450)</td><td>1450</td><td><div class=bar style=width:100.0%> 99.3% </div></td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=-721515842184382588bottom--721515842184382588extreme_values><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-721515842184382588extreme_values--721515842184382588firstn aria-controls=-721515842184382588extreme_values--721515842184382588firstn role=tab data-toggle=tab>Minimum 5 values</a></li><li role=presentation><a href=#-721515842184382588extreme_values--721515842184382588lastn aria-controls=-721515842184382588extreme_values--721515842184382588lastn role=tab data-toggle=tab>Maximum 5 values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-721515842184382588extreme_values--721515842184382588firstn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=1>1</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr><tr class><td title=2>2</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr><tr class><td title=3>3</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr><tr class><td title=4>4</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr><tr class><td title=5>5</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=-721515842184382588extreme_values--721515842184382588lastn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=1460>1460</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr><tr class><td title=1459>1459</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr><tr class><td title=1458>1458</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr><tr class><td title=1457>1457</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr><tr class><td title=1456>1456</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr></tbody></table></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_8906135945796978943></a><div class=variable><div class=col-sm-3><p class=h4 title=MSSubClass><a href=#pp_var_8906135945796978943>MSSubClass</a><br><small>Real number (&Ropf;<sub>&ge;0</sub>)</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>15</td></tr><tr><th>Distinct (%)</th><td>1.0%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Infinite</th><td>0</td></tr><tr><th>Infinite (%)</th><td>0.0%</td></tr><tr><th>Mean</th><td>56.89726027</td></tr></tbody></table></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>20</td></tr><tr><th>Maximum</th><td>190</td></tr><tr><th>Zeros</th><td>0</td></tr><tr><th>Zeros (%)</th><td>0.0%</td></tr><tr><th>Negative</th><td>0</td></tr><tr><th>Negative (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-3><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=162pt version=1.1 viewbox="0 0 216 162" width=216pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 162 \n", | |
"L 216 162 \n", | |
"L 216 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 10.8 121.141049 \n", | |
"L 205.2 121.141049 \n", | |
"L 205.2 10.8 \n", | |
"L 10.8 10.8 \n", | |
"z\n", | |
""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
"L 49.515625 72.90625 \n", | |
"L 49.515625 64.59375 \n", | |
"L 19.828125 64.59375 \n", | |
"L 19.828125 46.734375 \n", | |
"Q 21.96875 47.46875 24.109375 47.828125 \n", | |
"Q 26.265625 48.1875 28.421875 48.1875 \n", | |
"Q 40.625 48.1875 47.75 41.5 \n", | |
"Q 54.890625 34.8125 54.890625 23.390625 \n", | |
"Q 54.890625 11.625 47.5625 5.09375 \n", | |
"Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
"Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
"Q 12.796875 0.140625 7.71875 1.703125 \n", | |
"L 7.71875 11.625 \n", | |
"Q 12.109375 9.234375 16.796875 8.0625 \n", | |
"Q 21.484375 6.890625 26.703125 6.890625 \n", | |
"Q 35.15625 6.890625 40.078125 11.328125 \n", | |
"Q 45.015625 15.765625 45.015625 23.390625 \n", | |
"Q 45.015625 31 40.078125 35.4375 \n", | |
"Q 35.15625 39.890625 26.703125 39.890625 \n", | |
"Q 22.75 39.890625 18.8125 39.015625 \n", | |
"Q 14.890625 38.140625 10.796875 36.28125 \n", | |
"z\n", | |
""/><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
"Q 24.171875 66.40625 20.328125 58.90625 \n", | |
"Q 16.5 51.421875 16.5 36.375 \n", | |
"Q 16.5 21.390625 20.328125 13.890625 \n", | |
"Q 24.171875 6.390625 31.78125 6.390625 \n", | |
"Q 39.453125 6.390625 43.28125 13.890625 \n", | |
"Q 47.125 21.390625 47.125 36.375 \n", | |
"Q 47.125 51.421875 43.28125 58.90625 \n", | |
"Q 39.453125 66.40625 31.78125 66.40625 \n", | |
"z\n", | |
"M 31.78125 74.21875 \n", | |
"Q 44.046875 74.21875 50.515625 64.515625 \n", | |
"Q 56.984375 54.828125 56.984375 36.375 \n", | |
"Q 56.984375 17.96875 50.515625 8.265625 \n", | |
"Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
"Q 6.59375 17.96875 6.59375 36.375 \n", | |
"Q 6.59375 54.828125 13.0625 64.515625 \n", | |
"Q 19.53125 74.21875 31.78125 74.21875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(48.785294 145.637721)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(98.964317 149.236895)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><g style=fill:#262626; transform="translate(150.942927 149.236895)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=patch_3><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 19.636364 121.141049 \n", | |
"L 31.418182 121.141049 \n", | |
"L 31.418182 16.054336 \n", | |
"L 19.636364 16.054336 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 31.418182 121.141049 \n", | |
"L 43.2 121.141049 \n", | |
"L 43.2 120.446261 \n", | |
"L 31.418182 120.446261 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 43.2 121.141049 \n", | |
"L 54.981818 121.141049 \n", | |
"L 54.981818 94.04431 \n", | |
"L 43.2 94.04431 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 54.981818 121.141049 \n", | |
"L 66.763636 121.141049 \n", | |
"L 66.763636 69.205632 \n", | |
"L 54.981818 69.205632 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 66.763636 121.141049 \n", | |
"L 78.545455 121.141049 \n", | |
"L 78.545455 107.940073 \n", | |
"L 66.763636 107.940073 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 78.545455 121.141049 \n", | |
"L 90.327273 121.141049 \n", | |
"L 90.327273 107.592679 \n", | |
"L 78.545455 107.592679 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 90.327273 121.141049 \n", | |
"L 102.109091 121.141049 \n", | |
"L 102.109091 112.108802 \n", | |
"L 90.327273 112.108802 \n", | |
"z\n", | |
""/></g><g id=patch_10><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 102.109091 121.141049 \n", | |
"L 113.890909 121.141049 \n", | |
"L 113.890909 121.141049 \n", | |
"L 102.109091 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_11><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 113.890909 121.141049 \n", | |
"L 125.672727 121.141049 \n", | |
"L 125.672727 106.029406 \n", | |
"L 113.890909 106.029406 \n", | |
"z\n", | |
""/></g><g id=patch_12><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 125.672727 121.141049 \n", | |
"L 137.454545 121.141049 \n", | |
"L 137.454545 121.141049 \n", | |
"L 125.672727 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_13><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 137.454545 121.141049 \n", | |
"L 149.236364 121.141049 \n", | |
"L 149.236364 121.141049 \n", | |
"L 137.454545 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_14><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 149.236364 121.141049 \n", | |
"L 161.018182 121.141049 \n", | |
"L 161.018182 121.141049 \n", | |
"L 149.236364 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_15><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 161.018182 121.141049 \n", | |
"L 172.8 121.141049 \n", | |
"L 172.8 110.198135 \n", | |
"L 161.018182 110.198135 \n", | |
"z\n", | |
""/></g><g id=patch_16><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 172.8 121.141049 \n", | |
"L 184.581818 121.141049 \n", | |
"L 184.581818 121.141049 \n", | |
"L 172.8 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_17><path clip-path=url(#p2e9c9740de) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 184.581818 121.141049 \n", | |
"L 196.363636 121.141049 \n", | |
"L 196.363636 114.193167 \n", | |
"L 184.581818 114.193167 \n", | |
"z\n", | |
""/></g><g id=patch_18><path style=fill:none; d="M 10.8 121.141049 \n", | |
"L 10.8 10.8 \n", | |
""/></g><g id=patch_19><path style=fill:none; d="M 205.2 121.141049 \n", | |
"L 205.2 10.8 \n", | |
""/></g><g id=patch_20><path style=fill:none; d="M 10.8 121.141049 \n", | |
"L 205.2 121.141049 \n", | |
""/></g><g id=patch_21><path style=fill:none; d="M 10.8 10.8 \n", | |
"L 205.2 10.8 \n", | |
""/></g></g></g><defs><clippath id=p2e9c9740de><rect height=110.341049 width=194.4 x=10.8 y=10.8 /></clippath></defs></svg></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-8906135945796978943, #minifreqtable8906135945796978943" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-8906135945796978943 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#8906135945796978943bottom-8906135945796978943statistics aria-controls=8906135945796978943bottom-8906135945796978943statistics role=tab data-toggle=tab>Statistics</a></li><li role=presentation><a href=#8906135945796978943bottom-8906135945796978943histogram aria-controls=8906135945796978943bottom-8906135945796978943histogram role=tab data-toggle=tab>Histogram</a></li><li role=presentation><a href=#8906135945796978943bottom-8906135945796978943common_values aria-controls=8906135945796978943bottom-8906135945796978943common_values role=tab data-toggle=tab>Common values</a></li><li role=presentation><a href=#8906135945796978943bottom-8906135945796978943extreme_values aria-controls=8906135945796978943bottom-8906135945796978943extreme_values role=tab data-toggle=tab>Extreme values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=8906135945796978943bottom-8906135945796978943statistics><div class=col-sm-6><p class=h4>Quantile statistics</p><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>20</td></tr><tr><th>5-th percentile</th><td>20</td></tr><tr><th>Q1</th><td>20</td></tr><tr><th>median</th><td>50</td></tr><tr><th>Q3</th><td>70</td></tr><tr><th>95-th percentile</th><td>160</td></tr><tr><th>Maximum</th><td>190</td></tr><tr><th>Range</th><td>170</td></tr><tr><th>Interquartile range (IQR)</th><td>50</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Descriptive statistics</p><table class="table table-condensed stats"><tbody><tr><th>Standard deviation</th><td>42.30057099</td></tr><tr><th>Coefficient of variation (CV)</th><td>0.7434553226</td></tr><tr><th>Kurtosis</th><td>1.580187965</td></tr><tr><th>Mean</th><td>56.89726027</td></tr><tr><th>Median Absolute Deviation (MAD)</th><td>30</td></tr><tr><th>Skewness</th><td>1.407656747</td></tr><tr><th>Sum</th><td>83070</td></tr><tr><th>Variance</th><td>1789.338306</td></tr><tr><th>Monotonicity</th><td>Not monotonic</td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=8906135945796978943bottom-8906135945796978943histogram><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
"L 432 288 \n", | |
"L 432 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 56.675 243.605515 \n", | |
"L 421.2 243.605515 \n", | |
"L 421.2 10.8 \n", | |
"L 56.675 10.8 \n", | |
"z\n", | |
""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
"L 49.515625 72.90625 \n", | |
"L 49.515625 64.59375 \n", | |
"L 19.828125 64.59375 \n", | |
"L 19.828125 46.734375 \n", | |
"Q 21.96875 47.46875 24.109375 47.828125 \n", | |
"Q 26.265625 48.1875 28.421875 48.1875 \n", | |
"Q 40.625 48.1875 47.75 41.5 \n", | |
"Q 54.890625 34.8125 54.890625 23.390625 \n", | |
"Q 54.890625 11.625 47.5625 5.09375 \n", | |
"Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
"Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
"Q 12.796875 0.140625 7.71875 1.703125 \n", | |
"L 7.71875 11.625 \n", | |
"Q 12.109375 9.234375 16.796875 8.0625 \n", | |
"Q 21.484375 6.890625 26.703125 6.890625 \n", | |
"Q 35.15625 6.890625 40.078125 11.328125 \n", | |
"Q 45.015625 15.765625 45.015625 23.390625 \n", | |
"Q 45.015625 31 40.078125 35.4375 \n", | |
"Q 35.15625 39.890625 26.703125 39.890625 \n", | |
"Q 22.75 39.890625 18.8125 39.015625 \n", | |
"Q 14.890625 38.140625 10.796875 36.28125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(80.443182 270.976355)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
"Q 24.171875 66.40625 20.328125 58.90625 \n", | |
"Q 16.5 51.421875 16.5 36.375 \n", | |
"Q 16.5 21.390625 20.328125 13.890625 \n", | |
"Q 24.171875 6.390625 31.78125 6.390625 \n", | |
"Q 39.453125 6.390625 43.28125 13.890625 \n", | |
"Q 47.125 21.390625 47.125 36.375 \n", | |
"Q 47.125 51.421875 43.28125 58.90625 \n", | |
"Q 39.453125 66.40625 31.78125 66.40625 \n", | |
"z\n", | |
"M 31.78125 74.21875 \n", | |
"Q 44.046875 74.21875 50.515625 64.515625 \n", | |
"Q 56.984375 54.828125 56.984375 36.375 \n", | |
"Q 56.984375 17.96875 50.515625 8.265625 \n", | |
"Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
"Q 6.59375 17.96875 6.59375 36.375 \n", | |
"Q 6.59375 54.828125 13.0625 64.515625 \n", | |
"Q 19.53125 74.21875 31.78125 74.21875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(129.176471 270.976355)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-55 d="M 8.203125 72.90625 \n", | |
"L 55.078125 72.90625 \n", | |
"L 55.078125 68.703125 \n", | |
"L 28.609375 0 \n", | |
"L 18.3125 0 \n", | |
"L 43.21875 64.59375 \n", | |
"L 8.203125 64.59375 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(177.909759 270.976355)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-55 /><use x=63.623047 xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(224.393565 275.475322)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_5><g id=text_5><g style=fill:#262626; transform="translate(273.126853 275.475322)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-50 /><use x=127.246094 xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_6><g id=text_6><g style=fill:#262626; transform="translate(321.860142 275.475322)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_7><g id=text_7><g style=fill:#262626; transform="translate(370.593431 275.475322)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-55 /><use x=127.246094 xlink:href=#DejaVuSans-53 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_8><g style=fill:#262626; transform="translate(37.3125 247.404734)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_9><g style=fill:#262626; transform="translate(24.5875 210.756876)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_3><g id=text_10><g style=fill:#262626; transform="translate(24.5875 174.109019)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_11><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
"Q 47.65625 37.796875 51.625 33 \n", | |
"Q 55.609375 28.21875 55.609375 21.1875 \n", | |
"Q 55.609375 10.40625 48.1875 4.484375 \n", | |
"Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
"Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
"Q 12.796875 0.390625 7.625 2.203125 \n", | |
"L 7.625 11.71875 \n", | |
"Q 11.71875 9.328125 16.59375 8.109375 \n", | |
"Q 21.484375 6.890625 26.8125 6.890625 \n", | |
"Q 36.078125 6.890625 40.9375 10.546875 \n", | |
"Q 45.796875 14.203125 45.796875 21.1875 \n", | |
"Q 45.796875 27.640625 41.28125 31.265625 \n", | |
"Q 36.765625 34.90625 28.71875 34.90625 \n", | |
"L 20.21875 34.90625 \n", | |
"L 20.21875 43.015625 \n", | |
"L 29.109375 43.015625 \n", | |
"Q 36.375 43.015625 40.234375 45.921875 \n", | |
"Q 44.09375 48.828125 44.09375 54.296875 \n", | |
"Q 44.09375 59.90625 40.109375 62.90625 \n", | |
"Q 36.140625 65.921875 28.71875 65.921875 \n", | |
"Q 24.65625 65.921875 20.015625 65.03125 \n", | |
"Q 15.375 64.15625 9.8125 62.3125 \n", | |
"L 9.8125 71.09375 \n", | |
"Q 15.4375 72.65625 20.34375 73.4375 \n", | |
"Q 25.25 74.21875 29.59375 74.21875 \n", | |
"Q 40.828125 74.21875 47.359375 69.109375 \n", | |
"Q 53.90625 64.015625 53.90625 55.328125 \n", | |
"Q 53.90625 49.265625 50.4375 45.09375 \n", | |
"Q 46.96875 40.921875 40.578125 39.3125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(24.5875 137.461161)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-51 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_5><g id=text_12><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
"L 12.890625 25.390625 \n", | |
"L 37.796875 25.390625 \n", | |
"z\n", | |
"M 35.203125 72.90625 \n", | |
"L 47.609375 72.90625 \n", | |
"L 47.609375 25.390625 \n", | |
"L 58.015625 25.390625 \n", | |
"L 58.015625 17.1875 \n", | |
"L 47.609375 17.1875 \n", | |
"L 47.609375 0 \n", | |
"L 37.796875 0 \n", | |
"L 37.796875 17.1875 \n", | |
"L 4.890625 17.1875 \n", | |
"L 4.890625 26.703125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(24.5875 100.813304)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_6><g id=text_13><g style=fill:#262626; transform="translate(24.5875 64.165446)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_7><g id=text_14><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
"Q 26.375 40.375 22.484375 35.828125 \n", | |
"Q 18.609375 31.296875 18.609375 23.390625 \n", | |
"Q 18.609375 15.53125 22.484375 10.953125 \n", | |
"Q 26.375 6.390625 33.015625 6.390625 \n", | |
"Q 39.65625 6.390625 43.53125 10.953125 \n", | |
"Q 47.40625 15.53125 47.40625 23.390625 \n", | |
"Q 47.40625 31.296875 43.53125 35.828125 \n", | |
"Q 39.65625 40.375 33.015625 40.375 \n", | |
"z\n", | |
"M 52.59375 71.296875 \n", | |
"L 52.59375 62.3125 \n", | |
"Q 48.875 64.0625 45.09375 64.984375 \n", | |
"Q 41.3125 65.921875 37.59375 65.921875 \n", | |
"Q 27.828125 65.921875 22.671875 59.328125 \n", | |
"Q 17.53125 52.734375 16.796875 39.40625 \n", | |
"Q 19.671875 43.65625 24.015625 45.921875 \n", | |
"Q 28.375 48.1875 33.59375 48.1875 \n", | |
"Q 44.578125 48.1875 50.953125 41.515625 \n", | |
"Q 57.328125 34.859375 57.328125 23.390625 \n", | |
"Q 57.328125 12.15625 50.6875 5.359375 \n", | |
"Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
"Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
"Q 6.984375 17.96875 6.984375 36.375 \n", | |
"Q 6.984375 53.65625 15.1875 63.9375 \n", | |
"Q 23.390625 74.21875 37.203125 74.21875 \n", | |
"Q 40.921875 74.21875 44.703125 73.484375 \n", | |
"Q 48.484375 72.75 52.59375 71.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(24.5875 27.517589)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-54 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_15><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
"L 51.703125 72.90625 \n", | |
"L 51.703125 64.59375 \n", | |
"L 19.671875 64.59375 \n", | |
"L 19.671875 43.109375 \n", | |
"L 48.578125 43.109375 \n", | |
"L 48.578125 34.8125 \n", | |
"L 19.671875 34.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
"Q 39.59375 47.171875 37.8125 47.578125 \n", | |
"Q 36.03125 48 33.890625 48 \n", | |
"Q 26.265625 48 22.1875 43.046875 \n", | |
"Q 18.109375 38.09375 18.109375 28.8125 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 20.953125 51.171875 25.484375 53.578125 \n", | |
"Q 30.03125 56 36.53125 56 \n", | |
"Q 37.453125 56 38.578125 55.875 \n", | |
"Q 39.703125 55.765625 41.0625 55.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
"Q 14.796875 17.390625 18.875 11.75 \n", | |
"Q 22.953125 6.109375 30.078125 6.109375 \n", | |
"Q 37.203125 6.109375 41.296875 11.75 \n", | |
"Q 45.40625 17.390625 45.40625 27.296875 \n", | |
"Q 45.40625 37.203125 41.296875 42.84375 \n", | |
"Q 37.203125 48.484375 30.078125 48.484375 \n", | |
"Q 22.953125 48.484375 18.875 42.84375 \n", | |
"Q 14.796875 37.203125 14.796875 27.296875 \n", | |
"z\n", | |
"M 45.40625 8.203125 \n", | |
"Q 42.578125 3.328125 38.25 0.953125 \n", | |
"Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
"Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
"Q 5.515625 14.40625 5.515625 27.296875 \n", | |
"Q 5.515625 40.1875 11.734375 48.09375 \n", | |
"Q 17.96875 56 27.875 56 \n", | |
"Q 33.9375 56 38.25 53.625 \n", | |
"Q 42.578125 51.265625 45.40625 46.390625 \n", | |
"L 45.40625 54.6875 \n", | |
"L 54.390625 54.6875 \n", | |
"L 54.390625 -20.796875 \n", | |
"L 45.40625 -20.796875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
"L 8.5 54.6875 \n", | |
"L 17.484375 54.6875 \n", | |
"L 17.484375 21.921875 \n", | |
"Q 17.484375 14.15625 20.5 10.265625 \n", | |
"Q 23.53125 6.390625 29.59375 6.390625 \n", | |
"Q 36.859375 6.390625 41.078125 11.03125 \n", | |
"Q 45.3125 15.671875 45.3125 23.6875 \n", | |
"L 45.3125 54.6875 \n", | |
"L 54.296875 54.6875 \n", | |
"L 54.296875 0 \n", | |
"L 45.3125 0 \n", | |
"L 45.3125 8.40625 \n", | |
"Q 42.046875 3.421875 37.71875 1 \n", | |
"Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
"Q 18.265625 -1.421875 13.375 4.4375 \n", | |
"Q 8.5 10.296875 8.5 21.578125 \n", | |
"z\n", | |
"M 31.109375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
"L 54.890625 0 \n", | |
"L 45.90625 0 \n", | |
"L 45.90625 32.71875 \n", | |
"Q 45.90625 40.484375 42.875 44.328125 \n", | |
"Q 39.84375 48.1875 33.796875 48.1875 \n", | |
"Q 26.515625 48.1875 22.3125 43.546875 \n", | |
"Q 18.109375 38.921875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.34375 51.125 25.703125 53.5625 \n", | |
"Q 30.078125 56 35.796875 56 \n", | |
"Q 45.21875 56 50.046875 50.171875 \n", | |
"Q 54.890625 44.34375 54.890625 33.015625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
"L 48.78125 44.1875 \n", | |
"Q 44.96875 46.296875 41.140625 47.34375 \n", | |
"Q 37.3125 48.390625 33.40625 48.390625 \n", | |
"Q 24.65625 48.390625 19.8125 42.84375 \n", | |
"Q 14.984375 37.3125 14.984375 27.296875 \n", | |
"Q 14.984375 17.28125 19.8125 11.734375 \n", | |
"Q 24.65625 6.203125 33.40625 6.203125 \n", | |
"Q 37.3125 6.203125 41.140625 7.25 \n", | |
"Q 44.96875 8.296875 48.78125 10.40625 \n", | |
"L 48.78125 2.09375 \n", | |
"Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
"Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
"Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
"Q 5.515625 14.109375 5.515625 27.296875 \n", | |
"Q 5.515625 40.671875 12.859375 48.328125 \n", | |
"Q 20.21875 56 33.015625 56 \n", | |
"Q 37.15625 56 41.109375 55.140625 \n", | |
"Q 45.0625 54.296875 48.78125 52.59375 \n", | |
"z\n", | |
""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
"Q 28.375 -14.84375 24.75 -17.8125 \n", | |
"Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
"L 7.90625 -20.796875 \n", | |
"L 7.90625 -13.28125 \n", | |
"L 13.1875 -13.28125 \n", | |
"Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
"Q 21 -9.765625 23.484375 -3.21875 \n", | |
"L 25.09375 0.875 \n", | |
"L 2.984375 54.6875 \n", | |
"L 12.5 54.6875 \n", | |
"L 29.59375 11.921875 \n", | |
"L 46.6875 54.6875 \n", | |
"L 56.203125 54.6875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(18.299844 155.615414)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 73.244318 243.605515 \n", | |
"L 95.336742 243.605515 \n", | |
"L 95.336742 21.885977 \n", | |
"L 73.244318 21.885977 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 95.336742 243.605515 \n", | |
"L 117.429167 243.605515 \n", | |
"L 117.429167 242.139601 \n", | |
"L 95.336742 242.139601 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 117.429167 243.605515 \n", | |
"L 139.521591 243.605515 \n", | |
"L 139.521591 186.434857 \n", | |
"L 117.429167 186.434857 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 139.521591 243.605515 \n", | |
"L 161.614015 243.605515 \n", | |
"L 161.614015 134.028421 \n", | |
"L 139.521591 134.028421 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 161.614015 243.605515 \n", | |
"L 183.706439 243.605515 \n", | |
"L 183.706439 215.753143 \n", | |
"L 161.614015 215.753143 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 183.706439 243.605515 \n", | |
"L 205.798864 243.605515 \n", | |
"L 205.798864 215.020186 \n", | |
"L 183.706439 215.020186 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 205.798864 243.605515 \n", | |
"L 227.891288 243.605515 \n", | |
"L 227.891288 224.548629 \n", | |
"L 205.798864 224.548629 \n", | |
"z\n", | |
""/></g><g id=patch_10><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 227.891288 243.605515 \n", | |
"L 249.983712 243.605515 \n", | |
"L 249.983712 243.605515 \n", | |
"L 227.891288 243.605515 \n", | |
"z\n", | |
""/></g><g id=patch_11><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 249.983712 243.605515 \n", | |
"L 272.076136 243.605515 \n", | |
"L 272.076136 211.721879 \n", | |
"L 249.983712 211.721879 \n", | |
"z\n", | |
""/></g><g id=patch_12><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 272.076136 243.605515 \n", | |
"L 294.168561 243.605515 \n", | |
"L 294.168561 243.605515 \n", | |
"L 272.076136 243.605515 \n", | |
"z\n", | |
""/></g><g id=patch_13><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 294.168561 243.605515 \n", | |
"L 316.260985 243.605515 \n", | |
"L 316.260985 243.605515 \n", | |
"L 294.168561 243.605515 \n", | |
"z\n", | |
""/></g><g id=patch_14><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 316.260985 243.605515 \n", | |
"L 338.353409 243.605515 \n", | |
"L 338.353409 243.605515 \n", | |
"L 316.260985 243.605515 \n", | |
"z\n", | |
""/></g><g id=patch_15><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 338.353409 243.605515 \n", | |
"L 360.445833 243.605515 \n", | |
"L 360.445833 220.517365 \n", | |
"L 338.353409 220.517365 \n", | |
"z\n", | |
""/></g><g id=patch_16><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 360.445833 243.605515 \n", | |
"L 382.538258 243.605515 \n", | |
"L 382.538258 243.605515 \n", | |
"L 360.445833 243.605515 \n", | |
"z\n", | |
""/></g><g id=patch_17><path clip-path=url(#p244a77e63c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 382.538258 243.605515 \n", | |
"L 404.630682 243.605515 \n", | |
"L 404.630682 228.946372 \n", | |
"L 382.538258 228.946372 \n", | |
"z\n", | |
""/></g><g id=patch_18><path style=fill:none; d="M 56.675 243.605515 \n", | |
"L 56.675 10.8 \n", | |
""/></g><g id=patch_19><path style=fill:none; d="M 421.2 243.605515 \n", | |
"L 421.2 10.8 \n", | |
""/></g><g id=patch_20><path style=fill:none; d="M 56.675 243.605515 \n", | |
"L 421.2 243.605515 \n", | |
""/></g><g id=patch_21><path style=fill:none; d="M 56.675 10.8 \n", | |
"L 421.2 10.8 \n", | |
""/></g></g></g><defs><clippath id=p244a77e63c><rect height=232.805515 width=364.525 x=56.675 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"><strong>Histogram with fixed size bins</strong> (bins=15) </div></div><div role=tabpanel class="tab-pane col-sm-12" id=8906135945796978943bottom-8906135945796978943common_values><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=20>20</td><td>536</td><td><div class=bar style=width:100.0%> 36.7% </div></td></tr><tr class><td title=60>60</td><td>299</td><td><div class=bar style=width:55.8%> 20.5% </div></td></tr><tr class><td title=50>50</td><td>144</td><td><div class=bar style=width:26.9%> &nbsp; </div> 9.9% </td></tr><tr class><td title=120>120</td><td>87</td><td><div class=bar style=width:16.2%> &nbsp; </div> 6.0% </td></tr><tr class><td title=30>30</td><td>69</td><td><div class=bar style=width:12.9%> &nbsp; </div> 4.7% </td></tr><tr class><td title=160>160</td><td>63</td><td><div class=bar style=width:11.8%> &nbsp; </div> 4.3% </td></tr><tr class><td title=70>70</td><td>60</td><td><div class=bar style=width:11.2%> &nbsp; </div> 4.1% </td></tr><tr class><td title=80>80</td><td>58</td><td><div class=bar style=width:10.8%> &nbsp; </div> 4.0% </td></tr><tr class><td title=90>90</td><td>52</td><td><div class=bar style=width:9.7%> &nbsp; </div> 3.6% </td></tr><tr class><td title=190>190</td><td>30</td><td><div class=bar style=width:5.6%> &nbsp; </div> 2.1% </td></tr><tr class=other><td title="Other values (5)">Other values (5)</td><td>62</td><td><div class=bar style=width:11.6%> &nbsp; </div> 4.2% </td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=8906135945796978943bottom-8906135945796978943extreme_values><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#8906135945796978943extreme_values-8906135945796978943firstn aria-controls=8906135945796978943extreme_values-8906135945796978943firstn role=tab data-toggle=tab>Minimum 5 values</a></li><li role=presentation><a href=#8906135945796978943extreme_values-8906135945796978943lastn aria-controls=8906135945796978943extreme_values-8906135945796978943lastn role=tab data-toggle=tab>Maximum 5 values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=8906135945796978943extreme_values-8906135945796978943firstn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=20>20</td><td>536</td><td><div class=bar style=width:100.0%> 36.7% </div></td></tr><tr class><td title=30>30</td><td>69</td><td><div class=bar style=width:12.9%> &nbsp; </div> 4.7% </td></tr><tr class><td title=40>40</td><td>4</td><td><div class=bar style=width:0.7%> &nbsp; </div> 0.3% </td></tr><tr class><td title=45>45</td><td>12</td><td><div class=bar style=width:2.2%> &nbsp; </div> 0.8% </td></tr><tr class><td title=50>50</td><td>144</td><td><div class=bar style=width:26.9%> &nbsp; </div> 9.9% </td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=8906135945796978943extreme_values-8906135945796978943lastn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=190>190</td><td>30</td><td><div class=bar style=width:34.5%> &nbsp; </div> 2.1% </td></tr><tr class><td title=180>180</td><td>10</td><td><div class=bar style=width:11.5%> &nbsp; </div> 0.7% </td></tr><tr class><td title=160>160</td><td>63</td><td><div class=bar style=width:72.4%> 4.3% </div></td></tr><tr class><td title=120>120</td><td>87</td><td><div class=bar style=width:100.0%> 6.0% </div></td></tr><tr class><td title=90>90</td><td>52</td><td><div class=bar style=width:59.8%> 3.6% </div></td></tr></tbody></table></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_7047921806688471789></a><div class=variable><div class=col-sm-3><p class=h4 title=MSZoning><a href=#pp_var_7047921806688471789>MSZoning</a><br><small>Categorical</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>5</td></tr><tr><th>Distinct (%)</th><td>0.3%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> RL </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 1151&nbsp; </div></td></tr><tr class><th width=50%> RM </th><td width=50%><div class=bar style=width:18.9% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 218&nbsp; </div></td></tr><tr class><th width=50%> FV </th><td width=50%><div class=bar style=width:5.6% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 65 </td></tr><tr class><th width=50%> RH </th><td width=50%><div class=bar style=width:1.4% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 16 </td></tr><tr class><th width=50%> C (all) </th><td width=50%><div class=bar style=width:0.9% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 10 </td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-7047921806688471789, #minifreqtable7047921806688471789" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-7047921806688471789 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#7047921806688471789bottom-7047921806688471789overview aria-controls=7047921806688471789bottom-7047921806688471789overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#7047921806688471789bottom-7047921806688471789string aria-controls=7047921806688471789bottom-7047921806688471789string role=tab data-toggle=tab>Categories</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=7047921806688471789bottom-7047921806688471789overview><div class=row><div class=col-sm-6><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>RL</td></tr><tr><th>2nd row</th><td>RL</td></tr><tr><th>3rd row</th><td>RL</td></tr><tr><th>4th row</th><td>RL</td></tr><tr><th>5th row</th><td>RL</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=7047921806688471789bottom-7047921806688471789string><div class=row><div class=col-sm-6><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=RL>RL</td><td>1151</td><td><div class=bar style=width:100.0%> 78.8% </div></td></tr><tr class><td title=RM>RM</td><td>218</td><td><div class=bar style=width:18.9%> &nbsp; </div> 14.9% </td></tr><tr class><td title=FV>FV</td><td>65</td><td><div class=bar style=width:5.6%> &nbsp; </div> 4.5% </td></tr><tr class><td title=RH>RH</td><td>16</td><td><div class=bar style=width:1.4%> &nbsp; </div> 1.1% </td></tr><tr class><td title="C (all)">C (all)</td><td>10</td><td><div class=bar style=width:0.9%> &nbsp; </div> 0.7% </td></tr></tbody></table></div><div class=col-sm-6><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=263.763pt version=1.1 viewbox="0 0 405 263.763" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 263.763 \n", | |
"L 405 263.763 \n", | |
"L 405 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#p0f3d367aa5) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
"L 315.131918 106.86 \n", | |
"L 315.131918 16.26 \n", | |
"L 7.2 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_3><path clip-path=url(#p0f3d367aa5) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 315.131918 106.86 \n", | |
"L 373.454384 106.86 \n", | |
"L 373.454384 16.26 \n", | |
"L 315.131918 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#p0f3d367aa5) style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 373.454384 106.86 \n", | |
"L 390.84411 106.86 \n", | |
"L 390.84411 16.26 \n", | |
"L 373.454384 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#p0f3d367aa5) style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 390.84411 106.86 \n", | |
"L 395.124658 106.86 \n", | |
"L 395.124658 16.26 \n", | |
"L 390.84411 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#p0f3d367aa5) style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 395.124658 106.86 \n", | |
"L 397.8 106.86 \n", | |
"L 397.8 16.26 \n", | |
"L 395.124658 16.26 \n", | |
"z\n", | |
""/></g><g id=legend_1><g id=patch_7><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 256.563 \n", | |
"L 125.8245 256.563 \n", | |
"Q 129.2805 256.563 129.2805 253.107 \n", | |
"L 129.2805 128.016 \n", | |
"Q 129.2805 124.56 125.8245 124.56 \n", | |
"L 19.296 124.56 \n", | |
"Q 15.84 124.56 15.84 128.016 \n", | |
"L 15.84 253.107 \n", | |
"Q 15.84 256.563 19.296 256.563 \n", | |
"z\n", | |
""/></g><g id=patch_8><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
"L 57.312 144.6021 \n", | |
"L 57.312 132.5061 \n", | |
"L 22.752 132.5061 \n", | |
"z\n", | |
""/></g><g id=text_1><defs><path id=DejaVuSans-82 d="M 44.390625 34.1875 \n", | |
"Q 47.5625 33.109375 50.5625 29.59375 \n", | |
"Q 53.5625 26.078125 56.59375 19.921875 \n", | |
"L 66.609375 0 \n", | |
"L 56 0 \n", | |
"L 46.6875 18.703125 \n", | |
"Q 43.0625 26.03125 39.671875 28.421875 \n", | |
"Q 36.28125 30.8125 30.421875 30.8125 \n", | |
"L 19.671875 30.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"L 9.8125 72.90625 \n", | |
"L 32.078125 72.90625 \n", | |
"Q 44.578125 72.90625 50.734375 67.671875 \n", | |
"Q 56.890625 62.453125 56.890625 51.90625 \n", | |
"Q 56.890625 45.015625 53.6875 40.46875 \n", | |
"Q 50.484375 35.9375 44.390625 34.1875 \n", | |
"z\n", | |
"M 19.671875 64.796875 \n", | |
"L 19.671875 38.921875 \n", | |
"L 32.078125 38.921875 \n", | |
"Q 39.203125 38.921875 42.84375 42.21875 \n", | |
"Q 46.484375 45.515625 46.484375 51.90625 \n", | |
"Q 46.484375 58.296875 42.84375 61.546875 \n", | |
"Q 39.203125 64.796875 32.078125 64.796875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-76 d="M 9.8125 72.90625 \n", | |
"L 19.671875 72.90625 \n", | |
"L 19.671875 8.296875 \n", | |
"L 55.171875 8.296875 \n", | |
"L 55.171875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-82 /><use x=69.482422 xlink:href=#DejaVuSans-76 /></g></g><g id=patch_9><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
"L 57.312 169.9659 \n", | |
"L 57.312 157.8699 \n", | |
"L 22.752 157.8699 \n", | |
"z\n", | |
""/></g><g id=text_2><defs><path id=DejaVuSans-77 d="M 9.8125 72.90625 \n", | |
"L 24.515625 72.90625 \n", | |
"L 43.109375 23.296875 \n", | |
"L 61.8125 72.90625 \n", | |
"L 76.515625 72.90625 \n", | |
"L 76.515625 0 \n", | |
"L 66.890625 0 \n", | |
"L 66.890625 64.015625 \n", | |
"L 48.09375 14.015625 \n", | |
"L 38.1875 14.015625 \n", | |
"L 19.390625 64.015625 \n", | |
"L 19.390625 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-82 /><use x=69.482422 xlink:href=#DejaVuSans-77 /></g></g><g id=patch_10><path style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 195.3297 \n", | |
"L 57.312 195.3297 \n", | |
"L 57.312 183.2337 \n", | |
"L 22.752 183.2337 \n", | |
"z\n", | |
""/></g><g id=text_3><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
"L 51.703125 72.90625 \n", | |
"L 51.703125 64.59375 \n", | |
"L 19.671875 64.59375 \n", | |
"L 19.671875 43.109375 \n", | |
"L 48.578125 43.109375 \n", | |
"L 48.578125 34.8125 \n", | |
"L 19.671875 34.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-86 d="M 28.609375 0 \n", | |
"L 0.78125 72.90625 \n", | |
"L 11.078125 72.90625 \n", | |
"L 34.1875 11.53125 \n", | |
"L 57.328125 72.90625 \n", | |
"L 67.578125 72.90625 \n", | |
"L 39.796875 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 195.3297)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-70 /><use x=57.519531 xlink:href=#DejaVuSans-86 /></g></g><g id=patch_11><path style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 220.6935 \n", | |
"L 57.312 220.6935 \n", | |
"L 57.312 208.5975 \n", | |
"L 22.752 208.5975 \n", | |
"z\n", | |
""/></g><g id=text_4><defs><path id=DejaVuSans-72 d="M 9.8125 72.90625 \n", | |
"L 19.671875 72.90625 \n", | |
"L 19.671875 43.015625 \n", | |
"L 55.515625 43.015625 \n", | |
"L 55.515625 72.90625 \n", | |
"L 65.375 72.90625 \n", | |
"L 65.375 0 \n", | |
"L 55.515625 0 \n", | |
"L 55.515625 34.71875 \n", | |
"L 19.671875 34.71875 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 220.6935)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-82 /><use x=69.482422 xlink:href=#DejaVuSans-72 /></g></g><g id=patch_12><path style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 246.0573 \n", | |
"L 57.312 246.0573 \n", | |
"L 57.312 233.9613 \n", | |
"L 22.752 233.9613 \n", | |
"z\n", | |
""/></g><g id=text_5><defs><path id=DejaVuSans-67 d="M 64.40625 67.28125 \n", | |
"L 64.40625 56.890625 \n", | |
"Q 59.421875 61.53125 53.78125 63.8125 \n", | |
"Q 48.140625 66.109375 41.796875 66.109375 \n", | |
"Q 29.296875 66.109375 22.65625 58.46875 \n", | |
"Q 16.015625 50.828125 16.015625 36.375 \n", | |
"Q 16.015625 21.96875 22.65625 14.328125 \n", | |
"Q 29.296875 6.6875 41.796875 6.6875 \n", | |
"Q 48.140625 6.6875 53.78125 8.984375 \n", | |
"Q 59.421875 11.28125 64.40625 15.921875 \n", | |
"L 64.40625 5.609375 \n", | |
"Q 59.234375 2.09375 53.4375 0.328125 \n", | |
"Q 47.65625 -1.421875 41.21875 -1.421875 \n", | |
"Q 24.65625 -1.421875 15.125 8.703125 \n", | |
"Q 5.609375 18.84375 5.609375 36.375 \n", | |
"Q 5.609375 53.953125 15.125 64.078125 \n", | |
"Q 24.65625 74.21875 41.21875 74.21875 \n", | |
"Q 47.75 74.21875 53.53125 72.484375 \n", | |
"Q 59.328125 70.75 64.40625 67.28125 \n", | |
"z\n", | |
""/><path id=DejaVuSans-32 /><path id=DejaVuSans-40 d="M 31 75.875 \n", | |
"Q 24.46875 64.65625 21.28125 53.65625 \n", | |
"Q 18.109375 42.671875 18.109375 31.390625 \n", | |
"Q 18.109375 20.125 21.3125 9.0625 \n", | |
"Q 24.515625 -2 31 -13.1875 \n", | |
"L 23.1875 -13.1875 \n", | |
"Q 15.875 -1.703125 12.234375 9.375 \n", | |
"Q 8.59375 20.453125 8.59375 31.390625 \n", | |
"Q 8.59375 42.28125 12.203125 53.3125 \n", | |
"Q 15.828125 64.359375 23.1875 75.875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-97 d="M 34.28125 27.484375 \n", | |
"Q 23.390625 27.484375 19.1875 25 \n", | |
"Q 14.984375 22.515625 14.984375 16.5 \n", | |
"Q 14.984375 11.71875 18.140625 8.90625 \n", | |
"Q 21.296875 6.109375 26.703125 6.109375 \n", | |
"Q 34.1875 6.109375 38.703125 11.40625 \n", | |
"Q 43.21875 16.703125 43.21875 25.484375 \n", | |
"L 43.21875 27.484375 \n", | |
"z\n", | |
"M 52.203125 31.203125 \n", | |
"L 52.203125 0 \n", | |
"L 43.21875 0 \n", | |
"L 43.21875 8.296875 \n", | |
"Q 40.140625 3.328125 35.546875 0.953125 \n", | |
"Q 30.953125 -1.421875 24.3125 -1.421875 \n", | |
"Q 15.921875 -1.421875 10.953125 3.296875 \n", | |
"Q 6 8.015625 6 15.921875 \n", | |
"Q 6 25.140625 12.171875 29.828125 \n", | |
"Q 18.359375 34.515625 30.609375 34.515625 \n", | |
"L 43.21875 34.515625 \n", | |
"L 43.21875 35.40625 \n", | |
"Q 43.21875 41.609375 39.140625 45 \n", | |
"Q 35.0625 48.390625 27.6875 48.390625 \n", | |
"Q 23 48.390625 18.546875 47.265625 \n", | |
"Q 14.109375 46.140625 10.015625 43.890625 \n", | |
"L 10.015625 52.203125 \n", | |
"Q 14.9375 54.109375 19.578125 55.046875 \n", | |
"Q 24.21875 56 28.609375 56 \n", | |
"Q 40.484375 56 46.34375 49.84375 \n", | |
"Q 52.203125 43.703125 52.203125 31.203125 \n", | |
"z\n", | |
""/><path id=DejaVuSans-108 d="M 9.421875 75.984375 \n", | |
"L 18.40625 75.984375 \n", | |
"L 18.40625 0 \n", | |
"L 9.421875 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-41 d="M 8.015625 75.875 \n", | |
"L 15.828125 75.875 \n", | |
"Q 23.140625 64.359375 26.78125 53.3125 \n", | |
"Q 30.421875 42.28125 30.421875 31.390625 \n", | |
"Q 30.421875 20.453125 26.78125 9.375 \n", | |
"Q 23.140625 -1.703125 15.828125 -13.1875 \n", | |
"L 8.015625 -13.1875 \n", | |
"Q 14.5 -2 17.703125 9.0625 \n", | |
"Q 20.90625 20.125 20.90625 31.390625 \n", | |
"Q 20.90625 42.671875 17.703125 53.65625 \n", | |
"Q 14.5 64.65625 8.015625 75.875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 246.0573)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-67 /><use x=69.824219 xlink:href=#DejaVuSans-32 /><use x=101.611328 xlink:href=#DejaVuSans-40 /><use x=140.625 xlink:href=#DejaVuSans-97 /><use x=201.904297 xlink:href=#DejaVuSans-108 /><use x=229.6875 xlink:href=#DejaVuSans-108 /><use x=257.470703 xlink:href=#DejaVuSans-41 /></g></g></g></g></g><defs><clippath id=p0f3d367aa5><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_-4044077858387873843></a><div class=variable><div class=col-sm-3><p class=h4 title=LotFrontage><a href=#pp_var_-4044077858387873843>LotFrontage</a><br><small>Real number (&Ropf;<sub>&ge;0</sub>)</small></p><code>MISSING</code><br><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>110</td></tr><tr><th>Distinct (%)</th><td>9.2%</td></tr><tr class=alert><th>Missing</th><td>259</td></tr><tr class=alert><th>Missing (%)</th><td>17.7%</td></tr><tr><th>Infinite</th><td>0</td></tr><tr><th>Infinite (%)</th><td>0.0%</td></tr><tr><th>Mean</th><td>70.04995837</td></tr></tbody></table></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>21</td></tr><tr><th>Maximum</th><td>313</td></tr><tr><th>Zeros</th><td>0</td></tr><tr><th>Zeros (%)</th><td>0.0%</td></tr><tr><th>Negative</th><td>0</td></tr><tr><th>Negative (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-3><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=162pt version=1.1 viewbox="0 0 216 162" width=216pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 162 \n", | |
"L 216 162 \n", | |
"L 216 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 10.8 121.141049 \n", | |
"L 205.2 121.141049 \n", | |
"L 205.2 10.8 \n", | |
"L 10.8 10.8 \n", | |
"z\n", | |
""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
"Q 24.171875 66.40625 20.328125 58.90625 \n", | |
"Q 16.5 51.421875 16.5 36.375 \n", | |
"Q 16.5 21.390625 20.328125 13.890625 \n", | |
"Q 24.171875 6.390625 31.78125 6.390625 \n", | |
"Q 39.453125 6.390625 43.28125 13.890625 \n", | |
"Q 47.125 21.390625 47.125 36.375 \n", | |
"Q 47.125 51.421875 43.28125 58.90625 \n", | |
"Q 39.453125 66.40625 31.78125 66.40625 \n", | |
"z\n", | |
"M 31.78125 74.21875 \n", | |
"Q 44.046875 74.21875 50.515625 64.515625 \n", | |
"Q 56.984375 54.828125 56.984375 36.375 \n", | |
"Q 56.984375 17.96875 50.515625 8.265625 \n", | |
"Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
"Q 6.59375 17.96875 6.59375 36.375 \n", | |
"Q 6.59375 54.828125 13.0625 64.515625 \n", | |
"Q 19.53125 74.21875 31.78125 74.21875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(63.611742 149.236895)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(124.134781 149.236895)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
"Q 47.65625 37.796875 51.625 33 \n", | |
"Q 55.609375 28.21875 55.609375 21.1875 \n", | |
"Q 55.609375 10.40625 48.1875 4.484375 \n", | |
"Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
"Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
"Q 12.796875 0.390625 7.625 2.203125 \n", | |
"L 7.625 11.71875 \n", | |
"Q 11.71875 9.328125 16.59375 8.109375 \n", | |
"Q 21.484375 6.890625 26.8125 6.890625 \n", | |
"Q 36.078125 6.890625 40.9375 10.546875 \n", | |
"Q 45.796875 14.203125 45.796875 21.1875 \n", | |
"Q 45.796875 27.640625 41.28125 31.265625 \n", | |
"Q 36.765625 34.90625 28.71875 34.90625 \n", | |
"L 20.21875 34.90625 \n", | |
"L 20.21875 43.015625 \n", | |
"L 29.109375 43.015625 \n", | |
"Q 36.375 43.015625 40.234375 45.921875 \n", | |
"Q 44.09375 48.828125 44.09375 54.296875 \n", | |
"Q 44.09375 59.90625 40.109375 62.90625 \n", | |
"Q 36.140625 65.921875 28.71875 65.921875 \n", | |
"Q 24.65625 65.921875 20.015625 65.03125 \n", | |
"Q 15.375 64.15625 9.8125 62.3125 \n", | |
"L 9.8125 71.09375 \n", | |
"Q 15.4375 72.65625 20.34375 73.4375 \n", | |
"Q 25.25 74.21875 29.59375 74.21875 \n", | |
"Q 40.828125 74.21875 47.359375 69.109375 \n", | |
"Q 53.90625 64.015625 53.90625 55.328125 \n", | |
"Q 53.90625 49.265625 50.4375 45.09375 \n", | |
"Q 46.96875 40.921875 40.578125 39.3125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(184.657819 149.236895)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-51 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=patch_3><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 19.636364 121.141049 \n", | |
"L 23.170909 121.141049 \n", | |
"L 23.170909 97.022787 \n", | |
"L 19.636364 97.022787 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 23.170909 121.141049 \n", | |
"L 26.705455 121.141049 \n", | |
"L 26.705455 114.824361 \n", | |
"L 23.170909 114.824361 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 26.705455 121.141049 \n", | |
"L 30.24 121.141049 \n", | |
"L 30.24 102.76523 \n", | |
"L 26.705455 102.76523 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 30.24 121.141049 \n", | |
"L 33.774545 121.141049 \n", | |
"L 33.774545 95.874298 \n", | |
"L 30.24 95.874298 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 33.774545 121.141049 \n", | |
"L 37.309091 121.141049 \n", | |
"L 37.309091 77.498479 \n", | |
"L 33.774545 77.498479 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 37.309091 121.141049 \n", | |
"L 40.843636 121.141049 \n", | |
"L 40.843636 82.666678 \n", | |
"L 37.309091 82.666678 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 40.843636 121.141049 \n", | |
"L 44.378182 121.141049 \n", | |
"L 44.378182 16.054336 \n", | |
"L 40.843636 16.054336 \n", | |
"z\n", | |
""/></g><g id=patch_10><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 44.378182 121.141049 \n", | |
"L 47.912727 121.141049 \n", | |
"L 47.912727 54.528706 \n", | |
"L 44.378182 54.528706 \n", | |
"z\n", | |
""/></g><g id=patch_11><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 47.912727 121.141049 \n", | |
"L 51.447273 121.141049 \n", | |
"L 51.447273 36.727132 \n", | |
"L 47.912727 36.727132 \n", | |
"z\n", | |
""/></g><g id=patch_12><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 51.447273 121.141049 \n", | |
"L 54.981818 121.141049 \n", | |
"L 54.981818 46.489285 \n", | |
"L 51.447273 46.489285 \n", | |
"z\n", | |
""/></g><g id=patch_13><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 54.981818 121.141049 \n", | |
"L 58.516364 121.141049 \n", | |
"L 58.516364 40.172598 \n", | |
"L 54.981818 40.172598 \n", | |
"z\n", | |
""/></g><g id=patch_14><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 58.516364 121.141049 \n", | |
"L 62.050909 121.141049 \n", | |
"L 62.050909 86.686389 \n", | |
"L 58.516364 86.686389 \n", | |
"z\n", | |
""/></g><g id=patch_15><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 62.050909 121.141049 \n", | |
"L 65.585455 121.141049 \n", | |
"L 65.585455 98.74552 \n", | |
"L 62.050909 98.74552 \n", | |
"z\n", | |
""/></g><g id=patch_16><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 65.585455 121.141049 \n", | |
"L 69.12 121.141049 \n", | |
"L 69.12 101.042497 \n", | |
"L 65.585455 101.042497 \n", | |
"z\n", | |
""/></g><g id=patch_17><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 69.12 121.141049 \n", | |
"L 72.654545 121.141049 \n", | |
"L 72.654545 107.933429 \n", | |
"L 69.12 107.933429 \n", | |
"z\n", | |
""/></g><g id=patch_18><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 72.654545 121.141049 \n", | |
"L 76.189091 121.141049 \n", | |
"L 76.189091 114.250117 \n", | |
"L 72.654545 114.250117 \n", | |
"z\n", | |
""/></g><g id=patch_19><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 76.189091 121.141049 \n", | |
"L 79.723636 121.141049 \n", | |
"L 79.723636 113.675873 \n", | |
"L 76.189091 113.675873 \n", | |
"z\n", | |
""/></g><g id=patch_20><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 79.723636 121.141049 \n", | |
"L 83.258182 121.141049 \n", | |
"L 83.258182 117.695583 \n", | |
"L 79.723636 117.695583 \n", | |
"z\n", | |
""/></g><g id=patch_21><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 83.258182 121.141049 \n", | |
"L 86.792727 121.141049 \n", | |
"L 86.792727 117.695583 \n", | |
"L 83.258182 117.695583 \n", | |
"z\n", | |
""/></g><g id=patch_22><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 86.792727 121.141049 \n", | |
"L 90.327273 121.141049 \n", | |
"L 90.327273 119.418316 \n", | |
"L 86.792727 119.418316 \n", | |
"z\n", | |
""/></g><g id=patch_23><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 90.327273 121.141049 \n", | |
"L 93.861818 121.141049 \n", | |
"L 93.861818 119.418316 \n", | |
"L 90.327273 119.418316 \n", | |
"z\n", | |
""/></g><g id=patch_24><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 93.861818 121.141049 \n", | |
"L 97.396364 121.141049 \n", | |
"L 97.396364 119.99256 \n", | |
"L 93.861818 119.99256 \n", | |
"z\n", | |
""/></g><g id=patch_25><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 97.396364 121.141049 \n", | |
"L 100.930909 121.141049 \n", | |
"L 100.930909 119.418316 \n", | |
"L 97.396364 119.418316 \n", | |
"z\n", | |
""/></g><g id=patch_26><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 100.930909 121.141049 \n", | |
"L 104.465455 121.141049 \n", | |
"L 104.465455 120.566805 \n", | |
"L 100.930909 120.566805 \n", | |
"z\n", | |
""/></g><g id=patch_27><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 104.465455 121.141049 \n", | |
"L 108 121.141049 \n", | |
"L 108 121.141049 \n", | |
"L 104.465455 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_28><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 108 121.141049 \n", | |
"L 111.534545 121.141049 \n", | |
"L 111.534545 120.566805 \n", | |
"L 108 120.566805 \n", | |
"z\n", | |
""/></g><g id=patch_29><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 111.534545 121.141049 \n", | |
"L 115.069091 121.141049 \n", | |
"L 115.069091 119.99256 \n", | |
"L 111.534545 119.99256 \n", | |
"z\n", | |
""/></g><g id=patch_30><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 115.069091 121.141049 \n", | |
"L 118.603636 121.141049 \n", | |
"L 118.603636 120.566805 \n", | |
"L 115.069091 120.566805 \n", | |
"z\n", | |
""/></g><g id=patch_31><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 118.603636 121.141049 \n", | |
"L 122.138182 121.141049 \n", | |
"L 122.138182 121.141049 \n", | |
"L 118.603636 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_32><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 122.138182 121.141049 \n", | |
"L 125.672727 121.141049 \n", | |
"L 125.672727 121.141049 \n", | |
"L 122.138182 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_33><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 125.672727 121.141049 \n", | |
"L 129.207273 121.141049 \n", | |
"L 129.207273 121.141049 \n", | |
"L 125.672727 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_34><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 129.207273 121.141049 \n", | |
"L 132.741818 121.141049 \n", | |
"L 132.741818 121.141049 \n", | |
"L 129.207273 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_35><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 132.741818 121.141049 \n", | |
"L 136.276364 121.141049 \n", | |
"L 136.276364 121.141049 \n", | |
"L 132.741818 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_36><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 136.276364 121.141049 \n", | |
"L 139.810909 121.141049 \n", | |
"L 139.810909 121.141049 \n", | |
"L 136.276364 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_37><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 139.810909 121.141049 \n", | |
"L 143.345455 121.141049 \n", | |
"L 143.345455 121.141049 \n", | |
"L 139.810909 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_38><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 143.345455 121.141049 \n", | |
"L 146.88 121.141049 \n", | |
"L 146.88 121.141049 \n", | |
"L 143.345455 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_39><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 146.88 121.141049 \n", | |
"L 150.414545 121.141049 \n", | |
"L 150.414545 121.141049 \n", | |
"L 146.88 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_40><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 150.414545 121.141049 \n", | |
"L 153.949091 121.141049 \n", | |
"L 153.949091 121.141049 \n", | |
"L 150.414545 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_41><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 153.949091 121.141049 \n", | |
"L 157.483636 121.141049 \n", | |
"L 157.483636 121.141049 \n", | |
"L 153.949091 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_42><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 157.483636 121.141049 \n", | |
"L 161.018182 121.141049 \n", | |
"L 161.018182 121.141049 \n", | |
"L 157.483636 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_43><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 161.018182 121.141049 \n", | |
"L 164.552727 121.141049 \n", | |
"L 164.552727 121.141049 \n", | |
"L 161.018182 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_44><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 164.552727 121.141049 \n", | |
"L 168.087273 121.141049 \n", | |
"L 168.087273 121.141049 \n", | |
"L 164.552727 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_45><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 168.087273 121.141049 \n", | |
"L 171.621818 121.141049 \n", | |
"L 171.621818 121.141049 \n", | |
"L 168.087273 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_46><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 171.621818 121.141049 \n", | |
"L 175.156364 121.141049 \n", | |
"L 175.156364 121.141049 \n", | |
"L 171.621818 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_47><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 175.156364 121.141049 \n", | |
"L 178.690909 121.141049 \n", | |
"L 178.690909 121.141049 \n", | |
"L 175.156364 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_48><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 178.690909 121.141049 \n", | |
"L 182.225455 121.141049 \n", | |
"L 182.225455 121.141049 \n", | |
"L 178.690909 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_49><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 182.225455 121.141049 \n", | |
"L 185.76 121.141049 \n", | |
"L 185.76 121.141049 \n", | |
"L 182.225455 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_50><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 185.76 121.141049 \n", | |
"L 189.294545 121.141049 \n", | |
"L 189.294545 121.141049 \n", | |
"L 185.76 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_51><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 189.294545 121.141049 \n", | |
"L 192.829091 121.141049 \n", | |
"L 192.829091 121.141049 \n", | |
"L 189.294545 121.141049 \n", | |
"z\n", | |
""/></g><g id=patch_52><path clip-path=url(#pc25d4ac22a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 192.829091 121.141049 \n", | |
"L 196.363636 121.141049 \n", | |
"L 196.363636 119.99256 \n", | |
"L 192.829091 119.99256 \n", | |
"z\n", | |
""/></g><g id=patch_53><path style=fill:none; d="M 10.8 121.141049 \n", | |
"L 10.8 10.8 \n", | |
""/></g><g id=patch_54><path style=fill:none; d="M 205.2 121.141049 \n", | |
"L 205.2 10.8 \n", | |
""/></g><g id=patch_55><path style=fill:none; d="M 10.8 121.141049 \n", | |
"L 205.2 121.141049 \n", | |
""/></g><g id=patch_56><path style=fill:none; d="M 10.8 10.8 \n", | |
"L 205.2 10.8 \n", | |
""/></g></g></g><defs><clippath id=pc25d4ac22a><rect height=110.341049 width=194.4 x=10.8 y=10.8 /></clippath></defs></svg></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom--4044077858387873843, #minifreqtable-4044077858387873843" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom--4044077858387873843 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-4044077858387873843bottom--4044077858387873843statistics aria-controls=-4044077858387873843bottom--4044077858387873843statistics role=tab data-toggle=tab>Statistics</a></li><li role=presentation><a href=#-4044077858387873843bottom--4044077858387873843histogram aria-controls=-4044077858387873843bottom--4044077858387873843histogram role=tab data-toggle=tab>Histogram</a></li><li role=presentation><a href=#-4044077858387873843bottom--4044077858387873843common_values aria-controls=-4044077858387873843bottom--4044077858387873843common_values role=tab data-toggle=tab>Common values</a></li><li role=presentation><a href=#-4044077858387873843bottom--4044077858387873843extreme_values aria-controls=-4044077858387873843bottom--4044077858387873843extreme_values role=tab data-toggle=tab>Extreme values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-4044077858387873843bottom--4044077858387873843statistics><div class=col-sm-6><p class=h4>Quantile statistics</p><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>21</td></tr><tr><th>5-th percentile</th><td>34</td></tr><tr><th>Q1</th><td>59</td></tr><tr><th>median</th><td>69</td></tr><tr><th>Q3</th><td>80</td></tr><tr><th>95-th percentile</th><td>107</td></tr><tr><th>Maximum</th><td>313</td></tr><tr><th>Range</th><td>292</td></tr><tr><th>Interquartile range (IQR)</th><td>21</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Descriptive statistics</p><table class="table table-condensed stats"><tbody><tr><th>Standard deviation</th><td>24.28475177</td></tr><tr><th>Coefficient of variation (CV)</th><td>0.3466776047</td></tr><tr><th>Kurtosis</th><td>17.45286726</td></tr><tr><th>Mean</th><td>70.04995837</td></tr><tr><th>Median Absolute Deviation (MAD)</th><td>11</td></tr><tr><th>Skewness</th><td>2.163569142</td></tr><tr><th>Sum</th><td>84130</td></tr><tr><th>Variance</th><td>589.7491687</td></tr><tr><th>Monotonicity</th><td>Not monotonic</td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-4044077858387873843bottom--4044077858387873843histogram><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
"L 432 288 \n", | |
"L 432 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 56.925 243.693903 \n", | |
"L 421.2 243.693903 \n", | |
"L 421.2 10.8 \n", | |
"L 56.925 10.8 \n", | |
"z\n", | |
""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
"L 49.515625 72.90625 \n", | |
"L 49.515625 64.59375 \n", | |
"L 19.828125 64.59375 \n", | |
"L 19.828125 46.734375 \n", | |
"Q 21.96875 47.46875 24.109375 47.828125 \n", | |
"Q 26.265625 48.1875 28.421875 48.1875 \n", | |
"Q 40.625 48.1875 47.75 41.5 \n", | |
"Q 54.890625 34.8125 54.890625 23.390625 \n", | |
"Q 54.890625 11.625 47.5625 5.09375 \n", | |
"Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
"Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
"Q 12.796875 0.140625 7.71875 1.703125 \n", | |
"L 7.71875 11.625 \n", | |
"Q 12.109375 9.234375 16.796875 8.0625 \n", | |
"Q 21.484375 6.890625 26.703125 6.890625 \n", | |
"Q 35.15625 6.890625 40.078125 11.328125 \n", | |
"Q 45.015625 15.765625 45.015625 23.390625 \n", | |
"Q 45.015625 31 40.078125 35.4375 \n", | |
"Q 35.15625 39.890625 26.703125 39.890625 \n", | |
"Q 22.75 39.890625 18.8125 39.015625 \n", | |
"Q 14.890625 38.140625 10.796875 36.28125 \n", | |
"z\n", | |
""/><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
"Q 24.171875 66.40625 20.328125 58.90625 \n", | |
"Q 16.5 51.421875 16.5 36.375 \n", | |
"Q 16.5 21.390625 20.328125 13.890625 \n", | |
"Q 24.171875 6.390625 31.78125 6.390625 \n", | |
"Q 39.453125 6.390625 43.28125 13.890625 \n", | |
"Q 47.125 21.390625 47.125 36.375 \n", | |
"Q 47.125 51.421875 43.28125 58.90625 \n", | |
"Q 39.453125 66.40625 31.78125 66.40625 \n", | |
"z\n", | |
"M 31.78125 74.21875 \n", | |
"Q 44.046875 74.21875 50.515625 64.515625 \n", | |
"Q 56.984375 54.828125 56.984375 36.375 \n", | |
"Q 56.984375 17.96875 50.515625 8.265625 \n", | |
"Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
"Q 6.59375 17.96875 6.59375 36.375 \n", | |
"Q 6.59375 54.828125 13.0625 64.515625 \n", | |
"Q 19.53125 74.21875 31.78125 74.21875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(103.824248 271.064744)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(158.280089 275.563711)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><g style=fill:#262626; transform="translate(214.985412 275.563711)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(271.690736 275.563711)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_5><g id=text_5><g style=fill:#262626; transform="translate(328.39606 275.563711)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_6><g id=text_6><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
"Q 47.65625 37.796875 51.625 33 \n", | |
"Q 55.609375 28.21875 55.609375 21.1875 \n", | |
"Q 55.609375 10.40625 48.1875 4.484375 \n", | |
"Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
"Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
"Q 12.796875 0.390625 7.625 2.203125 \n", | |
"L 7.625 11.71875 \n", | |
"Q 11.71875 9.328125 16.59375 8.109375 \n", | |
"Q 21.484375 6.890625 26.8125 6.890625 \n", | |
"Q 36.078125 6.890625 40.9375 10.546875 \n", | |
"Q 45.796875 14.203125 45.796875 21.1875 \n", | |
"Q 45.796875 27.640625 41.28125 31.265625 \n", | |
"Q 36.765625 34.90625 28.71875 34.90625 \n", | |
"L 20.21875 34.90625 \n", | |
"L 20.21875 43.015625 \n", | |
"L 29.109375 43.015625 \n", | |
"Q 36.375 43.015625 40.234375 45.921875 \n", | |
"Q 44.09375 48.828125 44.09375 54.296875 \n", | |
"Q 44.09375 59.90625 40.109375 62.90625 \n", | |
"Q 36.140625 65.921875 28.71875 65.921875 \n", | |
"Q 24.65625 65.921875 20.015625 65.03125 \n", | |
"Q 15.375 64.15625 9.8125 62.3125 \n", | |
"L 9.8125 71.09375 \n", | |
"Q 15.4375 72.65625 20.34375 73.4375 \n", | |
"Q 25.25 74.21875 29.59375 74.21875 \n", | |
"Q 40.828125 74.21875 47.359375 69.109375 \n", | |
"Q 53.90625 64.015625 53.90625 55.328125 \n", | |
"Q 53.90625 49.265625 50.4375 45.09375 \n", | |
"Q 46.96875 40.921875 40.578125 39.3125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(385.101384 275.563711)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-51 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_7><g style=fill:#262626; transform="translate(37.5625 247.493122)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_8><g style=fill:#262626; transform="translate(31.2 217.192068)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-53 /></g></g></g><g id=ytick_3><g id=text_9><g style=fill:#262626; transform="translate(31.2 186.891013)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_10><defs><path id=DejaVuSans-55 d="M 8.203125 72.90625 \n", | |
"L 55.078125 72.90625 \n", | |
"L 55.078125 68.703125 \n", | |
"L 28.609375 0 \n", | |
"L 18.3125 0 \n", | |
"L 43.21875 64.59375 \n", | |
"L 8.203125 64.59375 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(31.2 156.589959)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-55 /><use x=63.623047 xlink:href=#DejaVuSans-53 /></g></g></g><g id=ytick_5><g id=text_11><g style=fill:#262626; transform="translate(24.8375 126.288905)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_6><g id=text_12><g style=fill:#262626; transform="translate(24.8375 95.987851)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-50 /><use x=127.246094 xlink:href=#DejaVuSans-53 /></g></g></g><g id=ytick_7><g id=text_13><g style=fill:#262626; transform="translate(24.8375 65.686796)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_8><g id=text_14><g style=fill:#262626; transform="translate(24.8375 35.385742)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-55 /><use x=127.246094 xlink:href=#DejaVuSans-53 /></g></g></g><g id=text_15><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
"L 51.703125 72.90625 \n", | |
"L 51.703125 64.59375 \n", | |
"L 19.671875 64.59375 \n", | |
"L 19.671875 43.109375 \n", | |
"L 48.578125 43.109375 \n", | |
"L 48.578125 34.8125 \n", | |
"L 19.671875 34.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
"Q 39.59375 47.171875 37.8125 47.578125 \n", | |
"Q 36.03125 48 33.890625 48 \n", | |
"Q 26.265625 48 22.1875 43.046875 \n", | |
"Q 18.109375 38.09375 18.109375 28.8125 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 20.953125 51.171875 25.484375 53.578125 \n", | |
"Q 30.03125 56 36.53125 56 \n", | |
"Q 37.453125 56 38.578125 55.875 \n", | |
"Q 39.703125 55.765625 41.0625 55.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
"Q 14.796875 17.390625 18.875 11.75 \n", | |
"Q 22.953125 6.109375 30.078125 6.109375 \n", | |
"Q 37.203125 6.109375 41.296875 11.75 \n", | |
"Q 45.40625 17.390625 45.40625 27.296875 \n", | |
"Q 45.40625 37.203125 41.296875 42.84375 \n", | |
"Q 37.203125 48.484375 30.078125 48.484375 \n", | |
"Q 22.953125 48.484375 18.875 42.84375 \n", | |
"Q 14.796875 37.203125 14.796875 27.296875 \n", | |
"z\n", | |
"M 45.40625 8.203125 \n", | |
"Q 42.578125 3.328125 38.25 0.953125 \n", | |
"Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
"Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
"Q 5.515625 14.40625 5.515625 27.296875 \n", | |
"Q 5.515625 40.1875 11.734375 48.09375 \n", | |
"Q 17.96875 56 27.875 56 \n", | |
"Q 33.9375 56 38.25 53.625 \n", | |
"Q 42.578125 51.265625 45.40625 46.390625 \n", | |
"L 45.40625 54.6875 \n", | |
"L 54.390625 54.6875 \n", | |
"L 54.390625 -20.796875 \n", | |
"L 45.40625 -20.796875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
"L 8.5 54.6875 \n", | |
"L 17.484375 54.6875 \n", | |
"L 17.484375 21.921875 \n", | |
"Q 17.484375 14.15625 20.5 10.265625 \n", | |
"Q 23.53125 6.390625 29.59375 6.390625 \n", | |
"Q 36.859375 6.390625 41.078125 11.03125 \n", | |
"Q 45.3125 15.671875 45.3125 23.6875 \n", | |
"L 45.3125 54.6875 \n", | |
"L 54.296875 54.6875 \n", | |
"L 54.296875 0 \n", | |
"L 45.3125 0 \n", | |
"L 45.3125 8.40625 \n", | |
"Q 42.046875 3.421875 37.71875 1 \n", | |
"Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
"Q 18.265625 -1.421875 13.375 4.4375 \n", | |
"Q 8.5 10.296875 8.5 21.578125 \n", | |
"z\n", | |
"M 31.109375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
"L 54.890625 0 \n", | |
"L 45.90625 0 \n", | |
"L 45.90625 32.71875 \n", | |
"Q 45.90625 40.484375 42.875 44.328125 \n", | |
"Q 39.84375 48.1875 33.796875 48.1875 \n", | |
"Q 26.515625 48.1875 22.3125 43.546875 \n", | |
"Q 18.109375 38.921875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.34375 51.125 25.703125 53.5625 \n", | |
"Q 30.078125 56 35.796875 56 \n", | |
"Q 45.21875 56 50.046875 50.171875 \n", | |
"Q 54.890625 44.34375 54.890625 33.015625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
"L 48.78125 44.1875 \n", | |
"Q 44.96875 46.296875 41.140625 47.34375 \n", | |
"Q 37.3125 48.390625 33.40625 48.390625 \n", | |
"Q 24.65625 48.390625 19.8125 42.84375 \n", | |
"Q 14.984375 37.3125 14.984375 27.296875 \n", | |
"Q 14.984375 17.28125 19.8125 11.734375 \n", | |
"Q 24.65625 6.203125 33.40625 6.203125 \n", | |
"Q 37.3125 6.203125 41.140625 7.25 \n", | |
"Q 44.96875 8.296875 48.78125 10.40625 \n", | |
"L 48.78125 2.09375 \n", | |
"Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
"Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
"Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
"Q 5.515625 14.109375 5.515625 27.296875 \n", | |
"Q 5.515625 40.671875 12.859375 48.328125 \n", | |
"Q 20.21875 56 33.015625 56 \n", | |
"Q 37.15625 56 41.109375 55.140625 \n", | |
"Q 45.0625 54.296875 48.78125 52.59375 \n", | |
"z\n", | |
""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
"Q 28.375 -14.84375 24.75 -17.8125 \n", | |
"Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
"L 7.90625 -20.796875 \n", | |
"L 7.90625 -13.28125 \n", | |
"L 13.1875 -13.28125 \n", | |
"Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
"Q 21 -9.765625 23.484375 -3.21875 \n", | |
"L 25.09375 0.875 \n", | |
"L 2.984375 54.6875 \n", | |
"L 12.5 54.6875 \n", | |
"L 29.59375 11.921875 \n", | |
"L 46.6875 54.6875 \n", | |
"L 56.203125 54.6875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(18.549844 155.659608)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 73.482955 243.693903 \n", | |
"L 80.106136 243.693903 \n", | |
"L 80.106136 192.788132 \n", | |
"L 73.482955 192.788132 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 80.106136 243.693903 \n", | |
"L 86.729318 243.693903 \n", | |
"L 86.729318 230.361439 \n", | |
"L 80.106136 230.361439 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 86.729318 243.693903 \n", | |
"L 93.3525 243.693903 \n", | |
"L 93.3525 204.908554 \n", | |
"L 86.729318 204.908554 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 93.3525 243.693903 \n", | |
"L 99.975682 243.693903 \n", | |
"L 99.975682 190.364048 \n", | |
"L 93.3525 190.364048 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 99.975682 243.693903 \n", | |
"L 106.598864 243.693903 \n", | |
"L 106.598864 151.578698 \n", | |
"L 99.975682 151.578698 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 106.598864 243.693903 \n", | |
"L 113.222045 243.693903 \n", | |
"L 113.222045 162.487078 \n", | |
"L 106.598864 162.487078 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 113.222045 243.693903 \n", | |
"L 119.845227 243.693903 \n", | |
"L 119.845227 21.890186 \n", | |
"L 113.222045 21.890186 \n", | |
"z\n", | |
""/></g><g id=patch_10><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 119.845227 243.693903 \n", | |
"L 126.468409 243.693903 \n", | |
"L 126.468409 103.097011 \n", | |
"L 119.845227 103.097011 \n", | |
"z\n", | |
""/></g><g id=patch_11><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 126.468409 243.693903 \n", | |
"L 133.091591 243.693903 \n", | |
"L 133.091591 65.523704 \n", | |
"L 126.468409 65.523704 \n", | |
"z\n", | |
""/></g><g id=patch_12><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 133.091591 243.693903 \n", | |
"L 139.714773 243.693903 \n", | |
"L 139.714773 86.128421 \n", | |
"L 133.091591 86.128421 \n", | |
"z\n", | |
""/></g><g id=patch_13><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 139.714773 243.693903 \n", | |
"L 146.337955 243.693903 \n", | |
"L 146.337955 72.795957 \n", | |
"L 139.714773 72.795957 \n", | |
"z\n", | |
""/></g><g id=patch_14><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 146.337955 243.693903 \n", | |
"L 152.961136 243.693903 \n", | |
"L 152.961136 170.971373 \n", | |
"L 146.337955 170.971373 \n", | |
"z\n", | |
""/></g><g id=patch_15><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 152.961136 243.693903 \n", | |
"L 159.584318 243.693903 \n", | |
"L 159.584318 196.424259 \n", | |
"L 152.961136 196.424259 \n", | |
"z\n", | |
""/></g><g id=patch_16><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 159.584318 243.693903 \n", | |
"L 166.2075 243.693903 \n", | |
"L 166.2075 201.272427 \n", | |
"L 159.584318 201.272427 \n", | |
"z\n", | |
""/></g><g id=patch_17><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 166.2075 243.693903 \n", | |
"L 172.830682 243.693903 \n", | |
"L 172.830682 215.816933 \n", | |
"L 166.2075 215.816933 \n", | |
"z\n", | |
""/></g><g id=patch_18><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 172.830682 243.693903 \n", | |
"L 179.453864 243.693903 \n", | |
"L 179.453864 229.149397 \n", | |
"L 172.830682 229.149397 \n", | |
"z\n", | |
""/></g><g id=patch_19><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 179.453864 243.693903 \n", | |
"L 186.077045 243.693903 \n", | |
"L 186.077045 227.937355 \n", | |
"L 179.453864 227.937355 \n", | |
"z\n", | |
""/></g><g id=patch_20><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 186.077045 243.693903 \n", | |
"L 192.700227 243.693903 \n", | |
"L 192.700227 236.42165 \n", | |
"L 186.077045 236.42165 \n", | |
"z\n", | |
""/></g><g id=patch_21><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 192.700227 243.693903 \n", | |
"L 199.323409 243.693903 \n", | |
"L 199.323409 236.42165 \n", | |
"L 192.700227 236.42165 \n", | |
"z\n", | |
""/></g><g id=patch_22><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 199.323409 243.693903 \n", | |
"L 205.946591 243.693903 \n", | |
"L 205.946591 240.057777 \n", | |
"L 199.323409 240.057777 \n", | |
"z\n", | |
""/></g><g id=patch_23><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 205.946591 243.693903 \n", | |
"L 212.569773 243.693903 \n", | |
"L 212.569773 240.057777 \n", | |
"L 205.946591 240.057777 \n", | |
"z\n", | |
""/></g><g id=patch_24><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 212.569773 243.693903 \n", | |
"L 219.192955 243.693903 \n", | |
"L 219.192955 241.269819 \n", | |
"L 212.569773 241.269819 \n", | |
"z\n", | |
""/></g><g id=patch_25><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 219.192955 243.693903 \n", | |
"L 225.816136 243.693903 \n", | |
"L 225.816136 240.057777 \n", | |
"L 219.192955 240.057777 \n", | |
"z\n", | |
""/></g><g id=patch_26><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 225.816136 243.693903 \n", | |
"L 232.439318 243.693903 \n", | |
"L 232.439318 242.481861 \n", | |
"L 225.816136 242.481861 \n", | |
"z\n", | |
""/></g><g id=patch_27><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 232.439318 243.693903 \n", | |
"L 239.0625 243.693903 \n", | |
"L 239.0625 243.693903 \n", | |
"L 232.439318 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_28><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 239.0625 243.693903 \n", | |
"L 245.685682 243.693903 \n", | |
"L 245.685682 242.481861 \n", | |
"L 239.0625 242.481861 \n", | |
"z\n", | |
""/></g><g id=patch_29><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 245.685682 243.693903 \n", | |
"L 252.308864 243.693903 \n", | |
"L 252.308864 241.269819 \n", | |
"L 245.685682 241.269819 \n", | |
"z\n", | |
""/></g><g id=patch_30><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 252.308864 243.693903 \n", | |
"L 258.932045 243.693903 \n", | |
"L 258.932045 242.481861 \n", | |
"L 252.308864 242.481861 \n", | |
"z\n", | |
""/></g><g id=patch_31><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 258.932045 243.693903 \n", | |
"L 265.555227 243.693903 \n", | |
"L 265.555227 243.693903 \n", | |
"L 258.932045 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_32><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 265.555227 243.693903 \n", | |
"L 272.178409 243.693903 \n", | |
"L 272.178409 243.693903 \n", | |
"L 265.555227 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_33><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 272.178409 243.693903 \n", | |
"L 278.801591 243.693903 \n", | |
"L 278.801591 243.693903 \n", | |
"L 272.178409 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_34><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 278.801591 243.693903 \n", | |
"L 285.424773 243.693903 \n", | |
"L 285.424773 243.693903 \n", | |
"L 278.801591 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_35><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 285.424773 243.693903 \n", | |
"L 292.047955 243.693903 \n", | |
"L 292.047955 243.693903 \n", | |
"L 285.424773 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_36><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 292.047955 243.693903 \n", | |
"L 298.671136 243.693903 \n", | |
"L 298.671136 243.693903 \n", | |
"L 292.047955 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_37><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 298.671136 243.693903 \n", | |
"L 305.294318 243.693903 \n", | |
"L 305.294318 243.693903 \n", | |
"L 298.671136 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_38><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 305.294318 243.693903 \n", | |
"L 311.9175 243.693903 \n", | |
"L 311.9175 243.693903 \n", | |
"L 305.294318 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_39><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 311.9175 243.693903 \n", | |
"L 318.540682 243.693903 \n", | |
"L 318.540682 243.693903 \n", | |
"L 311.9175 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_40><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 318.540682 243.693903 \n", | |
"L 325.163864 243.693903 \n", | |
"L 325.163864 243.693903 \n", | |
"L 318.540682 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_41><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 325.163864 243.693903 \n", | |
"L 331.787045 243.693903 \n", | |
"L 331.787045 243.693903 \n", | |
"L 325.163864 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_42><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 331.787045 243.693903 \n", | |
"L 338.410227 243.693903 \n", | |
"L 338.410227 243.693903 \n", | |
"L 331.787045 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_43><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 338.410227 243.693903 \n", | |
"L 345.033409 243.693903 \n", | |
"L 345.033409 243.693903 \n", | |
"L 338.410227 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_44><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 345.033409 243.693903 \n", | |
"L 351.656591 243.693903 \n", | |
"L 351.656591 243.693903 \n", | |
"L 345.033409 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_45><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 351.656591 243.693903 \n", | |
"L 358.279773 243.693903 \n", | |
"L 358.279773 243.693903 \n", | |
"L 351.656591 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_46><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 358.279773 243.693903 \n", | |
"L 364.902955 243.693903 \n", | |
"L 364.902955 243.693903 \n", | |
"L 358.279773 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_47><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 364.902955 243.693903 \n", | |
"L 371.526136 243.693903 \n", | |
"L 371.526136 243.693903 \n", | |
"L 364.902955 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_48><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 371.526136 243.693903 \n", | |
"L 378.149318 243.693903 \n", | |
"L 378.149318 243.693903 \n", | |
"L 371.526136 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_49><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 378.149318 243.693903 \n", | |
"L 384.7725 243.693903 \n", | |
"L 384.7725 243.693903 \n", | |
"L 378.149318 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_50><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 384.7725 243.693903 \n", | |
"L 391.395682 243.693903 \n", | |
"L 391.395682 243.693903 \n", | |
"L 384.7725 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_51><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 391.395682 243.693903 \n", | |
"L 398.018864 243.693903 \n", | |
"L 398.018864 243.693903 \n", | |
"L 391.395682 243.693903 \n", | |
"z\n", | |
""/></g><g id=patch_52><path clip-path=url(#p03526cf5d8) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 398.018864 243.693903 \n", | |
"L 404.642045 243.693903 \n", | |
"L 404.642045 241.269819 \n", | |
"L 398.018864 241.269819 \n", | |
"z\n", | |
""/></g><g id=patch_53><path style=fill:none; d="M 56.925 243.693903 \n", | |
"L 56.925 10.8 \n", | |
""/></g><g id=patch_54><path style=fill:none; d="M 421.2 243.693903 \n", | |
"L 421.2 10.8 \n", | |
""/></g><g id=patch_55><path style=fill:none; d="M 56.925 243.693903 \n", | |
"L 421.2 243.693903 \n", | |
""/></g><g id=patch_56><path style=fill:none; d="M 56.925 10.8 \n", | |
"L 421.2 10.8 \n", | |
""/></g></g></g><defs><clippath id=p03526cf5d8><rect height=232.893903 width=364.275 x=56.925 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"><strong>Histogram with fixed size bins</strong> (bins=50) </div></div><div role=tabpanel class="tab-pane col-sm-12" id=-4044077858387873843bottom--4044077858387873843common_values><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=60>60</td><td>143</td><td><div class=bar style=width:21.9%> &nbsp; </div> 9.8% </td></tr><tr class><td title=70>70</td><td>70</td><td><div class=bar style=width:10.7%> &nbsp; </div> 4.8% </td></tr><tr class><td title=80>80</td><td>69</td><td><div class=bar style=width:10.6%> &nbsp; </div> 4.7% </td></tr><tr class><td title=50>50</td><td>57</td><td><div class=bar style=width:8.7%> &nbsp; </div> 3.9% </td></tr><tr class><td title=75>75</td><td>53</td><td><div class=bar style=width:8.1%> &nbsp; </div> 3.6% </td></tr><tr class><td title=65>65</td><td>44</td><td><div class=bar style=width:6.7%> &nbsp; </div> 3.0% </td></tr><tr class><td title=85>85</td><td>40</td><td><div class=bar style=width:6.1%> &nbsp; </div> 2.7% </td></tr><tr class><td title=78>78</td><td>25</td><td><div class=bar style=width:3.8%> &nbsp; </div> 1.7% </td></tr><tr class><td title=90>90</td><td>23</td><td><div class=bar style=width:3.5%> &nbsp; </div> 1.6% </td></tr><tr class><td title=21>21</td><td>23</td><td><div class=bar style=width:3.5%> &nbsp; </div> 1.6% </td></tr><tr class=other><td title="Other values (100)">Other values (100)</td><td>654</td><td><div class=bar style=width:100.0%> 44.8% </div></td></tr><tr class=missing><td title=(Missing)>(Missing)</td><td>259</td><td><div class=bar style=width:39.6%> &nbsp; </div> 17.7% </td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=-4044077858387873843bottom--4044077858387873843extreme_values><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-4044077858387873843extreme_values--4044077858387873843firstn aria-controls=-4044077858387873843extreme_values--4044077858387873843firstn role=tab data-toggle=tab>Minimum 5 values</a></li><li role=presentation><a href=#-4044077858387873843extreme_values--4044077858387873843lastn aria-controls=-4044077858387873843extreme_values--4044077858387873843lastn role=tab data-toggle=tab>Maximum 5 values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-4044077858387873843extreme_values--4044077858387873843firstn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=21>21</td><td>23</td><td><div class=bar style=width:100.0%> 1.6% </div></td></tr><tr class><td title=24>24</td><td>19</td><td><div class=bar style=width:82.6%> 1.3% </div></td></tr><tr class><td title=30>30</td><td>6</td><td><div class=bar style=width:26.1%> &nbsp; </div> 0.4% </td></tr><tr class><td title=32>32</td><td>5</td><td><div class=bar style=width:21.7%> &nbsp; </div> 0.3% </td></tr><tr class><td title=33>33</td><td>1</td><td><div class=bar style=width:4.3%> &nbsp; </div> 0.1% </td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=-4044077858387873843extreme_values--4044077858387873843lastn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=313>313</td><td>2</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr><tr class><td title=182>182</td><td>1</td><td><div class=bar style=width:50.0%> 0.1% </div></td></tr><tr class><td title=174>174</td><td>2</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr><tr class><td title=168>168</td><td>1</td><td><div class=bar style=width:50.0%> 0.1% </div></td></tr><tr class><td title=160>160</td><td>1</td><td><div class=bar style=width:50.0%> 0.1% </div></td></tr></tbody></table></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_2174257455784840793></a><div class=variable><div class=col-sm-3><p class=h4 title=LotArea><a href=#pp_var_2174257455784840793>LotArea</a><br><small>Real number (&Ropf;<sub>&ge;0</sub>)</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>1073</td></tr><tr><th>Distinct (%)</th><td>73.5%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Infinite</th><td>0</td></tr><tr><th>Infinite (%)</th><td>0.0%</td></tr><tr><th>Mean</th><td>10516.82808</td></tr></tbody></table></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>1300</td></tr><tr><th>Maximum</th><td>215245</td></tr><tr><th>Zeros</th><td>0</td></tr><tr><th>Zeros (%)</th><td>0.0%</td></tr><tr><th>Negative</th><td>0</td></tr><tr><th>Negative (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-3><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=162pt version=1.1 viewbox="0 0 216 162" width=216pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 162 \n", | |
"L 216 162 \n", | |
"L 216 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 10.8 110.534447 \n", | |
"L 205.2 110.534447 \n", | |
"L 205.2 10.8 \n", | |
"L 10.8 10.8 \n", | |
"z\n", | |
""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
"Q 24.171875 66.40625 20.328125 58.90625 \n", | |
"Q 16.5 51.421875 16.5 36.375 \n", | |
"Q 16.5 21.390625 20.328125 13.890625 \n", | |
"Q 24.171875 6.390625 31.78125 6.390625 \n", | |
"Q 39.453125 6.390625 43.28125 13.890625 \n", | |
"Q 47.125 21.390625 47.125 36.375 \n", | |
"Q 47.125 51.421875 43.28125 58.90625 \n", | |
"Q 39.453125 66.40625 31.78125 66.40625 \n", | |
"z\n", | |
"M 31.78125 74.21875 \n", | |
"Q 44.046875 74.21875 50.515625 64.515625 \n", | |
"Q 56.984375 54.828125 56.984375 36.375 \n", | |
"Q 56.984375 17.96875 50.515625 8.265625 \n", | |
"Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
"Q 6.59375 17.96875 6.59375 36.375 \n", | |
"Q 6.59375 54.828125 13.0625 64.515625 \n", | |
"Q 19.53125 74.21875 31.78125 74.21875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(18.323862 131.431946)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
"L 49.515625 72.90625 \n", | |
"L 49.515625 64.59375 \n", | |
"L 19.828125 64.59375 \n", | |
"L 19.828125 46.734375 \n", | |
"Q 21.96875 47.46875 24.109375 47.828125 \n", | |
"Q 26.265625 48.1875 28.421875 48.1875 \n", | |
"Q 40.625 48.1875 47.75 41.5 \n", | |
"Q 54.890625 34.8125 54.890625 23.390625 \n", | |
"Q 54.890625 11.625 47.5625 5.09375 \n", | |
"Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
"Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
"Q 12.796875 0.140625 7.71875 1.703125 \n", | |
"L 7.71875 11.625 \n", | |
"Q 12.109375 9.234375 16.796875 8.0625 \n", | |
"Q 21.484375 6.890625 26.703125 6.890625 \n", | |
"Q 35.15625 6.890625 40.078125 11.328125 \n", | |
"Q 45.015625 15.765625 45.015625 23.390625 \n", | |
"Q 45.015625 31 40.078125 35.4375 \n", | |
"Q 35.15625 39.890625 26.703125 39.890625 \n", | |
"Q 22.75 39.890625 18.8125 39.015625 \n", | |
"Q 14.890625 38.140625 10.796875 36.28125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(52.427549 145.82864)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(91.929996 149.427814)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /><use x=318.115234 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><g style=fill:#262626; transform="translate(133.23203 149.427814)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /><use x=318.115234 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(174.534064 149.427814)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /><use x=318.115234 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=patch_3><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 19.636364 110.534447 \n", | |
"L 23.170909 110.534447 \n", | |
"L 23.170909 84.750636 \n", | |
"L 19.636364 84.750636 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 23.170909 110.534447 \n", | |
"L 26.705455 110.534447 \n", | |
"L 26.705455 15.549259 \n", | |
"L 23.170909 15.549259 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 26.705455 110.534447 \n", | |
"L 30.24 110.534447 \n", | |
"L 30.24 38.665779 \n", | |
"L 26.705455 38.665779 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 30.24 110.534447 \n", | |
"L 33.774545 110.534447 \n", | |
"L 33.774545 95.864348 \n", | |
"L 30.24 95.864348 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 33.774545 110.534447 \n", | |
"L 37.309091 110.534447 \n", | |
"L 37.309091 106.978059 \n", | |
"L 33.774545 106.978059 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 37.309091 110.534447 \n", | |
"L 40.843636 110.534447 \n", | |
"L 40.843636 108.756253 \n", | |
"L 37.309091 108.756253 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 40.843636 110.534447 \n", | |
"L 44.378182 110.534447 \n", | |
"L 44.378182 110.089899 \n", | |
"L 40.843636 110.089899 \n", | |
"z\n", | |
""/></g><g id=patch_10><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 44.378182 110.534447 \n", | |
"L 47.912727 110.534447 \n", | |
"L 47.912727 109.793533 \n", | |
"L 44.378182 109.793533 \n", | |
"z\n", | |
""/></g><g id=patch_11><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 47.912727 110.534447 \n", | |
"L 51.447273 110.534447 \n", | |
"L 51.447273 110.089899 \n", | |
"L 47.912727 110.089899 \n", | |
"z\n", | |
""/></g><g id=patch_12><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 51.447273 110.534447 \n", | |
"L 54.981818 110.534447 \n", | |
"L 54.981818 110.386264 \n", | |
"L 51.447273 110.386264 \n", | |
"z\n", | |
""/></g><g id=patch_13><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 54.981818 110.534447 \n", | |
"L 58.516364 110.534447 \n", | |
"L 58.516364 110.238082 \n", | |
"L 54.981818 110.238082 \n", | |
"z\n", | |
""/></g><g id=patch_14><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 58.516364 110.534447 \n", | |
"L 62.050909 110.534447 \n", | |
"L 62.050909 110.386264 \n", | |
"L 58.516364 110.386264 \n", | |
"z\n", | |
""/></g><g id=patch_15><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 62.050909 110.534447 \n", | |
"L 65.585455 110.534447 \n", | |
"L 65.585455 110.089899 \n", | |
"L 62.050909 110.089899 \n", | |
"z\n", | |
""/></g><g id=patch_16><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 65.585455 110.534447 \n", | |
"L 69.12 110.534447 \n", | |
"L 69.12 110.386264 \n", | |
"L 65.585455 110.386264 \n", | |
"z\n", | |
""/></g><g id=patch_17><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 69.12 110.534447 \n", | |
"L 72.654545 110.534447 \n", | |
"L 72.654545 110.386264 \n", | |
"L 69.12 110.386264 \n", | |
"z\n", | |
""/></g><g id=patch_18><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 72.654545 110.534447 \n", | |
"L 76.189091 110.534447 \n", | |
"L 76.189091 110.534447 \n", | |
"L 72.654545 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_19><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 76.189091 110.534447 \n", | |
"L 79.723636 110.534447 \n", | |
"L 79.723636 110.386264 \n", | |
"L 76.189091 110.386264 \n", | |
"z\n", | |
""/></g><g id=patch_20><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 79.723636 110.534447 \n", | |
"L 83.258182 110.534447 \n", | |
"L 83.258182 110.534447 \n", | |
"L 79.723636 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_21><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 83.258182 110.534447 \n", | |
"L 86.792727 110.534447 \n", | |
"L 86.792727 110.534447 \n", | |
"L 83.258182 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_22><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 86.792727 110.534447 \n", | |
"L 90.327273 110.534447 \n", | |
"L 90.327273 110.534447 \n", | |
"L 86.792727 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_23><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 90.327273 110.534447 \n", | |
"L 93.861818 110.534447 \n", | |
"L 93.861818 110.534447 \n", | |
"L 90.327273 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_24><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 93.861818 110.534447 \n", | |
"L 97.396364 110.534447 \n", | |
"L 97.396364 110.534447 \n", | |
"L 93.861818 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_25><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 97.396364 110.534447 \n", | |
"L 100.930909 110.534447 \n", | |
"L 100.930909 110.534447 \n", | |
"L 97.396364 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_26><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 100.930909 110.534447 \n", | |
"L 104.465455 110.534447 \n", | |
"L 104.465455 110.534447 \n", | |
"L 100.930909 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_27><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 104.465455 110.534447 \n", | |
"L 108 110.534447 \n", | |
"L 108 110.534447 \n", | |
"L 104.465455 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_28><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 108 110.534447 \n", | |
"L 111.534545 110.534447 \n", | |
"L 111.534545 110.534447 \n", | |
"L 108 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_29><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 111.534545 110.534447 \n", | |
"L 115.069091 110.534447 \n", | |
"L 115.069091 110.386264 \n", | |
"L 111.534545 110.386264 \n", | |
"z\n", | |
""/></g><g id=patch_30><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 115.069091 110.534447 \n", | |
"L 118.603636 110.534447 \n", | |
"L 118.603636 110.534447 \n", | |
"L 115.069091 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_31><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 118.603636 110.534447 \n", | |
"L 122.138182 110.534447 \n", | |
"L 122.138182 110.534447 \n", | |
"L 118.603636 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_32><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 122.138182 110.534447 \n", | |
"L 125.672727 110.534447 \n", | |
"L 125.672727 110.534447 \n", | |
"L 122.138182 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_33><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 125.672727 110.534447 \n", | |
"L 129.207273 110.534447 \n", | |
"L 129.207273 110.534447 \n", | |
"L 125.672727 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_34><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 129.207273 110.534447 \n", | |
"L 132.741818 110.534447 \n", | |
"L 132.741818 110.534447 \n", | |
"L 129.207273 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_35><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 132.741818 110.534447 \n", | |
"L 136.276364 110.534447 \n", | |
"L 136.276364 110.534447 \n", | |
"L 132.741818 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_36><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 136.276364 110.534447 \n", | |
"L 139.810909 110.534447 \n", | |
"L 139.810909 110.534447 \n", | |
"L 136.276364 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_37><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 139.810909 110.534447 \n", | |
"L 143.345455 110.534447 \n", | |
"L 143.345455 110.534447 \n", | |
"L 139.810909 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_38><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 143.345455 110.534447 \n", | |
"L 146.88 110.534447 \n", | |
"L 146.88 110.534447 \n", | |
"L 143.345455 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_39><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 146.88 110.534447 \n", | |
"L 150.414545 110.534447 \n", | |
"L 150.414545 110.386264 \n", | |
"L 146.88 110.386264 \n", | |
"z\n", | |
""/></g><g id=patch_40><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 150.414545 110.534447 \n", | |
"L 153.949091 110.534447 \n", | |
"L 153.949091 110.534447 \n", | |
"L 150.414545 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_41><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 153.949091 110.534447 \n", | |
"L 157.483636 110.534447 \n", | |
"L 157.483636 110.386264 \n", | |
"L 153.949091 110.386264 \n", | |
"z\n", | |
""/></g><g id=patch_42><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 157.483636 110.534447 \n", | |
"L 161.018182 110.534447 \n", | |
"L 161.018182 110.534447 \n", | |
"L 157.483636 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_43><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 161.018182 110.534447 \n", | |
"L 164.552727 110.534447 \n", | |
"L 164.552727 110.534447 \n", | |
"L 161.018182 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_44><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 164.552727 110.534447 \n", | |
"L 168.087273 110.534447 \n", | |
"L 168.087273 110.534447 \n", | |
"L 164.552727 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_45><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 168.087273 110.534447 \n", | |
"L 171.621818 110.534447 \n", | |
"L 171.621818 110.534447 \n", | |
"L 168.087273 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_46><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 171.621818 110.534447 \n", | |
"L 175.156364 110.534447 \n", | |
"L 175.156364 110.534447 \n", | |
"L 171.621818 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_47><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 175.156364 110.534447 \n", | |
"L 178.690909 110.534447 \n", | |
"L 178.690909 110.534447 \n", | |
"L 175.156364 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_48><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 178.690909 110.534447 \n", | |
"L 182.225455 110.534447 \n", | |
"L 182.225455 110.534447 \n", | |
"L 178.690909 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_49><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 182.225455 110.534447 \n", | |
"L 185.76 110.534447 \n", | |
"L 185.76 110.534447 \n", | |
"L 182.225455 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_50><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 185.76 110.534447 \n", | |
"L 189.294545 110.534447 \n", | |
"L 189.294545 110.534447 \n", | |
"L 185.76 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_51><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 189.294545 110.534447 \n", | |
"L 192.829091 110.534447 \n", | |
"L 192.829091 110.534447 \n", | |
"L 189.294545 110.534447 \n", | |
"z\n", | |
""/></g><g id=patch_52><path clip-path=url(#p010cfee7fa) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 192.829091 110.534447 \n", | |
"L 196.363636 110.534447 \n", | |
"L 196.363636 110.386264 \n", | |
"L 192.829091 110.386264 \n", | |
"z\n", | |
""/></g><g id=patch_53><path style=fill:none; d="M 10.8 110.534447 \n", | |
"L 10.8 10.8 \n", | |
""/></g><g id=patch_54><path style=fill:none; d="M 205.2 110.534447 \n", | |
"L 205.2 10.8 \n", | |
""/></g><g id=patch_55><path style=fill:none; d="M 10.8 110.534447 \n", | |
"L 205.2 110.534447 \n", | |
""/></g><g id=patch_56><path style=fill:none; d="M 10.8 10.8 \n", | |
"L 205.2 10.8 \n", | |
""/></g></g></g><defs><clippath id=p010cfee7fa><rect height=99.734447 width=194.4 x=10.8 y=10.8 /></clippath></defs></svg></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-2174257455784840793, #minifreqtable2174257455784840793" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-2174257455784840793 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#2174257455784840793bottom-2174257455784840793statistics aria-controls=2174257455784840793bottom-2174257455784840793statistics role=tab data-toggle=tab>Statistics</a></li><li role=presentation><a href=#2174257455784840793bottom-2174257455784840793histogram aria-controls=2174257455784840793bottom-2174257455784840793histogram role=tab data-toggle=tab>Histogram</a></li><li role=presentation><a href=#2174257455784840793bottom-2174257455784840793common_values aria-controls=2174257455784840793bottom-2174257455784840793common_values role=tab data-toggle=tab>Common values</a></li><li role=presentation><a href=#2174257455784840793bottom-2174257455784840793extreme_values aria-controls=2174257455784840793bottom-2174257455784840793extreme_values role=tab data-toggle=tab>Extreme values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=2174257455784840793bottom-2174257455784840793statistics><div class=col-sm-6><p class=h4>Quantile statistics</p><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>1300</td></tr><tr><th>5-th percentile</th><td>3311.7</td></tr><tr><th>Q1</th><td>7553.5</td></tr><tr><th>median</th><td>9478.5</td></tr><tr><th>Q3</th><td>11601.5</td></tr><tr><th>95-th percentile</th><td>17401.15</td></tr><tr><th>Maximum</th><td>215245</td></tr><tr><th>Range</th><td>213945</td></tr><tr><th>Interquartile range (IQR)</th><td>4048</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Descriptive statistics</p><table class="table table-condensed stats"><tbody><tr><th>Standard deviation</th><td>9981.264932</td></tr><tr><th>Coefficient of variation (CV)</th><td>0.949075601</td></tr><tr><th>Kurtosis</th><td>203.243271</td></tr><tr><th>Mean</th><td>10516.82808</td></tr><tr><th>Median Absolute Deviation (MAD)</th><td>1998</td></tr><tr><th>Skewness</th><td>12.20768785</td></tr><tr><th>Sum</th><td>15354569</td></tr><tr><th>Variance</th><td>99625649.65</td></tr><tr><th>Monotonicity</th><td>Not monotonic</td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=2174257455784840793bottom-2174257455784840793histogram><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
"L 432 288 \n", | |
"L 432 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 56.675 230.435651 \n", | |
"L 421.2 230.435651 \n", | |
"L 421.2 10.8 \n", | |
"L 56.675 10.8 \n", | |
"z\n", | |
""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
"Q 24.171875 66.40625 20.328125 58.90625 \n", | |
"Q 16.5 51.421875 16.5 36.375 \n", | |
"Q 16.5 21.390625 20.328125 13.890625 \n", | |
"Q 24.171875 6.390625 31.78125 6.390625 \n", | |
"Q 39.453125 6.390625 43.28125 13.890625 \n", | |
"Q 47.125 21.390625 47.125 36.375 \n", | |
"Q 47.125 51.421875 43.28125 58.90625 \n", | |
"Q 39.453125 66.40625 31.78125 66.40625 \n", | |
"z\n", | |
"M 31.78125 74.21875 \n", | |
"Q 44.046875 74.21875 50.515625 64.515625 \n", | |
"Q 56.984375 54.828125 56.984375 36.375 \n", | |
"Q 56.984375 17.96875 50.515625 8.265625 \n", | |
"Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
"Q 6.59375 17.96875 6.59375 36.375 \n", | |
"Q 6.59375 54.828125 13.0625 64.515625 \n", | |
"Q 19.53125 74.21875 31.78125 74.21875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(70.932395 253.307525)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
"L 49.515625 72.90625 \n", | |
"L 49.515625 64.59375 \n", | |
"L 19.828125 64.59375 \n", | |
"L 19.828125 46.734375 \n", | |
"Q 21.96875 47.46875 24.109375 47.828125 \n", | |
"Q 26.265625 48.1875 28.421875 48.1875 \n", | |
"Q 40.625 48.1875 47.75 41.5 \n", | |
"Q 54.890625 34.8125 54.890625 23.390625 \n", | |
"Q 54.890625 11.625 47.5625 5.09375 \n", | |
"Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
"Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
"Q 12.796875 0.140625 7.71875 1.703125 \n", | |
"L 7.71875 11.625 \n", | |
"Q 12.109375 9.234375 16.796875 8.0625 \n", | |
"Q 21.484375 6.890625 26.703125 6.890625 \n", | |
"Q 35.15625 6.890625 40.078125 11.328125 \n", | |
"Q 45.015625 15.765625 45.015625 23.390625 \n", | |
"Q 45.015625 31 40.078125 35.4375 \n", | |
"Q 35.15625 39.890625 26.703125 39.890625 \n", | |
"Q 22.75 39.890625 18.8125 39.015625 \n", | |
"Q 14.890625 38.140625 10.796875 36.28125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(139.381086 271.303392)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(214.578228 275.802359)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /><use x=318.115234 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_4><g id=text_4><g style=fill:#262626; transform="translate(292.024853 275.802359)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /><use x=318.115234 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(369.471478 275.802359)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /><use x=254.492188 xlink:href=#DejaVuSans-48 /><use x=318.115234 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_6><g style=fill:#262626; transform="translate(37.3125 234.23487)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_7><g style=fill:#262626; transform="translate(24.5875 201.601982)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_3><g id=text_8><g style=fill:#262626; transform="translate(24.5875 168.969094)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_9><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
"Q 47.65625 37.796875 51.625 33 \n", | |
"Q 55.609375 28.21875 55.609375 21.1875 \n", | |
"Q 55.609375 10.40625 48.1875 4.484375 \n", | |
"Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
"Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
"Q 12.796875 0.390625 7.625 2.203125 \n", | |
"L 7.625 11.71875 \n", | |
"Q 11.71875 9.328125 16.59375 8.109375 \n", | |
"Q 21.484375 6.890625 26.8125 6.890625 \n", | |
"Q 36.078125 6.890625 40.9375 10.546875 \n", | |
"Q 45.796875 14.203125 45.796875 21.1875 \n", | |
"Q 45.796875 27.640625 41.28125 31.265625 \n", | |
"Q 36.765625 34.90625 28.71875 34.90625 \n", | |
"L 20.21875 34.90625 \n", | |
"L 20.21875 43.015625 \n", | |
"L 29.109375 43.015625 \n", | |
"Q 36.375 43.015625 40.234375 45.921875 \n", | |
"Q 44.09375 48.828125 44.09375 54.296875 \n", | |
"Q 44.09375 59.90625 40.109375 62.90625 \n", | |
"Q 36.140625 65.921875 28.71875 65.921875 \n", | |
"Q 24.65625 65.921875 20.015625 65.03125 \n", | |
"Q 15.375 64.15625 9.8125 62.3125 \n", | |
"L 9.8125 71.09375 \n", | |
"Q 15.4375 72.65625 20.34375 73.4375 \n", | |
"Q 25.25 74.21875 29.59375 74.21875 \n", | |
"Q 40.828125 74.21875 47.359375 69.109375 \n", | |
"Q 53.90625 64.015625 53.90625 55.328125 \n", | |
"Q 53.90625 49.265625 50.4375 45.09375 \n", | |
"Q 46.96875 40.921875 40.578125 39.3125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(24.5875 136.336207)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-51 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_5><g id=text_10><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
"L 12.890625 25.390625 \n", | |
"L 37.796875 25.390625 \n", | |
"z\n", | |
"M 35.203125 72.90625 \n", | |
"L 47.609375 72.90625 \n", | |
"L 47.609375 25.390625 \n", | |
"L 58.015625 25.390625 \n", | |
"L 58.015625 17.1875 \n", | |
"L 47.609375 17.1875 \n", | |
"L 47.609375 0 \n", | |
"L 37.796875 0 \n", | |
"L 37.796875 17.1875 \n", | |
"L 4.890625 17.1875 \n", | |
"L 4.890625 26.703125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(24.5875 103.703319)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_6><g id=text_11><g style=fill:#262626; transform="translate(24.5875 71.070431)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_7><g id=text_12><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
"Q 26.375 40.375 22.484375 35.828125 \n", | |
"Q 18.609375 31.296875 18.609375 23.390625 \n", | |
"Q 18.609375 15.53125 22.484375 10.953125 \n", | |
"Q 26.375 6.390625 33.015625 6.390625 \n", | |
"Q 39.65625 6.390625 43.53125 10.953125 \n", | |
"Q 47.40625 15.53125 47.40625 23.390625 \n", | |
"Q 47.40625 31.296875 43.53125 35.828125 \n", | |
"Q 39.65625 40.375 33.015625 40.375 \n", | |
"z\n", | |
"M 52.59375 71.296875 \n", | |
"L 52.59375 62.3125 \n", | |
"Q 48.875 64.0625 45.09375 64.984375 \n", | |
"Q 41.3125 65.921875 37.59375 65.921875 \n", | |
"Q 27.828125 65.921875 22.671875 59.328125 \n", | |
"Q 17.53125 52.734375 16.796875 39.40625 \n", | |
"Q 19.671875 43.65625 24.015625 45.921875 \n", | |
"Q 28.375 48.1875 33.59375 48.1875 \n", | |
"Q 44.578125 48.1875 50.953125 41.515625 \n", | |
"Q 57.328125 34.859375 57.328125 23.390625 \n", | |
"Q 57.328125 12.15625 50.6875 5.359375 \n", | |
"Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
"Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
"Q 6.984375 17.96875 6.984375 36.375 \n", | |
"Q 6.984375 53.65625 15.1875 63.9375 \n", | |
"Q 23.390625 74.21875 37.203125 74.21875 \n", | |
"Q 40.921875 74.21875 44.703125 73.484375 \n", | |
"Q 48.484375 72.75 52.59375 71.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(24.5875 38.437543)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-54 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_13><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
"L 51.703125 72.90625 \n", | |
"L 51.703125 64.59375 \n", | |
"L 19.671875 64.59375 \n", | |
"L 19.671875 43.109375 \n", | |
"L 48.578125 43.109375 \n", | |
"L 48.578125 34.8125 \n", | |
"L 19.671875 34.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
"Q 39.59375 47.171875 37.8125 47.578125 \n", | |
"Q 36.03125 48 33.890625 48 \n", | |
"Q 26.265625 48 22.1875 43.046875 \n", | |
"Q 18.109375 38.09375 18.109375 28.8125 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 20.953125 51.171875 25.484375 53.578125 \n", | |
"Q 30.03125 56 36.53125 56 \n", | |
"Q 37.453125 56 38.578125 55.875 \n", | |
"Q 39.703125 55.765625 41.0625 55.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
"Q 14.796875 17.390625 18.875 11.75 \n", | |
"Q 22.953125 6.109375 30.078125 6.109375 \n", | |
"Q 37.203125 6.109375 41.296875 11.75 \n", | |
"Q 45.40625 17.390625 45.40625 27.296875 \n", | |
"Q 45.40625 37.203125 41.296875 42.84375 \n", | |
"Q 37.203125 48.484375 30.078125 48.484375 \n", | |
"Q 22.953125 48.484375 18.875 42.84375 \n", | |
"Q 14.796875 37.203125 14.796875 27.296875 \n", | |
"z\n", | |
"M 45.40625 8.203125 \n", | |
"Q 42.578125 3.328125 38.25 0.953125 \n", | |
"Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
"Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
"Q 5.515625 14.40625 5.515625 27.296875 \n", | |
"Q 5.515625 40.1875 11.734375 48.09375 \n", | |
"Q 17.96875 56 27.875 56 \n", | |
"Q 33.9375 56 38.25 53.625 \n", | |
"Q 42.578125 51.265625 45.40625 46.390625 \n", | |
"L 45.40625 54.6875 \n", | |
"L 54.390625 54.6875 \n", | |
"L 54.390625 -20.796875 \n", | |
"L 45.40625 -20.796875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
"L 8.5 54.6875 \n", | |
"L 17.484375 54.6875 \n", | |
"L 17.484375 21.921875 \n", | |
"Q 17.484375 14.15625 20.5 10.265625 \n", | |
"Q 23.53125 6.390625 29.59375 6.390625 \n", | |
"Q 36.859375 6.390625 41.078125 11.03125 \n", | |
"Q 45.3125 15.671875 45.3125 23.6875 \n", | |
"L 45.3125 54.6875 \n", | |
"L 54.296875 54.6875 \n", | |
"L 54.296875 0 \n", | |
"L 45.3125 0 \n", | |
"L 45.3125 8.40625 \n", | |
"Q 42.046875 3.421875 37.71875 1 \n", | |
"Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
"Q 18.265625 -1.421875 13.375 4.4375 \n", | |
"Q 8.5 10.296875 8.5 21.578125 \n", | |
"z\n", | |
"M 31.109375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
"L 54.890625 0 \n", | |
"L 45.90625 0 \n", | |
"L 45.90625 32.71875 \n", | |
"Q 45.90625 40.484375 42.875 44.328125 \n", | |
"Q 39.84375 48.1875 33.796875 48.1875 \n", | |
"Q 26.515625 48.1875 22.3125 43.546875 \n", | |
"Q 18.109375 38.921875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.34375 51.125 25.703125 53.5625 \n", | |
"Q 30.078125 56 35.796875 56 \n", | |
"Q 45.21875 56 50.046875 50.171875 \n", | |
"Q 54.890625 44.34375 54.890625 33.015625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
"L 48.78125 44.1875 \n", | |
"Q 44.96875 46.296875 41.140625 47.34375 \n", | |
"Q 37.3125 48.390625 33.40625 48.390625 \n", | |
"Q 24.65625 48.390625 19.8125 42.84375 \n", | |
"Q 14.984375 37.3125 14.984375 27.296875 \n", | |
"Q 14.984375 17.28125 19.8125 11.734375 \n", | |
"Q 24.65625 6.203125 33.40625 6.203125 \n", | |
"Q 37.3125 6.203125 41.140625 7.25 \n", | |
"Q 44.96875 8.296875 48.78125 10.40625 \n", | |
"L 48.78125 2.09375 \n", | |
"Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
"Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
"Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
"Q 5.515625 14.109375 5.515625 27.296875 \n", | |
"Q 5.515625 40.671875 12.859375 48.328125 \n", | |
"Q 20.21875 56 33.015625 56 \n", | |
"Q 37.15625 56 41.109375 55.140625 \n", | |
"Q 45.0625 54.296875 48.78125 52.59375 \n", | |
"z\n", | |
""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
"Q 28.375 -14.84375 24.75 -17.8125 \n", | |
"Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
"L 7.90625 -20.796875 \n", | |
"L 7.90625 -13.28125 \n", | |
"L 13.1875 -13.28125 \n", | |
"Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
"Q 21 -9.765625 23.484375 -3.21875 \n", | |
"L 25.09375 0.875 \n", | |
"L 2.984375 54.6875 \n", | |
"L 12.5 54.6875 \n", | |
"L 29.59375 11.921875 \n", | |
"L 46.6875 54.6875 \n", | |
"L 56.203125 54.6875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(18.299844 149.030482)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 73.244318 230.435651 \n", | |
"L 79.872045 230.435651 \n", | |
"L 79.872045 173.654426 \n", | |
"L 73.244318 173.654426 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 79.872045 230.435651 \n", | |
"L 86.499773 230.435651 \n", | |
"L 86.499773 21.258841 \n", | |
"L 79.872045 21.258841 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 86.499773 230.435651 \n", | |
"L 93.1275 230.435651 \n", | |
"L 93.1275 72.166145 \n", | |
"L 86.499773 72.166145 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 93.1275 230.435651 \n", | |
"L 99.755227 230.435651 \n", | |
"L 99.755227 198.129092 \n", | |
"L 93.1275 198.129092 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 99.755227 230.435651 \n", | |
"L 106.382955 230.435651 \n", | |
"L 106.382955 222.603758 \n", | |
"L 99.755227 222.603758 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 106.382955 230.435651 \n", | |
"L 113.010682 230.435651 \n", | |
"L 113.010682 226.519705 \n", | |
"L 106.382955 226.519705 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 113.010682 230.435651 \n", | |
"L 119.638409 230.435651 \n", | |
"L 119.638409 229.456665 \n", | |
"L 113.010682 229.456665 \n", | |
"z\n", | |
""/></g><g id=patch_10><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 119.638409 230.435651 \n", | |
"L 126.266136 230.435651 \n", | |
"L 126.266136 228.804007 \n", | |
"L 119.638409 228.804007 \n", | |
"z\n", | |
""/></g><g id=patch_11><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 126.266136 230.435651 \n", | |
"L 132.893864 230.435651 \n", | |
"L 132.893864 229.456665 \n", | |
"L 126.266136 229.456665 \n", | |
"z\n", | |
""/></g><g id=patch_12><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 132.893864 230.435651 \n", | |
"L 139.521591 230.435651 \n", | |
"L 139.521591 230.109322 \n", | |
"L 132.893864 230.109322 \n", | |
"z\n", | |
""/></g><g id=patch_13><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 139.521591 230.435651 \n", | |
"L 146.149318 230.435651 \n", | |
"L 146.149318 229.782993 \n", | |
"L 139.521591 229.782993 \n", | |
"z\n", | |
""/></g><g id=patch_14><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 146.149318 230.435651 \n", | |
"L 152.777045 230.435651 \n", | |
"L 152.777045 230.109322 \n", | |
"L 146.149318 230.109322 \n", | |
"z\n", | |
""/></g><g id=patch_15><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 152.777045 230.435651 \n", | |
"L 159.404773 230.435651 \n", | |
"L 159.404773 229.456665 \n", | |
"L 152.777045 229.456665 \n", | |
"z\n", | |
""/></g><g id=patch_16><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 159.404773 230.435651 \n", | |
"L 166.0325 230.435651 \n", | |
"L 166.0325 230.109322 \n", | |
"L 159.404773 230.109322 \n", | |
"z\n", | |
""/></g><g id=patch_17><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 166.0325 230.435651 \n", | |
"L 172.660227 230.435651 \n", | |
"L 172.660227 230.109322 \n", | |
"L 166.0325 230.109322 \n", | |
"z\n", | |
""/></g><g id=patch_18><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 172.660227 230.435651 \n", | |
"L 179.287955 230.435651 \n", | |
"L 179.287955 230.435651 \n", | |
"L 172.660227 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_19><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 179.287955 230.435651 \n", | |
"L 185.915682 230.435651 \n", | |
"L 185.915682 230.109322 \n", | |
"L 179.287955 230.109322 \n", | |
"z\n", | |
""/></g><g id=patch_20><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 185.915682 230.435651 \n", | |
"L 192.543409 230.435651 \n", | |
"L 192.543409 230.435651 \n", | |
"L 185.915682 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_21><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 192.543409 230.435651 \n", | |
"L 199.171136 230.435651 \n", | |
"L 199.171136 230.435651 \n", | |
"L 192.543409 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_22><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 199.171136 230.435651 \n", | |
"L 205.798864 230.435651 \n", | |
"L 205.798864 230.435651 \n", | |
"L 199.171136 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_23><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 205.798864 230.435651 \n", | |
"L 212.426591 230.435651 \n", | |
"L 212.426591 230.435651 \n", | |
"L 205.798864 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_24><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 212.426591 230.435651 \n", | |
"L 219.054318 230.435651 \n", | |
"L 219.054318 230.435651 \n", | |
"L 212.426591 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_25><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 219.054318 230.435651 \n", | |
"L 225.682045 230.435651 \n", | |
"L 225.682045 230.435651 \n", | |
"L 219.054318 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_26><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 225.682045 230.435651 \n", | |
"L 232.309773 230.435651 \n", | |
"L 232.309773 230.435651 \n", | |
"L 225.682045 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_27><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 232.309773 230.435651 \n", | |
"L 238.9375 230.435651 \n", | |
"L 238.9375 230.435651 \n", | |
"L 232.309773 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_28><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 238.9375 230.435651 \n", | |
"L 245.565227 230.435651 \n", | |
"L 245.565227 230.435651 \n", | |
"L 238.9375 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_29><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 245.565227 230.435651 \n", | |
"L 252.192955 230.435651 \n", | |
"L 252.192955 230.109322 \n", | |
"L 245.565227 230.109322 \n", | |
"z\n", | |
""/></g><g id=patch_30><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 252.192955 230.435651 \n", | |
"L 258.820682 230.435651 \n", | |
"L 258.820682 230.435651 \n", | |
"L 252.192955 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_31><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 258.820682 230.435651 \n", | |
"L 265.448409 230.435651 \n", | |
"L 265.448409 230.435651 \n", | |
"L 258.820682 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_32><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 265.448409 230.435651 \n", | |
"L 272.076136 230.435651 \n", | |
"L 272.076136 230.435651 \n", | |
"L 265.448409 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_33><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 272.076136 230.435651 \n", | |
"L 278.703864 230.435651 \n", | |
"L 278.703864 230.435651 \n", | |
"L 272.076136 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_34><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 278.703864 230.435651 \n", | |
"L 285.331591 230.435651 \n", | |
"L 285.331591 230.435651 \n", | |
"L 278.703864 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_35><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 285.331591 230.435651 \n", | |
"L 291.959318 230.435651 \n", | |
"L 291.959318 230.435651 \n", | |
"L 285.331591 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_36><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 291.959318 230.435651 \n", | |
"L 298.587045 230.435651 \n", | |
"L 298.587045 230.435651 \n", | |
"L 291.959318 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_37><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 298.587045 230.435651 \n", | |
"L 305.214773 230.435651 \n", | |
"L 305.214773 230.435651 \n", | |
"L 298.587045 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_38><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 305.214773 230.435651 \n", | |
"L 311.8425 230.435651 \n", | |
"L 311.8425 230.435651 \n", | |
"L 305.214773 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_39><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 311.8425 230.435651 \n", | |
"L 318.470227 230.435651 \n", | |
"L 318.470227 230.109322 \n", | |
"L 311.8425 230.109322 \n", | |
"z\n", | |
""/></g><g id=patch_40><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 318.470227 230.435651 \n", | |
"L 325.097955 230.435651 \n", | |
"L 325.097955 230.435651 \n", | |
"L 318.470227 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_41><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 325.097955 230.435651 \n", | |
"L 331.725682 230.435651 \n", | |
"L 331.725682 230.109322 \n", | |
"L 325.097955 230.109322 \n", | |
"z\n", | |
""/></g><g id=patch_42><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 331.725682 230.435651 \n", | |
"L 338.353409 230.435651 \n", | |
"L 338.353409 230.435651 \n", | |
"L 331.725682 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_43><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 338.353409 230.435651 \n", | |
"L 344.981136 230.435651 \n", | |
"L 344.981136 230.435651 \n", | |
"L 338.353409 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_44><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 344.981136 230.435651 \n", | |
"L 351.608864 230.435651 \n", | |
"L 351.608864 230.435651 \n", | |
"L 344.981136 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_45><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 351.608864 230.435651 \n", | |
"L 358.236591 230.435651 \n", | |
"L 358.236591 230.435651 \n", | |
"L 351.608864 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_46><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 358.236591 230.435651 \n", | |
"L 364.864318 230.435651 \n", | |
"L 364.864318 230.435651 \n", | |
"L 358.236591 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_47><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 364.864318 230.435651 \n", | |
"L 371.492045 230.435651 \n", | |
"L 371.492045 230.435651 \n", | |
"L 364.864318 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_48><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 371.492045 230.435651 \n", | |
"L 378.119773 230.435651 \n", | |
"L 378.119773 230.435651 \n", | |
"L 371.492045 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_49><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 378.119773 230.435651 \n", | |
"L 384.7475 230.435651 \n", | |
"L 384.7475 230.435651 \n", | |
"L 378.119773 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_50><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 384.7475 230.435651 \n", | |
"L 391.375227 230.435651 \n", | |
"L 391.375227 230.435651 \n", | |
"L 384.7475 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_51><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 391.375227 230.435651 \n", | |
"L 398.002955 230.435651 \n", | |
"L 398.002955 230.435651 \n", | |
"L 391.375227 230.435651 \n", | |
"z\n", | |
""/></g><g id=patch_52><path clip-path=url(#pa42a3652ac) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 398.002955 230.435651 \n", | |
"L 404.630682 230.435651 \n", | |
"L 404.630682 230.109322 \n", | |
"L 398.002955 230.109322 \n", | |
"z\n", | |
""/></g><g id=patch_53><path style=fill:none; d="M 56.675 230.435651 \n", | |
"L 56.675 10.8 \n", | |
""/></g><g id=patch_54><path style=fill:none; d="M 421.2 230.435651 \n", | |
"L 421.2 10.8 \n", | |
""/></g><g id=patch_55><path style=fill:none; d="M 56.675 230.435651 \n", | |
"L 421.2 230.435651 \n", | |
""/></g><g id=patch_56><path style=fill:none; d="M 56.675 10.8 \n", | |
"L 421.2 10.8 \n", | |
""/></g></g></g><defs><clippath id=pa42a3652ac><rect height=219.635651 width=364.525 x=56.675 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"><strong>Histogram with fixed size bins</strong> (bins=50) </div></div><div role=tabpanel class="tab-pane col-sm-12" id=2174257455784840793bottom-2174257455784840793common_values><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=7200>7200</td><td>25</td><td><div class=bar style=width:1.9%> &nbsp; </div> 1.7% </td></tr><tr class><td title=9600>9600</td><td>24</td><td><div class=bar style=width:1.8%> &nbsp; </div> 1.6% </td></tr><tr class><td title=6000>6000</td><td>17</td><td><div class=bar style=width:1.3%> &nbsp; </div> 1.2% </td></tr><tr class><td title=9000>9000</td><td>14</td><td><div class=bar style=width:1.1%> &nbsp; </div> 1.0% </td></tr><tr class><td title=8400>8400</td><td>14</td><td><div class=bar style=width:1.1%> &nbsp; </div> 1.0% </td></tr><tr class><td title=10800>10800</td><td>14</td><td><div class=bar style=width:1.1%> &nbsp; </div> 1.0% </td></tr><tr class><td title=1680>1680</td><td>10</td><td><div class=bar style=width:0.8%> &nbsp; </div> 0.7% </td></tr><tr class><td title=7500>7500</td><td>9</td><td><div class=bar style=width:0.7%> &nbsp; </div> 0.6% </td></tr><tr class><td title=9100>9100</td><td>8</td><td><div class=bar style=width:0.6%> &nbsp; </div> 0.5% </td></tr><tr class><td title=8125>8125</td><td>8</td><td><div class=bar style=width:0.6%> &nbsp; </div> 0.5% </td></tr><tr class=other><td title="Other values (1063)">Other values (1063)</td><td>1317</td><td><div class=bar style=width:100.0%> 90.2% </div></td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=2174257455784840793bottom-2174257455784840793extreme_values><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#2174257455784840793extreme_values-2174257455784840793firstn aria-controls=2174257455784840793extreme_values-2174257455784840793firstn role=tab data-toggle=tab>Minimum 5 values</a></li><li role=presentation><a href=#2174257455784840793extreme_values-2174257455784840793lastn aria-controls=2174257455784840793extreme_values-2174257455784840793lastn role=tab data-toggle=tab>Maximum 5 values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=2174257455784840793extreme_values-2174257455784840793firstn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=1300>1300</td><td>1</td><td><div class=bar style=width:50.0%> 0.1% </div></td></tr><tr class><td title=1477>1477</td><td>1</td><td><div class=bar style=width:50.0%> 0.1% </div></td></tr><tr class><td title=1491>1491</td><td>1</td><td><div class=bar style=width:50.0%> 0.1% </div></td></tr><tr class><td title=1526>1526</td><td>1</td><td><div class=bar style=width:50.0%> 0.1% </div></td></tr><tr class><td title=1533>1533</td><td>2</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=2174257455784840793extreme_values-2174257455784840793lastn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=215245>215245</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr><tr class><td title=164660>164660</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr><tr class><td title=159000>159000</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr><tr class><td title=115149>115149</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr><tr class><td title=70761>70761</td><td>1</td><td><div class=bar style=width:100.0%> 0.1% </div></td></tr></tbody></table></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_8754940476058458128></a><div class=variable><div class=col-sm-3><p class=h4 title=Street><a href=#pp_var_8754940476058458128>Street</a><br><small>Categorical</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>2</td></tr><tr><th>Distinct (%)</th><td>0.1%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> Pave </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 1454&nbsp; </div></td></tr><tr class><th width=50%> Grvl </th><td width=50%><div class=bar style=width:0.4% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 6 </td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-8754940476058458128, #minifreqtable8754940476058458128" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-8754940476058458128 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#8754940476058458128bottom-8754940476058458128overview aria-controls=8754940476058458128bottom-8754940476058458128overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#8754940476058458128bottom-8754940476058458128string aria-controls=8754940476058458128bottom-8754940476058458128string role=tab data-toggle=tab>Categories</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=8754940476058458128bottom-8754940476058458128overview><div class=row><div class=col-sm-6><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>Pave</td></tr><tr><th>2nd row</th><td>Pave</td></tr><tr><th>3rd row</th><td>Pave</td></tr><tr><th>4th row</th><td>Pave</td></tr><tr><th>5th row</th><td>Pave</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=8754940476058458128bottom-8754940476058458128string><div class=row><div class=col-sm-6><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=Pave>Pave</td><td>1454</td><td><div class=bar style=width:100.0%> 99.6% </div></td></tr><tr class><td title=Grvl>Grvl</td><td>6</td><td><div class=bar style=width:0.4%> &nbsp; </div> 0.4% </td></tr></tbody></table></div><div class=col-sm-6><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=187.6716pt version=1.1 viewbox="0 0 405 187.6716" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 187.6716 \n", | |
"L 405 187.6716 \n", | |
"L 405 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#p5e7d233c08) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
"L 396.194795 106.86 \n", | |
"L 396.194795 16.26 \n", | |
"L 7.2 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_3><path clip-path=url(#p5e7d233c08) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 396.194795 106.86 \n", | |
"L 397.8 106.86 \n", | |
"L 397.8 16.26 \n", | |
"L 396.194795 16.26 \n", | |
"z\n", | |
""/></g><g id=legend_1><g id=patch_4><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 180.4716 \n", | |
"L 115.6833 180.4716 \n", | |
"Q 119.1393 180.4716 119.1393 177.0156 \n", | |
"L 119.1393 128.016 \n", | |
"Q 119.1393 124.56 115.6833 124.56 \n", | |
"L 19.296 124.56 \n", | |
"Q 15.84 124.56 15.84 128.016 \n", | |
"L 15.84 177.0156 \n", | |
"Q 15.84 180.4716 19.296 180.4716 \n", | |
"z\n", | |
""/></g><g id=patch_5><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
"L 57.312 144.6021 \n", | |
"L 57.312 132.5061 \n", | |
"L 22.752 132.5061 \n", | |
"z\n", | |
""/></g><g id=text_1><defs><path id=DejaVuSans-80 d="M 19.671875 64.796875 \n", | |
"L 19.671875 37.40625 \n", | |
"L 32.078125 37.40625 \n", | |
"Q 38.96875 37.40625 42.71875 40.96875 \n", | |
"Q 46.484375 44.53125 46.484375 51.125 \n", | |
"Q 46.484375 57.671875 42.71875 61.234375 \n", | |
"Q 38.96875 64.796875 32.078125 64.796875 \n", | |
"z\n", | |
"M 9.8125 72.90625 \n", | |
"L 32.078125 72.90625 \n", | |
"Q 44.34375 72.90625 50.609375 67.359375 \n", | |
"Q 56.890625 61.8125 56.890625 51.125 \n", | |
"Q 56.890625 40.328125 50.609375 34.8125 \n", | |
"Q 44.34375 29.296875 32.078125 29.296875 \n", | |
"L 19.671875 29.296875 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-97 d="M 34.28125 27.484375 \n", | |
"Q 23.390625 27.484375 19.1875 25 \n", | |
"Q 14.984375 22.515625 14.984375 16.5 \n", | |
"Q 14.984375 11.71875 18.140625 8.90625 \n", | |
"Q 21.296875 6.109375 26.703125 6.109375 \n", | |
"Q 34.1875 6.109375 38.703125 11.40625 \n", | |
"Q 43.21875 16.703125 43.21875 25.484375 \n", | |
"L 43.21875 27.484375 \n", | |
"z\n", | |
"M 52.203125 31.203125 \n", | |
"L 52.203125 0 \n", | |
"L 43.21875 0 \n", | |
"L 43.21875 8.296875 \n", | |
"Q 40.140625 3.328125 35.546875 0.953125 \n", | |
"Q 30.953125 -1.421875 24.3125 -1.421875 \n", | |
"Q 15.921875 -1.421875 10.953125 3.296875 \n", | |
"Q 6 8.015625 6 15.921875 \n", | |
"Q 6 25.140625 12.171875 29.828125 \n", | |
"Q 18.359375 34.515625 30.609375 34.515625 \n", | |
"L 43.21875 34.515625 \n", | |
"L 43.21875 35.40625 \n", | |
"Q 43.21875 41.609375 39.140625 45 \n", | |
"Q 35.0625 48.390625 27.6875 48.390625 \n", | |
"Q 23 48.390625 18.546875 47.265625 \n", | |
"Q 14.109375 46.140625 10.015625 43.890625 \n", | |
"L 10.015625 52.203125 \n", | |
"Q 14.9375 54.109375 19.578125 55.046875 \n", | |
"Q 24.21875 56 28.609375 56 \n", | |
"Q 40.484375 56 46.34375 49.84375 \n", | |
"Q 52.203125 43.703125 52.203125 31.203125 \n", | |
"z\n", | |
""/><path id=DejaVuSans-118 d="M 2.984375 54.6875 \n", | |
"L 12.5 54.6875 \n", | |
"L 29.59375 8.796875 \n", | |
"L 46.6875 54.6875 \n", | |
"L 56.203125 54.6875 \n", | |
"L 35.6875 0 \n", | |
"L 23.484375 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-80 /><use x=55.802734 xlink:href=#DejaVuSans-97 /><use x=117.082031 xlink:href=#DejaVuSans-118 /><use x=176.261719 xlink:href=#DejaVuSans-101 /></g></g><g id=patch_6><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
"L 57.312 169.9659 \n", | |
"L 57.312 157.8699 \n", | |
"L 22.752 157.8699 \n", | |
"z\n", | |
""/></g><g id=text_2><defs><path id=DejaVuSans-71 d="M 59.515625 10.40625 \n", | |
"L 59.515625 29.984375 \n", | |
"L 43.40625 29.984375 \n", | |
"L 43.40625 38.09375 \n", | |
"L 69.28125 38.09375 \n", | |
"L 69.28125 6.78125 \n", | |
"Q 63.578125 2.734375 56.6875 0.65625 \n", | |
"Q 49.8125 -1.421875 42 -1.421875 \n", | |
"Q 24.90625 -1.421875 15.25 8.5625 \n", | |
"Q 5.609375 18.5625 5.609375 36.375 \n", | |
"Q 5.609375 54.25 15.25 64.234375 \n", | |
"Q 24.90625 74.21875 42 74.21875 \n", | |
"Q 49.125 74.21875 55.546875 72.453125 \n", | |
"Q 61.96875 70.703125 67.390625 67.28125 \n", | |
"L 67.390625 56.78125 \n", | |
"Q 61.921875 61.421875 55.765625 63.765625 \n", | |
"Q 49.609375 66.109375 42.828125 66.109375 \n", | |
"Q 29.4375 66.109375 22.71875 58.640625 \n", | |
"Q 16.015625 51.171875 16.015625 36.375 \n", | |
"Q 16.015625 21.625 22.71875 14.15625 \n", | |
"Q 29.4375 6.6875 42.828125 6.6875 \n", | |
"Q 48.046875 6.6875 52.140625 7.59375 \n", | |
"Q 56.25 8.5 59.515625 10.40625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
"Q 39.59375 47.171875 37.8125 47.578125 \n", | |
"Q 36.03125 48 33.890625 48 \n", | |
"Q 26.265625 48 22.1875 43.046875 \n", | |
"Q 18.109375 38.09375 18.109375 28.8125 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 20.953125 51.171875 25.484375 53.578125 \n", | |
"Q 30.03125 56 36.53125 56 \n", | |
"Q 37.453125 56 38.578125 55.875 \n", | |
"Q 39.703125 55.765625 41.0625 55.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-108 d="M 9.421875 75.984375 \n", | |
"L 18.40625 75.984375 \n", | |
"L 18.40625 0 \n", | |
"L 9.421875 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-71 /><use x=77.490234 xlink:href=#DejaVuSans-114 /><use x=118.603516 xlink:href=#DejaVuSans-118 /><use x=177.783203 xlink:href=#DejaVuSans-108 /></g></g></g></g></g><defs><clippath id=p5e7d233c08><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_258406018026027638></a><div class=variable><div class=col-sm-3><p class=h4 title=Alley><a href=#pp_var_258406018026027638>Alley</a><br><small>Categorical</small></p><code>MISSING</code><br><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>2</td></tr><tr><th>Distinct (%)</th><td>2.2%</td></tr><tr class=alert><th>Missing</th><td>1369</td></tr><tr class=alert><th>Missing (%)</th><td>93.8%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> Grvl </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 50&nbsp; </div></td></tr><tr class><th width=50%> Pave </th><td width=50%><div class=bar style=width:82.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 41&nbsp; </div></td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-258406018026027638, #minifreqtable258406018026027638" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-258406018026027638 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#258406018026027638bottom-258406018026027638overview aria-controls=258406018026027638bottom-258406018026027638overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#258406018026027638bottom-258406018026027638string aria-controls=258406018026027638bottom-258406018026027638string role=tab data-toggle=tab>Categories</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=258406018026027638bottom-258406018026027638overview><div class=row><div class=col-sm-6><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>Grvl</td></tr><tr><th>2nd row</th><td>Pave</td></tr><tr><th>3rd row</th><td>Pave</td></tr><tr><th>4th row</th><td>Grvl</td></tr><tr><th>5th row</th><td>Pave</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=258406018026027638bottom-258406018026027638string><div class=row><div class=col-sm-6><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=Grvl>Grvl</td><td>50</td><td><div class=bar style=width:3.7%> &nbsp; </div> 3.4% </td></tr><tr class><td title=Pave>Pave</td><td>41</td><td><div class=bar style=width:3.0%> &nbsp; </div> 2.8% </td></tr><tr class=missing><td title=(Missing)>(Missing)</td><td>1369</td><td><div class=bar style=width:100.0%> 93.8% </div></td></tr></tbody></table></div><div class=col-sm-6><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=187.6716pt version=1.1 viewbox="0 0 405 187.6716" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 187.6716 \n", | |
"L 405 187.6716 \n", | |
"L 405 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#pc3529d1c69) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
"L 221.815385 106.86 \n", | |
"L 221.815385 16.26 \n", | |
"L 7.2 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_3><path clip-path=url(#pc3529d1c69) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 221.815385 106.86 \n", | |
"L 397.8 106.86 \n", | |
"L 397.8 16.26 \n", | |
"L 221.815385 16.26 \n", | |
"z\n", | |
""/></g><g id=legend_1><g id=patch_4><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 180.4716 \n", | |
"L 115.6833 180.4716 \n", | |
"Q 119.1393 180.4716 119.1393 177.0156 \n", | |
"L 119.1393 128.016 \n", | |
"Q 119.1393 124.56 115.6833 124.56 \n", | |
"L 19.296 124.56 \n", | |
"Q 15.84 124.56 15.84 128.016 \n", | |
"L 15.84 177.0156 \n", | |
"Q 15.84 180.4716 19.296 180.4716 \n", | |
"z\n", | |
""/></g><g id=patch_5><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
"L 57.312 144.6021 \n", | |
"L 57.312 132.5061 \n", | |
"L 22.752 132.5061 \n", | |
"z\n", | |
""/></g><g id=text_1><defs><path id=DejaVuSans-71 d="M 59.515625 10.40625 \n", | |
"L 59.515625 29.984375 \n", | |
"L 43.40625 29.984375 \n", | |
"L 43.40625 38.09375 \n", | |
"L 69.28125 38.09375 \n", | |
"L 69.28125 6.78125 \n", | |
"Q 63.578125 2.734375 56.6875 0.65625 \n", | |
"Q 49.8125 -1.421875 42 -1.421875 \n", | |
"Q 24.90625 -1.421875 15.25 8.5625 \n", | |
"Q 5.609375 18.5625 5.609375 36.375 \n", | |
"Q 5.609375 54.25 15.25 64.234375 \n", | |
"Q 24.90625 74.21875 42 74.21875 \n", | |
"Q 49.125 74.21875 55.546875 72.453125 \n", | |
"Q 61.96875 70.703125 67.390625 67.28125 \n", | |
"L 67.390625 56.78125 \n", | |
"Q 61.921875 61.421875 55.765625 63.765625 \n", | |
"Q 49.609375 66.109375 42.828125 66.109375 \n", | |
"Q 29.4375 66.109375 22.71875 58.640625 \n", | |
"Q 16.015625 51.171875 16.015625 36.375 \n", | |
"Q 16.015625 21.625 22.71875 14.15625 \n", | |
"Q 29.4375 6.6875 42.828125 6.6875 \n", | |
"Q 48.046875 6.6875 52.140625 7.59375 \n", | |
"Q 56.25 8.5 59.515625 10.40625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
"Q 39.59375 47.171875 37.8125 47.578125 \n", | |
"Q 36.03125 48 33.890625 48 \n", | |
"Q 26.265625 48 22.1875 43.046875 \n", | |
"Q 18.109375 38.09375 18.109375 28.8125 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 20.953125 51.171875 25.484375 53.578125 \n", | |
"Q 30.03125 56 36.53125 56 \n", | |
"Q 37.453125 56 38.578125 55.875 \n", | |
"Q 39.703125 55.765625 41.0625 55.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-118 d="M 2.984375 54.6875 \n", | |
"L 12.5 54.6875 \n", | |
"L 29.59375 8.796875 \n", | |
"L 46.6875 54.6875 \n", | |
"L 56.203125 54.6875 \n", | |
"L 35.6875 0 \n", | |
"L 23.484375 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-108 d="M 9.421875 75.984375 \n", | |
"L 18.40625 75.984375 \n", | |
"L 18.40625 0 \n", | |
"L 9.421875 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-71 /><use x=77.490234 xlink:href=#DejaVuSans-114 /><use x=118.603516 xlink:href=#DejaVuSans-118 /><use x=177.783203 xlink:href=#DejaVuSans-108 /></g></g><g id=patch_6><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
"L 57.312 169.9659 \n", | |
"L 57.312 157.8699 \n", | |
"L 22.752 157.8699 \n", | |
"z\n", | |
""/></g><g id=text_2><defs><path id=DejaVuSans-80 d="M 19.671875 64.796875 \n", | |
"L 19.671875 37.40625 \n", | |
"L 32.078125 37.40625 \n", | |
"Q 38.96875 37.40625 42.71875 40.96875 \n", | |
"Q 46.484375 44.53125 46.484375 51.125 \n", | |
"Q 46.484375 57.671875 42.71875 61.234375 \n", | |
"Q 38.96875 64.796875 32.078125 64.796875 \n", | |
"z\n", | |
"M 9.8125 72.90625 \n", | |
"L 32.078125 72.90625 \n", | |
"Q 44.34375 72.90625 50.609375 67.359375 \n", | |
"Q 56.890625 61.8125 56.890625 51.125 \n", | |
"Q 56.890625 40.328125 50.609375 34.8125 \n", | |
"Q 44.34375 29.296875 32.078125 29.296875 \n", | |
"L 19.671875 29.296875 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-97 d="M 34.28125 27.484375 \n", | |
"Q 23.390625 27.484375 19.1875 25 \n", | |
"Q 14.984375 22.515625 14.984375 16.5 \n", | |
"Q 14.984375 11.71875 18.140625 8.90625 \n", | |
"Q 21.296875 6.109375 26.703125 6.109375 \n", | |
"Q 34.1875 6.109375 38.703125 11.40625 \n", | |
"Q 43.21875 16.703125 43.21875 25.484375 \n", | |
"L 43.21875 27.484375 \n", | |
"z\n", | |
"M 52.203125 31.203125 \n", | |
"L 52.203125 0 \n", | |
"L 43.21875 0 \n", | |
"L 43.21875 8.296875 \n", | |
"Q 40.140625 3.328125 35.546875 0.953125 \n", | |
"Q 30.953125 -1.421875 24.3125 -1.421875 \n", | |
"Q 15.921875 -1.421875 10.953125 3.296875 \n", | |
"Q 6 8.015625 6 15.921875 \n", | |
"Q 6 25.140625 12.171875 29.828125 \n", | |
"Q 18.359375 34.515625 30.609375 34.515625 \n", | |
"L 43.21875 34.515625 \n", | |
"L 43.21875 35.40625 \n", | |
"Q 43.21875 41.609375 39.140625 45 \n", | |
"Q 35.0625 48.390625 27.6875 48.390625 \n", | |
"Q 23 48.390625 18.546875 47.265625 \n", | |
"Q 14.109375 46.140625 10.015625 43.890625 \n", | |
"L 10.015625 52.203125 \n", | |
"Q 14.9375 54.109375 19.578125 55.046875 \n", | |
"Q 24.21875 56 28.609375 56 \n", | |
"Q 40.484375 56 46.34375 49.84375 \n", | |
"Q 52.203125 43.703125 52.203125 31.203125 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-80 /><use x=55.802734 xlink:href=#DejaVuSans-97 /><use x=117.082031 xlink:href=#DejaVuSans-118 /><use x=176.261719 xlink:href=#DejaVuSans-101 /></g></g></g></g></g><defs><clippath id=pc3529d1c69><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_-5274481314464329078></a><div class=variable><div class=col-sm-3><p class=h4 title=LotShape><a href=#pp_var_-5274481314464329078>LotShape</a><br><small>Categorical</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>4</td></tr><tr><th>Distinct (%)</th><td>0.3%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> Reg </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 925&nbsp; </div></td></tr><tr class><th width=50%> IR1 </th><td width=50%><div class=bar style=width:52.3% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 484&nbsp; </div></td></tr><tr class><th width=50%> IR2 </th><td width=50%><div class=bar style=width:4.4% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 41 </td></tr><tr class><th width=50%> IR3 </th><td width=50%><div class=bar style=width:1.1% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 10 </td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom--5274481314464329078, #minifreqtable-5274481314464329078" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom--5274481314464329078 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-5274481314464329078bottom--5274481314464329078overview aria-controls=-5274481314464329078bottom--5274481314464329078overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#-5274481314464329078bottom--5274481314464329078string aria-controls=-5274481314464329078bottom--5274481314464329078string role=tab data-toggle=tab>Categories</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-5274481314464329078bottom--5274481314464329078overview><div class=row><div class=col-sm-6><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>Reg</td></tr><tr><th>2nd row</th><td>Reg</td></tr><tr><th>3rd row</th><td>IR1</td></tr><tr><th>4th row</th><td>IR1</td></tr><tr><th>5th row</th><td>IR1</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-5274481314464329078bottom--5274481314464329078string><div class=row><div class=col-sm-6><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=Reg>Reg</td><td>925</td><td><div class=bar style=width:100.0%> 63.4% </div></td></tr><tr class><td title=IR1>IR1</td><td>484</td><td><div class=bar style=width:52.3%> 33.2% </div></td></tr><tr class><td title=IR2>IR2</td><td>41</td><td><div class=bar style=width:4.4%> &nbsp; </div> 2.8% </td></tr><tr class><td title=IR3>IR3</td><td>10</td><td><div class=bar style=width:1.1%> &nbsp; </div> 0.7% </td></tr></tbody></table></div><div class=col-sm-6><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=238.3992pt version=1.1 viewbox="0 0 405 238.3992" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 238.3992 \n", | |
"L 405 238.3992 \n", | |
"L 405 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#pb731a87777) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
"L 254.669178 106.86 \n", | |
"L 254.669178 16.26 \n", | |
"L 7.2 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_3><path clip-path=url(#pb731a87777) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 254.669178 106.86 \n", | |
"L 384.155753 106.86 \n", | |
"L 384.155753 16.26 \n", | |
"L 254.669178 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#pb731a87777) style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 384.155753 106.86 \n", | |
"L 395.124658 106.86 \n", | |
"L 395.124658 16.26 \n", | |
"L 384.155753 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#pb731a87777) style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 395.124658 106.86 \n", | |
"L 397.8 106.86 \n", | |
"L 397.8 16.26 \n", | |
"L 395.124658 16.26 \n", | |
"z\n", | |
""/></g><g id=legend_1><g id=patch_6><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 231.1992 \n", | |
"L 107.424 231.1992 \n", | |
"Q 110.88 231.1992 110.88 227.7432 \n", | |
"L 110.88 128.016 \n", | |
"Q 110.88 124.56 107.424 124.56 \n", | |
"L 19.296 124.56 \n", | |
"Q 15.84 124.56 15.84 128.016 \n", | |
"L 15.84 227.7432 \n", | |
"Q 15.84 231.1992 19.296 231.1992 \n", | |
"z\n", | |
""/></g><g id=patch_7><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
"L 57.312 144.6021 \n", | |
"L 57.312 132.5061 \n", | |
"L 22.752 132.5061 \n", | |
"z\n", | |
""/></g><g id=text_1><defs><path id=DejaVuSans-82 d="M 44.390625 34.1875 \n", | |
"Q 47.5625 33.109375 50.5625 29.59375 \n", | |
"Q 53.5625 26.078125 56.59375 19.921875 \n", | |
"L 66.609375 0 \n", | |
"L 56 0 \n", | |
"L 46.6875 18.703125 \n", | |
"Q 43.0625 26.03125 39.671875 28.421875 \n", | |
"Q 36.28125 30.8125 30.421875 30.8125 \n", | |
"L 19.671875 30.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"L 9.8125 72.90625 \n", | |
"L 32.078125 72.90625 \n", | |
"Q 44.578125 72.90625 50.734375 67.671875 \n", | |
"Q 56.890625 62.453125 56.890625 51.90625 \n", | |
"Q 56.890625 45.015625 53.6875 40.46875 \n", | |
"Q 50.484375 35.9375 44.390625 34.1875 \n", | |
"z\n", | |
"M 19.671875 64.796875 \n", | |
"L 19.671875 38.921875 \n", | |
"L 32.078125 38.921875 \n", | |
"Q 39.203125 38.921875 42.84375 42.21875 \n", | |
"Q 46.484375 45.515625 46.484375 51.90625 \n", | |
"Q 46.484375 58.296875 42.84375 61.546875 \n", | |
"Q 39.203125 64.796875 32.078125 64.796875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-103 d="M 45.40625 27.984375 \n", | |
"Q 45.40625 37.75 41.375 43.109375 \n", | |
"Q 37.359375 48.484375 30.078125 48.484375 \n", | |
"Q 22.859375 48.484375 18.828125 43.109375 \n", | |
"Q 14.796875 37.75 14.796875 27.984375 \n", | |
"Q 14.796875 18.265625 18.828125 12.890625 \n", | |
"Q 22.859375 7.515625 30.078125 7.515625 \n", | |
"Q 37.359375 7.515625 41.375 12.890625 \n", | |
"Q 45.40625 18.265625 45.40625 27.984375 \n", | |
"z\n", | |
"M 54.390625 6.78125 \n", | |
"Q 54.390625 -7.171875 48.1875 -13.984375 \n", | |
"Q 42 -20.796875 29.203125 -20.796875 \n", | |
"Q 24.46875 -20.796875 20.265625 -20.09375 \n", | |
"Q 16.0625 -19.390625 12.109375 -17.921875 \n", | |
"L 12.109375 -9.1875 \n", | |
"Q 16.0625 -11.328125 19.921875 -12.34375 \n", | |
"Q 23.78125 -13.375 27.78125 -13.375 \n", | |
"Q 36.625 -13.375 41.015625 -8.765625 \n", | |
"Q 45.40625 -4.15625 45.40625 5.171875 \n", | |
"L 45.40625 9.625 \n", | |
"Q 42.625 4.78125 38.28125 2.390625 \n", | |
"Q 33.9375 0 27.875 0 \n", | |
"Q 17.828125 0 11.671875 7.65625 \n", | |
"Q 5.515625 15.328125 5.515625 27.984375 \n", | |
"Q 5.515625 40.671875 11.671875 48.328125 \n", | |
"Q 17.828125 56 27.875 56 \n", | |
"Q 33.9375 56 38.28125 53.609375 \n", | |
"Q 42.625 51.21875 45.40625 46.390625 \n", | |
"L 45.40625 54.6875 \n", | |
"L 54.390625 54.6875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-82 /><use x=64.982422 xlink:href=#DejaVuSans-101 /><use x=126.505859 xlink:href=#DejaVuSans-103 /></g></g><g id=patch_8><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
"L 57.312 169.9659 \n", | |
"L 57.312 157.8699 \n", | |
"L 22.752 157.8699 \n", | |
"z\n", | |
""/></g><g id=text_2><defs><path id=DejaVuSans-73 d="M 9.8125 72.90625 \n", | |
"L 19.671875 72.90625 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-73 /><use x=29.492188 xlink:href=#DejaVuSans-82 /><use x=98.974609 xlink:href=#DejaVuSans-49 /></g></g><g id=patch_9><path style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 195.3297 \n", | |
"L 57.312 195.3297 \n", | |
"L 57.312 183.2337 \n", | |
"L 22.752 183.2337 \n", | |
"z\n", | |
""/></g><g id=text_3><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 195.3297)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-73 /><use x=29.492188 xlink:href=#DejaVuSans-82 /><use x=98.974609 xlink:href=#DejaVuSans-50 /></g></g><g id=patch_10><path style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 220.6935 \n", | |
"L 57.312 220.6935 \n", | |
"L 57.312 208.5975 \n", | |
"L 22.752 208.5975 \n", | |
"z\n", | |
""/></g><g id=text_4><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
"Q 47.65625 37.796875 51.625 33 \n", | |
"Q 55.609375 28.21875 55.609375 21.1875 \n", | |
"Q 55.609375 10.40625 48.1875 4.484375 \n", | |
"Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
"Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
"Q 12.796875 0.390625 7.625 2.203125 \n", | |
"L 7.625 11.71875 \n", | |
"Q 11.71875 9.328125 16.59375 8.109375 \n", | |
"Q 21.484375 6.890625 26.8125 6.890625 \n", | |
"Q 36.078125 6.890625 40.9375 10.546875 \n", | |
"Q 45.796875 14.203125 45.796875 21.1875 \n", | |
"Q 45.796875 27.640625 41.28125 31.265625 \n", | |
"Q 36.765625 34.90625 28.71875 34.90625 \n", | |
"L 20.21875 34.90625 \n", | |
"L 20.21875 43.015625 \n", | |
"L 29.109375 43.015625 \n", | |
"Q 36.375 43.015625 40.234375 45.921875 \n", | |
"Q 44.09375 48.828125 44.09375 54.296875 \n", | |
"Q 44.09375 59.90625 40.109375 62.90625 \n", | |
"Q 36.140625 65.921875 28.71875 65.921875 \n", | |
"Q 24.65625 65.921875 20.015625 65.03125 \n", | |
"Q 15.375 64.15625 9.8125 62.3125 \n", | |
"L 9.8125 71.09375 \n", | |
"Q 15.4375 72.65625 20.34375 73.4375 \n", | |
"Q 25.25 74.21875 29.59375 74.21875 \n", | |
"Q 40.828125 74.21875 47.359375 69.109375 \n", | |
"Q 53.90625 64.015625 53.90625 55.328125 \n", | |
"Q 53.90625 49.265625 50.4375 45.09375 \n", | |
"Q 46.96875 40.921875 40.578125 39.3125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 220.6935)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-73 /><use x=29.492188 xlink:href=#DejaVuSans-82 /><use x=98.974609 xlink:href=#DejaVuSans-51 /></g></g></g></g></g><defs><clippath id=pb731a87777><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_8809447796584088045></a><div class=variable><div class=col-sm-3><p class=h4 title=LandContour><a href=#pp_var_8809447796584088045>LandContour</a><br><small>Categorical</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>4</td></tr><tr><th>Distinct (%)</th><td>0.3%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> Lvl </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 1311&nbsp; </div></td></tr><tr class><th width=50%> Bnk </th><td width=50%><div class=bar style=width:4.8% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 63 </td></tr><tr class><th width=50%> HLS </th><td width=50%><div class=bar style=width:3.8% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 50 </td></tr><tr class><th width=50%> Low </th><td width=50%><div class=bar style=width:2.7% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 36 </td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-8809447796584088045, #minifreqtable8809447796584088045" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-8809447796584088045 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#8809447796584088045bottom-8809447796584088045overview aria-controls=8809447796584088045bottom-8809447796584088045overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#8809447796584088045bottom-8809447796584088045string aria-controls=8809447796584088045bottom-8809447796584088045string role=tab data-toggle=tab>Categories</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=8809447796584088045bottom-8809447796584088045overview><div class=row><div class=col-sm-6><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>Lvl</td></tr><tr><th>2nd row</th><td>Lvl</td></tr><tr><th>3rd row</th><td>Lvl</td></tr><tr><th>4th row</th><td>Lvl</td></tr><tr><th>5th row</th><td>Lvl</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=8809447796584088045bottom-8809447796584088045string><div class=row><div class=col-sm-6><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=Lvl>Lvl</td><td>1311</td><td><div class=bar style=width:100.0%> 89.8% </div></td></tr><tr class><td title=Bnk>Bnk</td><td>63</td><td><div class=bar style=width:4.8%> &nbsp; </div> 4.3% </td></tr><tr class><td title=HLS>HLS</td><td>50</td><td><div class=bar style=width:3.8%> &nbsp; </div> 3.4% </td></tr><tr class><td title=Low>Low</td><td>36</td><td><div class=bar style=width:2.7%> &nbsp; </div> 2.5% </td></tr></tbody></table></div><div class=col-sm-6><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=238.3992pt version=1.1 viewbox="0 0 405 238.3992" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 238.3992 \n", | |
"L 405 238.3992 \n", | |
"L 405 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#p9dca9e89f3) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
"L 357.937397 106.86 \n", | |
"L 357.937397 16.26 \n", | |
"L 7.2 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_3><path clip-path=url(#p9dca9e89f3) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 357.937397 106.86 \n", | |
"L 374.792055 106.86 \n", | |
"L 374.792055 16.26 \n", | |
"L 357.937397 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#p9dca9e89f3) style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 374.792055 106.86 \n", | |
"L 388.168767 106.86 \n", | |
"L 388.168767 16.26 \n", | |
"L 374.792055 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#p9dca9e89f3) style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 388.168767 106.86 \n", | |
"L 397.8 106.86 \n", | |
"L 397.8 16.26 \n", | |
"L 388.168767 16.26 \n", | |
"z\n", | |
""/></g><g id=legend_1><g id=patch_6><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 231.1992 \n", | |
"L 108.6228 231.1992 \n", | |
"Q 112.0788 231.1992 112.0788 227.7432 \n", | |
"L 112.0788 128.016 \n", | |
"Q 112.0788 124.56 108.6228 124.56 \n", | |
"L 19.296 124.56 \n", | |
"Q 15.84 124.56 15.84 128.016 \n", | |
"L 15.84 227.7432 \n", | |
"Q 15.84 231.1992 19.296 231.1992 \n", | |
"z\n", | |
""/></g><g id=patch_7><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
"L 57.312 144.6021 \n", | |
"L 57.312 132.5061 \n", | |
"L 22.752 132.5061 \n", | |
"z\n", | |
""/></g><g id=text_1><defs><path id=DejaVuSans-76 d="M 9.8125 72.90625 \n", | |
"L 19.671875 72.90625 \n", | |
"L 19.671875 8.296875 \n", | |
"L 55.171875 8.296875 \n", | |
"L 55.171875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-118 d="M 2.984375 54.6875 \n", | |
"L 12.5 54.6875 \n", | |
"L 29.59375 8.796875 \n", | |
"L 46.6875 54.6875 \n", | |
"L 56.203125 54.6875 \n", | |
"L 35.6875 0 \n", | |
"L 23.484375 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-108 d="M 9.421875 75.984375 \n", | |
"L 18.40625 75.984375 \n", | |
"L 18.40625 0 \n", | |
"L 9.421875 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-76 /><use x=55.712891 xlink:href=#DejaVuSans-118 /><use x=114.892578 xlink:href=#DejaVuSans-108 /></g></g><g id=patch_8><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
"L 57.312 169.9659 \n", | |
"L 57.312 157.8699 \n", | |
"L 22.752 157.8699 \n", | |
"z\n", | |
""/></g><g id=text_2><defs><path id=DejaVuSans-66 d="M 19.671875 34.8125 \n", | |
"L 19.671875 8.109375 \n", | |
"L 35.5 8.109375 \n", | |
"Q 43.453125 8.109375 47.28125 11.40625 \n", | |
"Q 51.125 14.703125 51.125 21.484375 \n", | |
"Q 51.125 28.328125 47.28125 31.5625 \n", | |
"Q 43.453125 34.8125 35.5 34.8125 \n", | |
"z\n", | |
"M 19.671875 64.796875 \n", | |
"L 19.671875 42.828125 \n", | |
"L 34.28125 42.828125 \n", | |
"Q 41.5 42.828125 45.03125 45.53125 \n", | |
"Q 48.578125 48.25 48.578125 53.8125 \n", | |
"Q 48.578125 59.328125 45.03125 62.0625 \n", | |
"Q 41.5 64.796875 34.28125 64.796875 \n", | |
"z\n", | |
"M 9.8125 72.90625 \n", | |
"L 35.015625 72.90625 \n", | |
"Q 46.296875 72.90625 52.390625 68.21875 \n", | |
"Q 58.5 63.53125 58.5 54.890625 \n", | |
"Q 58.5 48.1875 55.375 44.234375 \n", | |
"Q 52.25 40.28125 46.1875 39.3125 \n", | |
"Q 53.46875 37.75 57.5 32.78125 \n", | |
"Q 61.53125 27.828125 61.53125 20.40625 \n", | |
"Q 61.53125 10.640625 54.890625 5.3125 \n", | |
"Q 48.25 0 35.984375 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
"L 54.890625 0 \n", | |
"L 45.90625 0 \n", | |
"L 45.90625 32.71875 \n", | |
"Q 45.90625 40.484375 42.875 44.328125 \n", | |
"Q 39.84375 48.1875 33.796875 48.1875 \n", | |
"Q 26.515625 48.1875 22.3125 43.546875 \n", | |
"Q 18.109375 38.921875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.34375 51.125 25.703125 53.5625 \n", | |
"Q 30.078125 56 35.796875 56 \n", | |
"Q 45.21875 56 50.046875 50.171875 \n", | |
"Q 54.890625 44.34375 54.890625 33.015625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-107 d="M 9.078125 75.984375 \n", | |
"L 18.109375 75.984375 \n", | |
"L 18.109375 31.109375 \n", | |
"L 44.921875 54.6875 \n", | |
"L 56.390625 54.6875 \n", | |
"L 27.390625 29.109375 \n", | |
"L 57.625 0 \n", | |
"L 45.90625 0 \n", | |
"L 18.109375 26.703125 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-66 /><use x=68.603516 xlink:href=#DejaVuSans-110 /><use x=131.982422 xlink:href=#DejaVuSans-107 /></g></g><g id=patch_9><path style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 195.3297 \n", | |
"L 57.312 195.3297 \n", | |
"L 57.312 183.2337 \n", | |
"L 22.752 183.2337 \n", | |
"z\n", | |
""/></g><g id=text_3><defs><path id=DejaVuSans-72 d="M 9.8125 72.90625 \n", | |
"L 19.671875 72.90625 \n", | |
"L 19.671875 43.015625 \n", | |
"L 55.515625 43.015625 \n", | |
"L 55.515625 72.90625 \n", | |
"L 65.375 72.90625 \n", | |
"L 65.375 0 \n", | |
"L 55.515625 0 \n", | |
"L 55.515625 34.71875 \n", | |
"L 19.671875 34.71875 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-83 d="M 53.515625 70.515625 \n", | |
"L 53.515625 60.890625 \n", | |
"Q 47.90625 63.578125 42.921875 64.890625 \n", | |
"Q 37.9375 66.21875 33.296875 66.21875 \n", | |
"Q 25.25 66.21875 20.875 63.09375 \n", | |
"Q 16.5 59.96875 16.5 54.203125 \n", | |
"Q 16.5 49.359375 19.40625 46.890625 \n", | |
"Q 22.3125 44.4375 30.421875 42.921875 \n", | |
"L 36.375 41.703125 \n", | |
"Q 47.40625 39.59375 52.65625 34.296875 \n", | |
"Q 57.90625 29 57.90625 20.125 \n", | |
"Q 57.90625 9.515625 50.796875 4.046875 \n", | |
"Q 43.703125 -1.421875 29.984375 -1.421875 \n", | |
"Q 24.8125 -1.421875 18.96875 -0.25 \n", | |
"Q 13.140625 0.921875 6.890625 3.21875 \n", | |
"L 6.890625 13.375 \n", | |
"Q 12.890625 10.015625 18.65625 8.296875 \n", | |
"Q 24.421875 6.59375 29.984375 6.59375 \n", | |
"Q 38.421875 6.59375 43.015625 9.90625 \n", | |
"Q 47.609375 13.234375 47.609375 19.390625 \n", | |
"Q 47.609375 24.75 44.3125 27.78125 \n", | |
"Q 41.015625 30.8125 33.5 32.328125 \n", | |
"L 27.484375 33.5 \n", | |
"Q 16.453125 35.6875 11.515625 40.375 \n", | |
"Q 6.59375 45.0625 6.59375 53.421875 \n", | |
"Q 6.59375 63.09375 13.40625 68.65625 \n", | |
"Q 20.21875 74.21875 32.171875 74.21875 \n", | |
"Q 37.3125 74.21875 42.625 73.28125 \n", | |
"Q 47.953125 72.359375 53.515625 70.515625 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 195.3297)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-72 /><use x=75.195312 xlink:href=#DejaVuSans-76 /><use x=130.908203 xlink:href=#DejaVuSans-83 /></g></g><g id=patch_10><path style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 220.6935 \n", | |
"L 57.312 220.6935 \n", | |
"L 57.312 208.5975 \n", | |
"L 22.752 208.5975 \n", | |
"z\n", | |
""/></g><g id=text_4><defs><path id=DejaVuSans-111 d="M 30.609375 48.390625 \n", | |
"Q 23.390625 48.390625 19.1875 42.75 \n", | |
"Q 14.984375 37.109375 14.984375 27.296875 \n", | |
"Q 14.984375 17.484375 19.15625 11.84375 \n", | |
"Q 23.34375 6.203125 30.609375 6.203125 \n", | |
"Q 37.796875 6.203125 41.984375 11.859375 \n", | |
"Q 46.1875 17.53125 46.1875 27.296875 \n", | |
"Q 46.1875 37.015625 41.984375 42.703125 \n", | |
"Q 37.796875 48.390625 30.609375 48.390625 \n", | |
"z\n", | |
"M 30.609375 56 \n", | |
"Q 42.328125 56 49.015625 48.375 \n", | |
"Q 55.71875 40.765625 55.71875 27.296875 \n", | |
"Q 55.71875 13.875 49.015625 6.21875 \n", | |
"Q 42.328125 -1.421875 30.609375 -1.421875 \n", | |
"Q 18.84375 -1.421875 12.171875 6.21875 \n", | |
"Q 5.515625 13.875 5.515625 27.296875 \n", | |
"Q 5.515625 40.765625 12.171875 48.375 \n", | |
"Q 18.84375 56 30.609375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-119 d="M 4.203125 54.6875 \n", | |
"L 13.1875 54.6875 \n", | |
"L 24.421875 12.015625 \n", | |
"L 35.59375 54.6875 \n", | |
"L 46.1875 54.6875 \n", | |
"L 57.421875 12.015625 \n", | |
"L 68.609375 54.6875 \n", | |
"L 77.59375 54.6875 \n", | |
"L 63.28125 0 \n", | |
"L 52.6875 0 \n", | |
"L 40.921875 44.828125 \n", | |
"L 29.109375 0 \n", | |
"L 18.5 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 220.6935)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-76 /><use x=53.962891 xlink:href=#DejaVuSans-111 /><use x=115.144531 xlink:href=#DejaVuSans-119 /></g></g></g></g></g><defs><clippath id=p9dca9e89f3><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_4161506703621740256></a><div class=variable><div class=col-sm-3><p class=h4 title=Utilities><a href=#pp_var_4161506703621740256>Utilities</a><br><small>Categorical</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>2</td></tr><tr><th>Distinct (%)</th><td>0.1%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> AllPub </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 1459&nbsp; </div></td></tr><tr class><th width=50%> NoSeWa </th><td width=50%><div class=bar style=width:0.1% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 1 </td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-4161506703621740256, #minifreqtable4161506703621740256" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-4161506703621740256 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#4161506703621740256bottom-4161506703621740256overview aria-controls=4161506703621740256bottom-4161506703621740256overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#4161506703621740256bottom-4161506703621740256string aria-controls=4161506703621740256bottom-4161506703621740256string role=tab data-toggle=tab>Categories</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=4161506703621740256bottom-4161506703621740256overview><div class=row><div class=col-sm-6><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>1 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.1%</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>AllPub</td></tr><tr><th>2nd row</th><td>AllPub</td></tr><tr><th>3rd row</th><td>AllPub</td></tr><tr><th>4th row</th><td>AllPub</td></tr><tr><th>5th row</th><td>AllPub</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=4161506703621740256bottom-4161506703621740256string><div class=row><div class=col-sm-6><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=AllPub>AllPub</td><td>1459</td><td><div class=bar style=width:100.0%> 99.9% </div></td></tr><tr class><td title=NoSeWa>NoSeWa</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr></tbody></table></div><div class=col-sm-6><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=187.6716pt version=1.1 viewbox="0 0 405 187.6716" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 187.6716 \n", | |
"L 405 187.6716 \n", | |
"L 405 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#p0e31573299) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
"L 397.532466 106.86 \n", | |
"L 397.532466 16.26 \n", | |
"L 7.2 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_3><path clip-path=url(#p0e31573299) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 397.532466 106.86 \n", | |
"L 397.8 106.86 \n", | |
"L 397.8 16.26 \n", | |
"L 397.532466 16.26 \n", | |
"z\n", | |
""/></g><g id=legend_1><g id=patch_4><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 180.4716 \n", | |
"L 146.2689 180.4716 \n", | |
"Q 149.7249 180.4716 149.7249 177.0156 \n", | |
"L 149.7249 128.016 \n", | |
"Q 149.7249 124.56 146.2689 124.56 \n", | |
"L 19.296 124.56 \n", | |
"Q 15.84 124.56 15.84 128.016 \n", | |
"L 15.84 177.0156 \n", | |
"Q 15.84 180.4716 19.296 180.4716 \n", | |
"z\n", | |
""/></g><g id=patch_5><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
"L 57.312 144.6021 \n", | |
"L 57.312 132.5061 \n", | |
"L 22.752 132.5061 \n", | |
"z\n", | |
""/></g><g id=text_1><defs><path id=DejaVuSans-65 d="M 34.1875 63.1875 \n", | |
"L 20.796875 26.90625 \n", | |
"L 47.609375 26.90625 \n", | |
"z\n", | |
"M 28.609375 72.90625 \n", | |
"L 39.796875 72.90625 \n", | |
"L 67.578125 0 \n", | |
"L 57.328125 0 \n", | |
"L 50.6875 18.703125 \n", | |
"L 17.828125 18.703125 \n", | |
"L 11.1875 0 \n", | |
"L 0.78125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-108 d="M 9.421875 75.984375 \n", | |
"L 18.40625 75.984375 \n", | |
"L 18.40625 0 \n", | |
"L 9.421875 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-80 d="M 19.671875 64.796875 \n", | |
"L 19.671875 37.40625 \n", | |
"L 32.078125 37.40625 \n", | |
"Q 38.96875 37.40625 42.71875 40.96875 \n", | |
"Q 46.484375 44.53125 46.484375 51.125 \n", | |
"Q 46.484375 57.671875 42.71875 61.234375 \n", | |
"Q 38.96875 64.796875 32.078125 64.796875 \n", | |
"z\n", | |
"M 9.8125 72.90625 \n", | |
"L 32.078125 72.90625 \n", | |
"Q 44.34375 72.90625 50.609375 67.359375 \n", | |
"Q 56.890625 61.8125 56.890625 51.125 \n", | |
"Q 56.890625 40.328125 50.609375 34.8125 \n", | |
"Q 44.34375 29.296875 32.078125 29.296875 \n", | |
"L 19.671875 29.296875 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
"L 8.5 54.6875 \n", | |
"L 17.484375 54.6875 \n", | |
"L 17.484375 21.921875 \n", | |
"Q 17.484375 14.15625 20.5 10.265625 \n", | |
"Q 23.53125 6.390625 29.59375 6.390625 \n", | |
"Q 36.859375 6.390625 41.078125 11.03125 \n", | |
"Q 45.3125 15.671875 45.3125 23.6875 \n", | |
"L 45.3125 54.6875 \n", | |
"L 54.296875 54.6875 \n", | |
"L 54.296875 0 \n", | |
"L 45.3125 0 \n", | |
"L 45.3125 8.40625 \n", | |
"Q 42.046875 3.421875 37.71875 1 \n", | |
"Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
"Q 18.265625 -1.421875 13.375 4.4375 \n", | |
"Q 8.5 10.296875 8.5 21.578125 \n", | |
"z\n", | |
"M 31.109375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-98 d="M 48.6875 27.296875 \n", | |
"Q 48.6875 37.203125 44.609375 42.84375 \n", | |
"Q 40.53125 48.484375 33.40625 48.484375 \n", | |
"Q 26.265625 48.484375 22.1875 42.84375 \n", | |
"Q 18.109375 37.203125 18.109375 27.296875 \n", | |
"Q 18.109375 17.390625 22.1875 11.75 \n", | |
"Q 26.265625 6.109375 33.40625 6.109375 \n", | |
"Q 40.53125 6.109375 44.609375 11.75 \n", | |
"Q 48.6875 17.390625 48.6875 27.296875 \n", | |
"z\n", | |
"M 18.109375 46.390625 \n", | |
"Q 20.953125 51.265625 25.265625 53.625 \n", | |
"Q 29.59375 56 35.59375 56 \n", | |
"Q 45.5625 56 51.78125 48.09375 \n", | |
"Q 58.015625 40.1875 58.015625 27.296875 \n", | |
"Q 58.015625 14.40625 51.78125 6.484375 \n", | |
"Q 45.5625 -1.421875 35.59375 -1.421875 \n", | |
"Q 29.59375 -1.421875 25.265625 0.953125 \n", | |
"Q 20.953125 3.328125 18.109375 8.203125 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 75.984375 \n", | |
"L 18.109375 75.984375 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-65 /><use x=68.408203 xlink:href=#DejaVuSans-108 /><use x=96.191406 xlink:href=#DejaVuSans-108 /><use x=123.974609 xlink:href=#DejaVuSans-80 /><use x=182.527344 xlink:href=#DejaVuSans-117 /><use x=245.90625 xlink:href=#DejaVuSans-98 /></g></g><g id=patch_6><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
"L 57.312 169.9659 \n", | |
"L 57.312 157.8699 \n", | |
"L 22.752 157.8699 \n", | |
"z\n", | |
""/></g><g id=text_2><defs><path id=DejaVuSans-78 d="M 9.8125 72.90625 \n", | |
"L 23.09375 72.90625 \n", | |
"L 55.421875 11.921875 \n", | |
"L 55.421875 72.90625 \n", | |
"L 64.984375 72.90625 \n", | |
"L 64.984375 0 \n", | |
"L 51.703125 0 \n", | |
"L 19.390625 60.984375 \n", | |
"L 19.390625 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-111 d="M 30.609375 48.390625 \n", | |
"Q 23.390625 48.390625 19.1875 42.75 \n", | |
"Q 14.984375 37.109375 14.984375 27.296875 \n", | |
"Q 14.984375 17.484375 19.15625 11.84375 \n", | |
"Q 23.34375 6.203125 30.609375 6.203125 \n", | |
"Q 37.796875 6.203125 41.984375 11.859375 \n", | |
"Q 46.1875 17.53125 46.1875 27.296875 \n", | |
"Q 46.1875 37.015625 41.984375 42.703125 \n", | |
"Q 37.796875 48.390625 30.609375 48.390625 \n", | |
"z\n", | |
"M 30.609375 56 \n", | |
"Q 42.328125 56 49.015625 48.375 \n", | |
"Q 55.71875 40.765625 55.71875 27.296875 \n", | |
"Q 55.71875 13.875 49.015625 6.21875 \n", | |
"Q 42.328125 -1.421875 30.609375 -1.421875 \n", | |
"Q 18.84375 -1.421875 12.171875 6.21875 \n", | |
"Q 5.515625 13.875 5.515625 27.296875 \n", | |
"Q 5.515625 40.765625 12.171875 48.375 \n", | |
"Q 18.84375 56 30.609375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-83 d="M 53.515625 70.515625 \n", | |
"L 53.515625 60.890625 \n", | |
"Q 47.90625 63.578125 42.921875 64.890625 \n", | |
"Q 37.9375 66.21875 33.296875 66.21875 \n", | |
"Q 25.25 66.21875 20.875 63.09375 \n", | |
"Q 16.5 59.96875 16.5 54.203125 \n", | |
"Q 16.5 49.359375 19.40625 46.890625 \n", | |
"Q 22.3125 44.4375 30.421875 42.921875 \n", | |
"L 36.375 41.703125 \n", | |
"Q 47.40625 39.59375 52.65625 34.296875 \n", | |
"Q 57.90625 29 57.90625 20.125 \n", | |
"Q 57.90625 9.515625 50.796875 4.046875 \n", | |
"Q 43.703125 -1.421875 29.984375 -1.421875 \n", | |
"Q 24.8125 -1.421875 18.96875 -0.25 \n", | |
"Q 13.140625 0.921875 6.890625 3.21875 \n", | |
"L 6.890625 13.375 \n", | |
"Q 12.890625 10.015625 18.65625 8.296875 \n", | |
"Q 24.421875 6.59375 29.984375 6.59375 \n", | |
"Q 38.421875 6.59375 43.015625 9.90625 \n", | |
"Q 47.609375 13.234375 47.609375 19.390625 \n", | |
"Q 47.609375 24.75 44.3125 27.78125 \n", | |
"Q 41.015625 30.8125 33.5 32.328125 \n", | |
"L 27.484375 33.5 \n", | |
"Q 16.453125 35.6875 11.515625 40.375 \n", | |
"Q 6.59375 45.0625 6.59375 53.421875 \n", | |
"Q 6.59375 63.09375 13.40625 68.65625 \n", | |
"Q 20.21875 74.21875 32.171875 74.21875 \n", | |
"Q 37.3125 74.21875 42.625 73.28125 \n", | |
"Q 47.953125 72.359375 53.515625 70.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-87 d="M 3.328125 72.90625 \n", | |
"L 13.28125 72.90625 \n", | |
"L 28.609375 11.28125 \n", | |
"L 43.890625 72.90625 \n", | |
"L 54.984375 72.90625 \n", | |
"L 70.3125 11.28125 \n", | |
"L 85.59375 72.90625 \n", | |
"L 95.609375 72.90625 \n", | |
"L 77.296875 0 \n", | |
"L 64.890625 0 \n", | |
"L 49.515625 63.28125 \n", | |
"L 33.984375 0 \n", | |
"L 21.578125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-97 d="M 34.28125 27.484375 \n", | |
"Q 23.390625 27.484375 19.1875 25 \n", | |
"Q 14.984375 22.515625 14.984375 16.5 \n", | |
"Q 14.984375 11.71875 18.140625 8.90625 \n", | |
"Q 21.296875 6.109375 26.703125 6.109375 \n", | |
"Q 34.1875 6.109375 38.703125 11.40625 \n", | |
"Q 43.21875 16.703125 43.21875 25.484375 \n", | |
"L 43.21875 27.484375 \n", | |
"z\n", | |
"M 52.203125 31.203125 \n", | |
"L 52.203125 0 \n", | |
"L 43.21875 0 \n", | |
"L 43.21875 8.296875 \n", | |
"Q 40.140625 3.328125 35.546875 0.953125 \n", | |
"Q 30.953125 -1.421875 24.3125 -1.421875 \n", | |
"Q 15.921875 -1.421875 10.953125 3.296875 \n", | |
"Q 6 8.015625 6 15.921875 \n", | |
"Q 6 25.140625 12.171875 29.828125 \n", | |
"Q 18.359375 34.515625 30.609375 34.515625 \n", | |
"L 43.21875 34.515625 \n", | |
"L 43.21875 35.40625 \n", | |
"Q 43.21875 41.609375 39.140625 45 \n", | |
"Q 35.0625 48.390625 27.6875 48.390625 \n", | |
"Q 23 48.390625 18.546875 47.265625 \n", | |
"Q 14.109375 46.140625 10.015625 43.890625 \n", | |
"L 10.015625 52.203125 \n", | |
"Q 14.9375 54.109375 19.578125 55.046875 \n", | |
"Q 24.21875 56 28.609375 56 \n", | |
"Q 40.484375 56 46.34375 49.84375 \n", | |
"Q 52.203125 43.703125 52.203125 31.203125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-78 /><use x=74.804688 xlink:href=#DejaVuSans-111 /><use x=135.986328 xlink:href=#DejaVuSans-83 /><use x=199.462891 xlink:href=#DejaVuSans-101 /><use x=260.986328 xlink:href=#DejaVuSans-87 /><use x=353.488281 xlink:href=#DejaVuSans-97 /></g></g></g></g></g><defs><clippath id=p0e31573299><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_-4979626700173810756></a><div class=variable><div class=col-sm-3><p class=h4 title=LotConfig><a href=#pp_var_-4979626700173810756>LotConfig</a><br><small>Categorical</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>5</td></tr><tr><th>Distinct (%)</th><td>0.3%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> Inside </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 1052&nbsp; </div></td></tr><tr class><th width=50%> Corner </th><td width=50%><div class=bar style=width:25.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 263&nbsp; </div></td></tr><tr class><th width=50%> CulDSac </th><td width=50%><div class=bar style=width:8.9% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 94 </td></tr><tr class><th width=50%> FR2 </th><td width=50%><div class=bar style=width:4.5% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 47 </td></tr><tr class><th width=50%> FR3 </th><td width=50%><div class=bar style=width:0.4% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 4 </td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom--4979626700173810756, #minifreqtable-4979626700173810756" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom--4979626700173810756 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-4979626700173810756bottom--4979626700173810756overview aria-controls=-4979626700173810756bottom--4979626700173810756overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#-4979626700173810756bottom--4979626700173810756string aria-controls=-4979626700173810756bottom--4979626700173810756string role=tab data-toggle=tab>Categories</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-4979626700173810756bottom--4979626700173810756overview><div class=row><div class=col-sm-6><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>Inside</td></tr><tr><th>2nd row</th><td>FR2</td></tr><tr><th>3rd row</th><td>Inside</td></tr><tr><th>4th row</th><td>Corner</td></tr><tr><th>5th row</th><td>FR2</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-4979626700173810756bottom--4979626700173810756string><div class=row><div class=col-sm-6><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=Inside>Inside</td><td>1052</td><td><div class=bar style=width:100.0%> 72.1% </div></td></tr><tr class><td title=Corner>Corner</td><td>263</td><td><div class=bar style=width:25.0%> &nbsp; </div> 18.0% </td></tr><tr class><td title=CulDSac>CulDSac</td><td>94</td><td><div class=bar style=width:8.9%> &nbsp; </div> 6.4% </td></tr><tr class><td title=FR2>FR2</td><td>47</td><td><div class=bar style=width:4.5%> &nbsp; </div> 3.2% </td></tr><tr class><td title=FR3>FR3</td><td>4</td><td><div class=bar style=width:0.4%> &nbsp; </div> 0.3% </td></tr></tbody></table></div><div class=col-sm-6><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=263.763pt version=1.1 viewbox="0 0 405 263.763" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 263.763 \n", | |
"L 405 263.763 \n", | |
"L 405 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#pf1018c0a7b) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
"L 288.646027 106.86 \n", | |
"L 288.646027 16.26 \n", | |
"L 7.2 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_3><path clip-path=url(#pf1018c0a7b) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 288.646027 106.86 \n", | |
"L 359.007534 106.86 \n", | |
"L 359.007534 16.26 \n", | |
"L 288.646027 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#pf1018c0a7b) style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 359.007534 106.86 \n", | |
"L 384.155753 106.86 \n", | |
"L 384.155753 16.26 \n", | |
"L 359.007534 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#pf1018c0a7b) style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 384.155753 106.86 \n", | |
"L 396.729863 106.86 \n", | |
"L 396.729863 16.26 \n", | |
"L 384.155753 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#pf1018c0a7b) style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 396.729863 106.86 \n", | |
"L 397.8 106.86 \n", | |
"L 397.8 16.26 \n", | |
"L 396.729863 16.26 \n", | |
"z\n", | |
""/></g><g id=legend_1><g id=patch_7><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 256.563 \n", | |
"L 146.7765 256.563 \n", | |
"Q 150.2325 256.563 150.2325 253.107 \n", | |
"L 150.2325 128.016 \n", | |
"Q 150.2325 124.56 146.7765 124.56 \n", | |
"L 19.296 124.56 \n", | |
"Q 15.84 124.56 15.84 128.016 \n", | |
"L 15.84 253.107 \n", | |
"Q 15.84 256.563 19.296 256.563 \n", | |
"z\n", | |
""/></g><g id=patch_8><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
"L 57.312 144.6021 \n", | |
"L 57.312 132.5061 \n", | |
"L 22.752 132.5061 \n", | |
"z\n", | |
""/></g><g id=text_1><defs><path id=DejaVuSans-73 d="M 9.8125 72.90625 \n", | |
"L 19.671875 72.90625 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
"L 54.890625 0 \n", | |
"L 45.90625 0 \n", | |
"L 45.90625 32.71875 \n", | |
"Q 45.90625 40.484375 42.875 44.328125 \n", | |
"Q 39.84375 48.1875 33.796875 48.1875 \n", | |
"Q 26.515625 48.1875 22.3125 43.546875 \n", | |
"Q 18.109375 38.921875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.34375 51.125 25.703125 53.5625 \n", | |
"Q 30.078125 56 35.796875 56 \n", | |
"Q 45.21875 56 50.046875 50.171875 \n", | |
"Q 54.890625 44.34375 54.890625 33.015625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-115 d="M 44.28125 53.078125 \n", | |
"L 44.28125 44.578125 \n", | |
"Q 40.484375 46.53125 36.375 47.5 \n", | |
"Q 32.28125 48.484375 27.875 48.484375 \n", | |
"Q 21.1875 48.484375 17.84375 46.4375 \n", | |
"Q 14.5 44.390625 14.5 40.28125 \n", | |
"Q 14.5 37.15625 16.890625 35.375 \n", | |
"Q 19.28125 33.59375 26.515625 31.984375 \n", | |
"L 29.59375 31.296875 \n", | |
"Q 39.15625 29.25 43.1875 25.515625 \n", | |
"Q 47.21875 21.78125 47.21875 15.09375 \n", | |
"Q 47.21875 7.46875 41.1875 3.015625 \n", | |
"Q 35.15625 -1.421875 24.609375 -1.421875 \n", | |
"Q 20.21875 -1.421875 15.453125 -0.5625 \n", | |
"Q 10.6875 0.296875 5.421875 2 \n", | |
"L 5.421875 11.28125 \n", | |
"Q 10.40625 8.6875 15.234375 7.390625 \n", | |
"Q 20.0625 6.109375 24.8125 6.109375 \n", | |
"Q 31.15625 6.109375 34.5625 8.28125 \n", | |
"Q 37.984375 10.453125 37.984375 14.40625 \n", | |
"Q 37.984375 18.0625 35.515625 20.015625 \n", | |
"Q 33.0625 21.96875 24.703125 23.78125 \n", | |
"L 21.578125 24.515625 \n", | |
"Q 13.234375 26.265625 9.515625 29.90625 \n", | |
"Q 5.8125 33.546875 5.8125 39.890625 \n", | |
"Q 5.8125 47.609375 11.28125 51.796875 \n", | |
"Q 16.75 56 26.8125 56 \n", | |
"Q 31.78125 56 36.171875 55.265625 \n", | |
"Q 40.578125 54.546875 44.28125 53.078125 \n", | |
"z\n", | |
""/><path id=DejaVuSans-105 d="M 9.421875 54.6875 \n", | |
"L 18.40625 54.6875 \n", | |
"L 18.40625 0 \n", | |
"L 9.421875 0 \n", | |
"z\n", | |
"M 9.421875 75.984375 \n", | |
"L 18.40625 75.984375 \n", | |
"L 18.40625 64.59375 \n", | |
"L 9.421875 64.59375 \n", | |
"z\n", | |
""/><path id=DejaVuSans-100 d="M 45.40625 46.390625 \n", | |
"L 45.40625 75.984375 \n", | |
"L 54.390625 75.984375 \n", | |
"L 54.390625 0 \n", | |
"L 45.40625 0 \n", | |
"L 45.40625 8.203125 \n", | |
"Q 42.578125 3.328125 38.25 0.953125 \n", | |
"Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
"Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
"Q 5.515625 14.40625 5.515625 27.296875 \n", | |
"Q 5.515625 40.1875 11.734375 48.09375 \n", | |
"Q 17.96875 56 27.875 56 \n", | |
"Q 33.9375 56 38.25 53.625 \n", | |
"Q 42.578125 51.265625 45.40625 46.390625 \n", | |
"z\n", | |
"M 14.796875 27.296875 \n", | |
"Q 14.796875 17.390625 18.875 11.75 \n", | |
"Q 22.953125 6.109375 30.078125 6.109375 \n", | |
"Q 37.203125 6.109375 41.296875 11.75 \n", | |
"Q 45.40625 17.390625 45.40625 27.296875 \n", | |
"Q 45.40625 37.203125 41.296875 42.84375 \n", | |
"Q 37.203125 48.484375 30.078125 48.484375 \n", | |
"Q 22.953125 48.484375 18.875 42.84375 \n", | |
"Q 14.796875 37.203125 14.796875 27.296875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-73 /><use x=29.492188 xlink:href=#DejaVuSans-110 /><use x=92.871094 xlink:href=#DejaVuSans-115 /><use x=144.970703 xlink:href=#DejaVuSans-105 /><use x=172.753906 xlink:href=#DejaVuSans-100 /><use x=236.230469 xlink:href=#DejaVuSans-101 /></g></g><g id=patch_9><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
"L 57.312 169.9659 \n", | |
"L 57.312 157.8699 \n", | |
"L 22.752 157.8699 \n", | |
"z\n", | |
""/></g><g id=text_2><defs><path id=DejaVuSans-67 d="M 64.40625 67.28125 \n", | |
"L 64.40625 56.890625 \n", | |
"Q 59.421875 61.53125 53.78125 63.8125 \n", | |
"Q 48.140625 66.109375 41.796875 66.109375 \n", | |
"Q 29.296875 66.109375 22.65625 58.46875 \n", | |
"Q 16.015625 50.828125 16.015625 36.375 \n", | |
"Q 16.015625 21.96875 22.65625 14.328125 \n", | |
"Q 29.296875 6.6875 41.796875 6.6875 \n", | |
"Q 48.140625 6.6875 53.78125 8.984375 \n", | |
"Q 59.421875 11.28125 64.40625 15.921875 \n", | |
"L 64.40625 5.609375 \n", | |
"Q 59.234375 2.09375 53.4375 0.328125 \n", | |
"Q 47.65625 -1.421875 41.21875 -1.421875 \n", | |
"Q 24.65625 -1.421875 15.125 8.703125 \n", | |
"Q 5.609375 18.84375 5.609375 36.375 \n", | |
"Q 5.609375 53.953125 15.125 64.078125 \n", | |
"Q 24.65625 74.21875 41.21875 74.21875 \n", | |
"Q 47.75 74.21875 53.53125 72.484375 \n", | |
"Q 59.328125 70.75 64.40625 67.28125 \n", | |
"z\n", | |
""/><path id=DejaVuSans-111 d="M 30.609375 48.390625 \n", | |
"Q 23.390625 48.390625 19.1875 42.75 \n", | |
"Q 14.984375 37.109375 14.984375 27.296875 \n", | |
"Q 14.984375 17.484375 19.15625 11.84375 \n", | |
"Q 23.34375 6.203125 30.609375 6.203125 \n", | |
"Q 37.796875 6.203125 41.984375 11.859375 \n", | |
"Q 46.1875 17.53125 46.1875 27.296875 \n", | |
"Q 46.1875 37.015625 41.984375 42.703125 \n", | |
"Q 37.796875 48.390625 30.609375 48.390625 \n", | |
"z\n", | |
"M 30.609375 56 \n", | |
"Q 42.328125 56 49.015625 48.375 \n", | |
"Q 55.71875 40.765625 55.71875 27.296875 \n", | |
"Q 55.71875 13.875 49.015625 6.21875 \n", | |
"Q 42.328125 -1.421875 30.609375 -1.421875 \n", | |
"Q 18.84375 -1.421875 12.171875 6.21875 \n", | |
"Q 5.515625 13.875 5.515625 27.296875 \n", | |
"Q 5.515625 40.765625 12.171875 48.375 \n", | |
"Q 18.84375 56 30.609375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
"Q 39.59375 47.171875 37.8125 47.578125 \n", | |
"Q 36.03125 48 33.890625 48 \n", | |
"Q 26.265625 48 22.1875 43.046875 \n", | |
"Q 18.109375 38.09375 18.109375 28.8125 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 20.953125 51.171875 25.484375 53.578125 \n", | |
"Q 30.03125 56 36.53125 56 \n", | |
"Q 37.453125 56 38.578125 55.875 \n", | |
"Q 39.703125 55.765625 41.0625 55.515625 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-67 /><use x=69.824219 xlink:href=#DejaVuSans-111 /><use x=131.005859 xlink:href=#DejaVuSans-114 /><use x=170.369141 xlink:href=#DejaVuSans-110 /><use x=233.748047 xlink:href=#DejaVuSans-101 /><use x=295.271484 xlink:href=#DejaVuSans-114 /></g></g><g id=patch_10><path style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 195.3297 \n", | |
"L 57.312 195.3297 \n", | |
"L 57.312 183.2337 \n", | |
"L 22.752 183.2337 \n", | |
"z\n", | |
""/></g><g id=text_3><defs><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
"L 8.5 54.6875 \n", | |
"L 17.484375 54.6875 \n", | |
"L 17.484375 21.921875 \n", | |
"Q 17.484375 14.15625 20.5 10.265625 \n", | |
"Q 23.53125 6.390625 29.59375 6.390625 \n", | |
"Q 36.859375 6.390625 41.078125 11.03125 \n", | |
"Q 45.3125 15.671875 45.3125 23.6875 \n", | |
"L 45.3125 54.6875 \n", | |
"L 54.296875 54.6875 \n", | |
"L 54.296875 0 \n", | |
"L 45.3125 0 \n", | |
"L 45.3125 8.40625 \n", | |
"Q 42.046875 3.421875 37.71875 1 \n", | |
"Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
"Q 18.265625 -1.421875 13.375 4.4375 \n", | |
"Q 8.5 10.296875 8.5 21.578125 \n", | |
"z\n", | |
"M 31.109375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-108 d="M 9.421875 75.984375 \n", | |
"L 18.40625 75.984375 \n", | |
"L 18.40625 0 \n", | |
"L 9.421875 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-68 d="M 19.671875 64.796875 \n", | |
"L 19.671875 8.109375 \n", | |
"L 31.59375 8.109375 \n", | |
"Q 46.6875 8.109375 53.6875 14.9375 \n", | |
"Q 60.6875 21.78125 60.6875 36.53125 \n", | |
"Q 60.6875 51.171875 53.6875 57.984375 \n", | |
"Q 46.6875 64.796875 31.59375 64.796875 \n", | |
"z\n", | |
"M 9.8125 72.90625 \n", | |
"L 30.078125 72.90625 \n", | |
"Q 51.265625 72.90625 61.171875 64.09375 \n", | |
"Q 71.09375 55.28125 71.09375 36.53125 \n", | |
"Q 71.09375 17.671875 61.125 8.828125 \n", | |
"Q 51.171875 0 30.078125 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-83 d="M 53.515625 70.515625 \n", | |
"L 53.515625 60.890625 \n", | |
"Q 47.90625 63.578125 42.921875 64.890625 \n", | |
"Q 37.9375 66.21875 33.296875 66.21875 \n", | |
"Q 25.25 66.21875 20.875 63.09375 \n", | |
"Q 16.5 59.96875 16.5 54.203125 \n", | |
"Q 16.5 49.359375 19.40625 46.890625 \n", | |
"Q 22.3125 44.4375 30.421875 42.921875 \n", | |
"L 36.375 41.703125 \n", | |
"Q 47.40625 39.59375 52.65625 34.296875 \n", | |
"Q 57.90625 29 57.90625 20.125 \n", | |
"Q 57.90625 9.515625 50.796875 4.046875 \n", | |
"Q 43.703125 -1.421875 29.984375 -1.421875 \n", | |
"Q 24.8125 -1.421875 18.96875 -0.25 \n", | |
"Q 13.140625 0.921875 6.890625 3.21875 \n", | |
"L 6.890625 13.375 \n", | |
"Q 12.890625 10.015625 18.65625 8.296875 \n", | |
"Q 24.421875 6.59375 29.984375 6.59375 \n", | |
"Q 38.421875 6.59375 43.015625 9.90625 \n", | |
"Q 47.609375 13.234375 47.609375 19.390625 \n", | |
"Q 47.609375 24.75 44.3125 27.78125 \n", | |
"Q 41.015625 30.8125 33.5 32.328125 \n", | |
"L 27.484375 33.5 \n", | |
"Q 16.453125 35.6875 11.515625 40.375 \n", | |
"Q 6.59375 45.0625 6.59375 53.421875 \n", | |
"Q 6.59375 63.09375 13.40625 68.65625 \n", | |
"Q 20.21875 74.21875 32.171875 74.21875 \n", | |
"Q 37.3125 74.21875 42.625 73.28125 \n", | |
"Q 47.953125 72.359375 53.515625 70.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-97 d="M 34.28125 27.484375 \n", | |
"Q 23.390625 27.484375 19.1875 25 \n", | |
"Q 14.984375 22.515625 14.984375 16.5 \n", | |
"Q 14.984375 11.71875 18.140625 8.90625 \n", | |
"Q 21.296875 6.109375 26.703125 6.109375 \n", | |
"Q 34.1875 6.109375 38.703125 11.40625 \n", | |
"Q 43.21875 16.703125 43.21875 25.484375 \n", | |
"L 43.21875 27.484375 \n", | |
"z\n", | |
"M 52.203125 31.203125 \n", | |
"L 52.203125 0 \n", | |
"L 43.21875 0 \n", | |
"L 43.21875 8.296875 \n", | |
"Q 40.140625 3.328125 35.546875 0.953125 \n", | |
"Q 30.953125 -1.421875 24.3125 -1.421875 \n", | |
"Q 15.921875 -1.421875 10.953125 3.296875 \n", | |
"Q 6 8.015625 6 15.921875 \n", | |
"Q 6 25.140625 12.171875 29.828125 \n", | |
"Q 18.359375 34.515625 30.609375 34.515625 \n", | |
"L 43.21875 34.515625 \n", | |
"L 43.21875 35.40625 \n", | |
"Q 43.21875 41.609375 39.140625 45 \n", | |
"Q 35.0625 48.390625 27.6875 48.390625 \n", | |
"Q 23 48.390625 18.546875 47.265625 \n", | |
"Q 14.109375 46.140625 10.015625 43.890625 \n", | |
"L 10.015625 52.203125 \n", | |
"Q 14.9375 54.109375 19.578125 55.046875 \n", | |
"Q 24.21875 56 28.609375 56 \n", | |
"Q 40.484375 56 46.34375 49.84375 \n", | |
"Q 52.203125 43.703125 52.203125 31.203125 \n", | |
"z\n", | |
""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
"L 48.78125 44.1875 \n", | |
"Q 44.96875 46.296875 41.140625 47.34375 \n", | |
"Q 37.3125 48.390625 33.40625 48.390625 \n", | |
"Q 24.65625 48.390625 19.8125 42.84375 \n", | |
"Q 14.984375 37.3125 14.984375 27.296875 \n", | |
"Q 14.984375 17.28125 19.8125 11.734375 \n", | |
"Q 24.65625 6.203125 33.40625 6.203125 \n", | |
"Q 37.3125 6.203125 41.140625 7.25 \n", | |
"Q 44.96875 8.296875 48.78125 10.40625 \n", | |
"L 48.78125 2.09375 \n", | |
"Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
"Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
"Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
"Q 5.515625 14.109375 5.515625 27.296875 \n", | |
"Q 5.515625 40.671875 12.859375 48.328125 \n", | |
"Q 20.21875 56 33.015625 56 \n", | |
"Q 37.15625 56 41.109375 55.140625 \n", | |
"Q 45.0625 54.296875 48.78125 52.59375 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 195.3297)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-67 /><use x=69.824219 xlink:href=#DejaVuSans-117 /><use x=133.203125 xlink:href=#DejaVuSans-108 /><use x=160.986328 xlink:href=#DejaVuSans-68 /><use x=237.988281 xlink:href=#DejaVuSans-83 /><use x=301.464844 xlink:href=#DejaVuSans-97 /><use x=362.744141 xlink:href=#DejaVuSans-99 /></g></g><g id=patch_11><path style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 220.6935 \n", | |
"L 57.312 220.6935 \n", | |
"L 57.312 208.5975 \n", | |
"L 22.752 208.5975 \n", | |
"z\n", | |
""/></g><g id=text_4><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
"L 51.703125 72.90625 \n", | |
"L 51.703125 64.59375 \n", | |
"L 19.671875 64.59375 \n", | |
"L 19.671875 43.109375 \n", | |
"L 48.578125 43.109375 \n", | |
"L 48.578125 34.8125 \n", | |
"L 19.671875 34.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-82 d="M 44.390625 34.1875 \n", | |
"Q 47.5625 33.109375 50.5625 29.59375 \n", | |
"Q 53.5625 26.078125 56.59375 19.921875 \n", | |
"L 66.609375 0 \n", | |
"L 56 0 \n", | |
"L 46.6875 18.703125 \n", | |
"Q 43.0625 26.03125 39.671875 28.421875 \n", | |
"Q 36.28125 30.8125 30.421875 30.8125 \n", | |
"L 19.671875 30.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"L 9.8125 72.90625 \n", | |
"L 32.078125 72.90625 \n", | |
"Q 44.578125 72.90625 50.734375 67.671875 \n", | |
"Q 56.890625 62.453125 56.890625 51.90625 \n", | |
"Q 56.890625 45.015625 53.6875 40.46875 \n", | |
"Q 50.484375 35.9375 44.390625 34.1875 \n", | |
"z\n", | |
"M 19.671875 64.796875 \n", | |
"L 19.671875 38.921875 \n", | |
"L 32.078125 38.921875 \n", | |
"Q 39.203125 38.921875 42.84375 42.21875 \n", | |
"Q 46.484375 45.515625 46.484375 51.90625 \n", | |
"Q 46.484375 58.296875 42.84375 61.546875 \n", | |
"Q 39.203125 64.796875 32.078125 64.796875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 220.6935)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-70 /><use x=57.519531 xlink:href=#DejaVuSans-82 /><use x=127.001953 xlink:href=#DejaVuSans-50 /></g></g><g id=patch_12><path style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 246.0573 \n", | |
"L 57.312 246.0573 \n", | |
"L 57.312 233.9613 \n", | |
"L 22.752 233.9613 \n", | |
"z\n", | |
""/></g><g id=text_5><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
"Q 47.65625 37.796875 51.625 33 \n", | |
"Q 55.609375 28.21875 55.609375 21.1875 \n", | |
"Q 55.609375 10.40625 48.1875 4.484375 \n", | |
"Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
"Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
"Q 12.796875 0.390625 7.625 2.203125 \n", | |
"L 7.625 11.71875 \n", | |
"Q 11.71875 9.328125 16.59375 8.109375 \n", | |
"Q 21.484375 6.890625 26.8125 6.890625 \n", | |
"Q 36.078125 6.890625 40.9375 10.546875 \n", | |
"Q 45.796875 14.203125 45.796875 21.1875 \n", | |
"Q 45.796875 27.640625 41.28125 31.265625 \n", | |
"Q 36.765625 34.90625 28.71875 34.90625 \n", | |
"L 20.21875 34.90625 \n", | |
"L 20.21875 43.015625 \n", | |
"L 29.109375 43.015625 \n", | |
"Q 36.375 43.015625 40.234375 45.921875 \n", | |
"Q 44.09375 48.828125 44.09375 54.296875 \n", | |
"Q 44.09375 59.90625 40.109375 62.90625 \n", | |
"Q 36.140625 65.921875 28.71875 65.921875 \n", | |
"Q 24.65625 65.921875 20.015625 65.03125 \n", | |
"Q 15.375 64.15625 9.8125 62.3125 \n", | |
"L 9.8125 71.09375 \n", | |
"Q 15.4375 72.65625 20.34375 73.4375 \n", | |
"Q 25.25 74.21875 29.59375 74.21875 \n", | |
"Q 40.828125 74.21875 47.359375 69.109375 \n", | |
"Q 53.90625 64.015625 53.90625 55.328125 \n", | |
"Q 53.90625 49.265625 50.4375 45.09375 \n", | |
"Q 46.96875 40.921875 40.578125 39.3125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 246.0573)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-70 /><use x=57.519531 xlink:href=#DejaVuSans-82 /><use x=127.001953 xlink:href=#DejaVuSans-51 /></g></g></g></g></g><defs><clippath id=pf1018c0a7b><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_1085542022241038673></a><div class=variable><div class=col-sm-3><p class=h4 title=LandSlope><a href=#pp_var_1085542022241038673>LandSlope</a><br><small>Categorical</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>3</td></tr><tr><th>Distinct (%)</th><td>0.2%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> Gtl </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 1382&nbsp; </div></td></tr><tr class><th width=50%> Mod </th><td width=50%><div class=bar style=width:4.7% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 65 </td></tr><tr class><th width=50%> Sev </th><td width=50%><div class=bar style=width:0.9% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 13 </td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-1085542022241038673, #minifreqtable1085542022241038673" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-1085542022241038673 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#1085542022241038673bottom-1085542022241038673overview aria-controls=1085542022241038673bottom-1085542022241038673overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#1085542022241038673bottom-1085542022241038673string aria-controls=1085542022241038673bottom-1085542022241038673string role=tab data-toggle=tab>Categories</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=1085542022241038673bottom-1085542022241038673overview><div class=row><div class=col-sm-6><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>Gtl</td></tr><tr><th>2nd row</th><td>Gtl</td></tr><tr><th>3rd row</th><td>Gtl</td></tr><tr><th>4th row</th><td>Gtl</td></tr><tr><th>5th row</th><td>Gtl</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=1085542022241038673bottom-1085542022241038673string><div class=row><div class=col-sm-6><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=Gtl>Gtl</td><td>1382</td><td><div class=bar style=width:100.0%> 94.7% </div></td></tr><tr class><td title=Mod>Mod</td><td>65</td><td><div class=bar style=width:4.7%> &nbsp; </div> 4.5% </td></tr><tr class><td title=Sev>Sev</td><td>13</td><td><div class=bar style=width:0.9%> &nbsp; </div> 0.9% </td></tr></tbody></table></div><div class=col-sm-6><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=213.0354pt version=1.1 viewbox="0 0 405 213.0354" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 213.0354 \n", | |
"L 405 213.0354 \n", | |
"L 405 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#pcf9c972160) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
"L 376.932329 106.86 \n", | |
"L 376.932329 16.26 \n", | |
"L 7.2 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_3><path clip-path=url(#pcf9c972160) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 376.932329 106.86 \n", | |
"L 394.322055 106.86 \n", | |
"L 394.322055 16.26 \n", | |
"L 376.932329 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#pcf9c972160) style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 394.322055 106.86 \n", | |
"L 397.8 106.86 \n", | |
"L 397.8 16.26 \n", | |
"L 394.322055 16.26 \n", | |
"z\n", | |
""/></g><g id=legend_1><g id=patch_5><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 205.8354 \n", | |
"L 111.0447 205.8354 \n", | |
"Q 114.5007 205.8354 114.5007 202.3794 \n", | |
"L 114.5007 128.016 \n", | |
"Q 114.5007 124.56 111.0447 124.56 \n", | |
"L 19.296 124.56 \n", | |
"Q 15.84 124.56 15.84 128.016 \n", | |
"L 15.84 202.3794 \n", | |
"Q 15.84 205.8354 19.296 205.8354 \n", | |
"z\n", | |
""/></g><g id=patch_6><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
"L 57.312 144.6021 \n", | |
"L 57.312 132.5061 \n", | |
"L 22.752 132.5061 \n", | |
"z\n", | |
""/></g><g id=text_1><defs><path id=DejaVuSans-71 d="M 59.515625 10.40625 \n", | |
"L 59.515625 29.984375 \n", | |
"L 43.40625 29.984375 \n", | |
"L 43.40625 38.09375 \n", | |
"L 69.28125 38.09375 \n", | |
"L 69.28125 6.78125 \n", | |
"Q 63.578125 2.734375 56.6875 0.65625 \n", | |
"Q 49.8125 -1.421875 42 -1.421875 \n", | |
"Q 24.90625 -1.421875 15.25 8.5625 \n", | |
"Q 5.609375 18.5625 5.609375 36.375 \n", | |
"Q 5.609375 54.25 15.25 64.234375 \n", | |
"Q 24.90625 74.21875 42 74.21875 \n", | |
"Q 49.125 74.21875 55.546875 72.453125 \n", | |
"Q 61.96875 70.703125 67.390625 67.28125 \n", | |
"L 67.390625 56.78125 \n", | |
"Q 61.921875 61.421875 55.765625 63.765625 \n", | |
"Q 49.609375 66.109375 42.828125 66.109375 \n", | |
"Q 29.4375 66.109375 22.71875 58.640625 \n", | |
"Q 16.015625 51.171875 16.015625 36.375 \n", | |
"Q 16.015625 21.625 22.71875 14.15625 \n", | |
"Q 29.4375 6.6875 42.828125 6.6875 \n", | |
"Q 48.046875 6.6875 52.140625 7.59375 \n", | |
"Q 56.25 8.5 59.515625 10.40625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-116 d="M 18.3125 70.21875 \n", | |
"L 18.3125 54.6875 \n", | |
"L 36.8125 54.6875 \n", | |
"L 36.8125 47.703125 \n", | |
"L 18.3125 47.703125 \n", | |
"L 18.3125 18.015625 \n", | |
"Q 18.3125 11.328125 20.140625 9.421875 \n", | |
"Q 21.96875 7.515625 27.59375 7.515625 \n", | |
"L 36.8125 7.515625 \n", | |
"L 36.8125 0 \n", | |
"L 27.59375 0 \n", | |
"Q 17.1875 0 13.234375 3.875 \n", | |
"Q 9.28125 7.765625 9.28125 18.015625 \n", | |
"L 9.28125 47.703125 \n", | |
"L 2.6875 47.703125 \n", | |
"L 2.6875 54.6875 \n", | |
"L 9.28125 54.6875 \n", | |
"L 9.28125 70.21875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-108 d="M 9.421875 75.984375 \n", | |
"L 18.40625 75.984375 \n", | |
"L 18.40625 0 \n", | |
"L 9.421875 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-71 /><use x=77.490234 xlink:href=#DejaVuSans-116 /><use x=116.699219 xlink:href=#DejaVuSans-108 /></g></g><g id=patch_7><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
"L 57.312 169.9659 \n", | |
"L 57.312 157.8699 \n", | |
"L 22.752 157.8699 \n", | |
"z\n", | |
""/></g><g id=text_2><defs><path id=DejaVuSans-77 d="M 9.8125 72.90625 \n", | |
"L 24.515625 72.90625 \n", | |
"L 43.109375 23.296875 \n", | |
"L 61.8125 72.90625 \n", | |
"L 76.515625 72.90625 \n", | |
"L 76.515625 0 \n", | |
"L 66.890625 0 \n", | |
"L 66.890625 64.015625 \n", | |
"L 48.09375 14.015625 \n", | |
"L 38.1875 14.015625 \n", | |
"L 19.390625 64.015625 \n", | |
"L 19.390625 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-111 d="M 30.609375 48.390625 \n", | |
"Q 23.390625 48.390625 19.1875 42.75 \n", | |
"Q 14.984375 37.109375 14.984375 27.296875 \n", | |
"Q 14.984375 17.484375 19.15625 11.84375 \n", | |
"Q 23.34375 6.203125 30.609375 6.203125 \n", | |
"Q 37.796875 6.203125 41.984375 11.859375 \n", | |
"Q 46.1875 17.53125 46.1875 27.296875 \n", | |
"Q 46.1875 37.015625 41.984375 42.703125 \n", | |
"Q 37.796875 48.390625 30.609375 48.390625 \n", | |
"z\n", | |
"M 30.609375 56 \n", | |
"Q 42.328125 56 49.015625 48.375 \n", | |
"Q 55.71875 40.765625 55.71875 27.296875 \n", | |
"Q 55.71875 13.875 49.015625 6.21875 \n", | |
"Q 42.328125 -1.421875 30.609375 -1.421875 \n", | |
"Q 18.84375 -1.421875 12.171875 6.21875 \n", | |
"Q 5.515625 13.875 5.515625 27.296875 \n", | |
"Q 5.515625 40.765625 12.171875 48.375 \n", | |
"Q 18.84375 56 30.609375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-100 d="M 45.40625 46.390625 \n", | |
"L 45.40625 75.984375 \n", | |
"L 54.390625 75.984375 \n", | |
"L 54.390625 0 \n", | |
"L 45.40625 0 \n", | |
"L 45.40625 8.203125 \n", | |
"Q 42.578125 3.328125 38.25 0.953125 \n", | |
"Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
"Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
"Q 5.515625 14.40625 5.515625 27.296875 \n", | |
"Q 5.515625 40.1875 11.734375 48.09375 \n", | |
"Q 17.96875 56 27.875 56 \n", | |
"Q 33.9375 56 38.25 53.625 \n", | |
"Q 42.578125 51.265625 45.40625 46.390625 \n", | |
"z\n", | |
"M 14.796875 27.296875 \n", | |
"Q 14.796875 17.390625 18.875 11.75 \n", | |
"Q 22.953125 6.109375 30.078125 6.109375 \n", | |
"Q 37.203125 6.109375 41.296875 11.75 \n", | |
"Q 45.40625 17.390625 45.40625 27.296875 \n", | |
"Q 45.40625 37.203125 41.296875 42.84375 \n", | |
"Q 37.203125 48.484375 30.078125 48.484375 \n", | |
"Q 22.953125 48.484375 18.875 42.84375 \n", | |
"Q 14.796875 37.203125 14.796875 27.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-77 /><use x=86.279297 xlink:href=#DejaVuSans-111 /><use x=147.460938 xlink:href=#DejaVuSans-100 /></g></g><g id=patch_8><path style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 195.3297 \n", | |
"L 57.312 195.3297 \n", | |
"L 57.312 183.2337 \n", | |
"L 22.752 183.2337 \n", | |
"z\n", | |
""/></g><g id=text_3><defs><path id=DejaVuSans-83 d="M 53.515625 70.515625 \n", | |
"L 53.515625 60.890625 \n", | |
"Q 47.90625 63.578125 42.921875 64.890625 \n", | |
"Q 37.9375 66.21875 33.296875 66.21875 \n", | |
"Q 25.25 66.21875 20.875 63.09375 \n", | |
"Q 16.5 59.96875 16.5 54.203125 \n", | |
"Q 16.5 49.359375 19.40625 46.890625 \n", | |
"Q 22.3125 44.4375 30.421875 42.921875 \n", | |
"L 36.375 41.703125 \n", | |
"Q 47.40625 39.59375 52.65625 34.296875 \n", | |
"Q 57.90625 29 57.90625 20.125 \n", | |
"Q 57.90625 9.515625 50.796875 4.046875 \n", | |
"Q 43.703125 -1.421875 29.984375 -1.421875 \n", | |
"Q 24.8125 -1.421875 18.96875 -0.25 \n", | |
"Q 13.140625 0.921875 6.890625 3.21875 \n", | |
"L 6.890625 13.375 \n", | |
"Q 12.890625 10.015625 18.65625 8.296875 \n", | |
"Q 24.421875 6.59375 29.984375 6.59375 \n", | |
"Q 38.421875 6.59375 43.015625 9.90625 \n", | |
"Q 47.609375 13.234375 47.609375 19.390625 \n", | |
"Q 47.609375 24.75 44.3125 27.78125 \n", | |
"Q 41.015625 30.8125 33.5 32.328125 \n", | |
"L 27.484375 33.5 \n", | |
"Q 16.453125 35.6875 11.515625 40.375 \n", | |
"Q 6.59375 45.0625 6.59375 53.421875 \n", | |
"Q 6.59375 63.09375 13.40625 68.65625 \n", | |
"Q 20.21875 74.21875 32.171875 74.21875 \n", | |
"Q 37.3125 74.21875 42.625 73.28125 \n", | |
"Q 47.953125 72.359375 53.515625 70.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-118 d="M 2.984375 54.6875 \n", | |
"L 12.5 54.6875 \n", | |
"L 29.59375 8.796875 \n", | |
"L 46.6875 54.6875 \n", | |
"L 56.203125 54.6875 \n", | |
"L 35.6875 0 \n", | |
"L 23.484375 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 195.3297)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-83 /><use x=63.476562 xlink:href=#DejaVuSans-101 /><use x=125 xlink:href=#DejaVuSans-118 /></g></g></g></g></g><defs><clippath id=pcf9c972160><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_8517157861837513229></a><div class=variable><div class=col-sm-3><p class=h4 title=Neighborhood><a href=#pp_var_8517157861837513229>Neighborhood</a><br><small>Categorical</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>25</td></tr><tr><th>Distinct (%)</th><td>1.7%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> NAmes </th><td width=50%><div class=bar style=width:28.6% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 225&nbsp; </div></td></tr><tr class><th width=50%> CollgCr </th><td width=50%><div class=bar style=width:19.1% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 150&nbsp; </div></td></tr><tr class><th width=50%> OldTown </th><td width=50%><div class=bar style=width:14.4% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 113&nbsp; </div></td></tr><tr class><th width=50%> Edwards </th><td width=50%><div class=bar style=width:12.7% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 100&nbsp; </div></td></tr><tr class><th width=50%> Somerst </th><td width=50%><div class=bar style=width:10.9% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 86&nbsp; </div></td></tr><tr class=other><th width=50%> Other values (20) </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 786&nbsp; </div></td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-8517157861837513229, #minifreqtable8517157861837513229" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-8517157861837513229 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#8517157861837513229bottom-8517157861837513229overview aria-controls=8517157861837513229bottom-8517157861837513229overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#8517157861837513229bottom-8517157861837513229string aria-controls=8517157861837513229bottom-8517157861837513229string role=tab data-toggle=tab>Categories</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=8517157861837513229bottom-8517157861837513229overview><div class=row><div class=col-sm-6><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>CollgCr</td></tr><tr><th>2nd row</th><td>Veenker</td></tr><tr><th>3rd row</th><td>CollgCr</td></tr><tr><th>4th row</th><td>Crawfor</td></tr><tr><th>5th row</th><td>NoRidge</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=8517157861837513229bottom-8517157861837513229string><div class=row><div class=col-sm-12><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=NAmes>NAmes</td><td>225</td><td><div class=bar style=width:53.1%> 15.4% </div></td></tr><tr class><td title=CollgCr>CollgCr</td><td>150</td><td><div class=bar style=width:35.4%> &nbsp; </div> 10.3% </td></tr><tr class><td title=OldTown>OldTown</td><td>113</td><td><div class=bar style=width:26.7%> &nbsp; </div> 7.7% </td></tr><tr class><td title=Edwards>Edwards</td><td>100</td><td><div class=bar style=width:23.6%> &nbsp; </div> 6.8% </td></tr><tr class><td title=Somerst>Somerst</td><td>86</td><td><div class=bar style=width:20.3%> &nbsp; </div> 5.9% </td></tr><tr class><td title=Gilbert>Gilbert</td><td>79</td><td><div class=bar style=width:18.6%> &nbsp; </div> 5.4% </td></tr><tr class><td title=NridgHt>NridgHt</td><td>77</td><td><div class=bar style=width:18.2%> &nbsp; </div> 5.3% </td></tr><tr class><td title=Sawyer>Sawyer</td><td>74</td><td><div class=bar style=width:17.5%> &nbsp; </div> 5.1% </td></tr><tr class><td title=NWAmes>NWAmes</td><td>73</td><td><div class=bar style=width:17.2%> &nbsp; </div> 5.0% </td></tr><tr class><td title=SawyerW>SawyerW</td><td>59</td><td><div class=bar style=width:13.9%> &nbsp; </div> 4.0% </td></tr><tr class=other><td title="Other values (15)">Other values (15)</td><td>424</td><td><div class=bar style=width:100.0%> 29.0% </div></td></tr></tbody></table></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_-6609116637900692996></a><div class=variable><div class=col-sm-3><p class=h4 title=Condition1><a href=#pp_var_-6609116637900692996>Condition1</a><br><small>Categorical</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>9</td></tr><tr><th>Distinct (%)</th><td>0.6%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> Norm </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 1260&nbsp; </div></td></tr><tr class><th width=50%> Feedr </th><td width=50%><div class=bar style=width:6.4% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 81 </td></tr><tr class><th width=50%> Artery </th><td width=50%><div class=bar style=width:3.8% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 48 </td></tr><tr class><th width=50%> RRAn </th><td width=50%><div class=bar style=width:2.1% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 26 </td></tr><tr class><th width=50%> PosN </th><td width=50%><div class=bar style=width:1.5% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 19 </td></tr><tr class=other><th width=50%> Other values (4) </th><td width=50%><div class=bar style=width:2.1% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 26 </td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom--6609116637900692996, #minifreqtable-6609116637900692996" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom--6609116637900692996 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#-6609116637900692996bottom--6609116637900692996overview aria-controls=-6609116637900692996bottom--6609116637900692996overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#-6609116637900692996bottom--6609116637900692996string aria-controls=-6609116637900692996bottom--6609116637900692996string role=tab data-toggle=tab>Categories</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=-6609116637900692996bottom--6609116637900692996overview><div class=row><div class=col-sm-6><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>Norm</td></tr><tr><th>2nd row</th><td>Feedr</td></tr><tr><th>3rd row</th><td>Norm</td></tr><tr><th>4th row</th><td>Norm</td></tr><tr><th>5th row</th><td>Norm</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=-6609116637900692996bottom--6609116637900692996string><div class=row><div class=col-sm-6><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=Norm>Norm</td><td>1260</td><td><div class=bar style=width:100.0%> 86.3% </div></td></tr><tr class><td title=Feedr>Feedr</td><td>81</td><td><div class=bar style=width:6.4%> &nbsp; </div> 5.5% </td></tr><tr class><td title=Artery>Artery</td><td>48</td><td><div class=bar style=width:3.8%> &nbsp; </div> 3.3% </td></tr><tr class><td title=RRAn>RRAn</td><td>26</td><td><div class=bar style=width:2.1%> &nbsp; </div> 1.8% </td></tr><tr class><td title=PosN>PosN</td><td>19</td><td><div class=bar style=width:1.5%> &nbsp; </div> 1.3% </td></tr><tr class><td title=RRAe>RRAe</td><td>11</td><td><div class=bar style=width:0.9%> &nbsp; </div> 0.8% </td></tr><tr class><td title=PosA>PosA</td><td>8</td><td><div class=bar style=width:0.6%> &nbsp; </div> 0.5% </td></tr><tr class><td title=RRNn>RRNn</td><td>5</td><td><div class=bar style=width:0.4%> &nbsp; </div> 0.3% </td></tr><tr class><td title=RRNe>RRNe</td><td>2</td><td><div class=bar style=width:0.2%> &nbsp; </div> 0.1% </td></tr></tbody></table></div><div class=col-sm-6><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=365.2182pt version=1.1 viewbox="0 0 405 365.2182" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 365.2182 \n", | |
"L 405 365.2182 \n", | |
"L 405 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#p3a80cab257) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
"L 344.293151 106.86 \n", | |
"L 344.293151 16.26 \n", | |
"L 7.2 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_3><path clip-path=url(#p3a80cab257) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 344.293151 106.86 \n", | |
"L 365.963425 106.86 \n", | |
"L 365.963425 16.26 \n", | |
"L 344.293151 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#p3a80cab257) style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 365.963425 106.86 \n", | |
"L 378.805068 106.86 \n", | |
"L 378.805068 16.26 \n", | |
"L 365.963425 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#p3a80cab257) style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 378.805068 106.86 \n", | |
"L 385.760959 106.86 \n", | |
"L 385.760959 16.26 \n", | |
"L 378.805068 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#p3a80cab257) style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 385.760959 106.86 \n", | |
"L 390.84411 106.86 \n", | |
"L 390.84411 16.26 \n", | |
"L 385.760959 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#p3a80cab257) style=fill:#937860;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 390.84411 106.86 \n", | |
"L 393.786986 106.86 \n", | |
"L 393.786986 16.26 \n", | |
"L 390.84411 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#p3a80cab257) style=fill:#da8bc3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 393.786986 106.86 \n", | |
"L 395.92726 106.86 \n", | |
"L 395.92726 16.26 \n", | |
"L 393.786986 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#p3a80cab257) style=fill:#8c8c8c;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 395.92726 106.86 \n", | |
"L 397.264932 106.86 \n", | |
"L 397.264932 16.26 \n", | |
"L 395.92726 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_10><path clip-path=url(#p3a80cab257) style=fill:#ccb974;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 397.264932 106.86 \n", | |
"L 397.8 106.86 \n", | |
"L 397.8 16.26 \n", | |
"L 397.264932 16.26 \n", | |
"z\n", | |
""/></g><g id=legend_1><g id=patch_11><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 358.0182 \n", | |
"L 128.2545 358.0182 \n", | |
"Q 131.7105 358.0182 131.7105 354.5622 \n", | |
"L 131.7105 128.016 \n", | |
"Q 131.7105 124.56 128.2545 124.56 \n", | |
"L 19.296 124.56 \n", | |
"Q 15.84 124.56 15.84 128.016 \n", | |
"L 15.84 354.5622 \n", | |
"Q 15.84 358.0182 19.296 358.0182 \n", | |
"z\n", | |
""/></g><g id=patch_12><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
"L 57.312 144.6021 \n", | |
"L 57.312 132.5061 \n", | |
"L 22.752 132.5061 \n", | |
"z\n", | |
""/></g><g id=text_1><defs><path id=DejaVuSans-78 d="M 9.8125 72.90625 \n", | |
"L 23.09375 72.90625 \n", | |
"L 55.421875 11.921875 \n", | |
"L 55.421875 72.90625 \n", | |
"L 64.984375 72.90625 \n", | |
"L 64.984375 0 \n", | |
"L 51.703125 0 \n", | |
"L 19.390625 60.984375 \n", | |
"L 19.390625 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-111 d="M 30.609375 48.390625 \n", | |
"Q 23.390625 48.390625 19.1875 42.75 \n", | |
"Q 14.984375 37.109375 14.984375 27.296875 \n", | |
"Q 14.984375 17.484375 19.15625 11.84375 \n", | |
"Q 23.34375 6.203125 30.609375 6.203125 \n", | |
"Q 37.796875 6.203125 41.984375 11.859375 \n", | |
"Q 46.1875 17.53125 46.1875 27.296875 \n", | |
"Q 46.1875 37.015625 41.984375 42.703125 \n", | |
"Q 37.796875 48.390625 30.609375 48.390625 \n", | |
"z\n", | |
"M 30.609375 56 \n", | |
"Q 42.328125 56 49.015625 48.375 \n", | |
"Q 55.71875 40.765625 55.71875 27.296875 \n", | |
"Q 55.71875 13.875 49.015625 6.21875 \n", | |
"Q 42.328125 -1.421875 30.609375 -1.421875 \n", | |
"Q 18.84375 -1.421875 12.171875 6.21875 \n", | |
"Q 5.515625 13.875 5.515625 27.296875 \n", | |
"Q 5.515625 40.765625 12.171875 48.375 \n", | |
"Q 18.84375 56 30.609375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
"Q 39.59375 47.171875 37.8125 47.578125 \n", | |
"Q 36.03125 48 33.890625 48 \n", | |
"Q 26.265625 48 22.1875 43.046875 \n", | |
"Q 18.109375 38.09375 18.109375 28.8125 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 20.953125 51.171875 25.484375 53.578125 \n", | |
"Q 30.03125 56 36.53125 56 \n", | |
"Q 37.453125 56 38.578125 55.875 \n", | |
"Q 39.703125 55.765625 41.0625 55.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-109 d="M 52 44.1875 \n", | |
"Q 55.375 50.25 60.0625 53.125 \n", | |
"Q 64.75 56 71.09375 56 \n", | |
"Q 79.640625 56 84.28125 50.015625 \n", | |
"Q 88.921875 44.046875 88.921875 33.015625 \n", | |
"L 88.921875 0 \n", | |
"L 79.890625 0 \n", | |
"L 79.890625 32.71875 \n", | |
"Q 79.890625 40.578125 77.09375 44.375 \n", | |
"Q 74.3125 48.1875 68.609375 48.1875 \n", | |
"Q 61.625 48.1875 57.5625 43.546875 \n", | |
"Q 53.515625 38.921875 53.515625 30.90625 \n", | |
"L 53.515625 0 \n", | |
"L 44.484375 0 \n", | |
"L 44.484375 32.71875 \n", | |
"Q 44.484375 40.625 41.703125 44.40625 \n", | |
"Q 38.921875 48.1875 33.109375 48.1875 \n", | |
"Q 26.21875 48.1875 22.15625 43.53125 \n", | |
"Q 18.109375 38.875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.1875 51.21875 25.484375 53.609375 \n", | |
"Q 29.78125 56 35.6875 56 \n", | |
"Q 41.65625 56 45.828125 52.96875 \n", | |
"Q 50 49.953125 52 44.1875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-78 /><use x=74.804688 xlink:href=#DejaVuSans-111 /><use x=135.986328 xlink:href=#DejaVuSans-114 /><use x=175.349609 xlink:href=#DejaVuSans-109 /></g></g><g id=patch_13><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
"L 57.312 169.9659 \n", | |
"L 57.312 157.8699 \n", | |
"L 22.752 157.8699 \n", | |
"z\n", | |
""/></g><g id=text_2><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
"L 51.703125 72.90625 \n", | |
"L 51.703125 64.59375 \n", | |
"L 19.671875 64.59375 \n", | |
"L 19.671875 43.109375 \n", | |
"L 48.578125 43.109375 \n", | |
"L 48.578125 34.8125 \n", | |
"L 19.671875 34.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-100 d="M 45.40625 46.390625 \n", | |
"L 45.40625 75.984375 \n", | |
"L 54.390625 75.984375 \n", | |
"L 54.390625 0 \n", | |
"L 45.40625 0 \n", | |
"L 45.40625 8.203125 \n", | |
"Q 42.578125 3.328125 38.25 0.953125 \n", | |
"Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
"Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
"Q 5.515625 14.40625 5.515625 27.296875 \n", | |
"Q 5.515625 40.1875 11.734375 48.09375 \n", | |
"Q 17.96875 56 27.875 56 \n", | |
"Q 33.9375 56 38.25 53.625 \n", | |
"Q 42.578125 51.265625 45.40625 46.390625 \n", | |
"z\n", | |
"M 14.796875 27.296875 \n", | |
"Q 14.796875 17.390625 18.875 11.75 \n", | |
"Q 22.953125 6.109375 30.078125 6.109375 \n", | |
"Q 37.203125 6.109375 41.296875 11.75 \n", | |
"Q 45.40625 17.390625 45.40625 27.296875 \n", | |
"Q 45.40625 37.203125 41.296875 42.84375 \n", | |
"Q 37.203125 48.484375 30.078125 48.484375 \n", | |
"Q 22.953125 48.484375 18.875 42.84375 \n", | |
"Q 14.796875 37.203125 14.796875 27.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-70 /><use x=52.019531 xlink:href=#DejaVuSans-101 /><use x=113.542969 xlink:href=#DejaVuSans-101 /><use x=175.066406 xlink:href=#DejaVuSans-100 /><use x=238.542969 xlink:href=#DejaVuSans-114 /></g></g><g id=patch_14><path style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 195.3297 \n", | |
"L 57.312 195.3297 \n", | |
"L 57.312 183.2337 \n", | |
"L 22.752 183.2337 \n", | |
"z\n", | |
""/></g><g id=text_3><defs><path id=DejaVuSans-65 d="M 34.1875 63.1875 \n", | |
"L 20.796875 26.90625 \n", | |
"L 47.609375 26.90625 \n", | |
"z\n", | |
"M 28.609375 72.90625 \n", | |
"L 39.796875 72.90625 \n", | |
"L 67.578125 0 \n", | |
"L 57.328125 0 \n", | |
"L 50.6875 18.703125 \n", | |
"L 17.828125 18.703125 \n", | |
"L 11.1875 0 \n", | |
"L 0.78125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-116 d="M 18.3125 70.21875 \n", | |
"L 18.3125 54.6875 \n", | |
"L 36.8125 54.6875 \n", | |
"L 36.8125 47.703125 \n", | |
"L 18.3125 47.703125 \n", | |
"L 18.3125 18.015625 \n", | |
"Q 18.3125 11.328125 20.140625 9.421875 \n", | |
"Q 21.96875 7.515625 27.59375 7.515625 \n", | |
"L 36.8125 7.515625 \n", | |
"L 36.8125 0 \n", | |
"L 27.59375 0 \n", | |
"Q 17.1875 0 13.234375 3.875 \n", | |
"Q 9.28125 7.765625 9.28125 18.015625 \n", | |
"L 9.28125 47.703125 \n", | |
"L 2.6875 47.703125 \n", | |
"L 2.6875 54.6875 \n", | |
"L 9.28125 54.6875 \n", | |
"L 9.28125 70.21875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
"Q 28.375 -14.84375 24.75 -17.8125 \n", | |
"Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
"L 7.90625 -20.796875 \n", | |
"L 7.90625 -13.28125 \n", | |
"L 13.1875 -13.28125 \n", | |
"Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
"Q 21 -9.765625 23.484375 -3.21875 \n", | |
"L 25.09375 0.875 \n", | |
"L 2.984375 54.6875 \n", | |
"L 12.5 54.6875 \n", | |
"L 29.59375 11.921875 \n", | |
"L 46.6875 54.6875 \n", | |
"L 56.203125 54.6875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 195.3297)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-65 /><use x=68.408203 xlink:href=#DejaVuSans-114 /><use x=109.521484 xlink:href=#DejaVuSans-116 /><use x=148.730469 xlink:href=#DejaVuSans-101 /><use x=210.253906 xlink:href=#DejaVuSans-114 /><use x=251.367188 xlink:href=#DejaVuSans-121 /></g></g><g id=patch_15><path style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 220.6935 \n", | |
"L 57.312 220.6935 \n", | |
"L 57.312 208.5975 \n", | |
"L 22.752 208.5975 \n", | |
"z\n", | |
""/></g><g id=text_4><defs><path id=DejaVuSans-82 d="M 44.390625 34.1875 \n", | |
"Q 47.5625 33.109375 50.5625 29.59375 \n", | |
"Q 53.5625 26.078125 56.59375 19.921875 \n", | |
"L 66.609375 0 \n", | |
"L 56 0 \n", | |
"L 46.6875 18.703125 \n", | |
"Q 43.0625 26.03125 39.671875 28.421875 \n", | |
"Q 36.28125 30.8125 30.421875 30.8125 \n", | |
"L 19.671875 30.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"L 9.8125 72.90625 \n", | |
"L 32.078125 72.90625 \n", | |
"Q 44.578125 72.90625 50.734375 67.671875 \n", | |
"Q 56.890625 62.453125 56.890625 51.90625 \n", | |
"Q 56.890625 45.015625 53.6875 40.46875 \n", | |
"Q 50.484375 35.9375 44.390625 34.1875 \n", | |
"z\n", | |
"M 19.671875 64.796875 \n", | |
"L 19.671875 38.921875 \n", | |
"L 32.078125 38.921875 \n", | |
"Q 39.203125 38.921875 42.84375 42.21875 \n", | |
"Q 46.484375 45.515625 46.484375 51.90625 \n", | |
"Q 46.484375 58.296875 42.84375 61.546875 \n", | |
"Q 39.203125 64.796875 32.078125 64.796875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
"L 54.890625 0 \n", | |
"L 45.90625 0 \n", | |
"L 45.90625 32.71875 \n", | |
"Q 45.90625 40.484375 42.875 44.328125 \n", | |
"Q 39.84375 48.1875 33.796875 48.1875 \n", | |
"Q 26.515625 48.1875 22.3125 43.546875 \n", | |
"Q 18.109375 38.921875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.34375 51.125 25.703125 53.5625 \n", | |
"Q 30.078125 56 35.796875 56 \n", | |
"Q 45.21875 56 50.046875 50.171875 \n", | |
"Q 54.890625 44.34375 54.890625 33.015625 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 220.6935)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-82 /><use x=69.482422 xlink:href=#DejaVuSans-82 /><use x=134.964844 xlink:href=#DejaVuSans-65 /><use x=203.373047 xlink:href=#DejaVuSans-110 /></g></g><g id=patch_16><path style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 246.0573 \n", | |
"L 57.312 246.0573 \n", | |
"L 57.312 233.9613 \n", | |
"L 22.752 233.9613 \n", | |
"z\n", | |
""/></g><g id=text_5><defs><path id=DejaVuSans-80 d="M 19.671875 64.796875 \n", | |
"L 19.671875 37.40625 \n", | |
"L 32.078125 37.40625 \n", | |
"Q 38.96875 37.40625 42.71875 40.96875 \n", | |
"Q 46.484375 44.53125 46.484375 51.125 \n", | |
"Q 46.484375 57.671875 42.71875 61.234375 \n", | |
"Q 38.96875 64.796875 32.078125 64.796875 \n", | |
"z\n", | |
"M 9.8125 72.90625 \n", | |
"L 32.078125 72.90625 \n", | |
"Q 44.34375 72.90625 50.609375 67.359375 \n", | |
"Q 56.890625 61.8125 56.890625 51.125 \n", | |
"Q 56.890625 40.328125 50.609375 34.8125 \n", | |
"Q 44.34375 29.296875 32.078125 29.296875 \n", | |
"L 19.671875 29.296875 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-115 d="M 44.28125 53.078125 \n", | |
"L 44.28125 44.578125 \n", | |
"Q 40.484375 46.53125 36.375 47.5 \n", | |
"Q 32.28125 48.484375 27.875 48.484375 \n", | |
"Q 21.1875 48.484375 17.84375 46.4375 \n", | |
"Q 14.5 44.390625 14.5 40.28125 \n", | |
"Q 14.5 37.15625 16.890625 35.375 \n", | |
"Q 19.28125 33.59375 26.515625 31.984375 \n", | |
"L 29.59375 31.296875 \n", | |
"Q 39.15625 29.25 43.1875 25.515625 \n", | |
"Q 47.21875 21.78125 47.21875 15.09375 \n", | |
"Q 47.21875 7.46875 41.1875 3.015625 \n", | |
"Q 35.15625 -1.421875 24.609375 -1.421875 \n", | |
"Q 20.21875 -1.421875 15.453125 -0.5625 \n", | |
"Q 10.6875 0.296875 5.421875 2 \n", | |
"L 5.421875 11.28125 \n", | |
"Q 10.40625 8.6875 15.234375 7.390625 \n", | |
"Q 20.0625 6.109375 24.8125 6.109375 \n", | |
"Q 31.15625 6.109375 34.5625 8.28125 \n", | |
"Q 37.984375 10.453125 37.984375 14.40625 \n", | |
"Q 37.984375 18.0625 35.515625 20.015625 \n", | |
"Q 33.0625 21.96875 24.703125 23.78125 \n", | |
"L 21.578125 24.515625 \n", | |
"Q 13.234375 26.265625 9.515625 29.90625 \n", | |
"Q 5.8125 33.546875 5.8125 39.890625 \n", | |
"Q 5.8125 47.609375 11.28125 51.796875 \n", | |
"Q 16.75 56 26.8125 56 \n", | |
"Q 31.78125 56 36.171875 55.265625 \n", | |
"Q 40.578125 54.546875 44.28125 53.078125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 246.0573)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-80 /><use x=56.677734 xlink:href=#DejaVuSans-111 /><use x=117.859375 xlink:href=#DejaVuSans-115 /><use x=169.958984 xlink:href=#DejaVuSans-78 /></g></g><g id=patch_17><path style=fill:#937860;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 271.4211 \n", | |
"L 57.312 271.4211 \n", | |
"L 57.312 259.3251 \n", | |
"L 22.752 259.3251 \n", | |
"z\n", | |
""/></g><g id=text_6><g style=fill:#262626; transform="translate(71.136 271.4211)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-82 /><use x=69.482422 xlink:href=#DejaVuSans-82 /><use x=134.964844 xlink:href=#DejaVuSans-65 /><use x=201.623047 xlink:href=#DejaVuSans-101 /></g></g><g id=patch_18><path style=fill:#da8bc3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 296.7849 \n", | |
"L 57.312 296.7849 \n", | |
"L 57.312 284.6889 \n", | |
"L 22.752 284.6889 \n", | |
"z\n", | |
""/></g><g id=text_7><g style=fill:#262626; transform="translate(71.136 296.7849)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-80 /><use x=56.677734 xlink:href=#DejaVuSans-111 /><use x=117.859375 xlink:href=#DejaVuSans-115 /><use x=169.958984 xlink:href=#DejaVuSans-65 /></g></g><g id=patch_19><path style=fill:#8c8c8c;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 322.1487 \n", | |
"L 57.312 322.1487 \n", | |
"L 57.312 310.0527 \n", | |
"L 22.752 310.0527 \n", | |
"z\n", | |
""/></g><g id=text_8><g style=fill:#262626; transform="translate(71.136 322.1487)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-82 /><use x=69.482422 xlink:href=#DejaVuSans-82 /><use x=138.964844 xlink:href=#DejaVuSans-78 /><use x=213.769531 xlink:href=#DejaVuSans-110 /></g></g><g id=patch_20><path style=fill:#ccb974;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 347.5125 \n", | |
"L 57.312 347.5125 \n", | |
"L 57.312 335.4165 \n", | |
"L 22.752 335.4165 \n", | |
"z\n", | |
""/></g><g id=text_9><g style=fill:#262626; transform="translate(71.136 347.5125)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-82 /><use x=69.482422 xlink:href=#DejaVuSans-82 /><use x=138.964844 xlink:href=#DejaVuSans-78 /><use x=213.769531 xlink:href=#DejaVuSans-101 /></g></g></g></g></g><defs><clippath id=p3a80cab257><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_1197965650409948020></a><div class=variable><div class=col-sm-3><p class=h4 title=Condition2><a href=#pp_var_1197965650409948020>Condition2</a><br><small>Categorical</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>8</td></tr><tr><th>Distinct (%)</th><td>0.5%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> Norm </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 1445&nbsp; </div></td></tr><tr class><th width=50%> Feedr </th><td width=50%><div class=bar style=width:0.4% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 6 </td></tr><tr class><th width=50%> Artery </th><td width=50%><div class=bar style=width:0.1% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 2 </td></tr><tr class><th width=50%> RRNn </th><td width=50%><div class=bar style=width:0.1% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 2 </td></tr><tr class><th width=50%> PosN </th><td width=50%><div class=bar style=width:0.1% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 2 </td></tr><tr class=other><th width=50%> Other values (3) </th><td width=50%><div class=bar style=width:0.2% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 3 </td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-1197965650409948020, #minifreqtable1197965650409948020" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-1197965650409948020 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#1197965650409948020bottom-1197965650409948020overview aria-controls=1197965650409948020bottom-1197965650409948020overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#1197965650409948020bottom-1197965650409948020string aria-controls=1197965650409948020bottom-1197965650409948020string role=tab data-toggle=tab>Categories</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=1197965650409948020bottom-1197965650409948020overview><div class=row><div class=col-sm-6><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>3 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.2%</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>Norm</td></tr><tr><th>2nd row</th><td>Norm</td></tr><tr><th>3rd row</th><td>Norm</td></tr><tr><th>4th row</th><td>Norm</td></tr><tr><th>5th row</th><td>Norm</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=1197965650409948020bottom-1197965650409948020string><div class=row><div class=col-sm-6><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=Norm>Norm</td><td>1445</td><td><div class=bar style=width:100.0%> 99.0% </div></td></tr><tr class><td title=Feedr>Feedr</td><td>6</td><td><div class=bar style=width:0.4%> &nbsp; </div> 0.4% </td></tr><tr class><td title=Artery>Artery</td><td>2</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=RRNn>RRNn</td><td>2</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=PosN>PosN</td><td>2</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=PosA>PosA</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=RRAn>RRAn</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=RRAe>RRAe</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr></tbody></table></div><div class=col-sm-6><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=339.8544pt version=1.1 viewbox="0 0 405 339.8544" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 339.8544 \n", | |
"L 405 339.8544 \n", | |
"L 405 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#p0cbafc40dd) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
"L 393.786986 106.86 \n", | |
"L 393.786986 16.26 \n", | |
"L 7.2 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_3><path clip-path=url(#p0cbafc40dd) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 393.786986 106.86 \n", | |
"L 395.392192 106.86 \n", | |
"L 395.392192 16.26 \n", | |
"L 393.786986 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#p0cbafc40dd) style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 395.392192 106.86 \n", | |
"L 395.92726 106.86 \n", | |
"L 395.92726 16.26 \n", | |
"L 395.392192 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#p0cbafc40dd) style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 395.92726 106.86 \n", | |
"L 396.462329 106.86 \n", | |
"L 396.462329 16.26 \n", | |
"L 395.92726 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#p0cbafc40dd) style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 396.462329 106.86 \n", | |
"L 396.997397 106.86 \n", | |
"L 396.997397 16.26 \n", | |
"L 396.462329 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#p0cbafc40dd) style=fill:#937860;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 396.997397 106.86 \n", | |
"L 397.264932 106.86 \n", | |
"L 397.264932 16.26 \n", | |
"L 396.997397 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#p0cbafc40dd) style=fill:#da8bc3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 397.264932 106.86 \n", | |
"L 397.532466 106.86 \n", | |
"L 397.532466 16.26 \n", | |
"L 397.264932 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#p0cbafc40dd) style=fill:#8c8c8c;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 397.532466 106.86 \n", | |
"L 397.8 106.86 \n", | |
"L 397.8 16.26 \n", | |
"L 397.532466 16.26 \n", | |
"z\n", | |
""/></g><g id=legend_1><g id=patch_10><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 332.6544 \n", | |
"L 128.2545 332.6544 \n", | |
"Q 131.7105 332.6544 131.7105 329.1984 \n", | |
"L 131.7105 128.016 \n", | |
"Q 131.7105 124.56 128.2545 124.56 \n", | |
"L 19.296 124.56 \n", | |
"Q 15.84 124.56 15.84 128.016 \n", | |
"L 15.84 329.1984 \n", | |
"Q 15.84 332.6544 19.296 332.6544 \n", | |
"z\n", | |
""/></g><g id=patch_11><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
"L 57.312 144.6021 \n", | |
"L 57.312 132.5061 \n", | |
"L 22.752 132.5061 \n", | |
"z\n", | |
""/></g><g id=text_1><defs><path id=DejaVuSans-78 d="M 9.8125 72.90625 \n", | |
"L 23.09375 72.90625 \n", | |
"L 55.421875 11.921875 \n", | |
"L 55.421875 72.90625 \n", | |
"L 64.984375 72.90625 \n", | |
"L 64.984375 0 \n", | |
"L 51.703125 0 \n", | |
"L 19.390625 60.984375 \n", | |
"L 19.390625 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-111 d="M 30.609375 48.390625 \n", | |
"Q 23.390625 48.390625 19.1875 42.75 \n", | |
"Q 14.984375 37.109375 14.984375 27.296875 \n", | |
"Q 14.984375 17.484375 19.15625 11.84375 \n", | |
"Q 23.34375 6.203125 30.609375 6.203125 \n", | |
"Q 37.796875 6.203125 41.984375 11.859375 \n", | |
"Q 46.1875 17.53125 46.1875 27.296875 \n", | |
"Q 46.1875 37.015625 41.984375 42.703125 \n", | |
"Q 37.796875 48.390625 30.609375 48.390625 \n", | |
"z\n", | |
"M 30.609375 56 \n", | |
"Q 42.328125 56 49.015625 48.375 \n", | |
"Q 55.71875 40.765625 55.71875 27.296875 \n", | |
"Q 55.71875 13.875 49.015625 6.21875 \n", | |
"Q 42.328125 -1.421875 30.609375 -1.421875 \n", | |
"Q 18.84375 -1.421875 12.171875 6.21875 \n", | |
"Q 5.515625 13.875 5.515625 27.296875 \n", | |
"Q 5.515625 40.765625 12.171875 48.375 \n", | |
"Q 18.84375 56 30.609375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
"Q 39.59375 47.171875 37.8125 47.578125 \n", | |
"Q 36.03125 48 33.890625 48 \n", | |
"Q 26.265625 48 22.1875 43.046875 \n", | |
"Q 18.109375 38.09375 18.109375 28.8125 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 20.953125 51.171875 25.484375 53.578125 \n", | |
"Q 30.03125 56 36.53125 56 \n", | |
"Q 37.453125 56 38.578125 55.875 \n", | |
"Q 39.703125 55.765625 41.0625 55.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-109 d="M 52 44.1875 \n", | |
"Q 55.375 50.25 60.0625 53.125 \n", | |
"Q 64.75 56 71.09375 56 \n", | |
"Q 79.640625 56 84.28125 50.015625 \n", | |
"Q 88.921875 44.046875 88.921875 33.015625 \n", | |
"L 88.921875 0 \n", | |
"L 79.890625 0 \n", | |
"L 79.890625 32.71875 \n", | |
"Q 79.890625 40.578125 77.09375 44.375 \n", | |
"Q 74.3125 48.1875 68.609375 48.1875 \n", | |
"Q 61.625 48.1875 57.5625 43.546875 \n", | |
"Q 53.515625 38.921875 53.515625 30.90625 \n", | |
"L 53.515625 0 \n", | |
"L 44.484375 0 \n", | |
"L 44.484375 32.71875 \n", | |
"Q 44.484375 40.625 41.703125 44.40625 \n", | |
"Q 38.921875 48.1875 33.109375 48.1875 \n", | |
"Q 26.21875 48.1875 22.15625 43.53125 \n", | |
"Q 18.109375 38.875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.1875 51.21875 25.484375 53.609375 \n", | |
"Q 29.78125 56 35.6875 56 \n", | |
"Q 41.65625 56 45.828125 52.96875 \n", | |
"Q 50 49.953125 52 44.1875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-78 /><use x=74.804688 xlink:href=#DejaVuSans-111 /><use x=135.986328 xlink:href=#DejaVuSans-114 /><use x=175.349609 xlink:href=#DejaVuSans-109 /></g></g><g id=patch_12><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
"L 57.312 169.9659 \n", | |
"L 57.312 157.8699 \n", | |
"L 22.752 157.8699 \n", | |
"z\n", | |
""/></g><g id=text_2><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
"L 51.703125 72.90625 \n", | |
"L 51.703125 64.59375 \n", | |
"L 19.671875 64.59375 \n", | |
"L 19.671875 43.109375 \n", | |
"L 48.578125 43.109375 \n", | |
"L 48.578125 34.8125 \n", | |
"L 19.671875 34.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-100 d="M 45.40625 46.390625 \n", | |
"L 45.40625 75.984375 \n", | |
"L 54.390625 75.984375 \n", | |
"L 54.390625 0 \n", | |
"L 45.40625 0 \n", | |
"L 45.40625 8.203125 \n", | |
"Q 42.578125 3.328125 38.25 0.953125 \n", | |
"Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
"Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
"Q 5.515625 14.40625 5.515625 27.296875 \n", | |
"Q 5.515625 40.1875 11.734375 48.09375 \n", | |
"Q 17.96875 56 27.875 56 \n", | |
"Q 33.9375 56 38.25 53.625 \n", | |
"Q 42.578125 51.265625 45.40625 46.390625 \n", | |
"z\n", | |
"M 14.796875 27.296875 \n", | |
"Q 14.796875 17.390625 18.875 11.75 \n", | |
"Q 22.953125 6.109375 30.078125 6.109375 \n", | |
"Q 37.203125 6.109375 41.296875 11.75 \n", | |
"Q 45.40625 17.390625 45.40625 27.296875 \n", | |
"Q 45.40625 37.203125 41.296875 42.84375 \n", | |
"Q 37.203125 48.484375 30.078125 48.484375 \n", | |
"Q 22.953125 48.484375 18.875 42.84375 \n", | |
"Q 14.796875 37.203125 14.796875 27.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-70 /><use x=52.019531 xlink:href=#DejaVuSans-101 /><use x=113.542969 xlink:href=#DejaVuSans-101 /><use x=175.066406 xlink:href=#DejaVuSans-100 /><use x=238.542969 xlink:href=#DejaVuSans-114 /></g></g><g id=patch_13><path style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 195.3297 \n", | |
"L 57.312 195.3297 \n", | |
"L 57.312 183.2337 \n", | |
"L 22.752 183.2337 \n", | |
"z\n", | |
""/></g><g id=text_3><defs><path id=DejaVuSans-65 d="M 34.1875 63.1875 \n", | |
"L 20.796875 26.90625 \n", | |
"L 47.609375 26.90625 \n", | |
"z\n", | |
"M 28.609375 72.90625 \n", | |
"L 39.796875 72.90625 \n", | |
"L 67.578125 0 \n", | |
"L 57.328125 0 \n", | |
"L 50.6875 18.703125 \n", | |
"L 17.828125 18.703125 \n", | |
"L 11.1875 0 \n", | |
"L 0.78125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-116 d="M 18.3125 70.21875 \n", | |
"L 18.3125 54.6875 \n", | |
"L 36.8125 54.6875 \n", | |
"L 36.8125 47.703125 \n", | |
"L 18.3125 47.703125 \n", | |
"L 18.3125 18.015625 \n", | |
"Q 18.3125 11.328125 20.140625 9.421875 \n", | |
"Q 21.96875 7.515625 27.59375 7.515625 \n", | |
"L 36.8125 7.515625 \n", | |
"L 36.8125 0 \n", | |
"L 27.59375 0 \n", | |
"Q 17.1875 0 13.234375 3.875 \n", | |
"Q 9.28125 7.765625 9.28125 18.015625 \n", | |
"L 9.28125 47.703125 \n", | |
"L 2.6875 47.703125 \n", | |
"L 2.6875 54.6875 \n", | |
"L 9.28125 54.6875 \n", | |
"L 9.28125 70.21875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
"Q 28.375 -14.84375 24.75 -17.8125 \n", | |
"Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
"L 7.90625 -20.796875 \n", | |
"L 7.90625 -13.28125 \n", | |
"L 13.1875 -13.28125 \n", | |
"Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
"Q 21 -9.765625 23.484375 -3.21875 \n", | |
"L 25.09375 0.875 \n", | |
"L 2.984375 54.6875 \n", | |
"L 12.5 54.6875 \n", | |
"L 29.59375 11.921875 \n", | |
"L 46.6875 54.6875 \n", | |
"L 56.203125 54.6875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 195.3297)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-65 /><use x=68.408203 xlink:href=#DejaVuSans-114 /><use x=109.521484 xlink:href=#DejaVuSans-116 /><use x=148.730469 xlink:href=#DejaVuSans-101 /><use x=210.253906 xlink:href=#DejaVuSans-114 /><use x=251.367188 xlink:href=#DejaVuSans-121 /></g></g><g id=patch_14><path style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 220.6935 \n", | |
"L 57.312 220.6935 \n", | |
"L 57.312 208.5975 \n", | |
"L 22.752 208.5975 \n", | |
"z\n", | |
""/></g><g id=text_4><defs><path id=DejaVuSans-82 d="M 44.390625 34.1875 \n", | |
"Q 47.5625 33.109375 50.5625 29.59375 \n", | |
"Q 53.5625 26.078125 56.59375 19.921875 \n", | |
"L 66.609375 0 \n", | |
"L 56 0 \n", | |
"L 46.6875 18.703125 \n", | |
"Q 43.0625 26.03125 39.671875 28.421875 \n", | |
"Q 36.28125 30.8125 30.421875 30.8125 \n", | |
"L 19.671875 30.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"L 9.8125 72.90625 \n", | |
"L 32.078125 72.90625 \n", | |
"Q 44.578125 72.90625 50.734375 67.671875 \n", | |
"Q 56.890625 62.453125 56.890625 51.90625 \n", | |
"Q 56.890625 45.015625 53.6875 40.46875 \n", | |
"Q 50.484375 35.9375 44.390625 34.1875 \n", | |
"z\n", | |
"M 19.671875 64.796875 \n", | |
"L 19.671875 38.921875 \n", | |
"L 32.078125 38.921875 \n", | |
"Q 39.203125 38.921875 42.84375 42.21875 \n", | |
"Q 46.484375 45.515625 46.484375 51.90625 \n", | |
"Q 46.484375 58.296875 42.84375 61.546875 \n", | |
"Q 39.203125 64.796875 32.078125 64.796875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
"L 54.890625 0 \n", | |
"L 45.90625 0 \n", | |
"L 45.90625 32.71875 \n", | |
"Q 45.90625 40.484375 42.875 44.328125 \n", | |
"Q 39.84375 48.1875 33.796875 48.1875 \n", | |
"Q 26.515625 48.1875 22.3125 43.546875 \n", | |
"Q 18.109375 38.921875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.34375 51.125 25.703125 53.5625 \n", | |
"Q 30.078125 56 35.796875 56 \n", | |
"Q 45.21875 56 50.046875 50.171875 \n", | |
"Q 54.890625 44.34375 54.890625 33.015625 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 220.6935)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-82 /><use x=69.482422 xlink:href=#DejaVuSans-82 /><use x=138.964844 xlink:href=#DejaVuSans-78 /><use x=213.769531 xlink:href=#DejaVuSans-110 /></g></g><g id=patch_15><path style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 246.0573 \n", | |
"L 57.312 246.0573 \n", | |
"L 57.312 233.9613 \n", | |
"L 22.752 233.9613 \n", | |
"z\n", | |
""/></g><g id=text_5><defs><path id=DejaVuSans-80 d="M 19.671875 64.796875 \n", | |
"L 19.671875 37.40625 \n", | |
"L 32.078125 37.40625 \n", | |
"Q 38.96875 37.40625 42.71875 40.96875 \n", | |
"Q 46.484375 44.53125 46.484375 51.125 \n", | |
"Q 46.484375 57.671875 42.71875 61.234375 \n", | |
"Q 38.96875 64.796875 32.078125 64.796875 \n", | |
"z\n", | |
"M 9.8125 72.90625 \n", | |
"L 32.078125 72.90625 \n", | |
"Q 44.34375 72.90625 50.609375 67.359375 \n", | |
"Q 56.890625 61.8125 56.890625 51.125 \n", | |
"Q 56.890625 40.328125 50.609375 34.8125 \n", | |
"Q 44.34375 29.296875 32.078125 29.296875 \n", | |
"L 19.671875 29.296875 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-115 d="M 44.28125 53.078125 \n", | |
"L 44.28125 44.578125 \n", | |
"Q 40.484375 46.53125 36.375 47.5 \n", | |
"Q 32.28125 48.484375 27.875 48.484375 \n", | |
"Q 21.1875 48.484375 17.84375 46.4375 \n", | |
"Q 14.5 44.390625 14.5 40.28125 \n", | |
"Q 14.5 37.15625 16.890625 35.375 \n", | |
"Q 19.28125 33.59375 26.515625 31.984375 \n", | |
"L 29.59375 31.296875 \n", | |
"Q 39.15625 29.25 43.1875 25.515625 \n", | |
"Q 47.21875 21.78125 47.21875 15.09375 \n", | |
"Q 47.21875 7.46875 41.1875 3.015625 \n", | |
"Q 35.15625 -1.421875 24.609375 -1.421875 \n", | |
"Q 20.21875 -1.421875 15.453125 -0.5625 \n", | |
"Q 10.6875 0.296875 5.421875 2 \n", | |
"L 5.421875 11.28125 \n", | |
"Q 10.40625 8.6875 15.234375 7.390625 \n", | |
"Q 20.0625 6.109375 24.8125 6.109375 \n", | |
"Q 31.15625 6.109375 34.5625 8.28125 \n", | |
"Q 37.984375 10.453125 37.984375 14.40625 \n", | |
"Q 37.984375 18.0625 35.515625 20.015625 \n", | |
"Q 33.0625 21.96875 24.703125 23.78125 \n", | |
"L 21.578125 24.515625 \n", | |
"Q 13.234375 26.265625 9.515625 29.90625 \n", | |
"Q 5.8125 33.546875 5.8125 39.890625 \n", | |
"Q 5.8125 47.609375 11.28125 51.796875 \n", | |
"Q 16.75 56 26.8125 56 \n", | |
"Q 31.78125 56 36.171875 55.265625 \n", | |
"Q 40.578125 54.546875 44.28125 53.078125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 246.0573)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-80 /><use x=56.677734 xlink:href=#DejaVuSans-111 /><use x=117.859375 xlink:href=#DejaVuSans-115 /><use x=169.958984 xlink:href=#DejaVuSans-78 /></g></g><g id=patch_16><path style=fill:#937860;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 271.4211 \n", | |
"L 57.312 271.4211 \n", | |
"L 57.312 259.3251 \n", | |
"L 22.752 259.3251 \n", | |
"z\n", | |
""/></g><g id=text_6><g style=fill:#262626; transform="translate(71.136 271.4211)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-80 /><use x=56.677734 xlink:href=#DejaVuSans-111 /><use x=117.859375 xlink:href=#DejaVuSans-115 /><use x=169.958984 xlink:href=#DejaVuSans-65 /></g></g><g id=patch_17><path style=fill:#da8bc3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 296.7849 \n", | |
"L 57.312 296.7849 \n", | |
"L 57.312 284.6889 \n", | |
"L 22.752 284.6889 \n", | |
"z\n", | |
""/></g><g id=text_7><g style=fill:#262626; transform="translate(71.136 296.7849)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-82 /><use x=69.482422 xlink:href=#DejaVuSans-82 /><use x=134.964844 xlink:href=#DejaVuSans-65 /><use x=203.373047 xlink:href=#DejaVuSans-110 /></g></g><g id=patch_18><path style=fill:#8c8c8c;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 322.1487 \n", | |
"L 57.312 322.1487 \n", | |
"L 57.312 310.0527 \n", | |
"L 22.752 310.0527 \n", | |
"z\n", | |
""/></g><g id=text_8><g style=fill:#262626; transform="translate(71.136 322.1487)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-82 /><use x=69.482422 xlink:href=#DejaVuSans-82 /><use x=134.964844 xlink:href=#DejaVuSans-65 /><use x=201.623047 xlink:href=#DejaVuSans-101 /></g></g></g></g></g><defs><clippath id=p0cbafc40dd><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_7116373528387020393></a><div class=variable><div class=col-sm-3><p class=h4 title=BldgType><a href=#pp_var_7116373528387020393>BldgType</a><br><small>Categorical</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>5</td></tr><tr><th>Distinct (%)</th><td>0.3%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> 1Fam </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 1220&nbsp; </div></td></tr><tr class><th width=50%> TwnhsE </th><td width=50%><div class=bar style=width:9.3% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 114 </td></tr><tr class><th width=50%> Duplex </th><td width=50%><div class=bar style=width:4.3% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 52 </td></tr><tr class><th width=50%> Twnhs </th><td width=50%><div class=bar style=width:3.5% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 43 </td></tr><tr class><th width=50%> 2fmCon </th><td width=50%><div class=bar style=width:2.5% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 31 </td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-7116373528387020393, #minifreqtable7116373528387020393" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-7116373528387020393 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#7116373528387020393bottom-7116373528387020393overview aria-controls=7116373528387020393bottom-7116373528387020393overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#7116373528387020393bottom-7116373528387020393string aria-controls=7116373528387020393bottom-7116373528387020393string role=tab data-toggle=tab>Categories</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=7116373528387020393bottom-7116373528387020393overview><div class=row><div class=col-sm-6><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>1Fam</td></tr><tr><th>2nd row</th><td>1Fam</td></tr><tr><th>3rd row</th><td>1Fam</td></tr><tr><th>4th row</th><td>1Fam</td></tr><tr><th>5th row</th><td>1Fam</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=7116373528387020393bottom-7116373528387020393string><div class=row><div class=col-sm-6><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=1Fam>1Fam</td><td>1220</td><td><div class=bar style=width:100.0%> 83.6% </div></td></tr><tr class><td title=TwnhsE>TwnhsE</td><td>114</td><td><div class=bar style=width:9.3%> &nbsp; </div> 7.8% </td></tr><tr class><td title=Duplex>Duplex</td><td>52</td><td><div class=bar style=width:4.3%> &nbsp; </div> 3.6% </td></tr><tr class><td title=Twnhs>Twnhs</td><td>43</td><td><div class=bar style=width:3.5%> &nbsp; </div> 2.9% </td></tr><tr class><td title=2fmCon>2fmCon</td><td>31</td><td><div class=bar style=width:2.5%> &nbsp; </div> 2.1% </td></tr></tbody></table></div><div class=col-sm-6><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=263.763pt version=1.1 viewbox="0 0 405 263.763" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 263.763 \n", | |
"L 405 263.763 \n", | |
"L 405 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#pef3f752bfb) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
"L 333.591781 106.86 \n", | |
"L 333.591781 16.26 \n", | |
"L 7.2 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_3><path clip-path=url(#pef3f752bfb) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 333.591781 106.86 \n", | |
"L 364.090685 106.86 \n", | |
"L 364.090685 16.26 \n", | |
"L 333.591781 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#pef3f752bfb) style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 364.090685 106.86 \n", | |
"L 378.002466 106.86 \n", | |
"L 378.002466 16.26 \n", | |
"L 364.090685 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#pef3f752bfb) style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 378.002466 106.86 \n", | |
"L 389.506438 106.86 \n", | |
"L 389.506438 16.26 \n", | |
"L 378.002466 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#pef3f752bfb) style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 389.506438 106.86 \n", | |
"L 397.8 106.86 \n", | |
"L 397.8 16.26 \n", | |
"L 389.506438 16.26 \n", | |
"z\n", | |
""/></g><g id=legend_1><g id=patch_7><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 256.563 \n", | |
"L 142.092 256.563 \n", | |
"Q 145.548 256.563 145.548 253.107 \n", | |
"L 145.548 128.016 \n", | |
"Q 145.548 124.56 142.092 124.56 \n", | |
"L 19.296 124.56 \n", | |
"Q 15.84 124.56 15.84 128.016 \n", | |
"L 15.84 253.107 \n", | |
"Q 15.84 256.563 19.296 256.563 \n", | |
"z\n", | |
""/></g><g id=patch_8><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
"L 57.312 144.6021 \n", | |
"L 57.312 132.5061 \n", | |
"L 22.752 132.5061 \n", | |
"z\n", | |
""/></g><g id=text_1><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
"L 51.703125 72.90625 \n", | |
"L 51.703125 64.59375 \n", | |
"L 19.671875 64.59375 \n", | |
"L 19.671875 43.109375 \n", | |
"L 48.578125 43.109375 \n", | |
"L 48.578125 34.8125 \n", | |
"L 19.671875 34.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-97 d="M 34.28125 27.484375 \n", | |
"Q 23.390625 27.484375 19.1875 25 \n", | |
"Q 14.984375 22.515625 14.984375 16.5 \n", | |
"Q 14.984375 11.71875 18.140625 8.90625 \n", | |
"Q 21.296875 6.109375 26.703125 6.109375 \n", | |
"Q 34.1875 6.109375 38.703125 11.40625 \n", | |
"Q 43.21875 16.703125 43.21875 25.484375 \n", | |
"L 43.21875 27.484375 \n", | |
"z\n", | |
"M 52.203125 31.203125 \n", | |
"L 52.203125 0 \n", | |
"L 43.21875 0 \n", | |
"L 43.21875 8.296875 \n", | |
"Q 40.140625 3.328125 35.546875 0.953125 \n", | |
"Q 30.953125 -1.421875 24.3125 -1.421875 \n", | |
"Q 15.921875 -1.421875 10.953125 3.296875 \n", | |
"Q 6 8.015625 6 15.921875 \n", | |
"Q 6 25.140625 12.171875 29.828125 \n", | |
"Q 18.359375 34.515625 30.609375 34.515625 \n", | |
"L 43.21875 34.515625 \n", | |
"L 43.21875 35.40625 \n", | |
"Q 43.21875 41.609375 39.140625 45 \n", | |
"Q 35.0625 48.390625 27.6875 48.390625 \n", | |
"Q 23 48.390625 18.546875 47.265625 \n", | |
"Q 14.109375 46.140625 10.015625 43.890625 \n", | |
"L 10.015625 52.203125 \n", | |
"Q 14.9375 54.109375 19.578125 55.046875 \n", | |
"Q 24.21875 56 28.609375 56 \n", | |
"Q 40.484375 56 46.34375 49.84375 \n", | |
"Q 52.203125 43.703125 52.203125 31.203125 \n", | |
"z\n", | |
""/><path id=DejaVuSans-109 d="M 52 44.1875 \n", | |
"Q 55.375 50.25 60.0625 53.125 \n", | |
"Q 64.75 56 71.09375 56 \n", | |
"Q 79.640625 56 84.28125 50.015625 \n", | |
"Q 88.921875 44.046875 88.921875 33.015625 \n", | |
"L 88.921875 0 \n", | |
"L 79.890625 0 \n", | |
"L 79.890625 32.71875 \n", | |
"Q 79.890625 40.578125 77.09375 44.375 \n", | |
"Q 74.3125 48.1875 68.609375 48.1875 \n", | |
"Q 61.625 48.1875 57.5625 43.546875 \n", | |
"Q 53.515625 38.921875 53.515625 30.90625 \n", | |
"L 53.515625 0 \n", | |
"L 44.484375 0 \n", | |
"L 44.484375 32.71875 \n", | |
"Q 44.484375 40.625 41.703125 44.40625 \n", | |
"Q 38.921875 48.1875 33.109375 48.1875 \n", | |
"Q 26.21875 48.1875 22.15625 43.53125 \n", | |
"Q 18.109375 38.875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.1875 51.21875 25.484375 53.609375 \n", | |
"Q 29.78125 56 35.6875 56 \n", | |
"Q 41.65625 56 45.828125 52.96875 \n", | |
"Q 50 49.953125 52 44.1875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-70 /><use x=112.017578 xlink:href=#DejaVuSans-97 /><use x=173.296875 xlink:href=#DejaVuSans-109 /></g></g><g id=patch_9><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
"L 57.312 169.9659 \n", | |
"L 57.312 157.8699 \n", | |
"L 22.752 157.8699 \n", | |
"z\n", | |
""/></g><g id=text_2><defs><path id=DejaVuSans-84 d="M -0.296875 72.90625 \n", | |
"L 61.375 72.90625 \n", | |
"L 61.375 64.59375 \n", | |
"L 35.5 64.59375 \n", | |
"L 35.5 0 \n", | |
"L 25.59375 0 \n", | |
"L 25.59375 64.59375 \n", | |
"L -0.296875 64.59375 \n", | |
"z\n", | |
""/><path id=DejaVuSans-119 d="M 4.203125 54.6875 \n", | |
"L 13.1875 54.6875 \n", | |
"L 24.421875 12.015625 \n", | |
"L 35.59375 54.6875 \n", | |
"L 46.1875 54.6875 \n", | |
"L 57.421875 12.015625 \n", | |
"L 68.609375 54.6875 \n", | |
"L 77.59375 54.6875 \n", | |
"L 63.28125 0 \n", | |
"L 52.6875 0 \n", | |
"L 40.921875 44.828125 \n", | |
"L 29.109375 0 \n", | |
"L 18.5 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
"L 54.890625 0 \n", | |
"L 45.90625 0 \n", | |
"L 45.90625 32.71875 \n", | |
"Q 45.90625 40.484375 42.875 44.328125 \n", | |
"Q 39.84375 48.1875 33.796875 48.1875 \n", | |
"Q 26.515625 48.1875 22.3125 43.546875 \n", | |
"Q 18.109375 38.921875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.34375 51.125 25.703125 53.5625 \n", | |
"Q 30.078125 56 35.796875 56 \n", | |
"Q 45.21875 56 50.046875 50.171875 \n", | |
"Q 54.890625 44.34375 54.890625 33.015625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-104 d="M 54.890625 33.015625 \n", | |
"L 54.890625 0 \n", | |
"L 45.90625 0 \n", | |
"L 45.90625 32.71875 \n", | |
"Q 45.90625 40.484375 42.875 44.328125 \n", | |
"Q 39.84375 48.1875 33.796875 48.1875 \n", | |
"Q 26.515625 48.1875 22.3125 43.546875 \n", | |
"Q 18.109375 38.921875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 75.984375 \n", | |
"L 18.109375 75.984375 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.34375 51.125 25.703125 53.5625 \n", | |
"Q 30.078125 56 35.796875 56 \n", | |
"Q 45.21875 56 50.046875 50.171875 \n", | |
"Q 54.890625 44.34375 54.890625 33.015625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-115 d="M 44.28125 53.078125 \n", | |
"L 44.28125 44.578125 \n", | |
"Q 40.484375 46.53125 36.375 47.5 \n", | |
"Q 32.28125 48.484375 27.875 48.484375 \n", | |
"Q 21.1875 48.484375 17.84375 46.4375 \n", | |
"Q 14.5 44.390625 14.5 40.28125 \n", | |
"Q 14.5 37.15625 16.890625 35.375 \n", | |
"Q 19.28125 33.59375 26.515625 31.984375 \n", | |
"L 29.59375 31.296875 \n", | |
"Q 39.15625 29.25 43.1875 25.515625 \n", | |
"Q 47.21875 21.78125 47.21875 15.09375 \n", | |
"Q 47.21875 7.46875 41.1875 3.015625 \n", | |
"Q 35.15625 -1.421875 24.609375 -1.421875 \n", | |
"Q 20.21875 -1.421875 15.453125 -0.5625 \n", | |
"Q 10.6875 0.296875 5.421875 2 \n", | |
"L 5.421875 11.28125 \n", | |
"Q 10.40625 8.6875 15.234375 7.390625 \n", | |
"Q 20.0625 6.109375 24.8125 6.109375 \n", | |
"Q 31.15625 6.109375 34.5625 8.28125 \n", | |
"Q 37.984375 10.453125 37.984375 14.40625 \n", | |
"Q 37.984375 18.0625 35.515625 20.015625 \n", | |
"Q 33.0625 21.96875 24.703125 23.78125 \n", | |
"L 21.578125 24.515625 \n", | |
"Q 13.234375 26.265625 9.515625 29.90625 \n", | |
"Q 5.8125 33.546875 5.8125 39.890625 \n", | |
"Q 5.8125 47.609375 11.28125 51.796875 \n", | |
"Q 16.75 56 26.8125 56 \n", | |
"Q 31.78125 56 36.171875 55.265625 \n", | |
"Q 40.578125 54.546875 44.28125 53.078125 \n", | |
"z\n", | |
""/><path id=DejaVuSans-69 d="M 9.8125 72.90625 \n", | |
"L 55.90625 72.90625 \n", | |
"L 55.90625 64.59375 \n", | |
"L 19.671875 64.59375 \n", | |
"L 19.671875 43.015625 \n", | |
"L 54.390625 43.015625 \n", | |
"L 54.390625 34.71875 \n", | |
"L 19.671875 34.71875 \n", | |
"L 19.671875 8.296875 \n", | |
"L 56.78125 8.296875 \n", | |
"L 56.78125 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-84 /><use x=44.583984 xlink:href=#DejaVuSans-119 /><use x=126.371094 xlink:href=#DejaVuSans-110 /><use x=189.75 xlink:href=#DejaVuSans-104 /><use x=253.128906 xlink:href=#DejaVuSans-115 /><use x=305.228516 xlink:href=#DejaVuSans-69 /></g></g><g id=patch_10><path style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 195.3297 \n", | |
"L 57.312 195.3297 \n", | |
"L 57.312 183.2337 \n", | |
"L 22.752 183.2337 \n", | |
"z\n", | |
""/></g><g id=text_3><defs><path id=DejaVuSans-68 d="M 19.671875 64.796875 \n", | |
"L 19.671875 8.109375 \n", | |
"L 31.59375 8.109375 \n", | |
"Q 46.6875 8.109375 53.6875 14.9375 \n", | |
"Q 60.6875 21.78125 60.6875 36.53125 \n", | |
"Q 60.6875 51.171875 53.6875 57.984375 \n", | |
"Q 46.6875 64.796875 31.59375 64.796875 \n", | |
"z\n", | |
"M 9.8125 72.90625 \n", | |
"L 30.078125 72.90625 \n", | |
"Q 51.265625 72.90625 61.171875 64.09375 \n", | |
"Q 71.09375 55.28125 71.09375 36.53125 \n", | |
"Q 71.09375 17.671875 61.125 8.828125 \n", | |
"Q 51.171875 0 30.078125 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
"L 8.5 54.6875 \n", | |
"L 17.484375 54.6875 \n", | |
"L 17.484375 21.921875 \n", | |
"Q 17.484375 14.15625 20.5 10.265625 \n", | |
"Q 23.53125 6.390625 29.59375 6.390625 \n", | |
"Q 36.859375 6.390625 41.078125 11.03125 \n", | |
"Q 45.3125 15.671875 45.3125 23.6875 \n", | |
"L 45.3125 54.6875 \n", | |
"L 54.296875 54.6875 \n", | |
"L 54.296875 0 \n", | |
"L 45.3125 0 \n", | |
"L 45.3125 8.40625 \n", | |
"Q 42.046875 3.421875 37.71875 1 \n", | |
"Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
"Q 18.265625 -1.421875 13.375 4.4375 \n", | |
"Q 8.5 10.296875 8.5 21.578125 \n", | |
"z\n", | |
"M 31.109375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-112 d="M 18.109375 8.203125 \n", | |
"L 18.109375 -20.796875 \n", | |
"L 9.078125 -20.796875 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.390625 \n", | |
"Q 20.953125 51.265625 25.265625 53.625 \n", | |
"Q 29.59375 56 35.59375 56 \n", | |
"Q 45.5625 56 51.78125 48.09375 \n", | |
"Q 58.015625 40.1875 58.015625 27.296875 \n", | |
"Q 58.015625 14.40625 51.78125 6.484375 \n", | |
"Q 45.5625 -1.421875 35.59375 -1.421875 \n", | |
"Q 29.59375 -1.421875 25.265625 0.953125 \n", | |
"Q 20.953125 3.328125 18.109375 8.203125 \n", | |
"z\n", | |
"M 48.6875 27.296875 \n", | |
"Q 48.6875 37.203125 44.609375 42.84375 \n", | |
"Q 40.53125 48.484375 33.40625 48.484375 \n", | |
"Q 26.265625 48.484375 22.1875 42.84375 \n", | |
"Q 18.109375 37.203125 18.109375 27.296875 \n", | |
"Q 18.109375 17.390625 22.1875 11.75 \n", | |
"Q 26.265625 6.109375 33.40625 6.109375 \n", | |
"Q 40.53125 6.109375 44.609375 11.75 \n", | |
"Q 48.6875 17.390625 48.6875 27.296875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-108 d="M 9.421875 75.984375 \n", | |
"L 18.40625 75.984375 \n", | |
"L 18.40625 0 \n", | |
"L 9.421875 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-120 d="M 54.890625 54.6875 \n", | |
"L 35.109375 28.078125 \n", | |
"L 55.90625 0 \n", | |
"L 45.3125 0 \n", | |
"L 29.390625 21.484375 \n", | |
"L 13.484375 0 \n", | |
"L 2.875 0 \n", | |
"L 24.125 28.609375 \n", | |
"L 4.6875 54.6875 \n", | |
"L 15.28125 54.6875 \n", | |
"L 29.78125 35.203125 \n", | |
"L 44.28125 54.6875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 195.3297)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-68 /><use x=77.001953 xlink:href=#DejaVuSans-117 /><use x=140.380859 xlink:href=#DejaVuSans-112 /><use x=203.857422 xlink:href=#DejaVuSans-108 /><use x=231.640625 xlink:href=#DejaVuSans-101 /><use x=291.414062 xlink:href=#DejaVuSans-120 /></g></g><g id=patch_11><path style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 220.6935 \n", | |
"L 57.312 220.6935 \n", | |
"L 57.312 208.5975 \n", | |
"L 22.752 208.5975 \n", | |
"z\n", | |
""/></g><g id=text_4><g style=fill:#262626; transform="translate(71.136 220.6935)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-84 /><use x=44.583984 xlink:href=#DejaVuSans-119 /><use x=126.371094 xlink:href=#DejaVuSans-110 /><use x=189.75 xlink:href=#DejaVuSans-104 /><use x=253.128906 xlink:href=#DejaVuSans-115 /></g></g><g id=patch_12><path style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 246.0573 \n", | |
"L 57.312 246.0573 \n", | |
"L 57.312 233.9613 \n", | |
"L 22.752 233.9613 \n", | |
"z\n", | |
""/></g><g id=text_5><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-102 d="M 37.109375 75.984375 \n", | |
"L 37.109375 68.5 \n", | |
"L 28.515625 68.5 \n", | |
"Q 23.6875 68.5 21.796875 66.546875 \n", | |
"Q 19.921875 64.59375 19.921875 59.515625 \n", | |
"L 19.921875 54.6875 \n", | |
"L 34.71875 54.6875 \n", | |
"L 34.71875 47.703125 \n", | |
"L 19.921875 47.703125 \n", | |
"L 19.921875 0 \n", | |
"L 10.890625 0 \n", | |
"L 10.890625 47.703125 \n", | |
"L 2.296875 47.703125 \n", | |
"L 2.296875 54.6875 \n", | |
"L 10.890625 54.6875 \n", | |
"L 10.890625 58.5 \n", | |
"Q 10.890625 67.625 15.140625 71.796875 \n", | |
"Q 19.390625 75.984375 28.609375 75.984375 \n", | |
"z\n", | |
""/><path id=DejaVuSans-67 d="M 64.40625 67.28125 \n", | |
"L 64.40625 56.890625 \n", | |
"Q 59.421875 61.53125 53.78125 63.8125 \n", | |
"Q 48.140625 66.109375 41.796875 66.109375 \n", | |
"Q 29.296875 66.109375 22.65625 58.46875 \n", | |
"Q 16.015625 50.828125 16.015625 36.375 \n", | |
"Q 16.015625 21.96875 22.65625 14.328125 \n", | |
"Q 29.296875 6.6875 41.796875 6.6875 \n", | |
"Q 48.140625 6.6875 53.78125 8.984375 \n", | |
"Q 59.421875 11.28125 64.40625 15.921875 \n", | |
"L 64.40625 5.609375 \n", | |
"Q 59.234375 2.09375 53.4375 0.328125 \n", | |
"Q 47.65625 -1.421875 41.21875 -1.421875 \n", | |
"Q 24.65625 -1.421875 15.125 8.703125 \n", | |
"Q 5.609375 18.84375 5.609375 36.375 \n", | |
"Q 5.609375 53.953125 15.125 64.078125 \n", | |
"Q 24.65625 74.21875 41.21875 74.21875 \n", | |
"Q 47.75 74.21875 53.53125 72.484375 \n", | |
"Q 59.328125 70.75 64.40625 67.28125 \n", | |
"z\n", | |
""/><path id=DejaVuSans-111 d="M 30.609375 48.390625 \n", | |
"Q 23.390625 48.390625 19.1875 42.75 \n", | |
"Q 14.984375 37.109375 14.984375 27.296875 \n", | |
"Q 14.984375 17.484375 19.15625 11.84375 \n", | |
"Q 23.34375 6.203125 30.609375 6.203125 \n", | |
"Q 37.796875 6.203125 41.984375 11.859375 \n", | |
"Q 46.1875 17.53125 46.1875 27.296875 \n", | |
"Q 46.1875 37.015625 41.984375 42.703125 \n", | |
"Q 37.796875 48.390625 30.609375 48.390625 \n", | |
"z\n", | |
"M 30.609375 56 \n", | |
"Q 42.328125 56 49.015625 48.375 \n", | |
"Q 55.71875 40.765625 55.71875 27.296875 \n", | |
"Q 55.71875 13.875 49.015625 6.21875 \n", | |
"Q 42.328125 -1.421875 30.609375 -1.421875 \n", | |
"Q 18.84375 -1.421875 12.171875 6.21875 \n", | |
"Q 5.515625 13.875 5.515625 27.296875 \n", | |
"Q 5.515625 40.765625 12.171875 48.375 \n", | |
"Q 18.84375 56 30.609375 56 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 246.0573)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-102 /><use x=98.828125 xlink:href=#DejaVuSans-109 /><use x=196.240234 xlink:href=#DejaVuSans-67 /><use x=266.064453 xlink:href=#DejaVuSans-111 /><use x=327.246094 xlink:href=#DejaVuSans-110 /></g></g></g></g></g><defs><clippath id=pef3f752bfb><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_25486759442125376></a><div class=variable><div class=col-sm-3><p class=h4 title=HouseStyle><a href=#pp_var_25486759442125376>HouseStyle</a><br><small>Categorical</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>8</td></tr><tr><th>Distinct (%)</th><td>0.5%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-6><div class="col-sm- collapse in" id=minifreqtable><table class="mini freq"><tr class><th width=50%> 1Story </th><td width=50%><div class=bar style=width:100.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 726&nbsp; </div></td></tr><tr class><th width=50%> 2Story </th><td width=50%><div class=bar style=width:61.3% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 445&nbsp; </div></td></tr><tr class><th width=50%> 1.5Fin </th><td width=50%><div class=bar style=width:21.2% data-toggle=tooltip data-placement=right data-html=true data-delay=500> 154&nbsp; </div></td></tr><tr class><th width=50%> SLvl </th><td width=50%><div class=bar style=width:9.0% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 65 </td></tr><tr class><th width=50%> SFoyer </th><td width=50%><div class=bar style=width:5.1% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 37 </td></tr><tr class=other><th width=50%> Other values (3) </th><td width=50%><div class=bar style=width:4.5% data-toggle=tooltip data-placement=right data-html=true data-delay=500> &nbsp; </div> 33 </td></tr></table></div></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-25486759442125376, #minifreqtable25486759442125376" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-25486759442125376 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#25486759442125376bottom-25486759442125376overview aria-controls=25486759442125376bottom-25486759442125376overview role=tab data-toggle=tab>Overview</a></li><li role=presentation><a href=#25486759442125376bottom-25486759442125376string aria-controls=25486759442125376bottom-25486759442125376string role=tab data-toggle=tab>Categories</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=25486759442125376bottom-25486759442125376overview><div class=row><div class=col-sm-6><p class=h4>Unique</p><table class="table table-condensed stats"><tbody><tr><th>Unique</th><td>0 <span class="badge pull-right" style=color:#fff;background-color:#337ab7; title="The number of unique values (all values that occur exactly once in the dataset).">?</span></td></tr><tr><th>Unique (%)</th><td>0.0%</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Sample</p><table class="table table-condensed stats"><tbody><tr><th>1st row</th><td>2Story</td></tr><tr><th>2nd row</th><td>1Story</td></tr><tr><th>3rd row</th><td>2Story</td></tr><tr><th>4th row</th><td>2Story</td></tr><tr><th>5th row</th><td>2Story</td></tr></tbody></table></div></div></div><div role=tabpanel class="tab-pane col-sm-12" id=25486759442125376bottom-25486759442125376string><div class=row><div class=col-sm-6><h4>Common Values</h4><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=1Story>1Story</td><td>726</td><td><div class=bar style=width:100.0%> 49.7% </div></td></tr><tr class><td title=2Story>2Story</td><td>445</td><td><div class=bar style=width:61.3%> 30.5% </div></td></tr><tr class><td title=1.5Fin>1.5Fin</td><td>154</td><td><div class=bar style=width:21.2%> &nbsp; </div> 10.5% </td></tr><tr class><td title=SLvl>SLvl</td><td>65</td><td><div class=bar style=width:9.0%> &nbsp; </div> 4.5% </td></tr><tr class><td title=SFoyer>SFoyer</td><td>37</td><td><div class=bar style=width:5.1%> &nbsp; </div> 2.5% </td></tr><tr class><td title=1.5Unf>1.5Unf</td><td>14</td><td><div class=bar style=width:1.9%> &nbsp; </div> 1.0% </td></tr><tr class><td title=2.5Unf>2.5Unf</td><td>11</td><td><div class=bar style=width:1.5%> &nbsp; </div> 0.8% </td></tr><tr class><td title=2.5Fin>2.5Fin</td><td>8</td><td><div class=bar style=width:1.1%> &nbsp; </div> 0.5% </td></tr></tbody></table></div><div class=col-sm-6><h4>Category Frequency Plot</h4><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=339.8544pt version=1.1 viewbox="0 0 405 339.8544" width=405pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 339.8544 \n", | |
"L 405 339.8544 \n", | |
"L 405 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path clip-path=url(#pf8e884390c) style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 7.2 106.86 \n", | |
"L 201.429863 106.86 \n", | |
"L 201.429863 16.26 \n", | |
"L 7.2 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_3><path clip-path=url(#pf8e884390c) style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 201.429863 106.86 \n", | |
"L 320.482603 106.86 \n", | |
"L 320.482603 16.26 \n", | |
"L 201.429863 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#pf8e884390c) style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 320.482603 106.86 \n", | |
"L 361.682877 106.86 \n", | |
"L 361.682877 16.26 \n", | |
"L 320.482603 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#pf8e884390c) style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 361.682877 106.86 \n", | |
"L 379.072603 106.86 \n", | |
"L 379.072603 16.26 \n", | |
"L 361.682877 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#pf8e884390c) style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 379.072603 106.86 \n", | |
"L 388.97137 106.86 \n", | |
"L 388.97137 16.26 \n", | |
"L 379.072603 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#pf8e884390c) style=fill:#937860;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 388.97137 106.86 \n", | |
"L 392.716849 106.86 \n", | |
"L 392.716849 16.26 \n", | |
"L 388.97137 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#pf8e884390c) style=fill:#da8bc3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 392.716849 106.86 \n", | |
"L 395.659726 106.86 \n", | |
"L 395.659726 16.26 \n", | |
"L 392.716849 16.26 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#pf8e884390c) style=fill:#8c8c8c;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 395.659726 106.86 \n", | |
"L 397.8 106.86 \n", | |
"L 397.8 16.26 \n", | |
"L 395.659726 16.26 \n", | |
"z\n", | |
""/></g><g id=legend_1><g id=patch_10><path style=fill:#ffffff;opacity:0.8;stroke:#cccccc;stroke-linejoin:miter;stroke-width:0.3; d="M 19.296 332.6544 \n", | |
"L 133.4115 332.6544 \n", | |
"Q 136.8675 332.6544 136.8675 329.1984 \n", | |
"L 136.8675 128.016 \n", | |
"Q 136.8675 124.56 133.4115 124.56 \n", | |
"L 19.296 124.56 \n", | |
"Q 15.84 124.56 15.84 128.016 \n", | |
"L 15.84 329.1984 \n", | |
"Q 15.84 332.6544 19.296 332.6544 \n", | |
"z\n", | |
""/></g><g id=patch_11><path style=fill:#4c72b0;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 144.6021 \n", | |
"L 57.312 144.6021 \n", | |
"L 57.312 132.5061 \n", | |
"L 22.752 132.5061 \n", | |
"z\n", | |
""/></g><g id=text_1><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-83 d="M 53.515625 70.515625 \n", | |
"L 53.515625 60.890625 \n", | |
"Q 47.90625 63.578125 42.921875 64.890625 \n", | |
"Q 37.9375 66.21875 33.296875 66.21875 \n", | |
"Q 25.25 66.21875 20.875 63.09375 \n", | |
"Q 16.5 59.96875 16.5 54.203125 \n", | |
"Q 16.5 49.359375 19.40625 46.890625 \n", | |
"Q 22.3125 44.4375 30.421875 42.921875 \n", | |
"L 36.375 41.703125 \n", | |
"Q 47.40625 39.59375 52.65625 34.296875 \n", | |
"Q 57.90625 29 57.90625 20.125 \n", | |
"Q 57.90625 9.515625 50.796875 4.046875 \n", | |
"Q 43.703125 -1.421875 29.984375 -1.421875 \n", | |
"Q 24.8125 -1.421875 18.96875 -0.25 \n", | |
"Q 13.140625 0.921875 6.890625 3.21875 \n", | |
"L 6.890625 13.375 \n", | |
"Q 12.890625 10.015625 18.65625 8.296875 \n", | |
"Q 24.421875 6.59375 29.984375 6.59375 \n", | |
"Q 38.421875 6.59375 43.015625 9.90625 \n", | |
"Q 47.609375 13.234375 47.609375 19.390625 \n", | |
"Q 47.609375 24.75 44.3125 27.78125 \n", | |
"Q 41.015625 30.8125 33.5 32.328125 \n", | |
"L 27.484375 33.5 \n", | |
"Q 16.453125 35.6875 11.515625 40.375 \n", | |
"Q 6.59375 45.0625 6.59375 53.421875 \n", | |
"Q 6.59375 63.09375 13.40625 68.65625 \n", | |
"Q 20.21875 74.21875 32.171875 74.21875 \n", | |
"Q 37.3125 74.21875 42.625 73.28125 \n", | |
"Q 47.953125 72.359375 53.515625 70.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-116 d="M 18.3125 70.21875 \n", | |
"L 18.3125 54.6875 \n", | |
"L 36.8125 54.6875 \n", | |
"L 36.8125 47.703125 \n", | |
"L 18.3125 47.703125 \n", | |
"L 18.3125 18.015625 \n", | |
"Q 18.3125 11.328125 20.140625 9.421875 \n", | |
"Q 21.96875 7.515625 27.59375 7.515625 \n", | |
"L 36.8125 7.515625 \n", | |
"L 36.8125 0 \n", | |
"L 27.59375 0 \n", | |
"Q 17.1875 0 13.234375 3.875 \n", | |
"Q 9.28125 7.765625 9.28125 18.015625 \n", | |
"L 9.28125 47.703125 \n", | |
"L 2.6875 47.703125 \n", | |
"L 2.6875 54.6875 \n", | |
"L 9.28125 54.6875 \n", | |
"L 9.28125 70.21875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-111 d="M 30.609375 48.390625 \n", | |
"Q 23.390625 48.390625 19.1875 42.75 \n", | |
"Q 14.984375 37.109375 14.984375 27.296875 \n", | |
"Q 14.984375 17.484375 19.15625 11.84375 \n", | |
"Q 23.34375 6.203125 30.609375 6.203125 \n", | |
"Q 37.796875 6.203125 41.984375 11.859375 \n", | |
"Q 46.1875 17.53125 46.1875 27.296875 \n", | |
"Q 46.1875 37.015625 41.984375 42.703125 \n", | |
"Q 37.796875 48.390625 30.609375 48.390625 \n", | |
"z\n", | |
"M 30.609375 56 \n", | |
"Q 42.328125 56 49.015625 48.375 \n", | |
"Q 55.71875 40.765625 55.71875 27.296875 \n", | |
"Q 55.71875 13.875 49.015625 6.21875 \n", | |
"Q 42.328125 -1.421875 30.609375 -1.421875 \n", | |
"Q 18.84375 -1.421875 12.171875 6.21875 \n", | |
"Q 5.515625 13.875 5.515625 27.296875 \n", | |
"Q 5.515625 40.765625 12.171875 48.375 \n", | |
"Q 18.84375 56 30.609375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
"Q 39.59375 47.171875 37.8125 47.578125 \n", | |
"Q 36.03125 48 33.890625 48 \n", | |
"Q 26.265625 48 22.1875 43.046875 \n", | |
"Q 18.109375 38.09375 18.109375 28.8125 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 20.953125 51.171875 25.484375 53.578125 \n", | |
"Q 30.03125 56 36.53125 56 \n", | |
"Q 37.453125 56 38.578125 55.875 \n", | |
"Q 39.703125 55.765625 41.0625 55.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
"Q 28.375 -14.84375 24.75 -17.8125 \n", | |
"Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
"L 7.90625 -20.796875 \n", | |
"L 7.90625 -13.28125 \n", | |
"L 13.1875 -13.28125 \n", | |
"Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
"Q 21 -9.765625 23.484375 -3.21875 \n", | |
"L 25.09375 0.875 \n", | |
"L 2.984375 54.6875 \n", | |
"L 12.5 54.6875 \n", | |
"L 29.59375 11.921875 \n", | |
"L 46.6875 54.6875 \n", | |
"L 56.203125 54.6875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 144.6021)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-83 /><use x=127.099609 xlink:href=#DejaVuSans-116 /><use x=166.308594 xlink:href=#DejaVuSans-111 /><use x=227.490234 xlink:href=#DejaVuSans-114 /><use x=268.603516 xlink:href=#DejaVuSans-121 /></g></g><g id=patch_12><path style=fill:#dd8452;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 169.9659 \n", | |
"L 57.312 169.9659 \n", | |
"L 57.312 157.8699 \n", | |
"L 22.752 157.8699 \n", | |
"z\n", | |
""/></g><g id=text_2><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 169.9659)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-83 /><use x=127.099609 xlink:href=#DejaVuSans-116 /><use x=166.308594 xlink:href=#DejaVuSans-111 /><use x=227.490234 xlink:href=#DejaVuSans-114 /><use x=268.603516 xlink:href=#DejaVuSans-121 /></g></g><g id=patch_13><path style=fill:#55a868;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 195.3297 \n", | |
"L 57.312 195.3297 \n", | |
"L 57.312 183.2337 \n", | |
"L 22.752 183.2337 \n", | |
"z\n", | |
""/></g><g id=text_3><defs><path id=DejaVuSans-46 d="M 10.6875 12.40625 \n", | |
"L 21 12.40625 \n", | |
"L 21 0 \n", | |
"L 10.6875 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
"L 49.515625 72.90625 \n", | |
"L 49.515625 64.59375 \n", | |
"L 19.828125 64.59375 \n", | |
"L 19.828125 46.734375 \n", | |
"Q 21.96875 47.46875 24.109375 47.828125 \n", | |
"Q 26.265625 48.1875 28.421875 48.1875 \n", | |
"Q 40.625 48.1875 47.75 41.5 \n", | |
"Q 54.890625 34.8125 54.890625 23.390625 \n", | |
"Q 54.890625 11.625 47.5625 5.09375 \n", | |
"Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
"Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
"Q 12.796875 0.140625 7.71875 1.703125 \n", | |
"L 7.71875 11.625 \n", | |
"Q 12.109375 9.234375 16.796875 8.0625 \n", | |
"Q 21.484375 6.890625 26.703125 6.890625 \n", | |
"Q 35.15625 6.890625 40.078125 11.328125 \n", | |
"Q 45.015625 15.765625 45.015625 23.390625 \n", | |
"Q 45.015625 31 40.078125 35.4375 \n", | |
"Q 35.15625 39.890625 26.703125 39.890625 \n", | |
"Q 22.75 39.890625 18.8125 39.015625 \n", | |
"Q 14.890625 38.140625 10.796875 36.28125 \n", | |
"z\n", | |
""/><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
"L 51.703125 72.90625 \n", | |
"L 51.703125 64.59375 \n", | |
"L 19.671875 64.59375 \n", | |
"L 19.671875 43.109375 \n", | |
"L 48.578125 43.109375 \n", | |
"L 48.578125 34.8125 \n", | |
"L 19.671875 34.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-105 d="M 9.421875 54.6875 \n", | |
"L 18.40625 54.6875 \n", | |
"L 18.40625 0 \n", | |
"L 9.421875 0 \n", | |
"z\n", | |
"M 9.421875 75.984375 \n", | |
"L 18.40625 75.984375 \n", | |
"L 18.40625 64.59375 \n", | |
"L 9.421875 64.59375 \n", | |
"z\n", | |
""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
"L 54.890625 0 \n", | |
"L 45.90625 0 \n", | |
"L 45.90625 32.71875 \n", | |
"Q 45.90625 40.484375 42.875 44.328125 \n", | |
"Q 39.84375 48.1875 33.796875 48.1875 \n", | |
"Q 26.515625 48.1875 22.3125 43.546875 \n", | |
"Q 18.109375 38.921875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.34375 51.125 25.703125 53.5625 \n", | |
"Q 30.078125 56 35.796875 56 \n", | |
"Q 45.21875 56 50.046875 50.171875 \n", | |
"Q 54.890625 44.34375 54.890625 33.015625 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 195.3297)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-53 /><use x=159.033203 xlink:href=#DejaVuSans-70 /><use x=209.302734 xlink:href=#DejaVuSans-105 /><use x=237.085938 xlink:href=#DejaVuSans-110 /></g></g><g id=patch_14><path style=fill:#c44e52;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 220.6935 \n", | |
"L 57.312 220.6935 \n", | |
"L 57.312 208.5975 \n", | |
"L 22.752 208.5975 \n", | |
"z\n", | |
""/></g><g id=text_4><defs><path id=DejaVuSans-76 d="M 9.8125 72.90625 \n", | |
"L 19.671875 72.90625 \n", | |
"L 19.671875 8.296875 \n", | |
"L 55.171875 8.296875 \n", | |
"L 55.171875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-118 d="M 2.984375 54.6875 \n", | |
"L 12.5 54.6875 \n", | |
"L 29.59375 8.796875 \n", | |
"L 46.6875 54.6875 \n", | |
"L 56.203125 54.6875 \n", | |
"L 35.6875 0 \n", | |
"L 23.484375 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-108 d="M 9.421875 75.984375 \n", | |
"L 18.40625 75.984375 \n", | |
"L 18.40625 0 \n", | |
"L 9.421875 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 220.6935)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-83 /><use x=63.476562 xlink:href=#DejaVuSans-76 /><use x=119.189453 xlink:href=#DejaVuSans-118 /><use x=178.369141 xlink:href=#DejaVuSans-108 /></g></g><g id=patch_15><path style=fill:#8172b3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 246.0573 \n", | |
"L 57.312 246.0573 \n", | |
"L 57.312 233.9613 \n", | |
"L 22.752 233.9613 \n", | |
"z\n", | |
""/></g><g id=text_5><defs><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 246.0573)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-83 /><use x=63.476562 xlink:href=#DejaVuSans-70 /><use x=117.371094 xlink:href=#DejaVuSans-111 /><use x=178.552734 xlink:href=#DejaVuSans-121 /><use x=237.732422 xlink:href=#DejaVuSans-101 /><use x=299.255859 xlink:href=#DejaVuSans-114 /></g></g><g id=patch_16><path style=fill:#937860;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 271.4211 \n", | |
"L 57.312 271.4211 \n", | |
"L 57.312 259.3251 \n", | |
"L 22.752 259.3251 \n", | |
"z\n", | |
""/></g><g id=text_6><defs><path id=DejaVuSans-85 d="M 8.6875 72.90625 \n", | |
"L 18.609375 72.90625 \n", | |
"L 18.609375 28.609375 \n", | |
"Q 18.609375 16.890625 22.84375 11.734375 \n", | |
"Q 27.09375 6.59375 36.625 6.59375 \n", | |
"Q 46.09375 6.59375 50.34375 11.734375 \n", | |
"Q 54.59375 16.890625 54.59375 28.609375 \n", | |
"L 54.59375 72.90625 \n", | |
"L 64.5 72.90625 \n", | |
"L 64.5 27.390625 \n", | |
"Q 64.5 13.140625 57.4375 5.859375 \n", | |
"Q 50.390625 -1.421875 36.625 -1.421875 \n", | |
"Q 22.796875 -1.421875 15.734375 5.859375 \n", | |
"Q 8.6875 13.140625 8.6875 27.390625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-102 d="M 37.109375 75.984375 \n", | |
"L 37.109375 68.5 \n", | |
"L 28.515625 68.5 \n", | |
"Q 23.6875 68.5 21.796875 66.546875 \n", | |
"Q 19.921875 64.59375 19.921875 59.515625 \n", | |
"L 19.921875 54.6875 \n", | |
"L 34.71875 54.6875 \n", | |
"L 34.71875 47.703125 \n", | |
"L 19.921875 47.703125 \n", | |
"L 19.921875 0 \n", | |
"L 10.890625 0 \n", | |
"L 10.890625 47.703125 \n", | |
"L 2.296875 47.703125 \n", | |
"L 2.296875 54.6875 \n", | |
"L 10.890625 54.6875 \n", | |
"L 10.890625 58.5 \n", | |
"Q 10.890625 67.625 15.140625 71.796875 \n", | |
"Q 19.390625 75.984375 28.609375 75.984375 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(71.136 271.4211)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-53 /><use x=159.033203 xlink:href=#DejaVuSans-85 /><use x=232.226562 xlink:href=#DejaVuSans-110 /><use x=295.605469 xlink:href=#DejaVuSans-102 /></g></g><g id=patch_17><path style=fill:#da8bc3;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 296.7849 \n", | |
"L 57.312 296.7849 \n", | |
"L 57.312 284.6889 \n", | |
"L 22.752 284.6889 \n", | |
"z\n", | |
""/></g><g id=text_7><g style=fill:#262626; transform="translate(71.136 296.7849)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-53 /><use x=159.033203 xlink:href=#DejaVuSans-85 /><use x=232.226562 xlink:href=#DejaVuSans-110 /><use x=295.605469 xlink:href=#DejaVuSans-102 /></g></g><g id=patch_18><path style=fill:#8c8c8c;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 22.752 322.1487 \n", | |
"L 57.312 322.1487 \n", | |
"L 57.312 310.0527 \n", | |
"L 22.752 310.0527 \n", | |
"z\n", | |
""/></g><g id=text_8><g style=fill:#262626; transform="translate(71.136 322.1487)scale(0.1728 -0.1728)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-46 /><use x=95.410156 xlink:href=#DejaVuSans-53 /><use x=159.033203 xlink:href=#DejaVuSans-70 /><use x=209.302734 xlink:href=#DejaVuSans-105 /><use x=237.085938 xlink:href=#DejaVuSans-110 /></g></g></g></g></g><defs><clippath id=pf8e884390c><rect height=108.72 width=390.6 x=7.2 y=7.2 /></clippath></defs></svg></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_1857791591089843665></a><div class=variable><div class=col-sm-3><p class=h4 title=OverallQual><a href=#pp_var_1857791591089843665>OverallQual</a><br><small>Real number (&Ropf;<sub>&ge;0</sub>)</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>10</td></tr><tr><th>Distinct (%)</th><td>0.7%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Infinite</th><td>0</td></tr><tr><th>Infinite (%)</th><td>0.0%</td></tr><tr><th>Mean</th><td>6.099315068</td></tr></tbody></table></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>1</td></tr><tr><th>Maximum</th><td>10</td></tr><tr><th>Zeros</th><td>0</td></tr><tr><th>Zeros (%)</th><td>0.0%</td></tr><tr><th>Negative</th><td>0</td></tr><tr><th>Negative (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-3><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=162pt version=1.1 viewbox="0 0 216 162" width=216pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 162 \n", | |
"L 216 162 \n", | |
"L 216 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 10.8 124.764971 \n", | |
"L 205.2 124.764971 \n", | |
"L 205.2 10.8 \n", | |
"L 10.8 10.8 \n", | |
"z\n", | |
""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(39.034079 145.66247)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-50 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
"L 12.890625 25.390625 \n", | |
"L 37.796875 25.390625 \n", | |
"z\n", | |
"M 35.203125 72.90625 \n", | |
"L 47.609375 72.90625 \n", | |
"L 47.609375 25.390625 \n", | |
"L 58.015625 25.390625 \n", | |
"L 58.015625 17.1875 \n", | |
"L 47.609375 17.1875 \n", | |
"L 47.609375 0 \n", | |
"L 37.796875 0 \n", | |
"L 37.796875 17.1875 \n", | |
"L 4.890625 17.1875 \n", | |
"L 4.890625 26.703125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(78.306806 145.66247)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-52 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
"Q 26.375 40.375 22.484375 35.828125 \n", | |
"Q 18.609375 31.296875 18.609375 23.390625 \n", | |
"Q 18.609375 15.53125 22.484375 10.953125 \n", | |
"Q 26.375 6.390625 33.015625 6.390625 \n", | |
"Q 39.65625 6.390625 43.53125 10.953125 \n", | |
"Q 47.40625 15.53125 47.40625 23.390625 \n", | |
"Q 47.40625 31.296875 43.53125 35.828125 \n", | |
"Q 39.65625 40.375 33.015625 40.375 \n", | |
"z\n", | |
"M 52.59375 71.296875 \n", | |
"L 52.59375 62.3125 \n", | |
"Q 48.875 64.0625 45.09375 64.984375 \n", | |
"Q 41.3125 65.921875 37.59375 65.921875 \n", | |
"Q 27.828125 65.921875 22.671875 59.328125 \n", | |
"Q 17.53125 52.734375 16.796875 39.40625 \n", | |
"Q 19.671875 43.65625 24.015625 45.921875 \n", | |
"Q 28.375 48.1875 33.59375 48.1875 \n", | |
"Q 44.578125 48.1875 50.953125 41.515625 \n", | |
"Q 57.328125 34.859375 57.328125 23.390625 \n", | |
"Q 57.328125 12.15625 50.6875 5.359375 \n", | |
"Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
"Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
"Q 6.984375 17.96875 6.984375 36.375 \n", | |
"Q 6.984375 53.65625 15.1875 63.9375 \n", | |
"Q 23.390625 74.21875 37.203125 74.21875 \n", | |
"Q 40.921875 74.21875 44.703125 73.484375 \n", | |
"Q 48.484375 72.75 52.59375 71.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(117.579533 145.66247)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-54 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-56 d="M 31.78125 34.625 \n", | |
"Q 24.75 34.625 20.71875 30.859375 \n", | |
"Q 16.703125 27.09375 16.703125 20.515625 \n", | |
"Q 16.703125 13.921875 20.71875 10.15625 \n", | |
"Q 24.75 6.390625 31.78125 6.390625 \n", | |
"Q 38.8125 6.390625 42.859375 10.171875 \n", | |
"Q 46.921875 13.96875 46.921875 20.515625 \n", | |
"Q 46.921875 27.09375 42.890625 30.859375 \n", | |
"Q 38.875 34.625 31.78125 34.625 \n", | |
"z\n", | |
"M 21.921875 38.8125 \n", | |
"Q 15.578125 40.375 12.03125 44.71875 \n", | |
"Q 8.5 49.078125 8.5 55.328125 \n", | |
"Q 8.5 64.0625 14.71875 69.140625 \n", | |
"Q 20.953125 74.21875 31.78125 74.21875 \n", | |
"Q 42.671875 74.21875 48.875 69.140625 \n", | |
"Q 55.078125 64.0625 55.078125 55.328125 \n", | |
"Q 55.078125 49.078125 51.53125 44.71875 \n", | |
"Q 48 40.375 41.703125 38.8125 \n", | |
"Q 48.828125 37.15625 52.796875 32.3125 \n", | |
"Q 56.78125 27.484375 56.78125 20.515625 \n", | |
"Q 56.78125 9.90625 50.3125 4.234375 \n", | |
"Q 43.84375 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.734375 -1.421875 13.25 4.234375 \n", | |
"Q 6.78125 9.90625 6.78125 20.515625 \n", | |
"Q 6.78125 27.484375 10.78125 32.3125 \n", | |
"Q 14.796875 37.15625 21.921875 38.8125 \n", | |
"z\n", | |
"M 18.3125 54.390625 \n", | |
"Q 18.3125 48.734375 21.84375 45.5625 \n", | |
"Q 25.390625 42.390625 31.78125 42.390625 \n", | |
"Q 38.140625 42.390625 41.71875 45.5625 \n", | |
"Q 45.3125 48.734375 45.3125 54.390625 \n", | |
"Q 45.3125 60.0625 41.71875 63.234375 \n", | |
"Q 38.140625 66.40625 31.78125 66.40625 \n", | |
"Q 25.390625 66.40625 21.84375 63.234375 \n", | |
"Q 18.3125 60.0625 18.3125 54.390625 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(156.852261 145.66247)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-56 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
"Q 24.171875 66.40625 20.328125 58.90625 \n", | |
"Q 16.5 51.421875 16.5 36.375 \n", | |
"Q 16.5 21.390625 20.328125 13.890625 \n", | |
"Q 24.171875 6.390625 31.78125 6.390625 \n", | |
"Q 39.453125 6.390625 43.28125 13.890625 \n", | |
"Q 47.125 21.390625 47.125 36.375 \n", | |
"Q 47.125 51.421875 43.28125 58.90625 \n", | |
"Q 39.453125 66.40625 31.78125 66.40625 \n", | |
"z\n", | |
"M 31.78125 74.21875 \n", | |
"Q 44.046875 74.21875 50.515625 64.515625 \n", | |
"Q 56.984375 54.828125 56.984375 36.375 \n", | |
"Q 56.984375 17.96875 50.515625 8.265625 \n", | |
"Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
"Q 6.59375 17.96875 6.59375 36.375 \n", | |
"Q 6.59375 54.828125 13.0625 64.515625 \n", | |
"Q 19.53125 74.21875 31.78125 74.21875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(194.325401 149.261644)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=patch_3><path clip-path=url(#p451a8bd576) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 19.636364 124.764971 \n", | |
"L 37.309091 124.764971 \n", | |
"L 37.309091 124.21818 \n", | |
"L 19.636364 124.21818 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#p451a8bd576) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 37.309091 124.764971 \n", | |
"L 54.981818 124.764971 \n", | |
"L 54.981818 123.944784 \n", | |
"L 37.309091 123.944784 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#p451a8bd576) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 54.981818 124.764971 \n", | |
"L 72.654545 124.764971 \n", | |
"L 72.654545 119.297058 \n", | |
"L 54.981818 119.297058 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#p451a8bd576) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 72.654545 124.764971 \n", | |
"L 90.327273 124.764971 \n", | |
"L 90.327273 93.051077 \n", | |
"L 72.654545 93.051077 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#p451a8bd576) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 90.327273 124.764971 \n", | |
"L 108 124.764971 \n", | |
"L 108 16.226903 \n", | |
"L 90.327273 16.226903 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#p451a8bd576) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 108 124.764971 \n", | |
"L 125.672727 124.764971 \n", | |
"L 125.672727 22.515003 \n", | |
"L 108 22.515003 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#p451a8bd576) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 125.672727 124.764971 \n", | |
"L 143.345455 124.764971 \n", | |
"L 143.345455 37.551763 \n", | |
"L 125.672727 37.551763 \n", | |
"z\n", | |
""/></g><g id=patch_10><path clip-path=url(#p451a8bd576) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 143.345455 124.764971 \n", | |
"L 161.018182 124.764971 \n", | |
"L 161.018182 78.834504 \n", | |
"L 143.345455 78.834504 \n", | |
"z\n", | |
""/></g><g id=patch_11><path clip-path=url(#p451a8bd576) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 161.018182 124.764971 \n", | |
"L 178.690909 124.764971 \n", | |
"L 178.690909 113.008959 \n", | |
"L 161.018182 113.008959 \n", | |
"z\n", | |
""/></g><g id=patch_12><path clip-path=url(#p451a8bd576) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 178.690909 124.764971 \n", | |
"L 196.363636 124.764971 \n", | |
"L 196.363636 119.84385 \n", | |
"L 178.690909 119.84385 \n", | |
"z\n", | |
""/></g><g id=patch_13><path style=fill:none; d="M 10.8 124.764971 \n", | |
"L 10.8 10.8 \n", | |
""/></g><g id=patch_14><path style=fill:none; d="M 205.2 124.764971 \n", | |
"L 205.2 10.8 \n", | |
""/></g><g id=patch_15><path style=fill:none; d="M 10.8 124.764971 \n", | |
"L 205.2 124.764971 \n", | |
""/></g><g id=patch_16><path style=fill:none; d="M 10.8 10.8 \n", | |
"L 205.2 10.8 \n", | |
""/></g></g></g><defs><clippath id=p451a8bd576><rect height=113.964971 width=194.4 x=10.8 y=10.8 /></clippath></defs></svg></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-1857791591089843665, #minifreqtable1857791591089843665" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-1857791591089843665 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#1857791591089843665bottom-1857791591089843665statistics aria-controls=1857791591089843665bottom-1857791591089843665statistics role=tab data-toggle=tab>Statistics</a></li><li role=presentation><a href=#1857791591089843665bottom-1857791591089843665histogram aria-controls=1857791591089843665bottom-1857791591089843665histogram role=tab data-toggle=tab>Histogram</a></li><li role=presentation><a href=#1857791591089843665bottom-1857791591089843665common_values aria-controls=1857791591089843665bottom-1857791591089843665common_values role=tab data-toggle=tab>Common values</a></li><li role=presentation><a href=#1857791591089843665bottom-1857791591089843665extreme_values aria-controls=1857791591089843665bottom-1857791591089843665extreme_values role=tab data-toggle=tab>Extreme values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=1857791591089843665bottom-1857791591089843665statistics><div class=col-sm-6><p class=h4>Quantile statistics</p><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>1</td></tr><tr><th>5-th percentile</th><td>4</td></tr><tr><th>Q1</th><td>5</td></tr><tr><th>median</th><td>6</td></tr><tr><th>Q3</th><td>7</td></tr><tr><th>95-th percentile</th><td>8</td></tr><tr><th>Maximum</th><td>10</td></tr><tr><th>Range</th><td>9</td></tr><tr><th>Interquartile range (IQR)</th><td>2</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Descriptive statistics</p><table class="table table-condensed stats"><tbody><tr><th>Standard deviation</th><td>1.382996547</td></tr><tr><th>Coefficient of variation (CV)</th><td>0.2267462053</td></tr><tr><th>Kurtosis</th><td>0.09629277836</td></tr><tr><th>Mean</th><td>6.099315068</td></tr><tr><th>Median Absolute Deviation (MAD)</th><td>1</td></tr><tr><th>Skewness</th><td>0.2169439278</td></tr><tr><th>Sum</th><td>8905</td></tr><tr><th>Variance</th><td>1.912679448</td></tr><tr><th>Monotonicity</th><td>Not monotonic</td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=1857791591089843665bottom-1857791591089843665histogram><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
"L 432 288 \n", | |
"L 432 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 56.8 248.201709 \n", | |
"L 421.2 248.201709 \n", | |
"L 421.2 10.8 \n", | |
"L 56.8 10.8 \n", | |
"z\n", | |
""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(109.873406 271.073583)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
"L 12.890625 25.390625 \n", | |
"L 37.796875 25.390625 \n", | |
"z\n", | |
"M 35.203125 72.90625 \n", | |
"L 47.609375 72.90625 \n", | |
"L 47.609375 25.390625 \n", | |
"L 58.015625 25.390625 \n", | |
"L 58.015625 17.1875 \n", | |
"L 47.609375 17.1875 \n", | |
"L 47.609375 0 \n", | |
"L 37.796875 0 \n", | |
"L 37.796875 17.1875 \n", | |
"L 4.890625 17.1875 \n", | |
"L 4.890625 26.703125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(183.489568 271.073583)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
"Q 26.375 40.375 22.484375 35.828125 \n", | |
"Q 18.609375 31.296875 18.609375 23.390625 \n", | |
"Q 18.609375 15.53125 22.484375 10.953125 \n", | |
"Q 26.375 6.390625 33.015625 6.390625 \n", | |
"Q 39.65625 6.390625 43.53125 10.953125 \n", | |
"Q 47.40625 15.53125 47.40625 23.390625 \n", | |
"Q 47.40625 31.296875 43.53125 35.828125 \n", | |
"Q 39.65625 40.375 33.015625 40.375 \n", | |
"z\n", | |
"M 52.59375 71.296875 \n", | |
"L 52.59375 62.3125 \n", | |
"Q 48.875 64.0625 45.09375 64.984375 \n", | |
"Q 41.3125 65.921875 37.59375 65.921875 \n", | |
"Q 27.828125 65.921875 22.671875 59.328125 \n", | |
"Q 17.53125 52.734375 16.796875 39.40625 \n", | |
"Q 19.671875 43.65625 24.015625 45.921875 \n", | |
"Q 28.375 48.1875 33.59375 48.1875 \n", | |
"Q 44.578125 48.1875 50.953125 41.515625 \n", | |
"Q 57.328125 34.859375 57.328125 23.390625 \n", | |
"Q 57.328125 12.15625 50.6875 5.359375 \n", | |
"Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
"Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
"Q 6.984375 17.96875 6.984375 36.375 \n", | |
"Q 6.984375 53.65625 15.1875 63.9375 \n", | |
"Q 23.390625 74.21875 37.203125 74.21875 \n", | |
"Q 40.921875 74.21875 44.703125 73.484375 \n", | |
"Q 48.484375 72.75 52.59375 71.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(257.10573 271.073583)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-54 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-56 d="M 31.78125 34.625 \n", | |
"Q 24.75 34.625 20.71875 30.859375 \n", | |
"Q 16.703125 27.09375 16.703125 20.515625 \n", | |
"Q 16.703125 13.921875 20.71875 10.15625 \n", | |
"Q 24.75 6.390625 31.78125 6.390625 \n", | |
"Q 38.8125 6.390625 42.859375 10.171875 \n", | |
"Q 46.921875 13.96875 46.921875 20.515625 \n", | |
"Q 46.921875 27.09375 42.890625 30.859375 \n", | |
"Q 38.875 34.625 31.78125 34.625 \n", | |
"z\n", | |
"M 21.921875 38.8125 \n", | |
"Q 15.578125 40.375 12.03125 44.71875 \n", | |
"Q 8.5 49.078125 8.5 55.328125 \n", | |
"Q 8.5 64.0625 14.71875 69.140625 \n", | |
"Q 20.953125 74.21875 31.78125 74.21875 \n", | |
"Q 42.671875 74.21875 48.875 69.140625 \n", | |
"Q 55.078125 64.0625 55.078125 55.328125 \n", | |
"Q 55.078125 49.078125 51.53125 44.71875 \n", | |
"Q 48 40.375 41.703125 38.8125 \n", | |
"Q 48.828125 37.15625 52.796875 32.3125 \n", | |
"Q 56.78125 27.484375 56.78125 20.515625 \n", | |
"Q 56.78125 9.90625 50.3125 4.234375 \n", | |
"Q 43.84375 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.734375 -1.421875 13.25 4.234375 \n", | |
"Q 6.78125 9.90625 6.78125 20.515625 \n", | |
"Q 6.78125 27.484375 10.78125 32.3125 \n", | |
"Q 14.796875 37.15625 21.921875 38.8125 \n", | |
"z\n", | |
"M 18.3125 54.390625 \n", | |
"Q 18.3125 48.734375 21.84375 45.5625 \n", | |
"Q 25.390625 42.390625 31.78125 42.390625 \n", | |
"Q 38.140625 42.390625 41.71875 45.5625 \n", | |
"Q 45.3125 48.734375 45.3125 54.390625 \n", | |
"Q 45.3125 60.0625 41.71875 63.234375 \n", | |
"Q 38.140625 66.40625 31.78125 66.40625 \n", | |
"Q 25.390625 66.40625 21.84375 63.234375 \n", | |
"Q 18.3125 60.0625 18.3125 54.390625 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(330.721891 271.073583)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-56 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
"Q 24.171875 66.40625 20.328125 58.90625 \n", | |
"Q 16.5 51.421875 16.5 36.375 \n", | |
"Q 16.5 21.390625 20.328125 13.890625 \n", | |
"Q 24.171875 6.390625 31.78125 6.390625 \n", | |
"Q 39.453125 6.390625 43.28125 13.890625 \n", | |
"Q 47.125 21.390625 47.125 36.375 \n", | |
"Q 47.125 51.421875 43.28125 58.90625 \n", | |
"Q 39.453125 66.40625 31.78125 66.40625 \n", | |
"z\n", | |
"M 31.78125 74.21875 \n", | |
"Q 44.046875 74.21875 50.515625 64.515625 \n", | |
"Q 56.984375 54.828125 56.984375 36.375 \n", | |
"Q 56.984375 17.96875 50.515625 8.265625 \n", | |
"Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
"Q 6.59375 17.96875 6.59375 36.375 \n", | |
"Q 6.59375 54.828125 13.0625 64.515625 \n", | |
"Q 19.53125 74.21875 31.78125 74.21875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(402.08857 275.57255)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_6><g style=fill:#262626; transform="translate(37.4375 252.000928)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_7><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
"L 49.515625 72.90625 \n", | |
"L 49.515625 64.59375 \n", | |
"L 19.828125 64.59375 \n", | |
"L 19.828125 46.734375 \n", | |
"Q 21.96875 47.46875 24.109375 47.828125 \n", | |
"Q 26.265625 48.1875 28.421875 48.1875 \n", | |
"Q 40.625 48.1875 47.75 41.5 \n", | |
"Q 54.890625 34.8125 54.890625 23.390625 \n", | |
"Q 54.890625 11.625 47.5625 5.09375 \n", | |
"Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
"Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
"Q 12.796875 0.140625 7.71875 1.703125 \n", | |
"L 7.71875 11.625 \n", | |
"Q 12.109375 9.234375 16.796875 8.0625 \n", | |
"Q 21.484375 6.890625 26.703125 6.890625 \n", | |
"Q 35.15625 6.890625 40.078125 11.328125 \n", | |
"Q 45.015625 15.765625 45.015625 23.390625 \n", | |
"Q 45.015625 31 40.078125 35.4375 \n", | |
"Q 35.15625 39.890625 26.703125 39.890625 \n", | |
"Q 22.75 39.890625 18.8125 39.015625 \n", | |
"Q 14.890625 38.140625 10.796875 36.28125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(31.075 223.525252)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_3><g id=text_8><g style=fill:#262626; transform="translate(24.7125 195.049576)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_9><g style=fill:#262626; transform="translate(24.7125 166.5739)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_5><g id=text_10><g style=fill:#262626; transform="translate(24.7125 138.098225)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_6><g id=text_11><g style=fill:#262626; transform="translate(24.7125 109.622549)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_7><g id=text_12><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
"Q 47.65625 37.796875 51.625 33 \n", | |
"Q 55.609375 28.21875 55.609375 21.1875 \n", | |
"Q 55.609375 10.40625 48.1875 4.484375 \n", | |
"Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
"Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
"Q 12.796875 0.390625 7.625 2.203125 \n", | |
"L 7.625 11.71875 \n", | |
"Q 11.71875 9.328125 16.59375 8.109375 \n", | |
"Q 21.484375 6.890625 26.8125 6.890625 \n", | |
"Q 36.078125 6.890625 40.9375 10.546875 \n", | |
"Q 45.796875 14.203125 45.796875 21.1875 \n", | |
"Q 45.796875 27.640625 41.28125 31.265625 \n", | |
"Q 36.765625 34.90625 28.71875 34.90625 \n", | |
"L 20.21875 34.90625 \n", | |
"L 20.21875 43.015625 \n", | |
"L 29.109375 43.015625 \n", | |
"Q 36.375 43.015625 40.234375 45.921875 \n", | |
"Q 44.09375 48.828125 44.09375 54.296875 \n", | |
"Q 44.09375 59.90625 40.109375 62.90625 \n", | |
"Q 36.140625 65.921875 28.71875 65.921875 \n", | |
"Q 24.65625 65.921875 20.015625 65.03125 \n", | |
"Q 15.375 64.15625 9.8125 62.3125 \n", | |
"L 9.8125 71.09375 \n", | |
"Q 15.4375 72.65625 20.34375 73.4375 \n", | |
"Q 25.25 74.21875 29.59375 74.21875 \n", | |
"Q 40.828125 74.21875 47.359375 69.109375 \n", | |
"Q 53.90625 64.015625 53.90625 55.328125 \n", | |
"Q 53.90625 49.265625 50.4375 45.09375 \n", | |
"Q 46.96875 40.921875 40.578125 39.3125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(24.7125 81.146873)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-51 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_8><g id=text_13><g style=fill:#262626; transform="translate(24.7125 52.671197)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-51 /><use x=63.623047 xlink:href=#DejaVuSans-53 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_9><g id=text_14><g style=fill:#262626; transform="translate(24.7125 24.195521)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_15><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
"L 51.703125 72.90625 \n", | |
"L 51.703125 64.59375 \n", | |
"L 19.671875 64.59375 \n", | |
"L 19.671875 43.109375 \n", | |
"L 48.578125 43.109375 \n", | |
"L 48.578125 34.8125 \n", | |
"L 19.671875 34.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
"Q 39.59375 47.171875 37.8125 47.578125 \n", | |
"Q 36.03125 48 33.890625 48 \n", | |
"Q 26.265625 48 22.1875 43.046875 \n", | |
"Q 18.109375 38.09375 18.109375 28.8125 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 20.953125 51.171875 25.484375 53.578125 \n", | |
"Q 30.03125 56 36.53125 56 \n", | |
"Q 37.453125 56 38.578125 55.875 \n", | |
"Q 39.703125 55.765625 41.0625 55.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
"Q 14.796875 17.390625 18.875 11.75 \n", | |
"Q 22.953125 6.109375 30.078125 6.109375 \n", | |
"Q 37.203125 6.109375 41.296875 11.75 \n", | |
"Q 45.40625 17.390625 45.40625 27.296875 \n", | |
"Q 45.40625 37.203125 41.296875 42.84375 \n", | |
"Q 37.203125 48.484375 30.078125 48.484375 \n", | |
"Q 22.953125 48.484375 18.875 42.84375 \n", | |
"Q 14.796875 37.203125 14.796875 27.296875 \n", | |
"z\n", | |
"M 45.40625 8.203125 \n", | |
"Q 42.578125 3.328125 38.25 0.953125 \n", | |
"Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
"Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
"Q 5.515625 14.40625 5.515625 27.296875 \n", | |
"Q 5.515625 40.1875 11.734375 48.09375 \n", | |
"Q 17.96875 56 27.875 56 \n", | |
"Q 33.9375 56 38.25 53.625 \n", | |
"Q 42.578125 51.265625 45.40625 46.390625 \n", | |
"L 45.40625 54.6875 \n", | |
"L 54.390625 54.6875 \n", | |
"L 54.390625 -20.796875 \n", | |
"L 45.40625 -20.796875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
"L 8.5 54.6875 \n", | |
"L 17.484375 54.6875 \n", | |
"L 17.484375 21.921875 \n", | |
"Q 17.484375 14.15625 20.5 10.265625 \n", | |
"Q 23.53125 6.390625 29.59375 6.390625 \n", | |
"Q 36.859375 6.390625 41.078125 11.03125 \n", | |
"Q 45.3125 15.671875 45.3125 23.6875 \n", | |
"L 45.3125 54.6875 \n", | |
"L 54.296875 54.6875 \n", | |
"L 54.296875 0 \n", | |
"L 45.3125 0 \n", | |
"L 45.3125 8.40625 \n", | |
"Q 42.046875 3.421875 37.71875 1 \n", | |
"Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
"Q 18.265625 -1.421875 13.375 4.4375 \n", | |
"Q 8.5 10.296875 8.5 21.578125 \n", | |
"z\n", | |
"M 31.109375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
"L 54.890625 0 \n", | |
"L 45.90625 0 \n", | |
"L 45.90625 32.71875 \n", | |
"Q 45.90625 40.484375 42.875 44.328125 \n", | |
"Q 39.84375 48.1875 33.796875 48.1875 \n", | |
"Q 26.515625 48.1875 22.3125 43.546875 \n", | |
"Q 18.109375 38.921875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.34375 51.125 25.703125 53.5625 \n", | |
"Q 30.078125 56 35.796875 56 \n", | |
"Q 45.21875 56 50.046875 50.171875 \n", | |
"Q 54.890625 44.34375 54.890625 33.015625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
"L 48.78125 44.1875 \n", | |
"Q 44.96875 46.296875 41.140625 47.34375 \n", | |
"Q 37.3125 48.390625 33.40625 48.390625 \n", | |
"Q 24.65625 48.390625 19.8125 42.84375 \n", | |
"Q 14.984375 37.3125 14.984375 27.296875 \n", | |
"Q 14.984375 17.28125 19.8125 11.734375 \n", | |
"Q 24.65625 6.203125 33.40625 6.203125 \n", | |
"Q 37.3125 6.203125 41.140625 7.25 \n", | |
"Q 44.96875 8.296875 48.78125 10.40625 \n", | |
"L 48.78125 2.09375 \n", | |
"Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
"Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
"Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
"Q 5.515625 14.109375 5.515625 27.296875 \n", | |
"Q 5.515625 40.671875 12.859375 48.328125 \n", | |
"Q 20.21875 56 33.015625 56 \n", | |
"Q 37.15625 56 41.109375 55.140625 \n", | |
"Q 45.0625 54.296875 48.78125 52.59375 \n", | |
"z\n", | |
""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
"Q 28.375 -14.84375 24.75 -17.8125 \n", | |
"Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
"L 7.90625 -20.796875 \n", | |
"L 7.90625 -13.28125 \n", | |
"L 13.1875 -13.28125 \n", | |
"Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
"Q 21 -9.765625 23.484375 -3.21875 \n", | |
"L 25.09375 0.875 \n", | |
"L 2.984375 54.6875 \n", | |
"L 12.5 54.6875 \n", | |
"L 29.59375 11.921875 \n", | |
"L 46.6875 54.6875 \n", | |
"L 56.203125 54.6875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(18.424844 157.913511)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#pf2bc915b4c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 73.363636 248.201709 \n", | |
"L 106.490909 248.201709 \n", | |
"L 106.490909 247.062682 \n", | |
"L 73.363636 247.062682 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#pf2bc915b4c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 106.490909 248.201709 \n", | |
"L 139.618182 248.201709 \n", | |
"L 139.618182 246.493169 \n", | |
"L 106.490909 246.493169 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#pf2bc915b4c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 139.618182 248.201709 \n", | |
"L 172.745455 248.201709 \n", | |
"L 172.745455 236.811439 \n", | |
"L 139.618182 236.811439 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#pf2bc915b4c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 172.745455 248.201709 \n", | |
"L 205.872727 248.201709 \n", | |
"L 205.872727 182.138141 \n", | |
"L 172.745455 182.138141 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#pf2bc915b4c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 205.872727 248.201709 \n", | |
"L 239 248.201709 \n", | |
"L 239 22.104843 \n", | |
"L 205.872727 22.104843 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#pf2bc915b4c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 239 248.201709 \n", | |
"L 272.127273 248.201709 \n", | |
"L 272.127273 35.203654 \n", | |
"L 239 35.203654 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#pf2bc915b4c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 272.127273 248.201709 \n", | |
"L 305.254545 248.201709 \n", | |
"L 305.254545 66.526898 \n", | |
"L 272.127273 66.526898 \n", | |
"z\n", | |
""/></g><g id=patch_10><path clip-path=url(#pf2bc915b4c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 305.254545 248.201709 \n", | |
"L 338.381818 248.201709 \n", | |
"L 338.381818 152.523438 \n", | |
"L 305.254545 152.523438 \n", | |
"z\n", | |
""/></g><g id=patch_11><path clip-path=url(#pf2bc915b4c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 338.381818 248.201709 \n", | |
"L 371.509091 248.201709 \n", | |
"L 371.509091 223.712628 \n", | |
"L 338.381818 223.712628 \n", | |
"z\n", | |
""/></g><g id=patch_12><path clip-path=url(#pf2bc915b4c) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 371.509091 248.201709 \n", | |
"L 404.636364 248.201709 \n", | |
"L 404.636364 237.950466 \n", | |
"L 371.509091 237.950466 \n", | |
"z\n", | |
""/></g><g id=patch_13><path style=fill:none; d="M 56.8 248.201709 \n", | |
"L 56.8 10.8 \n", | |
""/></g><g id=patch_14><path style=fill:none; d="M 421.2 248.201709 \n", | |
"L 421.2 10.8 \n", | |
""/></g><g id=patch_15><path style=fill:none; d="M 56.8 248.201709 \n", | |
"L 421.2 248.201709 \n", | |
""/></g><g id=patch_16><path style=fill:none; d="M 56.8 10.8 \n", | |
"L 421.2 10.8 \n", | |
""/></g></g></g><defs><clippath id=pf2bc915b4c><rect height=237.401709 width=364.4 x=56.8 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"><strong>Histogram with fixed size bins</strong> (bins=10) </div></div><div role=tabpanel class="tab-pane col-sm-12" id=1857791591089843665bottom-1857791591089843665common_values><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=5>5</td><td>397</td><td><div class=bar style=width:100.0%> 27.2% </div></td></tr><tr class><td title=6>6</td><td>374</td><td><div class=bar style=width:94.2%> 25.6% </div></td></tr><tr class><td title=7>7</td><td>319</td><td><div class=bar style=width:80.4%> 21.8% </div></td></tr><tr class><td title=8>8</td><td>168</td><td><div class=bar style=width:42.3%> 11.5% </div></td></tr><tr class><td title=4>4</td><td>116</td><td><div class=bar style=width:29.2%> &nbsp; </div> 7.9% </td></tr><tr class><td title=9>9</td><td>43</td><td><div class=bar style=width:10.8%> &nbsp; </div> 2.9% </td></tr><tr class><td title=3>3</td><td>20</td><td><div class=bar style=width:5.0%> &nbsp; </div> 1.4% </td></tr><tr class><td title=10>10</td><td>18</td><td><div class=bar style=width:4.5%> &nbsp; </div> 1.2% </td></tr><tr class><td title=2>2</td><td>3</td><td><div class=bar style=width:0.8%> &nbsp; </div> 0.2% </td></tr><tr class><td title=1>1</td><td>2</td><td><div class=bar style=width:0.5%> &nbsp; </div> 0.1% </td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=1857791591089843665bottom-1857791591089843665extreme_values><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#1857791591089843665extreme_values-1857791591089843665firstn aria-controls=1857791591089843665extreme_values-1857791591089843665firstn role=tab data-toggle=tab>Minimum 5 values</a></li><li role=presentation><a href=#1857791591089843665extreme_values-1857791591089843665lastn aria-controls=1857791591089843665extreme_values-1857791591089843665lastn role=tab data-toggle=tab>Maximum 5 values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=1857791591089843665extreme_values-1857791591089843665firstn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=1>1</td><td>2</td><td><div class=bar style=width:0.5%> &nbsp; </div> 0.1% </td></tr><tr class><td title=2>2</td><td>3</td><td><div class=bar style=width:0.8%> &nbsp; </div> 0.2% </td></tr><tr class><td title=3>3</td><td>20</td><td><div class=bar style=width:5.0%> &nbsp; </div> 1.4% </td></tr><tr class><td title=4>4</td><td>116</td><td><div class=bar style=width:29.2%> &nbsp; </div> 7.9% </td></tr><tr class><td title=5>5</td><td>397</td><td><div class=bar style=width:100.0%> 27.2% </div></td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=1857791591089843665extreme_values-1857791591089843665lastn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=10>10</td><td>18</td><td><div class=bar style=width:4.8%> &nbsp; </div> 1.2% </td></tr><tr class><td title=9>9</td><td>43</td><td><div class=bar style=width:11.5%> &nbsp; </div> 2.9% </td></tr><tr class><td title=8>8</td><td>168</td><td><div class=bar style=width:44.9%> 11.5% </div></td></tr><tr class><td title=7>7</td><td>319</td><td><div class=bar style=width:85.3%> 21.8% </div></td></tr><tr class><td title=6>6</td><td>374</td><td><div class=bar style=width:100.0%> 25.6% </div></td></tr></tbody></table></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_7563046253966581377></a><div class=variable><div class=col-sm-3><p class=h4 title=OverallCond><a href=#pp_var_7563046253966581377>OverallCond</a><br><small>Real number (&Ropf;<sub>&ge;0</sub>)</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>9</td></tr><tr><th>Distinct (%)</th><td>0.6%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Infinite</th><td>0</td></tr><tr><th>Infinite (%)</th><td>0.0%</td></tr><tr><th>Mean</th><td>5.575342466</td></tr></tbody></table></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>1</td></tr><tr><th>Maximum</th><td>9</td></tr><tr><th>Zeros</th><td>0</td></tr><tr><th>Zeros (%)</th><td>0.0%</td></tr><tr><th>Negative</th><td>0</td></tr><tr><th>Negative (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-3><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=162pt version=1.1 viewbox="0 0 216 162" width=216pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 162 \n", | |
"L 216 162 \n", | |
"L 216 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 10.8 128.212117 \n", | |
"L 205.2 128.212117 \n", | |
"L 205.2 10.8 \n", | |
"L 10.8 10.8 \n", | |
"z\n", | |
""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(41.488624 149.109616)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-50 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
"L 12.890625 25.390625 \n", | |
"L 37.796875 25.390625 \n", | |
"z\n", | |
"M 35.203125 72.90625 \n", | |
"L 47.609375 72.90625 \n", | |
"L 47.609375 25.390625 \n", | |
"L 58.015625 25.390625 \n", | |
"L 58.015625 17.1875 \n", | |
"L 47.609375 17.1875 \n", | |
"L 47.609375 0 \n", | |
"L 37.796875 0 \n", | |
"L 37.796875 17.1875 \n", | |
"L 4.890625 17.1875 \n", | |
"L 4.890625 26.703125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(85.670442 149.109616)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-52 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
"Q 26.375 40.375 22.484375 35.828125 \n", | |
"Q 18.609375 31.296875 18.609375 23.390625 \n", | |
"Q 18.609375 15.53125 22.484375 10.953125 \n", | |
"Q 26.375 6.390625 33.015625 6.390625 \n", | |
"Q 39.65625 6.390625 43.53125 10.953125 \n", | |
"Q 47.40625 15.53125 47.40625 23.390625 \n", | |
"Q 47.40625 31.296875 43.53125 35.828125 \n", | |
"Q 39.65625 40.375 33.015625 40.375 \n", | |
"z\n", | |
"M 52.59375 71.296875 \n", | |
"L 52.59375 62.3125 \n", | |
"Q 48.875 64.0625 45.09375 64.984375 \n", | |
"Q 41.3125 65.921875 37.59375 65.921875 \n", | |
"Q 27.828125 65.921875 22.671875 59.328125 \n", | |
"Q 17.53125 52.734375 16.796875 39.40625 \n", | |
"Q 19.671875 43.65625 24.015625 45.921875 \n", | |
"Q 28.375 48.1875 33.59375 48.1875 \n", | |
"Q 44.578125 48.1875 50.953125 41.515625 \n", | |
"Q 57.328125 34.859375 57.328125 23.390625 \n", | |
"Q 57.328125 12.15625 50.6875 5.359375 \n", | |
"Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
"Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
"Q 6.984375 17.96875 6.984375 36.375 \n", | |
"Q 6.984375 53.65625 15.1875 63.9375 \n", | |
"Q 23.390625 74.21875 37.203125 74.21875 \n", | |
"Q 40.921875 74.21875 44.703125 73.484375 \n", | |
"Q 48.484375 72.75 52.59375 71.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(129.852261 149.109616)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-54 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-56 d="M 31.78125 34.625 \n", | |
"Q 24.75 34.625 20.71875 30.859375 \n", | |
"Q 16.703125 27.09375 16.703125 20.515625 \n", | |
"Q 16.703125 13.921875 20.71875 10.15625 \n", | |
"Q 24.75 6.390625 31.78125 6.390625 \n", | |
"Q 38.8125 6.390625 42.859375 10.171875 \n", | |
"Q 46.921875 13.96875 46.921875 20.515625 \n", | |
"Q 46.921875 27.09375 42.890625 30.859375 \n", | |
"Q 38.875 34.625 31.78125 34.625 \n", | |
"z\n", | |
"M 21.921875 38.8125 \n", | |
"Q 15.578125 40.375 12.03125 44.71875 \n", | |
"Q 8.5 49.078125 8.5 55.328125 \n", | |
"Q 8.5 64.0625 14.71875 69.140625 \n", | |
"Q 20.953125 74.21875 31.78125 74.21875 \n", | |
"Q 42.671875 74.21875 48.875 69.140625 \n", | |
"Q 55.078125 64.0625 55.078125 55.328125 \n", | |
"Q 55.078125 49.078125 51.53125 44.71875 \n", | |
"Q 48 40.375 41.703125 38.8125 \n", | |
"Q 48.828125 37.15625 52.796875 32.3125 \n", | |
"Q 56.78125 27.484375 56.78125 20.515625 \n", | |
"Q 56.78125 9.90625 50.3125 4.234375 \n", | |
"Q 43.84375 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.734375 -1.421875 13.25 4.234375 \n", | |
"Q 6.78125 9.90625 6.78125 20.515625 \n", | |
"Q 6.78125 27.484375 10.78125 32.3125 \n", | |
"Q 14.796875 37.15625 21.921875 38.8125 \n", | |
"z\n", | |
"M 18.3125 54.390625 \n", | |
"Q 18.3125 48.734375 21.84375 45.5625 \n", | |
"Q 25.390625 42.390625 31.78125 42.390625 \n", | |
"Q 38.140625 42.390625 41.71875 45.5625 \n", | |
"Q 45.3125 48.734375 45.3125 54.390625 \n", | |
"Q 45.3125 60.0625 41.71875 63.234375 \n", | |
"Q 38.140625 66.40625 31.78125 66.40625 \n", | |
"Q 25.390625 66.40625 21.84375 63.234375 \n", | |
"Q 18.3125 60.0625 18.3125 54.390625 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(174.034079 149.109616)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-56 /></g></g></g></g><g id=patch_3><path clip-path=url(#p41d8b7157a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 19.636364 128.212117 \n", | |
"L 39.272727 128.212117 \n", | |
"L 39.272727 128.075916 \n", | |
"L 19.636364 128.075916 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#p41d8b7157a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 39.272727 128.212117 \n", | |
"L 58.909091 128.212117 \n", | |
"L 58.909091 127.531111 \n", | |
"L 39.272727 127.531111 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#p41d8b7157a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 58.909091 128.212117 \n", | |
"L 78.545455 128.212117 \n", | |
"L 78.545455 124.80709 \n", | |
"L 58.909091 124.80709 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#p41d8b7157a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 78.545455 128.212117 \n", | |
"L 98.181818 128.212117 \n", | |
"L 98.181818 120.448657 \n", | |
"L 78.545455 120.448657 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#p41d8b7157a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 98.181818 128.212117 \n", | |
"L 117.818182 128.212117 \n", | |
"L 117.818182 16.391053 \n", | |
"L 98.181818 16.391053 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#p41d8b7157a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 117.818182 128.212117 \n", | |
"L 137.454545 128.212117 \n", | |
"L 137.454545 93.889452 \n", | |
"L 117.818182 93.889452 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#p41d8b7157a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 137.454545 128.212117 \n", | |
"L 157.090909 128.212117 \n", | |
"L 157.090909 100.290901 \n", | |
"L 137.454545 100.290901 \n", | |
"z\n", | |
""/></g><g id=patch_10><path clip-path=url(#p41d8b7157a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 157.090909 128.212117 \n", | |
"L 176.727273 128.212117 \n", | |
"L 176.727273 118.405641 \n", | |
"L 157.090909 118.405641 \n", | |
"z\n", | |
""/></g><g id=patch_11><path clip-path=url(#p41d8b7157a) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 176.727273 128.212117 \n", | |
"L 196.363636 128.212117 \n", | |
"L 196.363636 125.215694 \n", | |
"L 176.727273 125.215694 \n", | |
"z\n", | |
""/></g><g id=patch_12><path style=fill:none; d="M 10.8 128.212117 \n", | |
"L 10.8 10.8 \n", | |
""/></g><g id=patch_13><path style=fill:none; d="M 205.2 128.212117 \n", | |
"L 205.2 10.8 \n", | |
""/></g><g id=patch_14><path style=fill:none; d="M 10.8 128.212117 \n", | |
"L 205.2 128.212117 \n", | |
""/></g><g id=patch_15><path style=fill:none; d="M 10.8 10.8 \n", | |
"L 205.2 10.8 \n", | |
""/></g></g></g><defs><clippath id=p41d8b7157a><rect height=117.412117 width=194.4 x=10.8 y=10.8 /></clippath></defs></svg></div><div class="col-sm-12 text-right"><button class="btn btn-default btn-sm" data-toggle=collapse data-target="#bottom-7563046253966581377, #minifreqtable7563046253966581377" aria-expanded=true aria-controls=collapseExample>Toggle details</button></div><div id=bottom-7563046253966581377 class=collapse><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#7563046253966581377bottom-7563046253966581377statistics aria-controls=7563046253966581377bottom-7563046253966581377statistics role=tab data-toggle=tab>Statistics</a></li><li role=presentation><a href=#7563046253966581377bottom-7563046253966581377histogram aria-controls=7563046253966581377bottom-7563046253966581377histogram role=tab data-toggle=tab>Histogram</a></li><li role=presentation><a href=#7563046253966581377bottom-7563046253966581377common_values aria-controls=7563046253966581377bottom-7563046253966581377common_values role=tab data-toggle=tab>Common values</a></li><li role=presentation><a href=#7563046253966581377bottom-7563046253966581377extreme_values aria-controls=7563046253966581377bottom-7563046253966581377extreme_values role=tab data-toggle=tab>Extreme values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=7563046253966581377bottom-7563046253966581377statistics><div class=col-sm-6><p class=h4>Quantile statistics</p><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>1</td></tr><tr><th>5-th percentile</th><td>4</td></tr><tr><th>Q1</th><td>5</td></tr><tr><th>median</th><td>5</td></tr><tr><th>Q3</th><td>6</td></tr><tr><th>95-th percentile</th><td>8</td></tr><tr><th>Maximum</th><td>9</td></tr><tr><th>Range</th><td>8</td></tr><tr><th>Interquartile range (IQR)</th><td>1</td></tr></tbody></table></div><div class=col-sm-6><p class=h4>Descriptive statistics</p><table class="table table-condensed stats"><tbody><tr><th>Standard deviation</th><td>1.112799337</td></tr><tr><th>Coefficient of variation (CV)</th><td>0.1995930014</td></tr><tr><th>Kurtosis</th><td>1.106413461</td></tr><tr><th>Mean</th><td>5.575342466</td></tr><tr><th>Median Absolute Deviation (MAD)</th><td>0</td></tr><tr><th>Skewness</th><td>0.6930674725</td></tr><tr><th>Sum</th><td>8140</td></tr><tr><th>Variance</th><td>1.238322364</td></tr><tr><th>Monotonicity</th><td>Not monotonic</td></tr></tbody></table></div></div><div role=tabpanel class="tab-pane col-sm-12" id=7563046253966581377bottom-7563046253966581377histogram><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=288pt version=1.1 viewbox="0 0 432 288" width=432pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 288 \n", | |
"L 432 288 \n", | |
"L 432 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 56.675 252.621126 \n", | |
"L 421.2 252.621126 \n", | |
"L 421.2 10.8 \n", | |
"L 56.675 10.8 \n", | |
"z\n", | |
""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(72.946008 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(114.369303 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-51 d="M 40.578125 39.3125 \n", | |
"Q 47.65625 37.796875 51.625 33 \n", | |
"Q 55.609375 28.21875 55.609375 21.1875 \n", | |
"Q 55.609375 10.40625 48.1875 4.484375 \n", | |
"Q 40.765625 -1.421875 27.09375 -1.421875 \n", | |
"Q 22.515625 -1.421875 17.65625 -0.515625 \n", | |
"Q 12.796875 0.390625 7.625 2.203125 \n", | |
"L 7.625 11.71875 \n", | |
"Q 11.71875 9.328125 16.59375 8.109375 \n", | |
"Q 21.484375 6.890625 26.8125 6.890625 \n", | |
"Q 36.078125 6.890625 40.9375 10.546875 \n", | |
"Q 45.796875 14.203125 45.796875 21.1875 \n", | |
"Q 45.796875 27.640625 41.28125 31.265625 \n", | |
"Q 36.765625 34.90625 28.71875 34.90625 \n", | |
"L 20.21875 34.90625 \n", | |
"L 20.21875 43.015625 \n", | |
"L 29.109375 43.015625 \n", | |
"Q 36.375 43.015625 40.234375 45.921875 \n", | |
"Q 44.09375 48.828125 44.09375 54.296875 \n", | |
"Q 44.09375 59.90625 40.109375 62.90625 \n", | |
"Q 36.140625 65.921875 28.71875 65.921875 \n", | |
"Q 24.65625 65.921875 20.015625 65.03125 \n", | |
"Q 15.375 64.15625 9.8125 62.3125 \n", | |
"L 9.8125 71.09375 \n", | |
"Q 15.4375 72.65625 20.34375 73.4375 \n", | |
"Q 25.25 74.21875 29.59375 74.21875 \n", | |
"Q 40.828125 74.21875 47.359375 69.109375 \n", | |
"Q 53.90625 64.015625 53.90625 55.328125 \n", | |
"Q 53.90625 49.265625 50.4375 45.09375 \n", | |
"Q 46.96875 40.921875 40.578125 39.3125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(155.792598 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-51 /></g></g></g><g id=xtick_4><g id=text_4><defs><path id=DejaVuSans-52 d="M 37.796875 64.3125 \n", | |
"L 12.890625 25.390625 \n", | |
"L 37.796875 25.390625 \n", | |
"z\n", | |
"M 35.203125 72.90625 \n", | |
"L 47.609375 72.90625 \n", | |
"L 47.609375 25.390625 \n", | |
"L 58.015625 25.390625 \n", | |
"L 58.015625 17.1875 \n", | |
"L 47.609375 17.1875 \n", | |
"L 47.609375 0 \n", | |
"L 37.796875 0 \n", | |
"L 37.796875 17.1875 \n", | |
"L 4.890625 17.1875 \n", | |
"L 4.890625 26.703125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(197.215894 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /></g></g></g><g id=xtick_5><g id=text_5><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
"L 49.515625 72.90625 \n", | |
"L 49.515625 64.59375 \n", | |
"L 19.828125 64.59375 \n", | |
"L 19.828125 46.734375 \n", | |
"Q 21.96875 47.46875 24.109375 47.828125 \n", | |
"Q 26.265625 48.1875 28.421875 48.1875 \n", | |
"Q 40.625 48.1875 47.75 41.5 \n", | |
"Q 54.890625 34.8125 54.890625 23.390625 \n", | |
"Q 54.890625 11.625 47.5625 5.09375 \n", | |
"Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
"Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
"Q 12.796875 0.140625 7.71875 1.703125 \n", | |
"L 7.71875 11.625 \n", | |
"Q 12.109375 9.234375 16.796875 8.0625 \n", | |
"Q 21.484375 6.890625 26.703125 6.890625 \n", | |
"Q 35.15625 6.890625 40.078125 11.328125 \n", | |
"Q 45.015625 15.765625 45.015625 23.390625 \n", | |
"Q 45.015625 31 40.078125 35.4375 \n", | |
"Q 35.15625 39.890625 26.703125 39.890625 \n", | |
"Q 22.75 39.890625 18.8125 39.015625 \n", | |
"Q 14.890625 38.140625 10.796875 36.28125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(238.639189 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /></g></g></g><g id=xtick_6><g id=text_6><defs><path id=DejaVuSans-54 d="M 33.015625 40.375 \n", | |
"Q 26.375 40.375 22.484375 35.828125 \n", | |
"Q 18.609375 31.296875 18.609375 23.390625 \n", | |
"Q 18.609375 15.53125 22.484375 10.953125 \n", | |
"Q 26.375 6.390625 33.015625 6.390625 \n", | |
"Q 39.65625 6.390625 43.53125 10.953125 \n", | |
"Q 47.40625 15.53125 47.40625 23.390625 \n", | |
"Q 47.40625 31.296875 43.53125 35.828125 \n", | |
"Q 39.65625 40.375 33.015625 40.375 \n", | |
"z\n", | |
"M 52.59375 71.296875 \n", | |
"L 52.59375 62.3125 \n", | |
"Q 48.875 64.0625 45.09375 64.984375 \n", | |
"Q 41.3125 65.921875 37.59375 65.921875 \n", | |
"Q 27.828125 65.921875 22.671875 59.328125 \n", | |
"Q 17.53125 52.734375 16.796875 39.40625 \n", | |
"Q 19.671875 43.65625 24.015625 45.921875 \n", | |
"Q 28.375 48.1875 33.59375 48.1875 \n", | |
"Q 44.578125 48.1875 50.953125 41.515625 \n", | |
"Q 57.328125 34.859375 57.328125 23.390625 \n", | |
"Q 57.328125 12.15625 50.6875 5.359375 \n", | |
"Q 44.046875 -1.421875 33.015625 -1.421875 \n", | |
"Q 20.359375 -1.421875 13.671875 8.265625 \n", | |
"Q 6.984375 17.96875 6.984375 36.375 \n", | |
"Q 6.984375 53.65625 15.1875 63.9375 \n", | |
"Q 23.390625 74.21875 37.203125 74.21875 \n", | |
"Q 40.921875 74.21875 44.703125 73.484375 \n", | |
"Q 48.484375 72.75 52.59375 71.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(280.062485 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-54 /></g></g></g><g id=xtick_7><g id=text_7><defs><path id=DejaVuSans-55 d="M 8.203125 72.90625 \n", | |
"L 55.078125 72.90625 \n", | |
"L 55.078125 68.703125 \n", | |
"L 28.609375 0 \n", | |
"L 18.3125 0 \n", | |
"L 43.21875 64.59375 \n", | |
"L 8.203125 64.59375 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(321.48578 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-55 /></g></g></g><g id=xtick_8><g id=text_8><defs><path id=DejaVuSans-56 d="M 31.78125 34.625 \n", | |
"Q 24.75 34.625 20.71875 30.859375 \n", | |
"Q 16.703125 27.09375 16.703125 20.515625 \n", | |
"Q 16.703125 13.921875 20.71875 10.15625 \n", | |
"Q 24.75 6.390625 31.78125 6.390625 \n", | |
"Q 38.8125 6.390625 42.859375 10.171875 \n", | |
"Q 46.921875 13.96875 46.921875 20.515625 \n", | |
"Q 46.921875 27.09375 42.890625 30.859375 \n", | |
"Q 38.875 34.625 31.78125 34.625 \n", | |
"z\n", | |
"M 21.921875 38.8125 \n", | |
"Q 15.578125 40.375 12.03125 44.71875 \n", | |
"Q 8.5 49.078125 8.5 55.328125 \n", | |
"Q 8.5 64.0625 14.71875 69.140625 \n", | |
"Q 20.953125 74.21875 31.78125 74.21875 \n", | |
"Q 42.671875 74.21875 48.875 69.140625 \n", | |
"Q 55.078125 64.0625 55.078125 55.328125 \n", | |
"Q 55.078125 49.078125 51.53125 44.71875 \n", | |
"Q 48 40.375 41.703125 38.8125 \n", | |
"Q 48.828125 37.15625 52.796875 32.3125 \n", | |
"Q 56.78125 27.484375 56.78125 20.515625 \n", | |
"Q 56.78125 9.90625 50.3125 4.234375 \n", | |
"Q 43.84375 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.734375 -1.421875 13.25 4.234375 \n", | |
"Q 6.78125 9.90625 6.78125 20.515625 \n", | |
"Q 6.78125 27.484375 10.78125 32.3125 \n", | |
"Q 14.796875 37.15625 21.921875 38.8125 \n", | |
"z\n", | |
"M 18.3125 54.390625 \n", | |
"Q 18.3125 48.734375 21.84375 45.5625 \n", | |
"Q 25.390625 42.390625 31.78125 42.390625 \n", | |
"Q 38.140625 42.390625 41.71875 45.5625 \n", | |
"Q 45.3125 48.734375 45.3125 54.390625 \n", | |
"Q 45.3125 60.0625 41.71875 63.234375 \n", | |
"Q 38.140625 66.40625 31.78125 66.40625 \n", | |
"Q 25.390625 66.40625 21.84375 63.234375 \n", | |
"Q 18.3125 60.0625 18.3125 54.390625 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(362.909076 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-56 /></g></g></g><g id=xtick_9><g id=text_9><defs><path id=DejaVuSans-57 d="M 10.984375 1.515625 \n", | |
"L 10.984375 10.5 \n", | |
"Q 14.703125 8.734375 18.5 7.8125 \n", | |
"Q 22.3125 6.890625 25.984375 6.890625 \n", | |
"Q 35.75 6.890625 40.890625 13.453125 \n", | |
"Q 46.046875 20.015625 46.78125 33.40625 \n", | |
"Q 43.953125 29.203125 39.59375 26.953125 \n", | |
"Q 35.25 24.703125 29.984375 24.703125 \n", | |
"Q 19.046875 24.703125 12.671875 31.3125 \n", | |
"Q 6.296875 37.9375 6.296875 49.421875 \n", | |
"Q 6.296875 60.640625 12.9375 67.421875 \n", | |
"Q 19.578125 74.21875 30.609375 74.21875 \n", | |
"Q 43.265625 74.21875 49.921875 64.515625 \n", | |
"Q 56.59375 54.828125 56.59375 36.375 \n", | |
"Q 56.59375 19.140625 48.40625 8.859375 \n", | |
"Q 40.234375 -1.421875 26.421875 -1.421875 \n", | |
"Q 22.703125 -1.421875 18.890625 -0.6875 \n", | |
"Q 15.09375 0.046875 10.984375 1.515625 \n", | |
"z\n", | |
"M 30.609375 32.421875 \n", | |
"Q 37.25 32.421875 41.125 36.953125 \n", | |
"Q 45.015625 41.5 45.015625 49.421875 \n", | |
"Q 45.015625 57.28125 41.125 61.84375 \n", | |
"Q 37.25 66.40625 30.609375 66.40625 \n", | |
"Q 23.96875 66.40625 20.09375 61.84375 \n", | |
"Q 16.21875 57.28125 16.21875 49.421875 \n", | |
"Q 16.21875 41.5 20.09375 36.953125 \n", | |
"Q 23.96875 32.421875 30.609375 32.421875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(404.332371 275.493)rotate(-45)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-57 /></g></g></g></g><g id=matplotlib.axis_2><g id=ytick_1><g id=text_10><defs><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
"Q 24.171875 66.40625 20.328125 58.90625 \n", | |
"Q 16.5 51.421875 16.5 36.375 \n", | |
"Q 16.5 21.390625 20.328125 13.890625 \n", | |
"Q 24.171875 6.390625 31.78125 6.390625 \n", | |
"Q 39.453125 6.390625 43.28125 13.890625 \n", | |
"Q 47.125 21.390625 47.125 36.375 \n", | |
"Q 47.125 51.421875 43.28125 58.90625 \n", | |
"Q 39.453125 66.40625 31.78125 66.40625 \n", | |
"z\n", | |
"M 31.78125 74.21875 \n", | |
"Q 44.046875 74.21875 50.515625 64.515625 \n", | |
"Q 56.984375 54.828125 56.984375 36.375 \n", | |
"Q 56.984375 17.96875 50.515625 8.265625 \n", | |
"Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
"Q 6.59375 17.96875 6.59375 36.375 \n", | |
"Q 6.59375 54.828125 13.0625 64.515625 \n", | |
"Q 19.53125 74.21875 31.78125 74.21875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(37.3125 256.420345)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_2><g id=text_11><g style=fill:#262626; transform="translate(24.5875 228.368477)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_3><g id=text_12><g style=fill:#262626; transform="translate(24.5875 200.31661)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_4><g id=text_13><g style=fill:#262626; transform="translate(24.5875 172.264742)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-51 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_5><g id=text_14><g style=fill:#262626; transform="translate(24.5875 144.212874)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-52 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_6><g id=text_15><g style=fill:#262626; transform="translate(24.5875 116.161006)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-53 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_7><g id=text_16><g style=fill:#262626; transform="translate(24.5875 88.109138)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-54 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_8><g id=text_17><g style=fill:#262626; transform="translate(24.5875 60.057271)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-55 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=ytick_9><g id=text_18><g style=fill:#262626; transform="translate(24.5875 32.005403)scale(0.1 -0.1)"><use xlink:href=#DejaVuSans-56 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /></g></g></g><g id=text_19><defs><path id=DejaVuSans-70 d="M 9.8125 72.90625 \n", | |
"L 51.703125 72.90625 \n", | |
"L 51.703125 64.59375 \n", | |
"L 19.671875 64.59375 \n", | |
"L 19.671875 43.109375 \n", | |
"L 48.578125 43.109375 \n", | |
"L 48.578125 34.8125 \n", | |
"L 19.671875 34.8125 \n", | |
"L 19.671875 0 \n", | |
"L 9.8125 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-114 d="M 41.109375 46.296875 \n", | |
"Q 39.59375 47.171875 37.8125 47.578125 \n", | |
"Q 36.03125 48 33.890625 48 \n", | |
"Q 26.265625 48 22.1875 43.046875 \n", | |
"Q 18.109375 38.09375 18.109375 28.8125 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 20.953125 51.171875 25.484375 53.578125 \n", | |
"Q 30.03125 56 36.53125 56 \n", | |
"Q 37.453125 56 38.578125 55.875 \n", | |
"Q 39.703125 55.765625 41.0625 55.515625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-101 d="M 56.203125 29.59375 \n", | |
"L 56.203125 25.203125 \n", | |
"L 14.890625 25.203125 \n", | |
"Q 15.484375 15.921875 20.484375 11.0625 \n", | |
"Q 25.484375 6.203125 34.421875 6.203125 \n", | |
"Q 39.59375 6.203125 44.453125 7.46875 \n", | |
"Q 49.3125 8.734375 54.109375 11.28125 \n", | |
"L 54.109375 2.78125 \n", | |
"Q 49.265625 0.734375 44.1875 -0.34375 \n", | |
"Q 39.109375 -1.421875 33.890625 -1.421875 \n", | |
"Q 20.796875 -1.421875 13.15625 6.1875 \n", | |
"Q 5.515625 13.8125 5.515625 26.8125 \n", | |
"Q 5.515625 40.234375 12.765625 48.109375 \n", | |
"Q 20.015625 56 32.328125 56 \n", | |
"Q 43.359375 56 49.78125 48.890625 \n", | |
"Q 56.203125 41.796875 56.203125 29.59375 \n", | |
"z\n", | |
"M 47.21875 32.234375 \n", | |
"Q 47.125 39.59375 43.09375 43.984375 \n", | |
"Q 39.0625 48.390625 32.421875 48.390625 \n", | |
"Q 24.90625 48.390625 20.390625 44.140625 \n", | |
"Q 15.875 39.890625 15.1875 32.171875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-113 d="M 14.796875 27.296875 \n", | |
"Q 14.796875 17.390625 18.875 11.75 \n", | |
"Q 22.953125 6.109375 30.078125 6.109375 \n", | |
"Q 37.203125 6.109375 41.296875 11.75 \n", | |
"Q 45.40625 17.390625 45.40625 27.296875 \n", | |
"Q 45.40625 37.203125 41.296875 42.84375 \n", | |
"Q 37.203125 48.484375 30.078125 48.484375 \n", | |
"Q 22.953125 48.484375 18.875 42.84375 \n", | |
"Q 14.796875 37.203125 14.796875 27.296875 \n", | |
"z\n", | |
"M 45.40625 8.203125 \n", | |
"Q 42.578125 3.328125 38.25 0.953125 \n", | |
"Q 33.9375 -1.421875 27.875 -1.421875 \n", | |
"Q 17.96875 -1.421875 11.734375 6.484375 \n", | |
"Q 5.515625 14.40625 5.515625 27.296875 \n", | |
"Q 5.515625 40.1875 11.734375 48.09375 \n", | |
"Q 17.96875 56 27.875 56 \n", | |
"Q 33.9375 56 38.25 53.625 \n", | |
"Q 42.578125 51.265625 45.40625 46.390625 \n", | |
"L 45.40625 54.6875 \n", | |
"L 54.390625 54.6875 \n", | |
"L 54.390625 -20.796875 \n", | |
"L 45.40625 -20.796875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-117 d="M 8.5 21.578125 \n", | |
"L 8.5 54.6875 \n", | |
"L 17.484375 54.6875 \n", | |
"L 17.484375 21.921875 \n", | |
"Q 17.484375 14.15625 20.5 10.265625 \n", | |
"Q 23.53125 6.390625 29.59375 6.390625 \n", | |
"Q 36.859375 6.390625 41.078125 11.03125 \n", | |
"Q 45.3125 15.671875 45.3125 23.6875 \n", | |
"L 45.3125 54.6875 \n", | |
"L 54.296875 54.6875 \n", | |
"L 54.296875 0 \n", | |
"L 45.3125 0 \n", | |
"L 45.3125 8.40625 \n", | |
"Q 42.046875 3.421875 37.71875 1 \n", | |
"Q 33.40625 -1.421875 27.6875 -1.421875 \n", | |
"Q 18.265625 -1.421875 13.375 4.4375 \n", | |
"Q 8.5 10.296875 8.5 21.578125 \n", | |
"z\n", | |
"M 31.109375 56 \n", | |
"z\n", | |
""/><path id=DejaVuSans-110 d="M 54.890625 33.015625 \n", | |
"L 54.890625 0 \n", | |
"L 45.90625 0 \n", | |
"L 45.90625 32.71875 \n", | |
"Q 45.90625 40.484375 42.875 44.328125 \n", | |
"Q 39.84375 48.1875 33.796875 48.1875 \n", | |
"Q 26.515625 48.1875 22.3125 43.546875 \n", | |
"Q 18.109375 38.921875 18.109375 30.90625 \n", | |
"L 18.109375 0 \n", | |
"L 9.078125 0 \n", | |
"L 9.078125 54.6875 \n", | |
"L 18.109375 54.6875 \n", | |
"L 18.109375 46.1875 \n", | |
"Q 21.34375 51.125 25.703125 53.5625 \n", | |
"Q 30.078125 56 35.796875 56 \n", | |
"Q 45.21875 56 50.046875 50.171875 \n", | |
"Q 54.890625 44.34375 54.890625 33.015625 \n", | |
"z\n", | |
""/><path id=DejaVuSans-99 d="M 48.78125 52.59375 \n", | |
"L 48.78125 44.1875 \n", | |
"Q 44.96875 46.296875 41.140625 47.34375 \n", | |
"Q 37.3125 48.390625 33.40625 48.390625 \n", | |
"Q 24.65625 48.390625 19.8125 42.84375 \n", | |
"Q 14.984375 37.3125 14.984375 27.296875 \n", | |
"Q 14.984375 17.28125 19.8125 11.734375 \n", | |
"Q 24.65625 6.203125 33.40625 6.203125 \n", | |
"Q 37.3125 6.203125 41.140625 7.25 \n", | |
"Q 44.96875 8.296875 48.78125 10.40625 \n", | |
"L 48.78125 2.09375 \n", | |
"Q 45.015625 0.34375 40.984375 -0.53125 \n", | |
"Q 36.96875 -1.421875 32.421875 -1.421875 \n", | |
"Q 20.0625 -1.421875 12.78125 6.34375 \n", | |
"Q 5.515625 14.109375 5.515625 27.296875 \n", | |
"Q 5.515625 40.671875 12.859375 48.328125 \n", | |
"Q 20.21875 56 33.015625 56 \n", | |
"Q 37.15625 56 41.109375 55.140625 \n", | |
"Q 45.0625 54.296875 48.78125 52.59375 \n", | |
"z\n", | |
""/><path id=DejaVuSans-121 d="M 32.171875 -5.078125 \n", | |
"Q 28.375 -14.84375 24.75 -17.8125 \n", | |
"Q 21.140625 -20.796875 15.09375 -20.796875 \n", | |
"L 7.90625 -20.796875 \n", | |
"L 7.90625 -13.28125 \n", | |
"L 13.1875 -13.28125 \n", | |
"Q 16.890625 -13.28125 18.9375 -11.515625 \n", | |
"Q 21 -9.765625 23.484375 -3.21875 \n", | |
"L 25.09375 0.875 \n", | |
"L 2.984375 54.6875 \n", | |
"L 12.5 54.6875 \n", | |
"L 29.59375 11.921875 \n", | |
"L 46.6875 54.6875 \n", | |
"L 56.203125 54.6875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(18.299844 160.123219)rotate(-90)scale(0.11 -0.11)"><use xlink:href=#DejaVuSans-70 /><use x=50.269531 xlink:href=#DejaVuSans-114 /><use x=89.132812 xlink:href=#DejaVuSans-101 /><use x=150.65625 xlink:href=#DejaVuSans-113 /><use x=214.132812 xlink:href=#DejaVuSans-117 /><use x=277.511719 xlink:href=#DejaVuSans-101 /><use x=339.035156 xlink:href=#DejaVuSans-110 /><use x=402.414062 xlink:href=#DejaVuSans-99 /><use x=457.394531 xlink:href=#DejaVuSans-121 /></g></g></g><g id=patch_3><path clip-path=url(#p9335168fc6) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 73.244318 252.621126 \n", | |
"L 110.065025 252.621126 \n", | |
"L 110.065025 252.340608 \n", | |
"L 73.244318 252.340608 \n", | |
"z\n", | |
""/></g><g id=patch_4><path clip-path=url(#p9335168fc6) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 110.065025 252.621126 \n", | |
"L 146.885732 252.621126 \n", | |
"L 146.885732 251.218533 \n", | |
"L 110.065025 251.218533 \n", | |
"z\n", | |
""/></g><g id=patch_5><path clip-path=url(#p9335168fc6) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 146.885732 252.621126 \n", | |
"L 183.706439 252.621126 \n", | |
"L 183.706439 245.60816 \n", | |
"L 146.885732 245.60816 \n", | |
"z\n", | |
""/></g><g id=patch_6><path clip-path=url(#p9335168fc6) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 183.706439 252.621126 \n", | |
"L 220.527146 252.621126 \n", | |
"L 220.527146 236.631562 \n", | |
"L 183.706439 236.631562 \n", | |
"z\n", | |
""/></g><g id=patch_7><path clip-path=url(#p9335168fc6) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 220.527146 252.621126 \n", | |
"L 257.347854 252.621126 \n", | |
"L 257.347854 22.315292 \n", | |
"L 220.527146 22.315292 \n", | |
"z\n", | |
""/></g><g id=patch_8><path clip-path=url(#p9335168fc6) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 257.347854 252.621126 \n", | |
"L 294.168561 252.621126 \n", | |
"L 294.168561 181.93042 \n", | |
"L 257.347854 181.93042 \n", | |
"z\n", | |
""/></g><g id=patch_9><path clip-path=url(#p9335168fc6) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 294.168561 252.621126 \n", | |
"L 330.989268 252.621126 \n", | |
"L 330.989268 195.114797 \n", | |
"L 294.168561 195.114797 \n", | |
"z\n", | |
""/></g><g id=patch_10><path clip-path=url(#p9335168fc6) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 330.989268 252.621126 \n", | |
"L 367.809975 252.621126 \n", | |
"L 367.809975 232.423782 \n", | |
"L 330.989268 232.423782 \n", | |
"z\n", | |
""/></g><g id=patch_11><path clip-path=url(#p9335168fc6) style=fill:#337ab7;stroke:#ffffff;stroke-linejoin:miter;stroke-width:0.3; d="M 367.809975 252.621126 \n", | |
"L 404.630682 252.621126 \n", | |
"L 404.630682 246.449716 \n", | |
"L 367.809975 246.449716 \n", | |
"z\n", | |
""/></g><g id=patch_12><path style=fill:none; d="M 56.675 252.621126 \n", | |
"L 56.675 10.8 \n", | |
""/></g><g id=patch_13><path style=fill:none; d="M 421.2 252.621126 \n", | |
"L 421.2 10.8 \n", | |
""/></g><g id=patch_14><path style=fill:none; d="M 56.675 252.621126 \n", | |
"L 421.2 252.621126 \n", | |
""/></g><g id=patch_15><path style=fill:none; d="M 56.675 10.8 \n", | |
"L 421.2 10.8 \n", | |
""/></g></g></g><defs><clippath id=p9335168fc6><rect height=241.821126 width=364.525 x=56.675 y=10.8 /></clippath></defs></svg><div class="caption text-center text-muted"><strong>Histogram with fixed size bins</strong> (bins=9) </div></div><div role=tabpanel class="tab-pane col-sm-12" id=7563046253966581377bottom-7563046253966581377common_values><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=5>5</td><td>821</td><td><div class=bar style=width:100.0%> 56.2% </div></td></tr><tr class><td title=6>6</td><td>252</td><td><div class=bar style=width:30.7%> &nbsp; </div> 17.3% </td></tr><tr class><td title=7>7</td><td>205</td><td><div class=bar style=width:25.0%> &nbsp; </div> 14.0% </td></tr><tr class><td title=8>8</td><td>72</td><td><div class=bar style=width:8.8%> &nbsp; </div> 4.9% </td></tr><tr class><td title=4>4</td><td>57</td><td><div class=bar style=width:6.9%> &nbsp; </div> 3.9% </td></tr><tr class><td title=3>3</td><td>25</td><td><div class=bar style=width:3.0%> &nbsp; </div> 1.7% </td></tr><tr class><td title=9>9</td><td>22</td><td><div class=bar style=width:2.7%> &nbsp; </div> 1.5% </td></tr><tr class><td title=2>2</td><td>5</td><td><div class=bar style=width:0.6%> &nbsp; </div> 0.3% </td></tr><tr class><td title=1>1</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=7563046253966581377bottom-7563046253966581377extreme_values><div class="row spacing"><ul class="nav nav-tabs" role=tablist><li role=presentation class=active><a href=#7563046253966581377extreme_values-7563046253966581377firstn aria-controls=7563046253966581377extreme_values-7563046253966581377firstn role=tab data-toggle=tab>Minimum 5 values</a></li><li role=presentation><a href=#7563046253966581377extreme_values-7563046253966581377lastn aria-controls=7563046253966581377extreme_values-7563046253966581377lastn role=tab data-toggle=tab>Maximum 5 values</a></li></ul><div class=tab-content><div role=tabpanel class="tab-pane col-sm-12 active" id=7563046253966581377extreme_values-7563046253966581377firstn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=1>1</td><td>1</td><td><div class=bar style=width:0.1%> &nbsp; </div> 0.1% </td></tr><tr class><td title=2>2</td><td>5</td><td><div class=bar style=width:0.6%> &nbsp; </div> 0.3% </td></tr><tr class><td title=3>3</td><td>25</td><td><div class=bar style=width:3.0%> &nbsp; </div> 1.7% </td></tr><tr class><td title=4>4</td><td>57</td><td><div class=bar style=width:6.9%> &nbsp; </div> 3.9% </td></tr><tr class><td title=5>5</td><td>821</td><td><div class=bar style=width:100.0%> 56.2% </div></td></tr></tbody></table></div><div role=tabpanel class="tab-pane col-sm-12" id=7563046253966581377extreme_values-7563046253966581377lastn><table class="freq table table-hover table-striped"><thead><tr><td>Value</td><td>Count</td><td>Frequency (%)</td></tr></thead><tbody><tr class><td title=9>9</td><td>22</td><td><div class=bar style=width:2.7%> &nbsp; </div> 1.5% </td></tr><tr class><td title=8>8</td><td>72</td><td><div class=bar style=width:8.8%> &nbsp; </div> 4.9% </td></tr><tr class><td title=7>7</td><td>205</td><td><div class=bar style=width:25.0%> &nbsp; </div> 14.0% </td></tr><tr class><td title=6>6</td><td>252</td><td><div class=bar style=width:30.7%> &nbsp; </div> 17.3% </td></tr><tr class><td title=5>5</td><td>821</td><td><div class=bar style=width:100.0%> 56.2% </div></td></tr></tbody></table></div></div></div></div></div></div></div></div></div><div class="row spacing"><a class="anchor-pos anchor-pos-variable" id=pp_var_-5835865680840717960></a><div class=variable><div class=col-sm-3><p class=h4 title=YearBuilt><a href=#pp_var_-5835865680840717960>YearBuilt</a><br><small>Real number (&Ropf;<sub>&ge;0</sub>)</small></p><p class=variable-description></p></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Distinct</th><td>112</td></tr><tr><th>Distinct (%)</th><td>7.7%</td></tr><tr><th>Missing</th><td>0</td></tr><tr><th>Missing (%)</th><td>0.0%</td></tr><tr><th>Infinite</th><td>0</td></tr><tr><th>Infinite (%)</th><td>0.0%</td></tr><tr><th>Mean</th><td>1971.267808</td></tr></tbody></table></div><div class=col-sm-3><table class="table table-condensed stats"><tbody><tr><th>Minimum</th><td>1872</td></tr><tr><th>Maximum</th><td>2010</td></tr><tr><th>Zeros</th><td>0</td></tr><tr><th>Zeros (%)</th><td>0.0%</td></tr><tr><th>Negative</th><td>0</td></tr><tr><th>Negative (%)</th><td>0.0%</td></tr><tr><th>Memory size</th><td>11.5 KiB</td></tr></tbody></table></div><div class=col-sm-3><?xml version="1.0" encoding="utf-8" standalone="no"?><!DOCTYPE svg class="img-responsive center-img"PUBLIC "-//W3C//DTD SVG 1.1//EN"\n", | |
" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg class="img-responsive center-img" height=162pt version=1.1 viewbox="0 0 216 162" width=216pt xmlns=http://www.w3.org/2000/svg xmlns:xlink=http://www.w3.org/1999/xlink><defs><style type=text/css>\n", | |
"*{stroke-linecap:butt;stroke-linejoin:round;}\n", | |
" </style></defs><g id=figure_1><g id=patch_1><path style=fill:#ffffff; d="M 0 162 \n", | |
"L 216 162 \n", | |
"L 216 0 \n", | |
"L 0 0 \n", | |
"z\n", | |
""/></g><g id=axes_1><g id=patch_2><path style=fill:#ffffff; d="M 10.8 117.517127 \n", | |
"L 205.2 117.517127 \n", | |
"L 205.2 10.8 \n", | |
"L 10.8 10.8 \n", | |
"z\n", | |
""/></g><g id=matplotlib.axis_1><g id=xtick_1><g id=text_1><defs><path id=DejaVuSans-49 d="M 12.40625 8.296875 \n", | |
"L 28.515625 8.296875 \n", | |
"L 28.515625 63.921875 \n", | |
"L 10.984375 60.40625 \n", | |
"L 10.984375 69.390625 \n", | |
"L 28.421875 72.90625 \n", | |
"L 38.28125 72.90625 \n", | |
"L 38.28125 8.296875 \n", | |
"L 54.390625 8.296875 \n", | |
"L 54.390625 0 \n", | |
"L 12.40625 0 \n", | |
"z\n", | |
""/><path id=DejaVuSans-57 d="M 10.984375 1.515625 \n", | |
"L 10.984375 10.5 \n", | |
"Q 14.703125 8.734375 18.5 7.8125 \n", | |
"Q 22.3125 6.890625 25.984375 6.890625 \n", | |
"Q 35.75 6.890625 40.890625 13.453125 \n", | |
"Q 46.046875 20.015625 46.78125 33.40625 \n", | |
"Q 43.953125 29.203125 39.59375 26.953125 \n", | |
"Q 35.25 24.703125 29.984375 24.703125 \n", | |
"Q 19.046875 24.703125 12.671875 31.3125 \n", | |
"Q 6.296875 37.9375 6.296875 49.421875 \n", | |
"Q 6.296875 60.640625 12.9375 67.421875 \n", | |
"Q 19.578125 74.21875 30.609375 74.21875 \n", | |
"Q 43.265625 74.21875 49.921875 64.515625 \n", | |
"Q 56.59375 54.828125 56.59375 36.375 \n", | |
"Q 56.59375 19.140625 48.40625 8.859375 \n", | |
"Q 40.234375 -1.421875 26.421875 -1.421875 \n", | |
"Q 22.703125 -1.421875 18.890625 -0.6875 \n", | |
"Q 15.09375 0.046875 10.984375 1.515625 \n", | |
"z\n", | |
"M 30.609375 32.421875 \n", | |
"Q 37.25 32.421875 41.125 36.953125 \n", | |
"Q 45.015625 41.5 45.015625 49.421875 \n", | |
"Q 45.015625 57.28125 41.125 61.84375 \n", | |
"Q 37.25 66.40625 30.609375 66.40625 \n", | |
"Q 23.96875 66.40625 20.09375 61.84375 \n", | |
"Q 16.21875 57.28125 16.21875 49.421875 \n", | |
"Q 16.21875 41.5 20.09375 36.953125 \n", | |
"Q 23.96875 32.421875 30.609375 32.421875 \n", | |
"z\n", | |
""/><path id=DejaVuSans-48 d="M 31.78125 66.40625 \n", | |
"Q 24.171875 66.40625 20.328125 58.90625 \n", | |
"Q 16.5 51.421875 16.5 36.375 \n", | |
"Q 16.5 21.390625 20.328125 13.890625 \n", | |
"Q 24.171875 6.390625 31.78125 6.390625 \n", | |
"Q 39.453125 6.390625 43.28125 13.890625 \n", | |
"Q 47.125 21.390625 47.125 36.375 \n", | |
"Q 47.125 51.421875 43.28125 58.90625 \n", | |
"Q 39.453125 66.40625 31.78125 66.40625 \n", | |
"z\n", | |
"M 31.78125 74.21875 \n", | |
"Q 44.046875 74.21875 50.515625 64.515625 \n", | |
"Q 56.984375 54.828125 56.984375 36.375 \n", | |
"Q 56.984375 17.96875 50.515625 8.265625 \n", | |
"Q 44.046875 -1.421875 31.78125 -1.421875 \n", | |
"Q 19.53125 -1.421875 13.0625 8.265625 \n", | |
"Q 6.59375 17.96875 6.59375 36.375 \n", | |
"Q 6.59375 54.828125 13.0625 64.515625 \n", | |
"Q 19.53125 74.21875 31.78125 74.21875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(49.856662 149.212146)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-57 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_2><g id=text_2><defs><path id=DejaVuSans-53 d="M 10.796875 72.90625 \n", | |
"L 49.515625 72.90625 \n", | |
"L 49.515625 64.59375 \n", | |
"L 19.828125 64.59375 \n", | |
"L 19.828125 46.734375 \n", | |
"Q 21.96875 47.46875 24.109375 47.828125 \n", | |
"Q 26.265625 48.1875 28.421875 48.1875 \n", | |
"Q 40.625 48.1875 47.75 41.5 \n", | |
"Q 54.890625 34.8125 54.890625 23.390625 \n", | |
"Q 54.890625 11.625 47.5625 5.09375 \n", | |
"Q 40.234375 -1.421875 26.90625 -1.421875 \n", | |
"Q 22.3125 -1.421875 17.546875 -0.640625 \n", | |
"Q 12.796875 0.140625 7.71875 1.703125 \n", | |
"L 7.71875 11.625 \n", | |
"Q 12.109375 9.234375 16.796875 8.0625 \n", | |
"Q 21.484375 6.890625 26.703125 6.890625 \n", | |
"Q 35.15625 6.890625 40.078125 11.328125 \n", | |
"Q 45.015625 15.765625 45.015625 23.390625 \n", | |
"Q 45.015625 31 40.078125 35.4375 \n", | |
"Q 35.15625 39.890625 26.703125 39.890625 \n", | |
"Q 22.75 39.890625 18.8125 39.015625 \n", | |
"Q 14.890625 38.140625 10.796875 36.28125 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(113.888283 149.212146)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-49 /><use x=63.623047 xlink:href=#DejaVuSans-57 /><use x=127.246094 xlink:href=#DejaVuSans-53 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g><g id=xtick_3><g id=text_3><defs><path id=DejaVuSans-50 d="M 19.1875 8.296875 \n", | |
"L 53.609375 8.296875 \n", | |
"L 53.609375 0 \n", | |
"L 7.328125 0 \n", | |
"L 7.328125 8.296875 \n", | |
"Q 12.9375 14.109375 22.625 23.890625 \n", | |
"Q 32.328125 33.6875 34.8125 36.53125 \n", | |
"Q 39.546875 41.84375 41.421875 45.53125 \n", | |
"Q 43.3125 49.21875 43.3125 52.78125 \n", | |
"Q 43.3125 58.59375 39.234375 62.25 \n", | |
"Q 35.15625 65.921875 28.609375 65.921875 \n", | |
"Q 23.96875 65.921875 18.8125 64.3125 \n", | |
"Q 13.671875 62.703125 7.8125 59.421875 \n", | |
"L 7.8125 69.390625 \n", | |
"Q 13.765625 71.78125 18.9375 73 \n", | |
"Q 24.125 74.21875 28.421875 74.21875 \n", | |
"Q 39.75 74.21875 46.484375 68.546875 \n", | |
"Q 53.21875 62.890625 53.21875 53.421875 \n", | |
"Q 53.21875 48.921875 51.53125 44.890625 \n", | |
"Q 49.859375 40.875 45.40625 35.40625 \n", | |
"Q 44.1875 33.984375 37.640625 27.21875 \n", | |
"Q 31.109375 20.453125 19.1875 8.296875 \n", | |
"z\n", | |
""/></defs><g style=fill:#262626; transform="translate(177.919903 149.212146)rotate(-45)scale(0.08 -0.08)"><use xlink:href=#DejaVuSans-50 /><use x=63.623047 xlink:href=#DejaVuSans-48 /><use x=127.246094 xlink:href=#DejaVuSans-48 /><use x=190.869141 xlink:href=#DejaVuSans-48 /></g></g></g></g><g id=patch_3><path clip-path=url(#peb13e4177b) style=fill:#33 |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment