I use Namecheap.com as a registrar, and they resale SSL Certs from a number of other companies, including Comodo.
These are the steps I went through to set up an SSL cert.
data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7 |
s='substring'; | |
a=20140702230000+''; | |
d=new Date(a[s](0,4)+'-'+a[s](4,6)+'-'+a[s](6,8)+'T'+a[s](8,10)+':'+a[s](10,12)+':'+a[s](12,14)+'.000Z'); | |
d=(new Date(d-3600000)).toISOString().split('-').join('').split('T').join('').split(':').join('').split('.')[0]; |
<script> | |
var calc = function () { | |
var value = (this instanceof Number ? +this : 0); | |
if (!arguments.length) return value; | |
return calc.bind(arguments[0] + value); | |
} | |
console.log(calc(1)(8)(3)(99)()); | |
</script> |
def elem2dict(node): | |
""" | |
Convert an lxml.etree node tree into an object. | |
Notice: Since the xml and object (json) structure is not the same, | |
this utils will not work correctly if there is an xml element that | |
contains multiple duplicate child elements. For example: | |
<root> | |
<name>Hello</name> | |
<name>Is it me</name> | |
<hello>You looking for</hello> |
//============================================================ | |
// Register Namespace | |
//------------------------------------------------------------ | |
var Shape = Shape||{}; | |
//============================================================ | |
// Constructor - MUST BE AT TOP OF FILE | |
//------------------------------------------------------------ | |
Shape.Rectangle = function Shape_Rectangle(width, height, color){ | |
this.Width = width; |
// Fix this bug: http://bugs.mysql.com/bug.php?id=65941 | |
// Usage: | |
// node fix_mysqldump_single_quote_espace.js data.sql > data_fixed.sql | |
const fs = require('fs') | |
const file = process.argv.pop(); | |
const inputStream = fs.createReadStream(file, 'utf-8'); | |
const outputStream = fs.createWriteStream('output', 'utf-8'); | |
let backslashStack = []; |
Hòa learn to code. |
(function () { | |
String.prototype.padRight = function(l,c) {return this+Array(l-this.length+1).join(c||" ")}; | |
// intersection | |
const intersect = xs => ys => { | |
const zs = createSet(ys); | |
return filter(x => zs.has(x) | |
? true | |
: false | |
) (xs); |
I use Namecheap.com as a registrar, and they resale SSL Certs from a number of other companies, including Comodo.
These are the steps I went through to set up an SSL cert.
(() => { | |
const getSelector = target => { | |
const tag = target.tagName.toLowerCase(); | |
const classSelector = Array.from(target.classList) | |
.map(_ => '.' + _) | |
.join('') | |
const idSelector = target.id ? ('#' + target.id) : ''; |