Created
May 14, 2019 21:21
-
-
Save Ptys6969/9b199c5f1dc4599823e08eb1d1c2dd1a to your computer and use it in GitHub Desktop.
debug client
This file has been truncated, but you can view the full file.
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| [22:52:04] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLTweaker | |
| [22:52:04] [main/INFO] [LaunchWrapper]: Using primary tweak class name net.minecraftforge.fml.common.launcher.FMLTweaker | |
| [22:52:04] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLTweaker | |
| [22:52:04] [main/DEBUG] [FML]: Injecting tracing printstreams for STDOUT/STDERR. | |
| [22:52:04] [main/INFO] [FML]: Forge Mod Loader version 14.23.5.2837 for Minecraft 1.12.2 loading | |
| [22:52:04] [main/INFO] [FML]: Java is Java HotSpot(TM) 64-Bit Server VM, version 1.8.0_51, running on Windows 10:amd64:10.0, installed at C:\Program Files (x86)\Minecraft\runtime\jre-x64 | |
| [22:52:04] [main/DEBUG] [FML]: Java classpath at launch is: | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\minecraftforge\forge\1.12.2-14.23.5.2837\forge-1.12.2-14.23.5.2837.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\minecraft\launchwrapper\1.12\launchwrapper-1.12.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\ow2\asm\asm-all\5.2\asm-all-5.2.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\jline\jline\3.5.1\jline-3.5.1.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\java\dev\jna\jna\4.4.0\jna-4.4.0.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\typesafe\akka\akka-actor_2.11\2.3.3\akka-actor_2.11-2.3.3.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\typesafe\config\1.2.1\config-1.2.1.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\scala-actors-migration_2.11\1.1.0\scala-actors-migration_2.11-1.1.0.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\scala-compiler\2.11.1\scala-compiler-2.11.1.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\plugins\scala-continuations-library_2.11\1.0.2\scala-continuations-library_2.11-1.0.2.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\plugins\scala-continuations-plugin_2.11.1\1.0.2\scala-continuations-plugin_2.11.1-1.0.2.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\scala-library\2.11.1\scala-library-2.11.1.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\scala-parser-combinators_2.11\1.0.1\scala-parser-combinators_2.11-1.0.1.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\scala-reflect\2.11.1\scala-reflect-2.11.1.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\scala-swing_2.11\1.0.1\scala-swing_2.11-1.0.1.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\scala-xml_2.11\1.0.2\scala-xml_2.11-1.0.2.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\lzma\lzma\0.0.1\lzma-0.0.1.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\sf\jopt-simple\jopt-simple\5.0.3\jopt-simple-5.0.3.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\java3d\vecmath\1.5.2\vecmath-1.5.2.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\sf\trove4j\trove4j\3.0.3\trove4j-3.0.3.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\apache\maven\maven-artifact\3.5.3\maven-artifact-3.5.3.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\mojang\patchy\1.1\patchy-1.1.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\oshi-project\oshi-core\1.1\oshi-core-1.1.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\java\dev\jna\jna\4.4.0\jna-4.4.0.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\java\dev\jna\platform\3.4.0\platform-3.4.0.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\ibm\icu\icu4j-core-mojang\51.2\icu4j-core-mojang-51.2.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\sf\jopt-simple\jopt-simple\5.0.3\jopt-simple-5.0.3.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\paulscode\codecjorbis\20101023\codecjorbis-20101023.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\paulscode\codecwav\20101023\codecwav-20101023.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\paulscode\libraryjavasound\20101123\libraryjavasound-20101123.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\paulscode\librarylwjglopenal\20100824\librarylwjglopenal-20100824.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\paulscode\soundsystem\20120107\soundsystem-20120107.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\io\netty\netty-all\4.1.9.Final\netty-all-4.1.9.Final.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\google\guava\guava\21.0\guava-21.0.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\apache\commons\commons-lang3\3.5\commons-lang3-3.5.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\commons-io\commons-io\2.5\commons-io-2.5.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\commons-codec\commons-codec\1.10\commons-codec-1.10.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\java\jinput\jinput\2.0.5\jinput-2.0.5.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\java\jutils\jutils\1.0.0\jutils-1.0.0.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\google\code\gson\gson\2.8.0\gson-2.8.0.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\mojang\authlib\1.5.25\authlib-1.5.25.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\mojang\realms\1.10.22\realms-1.10.22.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\apache\commons\commons-compress\1.8.1\commons-compress-1.8.1.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\apache\httpcomponents\httpclient\4.3.3\httpclient-4.3.3.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\commons-logging\commons-logging\1.1.3\commons-logging-1.1.3.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\apache\httpcomponents\httpcore\4.3.2\httpcore-4.3.2.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\it\unimi\dsi\fastutil\7.1.0\fastutil-7.1.0.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\apache\logging\log4j\log4j-api\2.8.1\log4j-api-2.8.1.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\apache\logging\log4j\log4j-core\2.8.1\log4j-core-2.8.1.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\lwjgl\lwjgl\lwjgl\2.9.4-nightly-20150209\lwjgl-2.9.4-nightly-20150209.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\lwjgl\lwjgl\lwjgl_util\2.9.4-nightly-20150209\lwjgl_util-2.9.4-nightly-20150209.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\mojang\text2speech\1.10.3\text2speech-1.10.3.jar | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Roaming\.minecraft\versions\1.12.2\1.12.2.jar | |
| [22:52:04] [main/DEBUG] [FML]: Java library path at launch is: | |
| [22:52:04] [main/DEBUG] [FML]: C:\Users\Lenovo\AppData\Local\Temp\eb8f-d936-b039-a69d | |
| [22:52:04] [main/DEBUG] [FML]: Determined Minecraft Libraries Root: C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries | |
| [22:52:04] [main/DEBUG] [FML]: Cleaning up mods folder: C:\Users\Lenovo\AppData\Roaming\.minecraft\mods | |
| [22:52:04] [main/DEBUG] [FML]: Examining file: ActuallyAdditions-1.12.2-r147.jar | |
| [22:52:04] [main/DEBUG] [FML]: Examining file: ActuallyBaubles-1.12-1.1.jar | |
| [22:52:04] [main/DEBUG] [FML]: Examining file: additionalresources-1.9.4-0.2.0.28+47cd0bd_signed.jar | |
| [22:52:04] [main/DEBUG] [FML]: Examining file: advancedcombat-1.1.2-[1.12].jar | |
| [22:52:04] [main/DEBUG] [FML]: Examining file: adventurepack-1.6.2.jar | |
| [22:52:04] [main/DEBUG] [FML]: Examining file: aether_ii-1.12.2-0.2.0+build42-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Found existing ContainedDep phosphor-1.12.2-0.1.6+build31-universal.jar(me.jellysquid.mods:phosphor:1.12.2-0.1.6+build31) from C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\me\jellysquid\mods\phosphor\1.12.2-0.1.6+build31\phosphor-1.12.2-0.1.6+build31.jar extracted to C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\aether_ii-1.12.2-0.2.0+build42-universal.jar, skipping extraction | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: phosphor-1.12.2-0.1.6+build31.jar | |
| [22:52:05] [main/DEBUG] [FML]: Found existing ContainedDep orbis-lib-1.12.2-0.2.0+build42-universal.jar(com.gildedgames:orbis-lib:1.12.2-0.2.0+build42) from C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\com\gildedgames\orbis-lib\1.12.2-0.2.0+build42\orbis-lib-1.12.2-0.2.0+build42.jar extracted to C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\aether_ii-1.12.2-0.2.0+build42-universal.jar, skipping extraction | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: orbis-lib-1.12.2-0.2.0+build42.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: armorplus-1.12.2-11.22.0.58.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Baubles-1.12-1.5.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: BiblioCraft[v2.4.5][MC1.12.2].jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: BiomesOPlenty-1.12.2-7.0.1.2419-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: blockcraftery-1.12.2-1.2.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: bonsaitrees-1.1.2-b144.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Bookshelf-1.12.2-2.3.577.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Botania+r1.10-361.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: buildcraft-all-7.99.24.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Chameleon-1.12-4.1.3.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: ChanceCubes-1.12.2-3.2.3.242.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: ChestTransporter-1.12.2-2.8.8.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Chisel-MC1.12.2-0.2.1.35.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: chunkedgeindicator-1.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: CloudBoots-1.12.2-1.4.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: CoFHCore-1.12.2-4.6.2.25-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: CoFHWorld-1.12.2-1.3.0.6-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: CraftPresence-1.12.2-1.5.3.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: CreativeCore_v1.9.45_mc1.12.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: CTM-MC1.12.2-0.3.3.22.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Cyclic-1.12.2-1.19.9.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: DeathCounter-1.12.1-1.0.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Decocraft-2.6.2_1.12.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: dirt2path-1.8.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: ElevatorMod-1.12.2-1.3.10.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: EnchantingPlus-1.12.2-5.0.177.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: EnderCore-1.12.2-0.5.57.jar | |
| [22:52:05] [main/DEBUG] [FML]: Found existing ContainedDep META-INF/libraries/EnderCore-1.12.2-0.5.57-core.jar(com.enderio.core:EnderCore:1.12.2-0.5.57:core) from C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\com\enderio\core\EnderCore\1.12.2-0.5.57\EnderCore-1.12.2-0.5.57-core.jar extracted to C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\EnderCore-1.12.2-0.5.57.jar, skipping extraction | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: EnderCore-1.12.2-0.5.57-core.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: EnderIO-1.12.2-5.0.44.jar | |
| [22:52:05] [main/DEBUG] [FML]: Found existing ContainedDep META-INF/libraries/AutoSave-1.12.2-1.0.10.jar(info.loenwind.autosave:AutoSave:1.12.2-1.0.10) from C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\info\loenwind\autosave\AutoSave\1.12.2-1.0.10\AutoSave-1.12.2-1.0.10.jar extracted to C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\EnderIO-1.12.2-5.0.44.jar, skipping extraction | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: AutoSave-1.12.2-1.0.10.jar | |
| [22:52:05] [main/DEBUG] [FML]: Found existing ContainedDep META-INF/libraries/AutoConfig-1.12.2-1.0.2.jar(info.loenwind.autoconfig:AutoConfig:1.12.2-1.0.2) from C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\info\loenwind\autoconfig\AutoConfig\1.12.2-1.0.2\AutoConfig-1.12.2-1.0.2.jar extracted to C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\EnderIO-1.12.2-5.0.44.jar, skipping extraction | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: AutoConfig-1.12.2-1.0.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: enderutilities-1.12.2-0.7.12.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: environmentaltech-1.12.2-2.0.20.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: ExtraRails-1.12-1.3.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: extrautils2-1.12-1.9.9.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: FastLeafDecay-v14.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: forestry_1.12.2-5.8.1.322.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Forgelin-1.8.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: harvestersnight-1.12.2-1.1.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: hopperducts-mc1.12-1.5.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: HuntingDimension-1.12.2-1.0.38.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: iChunUtil-1.12.2-7.2.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: industrialcraft-2-2.8.109-ex112.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: industrialforegoing-1.12.2-1.12.12-236.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: inventorypets-1.12-2.0.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: inventorysorter-1.12.2-1.13.3+57.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: IronBackpacks-1.12.2-3.0.8-12.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: ironchest-1.12.2-7.0.59.842.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: ironfurnaces-1.3.3.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: ItemFilters-1.0.3.12.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: jei_1.12.2-4.15.0.268.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: journeymap-1.12.2-5.5.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: JustAFewFish-1.7_for_1.12.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: KeepingInventory-1.12.2-2.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: LibEx-1.12.2-1.0.8.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: LittleTiles_v1.5.0-pre135_mc1.12.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: llibrary-1.7.19-1.12.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Found existing ContainedDep llibrary-core-1.0.11-1.12.2.jar(net.ilexiconn:llibrary-core:1.0.11-1.12.2) from C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\net\ilexiconn\llibrary-core\1.0.11-1.12.2\llibrary-core-1.0.11-1.12.2.jar extracted to C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\llibrary-1.7.19-1.12.2.jar, skipping extraction | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: llibrary-core-1.0.11-1.12.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Making maven link for net.ilexiconn:llibrary:1.7.19-1.12.2 in memory to C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\llibrary-1.7.19-1.12.2.jar. | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: LootBags-1.12.2-2.5.8.5.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Mantle-1.12-1.3.3.49.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: mcjtylib-1.12-3.5.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: mysticallib-1.12.2-1.1.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Neat+1.4-17.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Netherending-Ores-1.12.2-1.3.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: NetherEx-1.12.2-2.0.8.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: notenoughroofs-1.12.2-0.8.0.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: notenoughwands-1.12-1.8.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: OptiFine_1.12.2_HD_U_E3.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: OreExcavation-1.4.140.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: ProjectE-1.12.2-PE1.4.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: ProportionalDestructionParticles-1.12.2-1.2.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: PTRLib-1.0.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: randompatches-1.12.2-1.15.1.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: RandomThings-MC1.12.2-4.2.7.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: randomtweaks-1.12.2-2.5.0.5.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: RebornCore-1.12.2-3.13.12.447-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: RedstoneFlux-1.12-2.1.0.6-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: redstonepaste-mc1.12-1.7.5.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Reliquary-1.12.2-1.3.4.786.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: ShadowMC-1.12-3.8.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: SimplyJetpacks2-1.12.2-2.2.12.65.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: SlashBlade-mc1.12-r23.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: SmoothFont-mc1.12.2-1.16.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Snad-1.12.1-1.7.09.16a.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: SpartanShields-1.12.2-1.5.3.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: StevesCarts-1.12.2-2.4.30.134.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: stg-1.12.2-1.2.3.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: StorageDrawers-1.12.2-5.3.8.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: switchbow-1.5.6.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Tabula-1.12.2-7.0.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: TConstruct-1.12.2-2.12.0.135.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: tesla-core-lib-1.12.2-1.0.15.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: thedragonlib-1.12.2-5.3.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: TheEightFabledBlades+V2.0.01.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: ThermalCultivation-1.12.2-0.3.2.11-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: ThermalFoundation-1.12.2-2.6.2.26-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: TinkerToolLeveling-1.12.2-1.1.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: torchmaster_1.12.2-1.7.1.74.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Trapcraft-1.12-v2.4.3a-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: TrashSlot_1.12.1-8.4.6.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: TS2K16-1.2.10.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: twilightforest-1.12.2-3.8.689-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: Uppers-0.0.6.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: valkyrielib-1.12.2-2.0.20.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: ViesCraft-1.12.2-5.9.13.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: wings-1.1.4-1.12.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: wolfarmor-1.12.2-2.2.3.1798-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: XtraGear+++1.0.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: ye.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: yoyos_1.12.2-1.2.2.20.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining file: [1.12.2]+SecurityCraft+v1.8.12.jar | |
| [22:52:05] [main/DEBUG] [FML]: File already proccessed C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\me\jellysquid\mods\phosphor\1.12.2-0.1.6+build31\phosphor-1.12.2-0.1.6+build31.jar, Skipping | |
| [22:52:05] [main/DEBUG] [FML]: File already proccessed C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\com\gildedgames\orbis-lib\1.12.2-0.2.0+build42\orbis-lib-1.12.2-0.2.0+build42.jar, Skipping | |
| [22:52:05] [main/DEBUG] [FML]: File already proccessed C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\com\enderio\core\EnderCore\1.12.2-0.5.57\EnderCore-1.12.2-0.5.57-core.jar, Skipping | |
| [22:52:05] [main/DEBUG] [FML]: File already proccessed C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\info\loenwind\autosave\AutoSave\1.12.2-1.0.10\AutoSave-1.12.2-1.0.10.jar, Skipping | |
| [22:52:05] [main/DEBUG] [FML]: File already proccessed C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\info\loenwind\autoconfig\AutoConfig\1.12.2-1.0.2\AutoConfig-1.12.2-1.0.2.jar, Skipping | |
| [22:52:05] [main/DEBUG] [FML]: File already proccessed C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\net\ilexiconn\llibrary-core\1.0.11-1.12.2\llibrary-core-1.0.11-1.12.2.jar, Skipping | |
| [22:52:05] [main/DEBUG] [FML]: File already proccessed C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\llibrary-1.7.19-1.12.2.jar, Skipping | |
| [22:52:05] [main/DEBUG] [FML]: Enabling runtime deobfuscation | |
| [22:52:05] [main/DEBUG] [FML]: Instantiating coremod class FMLCorePlugin | |
| [22:52:05] [main/DEBUG] [FML]: Found signing certificates for coremod FMLCorePlugin (net.minecraftforge.fml.relauncher.FMLCorePlugin) | |
| [22:52:05] [main/DEBUG] [FML]: Found certificate e3c3d50c7c986df74c645c0ac54639741c90a557 | |
| [22:52:05] [main/DEBUG] [FML]: Added access transformer class net.minecraftforge.fml.common.asm.transformers.AccessTransformer to enqueued access transformers | |
| [22:52:05] [main/DEBUG] [FML]: Enqueued coremod FMLCorePlugin | |
| [22:52:05] [main/DEBUG] [FML]: Instantiating coremod class FMLForgePlugin | |
| [22:52:05] [main/DEBUG] [FML]: Found signing certificates for coremod FMLForgePlugin (net.minecraftforge.classloading.FMLForgePlugin) | |
| [22:52:05] [main/DEBUG] [FML]: Found certificate e3c3d50c7c986df74c645c0ac54639741c90a557 | |
| [22:52:05] [main/DEBUG] [FML]: Enqueued coremod FMLForgePlugin | |
| [22:52:05] [main/DEBUG] [FML]: All fundamental core mods are successfully located | |
| [22:52:05] [main/DEBUG] [FML]: Discovering coremods | |
| [22:52:05] [main/INFO] [FML]: Searching C:\Users\Lenovo\AppData\Roaming\.minecraft\mods for mods | |
| [22:52:05] [main/DEBUG] [FML]: Adding ActuallyAdditions-1.12.2-r147.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ActuallyBaubles-1.12-1.1.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding additionalresources-1.9.4-0.2.0.28+47cd0bd_signed.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding advancedcombat-1.1.2-[1.12].jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding adventurepack-1.6.2.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding aether_ii-1.12.2-0.2.0+build42-universal.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding armorplus-1.12.2-11.22.0.58.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Baubles-1.12-1.5.2.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding BiblioCraft[v2.4.5][MC1.12.2].jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding BiomesOPlenty-1.12.2-7.0.1.2419-universal.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding blockcraftery-1.12.2-1.2.0.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding bonsaitrees-1.1.2-b144.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Bookshelf-1.12.2-2.3.577.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Botania+r1.10-361.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding buildcraft-all-7.99.24.1.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Chameleon-1.12-4.1.3.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ChanceCubes-1.12.2-3.2.3.242.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ChestTransporter-1.12.2-2.8.8.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Chisel-MC1.12.2-0.2.1.35.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding chunkedgeindicator-1.4.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding CloudBoots-1.12.2-1.4.1.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding CoFHCore-1.12.2-4.6.2.25-universal.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding CoFHWorld-1.12.2-1.3.0.6-universal.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding CraftPresence-1.12.2-1.5.3.1.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding CreativeCore_v1.9.45_mc1.12.2.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding CTM-MC1.12.2-0.3.3.22.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Cyclic-1.12.2-1.19.9.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding DeathCounter-1.12.1-1.0.0.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Decocraft-2.6.2_1.12.2.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding dirt2path-1.8.0.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ElevatorMod-1.12.2-1.3.10.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding EnchantingPlus-1.12.2-5.0.177.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding EnderCore-1.12.2-0.5.57.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding EnderIO-1.12.2-5.0.44.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding enderutilities-1.12.2-0.7.12.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding environmentaltech-1.12.2-2.0.20.1.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ExtraRails-1.12-1.3.0.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding extrautils2-1.12-1.9.9.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding FastLeafDecay-v14.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding forestry_1.12.2-5.8.1.322.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Forgelin-1.8.2.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding harvestersnight-1.12.2-1.1.0.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding hopperducts-mc1.12-1.5.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding HuntingDimension-1.12.2-1.0.38.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding iChunUtil-1.12.2-7.2.1.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding industrialcraft-2-2.8.109-ex112.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding industrialforegoing-1.12.2-1.12.12-236.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding inventorypets-1.12-2.0.1.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding inventorysorter-1.12.2-1.13.3+57.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding IronBackpacks-1.12.2-3.0.8-12.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ironchest-1.12.2-7.0.59.842.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ironfurnaces-1.3.3.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ItemFilters-1.0.3.12.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding jei_1.12.2-4.15.0.268.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding journeymap-1.12.2-5.5.4.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding JustAFewFish-1.7_for_1.12.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding KeepingInventory-1.12.2-2.4.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding LibEx-1.12.2-1.0.8.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding LittleTiles_v1.5.0-pre135_mc1.12.2.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding llibrary-1.7.19-1.12.2.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding LootBags-1.12.2-2.5.8.5.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Mantle-1.12-1.3.3.49.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding mcjtylib-1.12-3.5.2.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding mysticallib-1.12.2-1.1.1.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Neat+1.4-17.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Netherending-Ores-1.12.2-1.3.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding NetherEx-1.12.2-2.0.8.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding notenoughroofs-1.12.2-0.8.0.0.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding notenoughwands-1.12-1.8.1.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding OptiFine_1.12.2_HD_U_E3.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding OreExcavation-1.4.140.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ProjectE-1.12.2-PE1.4.1.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ProportionalDestructionParticles-1.12.2-1.2.4.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding PTRLib-1.0.4.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding randompatches-1.12.2-1.15.1.0.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding RandomThings-MC1.12.2-4.2.7.1.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding randomtweaks-1.12.2-2.5.0.5.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding RebornCore-1.12.2-3.13.12.447-universal.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding RedstoneFlux-1.12-2.1.0.6-universal.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding redstonepaste-mc1.12-1.7.5.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Reliquary-1.12.2-1.3.4.786.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ShadowMC-1.12-3.8.0.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding SimplyJetpacks2-1.12.2-2.2.12.65.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding SlashBlade-mc1.12-r23.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding SmoothFont-mc1.12.2-1.16.2.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Snad-1.12.1-1.7.09.16a.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding SpartanShields-1.12.2-1.5.3.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding StevesCarts-1.12.2-2.4.30.134.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding stg-1.12.2-1.2.3.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding StorageDrawers-1.12.2-5.3.8.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding switchbow-1.5.6.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Tabula-1.12.2-7.0.1.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding TConstruct-1.12.2-2.12.0.135.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding tesla-core-lib-1.12.2-1.0.15.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding thedragonlib-1.12.2-5.3.0.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding TheEightFabledBlades+V2.0.01.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ThermalCultivation-1.12.2-0.3.2.11-universal.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ThermalFoundation-1.12.2-2.6.2.26-universal.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding TinkerToolLeveling-1.12.2-1.1.0.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding torchmaster_1.12.2-1.7.1.74.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Trapcraft-1.12-v2.4.3a-universal.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding TrashSlot_1.12.1-8.4.6.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding TS2K16-1.2.10.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding twilightforest-1.12.2-3.8.689-universal.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding Uppers-0.0.6.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding valkyrielib-1.12.2-2.0.20.1.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ViesCraft-1.12.2-5.9.13.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding wings-1.1.4-1.12.2.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding wolfarmor-1.12.2-2.2.3.1798-universal.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding XtraGear+++1.0.4.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding ye.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding yoyos_1.12.2-1.2.2.20.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Adding [1.12.2]+SecurityCraft+v1.8.12.jar to the mod list | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy [1.12.2]+SecurityCraft+v1.8.12.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in [1.12.2]+SecurityCraft+v1.8.12.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy ActuallyAdditions-1.12.2-r147.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in ActuallyAdditions-1.12.2-r147.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy ActuallyBaubles-1.12-1.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in ActuallyBaubles-1.12-1.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy additionalresources-1.9.4-0.2.0.28+47cd0bd_signed.jar | |
| [22:52:05] [main/TRACE] [FML]: Adding additionalresources-1.9.4-0.2.0.28+47cd0bd_signed.jar to the list of known coremods, it will not be examined again | |
| [22:52:05] [main/DEBUG] [FML]: Instantiating coremod class Ar_CorePlugin | |
| [22:52:05] [main/WARN] [FML]: The coremod portablejim.additionalresources.Ar_CorePlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft | |
| [22:52:05] [main/DEBUG] [FML]: Found signing certificates for coremod Ar_CorePlugin (portablejim.additionalresources.Ar_CorePlugin) | |
| [22:52:05] [main/DEBUG] [FML]: Found certificate 5cf7d377141c68c344d222d4724a47154b5b56b4 | |
| [22:52:05] [main/DEBUG] [FML]: Enqueued coremod Ar_CorePlugin | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy advancedcombat-1.1.2-[1.12].jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in advancedcombat-1.1.2-[1.12].jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy adventurepack-1.6.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in adventurepack-1.6.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy aether_ii-1.12.2-0.2.0+build42-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in aether_ii-1.12.2-0.2.0+build42-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy armorplus-1.12.2-11.22.0.58.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in armorplus-1.12.2-11.22.0.58.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy Baubles-1.12-1.5.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in Baubles-1.12-1.5.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy BiblioCraft[v2.4.5][MC1.12.2].jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in BiblioCraft[v2.4.5][MC1.12.2].jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy BiomesOPlenty-1.12.2-7.0.1.2419-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in BiomesOPlenty-1.12.2-7.0.1.2419-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy blockcraftery-1.12.2-1.2.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in blockcraftery-1.12.2-1.2.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy bonsaitrees-1.1.2-b144.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in bonsaitrees-1.1.2-b144.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy Bookshelf-1.12.2-2.3.577.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in Bookshelf-1.12.2-2.3.577.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy Botania+r1.10-361.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in Botania+r1.10-361.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy buildcraft-all-7.99.24.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in buildcraft-all-7.99.24.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy Chameleon-1.12-4.1.3.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in Chameleon-1.12-4.1.3.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy ChanceCubes-1.12.2-3.2.3.242.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in ChanceCubes-1.12.2-3.2.3.242.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy ChestTransporter-1.12.2-2.8.8.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in ChestTransporter-1.12.2-2.8.8.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy Chisel-MC1.12.2-0.2.1.35.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in Chisel-MC1.12.2-0.2.1.35.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy chunkedgeindicator-1.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in chunkedgeindicator-1.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy CloudBoots-1.12.2-1.4.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in CloudBoots-1.12.2-1.4.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy CoFHCore-1.12.2-4.6.2.25-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in CoFHCore-1.12.2-4.6.2.25-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy CoFHWorld-1.12.2-1.3.0.6-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in CoFHWorld-1.12.2-1.3.0.6-universal.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy CraftPresence-1.12.2-1.5.3.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in CraftPresence-1.12.2-1.5.3.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy CreativeCore_v1.9.45_mc1.12.2.jar | |
| [22:52:05] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in CreativeCore_v1.9.45_mc1.12.2.jar. This is not recommended, @Mods should be in a separate jar from the coremod. | |
| [22:52:05] [main/DEBUG] [FML]: Instantiating coremod class CreativePatchingLoader | |
| [22:52:05] [main/WARN] [FML]: The coremod com.creativemd.creativecore.core.CreativePatchingLoader does not have a MCVersion annotation, it may cause issues with this version of Minecraft | |
| [22:52:05] [main/WARN] [FML]: The coremod CreativePatchingLoader (com.creativemd.creativecore.core.CreativePatchingLoader) is not signed! | |
| [22:52:05] [main/DEBUG] [FML]: Enqueued coremod CreativePatchingLoader | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy CTM-MC1.12.2-0.3.3.22.jar | |
| [22:52:05] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in CTM-MC1.12.2-0.3.3.22.jar. This is not recommended, @Mods should be in a separate jar from the coremod. | |
| [22:52:05] [main/DEBUG] [FML]: Instantiating coremod class CTMCorePlugin | |
| [22:52:05] [main/WARN] [FML]: The coremod team.chisel.ctm.client.asm.CTMCorePlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft | |
| [22:52:05] [main/WARN] [FML]: The coremod CTMCorePlugin (team.chisel.ctm.client.asm.CTMCorePlugin) is not signed! | |
| [22:52:05] [main/DEBUG] [FML]: Enqueued coremod CTMCorePlugin | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy Cyclic-1.12.2-1.19.9.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in Cyclic-1.12.2-1.19.9.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy DeathCounter-1.12.1-1.0.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in DeathCounter-1.12.1-1.0.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy Decocraft-2.6.2_1.12.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in Decocraft-2.6.2_1.12.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy dirt2path-1.8.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in dirt2path-1.8.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy ElevatorMod-1.12.2-1.3.10.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in ElevatorMod-1.12.2-1.3.10.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy EnchantingPlus-1.12.2-5.0.177.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in EnchantingPlus-1.12.2-5.0.177.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy EnderCore-1.12.2-0.5.57.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in EnderCore-1.12.2-0.5.57.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy EnderIO-1.12.2-5.0.44.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in EnderIO-1.12.2-5.0.44.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy enderutilities-1.12.2-0.7.12.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in enderutilities-1.12.2-0.7.12.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy environmentaltech-1.12.2-2.0.20.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in environmentaltech-1.12.2-2.0.20.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy ExtraRails-1.12-1.3.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in ExtraRails-1.12-1.3.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy extrautils2-1.12-1.9.9.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in extrautils2-1.12-1.9.9.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy FastLeafDecay-v14.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in FastLeafDecay-v14.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy forestry_1.12.2-5.8.1.322.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in forestry_1.12.2-5.8.1.322.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy Forgelin-1.8.2.jar | |
| [22:52:05] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in Forgelin-1.8.2.jar. This is not recommended, @Mods should be in a separate jar from the coremod. | |
| [22:52:05] [main/DEBUG] [FML]: Instantiating coremod class ForgelinPlugin | |
| [22:52:05] [main/WARN] [FML]: The coremod net.shadowfacts.forgelin.preloader.ForgelinPlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft | |
| [22:52:05] [main/WARN] [FML]: The coremod ForgelinPlugin (net.shadowfacts.forgelin.preloader.ForgelinPlugin) is not signed! | |
| [22:52:05] [main/DEBUG] [FML]: Enqueued coremod ForgelinPlugin | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy harvestersnight-1.12.2-1.1.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in harvestersnight-1.12.2-1.1.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy hopperducts-mc1.12-1.5.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in hopperducts-mc1.12-1.5.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy HuntingDimension-1.12.2-1.0.38.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in HuntingDimension-1.12.2-1.0.38.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy iChunUtil-1.12.2-7.2.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in iChunUtil-1.12.2-7.2.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy industrialcraft-2-2.8.109-ex112.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in industrialcraft-2-2.8.109-ex112.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy industrialforegoing-1.12.2-1.12.12-236.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in industrialforegoing-1.12.2-1.12.12-236.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy inventorypets-1.12-2.0.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in inventorypets-1.12-2.0.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy inventorysorter-1.12.2-1.13.3+57.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in inventorysorter-1.12.2-1.13.3+57.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy IronBackpacks-1.12.2-3.0.8-12.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in IronBackpacks-1.12.2-3.0.8-12.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy ironchest-1.12.2-7.0.59.842.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in ironchest-1.12.2-7.0.59.842.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy ironfurnaces-1.3.3.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in ironfurnaces-1.3.3.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy ItemFilters-1.0.3.12.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in ItemFilters-1.0.3.12.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy jei_1.12.2-4.15.0.268.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in jei_1.12.2-4.15.0.268.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy journeymap-1.12.2-5.5.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in journeymap-1.12.2-5.5.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy JustAFewFish-1.7_for_1.12.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in JustAFewFish-1.7_for_1.12.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy KeepingInventory-1.12.2-2.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in KeepingInventory-1.12.2-2.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy LibEx-1.12.2-1.0.8.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in LibEx-1.12.2-1.0.8.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy LittleTiles_v1.5.0-pre135_mc1.12.2.jar | |
| [22:52:05] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in LittleTiles_v1.5.0-pre135_mc1.12.2.jar. This is not recommended, @Mods should be in a separate jar from the coremod. | |
| [22:52:05] [main/DEBUG] [FML]: Instantiating coremod class LittlePatchingLoader | |
| [22:52:05] [main/WARN] [FML]: The coremod com.creativemd.littletiles.LittlePatchingLoader does not have a MCVersion annotation, it may cause issues with this version of Minecraft | |
| [22:52:05] [main/WARN] [FML]: The coremod LittlePatchingLoader (com.creativemd.littletiles.LittlePatchingLoader) is not signed! | |
| [22:52:05] [main/DEBUG] [FML]: Added access transformer class com.creativemd.littletiles.LittleTilesAfterTransformer to enqueued access transformers | |
| [22:52:05] [main/DEBUG] [FML]: Enqueued coremod LittlePatchingLoader | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy LootBags-1.12.2-2.5.8.5.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in LootBags-1.12.2-2.5.8.5.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy Mantle-1.12-1.3.3.49.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in Mantle-1.12-1.3.3.49.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy mcjtylib-1.12-3.5.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in mcjtylib-1.12-3.5.2.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy mysticallib-1.12.2-1.1.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in mysticallib-1.12.2-1.1.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy Neat+1.4-17.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in Neat+1.4-17.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy Netherending-Ores-1.12.2-1.3.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in Netherending-Ores-1.12.2-1.3.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy NetherEx-1.12.2-2.0.8.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in NetherEx-1.12.2-2.0.8.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy notenoughroofs-1.12.2-0.8.0.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in notenoughroofs-1.12.2-0.8.0.0.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy notenoughwands-1.12-1.8.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in notenoughwands-1.12-1.8.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy OptiFine_1.12.2_HD_U_E3.jar | |
| [22:52:05] [main/INFO] [FML]: Loading tweaker optifine.OptiFineForgeTweaker from OptiFine_1.12.2_HD_U_E3.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy OreExcavation-1.4.140.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in OreExcavation-1.4.140.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy ProjectE-1.12.2-PE1.4.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in ProjectE-1.12.2-PE1.4.1.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy ProportionalDestructionParticles-1.12.2-1.2.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in ProportionalDestructionParticles-1.12.2-1.2.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy PTRLib-1.0.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Not found coremod data in PTRLib-1.0.4.jar | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy randompatches-1.12.2-1.15.1.0.jar | |
| [22:52:05] [main/TRACE] [FML]: Adding randompatches-1.12.2-1.15.1.0.jar to the list of known coremods, it will not be examined again | |
| [22:52:05] [main/DEBUG] [FML]: Instantiating coremod class RPCore | |
| [22:52:05] [main/TRACE] [FML]: coremod named RandomPatches is loading | |
| [22:52:05] [main/WARN] [FML]: The coremod com.therandomlabs.randompatches.core.RPCore does not have a MCVersion annotation, it may cause issues with this version of Minecraft | |
| [22:52:05] [main/DEBUG] [FML]: Found signing certificates for coremod RandomPatches (com.therandomlabs.randompatches.core.RPCore) | |
| [22:52:05] [main/DEBUG] [FML]: Found certificate 20d08fb3fe9c268a63a75d337fb507464c8aaccd | |
| [22:52:05] [main/DEBUG] [FML]: Enqueued coremod RandomPatches | |
| [22:52:05] [main/DEBUG] [FML]: Examining for coremod candidacy RandomThings-MC1.12.2-4.2.7.1.jar | |
| [22:52:05] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in RandomThings-MC1.12.2-4.2.7.1.jar. This is not recommended, @Mods should be in a separate jar from the coremod. | |
| [22:52:05] [main/DEBUG] [FML]: Instantiating coremod class LoadingPlugin | |
| [22:52:06] [main/WARN] [FML]: The coremod lumien.randomthings.asm.LoadingPlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft | |
| [22:52:06] [main/DEBUG] [FML]: Found signing certificates for coremod LoadingPlugin (lumien.randomthings.asm.LoadingPlugin) | |
| [22:52:06] [main/DEBUG] [FML]: Found certificate d72e0dd57935b3e9476212aea0c0df352dd76291 | |
| [22:52:06] [main/DEBUG] [FML]: Enqueued coremod LoadingPlugin | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy randomtweaks-1.12.2-2.5.0.5.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in randomtweaks-1.12.2-2.5.0.5.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy RebornCore-1.12.2-3.13.12.447-universal.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in RebornCore-1.12.2-3.13.12.447-universal.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy RedstoneFlux-1.12-2.1.0.6-universal.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in RedstoneFlux-1.12-2.1.0.6-universal.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy redstonepaste-mc1.12-1.7.5.jar | |
| [22:52:06] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in redstonepaste-mc1.12-1.7.5.jar. This is not recommended, @Mods should be in a separate jar from the coremod. | |
| [22:52:06] [main/DEBUG] [FML]: Instantiating coremod class NWRTweak | |
| [22:52:06] [main/WARN] [FML]: The coremod net.fybertech.nwr.NWRTweak does not have a MCVersion annotation, it may cause issues with this version of Minecraft | |
| [22:52:06] [main/WARN] [FML]: The coremod NWRTweak (net.fybertech.nwr.NWRTweak) is not signed! | |
| [22:52:06] [main/DEBUG] [FML]: Enqueued coremod NWRTweak | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy Reliquary-1.12.2-1.3.4.786.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in Reliquary-1.12.2-1.3.4.786.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy ShadowMC-1.12-3.8.0.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in ShadowMC-1.12-3.8.0.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy SimplyJetpacks2-1.12.2-2.2.12.65.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in SimplyJetpacks2-1.12.2-2.2.12.65.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy SlashBlade-mc1.12-r23.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in SlashBlade-mc1.12-r23.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy SmoothFont-mc1.12.2-1.16.2.jar | |
| [22:52:06] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in SmoothFont-mc1.12.2-1.16.2.jar. This is not recommended, @Mods should be in a separate jar from the coremod. | |
| [22:52:06] [main/DEBUG] [FML]: Instantiating coremod class CorePlugin | |
| [22:52:06] [main/WARN] [FML]: The coremod bre.smoothfont.asm.CorePlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft | |
| [22:52:06] [main/WARN] [FML]: The coremod CorePlugin (bre.smoothfont.asm.CorePlugin) is not signed! | |
| [22:52:06] [main/DEBUG] [FML]: Enqueued coremod CorePlugin | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy Snad-1.12.1-1.7.09.16a.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in Snad-1.12.1-1.7.09.16a.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy SpartanShields-1.12.2-1.5.3.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in SpartanShields-1.12.2-1.5.3.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy StevesCarts-1.12.2-2.4.30.134.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in StevesCarts-1.12.2-2.4.30.134.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy stg-1.12.2-1.2.3.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in stg-1.12.2-1.2.3.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy StorageDrawers-1.12.2-5.3.8.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in StorageDrawers-1.12.2-5.3.8.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy switchbow-1.5.6.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in switchbow-1.5.6.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy Tabula-1.12.2-7.0.1.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in Tabula-1.12.2-7.0.1.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy TConstruct-1.12.2-2.12.0.135.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in TConstruct-1.12.2-2.12.0.135.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy tesla-core-lib-1.12.2-1.0.15.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in tesla-core-lib-1.12.2-1.0.15.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy thedragonlib-1.12.2-5.3.0.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in thedragonlib-1.12.2-5.3.0.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy TheEightFabledBlades+V2.0.01.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in TheEightFabledBlades+V2.0.01.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy ThermalCultivation-1.12.2-0.3.2.11-universal.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in ThermalCultivation-1.12.2-0.3.2.11-universal.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy ThermalFoundation-1.12.2-2.6.2.26-universal.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in ThermalFoundation-1.12.2-2.6.2.26-universal.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy TinkerToolLeveling-1.12.2-1.1.0.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in TinkerToolLeveling-1.12.2-1.1.0.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy torchmaster_1.12.2-1.7.1.74.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in torchmaster_1.12.2-1.7.1.74.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy Trapcraft-1.12-v2.4.3a-universal.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in Trapcraft-1.12-v2.4.3a-universal.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy TrashSlot_1.12.1-8.4.6.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in TrashSlot_1.12.1-8.4.6.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy TS2K16-1.2.10.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in TS2K16-1.2.10.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy twilightforest-1.12.2-3.8.689-universal.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in twilightforest-1.12.2-3.8.689-universal.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy Uppers-0.0.6.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in Uppers-0.0.6.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy valkyrielib-1.12.2-2.0.20.1.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in valkyrielib-1.12.2-2.0.20.1.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy ViesCraft-1.12.2-5.9.13.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in ViesCraft-1.12.2-5.9.13.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy wings-1.1.4-1.12.2.jar | |
| [22:52:06] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in wings-1.1.4-1.12.2.jar. This is not recommended, @Mods should be in a separate jar from the coremod. | |
| [22:52:06] [main/DEBUG] [FML]: Instantiating coremod class WingsLoadingPlugin | |
| [22:52:06] [main/TRACE] [FML]: coremod named wings is loading | |
| [22:52:06] [main/DEBUG] [FML]: The coremod me.paulf.wings.server.asm.plugin.WingsLoadingPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded. | |
| [22:52:06] [main/WARN] [FML]: The coremod wings (me.paulf.wings.server.asm.plugin.WingsLoadingPlugin) is not signed! | |
| [22:52:06] [main/DEBUG] [FML]: Enqueued coremod wings | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy wolfarmor-1.12.2-2.2.3.1798-universal.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in wolfarmor-1.12.2-2.2.3.1798-universal.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy XtraGear+++1.0.4.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in XtraGear+++1.0.4.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy ye.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in ye.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy yoyos_1.12.2-1.2.2.20.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in yoyos_1.12.2-1.2.2.20.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy phosphor-1.12.2-0.1.6+build31.jar | |
| [22:52:06] [main/INFO] [FML]: Loading tweaker org.spongepowered.asm.launch.MixinTweaker from phosphor-1.12.2-0.1.6+build31.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy orbis-lib-1.12.2-0.2.0+build42.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in orbis-lib-1.12.2-0.2.0+build42.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy EnderCore-1.12.2-0.5.57-core.jar | |
| [22:52:06] [main/TRACE] [FML]: Adding EnderCore-1.12.2-0.5.57-core.jar to the list of known coremods, it will not be examined again | |
| [22:52:06] [main/DEBUG] [FML]: Instantiating coremod class EnderCorePlugin | |
| [22:52:06] [main/DEBUG] [FML]: The coremod com.enderio.core.common.transform.EnderCorePlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded. | |
| [22:52:06] [main/DEBUG] [FML]: Found signing certificates for coremod EnderCorePlugin (com.enderio.core.common.transform.EnderCorePlugin) | |
| [22:52:06] [main/DEBUG] [FML]: Found certificate c40beb5bac3932800b68537c30a476f87cec6a5d | |
| [22:52:06] [main/DEBUG] [FML]: Enqueued coremod EnderCorePlugin | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy AutoSave-1.12.2-1.0.10.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in AutoSave-1.12.2-1.0.10.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy AutoConfig-1.12.2-1.0.2.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in AutoConfig-1.12.2-1.0.2.jar | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy llibrary-core-1.0.11-1.12.2.jar | |
| [22:52:06] [main/TRACE] [FML]: Adding llibrary-core-1.0.11-1.12.2.jar to the list of known coremods, it will not be examined again | |
| [22:52:06] [main/DEBUG] [FML]: Instantiating coremod class LLibraryPlugin | |
| [22:52:06] [main/TRACE] [FML]: coremod named llibrary is loading | |
| [22:52:06] [main/DEBUG] [FML]: The coremod net.ilexiconn.llibrary.server.core.plugin.LLibraryPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded. | |
| [22:52:06] [main/DEBUG] [FML]: Found signing certificates for coremod llibrary (net.ilexiconn.llibrary.server.core.plugin.LLibraryPlugin) | |
| [22:52:06] [main/DEBUG] [FML]: Found certificate b9f30a813bee3b9dd5652c460310cfcd54f6b7ec | |
| [22:52:06] [main/DEBUG] [FML]: Enqueued coremod llibrary | |
| [22:52:06] [main/DEBUG] [FML]: Examining for coremod candidacy llibrary-1.7.19-1.12.2.jar | |
| [22:52:06] [main/DEBUG] [FML]: Not found coremod data in llibrary-1.7.19-1.12.2.jar | |
| [22:52:06] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker | |
| [22:52:06] [main/INFO] [LaunchWrapper]: Loading tweak class name optifine.OptiFineForgeTweaker | |
| [22:52:06] [main/INFO] [LaunchWrapper]: Loading tweak class name org.spongepowered.asm.launch.MixinTweaker | |
| [22:52:06] [main/DEBUG] [mixin]: MixinService [LaunchWrapper] was successfully booted in sun.misc.Launcher$AppClassLoader@55f96302 | |
| [22:52:06] [main/INFO] [mixin]: SpongePowered MIXIN Subsystem Version=0.7.11 Source=file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.1.6+build31/phosphor-1.12.2-0.1.6+build31.jar Service=LaunchWrapper Env=CLIENT | |
| [22:52:06] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #1 | |
| [22:52:06] [main/DEBUG] [mixin]: Initialising Mixin Platform Manager | |
| [22:52:06] [main/DEBUG] [mixin]: Mixin platform: primary container is file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.1.6+build31/phosphor-1.12.2-0.1.6+build31.jar | |
| [22:52:06] [main/DEBUG] [mixin]: Adding mixin platform agents for container file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.1.6+build31/phosphor-1.12.2-0.1.6+build31.jar | |
| [22:52:06] [main/DEBUG] [mixin]: Instancing new MixinPlatformAgentFML for file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.1.6+build31/phosphor-1.12.2-0.1.6+build31.jar | |
| [22:52:06] [main/DEBUG] [mixin]: ForceLoadAsMod was specified for phosphor-1.12.2-0.1.6+build31.jar, attempting force-load | |
| [22:52:06] [main/DEBUG] [mixin]: Adding phosphor-1.12.2-0.1.6+build31.jar to reparseable coremod collection | |
| [22:52:06] [main/DEBUG] [mixin]: phosphor-1.12.2-0.1.6+build31.jar has core plugin me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin. Injecting it into FML for co-initialisation: | |
| [22:52:06] [main/DEBUG] [FML]: Instantiating coremod class PhosphorFMLLoadingPlugin | |
| [22:52:06] [main/DEBUG] [FML]: The coremod me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded. | |
| [22:52:06] [main/DEBUG] [FML]: Found signing certificates for coremod PhosphorFMLLoadingPlugin (me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin) | |
| [22:52:06] [main/DEBUG] [FML]: Found certificate f0387d288626cc2d937daa504e74af570c52a2f1 | |
| [22:52:06] [main/DEBUG] [FML]: Enqueued coremod PhosphorFMLLoadingPlugin | |
| [22:52:06] [main/DEBUG] [mixin]: Instancing new MixinPlatformAgentDefault for file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.1.6+build31/phosphor-1.12.2-0.1.6+build31.jar | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/minecraftforge/forge/1.12.2-14.23.5.2837/forge-1.12.2-14.23.5.2837.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/minecraft/launchwrapper/1.12/launchwrapper-1.12.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/ow2/asm/asm-all/5.2/asm-all-5.2.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/jline/jline/3.5.1/jline-3.5.1.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/java/dev/jna/jna/4.4.0/jna-4.4.0.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/typesafe/akka/akka-actor_2.11/2.3.3/akka-actor_2.11-2.3.3.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/typesafe/config/1.2.1/config-1.2.1.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/scala-actors-migration_2.11/1.1.0/scala-actors-migration_2.11-1.1.0.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/scala-compiler/2.11.1/scala-compiler-2.11.1.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/plugins/scala-continuations-library_2.11/1.0.2/scala-continuations-library_2.11-1.0.2.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/plugins/scala-continuations-plugin_2.11.1/1.0.2/scala-continuations-plugin_2.11.1-1.0.2.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/scala-library/2.11.1/scala-library-2.11.1.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/scala-parser-combinators_2.11/1.0.1/scala-parser-combinators_2.11-1.0.1.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/scala-reflect/2.11.1/scala-reflect-2.11.1.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/scala-swing_2.11/1.0.1/scala-swing_2.11-1.0.1.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/scala-xml_2.11/1.0.2/scala-xml_2.11-1.0.2.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/lzma/lzma/0.0.1/lzma-0.0.1.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/sf/jopt-simple/jopt-simple/5.0.3/jopt-simple-5.0.3.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/java3d/vecmath/1.5.2/vecmath-1.5.2.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/sf/trove4j/trove4j/3.0.3/trove4j-3.0.3.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/apache/maven/maven-artifact/3.5.3/maven-artifact-3.5.3.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/mojang/patchy/1.1/patchy-1.1.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/oshi-project/oshi-core/1.1/oshi-core-1.1.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/java/dev/jna/jna/4.4.0/jna-4.4.0.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/java/dev/jna/platform/3.4.0/platform-3.4.0.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/ibm/icu/icu4j-core-mojang/51.2/icu4j-core-mojang-51.2.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/sf/jopt-simple/jopt-simple/5.0.3/jopt-simple-5.0.3.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/paulscode/codecjorbis/20101023/codecjorbis-20101023.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/paulscode/codecwav/20101023/codecwav-20101023.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/paulscode/libraryjavasound/20101123/libraryjavasound-20101123.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/paulscode/librarylwjglopenal/20100824/librarylwjglopenal-20100824.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/paulscode/soundsystem/20120107/soundsystem-20120107.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/io/netty/netty-all/4.1.9.Final/netty-all-4.1.9.Final.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/google/guava/guava/21.0/guava-21.0.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/apache/commons/commons-lang3/3.5/commons-lang3-3.5.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/commons-io/commons-io/2.5/commons-io-2.5.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/commons-codec/commons-codec/1.10/commons-codec-1.10.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/java/jinput/jinput/2.0.5/jinput-2.0.5.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/java/jutils/jutils/1.0.0/jutils-1.0.0.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/google/code/gson/gson/2.8.0/gson-2.8.0.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/mojang/authlib/1.5.25/authlib-1.5.25.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/mojang/realms/1.10.22/realms-1.10.22.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/apache/commons/commons-compress/1.8.1/commons-compress-1.8.1.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/apache/httpcomponents/httpclient/4.3.3/httpclient-4.3.3.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/commons-logging/commons-logging/1.1.3/commons-logging-1.1.3.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/apache/httpcomponents/httpcore/4.3.2/httpcore-4.3.2.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/it/unimi/dsi/fastutil/7.1.0/fastutil-7.1.0.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/apache/logging/log4j/log4j-api/2.8.1/log4j-api-2.8.1.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/apache/logging/log4j/log4j-core/2.8.1/log4j-core-2.8.1.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/lwjgl/lwjgl/lwjgl/2.9.4-nightly-20150209/lwjgl-2.9.4-nightly-20150209.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/lwjgl/lwjgl/lwjgl_util/2.9.4-nightly-20150209/lwjgl_util-2.9.4-nightly-20150209.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/mojang/text2speech/1.10.3/text2speech-1.10.3.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/versions/1.12.2/1.12.2.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/additionalresources-1.9.4-0.2.0.28+47cd0bd_signed.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/CreativeCore_v1.9.45_mc1.12.2.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/CTM-MC1.12.2-0.3.3.22.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/Forgelin-1.8.2.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/LittleTiles_v1.5.0-pre135_mc1.12.2.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/OptiFine_1.12.2_HD_U_E3.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/randompatches-1.12.2-1.15.1.0.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/RandomThings-MC1.12.2-4.2.7.1.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/redstonepaste-mc1.12-1.7.5.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/SmoothFont-mc1.12.2-1.16.2.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/wings-1.1.4-1.12.2.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/com/enderio/core/EnderCore/1.12.2-0.5.57/EnderCore-1.12.2-0.5.57-core.jar for mixin tweaker | |
| [22:52:06] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/net/ilexiconn/llibrary-core/1.0.11-1.12.2/llibrary-core-1.0.11-1.12.2.jar for mixin tweaker | |
| [22:52:06] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLDeobfTweaker | |
| [22:52:06] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker | |
| [22:52:06] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker | |
| [22:52:06] [main/INFO] [LaunchWrapper]: Calling tweak class optifine.OptiFineForgeTweaker | |
| [22:52:06] [main/INFO] [STDOUT]: [optifine.OptiFineForgeTweaker:dbg:56]: OptiFineForgeTweaker: acceptOptions | |
| [22:52:06] [main/INFO] [STDOUT]: [optifine.OptiFineForgeTweaker:dbg:56]: OptiFineForgeTweaker: injectIntoClassLoader | |
| [22:52:06] [main/INFO] [STDOUT]: [optifine.OptiFineClassTransformer:dbg:221]: OptiFine ClassTransformer | |
| [22:52:06] [main/INFO] [STDOUT]: [optifine.OptiFineClassTransformer:dbg:221]: OptiFine ZIP file: C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\OptiFine_1.12.2_HD_U_E3.jar | |
| [22:52:06] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper | |
| [22:52:06] [main/DEBUG] [FML]: Injecting coremod FMLCorePlugin \{net.minecraftforge.fml.relauncher.FMLCorePlugin\} class transformers | |
| [22:52:06] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.SideTransformer | |
| [22:52:06] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[PREINIT] | |
| [22:52:06] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer | |
| [22:52:06] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer | |
| [22:52:06] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer | |
| [22:52:06] [main/DEBUG] [FML]: Injection complete | |
| [22:52:06] [main/DEBUG] [FML]: Running coremod plugin for FMLCorePlugin \{net.minecraftforge.fml.relauncher.FMLCorePlugin\} | |
| [22:52:06] [main/DEBUG] [FML]: Running coremod plugin FMLCorePlugin | |
| [22:52:08] [main/DEBUG] [FML]: Read 1140 binary patches | |
| [22:52:08] [main/DEBUG] [FML]: Loading deobfuscation resource /deobfuscation_data-1.12.2.lzma with 36083 records | |
| [22:52:09] [main/INFO] [FML]: Found valid fingerprint for Minecraft Forge. Certificate fingerprint e3c3d50c7c986df74c645c0ac54639741c90a557 | |
| [22:52:09] [main/INFO] [FML]: Found valid fingerprint for Minecraft. Certificate fingerprint cd99959656f753dc28d863b46769f7f8fbaefcfc | |
| [22:52:09] [main/DEBUG] [FML]: Coremod plugin class FMLCorePlugin run successfully | |
| [22:52:09] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper | |
| [22:52:09] [main/DEBUG] [FML]: Injecting coremod FMLForgePlugin \{net.minecraftforge.classloading.FMLForgePlugin\} class transformers | |
| [22:52:09] [main/DEBUG] [FML]: Injection complete | |
| [22:52:09] [main/DEBUG] [FML]: Running coremod plugin for FMLForgePlugin \{net.minecraftforge.classloading.FMLForgePlugin\} | |
| [22:52:09] [main/DEBUG] [FML]: Running coremod plugin FMLForgePlugin | |
| [22:52:09] [main/DEBUG] [FML]: Coremod plugin class FMLForgePlugin run successfully | |
| [22:52:09] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper | |
| [22:52:09] [main/DEBUG] [FML]: Injecting coremod Ar_CorePlugin \{portablejim.additionalresources.Ar_CorePlugin\} class transformers | |
| [22:52:09] [main/DEBUG] [FML]: Injection complete | |
| [22:52:09] [main/DEBUG] [FML]: Running coremod plugin for Ar_CorePlugin \{portablejim.additionalresources.Ar_CorePlugin\} | |
| [22:52:09] [main/DEBUG] [FML]: Running coremod plugin Ar_CorePlugin | |
| [22:52:09] [main/DEBUG] [FML]: Coremod plugin class Ar_CorePlugin run successfully | |
| [22:52:09] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper | |
| [22:52:09] [main/DEBUG] [FML]: Injecting coremod CreativePatchingLoader \{com.creativemd.creativecore.core.CreativePatchingLoader\} class transformers | |
| [22:52:09] [main/DEBUG] [FML]: Injection complete | |
| [22:52:09] [main/DEBUG] [FML]: Running coremod plugin for CreativePatchingLoader \{com.creativemd.creativecore.core.CreativePatchingLoader\} | |
| [22:52:09] [main/DEBUG] [FML]: Running coremod plugin CreativePatchingLoader | |
| [22:52:10] [main/DEBUG] [FML]: Coremod plugin class CreativePatchingLoader run successfully | |
| [22:52:10] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper | |
| [22:52:10] [main/DEBUG] [FML]: Injecting coremod ForgelinPlugin \{net.shadowfacts.forgelin.preloader.ForgelinPlugin\} class transformers | |
| [22:52:10] [main/DEBUG] [FML]: Injection complete | |
| [22:52:10] [main/DEBUG] [FML]: Running coremod plugin for ForgelinPlugin \{net.shadowfacts.forgelin.preloader.ForgelinPlugin\} | |
| [22:52:10] [main/DEBUG] [FML]: Running coremod plugin ForgelinPlugin | |
| [22:52:10] [main/DEBUG] [FML]: Coremod plugin class ForgelinPlugin run successfully | |
| [22:52:10] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper | |
| [22:52:10] [main/DEBUG] [FML]: Injecting coremod LittlePatchingLoader \{com.creativemd.littletiles.LittlePatchingLoader\} class transformers | |
| [22:52:10] [main/TRACE] [FML]: Registering transformer com.creativemd.littletiles.LittleTilesTransformer | |
| [22:52:10] [main/DEBUG] [FML]: Injection complete | |
| [22:52:10] [main/DEBUG] [FML]: Running coremod plugin for LittlePatchingLoader \{com.creativemd.littletiles.LittlePatchingLoader\} | |
| [22:52:10] [main/DEBUG] [FML]: Running coremod plugin LittlePatchingLoader | |
| [22:52:10] [main/DEBUG] [FML]: Coremod plugin class LittlePatchingLoader run successfully | |
| [22:52:10] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper | |
| [22:52:10] [main/DEBUG] [FML]: Injecting coremod CorePlugin \{bre.smoothfont.asm.CorePlugin\} class transformers | |
| [22:52:10] [main/TRACE] [FML]: Registering transformer bre.smoothfont.asm.Transformer | |
| [22:52:10] [main/DEBUG] [FML]: Injection complete | |
| [22:52:10] [main/DEBUG] [FML]: Running coremod plugin for CorePlugin \{bre.smoothfont.asm.CorePlugin\} | |
| [22:52:10] [main/DEBUG] [FML]: Running coremod plugin CorePlugin | |
| [22:52:10] [main/INFO] [SmoothFontCore ASM]: OptiFine was detected. | |
| [22:52:10] [main/DEBUG] [FML]: Coremod plugin class CorePlugin run successfully | |
| [22:52:10] [main/INFO] [LaunchWrapper]: Calling tweak class org.spongepowered.asm.launch.MixinTweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Processing prepare() for PlatformAgent[MixinPlatformAgentFML:file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.1.6+build31/phosphor-1.12.2-0.1.6+build31.jar] | |
| [22:52:10] [main/DEBUG] [mixin]: Processing prepare() for PlatformAgent[MixinPlatformAgentDefault:file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.1.6+build31/phosphor-1.12.2-0.1.6+build31.jar] | |
| [22:52:10] [main/DEBUG] [mixin]: Processing launch tasks for PlatformAgent[MixinPlatformAgentFML:file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.1.6+build31/phosphor-1.12.2-0.1.6+build31.jar] | |
| [22:52:10] [main/DEBUG] [mixin]: Creating FML remapper adapter: org.spongepowered.asm.bridge.RemapperAdapterFML | |
| [22:52:10] [main/INFO] [mixin]: Initialised Mixin FML Remapper Adapter with net.minecraftforge.fml.common.asm.transformers.deobf.FMLDeobfuscatingRemapper@36f1046f | |
| [22:52:10] [main/DEBUG] [mixin]: Processing launch tasks for PlatformAgent[MixinPlatformAgentDefault:file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.1.6+build31/phosphor-1.12.2-0.1.6+build31.jar] | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/minecraftforge/forge/1.12.2-14.23.5.2837/forge-1.12.2-14.23.5.2837.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/minecraft/launchwrapper/1.12/launchwrapper-1.12.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/ow2/asm/asm-all/5.2/asm-all-5.2.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/jline/jline/3.5.1/jline-3.5.1.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/java/dev/jna/jna/4.4.0/jna-4.4.0.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/typesafe/akka/akka-actor_2.11/2.3.3/akka-actor_2.11-2.3.3.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/typesafe/config/1.2.1/config-1.2.1.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/scala-actors-migration_2.11/1.1.0/scala-actors-migration_2.11-1.1.0.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/scala-compiler/2.11.1/scala-compiler-2.11.1.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/plugins/scala-continuations-library_2.11/1.0.2/scala-continuations-library_2.11-1.0.2.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/plugins/scala-continuations-plugin_2.11.1/1.0.2/scala-continuations-plugin_2.11.1-1.0.2.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/scala-library/2.11.1/scala-library-2.11.1.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/scala-parser-combinators_2.11/1.0.1/scala-parser-combinators_2.11-1.0.1.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/scala-reflect/2.11.1/scala-reflect-2.11.1.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/scala-swing_2.11/1.0.1/scala-swing_2.11-1.0.1.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/scala-lang/scala-xml_2.11/1.0.2/scala-xml_2.11-1.0.2.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/lzma/lzma/0.0.1/lzma-0.0.1.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/sf/jopt-simple/jopt-simple/5.0.3/jopt-simple-5.0.3.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/java3d/vecmath/1.5.2/vecmath-1.5.2.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/sf/trove4j/trove4j/3.0.3/trove4j-3.0.3.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/apache/maven/maven-artifact/3.5.3/maven-artifact-3.5.3.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/mojang/patchy/1.1/patchy-1.1.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/oshi-project/oshi-core/1.1/oshi-core-1.1.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/java/dev/jna/jna/4.4.0/jna-4.4.0.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/java/dev/jna/platform/3.4.0/platform-3.4.0.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/ibm/icu/icu4j-core-mojang/51.2/icu4j-core-mojang-51.2.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/sf/jopt-simple/jopt-simple/5.0.3/jopt-simple-5.0.3.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/paulscode/codecjorbis/20101023/codecjorbis-20101023.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/paulscode/codecwav/20101023/codecwav-20101023.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/paulscode/libraryjavasound/20101123/libraryjavasound-20101123.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/paulscode/librarylwjglopenal/20100824/librarylwjglopenal-20100824.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/paulscode/soundsystem/20120107/soundsystem-20120107.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/io/netty/netty-all/4.1.9.Final/netty-all-4.1.9.Final.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/google/guava/guava/21.0/guava-21.0.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/apache/commons/commons-lang3/3.5/commons-lang3-3.5.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/commons-io/commons-io/2.5/commons-io-2.5.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/commons-codec/commons-codec/1.10/commons-codec-1.10.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/java/jinput/jinput/2.0.5/jinput-2.0.5.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/net/java/jutils/jutils/1.0.0/jutils-1.0.0.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/google/code/gson/gson/2.8.0/gson-2.8.0.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/mojang/authlib/1.5.25/authlib-1.5.25.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/mojang/realms/1.10.22/realms-1.10.22.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/apache/commons/commons-compress/1.8.1/commons-compress-1.8.1.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/apache/httpcomponents/httpclient/4.3.3/httpclient-4.3.3.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/commons-logging/commons-logging/1.1.3/commons-logging-1.1.3.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/apache/httpcomponents/httpcore/4.3.2/httpcore-4.3.2.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/it/unimi/dsi/fastutil/7.1.0/fastutil-7.1.0.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/apache/logging/log4j/log4j-api/2.8.1/log4j-api-2.8.1.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/apache/logging/log4j/log4j-core/2.8.1/log4j-core-2.8.1.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/lwjgl/lwjgl/lwjgl/2.9.4-nightly-20150209/lwjgl-2.9.4-nightly-20150209.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/org/lwjgl/lwjgl/lwjgl_util/2.9.4-nightly-20150209/lwjgl_util-2.9.4-nightly-20150209.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/libraries/com/mojang/text2speech/1.10.3/text2speech-1.10.3.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/versions/1.12.2/1.12.2.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/additionalresources-1.9.4-0.2.0.28+47cd0bd_signed.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/CreativeCore_v1.9.45_mc1.12.2.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/CTM-MC1.12.2-0.3.3.22.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/Forgelin-1.8.2.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/LittleTiles_v1.5.0-pre135_mc1.12.2.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/OptiFine_1.12.2_HD_U_E3.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/randompatches-1.12.2-1.15.1.0.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/RandomThings-MC1.12.2-4.2.7.1.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/redstonepaste-mc1.12-1.7.5.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/SmoothFont-mc1.12.2-1.16.2.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/wings-1.1.4-1.12.2.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/com/enderio/core/EnderCore/1.12.2-0.5.57/EnderCore-1.12.2-0.5.57-core.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/net/ilexiconn/llibrary-core/1.0.11-1.12.2/llibrary-core-1.0.11-1.12.2.jar for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: Scanning asmgen:/ for mixin tweaker | |
| [22:52:10] [main/DEBUG] [mixin]: inject() running with 1 agents | |
| [22:52:10] [main/DEBUG] [mixin]: Processing inject() for PlatformAgent[MixinPlatformAgentFML:file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.1.6+build31/phosphor-1.12.2-0.1.6+build31.jar] | |
| [22:52:10] [main/DEBUG] [mixin]: FML agent is co-initiralising coremod instance PhosphorFMLLoadingPlugin {[]} for file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.1.6+build31/phosphor-1.12.2-0.1.6+build31.jar | |
| [22:52:10] [main/DEBUG] [FML]: Injecting coremod PhosphorFMLLoadingPlugin \{me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin\} class transformers | |
| [22:52:10] [main/DEBUG] [FML]: Injection complete | |
| [22:52:10] [main/DEBUG] [FML]: Running coremod plugin for PhosphorFMLLoadingPlugin \{me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin\} | |
| [22:52:10] [main/DEBUG] [FML]: Running coremod plugin PhosphorFMLLoadingPlugin | |
| [22:52:10] [main/INFO] [Phosphor]: Phosphor has been hooked, starting initialization | |
| [22:52:10] [main/INFO] [mixin]: Compatibility level set to JAVA_8 | |
| [22:52:10] [main/INFO] [Phosphor]: Phosphor has finished initializing | |
| [22:52:10] [main/DEBUG] [FML]: Coremod plugin class PhosphorFMLLoadingPlugin run successfully | |
| [22:52:10] [main/DEBUG] [mixin]: Processing inject() for PlatformAgent[MixinPlatformAgentDefault:file:/C:/Users/Lenovo/AppData/Roaming/.minecraft/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.1.6+build31/phosphor-1.12.2-0.1.6+build31.jar] | |
| [22:52:10] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLDeobfTweaker | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 215 rules from AccessTransformer config file forge_at.cfg | |
| [22:52:10] [main/DEBUG] [mixin]: Checking for additional mixins for MixinEnvironment[PREINIT] | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 13 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\armorplus-1.12.2-11.22.0.58.jar!META-INF/armorplus_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 4 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\RandomThings-MC1.12.2-4.2.7.1.jar!META-INF/randomthings_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 5 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\CTM-MC1.12.2-0.3.3.22.jar!META-INF/ctm_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 10 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\forestry_1.12.2-5.8.1.322.jar!META-INF/forestry_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\journeymap-1.12.2-5.5.4.jar!META-INF/journeymap_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 2 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\mcjtylib-1.12-3.5.2.jar!META-INF/mcjtylib_ng_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 7 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\TrashSlot_1.12.1-8.4.6.jar!META-INF/trashslot_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 8 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\Chisel-MC1.12.2-0.2.1.35.jar!META-INF/chisel_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 12 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\jei_1.12.2-4.15.0.268.jar!META-INF/jei_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\ElevatorMod-1.12.2-1.3.10.jar!META-INF/elevator_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 20 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\twilightforest-1.12.2-3.8.689-universal.jar!META-INF/tf_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 27 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\randomtweaks-1.12.2-2.5.0.5.jar!META-INF/randomtweaks_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 45 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\CoFHCore-1.12.2-4.6.2.25-universal.jar!META-INF/cofh_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 6 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\enderutilities-1.12.2-0.7.12.jar!META-INF/enderutilities_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 39 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\TConstruct-1.12.2-2.12.0.135.jar!META-INF/tconstruct_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 9 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\com\gildedgames\orbis-lib\1.12.2-0.2.0+build42\orbis-lib-1.12.2-0.2.0+build42.jar!META-INF/orbis-lib_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 8 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\Mantle-1.12-1.3.3.49.jar!META-INF/mantle_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 3 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\me\jellysquid\mods\phosphor\1.12.2-0.1.6+build31\phosphor-1.12.2-0.1.6+build31.jar!META-INF/phosphor_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 26 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\aether_ii-1.12.2-0.2.0+build42-universal.jar!META-INF/aether_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 13 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\BiomesOPlenty-1.12.2-7.0.1.2419-universal.jar!META-INF/biomesoplenty_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\Decocraft-2.6.2_1.12.2.jar!META-INF/decocraft_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 4 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\ProjectE-1.12.2-PE1.4.1.jar!META-INF/pe_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 50 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\Bookshelf-1.12.2-2.3.577.jar!META-INF/bookshelf_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 97 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\extrautils2-1.12-1.9.9.jar!META-INF/extrautils2_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 35 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\Botania+r1.10-361.jar!META-INF/botania_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 9 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\SmoothFont-mc1.12.2-1.16.2.jar!META-INF/SmoothFont_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 11 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\llibrary-1.7.19-1.12.2.jar!META-INF/llibrary_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 4 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\RebornCore-1.12.2-3.13.12.447-universal.jar!META-INF/reborncore_at.cfg | |
| [22:52:10] [main/DEBUG] [FML]: Loaded 119 rules from AccessTransformer mod jar file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\iChunUtil-1.12.2-7.2.1.jar!META-INF/iChunUtil_at.cfg | |
| [22:52:10] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #2 | |
| [22:52:10] [main/DEBUG] [FML]: Validating minecraft | |
| [22:52:10] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[INIT] | |
| [22:52:10] [main/DEBUG] [FML]: Minecraft validated, launching... | |
| [22:52:10] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper | |
| [22:52:10] [main/DEBUG] [FML]: Injecting coremod LoadingPlugin \{lumien.randomthings.asm.LoadingPlugin\} class transformers | |
| [22:52:11] [main/TRACE] [FML]: Registering transformer lumien.randomthings.asm.ClassTransformer | |
| [22:52:11] [main/DEBUG] [RandomThingsCore]: Starting Class Transformation | |
| [22:52:11] [main/DEBUG] [FML]: Injection complete | |
| [22:52:11] [main/DEBUG] [FML]: Running coremod plugin for LoadingPlugin \{lumien.randomthings.asm.LoadingPlugin\} | |
| [22:52:11] [main/DEBUG] [FML]: Running coremod plugin LoadingPlugin | |
| [22:52:11] [main/DEBUG] [FML]: Coremod plugin class LoadingPlugin run successfully | |
| [22:52:11] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper | |
| [22:52:11] [main/DEBUG] [FML]: Injecting coremod llibrary \{net.ilexiconn.llibrary.server.core.plugin.LLibraryPlugin\} class transformers | |
| [22:52:11] [main/TRACE] [FML]: Registering transformer net.ilexiconn.llibrary.server.core.plugin.LLibraryTransformer | |
| [22:52:11] [main/TRACE] [FML]: Registering transformer net.ilexiconn.llibrary.server.core.patcher.LLibraryRuntimePatcher | |
| [22:52:11] [main/DEBUG] [LLibrary Core]: Found runtime patcher net.ilexiconn.llibrary.server.core.patcher.LLibraryRuntimePatcher | |
| [22:52:11] [main/DEBUG] [FML]: Injection complete | |
| [22:52:11] [main/DEBUG] [FML]: Running coremod plugin for llibrary \{net.ilexiconn.llibrary.server.core.plugin.LLibraryPlugin\} | |
| [22:52:11] [main/DEBUG] [FML]: Running coremod plugin llibrary | |
| [22:52:11] [main/DEBUG] [FML]: Coremod plugin class LLibraryPlugin run successfully | |
| [22:52:11] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper | |
| [22:52:11] [main/DEBUG] [FML]: Injecting coremod wings \{me.paulf.wings.server.asm.plugin.WingsLoadingPlugin\} class transformers | |
| [22:52:11] [main/TRACE] [FML]: Registering transformer me.paulf.wings.server.asm.WingsRuntimePatcher | |
| [22:52:11] [main/DEBUG] [LLibrary Core]: Found no method mapping for java/lang/String/format(Ljava/lang/String;[Ljava/lang/Object;)Ljava/lang/String; | |
| [22:52:11] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/minecraft/client/model/ModelBiped/<init>(FZ)V | |
| [22:52:11] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/minecraft/client/renderer/entity/RenderPlayer/<init>(Lnet/minecraft/client/renderer/entity/RenderManager;Z)V | |
| [22:52:11] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/minecraftforge/client/ForgeHooksClient/handleCameraTransforms(Lnet/minecraft/client/renderer/block/model/IBakedModel;Lnet/minecraft/client/renderer/block/model/ItemCameraTransforms$TransformType;Z)Lnet/minecraft/client/renderer/block/model/IBakedModel; | |
| [22:52:11] [main/DEBUG] [LLibrary Core]: Found runtime patcher me.paulf.wings.server.asm.WingsRuntimePatcher | |
| [22:52:11] [main/TRACE] [FML]: Registering transformer me.paulf.wings.server.asm.mobends.WingsMoBendsRuntimePatcher | |
| [22:52:11] [main/DEBUG] [LLibrary Core]: Found no method mapping for /()L; | |
| [22:52:11] [main/DEBUG] [LLibrary Core]: Found no method mapping for /()L; | |
| [22:52:11] [main/DEBUG] [LLibrary Core]: Found no method mapping for /()L; | |
| [22:52:11] [main/DEBUG] [LLibrary Core]: Found no method mapping for /()L; | |
| [22:52:11] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/minecraftforge/client/ForgeHooksClient/shouldCauseReequipAnimation(Lnet/minecraft/item/ItemStack;Lnet/minecraft/item/ItemStack;I)Z | |
| [22:52:11] [main/DEBUG] [LLibrary Core]: Found runtime patcher me.paulf.wings.server.asm.mobends.WingsMoBendsRuntimePatcher | |
| [22:52:11] [main/DEBUG] [FML]: Injection complete | |
| [22:52:11] [main/DEBUG] [FML]: Running coremod plugin for wings \{me.paulf.wings.server.asm.plugin.WingsLoadingPlugin\} | |
| [22:52:11] [main/DEBUG] [FML]: Running coremod plugin wings | |
| [22:52:11] [main/DEBUG] [FML]: Coremod plugin class WingsLoadingPlugin run successfully | |
| [22:52:11] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper | |
| [22:52:11] [main/DEBUG] [FML]: Injecting coremod NWRTweak \{net.fybertech.nwr.NWRTweak\} class transformers | |
| [22:52:11] [main/TRACE] [FML]: Registering transformer net.fybertech.nwr.NWRTransformer | |
| [22:52:11] [main/DEBUG] [FML]: Injection complete | |
| [22:52:11] [main/DEBUG] [FML]: Running coremod plugin for NWRTweak \{net.fybertech.nwr.NWRTweak\} | |
| [22:52:11] [main/DEBUG] [FML]: Running coremod plugin NWRTweak | |
| [22:52:11] [main/DEBUG] [FML]: Coremod plugin class NWRTweak run successfully | |
| [22:52:11] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper | |
| [22:52:11] [main/DEBUG] [FML]: Injecting coremod RandomPatches \{com.therandomlabs.randompatches.core.RPCore\} class transformers | |
| [22:52:11] [main/TRACE] [FML]: Registering transformer com.therandomlabs.randompatches.core.RPTransformer | |
| [22:52:11] [main/DEBUG] [FML]: Injection complete | |
| [22:52:11] [main/DEBUG] [FML]: Running coremod plugin for RandomPatches \{com.therandomlabs.randompatches.core.RPCore\} | |
| [22:52:11] [main/DEBUG] [FML]: Running coremod plugin RandomPatches | |
| [22:52:11] [main/DEBUG] [FML]: Coremod plugin class RPCore run successfully | |
| [22:52:11] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper | |
| [22:52:11] [main/DEBUG] [FML]: Injecting coremod CTMCorePlugin \{team.chisel.ctm.client.asm.CTMCorePlugin\} class transformers | |
| [22:52:11] [main/TRACE] [FML]: Registering transformer team.chisel.ctm.client.asm.CTMTransformer | |
| [22:52:11] [main/DEBUG] [FML]: Injection complete | |
| [22:52:11] [main/DEBUG] [FML]: Running coremod plugin for CTMCorePlugin \{team.chisel.ctm.client.asm.CTMCorePlugin\} | |
| [22:52:11] [main/DEBUG] [FML]: Running coremod plugin CTMCorePlugin | |
| [22:52:11] [main/DEBUG] [FML]: Coremod plugin class CTMCorePlugin run successfully | |
| [22:52:11] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper | |
| [22:52:11] [main/DEBUG] [FML]: Injecting coremod EnderCorePlugin \{com.enderio.core.common.transform.EnderCorePlugin\} class transformers | |
| [22:52:11] [main/TRACE] [FML]: Registering transformer com.enderio.core.common.transform.EnderCoreTransformer | |
| [22:52:11] [main/TRACE] [FML]: Registering transformer com.enderio.core.common.transform.SimpleMixinPatcher | |
| [22:52:11] [main/DEBUG] [FML]: Injection complete | |
| [22:52:11] [main/DEBUG] [FML]: Running coremod plugin for EnderCorePlugin \{com.enderio.core.common.transform.EnderCorePlugin\} | |
| [22:52:11] [main/DEBUG] [FML]: Running coremod plugin EnderCorePlugin | |
| [22:52:11] [main/DEBUG] [FML]: Coremod plugin class EnderCorePlugin run successfully | |
| [22:52:11] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.TerminalTweaker | |
| [22:52:11] [main/INFO] [LaunchWrapper]: Loading tweak class name org.spongepowered.asm.mixin.EnvironmentStateTweaker | |
| [22:52:11] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.TerminalTweaker | |
| [22:52:11] [main/INFO] [LaunchWrapper]: Calling tweak class org.spongepowered.asm.mixin.EnvironmentStateTweaker | |
| [22:52:11] [main/INFO] [STDOUT]: [optifine.OptiFineForgeTweaker:dbg:56]: OptiFineForgeTweaker: getLaunchArguments | |
| [22:52:11] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #3 | |
| [22:52:11] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[DEFAULT] | |
| [22:52:11] [main/DEBUG] [mixin]: Selecting config mixins.phosphor.json | |
| [22:52:11] [main/DEBUG] [mixin]: Preparing mixins.phosphor.json (6) | |
| [22:52:11] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Rebuilding transformer delegation list: | |
| [22:52:11] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PatchingTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: optifine.OptiFineClassTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SideTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Excluding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.com.creativemd.littletiles.LittleTilesTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.bre.smoothfont.asm.Transformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.AccessTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: com.creativemd.littletiles.LittleTilesAfterTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ModAccessTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemStackTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockSpecialTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PotionEffectTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.lumien.randomthings.asm.ClassTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.net.ilexiconn.llibrary.server.core.plugin.LLibraryTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.net.ilexiconn.llibrary.server.core.patcher.LLibraryRuntimePatcher | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.me.paulf.wings.server.asm.WingsRuntimePatcher | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.me.paulf.wings.server.asm.mobends.WingsMoBendsRuntimePatcher | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.net.fybertech.nwr.NWRTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.com.therandomlabs.randompatches.core.RPTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.team.chisel.ctm.client.asm.CTMTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.com.enderio.core.common.transform.EnderCoreTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Adding: $wrapper.com.enderio.core.common.transform.SimpleMixinPatcher | |
| [22:52:11] [main/DEBUG] [mixin]: Excluding: net.minecraftforge.fml.common.asm.transformers.TerminalTransformer | |
| [22:52:11] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy | |
| [22:52:11] [main/DEBUG] [mixin]: Transformer delegation list created with 25 entries | |
| [22:52:11] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/storage/AnvilChunkLoader to metadata cache | |
| [22:52:11] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/Chunk to metadata cache | |
| [22:52:11] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/gen/ChunkProviderServer to metadata cache | |
| [22:52:12] [main/INFO] [STDOUT]: [com.creativemd.creativecore.transformer.CreativeTransformer:transform:49]: [littletiles] Patched net.minecraft.client.Minecraft ... | |
| [22:52:12] [main/DEBUG] [randompatches]: Transforming class: net.minecraft.client.Minecraft | |
| [22:52:12] [main/DEBUG] [randompatches]: Patching method: func_152348_aa | |
| [22:52:12] [main/INFO] [mixin]: A re-entrant transformer '$wrapper.com.therandomlabs.randompatches.core.RPTransformer' was detected and will no longer process meta class data | |
| [22:52:12] [main/TRACE] [mixin]: Added class metadata for net/minecraft/client/Minecraft to metadata cache | |
| [22:52:12] [main/DEBUG] [mixin]: Rebuilding transformer delegation list: | |
| [22:52:12] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PatchingTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: optifine.OptiFineClassTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SideTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Excluding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.com.creativemd.littletiles.LittleTilesTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.bre.smoothfont.asm.Transformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.AccessTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: com.creativemd.littletiles.LittleTilesAfterTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ModAccessTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemStackTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockSpecialTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PotionEffectTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.lumien.randomthings.asm.ClassTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.net.ilexiconn.llibrary.server.core.plugin.LLibraryTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.net.ilexiconn.llibrary.server.core.patcher.LLibraryRuntimePatcher | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.me.paulf.wings.server.asm.WingsRuntimePatcher | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.me.paulf.wings.server.asm.mobends.WingsMoBendsRuntimePatcher | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.net.fybertech.nwr.NWRTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Excluding: $wrapper.com.therandomlabs.randompatches.core.RPTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.team.chisel.ctm.client.asm.CTMTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.com.enderio.core.common.transform.EnderCoreTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.com.enderio.core.common.transform.SimpleMixinPatcher | |
| [22:52:12] [main/DEBUG] [mixin]: Excluding: net.minecraftforge.fml.common.asm.transformers.TerminalTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy | |
| [22:52:12] [main/DEBUG] [mixin]: Transformer delegation list created with 24 entries | |
| [22:52:12] [main/TRACE] [mixin]: Added class metadata for net/minecraft/network/play/server/SPacketChunkData to metadata cache | |
| [22:52:12] [main/DEBUG] [RandomThingsCore]: Found World Class: net/minecraft/world/World | |
| [22:52:12] [main/DEBUG] [RandomThingsCore]: - Found getRedstonePower (1/5) | |
| [22:52:12] [main/DEBUG] [RandomThingsCore]: - Found getStrongPower (2/5) | |
| [22:52:12] [main/DEBUG] [RandomThingsCore]: - Found isRainingAt (3/5) | |
| [22:52:12] [main/DEBUG] [RandomThingsCore]: - Found canSnowAt (4/5) | |
| [22:52:12] [main/INFO] [mixin]: A re-entrant transformer '$wrapper.lumien.randomthings.asm.ClassTransformer' was detected and will no longer process meta class data | |
| [22:52:12] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/World to metadata cache | |
| [22:52:12] [main/DEBUG] [mixin]: Rebuilding transformer delegation list: | |
| [22:52:12] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PatchingTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: optifine.OptiFineClassTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SideTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Excluding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.com.creativemd.littletiles.LittleTilesTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.bre.smoothfont.asm.Transformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.AccessTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: com.creativemd.littletiles.LittleTilesAfterTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ModAccessTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemStackTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockSpecialTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PotionEffectTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy | |
| [22:52:12] [main/DEBUG] [mixin]: Excluding: $wrapper.lumien.randomthings.asm.ClassTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.net.ilexiconn.llibrary.server.core.plugin.LLibraryTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.net.ilexiconn.llibrary.server.core.patcher.LLibraryRuntimePatcher | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.me.paulf.wings.server.asm.WingsRuntimePatcher | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.me.paulf.wings.server.asm.mobends.WingsMoBendsRuntimePatcher | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.net.fybertech.nwr.NWRTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Excluding: $wrapper.com.therandomlabs.randompatches.core.RPTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.team.chisel.ctm.client.asm.CTMTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.com.enderio.core.common.transform.EnderCoreTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Adding: $wrapper.com.enderio.core.common.transform.SimpleMixinPatcher | |
| [22:52:12] [main/DEBUG] [mixin]: Excluding: net.minecraftforge.fml.common.asm.transformers.TerminalTransformer | |
| [22:52:12] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy | |
| [22:52:12] [main/DEBUG] [mixin]: Transformer delegation list created with 23 entries | |
| [22:52:12] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/Chunk$EnumCreateEntityType to metadata cache | |
| [22:52:12] [main/TRACE] [mixin]: Added class metadata for net/minecraft/util/EnumFacing$Plane to metadata cache | |
| [22:52:12] [main/TRACE] [mixin]: Added class metadata for org/spongepowered/asm/mixin/injection/At$Shift to metadata cache | |
| [22:52:12] [main/DEBUG] [mixin]: Prepared 6 mixins in 1,187 sec (197,8ms avg) (3ms load, 927ms transform, 0ms plugin) | |
| [22:52:12] [main/INFO] [LaunchWrapper]: Launching wrapped minecraft {net.minecraft.client.main.Main} | |
| [22:52:13] [main/INFO] [STDOUT]: [com.creativemd.creativecore.transformer.CreativeTransformer:transform:49]: [littletiles] Patched net.minecraft.client.Minecraft ... | |
| [22:52:13] [main/DEBUG] [randompatches]: Transforming class: net.minecraft.client.Minecraft | |
| [22:52:13] [main/DEBUG] [randompatches]: Patching method: func_152348_aa | |
| [22:52:13] [main/DEBUG] [mixin]: Mixing MixinMinecraft from mixins.phosphor.json into net.minecraft.client.Minecraft | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for net/minecraft/profiler/Profiler to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/ILightingEngineProvider to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/ILightingEngine to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for org/spongepowered/asm/mixin/injection/callback/CallbackInfo to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for net/minecraft/util/ReportedException to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for net/minecraft/util/MinecraftError to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for java/lang/RuntimeException to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for java/lang/Exception to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for java/lang/Throwable to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for java/lang/Error to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for java/util/Iterator to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for net/minecraft/client/gui/GuiGameOver to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for net/minecraft/client/gui/GuiScreen to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for net/minecraft/client/gui/GuiMainMenu to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for java/lang/String to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for java/lang/Integer to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for java/lang/Number to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for com/mojang/authlib/yggdrasil/YggdrasilAuthenticationService to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for com/mojang/authlib/HttpAuthenticationService to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for com/mojang/authlib/BaseAuthenticationService to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for java/lang/InterruptedException to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for com/mojang/authlib/minecraft/MinecraftSessionService to metadata cache | |
| [22:52:13] [main/DEBUG] [RandomThingsCore]: Found World Class: net/minecraft/world/World | |
| [22:52:13] [main/DEBUG] [RandomThingsCore]: - Found getRedstonePower (1/5) | |
| [22:52:13] [main/DEBUG] [RandomThingsCore]: - Found getStrongPower (2/5) | |
| [22:52:13] [main/DEBUG] [RandomThingsCore]: - Found isRainingAt (3/5) | |
| [22:52:13] [main/DEBUG] [RandomThingsCore]: - Found canSnowAt (4/5) | |
| [22:52:13] [main/DEBUG] [mixin]: Mixing MixinWorld from mixins.phosphor.json into net.minecraft.world.World | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/common/world/LightingEngine to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for java/lang/Boolean to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for java/io/Serializable to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for java/lang/Comparable to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for org/spongepowered/asm/mixin/injection/callback/CallbackInfoReturnable to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/EnumSkyBlock to metadata cache | |
| [22:52:13] [main/TRACE] [mixin]: Added class metadata for net/minecraft/util/math/BlockPos to metadata cache | |
| [22:52:13] [main/INFO] [STDOUT]: [com.creativemd.creativecore.transformer.CreativeTransformer:transform:49]: [littletiles] Patched net.minecraft.client.multiplayer.WorldClient ... | |
| [22:52:13] [main/INFO] [STDOUT]: [com.creativemd.creativecore.transformer.CreativeTransformer:transform:49]: [littletiles] Patched net.minecraft.entity.player.EntityPlayer ... | |
| [22:52:13] [main/DEBUG] [LLibrary Core]: Patching class net/minecraft/entity/player/EntityPlayer | |
| [22:52:13] [main/DEBUG] [LLibrary Core]: Patching method func_184808_cD()V | |
| [22:52:13] [main/DEBUG] [LLibrary Core]: Found no method mapping for me/paulf/wings/server/asm/WingsHooks/onFlightCheck(Lnet/minecraft/entity/player/EntityPlayer;Z)Z | |
| [22:52:13] [main/DEBUG] [LLibrary Core]: Patching method func_71000_j(DDD)V | |
| [22:52:13] [main/DEBUG] [LLibrary Core]: Found no method mapping for me/paulf/wings/server/asm/WingsHooks/onAddFlown(Lnet/minecraft/entity/player/EntityPlayer;DDD)V | |
| [22:52:13] [main/DEBUG] [LLibrary Core]: Patching method func_70047_e()F | |
| [22:52:13] [main/DEBUG] [LLibrary Core]: Found no method mapping for me/paulf/wings/server/asm/WingsHooks/onFlightCheck(Lnet/minecraft/entity/player/EntityPlayer;Z)Z | |
| [22:52:13] [main/DEBUG] [LLibrary Core]: Patching method func_174820_d(ILnet/minecraft/item/ItemStack;)Z | |
| [22:52:13] [main/DEBUG] [LLibrary Core]: Found no method mapping for me/paulf/wings/server/asm/WingsHooks/onReplaceItemSlotCheck(Lnet/minecraft/item/Item;Lnet/minecraft/item/ItemStack;)Z | |
| [22:52:13] [main/WARN] [LLibrary Core]: Failed to fetch hierarchy node for net.minecraft.entity.EntityLivingBase. This may cause patch issues | |
| [22:52:13] [main/WARN] [LLibrary Core]: Failed to fetch hierarchy node for net.minecraft.entity.Entity. This may cause patch issues | |
| [22:52:13] [main/INFO] [EnderCore ASM]: Transforming net.minecraft.entity.player.EntityPlayer finished, added func_184613_cA() overriding EntityLivingBase | |
| [22:52:13] [main/DEBUG] [RandomThingsCore]: Found EntityLivingBase Class: net/minecraft/entity/EntityLivingBase | |
| [22:52:13] [main/DEBUG] [RandomThingsCore]: - Found updatePotionEffects (1/2) | |
| [22:52:13] [main/DEBUG] [RandomThingsCore]: - Found travel (2/2) | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Patching class net/minecraft/entity/EntityLivingBase | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Patching method func_110146_f(FF)F | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Found no method mapping for me/paulf/wings/server/asm/WingsHooks/onUpdateBodyRotation(Lnet/minecraft/entity/EntityLivingBase;F)V | |
| [22:52:14] [main/WARN] [LLibrary Core]: Failed to fetch hierarchy node for net.minecraft.entity.player.EntityPlayerMP. This may cause patch issues | |
| [22:52:14] [main/INFO] [STDOUT]: [com.creativemd.creativecore.transformer.CreativeTransformer:transform:49]: [littletiles] Patched net.minecraft.entity.Entity ... | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Patching class net/minecraft/entity/Entity | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Patching method func_70082_c(FF)V | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Found no method mapping for me/paulf/wings/server/asm/WingsHooksClient/onTurn(Lnet/minecraft/entity/Entity;F)V | |
| [22:52:14] [main/DEBUG] [randompatches]: Transforming class: net.minecraft.entity.Entity | |
| [22:52:14] [main/DEBUG] [randompatches]: Patching method: func_189511_e | |
| [22:52:14] [main/DEBUG] [randompatches]: Patching method: func_70020_e | |
| [22:52:14] [main/DEBUG] [randompatches]: Transforming class: net.minecraft.nbt.NBTTagCompound | |
| [22:52:14] [main/DEBUG] [randompatches]: Patching method: equals | |
| [22:52:14] [main/DEBUG] [randompatches]: Transforming class: net.minecraft.client.gui.GuiIngameMenu | |
| [22:52:14] [main/DEBUG] [randompatches]: Patching method: func_146284_a | |
| [22:52:14] [main/INFO] [SmoothFontCore ASM]: Transform: net.minecraftforge.client.GuiIngameForge | |
| [22:52:14] [main/INFO] [SmoothFontCore ASM]: Internal name = net.minecraftforge.client.GuiIngameForge | |
| [22:52:14] [main/INFO] [SmoothFontCore ASM]: Transformed name = net.minecraftforge.client.GuiIngameForge | |
| [22:52:14] [main/INFO] [SmoothFontCore ASM]: Modified renderExperience method. | |
| [22:52:14] [main/INFO] [SmoothFontCore ASM]: RENDER_EXPERIENCE:true | |
| [22:52:14] [main/INFO] [SmoothFontCore ASM]: ** GuiIngameForge was transformed successfully. | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Patching class net/minecraft/server/MinecraftServer | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Patching method run()V | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/getTickRate()J | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/getTickRate()J | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/getTickRate()J | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/getTickRate()J | |
| [22:52:14] [main/DEBUG] [randompatches]: Transforming class: net.minecraft.world.WorldServer | |
| [22:52:14] [main/DEBUG] [randompatches]: Patching method: <init> | |
| [22:52:14] [main/INFO] [STDOUT]: [com.creativemd.creativecore.transformer.CreativeTransformer:transform:49]: [littletiles] Patched net.minecraftforge.client.ForgeHooksClient ... | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Patching class net/minecraftforge/client/ForgeHooksClient | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Patching method handleCameraTransforms(Lnet/minecraft/client/renderer/block/model/IBakedModel;Lnet/minecraft/client/renderer/block/model/ItemCameraTransforms$TransformType;Z)Lnet/minecraft/client/renderer/block/model/IBakedModel; | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/providePerspectiveContext(Lnet/minecraft/client/renderer/block/model/ItemCameraTransforms$TransformType;)V | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Patching class net/minecraftforge/client/ForgeHooksClient | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Patching method shouldCauseReequipAnimation(Lnet/minecraft/item/ItemStack;Lnet/minecraft/item/ItemStack;I)Z | |
| [22:52:14] [main/DEBUG] [LLibrary Core]: Found no method mapping for me/paulf/wings/server/asm/WingsHooksClient/onCheckDoReequipAnimation(Lnet/minecraft/item/ItemStack;Lnet/minecraft/item/ItemStack;I)Z | |
| [22:52:14] [main/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:preTransform:230]: Transforming Class [net.minecraftforge.client.ForgeHooksClient], Method [getDamageModel] | |
| [22:52:14] [main/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:finishTransform:242]: Transforming net.minecraftforge.client.ForgeHooksClient Finished. | |
| [22:52:15] [Client thread/INFO] [net.minecraft.client.Minecraft]: Setting user: Ptychus | |
| [22:52:15] [Client thread/DEBUG] [RandomThingsCore]: Found Block Class: net/minecraft/block/Block | |
| [22:52:15] [Client thread/DEBUG] [RandomThingsCore]: - Found getLightValue (1/2) | |
| [22:52:15] [Client thread/DEBUG] [RandomThingsCore]: - Found addCollisionBoxesToList (2/2) | |
| [22:52:15] [Client thread/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:preTransform:230]: Transforming Class [net.minecraft.block.Block], Method [getExtendedState] | |
| [22:52:15] [Client thread/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:finishTransform:242]: Transforming net.minecraft.block.Block Finished. | |
| [22:52:16] [Client thread/INFO] [STDOUT]: [com.creativemd.creativecore.transformer.CreativeTransformer:transform:49]: [littletiles] Patched net.minecraft.util.math.AxisAlignedBB ... | |
| [22:52:16] [Client thread/DEBUG] [randompatches]: Transforming class: net.minecraft.item.ItemPotion | |
| [22:52:16] [Client thread/DEBUG] [randompatches]: Patching method: func_77636_d | |
| [22:52:16] [Client thread/DEBUG] [RandomThingsCore]: Found WorldGenAbstractTree Class: net/minecraft/world/gen/feature/WorldGenAbstractTree | |
| [22:52:16] [Client thread/DEBUG] [RandomThingsCore]: - Patching setDirtAt | |
| [22:52:16] [Client thread/DEBUG] [RandomThingsCore]: - Patched setDirtAt | |
| [22:52:16] [Client thread/DEBUG] [RandomThingsCore]: Found BlockFalling Class: net/minecraft/block/BlockFalling | |
| [22:52:16] [Client thread/DEBUG] [RandomThingsCore]: - Found canFallThrough | |
| [22:52:18] [Client thread/DEBUG] [randompatches]: Transforming class: net.minecraft.block.BlockEndPortal | |
| [22:52:18] [Client thread/DEBUG] [randompatches]: Patching method: func_176225_a | |
| [22:52:18] [Client thread/DEBUG] [randompatches]: Transforming class: net.minecraft.tileentity.TileEntityEndPortal | |
| [22:52:18] [Client thread/DEBUG] [randompatches]: Patching method: func_184313_a | |
| [22:52:19] [Client thread/DEBUG] [randompatches]: Transforming class: net.minecraft.item.ItemBucket | |
| [22:52:19] [Client thread/DEBUG] [randompatches]: Patching method: func_180616_a | |
| [22:52:20] [Client thread/DEBUG] [randompatches]: Transforming class: net.minecraft.entity.item.EntityMinecart | |
| [22:52:20] [Client thread/DEBUG] [randompatches]: Patching method: func_180460_a | |
| [22:52:20] [Client thread/DEBUG] [randompatches]: Transforming class: net.minecraft.entity.item.EntityBoat | |
| [22:52:20] [Client thread/DEBUG] [randompatches]: Patching method: func_70071_h_ | |
| [22:52:20] [Client thread/INFO] [STDOUT]: [com.creativemd.creativecore.transformer.CreativeTransformer:transform:49]: [littletiles] Patched net.minecraft.entity.player.EntityPlayerMP ... | |
| [22:52:21] [Client thread/INFO] [EnderCore ASM]: Transforming Class [net.minecraft.entity.ai.EntityAICreeperSwell], Method [func_75246_d] | |
| [22:52:21] [Client thread/INFO] [EnderCore ASM]: Transforming net.minecraft.entity.ai.EntityAICreeperSwell Finished. | |
| [22:52:21] [Client thread/DEBUG] [RandomThingsCore]: Found EntitySlime Class: net/minecraft/entity/monster/EntitySlime | |
| [22:52:21] [Client thread/DEBUG] [RandomThingsCore]: - Found getCanSpawnHere | |
| [22:52:21] [Client thread/DEBUG] [RandomThingsCore]: - Found Insertion Point | |
| [22:52:23] [Client thread/DEBUG] [FML]: Creating vanilla freeze snapshot | |
| [22:52:23] [Client thread/DEBUG] [FML]: Vanilla freeze snapshot created | |
| [22:52:24] [Client thread/DEBUG] [mixin]: Mixing MixinAnvilChunkLoader from mixins.phosphor.json into net.minecraft.world.chunk.storage.AnvilChunkLoader | |
| [22:52:24] [Client thread/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/common/world/LightingHooks to metadata cache | |
| [22:52:24] [Client thread/TRACE] [mixin]: Added class metadata for net/minecraft/nbt/NBTTagCompound to metadata cache | |
| [22:52:24] [Client thread/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/IChunkLightingData to metadata cache | |
| [22:52:24] [Client thread/TRACE] [mixin]: Added class metadata for net/minecraft/nbt/NBTBase to metadata cache | |
| [22:52:24] [Client thread/INFO] [EnderCore ASM]: Transforming Class [net.minecraft.inventory.ContainerFurnace], Method [func_82846_b] | |
| [22:52:24] [Client thread/INFO] [EnderCore ASM]: Transforming net.minecraft.inventory.ContainerFurnace Finished. | |
| [22:52:24] [Client thread/INFO] [Config]: [OptiFine] *** Reflector Forge *** | |
| [22:52:24] [Client thread/INFO] [Config]: [OptiFine] (Reflector) Class not present: mods.betterfoliage.client.BetterFoliageClient | |
| [22:52:24] [Client thread/DEBUG] [mixin]: Mixing MixinChunk from mixins.phosphor.json into net.minecraft.world.chunk.Chunk | |
| [22:52:24] [Client thread/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/IChunkLighting to metadata cache | |
| [22:52:25] [Client thread/TRACE] [mixin]: Added class metadata for net/minecraft/util/math/Vec3i to metadata cache | |
| [22:52:25] [Client thread/TRACE] [mixin]: Added class metadata for net/minecraft/world/WorldProvider to metadata cache | |
| [22:52:25] [Client thread/INFO] [EnderCore ASM]: Transforming Class [net.minecraft.world.chunk.storage.ExtendedBlockStorage], Method [func_76663_a] | |
| [22:52:25] [Client thread/INFO] [EnderCore ASM]: Transforming net.minecraft.world.chunk.storage.ExtendedBlockStorage Finished. | |
| [22:52:25] [Client thread/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/storage/ExtendedBlockStorage to metadata cache | |
| [22:52:25] [Client thread/TRACE] [mixin]: Added class metadata for net/minecraft/block/state/IBlockState to metadata cache | |
| [22:52:25] [Client thread/TRACE] [mixin]: Added class metadata for net/minecraft/init/Blocks to metadata cache | |
| [22:52:25] [Client thread/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:preTransform:230]: Transforming Class [net.minecraft.block.Block], Method [getExtendedState] | |
| [22:52:25] [Client thread/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:finishTransform:242]: Transforming net.minecraft.block.Block Finished. | |
| [22:52:25] [Client thread/TRACE] [mixin]: Added class metadata for net/minecraft/block/Block to metadata cache | |
| [22:52:25] [Client thread/TRACE] [mixin]: Added class metadata for net/minecraft/tileentity/TileEntity to metadata cache | |
| [22:52:25] [Client thread/TRACE] [mixin]: Added class metadata for net/minecraft/block/state/IBlockBehaviors to metadata cache | |
| [22:52:25] [Client thread/TRACE] [mixin]: Added class metadata for net/minecraft/block/state/IBlockProperties to metadata cache | |
| [22:52:25] [Client thread/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/common/world/WorldChunkSlice to metadata cache | |
| [22:52:25] [Client thread/TRACE] [mixin]: Added class metadata for net/minecraft/util/EnumFacing to metadata cache | |
| [22:52:25] [Client thread/TRACE] [mixin]: Added class metadata for java/lang/Math to metadata cache | |
| [22:52:25] [Client thread/DEBUG] [RandomThingsCore]: Found EntityRenderer Class: net/minecraft/client/renderer/EntityRenderer | |
| [22:52:25] [Client thread/DEBUG] [RandomThingsCore]: - Found renderRainSnow | |
| [22:52:25] [Client thread/DEBUG] [RandomThingsCore]: - Found canRain | |
| [22:52:25] [Client thread/DEBUG] [RandomThingsCore]: - Found getEnableSnow | |
| [22:52:25] [Client thread/DEBUG] [RandomThingsCore]: - Found addRainParticles | |
| [22:52:25] [Client thread/DEBUG] [LLibrary Core]: Patching class net/minecraft/client/renderer/EntityRenderer | |
| [22:52:25] [Client thread/DEBUG] [LLibrary Core]: Patching method func_78467_g(F)V | |
| [22:52:25] [Client thread/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/getViewDistance(Lnet/minecraft/entity/Entity;F)F | |
| [22:52:25] [Client thread/DEBUG] [LLibrary Core]: Patching class net/minecraft/client/renderer/EntityRenderer | |
| [22:52:25] [Client thread/DEBUG] [LLibrary Core]: Patching method func_78467_g(F)V | |
| [22:52:25] [Client thread/DEBUG] [LLibrary Core]: Found no method mapping for me/paulf/wings/server/asm/WingsHooks/onGetCameraEyeHeight(Lnet/minecraft/entity/Entity;F)F | |
| [22:52:25] [Client thread/INFO] [SmoothFontCore ASM]: Transform: net.minecraft.client.gui.ScaledResolution | |
| [22:52:25] [Client thread/INFO] [SmoothFontCore ASM]: Internal name = bit | |
| [22:52:25] [Client thread/INFO] [SmoothFontCore ASM]: Transformed name = net.minecraft.client.gui.ScaledResolution | |
| [22:52:25] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the hook in ScaledResolution.<init>. | |
| [22:52:25] [Client thread/INFO] [SmoothFontCore ASM]: INIT:true | |
| [22:52:25] [Client thread/INFO] [SmoothFontCore ASM]: ** ScaledResolution was transformed successfully. | |
| [22:52:25] [Client thread/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:preTransform:230]: Transforming Class [net.minecraft.client.renderer.texture.TextureAtlasSprite], Method [updateAnimationInterpolated] | |
| [22:52:25] [Client thread/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:finishTransform:242]: Transforming net.minecraft.client.renderer.texture.TextureAtlasSprite Finished. | |
| [22:52:26] [Client thread/INFO] [STDOUT]: [com.creativemd.creativecore.transformer.CreativeTransformer:transform:49]: [littletiles] Patched net.minecraftforge.common.ForgeHooks ... | |
| [22:52:26] [Client thread/INFO] [STDOUT]: [com.creativemd.creativecore.transformer.CreativeTransformer:transform:49]: [littletiles] Patched net.minecraft.network.NetHandlerPlayServer ... | |
| [22:52:26] [Client thread/DEBUG] [LLibrary Core]: Patching class net/minecraft/network/NetHandlerPlayServer | |
| [22:52:26] [Client thread/DEBUG] [LLibrary Core]: Patching method func_147347_a(Lnet/minecraft/network/play/client/CPacketPlayer;)V | |
| [22:52:26] [Client thread/DEBUG] [randompatches]: Transforming class: net.minecraft.network.NetHandlerPlayServer | |
| [22:52:26] [Client thread/DEBUG] [randompatches]: Patching method: func_73660_a | |
| [22:52:26] [Client thread/DEBUG] [randompatches]: Patching method: func_147347_a | |
| [22:52:26] [Client thread/DEBUG] [randompatches]: Patching method: func_184338_a | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Transform: net.minecraft.client.renderer.texture.TextureManager | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Internal name = cdr | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Transformed name = net.minecraft.client.renderer.texture.TextureManager | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the ExitHook in loadTexture() method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the ExitHook in loadTexture() method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: LOAD_TEXTURE:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: ** TextureManager was transformed successfully. | |
| [22:52:26] [Client thread/INFO] [STDOUT]: [com.creativemd.creativecore.transformer.CreativeTransformer:transform:49]: [littletiles] Patched net.minecraft.client.renderer.RenderGlobal ... | |
| [22:52:26] [Client thread/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:preTransform:230]: Transforming Class [net.minecraft.client.renderer.texture.TextureMap], Method [registerSprite] | |
| [22:52:26] [Client thread/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:finishTransform:242]: Transforming net.minecraft.client.renderer.texture.TextureMap Finished. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Transform: net.minecraft.client.gui.FontRenderer | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Internal name = bip | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Transformed name = net.minecraft.client.gui.FontRenderer | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: OptiFine (int)charWidth[] was found. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the EnterHook in constructor. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the ExitHook in constructor. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the ExitHook in readFontTexture method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the ExitHook in readFontTexture method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the ExitHook in readFontTexture method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the ExitHook in readGlyphSizes method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the ExitHook in readGlyphSizes method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the ExitHook in readGlyphSizes method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the EnterHook in renderChar() method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted renderCharGetCharIndexHook() in renderChar(). | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the EnterHook in renderDefaultChar method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the EnterHook in renderUnicodeChar() method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the EnterHook in renderStringAtPos method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted renderStringAtPosGetCharIndexHook() in renderStringAtPos(). | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Replaced unicodeFlag(x2) in renderStringAtPos(). | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted boldFlag related code in renderStringAtPos(). | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the ExitHook in renderStringAtPos method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the EnterHook in doDraw method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Modified doDraw method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the EnterHook in renderString method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the ExitHook in renderString method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the ExitHook in renderString method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the EnterHook in getStringWidth method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the EnterHook in getCharWidth method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted getCharWidthFloatGetCharIndexHook() in getCharWidthFloat(). | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the EnterHook in trimStringToWidth method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the ExitHook in setUnicodeFlag method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: Inserted the EnterHook in sizeStringToWidth method. | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: INIT:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: READ_FONT_TEXTURE:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: READ_GLYPH_SIZES:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: RENDER_CHAR:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: RENDER_DEFAULT_CHAR:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: RENDER_UNICODE_CHAR:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: RENDER_STRING_AT_POS:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: DO_DRAW:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: RENDER_STRING:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: GET_STRING_WIDTH:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: GET_CHAR_WIDTH:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: TRIM_STRING_TO_WIDTH:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: SET_UNICODE_FLAG:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: SIZE_STRING_TO_WIDTH:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: GET_CHAR_WIDTH_FLOAT:true | |
| [22:52:26] [Client thread/INFO] [SmoothFontCore ASM]: ** FontRenderer was transformed successfully. | |
| [22:52:26] [Client thread/INFO] [STDOUT]: [com.creativemd.creativecore.transformer.CreativeTransformer:transform:49]: [littletiles] Patched net.minecraft.client.renderer.BufferBuilder ... | |
| [22:52:26] [Client thread/DEBUG] [LLibrary Core]: Patching class net/minecraft/client/model/ModelBiped | |
| [22:52:26] [Client thread/DEBUG] [LLibrary Core]: Patching method func_78088_a(Lnet/minecraft/entity/Entity;FFFFFF)V | |
| [22:52:26] [Client thread/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/renderModel(Lnet/minecraft/client/model/ModelBiped;Lnet/minecraft/entity/Entity;FFFFFF)V | |
| [22:52:26] [Client thread/DEBUG] [LLibrary Core]: Patching method func_78087_a(FFFFFFLnet/minecraft/entity/Entity;)V | |
| [22:52:26] [Client thread/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/setRotationAngles(Lnet/minecraft/client/model/ModelBiped;Lnet/minecraft/entity/Entity;FFFFFF)V | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: Found RenderItem Class: net/minecraft/client/renderer/RenderItem | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Found renderEffect (1/3) | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Found Texture Binding | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Found Texture Binding | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Found renderItem (2/3) ((Lnet/minecraft/item/ItemStack;Lnet/minecraft/client/renderer/block/model/IBakedModel;)V) | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Inserting TE Item Renderer | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Inserting TE Item Renderer | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Found renderEffect calling | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Found renderQuads (3/3) ((Lnet/minecraft/client/renderer/BufferBuilder;Ljava/util/List;ILnet/minecraft/item/ItemStack;)V) | |
| [22:52:27] [Client thread/INFO] [EnderCore ASM]: Transforming Class [net.minecraft.client.renderer.RenderItem], Method [func_180453_a, func_184391_a] | |
| [22:52:27] [Client thread/INFO] [EnderCore ASM]: Transforming failed. Applying ersatz patch... | |
| [22:52:27] [Client thread/WARN] [EnderCore ASM]: Ersatz patch applied, things may break! | |
| [22:52:27] [Client thread/INFO] [EnderCore ASM]: Transforming net.minecraft.client.renderer.RenderItem Finished. | |
| [22:52:27] [Client thread/DEBUG] [LLibrary Core]: Patching class net/minecraft/client/renderer/tileentity/TileEntityItemStackRenderer | |
| [22:52:27] [Client thread/DEBUG] [LLibrary Core]: Patching method func_179022_a(Lnet/minecraft/item/ItemStack;)V | |
| [22:52:27] [Client thread/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/provideStackContext(Lnet/minecraft/item/ItemStack;)V | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: Found VertexLighterFlat Class: net/minecraftforge/client/model/pipeline/VertexLighterFlat | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Found processQuad | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Found patch target (lightmap) (1/4) | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Found lightmap array (2/4) | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Found tintTarget (3/4 | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Found updateColor target (tint) (4/4) | |
| [22:52:27] [Client thread/DEBUG] [randompatches]: Transforming class: net.minecraft.client.renderer.BlockModelShapes | |
| [22:52:27] [Client thread/DEBUG] [randompatches]: Patching method: func_178119_d | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: Found RenderLivingBase Class: net/minecraft/client/renderer/entity/RenderLivingBase | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Found canRenderName (1/1) | |
| [22:52:27] [Client thread/DEBUG] [LLibrary Core]: Patching class net/minecraft/client/renderer/entity/RenderLivingBase | |
| [22:52:27] [Client thread/DEBUG] [LLibrary Core]: Patching method func_77043_a(Lnet/minecraft/entity/EntityLivingBase;FFF)V | |
| [22:52:27] [Client thread/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/applyRotationsPre(Lnet/minecraft/client/renderer/entity/RenderLivingBase;Lnet/minecraft/entity/EntityLivingBase;F)V | |
| [22:52:27] [Client thread/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/applyRotationsPost(Lnet/minecraft/client/renderer/entity/RenderLivingBase;Lnet/minecraft/entity/EntityLivingBase;F)V | |
| [22:52:27] [Client thread/INFO] [Config]: [OptiFine] *** Reflector Vanilla *** | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: Found InventoryPlayer Class: net/minecraft/entity/player/InventoryPlayer | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Found dropAllItems (1/2) | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Patched dropAllItems (2/2) | |
| [22:52:27] [Client thread/DEBUG] [LLibrary Core]: Patching class net/minecraft/client/renderer/ItemRenderer | |
| [22:52:27] [Client thread/DEBUG] [LLibrary Core]: Patching method func_187457_a(Lnet/minecraft/client/entity/AbstractClientPlayer;FFLnet/minecraft/util/EnumHand;FLnet/minecraft/item/ItemStack;F)V | |
| [22:52:27] [Client thread/DEBUG] [LLibrary Core]: Found no method mapping for me/paulf/wings/server/asm/WingsHooksClient/onCheckRenderEmptyHand(ZLnet/minecraft/item/ItemStack;)Z | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: Found BlockRendererDispatcher Class: net/minecraft/client/renderer/BlockRendererDispatcher | |
| [22:52:27] [Client thread/DEBUG] [RandomThingsCore]: - Found renderBlock (1/1) | |
| [22:52:27] [Client thread/INFO] [NowWithRendering]: Processing net.minecraft.client.renderer.BlockRendererDispatcher | |
| [22:52:27] [Client thread/INFO] [NowWithRendering]: renderBlockDamage patched | |
| [22:52:27] [Client thread/INFO] [NowWithRendering]: renderBlock patched | |
| [22:52:28] [Client thread/INFO] [net.minecraft.client.Minecraft]: LWJGL Version: 2.9.4 | |
| [22:52:31] [Client thread/INFO] [Config]: [OptiFine] | |
| [22:52:31] [Client thread/INFO] [Config]: [OptiFine] OptiFine_1.12.2_HD_U_E3 | |
| [22:52:31] [Client thread/INFO] [Config]: [OptiFine] Build: 20181210-121000 | |
| [22:52:31] [Client thread/INFO] [Config]: [OptiFine] OS: Windows 10 (amd64) version 10.0 | |
| [22:52:31] [Client thread/INFO] [Config]: [OptiFine] Java: 1.8.0_51, Oracle Corporation | |
| [22:52:31] [Client thread/INFO] [Config]: [OptiFine] VM: Java HotSpot(TM) 64-Bit Server VM (mixed mode), Oracle Corporation | |
| [22:52:31] [Client thread/INFO] [Config]: [OptiFine] LWJGL: 2.9.4 | |
| [22:52:31] [Client thread/INFO] [Config]: [OptiFine] OpenGL: GeForce GTX 960M/PCIe/SSE2, version 4.5.0 NVIDIA 381.65, NVIDIA Corporation | |
| [22:52:31] [Client thread/INFO] [Config]: [OptiFine] OpenGL Version: 4.5.0 | |
| [22:52:31] [Client thread/INFO] [Config]: [OptiFine] Maximum texture size: 16384x16384 | |
| [22:52:31] [VersionCheck/INFO] [Config]: [OptiFine] Checking for new version | |
| [22:52:32] [Client thread/INFO] [net.optifine.shaders.SMCLog]: [Shaders] OpenGL Version: 4.5.0 NVIDIA 381.65 | |
| [22:52:32] [Client thread/INFO] [net.optifine.shaders.SMCLog]: [Shaders] Vendor: NVIDIA Corporation | |
| [22:52:32] [Client thread/INFO] [net.optifine.shaders.SMCLog]: [Shaders] Renderer: GeForce GTX 960M/PCIe/SSE2 | |
| [22:52:32] [Client thread/INFO] [net.optifine.shaders.SMCLog]: [Shaders] Capabilities: 2.0 2.1 3.0 3.2 4.0 | |
| [22:52:32] [Client thread/INFO] [net.optifine.shaders.SMCLog]: [Shaders] GL_MAX_DRAW_BUFFERS: 8 | |
| [22:52:32] [Client thread/INFO] [net.optifine.shaders.SMCLog]: [Shaders] GL_MAX_COLOR_ATTACHMENTS_EXT: 8 | |
| [22:52:32] [Client thread/INFO] [net.optifine.shaders.SMCLog]: [Shaders] GL_MAX_TEXTURE_IMAGE_UNITS: 32 | |
| [22:52:32] [Client thread/INFO] [net.optifine.shaders.SMCLog]: [Shaders] Load shaders configuration. | |
| [22:52:32] [Client thread/INFO] [net.optifine.shaders.SMCLog]: [Shaders] No shaderpack loaded. | |
| [22:52:32] [Client thread/INFO] [Config]: [OptiFine] [Shaders] Delayed loading of block mappings after resources are loaded | |
| [22:52:32] [VersionCheck/INFO] [Config]: [OptiFine] Version found: D3 | |
| [22:52:32] [Client thread/DEBUG] [LLibrary Core]: Patching class net/minecraft/client/resources/Locale | |
| [22:52:32] [Client thread/DEBUG] [LLibrary Core]: Patching method func_135022_a(Lnet/minecraft/client/resources/IResourceManager;Ljava/util/List;)V | |
| [22:52:32] [Client thread/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/addRemoteLocalizations(Ljava/lang/String;Ljava/util/Map;)V | |
| [22:52:32] [Client thread/WARN] [LLibrary Core]: Unable to call Core API! It has not been initialized yet! | |
| [22:52:32] [Client thread/WARN] [LLibrary Core]: Unable to call Core API! It has not been initialized yet! | |
| [22:52:32] [Client thread/DEBUG] [FML]: Bar Finished: Loading Resource - LanguageManager took 0.035s | |
| [22:52:32] [Client thread/INFO] [FML]: Forge Mod Loader has detected optifine OptiFine_1.12.2_HD_U_E3, enabling compatibility features | |
| [22:52:32] [Client thread/INFO] [FML]: -- System Details -- | |
| Details: | |
| Minecraft Version: 1.12.2 | |
| Operating System: Windows 10 (amd64) version 10.0 | |
| Java Version: 1.8.0_51, Oracle Corporation | |
| Java VM Version: Java HotSpot(TM) 64-Bit Server VM (mixed mode), Oracle Corporation | |
| Memory: 88709640 bytes (84 MB) / 301989888 bytes (288 MB) up to 4294967296 bytes (4096 MB) | |
| JVM Flags: 8 total; -XX:HeapDumpPath=MojangTricksIntelDriversForPerformance_javaw.exe_minecraft.exe.heapdump -Xmx4G -XX:+UnlockExperimentalVMOptions -XX:+UseG1GC -XX:G1NewSizePercent=20 -XX:G1ReservePercent=20 -XX:MaxGCPauseMillis=50 -XX:G1HeapRegionSize=32M | |
| IntCache: cache: 0, tcache: 0, allocated: 0, tallocated: 0 | |
| FML: | |
| Loaded coremods (and transformers): | |
| LoadingPlugin (RandomThings-MC1.12.2-4.2.7.1.jar) | |
| lumien.randomthings.asm.ClassTransformer | |
| LittlePatchingLoader (LittleTiles_v1.5.0-pre135_mc1.12.2.jar) | |
| com.creativemd.littletiles.LittleTilesTransformer | |
| CreativePatchingLoader (CreativeCore_v1.9.45_mc1.12.2.jar) | |
| Ar_CorePlugin (additionalresources-1.9.4-0.2.0.28+47cd0bd_signed.jar) | |
| RandomPatches (randompatches-1.12.2-1.15.1.0.jar) | |
| com.therandomlabs.randompatches.core.RPTransformer | |
| NWRTweak (redstonepaste-mc1.12-1.7.5.jar) | |
| net.fybertech.nwr.NWRTransformer | |
| ForgelinPlugin (Forgelin-1.8.2.jar) | |
| CTMCorePlugin (CTM-MC1.12.2-0.3.3.22.jar) | |
| team.chisel.ctm.client.asm.CTMTransformer | |
| llibrary (llibrary-core-1.0.11-1.12.2.jar) | |
| net.ilexiconn.llibrary.server.core.plugin.LLibraryTransformer | |
| net.ilexiconn.llibrary.server.core.patcher.LLibraryRuntimePatcher | |
| EnderCorePlugin (EnderCore-1.12.2-0.5.57-core.jar) | |
| com.enderio.core.common.transform.EnderCoreTransformer | |
| com.enderio.core.common.transform.SimpleMixinPatcher | |
| CorePlugin (SmoothFont-mc1.12.2-1.16.2.jar) | |
| bre.smoothfont.asm.Transformer | |
| PhosphorFMLLoadingPlugin (phosphor-1.12.2-0.1.6+build31.jar) | |
| wings (wings-1.1.4-1.12.2.jar) | |
| me.paulf.wings.server.asm.WingsRuntimePatcher | |
| me.paulf.wings.server.asm.mobends.WingsMoBendsRuntimePatcher | |
| GL info: ' Vendor: 'NVIDIA Corporation' Version: '4.5.0 NVIDIA 381.65' Renderer: 'GeForce GTX 960M/PCIe/SSE2' | |
| [22:52:32] [Client thread/INFO] [FML]: MinecraftForge v14.23.5.2837 Initialized | |
| [22:52:32] [Client thread/INFO] [FML]: Starts to replace vanilla recipe ingredients with ore ingredients. | |
| [22:52:32] [Client thread/INFO] [FML]: Invalid recipe found with multiple oredict ingredients in the same ingredient... | |
| [22:52:32] [Client thread/INFO] [FML]: Replaced 1227 ore ingredients | |
| [22:52:32] [Client thread/DEBUG] [FML]: File C:\Users\Lenovo\AppData\Roaming\.minecraft\config\injectedDependencies.json not found. No dependencies injected | |
| [22:52:32] [Client thread/DEBUG] [FML]: Building injected Mod Containers [net.minecraftforge.fml.common.FMLContainer, net.minecraftforge.common.ForgeModContainer, portablejim.additionalresources.Ar_ModContainer, com.creativemd.creativecore.core.CreativeCoreDummy, com.creativemd.littletiles.LittleTilesCore, bre.smoothfont.asm.ModContainer, com.therandomlabs.randompatches.core.RPCoreContainer] | |
| [22:52:33] [Thread-3/DEBUG] [FML]: Bar Finished: Loading Resource - FontTextureManager took 0.002s | |
| [22:52:33] [Client thread/DEBUG] [FML]: Attempting to load mods contained in the minecraft jar file and associated classes | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a minecraft related file at C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\minecraftforge\forge\1.12.2-14.23.5.2837\forge-1.12.2-14.23.5.2837.jar, examining for mod candidates | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\minecraft\launchwrapper\1.12\launchwrapper-1.12.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\ow2\asm\asm-all\5.2\asm-all-5.2.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\jline\jline\3.5.1\jline-3.5.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\java\dev\jna\jna\4.4.0\jna-4.4.0.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\typesafe\akka\akka-actor_2.11\2.3.3\akka-actor_2.11-2.3.3.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\typesafe\config\1.2.1\config-1.2.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\scala-actors-migration_2.11\1.1.0\scala-actors-migration_2.11-1.1.0.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\scala-compiler\2.11.1\scala-compiler-2.11.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\plugins\scala-continuations-library_2.11\1.0.2\scala-continuations-library_2.11-1.0.2.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\plugins\scala-continuations-plugin_2.11.1\1.0.2\scala-continuations-plugin_2.11.1-1.0.2.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\scala-library\2.11.1\scala-library-2.11.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\scala-parser-combinators_2.11\1.0.1\scala-parser-combinators_2.11-1.0.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\scala-reflect\2.11.1\scala-reflect-2.11.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\scala-swing_2.11\1.0.1\scala-swing_2.11-1.0.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\scala-lang\scala-xml_2.11\1.0.2\scala-xml_2.11-1.0.2.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\lzma\lzma\0.0.1\lzma-0.0.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\sf\jopt-simple\jopt-simple\5.0.3\jopt-simple-5.0.3.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\java3d\vecmath\1.5.2\vecmath-1.5.2.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\sf\trove4j\trove4j\3.0.3\trove4j-3.0.3.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a minecraft related file at C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\apache\maven\maven-artifact\3.5.3\maven-artifact-3.5.3.jar, examining for mod candidates | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a minecraft related file at C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\mojang\patchy\1.1\patchy-1.1.jar, examining for mod candidates | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\oshi-project\oshi-core\1.1\oshi-core-1.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\java\dev\jna\jna\4.4.0\jna-4.4.0.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\java\dev\jna\platform\3.4.0\platform-3.4.0.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\ibm\icu\icu4j-core-mojang\51.2\icu4j-core-mojang-51.2.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\sf\jopt-simple\jopt-simple\5.0.3\jopt-simple-5.0.3.jar | |
| [22:52:33] [Thread-3/INFO] [STDOUT]: [bre.smoothfont.util.Logger:info:59]: info: Detected charWidthFloat[] of OptiFine. | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\paulscode\codecjorbis\20101023\codecjorbis-20101023.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\paulscode\codecwav\20101023\codecwav-20101023.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\paulscode\libraryjavasound\20101123\libraryjavasound-20101123.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\paulscode\librarylwjglopenal\20100824\librarylwjglopenal-20100824.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\paulscode\soundsystem\20120107\soundsystem-20120107.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\io\netty\netty-all\4.1.9.Final\netty-all-4.1.9.Final.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\google\guava\guava\21.0\guava-21.0.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\apache\commons\commons-lang3\3.5\commons-lang3-3.5.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\commons-io\commons-io\2.5\commons-io-2.5.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\commons-codec\commons-codec\1.10\commons-codec-1.10.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\java\jinput\jinput\2.0.5\jinput-2.0.5.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\net\java\jutils\jutils\1.0.0\jutils-1.0.0.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\google\code\gson\gson\2.8.0\gson-2.8.0.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\mojang\authlib\1.5.25\authlib-1.5.25.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\mojang\realms\1.10.22\realms-1.10.22.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\apache\commons\commons-compress\1.8.1\commons-compress-1.8.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\apache\httpcomponents\httpclient\4.3.3\httpclient-4.3.3.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\commons-logging\commons-logging\1.1.3\commons-logging-1.1.3.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\apache\httpcomponents\httpcore\4.3.2\httpcore-4.3.2.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\it\unimi\dsi\fastutil\7.1.0\fastutil-7.1.0.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\apache\logging\log4j\log4j-api\2.8.1\log4j-api-2.8.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\apache\logging\log4j\log4j-core\2.8.1\log4j-core-2.8.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\lwjgl\lwjgl\lwjgl\2.9.4-nightly-20150209\lwjgl-2.9.4-nightly-20150209.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\org\lwjgl\lwjgl\lwjgl_util\2.9.4-nightly-20150209\lwjgl_util-2.9.4-nightly-20150209.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a minecraft related file at C:\Users\Lenovo\AppData\Roaming\.minecraft\libraries\com\mojang\text2speech\1.10.3\text2speech-1.10.3.jar, examining for mod candidates | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a minecraft related file at C:\Users\Lenovo\AppData\Roaming\.minecraft\versions\1.12.2\1.12.2.jar, examining for mod candidates | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\additionalresources-1.9.4-0.2.0.28+47cd0bd_signed.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\CreativeCore_v1.9.45_mc1.12.2.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\CTM-MC1.12.2-0.3.3.22.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\Forgelin-1.8.2.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\LittleTiles_v1.5.0-pre135_mc1.12.2.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\OptiFine_1.12.2_HD_U_E3.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\randompatches-1.12.2-1.15.1.0.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\RandomThings-MC1.12.2-4.2.7.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\redstonepaste-mc1.12-1.7.5.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\SmoothFont-mc1.12.2-1.16.2.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\wings-1.1.4-1.12.2.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\me\jellysquid\mods\phosphor\1.12.2-0.1.6+build31\phosphor-1.12.2-0.1.6+build31.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\com\enderio\core\EnderCore\1.12.2-0.5.57\EnderCore-1.12.2-0.5.57-core.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping known library file C:\Users\Lenovo\AppData\Roaming\.minecraft\mods\memory_repo\net\ilexiconn\llibrary-core\1.0.11-1.12.2\llibrary-core-1.0.11-1.12.2.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Minecraft jar mods loaded successfully | |
| [22:52:33] [Client thread/INFO] [FML]: Searching C:\Users\Lenovo\AppData\Roaming\.minecraft\mods for mods | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ActuallyAdditions-1.12.2-r147.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ActuallyBaubles-1.12-1.1.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding additionalresources-1.9.4-0.2.0.28+47cd0bd_signed.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding advancedcombat-1.1.2-[1.12].jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding adventurepack-1.6.2.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding aether_ii-1.12.2-0.2.0+build42-universal.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding armorplus-1.12.2-11.22.0.58.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Baubles-1.12-1.5.2.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding BiblioCraft[v2.4.5][MC1.12.2].jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding BiomesOPlenty-1.12.2-7.0.1.2419-universal.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding blockcraftery-1.12.2-1.2.0.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding bonsaitrees-1.1.2-b144.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Bookshelf-1.12.2-2.3.577.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Botania+r1.10-361.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding buildcraft-all-7.99.24.1.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Chameleon-1.12-4.1.3.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ChanceCubes-1.12.2-3.2.3.242.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ChestTransporter-1.12.2-2.8.8.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Chisel-MC1.12.2-0.2.1.35.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding chunkedgeindicator-1.4.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding CloudBoots-1.12.2-1.4.1.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding CoFHCore-1.12.2-4.6.2.25-universal.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding CoFHWorld-1.12.2-1.3.0.6-universal.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding CraftPresence-1.12.2-1.5.3.1.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding CreativeCore_v1.9.45_mc1.12.2.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding CTM-MC1.12.2-0.3.3.22.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Cyclic-1.12.2-1.19.9.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding DeathCounter-1.12.1-1.0.0.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Decocraft-2.6.2_1.12.2.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding dirt2path-1.8.0.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ElevatorMod-1.12.2-1.3.10.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding EnchantingPlus-1.12.2-5.0.177.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding EnderCore-1.12.2-0.5.57.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding EnderIO-1.12.2-5.0.44.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding enderutilities-1.12.2-0.7.12.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding environmentaltech-1.12.2-2.0.20.1.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ExtraRails-1.12-1.3.0.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding extrautils2-1.12-1.9.9.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding FastLeafDecay-v14.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding forestry_1.12.2-5.8.1.322.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Forgelin-1.8.2.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding harvestersnight-1.12.2-1.1.0.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding hopperducts-mc1.12-1.5.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding HuntingDimension-1.12.2-1.0.38.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding iChunUtil-1.12.2-7.2.1.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding industrialcraft-2-2.8.109-ex112.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding industrialforegoing-1.12.2-1.12.12-236.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding inventorypets-1.12-2.0.1.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding inventorysorter-1.12.2-1.13.3+57.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding IronBackpacks-1.12.2-3.0.8-12.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ironchest-1.12.2-7.0.59.842.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ironfurnaces-1.3.3.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ItemFilters-1.0.3.12.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding jei_1.12.2-4.15.0.268.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding journeymap-1.12.2-5.5.4.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding JustAFewFish-1.7_for_1.12.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding KeepingInventory-1.12.2-2.4.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding LibEx-1.12.2-1.0.8.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding LittleTiles_v1.5.0-pre135_mc1.12.2.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding llibrary-1.7.19-1.12.2.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding LootBags-1.12.2-2.5.8.5.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Mantle-1.12-1.3.3.49.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding mcjtylib-1.12-3.5.2.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding mysticallib-1.12.2-1.1.1.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Neat+1.4-17.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Netherending-Ores-1.12.2-1.3.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding NetherEx-1.12.2-2.0.8.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding notenoughroofs-1.12.2-0.8.0.0.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding notenoughwands-1.12-1.8.1.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding OptiFine_1.12.2_HD_U_E3.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding OreExcavation-1.4.140.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ProjectE-1.12.2-PE1.4.1.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ProportionalDestructionParticles-1.12.2-1.2.4.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding PTRLib-1.0.4.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding randompatches-1.12.2-1.15.1.0.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding RandomThings-MC1.12.2-4.2.7.1.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding randomtweaks-1.12.2-2.5.0.5.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding RebornCore-1.12.2-3.13.12.447-universal.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding RedstoneFlux-1.12-2.1.0.6-universal.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding redstonepaste-mc1.12-1.7.5.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Reliquary-1.12.2-1.3.4.786.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ShadowMC-1.12-3.8.0.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding SimplyJetpacks2-1.12.2-2.2.12.65.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding SlashBlade-mc1.12-r23.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding SmoothFont-mc1.12.2-1.16.2.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Snad-1.12.1-1.7.09.16a.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding SpartanShields-1.12.2-1.5.3.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding StevesCarts-1.12.2-2.4.30.134.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding stg-1.12.2-1.2.3.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding StorageDrawers-1.12.2-5.3.8.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding switchbow-1.5.6.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Tabula-1.12.2-7.0.1.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding TConstruct-1.12.2-2.12.0.135.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding tesla-core-lib-1.12.2-1.0.15.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding thedragonlib-1.12.2-5.3.0.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding TheEightFabledBlades+V2.0.01.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ThermalCultivation-1.12.2-0.3.2.11-universal.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ThermalFoundation-1.12.2-2.6.2.26-universal.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding TinkerToolLeveling-1.12.2-1.1.0.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding torchmaster_1.12.2-1.7.1.74.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Trapcraft-1.12-v2.4.3a-universal.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding TrashSlot_1.12.1-8.4.6.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding TS2K16-1.2.10.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding twilightforest-1.12.2-3.8.689-universal.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding Uppers-0.0.6.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding valkyrielib-1.12.2-2.0.20.1.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ViesCraft-1.12.2-5.9.13.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding wings-1.1.4-1.12.2.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding wolfarmor-1.12.2-2.2.3.1798-universal.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding XtraGear+++1.0.4.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding ye.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding yoyos_1.12.2-1.2.2.20.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Adding [1.12.2]+SecurityCraft+v1.8.12.jar to the mod list | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file [1.12.2]+SecurityCraft+v1.8.12.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ActuallyAdditions-1.12.2-r147.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ActuallyBaubles-1.12-1.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping already parsed coremod or tweaker additionalresources-1.9.4-0.2.0.28+47cd0bd_signed.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file advancedcombat-1.1.2-[1.12].jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file adventurepack-1.6.2.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file aether_ii-1.12.2-0.2.0+build42-universal.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file armorplus-1.12.2-11.22.0.58.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Baubles-1.12-1.5.2.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file BiblioCraft[v2.4.5][MC1.12.2].jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file BiomesOPlenty-1.12.2-7.0.1.2419-universal.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file blockcraftery-1.12.2-1.2.0.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file bonsaitrees-1.1.2-b144.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Bookshelf-1.12.2-2.3.577.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Botania+r1.10-361.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file buildcraft-all-7.99.24.1.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Chameleon-1.12-4.1.3.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ChanceCubes-1.12.2-3.2.3.242.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ChestTransporter-1.12.2-2.8.8.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Chisel-MC1.12.2-0.2.1.35.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file chunkedgeindicator-1.4.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file CloudBoots-1.12.2-1.4.1.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file CoFHCore-1.12.2-4.6.2.25-universal.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file CoFHWorld-1.12.2-1.3.0.6-universal.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file CraftPresence-1.12.2-1.5.3.1.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file CreativeCore_v1.9.45_mc1.12.2.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file CTM-MC1.12.2-0.3.3.22.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Cyclic-1.12.2-1.19.9.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file DeathCounter-1.12.1-1.0.0.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Decocraft-2.6.2_1.12.2.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file dirt2path-1.8.0.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ElevatorMod-1.12.2-1.3.10.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file EnchantingPlus-1.12.2-5.0.177.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file EnderCore-1.12.2-0.5.57.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file EnderIO-1.12.2-5.0.44.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file enderutilities-1.12.2-0.7.12.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file environmentaltech-1.12.2-2.0.20.1.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ExtraRails-1.12-1.3.0.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file extrautils2-1.12-1.9.9.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file FastLeafDecay-v14.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file forestry_1.12.2-5.8.1.322.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Forgelin-1.8.2.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file harvestersnight-1.12.2-1.1.0.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file hopperducts-mc1.12-1.5.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file HuntingDimension-1.12.2-1.0.38.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file iChunUtil-1.12.2-7.2.1.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file industrialcraft-2-2.8.109-ex112.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file industrialforegoing-1.12.2-1.12.12-236.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file inventorypets-1.12-2.0.1.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file inventorysorter-1.12.2-1.13.3+57.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file IronBackpacks-1.12.2-3.0.8-12.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ironchest-1.12.2-7.0.59.842.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ironfurnaces-1.3.3.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ItemFilters-1.0.3.12.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file jei_1.12.2-4.15.0.268.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file journeymap-1.12.2-5.5.4.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file JustAFewFish-1.7_for_1.12.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file KeepingInventory-1.12.2-2.4.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file LibEx-1.12.2-1.0.8.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file LittleTiles_v1.5.0-pre135_mc1.12.2.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file LootBags-1.12.2-2.5.8.5.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Mantle-1.12-1.3.3.49.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file mcjtylib-1.12-3.5.2.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file mysticallib-1.12.2-1.1.1.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Neat+1.4-17.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Netherending-Ores-1.12.2-1.3.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file NetherEx-1.12.2-2.0.8.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file notenoughroofs-1.12.2-0.8.0.0.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file notenoughwands-1.12-1.8.1.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping already parsed coremod or tweaker OptiFine_1.12.2_HD_U_E3.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file OreExcavation-1.4.140.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ProjectE-1.12.2-PE1.4.1.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ProportionalDestructionParticles-1.12.2-1.2.4.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file PTRLib-1.0.4.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping already parsed coremod or tweaker randompatches-1.12.2-1.15.1.0.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file RandomThings-MC1.12.2-4.2.7.1.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file randomtweaks-1.12.2-2.5.0.5.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file RebornCore-1.12.2-3.13.12.447-universal.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file RedstoneFlux-1.12-2.1.0.6-universal.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file redstonepaste-mc1.12-1.7.5.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Reliquary-1.12.2-1.3.4.786.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ShadowMC-1.12-3.8.0.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file SimplyJetpacks2-1.12.2-2.2.12.65.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file SlashBlade-mc1.12-r23.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file SmoothFont-mc1.12.2-1.16.2.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Snad-1.12.1-1.7.09.16a.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file SpartanShields-1.12.2-1.5.3.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file StevesCarts-1.12.2-2.4.30.134.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file stg-1.12.2-1.2.3.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file StorageDrawers-1.12.2-5.3.8.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file switchbow-1.5.6.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Tabula-1.12.2-7.0.1.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file TConstruct-1.12.2-2.12.0.135.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file tesla-core-lib-1.12.2-1.0.15.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file thedragonlib-1.12.2-5.3.0.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file TheEightFabledBlades+V2.0.01.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ThermalCultivation-1.12.2-0.3.2.11-universal.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ThermalFoundation-1.12.2-2.6.2.26-universal.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file TinkerToolLeveling-1.12.2-1.1.0.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file torchmaster_1.12.2-1.7.1.74.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Trapcraft-1.12-v2.4.3a-universal.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file TrashSlot_1.12.1-8.4.6.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file TS2K16-1.2.10.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file twilightforest-1.12.2-3.8.689-universal.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file Uppers-0.0.6.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file valkyrielib-1.12.2-2.0.20.1.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ViesCraft-1.12.2-5.9.13.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file wings-1.1.4-1.12.2.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file wolfarmor-1.12.2-2.2.3.1798-universal.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file XtraGear+++1.0.4.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file ye.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file yoyos_1.12.2-1.2.2.20.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file phosphor-1.12.2-0.1.6+build31.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file orbis-lib-1.12.2-0.2.0+build42.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping already parsed coremod or tweaker EnderCore-1.12.2-0.5.57-core.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file AutoSave-1.12.2-1.0.10.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file AutoConfig-1.12.2-1.0.2.jar | |
| [22:52:33] [Client thread/TRACE] [FML]: Skipping already parsed coremod or tweaker llibrary-core-1.0.11-1.12.2.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Found a candidate zip or jar file llibrary-1.7.19-1.12.2.jar | |
| [22:52:33] [Client thread/DEBUG] [FML]: Examining file forge-1.12.2-14.23.5.2837.jar for potential mods | |
| [22:52:33] [Client thread/DEBUG] [FML]: The mod container forge-1.12.2-14.23.5.2837.jar appears to be missing an mcmod.info file | |
| [22:52:33] [Client thread/DEBUG] [FML]: Examining file maven-artifact-3.5.3.jar for potential mods | |
| [22:52:33] [Client thread/DEBUG] [FML]: The mod container maven-artifact-3.5.3.jar appears to be missing an mcmod.info file | |
| [22:52:33] [Client thread/DEBUG] [FML]: Examining file patchy-1.1.jar for potential mods | |
| [22:52:33] [Client thread/DEBUG] [FML]: The mod container patchy-1.1.jar appears to be missing an mcmod.info file | |
| [22:52:33] [Client thread/DEBUG] [FML]: Examining file text2speech-1.10.3.jar for potential mods | |
| [22:52:33] [Client thread/DEBUG] [FML]: The mod container text2speech-1.10.3.jar appears to be missing an mcmod.info file | |
| [22:52:33] [Client thread/DEBUG] [FML]: Examining file 1.12.2.jar for potential mods | |
| [22:52:33] [Client thread/DEBUG] [FML]: The mod container 1.12.2.jar appears to be missing an mcmod.info file | |
| [22:52:34] [Client thread/DEBUG] [FML]: Examining file [1.12.2]+SecurityCraft+v1.8.12.jar for potential mods | |
| [22:52:34] [Client thread/DEBUG] [FML]: The mod container [1.12.2]+SecurityCraft+v1.8.12.jar appears to be missing an mcmod.info file | |
| [22:52:34] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.geforcemods.securitycraft.SecurityCraft) - loading | |
| [22:52:34] [Client thread/TRACE] [FML]: Parsed dependency info for securitycraft: Requirements: [forge@[14.23.3.2694,)] After:[forge@[14.23.3.2694,)] Before:[] | |
| [22:52:34] [Client thread/DEBUG] [FML]: Examining file ActuallyAdditions-1.12.2-r147.jar for potential mods | |
| [22:52:34] [Client thread/TRACE] [FML]: Located mcmod.info file in file ActuallyAdditions-1.12.2-r147.jar | |
| [22:52:34] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (de.ellpeck.actuallyadditions.mod.ActuallyAdditions) - loading | |
| [22:52:34] [Client thread/TRACE] [FML]: Parsed dependency info for actuallyadditions: Requirements: [] After:[fastbench@[1.3.2,)] Before:[craftingtweaks] | |
| [22:52:35] [Client thread/DEBUG] [FML]: Examining file ActuallyBaubles-1.12-1.1.jar for potential mods | |
| [22:52:35] [Client thread/TRACE] [FML]: Located mcmod.info file in file ActuallyBaubles-1.12-1.1.jar | |
| [22:52:35] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.jacky1356400.actuallybaubles.ActuallyBaubles) - loading | |
| [22:52:35] [Client thread/TRACE] [FML]: Parsed dependency info for actuallybaubles: Requirements: [actuallyadditions, baubles] After:[actuallyadditions, baubles] Before:[] | |
| [22:52:35] [Client thread/DEBUG] [FML]: Examining file advancedcombat-1.1.2-[1.12].jar for potential mods | |
| [22:52:35] [Client thread/TRACE] [FML]: Located mcmod.info file in file advancedcombat-1.1.2-[1.12].jar | |
| [22:52:35] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.advancedcombat.AdvancedCombat) - loading | |
| [22:52:35] [Client thread/TRACE] [FML]: Parsed dependency info for advancedcombat: Requirements: [] After:[] Before:[] | |
| [22:52:35] [Client thread/DEBUG] [FML]: Examining file adventurepack-1.6.2.jar for potential mods | |
| [22:52:35] [Client thread/TRACE] [FML]: Located mcmod.info file in file adventurepack-1.6.2.jar | |
| [22:52:35] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (brobotato.adventurepack.AdventurePack) - loading | |
| [22:52:35] [Client thread/TRACE] [FML]: Parsed dependency info for adventurepack: Requirements: [] After:[] Before:[] | |
| [22:52:35] [Client thread/DEBUG] [FML]: Examining file aether_ii-1.12.2-0.2.0+build42-universal.jar for potential mods | |
| [22:52:35] [Client thread/TRACE] [FML]: Located mcmod.info file in file aether_ii-1.12.2-0.2.0+build42-universal.jar | |
| [22:52:35] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.gildedgames.aether.common.AetherCore) - loading | |
| [22:52:35] [Client thread/TRACE] [FML]: Parsed dependency info for aether: Requirements: [orbis-lib@[0.2.0,)] After:[orbis-lib@[0.2.0,)] Before:[] | |
| [22:52:35] [Client thread/DEBUG] [FML]: Examining file armorplus-1.12.2-11.22.0.58.jar for potential mods | |
| [22:52:35] [Client thread/TRACE] [FML]: Located mcmod.info file in file armorplus-1.12.2-11.22.0.58.jar | |
| [22:52:35] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.sofodev.armorplus.ArmorPlus) - loading | |
| [22:52:35] [Client thread/TRACE] [FML]: Parsed dependency info for armorplus: Requirements: [forge@[14.23.5.2836,), thedragonlib@[1.12.2-5.3.0,)] After:[forge@[14.23.5.2836,), thedragonlib@[1.12.2-5.3.0,), mantle, tconstruct] Before:[] | |
| [22:52:35] [Client thread/DEBUG] [FML]: Examining file Baubles-1.12-1.5.2.jar for potential mods | |
| [22:52:35] [Client thread/TRACE] [FML]: Located mcmod.info file in file Baubles-1.12-1.5.2.jar | |
| [22:52:35] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (baubles.common.Baubles) - loading | |
| [22:52:35] [Client thread/TRACE] [FML]: Parsed dependency info for baubles: Requirements: [forge@[14.21.0.2348,)] After:[forge@[14.21.0.2348,)] Before:[] | |
| [22:52:35] [Client thread/DEBUG] [FML]: Examining file BiblioCraft[v2.4.5][MC1.12.2].jar for potential mods | |
| [22:52:35] [Client thread/TRACE] [FML]: Located mcmod.info file in file BiblioCraft[v2.4.5][MC1.12.2].jar | |
| [22:52:35] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (jds.bibliocraft.BiblioCraft) - loading | |
| [22:52:35] [Client thread/TRACE] [FML]: Parsed dependency info for bibliocraft: Requirements: [] After:[] Before:[] | |
| [22:52:35] [Thread-3/INFO] [FML]: Using sync timing. 200 frames of Display.update took 630066523 nanos | |
| [22:52:35] [Client thread/DEBUG] [FML]: Examining file BiomesOPlenty-1.12.2-7.0.1.2419-universal.jar for potential mods | |
| [22:52:35] [Client thread/TRACE] [FML]: Located mcmod.info file in file BiomesOPlenty-1.12.2-7.0.1.2419-universal.jar | |
| [22:52:35] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (biomesoplenty.core.BiomesOPlenty) - loading | |
| [22:52:35] [Client thread/TRACE] [FML]: Parsed dependency info for biomesoplenty: Requirements: [forge@[14.23.5.2768,)] After:[forge@[14.23.5.2768,)] Before:[] | |
| [22:52:35] [Client thread/DEBUG] [FML]: Examining file blockcraftery-1.12.2-1.2.0.jar for potential mods | |
| [22:52:35] [Client thread/TRACE] [FML]: Located mcmod.info file in file blockcraftery-1.12.2-1.2.0.jar | |
| [22:52:35] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (epicsquid.blockcraftery.Blockcraftery) - loading | |
| [22:52:35] [Client thread/TRACE] [FML]: Parsed dependency info for blockcraftery: Requirements: [mysticallib] After:[] Before:[mysticallib] | |
| [22:52:35] [Client thread/DEBUG] [FML]: Examining file bonsaitrees-1.1.2-b144.jar for potential mods | |
| [22:52:35] [Client thread/TRACE] [FML]: Located mcmod.info file in file bonsaitrees-1.1.2-b144.jar | |
| [22:52:35] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (org.dave.bonsaitrees.BonsaiTrees) - loading | |
| [22:52:35] [Client thread/TRACE] [FML]: Parsed dependency info for bonsaitrees: Requirements: [] After:[] Before:[] | |
| [22:52:35] [Client thread/DEBUG] [FML]: Examining file Bookshelf-1.12.2-2.3.577.jar for potential mods | |
| [22:52:35] [Client thread/TRACE] [FML]: Located mcmod.info file in file Bookshelf-1.12.2-2.3.577.jar | |
| [22:52:35] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.darkhax.bookshelf.Bookshelf) - loading | |
| [22:52:35] [Client thread/TRACE] [FML]: Parsed dependency info for bookshelf: Requirements: [] After:[] Before:[] | |
| [22:52:35] [Client thread/DEBUG] [FML]: Examining file Botania+r1.10-361.jar for potential mods | |
| [22:52:35] [Client thread/TRACE] [FML]: Located mcmod.info file in file Botania+r1.10-361.jar | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (vazkii.botania.common.Botania) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for botania: Requirements: [baubles@[1.5.2,)] After:[baubles@[1.5.2,), thaumcraft@[6.1.BETA21,), jei@[1.12.2-4.13.1.220,)] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Examining file buildcraft-all-7.99.24.1.jar for potential mods | |
| [22:52:36] [Client thread/TRACE] [FML]: Located mcmod.info file in file buildcraft-all-7.99.24.1.jar | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (buildcraft.compat.BCCompat) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for buildcraftcompat: Requirements: [forge@[14.23.0.2544,), buildcraftcore@[7.99.24.1,)] After:[forge@[14.23.0.2544,), buildcraftcore@[7.99.24.1,), buildcrafttransport, buildcraftbuilders, buildcraftsilicon, theoneprobe, forestry, crafttweaker] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (buildcraft.builders.BCBuilders) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for buildcraftbuilders: Requirements: [buildcraftcore@[7.99.24.1,7.99.24.1]] After:[buildcraftcore@[7.99.24.1,7.99.24.1]] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (buildcraft.core.BCCore) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for buildcraftcore: Requirements: [buildcraftlib@[7.99.24.1,7.99.24.1]] After:[buildcraftlib@[7.99.24.1,7.99.24.1]] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (buildcraft.energy.BCEnergy) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for buildcraftenergy: Requirements: [buildcraftcore@[7.99.24.1,7.99.24.1]] After:[buildcraftcore@[7.99.24.1,7.99.24.1]] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (buildcraft.factory.BCFactory) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for buildcraftfactory: Requirements: [buildcraftcore@[7.99.24.1,7.99.24.1]] After:[buildcraftcore@[7.99.24.1,7.99.24.1]] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (buildcraft.lib.BCLib) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for buildcraftlib: Requirements: [forge@[14.23.0.2544,)] After:[forge@[14.23.0.2544,)] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (buildcraft.robotics.BCRobotics) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for buildcraftrobotics: Requirements: [buildcraftcore@[7.99.24.1,7.99.24.1]] After:[buildcraftcore@[7.99.24.1,7.99.24.1]] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (buildcraft.silicon.BCSilicon) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for buildcraftsilicon: Requirements: [buildcraftcore@[7.99.24.1,7.99.24.1]] After:[buildcraftcore@[7.99.24.1,7.99.24.1], buildcrafttransport] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (buildcraft.transport.BCTransport) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for buildcrafttransport: Requirements: [buildcraftcore@[7.99.24.1,7.99.24.1]] After:[buildcraftcore@[7.99.24.1,7.99.24.1]] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Examining file Chameleon-1.12-4.1.3.jar for potential mods | |
| [22:52:36] [Client thread/TRACE] [FML]: Located mcmod.info file in file Chameleon-1.12-4.1.3.jar | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.jaquadro.minecraft.chameleon.Chameleon) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Using mcmod dependency info for chameleon: [forge] [] [] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Examining file ChanceCubes-1.12.2-3.2.3.242.jar for potential mods | |
| [22:52:36] [Client thread/TRACE] [FML]: Located mcmod.info file in file ChanceCubes-1.12.2-3.2.3.242.jar | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (chanceCubes.CCubesCore) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for chancecubes: Requirements: [] After:[] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Examining file ChestTransporter-1.12.2-2.8.8.jar for potential mods | |
| [22:52:36] [Client thread/TRACE] [FML]: Located mcmod.info file in file ChestTransporter-1.12.2-2.8.8.jar | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cubex2.mods.chesttransporter.ChestTransporter) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for chesttransporter: Requirements: [] After:[] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Examining file Chisel-MC1.12.2-0.2.1.35.jar for potential mods | |
| [22:52:36] [Client thread/TRACE] [FML]: Located mcmod.info file in file Chisel-MC1.12.2-0.2.1.35.jar | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (team.chisel.Chisel) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for chisel: Requirements: [forge@[14.23.0.2501,), ctm@[MC1.12-0.2.3.8,)] After:[forge@[14.23.0.2501,), ctm@[MC1.12-0.2.3.8,)] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Examining file chunkedgeindicator-1.4.jar for potential mods | |
| [22:52:36] [Client thread/TRACE] [FML]: Located mcmod.info file in file chunkedgeindicator-1.4.jar | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cei.ChunkEdgeIndicator) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for cei: Requirements: [] After:[] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Examining file CloudBoots-1.12.2-1.4.1.jar for potential mods | |
| [22:52:36] [Client thread/TRACE] [FML]: Located mcmod.info file in file CloudBoots-1.12.2-1.4.1.jar | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.tiviacz.cloudboots.CloudBoots) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for cloudboots: Requirements: [] After:[] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Examining file CoFHCore-1.12.2-4.6.2.25-universal.jar for potential mods | |
| [22:52:36] [Client thread/TRACE] [FML]: Located mcmod.info file in file CoFHCore-1.12.2-4.6.2.25-universal.jar | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cofh.CoFHCore) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for cofhcore: Requirements: [redstoneflux@[2.1.0,2.2.0), forge@[14.23.4.2705,15.0.0.0)] After:[forge@[14.23.4.2705,15.0.0.0), redstoneflux@[2.1.0,2.2.0)] Before:[] | |
| [22:52:36] [Client thread/DEBUG] [FML]: Examining file CoFHWorld-1.12.2-1.3.0.6-universal.jar for potential mods | |
| [22:52:36] [Client thread/TRACE] [FML]: Located mcmod.info file in file CoFHWorld-1.12.2-1.3.0.6-universal.jar | |
| [22:52:36] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cofh.cofhworld.CoFHWorld) - loading | |
| [22:52:36] [Client thread/TRACE] [FML]: Parsed dependency info for cofhworld: Requirements: [forge@[14.23.3.2655,15.0.0.0)] After:[forge@[14.23.3.2655,15.0.0.0)] Before:[] | |
| [22:52:37] [Client thread/DEBUG] [FML]: Examining file CraftPresence-1.12.2-1.5.3.1.jar for potential mods | |
| [22:52:37] [Client thread/TRACE] [FML]: Located mcmod.info file in file CraftPresence-1.12.2-1.5.3.1.jar | |
| [22:52:37] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.gitlab.cdagaming.craftpresence.CraftPresence) - loading | |
| [22:52:37] [Client thread/TRACE] [FML]: Parsed dependency info for craftpresence: Requirements: [] After:[] Before:[] | |
| [22:52:37] [Client thread/DEBUG] [FML]: Examining file CreativeCore_v1.9.45_mc1.12.2.jar for potential mods | |
| [22:52:37] [Client thread/TRACE] [FML]: Located mcmod.info file in file CreativeCore_v1.9.45_mc1.12.2.jar | |
| [22:52:37] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.creativemd.creativecore.CreativeCore) - loading | |
| [22:52:37] [Client thread/TRACE] [FML]: Parsed dependency info for creativecore: Requirements: [] After:[] Before:[] | |
| [22:52:37] [Client thread/DEBUG] [FML]: Examining file CTM-MC1.12.2-0.3.3.22.jar for potential mods | |
| [22:52:37] [Client thread/TRACE] [FML]: Located mcmod.info file in file CTM-MC1.12.2-0.3.3.22.jar | |
| [22:52:37] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (team.chisel.ctm.CTM) - loading | |
| [22:52:37] [Client thread/TRACE] [FML]: Parsed dependency info for ctm: Requirements: [] After:[forge@[14.23,)] Before:[chisel] | |
| [22:52:37] [Client thread/DEBUG] [FML]: Examining file Cyclic-1.12.2-1.19.9.jar for potential mods | |
| [22:52:37] [Client thread/TRACE] [FML]: Located mcmod.info file in file Cyclic-1.12.2-1.19.9.jar | |
| [22:52:37] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.lothrazar.cyclicmagic.ModCyclic) - loading | |
| [22:52:37] [Client thread/TRACE] [FML]: Parsed dependency info for cyclicmagic: Requirements: [forge@[14.23.4.2705,)] After:[jei, baubles,crafttweaker, fastbench@[1.5.3,)] Before:[guideapi] | |
| [22:52:37] [Client thread/DEBUG] [FML]: Attempting to load the file version.properties from Cyclic-1.12.2-1.19.9.jar to locate a version number for mod cyclicmagic | |
| [22:52:37] [Client thread/WARN] [FML]: Mod cyclicmagic is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 1.19.9 | |
| [22:52:37] [Client thread/DEBUG] [FML]: Examining file DeathCounter-1.12.1-1.0.0.jar for potential mods | |
| [22:52:37] [Client thread/TRACE] [FML]: Located mcmod.info file in file DeathCounter-1.12.1-1.0.0.jar | |
| [22:52:37] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.ichun.mods.deathcounter.common.core.DeathCounter) - loading | |
| [22:52:37] [Client thread/TRACE] [FML]: Parsed dependency info for deathcounter: Requirements: [forge@[13.19.0.2141,)] After:[forge@[13.19.0.2141,)] Before:[] | |
| [22:52:37] [Client thread/DEBUG] [FML]: Examining file Decocraft-2.6.2_1.12.2.jar for potential mods | |
| [22:52:37] [Client thread/TRACE] [FML]: Located mcmod.info file in file Decocraft-2.6.2_1.12.2.jar | |
| [22:52:37] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mia.props.Props) - loading | |
| [22:52:37] [Client thread/TRACE] [FML]: Parsed dependency info for props: Requirements: [ptrmodellib@[1.0.3,)] After:[ptrmodellib@[1.0.3,), ptrmodellib] Before:[] | |
| [22:52:37] [Client thread/DEBUG] [FML]: Examining file dirt2path-1.8.0.jar for potential mods | |
| [22:52:37] [Client thread/TRACE] [FML]: Located mcmod.info file in file dirt2path-1.8.0.jar | |
| [22:52:37] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mr208.dirt2path.Dirt2Path) - loading | |
| [22:52:37] [Client thread/TRACE] [FML]: Parsed dependency info for dirt2path: Requirements: [] After:[] Before:[] | |
| [22:52:37] [Client thread/DEBUG] [FML]: Examining file ElevatorMod-1.12.2-1.3.10.jar for potential mods | |
| [22:52:37] [Client thread/TRACE] [FML]: Located mcmod.info file in file ElevatorMod-1.12.2-1.3.10.jar | |
| [22:52:37] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (xyz.vsngamer.elevator.ElevatorMod) - loading | |
| [22:52:37] [Client thread/TRACE] [FML]: Parsed dependency info for elevatorid: Requirements: [] After:[] Before:[] | |
| [22:52:37] [Client thread/DEBUG] [FML]: Examining file EnchantingPlus-1.12.2-5.0.177.jar for potential mods | |
| [22:52:37] [Client thread/TRACE] [FML]: Located mcmod.info file in file EnchantingPlus-1.12.2-5.0.177.jar | |
| [22:52:37] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.darkhax.eplus.EnchantingPlus) - loading | |
| [22:52:37] [Client thread/TRACE] [FML]: Parsed dependency info for eplus: Requirements: [bookshelf@[2.3.557,)] After:[bookshelf@[2.3.557,)] Before:[] | |
| [22:52:37] [Client thread/DEBUG] [FML]: Examining file EnderCore-1.12.2-0.5.57.jar for potential mods | |
| [22:52:37] [Client thread/TRACE] [FML]: Located mcmod.info file in file EnderCore-1.12.2-0.5.57.jar | |
| [22:52:37] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.enderio.core.EnderCore) - loading | |
| [22:52:37] [Client thread/TRACE] [FML]: Parsed dependency info for endercore: Requirements: [] After:[] Before:[] | |
| [22:52:37] [Client thread/DEBUG] [FML]: Examining file EnderIO-1.12.2-5.0.44.jar for potential mods | |
| [22:52:37] [Client thread/TRACE] [FML]: Located mcmod.info file in file EnderIO-1.12.2-5.0.44.jar | |
| [22:52:38] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (crazypants.enderio.base.EnderIO) - loading | |
| [22:52:38] [Client thread/TRACE] [FML]: Parsed dependency info for enderio: Requirements: [forge@[14.23.4.2705,), endercore@[1.12.2-0.5.57,)] After:[baubles@[1.5.2,), buildcraft@[7.99.14,), endercore@[1.12.2-0.5.57,), forge@[14.23.4.2705,), jei@[4.14.1.234,), thaumcraft@[6.1.BETA13,)] Before:[] | |
| [22:52:38] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (crazypants.enderio.base.EnderIODummy) - loading | |
| [22:52:38] [Client thread/TRACE] [FML]: Parsed dependency info for enderiobase: Requirements: [] After:[enderio] Before:[] | |
| [22:52:38] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (crazypants.enderio.conduit.me.EnderIOConduitsAppliedEnergistics) - loading | |
| [22:52:38] [Client thread/TRACE] [FML]: Parsed dependency info for enderioconduitsappliedenergistics: Requirements: [enderioconduits@[5.0.44,), enderio@[5.0.44,), endercore@[1.12.2-0.5.57,), forge@[14.23.4.2705,)] After:[appliedenergistics@[rv5-stable-11,), endercore@[1.12.2-0.5.57,), enderio@[5.0.44,), enderioconduits@[5.0.44,), forge@[14.23.4.2705,), jei@[4.14.1.234,)] Before:[] | |
| [22:52:38] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (crazypants.enderio.conduit.oc.EnderIOConduitsOpenComputers) - loading | |
| [22:52:38] [Client thread/TRACE] [FML]: Parsed dependency info for enderioconduitsopencomputers: Requirements: [enderio@[5.0.44,), enderioconduits@[5.0.44,), forge@[14.23.4.2705,), endercore@[1.12.2-0.5.57,)] After:[endercore@[1.12.2-0.5.57,), enderio@[5.0.44,), enderioconduits@[5.0.44,), forge@[14.23.4.2705,), jei@[4.14.1.234,), opencomputers@[MC1.12.2-1.7.2.71,)] Before:[] | |
| [22:52:38] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (crazypants.enderio.conduit.refinedstorage.EnderIOConduitsRefinedStorage) - loading | |
| [22:52:38] [Client thread/TRACE] [FML]: Parsed dependency info for enderioconduitsrefinedstorage: Requirements: [endercore@[1.12.2-0.5.57,), enderio@[5.0.44,), forge@[14.23.4.2705,), enderioconduits@[5.0.44,)] After:[endercore@[1.12.2-0.5.57,), enderio@[5.0.44,), enderioconduits@[5.0.44,), forge@[14.23.4.2705,), jei@[4.14.1.234,), refinedstorage@[1.6.2,)] Before:[] | |
| [22:52:38] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (crazypants.enderio.conduits.EnderIOConduits) - loading | |
| [22:52:38] [Client thread/TRACE] [FML]: Parsed dependency info for enderioconduits: Requirements: [endercore@[1.12.2-0.5.57,), enderio@[5.0.44,), forge@[14.23.4.2705,)] After:[endercore@[1.12.2-0.5.57,), enderio@[5.0.44,), forge@[14.23.4.2705,)] Before:[] | |
| [22:52:38] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (crazypants.enderio.integration.forestry.EnderIOIntegrationForestry) - loading | |
| [22:52:38] [Client thread/TRACE] [FML]: Parsed dependency info for enderiointegrationforestry: Requirements: [forge@[14.23.4.2705,), enderio@[5.0.44,)] After:[enderio@[5.0.44,), forestry@[5.8.0.242,), forge@[14.23.4.2705,)] Before:[] | |
| [22:52:38] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (crazypants.enderio.integration.tic.EnderIOIntegrationTic) - loading | |
| [22:52:38] [Client thread/TRACE] [FML]: Parsed dependency info for enderiointegrationtic: Requirements: [enderio@[5.0.44,), forge@[14.23.4.2705,)] After:[enderio@[5.0.44,), forge@[14.23.4.2705,)] Before:[enderiobase, tconstruct@[1.12.2-2.10.0.81,)] | |
| [22:52:38] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (crazypants.enderio.integration.tic.EnderIOIntegrationTicLate) - loading | |
| [22:52:38] [Client thread/TRACE] [FML]: Parsed dependency info for enderiointegrationticlate: Requirements: [] After:[tconstruct, enderiointegrationtic, enderio] Before:[] | |
| [22:52:38] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (crazypants.enderio.machines.EnderIOMachines) - loading | |
| [22:52:38] [Client thread/TRACE] [FML]: Parsed dependency info for enderiomachines: Requirements: [endercore@[1.12.2-0.5.57,), enderio@[5.0.44,), forge@[14.23.4.2705,)] After:[endercore@[1.12.2-0.5.57,), enderio@[5.0.44,), forge@[14.23.4.2705,), ftblib@[5.0.0,), jei@[4.14.1.234,)] Before:[] | |
| [22:52:38] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (crazypants.enderio.powertools.EnderIOPowerTools) - loading | |
| [22:52:38] [Client thread/TRACE] [FML]: Parsed dependency info for enderiopowertools: Requirements: [] After:[enderioconduits] Before:[] | |
| [22:52:38] [Client thread/DEBUG] [FML]: Examining file enderutilities-1.12.2-0.7.12.jar for potential mods | |
| [22:52:38] [Client thread/TRACE] [FML]: Located mcmod.info file in file enderutilities-1.12.2-0.7.12.jar | |
| [22:52:38] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (fi.dy.masa.enderutilities.EnderUtilities) - loading | |
| [22:52:38] [Client thread/TRACE] [FML]: Parsed dependency info for enderutilities: Requirements: [forge@[14.23.3.2694,)] After:[forge@[14.23.3.2694,)] Before:[] | |
| [22:52:38] [Client thread/DEBUG] [FML]: Examining file environmentaltech-1.12.2-2.0.20.1.jar for potential mods | |
| [22:52:38] [Client thread/TRACE] [FML]: Located mcmod.info file in file environmentaltech-1.12.2-2.0.20.1.jar | |
| [22:52:38] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.valkyrieofnight.et.ETMod) - loading | |
| [22:52:38] [Client thread/TRACE] [FML]: Parsed dependency info for environmentaltech: Requirements: [valkyrielib@[1.12.2-2.0.20.1,1.12.2-2.0.20.9999)] After:[valkyrielib@[1.12.2-2.0.20.1,1.12.2-2.0.20.9999)] Before:[] | |
| [22:52:38] [Client thread/DEBUG] [FML]: Examining file ExtraRails-1.12-1.3.0.jar for potential mods | |
| [22:52:38] [Client thread/TRACE] [FML]: Located mcmod.info file in file ExtraRails-1.12-1.3.0.jar | |
| [22:52:38] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.shadowfacts.extrarails.ExtraRails) - loading | |
| [22:52:38] [Client thread/TRACE] [FML]: Parsed dependency info for extrarails: Requirements: [shadowmc@[3.4.2,)] After:[shadowmc@[3.4.2,)] Before:[] | |
| [22:52:38] [Client thread/DEBUG] [FML]: Examining file extrautils2-1.12-1.9.9.jar for potential mods | |
| [22:52:38] [Client thread/TRACE] [FML]: Located mcmod.info file in file extrautils2-1.12-1.9.9.jar | |
| [22:52:39] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.rwtema.extrautils2.ExtraUtils2) - loading | |
| [22:52:39] [Client thread/TRACE] [FML]: Parsed dependency info for extrautils2: Requirements: [] After:[tconstruct] Before:[] | |
| [22:52:39] [Client thread/DEBUG] [FML]: Examining file FastLeafDecay-v14.jar for potential mods | |
| [22:52:39] [Client thread/TRACE] [FML]: Located mcmod.info file in file FastLeafDecay-v14.jar | |
| [22:52:39] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.olafkeijsers.fastleafdecay.FastLeafDecay) - loading | |
| [22:52:39] [Client thread/TRACE] [FML]: Parsed dependency info for fastleafdecay: Requirements: [] After:[] Before:[] | |
| [22:52:39] [Client thread/DEBUG] [FML]: Examining file forestry_1.12.2-5.8.1.322.jar for potential mods | |
| [22:52:39] [Client thread/TRACE] [FML]: Located mcmod.info file in file forestry_1.12.2-5.8.1.322.jar | |
| [22:52:39] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (forestry.Forestry) - loading | |
| [22:52:39] [Client thread/TRACE] [FML]: Parsed dependency info for forestry: Requirements: [forge@[14.23.4.2705,)] After:[forge@[14.23.4.2705,), jei@[4.7.8.91,), ic2, natura, toughasnails, techreborn, buildcraftenergy] Before:[] | |
| [22:52:39] [Client thread/DEBUG] [FML]: Examining file Forgelin-1.8.2.jar for potential mods | |
| [22:52:39] [Client thread/TRACE] [FML]: Located mcmod.info file in file Forgelin-1.8.2.jar | |
| [22:52:39] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.shadowfacts.forgelin.Forgelin) - loading | |
| [22:52:39] [Client thread/TRACE] [FML]: Using custom language adapter net.shadowfacts.forgelin.KotlinAdapter for net.shadowfacts.forgelin.Forgelin (modid: forgelin) | |
| [22:52:39] [Client thread/TRACE] [FML]: Parsed dependency info for forgelin: Requirements: [] After:[] Before:[] | |
| [22:52:40] [Client thread/DEBUG] [FML]: Examining file harvestersnight-1.12.2-1.1.0.jar for potential mods | |
| [22:52:40] [Client thread/TRACE] [FML]: Located mcmod.info file in file harvestersnight-1.12.2-1.1.0.jar | |
| [22:52:40] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (lykrast.harvestersnight.common.HarvestersNight) - loading | |
| [22:52:40] [Client thread/TRACE] [FML]: Parsed dependency info for harvestersnight: Requirements: [] After:[] Before:[] | |
| [22:52:40] [Client thread/DEBUG] [FML]: Examining file hopperducts-mc1.12-1.5.jar for potential mods | |
| [22:52:40] [Client thread/TRACE] [FML]: Located mcmod.info file in file hopperducts-mc1.12-1.5.jar | |
| [22:52:40] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.fybertech.hopperducts.HopperDuctsMod) - loading | |
| [22:52:40] [Client thread/TRACE] [FML]: Parsed dependency info for hopperducts: Requirements: [] After:[] Before:[] | |
| [22:52:40] [Client thread/DEBUG] [FML]: Examining file HuntingDimension-1.12.2-1.0.38.jar for potential mods | |
| [22:52:40] [Client thread/TRACE] [FML]: Located mcmod.info file in file HuntingDimension-1.12.2-1.0.38.jar | |
| [22:52:40] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.darkhax.huntingdim.HuntingDimension) - loading | |
| [22:52:40] [Client thread/TRACE] [FML]: Parsed dependency info for huntingdim: Requirements: [bookshelf@[2.3.561,)] After:[bookshelf@[2.3.561,)] Before:[] | |
| [22:52:40] [Client thread/DEBUG] [FML]: Examining file iChunUtil-1.12.2-7.2.1.jar for potential mods | |
| [22:52:40] [Client thread/TRACE] [FML]: Located mcmod.info file in file iChunUtil-1.12.2-7.2.1.jar | |
| [22:52:40] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.ichun.mods.ichunutil.common.iChunUtil) - loading | |
| [22:52:40] [Client thread/TRACE] [FML]: Parsed dependency info for ichunutil: Requirements: [forge@[14.23.5.2781,99999.24.0.0)] After:[forge@[14.23.5.2781,99999.24.0.0)] Before:[] | |
| [22:52:40] [Client thread/DEBUG] [FML]: Examining file industrialcraft-2-2.8.109-ex112.jar for potential mods | |
| [22:52:40] [Client thread/TRACE] [FML]: Located mcmod.info file in file industrialcraft-2-2.8.109-ex112.jar | |
| [22:52:40] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (ic2.core.IC2) - loading | |
| [22:52:40] [Client thread/TRACE] [FML]: Parsed dependency info for ic2: Requirements: [forge@[13.20.0.2206,)] After:[forge@[13.20.0.2206,)] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file industrialforegoing-1.12.2-1.12.12-236.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file industrialforegoing-1.12.2-1.12.12-236.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.buuz135.industrial.IndustrialForegoing) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for industrialforegoing: Requirements: [forge@[14.23.5.2806,), teslacorelib@[1.0.15,)] After:[forge@[14.23.5.2806,), teslacorelib@[1.0.15,)] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file inventorypets-1.12-2.0.1.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file inventorypets-1.12-2.0.1.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.inventorypets.InventoryPets) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for inventorypets: Requirements: [] After:[] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file inventorysorter-1.12.2-1.13.3+57.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file inventorysorter-1.12.2-1.13.3+57.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cpw.mods.inventorysorter.InventorySorter) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for inventorysorter: Requirements: [] After:[] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Attempting to load the file version.properties from inventorysorter-1.12.2-1.13.3+57.jar to locate a version number for mod inventorysorter | |
| [22:52:41] [Client thread/DEBUG] [FML]: Found version 1.13.3+57 for mod inventorysorter in version.properties, using | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file IronBackpacks-1.12.2-3.0.8-12.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file IronBackpacks-1.12.2-3.0.8-12.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (gr8pefish.ironbackpacks.IronBackpacks) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for ironbackpacks: Requirements: [] After:[] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file ironchest-1.12.2-7.0.59.842.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file ironchest-1.12.2-7.0.59.842.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cpw.mods.ironchest.IronChest) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for ironchest: Requirements: [forge@[14.21.0.2359,)] After:[forge@[14.21.0.2359,)] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Attempting to load the file version.properties from ironchest-1.12.2-7.0.59.842.jar to locate a version number for mod ironchest | |
| [22:52:41] [Client thread/DEBUG] [FML]: Found version null for mod ironchest in version.properties, using | |
| [22:52:41] [Client thread/WARN] [FML]: Mod ironchest is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 1.12.2-7.0.59.842 | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file ironfurnaces-1.3.3.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file ironfurnaces-1.3.3.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.xenomustache.ironfurnaces.IronFurnaces) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for ironfurnaces: Requirements: [] After:[] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file ItemFilters-1.0.3.12.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file ItemFilters-1.0.3.12.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.latmod.mods.itemfilters.ItemFilters) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for itemfilters: Requirements: [] After:[forestry] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file jei_1.12.2-4.15.0.268.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file jei_1.12.2-4.15.0.268.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (mezz.jei.JustEnoughItems) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for jei: Requirements: [forge@[14.23.1.2594,)] After:[forge@[14.23.1.2594,)] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file journeymap-1.12.2-5.5.4.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file journeymap-1.12.2-5.5.4.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (journeymap.common.Journeymap) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Using mcmod dependency info for journeymap: [] [Forge@[14.23.5.2768,)] [] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file JustAFewFish-1.7_for_1.12.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file JustAFewFish-1.7_for_1.12.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.tmtravlr.jaff.JAFFMod) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for jaff: Requirements: [] After:[] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file KeepingInventory-1.12.2-2.4.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file KeepingInventory-1.12.2-2.4.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (silly511.keepinginventory.KeepingInventory) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for keepinginventory: Requirements: [] After:[] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file LibEx-1.12.2-1.0.8.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file LibEx-1.12.2-1.0.8.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (lex.LibEx) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for lex: Requirements: [forge@[1.12.2-14.23.4.2708,)] After:[forge@[1.12.2-14.23.4.2708,)] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file LittleTiles_v1.5.0-pre135_mc1.12.2.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file LittleTiles_v1.5.0-pre135_mc1.12.2.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.creativemd.littletiles.LittleTiles) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for littletiles: Requirements: [] After:[] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file LootBags-1.12.2-2.5.8.5.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file LootBags-1.12.2-2.5.8.5.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (mal.lootbags.LootBags) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for lootbags: Requirements: [forge@[14.23.4.2703,)] After:[mystcraft] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file Mantle-1.12-1.3.3.49.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file Mantle-1.12-1.3.3.49.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (slimeknights.mantle.Mantle) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for mantle: Requirements: [forge@[14.21.1.2387,)] After:[forge@[14.21.1.2387,)] Before:[] | |
| [22:52:41] [Client thread/DEBUG] [FML]: Examining file mcjtylib-1.12-3.5.2.jar for potential mods | |
| [22:52:41] [Client thread/TRACE] [FML]: Located mcmod.info file in file mcjtylib-1.12-3.5.2.jar | |
| [22:52:41] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (mcjty.lib.McJtyLib) - loading | |
| [22:52:41] [Client thread/TRACE] [FML]: Parsed dependency info for mcjtylib_ng: Requirements: [] After:[forge@[14.23.5.2800,), enderio@[5.0.21,)] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file mysticallib-1.12.2-1.1.1.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file mysticallib-1.12.2-1.1.1.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (epicsquid.mysticallib.MysticalLib) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for mysticallib: Requirements: [] After:[*] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file Neat+1.4-17.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file Neat+1.4-17.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (vazkii.neat.Neat) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for neat: Requirements: [] After:[] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file Netherending-Ores-1.12.2-1.3.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file Netherending-Ores-1.12.2-1.3.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (org.icannt.netherendingores.NetherendingOres) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for netherendingores: Requirements: [forge@[14.23.5.2768,)] After:[forge@[14.23.5.2768,), mantle@[1.12-1.3.1,), tconstruct@[1.12.2-2.9.1,), plustic, appliedenergistics2, mekanism@[1.12.2-9.4.13.349,), matteroverdrive, bigreactors] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file NetherEx-1.12.2-2.0.8.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file NetherEx-1.12.2-2.0.8.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (nex.NetherEx) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for nex: Requirements: [lex@[1.0.8,)] After:[lex@[1.0.8,)] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file notenoughroofs-1.12.2-0.8.0.0.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file notenoughroofs-1.12.2-0.8.0.0.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (notenoughroofs.NotEnoughRoofs) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for notenoughroofs: Requirements: [] After:[] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file notenoughwands-1.12-1.8.1.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file notenoughwands-1.12-1.8.1.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (romelo333.notenoughwands.NotEnoughWands) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for notenoughwands: Requirements: [mcjtylib_ng@[3.5.0,)] After:[mcjtylib_ng@[3.5.0,), forge@[13.19.0.2176,), redstoneflux@[2.0.0,)] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file OreExcavation-1.4.140.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file OreExcavation-1.4.140.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (oreexcavation.core.OreExcavation) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Using mcmod dependency info for oreexcavation: [] [gamestages] [] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file ProjectE-1.12.2-PE1.4.1.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file ProjectE-1.12.2-PE1.4.1.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (moze_intel.projecte.PECore) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for projecte: Requirements: [forge@[13.20.0.2253,)] After:[forge@[13.20.0.2253,), baubles@[1.3.3,), jei@[4.6.0,)] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file ProportionalDestructionParticles-1.12.2-1.2.4.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file ProportionalDestructionParticles-1.12.2-1.2.4.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (phylogeny.proportionaldestructionparticles.ProportionalDestructionParticles) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for pdp: Requirements: [] After:[fbp@[2.4.1,), chiselsandbits] Before:[cofhcore] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file PTRLib-1.0.4.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file PTRLib-1.0.4.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mia.craftstudio.minecraft.forge.CSLibMod) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for ptrmodellib: Requirements: [] After:[] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file RandomThings-MC1.12.2-4.2.7.1.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file RandomThings-MC1.12.2-4.2.7.1.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (lumien.randomthings.RandomThings) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for randomthings: Requirements: [] After:[jei@[4.7.11.100,)] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file randomtweaks-1.12.2-2.5.0.5.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file randomtweaks-1.12.2-2.5.0.5.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.therandomlabs.randomtweaks.RandomTweaks) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for randomtweaks: Requirements: [] After:[] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file RebornCore-1.12.2-3.13.12.447-universal.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file RebornCore-1.12.2-3.13.12.447-universal.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (reborncore.RebornCore) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for reborncore: Requirements: [forge@[14.21.0.2359,)] After:[forge@[14.21.0.2359,)] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file RedstoneFlux-1.12-2.1.0.6-universal.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file RedstoneFlux-1.12-2.1.0.6-universal.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cofh.redstoneflux.RedstoneFlux) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for redstoneflux: Requirements: [] After:[] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file redstonepaste-mc1.12-1.7.5.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file redstonepaste-mc1.12-1.7.5.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.fybertech.redstonepaste.RedstonePasteMod) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for redstonepaste: Requirements: [] After:[] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file Reliquary-1.12.2-1.3.4.786.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file Reliquary-1.12.2-1.3.4.786.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (xreliquary.Reliquary) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for xreliquary: Requirements: [] After:[baubles, enderio, tconstruct] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file ShadowMC-1.12-3.8.0.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file ShadowMC-1.12-3.8.0.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.shadowfacts.shadowmc.ShadowMC) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for shadowmc: Requirements: [] After:[] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file SimplyJetpacks2-1.12.2-2.2.12.65.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file SimplyJetpacks2-1.12.2-2.2.12.65.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (tonius.simplyjetpacks.SimplyJetpacks) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for simplyjetpacks: Requirements: [redstoneflux@[2.0.1,)] After:[redstoneflux@[2.0.1,), thermalexpansion, redstonearsenal, thermaldynamics, enderio, redstonerepository] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file SlashBlade-mc1.12-r23.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file SlashBlade-mc1.12-r23.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (mods.flammpfeil.slashblade.SlashBlade) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for flammpfeil.slashblade: Requirements: [] After:[] Before:[] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Examining file SmoothFont-mc1.12.2-1.16.2.jar for potential mods | |
| [22:52:42] [Client thread/TRACE] [FML]: Located mcmod.info file in file SmoothFont-mc1.12.2-1.16.2.jar | |
| [22:52:42] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (bre.smoothfont.mod_SmoothFont) - loading | |
| [22:52:42] [Client thread/TRACE] [FML]: Parsed dependency info for smoothfont: Requirements: [] After:[] Before:[*] | |
| [22:52:42] [Client thread/DEBUG] [FML]: Attempting to load the file version.properties from SmoothFont-mc1.12.2-1.16.2.jar to locate a version number for mod smoothfont | |
| [22:52:42] [Client thread/WARN] [FML]: Mod smoothfont is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version mc1.12.2-1.16.2 | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file Snad-1.12.1-1.7.09.16a.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file Snad-1.12.1-1.7.09.16a.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.robrit.snad.common.Snad) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for snad: Requirements: [] After:[] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file SpartanShields-1.12.2-1.5.3.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file SpartanShields-1.12.2-1.5.3.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.oblivioussp.spartanshields.ModSpartanShields) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for spartanshields: Requirements: [] After:[redstoneflux, enderio, rftools, botania, redstonearsenal, abyssalcraft, betterwithmods, thaumcraft] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file StevesCarts-1.12.2-2.4.30.134.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file StevesCarts-1.12.2-2.4.30.134.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (vswe.stevescarts.StevesCarts) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for stevescarts: Requirements: [forge@[14.21.0.2373,), reborncore] After:[reborncore, forge@[14.21.0.2373,)] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file stg-1.12.2-1.2.3.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file stg-1.12.2-1.2.3.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.exidex.stg.STG) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for stg: Requirements: [] After:[] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file StorageDrawers-1.12.2-5.3.8.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file StorageDrawers-1.12.2-5.3.8.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.jaquadro.minecraft.storagedrawers.StorageDrawers) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Using mcmod dependency info for storagedrawers: [forge, chameleon] [chameleon] [] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file switchbow-1.5.6.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file switchbow-1.5.6.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (de.Whitedraco.switchbow.Initial) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for switchbow: Requirements: [] After:[] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file Tabula-1.12.2-7.0.1.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file Tabula-1.12.2-7.0.1.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.ichun.mods.tabula.common.Tabula) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for tabula: Requirements: [ichunutil@[7.2.0,8.0.0)] After:[ichunutil@[7.2.0,8.0.0)] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file TConstruct-1.12.2-2.12.0.135.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file TConstruct-1.12.2-2.12.0.135.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (slimeknights.tconstruct.TConstruct) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for tconstruct: Requirements: [mantle@[1.12-1.3.3.49,), forge@[14.23.1.2577,)] After:[forge@[14.23.1.2577,), mantle@[1.12-1.3.3.49,), jei@[4.8,), chisel] Before:[taiga@(1.3.0,)] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file tesla-core-lib-1.12.2-1.0.15.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file tesla-core-lib-1.12.2-1.0.15.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.ndrei.teslacorelib.TeslaCoreLib) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Using custom language adapter net.shadowfacts.forgelin.KotlinAdapter for net.ndrei.teslacorelib.TeslaCoreLib (modid: teslacorelib) | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for teslacorelib: Requirements: [forgelin@[1.6.0,), forge@[14.23.3.2655,)] After:[forgelin@[1.6.0,), forge@[14.23.3.2655,), tesla, redstoneflux, buildcraftlib, mekanism] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.ndrei.teslacorelib.TeslaCoreRegistries) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Using custom language adapter net.shadowfacts.forgelin.KotlinAdapter for net.ndrei.teslacorelib.TeslaCoreRegistries (modid: teslacorelib_registries) | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for teslacorelib_registries: Requirements: [forgelin@[1.6.0,), forge@[14.23.3.2655,)] After:[forgelin@[1.6.0,), forge@[14.23.3.2655,), *] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file thedragonlib-1.12.2-5.3.0.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file thedragonlib-1.12.2-5.3.0.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.thedragonteam.thedragonlib.TheDragonLib) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for thedragonlib: Requirements: [forge@[14.22.0.2459,)] After:[forge@[14.22.0.2459,)] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file TheEightFabledBlades+V2.0.01.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file TheEightFabledBlades+V2.0.01.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.Shultrea.Rin.theeightfabledblades.TheEightFabledBlades) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for theeightfabledblades: Requirements: [] After:[] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file ThermalCultivation-1.12.2-0.3.2.11-universal.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file ThermalCultivation-1.12.2-0.3.2.11-universal.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cofh.thermalcultivation.ThermalCultivation) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for thermalcultivation: Requirements: [thermalfoundation@[2.6.0,2.7.0), cofhcore@[4.6.0,4.7.0)] After:[cofhcore@[4.6.0,4.7.0), thermalfoundation@[2.6.0,2.7.0), thermalexpansion] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file ThermalFoundation-1.12.2-2.6.2.26-universal.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file ThermalFoundation-1.12.2-2.6.2.26-universal.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cofh.thermalfoundation.ThermalFoundation) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for thermalfoundation: Requirements: [cofhcore@[4.6.0,4.7.0), cofhworld@[1.2.0,2.0.0)] After:[cofhcore@[4.6.0,4.7.0), cofhworld@[1.2.0,2.0.0)] Before:[enderio, immersiveengineering] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file TinkerToolLeveling-1.12.2-1.1.0.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file TinkerToolLeveling-1.12.2-1.1.0.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (slimeknights.toolleveling.TinkerToolLeveling) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for tinkertoolleveling: Requirements: [forge@[14.21.1.2410,), mantle@[1.12-1.3.1.21,), tconstruct@[1.12-2.10,)] After:[forge@[14.21.1.2410,), mantle@[1.12-1.3.1.21,), tconstruct@[1.12-2.10,)] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file torchmaster_1.12.2-1.7.1.74.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file torchmaster_1.12.2-1.7.1.74.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.xalcon.torchmaster.TorchMasterMod) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for torchmaster: Requirements: [forge@[14.21.1.2394,)] After:[forge@[14.21.1.2394,)] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file Trapcraft-1.12-v2.4.3a-universal.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file Trapcraft-1.12-v2.4.3a-universal.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (trapcraft.TrapcraftMod) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for trapcraft: Requirements: [] After:[] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file TrashSlot_1.12.1-8.4.6.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file TrashSlot_1.12.1-8.4.6.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.blay09.mods.trashslot.TrashSlot) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for trashslot: Requirements: [forge@[13.19.0.2162,)] After:[forge@[13.19.0.2162,)] Before:[] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Attempting to load the file version.properties from TrashSlot_1.12.1-8.4.6.jar to locate a version number for mod trashslot | |
| [22:52:43] [Client thread/WARN] [FML]: Mod trashslot is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 8.4.6 | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file TS2K16-1.2.10.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file TS2K16-1.2.10.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (ts2k16.core.TS2K16) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Using mcmod dependency info for ts2k16: [] [gamestages] [] | |
| [22:52:43] [Client thread/DEBUG] [FML]: Examining file twilightforest-1.12.2-3.8.689-universal.jar for potential mods | |
| [22:52:43] [Client thread/TRACE] [FML]: Located mcmod.info file in file twilightforest-1.12.2-3.8.689-universal.jar | |
| [22:52:43] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (twilightforest.TwilightForestMod) - loading | |
| [22:52:43] [Client thread/TRACE] [FML]: Parsed dependency info for twilightforest: Requirements: [forge@[14.23.3.2655,)] After:[ctm@[MC1.12.2-0.3.2.18,), forge@[14.23.3.2655,), thaumcraft@[6.1.BETA21,)] Before:[immersiveengineering@[0.12-83,), tconstruct] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Examining file Uppers-0.0.6.jar for potential mods | |
| [22:52:44] [Client thread/TRACE] [FML]: Located mcmod.info file in file Uppers-0.0.6.jar | |
| [22:52:44] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (uppers.Uppers) - loading | |
| [22:52:44] [Client thread/TRACE] [FML]: Parsed dependency info for uppers: Requirements: [] After:[] Before:[] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Examining file valkyrielib-1.12.2-2.0.20.1.jar for potential mods | |
| [22:52:44] [Client thread/TRACE] [FML]: Located mcmod.info file in file valkyrielib-1.12.2-2.0.20.1.jar | |
| [22:52:44] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.valkyrieofnight.um.UniversalModifiers) - loading | |
| [22:52:44] [Client thread/TRACE] [FML]: Parsed dependency info for universalmodifiers: Requirements: [] After:[] Before:[] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.valkyrieofnight.vliblegacy.ValkyrieLib) - loading | |
| [22:52:44] [Client thread/TRACE] [FML]: Parsed dependency info for valkyrielib: Requirements: [forge@[1.12.2-14.23.5.2768,)] After:[forge@[1.12.2-14.23.5.2768,)] Before:[] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Examining file ViesCraft-1.12.2-5.9.13.jar for potential mods | |
| [22:52:44] [Client thread/TRACE] [FML]: Located mcmod.info file in file ViesCraft-1.12.2-5.9.13.jar | |
| [22:52:44] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.viesis.viescraft.ViesCraft) - loading | |
| [22:52:44] [Client thread/TRACE] [FML]: Parsed dependency info for vc: Requirements: [] After:[] Before:[] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Examining file wings-1.1.4-1.12.2.jar for potential mods | |
| [22:52:44] [Client thread/TRACE] [FML]: Located mcmod.info file in file wings-1.1.4-1.12.2.jar | |
| [22:52:44] [Client thread/DEBUG] [FML]: Identified a mod of type Lme/paulf/wings/server/asm/plugin/Integration; (me.paulf.wings.server.integration.WingsBaublesIntegration) - loading | |
| [22:52:44] [Client thread/TRACE] [FML]: Parsed dependency info for bauble_wings: Requirements: [wings] After:[wings, baubles@[1.5,1.6)] Before:[] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Identified a mod of type Lme/paulf/wings/server/asm/plugin/Integration; (me.paulf.wings.server.integration.WingsMoBendsIntegration) - loading | |
| [22:52:44] [Client thread/TRACE] [FML]: Parsed dependency info for mobends_wings: Requirements: [wings] After:[wings, mobends@[0.24,0.25)] Before:[] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.paulf.wings.WingsMod) - loading | |
| [22:52:44] [Client thread/TRACE] [FML]: Using mcmod dependency info for wings: [forge@[14.23.4.2705,), llibrary@[1.7,1.8)] [forge@[14.23.4.2705,), llibrary@[1.7,1.8), jei@[4.8,5)] [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Attempting to load the file version.properties from wings-1.1.4-1.12.2.jar to locate a version number for mod wings | |
| [22:52:44] [Client thread/WARN] [FML]: Mod wings is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 1.1.4 | |
| [22:52:44] [Client thread/DEBUG] [FML]: Examining file wolfarmor-1.12.2-2.2.3.1798-universal.jar for potential mods | |
| [22:52:44] [Client thread/TRACE] [FML]: Located mcmod.info file in file wolfarmor-1.12.2-2.2.3.1798-universal.jar | |
| [22:52:44] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.attributestudios.wolfarmor.WolfArmorMod) - loading | |
| [22:52:44] [Client thread/TRACE] [FML]: Using mcmod dependency info for wolfarmor: [] [sophisticatedwolves, twilightforest] [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Examining file XtraGear+++1.0.4.jar for potential mods | |
| [22:52:44] [Client thread/TRACE] [FML]: Located mcmod.info file in file XtraGear+++1.0.4.jar | |
| [22:52:44] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (mod.mcreator.xtragear) - loading | |
| [22:52:44] [Client thread/TRACE] [FML]: Parsed dependency info for xtragear: Requirements: [] After:[] Before:[] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Examining file ye.jar for potential mods | |
| [22:52:44] [Client thread/TRACE] [FML]: Located mcmod.info file in file ye.jar | |
| [22:52:44] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (mob_grinding_utils.MobGrindingUtils) - loading | |
| [22:52:44] [Client thread/TRACE] [FML]: Parsed dependency info for mob_grinding_utils: Requirements: [] After:[] Before:[] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Examining file yoyos_1.12.2-1.2.2.20.jar for potential mods | |
| [22:52:44] [Client thread/TRACE] [FML]: Located mcmod.info file in file yoyos_1.12.2-1.2.2.20.jar | |
| [22:52:44] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.jozufozu.yoyos.Yoyos) - loading | |
| [22:52:44] [Client thread/TRACE] [FML]: Parsed dependency info for yoyos: Requirements: [] After:[tconstruct, plustic] Before:[] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Examining file phosphor-1.12.2-0.1.6+build31.jar for potential mods | |
| [22:52:44] [Client thread/TRACE] [FML]: Located mcmod.info file in file phosphor-1.12.2-0.1.6+build31.jar | |
| [22:52:44] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.jellysquid.mods.phosphor.common.PhosphorMod) - loading | |
| [22:52:44] [Client thread/TRACE] [FML]: Parsed dependency info for phosphor-lighting: Requirements: [] After:[] Before:[] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Examining file orbis-lib-1.12.2-0.2.0+build42.jar for potential mods | |
| [22:52:44] [Client thread/TRACE] [FML]: Located mcmod.info file in file orbis-lib-1.12.2-0.2.0+build42.jar | |
| [22:52:44] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.gildedgames.orbis.lib.OrbisLib) - loading | |
| [22:52:44] [Client thread/TRACE] [FML]: Using mcmod dependency info for orbis-lib: [] [] [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Examining file AutoSave-1.12.2-1.0.10.jar for potential mods | |
| [22:52:44] [Client thread/DEBUG] [FML]: The mod container AutoSave-1.12.2-1.0.10.jar appears to be missing an mcmod.info file | |
| [22:52:44] [Client thread/DEBUG] [FML]: Examining file AutoConfig-1.12.2-1.0.2.jar for potential mods | |
| [22:52:44] [Client thread/DEBUG] [FML]: The mod container AutoConfig-1.12.2-1.0.2.jar appears to be missing an mcmod.info file | |
| [22:52:44] [Client thread/DEBUG] [FML]: Examining file llibrary-1.7.19-1.12.2.jar for potential mods | |
| [22:52:44] [Client thread/TRACE] [FML]: Located mcmod.info file in file llibrary-1.7.19-1.12.2.jar | |
| [22:52:44] [Client thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.ilexiconn.llibrary.LLibrary) - loading | |
| [22:52:44] [Client thread/TRACE] [FML]: Parsed dependency info for llibrary: Requirements: [forge@[14.23.5.2772,)] After:[forge@[14.23.5.2772,)] Before:[] | |
| [22:52:44] [Client thread/INFO] [FML]: Forge Mod Loader has identified 143 mods to load | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.fuels (owned by ForestryAPI|core providing ForestryAPI|fuels) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.lepidopterology (owned by ForestryAPI|core providing ForestryAPI|lepidopterology) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.farm (owned by enderio providing enderioapi|farm) embedded in enderio | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.farm (owned by enderio providing enderioapi|farm) embedded in enderiobase | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.farm (owned by enderio providing enderioapi|farm) embedded in enderioconduitsappliedenergistics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.farm (owned by enderio providing enderioapi|farm) embedded in enderioconduitsopencomputers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.farm (owned by enderio providing enderioapi|farm) embedded in enderioconduitsrefinedstorage | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.farm (owned by enderio providing enderioapi|farm) embedded in enderioconduits | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.farm (owned by enderio providing enderioapi|farm) embedded in enderiointegrationforestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.farm (owned by enderio providing enderioapi|farm) embedded in enderiointegrationtic | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.farm (owned by enderio providing enderioapi|farm) embedded in enderiointegrationticlate | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.farm (owned by enderio providing enderioapi|farm) embedded in enderiomachines | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.farm (owned by enderio providing enderioapi|farm) embedded in enderiopowertools | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.addon (owned by enderio providing enderioapi|addon) embedded in enderio | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.addon (owned by enderio providing enderioapi|addon) embedded in enderiobase | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.addon (owned by enderio providing enderioapi|addon) embedded in enderioconduitsappliedenergistics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.addon (owned by enderio providing enderioapi|addon) embedded in enderioconduitsopencomputers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.addon (owned by enderio providing enderioapi|addon) embedded in enderioconduitsrefinedstorage | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.addon (owned by enderio providing enderioapi|addon) embedded in enderioconduits | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.addon (owned by enderio providing enderioapi|addon) embedded in enderiointegrationforestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.addon (owned by enderio providing enderioapi|addon) embedded in enderiointegrationtic | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.addon (owned by enderio providing enderioapi|addon) embedded in enderiointegrationticlate | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.addon (owned by enderio providing enderioapi|addon) embedded in enderiomachines | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.addon (owned by enderio providing enderioapi|addon) embedded in enderiopowertools | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API com.mia.craftstudio (owned by ptrmodellib providing CSLib|API) embedded in ptrmodellib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API cubex2.mods.chesttransporter.api (owned by chesttransporter providing chesttransporter|api) embedded in chesttransporter | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API team.chisel.ctm.api.util (owned by ctm providing ctm-api-utils) embedded in ctm | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API journeymap.client.api.util (owned by journeymap providing journeymap|client-api-util) embedded in journeymap | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API com.jaquadro.minecraft.storagedrawers.api.render (owned by StorageDrawersAPI providing StorageDrawersAPI|render) embedded in storagedrawers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.statements (owned by buildcraftapi_core providing buildcraftapi_statements) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.statements (owned by buildcraftapi_core providing buildcraftapi_statements) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.statements (owned by buildcraftapi_core providing buildcraftapi_statements) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.statements (owned by buildcraftapi_core providing buildcraftapi_statements) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.statements (owned by buildcraftapi_core providing buildcraftapi_statements) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.statements (owned by buildcraftapi_core providing buildcraftapi_statements) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.statements (owned by buildcraftapi_core providing buildcraftapi_statements) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.statements (owned by buildcraftapi_core providing buildcraftapi_statements) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.statements (owned by buildcraftapi_core providing buildcraftapi_statements) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API journeymap.client.api.event (owned by journeymap providing journeymap|client-api-event) embedded in journeymap | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API journeymap.client.api.model (owned by journeymap providing journeymap|client-api-model) embedded in journeymap | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API net.geforcemods.securitycraft.api (owned by securitycraft providing SecurityCraftAPI) embedded in securitycraft | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.apiculture.hives (owned by ForestryAPI|apiculture providing ForestryAPI|hives) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.greenhouse.api.greenhouse (owned by ForestryAPI|core providing ForestryAPI|greenhouse) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API com.jaquadro.minecraft.storagedrawers.api (owned by StorageDrawers providing StorageDrawersAPI) embedded in storagedrawers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API team.chisel.ctm.api.event (owned by ctm providing ctm-api-events) embedded in ctm | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API journeymap.client.api (owned by journeymap providing journeymap|client-api) embedded in journeymap | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tools (owned by buildcraftapi_core providing buildcraftapi_tools) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tools (owned by buildcraftapi_core providing buildcraftapi_tools) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tools (owned by buildcraftapi_core providing buildcraftapi_tools) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tools (owned by buildcraftapi_core providing buildcraftapi_tools) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tools (owned by buildcraftapi_core providing buildcraftapi_tools) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tools (owned by buildcraftapi_core providing buildcraftapi_tools) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tools (owned by buildcraftapi_core providing buildcraftapi_tools) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tools (owned by buildcraftapi_core providing buildcraftapi_tools) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tools (owned by buildcraftapi_core providing buildcraftapi_tools) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.robots (owned by buildcraftapi_core providing buildcraftapi_robotics) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.robots (owned by buildcraftapi_core providing buildcraftapi_robotics) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.robots (owned by buildcraftapi_core providing buildcraftapi_robotics) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.robots (owned by buildcraftapi_core providing buildcraftapi_robotics) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.robots (owned by buildcraftapi_core providing buildcraftapi_robotics) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.robots (owned by buildcraftapi_core providing buildcraftapi_robotics) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.robots (owned by buildcraftapi_core providing buildcraftapi_robotics) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.robots (owned by buildcraftapi_core providing buildcraftapi_robotics) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.robots (owned by buildcraftapi_core providing buildcraftapi_robotics) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.recipes (owned by ForestryAPI|core providing ForestryAPI|recipes) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API vswe.stevescarts.api.farms (owned by stevescarts providing stevescartsAPI|FARMS) embedded in stevescarts | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.upgrades (owned by enderio providing enderioapi|upgrades) embedded in enderio | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.upgrades (owned by enderio providing enderioapi|upgrades) embedded in enderiobase | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.upgrades (owned by enderio providing enderioapi|upgrades) embedded in enderioconduitsappliedenergistics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.upgrades (owned by enderio providing enderioapi|upgrades) embedded in enderioconduitsopencomputers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.upgrades (owned by enderio providing enderioapi|upgrades) embedded in enderioconduitsrefinedstorage | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.upgrades (owned by enderio providing enderioapi|upgrades) embedded in enderioconduits | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.upgrades (owned by enderio providing enderioapi|upgrades) embedded in enderiointegrationforestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.upgrades (owned by enderio providing enderioapi|upgrades) embedded in enderiointegrationtic | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.upgrades (owned by enderio providing enderioapi|upgrades) embedded in enderiointegrationticlate | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.upgrades (owned by enderio providing enderioapi|upgrades) embedded in enderiomachines | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.upgrades (owned by enderio providing enderioapi|upgrades) embedded in enderiopowertools | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API team.chisel.ctm.api.model (owned by ctm providing ctm-api-models) embedded in ctm | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API reborncore.api.power (owned by reborncore providing reborncoreAPI|Power) embedded in reborncore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API reborncore.api.recipe (owned by reborncore providing reborncoreAPI|Recipe) embedded in reborncore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API reborncore.api.tile (owned by reborncore providing reborncoreAPI|Tile) embedded in reborncore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API de.ellpeck.actuallyadditions.api (owned by actuallyadditions providing actuallyadditionsapi) embedded in actuallyadditions | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.library (owned by buildcraftapi_core providing buildcraftapi_library) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.library (owned by buildcraftapi_core providing buildcraftapi_library) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.library (owned by buildcraftapi_core providing buildcraftapi_library) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.library (owned by buildcraftapi_core providing buildcraftapi_library) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.library (owned by buildcraftapi_core providing buildcraftapi_library) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.library (owned by buildcraftapi_core providing buildcraftapi_library) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.library (owned by buildcraftapi_core providing buildcraftapi_library) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.library (owned by buildcraftapi_core providing buildcraftapi_library) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.library (owned by buildcraftapi_core providing buildcraftapi_library) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.conduits (owned by enderio providing enderioapi|conduits) embedded in enderio | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.conduits (owned by enderio providing enderioapi|conduits) embedded in enderiobase | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.conduits (owned by enderio providing enderioapi|conduits) embedded in enderioconduitsappliedenergistics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.conduits (owned by enderio providing enderioapi|conduits) embedded in enderioconduitsopencomputers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.conduits (owned by enderio providing enderioapi|conduits) embedded in enderioconduitsrefinedstorage | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.conduits (owned by enderio providing enderioapi|conduits) embedded in enderioconduits | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.conduits (owned by enderio providing enderioapi|conduits) embedded in enderiointegrationforestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.conduits (owned by enderio providing enderioapi|conduits) embedded in enderiointegrationtic | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.conduits (owned by enderio providing enderioapi|conduits) embedded in enderiointegrationticlate | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.conduits (owned by enderio providing enderioapi|conduits) embedded in enderiomachines | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.conduits (owned by enderio providing enderioapi|conduits) embedded in enderiopowertools | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API com.jaquadro.minecraft.storagedrawers.api.storage.attribute (owned by StorageDrawersAPI providing StorageDrawersAPI|storage-attribute) embedded in storagedrawers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API mezz.jei.api (owned by jei providing JustEnoughItemsAPI) embedded in jei | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API reborncore.api (owned by reborncore providing reborncoreAPI) embedded in reborncore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.storage (owned by ForestryAPI|core providing ForestryAPI|storage) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.modules (owned by ForestryAPI|core providing ForestryAPI|modules) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.blocks (owned by buildcraftapi_core providing buildcraftapi_blocks) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.blocks (owned by buildcraftapi_core providing buildcraftapi_blocks) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.blocks (owned by buildcraftapi_core providing buildcraftapi_blocks) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.blocks (owned by buildcraftapi_core providing buildcraftapi_blocks) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.blocks (owned by buildcraftapi_core providing buildcraftapi_blocks) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.blocks (owned by buildcraftapi_core providing buildcraftapi_blocks) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.blocks (owned by buildcraftapi_core providing buildcraftapi_blocks) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.blocks (owned by buildcraftapi_core providing buildcraftapi_blocks) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.blocks (owned by buildcraftapi_core providing buildcraftapi_blocks) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.boards (owned by buildcraftapi_core providing buildcraftapi_boards) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.boards (owned by buildcraftapi_core providing buildcraftapi_boards) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.boards (owned by buildcraftapi_core providing buildcraftapi_boards) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.boards (owned by buildcraftapi_core providing buildcraftapi_boards) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.boards (owned by buildcraftapi_core providing buildcraftapi_boards) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.boards (owned by buildcraftapi_core providing buildcraftapi_boards) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.boards (owned by buildcraftapi_core providing buildcraftapi_boards) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.boards (owned by buildcraftapi_core providing buildcraftapi_boards) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.boards (owned by buildcraftapi_core providing buildcraftapi_boards) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API cofh.redstoneflux (owned by redstoneflux providing redstonefluxapi) embedded in redstoneflux | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API com.sofodev.armorplus.api (owned by armorplus providing ArmorPlusApi) embedded in armorplus | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API com.buuz135.industrial.api (owned by industrialforegoing providing industrialforegoingapi) embedded in industrialforegoing | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.facades (owned by buildcraftapi_core providing buildcraftapi_facades) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.facades (owned by buildcraftapi_core providing buildcraftapi_facades) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.facades (owned by buildcraftapi_core providing buildcraftapi_facades) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.facades (owned by buildcraftapi_core providing buildcraftapi_facades) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.facades (owned by buildcraftapi_core providing buildcraftapi_facades) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.facades (owned by buildcraftapi_core providing buildcraftapi_facades) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.facades (owned by buildcraftapi_core providing buildcraftapi_facades) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.facades (owned by buildcraftapi_core providing buildcraftapi_facades) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.facades (owned by buildcraftapi_core providing buildcraftapi_facades) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tiles (owned by buildcraftapi_core providing buildcraftapi_tiles) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tiles (owned by buildcraftapi_core providing buildcraftapi_tiles) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tiles (owned by buildcraftapi_core providing buildcraftapi_tiles) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tiles (owned by buildcraftapi_core providing buildcraftapi_tiles) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tiles (owned by buildcraftapi_core providing buildcraftapi_tiles) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tiles (owned by buildcraftapi_core providing buildcraftapi_tiles) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tiles (owned by buildcraftapi_core providing buildcraftapi_tiles) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tiles (owned by buildcraftapi_core providing buildcraftapi_tiles) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.tiles (owned by buildcraftapi_core providing buildcraftapi_tiles) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.transport (owned by buildcraftapi_core providing buildcraftapi_transport) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.transport (owned by buildcraftapi_core providing buildcraftapi_transport) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.transport (owned by buildcraftapi_core providing buildcraftapi_transport) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.transport (owned by buildcraftapi_core providing buildcraftapi_transport) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.transport (owned by buildcraftapi_core providing buildcraftapi_transport) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.transport (owned by buildcraftapi_core providing buildcraftapi_transport) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.transport (owned by buildcraftapi_core providing buildcraftapi_transport) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.transport (owned by buildcraftapi_core providing buildcraftapi_transport) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.transport (owned by buildcraftapi_core providing buildcraftapi_transport) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.world (owned by ForestryAPI|core providing ForestryAPI|world) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.crops (owned by buildcraftapi_core providing buildcraftapi_crops) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.crops (owned by buildcraftapi_core providing buildcraftapi_crops) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.crops (owned by buildcraftapi_core providing buildcraftapi_crops) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.crops (owned by buildcraftapi_core providing buildcraftapi_crops) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.crops (owned by buildcraftapi_core providing buildcraftapi_crops) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.crops (owned by buildcraftapi_core providing buildcraftapi_crops) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.crops (owned by buildcraftapi_core providing buildcraftapi_crops) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.crops (owned by buildcraftapi_core providing buildcraftapi_crops) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.crops (owned by buildcraftapi_core providing buildcraftapi_crops) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.mail (owned by ForestryAPI|core providing ForestryAPI|mail) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API com.valkyrieofnight.vliblegacy.api (owned by valkyrielib providing valkyrielib.api) embedded in universalmodifiers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API com.valkyrieofnight.vliblegacy.api (owned by valkyrielib providing valkyrielib.api) embedded in valkyrielib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API vazkii.botania.api (owned by Botania providing BotaniaAPI) embedded in botania | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API me.ichun.mods.ichunutil.api (owned by iChun providing iChunUtil API) embedded in ichunutil | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API team.chisel.ctm.api.texture (owned by ctm providing ctm-api-textures) embedded in ctm | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.core (owned by buildcraftlib providing buildcraftapi_core) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.core (owned by buildcraftlib providing buildcraftapi_core) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.core (owned by buildcraftlib providing buildcraftapi_core) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.core (owned by buildcraftlib providing buildcraftapi_core) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.core (owned by buildcraftlib providing buildcraftapi_core) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.core (owned by buildcraftlib providing buildcraftapi_core) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.core (owned by buildcraftlib providing buildcraftapi_core) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.core (owned by buildcraftlib providing buildcraftapi_core) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.core (owned by buildcraftlib providing buildcraftapi_core) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API moze_intel.projecte.api (owned by projecte providing projecteapi) embedded in projecte | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.circuits (owned by ForestryAPI|core providing ForestryAPI|circuits) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API journeymap.client.api.display (owned by journeymap providing journeymap|client-api-display) embedded in journeymap | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.book (owned by ForestryAPI|core providing ForestryAPI|book) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.gui (owned by ForestryAPI|core providing ForestryAPI|gui) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.recipes (owned by buildcraftapi_core providing buildcraftapi_recipes) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.recipes (owned by buildcraftapi_core providing buildcraftapi_recipes) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.recipes (owned by buildcraftapi_core providing buildcraftapi_recipes) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.recipes (owned by buildcraftapi_core providing buildcraftapi_recipes) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.recipes (owned by buildcraftapi_core providing buildcraftapi_recipes) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.recipes (owned by buildcraftapi_core providing buildcraftapi_recipes) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.recipes (owned by buildcraftapi_core providing buildcraftapi_recipes) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.recipes (owned by buildcraftapi_core providing buildcraftapi_recipes) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.recipes (owned by buildcraftapi_core providing buildcraftapi_recipes) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.food (owned by ForestryAPI|core providing ForestryAPI|food) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.core (owned by Forestry providing ForestryAPI|core) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.redstone (owned by enderio providing enderioapi|redstone) embedded in enderio | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.redstone (owned by enderio providing enderioapi|redstone) embedded in enderiobase | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.redstone (owned by enderio providing enderioapi|redstone) embedded in enderioconduitsappliedenergistics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.redstone (owned by enderio providing enderioapi|redstone) embedded in enderioconduitsopencomputers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.redstone (owned by enderio providing enderioapi|redstone) embedded in enderioconduitsrefinedstorage | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.redstone (owned by enderio providing enderioapi|redstone) embedded in enderioconduits | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.redstone (owned by enderio providing enderioapi|redstone) embedded in enderiointegrationforestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.redstone (owned by enderio providing enderioapi|redstone) embedded in enderiointegrationtic | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.redstone (owned by enderio providing enderioapi|redstone) embedded in enderiointegrationticlate | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.redstone (owned by enderio providing enderioapi|redstone) embedded in enderiomachines | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.redstone (owned by enderio providing enderioapi|redstone) embedded in enderiopowertools | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API baubles.api (owned by Baubles providing Baubles|API) embedded in inventorypets | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.items (owned by buildcraftapi_core providing buildcraftapi_items) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.items (owned by buildcraftapi_core providing buildcraftapi_items) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.items (owned by buildcraftapi_core providing buildcraftapi_items) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.items (owned by buildcraftapi_core providing buildcraftapi_items) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.items (owned by buildcraftapi_core providing buildcraftapi_items) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.items (owned by buildcraftapi_core providing buildcraftapi_items) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.items (owned by buildcraftapi_core providing buildcraftapi_items) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.items (owned by buildcraftapi_core providing buildcraftapi_items) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.items (owned by buildcraftapi_core providing buildcraftapi_items) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API team.chisel.api (owned by chisel providing Chisel-API) embedded in chisel | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API com.jaquadro.minecraft.storagedrawers.api.storage (owned by StorageDrawersAPI providing StorageDrawersAPI|storage) embedded in storagedrawers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.multiblock (owned by ForestryAPI|core providing ForestryAPI|multiblock) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API baubles.api (owned by Baubles providing Baubles|API) embedded in baubles | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API cofh.api (owned by cofhcore providing cofhapi) embedded in cofhcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api (owned by enderio providing enderioapi) embedded in enderio | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api (owned by enderio providing enderioapi) embedded in enderiobase | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api (owned by enderio providing enderioapi) embedded in enderioconduitsappliedenergistics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api (owned by enderio providing enderioapi) embedded in enderioconduitsopencomputers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api (owned by enderio providing enderioapi) embedded in enderioconduitsrefinedstorage | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api (owned by enderio providing enderioapi) embedded in enderioconduits | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api (owned by enderio providing enderioapi) embedded in enderiointegrationforestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api (owned by enderio providing enderioapi) embedded in enderiointegrationtic | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api (owned by enderio providing enderioapi) embedded in enderiointegrationticlate | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api (owned by enderio providing enderioapi) embedded in enderiomachines | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api (owned by enderio providing enderioapi) embedded in enderiopowertools | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.farming (owned by ForestryAPI|core providing ForestryAPI|farming) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.climate (owned by Forestry providing ForestryAPI|climate) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.tool (owned by enderio providing enderioapi|tools) embedded in enderio | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.tool (owned by enderio providing enderioapi|tools) embedded in enderiobase | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.tool (owned by enderio providing enderioapi|tools) embedded in enderioconduitsappliedenergistics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.tool (owned by enderio providing enderioapi|tools) embedded in enderioconduitsopencomputers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.tool (owned by enderio providing enderioapi|tools) embedded in enderioconduitsrefinedstorage | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.tool (owned by enderio providing enderioapi|tools) embedded in enderioconduits | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.tool (owned by enderio providing enderioapi|tools) embedded in enderiointegrationforestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.tool (owned by enderio providing enderioapi|tools) embedded in enderiointegrationtic | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.tool (owned by enderio providing enderioapi|tools) embedded in enderiointegrationticlate | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.tool (owned by enderio providing enderioapi|tools) embedded in enderiomachines | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.tool (owned by enderio providing enderioapi|tools) embedded in enderiopowertools | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.arboriculture (owned by ForestryAPI|core providing ForestryAPI|arboriculture) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.events (owned by buildcraftapi_core providing buildcraftapi_events) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.events (owned by buildcraftapi_core providing buildcraftapi_events) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.events (owned by buildcraftapi_core providing buildcraftapi_events) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.events (owned by buildcraftapi_core providing buildcraftapi_events) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.events (owned by buildcraftapi_core providing buildcraftapi_events) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.events (owned by buildcraftapi_core providing buildcraftapi_events) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.events (owned by buildcraftapi_core providing buildcraftapi_events) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.events (owned by buildcraftapi_core providing buildcraftapi_events) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.events (owned by buildcraftapi_core providing buildcraftapi_events) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.fuels (owned by buildcraftapi_core providing buildcraftapi_fuels) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.fuels (owned by buildcraftapi_core providing buildcraftapi_fuels) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.fuels (owned by buildcraftapi_core providing buildcraftapi_fuels) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.fuels (owned by buildcraftapi_core providing buildcraftapi_fuels) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.fuels (owned by buildcraftapi_core providing buildcraftapi_fuels) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.fuels (owned by buildcraftapi_core providing buildcraftapi_fuels) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.fuels (owned by buildcraftapi_core providing buildcraftapi_fuels) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.fuels (owned by buildcraftapi_core providing buildcraftapi_fuels) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.fuels (owned by buildcraftapi_core providing buildcraftapi_fuels) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API team.chisel.ctm.api (owned by ctm providing ctm-api) embedded in ctm | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API team.chisel.api.carving (owned by Chisel providing ChiselAPI|Carving) embedded in chisel | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.teleport (owned by enderio providing enderioapi|teleport) embedded in enderio | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.teleport (owned by enderio providing enderioapi|teleport) embedded in enderiobase | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.teleport (owned by enderio providing enderioapi|teleport) embedded in enderioconduitsappliedenergistics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.teleport (owned by enderio providing enderioapi|teleport) embedded in enderioconduitsopencomputers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.teleport (owned by enderio providing enderioapi|teleport) embedded in enderioconduitsrefinedstorage | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.teleport (owned by enderio providing enderioapi|teleport) embedded in enderioconduits | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.teleport (owned by enderio providing enderioapi|teleport) embedded in enderiointegrationforestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.teleport (owned by enderio providing enderioapi|teleport) embedded in enderiointegrationtic | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.teleport (owned by enderio providing enderioapi|teleport) embedded in enderiointegrationticlate | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.teleport (owned by enderio providing enderioapi|teleport) embedded in enderiomachines | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.teleport (owned by enderio providing enderioapi|teleport) embedded in enderiopowertools | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.apiculture (owned by ForestryAPI|core providing ForestryAPI|apiculture) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API com.jaquadro.minecraft.storagedrawers.api.event (owned by StorageDrawersAPI providing StorageDrawersAPI|event) embedded in storagedrawers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API forestry.api.genetics (owned by ForestryAPI|core providing ForestryAPI|genetics) embedded in forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API com.attributestudios.wolfarmor.api (owned by wolfarmor providing wolfarmor|API) embedded in wolfarmor | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API com.jaquadro.minecraft.storagedrawers.api.registry (owned by StorageDrawersAPI providing StorageDrawersAPI|registry) embedded in storagedrawers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.power (owned by buildcraftapi_core providing buildcraftapi_power) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.power (owned by buildcraftapi_core providing buildcraftapi_power) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.power (owned by buildcraftapi_core providing buildcraftapi_power) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.power (owned by buildcraftapi_core providing buildcraftapi_power) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.power (owned by buildcraftapi_core providing buildcraftapi_power) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.power (owned by buildcraftapi_core providing buildcraftapi_power) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.power (owned by buildcraftapi_core providing buildcraftapi_power) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.power (owned by buildcraftapi_core providing buildcraftapi_power) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.power (owned by buildcraftapi_core providing buildcraftapi_power) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.filler (owned by buildcraftapi_core providing buildcraftapi_filler) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.filler (owned by buildcraftapi_core providing buildcraftapi_filler) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.filler (owned by buildcraftapi_core providing buildcraftapi_filler) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.filler (owned by buildcraftapi_core providing buildcraftapi_filler) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.filler (owned by buildcraftapi_core providing buildcraftapi_filler) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.filler (owned by buildcraftapi_core providing buildcraftapi_filler) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.filler (owned by buildcraftapi_core providing buildcraftapi_filler) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.filler (owned by buildcraftapi_core providing buildcraftapi_filler) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.filler (owned by buildcraftapi_core providing buildcraftapi_filler) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.gates (owned by buildcraftapi_core providing buildcraftapi_gates) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.gates (owned by buildcraftapi_core providing buildcraftapi_gates) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.gates (owned by buildcraftapi_core providing buildcraftapi_gates) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.gates (owned by buildcraftapi_core providing buildcraftapi_gates) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.gates (owned by buildcraftapi_core providing buildcraftapi_gates) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.gates (owned by buildcraftapi_core providing buildcraftapi_gates) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.gates (owned by buildcraftapi_core providing buildcraftapi_gates) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.gates (owned by buildcraftapi_core providing buildcraftapi_gates) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.gates (owned by buildcraftapi_core providing buildcraftapi_gates) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.lists (owned by buildcraftapi_core providing buildcraftapi_lists) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.lists (owned by buildcraftapi_core providing buildcraftapi_lists) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.lists (owned by buildcraftapi_core providing buildcraftapi_lists) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.lists (owned by buildcraftapi_core providing buildcraftapi_lists) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.lists (owned by buildcraftapi_core providing buildcraftapi_lists) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.lists (owned by buildcraftapi_core providing buildcraftapi_lists) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.lists (owned by buildcraftapi_core providing buildcraftapi_lists) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.lists (owned by buildcraftapi_core providing buildcraftapi_lists) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.lists (owned by buildcraftapi_core providing buildcraftapi_lists) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.capacitor (owned by enderio providing enderioapi|capacitor) embedded in enderio | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.capacitor (owned by enderio providing enderioapi|capacitor) embedded in enderiobase | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.capacitor (owned by enderio providing enderioapi|capacitor) embedded in enderioconduitsappliedenergistics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.capacitor (owned by enderio providing enderioapi|capacitor) embedded in enderioconduitsopencomputers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.capacitor (owned by enderio providing enderioapi|capacitor) embedded in enderioconduitsrefinedstorage | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.capacitor (owned by enderio providing enderioapi|capacitor) embedded in enderioconduits | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.capacitor (owned by enderio providing enderioapi|capacitor) embedded in enderiointegrationforestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.capacitor (owned by enderio providing enderioapi|capacitor) embedded in enderiointegrationtic | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.capacitor (owned by enderio providing enderioapi|capacitor) embedded in enderiointegrationticlate | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.capacitor (owned by enderio providing enderioapi|capacitor) embedded in enderiomachines | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API crazypants.enderio.api.capacitor (owned by enderio providing enderioapi|capacitor) embedded in enderiopowertools | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API vswe.stevescarts.api (owned by stevescarts providing stevescartsAPI) embedded in stevescarts | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.enums (owned by buildcraftapi_core providing buildcraftapi_enums) embedded in buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.enums (owned by buildcraftapi_core providing buildcraftapi_enums) embedded in buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.enums (owned by buildcraftapi_core providing buildcraftapi_enums) embedded in buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.enums (owned by buildcraftapi_core providing buildcraftapi_enums) embedded in buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.enums (owned by buildcraftapi_core providing buildcraftapi_enums) embedded in buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.enums (owned by buildcraftapi_core providing buildcraftapi_enums) embedded in buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.enums (owned by buildcraftapi_core providing buildcraftapi_enums) embedded in buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.enums (owned by buildcraftapi_core providing buildcraftapi_enums) embedded in buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Found API buildcraft.api.enums (owned by buildcraftapi_core providing buildcraftapi_enums) embedded in buildcrafttransport | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent StorageDrawers from APIContainer{StorageDrawersAPI|registry:2.1.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API StorageDrawersAPI|registry: owner: StorageDrawersAPI, dependents: [storagedrawers] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_robotics:3.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_robotics: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent StorageDrawers from APIContainer{StorageDrawersAPI|storage:2.1.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API StorageDrawersAPI|storage: owner: StorageDrawersAPI, dependents: [storagedrawers] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API SecurityCraftAPI: owner: securitycraft, dependents: [] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent ForestryAPI|core from APIContainer{ForestryAPI|hives:4.1.0} | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|hives:4.1.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|hives: owner: ForestryAPI|apiculture, dependents: [forestry] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API redstonefluxapi: owner: redstoneflux, dependents: [] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_crops:1.1} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_crops: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API enderioapi|conduits: owner: enderio, dependents: [enderiobase, enderioconduitsappliedenergistics, enderioconduitsopencomputers, enderioconduitsrefinedstorage, enderioconduits, enderiointegrationforestry, enderiointegrationtic, enderiointegrationticlate, enderiomachines, enderiopowertools] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|storage:5.0.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|storage: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-utils: owner: ctm, dependents: [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API reborncoreAPI: owner: reborncore, dependents: [] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_boards:2.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_boards: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_transport:5.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_transport: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_gates:4.1} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_gates: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ArmorPlusApi: owner: armorplus, dependents: [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API actuallyadditionsapi: owner: actuallyadditions, dependents: [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|core: owner: Forestry, dependents: [forestry] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|climate: owner: Forestry, dependents: [forestry] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-models: owner: ctm, dependents: [] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|mail:3.1.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|mail: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-textures: owner: ctm, dependents: [] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_power:1.3} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_power: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ChiselAPI|Carving: owner: Chisel, dependents: [chisel] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API stevescartsAPI|FARMS: owner: stevescarts, dependents: [] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_fuels:2.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_fuels: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|genetics:5.7.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|genetics: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API reborncoreAPI|Recipe: owner: reborncore, dependents: [] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|fuels:3.0.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|fuels: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|farming:5.8.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|farming: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_library:2.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_library: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_enums:1.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_enums: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API Baubles|API: owner: Baubles, dependents: [inventorypets, baubles] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API iChunUtil API: owner: iChun, dependents: [ichunutil] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API JustEnoughItemsAPI: owner: jei, dependents: [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API enderioapi|capacitor: owner: enderio, dependents: [enderiobase, enderioconduitsappliedenergistics, enderioconduitsopencomputers, enderioconduitsrefinedstorage, enderioconduits, enderiointegrationforestry, enderiointegrationtic, enderiointegrationticlate, enderiomachines, enderiopowertools] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API projecteapi: owner: projecte, dependents: [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API Chisel-API: owner: chisel, dependents: [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API enderioapi|upgrades: owner: enderio, dependents: [enderiobase, enderioconduitsappliedenergistics, enderioconduitsopencomputers, enderioconduitsrefinedstorage, enderioconduits, enderiointegrationforestry, enderiointegrationtic, enderiointegrationticlate, enderiomachines, enderiopowertools] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|circuits:3.1.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|circuits: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API enderioapi|tools: owner: enderio, dependents: [enderiobase, enderioconduitsappliedenergistics, enderioconduitsopencomputers, enderioconduitsrefinedstorage, enderioconduits, enderiointegrationforestry, enderiointegrationtic, enderiointegrationticlate, enderiomachines, enderiopowertools] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API journeymap|client-api: owner: journeymap, dependents: [] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent StorageDrawers from APIContainer{StorageDrawersAPI|render:2.1.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API StorageDrawersAPI|render: owner: StorageDrawersAPI, dependents: [storagedrawers] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_facades:1.1} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_facades: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_items:1.1} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_items: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_filler:5.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_filler: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|lepidopterology:1.4.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|lepidopterology: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API journeymap|client-api-util: owner: journeymap, dependents: [] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_lists:1.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_lists: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API enderioapi|redstone: owner: enderio, dependents: [enderiobase, enderioconduitsappliedenergistics, enderioconduitsopencomputers, enderioconduitsrefinedstorage, enderioconduits, enderiointegrationforestry, enderiointegrationtic, enderiointegrationticlate, enderiomachines, enderiopowertools] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_events:2.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_events: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|world:2.1.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|world: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API valkyrielib.api: owner: valkyrielib, dependents: [universalmodifiers] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API enderioapi|farm: owner: enderio, dependents: [enderiobase, enderioconduitsappliedenergistics, enderioconduitsopencomputers, enderioconduitsrefinedstorage, enderioconduits, enderiointegrationforestry, enderiointegrationtic, enderiointegrationticlate, enderiomachines, enderiopowertools] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API StorageDrawersAPI: owner: StorageDrawers, dependents: [storagedrawers] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API BotaniaAPI: owner: Botania, dependents: [botania] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|book:5.8.1} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|book: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|gui:5.8.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|gui: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|food:1.1.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|food: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_core: owner: buildcraftlib, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|multiblock:3.0.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|multiblock: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_blocks:1.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_blocks: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API enderioapi|addon: owner: enderio, dependents: [enderiobase, enderioconduitsappliedenergistics, enderioconduitsopencomputers, enderioconduitsrefinedstorage, enderioconduits, enderiointegrationforestry, enderiointegrationtic, enderiointegrationticlate, enderiomachines, enderiopowertools] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|recipes:5.4.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|recipes: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_recipes:3.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_recipes: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_tiles:1.2} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_tiles: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|apiculture:5.0.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|apiculture: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API enderioapi: owner: enderio, dependents: [enderiobase, enderioconduitsappliedenergistics, enderioconduitsopencomputers, enderioconduitsrefinedstorage, enderioconduits, enderiointegrationforestry, enderiointegrationtic, enderiointegrationticlate, enderiomachines, enderiopowertools] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|greenhouse:5.2.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|greenhouse: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent StorageDrawers from APIContainer{StorageDrawersAPI|event:2.1.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API StorageDrawersAPI|event: owner: StorageDrawersAPI, dependents: [storagedrawers] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API enderioapi|teleport: owner: enderio, dependents: [enderiobase, enderioconduitsappliedenergistics, enderioconduitsopencomputers, enderioconduitsrefinedstorage, enderioconduits, enderiointegrationforestry, enderiointegrationtic, enderiointegrationticlate, enderiomachines, enderiopowertools] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API journeymap|client-api-display: owner: journeymap, dependents: [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-events: owner: ctm, dependents: [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API reborncoreAPI|Tile: owner: reborncore, dependents: [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API cofhapi: owner: cofhcore, dependents: [] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|modules:5.7.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|modules: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API stevescartsAPI: owner: stevescarts, dependents: [] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|arboriculture:4.3.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|arboriculture: owner: ForestryAPI|core, dependents: [forestry] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API journeymap|client-api-model: owner: journeymap, dependents: [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API journeymap|client-api-event: owner: journeymap, dependents: [] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent StorageDrawers from APIContainer{StorageDrawersAPI|storage-attribute:2.1.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API StorageDrawersAPI|storage-attribute: owner: StorageDrawersAPI, dependents: [storagedrawers] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API ctm-api: owner: ctm, dependents: [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API chesttransporter|api: owner: chesttransporter, dependents: [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API wolfarmor|API: owner: wolfarmor, dependents: [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API reborncoreAPI|Power: owner: reborncore, dependents: [] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API CSLib|API: owner: ptrmodellib, dependents: [] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_tools:1.0} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_tools: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API industrialforegoingapi: owner: industrialforegoing, dependents: [] | |
| [22:52:44] [Client thread/TRACE] [FML]: Removing upstream parent buildcraftlib from APIContainer{buildcraftapi_statements:1.1} | |
| [22:52:44] [Client thread/DEBUG] [FML]: Creating API container dummy for API buildcraftapi_statements: owner: buildcraftapi_core, dependents: [buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftrobotics, buildcraftsilicon, buildcrafttransport] | |
| [22:52:44] [Client thread/TRACE] [FML]: Received a system property request '' | |
| [22:52:44] [Client thread/TRACE] [FML]: System property request managing the state of 0 mods | |
| [22:52:44] [Client thread/DEBUG] [FML]: After merging, found state information for 0 mods | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Forge Mod Loader is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Minecraft Forge is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod securitycraft | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod SecurityCraft is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod actuallyadditions | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Actually Additions is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod actuallybaubles | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Actually Baubles is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod advancedcombat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Advanced Combat is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod adventurepack | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod aether | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Aether II is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod armorplus | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod baubles | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod bibliocraft | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod biomesoplenty | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod blockcraftery | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod bonsaitrees | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod bookshelf | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod botania | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod buildcraftcompat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod BuildCraft Compat is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod buildcraftbuilders | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod BuildCraft Builders is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod buildcraftcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod BuildCraft is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod buildcraftenergy | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod BuildCraft Energy is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod buildcraftfactory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod BuildCraft Factory is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod buildcraftlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod BuildCraft Lib is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod buildcraftrobotics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod BuildCraft Robotics is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod buildcraftsilicon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod BuildCraft Silicon is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod buildcrafttransport | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod BuildCraft Transport is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod chameleon | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod chancecubes | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Chance Cubes is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod chesttransporter | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Chest Transporter is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod chisel | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod cei | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Chunk Edge Indicator is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod cloudboots | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod cofhcore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod CoFH Core is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod cofhworld | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod CoFH World is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod craftpresence | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod creativecore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod CreativeCore is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod ctm | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod CTM is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod cyclicmagic | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Cyclic is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod deathcounter | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod props | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod dirt2path | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Dirt2Path is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod elevatorid | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Elevator Mod is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod eplus | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Enchanting Plus is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod endercore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod enderio | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod enderiobase | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod enderioconduitsappliedenergistics | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod enderioconduitsopencomputers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod enderioconduitsrefinedstorage | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod enderioconduits | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod enderiointegrationforestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod enderiointegrationtic | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod enderiointegrationticlate | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod enderiomachines | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod enderiopowertools | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod enderutilities | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod environmentaltech | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod extrarails | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Extra Rails is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod extrautils2 | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod fastleafdecay | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod forestry | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod forgelin | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Shadowfacts' Forgelin is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod harvestersnight | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod hopperducts | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Hopper Ducts is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod huntingdim | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Hunting Dimension is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod ichunutil | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod ic2 | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod industrialforegoing | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Industrial Foregoing is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod inventorypets | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Inventory Pets is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod inventorysorter | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod ironbackpacks | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Iron Backpacks is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod ironchest | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Iron Chest is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod ironfurnaces | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod itemfilters | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod jei | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod journeymap | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod JourneyMap is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod jaff | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Just a Few Fish is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod keepinginventory | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Keeping Inventory is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod lex | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod littletiles | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod LittleTiles is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod lootbags | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Loot Bags is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod mantle | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Mantle is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod mcjtylib_ng | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod McJtyLib is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod mysticallib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod neat | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Neat is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod netherendingores | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod nex | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod notenoughroofs | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod notenoughwands | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod oreexcavation | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod OreExcavation is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod projecte | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod pdp | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Proportional Destruction Particles is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod ptrmodellib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod randomthings | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod randomtweaks | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod reborncore | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod redstoneflux | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Redstone Flux is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod redstonepaste | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Redstone Paste is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod xreliquary | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Reliquary is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod shadowmc | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod ShadowMC is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod simplyjetpacks | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod flammpfeil.slashblade | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod SlashBlade is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod smoothfont | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod snad | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Snad is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod spartanshields | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod stevescarts | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod stg | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod SwingThroughGrass is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod storagedrawers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod switchbow | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Switch-Bow is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod tabula | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod tconstruct | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod teslacorelib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Tesla Core Lib is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod teslacorelib_registries | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Tesla Core Lib Registries is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod thedragonlib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod theeightfabledblades | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod thermalcultivation | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Thermal Cultivation is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod thermalfoundation | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Thermal Foundation is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod tinkertoolleveling | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod torchmaster | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod trapcraft | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Trapcraft is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod trashslot | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod TrashSlot is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod ts2k16 | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Twerk-Sim 2K16 is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod twilightforest | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod uppers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod uppers is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod universalmodifiers | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod valkyrielib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod vc | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod ViesCraft is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod bauble_wings | |
| [22:52:44] [Client thread/WARN] [FML]: Mod mobends_wings has been disabled through configuration | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod wings | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod wolfarmor | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod xtragear | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod mob_grinding_utils | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod mob_grinding_utils is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod yoyos | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Yoyos is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod phosphor-lighting | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod Phosphor Lighting Engine is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod orbis-lib | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod OrbisLib is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/DEBUG] [FML]: Enabling mod llibrary | |
| [22:52:44] [Client thread/DEBUG] [FML]: Mod LLibrary is missing a pack.mcmeta file, substituting a dummy one | |
| [22:52:44] [Client thread/TRACE] [FML]: Verifying mod requirements are satisfied | |
| [22:52:45] [Client thread/TRACE] [FML]: All mod requirements are satisfied | |
| [22:52:45] [Client thread/TRACE] [FML]: Sorting mods into an ordered list | |
| [22:52:45] [Client thread/TRACE] [FML]: Mod sorting completed successfully | |
| [22:52:45] [Client thread/DEBUG] [FML]: Mod sorting data | |
| [22:52:45] [Client thread/DEBUG] [FML]: smoothfont(Smooth Font:mc1.12.2-1.16.2): SmoothFont-mc1.12.2-1.16.2.jar (before:*) | |
| [22:52:45] [Client thread/DEBUG] [FML]: securitycraft(SecurityCraft:v1.8.12): [1.12.2]+SecurityCraft+v1.8.12.jar (required-after:forge@[14.23.3.2694,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: actuallyadditions(Actually Additions:1.12.2-r147): ActuallyAdditions-1.12.2-r147.jar (before:craftingtweaks;after:fastbench@[1.3.2,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: Baubles|API(API: Baubles|API:1.1.1.0): inventorypets-1.12-2.0.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: baubles(Baubles:1.5.2): Baubles-1.12-1.5.2.jar (required-after:forge@[14.21.0.2348,);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: actuallybaubles(Actually Baubles:1.1): ActuallyBaubles-1.12-1.1.jar (required-after:actuallyadditions;required-after:baubles;) | |
| [22:52:45] [Client thread/DEBUG] [FML]: advancedcombat(Advanced Combat:1.1.2): advancedcombat-1.1.2-[1.12].jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: adventurepack(Adventure Tools:1.6.0): adventurepack-1.6.2.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: orbis-lib(OrbisLib:0.2.0): orbis-lib-1.12.2-0.2.0+build42.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: aether(Aether II:0.2.0): aether_ii-1.12.2-0.2.0+build42-universal.jar (required-after:orbis-lib@[0.2.0,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: mantle(Mantle:1.12-1.3.3.49): Mantle-1.12-1.3.3.49.jar (required-after:forge@[14.21.1.2387,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: ctm(CTM:MC1.12.2-0.3.3.22): CTM-MC1.12.2-0.3.3.22.jar (before:chisel;after:forge@[14.23,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: ChiselAPI|Carving(API: ChiselAPI|Carving:0.0.1): Chisel-MC1.12.2-0.2.1.35.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: chisel(Chisel:MC1.12.2-0.2.1.35): Chisel-MC1.12.2-0.2.1.35.jar (required-after:forge@[14.23.0.2501,);required-after-client:ctm@[MC1.12-0.2.3.8,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: endercore(EnderCore:1.12.2-0.5.57): EnderCore-1.12.2-0.5.57.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: jei(Just Enough Items:4.15.0.268): jei_1.12.2-4.15.0.268.jar (required-after:forge@[14.23.1.2594,);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: pdp(Proportional Destruction Particles:1.12.2-1.2.4): ProportionalDestructionParticles-1.12.2-1.2.4.jar (before:cofhcore;after:fbp@[2.4.1,);after:chiselsandbits) | |
| [22:52:45] [Client thread/DEBUG] [FML]: redstoneflux(Redstone Flux:2.1.0): RedstoneFlux-1.12-2.1.0.6-universal.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: cofhcore(CoFH Core:4.6.2): CoFHCore-1.12.2-4.6.2.25-universal.jar (required-after:forge@[14.23.4.2705,15.0.0.0);required-after:redstoneflux@[2.1.0,2.2.0);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: cofhworld(CoFH World:1.3.0): CoFHWorld-1.12.2-1.3.0.6-universal.jar (required-after:forge@[14.23.3.2655,15.0.0.0);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: thermalfoundation(Thermal Foundation:2.6.2): ThermalFoundation-1.12.2-2.6.2.26-universal.jar (required-after:cofhcore@[4.6.0,4.7.0);required-after:cofhworld@[1.2.0,2.0.0);before:enderio;before:immersiveengineering) | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderio(Ender IO:5.0.44): EnderIO-1.12.2-5.0.44.jar (after:baubles@[1.5.2,);after:buildcraft@[7.99.14,);required-after:endercore@[1.12.2-0.5.57,);required-after:forge@[14.23.4.2705,);after:jei@[4.14.1.234,);after:thaumcraft@[6.1.BETA13,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderioapi|conduits(API: enderioapi|conduits:4.0.0): EnderIO-1.12.2-5.0.44.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderioapi|capacitor(API: enderioapi|capacitor:4.0.0): EnderIO-1.12.2-5.0.44.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderioapi|upgrades(API: enderioapi|upgrades:4.0.0): EnderIO-1.12.2-5.0.44.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderioapi|tools(API: enderioapi|tools:4.0.0): EnderIO-1.12.2-5.0.44.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderioapi|redstone(API: enderioapi|redstone:4.0.0): EnderIO-1.12.2-5.0.44.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderioapi|farm(API: enderioapi|farm:4.0.0): EnderIO-1.12.2-5.0.44.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderioapi|addon(API: enderioapi|addon:4.0.0): EnderIO-1.12.2-5.0.44.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderioapi(API: enderioapi:4.0.0): EnderIO-1.12.2-5.0.44.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderioapi|teleport(API: enderioapi|teleport:4.0.0): EnderIO-1.12.2-5.0.44.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderiointegrationtic(Ender IO Integration with Tinkers' Construct:5.0.44): EnderIO-1.12.2-5.0.44.jar (required-after:enderio@[5.0.44,);before:enderiobase;required-after:forge@[14.23.4.2705,);before:tconstruct@[1.12.2-2.10.0.81,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: twilightforest(The Twilight Forest:3.8.689): twilightforest-1.12.2-3.8.689-universal.jar (after:ctm@[MC1.12.2-0.3.2.18,);before:immersiveengineering@[0.12-83,);before:tconstruct;required-after:forge@[14.23.3.2655,);after:thaumcraft@[6.1.BETA21,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: tconstruct(Tinkers' Construct:1.12.2-2.12.0.135): TConstruct-1.12.2-2.12.0.135.jar (required-after:forge@[14.23.1.2577,);required-after:mantle@[1.12-1.3.3.49,);after:jei@[4.8,);before:taiga@(1.3.0,);after:chisel) | |
| [22:52:45] [Client thread/DEBUG] [FML]: thedragonlib(TheDragonLib:1.12.2-5.3.0): thedragonlib-1.12.2-5.3.0.jar (required-after:forge@[14.22.0.2459,);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: armorplus(ArmorPlus:1.12.2-11.22.0.58): armorplus-1.12.2-11.22.0.58.jar (required-after:forge@[14.23.5.2836,);required-after:thedragonlib@[1.12.2-5.3.0,);after:mantle;after:tconstruct;) | |
| [22:52:45] [Client thread/DEBUG] [FML]: bibliocraft(BiblioCraft:2.4.5): BiblioCraft[v2.4.5][MC1.12.2].jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: biomesoplenty(Biomes O' Plenty:7.0.1.2419): BiomesOPlenty-1.12.2-7.0.1.2419-universal.jar (required-after:forge@[14.23.5.2768,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: blockcraftery(Blockcraftery:1.12.2-1.2.0): blockcraftery-1.12.2-1.2.0.jar (required-before:mysticallib) | |
| [22:52:45] [Client thread/DEBUG] [FML]: bonsaitrees(Bonsai Trees:1.1.2): bonsaitrees-1.1.2-b144.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: bookshelf(Bookshelf:2.3.577): Bookshelf-1.12.2-2.3.577.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: BotaniaAPI(API: BotaniaAPI:93): Botania+r1.10-361.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: botania(Botania:r1.10-361): Botania+r1.10-361.jar (required-after:baubles@[1.5.2,);after:thaumcraft@[6.1.BETA21,);after:jei@[1.12.2-4.13.1.220,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftlib(BuildCraft Lib:7.99.24.1): buildcraft-all-7.99.24.1.jar (required-after:forge@[14.23.0.2544,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_core(API: buildcraftapi_core:2.2): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_robotics(API: buildcraftapi_robotics:3.0): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_crops(API: buildcraftapi_crops:1.1): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_boards(API: buildcraftapi_boards:2.0): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_transport(API: buildcraftapi_transport:5.0): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_gates(API: buildcraftapi_gates:4.1): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_power(API: buildcraftapi_power:1.3): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_fuels(API: buildcraftapi_fuels:2.0): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_library(API: buildcraftapi_library:2.0): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_enums(API: buildcraftapi_enums:1.0): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_facades(API: buildcraftapi_facades:1.1): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_items(API: buildcraftapi_items:1.1): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_filler(API: buildcraftapi_filler:5.0): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_lists(API: buildcraftapi_lists:1.0): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_events(API: buildcraftapi_events:2.0): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_blocks(API: buildcraftapi_blocks:1.0): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_recipes(API: buildcraftapi_recipes:3.0): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_tiles(API: buildcraftapi_tiles:1.2): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_tools(API: buildcraftapi_tools:1.0): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftapi_statements(API: buildcraftapi_statements:1.1): buildcraft-all-7.99.24.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftcore(BuildCraft:7.99.24.1): buildcraft-all-7.99.24.1.jar (required-after:buildcraftlib@[7.99.24.1]) | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftbuilders(BuildCraft Builders:7.99.24.1): buildcraft-all-7.99.24.1.jar (required-after:buildcraftcore@[7.99.24.1]) | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcrafttransport(BuildCraft Transport:7.99.24.1): buildcraft-all-7.99.24.1.jar (required-after:buildcraftcore@[7.99.24.1]) | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftsilicon(BuildCraft Silicon:7.99.24.1): buildcraft-all-7.99.24.1.jar (required-after:buildcraftcore@[7.99.24.1];after:buildcrafttransport) | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftenergy(BuildCraft Energy:7.99.24.1): buildcraft-all-7.99.24.1.jar (required-after:buildcraftcore@[7.99.24.1]) | |
| [22:52:45] [Client thread/DEBUG] [FML]: ic2(IndustrialCraft 2:2.8.109-ex112): industrialcraft-2-2.8.109-ex112.jar (required-after:forge@[13.20.0.2206,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|core(API: ForestryAPI|core:5.7.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|apiculture(API: ForestryAPI|apiculture:5.0.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|hives(API: ForestryAPI|hives:4.1.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|storage(API: ForestryAPI|storage:5.0.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|climate(API: ForestryAPI|climate:5.0.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|mail(API: ForestryAPI|mail:3.1.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|genetics(API: ForestryAPI|genetics:5.7.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|fuels(API: ForestryAPI|fuels:3.0.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|farming(API: ForestryAPI|farming:5.8.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|circuits(API: ForestryAPI|circuits:3.1.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|lepidopterology(API: ForestryAPI|lepidopterology:1.4.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|world(API: ForestryAPI|world:2.1.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|book(API: ForestryAPI|book:5.8.1): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|gui(API: ForestryAPI|gui:5.8.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|food(API: ForestryAPI|food:1.1.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|multiblock(API: ForestryAPI|multiblock:3.0.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|recipes(API: ForestryAPI|recipes:5.4.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|greenhouse(API: ForestryAPI|greenhouse:5.2.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|modules(API: ForestryAPI|modules:5.7.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ForestryAPI|arboriculture(API: ForestryAPI|arboriculture:4.3.0): forestry_1.12.2-5.8.1.322.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: forestry(Forestry:5.8.1.322): forestry_1.12.2-5.8.1.322.jar (required-after:forge@[14.23.4.2705,);after:jei@[4.7.8.91,);after:ic2;after:natura;after:toughasnails;after:techreborn;after:buildcraftenergy;) | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftcompat(BuildCraft Compat:7.99.24.1): buildcraft-all-7.99.24.1.jar (required-after:forge@[14.23.0.2544,);required-after:buildcraftcore@[7.99.24.1,);after:buildcrafttransport;after:buildcraftbuilders;after:buildcraftsilicon;after:theoneprobe;after:forestry;after:crafttweaker) | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftfactory(BuildCraft Factory:7.99.24.1): buildcraft-all-7.99.24.1.jar (required-after:buildcraftcore@[7.99.24.1]) | |
| [22:52:45] [Client thread/DEBUG] [FML]: buildcraftrobotics(BuildCraft Robotics:7.99.24.1): buildcraft-all-7.99.24.1.jar (required-after:buildcraftcore@[7.99.24.1]) | |
| [22:52:45] [Client thread/DEBUG] [FML]: chameleon(Chameleon:1.12-4.1.3): Chameleon-1.12-4.1.3.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: chancecubes(Chance Cubes:1.12.2-3.2.3.242): ChanceCubes-1.12.2-3.2.3.242.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: chesttransporter(Chest Transporter:2.8.8): ChestTransporter-1.12.2-2.8.8.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: cei(Chunk Edge Indicator:1.3): chunkedgeindicator-1.4.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: cloudboots(Cloud Boots:1.4.1): CloudBoots-1.12.2-1.4.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: craftpresence(CraftPresence:v1.5.3.1): CraftPresence-1.12.2-1.5.3.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: creativecore(CreativeCore:1.9.9): CreativeCore_v1.9.45_mc1.12.2.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: cyclicmagic(Cyclic:1.19.9): Cyclic-1.12.2-1.19.9.jar (required:forge@[14.23.4.2705,);before:guideapi;after:jei;after:baubles,crafttweaker;after:fastbench@[1.5.3,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: deathcounter(DeathCounter:1.0.0): DeathCounter-1.12.1-1.0.0.jar (required-after:forge@[13.19.0.2141,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: ptrmodellib(ptrmodellib:1.0.4): PTRLib-1.0.4.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: props(Decocraft:2.6.2): Decocraft-2.6.2_1.12.2.jar (required-after-client:ptrmodellib@[1.0.3,);after:ptrmodellib) | |
| [22:52:45] [Client thread/DEBUG] [FML]: dirt2path(Dirt2Path:1.7.1): dirt2path-1.8.0.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: elevatorid(Elevator Mod:1.3.10): ElevatorMod-1.12.2-1.3.10.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: eplus(Enchanting Plus:5.0.177): EnchantingPlus-1.12.2-5.0.177.jar (required-after:bookshelf@[2.3.557,);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderiobase(Ender IO Base:5.0.44): EnderIO-1.12.2-5.0.44.jar (after:enderio) | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderioconduits(Ender IO Conduits:5.0.44): EnderIO-1.12.2-5.0.44.jar (required-after:endercore@[1.12.2-0.5.57,);required-after:enderio@[5.0.44,);required-after:forge@[14.23.4.2705,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderioconduitsappliedenergistics(Ender IO Applied Energistics Conduits:5.0.44): EnderIO-1.12.2-5.0.44.jar (after:appliedenergistics@[rv5-stable-11,);required-after:endercore@[1.12.2-0.5.57,);required-after:enderio@[5.0.44,);required-after:enderioconduits@[5.0.44,);required-after:forge@[14.23.4.2705,);after:jei@[4.14.1.234,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderioconduitsopencomputers(Ender IO Open Computers Conduits:5.0.44): EnderIO-1.12.2-5.0.44.jar (required-after:endercore@[1.12.2-0.5.57,);required-after:enderio@[5.0.44,);required-after:enderioconduits@[5.0.44,);required-after:forge@[14.23.4.2705,);after:jei@[4.14.1.234,);after:opencomputers@[MC1.12.2-1.7.2.71,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderioconduitsrefinedstorage(Ender IO Refined Storage Conduits:5.0.44): EnderIO-1.12.2-5.0.44.jar (required-after:endercore@[1.12.2-0.5.57,);required-after:enderio@[5.0.44,);required-after:enderioconduits@[5.0.44,);required-after:forge@[14.23.4.2705,);after:jei@[4.14.1.234,);after:refinedstorage@[1.6.2,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderiointegrationforestry(Ender IO Integration with Forestry:5.0.44): EnderIO-1.12.2-5.0.44.jar (required-after:enderio@[5.0.44,);after:forestry@[5.8.0.242,);required-after:forge@[14.23.4.2705,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderiointegrationticlate(Ender IO Integration with Tinkers' Construct:5.0.44): EnderIO-1.12.2-5.0.44.jar (after:tconstruct;after:enderiointegrationtic;after:enderio) | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderiomachines(Ender IO Machines:5.0.44): EnderIO-1.12.2-5.0.44.jar (required-after:endercore@[1.12.2-0.5.57,);required-after:enderio@[5.0.44,);required-after:forge@[14.23.4.2705,);after:ftblib@[5.0.0,);after:jei@[4.14.1.234,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderiopowertools(Ender IO Powertools:5.0.44): EnderIO-1.12.2-5.0.44.jar (after:enderioconduits) | |
| [22:52:45] [Client thread/DEBUG] [FML]: enderutilities(Ender Utilities:0.7.12): enderutilities-1.12.2-0.7.12.jar (required-after:forge@[14.23.3.2694,);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: valkyrielib(Valkyrie Lib:1.12.2-2.0.20.1): valkyrielib-1.12.2-2.0.20.1.jar (required-after:forge@[1.12.2-14.23.5.2768,);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: environmentaltech(Environmental Tech:1.12.2-2.0.20.1): environmentaltech-1.12.2-2.0.20.1.jar (required-after:valkyrielib@[1.12.2-2.0.20.1,1.12.2-2.0.20.9999);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: shadowmc(ShadowMC:3.8.0): ShadowMC-1.12-3.8.0.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: extrarails(Extra Rails:1.3.0): ExtraRails-1.12-1.3.0.jar (required-after:shadowmc@[3.4.2,);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: extrautils2(Extra Utilities 2:1.0): extrautils2-1.12-1.9.9.jar (after:tconstruct) | |
| [22:52:45] [Client thread/DEBUG] [FML]: fastleafdecay(Fast Leaf Decay:v14): FastLeafDecay-v14.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: forgelin(Shadowfacts' Forgelin:1.8.2): Forgelin-1.8.2.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: harvestersnight(Harvester's Night:1.1.0): harvestersnight-1.12.2-1.1.0.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: hopperducts(Hopper Ducts:1.5): hopperducts-mc1.12-1.5.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: huntingdim(Hunting Dimension:1.0.38): HuntingDimension-1.12.2-1.0.38.jar (required-after:bookshelf@[2.3.561,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: iChunUtil API(API: iChunUtil API:1.2.0): iChunUtil-1.12.2-7.2.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ichunutil(iChunUtil:7.2.1): iChunUtil-1.12.2-7.2.1.jar (required-after:forge@[14.23.5.2781,99999.24.0.0)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: teslacorelib(Tesla Core Lib:1.0.15): tesla-core-lib-1.12.2-1.0.15.jar (required-after:forgelin@[1.6.0,);required-after:forge@[14.23.3.2655,);after:tesla;after:redstoneflux;after:buildcraftlib;after:mekanism) | |
| [22:52:45] [Client thread/DEBUG] [FML]: industrialforegoing(Industrial Foregoing:1.12.2-1.12.2): industrialforegoing-1.12.2-1.12.12-236.jar (required-after:forge@[14.23.5.2806,);required-after:teslacorelib@[1.0.15,);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: inventorypets(Inventory Pets:2.0.1): inventorypets-1.12-2.0.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: inventorysorter(Simple Inventory sorting:1.13.3+57): inventorysorter-1.12.2-1.13.3+57.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ironbackpacks(Iron Backpacks:1.12.2-3.0.8-12): IronBackpacks-1.12.2-3.0.8-12.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ironchest(Iron Chest:1.12.2-7.0.59.842): ironchest-1.12.2-7.0.59.842.jar (required-after:forge@[14.21.0.2359,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: ironfurnaces(Iron Furnaces:1.3.3): ironfurnaces-1.3.3.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: itemfilters(Item Filters:1.0.3.12): ItemFilters-1.0.3.12.jar (after:forestry) | |
| [22:52:45] [Client thread/DEBUG] [FML]: journeymap(JourneyMap:1.12.2-5.5.4): journeymap-1.12.2-5.5.4.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: jaff(Just a Few Fish:1.7_for_1.12): JustAFewFish-1.7_for_1.12.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: keepinginventory(Keeping Inventory:2.4): KeepingInventory-1.12.2-2.4.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: lex(LibEx:1.0.8): LibEx-1.12.2-1.0.8.jar (required-after:forge@[1.12.2-14.23.4.2708,);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: littletiles(LittleTiles:1.5.0): LittleTiles_v1.5.0-pre135_mc1.12.2.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: lootbags(Loot Bags:2.5.8.5): LootBags-1.12.2-2.5.8.5.jar (required:forge@[14.23.4.2703,);after:mystcraft) | |
| [22:52:45] [Client thread/DEBUG] [FML]: mcjtylib_ng(McJtyLib:3.5.2): mcjtylib-1.12-3.5.2.jar (after:forge@[14.23.5.2800,);after:enderio@[5.0.21,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: neat(Neat:1.4-17): Neat+1.4-17.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: netherendingores(Netherending Ores:1.12.2-1.3): Netherending-Ores-1.12.2-1.3.jar (required-after:forge@[14.23.5.2768,);after:mantle@[1.12-1.3.1,);after:tconstruct@[1.12.2-2.9.1,);after:plustic;after:appliedenergistics2;after:mekanism@[1.12.2-9.4.13.349,);after:matteroverdrive;after:bigreactors;) | |
| [22:52:45] [Client thread/DEBUG] [FML]: nex(NetherEx:2.0.8): NetherEx-1.12.2-2.0.8.jar (required-after:lex@[1.0.8,);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: notenoughroofs(Not Enough Roofs:0.8.0.0): notenoughroofs-1.12.2-0.8.0.0.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: notenoughwands(Not Enough Wands:1.8.1): notenoughwands-1.12-1.8.1.jar (required-after:mcjtylib_ng@[3.5.0,);after:forge@[13.19.0.2176,);after:redstoneflux@[2.0.0,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: oreexcavation(OreExcavation:1.4.140): OreExcavation-1.4.140.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: projecte(ProjectE:1.12.2-PE1.4.1): ProjectE-1.12.2-PE1.4.1.jar (required-after:forge@[13.20.0.2253,);after:baubles@[1.3.3,);after:jei@[4.6.0,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: randomthings(Random Things:4.2.7.1): RandomThings-MC1.12.2-4.2.7.1.jar (after:jei@[4.7.11.100,);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: randomtweaks(RandomTweaks:1.12.2-2.5.0.5): randomtweaks-1.12.2-2.5.0.5.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: reborncore(Reborn Core:3.13.12.447): RebornCore-1.12.2-3.13.12.447-universal.jar (required-after:forge@[14.21.0.2359,);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: redstonepaste(Redstone Paste:1.7.5): redstonepaste-mc1.12-1.7.5.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: xreliquary(Reliquary:1.12.2-1.3.4.786): Reliquary-1.12.2-1.3.4.786.jar (after:baubles;after:enderio;after:tconstruct) | |
| [22:52:45] [Client thread/DEBUG] [FML]: simplyjetpacks(Simply Jetpacks 2:2.2.12.65): SimplyJetpacks2-1.12.2-2.2.12.65.jar (required-after:redstoneflux@[2.0.1,);after:thermalexpansion;after:redstonearsenal;after:thermaldynamics;after:enderio;after:redstonerepository;) | |
| [22:52:45] [Client thread/DEBUG] [FML]: flammpfeil.slashblade(SlashBlade:mc1.12-r23): SlashBlade-mc1.12-r23.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: snad(Snad:1.12.1-1.7.09.16a): Snad-1.12.1-1.7.09.16a.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: spartanshields(Spartan Shields:1.5.3): SpartanShields-1.12.2-1.5.3.jar (after:redstoneflux;after:enderio;after:rftools;after:botania;after:redstonearsenal;after:abyssalcraft;after:betterwithmods;after:thaumcraft) | |
| [22:52:45] [Client thread/DEBUG] [FML]: stevescarts(Steve's Carts 2:2.4.30.134): StevesCarts-1.12.2-2.4.30.134.jar (required-after:reborncore;required-after:forge@[14.21.0.2373,);) | |
| [22:52:45] [Client thread/DEBUG] [FML]: stg(SwingThroughGrass:1.12.2-1.2.3): stg-1.12.2-1.2.3.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: StorageDrawersAPI(API: StorageDrawersAPI:2.1.0): StorageDrawers-1.12.2-5.3.8.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: StorageDrawersAPI|registry(API: StorageDrawersAPI|registry:2.1.0): StorageDrawers-1.12.2-5.3.8.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: StorageDrawersAPI|storage(API: StorageDrawersAPI|storage:2.1.0): StorageDrawers-1.12.2-5.3.8.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: StorageDrawersAPI|render(API: StorageDrawersAPI|render:2.1.0): StorageDrawers-1.12.2-5.3.8.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: StorageDrawersAPI|event(API: StorageDrawersAPI|event:2.1.0): StorageDrawers-1.12.2-5.3.8.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: StorageDrawersAPI|storage-attribute(API: StorageDrawersAPI|storage-attribute:2.1.0): StorageDrawers-1.12.2-5.3.8.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: storagedrawers(Storage Drawers:1.12-5.3.5): StorageDrawers-1.12.2-5.3.8.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: switchbow(Switch-Bow:1.5.6): switchbow-1.5.6.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: tabula(Tabula:7.0.1): Tabula-1.12.2-7.0.1.jar (required-after:ichunutil@[7.2.0,8.0.0)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: theeightfabledblades(The Eight Fabled Blades:1.0.0): TheEightFabledBlades+V2.0.01.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: thermalcultivation(Thermal Cultivation:0.3.2): ThermalCultivation-1.12.2-0.3.2.11-universal.jar (required-after:cofhcore@[4.6.0,4.7.0);required-after:thermalfoundation@[2.6.0,2.7.0);after:thermalexpansion) | |
| [22:52:45] [Client thread/DEBUG] [FML]: tinkertoolleveling(Tinkers Tool Leveling:1.12.2-1.1.0.DEV.b23e769): TinkerToolLeveling-1.12.2-1.1.0.jar (required-after:forge@[14.21.1.2410,);required-after:mantle@[1.12-1.3.1.21,);required-after:tconstruct@[1.12-2.10,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: torchmaster(TorchMaster:1.7.1.74): torchmaster_1.12.2-1.7.1.74.jar (required-after:forge@[14.21.1.2394,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: trapcraft(Trapcraft:v2.4.3a): Trapcraft-1.12-v2.4.3a-universal.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: trashslot(TrashSlot:8.4.6): TrashSlot_1.12.1-8.4.6.jar (required-after:forge@[13.19.0.2162,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: ts2k16(Twerk-Sim 2K16:1.2.10): TS2K16-1.2.10.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: uppers(uppers:0.0.6): Uppers-0.0.6.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: valkyrielib.api(API: valkyrielib.api:1.12.2-2.0.10a): valkyrielib-1.12.2-2.0.20.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: universalmodifiers(Universal Modifiers:1.12.2-1.0.16.1): valkyrielib-1.12.2-2.0.20.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: vc(ViesCraft:5.9.13): ViesCraft-1.12.2-5.9.13.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: llibrary(LLibrary:1.7.19): llibrary-1.7.19-1.12.2.jar (required-after:forge@[14.23.5.2772,)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: wings(Wings:1.1.4): wings-1.1.4-1.12.2.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: bauble_wings(Bauble Wings:1.0.0): wings-1.1.4-1.12.2.jar (required-after:wings;after:baubles@[1.5,1.6)) | |
| [22:52:45] [Client thread/DEBUG] [FML]: wolfarmor(Wolf Armor and Storage:2.2.3.6): wolfarmor-1.12.2-2.2.3.1798-universal.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: xtragear(XtraGear++:1.0.4): XtraGear+++1.0.4.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: mob_grinding_utils(mob_grinding_utils:0.3.13): ye.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: yoyos(Yoyos:1.12.2-1.2.2.20): yoyos_1.12.2-1.2.2.20.jar (after:tconstruct;after:plustic) | |
| [22:52:45] [Client thread/DEBUG] [FML]: phosphor-lighting(Phosphor Lighting Engine:1.12.2-0.1.6): phosphor-1.12.2-0.1.6+build31.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: SecurityCraftAPI(API: SecurityCraftAPI:1.2.3): [1.12.2]+SecurityCraft+v1.8.12.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: redstonefluxapi(API: redstonefluxapi:2.1.0): RedstoneFlux-1.12-2.1.0.6-universal.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ctm-api-utils(API: ctm-api-utils:0.1.0): CTM-MC1.12.2-0.3.3.22.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: reborncoreAPI(API: reborncoreAPI:3.13.12.447): RebornCore-1.12.2-3.13.12.447-universal.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ArmorPlusApi(API: ArmorPlusApi:2.1): armorplus-1.12.2-11.22.0.58.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: actuallyadditionsapi(API: actuallyadditionsapi:34): ActuallyAdditions-1.12.2-r147.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ctm-api-models(API: ctm-api-models:0.1.0): CTM-MC1.12.2-0.3.3.22.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ctm-api-textures(API: ctm-api-textures:0.1.0): CTM-MC1.12.2-0.3.3.22.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: stevescartsAPI|FARMS(API: stevescartsAPI|FARMS:${version}): StevesCarts-1.12.2-2.4.30.134.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: reborncoreAPI|Recipe(API: reborncoreAPI|Recipe:3.13.12.447): RebornCore-1.12.2-3.13.12.447-universal.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: JustEnoughItemsAPI(API: JustEnoughItemsAPI:4.13.0): jei_1.12.2-4.15.0.268.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: projecteapi(API: projecteapi:1.12.2-1.2.0): ProjectE-1.12.2-PE1.4.1.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: Chisel-API(API: Chisel-API:0.0.1): Chisel-MC1.12.2-0.2.1.35.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: journeymap|client-api(API: journeymap|client-api:1.4): journeymap-1.12.2-5.5.4.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: journeymap|client-api-util(API: journeymap|client-api-util:1.4): journeymap-1.12.2-5.5.4.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: journeymap|client-api-display(API: journeymap|client-api-display:1.4): journeymap-1.12.2-5.5.4.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ctm-api-events(API: ctm-api-events:0.1.0): CTM-MC1.12.2-0.3.3.22.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: reborncoreAPI|Tile(API: reborncoreAPI|Tile:3.13.12.447): RebornCore-1.12.2-3.13.12.447-universal.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: cofhapi(API: cofhapi:2.5.0): CoFHCore-1.12.2-4.6.2.25-universal.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: stevescartsAPI(API: stevescartsAPI:${version}): StevesCarts-1.12.2-2.4.30.134.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: journeymap|client-api-model(API: journeymap|client-api-model:1.4): journeymap-1.12.2-5.5.4.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: journeymap|client-api-event(API: journeymap|client-api-event:1.4): journeymap-1.12.2-5.5.4.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: ctm-api(API: ctm-api:0.1.0): CTM-MC1.12.2-0.3.3.22.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: chesttransporter|api(API: chesttransporter|api:2): ChestTransporter-1.12.2-2.8.8.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: wolfarmor|API(API: wolfarmor|API:2.7): wolfarmor-1.12.2-2.2.3.1798-universal.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: reborncoreAPI|Power(API: reborncoreAPI|Power:3.13.12.447): RebornCore-1.12.2-3.13.12.447-universal.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: CSLib|API(API: CSLib|API:1.0.1): PTRLib-1.0.4.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: industrialforegoingapi(API: industrialforegoingapi:5): industrialforegoing-1.12.2-1.12.12-236.jar () | |
| [22:52:45] [Client thread/DEBUG] [FML]: mysticallib(Mystical Lib:1.12.2-1.1.1): mysticallib-1.12.2-1.1.1.jar (after:*) | |
| [22:52:45] [Client thread/DEBUG] [FML]: teslacorelib_registries(Tesla Core Lib Registries:1.0.15): tesla-core-lib-1.12.2-1.0.15.jar (required-after:forgelin@[1.6.0,);required-after:forge@[14.23.3.2655,);after:*;) | |
| [22:52:45] [Client thread/INFO] [FML]: FML has found a non-mod file AutoSave-1.12.2-1.0.10.jar in your mods directory. It will now be injected into your classpath. This could severe stability issues, it should be removed if possible. | |
| [22:52:45] [Client thread/INFO] [FML]: FML has found a non-mod file AutoConfig-1.12.2-1.0.2.jar in your mods directory. It will now be injected into your classpath. This could severe stability issues, it should be removed if possible. | |
| [22:52:45] [Client thread/DEBUG] [FML]: Loading @Config anotation data | |
| [22:52:45] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod minecraft | |
| [22:52:45] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod minecraft | |
| [22:52:45] [Client thread/DEBUG] [FML]: Bar Step: Construction - Minecraft took 0.002s | |
| [22:52:45] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mcp | |
| [22:52:45] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mcp | |
| [22:52:45] [Client thread/DEBUG] [FML]: Bar Step: Construction - Minecraft Coder Pack took 0.000s | |
| [22:52:45] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod FML | |
| [22:52:46] [Client thread/TRACE] [FML]: Mod FML is using network checker : Invoking method checkModLists | |
| [22:52:46] [Client thread/TRACE] [FML]: Testing mod FML to verify it accepts its own version in a remote connection | |
| [22:52:46] [Client thread/TRACE] [FML]: The mod FML accepts its own version (8.0.99.99) | |
| [22:52:46] [Client thread/INFO] [FML]: Attempting connection with missing mods [minecraft, mcp, FML, forge, additionalresources, creativecoredummy, littletilescore, smoothfontcore, randompatches, securitycraft, actuallyadditions, actuallybaubles, advancedcombat, adventurepack, aether, armorplus, baubles, bibliocraft, biomesoplenty, blockcraftery, bonsaitrees, bookshelf, botania, buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftlib, buildcraftrobotics, buildcraftsilicon, buildcrafttransport, chameleon, chancecubes, chesttransporter, chisel, cei, cloudboots, cofhcore, cofhworld, craftpresence, creativecore, ctm, cyclicmagic, deathcounter, props, dirt2path, elevatorid, eplus, endercore, enderio, enderiobase, enderioconduitsappliedenergistics, enderioconduitsopencomputers, enderioconduitsrefinedstorage, enderioconduits, enderiointegrationforestry, enderiointegrationtic, enderiointegrationticlate, enderiomachines, enderiopowertools, enderutilities, environmentaltech, extrarails, extrautils2, fastleafdecay, forestry, forgelin, harvestersnight, hopperducts, huntingdim, ichunutil, ic2, industrialforegoing, inventorypets, inventorysorter, ironbackpacks, ironchest, ironfurnaces, itemfilters, jei, journeymap, jaff, keepinginventory, lex, littletiles, lootbags, mantle, mcjtylib_ng, mysticallib, neat, netherendingores, nex, notenoughroofs, notenoughwands, oreexcavation, projecte, pdp, ptrmodellib, randomthings, randomtweaks, reborncore, redstoneflux, redstonepaste, xreliquary, shadowmc, simplyjetpacks, flammpfeil.slashblade, smoothfont, snad, spartanshields, stevescarts, stg, storagedrawers, switchbow, tabula, tconstruct, teslacorelib, teslacorelib_registries, thedragonlib, theeightfabledblades, thermalcultivation, thermalfoundation, tinkertoolleveling, torchmaster, trapcraft, trashslot, ts2k16, twilightforest, uppers, universalmodifiers, valkyrielib, vc, bauble_wings, wings, wolfarmor, xtragear, mob_grinding_utils, yoyos, phosphor-lighting, orbis-lib, llibrary] at CLIENT | |
| [22:52:46] [Client thread/INFO] [FML]: Attempting connection with missing mods [minecraft, mcp, FML, forge, additionalresources, creativecoredummy, littletilescore, smoothfontcore, randompatches, securitycraft, actuallyadditions, actuallybaubles, advancedcombat, adventurepack, aether, armorplus, baubles, bibliocraft, biomesoplenty, blockcraftery, bonsaitrees, bookshelf, botania, buildcraftcompat, buildcraftbuilders, buildcraftcore, buildcraftenergy, buildcraftfactory, buildcraftlib, buildcraftrobotics, buildcraftsilicon, buildcrafttransport, chameleon, chancecubes, chesttransporter, chisel, cei, cloudboots, cofhcore, cofhworld, craftpresence, creativecore, ctm, cyclicmagic, deathcounter, props, dirt2path, elevatorid, eplus, endercore, enderio, enderiobase, enderioconduitsappliedenergistics, enderioconduitsopencomputers, enderioconduitsrefinedstorage, enderioconduits, enderiointegrationforestry, enderiointegrationtic, enderiointegrationticlate, enderiomachines, enderiopowertools, enderutilities, environmentaltech, extrarails, extrautils2, fastleafdecay, forestry, forgelin, harvestersnight, hopperducts, huntingdim, ichunutil, ic2, industrialforegoing, inventorypets, inventorysorter, ironbackpacks, ironchest, ironfurnaces, itemfilters, jei, journeymap, jaff, keepinginventory, lex, littletiles, lootbags, mantle, mcjtylib_ng, mysticallib, neat, netherendingores, nex, notenoughroofs, notenoughwands, oreexcavation, projecte, pdp, ptrmodellib, randomthings, randomtweaks, reborncore, redstoneflux, redstonepaste, xreliquary, shadowmc, simplyjetpacks, flammpfeil.slashblade, smoothfont, snad, spartanshields, stevescarts, stg, storagedrawers, switchbow, tabula, tconstruct, teslacorelib, teslacorelib_registries, thedragonlib, theeightfabledblades, thermalcultivation, thermalfoundation, tinkertoolleveling, torchmaster, trapcraft, trashslot, ts2k16, twilightforest, uppers, universalmodifiers, valkyrielib, vc, bauble_wings, wings, wolfarmor, xtragear, mob_grinding_utils, yoyos, phosphor-lighting, orbis-lib, llibrary] at SERVER | |
| [22:52:46] [Client thread/INFO] [STDOUT]: [com.creativemd.creativecore.transformer.CreativeTransformer:transform:49]: [littletiles] Patched net.minecraft.network.PacketBuffer ... | |
| [22:52:46] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod FML | |
| [22:52:46] [Client thread/DEBUG] [FML]: Bar Step: Construction - Forge Mod Loader took 1.637s | |
| [22:52:46] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod forge | |
| [22:52:46] [Client thread/DEBUG] [forge]: Loading Vanilla annotations: sun.net.www.protocol.jar.JarURLConnection$JarURLInputStream@711680a8 | |
| [22:52:46] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/Minecraft$10 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/Minecraft$11 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/Minecraft$12 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/Minecraft$13 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/Minecraft$14 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/Minecraft$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/Minecraft$3 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/Minecraft$4 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/Minecraft$5 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/Minecraft$6 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/Minecraft$7 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/Minecraft$8 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/Minecraft$9 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/multiplayer/WorldClient$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/multiplayer/WorldClient$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/multiplayer/WorldClient$3 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/multiplayer/WorldClient$4 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/particle/ParticleManager$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/particle/ParticleManager$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/particle/ParticleManager$3 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/particle/ParticleManager$4 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/renderer/EntityRenderer$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/renderer/EntityRenderer$3 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/renderer/EntityRenderer$4 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/renderer/RenderGlobal$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/renderer/RenderItem$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/renderer/RenderItem$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/renderer/RenderItem$3 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/renderer/RenderItem$4 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/renderer/texture/TextureAtlasSprite$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/renderer/texture/TextureManager$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/renderer/texture/TextureMap$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/renderer/texture/TextureMap$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/client/renderer/texture/TextureMap$3 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/crash/CrashReport$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/crash/CrashReport$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/crash/CrashReport$3 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/crash/CrashReport$4 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/crash/CrashReport$5 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/crash/CrashReport$6 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/crash/CrashReport$7 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/crash/CrashReportCategory$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/crash/CrashReportCategory$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/crash/CrashReportCategory$3 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/crash/CrashReportCategory$4 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/crash/CrashReportCategory$5 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/entity/Entity$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/entity/Entity$3 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/entity/Entity$4 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/entity/Entity$5 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/entity/EntityTracker$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/entity/player/InventoryPlayer$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/nbt/NBTTagCompound$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/nbt/NBTTagCompound$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/network/NetHandlerPlayServer$3 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/network/NetworkSystem$6 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/server/MinecraftServer$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/server/MinecraftServer$3 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/server/dedicated/DedicatedServer$3 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/server/dedicated/DedicatedServer$4 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/server/integrated/IntegratedServer$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/server/integrated/IntegratedServer$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/tileentity/CommandBlockBaseLogic$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/tileentity/CommandBlockBaseLogic$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/tileentity/TileEntity$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/tileentity/TileEntity$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/tileentity/TileEntity$3 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/world/World$1 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/world/World$2 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/world/World$3 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/world/World$4 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/world/World$5 | |
| [22:52:46] [Client thread/DEBUG] [forge]: net/minecraft/world/chunk/Chunk$1 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraft/world/gen/structure/MapGenStructure$1 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraft/world/gen/structure/MapGenStructure$2 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraft/world/gen/structure/MapGenStructure$3 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraft/world/storage/WorldInfo$10 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraft/world/storage/WorldInfo$2 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraft/world/storage/WorldInfo$3 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraft/world/storage/WorldInfo$4 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraft/world/storage/WorldInfo$5 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraft/world/storage/WorldInfo$6 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraft/world/storage/WorldInfo$7 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraft/world/storage/WorldInfo$8 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraft/world/storage/WorldInfo$9 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Alignment | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Column | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Row | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraftforge/fml/client/SplashProgress$1 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraftforge/fml/client/SplashProgress$1 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraftforge/fml/common/FMLCommonHandler$1 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraftforge/fml/common/FMLCommonHandler$1 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraftforge/fml/common/ICrashCallable | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraftforge/fml/common/Loader$1 | |
| [22:52:47] [Client thread/DEBUG] [forge]: net/minecraftforge/fml/common/Loader$1 | |
| [22:52:47] [Client thread/TRACE] [FML]: Mod forge is using network checker : No network checking performed | |
| [22:52:47] [Client thread/TRACE] [FML]: Testing mod forge to verify it accepts its own version in a remote connection | |
| [22:52:47] [Client thread/TRACE] [FML]: The mod forge accepts its own version (14.23.5.2837) | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into forge for type INSTANCE | |
| [22:52:47] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod forge | |
| [22:52:47] [Client thread/DEBUG] [FML]: Bar Step: Construction - Minecraft Forge took 0.264s | |
| [22:52:47] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod additionalresources | |
| [22:52:47] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod additionalresources | |
| [22:52:47] [Client thread/DEBUG] [FML]: Bar Step: Construction - Additional Resources took 0.001s | |
| [22:52:47] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod creativecoredummy | |
| [22:52:47] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod creativecoredummy | |
| [22:52:47] [Client thread/DEBUG] [FML]: Bar Step: Construction - CreativeCoreDummy took 0.001s | |
| [22:52:47] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod littletilescore | |
| [22:52:47] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod littletilescore | |
| [22:52:47] [Client thread/DEBUG] [FML]: Bar Step: Construction - LittleTilesCore took 0.001s | |
| [22:52:47] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod smoothfontcore | |
| [22:52:47] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod smoothfontcore | |
| [22:52:47] [Client thread/DEBUG] [FML]: Bar Step: Construction - Smooth Font Core took 0.000s | |
| [22:52:47] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod randompatches | |
| [22:52:47] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod randompatches | |
| [22:52:47] [Client thread/DEBUG] [FML]: Bar Step: Construction - RandomPatches took 0.000s | |
| [22:52:47] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod smoothfont | |
| [22:52:47] [Client thread/TRACE] [FML]: Mod smoothfont is using network checker : Accepting version mc1.12.2-1.16.2 | |
| [22:52:47] [Client thread/TRACE] [FML]: Testing mod smoothfont to verify it accepts its own version in a remote connection | |
| [22:52:47] [Client thread/TRACE] [FML]: The mod smoothfont accepts its own version (mc1.12.2-1.16.2) | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into smoothfont | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for smoothfont | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into smoothfont for type INSTANCE | |
| [22:52:47] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod smoothfont | |
| [22:52:47] [Client thread/DEBUG] [FML]: Bar Step: Construction - Smooth Font took 0.064s | |
| [22:52:47] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod securitycraft | |
| [22:52:47] [Client thread/TRACE] [FML]: Mod securitycraft is using network checker : Accepting version v1.8.12 | |
| [22:52:47] [Client thread/TRACE] [FML]: Testing mod securitycraft to verify it accepts its own version in a remote connection | |
| [22:52:47] [Client thread/TRACE] [FML]: The mod securitycraft accepts its own version (v1.8.12) | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into securitycraft | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for securitycraft | |
| [22:52:47] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for net.geforcemods.securitycraft.RegistrationHandler for mod securitycraft | |
| [22:52:47] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class net.geforcemods.securitycraft.RegistrationHandler | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into securitycraft for type INSTANCE | |
| [22:52:47] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod securitycraft | |
| [22:52:47] [Client thread/DEBUG] [FML]: Bar Step: Construction - SecurityCraft took 0.256s | |
| [22:52:47] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod actuallyadditions | |
| [22:52:47] [Client thread/TRACE] [FML]: Mod actuallyadditions is using network checker : Accepting version 1.12.2-r147 | |
| [22:52:47] [Client thread/TRACE] [FML]: Testing mod actuallyadditions to verify it accepts its own version in a remote connection | |
| [22:52:47] [Client thread/TRACE] [FML]: The mod actuallyadditions accepts its own version (1.12.2-r147) | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into actuallyadditions | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for actuallyadditions | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into actuallyadditions for type INSTANCE | |
| [22:52:47] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod actuallyadditions | |
| [22:52:47] [Client thread/DEBUG] [FML]: Bar Step: Construction - Actually Additions took 0.053s | |
| [22:52:47] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod baubles | |
| [22:52:47] [Client thread/TRACE] [FML]: Mod baubles is using network checker : Accepting version 1.5.2 | |
| [22:52:47] [Client thread/TRACE] [FML]: Testing mod baubles to verify it accepts its own version in a remote connection | |
| [22:52:47] [Client thread/TRACE] [FML]: The mod baubles accepts its own version (1.5.2) | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into baubles | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for baubles | |
| [22:52:47] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for baubles.common.items.ItemRing for mod baubles | |
| [22:52:47] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class baubles.common.items.ItemRing | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into baubles for type INSTANCE | |
| [22:52:47] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod baubles | |
| [22:52:47] [Client thread/DEBUG] [FML]: Bar Step: Construction - Baubles took 0.029s | |
| [22:52:47] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod actuallybaubles | |
| [22:52:47] [Client thread/WARN] [FML]: Potentially Dangerous alternative prefix `actuallyadditions` for name `magnet_ring_bauble`, expected `actuallybaubles`. This could be a intended override, but in most cases indicates a broken mod. | |
| [22:52:47] [Client thread/WARN] [FML]: Potentially Dangerous alternative prefix `actuallyadditions` for name `potion_ring_advanced_bauble`, expected `actuallybaubles`. This could be a intended override, but in most cases indicates a broken mod. | |
| [22:52:47] [Client thread/WARN] [FML]: Potentially Dangerous alternative prefix `actuallyadditions` for name `battery_bauble`, expected `actuallybaubles`. This could be a intended override, but in most cases indicates a broken mod. | |
| [22:52:47] [Client thread/WARN] [FML]: Potentially Dangerous alternative prefix `actuallyadditions` for name `battery_double_bauble`, expected `actuallybaubles`. This could be a intended override, but in most cases indicates a broken mod. | |
| [22:52:47] [Client thread/WARN] [FML]: Potentially Dangerous alternative prefix `actuallyadditions` for name `battery_triple_bauble`, expected `actuallybaubles`. This could be a intended override, but in most cases indicates a broken mod. | |
| [22:52:47] [Client thread/WARN] [FML]: Potentially Dangerous alternative prefix `actuallyadditions` for name `battery_quadruple_bauble`, expected `actuallybaubles`. This could be a intended override, but in most cases indicates a broken mod. | |
| [22:52:47] [Client thread/WARN] [FML]: Potentially Dangerous alternative prefix `actuallyadditions` for name `battery_quintuple_bauble`, expected `actuallybaubles`. This could be a intended override, but in most cases indicates a broken mod. | |
| [22:52:47] [Client thread/TRACE] [FML]: Mod actuallybaubles is using network checker : Accepting version 1.1 | |
| [22:52:47] [Client thread/TRACE] [FML]: Testing mod actuallybaubles to verify it accepts its own version in a remote connection | |
| [22:52:47] [Client thread/TRACE] [FML]: The mod actuallybaubles accepts its own version (1.1) | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into actuallybaubles | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for actuallybaubles | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into actuallybaubles for type INSTANCE | |
| [22:52:47] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod actuallybaubles | |
| [22:52:47] [Client thread/DEBUG] [FML]: Bar Step: Construction - Actually Baubles took 0.130s | |
| [22:52:47] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod advancedcombat | |
| [22:52:47] [Client thread/TRACE] [FML]: Mod advancedcombat is using network checker : Accepting version 1.1.2 | |
| [22:52:47] [Client thread/TRACE] [FML]: Testing mod advancedcombat to verify it accepts its own version in a remote connection | |
| [22:52:47] [Client thread/TRACE] [FML]: The mod advancedcombat accepts its own version (1.1.2) | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into advancedcombat | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for advancedcombat | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into advancedcombat for type INSTANCE | |
| [22:52:47] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod advancedcombat | |
| [22:52:47] [Client thread/DEBUG] [FML]: Bar Step: Construction - Advanced Combat took 0.010s | |
| [22:52:47] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod adventurepack | |
| [22:52:47] [Client thread/TRACE] [FML]: Mod adventurepack is using network checker : Accepting version 1.6.0 | |
| [22:52:47] [Client thread/TRACE] [FML]: Testing mod adventurepack to verify it accepts its own version in a remote connection | |
| [22:52:47] [Client thread/TRACE] [FML]: The mod adventurepack accepts its own version (1.6.0) | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into adventurepack | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for adventurepack | |
| [22:52:47] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for brobotato.adventurepack.config.ModConfig$EventHandler for mod adventurepack | |
| [22:52:47] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class brobotato.adventurepack.config.ModConfig$EventHandler | |
| [22:52:47] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for brobotato.adventurepack.AdventurePack$RegistrationHandler for mod adventurepack | |
| [22:52:47] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class brobotato.adventurepack.AdventurePack$RegistrationHandler | |
| [22:52:47] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for brobotato.adventurepack.client.ModColorHandler for mod adventurepack | |
| [22:52:47] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class brobotato.adventurepack.client.ModColorHandler | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into adventurepack for type INSTANCE | |
| [22:52:47] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod adventurepack | |
| [22:52:47] [Client thread/DEBUG] [FML]: Bar Step: Construction - Adventure Tools took 0.039s | |
| [22:52:47] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod orbis-lib | |
| [22:52:47] [Client thread/TRACE] [FML]: Mod orbis-lib is using network checker : Accepting version 0.2.0 | |
| [22:52:47] [Client thread/TRACE] [FML]: Testing mod orbis-lib to verify it accepts its own version in a remote connection | |
| [22:52:47] [Client thread/TRACE] [FML]: The mod orbis-lib accepts its own version (0.2.0) | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into orbis-lib | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for orbis-lib | |
| [22:52:47] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.orbis.lib.CapabilityManagerOrbisLib for mod orbis-lib | |
| [22:52:47] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.orbis.lib.CapabilityManagerOrbisLib | |
| [22:52:47] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.orbis.lib.OrbisLib for mod orbis-lib | |
| [22:52:47] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.orbis.lib.OrbisLib | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into orbis-lib for type INSTANCE | |
| [22:52:47] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod orbis-lib | |
| [22:52:47] [Client thread/DEBUG] [FML]: Bar Step: Construction - OrbisLib took 0.046s | |
| [22:52:47] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod aether | |
| [22:52:47] [Client thread/TRACE] [FML]: Mod aether is using network checker : Accepting version 0.2.0 | |
| [22:52:47] [Client thread/TRACE] [FML]: Testing mod aether to verify it accepts its own version in a remote connection | |
| [22:52:47] [Client thread/TRACE] [FML]: The mod aether accepts its own version (0.2.0) | |
| [22:52:47] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into aether | |
| [22:52:48] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for aether | |
| [22:52:48] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.client.gui.tab.TabClientEvents for mod aether | |
| [22:52:48] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.client.gui.tab.TabClientEvents | |
| [22:52:48] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.CommonEvents for mod aether | |
| [22:52:48] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.CommonEvents | |
| [22:52:48] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.registry.content.RecipesAether for mod aether | |
| [22:52:48] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.registry.content.RecipesAether | |
| [22:52:48] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.world.aether.island.IslandTicker for mod aether | |
| [22:52:48] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.world.aether.island.IslandTicker | |
| [22:52:48] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.entities.util.MountEventHandler for mod aether | |
| [22:52:48] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.entities.util.MountEventHandler | |
| [22:52:48] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.items.ItemsAether for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.items.ItemsAether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.client.DamageSystemClient for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.client.DamageSystemClient | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.ConfigAether for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.ConfigAether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.items.weapons.swords.ItemSkyrootSword for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.items.weapons.swords.ItemSkyrootSword | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.client.SpecialMovesEventsClient for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.client.SpecialMovesEventsClient | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.items.tools.ItemToolHandler for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.items.tools.ItemToolHandler | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.client.ClientEventHandler for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.client.ClientEventHandler | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.client.renderer.ClientRenderHandler for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.client.renderer.ClientRenderHandler | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.registry.WorldEvents for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.registry.WorldEvents | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.world.spawning.SpawnAreaEvents for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.world.spawning.SpawnAreaEvents | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.capabilities.CapabilityManagerAether for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.capabilities.CapabilityManagerAether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.client.models.items.ItemModelsAether for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.client.models.items.ItemModelsAether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.client.SessionEventHandler for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.client.SessionEventHandler | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.registry.content.SoundsAether for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.registry.content.SoundsAether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.capabilities.DamageSystem for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.capabilities.DamageSystem | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.registry.content.BiomesAether for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.registry.content.BiomesAether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.client.models.blocks.AetherBlockModels for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.client.models.blocks.AetherBlockModels | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.entities.util.QuicksoilProcessor for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.entities.util.QuicksoilProcessor | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.client.sound.AetherMusicManager for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.client.sound.AetherMusicManager | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.client.ClientWeatherEventHandler for mod aether | |
| [22:52:49] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.client.ClientWeatherEventHandler | |
| [22:52:49] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.capabilities.entity.player.PlayerAetherHooks for mod aether | |
| [22:52:50] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.capabilities.entity.player.PlayerAetherHooks | |
| [22:52:50] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.blocks.BlocksAether for mod aether | |
| [22:52:50] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.blocks.BlocksAether | |
| [22:52:50] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.client.RespawnGuiOverrides for mod aether | |
| [22:52:50] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.client.RespawnGuiOverrides | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into aether for type INSTANCE | |
| [22:52:50] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod aether | |
| [22:52:50] [Client thread/DEBUG] [FML]: Bar Step: Construction - Aether II took 2.555s | |
| [22:52:50] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mantle | |
| [22:52:50] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:52:50] [Client thread/DEBUG] [forge]: slimeknights/mantle/pulsar/internal/CrashHandler | |
| [22:52:50] [Client thread/TRACE] [FML]: Mod mantle is using network checker : Accepting version 1.12-1.3.3.49 | |
| [22:52:50] [Client thread/TRACE] [FML]: Testing mod mantle to verify it accepts its own version in a remote connection | |
| [22:52:50] [Client thread/TRACE] [FML]: The mod mantle accepts its own version (1.12-1.3.3.49) | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into mantle | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for mantle | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into mantle for type INSTANCE | |
| [22:52:50] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mantle | |
| [22:52:50] [Client thread/DEBUG] [FML]: Bar Step: Construction - Mantle took 0.015s | |
| [22:52:50] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ctm | |
| [22:52:50] [Client thread/TRACE] [FML]: Mod ctm is using network checker : Accepting version MC1.12.2-0.3.3.22 | |
| [22:52:50] [Client thread/TRACE] [FML]: Testing mod ctm to verify it accepts its own version in a remote connection | |
| [22:52:50] [Client thread/TRACE] [FML]: The mod ctm accepts its own version (MC1.12.2-0.3.3.22) | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ctm | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ctm | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into ctm for type INSTANCE | |
| [22:52:50] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ctm | |
| [22:52:50] [Client thread/DEBUG] [FML]: Bar Step: Construction - CTM took 0.018s | |
| [22:52:50] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod chisel | |
| [22:52:50] [Client thread/TRACE] [FML]: Mod chisel is using network checker : Accepting version MC1.12.2-0.2.1.35 | |
| [22:52:50] [Client thread/TRACE] [FML]: Testing mod chisel to verify it accepts its own version in a remote connection | |
| [22:52:50] [Client thread/TRACE] [FML]: The mod chisel accepts its own version (MC1.12.2-0.2.1.35) | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into chisel | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for chisel | |
| [22:52:50] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for team.chisel.client.handler.BlockSpeedHandler for mod chisel | |
| [22:52:50] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class team.chisel.client.handler.BlockSpeedHandler | |
| [22:52:50] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for team.chisel.Features for mod chisel | |
| [22:52:50] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class team.chisel.Features | |
| [22:52:50] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for team.chisel.client.ClientProxy for mod chisel | |
| [22:52:50] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class team.chisel.client.ClientProxy | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into chisel for type INSTANCE | |
| [22:52:50] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod chisel | |
| [22:52:50] [Client thread/DEBUG] [FML]: Bar Step: Construction - Chisel took 0.342s | |
| [22:52:50] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod endercore | |
| [22:52:50] [Client thread/TRACE] [FML]: Mod endercore is using network checker : Accepting version 1.12.2-0.5.57 | |
| [22:52:50] [Client thread/TRACE] [FML]: Testing mod endercore to verify it accepts its own version in a remote connection | |
| [22:52:50] [Client thread/TRACE] [FML]: The mod endercore accepts its own version (1.12.2-0.5.57) | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into endercore | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for endercore | |
| [22:52:50] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.enderio.core.common.enchant.EnchantAutoSmelt for mod endercore | |
| [22:52:50] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.enderio.core.common.enchant.EnchantAutoSmelt | |
| [22:52:50] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.enderio.core.common.enchant.EnchantXPBoost for mod endercore | |
| [22:52:50] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.enderio.core.common.enchant.EnchantXPBoost | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into endercore for type INSTANCE | |
| [22:52:50] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod endercore | |
| [22:52:50] [Client thread/DEBUG] [FML]: Bar Step: Construction - EnderCore took 0.080s | |
| [22:52:50] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod jei | |
| [22:52:50] [Client thread/TRACE] [FML]: Mod jei is using network checker : Invoking method checkModLists | |
| [22:52:50] [Client thread/TRACE] [FML]: Testing mod jei to verify it accepts its own version in a remote connection | |
| [22:52:50] [Client thread/TRACE] [FML]: The mod jei accepts its own version (4.15.0.268) | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into jei | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for jei | |
| [22:52:50] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for mezz.jei.input.MouseHelper for mod jei | |
| [22:52:50] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class mezz.jei.input.MouseHelper | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into jei for type INSTANCE | |
| [22:52:50] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod jei | |
| [22:52:50] [Client thread/DEBUG] [FML]: Bar Step: Construction - Just Enough Items took 0.080s | |
| [22:52:50] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod pdp | |
| [22:52:50] [Client thread/TRACE] [FML]: Mod pdp is using network checker : Accepting version 1.12.2-1.2.4 | |
| [22:52:50] [Client thread/TRACE] [FML]: Testing mod pdp to verify it accepts its own version in a remote connection | |
| [22:52:50] [Client thread/TRACE] [FML]: The mod pdp accepts its own version (1.12.2-1.2.4) | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into pdp | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for pdp | |
| [22:52:50] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for phylogeny.proportionaldestructionparticles.ConfigMod for mod pdp | |
| [22:52:50] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class phylogeny.proportionaldestructionparticles.ConfigMod | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into pdp for type INSTANCE | |
| [22:52:50] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod pdp | |
| [22:52:50] [Client thread/DEBUG] [FML]: Bar Step: Construction - Proportional Destruction Particles took 0.031s | |
| [22:52:50] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod redstoneflux | |
| [22:52:50] [Client thread/TRACE] [FML]: Mod redstoneflux is using network checker : Accepting version 2.1.0 | |
| [22:52:50] [Client thread/TRACE] [FML]: Testing mod redstoneflux to verify it accepts its own version in a remote connection | |
| [22:52:50] [Client thread/TRACE] [FML]: The mod redstoneflux accepts its own version (2.1.0) | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into redstoneflux | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for redstoneflux | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into redstoneflux for type INSTANCE | |
| [22:52:50] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod redstoneflux | |
| [22:52:50] [Client thread/DEBUG] [FML]: Bar Step: Construction - Redstone Flux took 0.009s | |
| [22:52:50] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod cofhcore | |
| [22:52:50] [Client thread/TRACE] [FML]: Mod cofhcore is using network checker : Accepting version 4.6.2 | |
| [22:52:50] [Client thread/TRACE] [FML]: Testing mod cofhcore to verify it accepts its own version in a remote connection | |
| [22:52:50] [Client thread/TRACE] [FML]: The mod cofhcore accepts its own version (4.6.2) | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into cofhcore | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for cofhcore | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into cofhcore for type INSTANCE | |
| [22:52:50] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod cofhcore | |
| [22:52:50] [Client thread/DEBUG] [FML]: Bar Step: Construction - CoFH Core took 0.040s | |
| [22:52:50] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod cofhworld | |
| [22:52:50] [Client thread/TRACE] [FML]: Mod cofhworld is using network checker : No network checking performed | |
| [22:52:50] [Client thread/TRACE] [FML]: Testing mod cofhworld to verify it accepts its own version in a remote connection | |
| [22:52:50] [Client thread/TRACE] [FML]: The mod cofhworld accepts its own version (1.3.0) | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into cofhworld | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for cofhworld | |
| [22:52:50] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into cofhworld for type INSTANCE | |
| [22:52:50] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod cofhworld | |
| [22:52:50] [Client thread/DEBUG] [FML]: Bar Step: Construction - CoFH World took 0.097s | |
| [22:52:50] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod thermalfoundation | |
| [22:52:51] [Client thread/TRACE] [FML]: Mod thermalfoundation is using network checker : Accepting version 2.6.2 | |
| [22:52:51] [Client thread/TRACE] [FML]: Testing mod thermalfoundation to verify it accepts its own version in a remote connection | |
| [22:52:51] [Client thread/TRACE] [FML]: The mod thermalfoundation accepts its own version (2.6.2) | |
| [22:52:51] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into thermalfoundation | |
| [22:52:51] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for thermalfoundation | |
| [22:52:51] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into thermalfoundation for type INSTANCE | |
| [22:52:51] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod thermalfoundation | |
| [22:52:51] [Client thread/DEBUG] [FML]: Bar Step: Construction - Thermal Foundation took 0.071s | |
| [22:52:51] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod enderio | |
| [22:52:51] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:52:51] [Client thread/DEBUG] [forge]: crazypants/enderio/base/EnderIO$1 | |
| [22:52:51] [Client thread/DEBUG] [forge]: crazypants/enderio/base/diagnostics/EnderIOCrashCallable | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found annotation mixin: crazypants.enderio.base.power.forge.item.InternalPoweredItemMixin | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Registered mixin. | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found annotation mixin: crazypants.enderio.base.item.darksteel.upgrade.DarkSteelUpgradeMixin | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Registered mixin. | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found annotation mixin: crazypants.enderio.base.paint.MobilityFlagForPaintedBlocksMixin | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Registered mixin. | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found annotation mixin: crazypants.enderio.base.integration.thaumcraft.ThaumcraftArmorMixin | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Skipping mixin due to missing dependencies: [thaumcraft] | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found annotation mixin: crazypants.enderio.base.paint.MobilityFlagForPaintedBlocksMixin | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Registered mixin. | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found annotation mixin: crazypants.enderio.base.paint.MobilityFlagForPaintedBlocksMixin | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Registered mixin. | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found annotation mixin: crazypants.enderio.base.paint.MobilityFlagForPaintedBlocksMixin | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Registered mixin. | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found mixin source class data for crazypants.enderio.base.power.forge.item.InternalPoweredItemMixin. | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found interface target crazypants.enderio.base.power.forge.item.IInternalPoweredItem | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found mixin source class data for crazypants.enderio.base.item.darksteel.upgrade.DarkSteelUpgradeMixin. | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found interface target crazypants.enderio.api.upgrades.IDarkSteelItem | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found mixin source class data for crazypants.enderio.base.paint.MobilityFlagForPaintedBlocksMixin. | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found mixin source class data for crazypants.enderio.base.paint.MobilityFlagForPaintedBlocksMixin. | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found mixin source class data for crazypants.enderio.base.paint.MobilityFlagForPaintedBlocksMixin. | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found mixin source class data for crazypants.enderio.base.paint.MobilityFlagForPaintedBlocksMixin. | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found interface target crazypants.enderio.base.paint.IPaintable$ITexturePaintableBlock | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found interface target crazypants.enderio.base.paint.IPaintable$INonSolidBlockPaintableBlock | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found interface target crazypants.enderio.base.paint.IPaintable$IBlockPaintableBlock | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found interface target crazypants.enderio.base.paint.IPaintable$ISolidBlockPaintableBlock | |
| [22:52:51] [Client thread/TRACE] [FML]: Mod enderio is using network checker : Invoking method checkModLists | |
| [22:52:51] [Client thread/TRACE] [FML]: Testing mod enderio to verify it accepts its own version in a remote connection | |
| [22:52:51] [Client thread/TRACE] [FML]: The mod enderio accepts its own version (5.0.44) | |
| [22:52:51] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.conduits.EnderIOConduits.proxy since it is not for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.railcraft.RailcraftUtil for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.railcraft.RailcraftUtil | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.render.util.DynaTextureProvider$Unloader for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.render.util.DynaTextureProvider$Unloader | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.paint.PaintTooltipUtil for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.paint.PaintTooltipUtil | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.magnet.MagnetController for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.magnet.MagnetController | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.conduit.geom.ConduitGeometryUtil for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.conduit.geom.ConduitGeometryUtil | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.flippers.SwimUpgrade for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.flippers.SwimUpgrade | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.ae2.AE2Util for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.ae2.AE2Util | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.gardencore.GardencoreUtil for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.gardencore.GardencoreUtil | |
| [22:52:51] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineObject since it is not for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.transceiver.ServerChannelRegister for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.transceiver.ServerChannelRegister | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.jump.JumpUpgrade for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.jump.JumpUpgrade | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.travel.TravelUpgrade for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.travel.TravelUpgrade | |
| [22:52:51] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitTileEntity since it is not for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.render.pipeline.EnderItemOverrideList for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.render.pipeline.EnderItemOverrideList | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.hoe.HoeUpgrade for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.hoe.HoeUpgrade | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.metallurgy.MetallurgyUtil for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.metallurgy.MetallurgyUtil | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingHandler for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingHandler | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.power.wireless.WirelessChargerController for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.power.wireless.WirelessChargerController | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.ItemInventoryCharger for mod enderio | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found 1 patch to apply to class crazypants.enderio.base.item.darksteel.ItemInventoryCharger from implemented interfaces: [crazypants/enderio/api/upgrades/IDarkSteelItem] | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Patching 1 mixins onto class crazypants.enderio.base.item.darksteel.ItemInventoryCharger | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Added 2 new methods: [initCapabilities(Lnet/minecraft/item/ItemStack;Lnet/minecraft/nbt/NBTTagCompound;)Lnet/minecraftforge/common/capabilities/ICapabilityProvider;, getAttributeModifiers(Lnet/minecraft/inventory/EntityEquipmentSlot;Lnet/minecraft/item/ItemStack;)Lcom/google/common/collect/Multimap;] | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Successfully patched. | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.ItemInventoryCharger | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.sound.SoundRegistry for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.sound.SoundRegistry | |
| [22:52:51] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.recipes.PowerToolRecipes since it is not for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.render.pipeline.BlockStateWrapperBase for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.render.pipeline.BlockStateWrapperBase | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.handler.ServerTickHandler for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.handler.ServerTickHandler | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedUpgrade for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedUpgrade | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.matteroverdrive.MatterOverdriveUtil for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.matteroverdrive.MatterOverdriveUtil | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.mekanism.MekanismUtil for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.mekanism.MekanismUtil | |
| [22:52:51] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.BlockStateWrapperConduitBundle since it is not for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.spoon.SpoonUpgrade for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.spoon.SpoonUpgrade | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.farming.fertilizer.NoFertilizer for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.farming.fertilizer.NoFertilizer | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.ItemDarkSteelCrook for mod enderio | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Found 1 patch to apply to class crazypants.enderio.base.item.darksteel.ItemDarkSteelCrook from implemented interfaces: [crazypants/enderio/api/upgrades/IDarkSteelItem] | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Patching 1 mixins onto class crazypants.enderio.base.item.darksteel.ItemDarkSteelCrook | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Added 2 new methods: [initCapabilities(Lnet/minecraft/item/ItemStack;Lnet/minecraft/nbt/NBTTagCompound;)Lnet/minecraftforge/common/capabilities/ICapabilityProvider;, getAttributeModifiers(Lnet/minecraft/inventory/EntityEquipmentSlot;Lnet/minecraft/item/ItemStack;)Lcom/google/common/collect/Multimap;] | |
| [22:52:51] [Client thread/INFO] [EnderCore Mixins]: Successfully patched. | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.ItemDarkSteelCrook | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.block.infinity.InfinityFogDropHandler for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.block.infinity.InfinityFogDropHandler | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.magicalcrops.MagicalcropsUtil for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.magicalcrops.MagicalcropsUtil | |
| [22:52:51] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ClientProxy since it is not for mod enderio | |
| [22:52:51] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.handler.darksteel.PlayerAOEAttributeHandler for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.handler.darksteel.PlayerAOEAttributeHandler | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.te.TEUtil for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.te.TEUtil | |
| [22:52:52] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.autosave.ConduitHandlers since it is not for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.teleport.ChunkTicket for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.teleport.ChunkTicket | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.potion.PotionConfusion for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.potion.PotionConfusion | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.filter.recipes.FilterRecipes for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.filter.recipes.FilterRecipes | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.bop.BoPUtil for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.bop.BoPUtil | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.handler.darksteel.SwordHandler for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.handler.darksteel.SwordHandler | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.init.ModObjectRegistry for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.init.ModObjectRegistry | |
| [22:52:52] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolObject since it is not for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.autosave.BaseHandlers for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.autosave.BaseHandlers | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.potion.PotionWithering for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.potion.PotionWithering | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveDepthUpgrade for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveDepthUpgrade | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.ic2c.IC2cUtil for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.ic2c.IC2cUtil | |
| [22:52:52] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.me.EnderIOConduitsAppliedEnergistics since it is not for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.natura.NaturaUtil for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.natura.NaturaUtil | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.mfr.MFRUtil for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.mfr.MFRUtil | |
| [22:52:52] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.obelisk.weather.BlockWeatherObelisk since it is not for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.farming.FarmersRegistry for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.farming.FarmersRegistry | |
| [22:52:52] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolTileEntity since it is not for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTic since it is not for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.thaumcraft.ThaumcraftUtil for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.thaumcraft.ThaumcraftUtil | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.basemetals.BaseMetalsUtil for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.basemetals.BaseMetalsUtil | |
| [22:52:52] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitObject since it is not for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.capacitor.CapacitorKey for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.capacitor.CapacitorKey | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.botany.BotanyUtil for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.botany.BotanyUtil | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveUpgrade for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveUpgrade | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.enchantment.EnchantmentWitherWeapon for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.enchantment.EnchantmentWitherWeapon | |
| [22:52:52] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.killera.ZombieCache since it is not for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.spawner.BrokenSpawnerHandler for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.spawner.BrokenSpawnerHandler | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.potion.PotionFloating for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.potion.PotionFloating | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.fluid.Fluids for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.fluid.Fluids | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.handler.darksteel.DarkSteelController for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.handler.darksteel.DarkSteelController | |
| [22:52:52] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.refinedstorage.EnderIOConduitsRefinedStorage since it is not for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.enchantment.EnchantmentWitherArrow for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.enchantment.EnchantmentWitherArrow | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.farming.fertilizer.Fertilizer for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.farming.fertilizer.Fertilizer | |
| [22:52:52] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.capacitor.CapacitorKey since it is not for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.handler.darksteel.DarkSteelRecipeManager for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.handler.darksteel.DarkSteelRecipeManager | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.loot.Loot for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.loot.Loot | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.chickens.ChickensUtil for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.chickens.ChickensUtil | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.direct.DirectUpgrade for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.direct.DirectUpgrade | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.machine.recipes.MachineRecipes for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.machine.recipes.MachineRecipes | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.exu2.ExU2Util for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.exu2.ExU2Util | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingUpgrade for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingUpgrade | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.glider.GliderUpgrade for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.glider.GliderUpgrade | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.block.charge.EntityPrimedCharge for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.block.charge.EntityPrimedCharge | |
| [22:52:52] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.darksteel.upgrade.solar.SolarUpgrade since it is not for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.elytra.ElytraUpgrade for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.elytra.ElytraUpgrade | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.enchantment.EnchantmentShimmer for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.enchantment.EnchantmentShimmer | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.storage.StorageUpgrade for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.storage.StorageUpgrade | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.material.material.MaterialCraftingHandler for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.material.material.MaterialCraftingHandler | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.block.darksteel.anvil.BlockDarkSteelAnvil for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.block.darksteel.anvil.BlockDarkSteelAnvil | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.block.coldfire.BlockColdFire for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.block.coldfire.BlockColdFire | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.tic.TicUtil for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.tic.TicUtil | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.sound.SoundDetectorUpgrade for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.sound.SoundDetectorUpgrade | |
| [22:52:52] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.forestry.EnderIOIntegrationForestry since it is not for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.enchantment.HandlerSoulBound for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.enchantment.HandlerSoulBound | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.mysticalagriculture.MysticalAgricultureUtil for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.mysticalagriculture.MysticalAgricultureUtil | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.actuallyadditions.ActuallyadditionsUtil for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.actuallyadditions.ActuallyadditionsUtil | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.render.registry.SmartModelAttacher for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.render.registry.SmartModelAttacher | |
| [22:52:52] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.autosave.MachineHandlers since it is not for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.nightvision.NightVisionUpgrade for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.nightvision.NightVisionUpgrade | |
| [22:52:52] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.handler.ConduitBreakSpeedHandler since it is not for mod enderio | |
| [22:52:52] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawnerUser for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawnerUser | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.enchantment.EnchantmentSoulBound for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.enchantment.EnchantmentSoulBound | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveCarpetUpgrade for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveCarpetUpgrade | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.api.capacitor.CapabilityCapacitorData for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.api.capacitor.CapabilityCapacitorData | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.EnderIOMachines since it is not for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.oc.EnderIOConduitsOpenComputers since it is not for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.TileEntityEio for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.TileEntityEio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.handler.RecipeButtonHandler for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.handler.RecipeButtonHandler | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTicLate since it is not for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.material.recipes.MaterialOredicts for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.material.recipes.MaterialOredicts | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.botania.BotaniaUtil for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.botania.BotaniaUtil | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.farming.registry.Registry for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.farming.registry.Registry | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.top.TOPUtil for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.top.TOPUtil | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.events.ModSoundRegisterEvent for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.events.ModSoundRegisterEvent | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.enchantment.EnchantmentRepellent for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.enchantment.EnchantmentRepellent | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.handler.darksteel.UpgradeRegistry for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.handler.darksteel.UpgradeRegistry | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.fuels.FuelUtil for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.fuels.FuelUtil | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.techreborn.TechRebornUtil for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.techreborn.TechRebornUtil | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.capacitor.CapacitorKeyRegistry for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.capacitor.CapacitorKeyRegistry | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.IntegrationRegistry for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.IntegrationRegistry | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.ic2e.IC2eUtil for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.ic2e.IC2eUtil | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.diagnostics.EnderIOCrashCallable for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.diagnostics.EnderIOCrashCallable | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineTileEntity since it is not for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.machine.entity.EntityFallingMachine for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.machine.entity.EntityFallingMachine | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.teleport.telepad.TeleportEntityRenderHandler since it is not for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.paint.render.PaintRegistry for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.paint.render.PaintRegistry | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.conduitprobe.ToolTickHandler for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.conduitprobe.ToolTickHandler | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.handler.darksteel.UpgradeRenderManager for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [LLibrary Core]: Patching class net/minecraft/client/renderer/entity/RenderPlayer | |
| [22:52:53] [Client thread/DEBUG] [LLibrary Core]: Patching method <init>(Lnet/minecraft/client/renderer/entity/RenderManager;Z)V | |
| [22:52:53] [Client thread/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/assignModel(Lnet/minecraft/client/renderer/entity/RenderPlayer;Lnet/minecraft/client/model/ModelBiped;Z)Lnet/minecraft/client/model/ModelBiped; | |
| [22:52:53] [Client thread/DEBUG] [LLibrary Core]: Patching method func_177138_b(Lnet/minecraft/client/entity/AbstractClientPlayer;)V | |
| [22:52:53] [Client thread/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/renderArmPre(Lnet/minecraft/client/renderer/entity/RenderPlayer;Lnet/minecraft/client/entity/AbstractClientPlayer;Lnet/minecraft/util/EnumHandSide;)V | |
| [22:52:53] [Client thread/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/renderArmPost(Lnet/minecraft/client/renderer/entity/RenderPlayer;Lnet/minecraft/client/entity/AbstractClientPlayer;Lnet/minecraft/util/EnumHandSide;)V | |
| [22:52:53] [Client thread/DEBUG] [LLibrary Core]: Patching method func_177139_c(Lnet/minecraft/client/entity/AbstractClientPlayer;)V | |
| [22:52:53] [Client thread/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/renderArmPre(Lnet/minecraft/client/renderer/entity/RenderPlayer;Lnet/minecraft/client/entity/AbstractClientPlayer;Lnet/minecraft/util/EnumHandSide;)V | |
| [22:52:53] [Client thread/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/renderArmPost(Lnet/minecraft/client/renderer/entity/RenderPlayer;Lnet/minecraft/client/entity/AbstractClientPlayer;Lnet/minecraft/util/EnumHandSide;)V | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.handler.darksteel.UpgradeRenderManager | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.ConduitInOutRenderer since it is not for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.capacitor.CapacitorKey since it is not for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedController for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedController | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.darksteel.upgrade.energy.EnergyUpgrade for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.darksteel.upgrade.energy.EnergyUpgrade | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.init.ClientProxy for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.init.ClientProxy | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.machine.capbank.network.ClientNetworkManager since it is not for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.init.ModTileEntity for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.init.ModTileEntity | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawner for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawner | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.immersiveengineering.ImmersiveEngineeringUtil for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.immersiveengineering.ImmersiveEngineeringUtil | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.material.recipes.MaterialRecipes for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.material.recipes.MaterialRecipes | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.item.eggs.EntityOwlEgg for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.item.eggs.EntityOwlEgg | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.loot.LootManager for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.loot.LootManager | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.base.integration.draconic.DraconicUtil for mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.base.integration.draconic.DraconicUtil | |
| [22:52:53] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into enderio for type INSTANCE | |
| [22:52:53] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod enderio | |
| [22:52:53] [Client thread/DEBUG] [FML]: Bar Step: Construction - Ender IO took 2.364s | |
| [22:52:53] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:52:53] [Client thread/DEBUG] [forge]: crazypants/enderio/base/EnderIO$1 | |
| [22:52:53] [Client thread/DEBUG] [forge]: crazypants/enderio/base/diagnostics/EnderIOCrashCallable | |
| [22:52:53] [Client thread/TRACE] [FML]: Mod enderiointegrationtic is using network checker : Invoking method checkModLists | |
| [22:52:53] [Client thread/TRACE] [FML]: Testing mod enderiointegrationtic to verify it accepts its own version in a remote connection | |
| [22:52:53] [Client thread/TRACE] [FML]: The mod enderiointegrationtic accepts its own version (5.0.44) | |
| [22:52:53] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.conduits.EnderIOConduits.proxy since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.base.EnderIO.proxy since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.railcraft.RailcraftUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.util.DynaTextureProvider$Unloader since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.PaintTooltipUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.magnet.MagnetController since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.conduit.geom.ConduitGeometryUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.flippers.SwimUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ae2.AE2Util since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.gardencore.GardencoreUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineObject since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.transceiver.ServerChannelRegister since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.jump.JumpUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.travel.TravelUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitTileEntity since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.EnderItemOverrideList since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.hoe.HoeUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.metallurgy.MetallurgyUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingHandler since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.power.wireless.WirelessChargerController since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemInventoryCharger since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.sound.SoundRegistry since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.recipes.PowerToolRecipes since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.BlockStateWrapperBase since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.ServerTickHandler since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.matteroverdrive.MatterOverdriveUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mekanism.MekanismUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.BlockStateWrapperConduitBundle since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.spoon.SpoonUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.NoFertilizer since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemDarkSteelCrook since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.infinity.InfinityFogDropHandler since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.magicalcrops.MagicalcropsUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ClientProxy since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.PlayerAOEAttributeHandler since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.te.TEUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.autosave.ConduitHandlers since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.teleport.ChunkTicket since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionConfusion since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.filter.recipes.FilterRecipes since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.bop.BoPUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.SwordHandler since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModObjectRegistry since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolObject since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.autosave.BaseHandlers since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionWithering since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveDepthUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2c.IC2cUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.me.EnderIOConduitsAppliedEnergistics since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.natura.NaturaUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mfr.MFRUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.obelisk.weather.BlockWeatherObelisk since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.FarmersRegistry since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolTileEntity since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.integration.tic.EnderIOIntegrationTic for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.integration.tic.EnderIOIntegrationTic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.thaumcraft.ThaumcraftUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.basemetals.BaseMetalsUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitObject since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKey since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botany.BotanyUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherWeapon since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.killera.ZombieCache since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.spawner.BrokenSpawnerHandler since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionFloating since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.fluid.Fluids since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelController since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.refinedstorage.EnderIOConduitsRefinedStorage since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherArrow since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.Fertilizer since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.capacitor.CapacitorKey since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelRecipeManager since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.Loot since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.chickens.ChickensUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.direct.DirectUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.recipes.MachineRecipes since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.exu2.ExU2Util since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.glider.GliderUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.charge.EntityPrimedCharge since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.darksteel.upgrade.solar.SolarUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.elytra.ElytraUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentShimmer since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.storage.StorageUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.material.MaterialCraftingHandler since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.darksteel.anvil.BlockDarkSteelAnvil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.coldfire.BlockColdFire since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.tic.TicUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.sound.SoundDetectorUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.forestry.EnderIOIntegrationForestry since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.HandlerSoulBound since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mysticalagriculture.MysticalAgricultureUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.actuallyadditions.ActuallyadditionsUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.registry.SmartModelAttacher since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.autosave.MachineHandlers since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.nightvision.NightVisionUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.handler.ConduitBreakSpeedHandler since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawnerUser since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentSoulBound since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveCarpetUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.api.capacitor.CapabilityCapacitorData since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.EnderIOMachines since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.oc.EnderIOConduitsOpenComputers since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.TileEntityEio since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.RecipeButtonHandler since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTicLate since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialOredicts since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botania.BotaniaUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.registry.Registry since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.top.TOPUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.events.ModSoundRegisterEvent since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentRepellent since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRegistry since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.fuels.FuelUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.techreborn.TechRebornUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKeyRegistry since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.IntegrationRegistry since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2e.IC2eUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.diagnostics.EnderIOCrashCallable since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineTileEntity since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.entity.EntityFallingMachine since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.teleport.telepad.TeleportEntityRenderHandler since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.render.PaintRegistry since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.conduitprobe.ToolTickHandler since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRenderManager since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.ConduitInOutRenderer since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.capacitor.CapacitorKey since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedController since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.energy.EnergyUpgrade since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ClientProxy since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.machine.capbank.network.ClientNetworkManager since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModTileEntity since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawner since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.immersiveengineering.ImmersiveEngineeringUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialRecipes since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.eggs.EntityOwlEgg since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.LootManager since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.draconic.DraconicUtil since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into enderiointegrationtic for type INSTANCE | |
| [22:52:53] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for crazypants.enderio.base.EnderIO.instance since it is not for mod enderiointegrationtic | |
| [22:52:53] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod enderiointegrationtic | |
| [22:52:53] [Client thread/DEBUG] [FML]: Bar Step: Construction - Ender IO Integration with Tinkers' Construct took 0.018s | |
| [22:52:53] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod twilightforest | |
| [22:52:53] [Client thread/TRACE] [FML]: Mod twilightforest is using network checker : Accepting version 3.8.689 | |
| [22:52:53] [Client thread/TRACE] [FML]: Testing mod twilightforest to verify it accepts its own version in a remote connection | |
| [22:52:53] [Client thread/TRACE] [FML]: The mod twilightforest accepts its own version (3.8.689) | |
| [22:52:53] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.ItemTFTrophy for mod twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.ItemTFTrophy | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.TFRegisterItemEvent for mod twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.TFRegisterItemEvent | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.ItemTFMinotaurAxe for mod twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.ItemTFMinotaurAxe | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.TFRegisterItemRenderingEvent for mod twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.TFRegisterItemRenderingEvent | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.block.ColorHandler for mod twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.block.ColorHandler | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.potions.TFRegisterPotionEvent for mod twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.potions.TFRegisterPotionEvent | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.client.TFClientEvents for mod twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.client.TFClientEvents | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.TFEventListener for mod twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.TFEventListener | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.TFConfig for mod twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.TFConfig | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.TFSounds for mod twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.TFSounds | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.TFTickHandler for mod twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.TFTickHandler | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.recipe.TFRecipes for mod twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.recipe.TFRecipes | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.ItemTFFieryPick for mod twilightforest | |
| [22:52:53] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.ItemTFFieryPick | |
| [22:52:53] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.biomes.RegistryBiomeEvent for mod twilightforest | |
| [22:52:54] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.biomes.RegistryBiomeEvent | |
| [22:52:54] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.block.RegisterBlockEvent for mod twilightforest | |
| [22:52:54] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.block.RegisterBlockEvent | |
| [22:52:54] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.entity.TFEntities for mod twilightforest | |
| [22:52:54] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.entity.TFEntities | |
| [22:52:54] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.ItemTFKnightlySword for mod twilightforest | |
| [22:52:54] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.ItemTFKnightlySword | |
| [22:52:54] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into twilightforest for type INSTANCE | |
| [22:52:54] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod twilightforest | |
| [22:52:54] [Client thread/DEBUG] [FML]: Bar Step: Construction - The Twilight Forest took 0.862s | |
| [22:52:54] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod tconstruct | |
| [22:52:54] [Client thread/DEBUG] [Pulsar-tconstruct]: Attaching [PulseManager[tconstruct]] to event bus for container [FMLMod:tconstruct{1.12.2-2.12.0.135}] | |
| [22:52:55] [Client thread/INFO] [Pulsar-tconstruct]: Skipping Pulse chiselsandbitsIntegration; missing dependency: chiselsandbits | |
| [22:52:55] [Client thread/INFO] [Pulsar-tconstruct]: Skipping Pulse craftingtweaksIntegration; missing dependency: craftingtweaks | |
| [22:52:55] [Client thread/INFO] [Pulsar-tconstruct]: Skipping Pulse wailaIntegration; missing dependency: waila | |
| [22:52:55] [Client thread/INFO] [Pulsar-tconstruct]: Skipping Pulse theoneprobeIntegration; missing dependency: theoneprobe | |
| [22:52:55] [Client thread/INFO] [tconstruct]: Preparing to take over the world | |
| [22:52:55] [Client thread/TRACE] [FML]: Mod tconstruct is using network checker : Invoking method matchModVersions | |
| [22:52:55] [Client thread/TRACE] [FML]: Testing mod tconstruct to verify it accepts its own version in a remote connection | |
| [22:52:55] [Client thread/TRACE] [FML]: The mod tconstruct accepts its own version (1.12.2-2.12.0.135) | |
| [22:52:55] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into tconstruct | |
| [22:52:55] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for tconstruct | |
| [22:52:55] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for slimeknights.tconstruct.tools.ranged.RangedEvents for mod tconstruct | |
| [22:52:55] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class slimeknights.tconstruct.tools.ranged.RangedEvents | |
| [22:52:55] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for slimeknights.tconstruct.common.Sounds for mod tconstruct | |
| [22:52:55] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class slimeknights.tconstruct.common.Sounds | |
| [22:52:55] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for slimeknights.tconstruct.gadgets.WoodenHopperGUIDrawEvent for mod tconstruct | |
| [22:52:55] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class slimeknights.tconstruct.gadgets.WoodenHopperGUIDrawEvent | |
| [22:52:55] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for slimeknights.tconstruct.tools.common.inventory.ContainerCraftingStation for mod tconstruct | |
| [22:52:55] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class slimeknights.tconstruct.tools.common.inventory.ContainerCraftingStation | |
| [22:52:55] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for slimeknights.tconstruct.tools.ranged.RangedRenderEvents for mod tconstruct | |
| [22:52:55] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class slimeknights.tconstruct.tools.ranged.RangedRenderEvents | |
| [22:52:55] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into tconstruct for type INSTANCE | |
| [22:52:55] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod tconstruct | |
| [22:52:55] [Client thread/DEBUG] [FML]: Bar Step: Construction - Tinkers' Construct took 1.064s | |
| [22:52:55] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod thedragonlib | |
| [22:52:55] [Client thread/INFO] [thedragonlib]: Welcoming Minecraft | |
| [22:52:55] [Client thread/TRACE] [FML]: Mod thedragonlib is using network checker : Accepting version 1.12.2-5.3.0 | |
| [22:52:55] [Client thread/TRACE] [FML]: Testing mod thedragonlib to verify it accepts its own version in a remote connection | |
| [22:52:55] [Client thread/TRACE] [FML]: The mod thedragonlib accepts its own version (1.12.2-5.3.0) | |
| [22:52:55] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into thedragonlib | |
| [22:52:55] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for thedragonlib | |
| [22:52:55] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into thedragonlib for type INSTANCE | |
| [22:52:55] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod thedragonlib | |
| [22:52:55] [Client thread/DEBUG] [FML]: Bar Step: Construction - TheDragonLib took 0.016s | |
| [22:52:55] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod armorplus | |
| [22:52:55] [Client thread/INFO] [armorplus]: Welcoming Minecraft | |
| [22:52:55] [Client thread/TRACE] [FML]: Mod armorplus is using network checker : Accepting version 1.12.2-11.22.0.58 | |
| [22:52:55] [Client thread/TRACE] [FML]: Testing mod armorplus to verify it accepts its own version in a remote connection | |
| [22:52:55] [Client thread/TRACE] [FML]: The mod armorplus accepts its own version (1.12.2-11.22.0.58) | |
| [22:52:55] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into armorplus | |
| [22:52:55] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for armorplus | |
| [22:52:55] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.sofodev.armorplus.common.events.IntegrationEventHandler for mod armorplus | |
| [22:52:55] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.sofodev.armorplus.common.events.IntegrationEventHandler | |
| [22:52:55] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.sofodev.armorplus.common.events.ModelsEventHandler for mod armorplus | |
| [22:52:55] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.sofodev.armorplus.common.events.ModelsEventHandler | |
| [22:52:55] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.sofodev.armorplus.common.registry.ModBlocks for mod armorplus | |
| [22:52:55] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.sofodev.armorplus.common.registry.ModBlocks | |
| [22:52:55] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.sofodev.armorplus.common.events.RegistryEventHandler for mod armorplus | |
| [22:52:55] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.sofodev.armorplus.common.events.RegistryEventHandler | |
| [22:52:55] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.sofodev.armorplus.common.events.AbilityDataEventHandler for mod armorplus | |
| [22:52:55] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.sofodev.armorplus.common.events.AbilityDataEventHandler | |
| [22:52:55] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.sofodev.armorplus.common.config.ModConfig for mod armorplus | |
| [22:52:55] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.sofodev.armorplus.common.config.ModConfig | |
| [22:52:55] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.sofodev.armorplus.common.events.CommonEventHandler for mod armorplus | |
| [22:52:55] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.sofodev.armorplus.common.events.CommonEventHandler | |
| [22:52:55] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.sofodev.armorplus.common.events.ClientEventHandler for mod armorplus | |
| [22:52:55] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.sofodev.armorplus.common.events.ClientEventHandler | |
| [22:52:55] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for com.sofodev.armorplus.common.compat.tinkers.TinkersConstructEventHandler since it is not for mod armorplus | |
| [22:52:55] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.sofodev.armorplus.client.misc.CosmeticsRenderInit for mod armorplus | |
| [22:52:55] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.sofodev.armorplus.client.misc.CosmeticsRenderInit | |
| [22:52:55] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into armorplus for type INSTANCE | |
| [22:52:55] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod armorplus | |
| [22:52:55] [Client thread/DEBUG] [FML]: Bar Step: Construction - ArmorPlus took 0.400s | |
| [22:52:55] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod bibliocraft | |
| [22:52:55] [Client thread/TRACE] [FML]: Mod bibliocraft is using network checker : Accepting version 2.4.5 | |
| [22:52:55] [Client thread/TRACE] [FML]: Testing mod bibliocraft to verify it accepts its own version in a remote connection | |
| [22:52:55] [Client thread/TRACE] [FML]: The mod bibliocraft accepts its own version (2.4.5) | |
| [22:52:55] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into bibliocraft | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for bibliocraft | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for jds.bibliocraft.BiblioCraft$RegisterTheThings for mod bibliocraft | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class jds.bibliocraft.BiblioCraft$RegisterTheThings | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into bibliocraft for type INSTANCE | |
| [22:52:56] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod bibliocraft | |
| [22:52:56] [Client thread/DEBUG] [FML]: Bar Step: Construction - BiblioCraft took 0.390s | |
| [22:52:56] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod biomesoplenty | |
| [22:52:56] [Client thread/TRACE] [FML]: Mod biomesoplenty is using network checker : Accepting version 7.0.1.2419 | |
| [22:52:56] [Client thread/TRACE] [FML]: Testing mod biomesoplenty to verify it accepts its own version in a remote connection | |
| [22:52:56] [Client thread/TRACE] [FML]: The mod biomesoplenty accepts its own version (7.0.1.2419) | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into biomesoplenty | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for biomesoplenty | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into biomesoplenty for type INSTANCE | |
| [22:52:56] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod biomesoplenty | |
| [22:52:56] [Client thread/DEBUG] [FML]: Bar Step: Construction - Biomes O' Plenty took 0.029s | |
| [22:52:56] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod blockcraftery | |
| [22:52:56] [Client thread/TRACE] [FML]: Mod blockcraftery is using network checker : Accepting version 1.12.2-1.2.0 | |
| [22:52:56] [Client thread/TRACE] [FML]: Testing mod blockcraftery to verify it accepts its own version in a remote connection | |
| [22:52:56] [Client thread/TRACE] [FML]: The mod blockcraftery accepts its own version (1.12.2-1.2.0) | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into blockcraftery | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for blockcraftery | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into blockcraftery for type INSTANCE | |
| [22:52:56] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod blockcraftery | |
| [22:52:56] [Client thread/DEBUG] [FML]: Bar Step: Construction - Blockcraftery took 0.012s | |
| [22:52:56] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod bonsaitrees | |
| [22:52:56] [Client thread/TRACE] [FML]: Mod bonsaitrees is using network checker : Accepting version 1.1.2 | |
| [22:52:56] [Client thread/TRACE] [FML]: Testing mod bonsaitrees to verify it accepts its own version in a remote connection | |
| [22:52:56] [Client thread/TRACE] [FML]: The mod bonsaitrees accepts its own version (1.1.2) | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into bonsaitrees | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for bonsaitrees | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.dave.bonsaitrees.proxy.CommonProxy for mod bonsaitrees | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.dave.bonsaitrees.proxy.CommonProxy | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.dave.bonsaitrees.proxy.ClientProxy for mod bonsaitrees | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.dave.bonsaitrees.proxy.ClientProxy | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into bonsaitrees for type INSTANCE | |
| [22:52:56] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod bonsaitrees | |
| [22:52:56] [Client thread/DEBUG] [FML]: Bar Step: Construction - Bonsai Trees took 0.051s | |
| [22:52:56] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod bookshelf | |
| [22:52:56] [Client thread/TRACE] [FML]: Mod bookshelf is using network checker : Accepting version 2.3.577 | |
| [22:52:56] [Client thread/TRACE] [FML]: Testing mod bookshelf to verify it accepts its own version in a remote connection | |
| [22:52:56] [Client thread/TRACE] [FML]: The mod bookshelf accepts its own version (2.3.577) | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into bookshelf | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for bookshelf | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into bookshelf for type INSTANCE | |
| [22:52:56] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod bookshelf | |
| [22:52:56] [Client thread/DEBUG] [FML]: Bar Step: Construction - Bookshelf took 0.028s | |
| [22:52:56] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod botania | |
| [22:52:56] [Client thread/TRACE] [FML]: Mod botania is using network checker : Accepting version r1.10-361 | |
| [22:52:56] [Client thread/TRACE] [FML]: Testing mod botania to verify it accepts its own version in a remote connection | |
| [22:52:56] [Client thread/TRACE] [FML]: The mod botania accepts its own version (r1.10-361) | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.client.core.handler.HUDHandler for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.client.core.handler.HUDHandler | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.item.block.ItemBlockSpecialFlower for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.item.block.ItemBlockSpecialFlower | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.subtile.functional.SubTileVinculotus for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.subtile.functional.SubTileVinculotus | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.subtile.functional.BergamuteEventHandler for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.subtile.functional.BergamuteEventHandler | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.client.core.handler.MultiblockRenderHandler for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.client.core.handler.MultiblockRenderHandler | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.client.core.handler.BlockHighlightRenderHandler for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.client.core.handler.BlockHighlightRenderHandler | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.core.handler.SleepingHandler for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.core.handler.SleepingHandler | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.item.relic.ItemLokiRing for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.item.relic.ItemLokiRing | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.client.core.handler.TooltipHandler for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.client.core.handler.TooltipHandler | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.item.relic.ItemOdinRing for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.item.relic.ItemOdinRing | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.core.handler.ConfigHandler$ChangeListener for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.core.handler.ConfigHandler$ChangeListener | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.client.core.handler.LightningHandler for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.client.core.handler.LightningHandler | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.client.core.handler.BossBarHandler for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.client.core.handler.BossBarHandler | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.core.handler.CommonTickHandler for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.core.handler.CommonTickHandler | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.brew.ModPotions for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.brew.ModPotions | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.BlockGhostRail for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.BlockGhostRail | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.subtile.generating.SubTileNarslimmus for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.subtile.generating.SubTileNarslimmus | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.BlockFelPumpkin for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.BlockFelPumpkin | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.client.core.handler.TooltipAdditionDisplayHandler for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.client.core.handler.TooltipAdditionDisplayHandler | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.core.handler.ModSounds for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.core.handler.ModSounds | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.core.version.VersionChecker for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.core.version.VersionChecker | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.core.handler.SheddingHandler for mod botania | |
| [22:52:56] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.core.handler.SheddingHandler | |
| [22:52:56] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.ModBlocks for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.ModBlocks | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.client.core.handler.CorporeaInputHandler for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.client.core.handler.CorporeaInputHandler | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.string.BlockRedStringInterceptor for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.string.BlockRedStringInterceptor | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.core.handler.PixieHandler for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.core.handler.PixieHandler | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.item.equipment.bauble.ItemDodgeRing for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.item.equipment.bauble.ItemDodgeRing | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.subtile.functional.SubTileLoonuim for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.subtile.functional.SubTileLoonuim | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.crafting.ModCraftingRecipes for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.crafting.ModCraftingRecipes | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.client.core.handler.AstrolabePreviewHandler for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.client.core.handler.AstrolabePreviewHandler | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.client.render.world.SkyblockRenderEvents for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.client.render.world.SkyblockRenderEvents | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.item.equipment.bauble.ItemBauble for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.item.equipment.bauble.ItemBauble | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.ModFluffBlocks for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.ModFluffBlocks | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.item.ModItems for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.item.ModItems | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.item.equipment.bauble.ItemGoddessCharm for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.item.equipment.bauble.ItemGoddessCharm | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.client.core.handler.ModelHandler for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.client.core.handler.ModelHandler | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.client.core.handler.RenderLexicon for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.client.core.handler.RenderLexicon | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.client.core.handler.DebugHandler for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.client.core.handler.DebugHandler | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.client.core.handler.ClientTickHandler for mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.client.core.handler.ClientTickHandler | |
| [22:52:57] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into botania for type INSTANCE | |
| [22:52:57] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod botania | |
| [22:52:57] [Client thread/DEBUG] [FML]: Bar Step: Construction - Botania took 1.461s | |
| [22:52:57] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod buildcraftlib | |
| [22:52:57] [Client thread/TRACE] [FML]: Mod buildcraftlib is using network checker : Accepting version 7.99.24.1 | |
| [22:52:57] [Client thread/TRACE] [FML]: Testing mod buildcraftlib to verify it accepts its own version in a remote connection | |
| [22:52:57] [Client thread/TRACE] [FML]: The mod buildcraftlib accepts its own version (7.99.24.1) | |
| [22:52:57] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.factory.BCFactoryProxy.proxy since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.transport.BCTransportProxy.proxy since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.robotics.BCRoboticsProxy.proxy since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.compat.network.CompatGui.guiHandlerProxy since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.silicon.BCSiliconProxy.proxy since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.builders.BCBuildersProxy.proxy since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.core.BCCoreProxy.proxy since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.energy.BCEnergyProxy.proxy since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.energy.BCEnergyWorldGen since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.transport.BCTransportRecipes since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.silicon.BCSiliconRecipes since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into buildcraftlib for type INSTANCE | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.factory.BCFactory.INSTANCE since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.builders.BCBuilders.INSTANCE since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.robotics.BCRobotics.INSTANCE since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.compat.BCCompat.instance since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.core.BCCore.INSTANCE since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.silicon.BCSilicon.INSTANCE since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.transport.BCTransport.INSTANCE since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.energy.BCEnergy.INSTANCE since it is not for mod buildcraftlib | |
| [22:52:57] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod buildcraftlib | |
| [22:52:57] [Client thread/DEBUG] [FML]: Bar Step: Construction - BuildCraft Lib took 0.057s | |
| [22:52:57] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod buildcraftcore | |
| [22:52:57] [Client thread/TRACE] [FML]: Mod buildcraftcore is using network checker : Accepting version 7.99.24.1 | |
| [22:52:57] [Client thread/TRACE] [FML]: Testing mod buildcraftcore to verify it accepts its own version in a remote connection | |
| [22:52:57] [Client thread/TRACE] [FML]: The mod buildcraftcore accepts its own version (7.99.24.1) | |
| [22:52:57] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.factory.BCFactoryProxy.proxy since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.transport.BCTransportProxy.proxy since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.lib.BCLibProxy.proxy since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.robotics.BCRoboticsProxy.proxy since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.compat.network.CompatGui.guiHandlerProxy since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.silicon.BCSiliconProxy.proxy since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.builders.BCBuildersProxy.proxy since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.energy.BCEnergyProxy.proxy since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.energy.BCEnergyWorldGen since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.transport.BCTransportRecipes since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.silicon.BCSiliconRecipes since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into buildcraftcore for type INSTANCE | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.factory.BCFactory.INSTANCE since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.builders.BCBuilders.INSTANCE since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.robotics.BCRobotics.INSTANCE since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.compat.BCCompat.instance since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.lib.BCLib.INSTANCE since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.silicon.BCSilicon.INSTANCE since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.transport.BCTransport.INSTANCE since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.energy.BCEnergy.INSTANCE since it is not for mod buildcraftcore | |
| [22:52:57] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod buildcraftcore | |
| [22:52:57] [Client thread/DEBUG] [FML]: Bar Step: Construction - BuildCraft took 0.060s | |
| [22:52:57] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod buildcraftbuilders | |
| [22:52:57] [Client thread/TRACE] [FML]: Mod buildcraftbuilders is using network checker : Accepting version 7.99.24.1 | |
| [22:52:57] [Client thread/TRACE] [FML]: Testing mod buildcraftbuilders to verify it accepts its own version in a remote connection | |
| [22:52:57] [Client thread/TRACE] [FML]: The mod buildcraftbuilders accepts its own version (7.99.24.1) | |
| [22:52:57] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.factory.BCFactoryProxy.proxy since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.transport.BCTransportProxy.proxy since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.lib.BCLibProxy.proxy since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.robotics.BCRoboticsProxy.proxy since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.compat.network.CompatGui.guiHandlerProxy since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.silicon.BCSiliconProxy.proxy since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.core.BCCoreProxy.proxy since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.energy.BCEnergyProxy.proxy since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.energy.BCEnergyWorldGen since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.transport.BCTransportRecipes since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.silicon.BCSiliconRecipes since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into buildcraftbuilders for type INSTANCE | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.factory.BCFactory.INSTANCE since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.robotics.BCRobotics.INSTANCE since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.compat.BCCompat.instance since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.core.BCCore.INSTANCE since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.lib.BCLib.INSTANCE since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.silicon.BCSilicon.INSTANCE since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.transport.BCTransport.INSTANCE since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.energy.BCEnergy.INSTANCE since it is not for mod buildcraftbuilders | |
| [22:52:57] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod buildcraftbuilders | |
| [22:52:57] [Client thread/DEBUG] [FML]: Bar Step: Construction - BuildCraft Builders took 0.046s | |
| [22:52:57] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod buildcrafttransport | |
| [22:52:57] [Client thread/TRACE] [FML]: Mod buildcrafttransport is using network checker : Accepting version 7.99.24.1 | |
| [22:52:57] [Client thread/TRACE] [FML]: Testing mod buildcrafttransport to verify it accepts its own version in a remote connection | |
| [22:52:57] [Client thread/TRACE] [FML]: The mod buildcrafttransport accepts its own version (7.99.24.1) | |
| [22:52:57] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.factory.BCFactoryProxy.proxy since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.lib.BCLibProxy.proxy since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.robotics.BCRoboticsProxy.proxy since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.compat.network.CompatGui.guiHandlerProxy since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.silicon.BCSiliconProxy.proxy since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.builders.BCBuildersProxy.proxy since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.core.BCCoreProxy.proxy since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.energy.BCEnergyProxy.proxy since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.energy.BCEnergyWorldGen since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for buildcraft.transport.BCTransportRecipes for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class buildcraft.transport.BCTransportRecipes | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.silicon.BCSiliconRecipes since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into buildcrafttransport for type INSTANCE | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.factory.BCFactory.INSTANCE since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.builders.BCBuilders.INSTANCE since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.robotics.BCRobotics.INSTANCE since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.compat.BCCompat.instance since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.core.BCCore.INSTANCE since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.lib.BCLib.INSTANCE since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.silicon.BCSilicon.INSTANCE since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.energy.BCEnergy.INSTANCE since it is not for mod buildcrafttransport | |
| [22:52:57] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod buildcrafttransport | |
| [22:52:57] [Client thread/DEBUG] [FML]: Bar Step: Construction - BuildCraft Transport took 0.062s | |
| [22:52:57] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod buildcraftsilicon | |
| [22:52:58] [Client thread/TRACE] [FML]: Mod buildcraftsilicon is using network checker : Accepting version 7.99.24.1 | |
| [22:52:58] [Client thread/TRACE] [FML]: Testing mod buildcraftsilicon to verify it accepts its own version in a remote connection | |
| [22:52:58] [Client thread/TRACE] [FML]: The mod buildcraftsilicon accepts its own version (7.99.24.1) | |
| [22:52:58] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.factory.BCFactoryProxy.proxy since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.transport.BCTransportProxy.proxy since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.lib.BCLibProxy.proxy since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.robotics.BCRoboticsProxy.proxy since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.compat.network.CompatGui.guiHandlerProxy since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.builders.BCBuildersProxy.proxy since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.core.BCCoreProxy.proxy since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.energy.BCEnergyProxy.proxy since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.energy.BCEnergyWorldGen since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.transport.BCTransportRecipes since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for buildcraft.silicon.BCSiliconRecipes for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class buildcraft.silicon.BCSiliconRecipes | |
| [22:52:58] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into buildcraftsilicon for type INSTANCE | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.factory.BCFactory.INSTANCE since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.builders.BCBuilders.INSTANCE since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.robotics.BCRobotics.INSTANCE since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.compat.BCCompat.instance since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.core.BCCore.INSTANCE since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.lib.BCLib.INSTANCE since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.transport.BCTransport.INSTANCE since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.energy.BCEnergy.INSTANCE since it is not for mod buildcraftsilicon | |
| [22:52:58] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod buildcraftsilicon | |
| [22:52:58] [Client thread/DEBUG] [FML]: Bar Step: Construction - BuildCraft Silicon took 0.082s | |
| [22:52:58] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod buildcraftenergy | |
| [22:52:58] [Client thread/TRACE] [FML]: Mod buildcraftenergy is using network checker : Accepting version 7.99.24.1 | |
| [22:52:58] [Client thread/TRACE] [FML]: Testing mod buildcraftenergy to verify it accepts its own version in a remote connection | |
| [22:52:58] [Client thread/TRACE] [FML]: The mod buildcraftenergy accepts its own version (7.99.24.1) | |
| [22:52:58] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.factory.BCFactoryProxy.proxy since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.transport.BCTransportProxy.proxy since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.lib.BCLibProxy.proxy since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.robotics.BCRoboticsProxy.proxy since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.compat.network.CompatGui.guiHandlerProxy since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.silicon.BCSiliconProxy.proxy since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.builders.BCBuildersProxy.proxy since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.core.BCCoreProxy.proxy since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for buildcraft.energy.BCEnergyWorldGen for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class buildcraft.energy.BCEnergyWorldGen | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.transport.BCTransportRecipes since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.silicon.BCSiliconRecipes since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into buildcraftenergy for type INSTANCE | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.factory.BCFactory.INSTANCE since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.builders.BCBuilders.INSTANCE since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.robotics.BCRobotics.INSTANCE since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.compat.BCCompat.instance since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.core.BCCore.INSTANCE since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.lib.BCLib.INSTANCE since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.silicon.BCSilicon.INSTANCE since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.transport.BCTransport.INSTANCE since it is not for mod buildcraftenergy | |
| [22:52:58] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod buildcraftenergy | |
| [22:52:58] [Client thread/DEBUG] [FML]: Bar Step: Construction - BuildCraft Energy took 0.028s | |
| [22:52:58] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ic2 | |
| [22:52:58] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:52:58] [Client thread/DEBUG] [forge]: ic2/core/item/tool/HandHeldInventory$1 | |
| [22:52:58] [Client thread/TRACE] [FML]: Mod ic2 is using network checker : Accepting version 2.8.109-ex112 | |
| [22:52:58] [Client thread/TRACE] [FML]: Testing mod ic2 to verify it accepts its own version in a remote connection | |
| [22:52:58] [Client thread/TRACE] [FML]: The mod ic2 accepts its own version (2.8.109-ex112) | |
| [22:52:58] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ic2 | |
| [22:52:58] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ic2 | |
| [22:52:58] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into ic2 for type INSTANCE | |
| [22:52:58] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ic2 | |
| [22:52:58] [Client thread/DEBUG] [FML]: Bar Step: Construction - IndustrialCraft 2 took 0.868s | |
| [22:52:58] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod forestry | |
| [22:52:58] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:52:58] [Client thread/DEBUG] [forge]: forestry/core/utils/ForestryModEnvWarningCallable | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod forestry is using network checker : Accepting version 5.8.1.322 | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod forestry to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod forestry accepts its own version (5.8.1.322) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into forestry | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for forestry | |
| [22:52:59] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for forestry.core.utils.MigrationHelper for mod forestry | |
| [22:52:59] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class forestry.core.utils.MigrationHelper | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into forestry for type INSTANCE | |
| [22:52:59] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod forestry | |
| [22:52:59] [Client thread/DEBUG] [FML]: Bar Step: Construction - Forestry took 0.548s | |
| [22:52:59] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod buildcraftcompat | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod buildcraftcompat is using network checker : Accepting version 7.99.24.1 | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod buildcraftcompat to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod buildcraftcompat accepts its own version (7.99.24.1) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.factory.BCFactoryProxy.proxy since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.transport.BCTransportProxy.proxy since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.lib.BCLibProxy.proxy since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.robotics.BCRoboticsProxy.proxy since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.silicon.BCSiliconProxy.proxy since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.builders.BCBuildersProxy.proxy since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.core.BCCoreProxy.proxy since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.energy.BCEnergyProxy.proxy since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.energy.BCEnergyWorldGen since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.transport.BCTransportRecipes since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.silicon.BCSiliconRecipes since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into buildcraftcompat for type INSTANCE | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.factory.BCFactory.INSTANCE since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.builders.BCBuilders.INSTANCE since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.robotics.BCRobotics.INSTANCE since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.core.BCCore.INSTANCE since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.lib.BCLib.INSTANCE since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.silicon.BCSilicon.INSTANCE since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.transport.BCTransport.INSTANCE since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.energy.BCEnergy.INSTANCE since it is not for mod buildcraftcompat | |
| [22:52:59] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod buildcraftcompat | |
| [22:52:59] [Client thread/DEBUG] [FML]: Bar Step: Construction - BuildCraft Compat took 0.020s | |
| [22:52:59] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod buildcraftfactory | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod buildcraftfactory is using network checker : Accepting version 7.99.24.1 | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod buildcraftfactory to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod buildcraftfactory accepts its own version (7.99.24.1) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.transport.BCTransportProxy.proxy since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.lib.BCLibProxy.proxy since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.robotics.BCRoboticsProxy.proxy since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.compat.network.CompatGui.guiHandlerProxy since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.silicon.BCSiliconProxy.proxy since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.builders.BCBuildersProxy.proxy since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.core.BCCoreProxy.proxy since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.energy.BCEnergyProxy.proxy since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.energy.BCEnergyWorldGen since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.transport.BCTransportRecipes since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.silicon.BCSiliconRecipes since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into buildcraftfactory for type INSTANCE | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.builders.BCBuilders.INSTANCE since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.robotics.BCRobotics.INSTANCE since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.compat.BCCompat.instance since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.core.BCCore.INSTANCE since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.lib.BCLib.INSTANCE since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.silicon.BCSilicon.INSTANCE since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.transport.BCTransport.INSTANCE since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.energy.BCEnergy.INSTANCE since it is not for mod buildcraftfactory | |
| [22:52:59] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod buildcraftfactory | |
| [22:52:59] [Client thread/DEBUG] [FML]: Bar Step: Construction - BuildCraft Factory took 0.014s | |
| [22:52:59] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod buildcraftrobotics | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod buildcraftrobotics is using network checker : Accepting version 7.99.24.1 | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod buildcraftrobotics to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod buildcraftrobotics accepts its own version (7.99.24.1) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.factory.BCFactoryProxy.proxy since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.transport.BCTransportProxy.proxy since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.lib.BCLibProxy.proxy since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.compat.network.CompatGui.guiHandlerProxy since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.silicon.BCSiliconProxy.proxy since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.builders.BCBuildersProxy.proxy since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.core.BCCoreProxy.proxy since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping proxy injection for buildcraft.energy.BCEnergyProxy.proxy since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.energy.BCEnergyWorldGen since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.transport.BCTransportRecipes since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for buildcraft.silicon.BCSiliconRecipes since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into buildcraftrobotics for type INSTANCE | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.factory.BCFactory.INSTANCE since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.builders.BCBuilders.INSTANCE since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.compat.BCCompat.instance since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.core.BCCore.INSTANCE since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.lib.BCLib.INSTANCE since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.silicon.BCSilicon.INSTANCE since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.transport.BCTransport.INSTANCE since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for buildcraft.energy.BCEnergy.INSTANCE since it is not for mod buildcraftrobotics | |
| [22:52:59] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod buildcraftrobotics | |
| [22:52:59] [Client thread/DEBUG] [FML]: Bar Step: Construction - BuildCraft Robotics took 0.016s | |
| [22:52:59] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod chameleon | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod chameleon is using network checker : Accepting version 1.12-4.1.3 | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod chameleon to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod chameleon accepts its own version (1.12-4.1.3) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into chameleon | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for chameleon | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into chameleon for type INSTANCE | |
| [22:52:59] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod chameleon | |
| [22:52:59] [Client thread/DEBUG] [FML]: Bar Step: Construction - Chameleon took 0.021s | |
| [22:52:59] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod chancecubes | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod chancecubes is using network checker : Accepting version 1.12.2-3.2.3.242 | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod chancecubes to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod chancecubes accepts its own version (1.12.2-3.2.3.242) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into chancecubes | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for chancecubes | |
| [22:52:59] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for chanceCubes.blocks.CCubesBlocks for mod chancecubes | |
| [22:52:59] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class chanceCubes.blocks.CCubesBlocks | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into chancecubes for type INSTANCE | |
| [22:52:59] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod chancecubes | |
| [22:52:59] [Client thread/DEBUG] [FML]: Bar Step: Construction - Chance Cubes took 0.052s | |
| [22:52:59] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod chesttransporter | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod chesttransporter is using network checker : Accepting version 2.8.8 | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod chesttransporter to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod chesttransporter accepts its own version (2.8.8) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into chesttransporter | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for chesttransporter | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into chesttransporter for type INSTANCE | |
| [22:52:59] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod chesttransporter | |
| [22:52:59] [Client thread/DEBUG] [FML]: Bar Step: Construction - Chest Transporter took 0.029s | |
| [22:52:59] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod cei | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod cei is using network checker : Accepting version 1.3 | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod cei to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod cei accepts its own version (1.3) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into cei | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for cei | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into cei for type INSTANCE | |
| [22:52:59] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod cei | |
| [22:52:59] [Client thread/DEBUG] [FML]: Bar Step: Construction - Chunk Edge Indicator took 0.006s | |
| [22:52:59] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod cloudboots | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod cloudboots is using network checker : Accepting version 1.4.1 | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod cloudboots to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod cloudboots accepts its own version (1.4.1) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into cloudboots | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for cloudboots | |
| [22:52:59] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.tiviacz.cloudboots.CloudBoots for mod cloudboots | |
| [22:52:59] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.tiviacz.cloudboots.CloudBoots | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into cloudboots for type INSTANCE | |
| [22:52:59] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod cloudboots | |
| [22:52:59] [Client thread/DEBUG] [FML]: Bar Step: Construction - Cloud Boots took 0.015s | |
| [22:52:59] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod craftpresence | |
| [22:52:59] [Client thread/ERROR] [craftpresence]: Translations for craftpresence do not exist for pl_pl | |
| [22:52:59] [Client thread/ERROR] [craftpresence]: Unable to retrieve a Translation for key.craftpresence.config_keybind | |
| [22:52:59] [Client thread/ERROR] [craftpresence]: Unable to retrieve a Translation for key.craftpresence.category | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod craftpresence is using network checker : Accepting version v1.5.3.1 | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod craftpresence to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod craftpresence accepts its own version (v1.5.3.1) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into craftpresence | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for craftpresence | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into craftpresence for type INSTANCE | |
| [22:52:59] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod craftpresence | |
| [22:52:59] [Client thread/DEBUG] [FML]: Bar Step: Construction - CraftPresence took 0.138s | |
| [22:52:59] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod creativecore | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod creativecore is using network checker : Accepting version 1.9.9 | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod creativecore to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod creativecore accepts its own version (1.9.9) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into creativecore | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for creativecore | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into creativecore for type INSTANCE | |
| [22:52:59] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod creativecore | |
| [22:52:59] [Client thread/DEBUG] [FML]: Bar Step: Construction - CreativeCore took 0.018s | |
| [22:52:59] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod cyclicmagic | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod cyclicmagic is using network checker : Accepting range fml.messages.version.restriction.lower.inclusive | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod cyclicmagic to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod cyclicmagic accepts its own version (1.19.9) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into cyclicmagic | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for cyclicmagic | |
| [22:52:59] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.lothrazar.cyclicmagic.registry.EntityProjectileRegistry for mod cyclicmagic | |
| [22:52:59] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.lothrazar.cyclicmagic.registry.EntityProjectileRegistry | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into cyclicmagic for type INSTANCE | |
| [22:52:59] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod cyclicmagic | |
| [22:52:59] [Client thread/DEBUG] [FML]: Bar Step: Construction - Cyclic took 0.098s | |
| [22:52:59] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod deathcounter | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod deathcounter is using network checker : No network checking performed | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod deathcounter to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod deathcounter accepts its own version (1.0.0) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into deathcounter | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for deathcounter | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into deathcounter for type INSTANCE | |
| [22:52:59] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod deathcounter | |
| [22:52:59] [Client thread/DEBUG] [FML]: Bar Step: Construction - DeathCounter took 0.009s | |
| [22:52:59] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ptrmodellib | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod ptrmodellib is using network checker : Accepting version 1.0.4 | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod ptrmodellib to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod ptrmodellib accepts its own version (1.0.4) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ptrmodellib | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ptrmodellib | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into ptrmodellib for type INSTANCE | |
| [22:52:59] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ptrmodellib | |
| [22:52:59] [Client thread/DEBUG] [FML]: Bar Step: Construction - ptrmodellib took 0.016s | |
| [22:52:59] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod props | |
| [22:52:59] [Client thread/TRACE] [FML]: Mod props is using network checker : Accepting version 2.6.2 | |
| [22:52:59] [Client thread/TRACE] [FML]: Testing mod props to verify it accepts its own version in a remote connection | |
| [22:52:59] [Client thread/TRACE] [FML]: The mod props accepts its own version (2.6.2) | |
| [22:52:59] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into props | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for props | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into props for type INSTANCE | |
| [22:53:00] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod props | |
| [22:53:00] [Client thread/DEBUG] [FML]: Bar Step: Construction - Decocraft took 0.043s | |
| [22:53:00] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod dirt2path | |
| [22:53:00] [Client thread/TRACE] [FML]: Mod dirt2path is using network checker : No network checking performed | |
| [22:53:00] [Client thread/TRACE] [FML]: Testing mod dirt2path to verify it accepts its own version in a remote connection | |
| [22:53:00] [Client thread/TRACE] [FML]: The mod dirt2path accepts its own version (1.7.1) | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into dirt2path | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for dirt2path | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into dirt2path for type INSTANCE | |
| [22:53:00] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod dirt2path | |
| [22:53:00] [Client thread/DEBUG] [FML]: Bar Step: Construction - Dirt2Path took 0.008s | |
| [22:53:00] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod elevatorid | |
| [22:53:00] [Client thread/TRACE] [FML]: Mod elevatorid is using network checker : Accepting version 1.3.10 | |
| [22:53:00] [Client thread/TRACE] [FML]: Testing mod elevatorid to verify it accepts its own version in a remote connection | |
| [22:53:00] [Client thread/TRACE] [FML]: The mod elevatorid accepts its own version (1.3.10) | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into elevatorid | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for elevatorid | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xyz.vsngamer.elevator.init.ModSounds for mod elevatorid | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xyz.vsngamer.elevator.init.ModSounds | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xyz.vsngamer.elevator.init.Registry for mod elevatorid | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xyz.vsngamer.elevator.init.Registry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into elevatorid for type INSTANCE | |
| [22:53:00] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod elevatorid | |
| [22:53:00] [Client thread/DEBUG] [FML]: Bar Step: Construction - Elevator Mod took 0.025s | |
| [22:53:00] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod eplus | |
| [22:53:00] [Client thread/TRACE] [FML]: Mod eplus is using network checker : Accepting version 5.0.177 | |
| [22:53:00] [Client thread/TRACE] [FML]: Testing mod eplus to verify it accepts its own version in a remote connection | |
| [22:53:00] [Client thread/TRACE] [FML]: The mod eplus accepts its own version (5.0.177) | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into eplus | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for eplus | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into eplus for type INSTANCE | |
| [22:53:00] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod eplus | |
| [22:53:00] [Client thread/DEBUG] [FML]: Bar Step: Construction - Enchanting Plus took 0.053s | |
| [22:53:00] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/EnderIO$1 | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/diagnostics/EnderIOCrashCallable | |
| [22:53:00] [Client thread/TRACE] [FML]: Mod enderiobase is using network checker : Accepting version 5.0.44 | |
| [22:53:00] [Client thread/TRACE] [FML]: Testing mod enderiobase to verify it accepts its own version in a remote connection | |
| [22:53:00] [Client thread/TRACE] [FML]: The mod enderiobase accepts its own version (5.0.44) | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.conduits.EnderIOConduits.proxy since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.base.EnderIO.proxy since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.railcraft.RailcraftUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.util.DynaTextureProvider$Unloader since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.PaintTooltipUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.magnet.MagnetController since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.conduit.geom.ConduitGeometryUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.flippers.SwimUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ae2.AE2Util since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.gardencore.GardencoreUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineObject since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.transceiver.ServerChannelRegister since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.jump.JumpUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.travel.TravelUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitTileEntity since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.EnderItemOverrideList since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.hoe.HoeUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.metallurgy.MetallurgyUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingHandler since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.power.wireless.WirelessChargerController since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemInventoryCharger since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.sound.SoundRegistry since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.recipes.PowerToolRecipes since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.BlockStateWrapperBase since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.ServerTickHandler since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.matteroverdrive.MatterOverdriveUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mekanism.MekanismUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.BlockStateWrapperConduitBundle since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.spoon.SpoonUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.NoFertilizer since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemDarkSteelCrook since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.infinity.InfinityFogDropHandler since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.magicalcrops.MagicalcropsUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ClientProxy since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.PlayerAOEAttributeHandler since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.te.TEUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.autosave.ConduitHandlers since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.teleport.ChunkTicket since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionConfusion since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.filter.recipes.FilterRecipes since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.bop.BoPUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.SwordHandler since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModObjectRegistry since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolObject since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.autosave.BaseHandlers since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionWithering since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveDepthUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2c.IC2cUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.me.EnderIOConduitsAppliedEnergistics since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.natura.NaturaUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mfr.MFRUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.obelisk.weather.BlockWeatherObelisk since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.FarmersRegistry since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolTileEntity since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTic since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.thaumcraft.ThaumcraftUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.basemetals.BaseMetalsUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitObject since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKey since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botany.BotanyUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherWeapon since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.killera.ZombieCache since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.spawner.BrokenSpawnerHandler since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionFloating since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.fluid.Fluids since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelController since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.refinedstorage.EnderIOConduitsRefinedStorage since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherArrow since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.Fertilizer since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.capacitor.CapacitorKey since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelRecipeManager since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.Loot since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.chickens.ChickensUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.direct.DirectUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.recipes.MachineRecipes since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.exu2.ExU2Util since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.glider.GliderUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.charge.EntityPrimedCharge since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.darksteel.upgrade.solar.SolarUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.elytra.ElytraUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentShimmer since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.storage.StorageUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.material.MaterialCraftingHandler since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.darksteel.anvil.BlockDarkSteelAnvil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.coldfire.BlockColdFire since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.tic.TicUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.sound.SoundDetectorUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.forestry.EnderIOIntegrationForestry since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.HandlerSoulBound since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mysticalagriculture.MysticalAgricultureUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.actuallyadditions.ActuallyadditionsUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.registry.SmartModelAttacher since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.autosave.MachineHandlers since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.nightvision.NightVisionUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.handler.ConduitBreakSpeedHandler since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawnerUser since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentSoulBound since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveCarpetUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.api.capacitor.CapabilityCapacitorData since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.EnderIOMachines since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.oc.EnderIOConduitsOpenComputers since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.TileEntityEio since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.RecipeButtonHandler since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTicLate since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialOredicts since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botania.BotaniaUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.registry.Registry since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.top.TOPUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.events.ModSoundRegisterEvent since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentRepellent since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRegistry since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.fuels.FuelUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.techreborn.TechRebornUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKeyRegistry since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.IntegrationRegistry since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2e.IC2eUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.diagnostics.EnderIOCrashCallable since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineTileEntity since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.entity.EntityFallingMachine since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.teleport.telepad.TeleportEntityRenderHandler since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.render.PaintRegistry since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.conduitprobe.ToolTickHandler since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRenderManager since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.ConduitInOutRenderer since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.capacitor.CapacitorKey since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedController since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.energy.EnergyUpgrade since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ClientProxy since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.machine.capbank.network.ClientNetworkManager since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModTileEntity since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawner since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.immersiveengineering.ImmersiveEngineeringUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialRecipes since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.eggs.EntityOwlEgg since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.LootManager since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.draconic.DraconicUtil since it is not for mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into enderiobase for type INSTANCE | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for crazypants.enderio.base.EnderIO.instance since it is not for mod enderiobase | |
| [22:53:00] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod enderiobase | |
| [22:53:00] [Client thread/DEBUG] [FML]: Bar Step: Construction - Ender IO Base took 0.011s | |
| [22:53:00] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/EnderIO$1 | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/diagnostics/EnderIOCrashCallable | |
| [22:53:00] [Client thread/TRACE] [FML]: Mod enderioconduits is using network checker : Invoking method checkModLists | |
| [22:53:00] [Client thread/TRACE] [FML]: Testing mod enderioconduits to verify it accepts its own version in a remote connection | |
| [22:53:00] [Client thread/TRACE] [FML]: The mod enderioconduits accepts its own version (5.0.44) | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.base.EnderIO.proxy since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.railcraft.RailcraftUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.util.DynaTextureProvider$Unloader since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.PaintTooltipUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.magnet.MagnetController since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.conduit.geom.ConduitGeometryUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.flippers.SwimUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ae2.AE2Util since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.gardencore.GardencoreUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineObject since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.transceiver.ServerChannelRegister since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.jump.JumpUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.travel.TravelUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.conduits.init.ConduitTileEntity for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.conduits.init.ConduitTileEntity | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.EnderItemOverrideList since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.hoe.HoeUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.metallurgy.MetallurgyUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingHandler since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.power.wireless.WirelessChargerController since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemInventoryCharger since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.sound.SoundRegistry since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.recipes.PowerToolRecipes since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.BlockStateWrapperBase since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.ServerTickHandler since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.matteroverdrive.MatterOverdriveUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mekanism.MekanismUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.conduits.render.BlockStateWrapperConduitBundle for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.conduits.render.BlockStateWrapperConduitBundle | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.spoon.SpoonUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.NoFertilizer since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemDarkSteelCrook since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.infinity.InfinityFogDropHandler since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.magicalcrops.MagicalcropsUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.conduits.init.ClientProxy for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.conduits.init.ClientProxy | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.PlayerAOEAttributeHandler since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.te.TEUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.conduits.autosave.ConduitHandlers for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.conduits.autosave.ConduitHandlers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.teleport.ChunkTicket since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionConfusion since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.filter.recipes.FilterRecipes since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.bop.BoPUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.SwordHandler since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModObjectRegistry since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolObject since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.autosave.BaseHandlers since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionWithering since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveDepthUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2c.IC2cUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.me.EnderIOConduitsAppliedEnergistics since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.natura.NaturaUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mfr.MFRUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.obelisk.weather.BlockWeatherObelisk since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.FarmersRegistry since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.powertools.init.PowerToolTileEntity for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.powertools.init.PowerToolTileEntity | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTic since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.thaumcraft.ThaumcraftUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.basemetals.BaseMetalsUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.conduits.init.ConduitObject for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.conduits.init.ConduitObject | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKey since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botany.BotanyUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherWeapon since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.killera.ZombieCache since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.spawner.BrokenSpawnerHandler since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionFloating since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.fluid.Fluids since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelController since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.refinedstorage.EnderIOConduitsRefinedStorage since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherArrow since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.Fertilizer since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.capacitor.CapacitorKey since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelRecipeManager since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.Loot since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.chickens.ChickensUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.direct.DirectUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.recipes.MachineRecipes since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.exu2.ExU2Util since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.glider.GliderUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.charge.EntityPrimedCharge since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.darksteel.upgrade.solar.SolarUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.elytra.ElytraUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentShimmer since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.storage.StorageUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.material.MaterialCraftingHandler since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.darksteel.anvil.BlockDarkSteelAnvil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.coldfire.BlockColdFire since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.tic.TicUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.sound.SoundDetectorUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.forestry.EnderIOIntegrationForestry since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.HandlerSoulBound since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mysticalagriculture.MysticalAgricultureUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.actuallyadditions.ActuallyadditionsUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.registry.SmartModelAttacher since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.autosave.MachineHandlers since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.nightvision.NightVisionUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.conduits.handler.ConduitBreakSpeedHandler for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.conduits.handler.ConduitBreakSpeedHandler | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawnerUser since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentSoulBound since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveCarpetUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.api.capacitor.CapabilityCapacitorData since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.EnderIOMachines since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.oc.EnderIOConduitsOpenComputers since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.TileEntityEio since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.RecipeButtonHandler since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTicLate since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialOredicts since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botania.BotaniaUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.registry.Registry since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.top.TOPUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.events.ModSoundRegisterEvent since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentRepellent since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRegistry since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.fuels.FuelUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.techreborn.TechRebornUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKeyRegistry since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.IntegrationRegistry since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2e.IC2eUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.diagnostics.EnderIOCrashCallable since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineTileEntity since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.entity.EntityFallingMachine since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.teleport.telepad.TeleportEntityRenderHandler since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.render.PaintRegistry since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.conduitprobe.ToolTickHandler since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRenderManager since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.conduits.render.ConduitInOutRenderer for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.conduits.render.ConduitInOutRenderer | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.capacitor.CapacitorKey since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedController since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.energy.EnergyUpgrade since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ClientProxy since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.machine.capbank.network.ClientNetworkManager since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModTileEntity since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawner since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.immersiveengineering.ImmersiveEngineeringUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialRecipes since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.eggs.EntityOwlEgg since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.LootManager since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.draconic.DraconicUtil since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into enderioconduits for type INSTANCE | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for crazypants.enderio.base.EnderIO.instance since it is not for mod enderioconduits | |
| [22:53:00] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod enderioconduits | |
| [22:53:00] [Client thread/DEBUG] [FML]: Bar Step: Construction - Ender IO Conduits took 0.136s | |
| [22:53:00] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/EnderIO$1 | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/diagnostics/EnderIOCrashCallable | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Found annotation mixin: crazypants.enderio.conduit.me.conduit.MEMixin | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Skipping mixin due to missing dependencies: [appliedenergistics2|API] | |
| [22:53:00] [Client thread/TRACE] [FML]: Mod enderioconduitsappliedenergistics is using network checker : Invoking method checkModLists | |
| [22:53:00] [Client thread/TRACE] [FML]: Testing mod enderioconduitsappliedenergistics to verify it accepts its own version in a remote connection | |
| [22:53:00] [Client thread/TRACE] [FML]: The mod enderioconduitsappliedenergistics accepts its own version (5.0.44) | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.conduits.EnderIOConduits.proxy since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.base.EnderIO.proxy since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.railcraft.RailcraftUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.util.DynaTextureProvider$Unloader since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.PaintTooltipUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.magnet.MagnetController since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.conduit.geom.ConduitGeometryUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.flippers.SwimUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ae2.AE2Util since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.gardencore.GardencoreUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineObject since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.transceiver.ServerChannelRegister since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.jump.JumpUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.travel.TravelUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitTileEntity since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.EnderItemOverrideList since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.hoe.HoeUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.metallurgy.MetallurgyUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingHandler since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.power.wireless.WirelessChargerController since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemInventoryCharger since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.sound.SoundRegistry since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.recipes.PowerToolRecipes since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.BlockStateWrapperBase since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.ServerTickHandler since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.matteroverdrive.MatterOverdriveUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mekanism.MekanismUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.BlockStateWrapperConduitBundle since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.spoon.SpoonUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.NoFertilizer since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemDarkSteelCrook since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.infinity.InfinityFogDropHandler since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.magicalcrops.MagicalcropsUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ClientProxy since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.PlayerAOEAttributeHandler since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.te.TEUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.autosave.ConduitHandlers since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.teleport.ChunkTicket since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionConfusion since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.filter.recipes.FilterRecipes since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.bop.BoPUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.SwordHandler since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModObjectRegistry since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolObject since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.autosave.BaseHandlers since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionWithering since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveDepthUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2c.IC2cUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.conduit.me.EnderIOConduitsAppliedEnergistics for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.conduit.me.EnderIOConduitsAppliedEnergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.natura.NaturaUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mfr.MFRUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.obelisk.weather.BlockWeatherObelisk since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.FarmersRegistry since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolTileEntity since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTic since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.thaumcraft.ThaumcraftUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.basemetals.BaseMetalsUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitObject since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKey since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botany.BotanyUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherWeapon since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.killera.ZombieCache since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.spawner.BrokenSpawnerHandler since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionFloating since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.fluid.Fluids since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelController since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.refinedstorage.EnderIOConduitsRefinedStorage since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherArrow since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.Fertilizer since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.capacitor.CapacitorKey since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelRecipeManager since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.Loot since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.chickens.ChickensUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.direct.DirectUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.recipes.MachineRecipes since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.exu2.ExU2Util since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.glider.GliderUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.charge.EntityPrimedCharge since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.darksteel.upgrade.solar.SolarUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.elytra.ElytraUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentShimmer since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.storage.StorageUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.material.MaterialCraftingHandler since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.darksteel.anvil.BlockDarkSteelAnvil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.coldfire.BlockColdFire since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.tic.TicUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.sound.SoundDetectorUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.forestry.EnderIOIntegrationForestry since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.HandlerSoulBound since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mysticalagriculture.MysticalAgricultureUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.actuallyadditions.ActuallyadditionsUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.registry.SmartModelAttacher since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.autosave.MachineHandlers since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.nightvision.NightVisionUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.handler.ConduitBreakSpeedHandler since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawnerUser since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentSoulBound since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveCarpetUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.api.capacitor.CapabilityCapacitorData since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.EnderIOMachines since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.oc.EnderIOConduitsOpenComputers since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.TileEntityEio since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.RecipeButtonHandler since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTicLate since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialOredicts since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botania.BotaniaUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.registry.Registry since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.top.TOPUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.events.ModSoundRegisterEvent since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentRepellent since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRegistry since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.fuels.FuelUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.techreborn.TechRebornUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKeyRegistry since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.IntegrationRegistry since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2e.IC2eUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.diagnostics.EnderIOCrashCallable since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineTileEntity since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.entity.EntityFallingMachine since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.teleport.telepad.TeleportEntityRenderHandler since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.render.PaintRegistry since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.conduitprobe.ToolTickHandler since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRenderManager since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.ConduitInOutRenderer since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.capacitor.CapacitorKey since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedController since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.energy.EnergyUpgrade since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ClientProxy since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.machine.capbank.network.ClientNetworkManager since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModTileEntity since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawner since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.immersiveengineering.ImmersiveEngineeringUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialRecipes since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.eggs.EntityOwlEgg since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.LootManager since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.draconic.DraconicUtil since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into enderioconduitsappliedenergistics for type INSTANCE | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for crazypants.enderio.base.EnderIO.instance since it is not for mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod enderioconduitsappliedenergistics | |
| [22:53:00] [Client thread/DEBUG] [FML]: Bar Step: Construction - Ender IO Applied Energistics Conduits took 0.013s | |
| [22:53:00] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/EnderIO$1 | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/diagnostics/EnderIOCrashCallable | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Found annotation mixin: crazypants.enderio.conduit.oc.conduit.OCMixin | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Skipping mixin due to missing dependencies: [opencomputersapi|network] | |
| [22:53:00] [Client thread/TRACE] [FML]: Mod enderioconduitsopencomputers is using network checker : Invoking method checkModLists | |
| [22:53:00] [Client thread/TRACE] [FML]: Testing mod enderioconduitsopencomputers to verify it accepts its own version in a remote connection | |
| [22:53:00] [Client thread/TRACE] [FML]: The mod enderioconduitsopencomputers accepts its own version (5.0.44) | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.conduits.EnderIOConduits.proxy since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.base.EnderIO.proxy since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.railcraft.RailcraftUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.util.DynaTextureProvider$Unloader since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.PaintTooltipUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.magnet.MagnetController since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.conduit.geom.ConduitGeometryUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.flippers.SwimUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ae2.AE2Util since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.gardencore.GardencoreUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineObject since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.transceiver.ServerChannelRegister since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.jump.JumpUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.travel.TravelUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitTileEntity since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.EnderItemOverrideList since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.hoe.HoeUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.metallurgy.MetallurgyUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingHandler since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.power.wireless.WirelessChargerController since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemInventoryCharger since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.sound.SoundRegistry since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.recipes.PowerToolRecipes since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.BlockStateWrapperBase since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.ServerTickHandler since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.matteroverdrive.MatterOverdriveUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mekanism.MekanismUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.BlockStateWrapperConduitBundle since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.spoon.SpoonUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.NoFertilizer since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemDarkSteelCrook since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.infinity.InfinityFogDropHandler since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.magicalcrops.MagicalcropsUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ClientProxy since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.PlayerAOEAttributeHandler since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.te.TEUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.autosave.ConduitHandlers since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.teleport.ChunkTicket since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionConfusion since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.filter.recipes.FilterRecipes since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.bop.BoPUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.SwordHandler since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModObjectRegistry since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolObject since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.autosave.BaseHandlers since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionWithering since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveDepthUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2c.IC2cUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.me.EnderIOConduitsAppliedEnergistics since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.natura.NaturaUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mfr.MFRUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.obelisk.weather.BlockWeatherObelisk since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.FarmersRegistry since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolTileEntity since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTic since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.thaumcraft.ThaumcraftUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.basemetals.BaseMetalsUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitObject since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKey since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botany.BotanyUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherWeapon since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.killera.ZombieCache since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.spawner.BrokenSpawnerHandler since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionFloating since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.fluid.Fluids since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelController since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.refinedstorage.EnderIOConduitsRefinedStorage since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherArrow since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.Fertilizer since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.capacitor.CapacitorKey since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelRecipeManager since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.Loot since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.chickens.ChickensUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.direct.DirectUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.recipes.MachineRecipes since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.exu2.ExU2Util since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.glider.GliderUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.charge.EntityPrimedCharge since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.darksteel.upgrade.solar.SolarUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.elytra.ElytraUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentShimmer since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.storage.StorageUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.material.MaterialCraftingHandler since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.darksteel.anvil.BlockDarkSteelAnvil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.coldfire.BlockColdFire since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.tic.TicUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.sound.SoundDetectorUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.forestry.EnderIOIntegrationForestry since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.HandlerSoulBound since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mysticalagriculture.MysticalAgricultureUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.actuallyadditions.ActuallyadditionsUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.registry.SmartModelAttacher since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.autosave.MachineHandlers since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.nightvision.NightVisionUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.handler.ConduitBreakSpeedHandler since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawnerUser since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentSoulBound since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveCarpetUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.api.capacitor.CapabilityCapacitorData since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.EnderIOMachines since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.conduit.oc.EnderIOConduitsOpenComputers for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.conduit.oc.EnderIOConduitsOpenComputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.TileEntityEio since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.RecipeButtonHandler since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTicLate since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialOredicts since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botania.BotaniaUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.registry.Registry since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.top.TOPUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.events.ModSoundRegisterEvent since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentRepellent since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRegistry since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.fuels.FuelUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.techreborn.TechRebornUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKeyRegistry since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.IntegrationRegistry since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2e.IC2eUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.diagnostics.EnderIOCrashCallable since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineTileEntity since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.entity.EntityFallingMachine since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.teleport.telepad.TeleportEntityRenderHandler since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.render.PaintRegistry since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.conduitprobe.ToolTickHandler since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRenderManager since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.ConduitInOutRenderer since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.capacitor.CapacitorKey since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedController since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.energy.EnergyUpgrade since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ClientProxy since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.machine.capbank.network.ClientNetworkManager since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModTileEntity since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawner since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.immersiveengineering.ImmersiveEngineeringUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialRecipes since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.eggs.EntityOwlEgg since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.LootManager since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.draconic.DraconicUtil since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into enderioconduitsopencomputers for type INSTANCE | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for crazypants.enderio.base.EnderIO.instance since it is not for mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod enderioconduitsopencomputers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Bar Step: Construction - Ender IO Open Computers Conduits took 0.015s | |
| [22:53:00] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/EnderIO$1 | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/diagnostics/EnderIOCrashCallable | |
| [22:53:00] [Client thread/TRACE] [FML]: Mod enderioconduitsrefinedstorage is using network checker : Invoking method checkModLists | |
| [22:53:00] [Client thread/TRACE] [FML]: Testing mod enderioconduitsrefinedstorage to verify it accepts its own version in a remote connection | |
| [22:53:00] [Client thread/TRACE] [FML]: The mod enderioconduitsrefinedstorage accepts its own version (5.0.44) | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.conduits.EnderIOConduits.proxy since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.base.EnderIO.proxy since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.railcraft.RailcraftUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.util.DynaTextureProvider$Unloader since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.PaintTooltipUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.magnet.MagnetController since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.conduit.geom.ConduitGeometryUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.flippers.SwimUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ae2.AE2Util since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.gardencore.GardencoreUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineObject since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.transceiver.ServerChannelRegister since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.jump.JumpUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.travel.TravelUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitTileEntity since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.EnderItemOverrideList since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.hoe.HoeUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.metallurgy.MetallurgyUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingHandler since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.power.wireless.WirelessChargerController since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemInventoryCharger since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.sound.SoundRegistry since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.recipes.PowerToolRecipes since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.BlockStateWrapperBase since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.ServerTickHandler since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.matteroverdrive.MatterOverdriveUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mekanism.MekanismUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.BlockStateWrapperConduitBundle since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.spoon.SpoonUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.NoFertilizer since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemDarkSteelCrook since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.infinity.InfinityFogDropHandler since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.magicalcrops.MagicalcropsUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ClientProxy since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.PlayerAOEAttributeHandler since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.te.TEUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.autosave.ConduitHandlers since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.teleport.ChunkTicket since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionConfusion since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.filter.recipes.FilterRecipes since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.bop.BoPUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.SwordHandler since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModObjectRegistry since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolObject since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.autosave.BaseHandlers since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionWithering since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveDepthUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2c.IC2cUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.me.EnderIOConduitsAppliedEnergistics since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.natura.NaturaUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mfr.MFRUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.obelisk.weather.BlockWeatherObelisk since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.FarmersRegistry since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolTileEntity since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTic since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.thaumcraft.ThaumcraftUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.basemetals.BaseMetalsUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitObject since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKey since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botany.BotanyUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherWeapon since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.killera.ZombieCache since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.spawner.BrokenSpawnerHandler since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionFloating since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.fluid.Fluids since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelController since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.conduit.refinedstorage.EnderIOConduitsRefinedStorage for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.conduit.refinedstorage.EnderIOConduitsRefinedStorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherArrow since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.Fertilizer since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.capacitor.CapacitorKey since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelRecipeManager since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.Loot since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.chickens.ChickensUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.direct.DirectUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.recipes.MachineRecipes since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.exu2.ExU2Util since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.glider.GliderUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.charge.EntityPrimedCharge since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.darksteel.upgrade.solar.SolarUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.elytra.ElytraUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentShimmer since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.storage.StorageUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.material.MaterialCraftingHandler since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.darksteel.anvil.BlockDarkSteelAnvil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.coldfire.BlockColdFire since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.tic.TicUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.sound.SoundDetectorUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.forestry.EnderIOIntegrationForestry since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.HandlerSoulBound since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mysticalagriculture.MysticalAgricultureUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.actuallyadditions.ActuallyadditionsUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.registry.SmartModelAttacher since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.autosave.MachineHandlers since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.nightvision.NightVisionUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.handler.ConduitBreakSpeedHandler since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawnerUser since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentSoulBound since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveCarpetUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.api.capacitor.CapabilityCapacitorData since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.EnderIOMachines since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.oc.EnderIOConduitsOpenComputers since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.TileEntityEio since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.RecipeButtonHandler since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTicLate since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialOredicts since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botania.BotaniaUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.registry.Registry since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.top.TOPUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.events.ModSoundRegisterEvent since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentRepellent since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRegistry since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.fuels.FuelUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.techreborn.TechRebornUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKeyRegistry since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.IntegrationRegistry since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2e.IC2eUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.diagnostics.EnderIOCrashCallable since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineTileEntity since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.entity.EntityFallingMachine since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.teleport.telepad.TeleportEntityRenderHandler since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.render.PaintRegistry since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.conduitprobe.ToolTickHandler since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRenderManager since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.ConduitInOutRenderer since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.capacitor.CapacitorKey since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedController since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.energy.EnergyUpgrade since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ClientProxy since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.machine.capbank.network.ClientNetworkManager since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModTileEntity since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawner since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.immersiveengineering.ImmersiveEngineeringUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialRecipes since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.eggs.EntityOwlEgg since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.LootManager since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.draconic.DraconicUtil since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into enderioconduitsrefinedstorage for type INSTANCE | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for crazypants.enderio.base.EnderIO.instance since it is not for mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod enderioconduitsrefinedstorage | |
| [22:53:00] [Client thread/DEBUG] [FML]: Bar Step: Construction - Ender IO Refined Storage Conduits took 0.012s | |
| [22:53:00] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/EnderIO$1 | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/diagnostics/EnderIOCrashCallable | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Found annotation mixin: crazypants.enderio.integration.forestry.upgrades.ArmorMixin | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Registered mixin. | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Found mixin source class data for crazypants.enderio.integration.forestry.upgrades.ArmorMixin. | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Found 1 patch to apply to class crazypants.enderio.integration.forestry.upgrades.ArmorMixin from implemented interfaces: [crazypants/enderio/api/upgrades/IDarkSteelItem] | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Patching 1 mixins onto class crazypants.enderio.integration.forestry.upgrades.ArmorMixin | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Added 1 new interface: [com/enderio/core/api/client/gui/IAdvancedTooltipProvider] | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Added 5 new methods: [initCapabilities(Lnet/minecraft/item/ItemStack;Lnet/minecraft/nbt/NBTTagCompound;)Lnet/minecraftforge/common/capabilities/ICapabilityProvider;, getAttributeModifiers(Lnet/minecraft/inventory/EntityEquipmentSlot;Lnet/minecraft/item/ItemStack;)Lcom/google/common/collect/Multimap;, addCommonEntries(Lnet/minecraft/item/ItemStack;Lnet/minecraft/entity/player/EntityPlayer;Ljava/util/List;Z)V, addBasicEntries(Lnet/minecraft/item/ItemStack;Lnet/minecraft/entity/player/EntityPlayer;Ljava/util/List;Z)V, addDetailedEntries(Lnet/minecraft/item/ItemStack;Lnet/minecraft/entity/player/EntityPlayer;Ljava/util/List;Z)V] | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Successfully patched. | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Found 1 patch to apply to class crazypants.enderio.base.item.darksteel.ItemDarkSteelArmor from implemented interfaces: [crazypants/enderio/api/upgrades/IDarkSteelItem] | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Patching 2 mixins onto class crazypants.enderio.base.item.darksteel.ItemDarkSteelArmor | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Added 2 new interfaces: [forestry/api/apiculture/IArmorApiarist, forestry/api/core/IArmorNaturalist] | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Added 2 new methods: [canSeePollination(Lnet/minecraft/entity/player/EntityPlayer;Lnet/minecraft/item/ItemStack;Z)Z, protectEntity(Lnet/minecraft/entity/EntityLivingBase;Lnet/minecraft/item/ItemStack;Ljava/lang/String;Z)Z] | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Added 3 new methods: [initCapabilities(Lnet/minecraft/item/ItemStack;Lnet/minecraft/nbt/NBTTagCompound;)Lnet/minecraftforge/common/capabilities/ICapabilityProvider;, addCommonEntries(Lnet/minecraft/item/ItemStack;Lnet/minecraft/entity/player/EntityPlayer;Ljava/util/List;Z)V, addBasicEntries(Lnet/minecraft/item/ItemStack;Lnet/minecraft/entity/player/EntityPlayer;Ljava/util/List;Z)V] | |
| [22:53:00] [Client thread/INFO] [EnderCore Mixins]: Successfully patched. | |
| [22:53:00] [Client thread/TRACE] [FML]: Mod enderiointegrationforestry is using network checker : Invoking method checkModLists | |
| [22:53:00] [Client thread/TRACE] [FML]: Testing mod enderiointegrationforestry to verify it accepts its own version in a remote connection | |
| [22:53:00] [Client thread/TRACE] [FML]: The mod enderiointegrationforestry accepts its own version (5.0.44) | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.conduits.EnderIOConduits.proxy since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.base.EnderIO.proxy since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.railcraft.RailcraftUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.util.DynaTextureProvider$Unloader since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.PaintTooltipUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.magnet.MagnetController since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.conduit.geom.ConduitGeometryUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.flippers.SwimUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ae2.AE2Util since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.gardencore.GardencoreUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineObject since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.transceiver.ServerChannelRegister since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.jump.JumpUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.travel.TravelUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitTileEntity since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.EnderItemOverrideList since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.hoe.HoeUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.metallurgy.MetallurgyUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingHandler since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.power.wireless.WirelessChargerController since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemInventoryCharger since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.sound.SoundRegistry since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.recipes.PowerToolRecipes since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.BlockStateWrapperBase since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.ServerTickHandler since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.matteroverdrive.MatterOverdriveUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mekanism.MekanismUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.BlockStateWrapperConduitBundle since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.spoon.SpoonUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.NoFertilizer since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemDarkSteelCrook since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.infinity.InfinityFogDropHandler since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.magicalcrops.MagicalcropsUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ClientProxy since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.PlayerAOEAttributeHandler since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.te.TEUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.autosave.ConduitHandlers since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.teleport.ChunkTicket since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionConfusion since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.filter.recipes.FilterRecipes since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.bop.BoPUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.SwordHandler since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModObjectRegistry since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolObject since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.autosave.BaseHandlers since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionWithering since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveDepthUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2c.IC2cUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.me.EnderIOConduitsAppliedEnergistics since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.natura.NaturaUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mfr.MFRUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.obelisk.weather.BlockWeatherObelisk since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.FarmersRegistry since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolTileEntity since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTic since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.thaumcraft.ThaumcraftUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.basemetals.BaseMetalsUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitObject since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKey since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botany.BotanyUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherWeapon since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.killera.ZombieCache since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.spawner.BrokenSpawnerHandler since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionFloating since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.fluid.Fluids since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelController since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.refinedstorage.EnderIOConduitsRefinedStorage since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherArrow since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.Fertilizer since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.capacitor.CapacitorKey since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelRecipeManager since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.Loot since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.chickens.ChickensUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.direct.DirectUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.recipes.MachineRecipes since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.exu2.ExU2Util since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.glider.GliderUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.charge.EntityPrimedCharge since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.darksteel.upgrade.solar.SolarUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.elytra.ElytraUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentShimmer since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.storage.StorageUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.material.MaterialCraftingHandler since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.darksteel.anvil.BlockDarkSteelAnvil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.coldfire.BlockColdFire since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.tic.TicUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.sound.SoundDetectorUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.integration.forestry.EnderIOIntegrationForestry for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.integration.forestry.EnderIOIntegrationForestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.HandlerSoulBound since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mysticalagriculture.MysticalAgricultureUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.actuallyadditions.ActuallyadditionsUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.registry.SmartModelAttacher since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.autosave.MachineHandlers since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.nightvision.NightVisionUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.handler.ConduitBreakSpeedHandler since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawnerUser since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentSoulBound since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveCarpetUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.api.capacitor.CapabilityCapacitorData since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.EnderIOMachines since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.oc.EnderIOConduitsOpenComputers since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.TileEntityEio since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.RecipeButtonHandler since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTicLate since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialOredicts since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botania.BotaniaUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.registry.Registry since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.top.TOPUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.events.ModSoundRegisterEvent since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentRepellent since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRegistry since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.fuels.FuelUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.techreborn.TechRebornUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKeyRegistry since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.IntegrationRegistry since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2e.IC2eUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.diagnostics.EnderIOCrashCallable since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineTileEntity since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.entity.EntityFallingMachine since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.teleport.telepad.TeleportEntityRenderHandler since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.render.PaintRegistry since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.conduitprobe.ToolTickHandler since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRenderManager since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.ConduitInOutRenderer since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.capacitor.CapacitorKey since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedController since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.energy.EnergyUpgrade since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ClientProxy since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.machine.capbank.network.ClientNetworkManager since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModTileEntity since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawner since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.immersiveengineering.ImmersiveEngineeringUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialRecipes since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.eggs.EntityOwlEgg since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.LootManager since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.draconic.DraconicUtil since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into enderiointegrationforestry for type INSTANCE | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for crazypants.enderio.base.EnderIO.instance since it is not for mod enderiointegrationforestry | |
| [22:53:00] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod enderiointegrationforestry | |
| [22:53:00] [Client thread/DEBUG] [FML]: Bar Step: Construction - Ender IO Integration with Forestry took 0.149s | |
| [22:53:00] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/EnderIO$1 | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/diagnostics/EnderIOCrashCallable | |
| [22:53:00] [Client thread/TRACE] [FML]: Mod enderiointegrationticlate is using network checker : Invoking method checkModLists | |
| [22:53:00] [Client thread/TRACE] [FML]: Testing mod enderiointegrationticlate to verify it accepts its own version in a remote connection | |
| [22:53:00] [Client thread/TRACE] [FML]: The mod enderiointegrationticlate accepts its own version (5.0.44) | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.conduits.EnderIOConduits.proxy since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.base.EnderIO.proxy since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.railcraft.RailcraftUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.util.DynaTextureProvider$Unloader since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.PaintTooltipUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.magnet.MagnetController since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.conduit.geom.ConduitGeometryUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.flippers.SwimUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ae2.AE2Util since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.gardencore.GardencoreUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineObject since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.transceiver.ServerChannelRegister since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.jump.JumpUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.travel.TravelUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitTileEntity since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.EnderItemOverrideList since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.hoe.HoeUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.metallurgy.MetallurgyUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingHandler since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.power.wireless.WirelessChargerController since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemInventoryCharger since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.sound.SoundRegistry since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.recipes.PowerToolRecipes since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.BlockStateWrapperBase since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.ServerTickHandler since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.matteroverdrive.MatterOverdriveUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mekanism.MekanismUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.BlockStateWrapperConduitBundle since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.spoon.SpoonUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.NoFertilizer since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemDarkSteelCrook since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.infinity.InfinityFogDropHandler since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.magicalcrops.MagicalcropsUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ClientProxy since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.PlayerAOEAttributeHandler since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.te.TEUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.autosave.ConduitHandlers since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.teleport.ChunkTicket since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionConfusion since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.filter.recipes.FilterRecipes since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.bop.BoPUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.SwordHandler since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModObjectRegistry since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolObject since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.autosave.BaseHandlers since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionWithering since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveDepthUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2c.IC2cUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.me.EnderIOConduitsAppliedEnergistics since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.natura.NaturaUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mfr.MFRUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.obelisk.weather.BlockWeatherObelisk since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.FarmersRegistry since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolTileEntity since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTic since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.thaumcraft.ThaumcraftUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.basemetals.BaseMetalsUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitObject since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKey since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botany.BotanyUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherWeapon since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.killera.ZombieCache since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.spawner.BrokenSpawnerHandler since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionFloating since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.fluid.Fluids since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelController since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.refinedstorage.EnderIOConduitsRefinedStorage since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherArrow since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.Fertilizer since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.capacitor.CapacitorKey since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelRecipeManager since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.Loot since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.chickens.ChickensUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.direct.DirectUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.recipes.MachineRecipes since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.exu2.ExU2Util since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.glider.GliderUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.charge.EntityPrimedCharge since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.darksteel.upgrade.solar.SolarUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.elytra.ElytraUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentShimmer since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.storage.StorageUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.material.MaterialCraftingHandler since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.darksteel.anvil.BlockDarkSteelAnvil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.coldfire.BlockColdFire since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.tic.TicUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.sound.SoundDetectorUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.forestry.EnderIOIntegrationForestry since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.HandlerSoulBound since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mysticalagriculture.MysticalAgricultureUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.actuallyadditions.ActuallyadditionsUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.registry.SmartModelAttacher since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.autosave.MachineHandlers since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.nightvision.NightVisionUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.handler.ConduitBreakSpeedHandler since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawnerUser since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentSoulBound since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveCarpetUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.api.capacitor.CapabilityCapacitorData since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.EnderIOMachines since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.oc.EnderIOConduitsOpenComputers since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.TileEntityEio since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.RecipeButtonHandler since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.integration.tic.EnderIOIntegrationTicLate for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.integration.tic.EnderIOIntegrationTicLate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialOredicts since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botania.BotaniaUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.registry.Registry since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.top.TOPUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.events.ModSoundRegisterEvent since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentRepellent since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRegistry since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.fuels.FuelUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.techreborn.TechRebornUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKeyRegistry since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.IntegrationRegistry since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2e.IC2eUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.diagnostics.EnderIOCrashCallable since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineTileEntity since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.entity.EntityFallingMachine since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.teleport.telepad.TeleportEntityRenderHandler since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.render.PaintRegistry since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.conduitprobe.ToolTickHandler since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRenderManager since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.ConduitInOutRenderer since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.capacitor.CapacitorKey since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedController since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.energy.EnergyUpgrade since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ClientProxy since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.machine.capbank.network.ClientNetworkManager since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModTileEntity since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawner since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.immersiveengineering.ImmersiveEngineeringUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialRecipes since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.eggs.EntityOwlEgg since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.LootManager since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.draconic.DraconicUtil since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into enderiointegrationticlate for type INSTANCE | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for crazypants.enderio.base.EnderIO.instance since it is not for mod enderiointegrationticlate | |
| [22:53:00] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod enderiointegrationticlate | |
| [22:53:00] [Client thread/DEBUG] [FML]: Bar Step: Construction - Ender IO Integration with Tinkers' Construct took 0.010s | |
| [22:53:00] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/EnderIO$1 | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/diagnostics/EnderIOCrashCallable | |
| [22:53:00] [Client thread/TRACE] [FML]: Mod enderiomachines is using network checker : Invoking method checkModLists | |
| [22:53:00] [Client thread/TRACE] [FML]: Testing mod enderiomachines to verify it accepts its own version in a remote connection | |
| [22:53:00] [Client thread/TRACE] [FML]: The mod enderiomachines accepts its own version (5.0.44) | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.conduits.EnderIOConduits.proxy since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.base.EnderIO.proxy since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.railcraft.RailcraftUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.util.DynaTextureProvider$Unloader since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.PaintTooltipUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.magnet.MagnetController since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.conduit.geom.ConduitGeometryUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.flippers.SwimUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ae2.AE2Util since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.gardencore.GardencoreUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.machines.init.MachineObject for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.machines.init.MachineObject | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.transceiver.ServerChannelRegister since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.jump.JumpUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.travel.TravelUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitTileEntity since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.EnderItemOverrideList since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.hoe.HoeUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.metallurgy.MetallurgyUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingHandler since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.power.wireless.WirelessChargerController since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemInventoryCharger since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.sound.SoundRegistry since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.recipes.PowerToolRecipes since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.BlockStateWrapperBase since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.ServerTickHandler since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.matteroverdrive.MatterOverdriveUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mekanism.MekanismUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.BlockStateWrapperConduitBundle since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.spoon.SpoonUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.NoFertilizer since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemDarkSteelCrook since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.infinity.InfinityFogDropHandler since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.magicalcrops.MagicalcropsUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ClientProxy since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.PlayerAOEAttributeHandler since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.te.TEUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.autosave.ConduitHandlers since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.teleport.ChunkTicket since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionConfusion since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.filter.recipes.FilterRecipes since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.bop.BoPUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.SwordHandler since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModObjectRegistry since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolObject since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.autosave.BaseHandlers since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionWithering since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveDepthUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2c.IC2cUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.me.EnderIOConduitsAppliedEnergistics since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.natura.NaturaUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mfr.MFRUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.machines.machine.obelisk.weather.BlockWeatherObelisk for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.machines.machine.obelisk.weather.BlockWeatherObelisk | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.FarmersRegistry since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolTileEntity since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTic since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.thaumcraft.ThaumcraftUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.basemetals.BaseMetalsUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitObject since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKey since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botany.BotanyUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherWeapon since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.killera.ZombieCache since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.spawner.BrokenSpawnerHandler since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionFloating since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.fluid.Fluids since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelController since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.refinedstorage.EnderIOConduitsRefinedStorage since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherArrow since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.Fertilizer since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.capacitor.CapacitorKey since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelRecipeManager since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.Loot since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.chickens.ChickensUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.direct.DirectUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.recipes.MachineRecipes since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.exu2.ExU2Util since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.glider.GliderUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.charge.EntityPrimedCharge since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.machines.darksteel.upgrade.solar.SolarUpgrade for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.machines.darksteel.upgrade.solar.SolarUpgrade | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.elytra.ElytraUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentShimmer since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.storage.StorageUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.material.MaterialCraftingHandler since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.darksteel.anvil.BlockDarkSteelAnvil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.coldfire.BlockColdFire since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.tic.TicUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.sound.SoundDetectorUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.forestry.EnderIOIntegrationForestry since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.HandlerSoulBound since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mysticalagriculture.MysticalAgricultureUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.actuallyadditions.ActuallyadditionsUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.registry.SmartModelAttacher since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.machines.autosave.MachineHandlers for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.machines.autosave.MachineHandlers | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.nightvision.NightVisionUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.handler.ConduitBreakSpeedHandler since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawnerUser since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentSoulBound since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveCarpetUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.api.capacitor.CapabilityCapacitorData since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.machines.EnderIOMachines for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.machines.EnderIOMachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.oc.EnderIOConduitsOpenComputers since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.TileEntityEio since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.RecipeButtonHandler since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTicLate since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialOredicts since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botania.BotaniaUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.registry.Registry since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.top.TOPUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.events.ModSoundRegisterEvent since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentRepellent since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRegistry since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.fuels.FuelUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.techreborn.TechRebornUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKeyRegistry since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.IntegrationRegistry since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2e.IC2eUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.diagnostics.EnderIOCrashCallable since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.machines.init.MachineTileEntity for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.machines.init.MachineTileEntity | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.entity.EntityFallingMachine since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.machines.machine.teleport.telepad.TeleportEntityRenderHandler for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.machines.machine.teleport.telepad.TeleportEntityRenderHandler | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.render.PaintRegistry since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.conduitprobe.ToolTickHandler since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRenderManager since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.ConduitInOutRenderer since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.machines.capacitor.CapacitorKey for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.machines.capacitor.CapacitorKey | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedController since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.energy.EnergyUpgrade since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ClientProxy since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.machine.capbank.network.ClientNetworkManager since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModTileEntity since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawner since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.immersiveengineering.ImmersiveEngineeringUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialRecipes since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.eggs.EntityOwlEgg since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.LootManager since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.draconic.DraconicUtil since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into enderiomachines for type INSTANCE | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for crazypants.enderio.base.EnderIO.instance since it is not for mod enderiomachines | |
| [22:53:00] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod enderiomachines | |
| [22:53:00] [Client thread/DEBUG] [FML]: Bar Step: Construction - Ender IO Machines took 0.391s | |
| [22:53:00] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/EnderIO$1 | |
| [22:53:00] [Client thread/DEBUG] [forge]: crazypants/enderio/base/diagnostics/EnderIOCrashCallable | |
| [22:53:00] [Client thread/TRACE] [FML]: Mod enderiopowertools is using network checker : Invoking method checkModLists | |
| [22:53:00] [Client thread/TRACE] [FML]: Testing mod enderiopowertools to verify it accepts its own version in a remote connection | |
| [22:53:00] [Client thread/TRACE] [FML]: The mod enderiopowertools accepts its own version (5.0.44) | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.conduits.EnderIOConduits.proxy since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping proxy injection for crazypants.enderio.base.EnderIO.proxy since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.railcraft.RailcraftUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.util.DynaTextureProvider$Unloader since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.PaintTooltipUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.magnet.MagnetController since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.conduit.geom.ConduitGeometryUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.flippers.SwimUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ae2.AE2Util since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.gardencore.GardencoreUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineObject since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.transceiver.ServerChannelRegister since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.jump.JumpUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.travel.TravelUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitTileEntity since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.EnderItemOverrideList since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.hoe.HoeUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.metallurgy.MetallurgyUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingHandler since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.power.wireless.WirelessChargerController since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemInventoryCharger since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.sound.SoundRegistry since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.powertools.recipes.PowerToolRecipes for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.powertools.recipes.PowerToolRecipes | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.pipeline.BlockStateWrapperBase since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.ServerTickHandler since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.matteroverdrive.MatterOverdriveUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mekanism.MekanismUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.BlockStateWrapperConduitBundle since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.spoon.SpoonUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.NoFertilizer since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.ItemDarkSteelCrook since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.infinity.InfinityFogDropHandler since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.magicalcrops.MagicalcropsUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ClientProxy since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.PlayerAOEAttributeHandler since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.te.TEUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.autosave.ConduitHandlers since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.teleport.ChunkTicket since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionConfusion since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.filter.recipes.FilterRecipes since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.bop.BoPUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.SwordHandler since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModObjectRegistry since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.powertools.init.PowerToolObject for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.powertools.init.PowerToolObject | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.autosave.BaseHandlers since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionWithering since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveDepthUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2c.IC2cUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.me.EnderIOConduitsAppliedEnergistics since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.natura.NaturaUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mfr.MFRUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.obelisk.weather.BlockWeatherObelisk since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.FarmersRegistry since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.powertools.init.PowerToolTileEntity since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTic since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.thaumcraft.ThaumcraftUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.basemetals.BaseMetalsUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.init.ConduitObject since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKey since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botany.BotanyUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherWeapon since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.killera.ZombieCache since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.spawner.BrokenSpawnerHandler since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.potion.PotionFloating since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.fluid.Fluids since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelController since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.refinedstorage.EnderIOConduitsRefinedStorage since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentWitherArrow since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.fertilizer.Fertilizer since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.powertools.capacitor.CapacitorKey for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.powertools.capacitor.CapacitorKey | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.DarkSteelRecipeManager since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.Loot since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.chickens.ChickensUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.direct.DirectUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.recipes.MachineRecipes since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.exu2.ExU2Util since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.padding.PaddingUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.glider.GliderUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.charge.EntityPrimedCharge since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.darksteel.upgrade.solar.SolarUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.elytra.ElytraUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentShimmer since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.storage.StorageUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.material.MaterialCraftingHandler since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.darksteel.anvil.BlockDarkSteelAnvil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.block.coldfire.BlockColdFire since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.tic.TicUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.sound.SoundDetectorUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.forestry.EnderIOIntegrationForestry since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.HandlerSoulBound since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.mysticalagriculture.MysticalAgricultureUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.actuallyadditions.ActuallyadditionsUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.render.registry.SmartModelAttacher since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.autosave.MachineHandlers since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.nightvision.NightVisionUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.handler.ConduitBreakSpeedHandler since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawnerUser since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentSoulBound since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.explosive.ExplosiveCarpetUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.api.capacitor.CapabilityCapacitorData since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.EnderIOMachines since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduit.oc.EnderIOConduitsOpenComputers since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.TileEntityEio since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.RecipeButtonHandler since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.integration.tic.EnderIOIntegrationTicLate since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialOredicts since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.botania.BotaniaUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.farming.registry.Registry since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.top.TOPUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.events.ModSoundRegisterEvent since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.enchantment.EnchantmentRepellent since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRegistry since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.fuels.FuelUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.techreborn.TechRebornUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.capacitor.CapacitorKeyRegistry since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.IntegrationRegistry since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.ic2e.IC2eUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.diagnostics.EnderIOCrashCallable since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.init.MachineTileEntity since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.machine.entity.EntityFallingMachine since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.teleport.telepad.TeleportEntityRenderHandler since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.paint.render.PaintRegistry since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.conduitprobe.ToolTickHandler since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.handler.darksteel.UpgradeRenderManager since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.conduits.render.ConduitInOutRenderer since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.capacitor.CapacitorKey since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.speed.SpeedController since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.darksteel.upgrade.energy.EnergyUpgrade since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ClientProxy since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for crazypants.enderio.powertools.machine.capbank.network.ClientNetworkManager for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class crazypants.enderio.powertools.machine.capbank.network.ClientNetworkManager | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.init.ModTileEntity since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.machines.machine.spawner.creative.ContainerCreativeSpawner since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.immersiveengineering.ImmersiveEngineeringUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.material.recipes.MaterialRecipes since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.item.eggs.EntityOwlEgg since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.loot.LootManager since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for crazypants.enderio.base.integration.draconic.DraconicUtil since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into enderiopowertools for type INSTANCE | |
| [22:53:00] [Client thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for crazypants.enderio.base.EnderIO.instance since it is not for mod enderiopowertools | |
| [22:53:00] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod enderiopowertools | |
| [22:53:00] [Client thread/DEBUG] [FML]: Bar Step: Construction - Ender IO Powertools took 0.115s | |
| [22:53:00] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod enderutilities | |
| [22:53:00] [Client thread/TRACE] [FML]: Mod enderutilities is using network checker : Accepting version 0.7.12 | |
| [22:53:00] [Client thread/TRACE] [FML]: Testing mod enderutilities to verify it accepts its own version in a remote connection | |
| [22:53:00] [Client thread/TRACE] [FML]: The mod enderutilities accepts its own version (0.7.12) | |
| [22:53:00] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into enderutilities | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for enderutilities | |
| [22:53:01] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for fi.dy.masa.enderutilities.registry.EnderUtilitiesBlocks for mod enderutilities | |
| [22:53:01] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class fi.dy.masa.enderutilities.registry.EnderUtilitiesBlocks | |
| [22:53:01] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for fi.dy.masa.enderutilities.event.MissingMappingEventHandler for mod enderutilities | |
| [22:53:01] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class fi.dy.masa.enderutilities.event.MissingMappingEventHandler | |
| [22:53:01] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for fi.dy.masa.enderutilities.gui.client.base.GuiEnderUtilities for mod enderutilities | |
| [22:53:01] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class fi.dy.masa.enderutilities.gui.client.base.GuiEnderUtilities | |
| [22:53:01] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for fi.dy.masa.enderutilities.proxy.ClientProxy for mod enderutilities | |
| [22:53:01] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class fi.dy.masa.enderutilities.proxy.ClientProxy | |
| [22:53:01] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for fi.dy.masa.enderutilities.gui.client.GuiBarrel for mod enderutilities | |
| [22:53:01] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class fi.dy.masa.enderutilities.gui.client.GuiBarrel | |
| [22:53:01] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for fi.dy.masa.enderutilities.registry.EnderUtilitiesItems for mod enderutilities | |
| [22:53:01] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class fi.dy.masa.enderutilities.registry.EnderUtilitiesItems | |
| [22:53:01] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for fi.dy.masa.enderutilities.client.renderer.model.ModelNullifierBaked for mod enderutilities | |
| [22:53:01] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class fi.dy.masa.enderutilities.client.renderer.model.ModelNullifierBaked | |
| [22:53:01] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for fi.dy.masa.enderutilities.gui.client.GuiMSU for mod enderutilities | |
| [22:53:01] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class fi.dy.masa.enderutilities.gui.client.GuiMSU | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into enderutilities for type INSTANCE | |
| [22:53:01] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod enderutilities | |
| [22:53:01] [Client thread/DEBUG] [FML]: Bar Step: Construction - Ender Utilities took 0.565s | |
| [22:53:01] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod valkyrielib | |
| [22:53:01] [Client thread/TRACE] [FML]: Mod valkyrielib is using network checker : Accepting version 1.12.2-2.0.20.1 | |
| [22:53:01] [Client thread/TRACE] [FML]: Testing mod valkyrielib to verify it accepts its own version in a remote connection | |
| [22:53:01] [Client thread/TRACE] [FML]: The mod valkyrielib accepts its own version (1.12.2-2.0.20.1) | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into valkyrielib | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for valkyrielib | |
| [22:53:01] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.valkyrieofnight.vliblegacy.lib.registry.VLGameRegistry$BlockItemHandler for mod valkyrielib | |
| [22:53:01] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.valkyrieofnight.vliblegacy.lib.registry.VLGameRegistry$BlockItemHandler | |
| [22:53:01] [Client thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for com.valkyrieofnight.vlib.module.registry.VLGameRegistry since it is not for mod valkyrielib | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into valkyrielib for type INSTANCE | |
| [22:53:01] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod valkyrielib | |
| [22:53:01] [Client thread/DEBUG] [FML]: Bar Step: Construction - Valkyrie Lib took 0.233s | |
| [22:53:01] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod environmentaltech | |
| [22:53:01] [Client thread/TRACE] [FML]: Mod environmentaltech is using network checker : Accepting version 1.12.2-2.0.20.1 | |
| [22:53:01] [Client thread/TRACE] [FML]: Testing mod environmentaltech to verify it accepts its own version in a remote connection | |
| [22:53:01] [Client thread/TRACE] [FML]: The mod environmentaltech accepts its own version (1.12.2-2.0.20.1) | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into environmentaltech | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for environmentaltech | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into environmentaltech for type INSTANCE | |
| [22:53:01] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod environmentaltech | |
| [22:53:01] [Client thread/DEBUG] [FML]: Bar Step: Construction - Environmental Tech took 0.044s | |
| [22:53:01] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod shadowmc | |
| [22:53:01] [Client thread/TRACE] [FML]: Mod shadowmc is using network checker : Accepting version 3.8.0 | |
| [22:53:01] [Client thread/TRACE] [FML]: Testing mod shadowmc to verify it accepts its own version in a remote connection | |
| [22:53:01] [Client thread/TRACE] [FML]: The mod shadowmc accepts its own version (3.8.0) | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into shadowmc | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for shadowmc | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into shadowmc for type INSTANCE | |
| [22:53:01] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod shadowmc | |
| [22:53:01] [Client thread/DEBUG] [FML]: Bar Step: Construction - ShadowMC took 0.014s | |
| [22:53:01] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod extrarails | |
| [22:53:01] [Client thread/TRACE] [FML]: Mod extrarails is using network checker : Accepting version 1.3.0 | |
| [22:53:01] [Client thread/TRACE] [FML]: Testing mod extrarails to verify it accepts its own version in a remote connection | |
| [22:53:01] [Client thread/TRACE] [FML]: The mod extrarails accepts its own version (1.3.0) | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into extrarails | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for extrarails | |
| [22:53:01] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for net.shadowfacts.extrarails.ExtraRails$EventHandler for mod extrarails | |
| [22:53:01] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class net.shadowfacts.extrarails.ExtraRails$EventHandler | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into extrarails for type INSTANCE | |
| [22:53:01] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod extrarails | |
| [22:53:01] [Client thread/DEBUG] [FML]: Bar Step: Construction - Extra Rails took 0.061s | |
| [22:53:01] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod extrautils2 | |
| [22:53:01] [Client thread/TRACE] [FML]: Mod extrautils2 is using network checker : Accepting version 1.0 | |
| [22:53:01] [Client thread/TRACE] [FML]: Testing mod extrautils2 to verify it accepts its own version in a remote connection | |
| [22:53:01] [Client thread/TRACE] [FML]: The mod extrautils2 accepts its own version (1.0) | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into extrautils2 | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for extrautils2 | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into extrautils2 for type INSTANCE | |
| [22:53:01] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod extrautils2 | |
| [22:53:01] [Client thread/DEBUG] [FML]: Bar Step: Construction - Extra Utilities 2 took 0.068s | |
| [22:53:01] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod fastleafdecay | |
| [22:53:01] [Client thread/TRACE] [FML]: Mod fastleafdecay is using network checker : No network checking performed | |
| [22:53:01] [Client thread/TRACE] [FML]: Testing mod fastleafdecay to verify it accepts its own version in a remote connection | |
| [22:53:01] [Client thread/TRACE] [FML]: The mod fastleafdecay accepts its own version (v14) | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into fastleafdecay | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for fastleafdecay | |
| [22:53:01] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into fastleafdecay for type INSTANCE | |
| [22:53:01] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod fastleafdecay | |
| [22:53:01] [Client thread/DEBUG] [FML]: Bar Step: Construction - Fast Leaf Decay took 0.005s | |
| [22:53:01] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod forgelin | |
| [22:53:01] [Client thread/DEBUG] [KotlinAdapter]: FML has asked for Forgelin to be constructed | |
| [22:53:04] [Client thread/TRACE] [FML]: Mod forgelin is using network checker : No network checking performed | |
| [22:53:04] [Client thread/TRACE] [FML]: Testing mod forgelin to verify it accepts its own version in a remote connection | |
| [22:53:04] [Client thread/TRACE] [FML]: The mod forgelin accepts its own version (1.8.2) | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into forgelin | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for forgelin | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into forgelin for type INSTANCE | |
| [22:53:04] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod forgelin | |
| [22:53:04] [Client thread/DEBUG] [FML]: Bar Step: Construction - Shadowfacts' Forgelin took 2.334s | |
| [22:53:04] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod harvestersnight | |
| [22:53:04] [Client thread/TRACE] [FML]: Mod harvestersnight is using network checker : Accepting version 1.1.0 | |
| [22:53:04] [Client thread/TRACE] [FML]: Testing mod harvestersnight to verify it accepts its own version in a remote connection | |
| [22:53:04] [Client thread/TRACE] [FML]: The mod harvestersnight accepts its own version (1.1.0) | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into harvestersnight | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for harvestersnight | |
| [22:53:04] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for lykrast.harvestersnight.common.HarvestersNightConfig$EventHandler for mod harvestersnight | |
| [22:53:04] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class lykrast.harvestersnight.common.HarvestersNightConfig$EventHandler | |
| [22:53:04] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for lykrast.harvestersnight.common.HarvestersNight for mod harvestersnight | |
| [22:53:04] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class lykrast.harvestersnight.common.HarvestersNight | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into harvestersnight for type INSTANCE | |
| [22:53:04] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod harvestersnight | |
| [22:53:04] [Client thread/DEBUG] [FML]: Bar Step: Construction - Harvester's Night took 0.022s | |
| [22:53:04] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod hopperducts | |
| [22:53:04] [Client thread/TRACE] [FML]: Mod hopperducts is using network checker : Accepting version 1.5 | |
| [22:53:04] [Client thread/TRACE] [FML]: Testing mod hopperducts to verify it accepts its own version in a remote connection | |
| [22:53:04] [Client thread/TRACE] [FML]: The mod hopperducts accepts its own version (1.5) | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into hopperducts | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for hopperducts | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into hopperducts for type INSTANCE | |
| [22:53:04] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod hopperducts | |
| [22:53:04] [Client thread/DEBUG] [FML]: Bar Step: Construction - Hopper Ducts took 0.022s | |
| [22:53:04] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod huntingdim | |
| [22:53:04] [Client thread/TRACE] [FML]: Mod huntingdim is using network checker : Accepting version 1.0.38 | |
| [22:53:04] [Client thread/TRACE] [FML]: Testing mod huntingdim to verify it accepts its own version in a remote connection | |
| [22:53:04] [Client thread/TRACE] [FML]: The mod huntingdim accepts its own version (1.0.38) | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into huntingdim | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for huntingdim | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into huntingdim for type INSTANCE | |
| [22:53:04] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod huntingdim | |
| [22:53:04] [Client thread/DEBUG] [FML]: Bar Step: Construction - Hunting Dimension took 0.046s | |
| [22:53:04] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ichunutil | |
| [22:53:04] [Client thread/TRACE] [FML]: Mod ichunutil is using network checker : Accepting range fml.messages.version.restriction.bounded.upperexclusive | |
| [22:53:04] [Client thread/TRACE] [FML]: Testing mod ichunutil to verify it accepts its own version in a remote connection | |
| [22:53:04] [Client thread/TRACE] [FML]: The mod ichunutil accepts its own version (7.2.1) | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ichunutil | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ichunutil | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into ichunutil for type INSTANCE | |
| [22:53:04] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ichunutil | |
| [22:53:04] [Client thread/DEBUG] [FML]: Bar Step: Construction - iChunUtil took 0.093s | |
| [22:53:04] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod teslacorelib | |
| [22:53:04] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:53:04] [Client thread/DEBUG] [forge]: net/ndrei/teslacorelib/render/GhostedItemRenderer$renderItemInGUI$1 | |
| [22:53:04] [Client thread/DEBUG] [forge]: net/ndrei/teslacorelib/render/GhostedItemRenderer$renderItemInGUI$2 | |
| [22:53:04] [Client thread/DEBUG] [forge]: net/ndrei/teslacorelib/render/GhostedItemRenderer$renderItemInGUI$3 | |
| [22:53:04] [Client thread/DEBUG] [forge]: net/ndrei/teslacorelib/render/GhostedItemRenderer$renderItemInGUI$4 | |
| [22:53:04] [Client thread/DEBUG] [KotlinAdapter]: FML has asked for TeslaCoreLib to be constructed | |
| [22:53:04] [Client thread/TRACE] [FML]: Mod teslacorelib is using network checker : Accepting version 1.0.15 | |
| [22:53:04] [Client thread/TRACE] [FML]: Testing mod teslacorelib to verify it accepts its own version in a remote connection | |
| [22:53:04] [Client thread/TRACE] [FML]: The mod teslacorelib accepts its own version (1.0.15) | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into teslacorelib | |
| [22:53:04] [Client thread/DEBUG] [KotlinAdapter]: Setting proxy: TeslaCoreLib.proxy -> net.ndrei.teslacorelib.ClientProxy@19ae02f6 | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for teslacorelib | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into teslacorelib for type INSTANCE | |
| [22:53:04] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod teslacorelib | |
| [22:53:04] [Client thread/DEBUG] [FML]: Bar Step: Construction - Tesla Core Lib took 0.124s | |
| [22:53:04] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod industrialforegoing | |
| [22:53:04] [Client thread/TRACE] [FML]: Mod industrialforegoing is using network checker : Accepting version 1.12.2-1.12.2 | |
| [22:53:04] [Client thread/TRACE] [FML]: Testing mod industrialforegoing to verify it accepts its own version in a remote connection | |
| [22:53:04] [Client thread/TRACE] [FML]: The mod industrialforegoing accepts its own version (1.12.2-1.12.2) | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into industrialforegoing | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for industrialforegoing | |
| [22:53:04] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.buuz135.industrial.item.infinity.OneThreeFiveHandler for mod industrialforegoing | |
| [22:53:04] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.buuz135.industrial.item.infinity.OneThreeFiveHandler | |
| [22:53:04] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.buuz135.industrial.proxy.event.CocoaBeanRightClickHarvesting for mod industrialforegoing | |
| [22:53:04] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.buuz135.industrial.proxy.event.CocoaBeanRightClickHarvesting | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into industrialforegoing for type INSTANCE | |
| [22:53:04] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod industrialforegoing | |
| [22:53:04] [Client thread/DEBUG] [FML]: Bar Step: Construction - Industrial Foregoing took 0.124s | |
| [22:53:04] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod inventorypets | |
| [22:53:04] [Client thread/TRACE] [FML]: Mod inventorypets is using network checker : Accepting version 2.0.1 | |
| [22:53:04] [Client thread/TRACE] [FML]: Testing mod inventorypets to verify it accepts its own version in a remote connection | |
| [22:53:04] [Client thread/TRACE] [FML]: The mod inventorypets accepts its own version (2.0.1) | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into inventorypets | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for inventorypets | |
| [22:53:04] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.inventorypets.events.RecipeHandler for mod inventorypets | |
| [22:53:04] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.inventorypets.events.RecipeHandler | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into inventorypets for type INSTANCE | |
| [22:53:04] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod inventorypets | |
| [22:53:04] [Client thread/DEBUG] [FML]: Bar Step: Construction - Inventory Pets took 0.245s | |
| [22:53:04] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod inventorysorter | |
| [22:53:04] [Client thread/TRACE] [FML]: Mod inventorysorter is using network checker : Accepting version 1.13.3+57 | |
| [22:53:04] [Client thread/TRACE] [FML]: Testing mod inventorysorter to verify it accepts its own version in a remote connection | |
| [22:53:04] [Client thread/TRACE] [FML]: The mod inventorysorter accepts its own version (1.13.3+57) | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into inventorysorter | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for inventorysorter | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into inventorysorter for type INSTANCE | |
| [22:53:04] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod inventorysorter | |
| [22:53:04] [Client thread/DEBUG] [FML]: Bar Step: Construction - Simple Inventory sorting took 0.013s | |
| [22:53:04] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ironbackpacks | |
| [22:53:04] [Client thread/TRACE] [FML]: Mod ironbackpacks is using network checker : Accepting version 1.12.2-3.0.8-12 | |
| [22:53:04] [Client thread/TRACE] [FML]: Testing mod ironbackpacks to verify it accepts its own version in a remote connection | |
| [22:53:04] [Client thread/TRACE] [FML]: The mod ironbackpacks accepts its own version (1.12.2-3.0.8-12) | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ironbackpacks | |
| [22:53:04] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ironbackpacks | |
| [22:53:04] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for gr8pefish.ironbackpacks.client.ClientEventHandler for mod ironbackpacks | |
| [22:53:04] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class gr8pefish.ironbackpacks.client.ClientEventHandler | |
| [22:53:04] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for gr8pefish.ironbackpacks.core.EventHandler for mod ironbackpacks | |
| [22:53:04] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class gr8pefish.ironbackpacks.core.EventHandler | |
| [22:53:04] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for gr8pefish.ironbackpacks.ConfigHandler for mod ironbackpacks | |
| [22:53:04] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class gr8pefish.ironbackpacks.ConfigHandler | |
| [22:53:04] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for gr8pefish.ironbackpacks.core.RegistrarIronBackpacks for mod ironbackpacks | |
| [22:53:04] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class gr8pefish.ironbackpacks.core.RegistrarIronBackpacks | |
| [22:53:04] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for gr8pefish.ironbackpacks.core.UpgradeEventHandler for mod ironbackpacks | |
| [22:53:04] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class gr8pefish.ironbackpacks.core.UpgradeEventHandler | |
| [22:53:04] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for gr8pefish.ironbackpacks.core.RecipesIronBackpacks for mod ironbackpacks | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class gr8pefish.ironbackpacks.core.RecipesIronBackpacks | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into ironbackpacks for type INSTANCE | |
| [22:53:05] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ironbackpacks | |
| [22:53:05] [Client thread/DEBUG] [FML]: Bar Step: Construction - Iron Backpacks took 0.057s | |
| [22:53:05] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ironchest | |
| [22:53:05] [Client thread/TRACE] [FML]: Mod ironchest is using network checker : Accepting version 1.12.2-7.0.59.842 | |
| [22:53:05] [Client thread/TRACE] [FML]: Testing mod ironchest to verify it accepts its own version in a remote connection | |
| [22:53:05] [Client thread/TRACE] [FML]: The mod ironchest accepts its own version (1.12.2-7.0.59.842) | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ironchest | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ironchest | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for cpw.mods.ironchest.common.core.IronChestItems$Registration for mod ironchest | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class cpw.mods.ironchest.common.core.IronChestItems$Registration | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for cpw.mods.ironchest.common.core.IronChestBlocks$Registration for mod ironchest | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class cpw.mods.ironchest.common.core.IronChestBlocks$Registration | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into ironchest for type INSTANCE | |
| [22:53:05] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ironchest | |
| [22:53:05] [Client thread/DEBUG] [FML]: Bar Step: Construction - Iron Chest took 0.051s | |
| [22:53:05] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ironfurnaces | |
| [22:53:05] [Client thread/TRACE] [FML]: Mod ironfurnaces is using network checker : Accepting version 1.3.3 | |
| [22:53:05] [Client thread/TRACE] [FML]: Testing mod ironfurnaces to verify it accepts its own version in a remote connection | |
| [22:53:05] [Client thread/TRACE] [FML]: The mod ironfurnaces accepts its own version (1.3.3) | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ironfurnaces | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ironfurnaces | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.xenomustache.ironfurnaces.IronFurnaces$RegistrationHandler for mod ironfurnaces | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.xenomustache.ironfurnaces.IronFurnaces$RegistrationHandler | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.xenomustache.ironfurnaces.ModConfig$EventHandler for mod ironfurnaces | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.xenomustache.ironfurnaces.ModConfig$EventHandler | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into ironfurnaces for type INSTANCE | |
| [22:53:05] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ironfurnaces | |
| [22:53:05] [Client thread/DEBUG] [FML]: Bar Step: Construction - Iron Furnaces took 0.028s | |
| [22:53:05] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod itemfilters | |
| [22:53:05] [Client thread/TRACE] [FML]: Mod itemfilters is using network checker : Accepting version 1.0.3.12 | |
| [22:53:05] [Client thread/TRACE] [FML]: Testing mod itemfilters to verify it accepts its own version in a remote connection | |
| [22:53:05] [Client thread/TRACE] [FML]: The mod itemfilters accepts its own version (1.0.3.12) | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into itemfilters | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for itemfilters | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.latmod.mods.itemfilters.client.ItemFiltersClientEventHandler for mod itemfilters | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.latmod.mods.itemfilters.client.ItemFiltersClientEventHandler | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.latmod.mods.itemfilters.ItemFiltersEventHandler for mod itemfilters | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.latmod.mods.itemfilters.ItemFiltersEventHandler | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into itemfilters for type INSTANCE | |
| [22:53:05] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod itemfilters | |
| [22:53:05] [Client thread/DEBUG] [FML]: Bar Step: Construction - Item Filters took 0.033s | |
| [22:53:05] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod journeymap | |
| [22:53:05] [Client thread/TRACE] [FML]: Mod journeymap is using network checker : Invoking method checkModLists | |
| [22:53:05] [Client thread/TRACE] [FML]: Testing mod journeymap to verify it accepts its own version in a remote connection | |
| [22:53:05] [Client thread/TRACE] [FML]: The mod journeymap accepts its own version (1.12.2-5.5.4) | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into journeymap | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for journeymap | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into journeymap for type INSTANCE | |
| [22:53:05] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod journeymap | |
| [22:53:05] [Client thread/DEBUG] [FML]: Bar Step: Construction - JourneyMap took 0.046s | |
| [22:53:05] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod jaff | |
| [22:53:05] [Client thread/TRACE] [FML]: Mod jaff is using network checker : Accepting version 1.7_for_1.12 | |
| [22:53:05] [Client thread/TRACE] [FML]: Testing mod jaff to verify it accepts its own version in a remote connection | |
| [22:53:05] [Client thread/TRACE] [FML]: The mod jaff accepts its own version (1.7_for_1.12) | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into jaff | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for jaff | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into jaff for type INSTANCE | |
| [22:53:05] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod jaff | |
| [22:53:05] [Client thread/DEBUG] [FML]: Bar Step: Construction - Just a Few Fish took 0.351s | |
| [22:53:05] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod keepinginventory | |
| [22:53:05] [Client thread/TRACE] [FML]: Mod keepinginventory is using network checker : No network checking performed | |
| [22:53:05] [Client thread/TRACE] [FML]: Testing mod keepinginventory to verify it accepts its own version in a remote connection | |
| [22:53:05] [Client thread/TRACE] [FML]: The mod keepinginventory accepts its own version (2.4) | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into keepinginventory | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for keepinginventory | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for silly511.keepinginventory.KeepingInventory for mod keepinginventory | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class silly511.keepinginventory.KeepingInventory | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into keepinginventory for type INSTANCE | |
| [22:53:05] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod keepinginventory | |
| [22:53:05] [Client thread/DEBUG] [FML]: Bar Step: Construction - Keeping Inventory took 0.014s | |
| [22:53:05] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod lex | |
| [22:53:05] [Client thread/TRACE] [FML]: Mod lex is using network checker : Accepting version 1.0.8 | |
| [22:53:05] [Client thread/TRACE] [FML]: Testing mod lex to verify it accepts its own version in a remote connection | |
| [22:53:05] [Client thread/TRACE] [FML]: The mod lex accepts its own version (1.0.8) | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into lex | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for lex | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into lex for type INSTANCE | |
| [22:53:05] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod lex | |
| [22:53:05] [Client thread/DEBUG] [FML]: Bar Step: Construction - LibEx took 0.013s | |
| [22:53:05] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod littletiles | |
| [22:53:05] [Client thread/TRACE] [FML]: Mod littletiles is using network checker : Accepting version 1.5.0 | |
| [22:53:05] [Client thread/TRACE] [FML]: Testing mod littletiles to verify it accepts its own version in a remote connection | |
| [22:53:05] [Client thread/TRACE] [FML]: The mod littletiles accepts its own version (1.5.0) | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into littletiles | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for littletiles | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.creativemd.littletiles.LittleTiles for mod littletiles | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.creativemd.littletiles.LittleTiles | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.creativemd.littletiles.LittleTilesConfig for mod littletiles | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.creativemd.littletiles.LittleTilesConfig | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into littletiles for type INSTANCE | |
| [22:53:05] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod littletiles | |
| [22:53:05] [Client thread/DEBUG] [FML]: Bar Step: Construction - LittleTiles took 0.230s | |
| [22:53:05] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod lootbags | |
| [22:53:05] [Client thread/TRACE] [FML]: Mod lootbags is using network checker : Accepting version 2.5.8.5 | |
| [22:53:05] [Client thread/TRACE] [FML]: Testing mod lootbags to verify it accepts its own version in a remote connection | |
| [22:53:05] [Client thread/TRACE] [FML]: The mod lootbags accepts its own version (2.5.8.5) | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into lootbags | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for lootbags | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for mal.lootbags.LootBags$RegistrationHandler for mod lootbags | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class mal.lootbags.LootBags$RegistrationHandler | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into lootbags for type INSTANCE | |
| [22:53:05] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod lootbags | |
| [22:53:05] [Client thread/DEBUG] [FML]: Bar Step: Construction - Loot Bags took 0.073s | |
| [22:53:05] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mcjtylib_ng | |
| [22:53:05] [Client thread/TRACE] [FML]: Mod mcjtylib_ng is using network checker : Accepting version 3.5.2 | |
| [22:53:05] [Client thread/TRACE] [FML]: Testing mod mcjtylib_ng to verify it accepts its own version in a remote connection | |
| [22:53:05] [Client thread/TRACE] [FML]: The mod mcjtylib_ng accepts its own version (3.5.2) | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into mcjtylib_ng | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for mcjtylib_ng | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into mcjtylib_ng for type INSTANCE | |
| [22:53:05] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mcjtylib_ng | |
| [22:53:05] [Client thread/DEBUG] [FML]: Bar Step: Construction - McJtyLib took 0.035s | |
| [22:53:05] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod neat | |
| [22:53:05] [Client thread/TRACE] [FML]: Mod neat is using network checker : Accepting version 1.4-17 | |
| [22:53:05] [Client thread/TRACE] [FML]: Testing mod neat to verify it accepts its own version in a remote connection | |
| [22:53:05] [Client thread/TRACE] [FML]: The mod neat accepts its own version (1.4-17) | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into neat | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for neat | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into neat for type INSTANCE | |
| [22:53:05] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod neat | |
| [22:53:05] [Client thread/DEBUG] [FML]: Bar Step: Construction - Neat took 0.007s | |
| [22:53:05] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod netherendingores | |
| [22:53:05] [Client thread/TRACE] [FML]: Mod netherendingores is using network checker : Accepting version 1.12.2-1.3 | |
| [22:53:05] [Client thread/TRACE] [FML]: Testing mod netherendingores to verify it accepts its own version in a remote connection | |
| [22:53:05] [Client thread/TRACE] [FML]: The mod netherendingores accepts its own version (1.12.2-1.3) | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into netherendingores | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for netherendingores | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.icannt.netherendingores.common.registry.RegistryEvents$Events for mod netherendingores | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.icannt.netherendingores.common.registry.RegistryEvents$Events | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.icannt.netherendingores.common.registry.BlockRegistry$RegistrationHandler for mod netherendingores | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.icannt.netherendingores.common.registry.BlockRegistry$RegistrationHandler | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.icannt.netherendingores.proxy.CommonProxy for mod netherendingores | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.icannt.netherendingores.proxy.CommonProxy | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.icannt.netherendingores.proxy.ClientProxy for mod netherendingores | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.icannt.netherendingores.proxy.ClientProxy | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into netherendingores for type INSTANCE | |
| [22:53:05] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod netherendingores | |
| [22:53:05] [Client thread/DEBUG] [FML]: Bar Step: Construction - Netherending Ores took 0.032s | |
| [22:53:05] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod nex | |
| [22:53:05] [Client thread/TRACE] [FML]: Mod nex is using network checker : Accepting version 2.0.8 | |
| [22:53:05] [Client thread/TRACE] [FML]: Testing mod nex to verify it accepts its own version in a remote connection | |
| [22:53:05] [Client thread/TRACE] [FML]: The mod nex accepts its own version (2.0.8) | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into nex | |
| [22:53:05] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for nex | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.handler.BlockHandler for mod nex | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.handler.BlockHandler | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.handler.ClickHandler for mod nex | |
| [22:53:05] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.handler.ClickHandler | |
| [22:53:05] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.handler.LivingHandler for mod nex | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.handler.LivingHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.init.NetherExBiomes$EventHandler for mod nex | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.init.NetherExBiomes$EventHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.init.NetherExEffectTypes$EventHandler for mod nex | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.init.NetherExEffectTypes$EventHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.init.NetherExBlocks$EventHandler for mod nex | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.init.NetherExBlocks$EventHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.client.model.item.NetherExModels for mod nex | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.client.model.item.NetherExModels | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.handler.RemapHandler for mod nex | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.handler.RemapHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.handler.FeatureGenHandler for mod nex | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.handler.FeatureGenHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.init.NetherExItems$EventHandler for mod nex | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.init.NetherExItems$EventHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.handler.RenderHandler for mod nex | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.handler.RenderHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.init.NetherExSoundEvents$EventHandler for mod nex | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.init.NetherExSoundEvents$EventHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.handler.ConfigHandler$ConfigSyncHandler for mod nex | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.handler.ConfigHandler$ConfigSyncHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.init.NetherExEffects$EventHandler for mod nex | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.init.NetherExEffects$EventHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for nex.handler.WorldHandler for mod nex | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class nex.handler.WorldHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into nex for type INSTANCE | |
| [22:53:06] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod nex | |
| [22:53:06] [Client thread/DEBUG] [FML]: Bar Step: Construction - NetherEx took 0.486s | |
| [22:53:06] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod notenoughroofs | |
| [22:53:06] [Client thread/TRACE] [FML]: Mod notenoughroofs is using network checker : Accepting version 0.8.0.0 | |
| [22:53:06] [Client thread/TRACE] [FML]: Testing mod notenoughroofs to verify it accepts its own version in a remote connection | |
| [22:53:06] [Client thread/TRACE] [FML]: The mod notenoughroofs accepts its own version (0.8.0.0) | |
| [22:53:06] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into notenoughroofs | |
| [22:53:06] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for notenoughroofs | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for notenoughroofs.ConfigFile$EventHandler for mod notenoughroofs | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class notenoughroofs.ConfigFile$EventHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for notenoughroofs.NotEnoughRoofs$RegistrationHandler for mod notenoughroofs | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class notenoughroofs.NotEnoughRoofs$RegistrationHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into notenoughroofs for type INSTANCE | |
| [22:53:06] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod notenoughroofs | |
| [22:53:06] [Client thread/DEBUG] [FML]: Bar Step: Construction - Not Enough Roofs took 0.031s | |
| [22:53:06] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod notenoughwands | |
| [22:53:06] [Client thread/TRACE] [FML]: Mod notenoughwands is using network checker : Accepting version 1.8.1 | |
| [22:53:06] [Client thread/TRACE] [FML]: Testing mod notenoughwands to verify it accepts its own version in a remote connection | |
| [22:53:06] [Client thread/TRACE] [FML]: The mod notenoughwands accepts its own version (1.8.1) | |
| [22:53:06] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into notenoughwands | |
| [22:53:06] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for notenoughwands | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for romelo333.notenoughwands.setup.ClientRegistration for mod notenoughwands | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class romelo333.notenoughwands.setup.ClientRegistration | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for romelo333.notenoughwands.setup.Registration for mod notenoughwands | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class romelo333.notenoughwands.setup.Registration | |
| [22:53:06] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into notenoughwands for type INSTANCE | |
| [22:53:06] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod notenoughwands | |
| [22:53:06] [Client thread/DEBUG] [FML]: Bar Step: Construction - Not Enough Wands took 0.036s | |
| [22:53:06] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod oreexcavation | |
| [22:53:06] [Client thread/TRACE] [FML]: Mod oreexcavation is using network checker : Accepting version 1.4.140 | |
| [22:53:06] [Client thread/TRACE] [FML]: Testing mod oreexcavation to verify it accepts its own version in a remote connection | |
| [22:53:06] [Client thread/TRACE] [FML]: The mod oreexcavation accepts its own version (1.4.140) | |
| [22:53:06] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into oreexcavation | |
| [22:53:06] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for oreexcavation | |
| [22:53:06] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into oreexcavation for type INSTANCE | |
| [22:53:06] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod oreexcavation | |
| [22:53:06] [Client thread/DEBUG] [FML]: Bar Step: Construction - OreExcavation took 0.015s | |
| [22:53:06] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod projecte | |
| [22:53:06] [Client thread/TRACE] [FML]: Mod projecte is using network checker : Accepting version 1.12.2-PE1.4.1 | |
| [22:53:06] [Client thread/TRACE] [FML]: Testing mod projecte to verify it accepts its own version in a remote connection | |
| [22:53:06] [Client thread/TRACE] [FML]: The mod projecte accepts its own version (1.12.2-PE1.4.1) | |
| [22:53:06] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into projecte | |
| [22:53:06] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for projecte | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for moze_intel.projecte.events.TransmutationRenderingEvent for mod projecte | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class moze_intel.projecte.events.TransmutationRenderingEvent | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for moze_intel.projecte.events.KeyPressEvent for mod projecte | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class moze_intel.projecte.events.KeyPressEvent | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for moze_intel.projecte.events.PlayerRender for mod projecte | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class moze_intel.projecte.events.PlayerRender | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for moze_intel.projecte.gameObjs.ObjHandler for mod projecte | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class moze_intel.projecte.gameObjs.ObjHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for moze_intel.projecte.proxies.ClientProxy for mod projecte | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class moze_intel.projecte.proxies.ClientProxy | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for moze_intel.projecte.utils.SoundHandler for mod projecte | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class moze_intel.projecte.utils.SoundHandler | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for moze_intel.projecte.PECore for mod projecte | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class moze_intel.projecte.PECore | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for moze_intel.projecte.events.ToolTipEvent for mod projecte | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class moze_intel.projecte.events.ToolTipEvent | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for moze_intel.projecte.events.TickEvents for mod projecte | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class moze_intel.projecte.events.TickEvents | |
| [22:53:06] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for moze_intel.projecte.events.PlayerEvents for mod projecte | |
| [22:53:06] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class moze_intel.projecte.events.PlayerEvents | |
| [22:53:06] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into projecte for type INSTANCE | |
| [22:53:06] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod projecte | |
| [22:53:06] [Client thread/DEBUG] [FML]: Bar Step: Construction - ProjectE took 0.420s | |
| [22:53:06] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod randomthings | |
| [22:53:06] [Client thread/TRACE] [FML]: Mod randomthings is using network checker : Accepting version 4.2.7.1 | |
| [22:53:06] [Client thread/TRACE] [FML]: Testing mod randomthings to verify it accepts its own version in a remote connection | |
| [22:53:06] [Client thread/TRACE] [FML]: The mod randomthings accepts its own version (4.2.7.1) | |
| [22:53:06] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into randomthings | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for randomthings | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into randomthings for type INSTANCE | |
| [22:53:07] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod randomthings | |
| [22:53:07] [Client thread/DEBUG] [FML]: Bar Step: Construction - Random Things took 0.190s | |
| [22:53:07] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod randomtweaks | |
| [22:53:07] [Client thread/TRACE] [FML]: Mod randomtweaks is using network checker : No network checking performed | |
| [22:53:07] [Client thread/TRACE] [FML]: Testing mod randomtweaks to verify it accepts its own version in a remote connection | |
| [22:53:07] [Client thread/TRACE] [FML]: The mod randomtweaks accepts its own version (1.12.2-2.5.0.5) | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.common.BoneMealHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.common.BoneMealHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.client.DingHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.client.DingHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.common.SleepHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.common.SleepHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.common.ColoredSheepHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.common.ColoredSheepHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.common.CobwebHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.common.CobwebHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.common.SquidHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.common.SquidHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.client.StepupHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.client.StepupHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.common.MiscEventHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.common.MiscEventHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.common.world.WorldHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.common.world.WorldHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.common.PlayerHeadDropHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.common.PlayerHeadDropHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.client.KeyBindingHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.client.KeyBindingHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.client.TimeOfDayOverlay for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.client.TimeOfDayOverlay | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.common.EntityInteractHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.common.EntityInteractHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.client.MiscClientEventHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.client.MiscClientEventHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.common.AnvilHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.common.AnvilHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.client.CapeHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.client.CapeHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.therandomlabs.randomtweaks.common.RespawnHandler for mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.therandomlabs.randomtweaks.common.RespawnHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into randomtweaks for type INSTANCE | |
| [22:53:07] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod randomtweaks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Bar Step: Construction - RandomTweaks took 0.147s | |
| [22:53:07] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod reborncore | |
| [22:53:07] [Client thread/DEBUG] [forge]: Preloading CrashReport Classes | |
| [22:53:07] [Client thread/DEBUG] [forge]: reborncore/common/util/CrashHandler | |
| [22:53:07] [Client thread/TRACE] [FML]: Mod reborncore is using network checker : Accepting version 3.13.12.447 | |
| [22:53:07] [Client thread/TRACE] [FML]: Testing mod reborncore to verify it accepts its own version in a remote connection | |
| [22:53:07] [Client thread/TRACE] [FML]: The mod reborncore accepts its own version (3.13.12.447) | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into reborncore | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for reborncore | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for reborncore.common.misc.ModSounds for mod reborncore | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class reborncore.common.misc.ModSounds | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into reborncore for type INSTANCE | |
| [22:53:07] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod reborncore | |
| [22:53:07] [Client thread/DEBUG] [FML]: Bar Step: Construction - Reborn Core took 0.052s | |
| [22:53:07] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod redstonepaste | |
| [22:53:07] [Client thread/TRACE] [FML]: Mod redstonepaste is using network checker : Accepting version 1.7.5 | |
| [22:53:07] [Client thread/TRACE] [FML]: Testing mod redstonepaste to verify it accepts its own version in a remote connection | |
| [22:53:07] [Client thread/TRACE] [FML]: The mod redstonepaste accepts its own version (1.7.5) | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into redstonepaste | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for redstonepaste | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into redstonepaste for type INSTANCE | |
| [22:53:07] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod redstonepaste | |
| [22:53:07] [Client thread/DEBUG] [FML]: Bar Step: Construction - Redstone Paste took 0.032s | |
| [22:53:07] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod xreliquary | |
| [22:53:07] [Client thread/TRACE] [FML]: Mod xreliquary is using network checker : Accepting version 1.12.2-1.3.4.786 | |
| [22:53:07] [Client thread/TRACE] [FML]: Testing mod xreliquary to verify it accepts its own version in a remote connection | |
| [22:53:07] [Client thread/TRACE] [FML]: The mod xreliquary accepts its own version (1.12.2-1.3.4.786) | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xreliquary.reference.Settings$EventHandler for mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xreliquary.reference.Settings$EventHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xreliquary.handler.CommonEventHandler for mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xreliquary.handler.CommonEventHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xreliquary.client.init.ItemModels for mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xreliquary.client.init.ItemModels | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xreliquary.init.ModPotions for mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xreliquary.init.ModPotions | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xreliquary.handler.ClientEventHandler for mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xreliquary.handler.ClientEventHandler | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xreliquary.init.ModCapabilities for mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xreliquary.init.ModCapabilities | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xreliquary.init.ModCompat for mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xreliquary.init.ModCompat | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xreliquary.init.ModSounds for mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xreliquary.init.ModSounds | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xreliquary.init.ModBlocks for mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xreliquary.init.ModBlocks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xreliquary.init.ModLoot for mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xreliquary.init.ModLoot | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xreliquary.init.ModFluids for mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xreliquary.init.ModFluids | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xreliquary.init.ModItems for mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xreliquary.init.ModItems | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xreliquary.init.XRRecipes for mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xreliquary.init.XRRecipes | |
| [22:53:07] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for xreliquary.client.ClientProxy for mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class xreliquary.client.ClientProxy | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into xreliquary for type INSTANCE | |
| [22:53:07] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod xreliquary | |
| [22:53:07] [Client thread/DEBUG] [FML]: Bar Step: Construction - Reliquary took 0.591s | |
| [22:53:07] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod simplyjetpacks | |
| [22:53:07] [Client thread/TRACE] [FML]: Mod simplyjetpacks is using network checker : Accepting version 2.2.12.65 | |
| [22:53:07] [Client thread/TRACE] [FML]: Testing mod simplyjetpacks to verify it accepts its own version in a remote connection | |
| [22:53:07] [Client thread/TRACE] [FML]: The mod simplyjetpacks accepts its own version (2.2.12.65) | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into simplyjetpacks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for simplyjetpacks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into simplyjetpacks for type INSTANCE | |
| [22:53:07] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod simplyjetpacks | |
| [22:53:07] [Client thread/DEBUG] [FML]: Bar Step: Construction - Simply Jetpacks 2 took 0.052s | |
| [22:53:07] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod flammpfeil.slashblade | |
| [22:53:08] [Client thread/TRACE] [FML]: Mod flammpfeil.slashblade is using network checker : Accepting version mc1.12-r23 | |
| [22:53:08] [Client thread/TRACE] [FML]: Testing mod flammpfeil.slashblade to verify it accepts its own version in a remote connection | |
| [22:53:08] [Client thread/TRACE] [FML]: The mod flammpfeil.slashblade accepts its own version (mc1.12-r23) | |
| [22:53:08] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into flammpfeil.slashblade | |
| [22:53:08] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for flammpfeil.slashblade | |
| [22:53:08] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into flammpfeil.slashblade for type INSTANCE | |
| [22:53:08] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod flammpfeil.slashblade | |
| [22:53:08] [Client thread/DEBUG] [FML]: Bar Step: Construction - SlashBlade took 0.169s | |
| [22:53:08] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod snad | |
| [22:53:08] [Client thread/ERROR] [FML]: The mod snad is expecting signature @FINGERPRINT@ for source Snad-1.12.1-1.7.09.16a.jar, however there is no signature matching that description | |
| [22:53:08] [Client thread/TRACE] [FML]: Mod snad is using network checker : Accepting version 1.12.1-1.7.09.16a | |
| [22:53:08] [Client thread/TRACE] [FML]: Testing mod snad to verify it accepts its own version in a remote connection | |
| [22:53:08] [Client thread/TRACE] [FML]: The mod snad accepts its own version (1.12.1-1.7.09.16a) | |
| [22:53:08] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into snad | |
| [22:53:08] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for snad | |
| [22:53:08] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.robrit.snad.client.proxy.ClientProxy for mod snad | |
| [22:53:08] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.robrit.snad.client.proxy.ClientProxy | |
| [22:53:08] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.robrit.snad.common.util.RegistryHelper for mod snad | |
| [22:53:08] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.robrit.snad.common.util.RegistryHelper | |
| [22:53:08] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into snad for type INSTANCE | |
| [22:53:08] [Client thread/ERROR] [Snad]: No fingerprint found! | |
| [22:53:08] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod snad | |
| [22:53:08] [Client thread/DEBUG] [FML]: Bar Step: Construction - Snad took 0.036s | |
| [22:53:08] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod spartanshields | |
| [22:53:08] [Client thread/TRACE] [FML]: Mod spartanshields is using network checker : Accepting version 1.5.3 | |
| [22:53:08] [Client thread/TRACE] [FML]: Testing mod spartanshields to verify it accepts its own version in a remote connection | |
| [22:53:08] [Client thread/TRACE] [FML]: The mod spartanshields accepts its own version (1.5.3) | |
| [22:53:08] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into spartanshields | |
| [22:53:08] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for spartanshields | |
| [22:53:08] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.oblivioussp.spartanshields.init.EnchantmentRegistry for mod spartanshields | |
| [22:53:08] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.oblivioussp.spartanshields.init.EnchantmentRegistry | |
| [22:53:08] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.oblivioussp.spartanshields.init.ModelRenderRegistry for mod spartanshields | |
| [22:53:08] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.oblivioussp.spartanshields.init.ModelRenderRegistry | |
| [22:53:08] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.oblivioussp.spartanshields.event.EventHandlerCommon for mod spartanshields | |
| [22:53:08] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.oblivioussp.spartanshields.event.EventHandlerCommon | |
| [22:53:08] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.oblivioussp.spartanshields.init.ItemRegistrySS for mod spartanshields | |
| [22:53:08] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.oblivioussp.spartanshields.init.ItemRegistrySS | |
| [22:53:08] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.oblivioussp.spartanshields.util.ConfigHandler for mod spartanshields | |
| [22:53:08] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.oblivioussp.spartanshields.util.ConfigHandler | |
| [22:53:08] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.oblivioussp.spartanshields.event.EventHandlerClient for mod spartanshields | |
| [22:53:08] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.oblivioussp.spartanshields.event.EventHandlerClient | |
| [22:53:08] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.oblivioussp.spartanshields.init.RecipeRegistry for mod spartanshields | |
| [22:53:08] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.oblivioussp.spartanshields.init.RecipeRegistry | |
| [22:53:08] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into spartanshields for type INSTANCE | |
| [22:53:08] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod spartanshields | |
| [22:53:08] [Client thread/DEBUG] [FML]: Bar Step: Construction - Spartan Shields took 0.115s | |
| [22:53:08] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod stevescarts | |
| [22:53:08] [Client thread/TRACE] [FML]: Mod stevescarts is using network checker : Accepting version 2.4.30.134 | |
| [22:53:08] [Client thread/TRACE] [FML]: Testing mod stevescarts to verify it accepts its own version in a remote connection | |
| [22:53:08] [Client thread/TRACE] [FML]: The mod stevescarts accepts its own version (2.4.30.134) | |
| [22:53:08] [Client thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into stevescarts | |
| [22:53:08] [Client thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for stevescarts | |
| [22:53:08] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vswe.stevescarts.handlers.SoundHandler for mod stevescarts | |
| [22:53:08] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vswe.stevescarts.handlers.SoundHandler | |
| [22:53:08] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vswe.stevescarts.items.ModItems for mod stevescarts | |
| [22:53:08] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vswe.stevescarts.items.ModItems | |
| [22:53:08] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vswe.stevescarts.SCConfig for mod stevescarts | |
| [22:53:08] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vswe.stevescarts.SCConfig | |
| [22:53:08] [Client thread/DEBUG] [FML]: Registering @EventBusSubscriber for vswe.stevescarts.blocks.ModBlocks for mod stevescarts | |
| [22:53:08] [Client thread/DEBUG] [FML]: Injected @EventBusSubscriber class vswe.stevescarts.blocks.ModBlocks | |
| [22:53:08] [Client thread/DEBUG] [FML]: Attempting to inject @Config classes into stevescarts for type INSTANCE | |
| [22:53:08] [Client thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod stevescarts | |
| [22:53:08] [Client thread/DEBUG] [FML]: Bar Step: Construction - Steve's Carts 2 took 0.117s | |
| [22:53:08] [Client thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod stg |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment