Last active
September 4, 2021 00:27
-
-
Save denysvitali/3c0dddcc21d4dae53d38916e3a1fe927 to your computer and use it in GitHub Desktop.
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
/lib/ld-uClibc.so.0 | |
libpthread.so.0 | |
abort | |
fopen | |
memset | |
fclose | |
strlen | |
_fini | |
__data_start | |
librt.so.0 | |
libcrypt.so.0 | |
libstdc++.so.6 | |
_Jv_RegisterClasses | |
libm.so.0 | |
free | |
memcpy | |
malloc | |
__aeabi_i2f | |
__aeabi_fmul | |
memcmp | |
strncpy | |
strtoul | |
strcmp | |
strcpy | |
__errno_location | |
pthread_create | |
pthread_self | |
sem_init | |
pthread_mutex_init | |
sem_wait | |
pthread_mutex_lock | |
pthread_mutex_unlock | |
sem_post | |
gettimeofday | |
fread | |
fwrite | |
ioctl | |
pthread_cond_init | |
pthread_cond_wait | |
pthread_cond_signal | |
sscanf | |
socket | |
realloc | |
pthread_join | |
pthread_detach | |
pthread_cond_broadcast | |
pthread_mutex_destroy | |
pthread_cond_destroy | |
pthread_key_delete | |
pthread_key_create | |
recv | |
pthread_setcancelstate | |
mmap | |
munmap | |
strncmp | |
pthread_attr_init | |
pthread_attr_setdetachstate | |
pthread_attr_destroy | |
__assert | |
stderr | |
system | |
calloc | |
strchr | |
pthread_once | |
pthread_attr_setscope | |
__aeabi_fadd | |
fputs | |
stdin | |
stdout | |
__aeabi_d2iz | |
fflush | |
_ZdlPv | |
__cxa_end_cleanup | |
_Znwj | |
__gxx_personality_v0 | |
_ZdaPv | |
_Znaj | |
fcntl | |
vsprintf | |
floor | |
__aeabi_fdiv | |
memmove | |
clock_gettime | |
pthread_cond_timedwait | |
__aeabi_fcmplt | |
fileno | |
setvbuf | |
statfs | |
pthread_cancel | |
strftime | |
memchr | |
fopen64 | |
getenv | |
getuid | |
poll | |
sigaction | |
fputc | |
__aeabi_fcmpge | |
__aeabi_fcmple | |
__aeabi_fcmpgt | |
__aeabi_ui2f | |
__aeabi_fcmpeq | |
strtod | |
__isnan | |
__aeabi_fsub | |
__isnanf | |
fdopen | |
waitpid | |
writev | |
fork | |
crypt | |
execve | |
getrlimit | |
__h_errno_location | |
pthread_mutex_timedlock | |
pthread_mutex_trylock | |
pthread_kill | |
sched_get_priority_max | |
sched_get_priority_min | |
pthread_attr_setinheritsched | |
pthread_attr_setschedpolicy | |
pthread_attr_getschedparam | |
pthread_attr_setschedparam | |
pthread_attr_setstacksize | |
isspace | |
_ZTVN10__cxxabiv117__class_type_infoE | |
_ZNSsC1EPKcjRKSaIcE | |
_ZN9__gnu_cxx18__exchange_and_addEPVii | |
_ZNSs4_Rep10_M_destroyERKSaIcE | |
_ZNSsD1Ev | |
_ZNSs4_Rep20_S_empty_rep_storageE | |
_ZSt29_Rb_tree_insert_and_rebalancebPSt18_Rb_tree_node_baseS0_RS_ | |
_ZSt18_Rb_tree_decrementPSt18_Rb_tree_node_base | |
_ZSt18_Rb_tree_incrementPSt18_Rb_tree_node_base | |
__aeabi_atexit | |
_ZSt28_Rb_tree_rebalance_for_erasePSt18_Rb_tree_node_baseRS_ | |
_ZNSt8ios_base4InitC1Ev | |
_ZNSsC1EPKcRKSaIcE | |
_ZNSt8ios_base4InitD1Ev | |
_ZNSs7reserveEj | |
_ZNKSs4findEcj | |
isalnum | |
_ZNSs6assignEPKcj | |
_ZNSs6appendEPKcj | |
sem_trywait | |
sem_destroy | |
__cxa_pure_virtual | |
_ZTVN10__cxxabiv120__si_class_type_infoE | |
pthread_exit | |
sigfillset | |
pthread_sigmask | |
pthread_equal | |
nanosleep | |
pthread_getspecific | |
pthread_setspecific | |
wcrtomb | |
_stdlib_mb_cur_max | |
mbrtowc | |
ungetc | |
libnetpt.so | |
dms_sysnetapi_FindFile | |
dms_sysnetapi_FindClose | |
connect | |
dms_sysnetapi_open | |
REC_SetDebug | |
REC_StartRecord | |
dms_sysnetapi_start | |
REC_Init | |
usleep | |
fgets | |
prctl | |
dms_sysnetapi_MBUF_AddReader | |
feof | |
dms_sysnetapi_close | |
HXHT_XYtoMotionBlock | |
select | |
dms_sysnetapi_PlayBackByName | |
send | |
asfClose | |
dms_sysnetapi_FindNextFile | |
CheckRecordInMonth | |
accept | |
dms_sysnetapi_MBUF_GetReadPtrLeftNum | |
JB_search_file_list_from_date_dir_add | |
dms_sysnetapi_PlayBackStop | |
strcat | |
bind | |
inet_addr | |
asfOpen | |
dms_sysnetapi_PlayBackControl | |
setsockopt | |
dms_sysnetapi_MBUF_DelReader | |
strstr | |
strcasecmp | |
strtok | |
REC_StopAllRecord | |
listen | |
asfGetInfo | |
strncat | |
dms_sysnetapi_WriteSerialData | |
dms_sysnetapi_PlayBackByTime | |
dms_sysnetapi_PlayBackGetInfo | |
localtime | |
inet_ntoa | |
DMS_ThreadAutoCheckStart | |
dms_sysnetapi_ioctrl | |
dms_sysnetapi_PlayBackGetReadPtrPos | |
shutdown | |
REC_FindFile | |
dms_sysnetapi_MBUF_SetReadPtrPos | |
REC_FindFileByTime | |
dms_sysnetapi_MBUF_GetNextFrameType | |
REC_StopRecord | |
getsockopt | |
PlayBackSettoTime | |
dms_sysnetapi_MBUF_FindNextFrame | |
dms_sysnetapi_MBUF_GetReadPtrPos | |
netpt_close | |
netpt_open | |
atoi | |
dms_sysnetapi_MBUF_GetFrame | |
netpt_start | |
dms_sysnetapi_ioctrl_in | |
dms_sysnetapi_PlayBackGetFrame | |
REC_UnInit | |
dms_sysnetapi_MBUF_CanRead | |
dms_sysnetapi_WriteAudioData | |
sem_getvalue | |
../../Hi3518_SDK_V1.0.9.0/mpp2/lib/libisp.so | |
HI_MPI_ISP_SetDRCAttr | |
HI_MPI_ISP_SetInputTiming | |
HI_MPI_ISP_GetShadingAttr | |
HI_MPI_ISP_GetGammaAttr | |
HI_MPI_ISP_SetDemosaicAttr | |
perror | |
HI_MPI_ISP_SetDefectPixelAttr | |
HI_MPI_ISP_SetCfg | |
HI_MPI_ISP_SetGammaAttr | |
HI_MPI_ISP_GetSharpenAttr | |
HI_MPI_ISP_SetDenoiseAttr | |
HI_MPI_ISP_GetDefectPixelAttr | |
HI_MPI_ISP_SetGammaTable | |
HI_MPI_ISP_SetCrosstalkAttr | |
HI_MPI_VI_GetFd | |
HI_MPI_ISP_GetBlackLevelAttr | |
HI_MPI_ISP_SetShadingAttr | |
HI_MPI_ISP_Exit | |
HI_MPI_ISP_SetBlackLevelAttr | |
HI_MPI_ISP_SetAntiFogAttr | |
HI_MPI_ISP_GetGammaTable | |
HI_MPI_ISP_GetDemosaicAttr | |
HI_MPI_ISP_SetImageAttr | |
HI_MPI_ISP_GetCrosstalkAttr | |
HI_MPI_ISP_SetSharpenAttr | |
HI_MPI_SYS_Mmap | |
HI_MPI_SYS_Munmap | |
HI_MPI_ISP_GetAntiFogAttr | |
HI_MPI_ISP_Run | |
HI_MPI_ISP_Init | |
HI_MPI_ISP_GetDRCAttr | |
HI_MPI_ISP_GetDenoiseAttr | |
HI_MPI_ISP_GetImageAttr | |
../../Hi3518_SDK_V1.0.9.0/mpp2/lib/lib3518sensor.so | |
cmos_set_wdr_mode | |
sensor_register_callback | |
sensor_unregister_callback | |
../../Hi3518_SDK_V1.0.9.0/mpp2/lib/lib_hiae.so | |
HI_MPI_ISP_SetSlowFrameRate | |
HI_MPI_ISP_GetAEAttr | |
HI_MPI_AE_Register | |
HI_MPI_ISP_GetAEAttrEx | |
HI_MPI_ISP_GetExposureType | |
HI_MPI_ISP_SetAEAttrEx | |
HI_MPI_ISP_GetMEAttr | |
HI_MPI_ISP_SetAEAttr | |
HI_MPI_ISP_SetAntiFlickerAttr | |
HI_MPI_ISP_GetSlowFrameRate | |
HI_MPI_AE_UnRegister | |
HI_MPI_ISP_SetMEAttr | |
HI_MPI_ISP_SetAIAttr | |
HI_MPI_ISP_GetAntiFlickerAttr | |
HI_MPI_ISP_SetExposureType | |
HI_MPI_ISP_GetAIAttr | |
HI_MPI_ISP_QueryInnerStateInfo | |
../../Hi3518_SDK_V1.0.9.0/mpp2/lib/lib_hiaf.so | |
HI_MPI_ISP_SetFocusStaInfo | |
HI_MPI_AF_UnRegister | |
HI_MPI_AF_Register | |
HI_MPI_ISP_GetFocusStaInfo | |
../../Hi3518_SDK_V1.0.9.0/mpp2/lib/lib_hiawb.so | |
HI_MPI_ISP_GetAWBAttr | |
HI_MPI_ISP_SetCCM | |
HI_MPI_AWB_UnRegister | |
qsort | |
HI_MPI_ISP_SetSaturation | |
HI_MPI_ISP_GetSaturationAttr | |
HI_MPI_AWB_Register | |
HI_MPI_ISP_SetWBType | |
HI_MPI_ISP_SetSaturationAttr | |
HI_MPI_ISP_GetCCM | |
HI_MPI_ISP_SetAWBAttr | |
raise | |
libgcc_s.so.1 | |
__aeabi_unwind_cpp_pr0 | |
__aeabi_unwind_cpp_pr1 | |
libc.so.0 | |
vfprintf | |
strncasecmp | |
cfsetispeed | |
closedir | |
localtime_r | |
getaddrinfo | |
__res_query | |
cfsetospeed | |
inet_pton | |
srand48 | |
strdup | |
fgetc | |
vsnprintf | |
sigset | |
readlink | |
htons | |
nice | |
gai_strerror | |
gethostbyname_r | |
readdir_r | |
lstat | |
mkfifo | |
atoll | |
opendir | |
inet_aton | |
gmtime_r | |
__fgetc_unlocked | |
chroot | |
getpwnam | |
readdir | |
if_nametoindex | |
pipe | |
__ctype_toupper | |
strcspn | |
ftok | |
fsync | |
access | |
adjtimex | |
__dn_expand | |
herror | |
putchar | |
tcsetattr | |
inet_ntop | |
tzset | |
iconv_close | |
getservbyname | |
flock | |
mktime | |
tcgetattr | |
getcwd | |
freeaddrinfo | |
ctime | |
gethostbyname | |
__ctype_tolower | |
lseek | |
nl_langinfo | |
fscanf | |
getpeername | |
syslog | |
srand | |
strpbrk | |
hstrerror | |
msgrcv | |
getnameinfo | |
recvfrom | |
dup2 | |
fstat | |
__xpg_strerror_r | |
__uClibc_main | |
fchown | |
stime | |
ferror | |
getifaddrs | |
closelog | |
sendto | |
mknod | |
lrand48 | |
getdtablesize | |
getpid | |
popen | |
sendmsg | |
chdir | |
strspn | |
__ctype_b | |
alarm | |
setrlimit | |
syscall | |
strtol | |
posix_memalign | |
random | |
__fputc_unlocked | |
iconv_open | |
remove | |
daemon | |
tcflush | |
readahead | |
iconv | |
cfmakeraw | |
gmtime | |
freeifaddrs | |
fseek | |
sethostname | |
mkdir | |
msgsnd | |
getsockname | |
isalpha | |
ftell | |
gethostname | |
strrchr | |
pclose | |
atof | |
gethostbyname2 | |
atol | |
msgget | |
recvmsg | |
_edata | |
__bss_start | |
__bss_start__ | |
__bss_end__ | |
__end__ | |
_end | |
g_lpantsXmlModelV1 | |
g_lpantsXmlBeginHour | |
g_lpantsXmlNTPServer | |
CloseLPCMEncoder | |
g_lpantsXmlPanelVersion | |
g_lpantsXmlMaskIPV4 | |
g_stVqeAncCfgTab | |
_ZTV14TiXmlAttribute | |
g_lpantsXmlAddress | |
g_lpantsXmlAlarmOutDelay | |
OpenG711UDecoder | |
g_lpantsXmlResolverPort | |
CloseG711ADecoder | |
g_lpantsXmlManagerHostV2 | |
g_lpantsXmlContentEx | |
g_lpantsXmlID | |
gtdiscovery_create | |
_ZN6Base644bstrE | |
a140 | |
g_lpantsXmlWDMode | |
gs_rec_addfileindex | |
_ZTV13TiXmlDocument | |
LTALARMDEVRC4KEY | |
g_lpantsXmlGainMode | |
g_lpantsXmlBrightnessV1 | |
g_lpantsXmlEnableRelRecordChan | |
g_lpantsXmlBeginWeekNo | |
g_lpantsXmlDomain | |
OpenG711AEncoder | |
g_lpantsXmlSsid | |
OpenG711ADecoder | |
g_lpantsXmlShelter | |
g_lpantsXmlLocalIPV4 | |
g_lpantsXmlBacklightMode | |
g_lpantsXmlPlayBackVer | |
g_lpantsXmlSize | |
g_lpantsXmlDefaultRoute | |
g_lpantsXml3GValid | |
_ZTV9UDPSocket | |
g_lpantsXmlDataBit | |
g_lpantsXmlDelay | |
GTConnectionProStartChange | |
g_lpantsXmlManagerHostIPV4 | |
Asf_Header_Extension_Object | |
g_lpantsXmlEnableRemoteRec | |
_ZTV12TiXmlComment | |
g_lpantsXmlInfo | |
g_lpantsXmlSaturationV1 | |
g_lpantsXmlMaskV2 | |
g_lpANTSSubCircularBuffers | |
g_lpantsXmlTotal | |
b140_1 | |
g_lpantsXmlRecordTime | |
g_s32HRTimer | |
g_lpantsXmlLeftTop | |
g_lpantsXmlDSTBias | |
g_lpantsXml3DNRfode | |
MPI_AENC_ChnGetFrmProc | |
g_lpantsXmlIndex | |
DecodeG711AFrm | |
g_lpantsXmlUser | |
Aec_MIN_LEAK | |
g_lpantsXmlGatewayIP | |
g_lpantsXmlParameters | |
g_lpantsXmlShutterMode | |
g_lpantsXmlBitRate | |
g_lpantsXmlPrivate | |
ResamplerMono2X1Process | |
GetFrmInfo | |
g_lpantsXmlScop | |
g_lpantsXmlRes | |
g_lpantsXmlLocal | |
g_lpantsXmlEndMinute | |
Asf_Simple_Index_Object | |
s32VencMemFd | |
g_lpantsXmlEnablePreset | |
g_sVqeAnrVmTab | |
DecodeLPCMFrm | |
g_lpantsXmlEvtEncode | |
EncodeLPCMFrm | |
GIDNOTIFYHEADER | |
g_sVqeDbToGainTab | |
g_lpantsXmlHueV1 | |
g_lpantsXmlReceiver | |
_ZN9TiXmlBase11errorStringE | |
DecodeG726Frm | |
g_lpantsXmlBeginWeekDate | |
g_sVqeLog2Tab | |
g_lpantsXmlLocalBackup | |
g_lpantsXmlEnableLocalPlayBack | |
_ZN18CSVRControlSession17m_nCurPlayBackNumE | |
g_lpantsXmlWorkMode | |
_ZN11AsyncSocket10m_next_uidE | |
g_lpantsXmlCapacity | |
g_lpantsXmlEnablePreview | |
HDFullDetectThread | |
g_lpantsXmlVideoHideAlarm | |
g_lpantsXmlNight2DayThreshold | |
g_stMyVqeAnrCfgTab | |
g_lpantsXmlSMTP | |
g_lpantsXmlPicQualityMode | |
g_lpantsXmlNetDisk | |
Aec_VAR_BACKTRACK | |
gs_nRecordRun | |
g_lpantsXmlMaskV1 | |
g_lpantsXmlDisp | |
g_lpantsXmlWpa | |
g_lpantsXmlDns1 | |
SI_VERSION | |
Asf_File_Properties_Object | |
DecodeG711UFrm | |
g_lpantsXmlNetUser | |
g_lpantsXmlDSPSoftwareBuildDate | |
g_lpantsXmlHttps | |
g_pBuf | |
g_lpantsXmlSender | |
g_lpantsXmlDvrPort | |
g_lpantsXmlWifiEth | |
g_lpantsXmlBaudRate | |
g_lpantsXmlAttributeV2 | |
g_lpantsXmlDiskNumber | |
_ZTV12TiXmlElement | |
g_lpantsXmlAlarmInput | |
g_lpantsXmlInfoLen | |
g_lpantsXmlSpeed | |
_ZN18CSVRControlSession17m_PlayBackNumLockE | |
g_lpantsXmlProtocolV1 | |
g_lpantsXmlParamEx | |
stDMSReaderInfo | |
g_lpantsXmlISP | |
m_TSSessionGlobal_mutex | |
ResamplerMono1X2Process | |
g_lpantsXmlSubBitRate | |
g_lpantsXmlException | |
g_lpantsXmlSoftwareBuildDate | |
g_lpantsXmlOSD | |
g_stHseHcCfgTab | |
g_lpantsXmlAlarmHostIPV4 | |
g_lpantsXmlEnableManagerHost | |
g_lpantsXmlMinor | |
CloseG711UDecoder | |
CloseG711AEncoder | |
_ZN18CSVRControlSession14m_nCurMediaNumE | |
g_lpantsXmlVersion | |
_ZN11TiXmlString4nposE | |
AudioListHead | |
g_lpantsXmlNameEx | |
g_lpantsXmlEnableLocalRec | |
g_lpantsXmlAllDateRec | |
LangTao_IGDendelt | |
g_lpantsXmlKey | |
g_lpantsXmlEtherNets | |
EncodeG711AFrm | |
g_lpantsXmlUserV1 | |
g_lpantsXmlPreRecordTime | |
_ZN16CSVRVoiceSession10MainThreadEPv | |
g_lpantsXmlChannelV2 | |
Asf_Stream_Properties_Object | |
g_lpantsXmll3DNRLevel | |
g_lpantsXmlPOP3 | |
g_lpantsXmlFreeSpace | |
g_lpantsXmlIPV6 | |
_ZTV9TiXmlBase | |
g_lpantsXmlDns2 | |
g_lpantsXmlResult | |
ResamplerMono1X4Process | |
CloseADPCMEncoder | |
_ZN16CSVRAlarmSession10MainThreadEPv | |
g_hVqe | |
g_lpantsXmlTrackNo | |
g_lpantsXmlSharpnessLevel | |
g_s32VdaMemFd | |
sendworker | |
g_lpantsXmlDHCP | |
TSMainThread | |
patrolworker | |
g_lpantsXmlCommand | |
_ZN18CSVRControlSession12StreamThreadEPv | |
ASF_Extended_Stream_Properties_Object | |
dmsEvent | |
g_lpantsXmlDayNight | |
g_lpantsXmlAbility | |
Aec_VAR2_UPDATE | |
_ZTV9TiXmlText | |
g_lpantsXmlModeEx | |
g_lpantsXmlStatus | |
g_lpantsXmlPTZ | |
g_lpantsXmlType | |
g_lpantsXmlResEncode | |
_ZTV16TiXmlDeclaration | |
_ZTV12TiXmlVisitor | |
antsstxCode | |
ASF_Header_Object | |
_ZN18CSVRControlSession17m_nMaxPlayBackNumE | |
OpenADPCMEncoder | |
g_lpantsXmlRecType | |
CircleHandlePthread | |
_ZN20CSVRBroadCastSession10MainThreadEPv | |
g_lpantsXmlWeekDay | |
g_lpantsXmlIrisMode | |
g_lpantsXmlMinorMode | |
Aec_FLOAT_ONE | |
Aec_VAR1_SMOOTH | |
Aec_VAR2_SMOOTH | |
my_stVqeAlcCfgTab | |
g_struANTSServerFunctionCfg | |
g_lpantsXmlAntiflickerFreqMode | |
g_lpantsXmlVersionV1 | |
g_lpantsXmlPassword | |
g_lpantsXmlHttp | |
CloseG711UEncoder | |
_ZN9TiXmlBase13utf8ByteTableE | |
_ZN9TiXmlBase6entityE | |
g_lpantsXmlChanRec | |
_mxml_entity_cb | |
g_lpantsXmlDDNS | |
g_lpantsXmlTotalEx | |
_ZN7CServer10MainThreadEPv | |
g_lpantsXmlIP | |
g_lpantsXmlInterface | |
LBSSERVER_IP | |
g_lpantsXmlPriority | |
a2l_table | |
OpenG726Decoder | |
g_lpantsXmlManagerHostPort | |
s_s32LogFd | |
g_stVqeAlcCfgTab | |
ISGTUPDATING | |
g_hAec | |
wik_tab | |
b140 | |
g_lpantsXmlBeginMinute | |
EncodeG711UFrm | |
ResamplerMono6X1Process | |
g_lpantsXmlPhoneNo | |
g_lpantsXmlResolver | |
g_lpantsXmlPwdV1 | |
g_lpantsXmlGatewayIPV4 | |
g_lpantsXmlEndMonth | |
g_lpantsXmlMainBitRate | |
_ZTV11AsyncSocket | |
g_lpantsXmlNode | |
g_lpantsXmlAlternateDNSIPV4 | |
g_lpantsXmlPPPOE | |
g_lpantsXmlWifi | |
g_lpantsXmlEndWeekNo | |
g_lpantsXmlWrite | |
g_stHseAnrCfgTab | |
Aec_FLOAT_ZERO | |
g_lpantsXmlFrameRate | |
g_lpantsXmlUserName | |
g_lpantsXmlRead | |
g_sVqeSpeedDecTab | |
g_lpantsXmlDiskNo | |
g_lpantsXmlLocalRight | |
g_lpantsXmlMinute | |
_ZN5MutexD1Ev | |
OpenG711UEncoder | |
AlarmList_Str | |
_ZN18CSVRControlSession14m_MediaNumLockE | |
g_lpantsXmlDayNightMode | |
gs_Rec_NFSConfig | |
Asf_Video_Media | |
g_lpantsXmlMask | |
g_lpantsXmlTimeV2 | |
g_lpantsXmlWeeklyTime | |
g_lpantsXmlDateV2 | |
g_lpantsXmlIPV4 | |
g_lpantsXmlSerialNo | |
_ZN21CActiveControlSession12StreamThreadEPv | |
fik_tab | |
_ZN18CSVRControlSession17m_FindFileNumLockE | |
CloseG726Encoder | |
base64_code | |
g_lpantsXmlWBMode | |
g_lpantsXmlPortEx | |
g_lpantsXmlNormalEncode | |
g_lpantsXmlInterval | |
g_lpantsXmlTypeEx | |
_ZN15CSVRJpegSession10MainThreadEPv | |
g_lpantsXmlHDInfo | |
g_lpantsXmlAttribute | |
g_lpantsXmlAO | |
g_lpantsXmlChannel | |
g_lpantsXmlSizeEx | |
g_lpantsXmlRemoteIPV4 | |
EncodeG726Frm | |
UPNP_Start | |
g_lpantsXmlPortV1 | |
gs_rec_DiskChecking | |
g_lpantsXmlNFS | |
g_lpantsXmlVideoEffect | |
g_lpantsXmlStringInfo | |
g_lpantsXmlEnableV2 | |
g_lpantsXmlBeginMonth | |
u2a_table | |
Overflow | |
dequant_tab | |
LangTao_IGDstartelt | |
g_sVqeAnrPhsTab | |
_Z24gfx_voicestream_callbackiPhjPv | |
g_lpantsXmlNameV1 | |
g_lpantsXmlPwd | |
g_sVqeDbmToDbTab | |
g_lpantsXmlMAC | |
g_lpantsXmlModeV2 | |
_ZN20CSVRBroadCastSession8m_szWifiE | |
_ZN6Base644rstrE | |
_ZN18CSVRControlSession17m_nMaxFindFileNumE | |
g_lpantsXmlDescribe | |
g_lpantsXmlEnable | |
g_lpantsXmlContent | |
g_lpantsXmlMultiCastIPV2 | |
g_lpantsXmlUpnp | |
TSSessionThread | |
g_lpantsXmlCountV1 | |
g_lpantsXmlIPResolver | |
MPI_AO_ReceiveFrm | |
g_lpantsXmlEndHour | |
_ZTV9TCPSocket | |
g_lpantsXmlEnableRemotePTZ | |
g_lpantsXmlPreferredDNSIPV4 | |
g_lpantsXmlHardwareVersion | |
OpenLPCMDecoder | |
g_lpantsXmlPort | |
g_lpantsXmlParity | |
g_lpantsXmlVolume | |
g_lpantsXmlG3 | |
g_lpantsXmlParam | |
g_lpantsXmlAntiflickerMode | |
g_sVqeAnrSeRampTab | |
g_lpantsXmlPanelUser | |
g_lpANTSThirdCircularBuffers | |
DecodeADPCMFrm | |
g_lpantsXmlPwdEx | |
g_bUseWifiByMe | |
_Z26gfx_historystream_callbackiP20ANTS_MID_FRAMEHEADERPhjPv | |
g_lpantsXmlGroupNo | |
g_lpantsXmlServerName | |
g_lpantsXmlRecorderDuration | |
g_lpantsXmlParaType | |
_ZTV12TiXmlPrinter | |
a2u_table | |
g_lpantsXmlCount | |
m_rec_fileindex | |
g_lpantsXmlNetEncode | |
g_lpantsXmlAlarmHostPort | |
g_lpantsXmlAlarmHostV2 | |
g_lpantsXmlHandle | |
KEEPALIVEHEADER | |
OpenADPCMDecoder | |
_ZN7CServer15HeartBeatThreadEPv | |
g_lpantsXmlPos | |
g_lpantsXmlHostIndex | |
EncodeADPCMFrm | |
g_stVqeAecCfgTab | |
_ZTV9TiXmlNode | |
Asf_Audio_Media | |
g_sVqeAnrWindow | |
g_lpantsXmlContrastV1 | |
CloseADPCMDecoder | |
OpenG726Encoder | |
g_lpantsXmlFlowControl | |
g_lpantsXmlPresetNo | |
g_lpantsXmlAlarmOutput | |
_ZN11TiXmlString8nullrep_E | |
g_sVqeQmfCoefTab | |
g_lpantsXmlHour | |
g_lpantsXmlCell | |
g_lpantsXmlPPP | |
g_lpantsXmlEnableCruise | |
gs_hWndRecord | |
g_lpantsXmlMessage | |
g_lpantsXmlWep | |
g_lpantsXmlChannelEx | |
g_lpantsXmlDir | |
g_lpantsXmlLocalPreviewRight | |
g_lpantsXmlModeV1 | |
g_lpantsXmlMode | |
g_sVqeSpeedIncTab | |
_ZN9TiXmlBase18condenseWhiteSpaceE | |
antsetxCode | |
g_lpantsXmlServerVersion | |
g_lpantsXmlSharpnessMode | |
g_lpantsXmlLink | |
g_lpantsXmlValidMask | |
g_lpantsXmlEnableTrack | |
LangTao_IGDdata | |
g_lpantsXmlGammaMode | |
_ZN18CSVRControlSession14m_nMaxMediaNumE | |
g_stHseAecCfgTab | |
g_lpantsXmlMTU | |
g_lpantsXmlHDStatus | |
g_lpantsXmlStopBit | |
g_lpantsXmlEveryDayTime | |
g_lpantsXmlEth | |
g_lpantsXmlVideoMotion | |
g_lpantsXmlNetworkCardNum | |
g_lpantsXmlRtsp | |
g_lpantsXmlCruiseNo | |
g_lpantsXmlEndWeekDate | |
Aec_VAR1_UPDATE | |
_ZN19CSVRFindFileSession10MainThreadEPv | |
g_stVqeAnrCfgTab | |
g_lpantsXmlServerPort | |
AdaptCoeff_record | |
g_lpantsXmlLinkV1 | |
g_lpantsXmlRemoteRight | |
g_lpantsXmlDate | |
g_lpantsXmlTime | |
g_stHseAlcCfgTab | |
g_lpANTSMainCircularBuffers | |
g_lpantsXmlDSPSoftwareVersion | |
g_lpantsXmlVideoFormat | |
g_lpantsXmlCode | |
g_lpantsXmlIFrame | |
g_lpantsXmlName | |
ADEC_SendAoProc | |
g_lpantsXmlAI | |
CloseLPCMDecoder | |
g_lpantsXmlIPLink | |
g_glink_handle | |
recvworker | |
OpenLPCMEncoder | |
TSSearch | |
g_lpantsXmlReserve | |
g_lpantsXmlSoftwareVersion | |
_ZTV12TiXmlUnknown | |
g_lpantsXmlVideoLost | |
g_lpantsXmlEnableLocalPTZ | |
m_nRecordChNum | |
_ZN18CSVRControlSession17m_nCurFindFileNumE | |
g_lpantsXmlDay2NightThreshold | |
_ZN18CSVRControlSession14PlayBackThreadEPv | |
g_lpantsXmlGatewayIPV1 | |
u2l_table | |
ResamplerMono4X1Process | |
a140_1 | |
_ZN21CActiveControlSession10MainThreadEPv | |
g_lpantsXmlMultiCastIPV4 | |
LTPush_lc | |
g_lpantsXmlHeader | |
g_lpantsXmlServerIp | |
CloseG726Decoder | |
g_lpantsXmlRecycleRecord | |
g_lpantsXmlAddressEx | |
g_lpantsXmlArea | |
g_lpantsXmll3DNRMode | |
g_lpantsXmlMajor | |
ResamplerMono1X6Process | |
g_lpantsXmlEnableRemotePlayBack | |
GCC_3.5 | |
l-| | |
HdZ | |
<?H | |
0<kH | |
gfff | |
)8dYH | |
pI"0 | |
?h%I | |
QZ^& | |
8@- | |
Z AI | |
XBI | |
5<CI | |
pF" ` | |
*T{O | |
H264 | |
H264 | |
3@P@ | |
gfff | |
==== | |
VUUU | |
#EgvT2 | |
QZ^& | |
/0LB | |
/0LB | |
VUUU | |
==== | |
gfffP | |
gfff | |
gfff | |
gfff | |
gfff | |
gfff | |
H264 | |
MJPG0 | |
DIVX | |
H265 | |
H264 | |
H265` | |
MJPG | |
DIVX | |
H264H265 | |
DIVXMJPG | |
H264H265 | |
DIVXMJPG, | |
H264H265 | |
DIVXMJPG | |
kVUUU | |
QZ^& | |
#EgvT2 | |
|6*) | |
g&3g | |
D7q/;M | |
6666\\\\8oK | |
gfff | |
gfff | |
gfff | |
gfff | |
8@KL | |
QA1J | |
gfff | |
.p@- | |
VUUUp@- | |
VUUU | |
: 0[ | |
: 0[ | |
VUUU09N | |
;VUUU | |
gfffh | |
XQ@% | |
swkh | |
QZ^& | |
@Y@x | |
@Y@x | |
@Y@x | |
@Y@x | |
0CBh | |
QZ^& | |
zERR | |
zERR SZ | |
zimg | |
zERR | |
zERR | |
zERR00 | |
Y800zERRP | |
zERR | |
zERR | |
zERR | |
zERR | |
zERR | |
zERR, | |
zERR | |
zERR | |
zERR | |
zERR | |
zERR (P | |
zERR | |
zERR | |
zERR, | |
zERR | |
CGREYY800p | |
VUUU | |
zERR | |
zERR | |
zERR | |
zERR | |
zERR | |
zERR | |
zERR | |
zERR | |
i 8 | |
b0D0 | |
422P | |
zERR | |
gfff8@- | |
#EgvT2 | |
QZ^& | |
Qp`P | |
J@AS | |
QZ^& | |
Ah@| | |
Ah@| | |
gfff$ | |
Z$@H | |
Zh@ | |
Q Zh@ | |
Z0@H | |
Z @H | |
Z @H | |
Z @H | |
Z @H | |
X$@H | |
X @H | |
X @H | |
X @H | |
X @H | |
X @H | |
MH@ | |
E@@, | |
E0@, | |
E @, | |
I4@ | |
"OX@ | |
:O`@ | |
9OX@ | |
<OX@ | |
)P@@ | |
mL@D | |
gfff | |
gffft | |
PeBB( | |
~|zxusqomkigeca_^\ZXVTSQONLJIGEDB@?=<:9764320/-,+)('%$#! | |
gfffx | |
~|zxusqomkigeca_^\ZXVTSQONLJIGEDB@?=<:9764320/-,+)('%$#! | |
$ R | |
J R | |
: R | |
gfff | |
gfffT | |
ZZZZ( | |
ZZZZ | |
gfff | |
gfff | |
~|zxusqomkigeca_^\ZXVTSQONLJIGEDB@?=<:9764320/-,+)('%$#! | |
XP%A | |
XP%A | |
YP%A | |
YP%A | |
W@$A | |
W@$A | |
?*+k | |
____________Application will exit by signal:%d,pid:%d | |
____________Application exit thread name %s | |
/proc/%d/cmdline | |
./gdb %s %d | |
SYSTEMLOG Init | |
========== HI3518 PLATFORM APP V4 Build:%s %s pid:%d ============== | |
Feb 25 2016 | |
11:55:53 | |
###### FUNCTION_LANGTAO_SUPPORT ########## | |
###### FUNCTION_HIK_SUPPORT ########## | |
###### FUNCTION_TOPSEE_SUPPORT ########## | |
MIAN APP Build:%s %s | |
MIAN APP initSystem Failed | |
[lg][APP]: initSystem OK! | |
dms_sysnetapi_PlayBackGetFrame | |
dms_sysnetapi_MBUF_GetReadPtrPos | |
dms_sysnetapi_MBUF_GetFrame | |
dms_sysnetapi_ioctrl_in | |
#### %s %d | |
g_TotalNum == 0! | |
FUN:%sLINE:%d parameter error | |
dms_sysnetapi_MBUF_GetReadPtrPos ReaderId %d Jump Iframe | |
FUN:%sLINE:%d VS_BUF_GetFrame error%d | |
dms_sysnetapi_MBUF_DelReader nReaderId %d | |
dms_sysnetapi_MBUF_AddReader chn %d streamtype%d readerId %d | |
dms_sysnetapi_close handle:flag:%d | |
dms_sysnetapi_FindNextFile-pFilesInfo is NULL-g_dms_sysnet_stop=%d! | |
## dms_sysnetapi_FindNextFile-pFilesInfo->CurNum:%d,pFilesInfo->EndIndex:%d! | |
dms_sysnetapi_open successed handle:flag:%d | |
dms_sysnetapi_FindFile-pFindCond is NULL! | |
dms_sysnetapi_FindFile-pFilesInfo malloc failure! | |
dms_sysnetapi_FindFile-JB_search_file_list_add failure-FileCounts=%d! | |
FileNumInTime = %d! | |
pFilesInfo->TotalNum = %d! | |
FileCounts:%d,StartIndex:%d,EndIndex:%d,maxNum:%d! | |
20160225 | |
#### %s %d, dwSize=%ld, csDeviceModle:%s | |
Paramer error... | |
%s(%d) - %d , %s | |
dms_sysnetapi.c | |
192.168.1.100 | |
255.255.255.0 | |
192.168.1.1 | |
8.8.8.8 | |
WifiList.dwSize:%ld | |
channel_osdinfo.byShowChanName = %d | |
channel_osdinfo.dwShowNameTopLeftX = %ld | |
channel_osdinfo.dwShowNameTopLeftY = %ld | |
channel_osdinfo.csChannelName = %s | |
channel_osdinfo.time(%lu,%lu), stDevicInfo.fmt:%d | |
Set Brightness | |
Set Contrast | |
Set Saturation | |
Set Hue | |
Set Definition | |
DMS_NET_SET_SHELTERCFG | |
################## DMS_VENC_DisableVDA stop success................ | |
################## DMS_VENC_EnableVDA start success................ | |
XDMS_NET_SET_DECODERCFG | |
g_jb_globel_param.stServerCominfo[%d].eBaudRate = %ld, hspeed:%d, vspeed:%d | |
byDataBit:%d | |
pelco-d | |
DMS_NET_GET_DEF_DECODERCFG | |
DMS_NET_GET_ALARMOUTCFG:%d | |
DMS_NET_SET_ALARMOUTCFG:%d | |
DMS_NET_GET_USERCFG_V2 nChannel=%d | |
%s: DMS_NET_SET_USERCFG, User 0 can not empty. | |
%s: DMS_NET_SET_USERCFG_V2, User 0 can not empty. | |
admin | |
%s: DMS_NET_SET_USERCFG_V2, User%d can not be admin | |
%s: DMS_NET_SET_USERCFG_V2, Username is invalid %d,i=%d | |
%s: DMS_NET_SET_USERCFG_V2, groupid is invalid | |
%s: DMS_NET_SET_USERCFG_V2, Add user ch= %d | |
DMS_NET_SET_USERCFG | |
%s: DMS_NET_SET_USERCFG_V2, edt user ch= %d | |
%s,%d setuserconfig usernanme=%s,userright=%d,ch=%d,benable=%d | |
%s: DMS_NET_SET_USERCFG, User%d can not be admin | |
%s: DMS_NET_SET_USERCFG, Username is invalid %d | |
DMS_NET_GET_EXCEPTIONCFG, size=%d | |
DMS_NET_SET_EXCEPTIONCFG, size=%d | |
%s: DMS_NET_HD_FORMAT fail!ret=%d | |
/jb_config/jb_rootfs/default.tar.gz | |
### %s(%d) ERROR: pstSysNetApi == NULL | |
DMS_NET_REG_ALARMCALLBACK Param:0x%x | |
alarmout:%lu, %lu | |
function(%s) DMS_NET_CMD_START_TALKAUDIO enFormatTag:%d, nNumPerFrm:%d, pstSysNetApi:%d | |
dms_sysnetapi-dms_sysnetapi_ioctrl_in-DMS_NET_SET_SAVECFG | |
DMS_NET_SET_SAVECFG | |
%s:DMS_NET_SET_RTSPCFG Port is Invalid | |
DMS_NET_SET_RTSPCFG-old=%lu,new=%lu! | |
SendEmail return %d | |
This Is Test Mail | |
/jb_config/jb_rootfs/jb_default.config | |
/jb_config/jb_rootfs/logo.png | |
sizeof(DMS_LOG_RESULT)=%d, *lpOutSize=%d | |
download faile | |
download success | |
get DMS_NET_NOTIFY_SERVER: szie=%ld enable=%d interval=%ld port=%ld dns=%s | |
set DMS_NET_NOTIFY_SERVER: szie=%ld enable=%d interval=%ld port=%ld dns=%s | |
Unsupport cmd:0x%x! | |
dms_netplatform_init_config | |
dms_sysnetapi_inter_start | |
ls /tmp/lib/libnetpt.so -l > /tmp/lib_debug.info | |
/tmp/lib_debug.info | |
%s(%d) ########## buff:%s | |
libnetpt.so. | |
%s(%d) ########## enPlatManufacture:%d | |
dms_sysnetapi_inter.c | |
enPlatManufacture:%d(%s:%lu) '%s' | |
/usr/netview/app/lib/libnetpt.so.%d | |
Get stat on %s Error:%s | |
%s st_size error:%ld | |
rm -f /tmp/lib/libnetpt.so | |
ln -s /usr/netview/app/lib/libnetpt.so.%d /tmp/lib/libnetpt.so | |
%s(%d) ########## Config nPlatManufacture(%d) != ln nPlatManufacture(%d) buff:%s | |
JB_MailSend_Thread | |
================== thread %s pthread_self %d getpid() %d | |
MailSend | |
alloc for sendemailitem.csAttachBuf error | |
Send Email Thread Begin Run. | |
User Snapshot | |
Video Lost Alarm | |
Video Move Detect | |
Sensor Alarm | |
Alarm Type: %s(%s) | |
Video Move resume | |
Video ITEV Detect | |
Video ITEV resume | |
Video ITEV TRIPWIRE Detect | |
Video ITEV TRIPWIRE resume | |
Video ITEV VIDEOFOOL Detect | |
Video ITEV VIDEOFOOL resume | |
Server Break | |
Video Occlusion Alarm | |
Unknown error(%lu) | |
Server IpAddr: %s; | |
Server Name: %s; | |
Server Channel Count: %d; | |
Alarm Type: %s; | |
Alarm ChannelId: %d; | |
Date: %04d-%02d-%02d %02d:%02d:%02d | |
Server IpAddr: %s; | |
Server Name: %s; | |
Server Channel Count: %d; | |
Alarm Type: %s; | |
Alarm ProbeId: %d; | |
Date: %04d-%02d-%02d %02d:%02d:%02d | |
%04d-%02d-%02d_%02d:%02d:%02d_CH%d.jpg | |
SendMail Return %X | |
malloc memory for email send failed. | |
ftp_putfile | |
ftp_putfile | |
%s(%d) get ip faile | |
%s %d, ftpOpen %s failed!nRet=%d, %s | |
Manual_%02d_%02d_%02d_%03d.jpg | |
AlrmAV_%02d_%02d_%02d_%03d.jpg | |
Sensor_%02d_%02d_%02d_%03d.jpg | |
/%04d-%02d-%02d/Capture/ | |
%s(%d)/ | |
%s %d, ftpCheckAndMkdir %s failed | |
%s %d, csServerIp: %s,remotefile:%s | |
%s %d, send ftp data error! | |
dms_exceptalarmprocess_thread | |
dms_alarmprocess_thread | |
%s:%d status=%d! | |
jbalarmpro.c | |
malloc(%d) error.. | |
reset alarm out..... | |
#### set motion %d, enable:%d... | |
AlarmMng | |
except alarmprocess | |
Exit thread %s! | |
dms_alarmprocess_thread | |
codec: the audio out driver has been closed [fail] | |
jbaudiotalk.c | |
encrypt_At88sc0104 | |
check_encrypt err .............................................(%d) | |
/jb_config/jb_rootfs/hi3518c_mac.config | |
old g_authen_ic_raw_information.byPCBType [%d] | |
old g_authen_ic_raw_information.byPCBVer [%d] | |
[0].g_authen_ic_raw_information.bSize [%d] | |
[1].g_authen_ic_raw_information.bChannelCount [0x%x] | |
[2].g_authen_ic_raw_information.wCompany [%d] | |
[3].g_authen_ic_raw_information.wCpuType [%d] | |
[4].g_authen_ic_raw_information.bAlarmInCount [%d] | |
[5].g_authen_ic_raw_information.bAlarmOutCount [%d] | |
[6].g_authen_ic_raw_information.dwSupOption [%lu] | |
[7].MAC [0x%x:0x%x:0x%x:0x%x:0x%x:0x%x] | |
[8].g_authen_ic_raw_information.bSerial [%s] | |
[9].g_authen_ic_raw_information.bImageSize [%d] | |
[10].g_authen_ic_raw_information.byPCBType [%d] | |
[11].g_authen_ic_raw_information.byPCBVer [%d] | |
At88sc0104 check_encrypt suc ............................................. | |
jb_authen_interface.c | |
file(%s), line(%d), jb_authen_write error errno = %d | |
file(%s), line(%d), jb_authen_read error errno = %d | |
read 1 JB_AUTHEN_BLOCK0 [%d] | |
read 2 JB_AUTHEN_BLOCK1 [%d] | |
[8].bSerial [%s] | |
file(%s), line(%d), jb_authen_check_chip_online error errno = %d | |
file(%s), line(%d), jb_authen_init_burn error errno = %d | |
file(%s), line(%d), jb_authen_check error errno = %d | |
/dev/dms_authen0104 | |
file(%s), line(%d), jb_gpio_open: open jb_gpio error ret = %d, errno = %d | |
file(%s),line(%d), authen open ok | |
JB_DisplayVideoOsd | |
jb_start_adec | |
jb_start_aenc | |
JB_Video_jpegThread_Initial | |
snap_process_thread | |
alloc_snapnode | |
insert_snapnode | |
JB_Video_Auto_jpegThread | |
JB_Video_jpegThread | |
jbcodec.c | |
nChannel num error %d | |
OsdTime | |
OSDTimeUpdateThread | |
snap nChannel num error %d | |
$$$ %dx%d | |
create pthread for ch[%d] send stream fail ! | |
################## AV Channel:%d NOT OPENED | |
create pthread for ch[%d] send audio stream fail ! | |
jb debug : create audio encoder[%d] thread ok | |
%s %d, invalid channel!nChannel:%d | |
%s %d, invalid nStreamChn!nStreamChn:%d | |
SET channel_osdinfo.time(%lu,%lu), fmt:%d,%d | |
jbcode-API_Color_Set-channel-%d | |
%s--wType=%d! | |
%s already! | |
JB_Video_jpegThread_Initial create JB_Video_jpegThread | |
snap_process_thread | |
%s %d, start process data.SnapTarget:0x%x,g_snapnum:%d | |
send email ret=%d.... | |
%s %d, malloc error!err:%s | |
%s %d, ftp_putfile begin | |
%s %d, malloc pSN error!err:%s | |
%s %d, malloc pJpegData error!err:%s | |
%s %d, snapshot list is full! g_snapnum:%d | |
AutoJpegSnap | |
%s %d, alloc snapnode failed! | |
%s %d, SRDK_Codec_SnapShot failed! | |
snapt timer v2 is %X | |
................... Entry Video_jpegThread | |
Video Jpeg Snap toclientMsg->nID [%d] nChannel:%ld nErrorCode:%ld nCommand:%d | |
toclientMsg.nErrorCode=%lu | |
................... Leave Video_jpegThread | |
JB_AVCaptureThread | |
================================================== | |
DUMP AVCapture INFO | |
Venc Channel %d Enable %d-%d-%d | |
Venc Channel %d CaptureStep %d-%d-%d | |
AVCaptureThread Venc Main Stream FD:%d | |
AVCaptureThread Venc Query Main Stream :%d | |
AVCaptureThread Venc Second Stream FD:%d | |
AVCaptureThread Venc Query Second Stream :%d | |
AVCaptureThread Venc Mobile Stream FD:%d | |
AVCaptureThread Venc Query Mobile Stream :%d | |
OSD Time Update Step:%d | |
AEnc | |
file(%s), line(%d), alloc for audio buffer fail ! | |
jb_encoder_thread.c | |
JB_AEncFrameThread_%d | |
AVCapture | |
============================ JB_AVCaptureThread(%d:%d:%d) | |
JB_AVCaptureThread_%d | |
select err | |
%s-%d: RestartSystem-iDec=%d! | |
%s-%d: RestartSystem-g_sysMinute(%d)-errMinute(%d)-iDec=%d! | |
AVCaptureThread Time Out s32MainVencFd:%d, s32SubVencFd:%d, s32MobileVencFd:%d | |
============================ Leave JB_AVCaptureThread | |
jbioAlarm.c | |
Probe_set->nSensorID [%d] | |
SetAlarn | |
jb_ipaddr_format | |
###@@@FUN:%s LINE: %d Addr Bad | |
###@@@FUN:%s LINE: %d Addr NULL | |
jbmp4drv.c | |
HI3518E SUB D1 dwFrameRate %lu bigger than 5! | |
HI3518E SUB VGA dwFrameRate %lu bigger than 7! | |
HI3518E SUB 640x360 dwFrameRate %lu bigger than 9! | |
HI3518E SUB CIF dwFrameRate %lu bigger than 12! | |
Restart MAIN stream encode! | |
Restart SECOND stream encode! | |
Restart MOBILE stream encode! | |
BlockSendData | |
UdpPortListenThread | |
ListenThread | |
JB_Video_Net_Send | |
RestartListenThread | |
do_OpenFile_ByTime | |
access_listen_ret_thread | |
do_OpenFile_Request | |
jbnet.c | |
---------------------------------------------------err(%d) 2 | |
/proc/partitions | |
count =%d | |
%s %s %s | |
start Download flash bin file count=%d size=%d | |
/dev/mtd%d | |
file(%s) line(%d) open mtd=%s == %d | |
Count =%d i=%d DownloadFlashBinFile send end! | |
Invailid Socket %d, Net_Protocol::BlockSendData() failed. | |
%s %d socket %d Error:%d %s | |
BlockSendData %d socket %d send : %d %s | |
send failed: %s | |
%s:%d serchannel:%lu, maxchannel:%d | |
UdpPortListen | |
[ListenThread]: g_serinfo.hUdpPortSock(%d) | |
UdpPortListenThread | |
[UdpPortListenThread]: g_serinfo.bServerExit(%d) | |
[UdpPortListenThread]: g_serinfo.bListenExit(%d) | |
Exit %s! | |
Listen | |
[ListenThread]: g_serinfo.hListenSock(%d) | |
ListenThread | |
1.[ListenThread]: g_serinfo.bServerExit(%d) | |
1.[ListenThread]: g_serinfo.bListenExit(%d) | |
accept sock==0!!!!! why? | |
Start Logon accept()........... from %s:%d accept_sock= %d, tid:%lu | |
Realloc %d bytes(%d KB). | |
@@@ %s(%d) nID(%d) Error nCommand:0x%x, nBufSize:%d | |
Sending All Uer | |
Seek to %s to %lu-%lu-%lu | |
Seek to (%lu,%lu)%u mSec | |
Seek failed... | |
### TotalTime:%lu, %lu, %lux%lu, %lu, basetime:%lu | |
### FirstFrame:%lu type:%d size:%lu, vedio:%lu, audio:%u timetick:%lu(%lu:%lu:%lu),PlayTime:%lu ----- | |
### recv:%lu(%lx) ,%lu--------------- | |
VCR comamnd = JB_PLAY_CMD_PLAY | |
############################ get pos ERR | |
########### NextFile.. | |
########### end of play, nStopCount=%d.. | |
%s[%d] File_ReadAndSend FAILED. GOTO OUT_WORKER | |
Last Frame:%lu/%lu, size:%lu, type:%d | |
### stop and play next file, i:%d %s | |
##close socket... | |
Leave do_OpenFile_Request main body sockfd=%d | |
JB_Video_CheckUser_V2 level =%d | |
nCurNum(%d) + 1 >= MAX_THREAD_NUM(%d) | |
SOCK_LOGON ok...Alarm:(%lu,%lu) | |
[1] Open Channel ret[%d], socktype:%d, stream:%lu | |
--------- socket :%d | |
file(%s) line(%d) nRet == %d | |
### FileName:%s, SrmType:%lu, channel:%lu | |
### TotalTime:%lu, %lux%lu, %lu | |
### FirstFrame:%lu type:%d size:%lu, vedio:%lu, audio:%u timetick:%lu(%lu:%lu:%lu) --------------- | |
socket read error! | |
### recv:%lu ,%lu--------------- | |
VCR comamnd = REQUEST_SEEK bHasIndex :%d dwData:%lu SeekPlayStamp:%d FileStamp:%lu | |
Find I frame .... | |
Find I frame success. | |
talkback 1 | |
talkback 2 | |
startAudiotalk error !!! | |
talkback 3 | |
SOCK_ALARM ok! | |
### dms_ProcessOpenAlarm.. | |
Alarm 1 | |
Down Flash Bin file | |
.jpg | |
start download file:%s | |
map buffer failed! | |
send len is %d sendlen is %lu | |
send faild! | |
remove file:%s | |
[2] Open Channel [%d] | |
MultiIP ERROR | |
version.ini | |
TTTTTTTTTTTTTTTTTTTTTTTTTT %s, %d | |
net_set_ethx_down | |
net_set_ethx_up | |
%s %08lX %08lX %8X | |
/proc/net/route | |
fopen failed,INET (IPv4) not configured in this system!err:%s(%d) | |
%lx%lx%X%d%d%d%lx | |
ethname = %s,iface=%s | |
socket error!err:%s(%d) | |
ioctl:SIOCADDRT error!err:%s(%d) | |
ioctl:SIOCDELRT error!err:%s(%d) | |
ioctl:SIOCGIFNETMASK failed!err:%s(%d) | |
ioctl:SIOCSIFNETMASK error!err:%s(%d) | |
ioctl:SIOCSIFADDR error!err:%s(%d) | |
%u.%u.%u.%u | |
route del -net %s netmask %s dev %s | |
route add -net %s netmask %s dev %s | |
route del default dev %s | |
ifconfig eth0 down | |
%s%s | |
ifconfig eth0 hw ether | |
cmd = %s! | |
set_net_phyaddr cmd [%s] | |
ifconfig eth0 up | |
/etc/resolv.conf | |
nameserver | |
nameserver %32s | |
%02X:%02X:%02X:%02X:%02X:%02X | |
/etc/%s | |
nameserver %s | |
/etc/resolv_static.conf | |
get_ip_addr: invalid argument! | |
net_get_ipaddr: creat socket error | |
get_ip_addr: Get NetDev:%s ip fail,please change to eth0 | |
%s:%d: args invalid! | |
%s:%d: You can't pull down interface lo! | |
%s:%d: socket failed! | |
%s:%d: ioctl failed 1! | |
%s:%d: ioctl failed 2! | |
%s:%d: create socket failed! | |
%s:%d: ioctl error 1 | |
%s:%d: ioctl error 2 | |
StopUdpNode | |
StopAllTcpNode | |
UdpSendThread | |
TcpDataQuitThread | |
XSendLastPacket | |
TcpDataSendThread | |
STOP %s:%d | |
Exit %s! | |
%s:%d malloc failed | |
jbsendlist.c | |
UdpSend | |
TcpDataQuit | |
#################### %s %d, stPackHead.nSize=%ld, stPackData.wBufSize=%d | |
TcpDataSend | |
left=%d! | |
right=%d! | |
send timeout too long, and we will close this session! | |
send thread: snd_err_tick2 > 10 | |
JB_Update_File | |
JB_Send_Update_File | |
SetSysNetworkThread | |
DealJbCommand | |
ReceiveFun | |
%s(%d) JB_User_Right_Check_Func_V2 step3 nCommand=%d | |
jbsession.c | |
sizeof JB_SERVER_RECORD_CONFIG is not right | |
upgrade.img | |
%s: size=%d err! | |
size = %d! | |
update_header->nPackNo = %ld! | |
update_header->nPackNum=%ld! | |
update_header->nFileLength=%lu! | |
update_header->nFileOffset=%lu! | |
update_header->nPackSize=%lu! | |
update_header->bEndFile=%d! | |
update_header->ufh.dwFileLen=%lu! | |
update_header->ufh.csFileName=%s! | |
%s: nFileLength=%d err! | |
%s: pUpdeteFile->update_buffer malloc err! | |
%s: NULL == pUpdeteFile || NULL == pUpdeteFile->update_buffer! | |
%s: update_header->nFileLength = %ld! | |
%s: update_header->nFileOffset = %ld! | |
%s: update_header->nPackSize = %ld! | |
%s: update_header->bEndFile = %d! | |
%s: fopen %s err! | |
%s: NULL == pMsgHead || NULL == pFileName err! | |
%s: File(%s) is not exist! | |
s.st_size=%ld! | |
%s: malloc failure! | |
%s: NULL == pFile! | |
pMsgHead->nBufSize=%d! | |
/proc/%d/status | |
%*s %s | |
rm %s | |
Step in SetSysNetworkThread! | |
%02x:%02x:%02x:%02x:%02x:%02x | |
DEVICE_MAC | |
kill -9 `cat /var/run/udhcpc.pid` && rm /var/run/udhcpc.pid | |
%s:%d set dhcp will %s | |
Change ip address! | |
Change mask! | |
Change gateway! | |
Change ddns! | |
JB_Video_UserInfo_Set | |
Set user %s | |
length err:csUserName:%s,csPassword:%s! | |
Set user %s OK | |
#### set byNetPreviewRight=%d | |
toclientMsg.nID [%d] | |
%s(%d) call JB_initDefaultSet | |
### CMD_SET_COMMODE... | |
jbsession-DealJbCommand-CMD_UPDATEFLASH | |
CMD_SET_SHELTER | |
g_jb_globel_param.jb_Wifi_config.byStatus = %d! | |
### Begin All Record... | |
## CMD_GET_COMINFO | |
CMD_GET_COMMODE.... | |
Read CMD_GET_JB_I2C_CONFIG | |
Write CMD_SET_JB_I2C_CONFIG | |
CMD_GET_SERVER_STATUS....... | |
CMD_GET_CENTER_LICENCE.... | |
CMD_UPDATE_CENTER_LICENCE... | |
### CMD_UPDATA_DEFAULT_PTZCMD_DATA... | |
UPNP ok is %d - %d - %d | |
UPNP ENABLE is %d | |
UPNP mandatory map is %ld | |
NETCMD_OPEN_REVERSE_CH: Failed! | |
/usr/netview/web/res/logo.png | |
#### %s %d, %d-%d, dwCmd=%d | |
####, %s %d, dwCmd=%d, %d %d | |
#### %s %d, len=%d | |
#### %s %d, len=%d, 0x%X 0x%X 0x%X 0x%X 0x%X 0x%X | |
#### %s %d, index=%ld, check right error | |
Not Right ! | |
ReceiveFun nCommand:0x%x | |
%s-%d: it was upgrading system! | |
dms_ioctrl 0x%x error!, code:%x | |
/proc/bus/usb/devices | |
mount -t usbfs none /proc/bus/usb | |
WLAN | |
ProdID=3070 | |
ProdID=5370 | |
ProdID=7601 | |
Vendor=1c9e | |
Vendor= | |
Vendor=%x ProdID=%x | |
############# 3G/4G:%lu | |
index=%d, %s-%s | |
0x%X 0x%X 0x%X 0x%X 0x%X 0x%X====0x%X 0x%X 0x%X 0x%X 0x%X 0x%X | |
bNameCheck:%d, bPasswordCheck:%d, bUserIpCheck:%d, bWetherCheck:%d, bUserMac:%d | |
pFrame %p , enStreamType %d nChannelNo %d | |
jbstream.c | |
DMS_STREAM_Init g_bStreamInit=%d already! | |
DMS_YT_ACtion | |
JB_Check_Sensor_Type | |
JB_Network_DHCP | |
restartSystem | |
sysTimeThread | |
JB_Network_initNetWork | |
initSystem | |
/jb_config/jb_rootfs/dms_zero_check_test_%d | |
jbsysinit.c | |
date %04d.%02d.%02d-%02d:%02d:%02d | |
echo GMT-%d:%d > /etc/TZ | |
echo GMT-%d > /etc/TZ | |
echo GMT+%d:%d > /etc/TZ | |
echo GMT+%d > /etc/TZ | |
admin_group | |
operater_group | |
user_group | |
%s-%d: uiAct=%d! | |
uiSensor=%d | |
%s: Read LastViChip failure! | |
%s: LastViChip value(%d) failure! | |
%s: nCurVIChip=%d,nLastViChip=%u! | |
%ld.%ld.%ld.%ld | |
DNS Server Is Empty. | |
NetWork Gateway Is Empty. | |
Invalid Notify Network Port. | |
Get stNotifyServers.szDNS IpAddress error(%d) | |
echo -n > /etc/resolv_static.conf | |
%s,%d start dhcp client | |
/usr/share/udhcpc/eth0.script | |
udhcpc -s /usr/share/udhcpc/eth0.script -b -p /var/run/udhcpc.pid -i eth0 | |
udhcpc -b -p /var/run/udhcpc.pid -i eth0 | |
system udhcpc -n return %d,g_bkill_dhcp=%d | |
1.Get Network IP :%s | |
1.Get NetMask IP :%s | |
1.Get Gateway IP :%s | |
Get DNSServer IP :%s | |
dhcp step 9 %s | |
FUN.%s LINE.%d set netmask fail | |
FUN.%s LINE.%d set gateway fail | |
DMSNOTIFY_TYPE_RESET run | |
#### %s %d, dms_sysnetapi_ioctrl error! | |
this system will be restarted now !!! | |
umount /jb_config/jb_rootfs | |
sysTime | |
%s %d | |
/var/run/eth0updatetime | |
resolv_eth0.conf | |
/www/index.html | |
vPort | |
cfg Mac: %02x:%02x:%02x:%02x:%02x:%02x! | |
%s, IP: %s MASK: %s GATEWAY: %s | |
FUN.%s LINE.%d set ip fail | |
checkAndGetIP begin | |
set dns server addr ok, dns server addr is %s | |
ifconfig eth0:1 169.254.100.100 | |
port=%d | |
@@@@@@@@@ %s | |
========== HI3518 PLATFORM BAICMODULE Build:%s %s ============== | |
11:55:38 | |
nChannelNum [%d], nKeyCheckRes [%d] | |
+++++++++==========++++++ g_fatal_param.default_flag = %d | |
+++++++++==========+++++ g_fatal_param.fatal_param_len = %d | |
[1]: initialize the system parameter with HARDRESET default value. | |
%s call JB_initDefaultSet | |
[2]: initialize the system parameter with fFlagSoftReset default value. | |
[3]: initialize the system parameter with value. | |
[4]: initialize the system parameter with fFlagHardReset default value. | |
[5]: initialize the system parameter with HARDRESET default value. | |
#### %s %d, csID = %s | |
see-world.cc | |
[lg][APP]: Start up tty OK! | |
rm smart video device---------------------------------------------------- | |
/tmp/fifoserver | |
Create FIFO Sever Error ! | |
Create FIFO Sever Succseed ! | |
Open FIFO Fail! | |
Open FIFO OK! | |
TalkbackThread | |
jbtalkback.c | |
g_serinfo.hTalkbackSocket=0 error | |
Talkback | |
TalkbackThread: audio talk socket is rushed0! | |
TalkbackThread: audio talk socket is rushed1! | |
TalkbackThread: audio talk socket is rushed1:2! | |
TalkbackThread: audio talk socket is rushed2! | |
TalkbackThread: audio talk socket is rushed3! | |
TalkbackThread: audio talk socket is rushed4! | |
TcpListenNatThread | |
udpListenNatThread | |
jbthrough.c | |
inPort = %d | |
Get Jb_Notify_Servers.szDNS IpAddress error(%d) | |
sock is %d | |
InitTcpRemoteDir: REMOTE_HOST_DIR.tcpLocalSock = %d | |
connectRemoteHost: connect ok | |
InitUDPRemoteDir: the ip has exist | |
access_listen_ret_thread | |
access_listen_ret_thread ret | |
REMOTE_HOST_DIR.port == %d | |
REMOTE_HOST_DIR.ip == %lu | |
BackConnect : No Set Remote Server Address | |
Connect To Client %s %d Failed | |
Connect To Client %s %d Success | |
Connect To Client Send Message Failed | |
ProcessRemoteRequest Failed tcpLocalSock:%d | |
REMOTE_HOST_DIR.tcpLocalSock < 0 | |
REMOTE_HOST_DIR.status == LOGO_OFF | |
TcpListenNatThread | |
TcpListenNatThread Thread Start. | |
connectRemoteHost: tcpSendMsg error | |
ConnectForCreateCh: ProcessRemoteRequest error | |
[test]: ConnectForCreateCh OK! | |
udpListenNatThread | |
detectTtyThread | |
jbttyset.c | |
------ jb PTZ -------- | |
------ dms PTZ -------- | |
dms_ComInfo_RS485_Set | |
Set RS485 | |
### Write_PtzData2Rs485... | |
baud is %ld | |
jb_rs485_recv() Error errno = %d | |
================== Leave thread %s pthread_self %d getpid() %d | |
StopAllClient | |
TcpMsgQuitThread | |
TcpMsgRecvThread | |
TcpReceiveEX2 | |
jbuserlist.c | |
ClientLogoff-g_clientlist.nTotalNum = %d! | |
ClientLogon-g_clientlist.nTotalNum = %d! | |
TcpMsgQuit | |
TcpReceive-ret=%d,hSock=%d | |
TcpReceive other fd, re select(%lu,%lu).... | |
TcpReceive blocked or interruted | |
TcpReceive error : %s %d-%d ret is %d, nRecv:%lu/%lu | |
================== thread %s pthread_self %d getpid() %d, %d | |
TcpMsgRecv_%d | |
%s(%d) - %d , %s, remote client exit ok | |
error hSock = %d | |
%s:%d interrupted | |
%s:%d socket %d disconnected | |
local_record.c | |
entry JB_find_file_parse_then_send_buf>>>>>>>>>>>>>>>>>>>>>>>>> | |
### StartTime:%lu-%lu-%lu %lu:%lu:%lu | |
### StopTime :%lu-%lu-%lu %lu:%lu:%lu | |
there are too many files | |
there are %lu files | |
can not find files | |
### nFillBuffer = %d, FindFileResp.nCount=%lu, maxNum:%d | |
start JB_Video_Net_Send %d >>>>>>>>>>>>>>>>>>>>>>>> | |
HandleHDEvent event:%d | |
dms_process_resetstate | |
StartCtrLedSignal | |
NotifyUserBySound | |
DMS_Notify_User | |
notifyUser.c | |
file(%s), line(%d) fatal this system will restart !!! | |
#### %s, %d, create thread fail! ret=%d, %s(errno:%d) | |
CtrLedSignal | |
#### %s %d, dms_sysnetapi_ioctrl error!ret=%d | |
#### %s %d, open file %s failed | |
read file to end | |
#### %s %d, dms_sysnetapi_open failed netType=%d | |
DMS_Notify_User DMSNOTIFY_TYPE_CONNECT_SUCCESS | |
/usr/netview/app/notifySound/notifyConnectSuc.g711 | |
DMS_Notify_User DMSNOTIFY_TYPE_SCAN_SUCCESS | |
/usr/netview/app/notifySound/notifyScanSuc.g711 | |
DMS_Notify_User DMSNOTIFY_TYPE_RESET begin | |
/usr/netview/app/notifySound/notifyReset.g711 | |
DMS_Notify_User DMSNOTIFY_TYPE_RESET end | |
DMS_Notify_User DMSNOTIFY_TYPE_WIFI_PWD_ERROR | |
/usr/netview/app/notifySound/notifyPwdError.g711 | |
DMS_Notify_User DMSNOTIFY_TYPE_WIFI_NOT_SET | |
/usr/netview/app/notifySound/notifyWifiNotSet.g711 | |
#### %s %d, Not recognized notify type:%d | |
Get_NtpTimeZone | |
Get_NtpTimeZone | |
SetSysTime | |
ntp_thread | |
dvsinfo.%s | |
GET /gettime.aspx HTTP/1.1 | |
Accept: image/gif, image/x-xbitmap, image/jpeg, image/pjpeg, application/x-shockwave-flash, application/msword, application/vnd.ms-excel, application/vnd.ms-powerpoint, */* | |
Accept-Language: zh-cn | |
Accept-Encoding: gzip, deflate | |
User-Agent: Mozilla/4.0 (compatible; MSIE 6.0; Windows NT 5.1; SV1; .NET CLR 2.0.50727; Shuame) | |
Host: %s | |
socket | |
---%s(%d),connect failure | |
---%s(%d),send failure | |
---%s(%d),slect failure | |
---%s(%d),recv failure | |
status | |
recvdatabuf err | |
</status | |
no </status | |
%s(%d) status:%s | |
</time | |
-4.5 | |
-3.5 | |
5.75 | |
9.30 | |
%s(%d) zone:%d | |
currTime=%lu,ntpTime=%lu | |
not need to changge time diff less than 3 second | |
ntpmng.c | |
systime:%04d%02d%02d-%02d:%02d:%02d | |
ntp set time | |
GetNtpTime failed | |
Ntpthread | |
%s:%s[%d] ntp thread start... | |
Get_NtpTimeZone failed | |
Get_NtpTimeZone success NtpTimezone=%d | |
TimeAdjustCounter: %d, timezone=%d | |
TimeAdjustCounter: %d, wInterval=%d | |
ntpThrFxn | |
ntpclient -s -i %d -h %s -P %d | |
buf :%s | |
11111 ntpclient return %d. | |
ntpclient return %d. | |
dms_write_Channel_AlarmOut | |
JB_SetDataPort_Script | |
dms_defaultpara_server_user | |
dms_default_Channel_AlarmOut | |
dms_read_device_extension_config | |
JB_UpdateCfgFile | |
JB_GetIP_From_CfgFile | |
JB_GetMac_From_CfgFile | |
DMS_Dev_960P_Hi3518_GetSupportStreamFmt | |
dms_defaultpara_server_user_v2 | |
dms_read_lenses | |
dms_read_channel_hide_alarm | |
dms_read_onviftest_info | |
dms_read_email_param | |
dms_read_channel_cb_detection_config | |
dms_read_sensor_type | |
dms_read_ntp_param | |
dms_read_snap_timer | |
dms_read_rtsp_param | |
dms_read_p2p_param | |
dms_read_mobile_param | |
dms_read_upnp_param | |
dms_read_timezone_config | |
dms_read_wireless_tdscdma_param | |
dms_read_wireless_wifi_param | |
dms_read_default_ptz_Protocol | |
dms_read_producer_setting_config | |
dms_read_protect_key_information_config | |
dms_read_ddns_config | |
dms_upload_cfgfile | |
dms_read_pppoe_config | |
dms_read_notify_servers | |
dms_read_ftpupdata_param | |
dms_read_server_com2info | |
dms_read_server_cominfo | |
dms_read_exception_info | |
dms_read_channel_osd_info | |
dms_read_channel_video_lost | |
dms_read_channel_probe_alarm | |
dms_read_channel_motion_detect | |
dms_read_channel_shelter | |
dms_read_channel_enhanced_color | |
dms_read_channel_color | |
dms_read_record_setting | |
dms_read_Channel_AlarmOut | |
dms_read_stream_info | |
dms_read_server_user | |
dms_read_server_user_v2 | |
dms_read_device_config | |
dms_read_channel_pic_param | |
dms_read_server_network | |
InitDefaultConfigFile | |
JB_GetDefaultValue_From_CfgFile | |
dms_read_roi_cfg | |
/jb_config/jb_rootfs/dms_perimeter.json | |
paramcfg.c | |
/jb_config/jb_rootfs/dms_itevcontrol.json | |
/jb_config/jb_rootfs/dms_tripwire.json | |
/jb_config/jb_rootfs/dms_videofool.json | |
Check_cJSON_Value_Valid is failed the cJSON data is bad | |
end of free.. | |
location/city/ANY | |
time.windows.com | |
/tmp/default.tar.gz | |
tar -zcvf /tmp/default.tar.gz /jb_config/jb_rootfs/*.json | |
(%d)Filelen=%d | |
fopen faile.errno:%d | |
fread faile.ret=%d | |
file(%s), line(%d):jb_flash_write invalid parameters error | |
file(%s), line(%d):jb_flash_write fopen file(%s) fail(%d) | |
file(%s), line(%d):jb_flash_write fwrite fail | |
mainStream | |
streamType | |
roiName | |
roiId | |
enable | |
qpType | |
qpValue | |
height | |
secondStream | |
threeStream | |
/jb_config/jb_rootfs/dms_channel_roi.json | |
Index | |
/jb_config/jb_rootfs/dms_maintain.json | |
DeviceScopes1 | |
DeviceScopes2 | |
DeviceScopes3 | |
AuthEnable | |
/jb_config/jb_rootfs/dms_onviftest.json | |
NasItem | |
serverip | |
path | |
nasType | |
usrName | |
passWord | |
enableFlag | |
/jb_config/jb_rootfs/dms_nas.json | |
fatal_param_len | |
default_flag | |
sys_err_restart_tick | |
/jb_config/jb_rootfs/dms_dev_fatal.json | |
EnableEmail | |
AttachPicture | |
SmtpServerVerify | |
MailInterval | |
ServicePort | |
EncryptionType | |
EMailUser | |
EmailPass | |
SmtpServer | |
Pop3Server | |
ToAddrList | |
CcAddrList | |
BccAddrList | |
SendAddrList | |
EmailType | |
/jb_config/jb_rootfs/dms_email.json | |
DayNightDetection | |
Trigger | |
AGCSensitivity | |
IRCutLevel | |
LedLevel | |
ColorTime | |
StartHour | |
StartMin | |
StopHour | |
StopMin | |
/jb_config/jb_rootfs/dms_server_cb_detection.json | |
Sensor | |
/jb_config/jb_rootfs/dms_sensor.json | |
NTPServer | |
EnableNTP | |
TimeDifferenceH | |
TimeDifferenceM | |
NtpPort | |
/jb_config/jb_rootfs/dms_ntp.json | |
ScheduleTime | |
PictureQuality | |
ImageSize | |
StoragerMode | |
/jb_config/jb_rootfs/dms_snap_timer.json | |
/jb_config/jb_rootfs/dms_rtsp.json | |
p2ptype | |
/jb_config/jb_rootfs/dms_p2p.json | |
CenterPort | |
ServerNo | |
UserName | |
PassWord | |
AlarmPush | |
/jb_config/jb_rootfs/dms_mobile.json | |
DstMode | |
StartDst | |
EnableDST | |
DSTBias | |
BeginPoint | |
Month | |
WeekNo | |
WeekDate | |
/jb_config/jb_rootfs/dms_timezone.json | |
LineMode | |
ServerIp | |
DataPort | |
WebPort | |
MobilePort | |
/jb_config/jb_rootfs/dms_upnp.json | |
ChannelPic | |
ChannelName | |
RecordPara | |
CompressionType | |
StreamFormat | |
Height | |
Width | |
RateType | |
ImageQuality | |
MaxKeyInterval | |
EncodeAudio | |
EncodeVideo | |
FormatTag | |
BitsPerSample | |
NetPara | |
PhonePara | |
EventRecordPara | |
/jb_config/jb_rootfs/dms_channel_streampic.json | |
DevType | |
NetIpAddr | |
/jb_config/jb_rootfs/dms_wireless_tdscdma.json | |
WifiEnable | |
WifiMode | |
byWifiSetFlag | |
IpV4 | |
NetMask | |
DNSServer | |
Essid | |
NetworkType | |
EnableDHCP | |
WebKey | |
/jb_config/jb_rootfs/dms_wireless_wifi.json | |
WpsStatus | |
/jb_config/jb_rootfs/dms_wireless_WPS.json | |
ChannelPTZ | |
Describe | |
/jb_config/jb_rootfs/dms_pelco_d.json | |
IPAddr | |
PlatManufacture | |
GB28181 | |
HeartBeat | |
RegLoopTime | |
SipServerPort | |
Deviceport | |
Usrname | |
DeviceId | |
ChannelId01 | |
ChannelId02 | |
ChannelId03 | |
ChannelId04 | |
AlarmId01 | |
AlarmId02 | |
AlarmId03 | |
AlarmId04 | |
HXHT | |
NetMode | |
EnableUpnp | |
MsgdPort | |
VideoPort | |
TalkPort | |
VodPort | |
MsgdPortOK | |
VideoPortOK | |
TalkPortOK | |
VodPortOK | |
DITE | |
UsrName | |
UsrPswd | |
/jb_config/jb_rootfs/dms_producer_parameter_setting_ex.json | |
MACAddr | |
Product_Serial_Number | |
/jb_config/jb_rootfs/dms_protect_key_info.json | |
EnableDDNS | |
DDNS | |
DDNSType | |
DDNSUsername | |
DDNSPassword | |
DDNSDomain | |
DDNSAddress | |
DDNSPort | |
UpdateTime | |
/tmp/jb_config/jb_rootfs/dms_ddns_info.json | |
PPPoEEnable | |
PPPoEUser | |
PPPoEPassword | |
PPPoEIP | |
SecurityProtocol | |
/jb_config/jb_rootfs/dms_pppoe_info.json | |
TimeDelay | |
/jb_config/jb_rootfs/dms_notify_server.json | |
EnableFTP | |
FTPIpAddress | |
FTPPort | |
TopDirMode | |
SubDirMode | |
/jb_config/jb_rootfs/dms_ftpupdata.json | |
RS232Cfg | |
DataBit | |
Parity | |
Flowcontrol | |
WorkMode | |
/jb_config/jb_rootfs/dms_server_com2info.json | |
DecoderCfg | |
DecoderType | |
DecoderAddress | |
HSpeed | |
VSpeed | |
WatchPos | |
/jb_config/jb_rootfs/dms_server_cominfo.json | |
ChannelOsdInfo | |
ShowTime | |
DateFormat | |
DispWeek | |
TimeTopLeftX | |
TimeTopLeftY | |
OSDAttrib | |
ShowChanName | |
ShowNameTopLeftX | |
ShowNameTopLeftY | |
OsdEnable | |
OsdContentType | |
Layer | |
AreaAlpha | |
FgColor | |
BgColor | |
LeftX | |
LeftY | |
OsdCotent | |
/jb_config/jb_rootfs/dms_channel_osdinfo.json | |
ChannelShelter | |
Shelter | |
Color | |
/jb_config/jb_rootfs/dms_channel_shelter.json | |
ChannelEnhancedColor | |
SetFlag | |
EnableAutoDenoise | |
Denoise | |
EnableAWB | |
Blue | |
Green | |
EnableAEC | |
EnableAGC | |
Mirror | |
EnableBAW | |
IrisBasic | |
Gamma | |
WideDynamic | |
WDLevel | |
SceneMode | |
EnableAIris | |
EnableBLC | |
/jb_config/jb_rootfs/dms_channel_enchanced_color.json | |
lenses | |
enableAntifogFlag | |
antifogVal | |
enableDisFlag | |
enableShadingFlag | |
/jb_config/jb_rootfs/dms_lenses.json | |
StreamInfo | |
Stream1Height | |
Stream1Width | |
Stream1CodecID | |
Stream2Height | |
Stream2Width | |
Stream2CodecID | |
AudioChannels | |
AudioBits | |
AudioSamples | |
AudioFormatTag | |
/jb_config/jb_rootfs/dms_channel_stream.json | |
DeviceName | |
DeviceID | |
RecordLen | |
Language | |
RecycleRecord | |
OverWritePeriod | |
VideoStandard | |
DateSprtr | |
TimeFmt | |
ConfigWizard | |
SoftwareVersion | |
SoftwareBuildDate | |
DspSoftwareVersion | |
DspSoftwareBuildDate | |
PanelVersion | |
PanelSoftwareBuildDate | |
HardwareVersion | |
HardwareBuildDate | |
WebVersion | |
WebBuildDate | |
ServerCPUType | |
SysFlags | |
ServerType | |
VideoInNum | |
AudioInNum | |
AlarmInNum | |
AlarmOutNum | |
DiskNum | |
RS232Num | |
RS485Num | |
NetworkPortNum | |
DecordChans | |
VGANum | |
USBNum | |
DiskCtrlNum | |
AuxOutNum | |
StreamNum | |
/jb_config/jb_rootfs/dms_server_device.json | |
EtherNet | |
IPV4 | |
IPMask | |
NetInterface | |
NetName | |
MulticastIpAddr | |
GatewayIpAddr | |
ManagerIpAddr | |
DnsServer1IpAddr | |
DnsServer2IpAddr | |
MaxConnect | |
HttpPort | |
ManagerPort | |
MulticastPort | |
/jb_config/jb_rootfs/dms_server_network.json | |
AlarmOut | |
/jb_config/jb_rootfs/dms_channel_alarm_out.json | |
UTF-8 | |
GB2312 | |
g_iconv = %d! | |
%s(%d) iconv_open UTF-8 GB2312 failed:%s | |
/usr/netview/web/a.js | |
%s(%d) fopen:%s failed:%s | |
p1=%s, size1 = %d! | |
p2=%s, size2 = %d! | |
<!-- | |
var vPort = %d; | |
var vUPnPPort = %ld; | |
var vDevIP = "%s"; | |
var ServerName = "%s"; | |
var vP2PType = "%d"; | |
timer:%d,outputbytes:%d,writebytes:%d,totalbytes:%d! | |
write a.js failure! | |
%s%02d | |
AlarmIn | |
%s%d | |
ChannelColor | |
Contrast | |
Brightness | |
write: nBrightness=%d,nContrast=%d! | |
/jb_config/jb_rootfs/dms_write_error_color | |
/jb_config/jb_rootfs/dms_channel_color.json | |
Alarm Out-%d | |
#### %s %d, BUILD_INFO_8M_V3 | |
BUILD_INFO_8M_V3 | |
#### %s %d, enDeviceType=%d, csDeviceModle:%s | |
%s: pFileName == NULL! | |
%s: ini_config_create_from_file failure, name=%s! | |
PRODUCT_IP_SET | |
PRODUCT_IP_SET-DEFAULT-%d! | |
no value | |
%s-%d: pValue=%s! | |
NAME-DEFAULT-%d! | |
%s pValue=%s! | |
%x:%x:%x:%x:%x:%x | |
+++++++++++++++++ MainStreamFormat:%ld | |
+++++++++++++++++ NetStreamFormat:%ld | |
#### %s %d-Exit | |
rec stream: pPara->stRecordPara.dwMaxKeyInterval(%lu) < pPara->stRecordPara.dwFrameRate(%lu)! | |
net stream: pPara->stNetPara.dwMaxKeyInterval(%lu) < pPara->stNetPara.dwFrameRate(%lu)! | |
phone stream: pPara->stPhonePara.dwMaxKeyInterval(%lu) < pPara->stPhonePara.dwFrameRate(%lu)! | |
It is a error for main stream resolution! | |
pPara->stRecordPara.dwStreamFormat = %lu! | |
It is a error for second stream resolution! | |
pPara->stNetPara.dwStreamFormat = %lu! | |
It is a error for mobile stream resolution! | |
pPara->stPhonePara.dwStreamFormat = %lu! | |
dvripc.cn | |
192.168.5.202 | |
192.168.5.1 | |
IPC- | |
%s%02X | |
%s:%02X | |
1.wWidth1 = %d, wHeight1 = %d! | |
2.wWidth1 = %d, wHeight1 = %d! | |
C%03d- | |
%04d%02d%02d | |
data port: pPara->stEtherNet[0].wDataPort(%u) < 1024! | |
Hide_Alarm | |
ActionMask | |
ActionFlag | |
RelAlarmOut | |
RecordChannel | |
PtzLink | |
RecTime | |
DelayTime | |
BuzzerTime | |
/jb_config/jb_rootfs/dms_hidealarm.json | |
ExceptionHandle | |
/jb_config/jb_rootfs/dms_exception_info.json | |
ChannelVideoLost | |
/jb_config/jb_rootfs/dms_channel_video_lost.json | |
ChannelProbeAlarm | |
AlarmInName | |
AlarmType | |
AlarmInHandle | |
/jb_config/jb_rootfs/dms_channel_probe_alarm.json | |
ChannelMotionDetect | |
Sensitive | |
ManualDefence | |
MotionArea | |
/jb_config/jb_rootfs/dms_channel_motion_detech.json | |
ChannelRecordSetting | |
RecordSched | |
RecordType | |
PreRecordTime | |
RecorderDuration | |
RedundancyRec | |
AudioRec | |
RecordMode | |
StreamType | |
/jb_config/jb_rootfs/dms_record_setting.json | |
UserInfo | |
UserRight | |
Priority | |
/jb_config/jb_rootfs/dms_server_user.json | |
UserInfo_v2 | |
group_id | |
/jb_config/jb_rootfs/dms_server_user_v2.json | |
/jb_config/jb_rootfs/dms_channel_enchanced_color_night.json | |
/jb_config/jb_rootfs/dms_channel_color_night.json | |
file(%s), line(%d):jb_flash_read invalid parameters(%s) %p,%d error | |
file(%s), line(%d):jb_flash_read fopen file(%s) fail(%d) | |
file(%s), line(%d):jb_flash_read fread fail | |
file(%s), line(%d):jb_flash_read fread end | |
Error before: [%s], cfgbuf:%s | |
XX Error before: [%s], cfgbuf:%s | |
/jb_config/jb_rootfs/jb_email_param.config | |
rm -f /jb_config/jb_rootfs/jb_email_param.config | |
/jb_config/jb_rootfs/dms_server_cb_detection.config | |
rm -f /jb_config/jb_rootfs/dms_server_cb_detection.config | |
/jb_config/jb_rootfs/jb_sensor.config | |
rm -f /jb_config/jb_rootfs/jb_sensor.config | |
#### %s %d, u32Sensor=%d | |
/jb_config/jb_rootfs/ntp_param.config | |
rm -f /jb_config/jb_rootfs/ntp_param.config | |
/jb_config/jb_rootfs/jb_snap_timer.config | |
rm -f /jb_config/jb_rootfs/jb_snap_timer.config | |
/jb_config/jb_rootfs/jb_rtsp_param.config | |
rm -f /jb_config/jb_rootfs/jb_rtsp_param.config | |
/jb_config/jb_rootfs/jb_p2p_param.config | |
rm -f /jb_config/jb_rootfs/jb_p2p_param.config | |
/jb_config/jb_rootfs/jb_mobile_param.config | |
rm -f /jb_config/jb_rootfs/jb_mobile_param.config | |
/jb_config/jb_rootfs/jb_upnp_param.config | |
rm -f /jb_config/jb_rootfs/jb_upnp_param.config | |
/jb_config/jb_rootfs/jb_timezone_param.config | |
rm -f /jb_config/jb_rootfs/jb_timezone_param.config | |
/jb_config/jb_rootfs/wireless_tdscdma_param.config | |
rm -f /jb_config/jb_rootfs/wireless_tdscdma_param.config | |
/jb_config/jb_rootfs/wireless_wifi_param.config | |
/jb_config/jb_rootfs/wireless_WPS_param.config | |
rm -f /jb_config/jb_rootfs/wireless_wifi_param.config | |
rm -f /jb_config/jb_rootfs/wireless_WPS_param.config | |
/usr/lib/pelco_d.config | |
rm -f /jb_config/jb_rootfs/dms_pelco_d.json | |
/jb_config/jb_rootfs/jb_producer_parameter_setting.config | |
rm -f /jb_config/jb_rootfs/jb_producer_parameter_setting.config | |
/jb_config/jb_rootfs/jb_protect_key_info.config | |
rm -f /jb_config/jb_rootfs/jb_protect_key_info.config | |
/jb_config/jb_rootfs/jb_ddns_info.config | |
rm -f /jb_config/jb_rootfs/jb_ddns_info.config | |
fwrite faile.ret=%d | |
%s(%d) Local ServerCPUType:%x,ServerType:%x | |
%s(%d) tarfile ServerCPUType:%x,ServerType:%x | |
tar -zxvf /tmp/default.tar.gz -C /tmp | |
cp /tmp/jb_config/jb_rootfs/*.json /jb_config/jb_rootfs/ | |
tar -zcvf /tmp/default.tar.gz /tmp/jb_config/jb_rootfs/*.json | |
cp /tmp/default.tar.gz /jb_config/jb_rootfs/ | |
/jb_config/jb_rootfs/jb_pppoe_info.config | |
rm -f /jb_config/jb_rootfs/jb_pppoe_info.config | |
/jb_config/jb_rootfs/jb_notify_server.config | |
rm -f /jb_config/jb_rootfs/jb_notify_server.config | |
/jb_config/jb_rootfs/jb_ftpupdata_param.config | |
rm -f /jb_config/jb_rootfs/jb_ftpupdata_param.config | |
/jb_config/jb_rootfs/jb_server_com2info.config | |
rm -f /jb_config/jb_rootfs/jb_server_com2info.config | |
/jb_config/jb_rootfs/jb_server_cominfo.config | |
rm -f /jb_config/jb_rootfs/jb_server_cominfo.config | |
/jb_config/jb_rootfs/jb_channel_osdinfo.config | |
rm -f /jb_config/jb_rootfs/jb_channel_osdinfo.config | |
/jb_config/jb_rootfs/jb_channel_video_lost.config | |
Load jb video lost... | |
rm -f /jb_config/jb_rootfs/jb_channel_video_lost.config | |
/jb_config/jb_rootfs/jb_channel_probe_alarm.config | |
Load jb Probe_Alarm... | |
rm -f /jb_config/jb_rootfs/jb_channel_probe_alarm.config | |
/jb_config/jb_rootfs/jb_channel_motion_detech.config | |
Load jb Motion direct... | |
rm -f /jb_config/jb_rootfs/jb_channel_motion_detech.config | |
/jb_config/jb_rootfs/jb_channel_shelter.config | |
rm -f /jb_config/jb_rootfs/jb_channel_shelter.config | |
/jb_config/jb_rootfs/jb_channel_enchanced_color.config | |
rm -f /jb_config/jb_rootfs/jb_channel_enchanced_color.config | |
/jb_config/jb_rootfs/jb_channel_color.config | |
rm -f /jb_config/jb_rootfs/jb_channel_color.config | |
read: nBrightness=%d,nContrast=%d! | |
/jb_config/jb_rootfs/dms_read_error_color | |
/jb_config/jb_rootfs/jb_record_setting.config | |
rm -f /jb_config/jb_rootfs/jb_record_setting.config | |
/jb_config/jb_rootfs/jb_stream_info.config | |
rm -f /jb_config/jb_rootfs/jb_stream_info.config | |
/jb_config/jb_rootfs/jb_server_user.config | |
rm -f /jb_config/jb_rootfs/jb_server_user.config | |
### Error, jb users..... | |
0.0.0.0 | |
#### %s %d, i=%d, stUserInfo.dwUserRight=0x%x | |
UserInfo_V2 | |
#### %s %d, i=%d, stUserInfo.dwUserRight=%ld | |
/jb_config/jb_rootfs/jb_channel_streampic.config | |
rm -f /jb_config/jb_rootfs/jb_channel_streampic.config | |
/jb_config/jb_rootfs/dms_server_network.config | |
rm -f /jb_config/jb_rootfs/dms_server_network.config | |
/jb_config/jb_rootfs/jb_server_network.config | |
rm -f /jb_config/jb_rootfs/jb_server_network.config | |
stat err.ret=%d | |
tar -zxvf /jb_config/jb_rootfs/default.tar.gz -C /jb_config/jb_rootfs | |
cp /jb_config/jb_rootfs/tmp/jb_config/jb_rootfs/*.json /jb_config/jb_rootfs/ | |
rm -rf /jb_config/jb_rootfs/tmp/ | |
/jb_config/jb_rootfs/jb_dvs.fatal.config | |
rm -f /jb_config/jb_rootfs/jb_dvs.fatal.config | |
globelMalloc ChannelCount:%d | |
end of malloc.. | |
%s: File(%s) is exist! | |
[NAME] | |
DEFAULT=1 | |
DEVICENAME=%s | |
%s: ini_config_create_from_string failure | |
GATE | |
SUBNET | |
ISDHCP | |
VIDEOSTARDAD | |
INDEX | |
PORT | |
ADDRESS | |
PROVIDER | |
ISDDNS | |
UPNP | |
WEBLOGONAME | |
logo.png | |
ISUPNP | |
WIFI | |
TYPE | |
PLATFORM | |
ISON | |
COLOR_PARA | |
BRIGHTNESS | |
CONTRAST | |
SATURATION | |
DEFINITION | |
exit %s! | |
bVideoStandard -%d! | |
DEVICENAME | |
NAME-DEVICENAME-%s! | |
DEVICE_MAC-DEFAULT-%d! | |
PRODUCT_IP_SET-ISDHCP-%d! | |
PRODUCT_IP_SET-IP-%s! | |
PRODUCT_IP_SET-SUBNET-%s! | |
PRODUCT_IP_SET-GATE-%s! | |
PRODUCT_IP_SET-DNS-%s! | |
VIDEOSTARDAD-DEFAULT-%d! | |
VIDEOSTARDAD-INDEX-%d! | |
DDNS-DEFAULT-%d! | |
DDNS-ISDDNS-%d! | |
DDNS-PROVIDER-%d! | |
DDNS-ADDRESS-%s! | |
DDNS-PORT-%d! | |
DOMINNAME | |
DDNS-DOMINNAME-%s! | |
UPNP-DEFAULT-%d! | |
UPNP-ISUPNP-%d! | |
WIFI-DEFAULT-%d! | |
WIFI-TYPE-%d! | |
WIFI-IP-%s! | |
WIFI-SUBNET-%s! | |
WIFI-GATE-%s! | |
WIFI-DNS-%s! | |
PLATFORM-DEFAULT-%d! | |
PLATFORM-ISON-%d! | |
PLATFORM-IP-%s! | |
PLATFORM-PORT-%d! | |
PLATFORM-TYPE-%s! | |
COLOR_PARA-DEFAULT-%d! | |
COLOR_PARA-BRIGHTNESS-%d! | |
COLOR_PARA-CONTRAST-%d! | |
COLOR_PARA-SATURATION-%d! | |
COLOR_PARA-HUE-%d! | |
COLOR_PARA-DEFINITION-%d! | |
/jb_config/jb_rootfs/channel0_preset.config | |
SRDK_Codec_SnapShot | |
SRDK_Codec_SnapShot_V2 | |
SRDK_Codec_SnapShot_Y800 | |
SRDK_Codec_SnapShot_YUV | |
SRDK_Codec_SetEncodeAttr | |
SRDK_Codec_Stop_Video_Encode | |
SRDK_Codec_Start_Video_Encode | |
SRDK_Codec_Init | |
g_bInitCodec=%d--not yet! | |
%s %d, init snap failed! | |
%s %d, DMS_VENC_ExitSnap failed! | |
%s %d, exit snap failed! | |
SRDK_Codec_DeInit already! g_bInitCodec=%d! | |
Change resolution 960P to 720P! | |
Change resolution 1080P to 960P! | |
Change resolution 300H to 1080P! | |
nChn:%d,nStream:%d | |
%s %d, DMS_DEV_InitVenc failure!nRet:%d | |
%s already! g_bInitCodec=%d! | |
srdk_codec.c | |
DMS_MAIN_STREAM OK ################## | |
DMS_SECOND_STREAM failed ################## | |
DMS_SECOND_STREAM OK ################## | |
DMS_MOBILE_STREAM failed ################## | |
DMS_MOBILE_STREAM OK ################## | |
DMS_VENC_SetMd nChannel %d failed | |
jbcode-SRDK_Codec_Video_Color_Set_Single-channel-%lu | |
lpstColorSet->dwChannel----------%ld | |
DMS_UpgradeFlashThread_V2 | |
DMS_NET_UpgradeFlashData_V2 | |
HI_MPI_SYS_Mmap_V2 | |
DMS_UpgradeFlashThread_V1 | |
DMS_NET_UpgradeFlashData_V1 | |
SaveUpgradeAddress | |
SRDK_MallocVBMemory | |
DMS_NET_UpgradeFlashReq_V2 | |
DMS_NET_UpgradeFlashReq_V1 | |
DMS_UpgradeFlashThread | |
hisi3518 | |
/usr/netview/app/bin/anv_flash -b %d -d %s -m %d -n %ld -uid %d -v 2 | |
SystemCall_msg :%s | |
killall udhcpc | |
killall udhcpd | |
%s(%d) Finish Upgrade ret:%d | |
%s(%d) bUpdatestatus == FALSE | |
%s(%d) dwPackSize(%d) <= 0 | |
%s(%d) nPackNo:%d, now dwPackNo:%d | |
%s %d, upgrade data is NULL! | |
%s(%d) nFileOffset(%d) != nFileLen(%d) | |
#### %s %d, dwDataPos=%ld, dwDataLen=%ld | |
%s(%d) dwDataCRC(%lu) != dwFileCRC(%lu) | |
#### %s %d CRC<> !!!! | |
#### %s %d | |
upgradeFlashData_v2------------------------------------------------------------- lpVirAddr--->%d,nfileoffser=%d, pAddr=%d,lpUpgradData->PackSize=%d | |
#### %s %d, FlashOffset=%d | |
begin restart, update:%d | |
%s(%d) Failed nRes:0x%08X, userId=%d | |
mtdblock0 | |
mtdblock1 | |
mtdblock2 | |
%s:%s KB | |
/dev/mem | |
fun:%s line:%d, Open dev/mem failed!err:%s(%d) | |
fun:%s line:%d, mmap failed!err:%s(%d) | |
/usr/netview/app/bin/anv_flash -b %d -d %s -f %s -uid %d -wdt %d | |
%s(%d) nFileOffset(%d) != nFileLength(%d) | |
%s %d, upgrade ,u32PhyAddr: 0x%x | |
/dev/mtdblock0 | |
%s %d, open /dev/mtdblock0 error!err:%s(%d) | |
%s %d, lseek error!err:%s(%d),res=%d | |
%s %d, write upgrade address error!err:%s(%d),res=%d | |
/etc/fs | |
cramfs | |
anonymous | |
%s %d, HI_MPI_VB_CreatePool error! %d | |
%s %d, HI_MPI_VB_GetBlock error! | |
%s:%d malloc error | |
upgrade.c | |
#### %s %d, %ld-%ld-%ld-%ld-0x%X, %ld-%ld-%ld-%ld-0x%X, %ld-%ld-%ld-%ld-0x%X, %ld-%ld-%ld-%ld-0x%X, %ld-%ld-%ld-%ld-0x%X | |
#### %s %d, dwSize=%ld | |
#### %s %d, type=%ld, len=%ld | |
#### %s %d nFileLength =%d MtdBlocks=%d,nRootType=%d,lpItemHeader->dwDataType=%u | |
#### %s %d, nFileLength=%d, nRootfsType=%d, len=%d, dwDataType=%ld | |
%s(%d) Failed:0x%08X, rom type:%d, fs:%d userId=%d, FileLength:%d | |
SRDK_MallocVBMemory failure! | |
%s-%d: u32PhyAddr : 0x%08x,lpVirAddr : 0x%08x, uiFileSize=%d! | |
/tmp/%s | |
/tmp/upgrade.img | |
%s-%d, %s--%s | |
/tmp/komod/wifi | |
rm -rf /tmp/komod/wifi | |
/tmp/web | |
rm -rf /tmp/web | |
lpUpgradeReq->FileHdr.dwItemCount =%d IsV1update=%d | |
ShiLian_InitUpnpPort | |
InitUpnpPort | |
DMS_upnpPulse | |
jb_upnp_thread | |
error creating upnp thread. | |
SetUpnpCfg | |
SetUpnpCfg parameter invalid | |
GetUpnpCfg | |
%s(%d) upnpDiscover failed (errno %d - %s) | |
%s(%d) Found Internet Gateway Device %s | |
Local Address is %s | |
%s(%d) UPNP_GetValidIGD failed (ret %d) | |
If your router supports UPnP, please make sure UPnP is enabled! | |
upnp dev:%s gateway:%s | |
Local Address is "%s" | |
%s(%d) UPNP_GetValidIGD failed (ret %d - %s) | |
UPNP Port %d isn't forwarded | |
UPNP address changed from %s to %s - %s | |
UPNP address changed from %s to %s | |
Stopping UPNP port forwarding | |
%s at %d | |
Port forwarding through "%s", service "%s". (local address: %s:%d) | |
Port forwarding successful %d:%d ! | |
Port forwarding failed | |
upnputil.c | |
upnp | |
==================QUIT thread %s pthread_self %d getpid() %d | |
StartWifiAutoSet | |
GetWifiInfoFromQRcode | |
GetWifiInfoFromSmartLink | |
WifiAutoSetThread | |
/proc/smart_connection | |
PASSWORD | |
clear | |
WifiAutoSetThread | |
MyPCBType=%d | |
#### %s %d, alloc mem error! | |
not changed ,ssid:%s, key:%s | |
stWifiCfg.csEssid:%s, stWifiCfg.csWebKey:%s, ssid:%s, key:%s | |
#### %s %d, dms_sysnetapi_ioctrl DMS_NET_SET_WIFICFG begin! | |
================== thread %s exit pthread_self %d getpid() %d | |
load_drivers | |
JB_Wireless_Wifi_Set | |
check_drivers | |
wireless_wps_enable | |
unload_drivers | |
wireless_check_dev | |
JB_Wireless_Wifi_Start | |
CheckWirelessKey | |
wireless_wps_stop | |
wireless_dhcpc_start | |
get_scanning_cell_info | |
get_wifi_list_param | |
JB_Wireless_scan_list_Get | |
JB_Wireless_scan_Site_Get | |
JB_Wireless_Wifi_RT73_Start | |
CheckWifiLink | |
retryWifi | |
wireless_wps_working | |
Wireless_GetApEncryptInfo | |
wireless_wps_start | |
wifiDaemon | |
write_dhcpd_configfile | |
wireless_dhcpd_start | |
cd /tmp | |
rm -f /tmp/komod/wifi/* | |
tar -xf /usr/netview/wifi.tar.lzma wifi/ -C /tmp/komod | |
sync | |
#### %s %d, timeval=%ld | |
%s,No device! | |
fun:%s line:%d,No driver! | |
fun:%s line:%d,unsupport device:%x! | |
%s,Device(%x) unsopport ap mode! | |
insmod %s | |
ifconfig ra0 up | |
%s, No device! | |
#### %s %d, timeval=%ld, deviceid=%d, mode=%d | |
lpWificfg->bWifiEnable=%d, lpWificfg->byWifiMode=%d, g_jb_globel_param.stWificonfig.byWifiMode=%d | |
kill -SIGUSR1 `cat /var/run/udhcpc.pid` | |
%s, change wifi mode | |
%s %d, wps enable. | |
%s, device(%x) isn't support wps function! | |
ifconfig ra0 down | |
rmmod %s | |
udhcpc -p /var/run/udhcpc_wifi.pid -s /usr/share/udhcpc/wifi.script -i ra0 | |
wireless.c | |
%s %d, fopen error!%s(errno:%d) | |
%s,wifi dev product id:%x | |
/proc/net/tcp | |
iwconfig %s | grep 'Encryption key:' >/tmp/iwkey | |
/tmp/iwkey | |
%s %d, error: %s | |
Encryption key: | |
%s take %d second | |
CCMP | |
TKIP | |
WPA2 | |
WPA2PSK | |
WPAPSK | |
iwpriv ra0 set AuthMode=%s | |
iwpriv ra0 set EncrypType=%s | |
iwpriv ra0 set SSID="%s" | |
iwpriv ra0 set WPAPSK="%s" | |
wpa_passphrase %s %s > /etc/Wireless/RT2870STA/wpa.conf | |
wpa_supplicant -d -Dwext -i%s -c/etc/Wireless/RT2870STA/wpa.conf & | |
%s wps stop! | |
iwpriv ra0 wsc_stop | |
/var/run/udhcpc_wifi.pid | |
kill -9 `cat /var/run/udhcpc_wifi.pid` && rm /var/run/udhcpc_wifi.pid | |
killall -9 wpa_supplicant | |
%s %d, create thread fail!ret=%d,%s(errno:%d) | |
Quality= | |
Channel | |
Cell | |
Cell %02s - Address: %02s:%02s:%02s:%02s:%02s:%02s | |
<line:%d fun:%s> sscanf cell info failed! | |
<line:%d fun:%s> sscanf get cell index error! cellIdx = %d | |
/var/wifi_list.dat | |
<line:%d fun:%s> open error | |
When the wifi mode is AP,we can't scan access points. | |
iwlist ra0 scanning > /var/wifi_list.dat | |
JB_Wireless_scan_list_Get system(%s), ret=%d | |
%s(%d) iconv_open GB2312 UTF-8 failed:%s | |
grep ESSID:\"%s\" %s > %s | |
/var/wifi_ssid_list.dat | |
%s FAILED ret:%d | |
=======ifconfig ra0 up end===%04d%02d%02d%02d%02d%02d | |
iwpriv ra0 set NetworkType=Adhoc | |
################ad-hoc ret == %d | |
iwpriv ra0 set NetworkType=Infra | |
################managed ret == %d | |
iwpriv ra0 set NetworkType=Monitor_smtcn | |
WIFI SSID is %s key is %s | |
#### %s %d, csEssid:%s-%s | |
#### %s %d,count=%d csEssid:%s ============= MATCH OK!!!!!! | |
access set lpWificfg->nSecurity success | |
access stWifiList.stWifiSite[count].bySecurity success not WIFI_AUTH_AUTOMATCH | |
access stWifiList.stWifiSite[count].bySecurity success is WIFI_AUTH_AUTOMATCH | |
========end for | |
000000000000 | |
1111111111111 | |
iwpriv ra0 set AuthMode=OPEN | |
iwpriv ra0 set EncrypType=NONE | |
iwpriv ra0 set AuthMode=WEPAUTO | |
iwpriv ra0 set EncrypType=WEP | |
iwpriv ra0 set Key1="%s" | |
WIFI auth %s return %d | |
iwpriv ra0 set DefaultKeyID=1 | |
iwpriv ra0 set DefaultKeyID=2 | |
=======wireless_dhcpc_start begin===%04d%02d%02d%02d%02d%02d | |
%s %d, dhcpc start. | |
ifconfig ra0 %s netmask %s | |
JB_Wireless_Wifi_Start system(%s), ret=%d | |
iwpriv %s connStatus >/tmp/iwout | |
/tmp/iwout | |
:Connected | |
no private ioctls | |
ESSID:"%s" | |
%s Get Network IP:%s | |
%s Get NetMask IP:%s | |
%s Get Gateway IP:%s | |
%s Get DNS IP:%s | |
WIFI gateway address is %s old_gateware:%s | |
set wireless gateway error !!! | |
%s %d, udhcpc start. | |
%s %d, config static ip. | |
Get Network IP :%s | |
Get NetMask IP :%s | |
Get Gateway IP :%s | |
Get DNS IP :%s | |
iwpriv %s stat >/tmp/iwencrypt | |
/tmp/iwencrypt | |
%s %d, fopen error: %s | |
%s = %s | |
AuthType | |
EncrypType | |
KeyIndex | |
%s = %d | |
NONE | |
%s %d, wps start setup. | |
iwpriv ra0 wsc_conf_mode 1 | |
iwpriv ra0 wsc_mode 2 | |
iwpriv ra0 wsc_ap_band 0 | |
iwpriv ra0 wsc_start | |
%s %d, start udhcpc. | |
wifiDaemon | |
g_wifistatus=%d | |
/etc/udhcpd.conf | |
%s %d, fopen failed!err:%s(%d) | |
%s, write_dhcpd_configfile failed! | |
start %s | |
end %s | |
interface %s | |
option lease 86400 | |
option dns %s | |
option router %s | |
option subnet 255.255.255.0 | |
udhcpd /etc/udhcpd.conf & | |
/komod/wifi/rtutil5572sta.ko | |
/komod/wifi/rt5572sta.ko | |
/komod/wifi/rtnet5572sta.ko | |
/komod/wifi/rt3070sta.ko | |
/komod/wifi/rtutil5572ap.ko | |
/komod/wifi/rt5572ap.ko | |
/komod/wifi/rtnet5572ap.ko | |
/komod/wifi/mtutil7601Usta.ko | |
/komod/wifi/mt7601Usta.ko | |
/komod/wifi/mtnet7601Usta.ko | |
/komod/wifi/mt7601Uap.ko | |
/komod/wifi/rtutil3070ap.ko | |
/komod/wifi/rt3070ap.ko | |
/komod/wifi/rtnet3070ap.ko | |
jb_set_wdt_timeout error ret = %d, errno = %d | |
jb_set_wdt_timeout cur_margin is %x | |
jb_get_wdt_status error ret = %d, errno = %d | |
jb_get_wdt_timeout cur_margin is %x | |
jb_get_wdt_status status is %x | |
jb_wdt_keep_alive error ret = %d, errno = %d | |
jb_wdt_disable-retvalue:%d | |
before close, disable failed! | |
warning: file closed already! | |
/dev/watchdog | |
file(%s), line(%d), jb_wdt_startup(%s) open fail, errno(%d) | |
wtd_mng.c | |
jiabo video startup watchdog ok | |
MTMNT Init cfg chnid %d , max connect num %d, bufsize %d,wChannelNum:%d | |
the live mode is:%d | |
hisiinterleaved | |
DMS_UpdateLog | |
AutoCheck_WIFI | |
/jb_config/jb_rootfs/jb_dvs_log.log | |
system start! | |
DMS_InsertLog | |
[%s]--index=%d,start:%lu-%lu-%lu %lu:%lu:%lu,run:%lu-%lu-%lu %lu:%lu:%lu,%s! | |
system reboot! | |
system running! | |
AutoCheckCmdNode_AddTail--malloc failure | |
NULL == g_pAutoCheckCmdNode | |
return g_pAutoCheckCmdNode | |
alog:%d | |
1alog:%d | |
pDOMAIN:%s | |
szNewMac:%s | |
AutoCheck_RTC-rcv--%04d-%02d-%02d %02d:%02d:%02d! | |
AutoCheck_RTC-Write--%04d-%02d-%02d %02d:%02d:%02d! | |
AutoCheck_RTC-Read--%04d-%02d-%02d %02d:%02d:%02d! | |
DMS_NET_GET_HDCFG nRet:%d, hd.dwHDCount:%d | |
/test.txt | |
path:%s | |
hello | |
filetestw:%s | |
filetestr:%s,%s | |
PTZ control DMS_PTZ_CMD_UP fail!! | |
PTZ control STOP fail!! | |
PTZ control DMS_PTZ_CMD_DOWN fail!! | |
PTZ control DMS_PTZ_CMD_ZOOM_SUB fail!! | |
PTZ control DMS_PTZ_CMD_ZOOM_ADD fail!! | |
AutoCheck_3G enter | |
ifconfig ppp0 up | |
3G Status:%d | |
%s(%d) fun:%s | |
AutoCheck.c | |
WIFI Status:%d | |
AutoCheck | |
Endter ThreadAutoCheckBody | |
ThreadAutoCheckBody--pNetPackhead->nCommand = 0x%08x | |
Exit ThreadAutoCheckBody | |
1 != g_AutoCheckInit | |
1 == g_ThreadAutoCheckRun | |
check_ip_start | |
checkAndGetIP | |
==================IsWifi=%d, ifname:%s ip is changed curr:%s, expect:%s | |
checkip.c | |
%s:%d %s Change ip address! | |
/sys/class/net/%s/carrier | |
Open carrier | |
can't create raw socket | |
cannot enable bcast on raw socket | |
Set DHCP fail or static IP conflict! | |
%s-%d: device ip=%s! | |
192.168.1.%d | |
%s-%d: NetAddr=%s! | |
checkip | |
==============ip is changed!!!! | |
The IP(%s) is exist. | |
%s=%s | |
default | |
size:%lu, enable:%d, status:%d, sigs:%d, ip:%s, num:%d, provid:%d | |
apn:%s, user:%s,%s, num:%s | |
size:%lu, enable:%d, type:%d, status:%d, res:%d, ip:%lu | |
dwsiae:%lu, channel:%lu, blShowtime:%lu, week:%d(%lu,%lu) | |
Name:%d [%s], %lu,%lu, dateformat:%d | |
enb:%d, interv:%lu, qual:%d, size:%d, stor:%d(0:local, 1:ftp, 2:ftp|local), channel:%d | |
set defaut:(0x%lx) | |
Normal | |
VenCoder | |
Record | |
RS232 | |
Network | |
Alarm | |
VAlarm | |
PTZ | |
Preview | |
User | |
TVMode | |
Color | |
Snmp | |
--------------------------- | |
getCom2Info | |
Com2InfoToRs232 | |
setOsdShelterToDms | |
setOsdShelter | |
getCenterInfo | |
getChannelCfg | |
setVilostCfg | |
setMotionDetectCfg | |
getNetworkInfo | |
setWifiCfg | |
setNetworkInfo | |
setProbeAlarmCfg | |
getOsdInfo | |
setOsdInfo | |
getServerInfo | |
getFtpCfg | |
setFtpCfg | |
GetJbComInfoV2 | |
getCominfoV1 | |
getCominfo | |
setPPPoE_DDNS | |
getVilostCfg | |
getMotionDetectCfg | |
getProbeAlarmCfg | |
setTcdmaCfg | |
getTcdmaCfg | |
getWifiCfg | |
getPPPoE_DDNS | |
getPtzData | |
setCominfo | |
getChannelInfo | |
## Error %s %s:%d | |
dms_transform.c | |
Data bit:%d | |
line:%d fun:%s ---pMotion_cfg->wActionFlag:[0x%X]! | |
line:%d fun:%s ---pMotion_cfg->stHandle.bySnap[0]:[0x%X]! | |
## Error %s %s:%d %d, %d | |
channel_osdinfo.dwTimeFormat = %lu | |
### get byRecordMode=%d(jb:%d) | |
channelcom:%d | |
getVilostCfg | |
Motion | |
## getProbeAlarmCfg | |
### pPtz->szPTZData?? =%d | |
CominfoJbToDms | |
getChannelInfo, nSceneMode=%d, (width:%lux%lu) | |
Hisi_SendEmail | |
%s %d Param Error | |
%s %d No CC | |
%s %d No BCC | |
%s %d Param Error, no SendAddrList? | |
%s %d Param Error, passwd? | |
SendEmail have ssl | |
SendEmail no ssl | |
USE CRAMLOGIN SEND EMAIL FAILED | |
USE AUTHLOGINPLAIN SEND EMAIL FAILED | |
USE AUTHLOGIN SEND EMAIL FAILED | |
%s %d SendMail Success Use %d Mode | |
start_arp | |
jbarping.c | |
TTTTTTTTTTTTTTTTTTTTTTTTTT %s %s %s %s, %d | |
%s(%d) - %d , %s | |
WIFI ARP | |
255.255.255.255 | |
create_broadcast_sock | |
ServerInfoMultiBroadcastThread | |
jbbroadcastInfo.c | |
IPC 0x%X Broadcast MSG Send to address %s failed | |
%s %d, create socket error!err:%s(%d) | |
%s %d, setsockopt error!err:%s(%d) | |
%s %d, bind error!err:%s(%d) | |
224.188.188.188 | |
create_broadcast_sock end | |
Error Wifi IP and Netmask... | |
jbBroadcastSetInfo->nBufSize == %lu | |
jbBroadcastSetInfo->hdr.dwSize == %lu | |
jbBroadcastSetInfo->hdr.nCmd == %lu | |
jbBroadcastSetInfo->hdr.dwPackFlag == %lu | |
jbBroadcastSetInfo->hdr.nErrorCode == %lu | |
jbBroadcastSetInfo->setInfo.dwSize == %lu | |
jbBroadcastSetInfo->setInfo.dwIp == %lu | |
jbBroadcastSetInfo->setInfo.wMediaPort == %lu | |
jbBroadcastSetInfo->setInfo.wWebPort == %lu | |
jbBroadcastSetInfo->setInfo.dwNetMask == %lu | |
jbBroadcastSetInfo->setInfo.dwGateway== %lu | |
jbBroadcastSetInfo->setInfo.dwDNS == %lu | |
jbBroadcastSetInfo->setInfo.szoldMac == %s | |
jbBroadcastSetInfo->setInfo.szMac == %s | |
jbBroadcastSetInfo->setInfo.szServerName == %s | |
jbBroadcastSetInfo->setInfo.bEnableDHCP == %d | |
jbBroadcastSetInfo->setInfo.bEnableAutoDNS == %d | |
jbBroadcastSetInfo->setInfo.bEncodeAudio == %d | |
jbBroadcastSetInfo->nxServer.dwSize == %lu | |
jbBroadcastSetInfo->nxServer.bEnable == %d | |
jbBroadcastSetInfo->nxServer.dwCenterIp == %lu | |
jbBroadcastSetInfo->nxServer.wCenterPort == %lu | |
jbBroadcastSetInfo->nxServer.csServerNo == %s | |
Error IP and Netmask... | |
ServerInfoBroadcast | |
%s %d, create_broadcast_sock error:%d | |
SearchServer | |
JBNV_SET_SERVER_INFO_BROADCAST_V2 's size is not suit for our protocol | |
jbsearch.dwPackFlag == %lu | |
Not my wifi's mac ,you can not set wifi info | |
Not my mac ,you can not set my service info %x%x%x%x%x%x-%x%x%x%x%x%x | |
Not my ip and port , so I am not going to soft reset | |
Not my ip and port , so I am not going to soft reset all | |
Not proctol | |
Not my ip and port(0x%X,%u) , so I am not going to deal, (0x%X,%u) | |
dwCommand:0x%x wBufSize:%d | |
Error Command DMS_NET_SET_RESTORECFG | |
Error Command 0x%x | |
[jiabo video][APP]: chek encrypt chip fail! | |
[jiabo video][APP]: chek encrypt chip ok! | |
[jiabo video][APP]: CHECK CPU CHIP FAILED ! | |
jb_pppoe_ddns.c | |
DDNSCfg bEnableDDNS:%d | |
DDNSCfg enDDNSType:%d csDDNSDomain:%s, csDDNSAddress:%s, csDDNSUsername:%s, csDDNSPassword:%s | |
file(%s), line(%d): jb_get_pppoe_ipaddr error | |
ppp0 | |
file(%s), line(%d): jb_get_pppoe_ipaddr error(%d) | |
file(%s), line(%d), linking is attach to ppp0, but pppo is down, the ipaddr is: %s | |
adsl-status | |
file(%s), line(%d): jb_get_pppoe_status error | |
adsl-stop & | |
file(%s), line(%d): jb_pppoe_stop error | |
reset default gateway %s failed | |
g_jb_globel_param.stPppoeConfig.csDDNSUsername = %s | |
file(%s), line(%d): net_get_gateway error | |
file(%s), line(%d): net_del_gateway error | |
adsl-start & | |
file(%s), line(%d): jb_pppoe_start error | |
/etc/ppp/jb-ppp-config | |
file(%s), line(%d) open pppoe config file error | |
file(%s), line(%d) fwrite pppoe config file error | |
server | |
adsl-setup < /etc/ppp/jb-ppp-config'' | |
file(%s), line(%d): pppoe_setup error | |
pppoe | |
Exit thread jb_pppoe_running_thread! | |
GetNtpTime | |
Usage: %s [-c count] [-d] [-g goodness] -h hostname [-i interval] | |
[-l] [-p port] [-r] [-s] [-P serverport] | |
%d %f %f %f %lf %f %d | |
contemplate %u %.1f %.1f %d | |
fake %f %d | |
Replay input error | |
could not bind to udp port %d | |
bind | |
connect | |
packet of length %d received | |
Source: INET Port %d host %s | |
Source: Address family %d | |
adjtimex | |
LI=%d VN=%d Mode=%d Stratum=%d Poll=%d Precision=%d | |
Delay=%.1f Dispersion=%.1f Refid=%u.%u.%u.%u | |
Reference %u.%.10u | |
Originate %u.%.10u | |
Receive %u.%.10u | |
Transmit %u.%.10u | |
Our recv %u.%.10u | |
Total elapsed: %9.2f | |
Server stall: %9.2f | |
Slop: %9.2f | |
Skew: %9.2f | |
Frequency: %9d | |
day second elapsed stall skew dispersion freq | |
%d %.5d.%.3d %8.1f %8.1f %8.1f %8.1f %9d | |
Listening... | |
select | |
Sending ... | |
recvfrom | |
Ooops. pack_len=%d | |
((void *)0) != pNtpTime && ((void *)0) != pHostname | |
ntpclient.c | |
Configuration: | |
-c probe_count %d | |
-d (debug) %d | |
-g goodness %d | |
-h hostname %s | |
-i interval %d | |
-l live %d | |
-p local_port %d | |
-s set_clock %d | |
DeleteSnapVideoOsd | |
DeleteVideoOsd_Text | |
DeleteVideoOsd_Channel | |
DeleteVideoOsd_Time | |
OsdCreateRegion | |
ShowSnapVideo_Text | |
Osd_show_fixed_text | |
ShowSnapVideoOsd_Channel | |
ShowVideoOsd_Text | |
ShowVideoOsd_Channel | |
Osd_show_fixed_Time | |
DMS_Display_VideoOsdTime | |
VideoOsdExit | |
VideoOsdInit | |
ShowSnapVideoOsd_Time | |
ShowVideoOsd_Time | |
DeleteSnapVideo_Text--OK | |
FILE:%s FUNCTION:%s LINE:%d HI_MPI_RGN_DetachFromChn err %#x | |
HI3511Osd.c | |
FILE:%s FUNCTION:%s LINE:%d HI_MPI_RGN_Destroy err %#x | |
DeleteSnapVideoOsd--OK | |
FILE:%s FUNCTION:%s LINE:%d DeleteVideoOsd_Channel(%d) chngrp is NULL. | |
FILE:%s FUNCTION:%s LINE:%d DeleteVideoOsd_Channel fail. | |
FILE:%s FUNCTION:%s LINE:%d DeleteVideoOsd_Channel ok (%d) | |
FILE:%s FUNCTION:%s LINE:%d DeleteVideoOsd_Time(%d) chngrp is NULL. | |
FILE:%s FUNCTION:%s LINE:%d already DeleteVideoOsd_Time or no start ShowVideoOsd_Time. | |
FILE:%s FUNCTION:%s LINE:%d DeleteVideoOsd_Time fail. | |
FILE:%s FUNCTION:%s LINE:%d HI_MPI_VPP_CreateRegion err 0x%x! | |
%s: HI_MPI_RGN_AttachToChn (%d) failed with %#x! | |
FILE:%s FUNCTION:%s LINE:%d %s-show bitmap to region %d failed while displaying 0x%x | |
FILE:%s FUNCTION:%s LINE:%d %s-Put bitmap to region %d failed while displaying 0x%x | |
FILE:%s FUNCTION:%s LINE:%d %s--HI_MPI_VPP_CreateRegion err 0x%x! | |
ShowSnapVideo_Text--OK | |
%04d-%02d-%02d %02d:%02d:%02d | |
%02d-%02d-%04d %02d:%02d:%02d | |
%04d/%02d/%02d %02d:%02d:%02d | |
%02d/%02d/%04d %02d:%02d:%02d | |
[ENCODE]ASSERT failed: line %d, file %s | |
FILE:%s FUNCTION:%s LINE:%d Osd_show_fixed_text index(%d) errrrrrrrrrrr | |
FILE:%s FUNCTION:%s LINE:%d GetOsdBitmapRect index(%d) errrrrrrrrrrr | |
FILE:%s FUNCTION:%s LINE:%d Put bitmap to region %d failed while displaying 0x%x | |
FILE:%s FUNCTION:%s LINE:%d Osd_show_fixed_text-show bitmap to region %d failed while displaying 0x%x | |
FILE:%s FUNCTION:%s LINE:%d HI_MPI_VENC_GetChnAttr err %#x | |
FILE:%s FUNCTION:%s LINE:%d resolution = %d! | |
FILE:%s FUNCTION:%s LINE:%d GetOsdRegionRect err | |
FILE:%s FUNCTION:%s LINE:%d Bitmap.pData malloc err! | |
FILE:%s FUNCTION:%s LINE:%d x = %d! | |
FILE:%s FUNCTION:%s LINE:%d y = %d! | |
FILE:%s FUNCTION:%s LINE:%d w = %d! | |
FILE:%s FUNCTION:%s LINE:%d h = %d! | |
FILE:%s FUNCTION:%s LINE:%d OsdCreateRegion err! | |
FILE:%s FUNCTION:%s LINE:%d ShowVideoOsd_Channel(%d) chngrp is NULL. | |
FILE:%s FUNCTION:%s LINE:%d GetOsdRegionRect err | |
FILE:%s FUNCTION:%s LINE:%d ShowVideoOsd_Channel(%d) chnname is NULL. | |
FILE:%s FUNCTION:%s LINE:%d already ShowVideoOsd_Channel. | |
FILE:%s FUNCTION:%s LINE:%d Osd_show_fixed_Time index(%d) errrrrrrrrrrr | |
FILE:%s FUNCTION:%s LINE:%d %s %d, invalid channel!nChannel:%d | |
FILE:%s FUNCTION:%s LINE:%d %s %d, invalid nStreamChn!nStreamChn:%d | |
FILE:%s FUNCTION:%s LINE:%d VideoOsdExit already! g_bOsdInit=%d! | |
FILE:%s FUNCTION:%s LINE:%d VideoOsdInit already! g_bOsdInit=%d! | |
/font/hzk16 | |
FILE:%s FUNCTION:%s LINE:%d Open font lib hzk16 failed ! | |
/font/asc16 | |
FILE:%s FUNCTION:%s LINE:%d Open font lib asc16 failed ! | |
/font/hzk8 | |
FILE:%s FUNCTION:%s LINE:%d Open font lib hzk8 failed ! | |
/font/asc8 | |
FILE:%s FUNCTION:%s LINE:%d Open font lib asc8 failed ! | |
ShowSnapVideoOsd VeGrpChn:%d | |
ShowSnapVideoOsd--OK | |
FILE:%s FUNCTION:%s LINE:%d ShowVideoOsd_Time(%d) chngrp is NULL. | |
FILE:%s FUNCTION:%s LINE:%d already ShowVideoOsd_Time. | |
DMS_DEV_AENC_ReadFrame | |
Hi3518_COMM_AUDIO_StartAO | |
DMS_Adec_Init | |
DMS_Aenc_Init | |
DMS_Aenc_Release | |
DMS_AI_Release | |
Hi3518_COMM_AUDIO_StartAi | |
Hi3518_COMM_AUDIO_CfgAcodec | |
%s: get aenc stream select time out | |
%s: HI_MPI_AENC_GetStream(%d), failed with %#x! | |
send stream totallen(%d) to adec stStream u32Len:%d failed,err:%x | |
%s:input piont(pstAioAttr) is invalid! | |
%s: HI_MPI_AO_SetPubAttr(aodev%d) failed with %#x! | |
%s: HI_MPI_AO_Enable(%d) failed with %#x! | |
%s: HI_MPI_AO_EnableChn(%d) failed with %#x! | |
HI_MPI_SYS_UnBind err 0x%x | |
HI_MPI_AO_DisableChn err 0x%x | |
HI_MPI_AO_Disable err 0x%x | |
HI_MPI_ADEC_DestroyChn err 0x%x | |
create adec chn %d err:0x%x | |
HI_MPI_AO_BindAdec err 0x%x | |
@@@@@@@@@@@@@@@@ Hi3518 DMS_Aenc_Init @@@@@@@@@ | |
%s: invalid aenc payload type:%d | |
%s: HI_MPI_AENC_CreateChn(%d) failed with %#x! | |
%s: HI_MPI_SYS_Bind(%d) failed with %#x! | |
%s: HI_MPI_SYS_UnBind(%d) failed with %#x! | |
%s: HI_MPI_AENC_DestroyChn(%d) failed with %#x! | |
%s: HI_MPI_AI_DisableChn(%d,%d) failed with %#x | |
%s: HI_MPI_AI_Disable(%d) failed with %#x | |
%s: HI_MPI_AI_SetPubAttr(%d) failed with %#x | |
%s: HI_MPI_AI_Enable(%d) failed with %#x | |
%s: HI_MPI_AI_EnableChn(%d,%d) failed with %#x | |
/dev/acodec | |
%s: can't open acodec,%s | |
%s: set acodec sample rate failed | |
ipcbType = %d | |
PCB_CARD_LIU-1_____gain_mic=0x%02x!_____ | |
PCB_CARD_LIU-2_____gain_mic=0x%02x!_____ | |
PCB_CARD-1_____gain_mic=0x%02x!_____ | |
PCB_CARD-2_____gain_mic=0x%02x!_____ | |
PCB_PT-1_____gain_mic=0x%02x!_____ | |
PCB_PT-2_____gain_mic=0x%02x!_____ | |
PCB_COMMON_XM-1_____gain_mic=0x%02x!_____ | |
PCB_COMMON_XM-2_____gain_mic=0x%02x!_____ | |
x-1_____gain_mic=0x%02x!_____ | |
x-2_____gain_mic=0x%02x!_____ | |
%s: set acodec micin failed | |
@@@@@@@@@@@@@@@@ Hi3518 DMS_AI_Init @@@@@@@@@ | |
set audio cfg attr err:0x%x | |
set audio StartAi attr err:0x%x | |
DMS_DEV_VENC_MDGetStatus | |
DMS_VENC_SetOd | |
DMS_VENC_EnableVDA | |
DMS_DEV_VENC_ReadFrame_Ex | |
DMS_DEV_InitExpendChannel | |
DMS_DEV_InitViChannel | |
DMS_DEV_DeinitExpendChannel | |
DMS_DEV_DeinitViChannel | |
DMS_DEV_DeinitVoChannel | |
SaveSnapPic | |
DMS_VENC_ExitSnap | |
DMS_Disable_Encode | |
WndCommEnableVoDevLay | |
DMS_Enable_Encode | |
DMS_VENC_InitSnapEx | |
CHECK_Resolution | |
DMS_VENC_DisableVDA | |
SetVBRQualityMJPEG-u32PicWidth=%d,u32MaxBR=%d,Quality=%d | |
%s,%d HI_MPI_VDA_StopRecvPic--err! | |
%s,%d HI_MPI_VDA_StartRecvPic--err! | |
HI_MPI_VDA_GetFd failure,s32MD_Fd=%d! | |
FD_ISSET failure! | |
HI_MPI_VDA_GetData failure,s32Ret=0x%08x! | |
%s: HI_MPI_VDA_ReleaseData failed with %#x! | |
....%s,%d DMS_DEV_VENC_ODGetStatus..............%d chn:%d | |
DMS_DEV_VENC_ODGetStatus enWorkMode enWorkMode failed with %#x | |
DMS_DEV_VENC_ODGetStatus failed with %#x! | |
vda W:%d H:%d, alarm area: num=%d x=%d y=%d w=%d h=%d | |
HI_MPI_VDA_CreateChn ... err %#x | |
HI_MPI_SYS_Bind ... err %#x | |
HI_MPI_VDA_StartRecvPic ... err %#x | |
OD is start working... | |
%s HI_MPI_VDA_CreateChn failed with %#x | |
%s,%d HI_MPI_SYS_Bind--err! | |
%s,%d HI_MPI_VDA_StartRecvPic err! | |
MD chinnel %d OK | |
HI_MPI_VENC_GetRoiCfg err 0x%x | |
HI_MPI_VENC_SetRoiCfg err 0x%x | |
DMS_SetVencRoiAttr success. | |
DMS_VENC_Request_IFrame : HI_MPI_VENC_RequestIDR channel %d stream %d | |
DMS_VENC_Request_IFrame : HI_MPI_VENC_RequestIDR fail | |
HI_MPI_VENC_Query:0x%x err | |
malloc memory err! | |
HI_MPI_VENC_GetStream:0x%x | |
MJPEG frame too long:maxbuflen=%d,realFramelen=%d | |
H264 frame too long:maxbuflen=%d,realFramelen=%d | |
HI_MPI_VENC_ReleaseStream:0x%x VeChn:%d | |
%s-%d: nChannel(%d) error! | |
%s-%d: type(%d) error! | |
VS_BUF_GetWriteMemPos:0x%x | |
%s-%d: nStreamChn(%d) error! | |
%s: HI_MPI_VPSS_SetChnMode failed with %#x! | |
%s HI_MPI_VPSS_EnableChn failed with %#x | |
EnableVi ViDevId:%d, ViChn:%d | |
EnableVi stCapSize u32Width:%d, u32Height:%d | |
EnableVi stDestSize u32Width:%d, u32Height:%d | |
set VI attribute failed 0x%x!continue | |
set VI enable failed 0x%x! | |
%s: HI_MPI_VI_SetChnAttr failed with %#x! | |
%s: HI_MPI_VI_SetRotate %#x! | |
%s: HI_MPI_VI_EnableChn failed with %#x! | |
%s: HI_MPI_VPSS_CreateGrp failed with %#x! | |
%s: HI_MPI_VPSS_GetGrpParam failed with %#x! | |
%s: HI_MPI_VPSS_SetGrpParam failed with %#x! | |
%s: HI_MPI_VPSS_StartGrp failed with %#x! | |
%s: HI_MPI_SYS_Bind failed with %#x! | |
%s: HI_MPI_VPSS_SetChnAttr failed with %#x! | |
%s: HI_MPI_VPSS_EnableChn failed with %#x! | |
%s HI_MPI_VPSS_DisableChn failed with %#x | |
1.%s: HI_MPI_VPSS_DisableChn(%d) failed with %#x! | |
%s: HI_MPI_SYS_UnBind failed with %#x! | |
2.%s: HI_MPI_VPSS_DisableChn(%d) failed with %#x! | |
%s: HI_MPI_VPSS_StopGrp failed with %#x! | |
%s: HI_MPI_VPSS_DestroyGrp failed with %#x! | |
%s: HI_MPI_VI_DisableChn failed with %#x! | |
%s: HI_MPI_VI_DisableDev failed with %#x! | |
%s HI_MPI_SYS_UnBind failed with %#x | |
%s HI_MPI_VO_DisableChn failed with %#x | |
%s HI_MPI_VO_DisableVideoLayer failed with %#x | |
%s HI_MPI_VO_Disable failed with %#x | |
dev(%d),s32chn (%d),err (0x%x) | |
err (%d) | |
DMS_SetVideoChannelAttr HI_MPI_VENC_SetChnAttr ret = 0x%x | |
nChannel:%d, nStreamChn:%d, VeChn:%d, ret = 0x%x | |
bit_rate:%d,framerate:%d,Quality:%d,gop_size:%d,RateType:%d | |
HI_MPI_VPSS_SetDepth:0x%x | |
HI_MPI_VPSS_UserGetFrame:0x%x | |
u32Height=%d, u32Width=%d, u32Stride=%d | |
no data | |
NULL == pUserPageAddr[0] | |
s32Count=%d, size=%d | |
HI_MPI_VPSS_UserReleaseFrame:0x%x | |
HI_MPI_SYS_Munmap:0x%x | |
HI_MPI_VENC_GetFd err | |
time out | |
HI_MPI_VENC_Query:0x%x | |
%s %d, realloc error! | |
DMS VENC SNAPSHOT len:%d | |
HI_MPI_VENC_ReleaseStream:0x%x | |
HI_MPI_VENC_StartRecvPic err 0x%x | |
SaveSnapPic err 0x%x | |
HI_MPI_VENC_StopRecvPic err 0x%x | |
%s: HI_MPI_SYS_UnBind[%d] failed with %#x! | |
exit snap HI_MPI_VENC_UnRegisterChn failed(0x%x) | |
exit snap HI_MPI_VENC_DestroyChn failed(0x%x) | |
exit snap HI_MPI_VENC_DestroyGroup failed(0x%x) | |
HI_MPI_VENC_UnRegisterChn err 0x%x | |
HI_MPI_VENC_DestroyChn err 0x%x | |
HI_MPI_VENC_DestroyGroup err 0x%x | |
DMS_DEV_DeinitVenc err | |
%d HI_MPI_RGN_DetachFrmChn err 0x%x | |
%d HI_MPI_RGN_Destroy err 0x%x | |
%d HI_MPI_RGN_Create err 0x%x | |
%d show faild 0x%x!!! | |
%s(%d) Failed | |
err HI_MPI_VO_SetPubAttr()=%x | |
err %x | |
err %d | |
WndCommEnableVoDevLay fail | |
WndCommEnableVoChn fail | |
HI_MPI_VENC_CreateGroup err 0x%x | |
HI_MPI_VENC_CreateChn err 0x%x | |
HI_MPI_VENC_RegisterChn err 0x%x | |
%s: HI_MPI_VENC_RegisterChn failed with %#x! | |
InitVenc encode stream %d:%d format is %d. profile=%d! | |
DMS_DEV_InitVenc err | |
stJpegAttr.bByFrame = %d | |
stJpegAttr.bVIField = %d | |
stJpegAttr.u32BufSize = %u | |
stJpegAttr.u32Priority = %u | |
stJpegAttr.u32PicWidth = %u | |
stJpegAttr.u32PicHeight = %u | |
InitVenc VpssGrp:%d VpssChn:%d VeGrpChn:%d VeChn:%d | |
%s-%d: HI_MPI_VENC_GetJpegParam failure,s32Ret=0x%08X! | |
Get-stJpegParam.u32Qfactor = %u! | |
%s-%d: HI_MPI_VENC_SetJpegParam failure,s32Ret=0x%08X! | |
Set-u32Quality[%d] = %u! | |
DMS_MPP_Release already! g_bMppInit=%d! | |
HI_MPI_SYS_Exit failed 0x%x! | |
HI_MPI_VB_Exit failed 0x%x! | |
DMS_MPP_INIT already! g_bMppInit=%d! | |
maxChNum=%lu, mode=%lu, enDeviceType=%d | |
HI_MPI_VB_SetConf failed 0x%x! | |
HI_MPI_VB_Init failed 0x%x! | |
conf : system config failed 0x%x! | |
HI_MPI_SYS_Init err 0x%x | |
%s: HI_MPI_ISP_GetImageAttr failed with %#x! | |
%s-%d: nVencWidth=%d,nVencHeight=%d! | |
%s-%d: nVCapWidth=%d,nVCapHeight=%d! | |
od stop recvpic err:(0x%x)!!!! | |
od unbind err(0x%x)!!!! | |
od destroy err(0x%x)!!!! | |
%s,%d HI_MPI_SYS_UnBind--err! | |
%s HI_MPI_VDA_DestroyChn failed with %#x | |
ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/ | |
0123456789abcdef | |
DMS_Write_User_Data_24C04 | |
DMS_Write_IC_24C04 | |
DMS_Check_IC_24C04 | |
DMS_Read_User_Data_24C04 | |
DMS_Read_IC_24C04_UnDec | |
DMS_Write_IC_FLASH | |
DMS_Read_IC_FLASH_UnDec | |
DMS_Read_IC_FLASH | |
DMS_Read_IC_24C04 | |
/dev/hi_i2c | |
[error -- File: %s, Line: %d, Function: %s] error in open authen | |
ic_2c404.c | |
/jb_config/jb_rootfs/.nonedata | |
[error -- File: %s, Line: %d, Function: %s] invalid parameters error | |
[error -- File: %s, Line: %d, Function: %s] fopen file(%s) fail(%d) | |
[error -- File: %s, Line: %d, Function: %s] fseek fail | |
[error -- File: %s, Line: %d, Function: %s] fwrite fail | |
[error -- File: %s, Line: %d, Function: %s] fread fail | |
[error -- File: %s, Line: %d, Function: %s] fread end | |
CheckIsOnline | |
DMS_Check_IC_AT0104 | |
DMS_Write_User_Data_AT0104 | |
DMS_Read_User_Data_AT0104 | |
VerifyPassword | |
DMS_Read_Encrypt_AT0104 | |
AuthenticationZone | |
[error -- File: %s, Line: %d, Function: %s] Check Is Online Failed Return 0 | |
ic_at0104.c | |
[error -- File: %s, Line: %d, Function: %s] Check Is Online Failed | |
[error -- File: %s, Line: %d, Function: %s] open %s err! | |
[error -- File: %s, Line: %d, Function: %s] pdata is NULL! | |
[error -- File: %s, Line: %d, Function: %s] VerifyPassword %d Return %X | |
[error -- File: %s, Line: %d, Function: %s] AuthenticationZone Return -1 | |
[error -- File: %s, Line: %d, Function: %s] AuthenticationZone Return -2 | |
/dev/hi_rtc | |
open %s failed | |
jiabo video startup rtc ok | |
basic_rtc.c | |
tm_year:%d, tm_mon:%d, mday:%d, tm_hour:%d, tm_min:%d, tm_sec:%d | |
file(%s), line(%d): jb_hi3510_i2c_write_byte write i2c error | |
file(%s), line(%d): DMS_GPIO_I2C_Read read i2c error | |
open rs232 ok | |
open rs232 fail | |
basic_tty.c | |
open rs485 ok | |
open rs485 fail | |
DMS_DEV_GPIO_SetAlarmOutState | |
DMS_DEV_GPIO_SetIRCutState_Ex | |
DMS_DEV_GPIO_SetIRCutState | |
DMS_DEV_GPIO_GetSDCardState | |
DMS_DEV_GPIO_GetOneAlarmOutState | |
DMS_DEV_GPIO_GetAlarmOutState | |
DMS_DEV_GPIO_GetResetState | |
DMS_DEV_GPIO_GetOneAlarmInState | |
DMS_DEV_GPIO_GetAlarmInState | |
DMS_DEV_GPIO_GetWpsBtnState | |
DMS_DEV_GPIO_GetIRLightState | |
DMS_DEV_GPIO_GetOneIOInputState | |
DMS_DEV_GPIO_ReSetSDCardPower | |
DMS_DEV_GPIO_SetLightState | |
base:%d is invalid! | |
offset:%d is invalid! | |
dev_gpio.c | |
%s-%d: nDay=%d! | |
Set ircut to day mode! | |
Set ircut to night mode! | |
ReSetSDCardPower gpio 7-6 dir %d | |
PCB_TYPE = %d! | |
it is not WHITE_LIGHT_FLICKER version! | |
DMS_GPIO_Motor_GetState | |
DMS_GPIO_I2C_CAT9555_Action | |
DMS_GPIO_I2C_CAT9555_Write_Config | |
DMS_GPIO_I2C_CAT9555_Read_Config | |
DMS_GPIO_I2C_SetDir | |
DMS_GPIO_I2C_GetDir | |
DMS_GPIO_Motor_Action | |
DMS_GPIO_Motor_PresetManage_Load | |
DMS_GPIO_I2C_Open | |
%s-%d: m_i2cfd(%d) isn't open! | |
GPIO_MOTOR_ACTION failure! | |
%s-%d: CAT9555_MOTOR_ACTION failure! | |
%s-%d: pCfg==NULL or size = %d! | |
%s-%d: i=%d, CAT9555_WRITE_CONFIG failure! | |
%s-%d: CAT9555_READ_CONFIG failure! | |
DMS_GPIO_I2C_CAT9555_Read_Config-ucBuff[0]=0x%02X,ucBuff[1]=0x%02X! | |
DMS_GPIO_I2C_GetBit--m_gpiofd=%d,tmp=%d err | |
%s--ioctl GPIO_SET_DIR err(tmp=%d)! | |
%s--ioctl GPIO_GET_DIR err(tmp=%d)! | |
/jb_config/jb_rootfs/dms_motor_preset.config | |
DMS_GPIO_Motor_PresetManage_UpdateFile: Open file %s err! | |
DMS_GPIO_Motor_PresetManage_UpdateFile: pNode is NULL! | |
DMS_GPIO_Motor_PresetManage_UpdateFile: fwrite PresetNode err! | |
%s-%d: list_entry failure! | |
DMS_GPIO_Motor_PresetManage_Load: Open file %s err! | |
%s-%d: malloc failure! | |
%s-%d: fread PresetNode err! | |
GPIO_MOTOR_INIT--m_gpiofd=%d,tmp=%d err | |
gpiofd is not invalid | |
ioctl gpio write bit tmp:%d (%s) | |
open i2c error ret = %d, errno = %d | |
dev_i2c.c | |
open %s(m_i2cfd=%d) success! | |
/dev/hi_gpio | |
open gpio error ret = %d, errno = %d | |
open %s(m_gpiofd=%d) success! | |
DMS_DEV_TTY_Write | |
DMS_DEV_TTY_ReadBlock | |
DMS_DEV_TTY_Open | |
fd:%d err:%s | |
dev_tty.c | |
/dev/ttyAMA0 | |
/dev/ttyAMA1 | |
/dev/ttyAMA2 | |
/dev/ttyAMA3 | |
TTY open %s failed:%s | |
not support . | |
%s:%d [%s] | |
ErrorID(0x%X) %s | |
NOT Support VFormat %ld | |
NOT Support VFormat %ld | |
:::::::::::::::::: VICHIP HI3518 AR0230! | |
:::::::::::::::::: VICHIP HI3518 SOIH22! | |
:::::::::::::::::: VICHIP HI3518 AR0330! | |
:::::::::::::::::: VICHIP HI3518 GC1004! | |
:::::::::::::::::: VICHIP HI3518 AR0130! | |
:::::::::::::::::: VICHIP HI3518 OV9732! | |
:::::::::::::::::: VICHIP HI3518 OV9712B | |
:::::::::::::::::: VICHIP HI3518 OV9712 | |
:::::::::::::::::: VICHIP HI3518 IMX122 | |
:::::::::::::::::: VICHIP HI3518 IMX236 | |
:::::::::::::::::: VICHIP HI3518 IMX138 | |
:::::::::::::::::: VICHIP HI3518 IMX104 | |
:::::::::::::::::: VICHIP HI3518 SC1035 | |
:::::::::::::::::: AICHIP JB_TLV320 | |
DMS_Vadc_hi3518_GetSensorDNAttr | |
DMS_Vadc_hi3518_SetSensorDNAttr | |
DMS_vadc_hi3518_SetMode | |
DMS_vadc_hi3518_SetVideoStandard | |
DMS_vadc_hi3518_DNSet | |
DMS_vadc_hi3518_SetColor | |
DMS_vadc_hi3518_Check_ReInit | |
DMS_vadc_hi3518_deinit | |
DMS_vadc_hi3518_init | |
DMS_vadc_hi3518_Open | |
%s: enDNState = %d, error! | |
getAGCLevel failure! | |
DMS_vadc_hi3518_init not yet! | |
%s: HI_MPI_ISP_GetAntiFlickerAttr failed with %#x! | |
%s: HI_MPI_ISP_SetAntiFlickerAttr failed with %#x! | |
%s: HI_MPI_ISP_SetImageAttr failed with %#x! | |
%s enDNAction:%d bManul:%d WaitDNAction:%d, tNow:%ld LastDNActionTime:%ld | |
%s: g_bVadcInit not yet! | |
%s(%d) HI_MPI_ISP_GetPubAttr failed with %#x! | |
DMS_vadc_hi3518_deinit already! | |
hisi_af_lib | |
HI_MPI_AF_UnRegister %s s32Ret=0x%08X! | |
hisi_awb_lib | |
HI_MPI_AWB_UnRegister %s s32Ret=0x%08X! | |
hisi_ae_lib | |
HI_MPI_AE_UnRegister %s s32Ret=0x%08X! | |
sensor_unregister_callback s32Ret=0x%08X! | |
Exit %s: success! | |
%s: sensor_register_callback failed with %#x! | |
HI_MPI_AE_Register failed! | |
HI_MPI_AWB_Register failed! | |
HI_MPI_AF_Register failed! | |
%s: HI_MPI_ISP_Init failed-s32Ret=0x%08x! | |
%s %d: m_nHi3518VIChip = %d! | |
%s %d: stImageAttr.u16Width = %u! | |
%s %d: stImageAttr.u16Height = %u! | |
%s %d: stImageAttr.u16FrameRate = %u! | |
%s: HI_MPI_ISP_SetInputTiming failed with %#x! | |
%s: create isp running thread failed! | |
%s: init success! | |
/dev/ssp | |
Check OV9712-iRet = %d,value = 0x%x! | |
Check OV9732-iRet = %d,value = 0x%x! | |
Check AR0130-iRet = %d,value = 0x%x! | |
Check AR0230-iRet = %d,value = 0x%x! | |
Check GC1004-iRet = %d,value = 0x%x! | |
Check SC1035-iRet = %d,value = 0x%x! | |
rmmod ssp_pana | |
rmmod ssp_sony | |
rmmod ssp_ad9020 | |
insmod /tmp/komod/ssp_sony.ko | |
Check imx236-value = 0x%04x! | |
rm -f /tmp/komod/ssp_sony.ko | |
/jb_config/jb_rootfs/sensor.conf | |
%s: szBuffer = %s,m_nHi3518VIChip = %d! | |
gc1004 | |
sensortype=gc1004 | |
reboot | |
soih22 | |
sensortype=soih22 | |
ov9732 | |
sensortype=ov9732 | |
ov9712 | |
sensortype=ov9712 | |
ovb9712 | |
sensortype=ovb9712 | |
sc1035 | |
sensortype=sc1035 | |
ar0130 | |
sensortype=ar0130 | |
ar0330 | |
sensortype=ar0330 | |
ar0230 | |
sensortype=ar0230 | |
imx122 | |
sensortype=imx122 | |
imx236 | |
sensortype=imx236 | |
imx138 | |
sensortype=imx138 | |
imx104 | |
sensortype=imx104 | |
bg070x | |
sensortype=bg070x | |
%s-%d: s32Ret=0x%08X,u32ChipId=0x%08X! | |
DMS_Vadc_IMX104_ISP_Init | |
DMS_Vadc_IMX104_getAGCLevel | |
DMS_Vadc_IMX104_ISP_SetColor | |
%s: HI_MPI_ISP_SetExposureType failure! s32Ret = 0x%08X! | |
%s: HI_MPI_ISP_GetAEAttr failure! s32Ret = 0x%08X! | |
%s: HI_MPI_ISP_GetSharpenAttr failure! s32Ret = 0x%08X! | |
%s: HI_MPI_ISP_GetDenoiseAttr failure! s32Ret = 0x%08X! | |
%s: HI_MPI_ISP_SetGammaAttr failure! s32Ret = 0x%08X! | |
%s: HI_MPI_ISP_GetGammaTable failure! s32Ret = 0x%08X! | |
%s: HI_MPI_ISP_SetExpStaInfo failure! s32Ret = 0x%08X! | |
%s: HI_MPI_ISP_GetAWBAttr failure! s32Ret = 0x%08X! | |
%s: HI_MPI_ISP_SetAWBAttr failure! s32Ret = 0x%08X! | |
%s: stIspAeAttr.bByPassAE = %d! | |
%s: HI_MPI_ISP_SetAEAttr failure! s32Ret = 0x%08X! | |
%s: HI_MPI_ISP_SetSharpenAttr failure! s32Ret = 0x%08X! | |
%s: HI_MPI_ISP_SetDenoiseAttr failure! s32Ret = 0x%08X! | |
DMS_vadc_hi3518_ISP_IMX104_Init Success! | |
%s----index(%d) err! | |
%s(%d) not support cmd:%d | |
%s: %s nCmd:0x%08x nVal:%d | |
hi3518/vadc_imx104.c | |
%s: HI_MPI_VI_GetCSCAttr failed with %x! | |
%s: HI_MPI_ISP_SetSaturation failed with 0x%x! | |
%s: HI_MPI_VI_SetCSCAttr failed with 0x%x! | |
%s: HI_MPI_ISP_GetAIAttr failed with %#x! | |
%s: HI_MPI_ISP_SetAIAttr failed with %#x! | |
HI_MPI_ISP_SetAIAttr u32IrisHoldValue:%d | |
HI_MPI_ISP_SetAIAttr val:%d | |
%s: HI_MPI_ISP_SetWBType failed with %#x! | |
HI_MPI_ISP_SetWBType bEnable:%d | |
%s: HI_MPI_ISP_GetAWBAttr failed with %#x! | |
%s: HI_MPI_ISP_SetAWBAttr failed with %#x! | |
HI_MPI_ISP_SetAWBAttr u8RGStrength:%d | |
HI_MPI_ISP_SetAWBAttr u8BGStrength:%d | |
%s: HI_MPI_ISP_GetDenoiseAttr failed with %#x! | |
%s: HI_MPI_ISP_SetDenoiseAttr failed with %#x! | |
HI_MPI_ISP_SetDenoiseAttr bEnable:%d | |
HI_MPI_ISP_SetDenoiseAttr u8ThreshTarget:%d | |
%s: HI_MPI_ISP_GetMEAttr failed with %#x! | |
%s: HI_MPI_ISP_SetMEAttr failed with %#x! | |
HI_MPI_ISP_SetMEAttr u32ExpLine:%d | |
HI_MPI_ISP_SetMEAttr u32ExpLine:%d,val:%d | |
HI_MPI_ISP_SetMEAttr bManualAGainEnable:%d s32DGain:%d | |
DMS_Vadc_IMX122_getAGCLevel | |
DMS_Vadc_IMX122_SetColor | |
DMS_Vadc_IMX122_ISP_Init | |
hi3518/vadc_imx122.c | |
DMS_vadc_hi3518_ISP_IMX122_Init Success! | |
DMS_Vadc_IMX138_ISP_Init | |
DMS_Vadc_IMX138_getAGCLevel | |
DMS_Vadc_IMX138_ISP_SetColor | |
%s: HI_MPI_ISP_SetGammaTable failure! s32Ret = 0x%08X! | |
DMS_vadc_hi3518_ISP_IMX138_Init Success! | |
hi3518/vadc_imx138.c | |
DMS_Vadc_IMX236_ISP_Init | |
DMS_Vadc_IMX236_getAGCLevel | |
DMS_Vadc_IMX236_ISP_SetColor | |
%s: HI_MPI_ISP_GetGammaAttr failure! s32Ret = 0x%08X! | |
DMS_vadc_hi3518_ISP_IMX236_Init Success! | |
hi3518/vadc_imx236.c | |
DMS_Vadc_hi3518_GetSensorDNAttr failied with 0x%08X! | |
DMS_Vadc_OV9712B_ISP_Init | |
DMS_Vadc_OV9712B_getAGCLevel | |
DMS_Vadc_OV9712_getAGCLevel | |
DMS_Vadc_OV9712B_ISP_SetColor | |
DMS_Vadc_OV9712_ISP_SetColor | |
DMS_Vadc_OV9712B_SlowFramerate | |
DMS_Vadc_OV9712_ISP_Init | |
DMS_vadc_hi3518_ISP_OV9712_Init Success! | |
hi3518/vadc_ov9712.c | |
stSharpenAttr.bEnable=%d,stSharpenAttr.bManualEnable=%d! | |
DMS_Vadc_OV9732_ISP_Init | |
DMS_Vadc_OV9732_getAGCLevel | |
DMS_Vadc_OV9732_ISP_SetColor | |
DMS_Vadc_OV9732_SlowFramerate | |
hi3518/vadc_ov9732.c | |
DMS_Vadc_SC1035_getAGCLevel | |
DMS_Vadc_SC1035_ISP_SetColor | |
DMS_vadc_hi3518_ISP_SC1035_Init Success! | |
hi3518/vadc_sc1035.c | |
DMS_Vadc_SOIH22_ISP_Init | |
DMS_Vadc_SOIH22_getAGCLevel | |
DMS_Vadc_SOIH22_ISP_SetColor | |
DMS_vadc_hi3518_ISP_SOIH22_Init Success! | |
hi3518/vadc_soih22.c | |
DMS_Vadc_AR0130_getAGCLevel | |
DMS_Vadc_AR0130_SlowFramerate | |
DMS_Vadc_AR0130_ISP_SetColor | |
DMS_vadc_hi3518_ISP_AR0130_Init Success! | |
u8Value=%d,u8NewValue=%d! | |
hi3518/vadc_ar0130.c | |
DMS_Vadc_AR0230_getAGCLevel | |
DMS_Vadc_AR0230_ISP_SetColor | |
hi3518/vadc_ar0230.c | |
DMS_Vadc_AR0330_getAGCLevel | |
DMS_Vadc_AR0330_ISP_SetColor | |
hi3518/vadc_ar0330.c | |
DMS_Vadc_GC1004_SlowFramerate | |
DMS_Vadc_GC1004_ISP_Init | |
DMS_Vadc_GC1004_getAGCLevel | |
DMS_Vadc_GC1004_ISP_SetColor | |
DMS_vadc_ISP_GC1004_Init Success! | |
hi3518/vadc_gc1004.c | |
BUF_GetDataPoint | |
VS_BUF_GetFramePtr | |
VS_BUF_GetFramePtrEx | |
VS_BUF_GetNextFrameType | |
BUF_Lock param erro! | |
BUF_Lock g_pBuf NULL! | |
VS_BUF_Reset Para erro! | |
VS_BUF_GetWriteMemPos Para Error Exit | |
VS_BUF_GetWriteMemPos g_pBuf NULL! | |
VS_BUF_GetWriteMemPos pMemAddr NULL! | |
VS_BUF_GetBufSize Para Error Exit | |
VS_BUF_GetBufSize g_pBuf NULL! | |
VS_BUF_GetBufPhyAddr Para Error Exit | |
VS_BUF_GetBufPhyAddr g_pBuf NULL! | |
VS_BUF_GetStreamAttr Para Error Exit | |
VS_BUF_GetStreamAttr CBuffer Exit | |
VS_BUF_GetStreamAttr g_pBuf NULL! | |
VS_BUF_SetStreamAttr CBuffer Exit! | |
VS_BUF_SetStreamAttr g_pBuf NULL! | |
VS_BUF_GetReaderStreamAttr Para erro! | |
VS_BUF_GetReaderStreamAttr g_pBuf NULL! | |
VS_BUF_GetReadPtrLeftNum Para erro! | |
VS_BUF_GetReadPtrLeftNum Para erro | |
VS_BUF_GetReadPtrLeftNum g_pBuf NULL | |
VS_BUF_CheckReaderPacketNo Para erro | |
VS_BUF_CheckReaderPacketNo Para erro! | |
VS_BUF_CheckReaderPacketNo g_pBuf NULL | |
VS_BUF_CanRead Para erro | |
VS_BUF_CanRead Para erro! | |
VS_BUF_CanRead g_pBuf NULL | |
VS_BUF Module Build:%s %s | |
11:29:23 | |
VS_BUF_GetReadPtrPos Para erro! | |
VS_BUF_GetReadPtrPos g_pBuf NULL! | |
BUF_SetReadPtrPos Para erro! | |
BUF_SetReadPtrPos g_pBuf NULL! | |
VS_BUF_DelReader Para erro | |
VS_BUF_DelReader Para erro! | |
VS_BUF_DelReader g_pBuf NULL! | |
VS_BUF_AddReader Para erro! | |
VS_BUF_AddReader BUF_AddReader erro! | |
s32Chn %d enStreamType %d reader %d index %d bufferid %d | |
VS_BUF_Destroy param erro! | |
%s %d VS_BUF_CanRead %d failed %d | |
VS_BUF_ReleaseWriteMemPos CBuffer Exit! | |
VS_BUF_ReleaseWriteMemPos g_pBuf NULL! | |
VS_BUF_WriteFrame CBuffer Exit! | |
VS_BUF_WriteFrame g_pBuf NULL! | |
VS_BUF_Write param erro! | |
VS_BUF_Write g_pBuf NULL! | |
VS_BUF_Create param erro! | |
VS_BUF_Create CBuffer Exit! | |
VS_BUF_Create new CBuffer failed! | |
VS_BUF_Create BUF_Create failed! | |
VS_BUF_GetFrame para erro readid:%d | |
%s %d Return %d | |
LINE .%d BUF_SetReadPtrPos failed | |
1dcH264 | |
0dcH264 | |
dcdumy | |
BUF_GetDataPoint failed | |
BUF_SetReadPtrPos failed | |
read data frame type failed s32ReaderId %d enPolicy %d | |
VS_BUF_SetReadPtrPos failed | |
LINE .%d VS_BUF_GetFramePtr failed | |
LINE .%d VS_BUF_GetFrame Mem failed | |
VS_BUF_GetNextFrameType para erro readid:%d | |
GetLastWriteNIFramPos | |
BUF_WriteAudioData | |
BUF_WriteVideoData | |
BUF_GetStreamAttr para erro! | |
BUF_SetStreamAttr para erro! | |
BUF_GetReaderStreamAttr Buffer not create! | |
BUF_GetReaderStreamAttr Invalid reader id! | |
BUF_GetReaderStreamAttr para erro! | |
BUF_GetReadPtrLeftNum Buffer not create! | |
BUF_GetReadPtrLeftNum Invalid reader id! | |
BUF_GetReadPtrLeftNum m_u32BlockSize = 0 | |
BUF_GetReadPtrLeftNum Readptr over writeptr! | |
BUF_GetReadPtrLeftNum Invalid cycle! | |
BUF_SetReadPtrPos Buffer not create! | |
BUF_SetReadPtrPos Invalid reader id! | |
VSBUF Lost Video Packet ReaderId %d CurPacketNo %d Shoud Be %d | |
VSBUF Lost Audio Packet ReaderId %d CurPacketNo %d Shoud Be %d | |
BUF_CanRead Invalid reader id:%d,%d! | |
BUF_CanRead Readptr over writeptr! | |
BUF_CanRead Invalid position 2! s32ReaderId %d u32WritePos:%d, u32WriteCycle:%d, m_au32ReadPos[%d]:%d, m_au32ReadCycle[%d]:%d | |
%s %d BlockSize %d u32ExpectNumber %d | |
GetLastWriteNIFramPos u32ValidNumber %d | |
BUF_GetReadPtrPos Invalid para! | |
BUF_GetReadPtrPos Buffer not create! | |
BUF_GetReadPtrPos nofind N, s32N:%d | |
BUF_GetReadPtrPos Readptr over writeptr! | |
BUF_GetReadPtrPos2 nofind N, s32N:%d | |
BUF_GetReadPtrPos2 Readptr over writeptr!!! | |
BUF_GetReadPtrPos Invalid cycle! | |
BUF_GetReadPtrPos3 nofind N, s32N:%d | |
BUF_GetReadPtrPos3 Readptr NewData over writeptr! | |
BUF_GetReadPtrPos5 nofind N, s32N:%d | |
BUF_GetReadPtrPos5 NewData Readptr over writeptr!!! | |
BUF_GetReadPtrPos New Data Invalid cycle! | |
BUF_GetReadPtrPos Not support yet! | |
BUF_Write Buffer not create | |
BUF_Write Invalid para | |
BUF_Write Invalid I-frame time. | |
BUF_Write SetBlockInfo failed. | |
00dcdumy | |
00wb | |
left buffer small then head | |
#### %s %d, err:%d | |
00dcH264 | |
Wrong Frame type: %d, must be I or P. | |
BUF_DelReader Buffer not create! | |
BUF_DelReader Invalid reader id! | |
BUF_DelReader No readers yet! | |
BUF_AddReader Buffer not create! | |
BUF_AddReader NULL ptr! | |
BUF_AddReader already max readers! | |
BUF_Destroy Buffer not create! | |
BUF_Destroy Buffer in use | |
BUF_Create Buffer have been created! | |
BUF_Create Stream buffer create failed(-1)! | |
BUF_Create Stream buffer create failed(-2)! | |
logapi telnet send err:%s | |
logapi level of the trace error | |
logapi trace string is too long:%d | |
logapi sendto:%s | |
u%04x | |
false | |
%.0f | |
LIB_zoomcam_Start | |
LIB_zoomcam_Init | |
zoomcam_data_analysis | |
zoomcam_thread | |
m_CommuType:%d, data len:%d | |
@@@@@@@@@@ tty data check sum error Sum:0x%02X--0x%02X | |
osd too long %d | |
LIB_zoomcam_Start .... | |
LIB_zoomcam_Start Failed .... m_spi_fd:%d | |
LIB_zoomcam_Start OK.... | |
#### %s %d, pcbtype:0x%X, pcbver=0x%X | |
insmod /komod/extdrv/ssp_gpio.ko | |
insmod ssp_gpio.ko failed | |
/dev/hi_spi | |
Open /dev/hi_spi error! %s | |
show zoomosd line:%d, cow:%d len:%d text:%s | |
%s(%d) unkown cmd:%d | |
read cmd:0x%x invalid | |
zoomcam | |
%s Exit | |
DeleteZoomOsd | |
ClearAllZoomOsd | |
ZoomOsd_show_fixed_text | |
ShowZoomOsd | |
ZoomOsdCreateRegion | |
ZoomOsdInit | |
FILE:%s FUNCTION:%s LINE:%d DeleteVideoOsd index:%d fail. | |
src/zoomosd.c | |
FILE:%s FUNCTION:%s LINE:%d ClearAllZoomOsd ! | |
FILE:%s FUNCTION:%s LINE:%d Osd_show_fixed_text-show bitmap to region %d failed while displaying 0x%x bitmap_h:%d, bitmap_w:%d | |
FILE:%s FUNCTION:%s LINE:%d index:%d, s32X:%d, s32Y:%d | |
FILE:%s FUNCTION:%s LINE:%d ShowZoomOsd index(%d:%d) text too len:%d | |
FILE:%s FUNCTION:%s LINE:%d ShowZoomOsd index(%d:%d) text len:%d :%s | |
FILE:%s FUNCTION:%s LINE:%d HI_MPI_VPP_CreateRegion err 0x%x!xoffset=%d,yoffset=%d,w=%d,h=%d | |
FILE:%s FUNCTION:%s LINE:%d %s: HI_MPI_RGN_AttachToChn (handle:%d) streamtype:%d, index:%d, failed with %#x! | |
FILE:%s FUNCTION:%s LINE:%d VideoOsdInit.... | |
FILE:%s FUNCTION:%s LINE:%d VideoOsdInit...ok | |
GLNK_SetRecordConfigure_Callback | |
GLNK_ResetUsrPsword_Callback | |
GLNK_SearchWifi_Callback | |
GLNK_GetVide_AudioConfig_Callback | |
GLNK_SetVide_AudioConfig_Callback | |
GLNK_SetNetWorkConfig_Callback | |
GLNK_GetNetWorkConfig_Callback | |
GLNK_GetVersionFirmware_Callback | |
GLNK_DeviceUpDate_Callback | |
GLNK_RecordClose_CallBack | |
GLNK_RecordReadFrame_CallBack | |
GLNK_RecordOpen_CallBack | |
GLNK_PlayBackSendStreamContrl_Callback | |
GLNK_AudioEncodeClose_CallBack | |
GLNK_AudioEncodeOpen_CallBack | |
GLNK_RTVideoClose_Callback | |
GLNK_AudioDecodeClose_CallBack | |
GLNK_AudioDecodeOpen_CallBack | |
GLinkModule_Init | |
GLNK_WifiConfig_Callback | |
GLNK_GetDevInfo_Callback | |
GLinkModule_GetGidFromServer | |
GLNK_PwdAuth_Callback | |
GLinkModule_GetGidTread | |
GLinkModule_GetGidTread | |
GLinkModule_Start | |
GLinkModule_SubmitP2pGid | |
8.8.8.8 | |
202.96.134.133 | |
GLinkModule_ReGetGid | |
GLinkModule_SubmitGIDToServer | |
GLinkModule_SubmitP2PGidTread | |
GLNK_DownLoadFileConfig_Callback | |
GLNK_PlayBackSendStreamClose_CallBack | |
GLNK_PlayBackSendStreamOpen_CallBack | |
REC_PlayBack_Tread | |
RecFileFind | |
GLNK_VideoFileSearch_CallBack | |
GetRecFileInfo | |
CloseRecFileFind | |
GLNK_RTVideoOpen_Callback | |
ChangeNetInterface | |
GLinkModule_NetChkThread | |
Return_GetCmd_Info | |
Return_GetCmd_Info | |
Thread_TransparentCh | |
GLinkModule_SendStream | |
GLinkModule_P2PStreamThread | |
GLinkInfo:%s(%d) send continue | |
GLinkInfo:%s(%d) send pause | |
GLinkInfo:%s(%d) send stop | |
GLinkInfo:%s(%d) quick play | |
GLinkInfo:%s(%d) slow paly | |
GLinkInfo:%s(%d) drag the palyback | |
%s(%d) | |
%s(%d),ismainorsub=%d,nReadStreamID=%d | |
GLinkErr:%s(%d) open module err | |
GLinkErr:%s(%d) DMS_NET_REG_ALARMCALLBACK failure | |
%s(%d) : name:%s ssid:%s pwd:%s | |
WH Tech | |
IPC01 | |
GLinkInfo:%s(%d) softwareVersion=%s,channelNum=%d | |
GLinkErr:%s(%d) para err | |
p2p%s | |
GLinkInfo:%s(%d) GetMacAddr err | |
GET /getp2pid.aspx?name=%s&dvsid=%s&version=2&p2ptype=1 HTTP/1.1 | |
GLinkErr:%s(%d) get IP faile | |
GLinkErr:%s(%d) connect Error %s | |
GLinkErr:%s(%d) send Error %s | |
GLinkErr:%s(%d) select Error %s | |
GLinkErr:%s(%d) recv Error %s | |
<status> | |
GLinkErr:%s(%d) Error %s | |
</status> | |
released | |
<p2pid> | |
</p2pid> | |
GLinkInfo:%s(%d) psuidstr=%s | |
%s(%d),check the userinfo OK | |
%s(%d),check the userinfo err | |
GLink_GetGidTread | |
%s(%d) GooLinkModule start... | |
GLinkErr:%s(%d) GET P2PCFG faile | |
GLinkInfo:%s(%d) GID From EncryptionChip,GID=%s | |
GLinkInfo:%s(%d) GID From Server %s | |
%s(%d) GooLink Version is 0x%08X CopyRight WH Tech V1.2 | |
%s(%d),g_glink_GID=%s | |
Create Thread_NetworkCheck Failed | |
GLinkInfo:%s(%d) P2Pservername=%s,P2Pid=%s | |
stop! | |
zoom decrease! | |
zoom increase! | |
focus increase! | |
focus decrease! | |
move up! | |
move down! | |
move left! | |
move right! | |
iris increase! | |
iris decrease! | |
auto cruise! | |
position reset! | |
position set! | |
position clear! | |
action reset! | |
move leftup! | |
move leftdown! | |
move rightup! | |
move rightdown! | |
clear tour! | |
preset tour! | |
delete tour! | |
114.114.114.114 | |
GLinkInfo:%s(%d) get GID err | |
GLinkErr:%s(%d) P2PGidInfo err | |
GLinkErr:%s(%d) servername err | |
.sieraddns.com | |
GLinkErr:%s(%d) this DDNSDomain do not support SubmitGIDToServer | |
GLinkErr:%s(%d) GetMacAddr faile | |
GET /getp2pid.aspx?name=%s&dvsid=%s&p2pid=%s&version=2&p2ptype=1 HTTP/1.1 | |
GET /getp2pid.aspx?name=%s&dvsid=%s&p2pid=%s&version=2&p2ptype=3 HTTP/1.1 | |
GLinkErr:%s(%d) get ip faile | |
GLinkErr:%s(%d) connect failure | |
GLinkErr:%s(%d) send failure | |
%s %d Error %s | |
GLinkErr:%s(%d) recvdatabuf err | |
GLinkErr:%s(%d) no </status | |
GLinkInfo:%s(%d) status:%s | |
nodevice | |
DdnsUnregistered | |
GLinkErr:%s(%d) status err | |
P2PGID_SubmitTread | |
GLinkInfo:%s(%d) P2PGID SubmitTread start... | |
GLinkErr:%s(%d) GET DDNSCFG error | |
GLinkErr:%s(%d) Submit GID faile | |
GLinkInfo:%s(%d) type:%d,SessionID:%d,filename:%s,offset:%d | |
GLinkInfo:%s(%d) fopen faile.errno:%d | |
GLinkInfo:%s(%d) ret:%d,sendlen:%d,Totalsendlen:%d,FileLen:%d | |
GLinkInfo:%s(%d) download success! ret:%d,sendlen:%d,Totalsendlen:%d,FileLen:%d | |
GLinkInfo:%s(%d) connect failed! sendlen:%d,Totalsendlen:%d,FileLen:%d | |
set systime faile | |
sec:%d | |
usec:%d | |
istwelve:%d | |
wDay:%d | |
wHour:%d | |
wMinute:%d | |
wSecond:%d | |
GLinkInfo:%s(%d) RecordClose(%d),g_playstatus[%d]=%d | |
GLinkInfo:%s(%d) the number of users err | |
GLinkInfo:%s(%d) PlayBackByName err | |
Open dms_sysnetapi_ioctrl error | |
REC_PlayBack_Tread | |
GLinkInfo:%s(%d) playback_stop | |
GLinkInfo:%s(%d) GetReadPtrPos err,RET=%d,g_playstatus[%d]=%d | |
GLinkInfo:%s(%d) target=%d,recordfd=%d | |
GLinkInfo:%s(%d) time out,target=%d | |
%s(%d) FindFile faile | |
GLinkInfo:%s(%d) RecFileFind faile | |
GLinkInfo:%s(%d) FileInfo malloc faile | |
GLinkInfo:%s(%d) GetRecFileInfo faile | |
GLinkInfo:%s(%d) VideoTotalTime=%d,channel=%d,length=%d,recordType=%d,fileName=%s,startTime:%d-%d-%d %d:%d:%d,endTime:%d-%d-%d %d:%d:%d | |
GLinkInfo:%s(%d) FindClose faile,ret=%d | |
GLinkInfo:%s(%d) CloseRecFileFind faile | |
GLinkInfo:%s(%d) framerate:%d,bitrate:%d,bIsMainStream:%d,nReadStreamID:%d | |
GLinkInfo:%s(%d) lpInterface:%s,lpDevID:%s,bCurifnameiseth0:%d | |
GLinkInfo:%s(%d) glnk_init Return %d,GID=%s,mobilePort=%lu,Interface:%s | |
Thread_NetworkCheck | |
Thread_NetworkCheck start... | |
%s(%d) : net change to ra0 | |
%s(%d) : net change to eth0 | |
%s(%d) glnk_ses_write OK | |
%s(%d) ,WriteLen=%d | |
glnk_ses_write OK | |
Transparentchannel | |
%s(%d),RecvData->dwSize=%lu,RecvData->dwCommand=0x%x | |
%s(%d),connect timeout | |
%s(%d),glnk_ses_read faile | |
unSupport cmd : 0x%x | |
%s(%d), free StreamBuffer | |
%s(%d),delete nReadStreamID | |
%s(%d) malloc StreamBuffer | |
%s(%d) : malloc Failed | |
%s(%d) Read Stream Data Failed ret = %d | |
p2pStreamThread | |
%s(%d) p2pStreamThread start... | |
GooLink State Change To %d | |
GlinkModule_CheckDomainServer | |
GlinkModule_GetMacAddr | |
GlinkModule_GetSerAddr | |
GLinkInfo:%s(%d) NewDomain:%s,OldDomain:%s | |
GLinkErr:%s(%d) NewDomain Type err | |
GLinkInfo:%s(%d) NewDomainServer:%s | |
GLinkErr:%s(%d) OldDomain Type err | |
GLinkInfo:%s(%d) OldDomainServer:%s | |
GLinkErr:%s(%d) GET NETCFG faile | |
GLinkErr:%s(%d) GET DDNSCFG faile | |
glnk_ants_send | |
glnk_stop | |
glnk_destroy | |
glnk_init | |
%s:%d: | |
%s:%d: ret=%d | |
ifname is too long! | |
ifname pointer is NULL! | |
Can not get the IP addr of this ifname! | |
Can not get the IP addr of this ifname! %s | |
Change ifname succeed! %s | |
destroy begin! | |
gtserver_destroy | |
after glnk_destroy! | |
COMPANYNAME is %s | |
local port = %d | |
LT4a7a46c58aae9 | |
eViews.push2u.com | |
glnk_init end! | |
gtserver_init | |
gtserver_start | |
gtserver_create | |
Create thread error!%s:%d Error: %s | |
TCP server destroy=%d, istop=%d | |
glnk_stopSendplaybackdata | |
target[%d] GTSHAREBUFFER[target]->FrameSum > 60! | |
GTUpdate_SetStatus | |
decode_string | |
GTUpdate_Create | |
GTUpdate_SetUpdateType | |
GTUpdate_GetUpdateType | |
GTUpdate_Start | |
fopen %s failed | |
malloc failed. | |
%s:%d: statue [%d] -> [%d] %d | |
Goolink2014 | |
{"AppCom":"%s","SolCom":"%s","ReleaseTime":"%s","HDVersion":"%s"} | |
POST /g_version_match.php HTTP/1.1 | |
User-Agent: Dalvik/1.6.0 (Linux; U; Android 4.1.1; MI 2S MIUI/4.11.28) | |
Host: %s | |
Connection: Keep-Alive | |
Accept-Encoding: gzip | |
Content-Type: application/x-www-form-urlencoded | |
Content-Length: %d | |
%s:%d: buf = %s | |
%s:%d: reresult = %s | |
%s:%d: urlresult = %s | |
%s:%d: versionresult = %s | |
%s:%d: md5result = %s | |
"re":" | |
"downurl":" | |
"version":" | |
"md5":" | |
","downurl | |
","version | |
","md5 | |
Failed to create hupd instance! | |
Failed to create GTUPDATE instance2! | |
%s:%d: GTUPDATEOPT_GET FAIL | |
%s:%d: statue [%d] -> [%d] | |
hupd->stop = %d | |
%s:%d: Connect server fiald | |
fyrs.goolink.org | |
udp_server_create | |
udpserver | |
C2C_GetRsp | |
C2C_PutRsp | |
C2C_PutReq | |
CallToCom_Init | |
CallToCom_Mgr | |
%s:%d: Can not alloc memery! | |
GTCPcreate | |
DestorySendSignalingList | |
DestoryList | |
session_recvfromextlist | |
GTConnectionProSearchFilereq | |
GTConnectionProSetViewMode | |
GTConnectionProContrlVod_NewPlayback | |
GTConnectionProLogin | |
session_write | |
GTConnectionSendSignaling | |
GTConnectionSendFileInfo | |
GTConnectionSendUpDateResult | |
session_full_process | |
session_discretesend | |
GTConnectionMustToCheck | |
GTConnectionSendVodBuf | |
GTConnectionProHandleRecvbuf | |
session_close | |
sesmgr_delsession | |
GTConnectionProStartChange | |
sesmgr_destroy | |
session_recvbyants | |
sesmgr_addsession | |
Good Job | |
%s:%d: GTConnectionProSetViewMode mode :%d success | |
%s:%d: GTConnectionProSetViewMode mode :%d fail | |
%s:%d: GLNK_PlayCommandPause | |
%s:%d: GLNK_PlayCommandResume | |
GLNK_RecordOpen_CallBack | |
GLNK_RecordOpen_CallBack end | |
GLNK_SearchWifi_Callback | |
GLNK_SearchWifi_Callback end | |
GLNK_RecordClose_CallBack | |
GLNK_RecordClose_CallBack end | |
%s:%d: connectionID=%d error protocol! | |
%s:%d: alloc memery error! | |
%s:%d: session closed! | |
%s:%d: [0]:%d, [1]:%d | |
GTCSendVodBuf ret=%d GLNK_RecordClose_CallBack | |
GTCSendVodBuf ret==0 GLNK_RecordClose_CallBack end | |
ssid = %s pwd = %s name = %s | |
eof.size= %d | |
version info | |
%s:%d: CustomExts length=%d | |
%s:session remain:%d | |
%s:session count:%d | |
%s:%d, %d | |
GTConnectionProGetSmartSwitchOption | |
GTConnectionProSetSmartSwitchOption | |
GTConnectionProGetStorageOption | |
GTConnectionProGetOSDOption | |
GTConnectionProSetOSDOption | |
GTConnectionProGetImageOption | |
GTConnectionProSetImageOption | |
GTConnectionProGetAudioStreamOption | |
GTConnectionProSetAudioStreamOption | |
GTConnectionProGetVideoStreamOption | |
GTConnectionProSetVideoStreamOption | |
GTConnectionProGetTimeOption | |
GTConnectionProSetTimeOption | |
GTConnectionProGetOption | |
GTConnectionProSettingOption | |
ReSuc | |
SmartSwitchOpt | |
GLOPT%s | |
SmartSwitchRsp | |
FormatErr | |
StorageGetOpt | |
pStr = %s | |
OSDGetOpt | |
OSDSetOpt | |
ImageGetOpt | |
ImageSetOpt | |
AudioStreamGetOpt | |
AudioStreamSetOpt | |
VideoStreamGetOpt | |
VideoStreamSetOpt | |
TimeGetOpt | |
TimeSetOpt | |
MotionDetectReq | |
MotionDetectOpt | |
VideoRecordReq | |
VideoRecordOpt | |
MotionDetectRsp | |
VideoRecordRsp | |
LTAlarmDev_FreeDevList | |
LTAlarmDev_PushDevAlarm | |
PushAlarmDevList_Add | |
LTAlarmDev_ParseDevList | |
LTAlarmDev_Proccees | |
PushAlarmDevList_Remove | |
LTAlarmDev_Destroy | |
GoolinkPushIdo | |
/sen_info.php | |
/sen_alarm.php | |
{"gwdevno":"%s"} | |
{"gwdevno":"%s",%s,"mcode":"%d","atime":"%04d%02d%02d%02d%02d%02d"} | |
POST | |
%s:%d: DevAlarm is stop! | |
%s:%d: There is no dev need to send! | |
%s:%d: Push interval %llu usec | |
%s:%d: No suitable Dev[%s] found! | |
%s:%d: This should not happen, there must be a bug! | |
%s:%d: DevAlarm list full! | |
"slist" | |
pushflag | |
acode | |
Failed to create LTAlarmDev instance2! | |
GetEffectiveSocket | |
ltpush_send_alarm | |
LTPush_lc | |
ltpush_destroy | |
ltpush_create | |
Errortype = %x channel = %x | |
./gtagent.conf | |
fopen error | |
fopen | |
CommuPort | |
%04d%02d%02d%02d%02d%02d | |
videopush2012 | |
%s|%s|%d|%d|%s | |
GET /pu.php?c=%s HTTP/1.1 | |
Accept: */* | |
User-Agent: Mozilla/5.0 | |
Content-Length: %d | |
Content-Type: application/x-www-form-urlencoded | |
Host: %s | |
Connecting to push server: %s | |
Failed to connect to %s!, error: %s | |
send to server :%s | |
Received response: %s | |
Failed to receive response, ret = %d, error: %s | |
mobileeyedoor.push2u.com | |
LT4a7a46c789959 | |
ALARM_ERROR_DEVICE_UPDATE %d, ret=%d | |
ALARM_ERROR_LIST_FULL %d, ret=%d | |
ALARM_ERROR_INTERVAL_TIME_LESS %d | |
zy01406b87 | |
GooLink | |
www.push2u.com | |
ltpush_send_alarm = %d | |
LBS_login | |
TSI_SetStatus | |
TSInterflow_setUPnP | |
TSInterflow_create | |
TSI_RecvFromGOO | |
create_fwd_session | |
create_sctfwd_session | |
TSI_CheckNetwork | |
TSI_SendAliveToGOO | |
TSI_RecvLoginFromGOO | |
TSInterflow_reconnect | |
TSI_start | |
TSI_GOORegister | |
TSI_CheckMapPortInfo | |
langtao-67616e796f6e67 | |
lbs rc4out | |
Failed to open socket! | |
lbserror | |
%s:%d: Create thread error! ret:%d errno : %s | |
test4longanshi | |
%s:%d: connect %s:%d fail! | |
%s:%d: sendlen=%d / %d | |
Have not been used! | |
Have not been used! pJsonData = %x JsonDataLen = %d pResultData = %x ResultDataLen = %x | |
Have not been used! filename = %s result = %d | |
Have not been used! sec = %d usec = %d mdlname = %s threadname = %s code = %d threadid=%d logsize = %d logseq = %d log = %s | |
b64_decode_ | |
?456789:;<= | |
!"#$%&'()*+,-./0123 | |
b64_encode_ | |
ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/ | |
b64_encode2 | |
Operation was successful | |
The given translation buffer was not of sufficient size | |
The input did not represent a fully formed stream of octet couplings | |
Invalid data | |
(((void *)0) != badChar) | |
GTBase/b64.c | |
(((void *)0) != rc) | |
(currIndex < (4)) | |
(((void *)0) != strchr(b64_chars, *(p-1))) | |
(len != lineLen) | |
(0 == (lineLen % 4)) | |
[%02d:%02d:%02d.%06ld] | |
[%d][%s] | |
GET %s HTTP/1.1 | |
Host: %s | |
Connection: Keep-Alive | |
Accept: text/html,application/xhtml+xml,application/xml;q=0.9,image/webp,*/*;q=0.8 | |
User-Agent: SE 2.X MetaSr 1.0 | |
Accept-Encoding: gzip, deflate | |
Content-Length | |
PUT %s | |
Accept: */* | |
Host: | |
GET %s | |
Range: bytes=%s- | |
/home/123.rar | |
len = %d | |
http:// | |
url:%s format error | |
Cannot Get IP | |
url not contain '/' | |
ERR:recv fail | |
Open %s Error | |
ERR:Save_File | |
%s.bp | |
ERR:Save_Breakpoint | |
ERR:Get_Breakpoint read | |
%s not available | |
GetDomainnameInfo1 | |
LTDNSCheck | |
TcpOpenConnectTimeOut | |
TcpOpenConnect | |
TcpOpenAndBind | |
TcpOpenSetReuseAndBind | |
UdpOpenAndBind | |
getIpfd | |
%s %s HTTP/1.1 | |
User-Agent: GooLink Terminal 0x%x | |
Host: %s | |
Connection: Keep-Alive | |
Content-Type: application/x-www-form-urlencoded | |
Content-Length: %d | |
</%s> | |
LC_ALL=C route -n | grep 'UG'| awk '{ print $2}' | |
getaddrinfo: %s to %s | |
%s:%d: getaddrinfo: %s to %s | |
set socket reuse error value : %d | |
%s:%d %d bytes! | |
%s:%d rbytes=%x | |
rdata[5]=%x | |
%s:%d rbytes=%d, rdata[5]=%x | |
%s:%d: %s:%d open socket fail! | |
HandleMappingPort | |
TcpSendHttpBufferToSvr | |
TcpConnectSvr | |
UdpSetting | |
TcpRecvHttpBufferFormSvr | |
UPNP_CheckMapPortFunc | |
UPNP_AddMapPortInfoHttpFunc | |
UPNP_DeleteMapPortFunc | |
UPNP_MsearchHttpFunc | |
UPNP_Start | |
UPNP_Destroy | |
UPNP_Create | |
<?xml version="1.0"?><s:Envelope xmlns:s="http://schemas.xmlsoap.org/soap/envelope/"s:encodingStyle="http://schemas.xmlsoap.org/soap/encoding/"><s:Body><u:GetExternalIPAddress xmlns:u="%s"></u:GetExternalIPAddress></s:Body></s:Envelope> | |
POST %s HTTP/1.1 | |
HOST: %s:%d | |
User-Agent: UPnP, MiniUPnPc | |
Content-Type: text/xml | |
Content-Length: %d | |
SOAPAction: "%s#GetExternalIPAddress" | |
<?xml version="1.0"?><s:Envelope xmlns:s="http://schemas.xmlsoap.org/soap/envelope/"s:encodingStyle="http://schemas.xmlsoap.org/soap/encoding/"><s:Body><u:GetSpecificPortMappingEntry xmlns:u="%s"><NewRemoteHost></NewRemoteHost><NewExternalPort>%s</NewExternalPort><NewProtocol>%s</NewProtocol></u:GetSpecificPortMappingEntry></s:Body></s:Envelope> | |
POST %s HTTP/1.1 | |
HOST: %s:%d | |
User-Agent: UPnP, MiniUPnPc | |
Content-Type: text/xml | |
Content-Length: %d | |
SOAPAction: "%s#GetSpecificPortMappingEntry" | |
<?xml version="1.0"?><s:Envelope xmlns:s="http://schemas.xmlsoap.org/soap/envelope/"s:encodingStyle="http://schemas.xmlsoap.org/soap/encoding/"><s:Body><u:GetGenericPortMappingEntry xmlns:u="%s"><NewRemoteHost></NewRemoteHost><NewPortMappingIndex>%d</NewPortMappingIndex></u:GetGenericPortMappingEntry></s:Body></s:Envelope> | |
POST %s HTTP/1.1 | |
HOST: %s:%d | |
User-Agent: UPnP, MiniUPnPc | |
Content-Type: text/xml | |
Content-Length: %d | |
SOAPAction: "%s#GetGenericPortMappingEntry" | |
<?xml version="1.0"?><s:Envelope xmlns:s="http://schemas.xmlsoap.org/soap/envelope/"s:encodingStyle="http://schemas.xmlsoap.org/soap/encoding/"><s:Body><u:DeletePortMapping xmlns:u="%s"><NewRemoteHost></NewRemoteHost><NewExternalPort>%s</NewExternalPort><NewProtocol>%s</NewProtocol></u:DeletePortMapping></s:Body></s:Envelope> | |
POST %s HTTP/1.1 | |
HOST: %s:%d | |
User-Agent: UPnP, MiniUPnPc | |
Content-Type: text/xml | |
Content-Length: %d | |
SOAPAction: "%s#DeletePortMapping" | |
<?xml version="1.0"?><s:Envelope xmlns:s="http://schemas.xmlsoap.org/soap/envelope/"s:encodingStyle="http://schemas.xmlsoap.org/soap/encoding/"><s:Body><u:AddPortMapping xmlns:u="%s"><NewRemoteHost></NewRemoteHost><NewExternalPort>%s</NewExternalPort><NewProtocol>%s</NewProtocol><NewInternalPort>%s</NewInternalPort><NewInternalClient>%s</NewInternalClient><NewEnabled>1</NewEnabled><NewPortMappingDescription>%s</NewPortMappingDescription><NewLeaseDuration>%s</NewLeaseDuration></u:AddPortMapping></s:Body></s:Envelope> | |
POST %s HTTP/1.1 | |
HOST: %s:%d | |
User-Agent: UPnP, MiniUPnPc | |
Content-Type: text/xml | |
Content-Length: %d | |
SOAPAction: "%s#AddPortMapping" | |
GET %s HTTP/1.1 | |
HOST: %s:%d | |
User-Agent: UPnP, MiniUPnPc | |
M-SEARCH * HTTP/1.1 | |
HOST:%s:%d | |
MAN:"ssdp:discover" | |
MX:2 | |
ST:urn:schemas-upnp-org:device:InternetGatewayDevice:1 | |
200 OK | |
NewRemoteHost | |
NewExternalPort | |
NewProtocol | |
NewInternalClient | |
NewInternalPort | |
NewEnabled | |
NewPortMappingDescription | |
NewLeaseDuration | |
200 OK | |
NewExternalIPAddress | |
(!url) | |
(!p1) | |
(!p3) | |
239.255.255.250 | |
location | |
GLNK-%s | |
%s:%d: Create error! | |
NewPortListing | |
CreateCircleHandlePthread | |
CircleHandlePthread | |
gtdiscovery_create | |
gtdiscovery_start | |
thread creation error! | |
0000000000SZLANGTAO01a8bc76f15b | |
gtdiscovery socket creation failure! | |
gtdiscovery bind error value :%d | |
gtdiscovery convert locaddr address error! %s | |
code=%d, description=%s | |
set multicast i/f error! | |
code=%d, description=%s | |
235.10.10.10 | |
invalid multicast address! | |
add multicast group member error! | |
socket error | |
set socket error... | |
send error.... | |
out of loop! | |
sendstream | |
sendworker | |
patrolworker | |
getempytpacket | |
SCTDiscreteSend | |
SCTSend | |
pl_puttoport | |
recvworker | |
%s:%s:%llu | |
%s:%d: memery alloc error! | |
%s:%d: %s:%d alloc memery error! | |
%s:%d: alloc fail! | |
%s:%d: alloc memery fail! | |
UpLoad_Alarm_Stream_Config | |
EndToUpLoadStream | |
UploadStream_GetSvrIPAddr | |
UploadStream_ConnectionSvr | |
UploadFile_ConnectSvr | |
Upload_SendAudioStreamData | |
Upload_SendVideoStreamData | |
Upload_UpLoadStreamData | |
SendFilenameToServer | |
UploadStream_MkFile | |
UploadFile_MkFile | |
UploadStream_Bput | |
UploadFile_Bput | |
UploadStream_MkBlk | |
UploadFile_MkBlk | |
Upload_UpLoadFileData | |
UpLoadFileFinish | |
UpLoad_Destroy | |
Upload_RecvSrvReply | |
UploadFile_RecvSrvReply | |
GetUpLoadTokenFromSrv | |
UpLoad_StreamProcess | |
UpLoadFile_Process | |
%s:%d: %s ENABLE | |
%s:%d: %s DISABLE | |
POST /mkfile/%d/key/%s HTTP/1.1 | |
Host: %s | |
Content-Type:text/plain | |
Content-Length: %d | |
Accept: */* | |
Authorization: UpToken %s | |
upload.qiniu.com | |
POST /bput/%s/%d HTTP/1.1 | |
Host: %s | |
Content-Type: application/octet-stream | |
Content-Length: %d | |
Accept: */* | |
Authorization: UpToken %s | |
POST /mkblk/%d HTTP/1.1 | |
Host: %s | |
Content-Type: application/octet-stream | |
Content-Length: %d | |
Accept: */* | |
Authorization: UpToken %s | |
"ctx":" | |
","checksum" | |
218.19.130.196 | |
%s-%d-0-%s-%s.h264 | |
%s-1-%s-%s | |
DevID_Reg | |
LTGoolink20 | |
%s|%s | |
GET /g_regdev.php?c=%s HTTP/1.0 | |
Accept: */* | |
User-Agent: Mozilla/4.0 | |
Content-Length: %d | |
Content-Type: application/x-www-form-urlencoded | |
Host: %s | |
cloud.goolink.org | |
ThrMold_Option | |
Create thread error!%s:%d Error %s | |
%s:%d: Create thread error! | |
urlsafe_b64_decode_ | |
?456789:;<= | |
!"#$%&'()*+,-./0123 | |
urlsafe_b64_encode_ | |
ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789-_ | |
urlsafe_b64_encode2 | |
GTBase/urlsafe_b64.c | |
URLBase | |
presentationURL | |
serviceType | |
controlURL | |
eventSubURL | |
SCPDURL | |
service | |
urn:schemas-upnp-org:service:WANCommonInterfaceConfig:1 | |
urn:schemas-upnp-org:service:WANIPv6FirewallControl:1 | |
urn:schemas-upnp-org:service:WANIPConnection:1 | |
urn:schemas-upnp-org:service:WANPPPConnection:1 | |
<![CDATA[ | |
MT_StopMulticastStreaming | |
MT_StartMulticastStreaming | |
HI_MT_StartSvr | |
HI_MT_Init | |
%s %d, The rtsp server has not inited. | |
the MT have stop the rtsp server.repeate | |
<MT>Stop MediaTrans.rtsp_streamsvr Successed. | |
<MT>Stop MediaTrans.rtsp_streamsvr Failed: %#x. | |
<MT>Deinit rtspOhttp Successed. | |
<MT>Deinit rtspOhttp Failed: %#x. | |
the MT have deinit.repeate | |
<MT>MediaTrans deinit. | |
the MT haven't init,please first init the mt. | |
the MT have start the rtsp server.repeate | |
%s: g_pMTConfig->rtspsvr.listen_port=%d! | |
Start MediaTrans.rtsp_streamsvr Successed. | |
Start MediaTrans.rtsp_streamsvr Failed: %#x. | |
the MT have start the rtspOhttp server.repeate | |
RtspOhttp init Successeful!. | |
rtsp | |
RtspOhttp init Failed: %#x. | |
libmt version: %s | |
v0.4build20090319-1732 | |
<MT>init error. invalid args | |
HI_MT_Init have init,init is repeate . | |
HI_MT_Init failed the param invalid the chn cnt is :%d . | |
HI_MT_Init failed the mbuf %d 's chnid is the same as %d cnt:%d. | |
Start HI_VOD_Init.vod Successed. | |
Start MediaTrans.vod Failed:%#x. | |
MTRANS_FindFrame_TCP | |
MTRANS_Check_Redirect | |
MTRANS_StartMulticastSendTask | |
MTRANS_playback_seek | |
MTRANS_StartMulticastStreaming | |
MTRANS_SendJpegDataInRtpFUA | |
MTRANS_SendDataInRtpFUA | |
HI_MTRANS_GetBaseTimeStamp | |
multicast_send_thread | |
MTRANS_SendJpegDataInRtpFUA_TCP | |
MTRANS_SendDataInRtpFUA_TCP | |
MTRANS_playback_send | |
OnProcItlvTrans | |
%s-%d:u8NALType = 0x%02x! | |
udp mtrans task %p for cli %s withdrawfor invalid data type %d from mbuff | |
the video formate is :%d | |
the audio formate is :%d | |
fun:%s line:%d, select error,err:%s(%d) | |
fun:%s line:%d, recvfrom failed,err:%s(%d) | |
fun:%s,redirect video to ip:%s | |
fun:%s,redirect video to port:%d | |
fun:%s,redirect audio to ip:%s | |
fun:%s,redirect audio to port:%d | |
%s %d, Multicast task had been started. | |
MTRANS Init failed: already deinited. | |
Hi_mtrans Module Build:%s %s | |
Nov 3 2015 | |
18:21:22 | |
MTRANS Init failed: illegal task num %d. | |
MTRANS Init failed: illegal udp prot %d-%d. | |
MTRANS Init failed: illegal pack len %d. | |
MTRANS Init:conn num=%d minport-maxport=%d-%d,pack len=%d. | |
MTRANS Init failed: already inited. | |
%s, BufAbstract_Playback_Seek failed! | |
stop task with illegale task handel %p. | |
stop trans task failed %X. | |
MTRANS udp start:%d sendport %d,send sock %d,cli ip %s ---- rtcport:%d | |
MTRANS udp start:cli ip %s ---- cli port:%d | |
error:get socket from port%d. | |
%s %d, Create send task failed! | |
%s %d, HI_BufAbstract_GetMediaInfo error! | |
%s %d, malloc memory failed!err:%s(%d) | |
%s %d, HI_BufAbstract_Alloc failed! | |
%s %d, MTRANS_TaskStartMulticast error! | |
<mtrans> the packlangtao malloc pack buffer | |
<mtrans> the fua malloc pack buffer | |
error:calloc pack buff for task handel %p. | |
start trans task failed %X. | |
send media data error 1: %s | |
send media data error: write fd not in fd set | |
send media data error: send over time 10s | |
send media data error 2: %s | |
%s,%d RTP video send error | |
src/mtrans/hi_mtrans.c | |
[%s-%d].RTP video send error | |
RTP video send error | |
%s(%d) this package is not have OneFrame=%d | |
%s(%d) MTRANS_FindFrame error!u32FrameLen=%d | |
3.RTP video send error | |
RTP FU Head pack error %X | |
6.RTP video send error | |
not allowed to get basepts before start mtrans task. | |
%s(%d) get base stamp:MBUF_Read read no data | |
not key video | |
video come,orig pts =%llu | |
video come,pro pts =%llu | |
get base stamp:MTRANS_GetPacketAndSendParam error %X | |
get base time ok, now withdraw | |
RtpMcast%d_%d | |
%s %d, start multicast task.Port:%lu | |
%s %d, Multicast task is not ready to work! | |
%s %d, HI_BufAbstract_Read failed. | |
DEBUG %s,%d go end | |
DEBUG %s,%d fua go end | |
%s %d, Multicast thread exit. | |
1.RTP video send error | |
2.RTP video send error | |
%s(%d) this package is not have OneFrame | |
4.RTP video send error | |
7.RTP video send error | |
%s, Unsupport enPackType:%d | |
DEBUG %s,%d OnProcItlvTrans step4.2 return | |
%s,%d port_isfree =0 port=%d or %d is used | |
min %d ---max %d ,cur = %d v1 | |
can't add or change media's param when there is a playing meidia. | |
239.1.2.3 | |
mtrans task init the media:%d | |
mtrans task init udp the media:%d | |
not support trans mode %d. | |
have the mtrans task | |
before_trans_audio.h264 | |
web/before_trans_video.h264 | |
after_trans_audio.h264 | |
web/after_trans_video.h264 | |
StreamBeforeTrans : open file error | |
StreamBeforeTrans : write file error: toLen:%u, aucLen:%d | |
can't creat new task:over preset max num | |
destroy task with illegale task handel %p. | |
SR_received:%d, pkt_count:%d, octet_count:%d, ssrc=0x%X, %lld, %lld, %lld, %d, %d, %d, %d, %d, %d, %d, %d, %d | |
----> packet_len:%d | |
SDES item type CNAME | |
SDES item type NAME | |
SDES item type EMAIL | |
SDES item type PHONE | |
SDES item type LOC | |
SDES item type TOOL | |
SDES item type NOTE | |
SDES item type PRIV | |
----> len:%d, len1:%d, len2:%d, len3:%d | |
RTCP Decode SR packet received | |
RTCP Decode RR packet received | |
RTCP Decode SDES packet received, len:%d, item:%d | |
RTCP BYE packet received | |
RTCP APP packet received | |
Unknown RTCP received and ignored. | |
HI_RTP_FU_PackageHeader erro : pHeader=%X pMessage=%X | |
HI_RTP_FU_PackageHeader erro : start=%d end=%d | |
this package is not have NALU | |
RTSP_Handle_Setup | |
RTSP_Handle_Discrible | |
RTSP_Handle_Play | |
%s:just RTSP msg. | |
%s:ready to send,but not trans data in RTSP thread. | |
creat session for a new connect error=%d. | |
copy first msg to session buff error=%d. | |
Start RTSP session process thread error. cann't create thread. | |
RTSP LiveSvr DeInit Failed:already deinited. | |
RTSP Listen svr deInit error=%X | |
RTSP Live DeInit ok ... | |
rtsp_keep_alive | |
get flag:%d | |
open file error | |
RTSP LiveSvr Init Failed . | |
RTSP LiveSvr Init Failed (Session Init Error=%d). | |
RTSP Listen svr Init error=%d,instread, user can connet through web server listen svr. | |
RTSP Live svr Init ok. | |
bandwidth | |
%d %d | |
get Bandwidth, all:%d, v:%d | |
DEBUG %s,%d parseRangeParam start | |
src/sess_rtsp/hi_msession_rtsp.c | |
npt = %lf - %lf | |
npt = %n%lf - | |
npt = now - %lf | |
npt = now -%n | |
clock = %n | |
%[^-]-%s | |
smtpe = %n | |
DEBUG %s,%d parseRangeParam end | |
Range: | |
DEBUG %s,%d parseRangeHeader | |
Transport | |
%10s %255s | |
Transport formed unstandard | |
%255s,%255s | |
RTP/AVP/TCP | |
interleaved=%d-%d | |
RTP/AVP | |
multicast | |
client_port | |
port=%d-%d | |
client_port=%d-%d | |
--------udp port pase error ---------- | |
%s %d %s | |
RTSP/1.0 | |
CSeq: %d | |
Server: %s | |
WWW-Authenticate: Basic realm="." | |
Date: %s GMT | |
WWW-Authenticate: Digest realm="LIVE555 Streaming Media", nonce="70b16a51eb135f69c972231f4dbeff5e" | |
%*s %254s | |
<RTSP>HI_VOD_GetVersion failed:%x | |
<RTSP>RTSP_Get_SessId failed:%x | |
Session: %s | |
RTSP_Handle_RequestIFrame--Enter! | |
Recive C --> S >>>>>> | |
<<<<<< | |
RTSP_Handle_RequestIFrame--Exit! | |
s32Ret=%d,aszSessID=%s,pSess->aszSessID=%s! | |
<RTSP> Handle Teardown aszSessID:%s | |
invalid cseq no. | |
Date: %sGMT | |
nothing to pause (client %s) | |
Public: OPTIONS, DESCRIBE, SETUP, TEARDOWN, PLAY,SET_PARAMETER, GET_PARAMETER | |
Cseq: %d | |
Require: Transport settings of rtp/udp;client_port=nnnn. | |
Require: Transport settings of rtp/udp;port=nnnn. | |
%10s%255s | |
DEBUG %s %d send 400 | |
destination= | |
destination=%[^; | |
trackID | |
DEBUG %s,%d not trackID url=%s | |
%8s%d | |
rtsp setup: chn %d traID %d pSess:%d 0:%d 1:%d | |
%s,file name:%s,trackid:%d | |
setup video request repeat (client %s) | |
setup the url is :%s | |
setup audio request repeat (client %s) | |
#### %s %d, pSess->bIsPlayback=%d | |
sprintf au8MediaFile = %s | |
vod setup failed %X(client %s) | |
the ssrc is :%d %08x | |
Session | |
rtsp handle setup two time | |
vod setup failed %X:illegal user %s(%s %s) | |
vod setup failed %X:over max usernumber for cli %s | |
vod setup failed %X for %s | |
fun:%s,map addr failed! | |
Session: %s | |
client_port=%d-%d;server_port=%d-%d | |
client_port=%d;server_port=%d | |
Transport: RTP/AVP;unicast;mode=play;source=%s;%s;destination=%s;ssrc=%08x | |
Transport: RTP/AVP;unicast;mode=play;source=%s;%s;ssrc=%08x | |
Transport: RTP/AVP/TCP;unicast;interleaved=%d-%d;ssrc=%08x;mode="play" | |
Date: Wed, Dec 17 2014 16:44:21 GMT | |
Transport: RTP/AVP/TCP;unicast;mode=play;source=%s;interleaved=%d-%d;ssrc=%08x | |
Client want to setup.but trackid %d is wrong. | |
Transport: RTP/AVP;multicast;mode=play;client_port=%d-%d;destination=239.1.2.3;server_port=%d-%d | |
invalid url: %s | |
Accept | |
application/sdp | |
Only accept require. | |
date= | |
error user-agent: %d | |
%s,%d RTSP Authorization type=%d | |
#### %s %d, server:%s,filename:%s | |
Un Authorization: %s | |
invalid Authorization: %s | |
vod describe failed %X(client %s) | |
Content-Type: application/sdp | |
AdditionalHead: %s | |
<RTSP> DISCRIBLE the band all:%d video :%d audio:%d | |
o=- 1418744474352605 1418744474352605 IN IP4 %s | |
s=Media Presentation | |
e=NONE | |
b=AS:5100 | |
i=mpeg4 | |
t=0 0 | |
a=tool:LIVE555 Streaming Media v2009.09.28 | |
a=type:broadcast | |
a=control:* | |
a=range:npt=0- | |
a=x-qt-text-nam:RTSP/RTP stream from Network Video Server | |
a=x-qt-text-inf:mpeg4 | |
c=IN IP4 239.1.2.3/127 | |
c=IN IP4 0.0.0.0 | |
a=range:npt=now- | |
m=video 0 RTP/AVP 26 | |
m=video 0 RTP/AVP 96 | |
b=AS:%d | |
a=control:trackID=%d | |
a=rtpmap:26 JPEG/90000 | |
a=rtpmap:96 H265/90000 | |
a=x-dimensions: %d, %d | |
a=rtpmap:96 H264/90000 | |
a=fmtp:96 profile-level-id=%s; packetization-mode=1; sprop-parameter-sets=%s | |
a=framesize:96 %d-%d | |
a=x-framerate: %d | |
m=audio 0 RTP/AVP 8 | |
b=AS:50 | |
a=rtpmap:8 PCMA/8000 | |
a=Media_header:MEDIAINFO=494D4B48010100000400050000000000000000000000000000000000000000000000000000000000; | |
a=Media_header:MEDIAINFO=494D4B48010100000400010000000000000000000000000000000000000000000000000000000000; | |
a=appversion:1.0 | |
Content-Length: %d | |
#### %s %d, pTemp2:%s | |
RTSP response Send error:%X | |
RTSP response Send error:fd not in fd_set | |
RTSP response Send error: select overtime %d.%ds | |
distribute link to RTSP svr failed:RTSP svr not start yet. | |
4.Method requested was invalid. Message discarded.Method = %s | |
RTSP server not accept a RTSP response now.Message discarded.Method = %s | |
RTSP server not accept a RTSP response now.Message discarded Method = %s | |
Cache-Control: no-cache | |
Server: Hisilicon Ipcam | |
request message for live is not a desired RTSP format, and send its response %d bytethought sock %d failed | |
<RTSP> have not recv the msg response ,the conn is disconnected | |
%s %s %s | |
GET_PARAMETER | |
Cseq: %d | |
S --> C :%s | |
to send RTSP pause response %d byte to cli %s thought sock %d failed | |
to send RTSP pause response %d byte thought sock %d failed | |
to send RTSP response %d byte to cli %s thought sock %d failed | |
nothing to play (client %s) | |
HI_VOD_Resume failed :%x | |
HI_VOD_Play failed :%x | |
fun:%s,MTRANS_Check_Redirect error! | |
Range: npt=%lf- | |
%s, seek to time:%lfS | |
%s, MTRANS_playback_seek failed! | |
RTP-Info:url=%s;seq=%lu;rtptime=%lu | |
User-Agent:NKPlayer-1.00.00.081112 | |
RTP-Info:url=%s;seq=%lu;rtptime=%lu | |
RTSPMethodProcess process error =%X | |
RtspSesProc | |
the RTSP session is null in RTSPSessionProc | |
first msg come! SessID=%s! | |
client teardown %s disconnected the session | |
client %s disconnected (%d client alive):[RTSP process: %X] | |
[Info]client %s connected (%d client alive) !!! | |
[Info]RTSP live process thread %d start ok, communite with cli %s.... | |
9.Aobaozi----Exit RTSPSessionProc ! | |
client %s disconnected (%d client alive):[not complete RTSP session,select: overtime %d.%ds)] | |
8.Aobaozi----Exit RTSPSessionProc ! | |
client %s disconnected (%d client alive):[RTSP msg read from socket: %s] | |
7.Aobaozi----Exit RTSPSessionProc ! | |
client %s disconnected (%d client alive):[peer closed]. | |
6.Aobaozi----Exit RTSPSessionProc ! | |
5.Aobaozi----Exit RTSPSessionProc ! | |
client %s disconnected (%d client alive):[RTSP process: %X] | |
4.Aobaozi----Exit RTSPSessionProc ! | |
client %s disconnected (%d client alive):[something wrong in network ] | |
3.Aobaozi----Exit RTSPSessionProc ! | |
client %s disconnected (%d client alive):[send media data error %X] | |
A.Aobaozi----Exit RTSPSessionProc ! | |
2.Aobaozi----Exit RTSPSessionProc ! | |
11.Aobaozi----Exit RTSPSessionProc ! | |
RTSP_SEND_GetParameter send failed :%x the client:%s is disconnected | |
client %s disconnected (%d client alive):[some operation happened,such as root, set video size ... ] | |
1.Aobaozi----Exit RTSPSessionProc ! | |
handleHKvsRtsp | |
RTSP_Parse_Url | |
RTSP_GetUserName | |
CSeq:%d | |
User-Agent | |
%*s %[^ | |
%*[^:]:%[^ | |
pParseTmp =%s sscanf failed | |
#### %s:%d, input url %s | |
H261 | |
H263 | |
MJPEG | |
PCMA | |
PCMU | |
G726 | |
rtsp:// | |
mcast | |
playback/ | |
playback == true | |
/av%d_%d | |
trackID= | |
%d%d/trackID=%d | |
%d%d | |
hashtoken= | |
channelno= | |
streamtype= | |
cast/ | |
mpeg4 | |
mpeg4cif | |
ROH/channel/ | |
H264MainStream | |
H264SubStream | |
DESCRIBE | |
#### %s %d, pRTSPRecvBuff:%s | |
Authorization | |
#### %s %d, pTemp:%s | |
Authorization: Basic | |
Authorization:Basic | |
Basic %s | |
%[^:]:%s | |
%s(%d): DMS_NET_GET_PICCFG failure! | |
DEBUG %s %d csusername=%s,pwd=%s, usersend %s,%s | |
src/sess_rtsp/hi_rtsp_parse.c | |
ipcam | |
w54723 | |
%s,%d Digest check...... | |
username=" | |
%s,%d find username failed | |
username="%s" | |
realm=" | |
%s,%d find realm failed | |
realm="%s" | |
nonce=" | |
%s,%d find nonce failed | |
nonce="%s" | |
uri=" | |
%s,%d find uri failed | |
uri="%s" | |
response=" | |
%s,%d find response failed | |
response="%s" | |
DESCRIBE:%s | |
%s:LIVE555 Streaming Media:%s | |
%s:70b16a51eb135f69c972231f4dbeff5e:%s | |
#### %s %d, pUsername:%s, pPassword:%s | |
SETUP | |
SETUP:%s | |
PLAY | |
PLAY:%s | |
%31s %d %255s | |
RTSP/ | |
%[^ ] | |
Parse URL Failed!Read Method Fail. | |
TEARDOWN | |
OPTIONS | |
PAUSE | |
SET_PARAMETER | |
CMD:INSERTIFRAME | |
HEARTBEAT | |
Continue | |
Non-Authoritative Information | |
No Content | |
Reset Content | |
Partial Content | |
Multiple Choices | |
Moved Permanently | |
Moved Temporarily | |
Unauthorized | |
Payment Required | |
Forbidden | |
Not Acceptable | |
Proxy Authentication Required | |
Request Time-out | |
Conflict | |
Gone | |
Length Required | |
Precondition Failed | |
Request Entity Too Large | |
Request-URI Too Large | |
Unsupported Media Type | |
Over Supported connection | |
Bad Extension | |
Invalid Parameter | |
Parameter Not Understood | |
Conference Not Found | |
Not Enough Bandwidth | |
Session Not Found | |
Method Not Valid In This State | |
Header Field Not Valid for Resource | |
Invalid Range | |
Parameter Is Read-Only | |
Not Implemented | |
Bad Gateway | |
Service Unavailable | |
Gateway Time-out | |
RTSP Version Not Supported | |
Extended Error: | |
Invalid Method | |
HI_RTSP_SessionCreat | |
RTSP msg too long %d byte: over %d byte. | |
msg: %s. | |
%s %d, calloc failed!err:%s(%d) | |
<RTSP>Close the session socket :%d | |
HI_RTSP_O_HTTP_PostMsgProc | |
RTSP_O_HTTP_Handle_Options | |
RTSP_O_HTTP_Handle_Describle | |
HI_RTSP_O_HTTP_CreatHttpLiveSession | |
HI_RTSP_O_HTTP_DistribLink | |
RTSP_O_HTTP_CMD_Proc | |
RTSP_O_HTTPSessionProc | |
x-sessioncookie: | |
x-sessioncookie: %s | |
x-rtsp-tunnelled | |
RTSP_O_HTTP LiveSvr DeInit Failed:already deinited. | |
rtsp_o_http Live DeInit ok ... | |
RTSP_O_HTTP LiveSvr Init Failed . | |
RTSP_O_HTTP LiveSvr Init Failed (Session Init Error=%d). | |
rtsp_o_http Live svr Init ok. | |
%s ----------post---------- | |
--------------------------- | |
%s %d, Invalid rtsp over http request msg!s32Ret:%d | |
%s %d, can't find the session which have a same cookie:%s | |
Start rtsp_o_http session process thread error. cann't create thread. | |
%s RTSP_O_HTTP_Get_CSeq failed! | |
RTSP/1.0 200 OK | |
Public: OPTIONS, DESCRIBE, SETUP, TEARDOWN, PLAY, SET_PARAMETER | |
%s %255s %31s | |
the method %s not support | |
the method is :%s %d | |
HTTP/1.1 | |
Connection: Keep-Alive | |
the session is null in play | |
%*s %254s | |
Range: %s | |
vod play failed %X(client %s) | |
vod play call after | |
Range: npt=now- | |
RTP-Info: url=%s/trackID=0;seq=0;rtptime=0 | |
the play session media type is:%d | |
,url=%s/trackID=1;seq=0;rtptime=%u | |
trackID=%d | |
RTSP_O_HTTP_Handle_Setup tackId;%d | |
the setup media type is :%d | |
interleaved= | |
interleaved=%u-%u | |
the vod setup call after | |
Session:: %s | |
Transport: RTP/AVP/TCP;unicast;interleaved=%u-%u;ssrc=%x | |
DEBUG %s,%d 400 err | |
src/sess_rtsp_over_http/hi_msession_rtsp_o_http.c | |
the pSess is null | |
%s, RTSP_O_HTTP_GetFileName error! | |
o=StreamingServer 3441443066 1110182530000 IN IP4 %s | |
e=NONE | |
Content-length: %d | |
rtsp_o_http response Send error:%X | |
rtsp_o_http response Send error:fd not in fd_set | |
rtsp_o_http response Send error: select overtime %d.%ds | |
--------get,fd=%d------- | |
------------------ | |
HTTP/1.0 200 OK | |
Content-Type: application/x-rtsp-tunnelled | |
%s %d, Send response msg failed!err: | |
the http msg is null | |
%s, Rtsp_o_http service already stoped! | |
rtsp_o_http distribute link start | |
rtsp_o_http distribute link is resp | |
rtsp_o_http distribute link start HI_RTSP_O_HTTP_CreatHttpLiveSession | |
%s, HI_RTSP_O_HTTP_CreatHttpLiveSession error! | |
rtsp_o_http distribute link start HI_RTSP_O_HTTP_PostMsgProc | |
%s %d, the method %d is not supported. | |
to send rtsp_o_http pause response %d byte thought sock %d failed | |
HI_VOD_Pause failed:%x | |
Content-Type: application/octet-stream | |
to send rtsp_o_http replay response %d byte thought sock %d failed | |
strlen(au8RecvBuff) = 0 | |
s32declen = 0 | |
the decode recv msg is :%s | |
the discribe method | |
the setup method | |
the play method | |
the pause method | |
the teardown method | |
the options method | |
%s, unsupport method %d ret=%d | |
%s, HI_RTSP_O_HTTP_Send failed :%x | |
to send rtsp_o_http response %d byte to cli %s thought sock %d failed | |
[Info]rtsp_o_http client %s connected (%d client alive) !!! | |
%s(%d),Process First message failed!ret:%x | |
rtsp_o_http client %s disconnected (%d client alive):[select: %s] | |
%s %d, recv failed!err:%s(%d) | |
%s %d, peer close!err:%s(%d) | |
the cmd session is closed ret:%x | |
:/ | |
%*s %d | |
action= | |
%*[^=]=%32[^&] | |
play | |
pause | |
replay | |
media= | |
HTTP/ | |
x-sessioncookie | |
the session cookie is :%s | |
%s %255s %31s | |
the method is :%s ver:%s | |
HTTP/1.0 | |
not support protocl | |
not support mehod in get | |
HTTP Version Not Supported | |
<httplive>find relate , sessiontag: %s., pFinded:%#x | |
rtsp_o_http session list init:max supported connect num %d illegale. | |
max supported connect num %d illegale. | |
can't creat session:over preset rtsp_o_http session num | |
rtsp_o_http msg too long %d byte: over %d byte. | |
msg: %s. | |
HI_VOD_SetUp | |
VOD play Failed: vod svr already deinited . | |
VOD get base pts Failed for cli (can't find session :protocal %d, session id %s | |
VOD get base pts Failed for cli (user has no right to play :protocal %d, session id %s | |
VOD call Mtrans get base time :VOD id %s hdl %X,trans hdl %X | |
VOD get base pts Failed for cli (get pts from mtrans err %X :protocal %d, session id %s | |
vod get base time finish | |
HI_VOD_Teardown--enSessType=%d,aszSessID:%s! | |
VOD teardown Failed for cli (can't find session :protocal %d, session id %s | |
VOD teardown Failed for cli (get mtrans handle from vod session failed %X | |
VOD teardown Failed for cli (can't destroy mtrans task %X | |
<VOD> vod hand teardown destroySendTask ret:%x | |
VOD teardown Failed for cli (get mbuff handle from session failed %X | |
VOD teardown Failed for cli (mbuff free fail %X | |
<VOD> vod hand teardown free mbuf ret:%x | |
VOD teardown Failed for cli (vod session destroy fail %X | |
<VOD> vod hand teardown HI_VOD_SessionDestroy ret:%x | |
VOD resume Failed: vod svr already deinited . | |
VOD resume Failed for cli (can't find session :protocal %d, session id %s | |
VOD resume Failed for cli (request media %d is not in ready state | |
VOD resume Failed for cli (get mtrans handle from session failed %X | |
VOD resume Failed for cli (can't resume mtrans task %X | |
VOD pause Failed: vod svr already deinited . | |
VOD pause Failed for cli (can't find session :protocal %d, session id %s | |
VOD pause Failed for cli (user has no right to pause :protocal %d, session id %s | |
VOD pause Failed for cli (request media %d is not in play state | |
VOD pause Failed for cli (get mbuff handle from session failed %X | |
VOD pause Failed for cli (get mtrans handle from session failed %X | |
VOD pause Failed for cli (can't pause mtrans task %X | |
[VOD]asd vod of vschn %d | |
vod play proc start | |
VOD play Failed for cli (can't find session :protocal %d, session id %s | |
VOD play Failed for cli (user has no right to play :protocal %d, session id %s | |
VOD play Failed for cli (request media %d is not in ready state | |
VOD play Failed for cli (get mtrans handle from session failed %X | |
start send task befor | |
start send task after | |
VOD play Failed for cli (can't start mtrans task %X | |
VOD play Failed for cli (get mbuff handle from session failed %X | |
+++++++++++play handle:%d: MBUF_Register video_enable= %d,audio_enable=%d, data_enable = %d | |
HiIpcam/V100R003 VodServer/1.0.0 | |
VOD describe Failed : get chn %d info err %X | |
VOD deInit Failed: already deinited. | |
VOD Init Failed: already inited. | |
VOD Init Failed (chn num error=%d). | |
s32ValidChnNum:%d,u32TotalUserNum=%d! | |
VOD Init Failed (Session Init Error=%d). | |
VOD Init Failed (malloc for muff info Error). | |
num:%d i:%d Mbuf Init cfg chnid %d , max connect num %d, bufsize %d | |
VOD Init Failed (MBUF Init Error=%d). | |
VOD setup Failed: vod svr already deinited . | |
VOD setup Failed : unAuthorization for user/pwd (%s/%s)error. | |
set up have aszSessID len is:%d! | |
set up have before | |
the vod session create after failure! | |
the vod session init after | |
HI_VOD_SessionDestroy cli (vod session destroy fail %X | |
vod setup handle have | |
there is no effective one in client supported transition list. | |
we not support tcp mode now | |
we not support udp interleaved mode now | |
not unrecognized trans mode %d | |
VOD setup Failed for cli %s (creat trans task Error=%X). | |
%s %d, #########,%d | |
VOD setup Failed for cli (MBUF alloc Error=%d). | |
we not support tcp interleaved mode now | |
HI_VOD_SessionCreat | |
HI_VOD_SessionFind--enSessType=%d,pas8SessID=%s,pTempSession->aszSessID=%s! | |
Num:%d sessId:%s | |
Video state:%d Audio state:%d MDAlarm state:%d | |
loseFramNum:%llu | |
ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/ | |
?456789:;<= | |
!"#$%&'()*+,-./0123 | |
ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/ | |
0123456789abcdef | |
HI_BufAbstract_Deinit | |
HI_BufAbstract_Init | |
HI_BufAbstract_Alloc | |
HI_BufAbstract_Free | |
HI_BufAbstract_Read | |
HI_BufAbstract_GetMediaInfo | |
BufAbstract_Playback_Alloc | |
BufAbstract_Playback_GetMediaInfo | |
BufAbstract_ParseDate | |
BufAbstract_ParseTime | |
BufAbstract_PlaybackByTime_GetMediaInfo | |
BufAbstract_Playback_GetAudioEnable | |
BufAbstract_Playback_Seek | |
%s:%s(%d)-LIVE_MODE_1CHN1USER-success | |
src/hi_buf_abstract/hi_buffer_abstract.c | |
not support the mode:%d | |
init the mbuf success | |
invalid live mode | |
%s:%s(%d)-LIVE_MODE_1CHN1USER-read audio frame success | |
[%s-%d]: dms_sysnetapi_MBUF_GetFrame failure! | |
%s(%d) Param s32Chn:%d, s32SrcChn:%d, s32Stream:%d | |
%s,%d s32SrcChn=%d | |
%s,%d stRecordPara width=%d, format=%d | |
%s,%d stNetPara with=%d,format=%d | |
%s,%d stPhonePara with=%d format=%d | |
%s(%d) Width:%u, Height:%u, Type:%d | |
%s(%d): DMS_NET_CMD_GET_SPSPPSBASE64ENCODE_DATA failure! | |
%s(%d): DMS_NET_CMD_GET_SPSPPSBASE64ENCODE_DATA error! | |
the chn:%d's spspps len;%d string :%s | |
profile_level_id :%s | |
%s,dms_sysnetapi_PlayBackByName failed! csFileName:%s | |
%s,dms_sysnetapi_PlayBackGetReadPtrPos failed! s32Ret:%d | |
%s, Got an Invalid frame! | |
%s, can't get sps and pps info! | |
%s, Invalid date!(%s) | |
%s, Invalid year:%d | |
%s, Invalid month:%d | |
%s, Invalid day:%d | |
%s, Invalid time format:%s | |
%s, Invalid hour:%d | |
%s, Invalid minute:%d | |
%s, Invalid second:%d | |
%s %d,Invalid date:%s | |
%s %d, Invalid request date!(%s) | |
time= | |
%s,Invalid time:%s | |
%s, Invalid request time!(%s) | |
chn= | |
%s, The request file dosn't exist! | |
/%[^/]/%[^/]/%[^/]/%d/%[^.] | |
%s, can not recognize file name:%s | |
%s %d,Invalid time:%s | |
%s, aaaaaaaaaaaaaaaaaa,start_offset:%d | |
%s,dms_sysnetapi_PlayBackGetInfo failed! csFileName:%s | |
%s ,seektime:%lf | |
Find I frame .... | |
%s,############################ get pos ERR | |
Find I frame success. | |
MT_SOCKET_Multicast_Open | |
MT_SOCKET_Udp_Open erro: | |
%s %d, setsockopt failed.err:%s(%d) | |
MT_SOCKET_Udp_Open bind erro: | |
malloc for lisn server error. | |
rtsp listen port: %d! | |
rtsp listen thread: select error=%s | |
[rtsp lisen thread] read data from socket error= %s. remoteip:%s | |
[rtsp lisen thread]peer close socket %d.remoteip: %s | |
rtsp lisn svr accept conn error=%s (cliIp:%s,cliPort:%d) | |
s32AccptCliSock=%d, local address:%s | |
s32Ret=%d, errno=%d | |
[Info]rtsp listen svr stoped: thread %d withdraw | |
connet cli number which rtspLisThd is processing over preset max number %d | |
StopRecord | |
GetRecordTime | |
fileWrite | |
fileOpen | |
AVRecordNext | |
RecordTask | |
StartRecord | |
AVRecordStart | |
bmodify is %d | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d FAILED !!!!! Wait Timeout nStat(%d) != REC_STATUS_IDLE | |
./src/RecordMng.c | |
No PlayFileInfo... | |
dwInLen %lu... | |
### play set pos(%lu/%lu) %02f. | |
### end of set pos %s.. | |
jbx_search_file_list_from_date_dir: opendir(%s) failed | |
%s/%s | |
JB_search_file_list_from_channel_dir_add: opendir(%s) failed | |
channel %d file %s is recording and skipped | |
### leave JB_search_file_list_from_date_dir_add %d,%d | |
count:%lu, type:%lu, status:%lu %lu/%lu [%s] | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d Reset file time[%04d%02d%02d%02d%02d%02d] | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d nLen:%lu | |
smb:// | |
Not vaild smb url! | |
spath0 is %s | |
make dir failed:%s | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d TFile Handle:0x%X Statu Invalid nFileStat:%d | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d open fd is:%d | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d fopen %s failed(%d):%s | |
/jb_config/jb_rootfs/dms_ioerror.log | |
error:%d:%d | |
Record failed. | |
USB/SD error count = %d, %d | |
USB/SD/FTP Write error | |
Error Msg %d | |
error:%d:%d | |
Disl error, wait need format disk..... | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d GetRecordAttr failed. | |
get nfs dir failed | |
%s/Record/%s/%d/%s.%s | |
%s/%d | |
%s/Record/%s/%s%s.%s | |
%s/%s/%s%s.%s | |
No record viedo.. | |
cInfo %dx%d, dwChannel=%lu, type:%lu, recordflag:%d, streamtype:%d,%d | |
Recreate MBuffer reader..... | |
NextRecord dms_sysnetapi_MBUF_AddReader failure:0x%08x! | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d Next Open file[%s] %d, failed. errno:%d | |
record[%s] | |
Next record %lu(nSec)blRet=%d,nTrigerType:0X%X, nRecordFlag:%d | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d sys time is %04d-%02d-%02d %02d:%02d:%02d | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d ### Next record failed. | |
########## stop by timeout(%d) %lu(%lu, %lu)..... | |
wait connect %d...%d, %d | |
end of wait connect...%d | |
stop record... | |
end of RecordTask .... | |
Record started type:%d..... | |
Recount record time %lu(min).... | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d Unknow recdInfo.nStorageType=%d | |
get sub dir failed | |
subdir is %s | |
%s/Record/%s/%s.%s | |
%s/%s/%s.%s | |
cInfo %dx%d, dwChannel=%lu, type:%lu, recordflag:%d, streamtype:%d | |
Open file[%s] %d, failed, errno:%d.nRet=%d | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d FileFormatNew error, type:%d.. | |
StartRecord dms_sysnetapi_MBUF_AddReader failure:0x%08x! | |
start record %lu(nSec)blRet=%d,nTrigerType:0X%X, nRecordFlag:%d | |
Check File storage Failed. | |
SaveSnapShot | |
NFS_SaveSnapShot | |
CheckSnapShot | |
%s/Capture/%s%d%02d%02d/%d/1_%02d_%02d_%02d_%u.jpg | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d Save Snapshot,filename=[%s] %d | |
./src/SnapMng.c | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d [%d] %s | |
%s/.index | |
open file failed! | |
1_%02d_%02d_%02d_%u.jpg | |
%s/Capture/%d-%02d-%02d/CH_%02d/%02d_%02d_%02d_%03d.jpg | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d make dir failed! | |
%s/Capture/%d-%02d-%02d/CH_%02lu/%s%02d_%02d_%02d_%03d.jpg | |
1_%d_%d_%d_%u.jpg | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d open file failed:%s | |
%s/capture/ | |
%s/capture/%04d%02d%02d/ | |
.index | |
FindSnapShotFile: opendir(%s) failed | |
### entry FindSnapShotFile (%s) | |
### entry FindSnapShotFileByChannel (%s) | |
AlrmAV_ | |
Sensor_ | |
CheckRecordInMonth | |
UpdateIndexFile | |
OnCreateIndexFiles | |
REC_FindFile | |
PlayBackByName | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d No udisk/sd card.... | |
./src/libplayback.c | |
%s/%s/%d | |
save index failed! | |
save index file name as:%s | |
%s;%u;%s | |
open file%s failed! | |
Write All line[%s]... | |
index.dat | |
00:00:00 | |
add index:%d file %s:%s | |
sdate is %s index date is %s | |
23:59:59 | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d ASF file start time:%s stop time:%s | |
%s/index.dat | |
### OnCreateIndexFiles... | |
OnCreateIndexFiles | |
Begin Create index file[%s]... | |
End of Create index file... | |
index file is :%s sfile is %s | |
%s/%02lu%02lu%02lu/index.dat | |
%d:%d:%d | |
check %d in %d to %d | |
REC_FindFileByTime: opendir(%s) failed | |
### find (%s)(%d) | |
##### Open [%s], channel:%d | |
%d%s | |
### search return nFileNum:%d | |
SearchFile resoult:%d | |
JB_search_file_list_add: opendir(%s) failed | |
### entry JB_search_file_list_add (%s) | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d | |
there are too many files to send | |
JB_search_file_list_add return nFileNum:%d | |
leave JB_search_file_list_add>>>>>>>>>>>>>>>>>>>>>>>>> | |
dms_sysnetapi_PlayBackGetReadPtrPos--first read frame failure! | |
########### StopPlayBack(%d,%d).... | |
%s %d-file name:%s! | |
/mnt/mmc/ | |
/mnt/usb/ | |
/mnt/%3s/%04d%02d%02d/0/%02d%02d%02d.asf | |
/mnt/%4s/%04d%02d%02d/0/%02d%02d%02d.asf | |
subdir:[%s] | |
ScheduleRecordMngThread | |
REC_StopRecord nChanne=%dl, nTrigerType=%d | |
REC_StartRecord nChanne=%dl, nTrigerType=%d, nDuration=%lu | |
#####%s:%d error, startRecord stopRecord conflict### | |
./src/librecord.c | |
need start motion! so we start record task! | |
Leave REC_StopAllRecord | |
Set NFS config failed! | |
echo "2" >/proc/sys/vm/dirty_background_ratio | |
echo "100">/proc/sys/vm/dirty_writeback_centisecs | |
############# REC_Init (%s %s) ############# | |
11:29:35 | |
Open platform error! | |
check record... | |
MainRecord | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d sync index! | |
_\D+6& | |
iMovSC | |
Se3& | |
Se@ | |
_\D+ | |
_\D+ | |
[ZNFS_GetMinDay | |
RemoveHourFile | |
RemovePerferFile | |
NFS_RemoveHourFile | |
HDFullDetectThread | |
delete file is %s | |
NFS_delete_nulldir count i s%d | |
remove dir[%s] %d | |
%s/Record | |
%s/Capture | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d Opendir:%s failed | |
./src/DiskFullMng.c | |
GetMInday %s | |
%d-%d-%d | |
minday is %d %s | |
%sindex.dat | |
1_%02d_ | |
delete_nulldir [%s] | |
Opendir:%s failed:%s | |
%s/%d/ | |
opendir [%s] failed, errno=%d | |
OpenDir[%s] | |
%s Opendir %s failed | |
funtion:%s, not RemoveFile last record file:%s | |
removing file %s [%d,%d] | |
Delete file[%s] Return %d errno=%d %s | |
## SetBaseTime from %d to %d | |
## delete all failed. reboot and fix disk .... | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d nminday == 0, g_nminbadday=%d | |
## opendir [%s] failed, errno:%d | |
RemoveFile count:[%s] %d | |
### RemoveFile failed:%s, time:%s | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d empty rec index! | |
##delete_nulldir(%s), nCount=%d, g_nminbadday =%d, nminday=%d | |
HDFullDetect | |
total space is %d free space is %d bsize:%d | |
free space is %dMB | |
remove prefrer file | |
%s/Capture/%d-%02d-%02d/CH_%02d/ | |
%d_%d_%d_%d.jpg | |
##delete_nulldir nCount=%d, nminday=%d | |
%s/Capture/%d-%02d-%02d | |
open file %s | |
date is %d | |
hour is %s | |
Delete file[%s] Return %d | |
##delete_nulldir(%s), nCount=%d, nminday=%d | |
delete '%s' | |
%s/%d/%d | |
%s/capture | |
REC_ERR::[FILE]:%s [FUNCTION]:%s [LINE]:%d Delete Failed,Umount,fsck,Delete again, stat:%lu(%d, nRet:%d) | |
CheckFileFormat | |
ReWriteFileIndex | |
GetFileInfo_EX2 | |
GetFileInfo_EX | |
--------- Entry DumpFileHeader -------------- | |
::::::::: FileHeader Object_ID Data1:0x%lx, Data2:0x%x, Data3:0x%x, Data4:0x%x 0x%x 0x%x 0x%x 0x%x 0x%x 0x%x 0x%x | |
::::::::: FileHeader Object_Size:%llu | |
::::::::: FileHeader Number_of_Header_Objects:%ld | |
::::::::: FileHeader Reserved1:%d | |
::::::::: FileHeader Reserved2:%d | |
--------- Leave DumpFileHeader -------------- | |
--------- Entry DumpDataObject -------------- | |
::::::::: DataObject Object_ID Data1:0x%lx, Data2:0x%x, Data3:0x%x, Data4:0x%x 0x%x 0x%x 0x%x 0x%x 0x%x 0x%x 0x%x | |
::::::::: DataObject Object_Size:%llu | |
::::::::: DataObject Total_Data_Packets:%llu | |
::::::::: DataObject Reserved:%d | |
--------- Leave DumpDataObject -------------- | |
free m_lpTmpBuffer:0x%x | |
free m_lpIFrame:0x%x | |
free m_lpIndexBuf:0x%x | |
free m_lpIndex:0x%x | |
free m_lpbih:0x%x | |
free m_lpwfx:0x%x | |
fclose m_fp:0x%x | |
free lpRander:0x%x | |
#### start:%lu, total:%lu, seekto:%lu(%f), Handle:%p | |
SetFilePointer Index Object Pos :%lu, fp:%p | |
### m_dwIFrameCount=%lu Index_Entries_Count=%lu | |
## Frame %lu/%lu TimeTick:%lu/%lu dwDataPos = %lu Size %lu | |
BeginPacketPos:%lu,Minimum_Data_Packet_Size:%lu,Packet_Number;%lu! | |
SetFilePosToTime %lu IFrame %lu dwDataPos = %lu | |
SetFilePointer dwDataStartPos:%lu,realpos:%lu | |
### ReadPacketHeader error.. | |
111 FilePos:%lu, objPos:%lu | |
./src/FileRander_ASF.c | |
222 FilePos:%lu, objPos:%lu | |
%s(%d) - %d , %s (%lu/%u) | |
err:%s:%d errno:%d | |
Object_ID Data1:0x%lx, Data2:0x%x, Data3:0x%x, Data4:0x%x 0x%x 0x%x 0x%x 0x%x 0x%x 0x%x 0x%x | |
--------- Entry DumpFileOjbect -------------- | |
::::::::: File_Properties_Object Object_ID Data1:0x%lx, Data2:0x%x, Data3:0x%x, Data4:0x%x 0x%x 0x%x 0x%x 0x%x 0x%x 0x%x 0x%x | |
::::::::: File_Properties_Object Object_Size:%llu | |
::::::::: File_Properties_Object File_ID Data1:0x%lx, Data2:0x%x, Data3:0x%x, Data4:0x%x 0x%x 0x%x 0x%x 0x%x 0x%x 0x%x 0x%x | |
::::::::: File_Properties_Object File_Size:%llu | |
::::::::: File_Properties_Object Creation_Date:%llu | |
::::::::: File_Properties_Object Data_Packets_Count:%llu | |
::::::::: File_Properties_Object Play_Duration:%llu | |
::::::::: File_Properties_Object Send_Duration:%llu | |
::::::::: File_Properties_Object Preroll:%llu | |
::::::::: File_Properties_Object Flags:%ld | |
::::::::: File_Properties_Object Minimum_Data_Packet_Size:%ld | |
::::::::: File_Properties_Object Maximum_Data_Packet_Size:%ld | |
::::::::: File_Properties_Object Maximum_Bitrate:%ld | |
--------- Leave DumpFileOjbect -------------- | |
--------- Entry DumpVideoFormat -------------- | |
::::::::: BITMAPINFOHEADER biSize:%ld | |
::::::::: BITMAPINFOHEADER biWidth:%ld | |
::::::::: BITMAPINFOHEADER biHeight:%ld | |
::::::::: BITMAPINFOHEADER biPlanes:%d | |
::::::::: BITMAPINFOHEADER biBitCount:%d | |
::::::::: BITMAPINFOHEADER biCompression:%lx | |
::::::::: BITMAPINFOHEADER biSizeImage:%ld | |
::::::::: BITMAPINFOHEADER biXPelsPerMeter:%ld | |
::::::::: BITMAPINFOHEADER biYPelsPerMeter:%ld | |
::::::::: BITMAPINFOHEADER biClrUsed:%ld | |
::::::::: BITMAPINFOHEADER biClrImportant:%ld | |
--------- Leave DumpVideoFormat -------------- | |
##### read %lu/%d at %lu | |
CheckFileFormat failed. | |
ReWriteFileIndex %s | |
#### %s %d, st_size=%ld | |
#### %s %d, packesize= %ld | |
file st_size:%ld | |
Rewrite Frameindex success. | |
GetFileInfo_Ex2.............. | |
lock file................ | |
unlock file................ | |
GetFileInfo_Ex.............. | |
hd_set_nas | |
hd_mng_init | |
GetDiskSpaceInfo | |
nas_FindMountDir | |
nas_mount | |
disk_format | |
nas_format | |
CheckUsbVersion | |
start set nas thread! | |
%s %d, create nasmng thread fail!ret=%d,%s(errno:%d) | |
/dev/mmcblk0 | |
/dev/sd%c | |
%s %d, create hdmng thread fail!ret=%d,%s(errno:%d) | |
Hd_mng Module Build:%s %s | |
Jan 26 2016 | |
09:24:15 | |
%s %d, path:%s, errno: %d, %s | |
umount %s | |
mount nas start!!! | |
mount -t nfs -o tcp -o nolock %s:/%s %s | |
/mnt/nas0 | |
[%s:%d] %s | |
mount nas failed! | |
mount nas ok! | |
usb_detect | |
remove | |
mmcblk0 | |
usb:%d DiskNo:%d,%lu[%s] | |
hdmng | |
/dev/mmcblk0p%d | |
/mnt/mmc%d | |
/mnt/mmc | |
mount -t vfat %s %s | |
/mnt/usb%d | |
/mnt/usb | |
usb-storage | |
Spd= | |
Error: HD unmount fail so HD format fail | |
mkdosfs -F 32 %s | |
Error: HD format fail | |
rm -rf %s/* | |
ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/ | |
SmtpClientInit | |
GetFormatDate | |
----=_NextPart_000_0049_01C9AB9E.FB4D2810 | |
----=_NextPart_000_003D_01C9AB9E.C75EEFC0 | |
SWL_Connect | |
PUB_GetTickCount | |
ConnectMailServer | |
ConnectMailServer | |
HI_SMTPC_SendMail | |
%s %d pBuff = %s | |
./src/SmtpClient.c | |
%s %d pLastLRCF = %s | |
sendBufLen > 0 && sendBufLen < 8*1024*1024 | |
((void *)0) != m_pSendBuf | |
%d.%d@%s | |
ipcamera | |
Date: | |
((void *)0) != pDate | |
%a, %d %b %Y %H:%M:%S 0000 GMT | |
From: "=?utf-8?B?%s?=" | |
<%s> | |
From: <%s> | |
To: "=?utf-8?B?%s?=" | |
To: <%s> | |
"=?utf-8?B?%s?=" | |
<%s> | |
%s-%s | |
Subject: =?utf-8?B?%s?= | |
Message-ID: <%s> | |
X-Mailer: ANNI IPCAMERA mailsender 1.0 | |
MIME-Version: 1.0 | |
--%s | |
Content-Type: multipart/mixed; boundary="%s" | |
Content-Type: multipart/alternative; boundary="%s" | |
Content-Type: text/plain; charset="utf-8" | |
Content-Transfer-Encoding: quoted-printable | |
--%s-- | |
Content-Type: image/jpeg; name="%s" | |
Content-Disposition: attachment; | |
filename="%s" | |
Content-Transfer-Encoding: base64 | |
%s %d base64Len=%d, len=%d, pAttachName:%s | |
send : %s | |
%s %d Error: %s | |
%s %d errno=%d! | |
recv : %s | |
%s %d end while! | |
%s %d Error! | |
QUIT | |
DATA | |
RCPT TO:< | |
AUTH LOGIN | |
AUTH PLAIN | |
EHLO | |
LOGIN | |
PLAIN | |
STARTTLS | |
STARTTLS | |
%s %d, SSL_new fail | |
%s %d %s | |
%s %d | |
%s %d --------ConnectMailServer begin------------ | |
#### %s %d, pServer:%s, s_addr=0x%X | |
#### %s %d, m_ucSSL=%d, port=%d, in=0x%X | |
%s:%d | |
m_pBio=%p, ConnectMailServer %s | |
%s %d --------SmtpReady end------------ | |
%s %d --------SmtpEhlo end------------ | |
%s %d --------SmtpAuth end------------ | |
MAIL FROM:< | |
%s %d buf:%s | |
%s %d --------SmtpRcpt end------------ | |
%s %d --------SmtpData end------------ | |
%s %d iBuffLen=%d | |
%s %d pBuff:%s | |
%s %d ret=%d | |
encryption = %u port = %d pSendAddress = %s pServer = %s user = %s pwd = %s pTitle = %s text = %s | |
%s %d --------ConnectMailServer end------------ | |
%s %d --------SmtpFrom end------------ | |
#### %s %d, njpeglen=%d, attachNum=%d | |
#### %s %d, %s-%s | |
s23_clnt.c | |
s->version <= TLS_MAX_VERSION | |
TLSv1 part of OpenSSL 1.0.1p 9 Jul 2015 | |
t1_lib.c | |
client finished | |
server finished | |
t1_enc.c | |
t >= 0 | |
t > 0 | |
n >= 0 | |
%s:%d: rec->data != rec->input | |
chunk >= 0 | |
client write key | |
server write key | |
IV block | |
key expansion | |
master secret | |
TLSv1.2 | |
TLSv1.1 | |
TLSv1 | |
SSLv3 | |
unknown | |
SSLv2 | |
ssl_lib.c | |
ALL:!EXPORT:!aNULL:!eNULL:!SSLv2 | |
ssl->sid_ctx_length <= sizeof(ssl->sid_ctx) | |
ssl2-md5 | |
ssl3-md5 | |
ssl3-sha1 | |
s->sid_ctx_length <= sizeof s->sid_ctx | |
OpenSSL 1.0.1p 9 Jul 2015 | |
ssl_cert.c | |
OPENSSL_DIR_read(&ctx, ' | |
SSL for verify callback | |
ssl_server | |
ssl_client | |
SSL SESSION PARAMETERS | |
ssl_sess.c | |
(NONE) | |
TLSv1/SSLv3 | |
export | |
DH/DSS | |
DH/RSA | |
RSA(1024) | |
RSA(512) | |
KRB5 | |
DH(1024) | |
DH(512) | |
ECDH/RSA | |
ECDH/ECDSA | |
ECDH | |
GOST | |
None | |
ECDSA | |
GOST01 | |
IDEA(128) | |
3DES(168) | |
DES(56) | |
DES(40) | |
RC4(56) | |
RC4(40) | |
RC4(128) | |
RC4(64) | |
RC2(128) | |
RC2(56) | |
RC2(40) | |
AES(128) | |
AES(256) | |
AESGCM(128) | |
AESGCM(256) | |
Camellia(128) | |
Camellia(256) | |
SEED(128) | |
GOST89(256) | |
ssl_ciph.c | |
OPENSSL_malloc Error | |
Buffer too small | |
STRENGTH | |
RC4-HMAC-MD5 | |
AES-128-CBC-HMAC-SHA1 | |
AES-256-CBC-HMAC-SHA1 | |
DES-CBC | |
DES-EDE3-CBC | |
AES-128-CBC | |
AES-256-CBC | |
CAMELLIA-128-CBC | |
CAMELLIA-256-CBC | |
gost89-cnt | |
SEED-CBC | |
id-aes128-GCM | |
id-aes256-GCM | |
ssl_mac_secret_size[SSL_MD_MD5_IDX] >= 0 | |
ssl_mac_secret_size[SSL_MD_SHA1_IDX] >= 0 | |
md_gost94 | |
ssl_mac_secret_size[SSL_MD_GOST94_IDX] >= 0 | |
gost-mac | |
gost94 | |
gost2001 | |
%-23s %s Kx=%-8s Au=%-4s Enc=%-9s Mac=%-4s%s | |
COMPLEMENTOFALL | |
COMPLEMENTOFDEFAULT | |
kRSA | |
kDHr | |
kDHd | |
kEDH | |
kKRB5 | |
kECDHr | |
kECDHe | |
kECDH | |
kEECDH | |
kPSK | |
kSRP | |
kGOST | |
aRSA | |
aDSS | |
aKRB5 | |
aNULL | |
aECDH | |
aECDSA | |
aPSK | |
aGOST94 | |
aGOST01 | |
aGOST | |
aSRP | |
EECDH | |
AECDH | |
3DES | |
IDEA | |
SEED | |
eNULL | |
AES128 | |
AES256 | |
AESGCM | |
CAMELLIA128 | |
CAMELLIA256 | |
CAMELLIA | |
GOST89MAC | |
EXPORT | |
EXPORT40 | |
EXPORT56 | |
MEDIUM | |
HIGH | |
FIPS | |
AEAD | |
RSA-SHA1-2 | |
RSA-SHA1 | |
bio_ssl.c | |
tls_srp.c | |
t1_reneg.c | |
!expected_len || s->s3->previous_client_finished_len | |
!expected_len || s->s3->previous_server_finished_len | |
s3_clnt.c | |
s3_lib.c | |
NULL-MD5 | |
NULL-SHA | |
EXP-RC4-MD5 | |
RC4-SHA | |
EXP-RC2-CBC-MD5 | |
EXP-DES-CBC-SHA | |
EXP-DH-DSS-DES-CBC-SHA | |
DH-DSS-DES-CBC3-SHA | |
EXP-DH-RSA-DES-CBC-SHA | |
DH-RSA-DES-CBC3-SHA | |
EXP-EDH-DSS-DES-CBC-SHA | |
EDH-DSS-DES-CBC3-SHA | |
EXP-EDH-RSA-DES-CBC-SHA | |
EDH-RSA-DES-CBC3-SHA | |
EXP-ADH-RC4-MD5 | |
EXP-ADH-DES-CBC-SHA | |
ADH-DES-CBC3-SHA | |
DH-DSS-AES128-SHA | |
DH-RSA-AES128-SHA | |
DHE-DSS-AES128-SHA | |
DHE-RSA-AES128-SHA | |
ADH-AES128-SHA | |
DH-DSS-AES256-SHA | |
DH-RSA-AES256-SHA | |
DHE-DSS-AES256-SHA | |
DHE-RSA-AES256-SHA | |
ADH-AES256-SHA | |
NULL-SHA256 | |
DH-DSS-AES128-SHA256 | |
DH-RSA-AES128-SHA256 | |
DHE-DSS-AES128-SHA256 | |
DHE-RSA-AES128-SHA256 | |
DH-DSS-AES256-SHA256 | |
DH-RSA-AES256-SHA256 | |
DHE-DSS-AES256-SHA256 | |
DHE-RSA-AES256-SHA256 | |
ADH-AES128-SHA256 | |
ADH-AES256-SHA256 | |
GOST94-GOST89-GOST89 | |
GOST2001-GOST89-GOST89 | |
GOST94-NULL-GOST94 | |
GOST2001-NULL-GOST94 | |
DHE-RSA-AES128-GCM-SHA256 | |
DHE-RSA-AES256-GCM-SHA384 | |
DH-RSA-AES128-GCM-SHA256 | |
DH-RSA-AES256-GCM-SHA384 | |
DHE-DSS-AES128-GCM-SHA256 | |
DHE-DSS-AES256-GCM-SHA384 | |
DH-DSS-AES128-GCM-SHA256 | |
DH-DSS-AES256-GCM-SHA384 | |
ADH-AES128-GCM-SHA256 | |
ADH-AES256-GCM-SHA384 | |
SRP-3DES-EDE-CBC-SHA | |
SRP-RSA-3DES-EDE-CBC-SHA | |
SRP-DSS-3DES-EDE-CBC-SHA | |
SRP-AES-128-CBC-SHA | |
SRP-RSA-AES-128-CBC-SHA | |
SRP-DSS-AES-128-CBC-SHA | |
SRP-AES-256-CBC-SHA | |
SRP-RSA-AES-256-CBC-SHA | |
SRP-DSS-AES-256-CBC-SHA | |
CLNT | |
SRVR | |
s3_enc.c | |
s3_pkt.c | |
s->s3->wnum <= INT_MAX | |
mac_size <= EVP_MAX_MD_SIZE | |
SSL alert number | |
s3_both.c | |
i <= EVP_MAX_MD_SIZE | |
s3_cbc.c | |
orig_len >= md_size | |
md_size <= EVP_MAX_MD_SIZE | |
data_plus_mac_plus_padding_size < 1024 * 1024 | |
mac_secret_length <= sizeof(hmac_pad) | |
GET | |
POST | |
HEAD | |
PUT | |
CONNECT | |
s23_srvr.c | |
d1_both.c | |
invalid state reached %s:%d | |
s->init_off == 0 | |
s->d1->w_msg_hdr.msg_len + ((s->version == DTLS1_VERSION) ? DTLS1_CCS_HEADER_LENGTH : 3) == (unsigned int)s->init_num | |
s->d1->w_msg_hdr.msg_len + DTLS1_HM_HEADER_LENGTH == (unsigned int)s->init_num | |
((long)msg_hdr->msg_len) > 0 | |
item != NULL | |
s->d1->mtu >= dtls1_min_mtu(s) | |
s->init_num == (int)s->d1->w_msg_hdr.msg_len + DTLS1_HM_HEADER_LENGTH | |
s->init_off > DTLS1_HM_HEADER_LENGTH | |
len == (unsigned int)ret | |
retransmit: message %d non-existant | |
dtls1_retransmit_message() failed | |
ssl_rsa.c | |
s3_srvr.c | |
GOST signature length is %d | |
d1_pkt.c | |
len <= SSL3_RT_MAX_PLAIN_LENGTH | |
%s(%d): OpenSSL internal error, assertion failed: %s | |
dynamic | |
ERROR | |
cryptlib.c | |
pointer != NULL | |
<<ERROR>> | |
ex_data | |
x509 | |
x509_info | |
x509_pkey | |
x509_crl | |
x509_req | |
evp_pkey | |
x509_store | |
ssl_ctx | |
ssl_cert | |
ssl_session | |
ssl_sess_cert | |
ssl_method | |
rand | |
rand2 | |
debug_malloc | |
gethostbyname | |
getservbyname | |
readdir | |
RSA_blinding | |
debug_malloc2 | |
dynlock | |
engine | |
ecdsa | |
ecdh | |
ec_pre_comp | |
store | |
comp | |
fips | |
fips2 | |
ex_data.c | |
o_names.c | |
Ag*g* | |
g+g+ | |
obj_dat.c | |
.%lu | |
UNDEF | |
undefined | |
rsadsi | |
RSA Data Security, Inc. | |
pkcs | |
RSA Data Security, Inc. PKCS | |
rsaEncryption | |
RSA-MD2 | |
md2WithRSAEncryption | |
RSA-MD5 | |
md5WithRSAEncryption | |
PBE-MD2-DES | |
pbeWithMD2AndDES-CBC | |
PBE-MD5-DES | |
pbeWithMD5AndDES-CBC | |
X500 | |
directory services (X.500) | |
X509 | |
commonName | |
countryName | |
localityName | |
stateOrProvinceName | |
organizationName | |
organizationalUnitName | |
pkcs7 | |
pkcs7-data | |
pkcs7-signedData | |
pkcs7-envelopedData | |
pkcs7-signedAndEnvelopedData | |
pkcs7-digestData | |
pkcs7-encryptedData | |
pkcs3 | |
dhKeyAgreement | |
DES-ECB | |
des-ecb | |
DES-CFB | |
des-cfb | |
des-cbc | |
DES-EDE | |
des-ede | |
DES-EDE3 | |
des-ede3 | |
IDEA-CBC | |
idea-cbc | |
IDEA-CFB | |
idea-cfb | |
IDEA-ECB | |
idea-ecb | |
rc2-cbc | |
RC2-ECB | |
rc2-ecb | |
RC2-CFB | |
rc2-cfb | |
RC2-OFB | |
rc2-ofb | |
RSA-SHA | |
shaWithRSAEncryption | |
DES-EDE-CBC | |
des-ede-cbc | |
des-ede3-cbc | |
DES-OFB | |
des-ofb | |
IDEA-OFB | |
idea-ofb | |
pkcs9 | |
emailAddress | |
unstructuredName | |
contentType | |
messageDigest | |
signingTime | |
countersignature | |
challengePassword | |
unstructuredAddress | |
extendedCertificateAttributes | |
Netscape | |
Netscape Communications Corp. | |
nsCertExt | |
Netscape Certificate Extension | |
nsDataType | |
Netscape Data Type | |
DES-EDE-CFB | |
des-ede-cfb | |
DES-EDE3-CFB | |
des-ede3-cfb | |
DES-EDE-OFB | |
des-ede-ofb | |
DES-EDE3-OFB | |
des-ede3-ofb | |
sha1WithRSAEncryption | |
DSA-SHA | |
dsaWithSHA | |
DSA-old | |
dsaEncryption-old | |
PBE-SHA1-RC2-64 | |
pbeWithSHA1AndRC2-CBC | |
PBKDF2 | |
DSA-SHA1-old | |
dsaWithSHA1-old | |
nsCertType | |
Netscape Cert Type | |
nsBaseUrl | |
Netscape Base Url | |
nsRevocationUrl | |
Netscape Revocation Url | |
nsCaRevocationUrl | |
Netscape CA Revocation Url | |
nsRenewalUrl | |
Netscape Renewal Url | |
nsCaPolicyUrl | |
Netscape CA Policy Url | |
nsSslServerName | |
Netscape SSL Server Name | |
nsComment | |
Netscape Comment | |
nsCertSequence | |
Netscape Certificate Sequence | |
DESX-CBC | |
desx-cbc | |
id-ce | |
subjectKeyIdentifier | |
X509v3 Subject Key Identifier | |
keyUsage | |
X509v3 Key Usage | |
privateKeyUsagePeriod | |
X509v3 Private Key Usage Period | |
subjectAltName | |
X509v3 Subject Alternative Name | |
issuerAltName | |
X509v3 Issuer Alternative Name | |
basicConstraints | |
X509v3 Basic Constraints | |
crlNumber | |
X509v3 CRL Number | |
certificatePolicies | |
X509v3 Certificate Policies | |
authorityKeyIdentifier | |
X509v3 Authority Key Identifier | |
BF-CBC | |
bf-cbc | |
BF-ECB | |
bf-ecb | |
BF-CFB | |
bf-cfb | |
BF-OFB | |
bf-ofb | |
mdc2 | |
RSA-MDC2 | |
mdc2WithRSA | |
RC4-40 | |
rc4-40 | |
RC2-40-CBC | |
rc2-40-cbc | |
givenName | |
surname | |
initials | |
crlDistributionPoints | |
X509v3 CRL Distribution Points | |
RSA-NP-MD5 | |
md5WithRSA | |
serialNumber | |
title | |
description | |
CAST5-CBC | |
cast5-cbc | |
CAST5-ECB | |
cast5-ecb | |
CAST5-CFB | |
cast5-cfb | |
CAST5-OFB | |
cast5-ofb | |
pbeWithMD5AndCast5CBC | |
DSA-SHA1 | |
dsaWithSHA1 | |
MD5-SHA1 | |
md5-sha1 | |
sha1WithRSA | |
dsaEncryption | |
ripemd160 | |
RSA-RIPEMD160 | |
ripemd160WithRSA | |
RC5-CBC | |
rc5-cbc | |
RC5-ECB | |
rc5-ecb | |
RC5-CFB | |
rc5-cfb | |
RC5-OFB | |
rc5-ofb | |
run length compression | |
ZLIB | |
zlib compression | |
extendedKeyUsage | |
X509v3 Extended Key Usage | |
PKIX | |
id-kp | |
serverAuth | |
TLS Web Server Authentication | |
clientAuth | |
TLS Web Client Authentication | |
codeSigning | |
Code Signing | |
emailProtection | |
E-mail Protection | |
timeStamping | |
Time Stamping | |
msCodeInd | |
Microsoft Individual Code Signing | |
msCodeCom | |
Microsoft Commercial Code Signing | |
msCTLSign | |
Microsoft Trust List Signing | |
msSGC | |
Microsoft Server Gated Crypto | |
msEFS | |
Microsoft Encrypted File System | |
nsSGC | |
Netscape Server Gated Crypto | |
deltaCRL | |
X509v3 Delta CRL Indicator | |
CRLReason | |
X509v3 CRL Reason Code | |
invalidityDate | |
Invalidity Date | |
SXNetID | |
Strong Extranet ID | |
PBE-SHA1-RC4-128 | |
pbeWithSHA1And128BitRC4 | |
PBE-SHA1-RC4-40 | |
pbeWithSHA1And40BitRC4 | |
PBE-SHA1-3DES | |
pbeWithSHA1And3-KeyTripleDES-CBC | |
PBE-SHA1-2DES | |
pbeWithSHA1And2-KeyTripleDES-CBC | |
PBE-SHA1-RC2-128 | |
pbeWithSHA1And128BitRC2-CBC | |
PBE-SHA1-RC2-40 | |
pbeWithSHA1And40BitRC2-CBC | |
keyBag | |
pkcs8ShroudedKeyBag | |
certBag | |
crlBag | |
secretBag | |
safeContentsBag | |
friendlyName | |
localKeyID | |
x509Certificate | |
sdsiCertificate | |
x509Crl | |
PBES2 | |
PBMAC1 | |
hmacWithSHA1 | |
id-qt-cps | |
Policy Qualifier CPS | |
id-qt-unotice | |
Policy Qualifier User Notice | |
RC2-64-CBC | |
rc2-64-cbc | |
SMIME-CAPS | |
S/MIME Capabilities | |
PBE-MD2-RC2-64 | |
pbeWithMD2AndRC2-CBC | |
PBE-MD5-RC2-64 | |
pbeWithMD5AndRC2-CBC | |
PBE-SHA1-DES | |
pbeWithSHA1AndDES-CBC | |
msExtReq | |
Microsoft Extension Request | |
extReq | |
Extension Request | |
dnQualifier | |
id-pe | |
id-ad | |
authorityInfoAccess | |
Authority Information Access | |
OCSP | |
caIssuers | |
CA Issuers | |
OCSPSigning | |
OCSP Signing | |
member-body | |
ISO Member Body | |
ISO-US | |
ISO US Member Body | |
X9-57 | |
X9.57 | |
X9cm | |
X9.57 CM ? | |
pkcs1 | |
pkcs5 | |
SMIME | |
S/MIME | |
id-smime-mod | |
id-smime-ct | |
id-smime-aa | |
id-smime-alg | |
id-smime-cd | |
id-smime-spq | |
id-smime-cti | |
id-smime-mod-cms | |
id-smime-mod-ess | |
id-smime-mod-oid | |
id-smime-mod-msg-v3 | |
id-smime-mod-ets-eSignature-88 | |
id-smime-mod-ets-eSignature-97 | |
id-smime-mod-ets-eSigPolicy-88 | |
id-smime-mod-ets-eSigPolicy-97 | |
id-smime-ct-receipt | |
id-smime-ct-authData | |
id-smime-ct-publishCert | |
id-smime-ct-TSTInfo | |
id-smime-ct-TDTInfo | |
id-smime-ct-contentInfo | |
id-smime-ct-DVCSRequestData | |
id-smime-ct-DVCSResponseData | |
id-smime-aa-receiptRequest | |
id-smime-aa-securityLabel | |
id-smime-aa-mlExpandHistory | |
id-smime-aa-contentHint | |
id-smime-aa-msgSigDigest | |
id-smime-aa-encapContentType | |
id-smime-aa-contentIdentifier | |
id-smime-aa-macValue | |
id-smime-aa-equivalentLabels | |
id-smime-aa-contentReference | |
id-smime-aa-encrypKeyPref | |
id-smime-aa-signingCertificate | |
id-smime-aa-smimeEncryptCerts | |
id-smime-aa-timeStampToken | |
id-smime-aa-ets-sigPolicyId | |
id-smime-aa-ets-commitmentType | |
id-smime-aa-ets-signerLocation | |
id-smime-aa-ets-signerAttr | |
id-smime-aa-ets-otherSigCert | |
id-smime-aa-ets-contentTimestamp | |
id-smime-aa-ets-CertificateRefs | |
id-smime-aa-ets-RevocationRefs | |
id-smime-aa-ets-certValues | |
id-smime-aa-ets-revocationValues | |
id-smime-aa-ets-escTimeStamp | |
id-smime-aa-ets-certCRLTimestamp | |
id-smime-aa-ets-archiveTimeStamp | |
id-smime-aa-signatureType | |
id-smime-aa-dvcs-dvc | |
id-smime-alg-ESDHwith3DES | |
id-smime-alg-ESDHwithRC2 | |
id-smime-alg-3DESwrap | |
id-smime-alg-RC2wrap | |
id-smime-alg-ESDH | |
id-smime-alg-CMS3DESwrap | |
id-smime-alg-CMSRC2wrap | |
id-smime-cd-ldap | |
id-smime-spq-ets-sqt-uri | |
id-smime-spq-ets-sqt-unotice | |
id-smime-cti-ets-proofOfOrigin | |
id-smime-cti-ets-proofOfReceipt | |
id-smime-cti-ets-proofOfDelivery | |
id-smime-cti-ets-proofOfSender | |
id-smime-cti-ets-proofOfApproval | |
id-smime-cti-ets-proofOfCreation | |
id-pkix-mod | |
id-qt | |
id-it | |
id-pkip | |
id-alg | |
id-cmc | |
id-on | |
id-pda | |
id-aca | |
id-qcs | |
id-cct | |
id-pkix1-explicit-88 | |
id-pkix1-implicit-88 | |
id-pkix1-explicit-93 | |
id-pkix1-implicit-93 | |
id-mod-crmf | |
id-mod-cmc | |
id-mod-kea-profile-88 | |
id-mod-kea-profile-93 | |
id-mod-cmp | |
id-mod-qualified-cert-88 | |
id-mod-qualified-cert-93 | |
id-mod-attribute-cert | |
id-mod-timestamp-protocol | |
id-mod-ocsp | |
id-mod-dvcs | |
id-mod-cmp2000 | |
biometricInfo | |
Biometric Info | |
qcStatements | |
ac-auditEntity | |
ac-targeting | |
aaControls | |
sbgp-ipAddrBlock | |
sbgp-autonomousSysNum | |
sbgp-routerIdentifier | |
textNotice | |
ipsecEndSystem | |
IPSec End System | |
ipsecTunnel | |
IPSec Tunnel | |
ipsecUser | |
IPSec User | |
DVCS | |
dvcs | |
id-it-caProtEncCert | |
id-it-signKeyPairTypes | |
id-it-encKeyPairTypes | |
id-it-preferredSymmAlg | |
id-it-caKeyUpdateInfo | |
id-it-currentCRL | |
id-it-unsupportedOIDs | |
id-it-subscriptionRequest | |
id-it-subscriptionResponse | |
id-it-keyPairParamReq | |
id-it-keyPairParamRep | |
id-it-revPassphrase | |
id-it-implicitConfirm | |
id-it-confirmWaitTime | |
id-it-origPKIMessage | |
id-regCtrl | |
id-regInfo | |
id-regCtrl-regToken | |
id-regCtrl-authenticator | |
id-regCtrl-pkiPublicationInfo | |
id-regCtrl-pkiArchiveOptions | |
id-regCtrl-oldCertID | |
id-regCtrl-protocolEncrKey | |
id-regInfo-utf8Pairs | |
id-regInfo-certReq | |
id-alg-des40 | |
id-alg-noSignature | |
id-alg-dh-sig-hmac-sha1 | |
id-alg-dh-pop | |
id-cmc-statusInfo | |
id-cmc-identification | |
id-cmc-identityProof | |
id-cmc-dataReturn | |
id-cmc-transactionId | |
id-cmc-senderNonce | |
id-cmc-recipientNonce | |
id-cmc-addExtensions | |
id-cmc-encryptedPOP | |
id-cmc-decryptedPOP | |
id-cmc-lraPOPWitness | |
id-cmc-getCert | |
id-cmc-getCRL | |
id-cmc-revokeRequest | |
id-cmc-regInfo | |
id-cmc-responseInfo | |
id-cmc-queryPending | |
id-cmc-popLinkRandom | |
id-cmc-popLinkWitness | |
id-cmc-confirmCertAcceptance | |
id-on-personalData | |
id-pda-dateOfBirth | |
id-pda-placeOfBirth | |
id-pda-gender | |
id-pda-countryOfCitizenship | |
id-pda-countryOfResidence | |
id-aca-authenticationInfo | |
id-aca-accessIdentity | |
id-aca-chargingIdentity | |
id-aca-group | |
id-aca-role | |
id-qcs-pkixQCSyntax-v1 | |
id-cct-crs | |
id-cct-PKIData | |
id-cct-PKIResponse | |
ad_timestamping | |
AD Time Stamping | |
AD_DVCS | |
ad dvcs | |
basicOCSPResponse | |
Basic OCSP Response | |
OCSP Nonce | |
CrlID | |
OCSP CRL ID | |
acceptableResponses | |
Acceptable OCSP Responses | |
noCheck | |
OCSP No Check | |
archiveCutoff | |
OCSP Archive Cutoff | |
serviceLocator | |
OCSP Service Locator | |
extendedStatus | |
Extended OCSP Status | |
valid | |
trustRoot | |
Trust Root | |
algorithm | |
rsaSignature | |
X500algorithms | |
directory services - algorithms | |
IANA | |
iana | |
directory | |
Directory | |
mgmt | |
Management | |
experimental | |
Experimental | |
private | |
Private | |
security | |
snmpv2 | |
SNMPv2 | |
enterprises | |
Enterprises | |
dcobject | |
dcObject | |
domainComponent | |
domain | |
selected-attribute-types | |
Selected Attribute Types | |
clearance | |
RSA-MD4 | |
md4WithRSAEncryption | |
ac-proxying | |
subjectInfoAccess | |
Subject Information Access | |
id-aca-encAttrs | |
role | |
policyConstraints | |
X509v3 Policy Constraints | |
targetInformation | |
X509v3 AC Targeting | |
noRevAvail | |
X509v3 No Revocation Available | |
ansi-X9-62 | |
ANSI X9.62 | |
prime-field | |
characteristic-two-field | |
id-ecPublicKey | |
prime192v1 | |
prime192v2 | |
prime192v3 | |
prime239v1 | |
prime239v2 | |
prime239v3 | |
prime256v1 | |
ecdsa-with-SHA1 | |
CSPName | |
Microsoft CSP Name | |
AES-128-ECB | |
aes-128-ecb | |
aes-128-cbc | |
AES-128-OFB | |
aes-128-ofb | |
AES-128-CFB | |
aes-128-cfb | |
AES-192-ECB | |
aes-192-ecb | |
AES-192-CBC | |
aes-192-cbc | |
AES-192-OFB | |
aes-192-ofb | |
AES-192-CFB | |
aes-192-cfb | |
AES-256-ECB | |
aes-256-ecb | |
aes-256-cbc | |
AES-256-OFB | |
aes-256-ofb | |
AES-256-CFB | |
aes-256-cfb | |
holdInstructionCode | |
Hold Instruction Code | |
holdInstructionNone | |
Hold Instruction None | |
holdInstructionCallIssuer | |
Hold Instruction Call Issuer | |
holdInstructionReject | |
Hold Instruction Reject | |
pilot | |
pilotAttributeType | |
pilotAttributeSyntax | |
pilotObjectClass | |
pilotGroups | |
iA5StringSyntax | |
caseIgnoreIA5StringSyntax | |
pilotObject | |
pilotPerson | |
document | |
room | |
documentSeries | |
rFC822localPart | |
dNSDomain | |
domainRelatedObject | |
friendlyCountry | |
simpleSecurityObject | |
pilotOrganization | |
pilotDSA | |
qualityLabelledData | |
userId | |
textEncodedORAddress | |
rfc822Mailbox | |
favouriteDrink | |
roomNumber | |
photo | |
userClass | |
manager | |
documentIdentifier | |
documentTitle | |
documentVersion | |
documentAuthor | |
documentLocation | |
homeTelephoneNumber | |
secretary | |
otherMailbox | |
lastModifiedTime | |
lastModifiedBy | |
aRecord | |
pilotAttributeType27 | |
mXRecord | |
nSRecord | |
sOARecord | |
cNAMERecord | |
associatedDomain | |
associatedName | |
homePostalAddress | |
personalTitle | |
mobileTelephoneNumber | |
pagerTelephoneNumber | |
friendlyCountryName | |
organizationalStatus | |
janetMailbox | |
mailPreferenceOption | |
buildingName | |
dSAQuality | |
singleLevelQuality | |
subtreeMinimumQuality | |
subtreeMaximumQuality | |
personalSignature | |
dITRedirect | |
documentPublisher | |
x500UniqueIdentifier | |
mime-mhs | |
MIME MHS | |
mime-mhs-headings | |
mime-mhs-bodies | |
id-hex-partial-message | |
id-hex-multipart-message | |
generationQualifier | |
pseudonym | |
id-set | |
Secure Electronic Transactions | |
set-ctype | |
content types | |
set-msgExt | |
message extensions | |
set-attr | |
set-policy | |
set-certExt | |
certificate extensions | |
set-brand | |
setct-PANData | |
setct-PANToken | |
setct-PANOnly | |
setct-OIData | |
setct-PI | |
setct-PIData | |
setct-PIDataUnsigned | |
setct-HODInput | |
setct-AuthResBaggage | |
setct-AuthRevReqBaggage | |
setct-AuthRevResBaggage | |
setct-CapTokenSeq | |
setct-PInitResData | |
setct-PI-TBS | |
setct-PResData | |
setct-AuthReqTBS | |
setct-AuthResTBS | |
setct-AuthResTBSX | |
setct-AuthTokenTBS | |
setct-CapTokenData | |
setct-CapTokenTBS | |
setct-AcqCardCodeMsg | |
setct-AuthRevReqTBS | |
setct-AuthRevResData | |
setct-AuthRevResTBS | |
setct-CapReqTBS | |
setct-CapReqTBSX | |
setct-CapResData | |
setct-CapRevReqTBS | |
setct-CapRevReqTBSX | |
setct-CapRevResData | |
setct-CredReqTBS | |
setct-CredReqTBSX | |
setct-CredResData | |
setct-CredRevReqTBS | |
setct-CredRevReqTBSX | |
setct-CredRevResData | |
setct-PCertReqData | |
setct-PCertResTBS | |
setct-BatchAdminReqData | |
setct-BatchAdminResData | |
setct-CardCInitResTBS | |
setct-MeAqCInitResTBS | |
setct-RegFormResTBS | |
setct-CertReqData | |
setct-CertReqTBS | |
setct-CertResData | |
setct-CertInqReqTBS | |
setct-ErrorTBS | |
setct-PIDualSignedTBE | |
setct-PIUnsignedTBE | |
setct-AuthReqTBE | |
setct-AuthResTBE | |
setct-AuthResTBEX | |
setct-AuthTokenTBE | |
setct-CapTokenTBE | |
setct-CapTokenTBEX | |
setct-AcqCardCodeMsgTBE | |
setct-AuthRevReqTBE | |
setct-AuthRevResTBE | |
setct-AuthRevResTBEB | |
setct-CapReqTBE | |
setct-CapReqTBEX | |
setct-CapResTBE | |
setct-CapRevReqTBE | |
setct-CapRevReqTBEX | |
setct-CapRevResTBE | |
setct-CredReqTBE | |
setct-CredReqTBEX | |
setct-CredResTBE | |
setct-CredRevReqTBE | |
setct-CredRevReqTBEX | |
setct-CredRevResTBE | |
setct-BatchAdminReqTBE | |
setct-BatchAdminResTBE | |
setct-RegFormReqTBE | |
setct-CertReqTBE | |
setct-CertReqTBEX | |
setct-CertResTBE | |
setct-CRLNotificationTBS | |
setct-CRLNotificationResTBS | |
setct-BCIDistributionTBS | |
setext-genCrypt | |
generic cryptogram | |
setext-miAuth | |
merchant initiated auth | |
setext-pinSecure | |
setext-pinAny | |
setext-track2 | |
setext-cv | |
additional verification | |
set-policy-root | |
setCext-hashedRoot | |
setCext-certType | |
setCext-merchData | |
setCext-cCertRequired | |
setCext-tunneling | |
setCext-setExt | |
setCext-setQualf | |
setCext-PGWYcapabilities | |
setCext-TokenIdentifier | |
setCext-Track2Data | |
setCext-TokenType | |
setCext-IssuerCapabilities | |
setAttr-Cert | |
setAttr-PGWYcap | |
payment gateway capabilities | |
setAttr-TokenType | |
setAttr-IssCap | |
issuer capabilities | |
set-rootKeyThumb | |
set-addPolicy | |
setAttr-Token-EMV | |
setAttr-Token-B0Prime | |
setAttr-IssCap-CVM | |
setAttr-IssCap-T2 | |
setAttr-IssCap-Sig | |
setAttr-GenCryptgrm | |
generate cryptogram | |
setAttr-T2Enc | |
encrypted track 2 | |
setAttr-T2cleartxt | |
cleartext track 2 | |
setAttr-TokICCsig | |
ICC or token signature | |
setAttr-SecDevSig | |
secure device signature | |
set-brand-IATA-ATA | |
set-brand-Diners | |
set-brand-AmericanExpress | |
set-brand-JCB | |
set-brand-Visa | |
set-brand-MasterCard | |
set-brand-Novus | |
DES-CDMF | |
des-cdmf | |
rsaOAEPEncryptionSET | |
ITU-T | |
itu-t | |
JOINT-ISO-ITU-T | |
joint-iso-itu-t | |
international-organizations | |
International Organizations | |
msSmartcardLogin | |
Microsoft Smartcardlogin | |
msUPN | |
Microsoft Universal Principal Name | |
AES-128-CFB1 | |
aes-128-cfb1 | |
AES-192-CFB1 | |
aes-192-cfb1 | |
AES-256-CFB1 | |
aes-256-cfb1 | |
AES-128-CFB8 | |
aes-128-cfb8 | |
AES-192-CFB8 | |
aes-192-cfb8 | |
AES-256-CFB8 | |
aes-256-cfb8 | |
DES-CFB1 | |
des-cfb1 | |
DES-CFB8 | |
des-cfb8 | |
DES-EDE3-CFB1 | |
des-ede3-cfb1 | |
DES-EDE3-CFB8 | |
des-ede3-cfb8 | |
street | |
streetAddress | |
postalCode | |
id-ppl | |
proxyCertInfo | |
Proxy Certificate Information | |
id-ppl-anyLanguage | |
Any language | |
id-ppl-inheritAll | |
Inherit all | |
nameConstraints | |
X509v3 Name Constraints | |
id-ppl-independent | |
Independent | |
RSA-SHA256 | |
sha256WithRSAEncryption | |
RSA-SHA384 | |
sha384WithRSAEncryption | |
RSA-SHA512 | |
sha512WithRSAEncryption | |
RSA-SHA224 | |
sha224WithRSAEncryption | |
sha256 | |
sha384 | |
sha512 | |
sha224 | |
identified-organization | |
certicom-arc | |
wap-wsg | |
id-characteristic-two-basis | |
onBasis | |
tpBasis | |
ppBasis | |
c2pnb163v1 | |
c2pnb163v2 | |
c2pnb163v3 | |
c2pnb176v1 | |
c2tnb191v1 | |
c2tnb191v2 | |
c2tnb191v3 | |
c2onb191v4 | |
c2onb191v5 | |
c2pnb208w1 | |
c2tnb239v1 | |
c2tnb239v2 | |
c2tnb239v3 | |
c2onb239v4 | |
c2onb239v5 | |
c2pnb272w1 | |
c2pnb304w1 | |
c2tnb359v1 | |
c2pnb368w1 | |
c2tnb431r1 | |
secp112r1 | |
secp112r2 | |
secp128r1 | |
secp128r2 | |
secp160k1 | |
secp160r1 | |
secp160r2 | |
secp192k1 | |
secp224k1 | |
secp224r1 | |
secp256k1 | |
secp384r1 | |
secp521r1 | |
sect113r1 | |
sect113r2 | |
sect131r1 | |
sect131r2 | |
sect163k1 | |
sect163r1 | |
sect163r2 | |
sect193r1 | |
sect193r2 | |
sect233k1 | |
sect233r1 | |
sect239k1 | |
sect283k1 | |
sect283r1 | |
sect409k1 | |
sect409r1 | |
sect571k1 | |
sect571r1 | |
wap-wsg-idm-ecid-wtls1 | |
wap-wsg-idm-ecid-wtls3 | |
wap-wsg-idm-ecid-wtls4 | |
wap-wsg-idm-ecid-wtls5 | |
wap-wsg-idm-ecid-wtls6 | |
wap-wsg-idm-ecid-wtls7 | |
wap-wsg-idm-ecid-wtls8 | |
wap-wsg-idm-ecid-wtls9 | |
wap-wsg-idm-ecid-wtls10 | |
wap-wsg-idm-ecid-wtls11 | |
wap-wsg-idm-ecid-wtls12 | |
anyPolicy | |
X509v3 Any Policy | |
policyMappings | |
X509v3 Policy Mappings | |
inhibitAnyPolicy | |
X509v3 Inhibit Any Policy | |
Oakley-EC2N-3 | |
ipsec3 | |
Oakley-EC2N-4 | |
ipsec4 | |
camellia-128-cbc | |
CAMELLIA-192-CBC | |
camellia-192-cbc | |
camellia-256-cbc | |
CAMELLIA-128-ECB | |
camellia-128-ecb | |
CAMELLIA-192-ECB | |
camellia-192-ecb | |
CAMELLIA-256-ECB | |
camellia-256-ecb | |
CAMELLIA-128-CFB | |
camellia-128-cfb | |
CAMELLIA-192-CFB | |
camellia-192-cfb | |
CAMELLIA-256-CFB | |
camellia-256-cfb | |
CAMELLIA-128-CFB1 | |
camellia-128-cfb1 | |
CAMELLIA-192-CFB1 | |
camellia-192-cfb1 | |
CAMELLIA-256-CFB1 | |
camellia-256-cfb1 | |
CAMELLIA-128-CFB8 | |
camellia-128-cfb8 | |
CAMELLIA-192-CFB8 | |
camellia-192-cfb8 | |
CAMELLIA-256-CFB8 | |
camellia-256-cfb8 | |
CAMELLIA-128-OFB | |
camellia-128-ofb | |
CAMELLIA-192-OFB | |
camellia-192-ofb | |
CAMELLIA-256-OFB | |
camellia-256-ofb | |
subjectDirectoryAttributes | |
X509v3 Subject Directory Attributes | |
issuingDistributionPoint | |
X509v3 Issuing Distrubution Point | |
certificateIssuer | |
X509v3 Certificate Issuer | |
KISA | |
kisa | |
SEED-ECB | |
seed-ecb | |
seed-cbc | |
SEED-OFB | |
seed-ofb | |
SEED-CFB | |
seed-cfb | |
id-PasswordBasedMAC | |
password based MAC | |
id-DHBasedMac | |
Diffie-Hellman based MAC | |
id-it-suppLangTags | |
caRepository | |
CA Repository | |
id-smime-ct-compressedData | |
id-ct-asciiTextWithCRLF | |
id-aes128-wrap | |
id-aes192-wrap | |
id-aes256-wrap | |
ecdsa-with-Recommended | |
ecdsa-with-Specified | |
ecdsa-with-SHA224 | |
ecdsa-with-SHA256 | |
ecdsa-with-SHA384 | |
ecdsa-with-SHA512 | |
hmacWithMD5 | |
hmacWithSHA224 | |
hmacWithSHA256 | |
hmacWithSHA384 | |
hmacWithSHA512 | |
dsa_with_SHA224 | |
dsa_with_SHA256 | |
whirlpool | |
cryptopro | |
cryptocom | |
id-GostR3411-94-with-GostR3410-2001 | |
GOST R 34.11-94 with GOST R 34.10-2001 | |
id-GostR3411-94-with-GostR3410-94 | |
GOST R 34.11-94 with GOST R 34.10-94 | |
GOST R 34.11-94 | |
id-HMACGostR3411-94 | |
HMAC GOST 34.11-94 | |
GOST R 34.10-2001 | |
GOST R 34.10-94 | |
gost89 | |
GOST 28147-89 | |
GOST 28147-89 MAC | |
prf-gostr3411-94 | |
GOST R 34.11-94 PRF | |
id-GostR3410-2001DH | |
GOST R 34.10-2001 DH | |
id-GostR3410-94DH | |
GOST R 34.10-94 DH | |
id-Gost28147-89-CryptoPro-KeyMeshing | |
id-Gost28147-89-None-KeyMeshing | |
id-GostR3411-94-TestParamSet | |
id-GostR3411-94-CryptoProParamSet | |
id-Gost28147-89-TestParamSet | |
id-Gost28147-89-CryptoPro-A-ParamSet | |
id-Gost28147-89-CryptoPro-B-ParamSet | |
id-Gost28147-89-CryptoPro-C-ParamSet | |
id-Gost28147-89-CryptoPro-D-ParamSet | |
id-Gost28147-89-CryptoPro-Oscar-1-1-ParamSet | |
id-Gost28147-89-CryptoPro-Oscar-1-0-ParamSet | |
id-Gost28147-89-CryptoPro-RIC-1-ParamSet | |
id-GostR3410-94-TestParamSet | |
id-GostR3410-94-CryptoPro-A-ParamSet | |
id-GostR3410-94-CryptoPro-B-ParamSet | |
id-GostR3410-94-CryptoPro-C-ParamSet | |
id-GostR3410-94-CryptoPro-D-ParamSet | |
id-GostR3410-94-CryptoPro-XchA-ParamSet | |
id-GostR3410-94-CryptoPro-XchB-ParamSet | |
id-GostR3410-94-CryptoPro-XchC-ParamSet | |
id-GostR3410-2001-TestParamSet | |
id-GostR3410-2001-CryptoPro-A-ParamSet | |
id-GostR3410-2001-CryptoPro-B-ParamSet | |
id-GostR3410-2001-CryptoPro-C-ParamSet | |
id-GostR3410-2001-CryptoPro-XchA-ParamSet | |
id-GostR3410-2001-CryptoPro-XchB-ParamSet | |
id-GostR3410-94-a | |
id-GostR3410-94-aBis | |
id-GostR3410-94-b | |
id-GostR3410-94-bBis | |
id-Gost28147-89-cc | |
GOST 28147-89 Cryptocom ParamSet | |
gost94cc | |
GOST 34.10-94 Cryptocom | |
gost2001cc | |
GOST 34.10-2001 Cryptocom | |
id-GostR3411-94-with-GostR3410-94-cc | |
GOST R 34.11-94 with GOST R 34.10-94 Cryptocom | |
id-GostR3411-94-with-GostR3410-2001-cc | |
GOST R 34.11-94 with GOST R 34.10-2001 Cryptocom | |
id-GostR3410-2001-ParamSet-cc | |
GOST R 3410-2001 Parameter Set Cryptocom | |
HMAC | |
hmac | |
LocalKeySet | |
Microsoft Local Key set | |
freshestCRL | |
X509v3 Freshest CRL | |
id-on-permanentIdentifier | |
Permanent Identifier | |
searchGuide | |
businessCategory | |
postalAddress | |
postOfficeBox | |
physicalDeliveryOfficeName | |
telephoneNumber | |
telexNumber | |
teletexTerminalIdentifier | |
facsimileTelephoneNumber | |
x121Address | |
internationaliSDNNumber | |
registeredAddress | |
destinationIndicator | |
preferredDeliveryMethod | |
presentationAddress | |
supportedApplicationContext | |
member | |
owner | |
roleOccupant | |
seeAlso | |
userPassword | |
userCertificate | |
cACertificate | |
authorityRevocationList | |
certificateRevocationList | |
crossCertificatePair | |
enhancedSearchGuide | |
protocolInformation | |
distinguishedName | |
uniqueMember | |
houseIdentifier | |
supportedAlgorithms | |
deltaRevocationList | |
dmdName | |
id-alg-PWRI-KEK | |
CMAC | |
cmac | |
aes-128-gcm | |
id-aes128-CCM | |
aes-128-ccm | |
id-aes128-wrap-pad | |
id-aes192-GCM | |
aes-192-gcm | |
id-aes192-CCM | |
aes-192-ccm | |
id-aes192-wrap-pad | |
aes-256-gcm | |
id-aes256-CCM | |
aes-256-ccm | |
id-aes256-wrap-pad | |
AES-128-CTR | |
aes-128-ctr | |
AES-192-CTR | |
aes-192-ctr | |
AES-256-CTR | |
aes-256-ctr | |
id-camellia128-wrap | |
id-camellia192-wrap | |
id-camellia256-wrap | |
anyExtendedKeyUsage | |
Any Extended Key Usage | |
MGF1 | |
mgf1 | |
RSASSA-PSS | |
rsassaPss | |
AES-128-XTS | |
aes-128-xts | |
AES-256-XTS | |
aes-256-xts | |
rc4-hmac-md5 | |
aes-128-cbc-hmac-sha1 | |
AES-192-CBC-HMAC-SHA1 | |
aes-192-cbc-hmac-sha1 | |
aes-256-cbc-hmac-sha1 | |
RSAES-OAEP | |
rsaesOaep | |
obj_lib.c | |
vRQ> | |
8STs | |
LwH' | |
SHA-256 part of OpenSSL 1.0.1p 9 Jul 2015 | |
D7q/;M | |
+Yo, | |
&\8! | |
* qW | |
LwH' | |
L*~e | |
DlSHA-512 part of OpenSSL 1.0.1p 9 Jul 2015 | |
hmac.c | |
j <= (int)sizeof(ctx->key) | |
Big Number part of OpenSSL 1.0.1p 9 Jul 2015 | |
bn_lib.c | |
bn(%d,%d) | |
bn_print.c | |
%09u | |
rsa_lib.c | |
rsa_sign.c | |
signature has problems, re-make with post SSLeay045 | |
RSA_PSS_PARAMS | |
version | |
dmp1 | |
dmq1 | |
iqmp | |
hashAlgorithm | |
maskGenAlgorithm | |
saltLength | |
trailerField | |
buffer.c | |
buf_str.c | |
bio_lib.c | |
memory buffer | |
fopen(' | |
FILE pointer | |
host= | |
bss_conn.c | |
socket connect | |
bf_buff.c | |
buffer | |
b_print.c | |
0123456789abcdef | |
0123456789ABCDEF | |
<NULL> | |
0123456789 | |
doapr() | |
getnameinfo | |
b_sock.c | |
%s:%s | |
%d.%d.%d.%d:%d | |
http | |
telnet | |
socks | |
https | |
gopher | |
service=' | |
getaddrinfo | |
freeaddrinfo | |
port=' | |
stack.c | |
lhash.c | |
err.c | |
int_thread_get (err.c) | |
int_err_get (err.c) | |
lib(%lu) | |
func(%lu) | |
reason(%lu) | |
error:%08lX:%s:%s:%s | |
digest.c | |
ctx->digest->md_size <= EVP_MAX_MD_SIZE | |
evp_enc.c | |
b <= sizeof ctx->final | |
b <= sizeof ctx->buf | |
bl <= (int)sizeof(ctx->buf) | |
ctx->cipher->block_size == 1 || ctx->cipher->block_size == 8 || ctx->cipher->block_size == 16 | |
EVP_CIPHER_CTX_iv_length(ctx) <= (int)sizeof(ctx->iv) | |
e_aes.c | |
%s algorithm "%s" unsupported | |
Private Key | |
p_lib.c | |
Public Key | |
pmeth_lib.c | |
digest | |
pmeth_fn.c | |
a_object.c | |
<INVALID> | |
a_int.c | |
X509_ALGOR | |
X509_ALGORS | |
X509_SIG | |
algor | |
X509_ATTRIBUTE | |
value.set | |
value.single | |
object | |
BIGNUM | |
LONG | |
ZLONG | |
x_name.c | |
X509_NAME_ENTRY | |
X509_NAME_ENTRIES | |
X509_NAME_INTERNAL | |
X509_NAME | |
value | |
RDNS | |
X509_CINF | |
signature | |
issuer | |
validity | |
subject | |
issuerUID | |
subjectUID | |
cert_info | |
sig_alg | |
X509_CERT_AUX | |
X509_CERT_PAIR | |
trust | |
reject | |
keyid | |
other | |
forward | |
reverse | |
tasn_new.c | |
tasn_enc.c | |
Field= | |
, Type= | |
Type= | |
tasn_utl.c | |
ASN1_INTEGER | |
ASN1_ENUMERATED | |
ASN1_BIT_STRING | |
ASN1_OCTET_STRING | |
ASN1_NULL | |
ASN1_OBJECT | |
ASN1_UTF8STRING | |
ASN1_PRINTABLESTRING | |
ASN1_T61STRING | |
ASN1_IA5STRING | |
ASN1_GENERALSTRING | |
ASN1_UTCTIME | |
ASN1_GENERALIZEDTIME | |
ASN1_VISIBLESTRING | |
ASN1_UNIVERSALSTRING | |
ASN1_BMPSTRING | |
ASN1_ANY | |
ASN1_SEQUENCE | |
ASN1_PRINTABLE | |
DISPLAYTEXT | |
DIRECTORYSTRING | |
ASN1_BOOLEAN | |
ASN1_TBOOLEAN | |
ASN1_FBOOLEAN | |
ASN1_OCTET_STRING_NDEF | |
ASN1_SEQUENCE_ANY | |
ASN1_SET_ANY | |
X509_EXTENSION | |
X509_EXTENSIONS | |
critical | |
address= | |
offset= | |
asn1_lib.c | |
0123456789ABCDEF | |
NO X509_NAME | |
x509_vfy.c | |
OPENSSL_ALLOW_PROXY_CERTS | |
x509_lu.c | |
x509_trs.c | |
compatible | |
SSL Client | |
SSL Server | |
S/MIME email | |
Object Signer | |
OCSP responder | |
OCSP request | |
TSA server | |
x509_vpm.c | |
smime_sign | |
OTHERNAME | |
EDIPARTYNAME | |
GENERAL_NAME | |
GENERAL_NAMES | |
type_id | |
nameAssigner | |
partyName | |
d.otherName | |
d.rfc822Name | |
d.dNSName | |
d.x400Address | |
d.directoryName | |
d.ediPartyName | |
d.uniformResourceIdentifier | |
d.iPAddress | |
d.registeredID | |
GeneralNames | |
section= | |
v3_alt.c | |
value= | |
dirName | |
otherName | |
name= | |
othername:<unsupported> | |
X400Name:<unsupported> | |
EdiPartyName:<unsupported> | |
email:%s | |
DNS:%s | |
URI:%s | |
DirName: | |
IP Address:%d.%d.%d.%d | |
IP Address | |
IP Address:<invalid> | |
Registered ID | |
othername | |
<unsupported> | |
X400Name | |
EdiPartyName | |
DirName | |
<invalid> | |
copy | |
move | |
hash | |
always | |
serial | |
Not After: | |
PKEY_USAGE_PERIOD | |
notBefore | |
notAfter | |
Unspecified | |
unspecified | |
Key Compromise | |
keyCompromise | |
CA Compromise | |
CACompromise | |
Affiliation Changed | |
affiliationChanged | |
Superseded | |
superseded | |
Cessation Of Operation | |
cessationOfOperation | |
Certificate Hold | |
certificateHold | |
Remove From CRL | |
removeFromCRL | |
Privilege Withdrawn | |
privilegeWithdrawn | |
AA Compromise | |
AACompromise | |
%*sVersion: %ld (0x%lX) | |
%*sZone: %s, User: | |
SXNETID | |
SXNET | |
zone | |
%*sCPS: %s | |
%*sUser Notice: | |
%*sOrganization: %s | |
%*sNumber%s: | |
%*sExplicit Text: %s | |
%*sUnknown Qualifier: | |
%*sPolicy: | |
Non Critical | |
%*s%s | |
%*sNo Qualifiers | |
section: | |
,name: | |
,value: | |
ia5org | |
policyIdentifier | |
userNotice | |
explicitText | |
organization | |
noticeNumbers | |
CERTIFICATEPOLICIES | |
POLICYINFO | |
POLICYQUALINFO | |
USERNOTICE | |
NOTICEREF | |
policyid | |
qualifiers | |
pqualid | |
noticeref | |
exptext | |
noticenos | |
d.cpsuri | |
d.usernotice | |
d.other | |
%*s%s: | |
<EMPTY> | |
%*sFull Name: | |
%*sRelative Name: | |
%*sOnly User Certificates | |
%*sOnly CA Certificates | |
%*sIndirect CRL | |
Only Some Reasons | |
%*sOnly Attribute Certificates | |
%*s<EMPTY> | |
fullname | |
relativename | |
onlyuser | |
onlyCA | |
onlyAA | |
indirectCRL | |
onlysomereasons | |
CRLissuer | |
Reasons | |
%*sCRL Issuer: | |
DIST_POINT_NAME | |
CRL_DIST_POINTS | |
ISSUING_DIST_POINT | |
Unused | |
unused | |
name.fullname | |
name.relativename | |
distpoint | |
CRLDistributionPoints | |
onlyattr | |
v3_purp.c | |
SSL client | |
sslclient | |
SSL server | |
sslserver | |
Netscape SSL server | |
nssslserver | |
S/MIME signing | |
smimesign | |
S/MIME encryption | |
smimeencrypt | |
CRL signing | |
crlsign | |
Any Purpose | |
OCSP helper | |
ocsphelper | |
Time Stamp signing | |
timestampsign | |
v3_info.c | |
ACCESS_DESCRIPTION | |
AUTHORITY_INFO_ACCESS | |
%*sIssuer: | |
%*scrlUrl: | |
%*scrlNum: | |
%*scrlTime: | |
AUTHORITY_KEYID | |
POLICY_MAPPING | |
POLICY_MAPPINGS | |
issuerDomainPolicy | |
subjectDomainPolicy | |
Require Explicit Policy | |
Inhibit Policy Mapping | |
requireExplicitPolicy | |
inhibitPolicyMapping | |
POLICY_CONSTRAINTS | |
%*s%s: | |
%d.%d.%d.%d/%d.%d.%d.%d | |
Permitted | |
Excluded | |
permitted | |
excluded | |
GENERAL_SUBTREE | |
NAME_CONSTRAINTS | |
base | |
minimum | |
maximum | |
permittedSubtrees | |
excludedSubtrees | |
PROXY_POLICY | |
PROXY_CERT_INFO_EXTENSION | |
policyLanguage | |
pcPathLengthConstraint | |
proxyPolicy | |
pathlen | |
hex: | |
v3_pci.c | |
file: | |
text: | |
%*sPath Length Constraint: | |
infinite | |
%*sPolicy Language: | |
%*sPolicy Text: %s | |
pcy_cache.c | |
pcy_data.c | |
pcy_tree.c | |
OCSP_SIGNATURE | |
OCSP_CERTID | |
OCSP_ONEREQ | |
OCSP_REQINFO | |
OCSP_REQUEST | |
OCSP_RESPBYTES | |
OCSP_RESPONSE | |
OCSP_RESPID | |
OCSP_REVOKEDINFO | |
OCSP_CERTSTATUS | |
OCSP_SINGLERESP | |
OCSP_RESPDATA | |
OCSP_BASICRESP | |
OCSP_CRLID | |
OCSP_SERVICELOC | |
signatureAlgorithm | |
certs | |
issuerNameHash | |
issuerKeyHash | |
reqCert | |
singleRequestExtensions | |
requestorName | |
requestList | |
requestExtensions | |
tbsRequest | |
optionalSignature | |
responseType | |
response | |
responseStatus | |
responseBytes | |
value.byName | |
value.byKey | |
revocationTime | |
revocationReason | |
value.good | |
value.revoked | |
value.unknown | |
certId | |
certStatus | |
thisUpdate | |
nextUpdate | |
singleExtensions | |
responderId | |
producedAt | |
responses | |
responseExtensions | |
tbsResponseData | |
crlUrl | |
crlNum | |
crlTime | |
locator | |
srp_lib.c | |
8192 | |
6144 | |
4096 | |
3072 | |
2048 | |
1536 | |
1024 | |
OpenSSL CMAC method | |
cipher | |
hexkey | |
mem_dbg.c | |
[%02d:%02d:%02d] | |
%5lu file=%s, line=%d, | |
thread=%lu, | |
number=%d, address=%08lX | |
thread=%lu, file=%s, line=%d, info=" | |
%ld bytes leaked in %d chunks | |
hm_ameth.c | |
OpenSSL HMAC method | |
hm_pmeth.c | |
P00` | |
}++V | |
=j&&LZ66lA??~ | |
\44h | |
S11b? | |
e##F^ | |
i''N | |
t,,X. | |
M;;va | |
}{))R> | |
q//^ | |
` @ | |
gK99r | |
U33f | |
D<<x | |
!H88p | |
c!!B0 | |
G==z | |
f""D~**T | |
V22dN::t | |
l$$H | |
Y77n | |
o%%Jr..\$ | |
B>>| | |
_55j | |
x((Pz | |
)w--Z | |
T00`P | |
++V} | |
&&Lj66lZ??~A | |
O44h\ | |
s11bS | |
R##Fe | |
&''Ni | |
,,Xt | |
6-nn | |
;;vM | |
))R{ | |
>//^q | |
, @` | |
99rKJJ | |
33fU | |
<<xD | |
88pH | |
u!!Bc | |
==zGdd | |
2+ss | |
""Df**T~ | |
;22dV::tN | |
$$Hl\\ | |
C77nYmm | |
%%Jo..\r | |
>!KK | |
>>|B | |
55j_WW | |
"3ii | |
((Px | |
--Zw | |
0`P0 | |
g+V}+ | |
&Lj&6lZ6?~A? | |
4h\4 | |
1bS1 | |
#Fe# | |
'Ni' | |
,Xt, | |
R;vM; | |
)R{) | |
/^q/ | |
@` | |
9rK9J | |
M3fU3 | |
P<xD< | |
8pH8 | |
!Bc! | |
~=zG=d | |
"Df"*T~* | |
2dV2:tN: | |
$Hl$\ | |
7nY7m | |
x%Jo%.\r. | |
p>|B> | |
a5j_5W | |
U(Px( | |
-Zw- | |
`P00 | |
ggV}++ | |
Lj&&lZ66~A?? | |
h\44Q | |
bS11*? | |
Fe## | |
Ni'' | |
Xt,,4. | |
RRvM;; | |
R{)) | |
^q// | |
@` | |
rK99 | |
MMfU33 | |
PPxD<<% | |
pH88 | |
Bc!! 0 | |
DD.9 | |
~~zG== | |
]]2+ | |
Df""T~**; | |
dV22tN:: | |
Hl$$ | |
nY77 | |
xxJo%%\r..8$ | |
tt>! | |
pp|B>>q | |
aaj_55 | |
UUPx(( | |
Zw-- | |
~SeA | |
!tI)i | |
k>X' | |
`3QbE | |
pXhH | |
C@gw | |
lNrZ | |
6'9- | |
T[$:.6 | |
ZiKw | |
;f[4~ | |
_TbF~ | |
x&n | |
*1#? | |
h8,4$ | |
2Ht\l | |
QSeA~ | |
!tX)i | |
XhHp | |
NrZl | |
='9-6d | |
:.6$ | |
aiKwZ | |
;fD4~ | |
[v)C | |
cB@" | |
_jbF~T | |
11#?*0 | |
,4$8_@ | |
I<(A | |
t\lHBW | |
QPeA~S | |
0 Umv | |
-!tX | |
SbEwd | |
hHpX | |
Uf*( | |
+2Hp | |
rZlN | |
9-6' | |
\h!T[ | |
.6$:g | |
KwZi | |
[4)C | |
F~Tb | |
#?*1 | |
_[o= | |
>4$8,@ | |
p\lHtW | |
A~Se | |
`3SbE | |
+HpXhE | |
pZlNr | |
-6'9 | |
T6$:. | |
wZiK | |
*"<C | |
[4~C | |
~TbF | |
xYn | |
?*1# | |
fNt7 | |
$8,4 | |
lHt\ | |
BWR j | |
lpHP | |
bn_exp.c | |
bn_ctx.c | |
bn_blind.c | |
bn_mont.c | |
rsa_eay.c | |
Eric Young's PKCS#1 RSA | |
rsa_pk1.c | |
rsa_oaep.c | |
(INVALID PSS PARAMETERS) | |
Hash Algorithm: | |
sha1 (default) | |
Mask Algorithm: | |
with | |
INVALID | |
mgf1 with sha1 (default) | |
Salt Length: 0x | |
14 (default) | |
Trailer Field: 0x | |
BC (default) | |
rsa_ameth.c | |
Private-Key: (%d bit) | |
publicExponent: | |
modulus: | |
Public-Key: (%d bit) | |
Exponent: | |
Modulus: | |
privateExponent: | |
prime1: | |
prime2: | |
exponent1: | |
exponent2: | |
coefficient: | |
OpenSSL RSA method | |
rsa_padding_mode | |
sslv23 | |
none | |
oeap | |
oaep | |
x931 | |
rsa_pss_saltlen | |
rsa_keygen_bits | |
rsa_keygen_pubexp | |
rsa_pmeth.c | |
md_rand.c | |
.................... | |
You need to read the OpenSSL FAQ, http://www.openssl.org/support/faq.html | |
/var/run/egd-pool | |
/dev/egd-pool | |
/etc/egd-pool | |
/etc/entropy | |
/dev/urandom | |
/dev/random | |
/dev/srandom | |
a_bitstr.c | |
a_utctm.c | |
%02d%02d%02d%02d%02d%02dZ | |
a_gentm.c | |
%04d%02d%02d%02d%02d%02dZ | |
ASN1_TIME | |
0123456789ABCDEF | |
\W%08lX | |
\U%04lX | |
\%02X | |
a_strex.c | |
X509_VAL | |
x_pubkey.c | |
X509_PUBKEY | |
public_key | |
x_crl.c | |
X509_REVOKED | |
X509_CRL_INFO | |
X509_CRL | |
revocationDate | |
lastUpdate | |
revoked | |
GMT | |
%s %2d %02d:%02d:%02d %d%s | |
Bad time value | |
%s %2d %02d:%02d:%02d%.*s %d%s | |
%02x%s | |
Subject OCSP hash: | |
t_x509.c | |
Public key OCSP hash: | |
Signature Algorithm: | |
Certificate: | |
Data: | |
%8sVersion: %lu (0x%lx) | |
Serial Number: | |
%s%lu (%s0x%lx) | |
(Negative) | |
%12s%s | |
%02x%c | |
Issuer:%c | |
Validity | |
Not Before: | |
Not After : | |
Subject:%c | |
Subject Public Key Info: | |
%12sPublic Key Algorithm: | |
%12sUnable to load Public Key | |
X509v3 extensions | |
%s 0 | |
%s %s%lu (%s0x%lx) | |
f_int.c | |
f_string.c | |
string= | |
asn1_gen.c | |
Char= | |
tag= | |
ASCII | |
UTF8 | |
BITLIST | |
BOOL | |
BOOLEAN | |
ENUM | |
OBJECT | |
UTCTIME | |
GENERALIZEDTIME | |
GENTIME | |
OCTETSTRING | |
BITSTR | |
BITSTRING | |
UNIVERSALSTRING | |
UNIV | |
IA5STRING | |
UTF8String | |
BMPSTRING | |
VISIBLESTRING | |
VISIBLE | |
PRINTABLESTRING | |
PRINTABLE | |
T61STRING | |
TELETEXSTRING | |
GeneralString | |
GENSTR | |
NUMERIC | |
NUMERICSTRING | |
SEQUENCE | |
EXPLICIT | |
IMPLICIT | |
OCTWRAP | |
SEQWRAP | |
SETWRAP | |
BITWRAP | |
FORMAT | |
%-18s | |
(unknown) | |
Error in encoding | |
%5ld: | |
d=%-2d hl=%ld l=%4ld | |
d=%-2d hl=%ld l=inf | |
prim: | |
cons: | |
priv [ %d ] | |
cont [ %d ] | |
appl [ %d ] | |
<ASN1 %d> | |
length is greater than %ld | |
:BAD OBJECT | |
Bad boolean | |
[HEX DUMP]: | |
BAD INTEGER | |
BAD ENUMERATED | |
BIT STRING | |
OCTET STRING | |
OBJECT DESCRIPTOR | |
EXTERNAL | |
REAL | |
<ASN1 11> | |
UTF8STRING | |
<ASN1 13> | |
<ASN1 14> | |
<ASN1 15> | |
VIDEOTEXSTRING | |
GRAPHICSTRING | |
GENERALSTRING | |
<ASN1 29> | |
BASIC_CONSTRAINTS | |
Object Signing | |
objsign | |
reserved | |
SSL CA | |
sslCA | |
S/MIME CA | |
emailCA | |
Object Signing CA | |
objCA | |
Digital Signature | |
digitalSignature | |
Non Repudiation | |
nonRepudiation | |
Key Encipherment | |
keyEncipherment | |
Data Encipherment | |
dataEncipherment | |
Key Agreement | |
keyAgreement | |
Certificate Sign | |
keyCertSign | |
CRL Sign | |
cRLSign | |
Encipher Only | |
encipherOnly | |
Decipher Only | |
decipherOnly | |
EXTENDED_KEY_USAGE | |
v3_ia5.c | |
0123456789ABCDEF | |
v3_utl.c | |
TRUE | |
FALSE | |
pcy_node.c | |
cmac.c | |
bn_rand.c | |
rsa_saos.c | |
rsa_pss.c | |
'()+,-./:=? | |
a_mbstr.c | |
minsize= | |
maxsize= | |
# % + / 5 C I M O U Y _ k q w | |
' ) - 3 G M Q _ c e i w } | |
!5!A!I!O!Y![!_!s!}! | |
"!"%"+"1"9"K"O"c"g"s"u" | |
#'#)#/#3#5#E#Q#S#Y#c#k# | |
$)$=$A$C$M$_$g$k$y$}$ | |
%'%1%=%C%K%O%s% | |
&'&)&5&;&?&K&S&Y&e&i&o&{& | |
'5'7'M'S'U'_'k'm's'w' | |
(!(1(=(?(I(Q([(](a(g(u( | |
)!)#)?)G)])e)i)o)u) | |
*%*/*O*U*_*e*k*m*s* | |
+'+1+3+=+?+K+O+U+i+m+o+{+ | |
,#,/,5,9,A,W,Y,i,w, | |
-;-C-I-M-a-e-q- | |
.%.-.3.7.9.?.W.[.o.y. | |
/'/)/A/E/K/M/Q/W/o/u/}/ | |
0#0)070;0U0Y0[0g0q0y0}0 | |
1!1'1-191C1E1K1]1a1g1m1s1 | |
2)252Y2]2c2k2o2u2w2{2 | |
3%3+3/353A3G3[3_3g3k3s3y3 | |
474E4U4W4c4i4m4 | |
5-535;5A5Q5e5o5q5w5{5}5 | |
6#6165676;6M6O6S6Y6a6k6m6 | |
7?7E7I7O7]7a7u7 | |
8!83858A8G8K8S8W8_8e8o8q8}8 | |
9#9%9)9/9=9A9M9[9k9y9}9 | |
:':+:1:K:Q:[:c:g:m:y: | |
;!;#;-;9;E;S;Y;_;q;{; | |
<)<5<C<O<S<[<e<k<q< | |
=!=-=3=7=?=C=o=s=u=y={= | |
>#>)>/>3>A>W>c>e>w> | |
?7?;?=?A?Y?_?e?g?y?}? | |
@!@%@+@1@?@C@E@]@a@g@m@ | |
A!A3A5A;A?AYAeAkAwA{A | |
B#B)B/BCBSBUB[BaBsB}B | |
C%C'C3C7C9COCWCiC | |
D#D)D;D?DEDKDQDSDYDeDoD | |
E+E1EAEIESEUEaEwE}E | |
EOnvif_ResetLinkState | |
Onvif_DeInit | |
net_get_hwaddr | |
Onvif_Init | |
Onvif_StopRequest | |
__tptz10__GotoPreset | |
__tptz10__SetPreset | |
__tptz__GotoPreset | |
__tptz__RemovePreset | |
__timg__Stop | |
__timg__Move | |
__tptz10__GetPresets | |
__tptz__SetPreset | |
__tptz__GetPresets | |
__tptz__CreatePresetTour | |
__tptz__GetPresetTourOptions | |
__tptz__GetPresetTours | |
__trt__GetAudioEncoderConfigurationOptions | |
__trt__GetAudioSourceConfigurationOptions | |
__trt__GetVideoSourceConfigurationOptions | |
__tptz__RemovePresetTour | |
__tptz__OperatePresetTour | |
__tptz__ModifyPresetTour | |
__tptz__GetPresetTour | |
__tds__SetNetworkDefaultGateway | |
__trt__GetVideoEncoderConfigurationOptions | |
__trt__SetVideoEncoderConfiguration | |
__trt__GetVideoSources | |
__tmd__GetVideoSources | |
__timg10__GetImagingSettings | |
__timg__GetImagingSettings | |
__timg10__GetOptions | |
__timg__GetOptions | |
__timg10__SetImagingSettings | |
__timg__SetImagingSettings | |
ParseTimeZone | |
__tds__SetSystemDateAndTime | |
checkdev | |
send_bye | |
Onvif_Server | |
probe_process | |
code_convert | |
__tds__GetScopes | |
StartProbeThread | |
send_hello | |
onvif_alarm | |
**********%s******************* | |
Unregister onvif module~! | |
%s uninit second times! | |
get_ip_addr: invalid argument! | |
%s %d, socket error | |
%s %d, ioctl SIOCGIFHWADDR error! | |
%08x-%04x-%04x-%02x%02x-%02x%02x%02x%02x%02x%02x | |
http://www.onvif.org/ver10/tev/topicExpression/ConcreteSet | |
tns1:RuleEngine/CellMotionDetector/Motion | |
enable motion alarm! | |
http://docs.oasis-open.org/wsn/t-1/TopicExpression/Concrete | |
tns1:Device/Trigger/DigitalInput | |
enable io alarm! | |
tns1:VideoAnalytics/tns1:MotionDetection/ | |
tns1:VideoAnalytics/tns1:FaceDetection/ | |
@Name | |
@Name= | |
%s %d, dms_sysnetapi_ioctrl DMS_NET_GET_DEVICECFG failed! | |
%s %d, dms_sysnetapi_open failed! | |
onvif | |
Onvif Module Build:%s %s | |
Jan 15 2016 | |
18:04:46 | |
%s ======PTZ stop====== | |
urn:uuid:1419d68a-1dd2-11b2-a105-%02X%02X%02X%02X%02X%02X | |
__ns6__Notify | |
G711 | |
user%d | |
PT1Y | |
AudioEncoderConfiguration%d | |
PT30M | |
AudioSourceConfiguration%d | |
AudioSource%d | |
Anv_ptz_%d | |
http://www.onvif.org/ver10/tptz/PanTiltSpaces/VelocitySpaceDegrees | |
http://www.onvif.org/ver10/tptz/ZoomSpaces/VelocitySpaceMillimeter | |
PT1S | |
http://www.onvif.org/ver10/tptz/PanTiltSpaces/VelocityGenericSpace | |
http://www.onvif.org/ver10/tptz/ZoomSpaces/VelocityGenericSpace | |
http://www.onvif.org/ver10/tptz/PanTiltSpaces/PositionGenericSpace | |
http://www.onvif.org/ver10/tptz/ZoomSpaces/PositionGenericSpace | |
do_i0 | |
PT%dS | |
192.168.1.168 | |
http://%s:%d/onvif/Analytics | |
http://%s/onvif/Analytics | |
http://%s:%d/onvif/device_service | |
http://%s/onvif/device_service | |
http://%s:%d/onvif/Media | |
http://%s/onvif/Media | |
http://%s:%d/onvif/Events | |
http://%s/onvif/Events | |
http://%s:%d/onvif/Imaging | |
http://%s/onvif/Imaging | |
http://%s:%d/onvif/PTZ | |
http://%s/onvif/PTZ | |
no log | |
curtime is %d-%d-%d:%d-%d-%d utc time is %d-%d-%d:%d-%d-%d | |
getsystem datetime:%s | |
SOAP-ENV:Sender | |
ter:InvalidArgVal | |
CreateRules is not supported | |
SOAP-ENV:Receiver | |
ter:Action | |
ter:NoProfile | |
Not supported. | |
ter:ConfigurationToken | |
The ConfigurationToken is error. | |
invalid | |
ter:ConfigModify | |
The ConfigurationToken error | |
ter:NoConfig | |
The requested configuration does not exist. | |
token is %s | |
AudioSource | |
The Set VideoSourceConfiguration error | |
ter:ProfileToken | |
The ProfileToken is NULL | |
axxon | |
profile | |
The requested profile does not exist. | |
00======PTZ stop====== | |
pantilt x:%f y:%f | |
Zoom X:%f | |
======PTZ stop====== | |
======PTZ RIGHT====== | |
======PTZ up====== | |
======PTZ right====== | |
======PTZ down====== | |
======PTZ left====== | |
Zoom x:%f | |
Zoom ++++++++ | |
Zoom -------- | |
ter:InvalidVelocity | |
The requested velocity is out of bounds. | |
ProfileToken is NULL! | |
ter:NoToken | |
%s DMS_NET_CMD_PTZ_CONTROL error!ret=%d | |
%s DMS_NET_GET_ALL_PRESET error!ret=%d | |
%s ,cannot set more preset! | |
preset%d | |
Set preset, point:%d, name:%s | |
pantilt x:%f y:%f, x=%f y=%f, a=%d, b=%d | |
Zoom x:%f, y:%f | |
ter:CannotOverwriteHome | |
set homepositon not support | |
The configuration does not exist. | |
Anv_ptz_ | |
The configuration token is invalid. | |
run here! | |
The requested preset token does not exist. | |
ch is %d | |
nodenum is %d | |
remove node is %d cur node is %d | |
%s %d, remove preset:%d | |
VideoSource | |
ter:NoSource | |
The requested VideoSource does not exist. | |
%s, Focus mode:Continuous speed:%f | |
ter:NoImagingForSource | |
The requested VideoSource does not support imaging settings. | |
%s, DMS_NET_CMD_PTZ_CONTROL error!ret=%d | |
ter:ServiceNotSupported | |
ter:DynamicDNSNotSupported | |
ter:UsernameMissing | |
username is not existing. | |
ter:OperationProhibited | |
ter:UsernameClash | |
username is existing. | |
onvif://www.onvif.org/ | |
type/ | |
hardware/ | |
ter:ScopeOverwrite | |
Trying overwriting permanent device scope setting | |
%d %s %s | |
chno is %d | |
ter:NoVideoSource | |
VideoSourceConfiguration%d | |
VideoSource%d | |
PT3M | |
PT30S | |
ter:NoEntity | |
No such PTZNode on the device . | |
http://www.onvif.org/ver10/tptz/PanTiltSpaces/SpeedSpaceDegrees | |
http://www.onvif.org/ver10/tptz/ZoomSpaces/SpeedSpaceMillimeter | |
%s presetNum=%d | |
http://www.onvif.org/ver10/tptz/PanTiltSpaces/VelocitySpaceFOV | |
%s dms:% error!ret=%d | |
%s, DMS_NET_GET_CRUISE_CFG failed! | |
tour%d | |
ter:TooManyPresetTours | |
There is not enough space in the device to create the new preset tour to the profile | |
%s, DMS_NET_SET_CRUISE_INFO failed! | |
PT60S | |
%s DMS_NET_GET_CRUISE_CFG error!ret=%d | |
onvif/Subscription?Idx= | |
id is %d | |
http://www.w3.org/2005/08/addressing/soap/fault | |
ter:InvalidFilterFaultType | |
get system config failed | |
is clear! | |
onvif/Pull?Idx= | |
%d is clear! | |
http://docs.oasis-open.org/wsn/bw-2/SubscriptionManager/UnsubscribeResponse | |
http://www.onvif.org/ver10/events/wsdl/EventPortType/GetEventPropertiesResponse | |
http://www.onvif.org/onvif/ver10/topics/topicns.xml | |
<tns1:RuleEngine wstop:topic="true"><CellMotionDetector wstop:topic="true"><Motion wstop:topic="true"><tt:MessageDescription IsProperty="true"><tt:Source><tt:SimpleItemDescription Name="VideoSourceConfigurationToken" Type="tt:ReferenceToken"/><tt:SimpleItemDescription Name="VideoAnalyticsConfigurationToken" Type="tt:ReferenceToken"/><tt:SimpleItemDescription Name="Rule" Type="xs:string"/></tt:Source><tt:Data><tt:SimpleItemDescription Name="IsMotion" Type="xs:boolean"/></tt:Data></tt:MessageDescription></Motion></CellMotionDetector></tns1:RuleEngine><tns1:Device wstop:topic="true"><Trigger wstop:topic="true"><DigitalInput wstop:topic="true"><tt:MessageDescription IsProperty="true"><tt:Source><tt:SimpleItemDescription Name="InputToken" Type="tt:ReferanceToken"/></tt:Source><tt:Data><tt:SimpleItemDescription Name="LogicalState" Type="xs:boolean"/></tt:Data></tt:MessageDescription></DigitalInput></Trigger></tns1:Device> | |
http://www.onvif.org/ver10/tev/messageContentFilter/ItemFilter | |
http://www.onvif.org/ver10/schema/onvif.xsd | |
http://www.onvif.org/ver10/events/wsdl/EventPortType/GetServiceCapabilities | |
http://www.onvif.org/ver10/events/wsdl/PullPointSubscription/SetSynchronizationPointResponse | |
The ConfigurationToken is NULL. | |
nothing | |
www.onvif.org/ver20/HalfDuplex/Auto | |
DigitInputToken0 | |
http://www.onvif.org/ | |
PT50S | |
***system reboot*** | |
http://www.onvif.org/ver10/device/wsdl | |
http://www.onvif.org/ver10/media/wsdl | |
http://www.onvif.org/ver10/events/wsdl | |
http://www.onvif.org/ver20/ptz/wsdl | |
http://www.onvif.org/ver20/imaging/wsdl | |
http://www.onvif.org/ver10/deviceIO/wsdl | |
http://www.onvif.org/ver20/analytics/wsdl | |
http://%s:%d/onvif | |
%s/device_service | |
%s/Media | |
%s/onvif/Events | |
%s/onvif/PTZ | |
%s/Imaging | |
%s/DeviceIO | |
%s/Analytics | |
<tds:Capabilities><tds:Network NTP="1" HostnameFromDHCP="false" Dot11Configuration="false" DynDNS="true" IPVersion6="false" ZeroConfiguration="false" IPFilter="false"></tds:Network><tds:Security RELToken="false" HttpDigest="false" UsernameToken="true" KerberosToken="false" SAMLToken="false" X.509Token="false" RemoteUserHandling="false" Dot1X="false" DefaultAccessPolicy="false" AccessPolicyConfig="false" OnboardKeyGeneration="false" TLS1.2="false" TLS1.1="false" TLS1.0="false"></tds:Security><tds:System HttpSupportInformation="false" HttpSystemLogging="true" HttpSystemBackup="true" HttpFirmwareUpgrade="true" FirmwareUpgrade="false" SystemLogging="false" SystemBackup="false" RemoteDiscovery="false" DiscoveryBye="true" DiscoveryResolve="false"></tds:System></tds:Capabilities> | |
<trt:Capabilities SnapshotUri="true" Rotation="false" OSD="true"><trt:ProfileCapabilities MaximumNumberOfProfiles="%d"></trt:ProfileCapabilities><trt:StreamingCapabilities RTPMulticast="false" RTP_TCP="true" RTP_RTSP_TCP="true" NonAggregateControl="false"></trt:StreamingCapabilities></trt:Capabilities> | |
<tev:Capabilities WSSubscriptionPolicySupport="true" WSPullPointSupport="true" WSPausableSubscriptionManagerInterfaceSupport="false" MaxNotificationProducers="10" MaxPullPoints="10"></tev:Capabilities> | |
<tptz:Capabilities tt:EFlip="false" tt:Reverse="false"></tptz:Capabilities> | |
<timg:Capabilities ImageStabilization="false"></timg:Capabilities> | |
<tmd:Capabilities VideoSources="1" VideoOutputs="0" AudioSources="1" AudioOutputs="1" RelayOutputs="1" DigitalInputs="1" SerialPorts="0"></tmd:Capabilities> | |
<tan:Capabilities RuleSupport="true" AnalyticsModuleSupport="true" CellBasedSceneDescriptionSupported="true"/> | |
http://%s:%d/onvif/DeviceIO | |
http://%s/onvif/DeviceIO | |
ter:ActionNotSupported | |
ter:NoSuchService | |
The matching rule specified is not supported | |
VideoAnalyticsToken | |
VideoAnalyticsToken%d | |
MyCellMotionModule | |
tt:CellMotionEngine | |
Sensitivity | |
Value = %d | |
Set motion flag is %lu | |
save motion para failed! | |
<tt:CellLayout Columns="22" Rows="18"><tt:Transformation><tt:Translate x="-1.000000" y="-1.000000"/><tt:Scale x="0.001953" y="0.002604"/></tt:Transformation></tt:CellLayout> | |
http://www.w3.org/2001/XMLSchema | |
xs:integer | |
tt:CellLayout | |
VideoSourceConfigurationToken | |
tt:ReferenceToken | |
VideoAnalyticsConfigurationToken | |
xs:string | |
IsMotion | |
xs:boolean | |
tt:CellMotionDetector | |
MinCount | |
AlarmOnDelay | |
AlarmOffDelay | |
ActiveCells | |
xs:base64Binary | |
The ProfileToken is NULL. | |
profile%d_%d | |
The media profile does not exist. | |
http://%s:%d/cgi-bin/anv/images_cgi?channel=%d&user=%s&pwd=%s | |
The ProfileToken is not existing | |
%s configuration does not exist! | |
The ConfigurationToken is NULL. | |
token is %s*******************%s | |
VideoEncoderConfiguration%d_%d | |
ter:CreateProfile | |
The CreateProfile Name is NULL | |
ter:ProfileExists | |
The profile is already exists. | |
AudioSourceConfiguration0 | |
AudioEncoderConfiguration0 | |
VideoSourceConfiguration0 | |
VideoEncoderConfiguration0_0 | |
%s, Invalid PresetTourToken! | |
The requested PresetTourToken does not exist. | |
ter:ActivationFailed | |
The requested operation is not supported. | |
%s DMS_NET_CMD_PTZ_CONTROL failed! | |
%s, Invalid parameter! | |
%s, Too many TourSpots are included in the PresetTour!num:%d | |
ter:TooManyPresets | |
Too many TourSpots are included in the PresetTour. | |
%s, Invalid TourSpots type! | |
ter:InvalidPresetTour | |
The suggested PresetTour includes invalid parameter(s) | |
%s, Invalid PresetNo:%d! | |
ter:InvalidGatewayAddress | |
The suggested IPv4 address is invalid. | |
ter:InvalidNetworkInterface | |
The supplied network interface token does not exists. | |
ter:InvalidIPv4Address | |
###### __tds__SetNetworkInterfaces ip:%s | |
hwaddr error. | |
HWaddr: %02X:%02X:%02X:%02X:%02X:%02X | |
%d-%d-%dT%d:%d:%dZ | |
ter:ResourceUnknownFaultType | |
NoSubscribe | |
http://docs.oasis-open.org/wsn/bw-2/SubscriptionManager/RenewResponse | |
http://www.onvif.org/ver10/events/wsdl/PullPointSubscription/PullMessagesResponse | |
/onvif/Pull?Idx= | |
Initialized | |
<tt:Message UtcTime="%d-%02d-%02dT%02d:%02d:%02dZ" PropertyOperation="%s"><tt:Source><tt:SimpleItem Name="VideoSourceConfigurationToken" Value="VideoSourceConfiguration%d"/><tt:SimpleItem Name="VideoAnalyticsConfigurationToken" Value="VideoAnalyticsToken%d"/><tt:SimpleItem Name="Rule" Value="MyMotionDetectorRule"/></tt:Source><tt:Data><tt:SimpleItem Name="IsMotion" Value="%s"/></tt:Data></tt:Message> | |
<tt:Message UtcTime="%d-%02d-%02dT%02d:%02d:%02dZ" PropertyOperation="%s"><tt:Source><tt:SimpleItem Name="InputToken" Value="VideoSourceConfiguration%d"/></tt:Source><tt:Data><tt:SimpleItem Name="LogicalState" Value="%s"/></tt:Data></tt:Message> | |
rtsp://%s/ROH/channel/%d%d | |
rtsp://%s:%d/ucast/%d%d | |
rtsp://%s:%d/mcast/%d%d | |
%s:%d set para failed! | |
%s:%d get support message para failed! | |
111set width:%d height:%d | |
Parameters can not be set. | |
set width:%d height:%d | |
The configuration parameters are not possible to set. | |
get video encodertype is %d | |
%s get_color_param error! ret=%d | |
InvalidPosition | |
The postion is invalid. | |
%s get_color_param_range error! ret=%d | |
%s set_color_param error! ret=%d | |
ter:SettingsInvalid | |
The requested configuration not supported. | |
ter:RelayToken | |
error relay token | |
64.4.10.33 | |
ter:InvalidHostname | |
The requested hostname cannot be accepted by the NVT. | |
(none) | |
ter:InvalidTimeZone | |
time zone null | |
time zone:%s | |
setsystem datetime:%s | |
IDLW | |
AHST | |
HAST | |
MEWT | |
MESZ | |
WETDST | |
MEST | |
CETDST | |
METDST | |
EETDST | |
AWST | |
CST-8 | |
AWSST | |
EAST | |
LIGT | |
AESST | |
IDLE | |
NZST | |
%s %d, unknow time zone : %s | |
GMT%d:%d | |
%s %d, unknow time zone name: %s | |
the matching rule specified is not supported | |
close ntp! | |
check date time failed! | |
ter:InvalidDateTime | |
An invalid date or time was specified. | |
timezone error!tz_hour=%d, tz_min=%d | |
IPC-F13P | |
IPC-F20M | |
IPC-F10P | |
1419d68a-1dd2-11b2-a105-%02X%02X%02X%02X%02X%02X | |
Cannot get control socket, errno:%d, %s | |
%s ioctl error %d %s | |
send bye! | |
has been send bye! | |
%02x%02x%02x%02x-%02x%02x-4adf-8702-%02x%02x%02x%02x%02x%02x | |
<?xml version="1.0" encoding="UTF-8" ?><SOAP-ENV:Envelope xmlns:SOAP-ENV="http://www.w3.org/2003/05/soap-envelope" xmlns:SOAP-ENC="http://www.w3.org/2003/05/soap-encoding" xmlns:wsa="http://schemas.xmlsoap.org/ws/2004/08/addressing" xmlns:d="http://schemas.xmlsoap.org/ws/2005/04/discovery" xmlns:dn="http://www.onvif.org/ver10/network/wsdl"><SOAP-ENV:Header><wsa:Action>http://schemas.xmlsoap.org/ws/2005/04/discovery/Bye</wsa:Action><wsa:MessageID>uuid:%s</wsa:MessageID><wsa:To>urn:schemas-xmlsoap-org:ws:2005:04:discovery</wsa:To></SOAP-ENV:Header><SOAP-ENV:Body><d:Bye><wsa:EndpointReference><wsa:Address>urn:uuid:%s</wsa:Address></wsa:EndpointReference></d:Bye></SOAP-ENV:Body></SOAP-ENV:Envelope> | |
Creatingsocket failed. | |
%s %d, sendto error! errno: %d, %s | |
:Envelope> | |
%s, Invalid http content-length:%d.In fact we received %d bytes | |
have not the string in content | |
%s, Invalid method type :%d | |
Probe> | |
xmlns | |
http://schemas.xmlsoap.org/ws/2004/08/addressing" | |
uuid: | |
MatchBy | |
http://schemas.xmlsoap.org/ws/2005/04/discovery/ | |
onvif://www.onvif.org | |
hardware | |
onvif://www.onvif.org/%s | |
<?xml version="1.0" encoding="UTF-8"?><SOAP-ENV:Envelope xmlns:SOAP-ENV="http://www.w3.org/2003/05/soap-envelope" xmlns:SOAP-ENC="http://www.w3.org/2003/05/soap-encoding" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns:wsa="http://schemas.xmlsoap.org/ws/2004/08/addressing" xmlns:d="http://schemas.xmlsoap.org/ws/2005/04/discovery" xmlns:dn="http://www.onvif.org/ver10/network/wsdl"><SOAP-ENV:Header> | |
<wsa:MessageID>uuid:%s</wsa:MessageID> | |
<wsa:RelatesTo>%s</wsa:RelatesTo> | |
<wsa:To>http://schemas.xmlsoap.org/ws/2004/08/addressing/role/anonymous</wsa:To> | |
<wsa:Action>http://schemas.xmlsoap.org/ws/2005/04/discovery/ProbeMatches</wsa:Action> | |
</SOAP-ENV:Header> | |
<SOAP-ENV:Body> | |
<d:ProbeMatches> | |
<d:ProbeMatch> | |
<wsa:EndpointReference> | |
<wsa:Address>urn:uuid:%s</wsa:Address> | |
</wsa:EndpointReference> | |
<d:Types>dn:NetworkVideoTransmitter</d:Types> | |
<d:Scopes> | |
onvif://www.onvif.org/type/video_encoder | |
onvif://www.onvif.org/type/audio_encoder | |
onvif://www.onvif.org/type/ptz | |
onvif://www.onvif.org/hardware/IPCAM | |
onvif://www.onvif.org/Profile/Streaming | |
onvif://www.onvif.org/type/network_video_transmitter | |
onvif://www.onvif.org/name/%s %s | |
</d:Scopes> | |
<d:XAddrs>http://%s/onvif/device_service</d:XAddrs> | |
<d:XAddrs>http://%s:%d/onvif/device_service</d:XAddrs> | |
<d:MetadataVersion>1</d:MetadataVersion> | |
</d:ProbeMatch> | |
</d:ProbeMatches> | |
</SOAP-ENV:Body> | |
</SOAP-ENV:Envelope> | |
Creating reply socket failed. | |
%s %d, %s reply_sock=%d, errno: %d, %s | |
iconv_err:%d | |
#### %s %d, pout:%s, outlen=%d | |
get osdinfo failed! | |
set scopes:%s | |
onvif://www.onvif.org/type/audio_encoder | |
onvif://www.onvif.org/type/ptz | |
onvif://www.onvif.org/hardware/IPCAM | |
#### %s %d, %s-%s, %d-%d | |
onvif://www.onvif.org/name/%s | |
onvif://www.onvif.org/Profile/Streaming | |
onvif://www.onvif.org/%s | |
%s: link state changed.please wait... | |
route add -net 224.0.0.0 netmask 240.0.0.0 eth0 | |
route add -net 224.0.0.0 netmask 240.0.0.0 ra0 | |
<?xml version="1.0" encoding="UTF-8"?><env:Envelope xmlns:env="http://www.w3.org/2003/05/soap-envelope" xmlns:tds="http://www.onvif.org/ver10/device/wsdl" xmlns:dn="http://www.onvif.org/ver10/network/wsdl" xmlns:d="http://schemas.xmlsoap.org/ws/2005/04/discovery" xmlns:wsadis="http://schemas.xmlsoap.org/ws/2004/08/addressing" xmlns:wsa="http://www.w3.org/2005/08/addressing"><env:Header><wsadis:MessageID>uuid:%s</wsadis:MessageID><wsadis:To>urn:schemas-xmlsoap-org:ws:2005:04:discovery</wsadis:To><wsadis:Action>http://schemas.xmlsoap.org/ws/2005/04/discovery/Hello</wsadis:Action></env:Header><env:Body><d:Hello><wsadis:EndpointReference><wsadis:Address>urn:uuid:%s</wsadis:Address></wsadis:EndpointReference><d:Types>dn:NetworkVideoTransmitter tds:Device</d:Types><d:Scopes>onvif://www.onvif.org/type/video_encoder onvif://www.onvif.org/type/audio_encoder onvif://www.onvif.org/type/ptz onvif://www.onvif.org/hardware/IPCAM onvif://www.onvif.org/Profile/Streaming onvif://www.onvif.org/name/%s onvif://www.onvif.org/type/network_video_transmitter %s</d:Scopes><d:XAddrs>http://%s:%d/onvif/device_service</d:XAddrs><d:MetadataVersion>1</d:MetadataVersion></d:Hello></env:Body></env:Envelope> | |
#### %s %d, interfacename:%s, ipaddr:%s | |
new sockfd is %d | |
recv error! | |
no response! | |
Bind()error. | |
%s %d, setsockopt error!err:%s(%d) | |
setsockopt:IP_ADD_MEMBERSHIP | |
probe thread select | |
scokfd is %d | |
%s %d, recvfrom error: %s(%d) | |
invalid filter fault | |
ter:InvalidTerminationTime | |
ter:OutOfMemory | |
get node is %d %X %X | |
subscibe id is %d notify id is %d | |
find a id %d | |
address is %s | |
http://%s:60987/onvif/Subscription?Idx=%d | |
http://docs.oasis-open.org/wsn/bw-2/NotificationProducer/SubscribeResponse | |
pull id%d is timeout!!! | |
time out is %s | |
http://%s:60987/onvif/Pull?Idx=%u | |
http://www.onvif.org/ver10/events/wsdl/EventPortType/CreatePullPointSubscriptionResponse | |
token is %s %s | |
ch = %d | |
ch = %d index = %d | |
MyMotionDetectorRule | |
1000 | |
AudioEncoderConfiguration ch = %d | |
VideoSourceConfiguration ch = %d | |
Getrules token is %s | |
ter:InvalidRule | |
No such rule | |
base64 encode string is %s | |
unpacked RLE data would overflow row (run) | |
unpacked RLE data would overflow row (copy) | |
not enough RLE data for row | |
%02X | |
*************************** | |
open %s Error! | |
path = %s | |
<?xml version="1.0" encoding="UTF-8"?> | |
<SOAP-ENV:Envelope xmlns:SOAP-ENV="http://www.w3.org/2003/05/soap-envelope" xmlns:SOAP-ENC="http://schemas.xmlsoap.org/soap/encoding/" xmlns:tt="http://www.onvif.org/ver10/schema" xmlns:wsnt="http://docs.oasis-open.org/wsn/b-2" xmlns:wsa="http://www.w3.org/2005/08/addressing" xmlns:tns1="http://www.onvif.org/ver10/topics"><SOAP-ENV:Header><wsa:To SOAP-ENV:mustUnderstand="true">%s</wsa:To><wsa:Action>http://docs.oasis-open.org/wsn/bw-2/NotificationConsumer/Notify</wsa:Action></SOAP-ENV:Header><SOAP-ENV:Body><wsnt:Notify> | |
<wsnt:NotificationMessage><wsnt:Topic Dialect="http://www.onvif.org/ver10/tev/topicExpression/ConcreteSet">tns1:RuleEngine/CellMotionDetector/Motion</wsnt:Topic><wsnt:Message><tt:Message UtcTime="%04d-%02d-%02dT%02d:%02d:%02dZ" PropertyOperation="%s"><tt:Source><tt:SimpleItem Name="VideoSourceConfigurationToken" Value="VideoSourceConfiguration%d"/><tt:SimpleItem Name="VideoAnalyticsConfigurationToken" Value="VideoAnalyticsToken%d"/><tt:SimpleItem Name="Rule" Value="MyMotionDetectorRule"/></tt:Source><tt:Data><tt:SimpleItem Name="IsMotion" Value="%s"/></tt:Data></tt:Message></wsnt:Message></wsnt:NotificationMessage> | |
<wsnt:NotificationMessage><wsnt:Topic Dialect="http://docs.oasis-open.org/wsn/t-1/TopicExpression/Concrete">tns1:Device/Trigger/DigitalInput</wsnt:Topic><wsnt:Message><tt:Message UtcTime="%04d-%02d-%02dT%02d:%02d:%02dZ" PropertyOperation="%s"><tt:Source><tt:SimpleItem Name="InputToken" Value="DigitInputToken0"/></tt:Source><tt:Data><tt:SimpleItem Name="LogicalState" Value="%s"/></tt:Data></tt:Message></wsnt:Message></wsnt:NotificationMessage> | |
</wsnt:Notify></SOAP-ENV:Body></SOAP-ENV:Envelope> | |
POST /%s HTTP/1.1 | |
POST / HTTP/1.1 | |
Host: %s:%d | |
User-Agent: gSOAP/2.8 | |
Content-Type: application/soap+xml; charset=utf-8; action="http://docs.oasis-open.org/wsn/bw-2/NotificationConsumer/Notify" | |
Content-Length: %d | |
timeout | |
open socket failed! | |
listen failed! | |
id%d is timeout!!! | |
Post Alarm start | |
Post Alarm end | |
SOAP-ENV | |
http://www.w3.org/2003/05/soap-envelope | |
http://www.w3.org/*/soap-envelope | |
SOAP-ENC | |
http://schemas.xmlsoap.org/soap/encoding/ | |
http://www.w3.org/*/soap-encoding | |
http://www.w3.org/2001/XMLSchema-instance | |
http://www.w3.org/*/XMLSchema-instance | |
http://www.w3.org/*/XMLSchema | |
http://www.w3.org/2004/08/xop/include | |
http://www.onvif.org/ver10/schema | |
xmime | |
http://www.w3.org/2005/05/xmlmime | |
http://www.w3.org/2005/08/addressing | |
wsse | |
http://docs.oasis-open.org/wss/2004/01/oasis-200401-wss-wssecurity-secext-1.0.xsd | |
http://docs.oasis-open.org/wss/2004/01/oasis-200401-wss-wssecurity-utility-1.0.xsd | |
wstop | |
http://docs.oasis-open.org/wsn/t-1 | |
http://schemas.xmlsoap.org/ws/2005/04/discovery | |
wsadis | |
http://schemas.xmlsoap.org/ws/2004/08/addressing | |
wsrf | |
http://docs.oasis-open.org/wsrf/r-2 | |
ns10 | |
http://www.onvif.org/ver10/events/wsdl/PullPointBinding | |
ns11 | |
http://www.onvif.org/ver10/events/wsdl/CreatePullPointBinding | |
ns12 | |
http://www.onvif.org/ver10/events/wsdl/PausableSubscriptionManagerBinding | |
ns13 | |
http://www.onvif.org/ver10/network/wsdl/RemoteDiscoveryBinding | |
ns14 | |
http://www.onvif.org/ver10/network/wsdl/DiscoveryLookupBinding | |
http://www.onvif.org/ver10/network/wsdl | |
http://www.onvif.org/ver20/analytics/wsdl/RuleEngineBinding | |
http://www.onvif.org/ver20/analytics/wsdl/AnalyticsEngineBinding | |
tan10 | |
http://www.onvif.org/ver10/analytics/wsdl | |
http://www.onvif.org/ver10/events/wsdl/PullPointSubscriptionBinding | |
http://www.onvif.org/ver10/events/wsdl/EventBinding | |
http://www.onvif.org/ver10/events/wsdl/SubscriptionManagerBinding | |
http://www.onvif.org/ver10/events/wsdl/NotificationProducerBinding | |
wsnt | |
http://docs.oasis-open.org/wsn/b-2 | |
http://www.onvif.org/ver10/events/wsdl/NotificationConsumerBinding | |
http://www.onvif.org/ver10/analyticsdevice/wsdl | |
timg | |
timg10 | |
http://www.onvif.org/ver10/imaging/wsdl | |
http://www.onvif.org/ver10/display/wsdl | |
tptz | |
tptz10 | |
http://www.onvif.org/ver10/ptz/wsdl | |
http://www.onvif.org/ver10/recording/wsdl | |
http://www.onvif.org/ver10/replay/wsdl | |
http://www.onvif.org/ver10/receiver/wsdl | |
http://www.onvif.org/ver10/search/wsdl | |
http://www.onvif.org/ver10/error | |
tns1 | |
http://www.onvif.org/ver10/topics | |
http://www.w3.org/2001/XMLSchema:QName | |
GMT12 | |
SST11 | |
HAST10 | |
AKST9 | |
PST8 | |
MST7 | |
CST6 | |
EST5 | |
VET4:30 | |
AST4 | |
NST3:30 | |
BRT3 | |
GST2 | |
CVT1 | |
GMT0 | |
CET-1 | |
EET-2 | |
AST-3 | |
IRT-3:30 | |
GMT-4 | |
AFT-4:30 | |
PKT-5 | |
IST-5:30 | |
NPT-5:45 | |
BDT-6 | |
MMT-6:30 | |
ICT-7 | |
JST-9 | |
CST-9:30 | |
EST-10 | |
SBT-11 | |
NZST-12 | |
TOT-13 | |
AKST9AKDT | |
PST8PDT,M3.2.0/02:00:00,M11.1.0/02:00:00 | |
MST7MDT | |
GMT+0IST-1,M3.5.0/01:00:00,M10.5.0/02:00:00 | |
WET-0WEST-1,M3.5.0/01:00:00,M10.5.0/02:00:00 | |
GMT+0BST-1,M3.5.0/01:00:00,M10.5.0/02:00:00 | |
CET-1CEST-2,M3.5.0/02:00:00,M10.5.0/03:00:00 | |
CFT-1CEST-2,M3.5.0/02:00:00,M10.5.0/03:00:00 | |
EET-2EEST-3,M3.5.0/03:00:00,M10.5.0/04:00:00 | |
MSK-3MSD,M3.5.0/2,M10.5.0/3 | |
MST-3MDT,M3.5.0/2,M10.5.0/3 | |
CST-9:30CDT-10:30,M10.5.0/02:00:00,M3.5.0/03:00:00 | |
EST-10EDT-11,M10.5.0/02:00:00,M3.5.0/03:00:00 | |
EST-10EDT-11,M10.1.0/02:00:00,M3.5.0/03:00:00 | |
NZST-12NZDT-13,M10.1.0/02:00:00,M3.3.0/03:00:00 | |
soap_serve___trt__SetVideoEncoderConfiguration | |
-tse:GetMetadataSearchResults | |
tse:GetMetadataSearchResultsResponse | |
-tse:FindMetadata | |
tse:FindMetadataResponse | |
-tse:EndSearch | |
tse:EndSearchResponse | |
-tse:GetSearchState | |
tse:GetSearchStateResponse | |
-tse:GetPTZPositionSearchResults | |
tse:GetPTZPositionSearchResultsResponse | |
-tse:FindPTZPosition | |
tse:FindPTZPositionResponse | |
-tse:GetEventSearchResults | |
tse:GetEventSearchResultsResponse | |
-tse:FindEvents | |
tse:FindEventsResponse | |
-tse:GetRecordingSearchResults | |
tse:GetRecordingSearchResultsResponse | |
-tse:FindRecordings | |
tse:FindRecordingsResponse | |
-tse:GetMediaAttributes | |
tse:GetMediaAttributesResponse | |
-tse:GetRecordingInformation | |
tse:GetRecordingInformationResponse | |
-tse:GetRecordingSummary | |
tse:GetRecordingSummaryResponse | |
-tse:GetServiceCapabilities | |
tse:GetServiceCapabilitiesResponse | |
-trv:GetReceiverState | |
trv:GetReceiverStateResponse | |
-trv:SetReceiverMode | |
trv:SetReceiverModeResponse | |
-trv:ConfigureReceiver | |
trv:ConfigureReceiverResponse | |
-trv:DeleteReceiver | |
trv:DeleteReceiverResponse | |
-trv:CreateReceiver | |
trv:CreateReceiverResponse | |
-trv:GetReceiver | |
trv:GetReceiverResponse | |
-trv:GetReceivers | |
trv:GetReceiversResponse | |
-trv:GetServiceCapabilities | |
trv:GetServiceCapabilitiesResponse | |
-trt:GetSnapshotUri | |
trt:GetSnapshotUriResponse | |
-trt:SetSynchronizationPoint | |
trt:SetSynchronizationPointResponse | |
-trt:StopMulticastStreaming | |
trt:StopMulticastStreamingResponse | |
-trt:StartMulticastStreaming | |
trt:StartMulticastStreamingResponse | |
-trt:GetStreamUri | |
trt:GetStreamUriResponse | |
-trt:GetGuaranteedNumberOfVideoEncoderInstances | |
trt:GetGuaranteedNumberOfVideoEncoderInstancesResponse | |
-trt:GetAudioDecoderConfigurationOptions | |
trt:GetAudioDecoderConfigurationOptionsResponse | |
-trt:GetAudioOutputConfigurationOptions | |
trt:GetAudioOutputConfigurationOptionsResponse | |
-trt:GetMetadataConfigurationOptions | |
trt:GetMetadataConfigurationOptionsResponse | |
-trt:GetAudioEncoderConfigurationOptions | |
trt:GetAudioEncoderConfigurationOptionsResponse | |
-trt:GetAudioSourceConfigurationOptions | |
trt:GetAudioSourceConfigurationOptionsResponse | |
-trt:GetVideoEncoderConfigurationOptions | |
trt:GetVideoEncoderConfigurationOptionsResponse | |
-trt:GetVideoSourceConfigurationOptions | |
trt:GetVideoSourceConfigurationOptionsResponse | |
-trt:SetAudioDecoderConfiguration | |
trt:SetAudioDecoderConfigurationResponse | |
-trt:SetAudioOutputConfiguration | |
trt:SetAudioOutputConfigurationResponse | |
-trt:SetMetadataConfiguration | |
trt:SetMetadataConfigurationResponse | |
-trt:SetVideoAnalyticsConfiguration | |
trt:SetVideoAnalyticsConfigurationResponse | |
-trt:SetAudioEncoderConfiguration | |
trt:SetAudioEncoderConfigurationResponse | |
-trt:SetAudioSourceConfiguration | |
trt:SetAudioSourceConfigurationResponse | |
-trt:SetVideoEncoderConfiguration | |
trt:SetVideoEncoderConfigurationResponse | |
-trt:SetVideoSourceConfiguration | |
trt:SetVideoSourceConfigurationResponse | |
-trt:GetCompatibleAudioDecoderConfigurations | |
trt:GetCompatibleAudioDecoderConfigurationsResponse | |
-trt:GetCompatibleAudioOutputConfigurations | |
trt:GetCompatibleAudioOutputConfigurationsResponse | |
-trt:GetCompatibleMetadataConfigurations | |
trt:GetCompatibleMetadataConfigurationsResponse | |
-trt:GetCompatibleVideoAnalyticsConfigurations | |
trt:GetCompatibleVideoAnalyticsConfigurationsResponse | |
-trt:GetCompatibleAudioSourceConfigurations | |
trt:GetCompatibleAudioSourceConfigurationsResponse | |
-trt:GetCompatibleAudioEncoderConfigurations | |
trt:GetCompatibleAudioEncoderConfigurationsResponse | |
-trt:GetCompatibleVideoSourceConfigurations | |
trt:GetCompatibleVideoSourceConfigurationsResponse | |
-trt:GetCompatibleVideoEncoderConfigurations | |
trt:GetCompatibleVideoEncoderConfigurationsResponse | |
-trt:GetAudioDecoderConfiguration | |
trt:GetAudioDecoderConfigurationResponse | |
-trt:GetAudioOutputConfiguration | |
trt:GetAudioOutputConfigurationResponse | |
-trt:GetMetadataConfiguration | |
trt:GetMetadataConfigurationResponse | |
-trt:GetVideoAnalyticsConfiguration | |
trt:GetVideoAnalyticsConfigurationResponse | |
-trt:GetAudioEncoderConfiguration | |
trt:GetAudioEncoderConfigurationResponse | |
-trt:GetAudioSourceConfiguration | |
trt:GetAudioSourceConfigurationResponse | |
-trt:GetVideoEncoderConfiguration | |
trt:GetVideoEncoderConfigurationResponse | |
-trt:GetVideoSourceConfiguration | |
trt:GetVideoSourceConfigurationResponse | |
-trt:GetAudioDecoderConfigurations | |
trt:GetAudioDecoderConfigurationsResponse | |
-trt:GetAudioOutputConfigurations | |
trt:GetAudioOutputConfigurationsResponse | |
-trt:GetMetadataConfigurations | |
trt:GetMetadataConfigurationsResponse | |
-trt:GetVideoAnalyticsConfigurations | |
trt:GetVideoAnalyticsConfigurationsResponse | |
-trt:GetAudioEncoderConfigurations | |
trt:GetAudioEncoderConfigurationsResponse | |
-trt:GetAudioSourceConfigurations | |
trt:GetAudioSourceConfigurationsResponse | |
-trt:GetVideoEncoderConfigurations | |
trt:GetVideoEncoderConfigurationsResponse | |
-trt:GetVideoSourceConfigurations | |
trt:GetVideoSourceConfigurationsResponse | |
-trt:DeleteProfile | |
trt:DeleteProfileResponse | |
-trt:RemoveAudioDecoderConfiguration | |
trt:RemoveAudioDecoderConfigurationResponse | |
-trt:RemoveAudioOutputConfiguration | |
trt:RemoveAudioOutputConfigurationResponse | |
-trt:RemoveMetadataConfiguration | |
trt:RemoveMetadataConfigurationResponse | |
-trt:RemoveVideoAnalyticsConfiguration | |
trt:RemoveVideoAnalyticsConfigurationResponse | |
-trt:RemovePTZConfiguration | |
trt:RemovePTZConfigurationResponse | |
-trt:RemoveAudioSourceConfiguration | |
trt:RemoveAudioSourceConfigurationResponse | |
-trt:RemoveAudioEncoderConfiguration | |
trt:RemoveAudioEncoderConfigurationResponse | |
-trt:RemoveVideoSourceConfiguration | |
trt:RemoveVideoSourceConfigurationResponse | |
-trt:RemoveVideoEncoderConfiguration | |
trt:RemoveVideoEncoderConfigurationResponse | |
-trt:AddAudioDecoderConfiguration | |
trt:AddAudioDecoderConfigurationResponse | |
-trt:AddAudioOutputConfiguration | |
trt:AddAudioOutputConfigurationResponse | |
-trt:AddMetadataConfiguration | |
trt:AddMetadataConfigurationResponse | |
-trt:AddVideoAnalyticsConfiguration | |
trt:AddVideoAnalyticsConfigurationResponse | |
-trt:AddPTZConfiguration | |
trt:AddPTZConfigurationResponse | |
-trt:AddAudioSourceConfiguration | |
trt:AddAudioSourceConfigurationResponse | |
-trt:AddAudioEncoderConfiguration | |
trt:AddAudioEncoderConfigurationResponse | |
-trt:AddVideoSourceConfiguration | |
trt:AddVideoSourceConfigurationResponse | |
-trt:AddVideoEncoderConfiguration | |
trt:AddVideoEncoderConfigurationResponse | |
-trt:GetProfiles | |
trt:GetProfilesResponse | |
-trt:GetProfile | |
trt:GetProfileResponse | |
-trt:CreateProfile | |
trt:CreateProfileResponse | |
-trt:GetAudioOutputs | |
trt:GetAudioOutputsResponse | |
-trt:GetAudioSources | |
trt:GetAudioSourcesResponse | |
-trt:GetVideoSources | |
trt:GetVideoSourcesResponse | |
-trt:GetServiceCapabilities | |
trt:GetServiceCapabilitiesResponse | |
-trp:SetReplayConfiguration | |
trp:SetReplayConfigurationResponse | |
-trp:GetReplayConfiguration | |
trp:GetReplayConfigurationResponse | |
-trp:GetReplayUri | |
trp:GetReplayUriResponse | |
-trp:GetServiceCapabilities | |
trp:GetServiceCapabilitiesResponse | |
-trc:GetRecordingJobState | |
trc:GetRecordingJobStateResponse | |
-trc:SetRecordingJobMode | |
trc:SetRecordingJobModeResponse | |
-trc:GetRecordingJobConfiguration | |
trc:GetRecordingJobConfigurationResponse | |
-trc:SetRecordingJobConfiguration | |
trc:SetRecordingJobConfigurationResponse | |
-trc:GetRecordingJobs | |
trc:GetRecordingJobsResponse | |
-trc:DeleteRecordingJob | |
trc:DeleteRecordingJobResponse | |
-trc:CreateRecordingJob | |
trc:CreateRecordingJobResponse | |
-trc:SetTrackConfiguration | |
trc:SetTrackConfigurationResponse | |
-trc:GetTrackConfiguration | |
trc:GetTrackConfigurationResponse | |
-trc:DeleteTrack | |
trc:DeleteTrackResponse | |
-trc:CreateTrack | |
trc:CreateTrackResponse | |
-trc:GetRecordingConfiguration | |
trc:GetRecordingConfigurationResponse | |
-trc:SetRecordingConfiguration | |
trc:SetRecordingConfigurationResponse | |
-trc:GetRecordings | |
trc:GetRecordingsResponse | |
-trc:DeleteRecording | |
trc:DeleteRecordingResponse | |
-trc:CreateRecording | |
trc:CreateRecordingResponse | |
-trc:GetServiceCapabilities | |
trc:GetServiceCapabilitiesResponse | |
-tptz10:Stop | |
tptz10:StopResponse | |
-tptz10:AbsoluteMove | |
tptz10:AbsoluteMoveResponse | |
-tptz10:SendAuxiliaryCommand | |
tptz10:SendAuxiliaryCommandResponse | |
-tptz10:RelativeMove | |
tptz10:RelativeMoveResponse | |
-tptz10:ContinuousMove | |
tptz10:ContinuousMoveResponse | |
-tptz10:SetHomePosition | |
tptz10:SetHomePositionResponse | |
-tptz10:GotoHomePosition | |
tptz10:GotoHomePositionResponse | |
-tptz10:GetConfigurationOptions | |
tptz10:GetConfigurationOptionsResponse | |
-tptz10:SetConfiguration | |
tptz10:SetConfigurationResponse | |
-tptz10:GetNode | |
tptz10:GetNodeResponse | |
-tptz10:GetNodes | |
tptz10:GetNodesResponse | |
-tptz10:GetConfiguration | |
tptz10:GetConfigurationResponse | |
-tptz10:GetStatus | |
tptz10:GetStatusResponse | |
-tptz10:GotoPreset | |
tptz10:GotoPresetResponse | |
-tptz10:RemovePreset | |
tptz10:RemovePresetResponse | |
-tptz10:SetPreset | |
tptz10:SetPresetResponse | |
-tptz10:GetPresets | |
tptz10:GetPresetsResponse | |
-tptz10:GetConfigurations | |
tptz10:GetConfigurationsResponse | |
-tptz:RemovePresetTour | |
tptz:RemovePresetTourResponse | |
-tptz:OperatePresetTour | |
tptz:OperatePresetTourResponse | |
-tptz:ModifyPresetTour | |
tptz:ModifyPresetTourResponse | |
-tptz:CreatePresetTour | |
tptz:CreatePresetTourResponse | |
-tptz:GetPresetTourOptions | |
tptz:GetPresetTourOptionsResponse | |
-tptz:GetPresetTour | |
tptz:GetPresetTourResponse | |
-tptz:GetPresetTours | |
tptz:GetPresetToursResponse | |
-tptz:Stop | |
tptz:StopResponse | |
-tptz:AbsoluteMove | |
tptz:AbsoluteMoveResponse | |
-tptz:SendAuxiliaryCommand | |
tptz:SendAuxiliaryCommandResponse | |
-tptz:RelativeMove | |
tptz:RelativeMoveResponse | |
-tptz:ContinuousMove | |
tptz:ContinuousMoveResponse | |
-tptz:SetHomePosition | |
tptz:SetHomePositionResponse | |
-tptz:GotoHomePosition | |
tptz:GotoHomePositionResponse | |
-tptz:GetConfigurationOptions | |
tptz:GetConfigurationOptionsResponse | |
-tptz:SetConfiguration | |
tptz:SetConfigurationResponse | |
-tptz:GetNode | |
tptz:GetNodeResponse | |
-tptz:GetNodes | |
tptz:GetNodesResponse | |
-tptz:GetConfiguration | |
tptz:GetConfigurationResponse | |
-tptz:GetStatus | |
tptz:GetStatusResponse | |
-tptz:GotoPreset | |
tptz:GotoPresetResponse | |
-tptz:RemovePreset | |
tptz:RemovePresetResponse | |
-tptz:SetPreset | |
tptz:SetPresetResponse | |
-tptz:GetPresets | |
tptz:GetPresetsResponse | |
-tptz:GetConfigurations | |
tptz:GetConfigurationsResponse | |
-tptz:GetServiceCapabilities | |
tptz:GetServiceCapabilitiesResponse | |
-tmd:SendReceiveSerialCommand | |
tmd:SendReceiveSerialCommandResponse | |
-tmd:GetSerialPortConfigurationOptions | |
tmd:GetSerialPortConfigurationOptionsResponse | |
-tmd:SetSerialPortConfiguration | |
tmd:SetSerialPortConfigurationResponse | |
-tmd:GetSerialPortConfiguration | |
tmd:GetSerialPortConfigurationResponse | |
-tmd:GetSerialPorts | |
tmd:GetSerialPortsResponse | |
-tmd:GetDigitalInputs | |
tmd:GetDigitalInputsResponse | |
-tmd:SetRelayOutputState | |
tds:SetRelayOutputStateResponse | |
-tmd:SetRelayOutputSettings | |
tmd:SetRelayOutputSettingsResponse | |
-tmd:GetRelayOutputs | |
tds:GetRelayOutputsResponse | |
-tmd:GetAudioOutputConfigurationOptions | |
tmd:GetAudioOutputConfigurationOptionsResponse | |
-tmd:GetAudioSourceConfigurationOptions | |
tmd:GetAudioSourceConfigurationOptionsResponse | |
-tmd:GetVideoOutputConfigurationOptions | |
tmd:GetVideoOutputConfigurationOptionsResponse | |
-tmd:GetVideoSourceConfigurationOptions | |
tmd:GetVideoSourceConfigurationOptionsResponse | |
-tmd:SetAudioOutputConfiguration | |
tmd:SetAudioOutputConfigurationResponse | |
-tmd:SetAudioSourceConfiguration | |
tmd:SetAudioSourceConfigurationResponse | |
-tmd:SetVideoOutputConfiguration | |
tmd:SetVideoOutputConfigurationResponse | |
-tmd:SetVideoSourceConfiguration | |
tmd:SetVideoSourceConfigurationResponse | |
-tmd:GetAudioOutputConfiguration | |
tmd:GetAudioOutputConfigurationResponse | |
-tmd:GetAudioSourceConfiguration | |
tmd:GetAudioSourceConfigurationResponse | |
-tmd:GetVideoOutputConfiguration | |
tmd:GetVideoOutputConfigurationResponse | |
-tmd:GetVideoSourceConfiguration | |
tmd:GetVideoSourceConfigurationResponse | |
-tmd:GetVideoOutputs | |
tmd:GetVideoOutputsResponse | |
-tmd:GetVideoSources | |
-tmd:GetAudioOutputs | |
-tmd:GetAudioSources | |
-tmd:GetRelayOutputOptions | |
tmd:GetRelayOutputOptionsResponse | |
-tmd:GetServiceCapabilities | |
tmd:GetServiceCapabilitiesResponse | |
-tls:DeletePaneConfiguration | |
tls:DeletePaneConfigurationResponse | |
-tls:CreatePaneConfiguration | |
tls:CreatePaneConfigurationResponse | |
-tls:SetPaneConfiguration | |
tls:SetPaneConfigurationResponse | |
-tls:SetPaneConfigurations | |
tls:SetPaneConfigurationsResponse | |
-tls:GetPaneConfiguration | |
tls:GetPaneConfigurationResponse | |
-tls:GetPaneConfigurations | |
tls:GetPaneConfigurationsResponse | |
-tls:GetDisplayOptions | |
tls:GetDisplayOptionsResponse | |
-tls:SetLayout | |
tls:SetLayoutResponse | |
-tls:GetLayout | |
tls:GetLayoutResponse | |
-tls:GetServiceCapabilities | |
tls:GetServiceCapabilitiesResponse | |
-timg10:GetMoveOptions | |
timg10:GetMoveOptionsResponse | |
-timg10:GetStatus | |
timg10:GetStatusResponse | |
-timg10:Stop | |
timg10:StopResponse | |
-timg10:Move | |
timg10:MoveResponse | |
-timg10:GetOptions | |
timg10:GetOptionsResponse | |
-timg10:SetImagingSettings | |
timg10:SetImagingSettingsResponse | |
-timg10:GetImagingSettings | |
timg10:GetImagingSettingsResponse | |
-timg:GetMoveOptions | |
timg:GetMoveOptionsResponse | |
-timg:GetStatus | |
timg:GetStatusResponse | |
-timg:Stop | |
timg:StopResponse | |
-timg:Move | |
timg:MoveResponse | |
-timg:GetOptions | |
timg:GetOptionsResponse | |
-timg:SetImagingSettings | |
timg:SetImagingSettingsResponse | |
-timg:GetImagingSettings | |
timg:GetImagingSettingsResponse | |
-timg:GetServiceCapabilities | |
timg:GetServiceCapabilitiesResponse | |
-tds:StartSystemRestore | |
tds:StartSystemRestoreResponse | |
-tds:StartFirmwareUpgrade | |
tds:StartFirmwareUpgradeResponse | |
-tds:GetSystemUris | |
tds:GetSystemUrisResponse | |
-tds:ScanAvailableDot11Networks | |
tds:ScanAvailableDot11NetworksResponse | |
-tds:GetDot11Status | |
tds:GetDot11StatusResponse | |
-tds:GetDot11Capabilities | |
tds:GetDot11CapabilitiesResponse | |
-tds:DeleteDot1XConfiguration | |
tds:DeleteDot1XConfigurationResponse | |
-tds:GetDot1XConfigurations | |
tds:GetDot1XConfigurationsResponse | |
-tds:GetDot1XConfiguration | |
tds:GetDot1XConfigurationResponse | |
-tds:SetDot1XConfiguration | |
tds:SetDot1XConfigurationResponse | |
-tds:CreateDot1XConfiguration | |
tds:CreateDot1XConfigurationResponse | |
-tds:LoadCACertificates | |
tds:LoadCACertificatesResponse | |
-tds:GetCertificateInformation | |
tds:GetCertificateInformationResponse | |
-tds:LoadCertificateWithPrivateKey | |
tds:LoadCertificateWithPrivateKeyResponse | |
-tds:GetCACertificates | |
tds:GetCACertificatesResponse | |
-tds:SendAuxiliaryCommand | |
tds:SendAuxiliaryCommandResponse | |
-tds:SetRelayOutputState | |
-tds:SetRelayOutputSettings | |
tds:SetRelayOutputSettingsResponse | |
-tds:GetRelayOutputs | |
-tds:SetClientCertificateMode | |
tds:SetClientCertificateModeResponse | |
-tds:GetClientCertificateMode | |
tds:GetClientCertificateModeResponse | |
-tds:LoadCertificates | |
tds:LoadCertificatesResponse | |
-tds:GetPkcs10Request | |
tds:GetPkcs10RequestResponse | |
-tds:DeleteCertificates | |
tds:DeleteCertificatesResponse | |
-tds:SetCertificatesStatus | |
tds:SetCertificatesStatusResponse | |
-tds:GetCertificatesStatus | |
tds:GetCertificatesStatusResponse | |
-tds:GetCertificates | |
tds:GetCertificatesResponse | |
-tds:CreateCertificate | |
tds:CreateCertificateResponse | |
-tds:SetAccessPolicy | |
tds:SetAccessPolicyResponse | |
-tds:GetAccessPolicy | |
tds:GetAccessPolicyResponse | |
-tds:RemoveIPAddressFilter | |
tds:RemoveIPAddressFilterResponse | |
-tds:AddIPAddressFilter | |
tds:AddIPAddressFilterResponse | |
-tds:SetIPAddressFilter | |
tds:SetIPAddressFilterResponse | |
-tds:GetIPAddressFilter | |
tds:GetIPAddressFilterResponse | |
-tds:SetZeroConfiguration | |
tds:SetZeroConfigurationResponse | |
-tds:GetZeroConfiguration | |
tds:GetZeroConfigurationResponse | |
-tds:SetNetworkDefaultGateway | |
tds:SetNetworkDefaultGatewayResponse | |
-tds:GetNetworkDefaultGateway | |
tds:GetNetworkDefaultGatewayResponse | |
-tds:SetNetworkProtocols | |
tds:SetNetworkProtocolsResponse | |
-tds:GetNetworkProtocols | |
tds:GetNetworkProtocolsResponse | |
-tds:SetNetworkInterfaces | |
tds:SetNetworkInterfacesResponse | |
-tds:GetNetworkInterfaces | |
tds:GetNetworkInterfacesResponse | |
-tds:SetDynamicDNS | |
tds:SetDynamicDNSResponse | |
-tds:GetDynamicDNS | |
tds:GetDynamicDNSResponse | |
-tds:SetNTP | |
tds:SetNTPResponse | |
-tds:GetNTP | |
tds:GetNTPResponse | |
-tds:SetDNS | |
tds:SetDNSResponse | |
-tds:GetDNS | |
tds:GetDNSResponse | |
-tds:SetHostnameFromDHCP | |
tds:SetHostnameFromDHCPResponse | |
-tds:SetHostname | |
tds:SetHostnameResponse | |
-tds:GetHostname | |
tds:GetHostnameResponse | |
-tds:SetDPAddresses | |
tds:SetDPAddressesResponse | |
-tds:GetCapabilities | |
tds:GetCapabilitiesResponse | |
-tds:GetWsdlUrl | |
tds:GetWsdlUrlResponse | |
-tds:SetUser | |
tds:SetUserResponse | |
-tds:DeleteUsers | |
tds:DeleteUsersResponse | |
-tds:CreateUsers | |
tds:CreateUsersResponse | |
-tds:GetUsers | |
tds:GetUsersResponse | |
-tds:SetRemoteUser | |
tds:SetRemoteUserResponse | |
-tds:GetRemoteUser | |
tds:GetRemoteUserResponse | |
-tds:GetEndpointReference | |
tds:GetEndpointReferenceResponse | |
-tds:GetDPAddresses | |
tds:GetDPAddressesResponse | |
-tds:SetRemoteDiscoveryMode | |
tds:SetRemoteDiscoveryModeResponse | |
-tds:GetRemoteDiscoveryMode | |
tds:GetRemoteDiscoveryModeResponse | |
-tds:SetDiscoveryMode | |
tds:SetDiscoveryModeResponse | |
-tds:GetDiscoveryMode | |
tds:GetDiscoveryModeResponse | |
-tds:RemoveScopes | |
tds:RemoveScopesResponse | |
-tds:AddScopes | |
tds:AddScopesResponse | |
-tds:SetScopes | |
tds:SetScopesResponse | |
-tds:GetScopes | |
tds:GetScopesResponse | |
-tds:GetSystemSupportInformation | |
tds:GetSystemSupportInformationResponse | |
-tds:GetSystemLog | |
tds:GetSystemLogResponse | |
-tds:GetSystemBackup | |
tds:GetSystemBackupResponse | |
-tds:RestoreSystem | |
tds:RestoreSystemResponse | |
-tds:SystemReboot | |
tds:SystemRebootResponse | |
-tds:UpgradeSystemFirmware | |
tds:UpgradeSystemFirmwareResponse | |
-tds:SetSystemFactoryDefault | |
tds:SetSystemFactoryDefaultResponse | |
-tds:GetSystemDateAndTime | |
tds:GetSystemDateAndTimeResponse | |
-tds:SetSystemDateAndTime | |
tds:SetSystemDateAndTimeResponse | |
-tds:GetDeviceInformation | |
tds:GetDeviceInformationResponse | |
-tds:GetServiceCapabilities | |
tds:GetServiceCapabilitiesResponse | |
-tds:GetServices | |
tds:GetServicesResponse | |
-tad:GetAnalyticsState | |
tad:GetAnalyticsStateResponse | |
-tad:DeleteAnalyticsEngineInputs | |
tad:DeleteAnalyticsEngineInputsResponse | |
-tad:CreateAnalyticsEngineInputs | |
tad:CreateAnalyticsEngineInputsResponse | |
-tad:GetVideoAnalyticsConfiguration | |
tad:GetVideoAnalyticsConfigurationResponse | |
-tad:GetAnalyticsDeviceStreamUri | |
tad:GetAnalyticsDeviceStreamUriResponse | |
-tad:GetAnalyticsEngineInputs | |
tad:GetAnalyticsEngineInputsResponse | |
-tad:GetAnalyticsEngineInput | |
tad:GetAnalyticsEngineInputResponse | |
-tad:SetAnalyticsEngineInput | |
tad:SetAnalyticsEngineInputResponse | |
-tad:SetVideoAnalyticsConfiguration | |
tad:SetVideoAnalyticsConfigurationResponse | |
-tad:GetAnalyticsEngines | |
tad:GetAnalyticsEnginesResponse | |
-tad:GetAnalyticsEngine | |
tad:GetAnalyticsEngineResponse | |
-tad:GetAnalyticsEngineControls | |
tad:GetAnalyticsEngineControlsResponse | |
-tad:GetAnalyticsEngineControl | |
tad:GetAnalyticsEngineControlResponse | |
-tad:SetAnalyticsEngineControl | |
tad:SetAnalyticsEngineControlResponse | |
-tad:CreateAnalyticsEngineControl | |
tad:CreateAnalyticsEngineControlResponse | |
-tad:DeleteAnalyticsEngineControl | |
tad:DeleteAnalyticsEngineControlResponse | |
-tad:GetServiceCapabilities | |
tad:GetServiceCapabilitiesResponse | |
-ns9:ResumeSubscription | |
wsnt:ResumeSubscriptionResponse | |
-ns9:PauseSubscription | |
wsnt:PauseSubscriptionResponse | |
-ns9:Unsubscribe | |
wsnt:UnsubscribeResponse | |
-ns9:Renew | |
wsnt:RenewResponse | |
-ns8:CreatePullPoint | |
wsnt:CreatePullPointResponse | |
-ns7:Notify | |
-ns7:DestroyPullPoint | |
wsnt:DestroyPullPointResponse | |
-ns7:GetMessages | |
wsnt:GetMessagesResponse | |
-ns6:Notify | |
-ns5:GetCurrentMessage | |
wsnt:GetCurrentMessageResponse | |
-ns5:Subscribe | |
wsnt:SubscribeResponse | |
-ns4:Unsubscribe | |
-ns4:Renew | |
-ns3:GetEventProperties | |
tev:GetEventPropertiesResponse | |
-ns3:CreatePullPointSubscription | |
tev:CreatePullPointSubscriptionResponse | |
-ns3:GetServiceCapabilities | |
tev:GetServiceCapabilitiesResponse | |
-ns2:SetSynchronizationPoint | |
tev:SetSynchronizationPointResponse | |
-ns2:PullMessages | |
tev:PullMessagesResponse | |
-ns13:ModifyAnalyticsModules | |
tan:ModifyAnalyticsModulesResponse | |
-ns13:GetAnalyticsModules | |
tan:GetAnalyticsModulesResponse | |
-ns13:DeleteAnalyticsModules | |
tan:DeleteAnalyticsModulesResponse | |
-ns13:CreateAnalyticsModules | |
tan:CreateAnalyticsModulesResponse | |
-ns13:GetSupportedAnalyticsModules | |
tan:GetSupportedAnalyticsModulesResponse | |
-ns13:GetServiceCapabilities | |
tan:GetServiceCapabilitiesResponse | |
-ns12:ModifyRules | |
tan:ModifyRulesResponse | |
-ns12:GetRules | |
tan:GetRulesResponse | |
-ns12:DeleteRules | |
tan:DeleteRulesResponse | |
-ns12:CreateRules | |
tan:CreateRulesResponse | |
-ns12:GetSupportedRules | |
tan:GetSupportedRulesResponse | |
-ns11:ModifyAnalytics | |
tan10:ModifyAnalyticsModulesResponse | |
-ns11:GetAnalytics | |
tan10:GetAnalyticsModulesResponse | |
-ns11:DeleteAnalytics | |
tan10:DeleteAnalyticsModulesResponse | |
-ns11:CreateAnalytics | |
tan10:CreateAnalyticsModulesResponse | |
-ns11:GetSupportedAnalytics | |
tan10:GetSupportedAnalyticsModulesResponse | |
-ns10:ModifyRule | |
tan10:ModifyRulesResponse | |
-ns10:GetRules | |
tan10:GetRulesResponse | |
-ns10:DeleteRule | |
tan10:DeleteRulesResponse | |
-ns10:CreateRule | |
tan10:CreateRulesResponse | |
-ns10:GetSupportedRules | |
tan10:GetSupportedRulesResponse | |
-d4:Probe | |
dn:ProbeResponse | |
-d3:Bye | |
dn:ByeResponse | |
-d3:Hello | |
dn:HelloResponse | |
http://docs.oasis-open.org/wss/2004/01/oasis-200401-wss-username-token-profile-1.0#PasswordDigest | |
ter:NotAuthorized | |
Sender not Authorized | |
The action requested requires authorization and the sender is not authorized | |
wsnt:Unsubscribe | |
wsnt:Renew | |
tev:SetSynchronizationPoint | |
tev:PullMessages | |
error is %d | |
*********soap->tag:%s******** | |
StopRequest | |
tds:GetServiceCapabilities | |
http://www.onvif.org/ver10/device/wsdl/GetServiceCapabilities | |
tds:GetServices | |
http://www.onvif.org/ver10/device/wsdl/GetServices | |
tds:GetCapabilities | |
http://www.onvif.org/ver10/device/wsdl/GetCapabilities | |
tds:GetWsdlUrl | |
http://www.onvif.org/ver10/device/wsdl/GetWsdlUrl | |
tds:GetHostname | |
http://www.onvif.org/ver10/device/wsdl/GetHostname | |
tds:GetSystemDateAndTime | |
http://www.onvif.org/ver10/device/wsdl/GetSystemDateAndTime | |
tev:GetEventProperties | |
http://www.onvif.org/ver10/events/wsdl/EventPortType/GetEventPropertiesRequest | |
tev:CreatePullPointSubscription | |
http://www.onvif.org/ver10/events/wsdl/CreatePullPointSubscription | |
http://www.onvif.org/ver10/events/wsdl/EventPortType/CreatePullPointSubscriptionRequest | |
wsnt:Subscribe | |
http://docs.oasis-open.org/wsn/bw-2/NotificationProducer/SubscribeRequest | |
tds:GetDeviceInformation | |
http://www.onvif.org/ver10/device/wsdl/GetDeviceInformation | |
tds:SetSystemDateAndTime | |
http://www.onvif.org/ver10/device/wsdl/SetSystemDateAndTime | |
tds:SetSystemFactoryDefault | |
http://www.onvif.org/ver10/device/wsdl/SetSystemFactoryDefault | |
tds:SystemReboot | |
http://www.onvif.org/ver10/device/wsdl/SystemReboot | |
tds:RestoreSystem | |
http://www.onvif.org/ver10/device/wsdl/RestoreSystem | |
tds:GetSystemBackup | |
http://www.onvif.org/ver10/device/wsdl/GetSystemBackup | |
tds:GetSystemLog | |
http://www.onvif.org/ver10/device/wsdl/GetSystemLog | |
tds:GetScopes | |
http://www.onvif.org/ver10/device/wsdl/GetScopes | |
tds:SetScopes | |
http://www.onvif.org/ver10/device/wsdl/SetScopes | |
tan10:GetSupportedRules | |
http://www.onvif.org/ver10/analytics/wsdl/GetSupportedRules | |
tan10:CreateRules | |
http://www.onvif.org/ver10/analytics/wsdl/CreateRule | |
tan10:DeleteRules | |
http://www.onvif.org/ver10/analytics/wsdl/DeleteRule | |
tan10:GetRules | |
http://www.onvif.org/ver10/analytics/wsdl/GetRules | |
tan10:ModifyRules | |
http://www.onvif.org/ver10/analytics/wsdl/ModifyRule | |
tan10:GetSupportedAnalyticsModules | |
http://www.onvif.org/ver10/analytics/wsdl/GetSupportedAnalytics | |
tan10:CreateAnalyticsModules | |
http://www.onvif.org/ver10/analytics/wsdl/CreateAnalytics | |
tan10:DeleteAnalyticsModules | |
http://www.onvif.org/ver10/analytics/wsdl/DeleteAnalytics | |
tan10:GetAnalyticsModules | |
http://www.onvif.org/ver10/analytics/wsdl/GetAnalytics | |
tan10:ModifyAnalyticsModules | |
http://www.onvif.org/ver10/analytics/wsdl/ModifyAnalytics | |
tan:GetSupportedRules | |
http://www.onvif.org/ver20/analytics/wsdl/GetSupportedRules | |
tan:GetRules | |
http://www.onvif.org/ver20/analytics/wsdl/GetRules | |
tan:ModifyRules | |
http://www.onvif.org/ver20/analytics/wsdl/ModifyRules | |
tan:GetServiceCapabilities | |
http://www.onvif.org/ver20/analytics/wsdl/GetServiceCapabilities | |
tan:GetSupportedAnalyticsModules | |
http://www.onvif.org/ver20/analytics/wsdl/GetSupportedAnalyticsModules | |
tan:GetAnalyticsModules | |
http://www.onvif.org/ver20/analytics/wsdl/GetAnalyticsModules | |
tan:ModifyAnalyticsModules | |
http://www.onvif.org/ver20/analytics/wsdl/ModifyAnalyticsModules | |
tev:GetServiceCapabilities | |
trt:GetSnapshotUri | |
http://www.onvif.org/ver10/media/wsdl/GetSnapshotUri | |
tad:GetServiceCapabilities | |
http://www.onvif.org/ver10/analyticsdevice/wsdl/GetServiceCapabilities | |
tds:AddScopes | |
http://www.onvif.org/ver10/device/wsdl/AddScopes | |
tds:RemoveScopes | |
http://www.onvif.org/ver10/device/wsdl/RemoveScopes | |
tds:GetDiscoveryMode | |
http://www.onvif.org/ver10/device/wsdl/GetDiscoveryMode | |
tds:SetDiscoveryMode | |
http://www.onvif.org/ver10/device/wsdl/SetDiscoveryMode | |
tds:GetUsers | |
http://www.onvif.org/ver10/device/wsdl/GetUsers | |
tds:CreateUsers | |
http://www.onvif.org/ver10/device/wsdl/CreateUsers | |
tds:DeleteUsers | |
http://www.onvif.org/ver10/device/wsdl/DeleteUsers | |
tds:SetUser | |
http://www.onvif.org/ver10/device/wsdl/SetUser | |
tds:SetHostname | |
http://www.onvif.org/ver10/device/wsdl/SetHostname | |
tds:SetHostnameFromDHCP | |
http://www.onvif.org/ver10/device/wsdl/SetHostnameFromDHCP | |
tds:GetDNS | |
http://www.onvif.org/ver10/device/wsdl/GetDNS | |
tds:SetDNS | |
http://www.onvif.org/ver10/device/wsdl/SetDNS | |
tds:GetNTP | |
http://www.onvif.org/ver10/device/wsdl/GetNTP | |
tds:SetNTP | |
http://www.onvif.org/ver10/device/wsdl/SetNTP | |
tds:GetDynamicDNS | |
http://www.onvif.org/ver10/device/wsdl/GetDynamicDNS | |
tds:SetDynamicDNS | |
http://www.onvif.org/ver10/device/wsdl/SetDynamicDNS | |
tds:GetNetworkInterfaces | |
http://www.onvif.org/ver10/device/wsdl/GetNetworkInterfaces | |
tds:SetNetworkInterfaces | |
http://www.onvif.org/ver10/device/wsdl/SetNetworkInterfaces | |
tds:GetNetworkProtocols | |
http://www.onvif.org/ver10/device/wsdl/GetNetworkProtocols | |
tds:SetNetworkProtocols | |
http://www.onvif.org/ver10/device/wsdl/SetNetworkProtocols | |
tds:GetNetworkDefaultGateway | |
http://www.onvif.org/ver10/device/wsdl/GetNetworkDefaultGateway | |
tds:SetNetworkDefaultGateway | |
http://www.onvif.org/ver10/device/wsdl/SetNetworkDefaultGateway | |
tds:GetZeroConfiguration | |
http://www.onvif.org/ver10/device/wsdl/GetZeroConfiguration | |
tds:GetRelayOutputs | |
http://www.onvif.org/ver10/device/wsdl/GetRelayOutputs | |
tds:SetRelayOutputSettings | |
http://www.onvif.org/ver10/device/wsdl/SetRelayOutputSettings | |
tds:SetRelayOutputState | |
http://www.onvif.org/ver10/device/wsdl/SetRelayOutputState | |
timg:GetServiceCapabilities | |
http://www.onvif.org/ver20/imaging/wsdl/GetServiceCapabilities | |
timg:GetImagingSettings | |
http://www.onvif.org/ver20/imaging/wsdl/GetImagingSettings | |
timg:SetImagingSettings | |
http://www.onvif.org/ver20/imaging/wsdl/SetImagingSettings | |
timg:GetOptions | |
http://www.onvif.org/ver20/imaging/wsdl/GetOptions | |
timg:Move | |
http://www.onvif.org/ver20/imaging/wsdl/Move | |
timg:Stop | |
http://www.onvif.org/ver20/imaging/wsdl/FocusStop | |
timg:GetStatus | |
http://www.onvif.org/ver20/imaging/wsdl/GetStatus | |
timg:GetMoveOptions | |
http://www.onvif.org/ver20/imaging/wsdl/GetMoveOptions | |
timg10:GetImagingSettings | |
http://www.onvif.org/ver10/imaging/wsdl/GetImagingSettings | |
timg10:SetImagingSettings | |
http://www.onvif.org/ver10/imaging/wsdl/SetImagingSettings | |
timg10:GetOptions | |
http://www.onvif.org/ver10/imaging/wsdl/GetOptions | |
timg10:Move | |
http://www.onvif.org/ver10/imaging/wsdl/Move | |
timg10:Stop | |
http://www.onvif.org/ver10/imaging/wsdl/FocusStop | |
timg10:GetStatus | |
http://www.onvif.org/ver10/imaging/wsdl/GetStatus | |
timg10:GetMoveOptions | |
http://www.onvif.org/ver10/imaging/wsdl/GetMoveOptions | |
tmd:GetServiceCapabilities | |
http://www.onvif.org/ver10/deviceio/wsdl/GetServiceCapabilities | |
tmd:GetRelayOutputOptions | |
http://www.onvif.org/ver10/deviceio/wsdl/GetRelayOutputOptions | |
trt:GetAudioSources | |
http://www.onvif.org/ver10/deviceio/wsdl/GetAudioSources | |
trt:GetAudioOutputs | |
http://www.onvif.org/ver10/deviceio/wsdl/GetAudioOutputs | |
trt:GetVideoSources | |
http://www.onvif.org/ver10/deviceio/wsdl/GetVideoSources | |
http://www.onvif.org/ver10/deviceio/wsdl/GetRelayOutputs | |
http://www.onvif.org/ver10/deviceio/wsdl/SetRelayOutputState | |
tmd:GetDigitalInputs | |
http://www.onvif.org/ver10/deviceio/wsdl/GetDigitalInputs | |
tptz:GetServiceCapabilities | |
http://www.onvif.org/ver20/ptz/wsdl/GetServiceCapabilities | |
tptz:GetConfigurations | |
http://www.onvif.org/ver20/ptz/wsdl/GetConfigurations | |
tptz:GetPresets | |
http://www.onvif.org/ver20/ptz/wsdl/GetPresets | |
tptz:SetPreset | |
http://www.onvif.org/ver20/ptz/wsdl/SetPreset | |
tptz:RemovePreset | |
http://www.onvif.org/ver20/ptz/wsdl/RemovePreset | |
tptz:GotoPreset | |
http://www.onvif.org/ver20/ptz/wsdl/GotoPreset | |
tptz:GetStatus | |
http://www.onvif.org/ver20/ptz/wsdl/GetStatus | |
tptz:GetConfiguration | |
http://www.onvif.org/ver20/ptz/wsdl/GetConfiguration | |
tptz:GetNodes | |
http://www.onvif.org/ver20/ptz/wsdl/GetNodes | |
tptz:GetNode | |
http://www.onvif.org/ver20/ptz/wsdl/GetNode | |
tptz:SetConfiguration | |
http://www.onvif.org/ver20/ptz/wsdl/SetConfiguration | |
tptz:GetConfigurationOptions | |
http://www.onvif.org/ver20/ptz/wsdl/GetConfigurationOptions | |
tptz:GotoHomePosition | |
http://www.onvif.org/ver20/ptz/wsdl/GotoHomePosition | |
tptz:SetHomePosition | |
http://www.onvif.org/ver20/ptz/wsdl/SetHomePosition | |
tptz:ContinuousMove | |
http://www.onvif.org/ver20/ptz/wsdl/ContinuousMove | |
tptz2:ContinuousMove | |
tptz:RelativeMove | |
http://www.onvif.org/ver20/ptz/wsdl/RelativeMove | |
tptz:SendAuxiliaryCommand | |
http://www.onvif.org/ver20/ptz/wsdl/SendAuxiliaryCommand | |
tptz:AbsoluteMove | |
http://www.onvif.org/ver20/ptz/wsdl/AbsoluteMove | |
tptz:Stop | |
http://www.onvif.org/ver20/ptz/wsdl/Stop | |
tptz:GetPresetTours | |
http://www.onvif.org/ver20/ptz/wsdl/GetPresetTours | |
tptz:GetPresetTour | |
http://www.onvif.org/ver20/ptz/wsdl/GetPresetTour | |
tptz:GetPresetTourOptions | |
http://www.onvif.org/ver20/ptz/wsdl/GetPresetTourOptions | |
tptz:CreatePresetTour | |
http://www.onvif.org/ver20/ptz/wsdl/CreatePresetTour | |
tptz:ModifyPresetTour | |
http://www.onvif.org/ver20/ptz/wsdl/ModifyPresetTour | |
tptz:OperatePresetTour | |
http://www.onvif.org/ver20/ptz/wsdl/OperatePresetTour | |
tptz:RemovePresetTour | |
http://www.onvif.org/ver20/ptz/wsdl/RemovePresetTour | |
tptz10:GetConfigurations | |
http://www.onvif.org/ver10/ptz/wsdl/GetConfigurations | |
tptz10:GetPresets | |
http://www.onvif.org/ver10/ptz/wsdl/GetPresets | |
tptz10:SetPreset | |
http://www.onvif.org/ver10/ptz/wsdl/SetPreset | |
tptz10:RemovePreset | |
http://www.onvif.org/ver10/ptz/wsdl/RemovePreset | |
tptz10:GotoPreset | |
http://www.onvif.org/ver10/ptz/wsdl/GotoPreset | |
tptz10:GetStatus | |
http://www.onvif.org/ver10/ptz/wsdl/GetStatus | |
tptz10:GetConfiguration | |
http://www.onvif.org/ver10/ptz/wsdl/GetConfiguration | |
tptz10:GetNodes | |
http://www.onvif.org/ver10/ptz/wsdl/GetNodes | |
tptz10:GetNode | |
http://www.onvif.org/ver10/ptz/wsdl/GetNode | |
tptz10:SetConfiguration | |
http://www.onvif.org/ver10/ptz/wsdl/SetConfiguration | |
tptz10:GetConfigurationOptions | |
http://www.onvif.org/ver10/ptz/wsdl/GetConfigurationOptions | |
tptz10:GotoHomePosition | |
http://www.onvif.org/ver10/ptz/wsdl/GotoHomePosition | |
tptz10:SetHomePosition | |
http://www.onvif.org/ver10/ptz/wsdl/SetHomePosition | |
tptz10:ContinuousMove | |
http://www.onvif.org/ver10/ptz/wsdl/ContinuousMove | |
tptz10:RelativeMove | |
http://www.onvif.org/ver10/ptz/wsdl/RelativeMove | |
tptz10:SendAuxiliaryCommand | |
http://www.onvif.org/ver10/ptz/wsdl/SendAuxiliaryCommand | |
tptz10:AbsoluteMove | |
http://www.onvif.org/ver10/ptz/wsdl/AbsoluteMove | |
tptz10:StopRequest | |
http://www.onvif.org/ver10/ptz/wsdl/Stop | |
trp:GetServiceCapabilities | |
http://www.onvif.org/ver10/replay/wsdl/GetServiceCapabilities | |
trp:GetReplayUri | |
http://www.onvif.org/ver10/replay/wsdl/GetReplayUri | |
trp:GetReplayConfiguration | |
http://www.onvif.org/ver10/replay/wsdl/GetReplayConfiguration | |
trp:SetReplayConfiguration | |
http://www.onvif.org/ver10/replay/wsdl/SetReplayConfiguration | |
trt:GetServiceCapabilities | |
http://www.onvif.org/ver10/media/wsdl/GetServiceCapabilities | |
http://www.onvif.org/ver10/media/wsdlGetVideoSources/ | |
http://www.onvif.org/ver10/media/wsdl/GetAudioSources | |
http://www.onvif.org/ver10/media/wsdl/GetAudioOutputs | |
trt:CreateProfile | |
http://www.onvif.org/ver10/media/wsdl/CreateProfile | |
trt:GetProfile | |
http://www.onvif.org/ver10/media/wsdlGetProfile/ | |
trt:GetProfiles | |
http://www.onvif.org/ver10/media/wsdl/GetProfiles | |
trt:AddVideoEncoderConfiguration | |
http://www.onvif.org/ver10/media/wsdl/AddVideoEncoderConfiguration | |
trt:AddVideoSourceConfiguration | |
http://www.onvif.org/ver10/media/wsdl/AddVideoSourceConfiguration | |
trt:AddAudioEncoderConfiguration | |
http://www.onvif.org/ver10/media/wsdl/AddAudioEncoderConfiguration | |
trt:AddAudioSourceConfiguration | |
http://www.onvif.org/ver10/media/wsdl/AddAudioSourceConfiguration | |
trt:AddPTZConfiguration | |
http://www.onvif.org/ver10/media/wsdl/AddPTZConfiguration | |
trt:AddAudioOutputConfiguration | |
http://www.onvif.org/ver10/media/wsdl/AddAudioOutputConfiguration | |
trt:AddAudioDecoderConfiguration | |
http://www.onvif.org/ver10/media/wsdl/AddAudioDecoderConfiguration | |
trt:RemoveVideoEncoderConfiguration | |
http://www.onvif.org/ver10/media/wsdl/RemoveVideoEncoderConfiguration | |
trt:RemoveVideoSourceConfiguration | |
http://www.onvif.org/ver10/media/wsdl/RemoveVideoSourceConfiguration | |
trt:RemoveAudioEncoderConfiguration | |
http://www.onvif.org/ver10/media/wsdl/RemoveAudioEncoderConfiguration | |
trt:RemoveAudioSourceConfiguration | |
http://www.onvif.org/ver10/media/wsdl/RemoveAudioSourceConfiguration | |
trt:RemovePTZConfiguration | |
http://www.onvif.org/ver10/media/wsdl/RemovePTZConfiguration | |
trt:RemoveVideoAnalyticsConfiguration | |
http://www.onvif.org/ver10/media/wsdl/RemoveVideoAnalyticsConfiguration | |
trt:RemoveMetadataConfiguration | |
http://www.onvif.org/ver10/media/wsdl/RemoveMetadataConfiguration | |
trt:RemoveAudioOutputConfiguration | |
http://www.onvif.org/ver10/media/wsdl/RemoveAudioOutputConfiguration | |
trt:RemoveAudioDecoderConfiguration | |
http://www.onvif.org/ver10/media/wsdl/RemoveAudioDecoderConfiguration | |
trt:DeleteProfile | |
http://www.onvif.org/ver10/media/wsdl/DeleteProfile | |
trt:GetVideoSourceConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetVideoSourceConfigurations | |
trt:GetVideoEncoderConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetVideoEncoderConfigurations | |
trt:GetAudioSourceConfigurations | |
http://www.onvif.org/ver10/media/wsdlGetAudioSourceConfigurations/ | |
trt:GetAudioEncoderConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetAudioEncoderConfigurations | |
trt:GetVideoAnalyticsConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetVideoAnalyticsConfigurations | |
trt:GetMetadataConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetMetadataConfigurations | |
trt:GetAudioOutputConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetAudioOutputConfigurations | |
trt:GetAudioDecoderConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetAudioDecoderConfigurations | |
trt:GetVideoSourceConfiguration | |
http://www.onvif.org/ver10/media/wsdl/GetVideoSourceConfiguration | |
trt:GetVideoEncoderConfiguration | |
http://www.onvif.org/ver10/media/wsdl/GetVideoEncoderConfiguration | |
trt:GetAudioSourceConfiguration | |
http://www.onvif.org/ver10/media/wsdl/GetAudioSourceConfiguration | |
trt:GetAudioEncoderConfiguration | |
http://www.onvif.org/ver10/media/wsdl/GetAudioEncoderConfiguration | |
trt:GetVideoAnalyticsConfiguration | |
http://www.onvif.org/ver10/media/wsdl/GetVideoAnalyticsConfiguration | |
trt:GetMetadataConfiguration | |
http://www.onvif.org/ver10/media/wsdl/GetMetadataConfiguration | |
trt:GetAudioOutputConfiguration | |
http://www.onvif.org/ver10/media/wsdl/GetAudioOutputConfiguration | |
trt:GetAudioDecoderConfiguration | |
http://www.onvif.org/ver10/media/wsdl/GetAudioDecoderConfiguration | |
trt:GetCompatibleVideoEncoderConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetCompatibleVideoEncoderConfigurations | |
trt:GetCompatibleVideoSourceConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetCompatibleVideoSourceConfigurations | |
trt:GetCompatibleAudioEncoderConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetCompatibleAudioEncoderConfigurations | |
trt:GetCompatibleAudioSourceConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetCompatibleAudioSourceConfigurations | |
trt:GetCompatibleVideoAnalyticsConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetCompatibleVideoAnalyticsConfigurations | |
trt:GetCompatibleMetadataConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetCompatibleMetadataConfigurations | |
trt:GetCompatibleAudioOutputConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetCompatibleAudioOutputConfigurations | |
trt:GetCompatibleAudioDecoderConfigurations | |
http://www.onvif.org/ver10/media/wsdl/GetCompatibleAudioDecoderConfigurations | |
trt:SetVideoSourceConfiguration | |
http://www.onvif.org/ver10/media/wsdl/SetVideoSourceConfiguration | |
trt:SetVideoEncoderConfiguration | |
http://www.onvif.org/ver10/media/wsdl/SetVideoEncoderConfiguration | |
trt:SetAudioSourceConfiguration | |
http://www.onvif.org/ver10/media/wsdl/SetAudioSourceConfiguration | |
trt:SetAudioEncoderConfiguration | |
http://www.onvif.org/ver10/media/wsdl/SetAudioEncoderConfiguration | |
trt:SetVideoAnalyticsConfiguration | |
http://www.onvif.org/ver10/media/wsdl/SetVideoAnalyticsConfiguration | |
trt:SetMetadataConfiguration | |
http://www.onvif.org/ver10/media/wsdl/SetMetadataConfiguration | |
trt:SetAudioOutputConfiguration | |
http://www.onvif.org/ver10/media/wsdl/SetAudioOutputConfiguration | |
trt:SetAudioDecoderConfiguration | |
http://www.onvif.org/ver10/media/wsdl/SetAudioDecoderConfiguration | |
trt:GetVideoSourceConfigurationOptions | |
http://www.onvif.org/ver10/media/wsdlGetVideoSourceConfigurationOptions/ | |
trt:GetVideoEncoderConfigurationOptions | |
http://www.onvif.org/ver10/media/wsdl/GetVideoEncoderConfigurationOptions | |
trt:GetAudioSourceConfigurationOptions | |
http://www.onvif.org/ver10/media/wsdl/GetAudioSourceConfigurationOptions | |
trt:GetAudioEncoderConfigurationOptions | |
http://www.onvif.org/ver10/media/wsdl/GetAudioEncoderConfigurationOptions | |
trt:GetMetadataConfigurationOptions | |
http://www.onvif.org/ver10/media/wsdl/GetMetadataConfigurationOptions | |
trt:GetAudioOutputConfigurationOptions | |
http://www.onvif.org/ver10/media/wsdl/GetAudioOutputConfigurationOptions | |
trt:GetAudioDecoderConfigurationOptions | |
http://www.onvif.org/ver10/media/wsdl/GetAudioDecoderConfigurationOptions | |
trt:GetGuaranteedNumberOfVideoEncoderInstances | |
http://www.onvif.org/ver10/media/wsdl/GetGuaranteedNumberOfVideoEncoderInstances | |
trt:GetStreamUri | |
http://www.onvif.org/ver10/media/wsdl/GetStreamUri | |
trt:SetSynchronizationPoint | |
http://www.onvif.org/ver10/media/wsdl/SetSynchronizationPoint | |
ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/ | |
>XXX?456789:;<=XXXXXXX | |
XXXXXX | |
!"#$%&'()*+,-./0123 | |
http://schemas.xmlsoap.org/soap/envelope/ | |
http://www.w3.org/2003/05/soap-rpc | |
http://schemas.xmlsoap.org/soap/encoding/ | |
http://www.w3.org/2003/05/soap-envelope | |
http://www.w3.org/2003/05/soap-encoding | |
%.9G | |
%.17lG | |
cid:id%d | |
%s%c | |
<!-- ** HERE ** --> | |
SOAP-ENV:Server | |
SOAP-ENV:Client | |
Validation constraint violation: %s%s in element '%s' | |
Validation constraint violation: %s%s | |
%lld | |
& | |
	 | |
< | |
> | |
" | |

 | |

 | |
Content-Type: | |
Content-Transfer-Encoding: | |
Content-ID: | |
Content-Location: | |
Content-Description: | |
Operation interrupted or timed out | |
(%d%cs receive delay) | |
(%d%cs send delay) | |
WSAStartup failed | |
TCP/UDP IP error %d | |
select failed in soap_poll() | |
Client fault | |
Server fault | |
tag name or namespace mismatch | |
data type mismatch | |
Well-formedness violation | |
No XML root element | |
SOAP-ENV:MustUnderstand | |
The data in element '%s' must be understood but cannot be handled | |
SOAP-ENV:VersionMismatch | |
Invalid SOAP message or SOAP version mismatch | |
SOAP-ENV:DataEncodingUnknown | |
Unsupported SOAP data encoding | |
namespace error | |
User data error | |
Fatal error | |
Method '%s' not implemented: method name or namespace not recognized | |
Data required for operation | |
HTTP GET method not implemented | |
HTTP PUT method not implemented | |
HTTP method not implemented | |
Out of memory | |
Memory overflow or memory corruption error | |
Header line too long | |
Array index out of bounds | |
nil not allowed | |
multiple definitions (use the SOAP_XML_TREE flag) of the same id | |
SOAP-ENC:DuplicateID | |
missing id for ref | |
SOAP-ENC:MissingID | |
incompatible object type ref/id pair | |
Message too large for UDP packet | |
An HTTP processing error occurred | |
An HTTP NTLM authentication error occurred | |
OpenSSL not installed: recompile with -DWITH_OPENSSL | |
Plugin registry error | |
DIME format error | |
DIME href to missing attachment | |
DIME version/transmission error | |
End of DIME error | |
MIME format error | |
MIME href to missing attachment | |
End of MIME error | |
Zlib/gzip not installed for (de)compression: recompile with -DWITH_GZIP | |
missing required attribute | |
prohibited attribute present | |
occurrence violation | |
content range or length violation | |
Maximum number of open connections was reached (no define HAVE_POLL): increase FD_SETSIZE | |
UTF content encoding error | |
Stopped: no response to be sent or received (informative) | |
End of file or no input: | |
HTTP Error: %d %s | |
Error %d | |
Error: soap struct not initialized | |
SOAP 1. | |
no subcode | |
[no reason] | |
[no detail] | |
%s%d fault: %s [%s] | |
"%s" | |
Detail: %s | |
Error | |
Error: soap struct state not initialized | |
SOAP-ENV:Body | |
SOAP-ENV:Envelope | |
text/html; charset=utf-8 | |
text/xml; charset=utf-8 | |
application/soap+xml; charset=utf-8 | |
application/dime | |
text/xml | |
application/xop+xml | |
application/soap+xml | |
multipart/related; charset=utf-8; boundary="%s"; type=" | |
"; start=" | |
; start-info=" | |
; action="%s" | |
Content-Type | |
chunked | |
close | |
keep-alive | |
Connection | |
%s[%d | |
202 Accepted | |
HTTP/%s %s | |
HTTP/%s %d %s | |
gSOAP Web Service | |
Basic realm="%s" | |
WWW-Authenticate | |
405 Method Not Allowed | |
400 Bad Request | |
500 Internal Server Error | |
cid: | |
xml: | |
xmlns: | |
wsu:Id | |
xmlns:_%d | |
xmlns:%s | |
<?xml version="1.0" encoding="UTF-8"?> | |
============soap_element <?xml version="1.0" encoding="UTF-8"?> | |
xsi:type | |
SOAP-ENC:position | |
SOAP-ENV:actor | |
SOAP-ENV:role | |
SOAP-ENV:mustUnderstand | |
SOAP-ENV:encodingStyle | |
SOAP-RPC:result | |
xmlns:SOAP-RPC | |
xsi:nil | |
SOAP-ENC:ref | |
href | |
#_%d | |
Body | |
application/xop+xml; charset=utf-8; type="application/soap+xml" | |
application/xop+xml; charset=utf-8; type="text/xml" | |
--%s | |
Content-Type: %s | |
Content-Transfer-Encoding: binary | |
Content-ID: %s | |
http:* | |
https:* | |
httpg: | |
%s %s:%d HTTP/%s | |
%s %s HTTP/%s | |
%s /%s HTTP/%s | |
Host | |
Basic | |
Proxy-Authorization | |
SOAPAction | |
:float | |
:double | |
:decimal | |
:integer | |
:positiveInteger | |
:negativeInteger | |
:nonPositiveInteger | |
:nonNegativeInteger | |
:long | |
:int | |
:short | |
:byte | |
:unsignedLong | |
:unsignedInt | |
:unsignedShort | |
:unsignedByte | |
xsd:anyType | |
xsd:ur-type | |
%d-%d-%dT%d:%d:%d%31s | |
%4d%2d%2dT%2d%2d%2d%31s | |
%4d%2d%2dT%d:%d:%d%31s | |
%d:%d | |
%Y-%m-%dT%H:%M:%SZ | |
1969-12-31T23:59:59Z | |
multipart/related | |
multipart/form-data | |
boundary | |
action | |
Content-Encoding | |
deflate | |
gzip | |
Basic * | |
Proxy-Authenticate | |
realm | |
Expect | |
100-continue | |
HTTP/1.1 100 Continue | |
X-Forwarded-For | |
Content-ID | |
Content-Location | |
Content-Disposition | |
Content-Description | |
Content-Transfer-Encoding | |
+INF | |
-INF | |
SOAP-ENC:Array | |
SOAP-ENC:itemType | |
SOAP-ENC:arraySize | |
SOAP-ENC:offset | |
SOAP-ENC:arrayType | |
<SOAP-ENV:Envelope> | |
soap.udp: | |
no master socket in soap_accept() | |
accept failed in soap_accept() | |
accept failed in soap_accept() 111111111111111111 | |
accept failed in soap_accept() 22222222222222222222222222222 | |
setsockopt SO_LINGER failed in soap_accept() | |
setsockopt failed in soap_accept() | |
setsockopt SO_KEEPALIVE failed in soap_accept() | |
setsockopt SO_SNDBUF failed in soap_accept() | |
setsockopt SO_RCVBUF failed in soap_accept() | |
setsockopt TCP_NODELAY failed in soap_accept() | |
accept failed form %s | |
socket failed in tcp_connect() | |
setsockopt SO_LINGER failed in tcp_connect() | |
setsockopt failed in tcp_connect() | |
setsockopt SO_KEEPALIVE failed in tcp_connect() | |
setsockopt SO_SNDBUF failed in tcp_connect() | |
setsockopt SO_RCVBUF failed in tcp_connect() | |
setsockopt TCP_KEEPIDLE failed in tcp_connect() | |
setsockopt TCP_KEEPINTVL failed in tcp_connect() | |
setsockopt TCP_KEEPCNT failed in tcp_connect() | |
setsockopt TCP_NODELAY failed in tcp_connect() | |
setsockopt IP_MULTICAST_TTL failed in tcp_connect() | |
setsockopt IP_MULTICAST_IF failed in tcp_connect() | |
get proxy host by name failed in tcp_connect() | |
get host by name failed in tcp_connect() | |
connect failed in tcp_connect() | |
DELETE | |
OPTIONS | |
HTTP Error | |
xml | |
encoding= | |
iso-8859-1* | |
latin1* | |
utf-8* | |
quot | |
apos | |
quot; | |
xsi:null | |
SOAP-ENC:root | |
http://schemas.xmlsoap.org/soap/actor/next | |
http://www.w3.org/2003/05/soap-envelope/role/next | |
wsdl:required | |
Envelope | |
:dateTime | |
xop:Include | |
socket failed in soap_bind() | |
setsockopt failed in soap_bind() | |
setsockopt SO_KEEPALIVE failed in soap_bind() | |
setsockopt SO_SNDBUF failed in soap_bind() | |
setsockopt SO_RCVBUF failed in soap_bind() | |
setsockopt TCP_NODELAY failed in soap_bind() | |
get host by name failed in soap_bind() | |
bind failed in soap_bind() | |
listen failed in soap_bind() | |
Host not found | |
Try Again | |
No Recovery | |
No Data | |
No Address | |
See Other | |
Not Modified | |
Use Proxy | |
Temporary Redirect | |
Requested range not satisfiable | |
Expectation Failed | |
HTTP Version not supported | |
7bit | |
8bit | |
binary | |
quoted-printable | |
base64 | |
ietf-token | |
x-token | |
nbsp | |
iexcl | |
cent | |
pound | |
curren | |
brvbar | |
sect | |
ordf | |
laquo | |
macr | |
plusmn | |
sup2 | |
sup3 | |
acute | |
micro | |
para | |
middot | |
cedil | |
sup1 | |
ordm | |
raquo | |
frac14 | |
frac12 | |
frac34 | |
iquest | |
Agrave | |
Aacute | |
Acirc | |
Atilde | |
Auml | |
Aring | |
AElig | |
Ccedil | |
Egrave | |
Eacute | |
Ecirc | |
Euml | |
Igrave | |
Iacute | |
Icirc | |
Iuml | |
Ntilde | |
Ograve | |
Oacute | |
Ocirc | |
Otilde | |
Ouml | |
times | |
Oslash | |
Ugrave | |
Uacute | |
Ucirc | |
Uuml | |
Yacute | |
THORN | |
szlig | |
agrave | |
aacute | |
acirc | |
atilde | |
auml | |
aring | |
aelig | |
ccedil | |
egrave | |
eacute | |
ecirc | |
euml | |
igrave | |
iacute | |
icirc | |
iuml | |
ntilde | |
ograve | |
oacute | |
ocirc | |
otilde | |
ouml | |
divide | |
oslash | |
ugrave | |
uacute | |
ucirc | |
uuml | |
yacute | |
thorn | |
yuml | |
DELETE | |
%s %d, select error!err:%d(%s) | |
select FD_ISSET error! | |
%s %d, recv error!err:%d(%s) | |
%s recv connect down! | |
%s %d, send error!err:%d(%s) | |
%s,IP addr is NULL! | |
%s, Invalid port:%d | |
%s %d, create socket failed!err:%s(%d) | |
%s %d, getsockopt failed!err:%s(%d) | |
%s %d, getsockopt failed!,error:%d | |
%s,select error! | |
%s %d, connect failed!err:%s(%d) | |
PTZ control fail!! | |
byte | |
-tptz:SetConfigurationResponse-sequence | |
-tptz10:SetConfigurationResponse-sequence | |
wsse:Security | |
ds:P | |
xsd:string | |
ds:Q | |
ds:Seed | |
ds:PgenCounter | |
PortName | |
-anyAttribute | |
wsa:ServiceNameType | |
xml:lang | |
d:ScopesType | |
wsadis:AttributedURI | |
wsadis:AttributedQName | |
wsadis:ServiceNameType | |
wsadis:ReplyAfterType | |
wsadis:RetryAfterType | |
ValueType | |
EncodingType | |
RelationshipType | |
wsa:RelatesTo | |
wsa:Relationship | |
wsrf-bf:BaseFaultType-Description | |
wsnt:SubscribeCreationFailedFaultType-Description | |
wsnt:InvalidFilterFaultType-Description | |
wsnt:TopicExpressionDialectUnknownFaultType-Description | |
wsnt:InvalidTopicExpressionFaultType-Description | |
wsnt:TopicNotSupportedFaultType-Description | |
wsnt:MultipleTopicsSpecifiedFaultType-Description | |
wsnt:InvalidProducerPropertiesExpressionFaultType-Description | |
wsnt:InvalidMessageContentExpressionFaultType-Description | |
wsnt:UnrecognizedPolicyRequestFaultType-Description | |
wsnt:UnsupportedPolicyRequestFaultType-Description | |
wsnt:NotifyMessageNotSupportedFaultType-Description | |
wsnt:UnacceptableInitialTerminationTimeFaultType-Description | |
wsnt:NoCurrentMessageOnTopicFaultType-Description | |
wsnt:UnableToGetMessagesFaultType-Description | |
wsnt:UnableToDestroyPullPointFaultType-Description | |
wsnt:UnableToCreatePullPointFaultType-Description | |
wsnt:UnacceptableTerminationTimeFaultType-Description | |
wsnt:UnableToDestroySubscriptionFaultType-Description | |
wsnt:PauseFailedFaultType-Description | |
wsnt:ResumeFailedFaultType-Description | |
wsrf:ResourceUnknownFaultType-Description | |
wsrf:ResourceUnavailableFaultType-Description | |
wsadis:Relationship | |
wsse:Password | |
wsse:BinarySecurityToken | |
wsse:KeyIdentifier | |
-ds:DSAKeyValueType-sequence | |
-any | |
wsa:ReferencePropertiesType | |
wsa:ReferenceParametersType | |
wsa:Address | |
wsa:ReferenceProperties | |
wsa:ReferenceParameters | |
wsa:PortType | |
wsa:ServiceName | |
wsa:From | |
wsa:ReplyTo | |
wsa:FaultTo | |
wsa:EndpointReferenceType | |
wsa:MessageID | |
wsa:To | |
wsa:Action | |
SOAP-ENV:Header | |
PrefixList | |
c14n:InclusiveNamespaces | |
ds:TransformType | |
tad:Capabilities | |
tad:ConfigurationToken | |
tad:DeleteAnalyticsEngineControl | |
tad:GetAnalyticsEngineControl | |
tad:GetAnalyticsEngineControls | |
tad:GetAnalyticsEngine | |
tad:GetAnalyticsEngines | |
tad:GetAnalyticsEngineInput | |
tad:GetAnalyticsEngineInputs | |
tad:GetVideoAnalyticsConfiguration | |
tad:DeleteAnalyticsEngineInputs | |
tad:AnalyticsEngineControlToken | |
tad:GetAnalyticsState | |
tt:DeviceEntity | |
tt:Min | |
tt:Max | |
tt:DurationRange | |
tt:AnyHolder | |
tt:VideoSourceExtension2 | |
tt:ProfileExtension2 | |
tt:VideoSourceConfigurationExtension2 | |
tt:RotateExtension | |
tt:VideoSourceConfigurationOptionsExtension2 | |
tt:RotateOptionsExtension | |
tt:VideoEncoderOptionsExtension2 | |
tt:AudioSourceOptionsExtension | |
tt:InputTokensAvailable | |
tt:Extension | |
tt:AudioSourceConfigurationOptions | |
tt:MetadataConfigurationExtension | |
wsnt:FilterType | |
tt:EventSubscription-SubscriptionPolicy | |
tt:Filter | |
tt:SubscriptionPolicy | |
tt:EventSubscription | |
tt:PTZStatusFilterOptionsExtension | |
tt:VideoOutputExtension | |
tt:VideoOutputConfigurationOptions | |
tt:VideoDecoderConfigurationOptionsExtension | |
tt:AudioDecoderConfigurationOptionsExtension | |
tt:Dot3Configuration | |
tt:NetworkInterfaceExtension2 | |
tt:IPv6ConfigurationExtension | |
tt:NetworkProtocolExtension | |
tt:NetworkHostExtension | |
tt:HostnameInformationExtension | |
tt:DNSInformationExtension | |
tt:NTPInformationExtension | |
tt:DynamicDNSInformationExtension | |
tt:NetworkInterfaceSetConfigurationExtension2 | |
tt:IPv4Address | |
tt:IPv6Address | |
tt:NetworkGateway | |
tt:NetworkZeroConfigurationExtension2 | |
tt:IPAddressFilterExtension | |
tt:Dot11SecurityConfigurationExtension | |
tt:Dot11PSKSetExtension | |
tt:Dot11AvailableNetworksExtension | |
tt:XAddr | |
tt:ImagingCapabilities | |
tt:PTZCapabilities | |
tt:ReplayCapabilities | |
tt:CapabilitiesExtension2 | |
tt:DeviceCapabilitiesExtension | |
tt:IOCapabilitiesExtension2 | |
tt:RealTimeStreamingCapabilitiesExtension | |
tt:NetworkCapabilitiesExtension2 | |
tt:SystemCapabilitiesExtension2 | |
tt:AnalyticsDeviceExtension | |
xmime:contentType | |
tt:AttachmentData | |
tt:Binary | |
tt:String | |
tt:SystemLog | |
tt:SupportInformation | |
tt:Name | |
tt:Data | |
tt:BackupFile | |
tt:TZ | |
tt:TimeZone | |
tt:SystemDateTimeExtension | |
tt:UserExtension | |
tt:CertificateGenerationParametersExtension | |
tt:CertificateID | |
tt:Subject | |
tt:ValidNotBefore | |
tt:ValidNotAfter | |
tt:CertificateGenerationParameters | |
tt:CertificateInformationExtension | |
tt:Dot1XConfigurationExtension | |
tt:TLSConfiguration | |
tt:EapMethodExtension | |
tt:Password | |
tt:EAPMethodConfiguration | |
tt:GenericEapPwdConfigurationExtension | |
tt:PTZNodeExtension2 | |
tt:PTZPresetTourSupportedExtension | |
tt:PTZConfigurationExtension2 | |
tt:PTControlDirectionExtension | |
tt:PTZConfigurationOptions2 | |
tt:PTControlDirectionOptionsExtension | |
tt:EFlipOptionsExtension | |
tt:ReverseOptionsExtension | |
tt:PTZSpacesExtension | |
tt:PTZPresetTourExtension | |
tt:PTZPresetTourSpotExtension | |
tt:PTZPresetTourTypeExtension | |
tt:PTZPresetTourStatusExtension | |
tt:PTZPresetTourStartingConditionExtension | |
tt:PTZPresetTourPresetDetailOptionsExtension | |
tt:PTZPresetTourStartingConditionOptionsExtension | |
tt:ImagingSettingsExtension | |
tt:ImagingStatus20Extension | |
tt:FocusStatus20Extension | |
tt:ImagingSettingsExtension202 | |
tt:ImageStabilizationExtension | |
tt:ImagingOptions20Extension2 | |
tt:ImageStabilizationOptionsExtension | |
tt:WhiteBalance20Extension | |
tt:FocusConfiguration20Extension | |
tt:WhiteBalanceOptions20Extension | |
tt:FocusOptions20Extension | |
tt:MessageExtension | |
tt:ItemList-SimpleItem | |
tt:ItemList-ElementItem | |
tt:ItemListExtension | |
tt:SimpleItem | |
tt:ElementItem | |
tt:ItemList | |
tt:MessageDescriptionExtension | |
tt:ItemListDescription-SimpleItemDescription | |
tt:ItemListDescription-ElementItemDescription | |
tt:ItemListDescriptionExtension | |
tt:SimpleItemDescription | |
tt:ElementItemDescription | |
tt:ItemListDescription | |
tt:AppearanceExtension | |
tt:ShapeDescriptorExtension | |
tt:ColorDescriptorExtension | |
tt:ClassDescriptorExtension2 | |
tt:ObjectExtension | |
tt:TransformationExtension | |
tt:FrameExtension2 | |
ObjectId | |
tt:ObjectId | |
tt:from | |
tt:to | |
tt:Merge | |
tt:Split | |
tt:Rename | |
tt:Behaviour-Removed | |
tt:Behaviour-Idle | |
tt:BehaviourExtension | |
tt:Removed | |
tt:Idle | |
tt:Behaviour | |
tt:ObjectTreeExtension | |
tt:Delete | |
tt:ObjectTree | |
tt:Parameters | |
tt:Config | |
tt:AnalyticsEngineConfigurationExtension | |
tt:AnalyticsModule | |
tt:AnalyticsEngineConfiguration | |
tt:RuleEngineConfigurationExtension | |
tt:Rule | |
tt:RuleEngineConfiguration | |
tt:ConfigDescriptionExtension | |
tt:SupportedRulesExtension | |
tt:SupportedAnalyticsModulesExtension | |
tt:PolylineArrayExtension | |
tt:Expression | |
tt:MotionExpression | |
tt:MotionExpressionConfiguration | |
tt:MetadataStreamExtension | |
tt:VideoAnalyticsStreamExtension | |
tt:PTZStreamExtension | |
tt:EventStreamExtension | |
tt:LayoutExtension | |
tt:LayoutOptionsExtension | |
tt:PaneOptionExtension | |
tt:Token | |
tt:SourceReference | |
tt:SearchScopeExtension | |
tt:IncludedSources | |
tt:IncludedRecordings | |
tt:RecordingInformationFilter | |
tt:SearchScope | |
tt:MetadataStreamFilter | |
tt:MetadataFilter | |
tt:SourceId | |
tt:Location | |
tt:Description | |
tt:Address | |
tt:RecordingSourceInformation | |
tt:TrackAttributesExtension | |
tt:Source | |
tt:Content | |
tt:MaximumRetentionTime | |
tt:RecordingConfiguration | |
tt:RecordingJobConfigurationExtension | |
tt:SourceTag | |
tt:Destination | |
tt:RecordingJobTrack | |
tt:RecordingJobSourceExtension | |
tt:RecordingJobStateInformationExtension | |
tt:Error | |
tt:State | |
tt:RecordingJobStateTrack | |
tt:Track | |
tt:RecordingJobStateTracks | |
tt:SourceToken | |
tt:Tracks | |
tt:RecordingJobStateSource | |
tt:RecordingToken | |
tt:Sources | |
tt:RecordingJobStateInformation | |
tt:SessionTimeout | |
tt:ReplayConfiguration | |
tt:AnalyticsDeviceEngineConfigurationExtension | |
tt:AnalyticsEngineInputInfoExtension | |
tt:InputInfo | |
tt:AnalyticsEngineInputInfo | |
tt:SourceIdentificationExtension | |
tt:SourceIdentification | |
tt:MetadataInputExtension | |
tt:MetadataConfig | |
tt:MetadataInput | |
tt:AnalyticsState | |
tt:AnalyticsEngineControlToken | |
tt:AnalyticsStateInformation | |
tt:ActionEngineEventPayloadExtension | |
-mixed | |
wsnt:QueryExpressionType | |
wsnt:TopicExpressionType | |
wsnt:SubscriptionPolicyType | |
wsnt:NotificationMessageHolderType-Message | |
wsnt:SubscriptionReference | |
wsnt:Topic | |
wsnt:ProducerReference | |
wsnt:Message | |
wsnt:NotificationMessageHolderType | |
wsnt:NotificationMessage | |
-tt:union-EventStream | |
tt:EventStream | |
wsnt:Notify | |
wsnt:UseRaw | |
wsnt:Subscribe-SubscriptionPolicy | |
wsnt:ConsumerReference | |
wsnt:Filter | |
wsnt:InitialTerminationTime | |
wsnt:SubscriptionPolicy | |
wsnt:GetCurrentMessage | |
wsnt:MaximumNumber | |
wsnt:GetMessages | |
wsnt:DestroyPullPoint | |
wsnt:CreatePullPoint | |
wsnt:TerminationTime | |
wsnt:PauseSubscription | |
wsnt:ResumeSubscription | |
dialect | |
wsrf-bf:BaseFaultType-ErrorCode | |
wsrf-bf:BaseFaultType-FaultCause | |
wstop:Documentation | |
wstop:documentation | |
wstop:TopicSetType | |
wstop:ExtensibleDocumented | |
wstop:QueryExpressionType | |
tmd:RelayOutputOptionsExtension | |
tmd:RelayOutputToken | |
tmd:GetVideoOutputs | |
tmd:AudioSourceToken | |
tmd:GetAudioSourceConfiguration | |
tmd:AudioOutputToken | |
tmd:GetAudioOutputConfiguration | |
tmd:VideoSourceToken | |
tmd:GetVideoSourceConfiguration | |
tmd:VideoOutputToken | |
tmd:GetVideoOutputConfiguration | |
tmd:GetVideoSourceConfigurationOptions | |
tmd:GetVideoOutputConfigurationOptions | |
tmd:GetAudioSourceConfigurationOptions | |
tmd:GetAudioOutputConfigurationOptions | |
tt:DigitalInput | |
tmd:GetSerialPorts | |
tmd:SerialPort | |
tmd:SerialPortToken | |
tmd:GetSerialPortConfiguration | |
tmd:GetSerialPortConfigurationOptions | |
tt:AudioOutput | |
trt:Name | |
trt:Token | |
trt:ProfileToken | |
trt:ConfigurationToken | |
trt:AddVideoAnalyticsConfiguration | |
trt:AddMetadataConfiguration | |
trt:StartMulticastStreaming | |
trt:StopMulticastStreaming | |
tds:Service-Capabilities | |
AuxiliaryCommands | |
tds:MiscCapabilities | |
tds:Firmware | |
tds:UpgradeSystemFirmware | |
tds:BackupFiles | |
tds:GetSystemSupportInformation | |
tds:Scopes | |
tds:ScopeItem | |
tds:GetRemoteDiscoveryMode | |
tds:GetDPAddresses | |
tds:GetEndpointReference | |
tds:GetRemoteUser | |
tds:Username | |
tds:Name | |
tds:IPv4Address | |
tds:IPv6Address | |
tds:GetIPAddressFilter | |
tds:GetAccessPolicy | |
tds:GetCertificates | |
tds:GetCertificatesStatus | |
tds:CertificateID | |
tds:DeleteCertificates | |
tds:GetClientCertificateMode | |
tds:GetCACertificates | |
tds:GetCertificateInformation | |
tds:Dot1XConfigurationToken | |
tds:GetDot1XConfiguration | |
tds:GetDot1XConfigurations | |
tds:DeleteDot1XConfiguration | |
tds:AuxiliaryCommand | |
tds:SendAuxiliaryCommand | |
tds:GetDot11Capabilities | |
tds:InterfaceToken | |
tds:GetDot11Status | |
tds:ScanAvailableDot11Networks | |
tds:GetSystemUris | |
tds:GetSystemUrisResponse-Extension | |
tds:StartFirmwareUpgrade | |
tds:StartSystemRestore | |
tls:GetServiceCapabilities | |
tls:VideoOutput | |
tls:GetLayout | |
tls:GetDisplayOptions | |
tls:GetPaneConfigurations | |
tls:Pane | |
tls:GetPaneConfiguration | |
tls:PaneToken | |
tls:DeletePaneConfiguration | |
tev:CreatePullPointSubscription-SubscriptionPolicy | |
tev:Filter | |
tev:InitialTerminationTime | |
tev:SubscriptionPolicy | |
tptz:NodeToken | |
tptz:PTZConfigurationToken | |
tptz:ConfigurationToken | |
tptz:ProfileToken | |
tptz:AuxiliaryData | |
tptz:PresetName | |
tptz:PresetToken | |
tptz:PresetTourToken | |
tptz10:NodeToken | |
tptz10:NodeName | |
tptz10:ConfigurationToken | |
tptz10:ConfigurationName | |
tptz10:ProfileToken | |
tptz10:AuxiliaryData | |
tptz10:PresetName | |
tptz10:PresetToken | |
tptz10:GetPreset | |
trc:GetServiceCapabilities | |
trc:RecordingConfiguration | |
trc:CreateRecording | |
trc:RecordingToken | |
trc:DeleteRecording | |
trc:GetRecordings | |
trc:SetRecordingConfiguration | |
trc:GetRecordingConfiguration | |
trc:TrackToken | |
trc:DeleteTrack | |
trc:GetTrackConfiguration | |
trc:JobToken | |
trc:DeleteRecordingJob | |
trc:GetRecordingJobs | |
trc:GetRecordingJobConfiguration | |
trc:Mode | |
trc:SetRecordingJobMode | |
trc:GetRecordingJobState | |
trp:Configuration | |
tan10:ConfigurationToken | |
tan10:Rule | |
tan10:RuleName | |
tan10:AnalyticsModule | |
tan10:AnalyticsModuleName | |
tan:ConfigurationToken | |
tan:Rule | |
tan:CreateRules | |
tan:RuleName | |
tan:DeleteRules | |
tan:AnalyticsModule | |
tan:CreateAnalyticsModules | |
tan:AnalyticsModuleName | |
tan:DeleteAnalyticsModules | |
timg:VideoSourceToken | |
trv:GetServiceCapabilities | |
trv:GetReceivers | |
trv:ReceiverToken | |
trv:GetReceiver | |
trv:DeleteReceiver | |
trv:GetReceiverState | |
d:Types | |
d:Scopes | |
d:ProbeType | |
dn:Probe | |
wsadis:ReferencePropertiesType | |
wsadis:ReferenceParametersType | |
wsadis:Address | |
wsadis:ReferenceProperties | |
wsadis:ReferenceParameters | |
wsadis:PortType | |
wsadis:ServiceName | |
wsadis:EndpointReferenceType | |
tse:GetServiceCapabilities | |
tse:GetRecordingSummary | |
tse:RecordingToken | |
tse:GetRecordingInformation | |
tt:EventFilter | |
tse:SearchToken | |
tse:GetSearchState | |
tse:EndSearch | |
ds:CanonicalizationMethodType | |
ds:Transform | |
ds:TransformsType | |
ds:Transforms | |
ds:RetrievalMethodType | |
ds:DigestMethodType | |
ds:DigestMethod | |
ds:DigestValue | |
ds:ReferenceType | |
-DSAKeyValueType-sequence | |
ds:G | |
ds:Y | |
ds:J | |
ds:DSAKeyValueType | |
ds:Modulus | |
ds:Exponent | |
ds:RSAKeyValueType | |
ds:DSAKeyValue | |
ds:RSAKeyValue | |
ds:KeyValueType | |
ds:X509IssuerName | |
ds:X509SerialNumber | |
ds:X509IssuerSerialType | |
wsnt:SubscribeCreationFailedFaultType-ErrorCode | |
wsnt:SubscribeCreationFailedFaultType-FaultCause | |
wsnt:InvalidFilterFaultType-ErrorCode | |
wsnt:InvalidFilterFaultType-FaultCause | |
wsnt:TopicExpressionDialectUnknownFaultType-ErrorCode | |
wsnt:TopicExpressionDialectUnknownFaultType-FaultCause | |
wsnt:InvalidTopicExpressionFaultType-ErrorCode | |
wsnt:InvalidTopicExpressionFaultType-FaultCause | |
wsnt:TopicNotSupportedFaultType-ErrorCode | |
wsnt:TopicNotSupportedFaultType-FaultCause | |
wsnt:MultipleTopicsSpecifiedFaultType-ErrorCode | |
wsnt:MultipleTopicsSpecifiedFaultType-FaultCause | |
wsnt:InvalidProducerPropertiesExpressionFaultType-ErrorCode | |
wsnt:InvalidProducerPropertiesExpressionFaultType-FaultCause | |
wsnt:InvalidMessageContentExpressionFaultType-ErrorCode | |
wsnt:InvalidMessageContentExpressionFaultType-FaultCause | |
wsnt:UnrecognizedPolicyRequestFaultType-ErrorCode | |
wsnt:UnrecognizedPolicyRequestFaultType-FaultCause | |
wsnt:UnsupportedPolicyRequestFaultType-ErrorCode | |
wsnt:UnsupportedPolicyRequestFaultType-FaultCause | |
wsnt:NotifyMessageNotSupportedFaultType-ErrorCode | |
wsnt:NotifyMessageNotSupportedFaultType-FaultCause | |
wsnt:UnacceptableInitialTerminationTimeFaultType-ErrorCode | |
wsnt:UnacceptableInitialTerminationTimeFaultType-FaultCause | |
wsnt:NoCurrentMessageOnTopicFaultType-ErrorCode | |
wsnt:NoCurrentMessageOnTopicFaultType-FaultCause | |
wsnt:UnableToGetMessagesFaultType-ErrorCode | |
wsnt:UnableToGetMessagesFaultType-FaultCause | |
wsnt:UnableToDestroyPullPointFaultType-ErrorCode | |
wsnt:UnableToDestroyPullPointFaultType-FaultCause | |
wsnt:UnableToCreatePullPointFaultType-ErrorCode | |
wsnt:UnableToCreatePullPointFaultType-FaultCause | |
wsnt:UnacceptableTerminationTimeFaultType-ErrorCode | |
wsnt:UnacceptableTerminationTimeFaultType-FaultCause | |
wsnt:UnableToDestroySubscriptionFaultType-ErrorCode | |
wsnt:UnableToDestroySubscriptionFaultType-FaultCause | |
wsnt:PauseFailedFaultType-ErrorCode | |
wsnt:PauseFailedFaultType-FaultCause | |
wsnt:ResumeFailedFaultType-ErrorCode | |
wsnt:ResumeFailedFaultType-FaultCause | |
wsrf:ResourceUnknownFaultType-ErrorCode | |
wsrf:ResourceUnknownFaultType-FaultCause | |
wsrf:ResourceUnavailableFaultType-ErrorCode | |
wsrf:ResourceUnavailableFaultType-FaultCause | |
wsse:Username | |
wsse:Nonce | |
wsu:Created | |
wsse:UsernameToken | |
wsse:Reference | |
wsse:Embedded | |
wsse:SecurityTokenReference | |
wsu:Expires | |
wsu:Timestamp | |
SOAP-ENV:Value | |
SOAP-ENV:Subcode | |
SOAP-ENV:Code | |
SOAP-ENV:Text | |
SOAP-ENV:Reason | |
SOAP-ENV: | |
xsd:duration | |
xsd:anyURI | |
xsd:token | |
tt:RecordingReference | |
tt:XPathExpression | |
tt:TrackReference | |
tt:RecordingJobState | |
-union-EventStream | |
wsnt:AbsoluteOrRelativeTimeType | |
xsd:nonNegativeInteger | |
tt:AuxiliaryData | |
tt:RecordingJobReference | |
tt:RecordingJobMode | |
d:QNameListType | |
tt:JobToken | |
xsd:integer | |
:base64Binary | |
:base64 | |
tmd:Binary | |
xsd:base64Binary | |
tmd:String | |
tmd:SerialData | |
tmd:TimeOut | |
tmd:DataLength | |
tmd:Delimiter | |
tmd:SendReceiveSerialCommand | |
ds:X509IssuerSerial | |
ds:X509SKI | |
ds:X509SubjectName | |
ds:X509Certificate | |
ds:X509CRL | |
-X509DataType-sequence | |
-ds:X509DataType-sequence | |
ds:KeyName | |
ds:KeyValue | |
ds:RetrievalMethod | |
ds:X509Data | |
ds:X509DataType | |
tt:Certificate | |
tt:BinaryData | |
tds:NVTCertificate | |
tds:LoadCertificates | |
tds:CACertificate | |
tds:LoadCACertificates | |
tt:PrivateKey | |
tds:CertificateWithPrivateKey | |
tt:CertificateWithPrivateKey | |
tds:LoadCertificateWithPrivateKey | |
tds:PolicyFile | |
tds:SetAccessPolicy | |
tds:Subject | |
tds:Attributes | |
tds:GetPkcs10Request | |
ds:KeyInfoType | |
:hexBinary | |
tt:Key | |
tt:Dot11PSK | |
tt:Passphrase | |
tt:Dot11PSKPassphrase | |
xsd:hexBinary | |
tt:Dot11SSIDType | |
tt:Dot11PSKSet | |
tad:Uri | |
tad:State | |
-size | |
-sizeNotificationMessage | |
wsnt:PullPoint | |
tmd:VideoOutputConfigurationOptions | |
tmd:AudioSourceOptions | |
tmd:DigitalInputs | |
-sizeDigitalInputs | |
-sizeSerialPort | |
trt:AudioOutputs | |
-sizeAudioOutputs | |
trt:Options | |
tds:Manufacturer | |
tds:Model | |
tds:FirmwareVersion | |
tds:SerialNumber | |
tds:HardwareId | |
tds:Message | |
-sizeBackupFiles | |
tds:SupportInformation | |
tds:SystemLog | |
-sizeScopeItem | |
tds:GUID | |
tds:WsdlUrl | |
tds:NetworkGateway | |
tds:NvtCertificate | |
-sizeNvtCertificate | |
tds:Pkcs10Request | |
-sizeCACertificate | |
tds:AuxiliaryCommandResponse | |
tds:UploadUri | |
tds:UploadDelay | |
tds:ExpectedDownTime | |
-SetConfigurationResponse-sequence | |
-size-SetConfigurationResponse-sequence | |
tptz:AuxiliaryResponse | |
tptz10:AuxiliaryResponse | |
trc:State | |
trp:Uri | |
-sizeAnalyticsModule | |
-sizeRule | |
wsadis:EndpointReference | |
d:ResolveType | |
tmd:Capabilities | |
MaximumNumberOfProfiles | |
tt:IntRectangle | |
trt:ProfileCapabilities | |
tt:PanTilt | |
tt:Vector2D | |
tt:Zoom | |
tt:Vector1D | |
tt:PTZPosition | |
tt:PTZVector | |
tptz10:Preset | |
tt:PTZPreset | |
tptz:Preset | |
-sizePreset | |
tptz10:PTZPreset | |
-sizePTZPreset | |
tptz:Speed | |
tt:PTZSpeed | |
tptz:Velocity | |
tptz:Timeout | |
tptz:Translation | |
tptz:Position | |
xsd:Name | |
tptz10:Speed | |
tptz10:Velocity | |
tptz10:Timeout | |
tptz10:Translation | |
tptz10:Destination | |
bottom | |
right | |
left | |
tt:Pane | |
tt:Area | |
tt:Rectangle | |
tt:PaneLayout | |
tls:Layout | |
tt:Layout | |
tls:SetLayout | |
tt:PaneLayoutOptions | |
tt:Translate | |
tt:Vector | |
tt:Scale | |
Columns | |
Rows | |
tt:Transformation | |
tt:Point | |
tt:Polygon | |
tt:BoundingBox | |
tt:CenterOfGravity | |
tt:Segment | |
tt:Polyline | |
tt:PolylineArray | |
Colorspace | |
tptz10:GetPresetResponse | |
tt:LayoutOptions | |
tt:PolygonConfiguration | |
tt:ShapeDescriptor | |
tt:PolylineArrayConfiguration | |
tt:Color | |
tt:ColorCovariance | |
Cells | |
tt:MotionInCells | |
KeyId | |
Refs | |
d:Sig | |
d:SigType | |
tt:FrameExtension | |
d:SecurityType | |
InstanceId | |
SequenceId | |
MessageNumber | |
d:AppSequenceType | |
tt:CertificateUsage | |
IsProperty | |
tt:ParentTopic | |
tt:Messages | |
tt:RuleContentSchemaLocation | |
tt:RuleDescription | |
tt:ConfigDescription | |
tan:SupportedRules | |
tt:SupportedRules | |
tt:AnalyticsModuleContentSchemaLocation | |
tt:AnalyticsModuleDescription | |
tan:SupportedAnalyticsModules | |
tt:SupportedAnalyticsModules | |
tan10:RuleContentSchemaLocation | |
tan10:RuleDescription | |
-sizeRuleContentSchemaLocation | |
tan10:AnalyticsModuleContentSchemaLocation | |
tan10:AnalyticsModuleDescription | |
-sizeAnalyticsModuleContentSchemaLocation | |
RTPMulticast | |
RTP_TCP | |
RTP_RTSP_TCP | |
NonAggregateControl | |
Rotation | |
trt:StreamingCapabilities | |
trt:Capabilities | |
IPFilter | |
IPVersion6 | |
DynDNS | |
Dot11Configuration | |
TLS1.0 | |
TLS1.1 | |
TLS1.2 | |
OnboardKeyGeneration | |
AccessPolicyConfig | |
DefaultAccessPolicy | |
Dot1X | |
RemoteUserHandling | |
X.509Token | |
SAMLToken | |
KerberosToken | |
UsernameToken | |
HttpDigest | |
RELToken | |
SupportedEAPMethods | |
DiscoveryResolve | |
DiscoveryBye | |
RemoteDiscovery | |
HttpFirmwareUpgrade | |
HttpSystemBackup | |
HttpSystemLogging | |
HttpSupportInformation | |
tds:Network | |
tds:NetworkCapabilities | |
tds:Security | |
tds:SecurityCapabilities | |
tds:System | |
tds:SystemCapabilities | |
tds:Misc | |
tds:Capabilities | |
tds:DeviceServiceCapabilities | |
FixedLayout | |
tls:Capabilities | |
WSSubscriptionPolicySupport | |
WSPullPointSupport | |
WSPausableSubscriptionManagerInterfaceSupport | |
tev:Capabilities | |
EFlip | |
Reverse | |
tptz:Capabilities | |
DynamicRecordings | |
DynamicTracks | |
MaxRate | |
MaxTotalRate | |
MaxRecordings | |
trc:Capabilities | |
ReversePlayback | |
SessionTimeoutRange | |
trp:Capabilities | |
RuleSupport | |
AnalyticsModuleSupport | |
CellBasedSceneDescriptionSupported | |
tan:Capabilities | |
ImageStabilization | |
timg:Capabilities | |
RTP_Multicast | |
SupportedReceivers | |
MaximumRTSPURILength | |
trv:Capabilities | |
MetadataSearch | |
tse:Capabilities | |
messageTypes | |
final | |
wstop:MessagePattern | |
wstop:Topic | |
wstop:TopicType | |
parent | |
targetNamespace | |
:boolean | |
tt:RuleSupport | |
xsd:boolean | |
tt:Auxiliary | |
tt:AuxiliaryCommands | |
tt:RTPMulticast | |
tt:RTP_TCP | |
tt:RTP_RTSP_TCP | |
tt:Dot11Configuration | |
tt:IPFilter | |
tt:ZeroConfiguration | |
tt:IPVersion6 | |
tt:DynDNS | |
tt:NetworkCapabilitiesExtension | |
tt:HttpFirmwareUpgrade | |
tt:HttpSystemBackup | |
tt:HttpSystemLogging | |
tt:HttpSupportInformation | |
tt:AutoCreateReceiver | |
wsnt:TopicExpression | |
wsnt:FixedTopicSet | |
wsnt:TopicExpressionDialect | |
wstop:TopicSet | |
tptz:PanTilt | |
tptz:Zoom | |
tptz10:PanTilt | |
tptz10:Zoom | |
tt:PresetToken | |
tt:Home | |
tt:TypeExtension | |
tt:PresetDetail | |
tt:PTZPresetTourPresetDetail | |
tt:Speed | |
tt:StayTime | |
tt:Status | |
tt:Position | |
tt:PanTiltStatusSupported | |
tt:ZoomStatusSupported | |
tt:PanTiltPositionSupported | |
tt:ZoomPositionSupported | |
tt:PTZStatusFilterOptions | |
tt:MetadataConfigurationOptions | |
tt:Uri | |
tt:InvalidAfterConnect | |
tt:InvalidAfterReboot | |
tt:Timeout | |
trt:MediaUri | |
tt:MediaUri | |
tt:FromDHCP | |
tds:HostnameInformation | |
tt:HostnameInformation | |
tt:InterfaceToken | |
tt:Enabled | |
tt:Addresses | |
tt:NetworkZeroConfigurationExtension | |
tds:ZeroConfiguration | |
tt:NetworkZeroConfiguration | |
tt:Additional | |
tt:TKIP | |
tt:ScanAvailableNetworks | |
tt:MultipleConfiguration | |
tt:AdHocStationMode | |
tt:WEP | |
tt:Dot11Capabilities | |
tt:AnalyticsModuleSupport | |
tt:WSSubscriptionPolicySupport | |
tt:WSPullPointSupport | |
tt:WSPausableSubscriptionManagerInterfaceSupport | |
tt:FixedLayout | |
tt:MetadataSearch | |
tt:Username | |
tt:UseDerivedPassword | |
tds:RemoteUser | |
tt:RemoteUser | |
tds:SetRemoteUser | |
tds:CertificateStatus | |
tt:CertificateStatus | |
-sizeCertificateStatus | |
tds:SetCertificatesStatus | |
tt:MinPosition | |
tt:MaxPosition | |
tt:EnterOrExit | |
tt:CanContainPTZ | |
tt:CanContainAnalytics | |
tt:CanContainNotifications | |
tds:IncludeCapability | |
tds:FromDHCP | |
tds:RebootNeeded | |
tds:Enabled | |
tds:SetZeroConfiguration | |
tds:SetClientCertificateMode | |
tev:TopicNamespaceLocation | |
tev:MessageContentFilterDialect | |
tev:ProducerPropertiesFilterDialect | |
tev:MessageContentSchemaLocation | |
-sizeTopicNamespaceLocation | |
tt:Protocol | |
tt:TransportProtocol | |
tt:Tunnel | |
tt:Transport | |
tt:Stream | |
tt:StreamType | |
tad:StreamSetup | |
tt:StreamSetup | |
tad:GetAnalyticsDeviceStreamUri | |
trt:StreamSetup | |
trp:StreamSetup | |
trp:RecordingToken | |
tt:ScopeDef | |
tt:ScopeDefinition | |
tt:ScopeItem | |
tt:Scope | |
-sizeScopes | |
tds:DiscoveryMode | |
tt:DiscoveryMode | |
tds:RemoteDiscoveryMode | |
tds:SetRemoteDiscoveryMode | |
tt:Type | |
tt:NetworkHostType | |
tt:DNSname | |
tt:DNSName | |
tt:NTPFromDHCP | |
tt:NetworkHost | |
tt:NTPManual | |
tds:NTPInformation | |
tt:NTPInformation | |
tds:DPAddress | |
-sizeDPAddress | |
tds:SetDPAddresses | |
tds:NTPManual | |
tt:IPType | |
tt:SearchDomain | |
tt:DNSFromDHCP | |
tt:IPAddress | |
tt:DNSManual | |
tds:DNSInformation | |
tt:DNSInformation | |
tds:SearchDomain | |
tds:DNSManual | |
tt:DynamicDNSType | |
tt:TTL | |
tds:DynamicDNSInformation | |
tt:DynamicDNSInformation | |
tds:Type | |
tds:TTL | |
tt:Mode | |
tt:Dot11SecurityMode | |
tt:Algorithm | |
tt:Dot11Cipher | |
tt:PSK | |
tt:Dot1X | |
tt:SSID | |
tt:Dot11StationMode | |
tt:Alias | |
tt:Priority | |
tt:NetworkInterfaceConfigPriority | |
tt:Security | |
tt:Dot11SecurityConfiguration | |
tt:Dot3 | |
tt:Dot11 | |
tt:BSSID | |
tt:PairCipher | |
tt:GroupCipher | |
tt:SignalStrength | |
tt:Dot11SignalStrength | |
tt:ActiveConfigAlias | |
tds:Status | |
tt:Dot11Status | |
tt:AuthAndMangementSuite | |
tt:Dot11AuthAndMangementSuite | |
tds:Networks | |
tt:Dot11AvailableNetworks | |
-sizeNetworks | |
tds:Category | |
tt:CapabilityCategory | |
tt:SystemLogType | |
tt:SystemLogUri | |
tds:SystemLogUris | |
tt:SystemLogUriList | |
tds:SupportInfoUri | |
tds:SystemBackupUri | |
tds:Extension | |
tds:LogType | |
tds:FactoryDefault | |
tt:FactoryDefaultType | |
tt:UserLevel | |
tds:User | |
tt:User | |
-sizeUser | |
tds:RelayOutputToken | |
tds:LogicalState | |
tt:RelayLogicalState | |
tt:RelayMode | |
tt:DelayTime | |
tt:IdleState | |
tt:RelayIdleState | |
tt:Properties | |
tt:RelayOutputSettings | |
tmd:RelayOutput | |
tt:RelayOutput | |
tmd:SetRelayOutputSettings | |
tds:RelayOutputs | |
-sizeRelayOutputs | |
tds:Properties | |
tmd:Mode | |
tmd:DelayTimes | |
tmd:Discrete | |
tmd:Extension | |
tmd:RelayOutputOptions | |
-sizeRelayOutputOptions | |
tt:EFlipMode | |
tt:ReverseMode | |
tt:EFlip | |
tt:Reverse | |
tt:PTControlDirection | |
tt:EFlipOptions | |
tt:ReverseOptions | |
tt:MoveStatus | |
tt:PTZPresetTourState | |
tt:CurrentTourSpot | |
tt:PTZPresetTourSpot | |
tptz:Operation | |
tt:PTZPresetTourOperation | |
UtcTime | |
PropertyOperation | |
tt:ReceiverMode | |
tt:Configuration | |
tt:ReceiverConfiguration | |
trv:Receiver | |
tt:Receiver | |
trv:Receivers | |
-sizeReceivers | |
trv:Configuration | |
trv:CreateReceiver | |
trv:ConfigureReceiver | |
trv:Mode | |
trv:SetReceiverMode | |
tt:ReceiverState | |
tt:AutoCreated | |
trv:ReceiverState | |
tt:ReceiverStateInformation | |
tse:State | |
tt:SearchState | |
tt:TrackType | |
tt:TrackToken | |
tt:TrackConfiguration | |
tt:GetTracksResponseItem | |
tt:GetTracksResponseList | |
trc:RecordingItem | |
tt:GetRecordingsResponseItem | |
-sizeRecordingItem | |
trc:TrackConfiguration | |
trc:CreateTrack | |
trc:SetTrackConfiguration | |
tmd:Items | |
tmd:ParityBit | |
tt:MessageDescription | |
tt:ConfigDescription-Messages | |
MaxNotificationProducers | |
MaxPullPoints | |
wstop:TopicNamespaceType-Topic | |
wstop:TopicNamespaceType | |
tt:AnalyticsDeviceCapabilities | |
tt:IOCapabilitiesExtension | |
tt:RealTimeStreamingCapabilities | |
tt:NetworkCapabilities | |
tt:SystemCapabilitiesExtension | |
tt:RecordingJobSource | |
wsnt:NotificationProducerRP | |
tt:PTZFilter | |
tt:AnalyticsCapabilities | |
tt:EventCapabilities | |
tt:DisplayCapabilities | |
tt:SearchCapabilities | |
tt:PTZPositionFilter | |
tt:MetadataAttributes | |
wsa:RelationshipTypeValues | |
wsa:FaultSubcodeValues | |
tt:RotateMode | |
tt:VideoEncoding | |
tt:Mpeg4Profile | |
tt:H264Profile | |
tt:AudioEncoding | |
tt:Duplex | |
tt:IPv6DHCPConfiguration | |
tt:NetworkProtocolType | |
tt:IPAddressFilterType | |
tt:NetworkInterfaceSetConfigurationExtension | |
tt:SetDateTimeType | |
tt:PTZConfigurationExtension | |
tt:PTControlDirectionOptions | |
tt:PTZMoveStatus | |
tt:PTZPresetTourStatus | |
tt:PTZPresetTourDirection | |
tt:AutoFocusMode | |
tt:WideDynamicMode | |
tt:BacklightCompensationMode | |
tt:ExposurePriority | |
tt:ExposureMode | |
tt:WhiteBalanceMode | |
tt:IrCutFilterMode | |
tt:ImageStabilizationMode | |
tt:Message | |
tt:PropertyOperation | |
tt:Direction | |
tt:ClassType | |
tt:RecordingStatus | |
tt:ModeOfOperation | |
tmd:SerialPortType | |
tmd:ParityBitList | |
d:RelationshipType | |
d:FaultCodeType | |
wsadis:RelationshipTypeValues | |
wsadis:FaultSubcodeValues | |
wsse:FaultcodeEnum | |
wsu:tTimestampFault | |
wsnt:CreationTime | |
xsd:dateTime | |
wsnt:CurrentTime | |
tds:ValidNotBefore | |
tds:ValidNotAfter | |
tds:CreateCertificate | |
tt:From | |
tt:Until | |
tt:UtcTime | |
tt:PTZStatus | |
-union-PTZStream | |
-tt:union-PTZStream | |
tptz:PTZStatus | |
tptz10:PTZStatus | |
tt:Time | |
tt:Event | |
tt:StartStateEvent | |
tt:Result | |
tt:FindEventResult | |
tse:ResultList | |
tt:FindEventResultList | |
tt:FindPTZPositionResult | |
tt:FindPTZPositionResultList | |
tt:FindMetadataResult | |
tt:FindMetadataResultList | |
tt:DataFrom | |
tt:DataTo | |
tt:EarliestRecording | |
tt:LatestRecording | |
tt:TrackInformation | |
tse:RecordingInformation | |
tt:RecordingInformation | |
tt:FindRecordingResultList | |
wsrf-bf:Timestamp | |
wsrf-bf:Originator | |
wsrf-bf:ErrorCode | |
wsrf-bf:Description | |
wsrf-bf:FaultCause | |
tev:SubscriptionReference | |
tev:CurrentTime | |
tev:TerminationTime | |
tse:RecordingTokens | |
tse:Time | |
tse:GetMediaAttributes | |
tse:Endpoint | |
wsnt:Timestamp | |
wsnt:Originator | |
wsnt:ErrorCode | |
wsnt:Description | |
wsnt:FaultCause | |
wsnt:UnknownFilter | |
wsnt:UnrecognizedPolicy | |
wsnt:UnsupportedPolicy | |
wsnt:MinimumTime | |
wsnt:MaximumTime | |
wsrf:Timestamp | |
wsrf:Originator | |
wsrf:ErrorCode | |
wsrf:Description | |
wsrf:FaultCause | |
wsnt:SubscriptionManagerRP | |
tt:DateTimeRange | |
tt:PTZStream | |
wsrf-bf:BaseFaultType | |
wsnt:SubscribeCreationFailedFaultType | |
wsnt:InvalidFilterFaultType | |
wsnt:TopicExpressionDialectUnknownFaultType | |
wsnt:InvalidTopicExpressionFaultType | |
wsnt:TopicNotSupportedFaultType | |
wsnt:MultipleTopicsSpecifiedFaultType | |
wsnt:InvalidProducerPropertiesExpressionFaultType | |
wsnt:InvalidMessageContentExpressionFaultType | |
wsnt:UnrecognizedPolicyRequestFaultType | |
wsnt:UnsupportedPolicyRequestFaultType | |
wsnt:NotifyMessageNotSupportedFaultType | |
wsnt:UnacceptableInitialTerminationTimeFaultType | |
wsnt:NoCurrentMessageOnTopicFaultType | |
wsnt:UnableToGetMessagesFaultType | |
wsnt:UnableToDestroyPullPointFaultType | |
wsnt:UnableToCreatePullPointFaultType | |
wsnt:UnacceptableTerminationTimeFaultType | |
wsnt:UnableToDestroySubscriptionFaultType | |
wsnt:PauseFailedFaultType | |
wsnt:ResumeFailedFaultType | |
wsrf:ResourceUnknownFaultType | |
wsrf:ResourceUnavailableFaultType | |
d:XAddrs | |
d:UriListType | |
d:MetadataVersion | |
xsd:unsignedInt | |
dn:Bye | |
d:ByeType | |
dn:Hello | |
d:HelloType | |
d:ProbeMatch | |
d:ProbeMatchType | |
-sizeProbeMatch | |
d:ResolveMatch | |
d:ResolveMatchType | |
d:ProbeMatchesType | |
d:ResolveMatchesType | |
unsignedByte | |
tt:Level | |
xsd:float | |
tt:Window | |
tt:MinExposureTime | |
tt:MaxExposureTime | |
tt:MinGain | |
tt:MaxGain | |
tt:MinIris | |
tt:MaxIris | |
tt:ExposureTime | |
tt:Gain | |
tt:Iris | |
tt:DefaultSpeed | |
tt:NearLimit | |
tt:FarLimit | |
tt:CrGain | |
tt:CbGain | |
tt:ImageStabilization | |
tt:BacklightCompensation | |
tt:BacklightCompensation20 | |
tt:Brightness | |
tt:ColorSaturation | |
tt:Contrast | |
tt:Exposure | |
tt:Exposure20 | |
tt:Focus | |
tt:FocusConfiguration20 | |
tt:IrCutFilter | |
tt:Sharpness | |
tt:WideDynamicRange | |
tt:WideDynamicRange20 | |
tt:WhiteBalance | |
tt:WhiteBalance20 | |
tt:ImagingSettingsExtension20 | |
tt:Imaging | |
tt:ImagingSettings20 | |
timg:ImagingSettings | |
timg:ForcePersistence | |
tt:Weight | |
tt:Covariance | |
tt:ColorCluster | |
tt:URI | |
tt:XRange | |
tt:FloatRange | |
tt:YRange | |
tt:Range | |
tt:Space2DDescription | |
tt:Space1DDescription | |
tt:PanTiltPositionSpace | |
tt:ZoomPositionSpace | |
tt:PTZPresetTourPresetDetailOptions | |
tt:AbsolutePanTiltPositionSpace | |
tt:AbsoluteZoomPositionSpace | |
tt:RelativePanTiltTranslationSpace | |
tt:RelativeZoomTranslationSpace | |
tt:ContinuousPanTiltVelocitySpace | |
tt:ContinuousZoomVelocitySpace | |
tt:PanTiltSpeedSpace | |
tt:ZoomSpeedSpace | |
tt:Spaces | |
tt:PTZSpaces | |
tt:PTZTimeout | |
tptz:PTZConfigurationOptions | |
tt:PTZConfigurationOptions | |
tptz10:PTZConfigurationOptions | |
tt:AutoFocusModes | |
tt:YrGain | |
tt:YbGain | |
tt:BacklightCompensationOptions | |
tt:ExposureOptions | |
tt:FocusOptions | |
tt:IrCutFilterModes | |
tt:WideDynamicRangeOptions | |
tt:WhiteBalanceOptions | |
ImagingOptions | |
tt:ImagingOptions | |
tt:Distance | |
tt:Absolute | |
tt:AbsoluteFocusOptions | |
tt:Relative | |
tt:RelativeFocusOptions | |
tt:Continuous | |
tt:ContinuousFocusOptions | |
tt:MoveOptions | |
tt:ImageStabilizationOptions | |
tt:BacklightCompensationOptions20 | |
tt:ExposureOptions20 | |
tt:FocusOptions20 | |
tt:WideDynamicRangeOptions20 | |
tt:WhiteBalanceOptions20 | |
tt:ImagingOptions20Extension | |
timg:ImagingOptions | |
tt:ImagingOptions20 | |
tt:RelativeFocusOptions20 | |
timg:MoveOptions | |
tt:MoveOptions20 | |
tt:Items | |
tt:FocusStatus | |
tt:ImagingStatus | |
tt:FocusConfiguration | |
tt:ImagingSettings | |
ForcePersistence | |
tt:AbsoluteFocus | |
tt:RelativeFocus | |
tt:ContinuousFocus | |
timg:Focus | |
tt:FocusMove | |
Focus | |
tt:FocusStatus20 | |
timg:Status | |
tt:ImagingStatus20 | |
tt:Likelihood | |
tt:OtherTypes | |
tt:OtherType | |
tt:ClassCandidate | |
tt:ClassDescriptorExtension | |
tt:Shape | |
tt:ColorDescriptor | |
tt:Class | |
tt:ClassDescriptor | |
tt:Appearance | |
tt:Object | |
tt:Frame | |
-union-VideoAnalyticsStream | |
-tt:union-VideoAnalyticsStream | |
tt:VideoAnalytics | |
tt:VideoAnalyticsStream | |
tt:PTZ | |
-union-MetadataStream | |
-tt:union-MetadataStream | |
tt:VideoSourceExtension | |
tt:ColorDescriptor-ColorCluster | |
tt:PanTiltLimits | |
tt:ZoomLimits | |
tt:PTZPresetTourSpotOptions | |
tt:FloatList | |
tt:ClassDescriptor-ClassCandidate | |
tt:MetadataStream | |
tt:Degree | |
xsd:int | |
tt:Rotate | |
tt:HwAddress | |
tt:MTU | |
tt:InputConnectors | |
tt:RelayOutputs | |
tt:IssuerDN | |
tt:SubjectDN | |
tt:KeyUsage | |
tt:ExtendedKeyUsage | |
tt:KeyLength | |
tt:Version | |
tt:SerialNum | |
tt:SignatureAlgorithm | |
tt:Validity | |
tds:CertificateInformation | |
tt:CertificateInformation | |
tt:RecurringTime | |
tt:RecurringDuration | |
tt:AutoStart | |
tt:StartingCondition | |
tt:PTZPresetTourStartingCondition | |
tt:TourSpot | |
tptz:PresetTour | |
tt:PresetTour | |
-sizePresetTour | |
tse:Scope | |
tse:MaxMatches | |
tse:KeepAliveTime | |
tse:FindRecordings | |
tse:MinResults | |
tse:MaxResults | |
tse:WaitTime | |
tse:GetRecordingSearchResults | |
tse:StartPoint | |
tse:EndPoint | |
tse:SearchFilter | |
tse:IncludeStartState | |
tse:FindEvents | |
tse:GetEventSearchResults | |
tse:FindPTZPosition | |
tse:GetPTZPositionSearchResults | |
tse:MetadataFilter | |
tse:FindMetadata | |
tse:GetMetadataSearchResults | |
ds:HMACOutputLength | |
ds:CanonicalizationMethod | |
ds:SignatureMethod | |
ds:SignatureMethodType | |
ds:Reference | |
ds:SignedInfo | |
ds:SignedInfoType | |
ds:SignatureValue | |
ds:KeyInfo | |
ds:Signature | |
ds:SignatureType | |
tt:UseCount | |
tad:Configuration | |
tt:VideoAnalyticsConfiguration | |
tad:ForcePersistence | |
tad:SetVideoAnalyticsConfiguration | |
tt:EngineConfiguration | |
trt:Configuration | |
trt:ForcePersistence | |
trt:Configurations | |
-sizeConfigurations | |
tt:AnalyticsDeviceEngineConfiguration | |
tt:AnalyticsEngine | |
-sizeConfiguration | |
tt:IntRange | |
tt:WidthRange | |
tt:HeightRange | |
tt:OutputTokensAvailable | |
tt:SendPrimacyOptions | |
tt:OutputLevelRange | |
tmd:AudioOutputOptions | |
tt:AudioOutputConfigurationOptions | |
tt:PTZPresetTourStartingConditionOptions | |
tptz:Options | |
tt:PTZPresetTourOptions | |
tt:DegreeList | |
tt:IntList | |
tt:RotateOptions | |
tt:BoundsRange | |
tt:IntRectangleRange | |
tt:VideoSourceTokensAvailable | |
tt:VideoSourceConfigurationOptionsExtension | |
tmd:VideoSourceConfigurationOptions | |
tt:VideoSourceConfigurationOptions | |
tt:Encoding | |
tt:BitrateList | |
tt:SampleRateList | |
tt:Options | |
tt:AudioEncoderConfigurationOption | |
tt:AudioEncoderConfigurationOptions | |
tt:Bitrate | |
tt:SampleRateRange | |
tt:AACDecOptions | |
tt:G711DecOptions | |
tt:G726DecOptions | |
tt:AudioDecoderConfigurationOptions | |
tmd:BaudRateList | |
tmd:CharacterLengthList | |
tmd:StopBitList | |
tmd:SerialPortOptions | |
tmd:SerialPortConfigurationOptions | |
tt:Bounds | |
tt:VideoSourceConfigurationExtension | |
tmd:VideoSourceConfiguration | |
tt:VideoSourceConfiguration | |
tmd:Configuration | |
tmd:ForcePersistence | |
tmd:SetVideoSourceConfiguration | |
tmd:AudioSourceConfiguration | |
tt:AudioSourceConfiguration | |
tmd:SetAudioSourceConfiguration | |
tt:NodeToken | |
tt:DefaultAbsolutePantTiltPositionSpace | |
tt:DefaultAbsoluteZoomPositionSpace | |
tt:DefaultRelativePanTiltTranslationSpace | |
tt:DefaultRelativeZoomTranslationSpace | |
tt:DefaultContinuousPanTiltVelocitySpace | |
tt:DefaultContinuousZoomVelocitySpace | |
tt:DefaultPTZSpeed | |
tt:DefaultPTZTimeout | |
tptz:PTZConfiguration | |
tt:PTZConfiguration | |
tptz:ForcePersistence | |
tptz10:PTZConfiguration | |
tptz10:ForcePersistence | |
-sizePTZConfiguration | |
tptz10:PTZConfigurations | |
-sizePTZConfigurations | |
tt:OutputToken | |
tt:SendPrimacy | |
tt:OutputLevel | |
tmd:AudioOutputConfiguration | |
tt:AudioOutputConfiguration | |
tmd:SetAudioOutputConfiguration | |
tt:AudioDecoderConfiguration | |
tt:Width | |
tt:Height | |
tt:Resolution | |
tt:VideoResolution | |
tt:RefreshRate | |
tt:AspectRatio | |
tmd:VideoOutputs | |
tt:VideoOutput | |
-sizeVideoOutputs | |
tt:Framerate | |
trt:VideoSources | |
tt:VideoSource | |
-sizeVideoSources | |
tt:ResolutionsAvailable | |
tt:FrameRateRange | |
tt:EncodingIntervalRange | |
tt:GovLengthRange | |
tt:Mpeg4ProfilesSupported | |
tt:H264ProfilesSupported | |
tt:BitrateRange | |
tt:JPEG | |
tt:JpegOptions2 | |
tt:MPEG4 | |
tt:Mpeg4Options2 | |
tt:H264 | |
tt:H264Options2 | |
tt:QualityRange | |
tt:JpegOptions | |
tt:Mpeg4Options | |
tt:H264Options | |
tt:VideoEncoderOptionsExtension | |
tt:VideoEncoderConfigurationOptions | |
tt:SupportedInputBitrate | |
tt:SupportedFrameRate | |
tt:SupportedH264Profiles | |
tt:SupportedMpeg4Profiles | |
tt:JpegDecOptions | |
tt:H264DecOptions | |
tt:Mpeg4DecOptions | |
tt:AudioEncodingCapabilities | |
tt:AudioDecodingCapabilities | |
tt:VideoDecodingCapabilities | |
tt:VideoDecoderConfigurationOptions | |
tls:LayoutOptions | |
tls:CodingCapabilities | |
tt:CodingCapabilities | |
tt:FrameRateLimit | |
tt:EncodingInterval | |
tt:BitrateLimit | |
tt:GovLength | |
tt:Port | |
tt:EngineToken | |
tt:EngineConfigToken | |
tt:InputToken | |
tt:ReceiverToken | |
tt:Multicast | |
tt:MulticastConfiguration | |
tt:Subscription | |
tt:AnalyticsEngineControl | |
tad:CreateAnalyticsEngineControl | |
tad:SetAnalyticsEngineControl | |
tad:AnalyticsEngineControls | |
-sizeAnalyticsEngineControls | |
tt:Quality | |
tt:RateControl | |
tt:VideoRateControl | |
tt:Mpeg4Configuration | |
tt:H264Configuration | |
tt:VideoEncoderConfiguration | |
tt:VideoInput | |
tt:AnalyticsEngineInput | |
tad:SetAnalyticsEngineInput | |
tad:CreateAnalyticsEngineInputs | |
tt:SampleRate | |
tt:PaneName | |
tt:AudioOutputToken | |
tt:AudioSourceToken | |
tt:AudioEncoderConfiguration | |
tls:PaneConfiguration | |
tt:PaneConfiguration | |
tls:SetPaneConfiguration | |
tls:CreatePaneConfiguration | |
-sizePaneConfiguration | |
tls:SetPaneConfigurations | |
tt:Events | |
tt:Analytics | |
fixed | |
tt:MetadataConfiguration | |
tt:ProfileExtension | |
trt:Profile | |
tt:Profile | |
trt:Profiles | |
-sizeProfiles | |
tt:AutoNegotiation | |
tt:PrefixLength | |
tt:Manual | |
tt:PrefixedIPv4Address | |
tt:LinkLocal | |
tt:DHCP | |
tt:IPv4Configuration | |
tt:AcceptRouterAdvert | |
tt:PrefixedIPv6Address | |
tt:FromRA | |
tt:IPv6Configuration | |
tt:Link | |
tt:NetworkInterfaceConnectionSetting | |
tt:IPv4 | |
tt:IPv4NetworkInterfaceSetConfiguration | |
tt:IPv6 | |
tt:IPv6NetworkInterfaceSetConfiguration | |
tds:NetworkInterface | |
tt:NetworkInterfaceSetConfiguration | |
tds:IPAddressFilter | |
tt:IPAddressFilter | |
tds:SetIPAddressFilter | |
tds:AddIPAddressFilter | |
tds:RemoveIPAddressFilter | |
tds:NetworkProtocols | |
tt:NetworkProtocol | |
-sizeNetworkProtocols | |
tt:VideoSources | |
tt:VideoOutputs | |
tt:AudioSources | |
tt:AudioOutputs | |
tt:ReceiverSource | |
tt:MediaProfileSource | |
tt:DynamicRecordings | |
tt:DynamicTracks | |
tt:MaxStringLength | |
tt:RTP_Multicast | |
tt:SupportedReceivers | |
tt:MaximumRTSPURILength | |
tt:DeviceIO | |
tt:DeviceIOCapabilities | |
tt:Display | |
tt:Recording | |
tt:RecordingCapabilities | |
tt:Search | |
tt:Replay | |
tt:ReceiverCapabilities | |
tt:AnalyticsDevice | |
tt:Extensions | |
tt:MaximumNumberOfProfiles | |
tt:ProfileCapabilities | |
tt:StreamingCapabilities | |
tt:MediaCapabilitiesExtension | |
tt:SupportedEAPMethod | |
tt:RemoteUserHandling | |
tt:TLS1.0 | |
tt:SecurityCapabilitiesExtension2 | |
tt:TLS1.1 | |
tt:TLS1.2 | |
tt:OnboardKeyGeneration | |
tt:AccessPolicyConfig | |
tt:X.509Token | |
tt:SAMLToken | |
tt:KerberosToken | |
tt:RELToken | |
tt:SecurityCapabilitiesExtension | |
tt:Major | |
tt:Minor | |
tds:Namespace | |
tds:XAddr | |
tds:Version | |
tt:OnvifVersion | |
tds:Service | |
-sizeService | |
tt:DiscoveryResolve | |
tt:DiscoveryBye | |
tt:RemoteDiscovery | |
tt:SystemBackup | |
tt:SystemLogging | |
tt:FirmwareUpgrade | |
tt:SupportedVersions | |
tt:Network | |
tt:System | |
tt:SystemCapabilities | |
tt:IO | |
tt:IOCapabilities | |
tt:SecurityCapabilities | |
tt:Device | |
tt:DeviceCapabilities | |
tt:Media | |
tt:MediaCapabilities | |
tt:CapabilitiesExtension | |
tt:Capabilities | |
tt:Hour | |
tt:Minute | |
tt:Second | |
tt:Year | |
tt:Month | |
tt:Day | |
tt:Date | |
tt:DateTimeType | |
tt:DaylightSavings | |
tt:UTCDateTime | |
tt:DateTime | |
tt:LocalDateTime | |
tds:SystemDateAndTime | |
tt:SystemDateTime | |
tds:DateTimeType | |
tds:DaylightSavings | |
tds:TimeZone | |
tds:UTCDateTime | |
tt:Dot1XConfigurationToken | |
tt:Identity | |
tt:AnonymousID | |
tt:EAPMethod | |
tt:CACertificateID | |
tds:Dot1XConfiguration | |
tt:Dot1XConfiguration | |
tds:CreateDot1XConfiguration | |
tds:SetDot1XConfiguration | |
-sizeDot1XConfiguration | |
tt:MaximumNumberOfPresetTours | |
tt:SupportedPresetTour | |
tt:PTZPresetTourSupported | |
tt:DataUntil | |
tt:NumberRecordings | |
tse:Summary | |
tt:RecordingSummary | |
tt:Samplerate | |
tt:VideoAttributes | |
tt:AudioAttributes | |
tt:TrackAttributes | |
tse:MediaAttributes | |
tt:MediaAttributes | |
-sizeMediaAttributes | |
tt:JobConfiguration | |
tt:RecordingJobConfiguration | |
trc:JobItem | |
tt:GetRecordingJobsResponseItem | |
-sizeJobItem | |
trc:JobConfiguration | |
trc:CreateRecordingJob | |
trc:SetRecordingJobConfiguration | |
tmd:BaudRate | |
tmd:CharacterLength | |
tmd:StopBit | |
tmd:SerialPortConfiguration | |
tmd:ForcePersistance | |
tmd:SetSerialPortConfiguration | |
tmd:VideoOutputConfiguration | |
tt:VideoOutputConfiguration | |
tmd:SetVideoOutputConfiguration | |
tt:Channels | |
trt:AudioSources | |
tt:AudioSource | |
-sizeAudioSources | |
trt:TotalNumber | |
trt:JPEG | |
trt:H264 | |
trt:MPEG4 | |
tev:Timeout | |
tev:MessageLimit | |
tev:MaxTimeout | |
tev:MaxMessageLimit | |
tev:PullMessagesFaultResponse | |
wsnt:InvalidFilterFault | |
wsnt:InvalidMessageContentExpressionFault | |
wsnt:InvalidProducerPropertiesExpressionFault | |
wsnt:InvalidTopicExpressionFault | |
wsnt:NotifyMessageNotSupportedFault | |
wsrf:ResourceUnknownFault | |
wsnt:SubscribeCreationFailedFault | |
wsnt:TopicExpressionDialectUnknownFault | |
wsnt:TopicNotSupportedFault | |
wsnt:UnacceptableInitialTerminationTimeFault | |
wsnt:UnrecognizedPolicyRequestFault | |
wsnt:UnsupportedPolicyRequestFault | |
wsnt:UnableToDestroySubscriptionFault | |
wsnt:UnacceptableTerminationTimeFault | |
wsnt:MultipleTopicsSpecifiedFault | |
wsnt:NoCurrentMessageOnTopicFault | |
wsnt:UnableToDestroyPullPointFault | |
wsnt:UnableToGetMessagesFault | |
wsnt:UnableToCreatePullPointFault | |
wsnt:PauseFailedFault | |
wsnt:ResumeFailedFault | |
faultcode | |
faultstring | |
faultactor | |
detail | |
SOAP-ENV:Node | |
SOAP-ENV:Role | |
SOAP-ENV:Detail | |
tt:RequestInfo | |
tt:ResponseInfo | |
tt:Fault | |
SOAP-ENV:Fault | |
FixedHomePosition | |
tt:SupportedPTZSpaces | |
tt:MaximumNumberOfPresets | |
tt:HomeSupported | |
tt:PTZNodeExtension | |
tptz:PTZNode | |
tt:PTZNode | |
tptz10:PTZNode | |
-sizePTZNode | |
tt:InterfaceType | |
tt:IANA-IfTypes | |
tt:AdminSettings | |
tt:OperSettings | |
tt:Info | |
tt:NetworkInterfaceInfo | |
tt:NetworkInterfaceLink | |
tt:IPv4NetworkInterface | |
tt:IPv6NetworkInterface | |
tt:NetworkInterfaceExtension | |
tds:NetworkInterfaces | |
tt:NetworkInterface | |
-sizeNetworkInterfaces | |
tt:ConfigurationEntity | |
tt:ActionEngineEventPayload | |
wsa:Reply | |
wsa:InvalidMessageInformationHeader | |
wsa:MessageInformationHeaderRequired | |
wsa:DestinationUnreachable | |
wsa:ActionNotSupported | |
wsa:EndpointUnavailable | |
AUTO | |
Baseline | |
Main | |
Extended | |
High | |
RTP-Unicast | |
RTP-Multicast | |
RTSP | |
HTTP | |
Fixed | |
Configurable | |
Discoverable | |
NonDiscoverable | |
Full | |
Half | |
Auto | |
Stateful | |
Stateless | |
HTTPS | |
IPv4 | |
IPv6 | |
Allow | |
Deny | |
NoUpdate | |
ClientUpdates | |
ServerUpdates | |
Ad-hoc | |
Infrastructure | |
Very Bad | |
Good | |
Very Good | |
Hard | |
Soft | |
Manual | |
Administrator | |
Operator | |
Anonymous | |
active | |
inactive | |
closed | |
open | |
Monostable | |
Bistable | |
MOVING | |
UNKNOWN | |
Idle | |
Touring | |
Paused | |
Forward | |
Backward | |
Start | |
Pause | |
MANUAL | |
LowNoise | |
ENABLED | |
DISABLED | |
Deleted | |
Animal | |
Face | |
Human | |
Vehical | |
AutoConnect | |
AlwaysConnect | |
NeverConnect | |
Unknown | |
NotConnected | |
Connecting | |
Connected | |
Queued | |
Searching | |
Completed | |
Initiated | |
Recording | |
Stopped | |
Removing | |
Removed | |
Video | |
Active | |
RS232 | |
RS422HalfDuplex | |
RS422FullDuplex | |
RS485HalfDuplex | |
RS485FullDuplex | |
Generic | |
Even | |
Mark | |
d:Suppression | |
d:MatchingRuleNotSupported | |
wsadis:Reply | |
wsadis:InvalidMessageInformationHeader | |
wsadis:MessageInformationHeaderRequired | |
wsadis:DestinationUnreachable | |
wsadis:ActionNotSupported | |
wsadis:EndpointUnavailable | |
wsse:UnsupportedSecurityToken | |
wsse:UnsupportedAlgorithm | |
wsse:InvalidSecurity | |
wsse:InvalidSecurityToken | |
wsse:FailedAuthentication | |
wsse:FailedCheck | |
wsse:SecurityTokenUnavailable | |
wsu:MessageExpired | |
M-SEARCH * HTTP/1.1 | |
HOST: 239.255.255.250:1900 | |
ST: %s | |
MAN: "ssdp:discover" | |
MX: %u | |
content-length | |
recv | |
poll | |
/var/run/minissdpd.sock | |
urn:schemas-upnp-org:device:InternetGatewayDevice:1 | |
rootdevice | |
setsockopt | |
1900 | |
getaddrinfo: %s | |
sendto | |
%s#%s | |
<?xml version="1.0"?> | |
<s:Envelope xmlns:s="http://schemas.xmlsoap.org/soap/envelope/" s:encodingStyle="http://schemas.xmlsoap.org/soap/encoding/"><s:Body><u:%s xmlns:u="%s"></u:%s></s:Body></s:Envelope> | |
<?xml version="1.0"?> | |
<s:Envelope xmlns:s="http://schemas.xmlsoap.org/soap/envelope/" s:encodingStyle="http://schemas.xmlsoap.org/soap/encoding/"><s:Body><u:%s xmlns:u="%s"> | |
upnp:rootdevice | |
getsockname | |
getnameinfo() failed : %s | |
GET %s HTTP/%s | |
Host: %s:%d | |
Connection: Close | |
User-Agent: FedoraCore/5, UPnP/1.0, MiniUPnPc/1.4 | |
url:%s,hostname:%s,port:%d,path:%s | |
GetSpecificPortMappingEntry | |
errorCode | |
GetPortMappingNumberOfEntries | |
NewPortMappingNumberOfEntries | |
NewPortMappingIndex | |
GetGenericPortMappingEntry | |
DeletePortMapping | |
libminiupnpc | |
AddPortMapping | |
GetExternalIPAddress | |
GetCommonLinkProperties | |
NewLayer1DownstreamMaxBitRate | |
NewLayer1UpstreamMaxBitRate | |
GetConnectionTypeInfo | |
NewConnectionType | |
GetStatusInfo | |
NewUptime | |
NewConnectionStatus | |
NewLastConnectionError | |
GetTotalPacketsReceived | |
NewTotalPacketsReceived | |
GetTotalPacketsSent | |
NewTotalPacketsSent | |
GetTotalBytesReceived | |
NewTotalBytesReceived | |
GetTotalBytesSent | |
NewTotalBytesSent | |
getaddrinfo() error : %s | |
getsockopt | |
urlbase = '%s' | |
WAN Device (Common interface config) : | |
serviceType = '%s' | |
controlURL = '%s' | |
eventSubURL = '%s' | |
SCPDURL = '%s' | |
WAN Connection Device (IP or PPP Connection): | |
servicetype = '%s' | |
secondary WAN Connection Device (IP or PPP Connection): | |
:%hu | |
POST %s HTTP/%s | |
Host: %s%s | |
User-Agent: FedoraCore/5, UPnP/1.0, MiniUPnPc/1.4 | |
Content-Length: %d | |
Content-Type: text/xml | |
SOAPAction: "%s" | |
Connection: Close | |
Cache-Control: no-cache | |
Pragma: no-cache | |
socket(unix) | |
minissdpc.c: write() | |
minissdpc.c: read() | |
images_cgi | |
network_cgi | |
date_cgi | |
pwdgrp_cgi | |
restart_cgi | |
factorydefault_cgi | |
hardfactorydefault_cgi | |
videocoding_cgi | |
videomask_cgi | |
videoparameter_cgi | |
videoformat_cgi | |
audio_cgi | |
textoverlay_cgi | |
motion_cgi | |
shelter_cgi | |
sensor_cgi | |
videolose_cgi | |
networkinterruption_cgi | |
alarmstate_cgi | |
pppoe_cgi | |
upnp_cgi | |
email_cgi | |
ftp_cgi | |
ddns_cgi | |
vpn_cgi | |
rtsp_cgi | |
ipemail_cgi | |
connecting_cgi | |
mobile_cgi | |
record_cgi | |
snap_cgi | |
com_cgi | |
systeminfo_cgi | |
upgrade_cgi | |
syslog_cgi | |
ptz_cgi | |
ptzsetting_cgi | |
domecontrol_cgi | |
sysparam_cgi | |
osdposition_cgi | |
snmp_cgi | |
videolist_cgi | |
alarmoutstate_cgi | |
alarm_cgi | |
anv/rtsp_cgi | |
anv/images_cgi | |
anv/network_cgi | |
anv/date_cgi | |
anv/pwdgrp_cgi | |
anv/restart_cgi | |
anv/factorydefault_cgi | |
anv/hardfactorydefault_cgi | |
anv/videocoding_cgi | |
anv/videomask_cgi | |
anv/videoparameter_cgi | |
anv/videoformat_cgi | |
anv/audio_cgi | |
anv/textoverlay_cgi | |
anv/motion_cgi | |
anv/shelter_cgi | |
anv/sensor_cgi | |
anv/videolose_cgi | |
anv/networkinterruption_cgi | |
anv/alarmstate_cgi | |
anv/pppoe_cgi | |
anv/upnp_cgi | |
anv/email_cgi | |
anv/ftp_cgi | |
anv/ddns_cgi | |
anv/vpn_cgi | |
anv/connecting_cgi | |
anv/mobile_cgi | |
anv/record_cgi | |
anv/snap_cgi | |
anv/com_cgi | |
anv/systeminfo_cgi | |
anv/upgrade_cgi | |
anv/ptz_cgi | |
anv/ptzsetting_cgi | |
anv/domecontrol_cgi | |
anv/alarmoutstate_cgi | |
anv/videolist_cgi | |
anv/wifi_cgi | |
anv/ptzcruise_cgi | |
anv/logquery_cgi | |
username invalib | |
password invalib | |
Open dms_sysnetapi_ioctrl error | |
admin | |
0.0.0.0 | |
The user doesn't find | |
The user doesn't find | |
Password is incorrect | |
IP is not access | |
Valib charater in channel | |
0123456789ABCDEF | |
%d.%d.%d.%d | |
Time%d_Week=%-9s Time%d_BgnHour=%-2d Time%d_BgnMinute=%-2d Time%d_EndHour=%-2d Time%d_EndMinute=%-2d | |
Monday | |
Tuesday | |
Wednesday | |
Thursday | |
Friday | |
Saturday | |
Sundays | |
everyday | |
false | |
%d-%s-%d | |
invalib | |
preset | |
poll | |
cruise | |
false | |
MotionArea%d_x=%-6d MotionArea%d_y=%-6d MotionArea%d_w=%-6d MotionArea%d_h=%-6d | |
Time%d_Week=%-10sTime%d_RecordType=%s Time%d_BgnHour=%d Time%d_BgnMinute=%d Time%d_EndHour=%d Time%d_EndMinute=%d | |
Schedule | |
MotionDetection | |
SensorAlarm | |
Manual | |
Time_Week error | |
RecordType error | |
BgnHour error | |
BgnMinute error | |
EndHour error | |
EndMinute error | |
EndTime < StartTime | |
******** Command = %s | |
command_type = %d | |
update | |
remove | |
clear | |
Down | |
Left | |
Right | |
start | |
stop | |
%s Param error, %s or %s | |
%s Param error, limit:more than %d, less than %d | |
PresetNo:%d, RemainTime:%d, Speed:%d | |
Open platform error! | |
!!!!!!!!!!!init_cgi sucessful end !!!!!!!!!!!!!!!!!! | |
HTTP/1.0 200 OK | |
Content-Type:text/plain | |
Request failed:Param error | |
action | |
user | |
channel | |
imagesize | |
streamtype | |
alloc mem error! | |
StreamType err | |
Open dms_sysnetapi_ioctrl error | |
HTTP/1.0 200 OK | |
Server: Ipcamer | |
Cache-Control: no-store, no-cache, must-revalidate, pre-check=0, post-check=0, max-age=0 | |
Pragma: no-cache | |
Content-type: image/jpeg | |
Content-Length:%ld | |
net_snap_data.dwBufSize out = %ld | |
Action error | |
Param error | |
BootProto | |
IPAddress | |
SubnetMask | |
DefaultRouter | |
HostName | |
DNSServer1 | |
DNSServer2 | |
DataPort | |
WebPort | |
MACAddress | |
fifth-wheel param in syntax | |
%s=%s | |
dhcp | |
none | |
%02x-%02x-%02x-%02x-%02x-%02x | |
%s=%d | |
OK,Device is rebooting | |
Param not change | |
Request failed:Param error | |
year | |
month | |
hour | |
minute | |
second | |
%2d %2d,%d %2d:%2d:%2d | |
======%s-%s-%s | |
=========%04d-%02d-%02d | |
username | |
password | |
level | |
Privilege | |
accessip | |
Request failed:fifth-wheel param | |
%s:%s:%d | |
Administrator user can't increase | |
username & password no existence | |
username & password has invalib characters | |
No User surplus | |
The user doesn't find | |
Privilege error | |
username no existence | |
Username has invalib characters | |
Action error in syntax | |
OK, Device is rebooting | |
Request failed:fifth-wheel param in syntax | |
EncType1 | |
Resolution1 | |
BitflowType1 | |
KeyInterval1 | |
FrameRate1 | |
NormalBitrate1 | |
AlarmBitrate1 | |
ImageQuality1 | |
EncType2 | |
Resolution2 | |
BitflowType2 | |
KeyInterval2 | |
FrameRate2 | |
NormalBitrate2 | |
AlarmBitrate2 | |
ImageQuality2 | |
Main stream options: | |
H.264 | |
MJPEG | |
%s=%d*%d | |
%s=%ld | |
%s=%s | |
Sub-stream options: | |
%d*%d | |
Resolution1 error. | |
Resolution1= | |
or | |
ImageQuality1 error | |
Resolution2 error. | |
Resolution2= | |
ImageQuality2 error | |
Best | |
Good | |
Normal | |
Not So Good | |
352*288 | |
704*576 | |
704*288 | |
176*144 | |
640*480 | |
240*320 | |
1280*720 | |
120*160 | |
1900*1200 | |
800*600 | |
1920*1080 | |
1027*768 | |
MaskSwitch | |
MaskArea0_x | |
MaskArea0_y | |
MaskArea0_w | |
MaskArea0_h | |
MaskArea1_x | |
MaskArea1_y | |
MaskArea1_w | |
MaskArea1_h | |
MaskArea2_x | |
MaskArea2_y | |
MaskArea2_w | |
MaskArea2_h | |
MaskArea3_x | |
MaskArea3_y | |
MaskArea3_w | |
MaskArea3_h | |
MaskArea4_x | |
MaskArea4_y | |
MaskArea4_w | |
MaskArea4_h | |
open | |
close | |
MaskArea%d_x=%d MaskArea%d_y=%d MaskArea%d_w=%d MaskArea%d_h=%d | |
MaskArea%d_x | |
MaskArea%d_y | |
MaskArea%d_w | |
MaskArea%d_h | |
Lightness | |
Contrast | |
Sharpness | |
Saturation | |
Acutance | |
Green | |
Blue | |
Gamma | |
Videoformat | |
NTSC | |
serverip | |
port | |
monitor | |
Action success | |
server ip error | |
AudioType | |
DuplexMode | |
TalkPort | |
error:argv[%d]=%s | |
disable | |
Title | |
WeekValue | |
TimeValue | |
DateValue | |
BitrateValue | |
TitleValue | |
Color | |
Title error | |
Action error in syntax. | |
Sensitivity | |
MotionSwitch | |
EMailSwitch | |
Time1Switch | |
Time1_BgnHour | |
Time1_BgnMinute | |
Time1_EndHour | |
Time1_EndMinute | |
Time2Switch | |
Time2_BgnHour | |
Time2_BgnMinute | |
Time2_EndHour | |
Time2_EndMinute | |
DetectArea1_x | |
DetectArea1_y | |
DetectArea1_w | |
DetectArea1_h | |
DetectArea2_x | |
DetectArea2_y | |
DetectArea2_w | |
DetectArea2_h | |
DetectArea3_x | |
DetectArea3_y | |
DetectArea3_w | |
DetectArea3_h | |
DetectArea4_x | |
DetectArea4_y | |
DetectArea4_w | |
DetectArea4_h | |
OutputSwitch | |
OutputDuration | |
SnapSwitch | |
SnapNum | |
SnapInterval | |
SnapSaveMode | |
RecordSwitch | |
RecordTime | |
RecordSaveMode | |
Time%dSwitch=%s | |
Time%d_BgnHour=%2d Time%d_BgnMinute=%2d Time%d_BgnHour=%2d Time%d_BgnMinute=%2d | |
FtpEmail | |
Local | |
RecordSaveMode=%s | |
Time param error | |
TimeSwitch | |
SnapSwitch error | |
DetectArea error | |
open dms_sysnetapi_ioctrl error | |
ShelterSwitch | |
DetectSwitch | |
SensorType | |
Time3Switch | |
Time3_BgnHour | |
Time3_BgnMinute | |
Time3_EndHour | |
Time3_EndMinute | |
Time4Switch | |
Time4_BgnHour | |
Time4_BgnMinute | |
Time4_EndHour | |
Time4_EndMinute | |
NormalClose | |
NormalOpen | |
Time%d_BgnHour=%2d Time%d_BgnMinute=%2d Time%d_EndHour=%2d Time%d_EndMinute=%2d | |
SnapChannel | |
get byAlarmInHandle=%d, wActionFlag=0x%X | |
Time1 param error | |
SnapSaveMode error | |
set byAlarmInHandle=%d, wActionFlag=0x%X | |
LoseSwitch | |
action error | |
Alarm Type | |
%s=%s %s=%d %s=%d-%d-%d %s=%d:%d:%d | |
date | |
time | |
VideoLoss | |
No Alarm | |
PppoeSwitch | |
PppoeIpaddr | |
PppoeUser | |
PppoePwd | |
OnlieTime | |
Open dms_sysnetapi_ioctrl error. | |
PppoeIpAddr can't be set | |
Valib character in PppoeUser | |
Valib characters in PppoeUser | |
Valib characters in PppoePwd | |
UpnpSwitch | |
UpnpEthNo | |
UpnpMode | |
UpnpHost | |
UpnpWebPort | |
UpnpDataPort | |
WiFi | |
Lineate | |
Designate | |
Auto | |
UpnpHost error | |
SmtpServer | |
MailFrom | |
MailTo | |
SmtpUser | |
SmtpPwd | |
MailTile | |
SmtpPort | |
SmtpUser valib | |
SmtpPwd valib | |
FtpURL | |
FtpPath | |
FtpUser | |
FtpPwd | |
FtpPort | |
Preferred Server: | |
FtpURL error | |
FtpUser error | |
FtpPwd error | |
DDNSSwitch | |
Provider | |
DdnsName | |
DdnsPass | |
Domain | |
ServerUrl | |
ServerPort | |
DdnsMapDataPort | |
DdnsMapWebPort | |
UpdateInterval | |
Provider error | |
NULL | |
3322.org | |
dyndns.org | |
nightowldvr.org | |
noip.org | |
myeye.org | |
peanuthull.org | |
2 minutes | |
5 minutes | |
30 minutes | |
1 hours | |
2 hours | |
1 days | |
IP update | |
Support VPN in future. | |
RtspPort | |
Support ip email in future | |
ConnectCenterSwitch | |
ConnectCenterPort | |
ConnectCenterIP | |
ConnectCenterIP error | |
MobileMode | |
DeviceId | |
RealTime | |
ChannelSwitch0 | |
ChannelSwitch1 | |
ChannelSwitch2 | |
ChannelSwitch3 | |
Mode | |
support in furture | |
ServerUrl error | |
SaveMode | |
StreamType | |
PackageTime | |
SaveDay | |
OverWrite | |
AlternateStream | |
PreferredStream | |
Time%dSwitch=open | |
Time%d_BngHour=%d Time%d_BngMinute=%d | |
Time%d_EndHour=%d Time%d_EndMinute=%d | |
Channel error | |
Time2 param error | |
Param error | |
ShootInterval | |
fifth-wheel param in syntax | |
Open dms_sysnetapi_ioctrl error | |
Time%d_BgnHour=%d Time%d_BgnMinute=%d | |
Time%d_BgnHour=%d Time%d_BgnMinute=%d | |
Time1 param error | |
Time2 param error | |
Action error in syntax | |
Address1 | |
Baudrate1 | |
DataBits1 | |
StopBits1 | |
CheckType1 | |
FlowCtrl1 | |
Baudrate2 | |
DataBits2 | |
StopBits2 | |
CheckType2 | |
FlowCtrl2 | |
COM RS485: | |
COM RS232: | |
Baudrate1 error | |
CheckType1 error | |
FlowCtrl1 error | |
Baudrate2 error | |
CheckType2 error | |
FlowCtrl2 error | |
1200 | |
2400 | |
4800 | |
9600 | |
19200 | |
38400 | |
43000 | |
56000 | |
57600 | |
115200 | |
None | |
Even | |
Mark | |
Space | |
Hardware | |
Xon/Xoff | |
ChannelNum | |
Standard | |
DeviceID | |
%s=%ld.%ld | |
SoftwareVersion | |
HardwareVersion | |
FocusSub | |
FocusAdd | |
ZoomSub | |
ZoomAdd | |
IrisSub | |
IrisAdd | |
Stop | |
Preset | |
Call | |
AutoStart | |
AutoStop | |
LightOpen | |
LightClose | |
BrushStart | |
BrushStop | |
TrackStart | |
TrackStop | |
TrackRun | |
%s(%d) | |
AutoFlip | |
ProportionalPan | |
VirtualZero | |
ManualLimit | |
ScanLimit | |
DomeCameraReset | |
HSpeed | |
VSpeed | |
ParkMode | |
ParkTime | |
Preset1Num1 | |
Preset1Num2 | |
Preset1Num3 | |
Preset1Num4 | |
Preset1Num5 | |
Preset1Num6 | |
Preset1Num7 | |
Preset1Num8 | |
Preset2Num1 | |
Preset2Num2 | |
Preset2Num3 | |
Preset2Num4 | |
Preset2Num5 | |
Preset2Num6 | |
Preset2Num7 | |
Preset2Num8 | |
Preset1KeepTime1 | |
Preset1KeepTime2 | |
Preset1KeepTime3 | |
Preset1KeepTime4 | |
Preset1KeepTime5 | |
Preset1KeepTime6 | |
Preset1KeepTime7 | |
Preset1KeepTime8 | |
Preset2KeepTime1 | |
Preset2KeepTime2 | |
Preset2KeepTime3 | |
Preset2KeepTime4 | |
Preset2KeepTime5 | |
Preset2KeepTime6 | |
Preset2KeepTime7 | |
Preset2KeepTime8 | |
Time1Task | |
Time1BgnHour | |
Time1BgnMinute | |
Time1EndHour | |
Time1EndMinute | |
Time2Task | |
Time2BgnHour | |
Time2BgnMinute | |
Time2EndHour | |
Time2EndMinute | |
Time3Task | |
Time3BgnHour | |
Time3BgnMinute | |
Time3EndHour | |
Time3EndMinute | |
Time4Task | |
Time4BgnHour | |
Time4BgnMinute | |
Time4EndHour | |
Time4EndMinute | |
Time5Switch | |
Time5Task | |
Time5BgnHour | |
Time5BgnMinute | |
Time5EndHour | |
Time5EndMinute | |
PTZ Setting: | |
Scan Speed: | |
%s=%d %s=%d | |
Park Set: | |
%s=0 %s=2 | |
Time Set: | |
Time%dSwitch=close Time%dTask=0 | |
Time%dBgnHour=0 Time%dBgnMinute=0 Time%dEndHour=23 Time%dEndMinute=59 | |
Open dms_sysnetapi_ioctrl get error | |
Open dms_sysnetapi_ioctrl set error | |
PresetNum | |
FigureScanNum | |
PresetSet | |
PresetCall | |
PresetClear | |
PresetGet | |
FigureScanSet | |
FigureScanSave | |
FigureScanRun | |
FigureScanStop | |
LevelFlip | |
ZeroDetection | |
UpLimit | |
DownLimit | |
LeftLimit | |
RightLimit | |
PresetScan1 | |
PresetScan2 | |
PresetScanStop | |
AppleScan | |
AppleScanStop | |
HTTP/1.0 200 OK | |
Content-Type:text/xml | |
<?xml version = "1.0" encoding = "UTF-8"?> | |
<DOCUMENT> | |
<SysParam> | |
alloc memory failed | |
<SysInfo> | |
<Frame | |
%s = "%s" | |
%s = "%d" | |
%s = "%ld" | |
%s = "%ld.%ld" | |
</SysInfo> | |
<SysVideo> | |
<Frame | |
Brightness | |
Chroma | |
</SysVideo> | |
<SysAudio> | |
<Frame | |
%s = "0" | |
AudioSwitch | |
%s = "0" %s = "0" %s = "0" | |
AudioInput | |
AudioInVol | |
AudioOutVol | |
</SysAudio> | |
<SysNetwork> | |
<Frame | |
%02x- | |
%s= "%d" | |
Port | |
</SysNetwork> | |
<SysNetService> | |
<Frame | |
</SysNetService> | |
<SysFunction> | |
<Frame | |
</SysFunction> | |
<SysCOM> | |
<Frame | |
Unknow | |
</SysCOM> | |
<UserManage> | |
<Frame | |
%s = "%s" %s = "%s" %s = "%d" /> | |
<Frame | |
Username | |
Password | |
</UserManage> | |
</SysParam> | |
</DOCUMENT> | |
Software | |
value | |
starttime | |
endtime | |
recordtype | |
%d-%d-%d | |
%d:%d:%d | |
alloc memery failed! | |
<REC> | |
<DATE>%ld-%02ld-%02ld</DATE> | |
<TIME>%02ld:%02ld:%02ld-%02ld:%02ld:%02ld</TIME> | |
<CHANNEL>%d</CHANNEL> | |
<SIZE>%.1fM</SIZE> | |
<RTSP_SOURCE>rtsp://%s/video/%s</RTSP_SOURCE> | |
<HTTP_SOURCE>http://%s/video/%s.html</HTTP_SOURCE> | |
</REC> | |
<REC> | |
<DATE>%ld-%02ld-%02ld</DATE> | |
<TIME>00:00:00-23:59:59</TIME> | |
<CHANNEL>%d</CHANNEL> | |
<SIZE>0M</SIZE> | |
<RTSP_SOURCE>no data</RTSP_SOURCE> | |
<HTTP_SOURCE>no data</HTTP_SOURCE> | |
</REC> | |
HTTP/1.0 OK | |
Content-Type:text/plain | |
<?xml version = "1.0" encoding = "utf-8"?> | |
<VIDEO> | |
%s | |
</VIDEO> | |
state | |
Invalid Channel | |
Alarm Out State: | |
%s=%d | |
Channel | |
State | |
action param is invalid | |
filetype | |
PictureQuality | |
Resolution | |
rand | |
Request failed:StreamType error | |
alloc mem failed! | |
HTTP/1.0 200 OK | |
Content-type: image/jpeg | |
Date: Sat, 01 Jan 2000 18:54:34 GMT | |
Connection: close | |
Accept-Ranges:bytes | |
Last-Modified:sta, -1 Jan 2000 18:54:33 GMT | |
Content-Length:%ld | |
Better | |
Worst | |
MACAddr | |
NetName | |
MulticastAddr | |
GatewayAddr | |
ManagerServerAddr | |
EnableDHCP | |
MaxConnect | |
HttpPort | |
ManagerPort | |
MulticastPort | |
Dataport | |
%s=%02X-%02X-%02X-%02X-%02X-%02X | |
true | |
timezone | |
%02d %02d,%d %02d:%02d:%02d %d | |
Request failed: Param error | |
UserName | |
AccessIP | |
AccessMAC | |
Priority | |
%-32s %-32s %-32s %-20s %-20s | |
UserIPAddress | |
UserMACAdrress | |
Please check new UserName or Password | |
No user surplus or users already exist. | |
Please check remove UserName | |
Administrators can't be deleted | |
middle | |
higher | |
administrator | |
CompressionType1 | |
RateType1 | |
BitRate1 | |
KeyInterva1 | |
EncodeAudio1 | |
CompressionType2 | |
RateType2 | |
BitRate2 | |
KeyInterva2 | |
EncodeAudio2 | |
MPEG4 | |
sub-stream options: | |
CompressionType1 error | |
EncodeAudio1 error | |
CompressionType2 error | |
EncodeAudio2 error | |
EnableMask | |
SetFlag | |
SetFlag error | |
save | |
restore | |
ShowTime | |
DispWeek | |
TimeTopLeftX | |
TimeTopLeftY | |
OSDAttrib | |
ShowChanName | |
ShowNameTopLeftX | |
ShowNameTopLeftY | |
ChannelName | |
OSDAttrib error | |
TransparentFlash | |
TransparentUnflash | |
UntransparentFlash | |
UntransparentUnflash | |
Enable | |
MotionArea1_x | |
MotionArea1_y | |
MotionArea1_w | |
MotionArea1_h | |
MotionArea2_x | |
MotionArea2_y | |
MotionArea2_w | |
MotionArea2_h | |
MotionArea3_x | |
MotionArea3_y | |
MotionArea3_w | |
MotionArea3_h | |
MotionArea4_x | |
MotionArea4_y | |
MotionArea4_w | |
MotionArea4_h | |
Time1_Week | |
Time2_Week | |
Time3_Week | |
Time4_Week | |
Record | |
RecTime | |
ScreenTip | |
AlarmOut | |
AlarmOutTime | |
Buzzer | |
BuzzerTime | |
Voice | |
Snap | |
Talk | |
Sensitive | |
PTZ= | |
Time%d error | |
Record error | |
PTZ error | |
AlarmOut error | |
ShelterAlarmEnable | |
ShelterEnable1 | |
ShelterTopLeft1_X | |
ShelterTopLeft1_Y | |
ShelterWidth1 | |
ShelterHeight1 | |
ShelterColor1 | |
ShelterEnable2 | |
ShelterTopLeft2_X | |
ShelterTopLeft2_Y | |
ShelterWidth2 | |
ShelterHeight2 | |
ShelterColor2 | |
ShelterEnable3 | |
ShelterTopLeft3_X | |
ShelterTopLeft3_Y | |
ShelterWidth3 | |
ShelterHeight3 | |
ShelterColor3 | |
ShelterEnable4 | |
ShelterTopLeft4_X | |
ShelterTopLeft4_Y | |
ShelterWidth4 | |
ShelterHeight4 | |
ShelterColor4 | |
ShelterEnable5 | |
ShelterTopLeft5_X | |
ShelterTopLeft5_Y | |
ShelterWidth5 | |
ShelterHeight5 | |
ShelterColor5 | |
%s%d=%-9s | |
ShelterEnable | |
ShelterTopLeft%d_X=%-4dShelterTopLeft%d_Y=%-4dShelterWidth%d=%-4dShelterHeight%d=%-4dShelterColor%d=%ld | |
ShelterEnable%d error | |
ShelterTopLeft%d_X | |
ShelterTopLeft%d_Y | |
ShelterWidth%d | |
ShelterHeight%d | |
ShelterColor%d | |
code | |
preview | |
AlarmInName | |
AlarmType | |
AlarmInHandle | |
Undo | |
LoseEnable | |
RecTime error | |
SersorID | |
Video Shelter | |
PppoEEnable | |
PppoEUser | |
PppoEPassword | |
PppoEIpaddr | |
PppoEPwd | |
PppoEUser error | |
PppoEPassword error | |
UpnpEnable | |
LineMode | |
ServerIp | |
DataPort1 | |
DataPortOK | |
WebPort1 | |
WebPortOK | |
MobilePort | |
MobilePort1 | |
MobilePortOK | |
ServerIp error | |
DataPortOK error | |
WebPortOK error | |
MobilePortOK error | |
inactive | |
succeed | |
failed | |
EmailEnable | |
AttachPicture | |
SmtpServerVerify | |
MailInterval | |
ServicePort | |
EncryptionType | |
EmailUser | |
EmailPassword | |
Pop3Server | |
ToUserAddrList | |
CcUserAddrList | |
BccUserAddrList | |
SendAddrList | |
FTPEnable | |
FTPIpAddress | |
TopDirMode | |
SubDirMode | |
EnableFTP | |
FTPPort | |
EnableDDNS | |
DDNSType | |
DDNSUsername | |
DDNSPassword | |
DDNSDomain | |
DDNSAddress | |
DDNSPort | |
DDNSStatus | |
DDNSType error | |
UpdateInterval error | |
Support in furture | |
CenterEnable | |
CenterIPAddr | |
CenterPort | |
ServerNO | |
PlatManufacture | |
ManufactureInfo | |
ServerNo | |
CenterIPAddr error | |
PlatManufacture error | |
NONE | |
DMS CMS | |
CHAOYU | |
HXHT | |
HUAWEI | |
HAIDOU | |
BEIER | |
RCJW | |
HUAKE | |
DMS CGI | |
DMS SHIXUN | |
HLZT | |
DMS XTREAM | |
MobileEnable | |
MobileIpAddr | |
MobileCenterPort | |
MobileUsername | |
MobilePassword | |
MobileServerNo | |
MobileStatus | |
MobileUserName | |
MobileIpAddr error | |
MobileUsername error | |
MobilePassword error | |
unconnect | |
connecting | |
connectOK | |
RecordEnable | |
PreRecordTime | |
RedundancyRec | |
AudioRecord | |
RecordMode | |
RecycleRecord | |
Time1_RecordType | |
Time2_RecordType | |
Time3_RecordType | |
Time4_RecordType | |
RecordMode error | |
Time error | |
auto | |
static | |
manual | |
alloff | |
SnapEnable | |
Interval | |
local | |
PictureQuality error | |
Resolution error | |
FtpUpload | |
2048*1536 | |
1600*1200 | |
1280*960 | |
320*240 | |
Baudrate | |
DataBit | |
StopBit | |
Parity | |
Flowcontrol | |
%s=1 | |
%s=2 | |
Baudrate error | |
Parity error | |
Flowcontrol error | |
even | |
software | |
hardware | |
DeviceName | |
RecordLen | |
Language | |
VideoStandard | |
DateFormat | |
DateSprtr | |
DeviceName=%s | |
DeviceID=%ld | |
RecordLen=%d | |
Language=%s | |
Language= | |
Softwareversion | |
%s=%ld%ld%ld | |
SoftwareBuildDate | |
DspSoftwareVersion | |
DspSoftwareBuildDate | |
PanelVersion | |
PanelsoftwareBuildDate | |
HardwareBuildDate | |
WebVersion | |
WebBuildDate | |
SerialNumber | |
ServerCPUType | |
SysFlags | |
ServerType | |
VideoInNum | |
AudioInNum | |
AlarmInNum | |
AlarmOutNum | |
DiskNum | |
RS485Num | |
RS232Num | |
NetworkPortNum | |
DecordChans | |
VGANum | |
USBNum | |
DiskCtrlNum | |
AuxOutNum | |
StreamNum | |
Language error | |
DateFormat error | |
DateSprtr error | |
English | |
Chinese Simplified | |
Chinese Traditional | |
Italian | |
Spanish | |
Japanese | |
Russian | |
French | |
Greman | |
Portuguese | |
Turkey | |
Polish | |
Romanian | |
Hungarian | |
Finnish | |
Estonian | |
Korean | |
Farsi | |
Dansk | |
Czechish | |
Bulgaria | |
Slovakian | |
Slovenia | |
Croatian | |
Dutch | |
Greek | |
Ukrainian | |
Swedish | |
Serbian | |
Vietnamese | |
Lithuanian | |
Filipino | |
Arabic | |
Catalan | |
Latvian | |
YYYY-MM-DD | |
MM-DD-YYYY | |
DD-MM-YYYY | |
Hi8120 | |
Hi8180 | |
Hi8160 | |
Hi3510 | |
Hi3511 | |
Hi3512 | |
IrisSUB | |
BrushOpen | |
BrushClose | |
DecoderType | |
DecoderAddr | |
Pelco-d | |
Pelco-p | |
DecoderType error | |
PresetSetNum | |
PresetSet needs to set up "Title" | |
PresetSet needs to set up "PresetNum" | |
Alarm Out State: | |
Action=start | |
Duration=%d | |
Alarm Out State: | |
Action=stop | |
WifiEnable | |
WifiIpAddr | |
WifiNetMask | |
WifiGateway | |
WifiDDNSServer | |
WifiEssid | |
WifiSecurity | |
NetworkType | |
WifiEnableDHCP | |
WifiStatus | |
WifiWebKey | |
infra | |
ad-hoc | |
successed | |
WifiIpAddr error | |
WifiNetMask error | |
WifiGateway error | |
WifiDDNSServer error | |
WifiSecurity error | |
web 64 ascii | |
web 64 hex | |
web 128 ascii | |
web 128 hex | |
WPAPSK-TKIP | |
WPASK-AES | |
WPA2PSK-AES | |
CruiseIndex | |
CruiseEnable | |
CruiseDetail | |
PointNum | |
%s=%d, %s=%d | |
%s:%d, %s:%d, %s:%d; | |
PresetNo | |
RemainTime | |
Speed | |
Invalid CruiseIndex | |
Invalid PointNum | |
PointNum is not match to CruiseDetail | |
maintype | |
subtype | |
maintype miss | |
subtype miss | |
Unkown maintype | |
Unkown subtype | |
#### %s %d, outLen=%d | |
#### %s %d, u32Num=%d | |
have no logs | |
Unkown error | |
%s=%s, %s=%s, %s=%04u-%02u-%02u,%02u:%02u:%02u, | |
Main type | |
Sub type | |
Time | |
%s=%s, %s=%d, | |
STOP | |
START | |
Action | |
%s=%d, %s=%d, | |
UerID | |
%s=%s, | |
%s=%s, | |
ExtInfo | |
#### %s %d currIndex=%d, currLen=%d | |
LOG_TYPE_ALL | |
LOG_TYPE_OPER | |
LOG_TYPE_ALARM | |
LOG_TYPE_SMART | |
LOG_TYPE_ACCESS | |
LOG_TYPE_INFO | |
LOG_TYPE_ABNORMAL | |
LOG_TYPE_BUTT | |
LOG_OPER_ALL | |
LOG_OPER_POWERON | |
LOG_OPER_POWEROFF | |
LOG_OPER_REBOOT | |
LOG_OPER_SAVEPARA | |
LOG_OPER_RECMANUAL | |
LOG_OPER_PTZCONTROL | |
LOG_OPER_STARTCRUISE | |
LOG_OPER_STOPCRUISE | |
LOG_OPER_SNAPMAUNAL | |
LOG_OPER_STARTTALKBACK | |
LOG_OPER_STOPTALKBACK | |
LOG_OPER_UPGRADEAPP | |
LOG_OPER_UPGRADEKERNEL | |
LOG_OPER_UPGRADEWEB | |
LOG_OPER_FORMAT | |
LOG_OPER_UNINSTALLDISK | |
LOG_OPER_BUTT | |
LOG_ALARM_ALL | |
LOG_ALARM_SENSOR | |
LOG_ALARM_MOTION | |
LOG_ALARM_VLOST | |
LOG_ALARM_SHELTER | |
LOG_ALARM_NET_BROKEN | |
LOG_ALARM_IP_CONFLICT | |
LOG_ALARM_BUTT | |
LOG_SMART_ALL | |
LOG_SMART_AUDIO_ABNORMAL | |
LOG_SMART_DEFOCUS | |
LOG_SMART_SCENE_CHANGE | |
LOG_SMART_FACE_DETECTION | |
LOG_SMART_BORDER_DETECTION | |
LOG_SMART_REGIONAL_INVASION | |
LOG_SMART_ENTER_REGION | |
LOG_SMART_LEAVE_REGION | |
LOG_SMART_LINGER_DETECTION | |
LOG_SMART_PERSONNEL_GATHERS | |
LOG_SMART_FAST_MOVING | |
LOG_SMART_PARKING_DETECTION | |
LOG_SMART_ARTICLES_LEFT | |
LOG_SMART_ARTICLES_TAKE | |
LOG_SMART_BUTT | |
LOG_ACCESS_ALL | |
LOG_ACCESS_CLIENT | |
LOG_ACCESS_MOBILE | |
LOG_ACCESS_RTSP | |
LOG_ACCESS_ONVIF | |
LOG_ACCESS_G28181 | |
LOG_ACCESS_AN | |
LOG_ACCESS_I8 | |
LOG_ACCESS_ZN | |
LOG_ACCESS_BUTT | |
LOG_INFO_ALL | |
LOG_INFO_RECSCH | |
LOG_INFO_RECALARM | |
LOG_INFO_SNAPFTP | |
LOG_INFO_EMAIL | |
LOG_INFO_UPNP_SUCC | |
LOG_INFO_DDNS_SUCC | |
LOG_INFO_PPPOE_SUCC | |
LOG_INFO_3G_SUCC | |
LOG_INFO_NTP | |
LOG_INFO_BUTT | |
LOG_ERROR_ALL | |
LOG_ERROR_MEM | |
LOG_ERROR_BUTT | |
127.0.0.1 | |
EnableAutoDenoise | |
Denoise | |
EnableAWB | |
EnableAEC | |
EnableAGC | |
Mirror | |
EnableBAW | |
IrisBasic | |
EnableWideDynamic | |
WDLevel | |
SceneMode | |
EnableAIris | |
EnableBLC | |
EnableAntifog | |
AntifogStrength | |
Denoise error | |
Red error | |
Blue error | |
Green error | |
EC error | |
GC error | |
Mirror error | |
IrisBasic error | |
Gamma error | |
WDLevel error | |
SceneMode error | |
AntifogStrength error | |
### %s(%d) hc->origfilename=%s | |
POST | |
have not the string in content | |
### %s(%d) query: %s | |
argc = %d | |
#### %s %d | |
URL Error | |
CGI_CMDProcess | |
anv_logquery_process | |
2<Pd | |
ptz_setting_process | |
full | |
half | |
post | |
disable | |
G.726 | |
G.711A | |
G.711U | |
start talk..... | |
### DupleMode=%d, ret=%d | |
DMS_NET_REG_AUDIOCALLBACK error.... | |
DMS_NET_CMD_START_TALKAUDIO error.... | |
stop talk.. | |
cgi_audio_stop .... | |
cgi_audio_stop ok.... | |
running... | |
Start .... | |
socket(): | |
bind(): | |
listen(): | |
###Start(udp:%d,tcp:%d, port:%d, %lu, %lu).. | |
UDP read [%s] | |
DuplexMode=%d | |
DuplexMode=%d, Ignal .... | |
Error dms_sysnetapi_WriteAudioData:%d | |
%02X | |
Alarm Type=MotionDetection status=%s channel=%d date=%d-%d-%d time=%d:%02d:%02d | |
start | |
resume | |
Alarm Type=Alarmin status=%s channel=%d date=%d-%d-%d time=%d:%02d:%02d | |
Alarm Type=VideoLoss status=%s channel=%d date=%d-%d-%d time=%d:%02d:%02d | |
/jb_config/jb_rootfs/cgi_alarm.conf | |
start alarm...... | |
%s:%d | |
stop alarm...... | |
PASV | |
%d,%d,%d,%d,%d,%d | |
STOR %s | |
PORT %d,%d,%d,%d,%d,%d | |
PORT Listen %s:%d | |
TYPE I | |
SIZE %s | |
REST %d | |
CWD %s | |
MKD %s | |
CWD / | |
connect: | |
-1 Connected failed. | |
USER %s | |
PASS %s | |
Errno: %d. | |
Check Login OK | |
REST 100 | |
Check REST OK | |
REST 0 | |
MKD _TMP | |
RMD _TMP | |
RMD Error:%s | |
_tmpchk.tmp | |
Failed to rewrite... | |
DELE %s | |
Failed to delete file.. | |
Message:%s | |
Open(%s) error... | |
throttle #%d '%.80s' rate %ld greatly exceeding limit %ld; %d sending | |
throttle #%d '%.80s' rate %ld exceeding limit %ld; %d sending | |
throttle #%d '%.80s' rate %ld lower than minimum %ld; %d sending | |
%s: no value required for %s option | |
%s: value required for %s option | |
usage: %s [-C configfile] [-p port] [-d dir] [-r|-nor] [-dd data_dir] [-s|-nos] [-v|-nov] [-g|-nog] [-u user] [-c cgipat] [-t throttles] [-h host] [-l logfile] [-i pidfile] [-T charset] [-P P3P] [-M maxage] [-V] [-D] | |
Exit thttpd_stop_main!use %d seconds. | |
<THTTPD> sighup | |
out of memory copying a string | |
%s: out of memory copying a string | |
debug | |
chroot | |
nochroot | |
data_dir | |
symlink | |
nosymlink | |
symlinks | |
nosymlinks | |
cgipat | |
cgilimit | |
urlpat | |
noemptyreferers | |
localpat | |
throttles | |
logfile | |
vhost | |
novhost | |
globalpasswd | |
noglobalpasswd | |
pidfile | |
charset | |
max_age | |
%s: unknown config option '%s' | |
too many connections! | |
the connects free list is messed up | |
out of memory allocating an httpd_conn | |
replacing non-null linger_timer! | |
tmr_create(linger_clear_connection) failed | |
up %ld seconds, stats for %ld seconds: | |
thttpd - %ld connections (%g/sec), %d max simultaneous, %lld bytes (%g/sec), %d httpd_conns allocated | |
<THTTPD> sigusr1 | |
exiting | |
<THTTPD> sigterm. | |
exiting due to signal %d | |
<THTTPD> sigusr2 | |
%.80s connection timed out reading | |
%.80s connection timed out sending | |
<THTTPD> abort(). | |
/tmp | |
<THTTPD> sigchld. | |
<THTTPD> wait for any child end. | |
child wait - %m | |
<THTTPD> sigchld, cgi_count:%d. | |
nobody | |
-nor | |
-nos | |
-nov | |
-nog | |
thttpd/2.25b 29dec2003 | |
Thttpd Module Build:%s %s | |
11:31:41 | |
thttpd | |
/etc/cgi/webserver.conf | |
thttpd_start port:%d | |
gethostbyname %.80s failed | |
%s: gethostbyname %s failed | |
%.80s - non-IP network address | |
%s: %s - non-IP network address | |
%4900[^ ] %ld-%ld | |
%4900[^ ] %ld | |
unparsable line in %.80s - %.80s | |
%s: unparsable line in %.80s - %.80s | |
out of memory allocating a throttletab | |
%s: out of memory allocating a throttletab | |
unknown user - '%.80s' | |
%s: unknown user - '%s' | |
/dev/null | |
logfile is not an absolute path, you may not be able to re-open it | |
%s: logfile is not an absolute path, you may not be able to re-open it | |
fchown logfile - %m | |
fchown logfile | |
chdir - %m | |
chdir | |
daemon - %m | |
fdwatch initialization failure | |
chroot - %m | |
logfile is not within the chroot tree, you will not be able to re-open it | |
%s: logfile is not within the chroot tree, you will not be able to re-open it | |
chroot chdir - %m | |
chroot chdir | |
data_dir chdir - %m | |
data_dir chdir | |
tmr_create(occasional) failed | |
tmr_create(idle) failed | |
tmr_create(update_throttles) failed | |
tmr_create(show_stats) failed | |
out of memory allocating a connecttab | |
thttpd_start_main | |
re-opening logfile | |
re-opening %.80s - %m | |
fdwatch - %m | |
throttle sending count was negative - shouldn't happen! | |
replacing non-null wakeup_timer! | |
tmr_create(wakeup_connection) failed | |
write - %m sending %.80s | |
Exit thttpd_start_main thread success! | |
httpd_write_fully | |
httpd_write_response | |
libhttpd - %d strings allocated, %lu bytes (%g bytes/str) | |
%s %d, write error!%s(%d) | |
out of memory reallocating a string to %d bytes | |
killed CGI process %d | |
tmr_create(cgi_kill2) failed | |
hard-killed CGI process %d | |
cgi-bin/anv/ | |
cgi-bin/ | |
onvif/ | |
json-bin/ | |
readlink %.80s - %m | |
too many symlinks in %.80s | |
%s %d, fd=%d,delay_close=%d,closeflag=%d | |
out of memory copying environment variable | |
PATH=%s | |
/usr/local/bin:/usr/ucb:/bin:/usr/bin | |
SERVER_SOFTWARE=%s | |
SERVER_NAME=%s | |
GATEWAY_INTERFACE=CGI/1.1 | |
SERVER_PROTOCOL=%s | |
SERVER_PORT=%s | |
REQUEST_METHOD=%s | |
PATH_INFO=/%s | |
PATH_TRANSLATED=%s | |
SCRIPT_NAME=/%s | |
QUERY_STRING=%s | |
REMOTE_ADDR=%s | |
HTTP_REFERER=%s | |
HTTP_USER_AGENT=%s | |
HTTP_ACCEPT=%s | |
HTTP_ACCEPT_ENCODING=%s | |
HTTP_ACCEPT_LANGUAGE=%s | |
HTTP_COOKIE=%s | |
CONTENT_TYPE=%s | |
HTTP_HOST=%s | |
CONTENT_LENGTH=%s | |
REMOTE_USER=%s | |
AUTH_TYPE=%s | |
TZ=%s | |
CGI_PATTERN=%s | |
<HR> | |
<ADDRESS><A HREF="%s">%s</A></ADDRESS> | |
</BODY> | |
</HTML> | |
http://www.acme.com/software/thttpd/ | |
Status: | |
Location: | |
Something | |
HTTP/1.0 %d %s | |
text/plain; charset=%s | |
%a, %d %b %Y %H:%M:%S GMT | |
%.20s %d %s | |
Server: %s | |
Content-Type: %s | |
Date: %s | |
Last-Modified: %s | |
Accept-Ranges: bytes | |
Connection: close | |
Cache-Control: no-cache,no-store | |
Content-Encoding: %s | |
Content-Range: bytes %lld-%lld/%lld | |
Content-Length: %lld | |
Content-Length: %lld | |
P3P: %s | |
Cache-Control: max-age=%d | |
Expires: %s | |
text/html; charset=%s | |
<HTML> | |
<HEAD><TITLE>%d %s</TITLE></HEAD> | |
<BODY BGCOLOR="#cc9999" TEXT="#000000" LINK="#2020ff" VLINK="#4040cc"> | |
<H2>%d %s</H2> | |
**MSIE** | |
<!-- | |
Padding so that MSIE deigns to show this error instead of its own canned one. | |
/%.100s%.200s | |
%.200s | |
%d/%b/%Y:%H:%M:%S | |
%s %c%04d | |
%.80s - %.80s [%s] "%.80s %.300s %.80s" %d %s "%.200s" "%.200s" | |
%.80s - %.80s "%.80s %.200s %.80s" %d %s "%.200s" "%.200s" | |
accept - %m | |
unknown sockaddr family | |
%s/%s/err%d.html | |
errors | |
%s/err%d.html | |
opendir %.80s - %m | |
fork - %m | |
fdopen - %m | |
<HTML> | |
<HEAD><TITLE>Index of %.80s</TITLE></HEAD> | |
<BODY BGCOLOR="#99cc99" TEXT="#000000" LINK="#2020ff" VLINK="#4040cc"> | |
<H2>Index of %.80s</H2> | |
<PRE> | |
mode links bytes last-changed name | |
<HR> | |
out of memory reallocating directory names | |
/_.-~ | |
%%%02x | |
-> | |
%s %3ld %10lld %s <A HREF="/%.500s%s">%.80s</A>%s%s%s | |
</PRE></BODY> | |
</HTML> | |
spawned indexing process %d for directory '%.200s' | |
tmr_create(cgi_kill ls) failed | |
%s%s" | |
.htpasswd | |
%.80s auth file %.80s could not be opened - %m | |
The requested URL '%.80s' is protected by an authentication file, but the authentication file cannot be opened. | |
%.80s non-local referer "%.80s%.80s" "%.80s" | |
You must supply a local referer to get URL '%.80s' from this server. | |
$$$$$$$$$ hc->expnfilename:%s | |
ROH/channel | |
stat is error : File name is too long. | |
%.80s URL "%.80s" resolves to a non world-readable file | |
The requested URL '%.80s' resolves to a file that is not world-readable. | |
%s/?%s | |
%s%s | |
index.html | |
index.htm | |
index.xhtml | |
index.xht | |
Default.htm | |
index.cgi | |
%.80s URL "%.80s" tried to index a directory with indexing disabled | |
The requested URL '%.80s' resolves to a directory that has indexing disabled. | |
%.80s URL "%.80s" resolves to a non-world-readable index file | |
The requested URL '%.80s' resolves to an index file that is not world-readable. | |
%.80s URL "%.80s" tried to retrieve an auth file | |
The requested URL '%.80s' is an authorization file, retrieving it is not permitted. | |
pipe - %m | |
nph- | |
execve %.80s - %m | |
spawned CGI process %d for file '%.200s' | |
tmr_create(cgi_kill child) failed | |
%.80s URL "%.80s" is executable but isn't CGI | |
The requested URL '%.80s' resolves to a file which is marked executable but is not a CGI file; retrieving it is forbidden. | |
%.80s URL "%.80s" has pathinfo but isn't CGI | |
The requested URL '%.80s' resolves to a file plus CGI-style pathinfo, but the file is not a valid CGI file. | |
HTTP/0.9 | |
HEAD | |
/../ | |
Referer: | |
User-Agent: | |
Host: | |
Accept: | |
%.80s way too much Accept: data | |
Accept-Encoding: | |
%.80s way too much Accept-Encoding: data | |
Accept-Language: | |
If-Modified-Since: | |
unparsable time: %.80s | |
Cookie: | |
Range: | |
Range-If: | |
If-Range: | |
Content-Type: | |
Content-Length: | |
Authorization: | |
Connection: | |
getsockname - %m | |
%.80s URL "%.80s" goes outside the web tree | |
The requested URL '%.80s' resolves to a file outside the permitted web server directory tree. | |
unknown sockaddr family on listen socket | |
socket %.80s - %m | |
setsockopt SO_REUSEADDR - %m | |
bind %.80s - %m | |
fcntl F_GETFL - %m | |
fcntl O_NDELAY - %m | |
listen - %m | |
out of memory allocating an httpd_server | |
out of memory copying hostname | |
out of memory copying cgi_pattern | |
out of memory copying cwd | |
out of memory copying url_pattern | |
out of memory copying local_pattern | |
%.80s starting on port %d | |
%.80s starting on %.80s, port %d | |
Your request has bad syntax or is inherently impossible to satisfy. | |
Request Timeout | |
No request appeared within a reasonable time period. | |
Service Temporarily Overloaded | |
The requested URL '%.80s' is temporarily overloaded. Please try again later. | |
The requested method '%.80s' is not implemented by this server. | |
Internal Error | |
There was an unusual problem serving the requested URL '%.80s'. | |
The requested URL '%.80s' was not found on this server. | |
The actual URL is '%.80s'. | |
Authorization required for the URL '%.80s'. | |
compress | |
x-uuencode | |
application/octet-stream | |
application/x-authorware-bin | |
application/x-authorware-map | |
application/x-authorware-seg | |
application/postscript | |
audio/x-aiff | |
aifc | |
text/plain | |
video/x-ms-asf | |
audio/basic | |
video/x-msvideo | |
bcpio | |
application/x-bcpio | |
image/bmp | |
application/x-netcdf | |
class | |
application/x-java-vm | |
cpio | |
application/x-cpio | |
application/mac-compactpro | |
application/x-pkcs7-crl | |
application/x-x509-ca-cert | |
application/x-csh | |
text/css | |
application/x-director | |
image/vnd.djvu | |
djvu | |
application/msword | |
dump | |
application/x-dvi | |
text/x-setext | |
application/andrew-inset | |
image/x-freehand | |
image/gif | |
gtar | |
application/x-gtar | |
application/x-hdf | |
application/mac-binhex40 | |
x-conference/x-cooltalk | |
image/ief | |
iges | |
model/iges | |
application/x-inventor | |
application/x-java-archive | |
jfif | |
image/jpeg | |
jpeg | |
application/x-javascript | |
audio/midi | |
latex | |
application/x-latex | |
audio/x-mpegurl | |
application/x-troff-man | |
mathml | |
application/mathml+xml | |
application/x-troff-me | |
mesh | |
model/mesh | |
midi | |
application/vnd.mif | |
mime | |
message/rfc822 | |
video/quicktime | |
video/x-sgi-movie | |
audio/mpeg | |
video/mp4 | |
video/mpeg | |
mpeg | |
mpga | |
application/x-troff-ms | |
video/vnd.mpegurl | |
application/oda | |
application/x-ogg | |
application/x-ns-proxy-autoconfig | |
image/x-portable-bitmap | |
chemical/x-pdb | |
application/pdf | |
image/x-portable-graymap | |
application/x-chess-pgn | |
image/png | |
image/x-portable-anymap | |
image/x-portable-pixmap | |
application/vnd.ms-powerpoint | |
audio/x-realaudio | |
audio/x-pn-realaudio | |
image/x-cmu-raster | |
application/rdf+xml | |
image/x-rgb | |
roff | |
application/x-troff | |
audio/x-pn-realaudio-plugin | |
application/rss+xml | |
text/rtf | |
text/richtext | |
text/sgml | |
sgml | |
application/x-sh | |
shar | |
application/x-shar | |
silo | |
application/x-stuffit | |
application/x-koan | |
application/smil | |
application/x-futuresplash | |
application/x-wais-source | |
application/vnd.sun.xml.calc.template | |
application/vnd.sun.xml.draw.template | |
application/vnd.sun.xml.impress.template | |
application/vnd.sun.xml.writer.template | |
sv4cpio | |
application/x-sv4cpio | |
sv4crc | |
application/x-sv4crc | |
image/svg+xml | |
svgz | |
application/x-shockwave-flash | |
application/vnd.sun.xml.calc | |
application/vnd.sun.xml.draw | |
application/vnd.sun.xml.writer.global | |
application/vnd.sun.xml.impress | |
application/vnd.sun.xml.math | |
application/vnd.sun.xml.writer | |
application/x-tar | |
application/x-tcl | |
application/x-tex | |
texi | |
application/x-texinfo | |
texinfo | |
image/tiff | |
tiff | |
application/dsptype | |
text/tab-separated-values | |
ustar | |
application/x-ustar | |
application/x-cdlink | |
vrml | |
model/vrml | |
video/x-rad-screenplay | |
audio/x-wav | |
audio/x-ms-wax | |
wbmp | |
image/vnd.wap.wbmp | |
application/vnd.wap.wbxml | |
video/x-ms-wm | |
audio/x-ms-wma | |
application/x-ms-wmd | |
text/vnd.wap.wml | |
application/vnd.wap.wmlc | |
wmls | |
text/vnd.wap.wmlscript | |
wmlsc | |
application/vnd.wap.wmlscriptc | |
video/x-ms-wmv | |
video/x-ms-wmx | |
application/x-ms-wmz | |
wsrc | |
video/x-ms-wvx | |
image/x-xbitmap | |
application/xhtml+xml | |
xhtml | |
application/vnd.ms-excel | |
image/x-xpixmap | |
image/x-xwindowdump | |
chemical/x-xyz | |
application/zip | |
fdwatch - %ld %ss (%g/sec) | |
bad ridx (%d) in poll_get_fd! | |
bad fd (%d) passed to fdwatch_check_fd! | |
bad fdidx (%d) in poll_check_fd! | |
bad fd (%d) passed to fdwatch_del_fd! | |
bad idx (%d) in poll_del_fd! | |
bad fd (%d) passed to fdwatch_add_fd! | |
too many fds in poll_add_fd! | |
map cache - %d allocated, %d active (%lld bytes), %d free; hash size: %d; expire age: %ld | |
map counts don't add up! | |
mmc_unmap found zero or negative refcount! | |
mmc_unmap failed to find entry! | |
stat - %m | |
open - %m | |
out of memory allocating a Map | |
mmc panic - freeing all unreferenced maps | |
out of memory storing a file | |
read - %m | |
add_hash() failure | |
check_hash_size() failure | |
timers - %d allocated, %d active, %d free | |
timer counts don't add up! | |
%d-%400[a-zA-Z]-%d %d:%d:%d GMT | |
%d %400[a-zA-Z] %d %d:%d:%d GMT | |
%d:%d:%d GMT %d-%400[a-zA-Z]-%d | |
%d:%d:%d GMT %d %400[a-zA-Z] %d | |
%400[a-zA-Z], %d-%400[a-zA-Z]-%d %d:%d:%d GMT | |
%400[a-zA-Z], %d %400[a-zA-Z] %d %d:%d:%d GMT | |
%400[a-zA-Z] %400[a-zA-Z] %d %d:%d:%d GMT %d | |
sunday | |
monday | |
tuesday | |
wednesday | |
thursday | |
friday | |
saturday | |
january | |
february | |
march | |
april | |
june | |
july | |
august | |
september | |
october | |
november | |
december | |
HI_ICGI_Register_Proc | |
<%s>(%d):g_pfunOnvif is NULL | |
cgiinterface.c | |
<%s>(%d):g_pfunRtspProc is NULL | |
json-bin | |
szCommand:%s hc->conn_fd:%d g_pfunJSONProc:%d | |
<%s>(%d):g_pfunJSONProc is NULL | |
szCommand:%s hc->conn_fd:%d g_pfunCGIProc:%d | |
<%s>(%d):g_pfunCGIProc is NULL | |
========= Begin ANV CGI: Dump Http conn 0x%x======== | |
ANV CGI: Dump Http conn initialized:%d | |
ANV CGI: Dump Http conn hs:0x%x | |
ANV CGI: Dump Http conn encodedurl:%s | |
ANV CGI: Dump Http conn decodedurl:%s | |
ANV CGI: Dump Http conn origfilename:%s | |
ANV CGI: Dump Http conn expnfilename:%s | |
ANV CGI: Dump Http conn encodings:%s | |
ANV CGI: Dump Http conn pathinfo:%s | |
ANV CGI: Dump Http conn query:%s | |
========= End ANV CGI: Dump Http conn 0x%x======== | |
<html><head><title></title> <META http-equiv="Content-Type" content="text/html; charset=iso-8859-1"> <META http-equiv="Refresh" content="0;URL=%s"></head><body></body></html> | |
HTTP/1.0 200 OK | |
Content-Type:text/html | |
%s(%d): Register %s pfunProc=%d process function. | |
DDNSServer_Start | |
@@@@@@@@@@%s %d DDNS START!!!!!!!! | |
setDdnsInfo | |
RegisterDomain | |
noip_Connect | |
noip_get_our_visible_IPaddr | |
centerddns_asyn_connect | |
www. | |
eyeDDNSUpdateFunc | |
ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/ | |
"#$%&+,/:;<=>?@[\]^`{|}~ | |
%s%.2x%s%.2x | |
%s%.2x | |
@@@@@@@@@@%s %d DMS_NET_GET_DDNSCFG nRet:%X | |
DMS_NET_GET_DDNSCFG failure | |
GET %s HTTP/1.0 | |
User-Agent: Linux-DUC/2.1.9 | |
GET %s HTTP/1.0 | |
Host: %s | |
Authorization: Basic %s | |
Connection: close | |
%s %d | |
URL:%s | |
/nic/update?hostname=%s&myip=%s | |
www.sieraddns.com | |
good | |
nochg | |
******DOMAIN_NAME_NO_IP | |
http://%s/ducupdate.php?username=%s&pass=%s&hostname=%s&ip=%s | |
/nic/update?system=dyndns&hostname=%s&myip=%s | |
************ %s | |
www.nightowldvr.com | |
http://www.perfecteyes.com/ddns/update?hostname=%s&myip=%s | |
www.perfecteyes.com | |
/nic/update?hostname=%s&myip=%s&wildcard=OFF&offline=NO | |
members.dyndns.org | |
http://members.3322.org/dyndns/update?hostname=%s&myip=%s&wildcard=OFF&offline=NO | |
members.3322.org | |
line:%d fun:%s h_errno:%d(%s) | |
line:%d fun:%s-------------x:%d | |
GET http://%s/ HTTP/1.0 | |
ip1.dynupdate.no-ip.com | |
Not connected to Net! | |
GET http://dynupdate.no-ip.com/ducupdate.php?username=%s&pass=%s&hostname=%s&myip=%s HTTP/1.0 | |
connect to ddns server %s:%d | |
183.90.186.130 | |
tmp_ip = %s | |
~~~~~~~~~~~[Fun: %s][Line: %d] | |
connect the remote server ok sock = %d | |
connect nvrddns fail,shutdown ..... | |
DMS_NET_SET_COLORCFG failure | |
DMS_UPNP_GET_CONFIG failure | |
<?xml version="1.0" encoding="gb2312"?> | |
<dvs | |
dvsid="%02X%02X%02X" | |
domainname="%s" | |
***usrname = %s | |
corpid="%s" | |
dvsname="%s" | |
dvsip="%s" | |
webport="%d" ctrlport="%d" | |
protocol="tcp" userid="admin" | |
password="%s" | |
model="32" | |
postfrequency="60" | |
version="%s" | |
00001 | |
status="0" | |
serverip="0.0.0.0" | |
serverport="0" | |
transfer="0" | |
Ch%d | |
<dv channel="%d" dvname="%s" status="%d" /> | |
</dvs> | |
/post/post.aspx | |
GET %s?xmldata=%s HTTP/1.1 | |
Accept:*/* | |
Accept-Language:zh-ch | |
Accept-Encoding:gzip,deflate | |
Host: dvs.nsid.info | |
Connection: Keep-Alive | |
dvripc.net | |
post.%s | |
error yw_ret:%d | |
centerddns_tcp_send send error sendlen:%d | |
hostnameexist | |
====centerddns_tcp_recv:%s | |
insertsuccess | |
updatesuccess | |
GET /default.aspx/ HTTP/1.1 | |
Accept:*/* | |
Accept-Language:zh-ch | |
Accept-Encoding:gzip,deflate | |
Host: %s | |
Connection: Keep-Alive | |
DMS_NET_GET_USERCFG failure | |
I%02x%02x%02x | |
H%02x%02x%02x | |
<?xml version="1.0" encoding="gb2312"?> | |
<dvs dvsid="%s" domainname="%s" corpid="%s" dvsname="%s" dvsip="%s" webport="%d" ctrlport="%d" protocol="tcp" userid="%s" password="%s" model="%s" postfrequency="%d" version="%s" status="%d" serverip="%s" serverport="%d" transfer="%d" mobileport="%ld" channelcount="%d"> | |
[%s]: eyeaddr:%s | |
GET %s?xmldata=%s HTTP/1.1 | |
Accept:*/* | |
Accept-Language:zh-ch | |
Accept-Encoding:gzip,deflate | |
Host: %s | |
Connection: Keep-Alive | |
line:%d fun:%s -------eyeaddr:%s | |
line:%d fun:%s -------buf_len:%d | |
centerddns_tcp_recv recv error sendlen:%d | |
line:%d fun:%s | |
ddns | |
NewDDNSSetting.stDDNS[0].nUpdateTime=%d! | |
nSleepCount=%d! | |
TSInit | |
fTopSeeNetAlarmCallback | |
TSMainThread | |
TSSetEncodeCapability | |
TSGetVideoEncode | |
TSUserManageInfoSet | |
TSUserManageInfoSet | |
TSDDNSSet | |
TSSMTPSet | |
TSStreamMediaParamSet | |
TSVideoEncodeSet | |
TSVideoEncodeSet | |
TSVCParamSet | |
TSPhotoSnapSet | |
TSShelterSet | |
TsVideoLostSet | |
TsDiscFullSet | |
TSMaintainSet | |
TSEtherNetSet | |
TSEtherNetSet | |
TsTimeSet | |
TSTimeAndTitleSet | |
TSTimeAndTitleSet | |
TSClockSet | |
TSClockSet | |
TSMDAlarmSet | |
TSPTZControl | |
TS_SendRespond | |
TSGetPassWord_New | |
TSGetUserName_New | |
TSLoginAuthentication | |
TSGetPassWord | |
TSGetUserName | |
TSGetMsgFlag_New | |
TSGetMsgCode_New | |
TSGetMstType_New | |
TSSearch | |
TSGetMsgFlag | |
TSGetMsgCode | |
TSGetMstType | |
erro:creat TSMainThread fail | |
erro:creat TSSearch fail | |
%d-%02d-%02d %02d:%02d:%02d | |
<?xml version="1.0" encoding="GB2312" ?> | |
<MESSAGE_HEADER | |
Msg_type="ALARM_REPORT_MESSAGE" | |
Msg_code="CMD_REPORT_ALARM" | |
Msg_flag="0" | |
<MESSAGE_BODY> | |
<ALARM_REPORT_PARAM> | |
<ALARM_ITEM> | |
<ALARM_INFO | |
Alarm_code="14" | |
Alarm_flag="1" | |
Alarm_level="1" | |
Alarm_data="motion detect" | |
<ALARM_TIME | |
Year="%d" | |
Month="%d" | |
Day="%d" | |
WDay="%d" | |
Hour="%d" | |
Minute="%d" | |
Second="%d"/> | |
</ALARM_ITEM> | |
</ALARM_REPORT_PARAM> | |
</MESSAGE_BODY> | |
</XML_TOPSEE> | |
%s(%d) fd=%d | |
Alarm: Type = %d | |
<?xml version="1.0" encoding="GB2312" ?><XML_TOPSEE> | |
Msg_type="AUXPTZ_HEARTBEAT_MESSAGE" | |
Msg_code="CMD_HEARTBEAT" | |
Msg_type="SYSTEM_CONTROL_MESSAGE" | |
Msg_code="1020" | |
<RESPONSE_PARAM SystemConfigString=" + schedule_record + ftpemail_storage + picture_capture + zh_cn + zh_tw + en_us + ru_py + front_replay + media_capabiltiy + profile_setting + video_mask + system_maitain + linkdown_record + ircut_setting + WITHOUT_ACTIVE_IRCUT + pptp_support + SEARCH_WIFIAP + LONG_TITLE + timezone_halfhour + p2p_cfg_support + WIFI_AUTO_SCAN + MEDIA_ADVANCE_CONFIG_SUPPORT + P2PReplay + p2p_function_config + dst_support" /> | |
</XML_TOPSEE>. | |
Msg_type="SYSTEM_CONFIG_GET_MESSAGE" | |
Msg_code="205" | |
<MiscConfig | |
Language="zh_cn" | |
Msg_type="SYSTEM_CONFIG_SET_MESSAGE" | |
Msg_code="227" | |
Msg_flag="-1" | |
Msg_code="204" | |
<SystemLogConfig | |
LogLevel="DEBUG+RUN+ERROR+OPERATION+ALARM+STAT+COMMON" | |
MaxDay="30" | |
StoreMedia="FLASH" | |
StorePolicy="OVERWRITE" | |
AutoBackup="0" | |
BackupWay="EMAIL" | |
Msg_code="224" | |
Msg_code="1027" | |
<MESSAGE_BODY> | |
Msg_code="330" | |
Msg_code="331" | |
Msg_code="315" | |
<P2PConfig | |
Enable="1" | |
SyncTime="1" | |
Msg_code="335" | |
Msg_code="421" | |
Msg_code="650" | |
<PlatformConfig> | |
<TopseeConfig | |
Enable="0" | |
Server="192.168.0.1" | |
Port="10001" | |
Username="user" | |
Password="user" | |
</PlatformConfig> | |
</XML_TOPSEE>. | |
Msg_code="670" | |
Msg_code="314" | |
<PPTPConfig | |
Server="192.168.88.172" | |
MTU="1460" | |
Msg_code="334" | |
Msg_code="700" | |
<RecordConfig> | |
<Common | |
LocalEnable="1" | |
StorageSequence="0" | |
RemoteEnable="0" | |
MountParam="" | |
StoragePolicy="FIFO" | |
RecordFileSize="30" | |
<ScheduleRecord | |
Stream="1" | |
FileFormat="AVI" | |
MediaType="AV" | |
LocalStore="0" | |
RemoteStore="0" | |
JpegInterval="0" | |
FtpUpload="0" | |
EmailUpload="0" | |
<EnableTimeList> | |
<Workday | |
Day="1" | |
<TimeSpan | |
StartTime=" 0: 0: 0" | |
EndTime="24: 0: 0" | |
</Workday> | |
</EnableTimeList> | |
</ScheduleRecord> | |
<MotionDetectRecord | |
PreRecordTime="5" | |
RecordTime="60" | |
<MotionDetectCapture | |
PreTakeTime="5" | |
TotalTakeTime="10" | |
<InputAlarmRecord | |
<InputAlarmCapture | |
<LinkdownRecord | |
Stream="0" | |
FileFormat="" | |
MediaType="" | |
PreRecordTime="0" | |
RecordTime="0" | |
<LinkdownCapture | |
PreTakeTime="0" | |
TotalTakeTime="0" | |
</RecordConfig> | |
TSMainThread | |
TSMainThread pid:%d tid:%d | |
socket error%s | |
TSMainThread end ! | |
bind err%s | |
listen error%s | |
%s(%d) begin to accept,n_peer:%d | |
%s(%d): accept failed%s | |
erro:creat TSSessionThread fail | |
Msg_code="203" | |
<UserConfig> | |
<Account | |
Username="%s" | |
Password="%s" | |
Group="Operator" | |
Group="Administrator" | |
Status="Enable" | |
Status="Disable" | |
</UserConfig> | |
Msg_code="1012" | |
<RESPONSE_PARAM | |
KernelVersion="Linux version 3.0.8" | |
FileSystemVersion="TH38C V1.0.0, build %02X-%02X-%02X 09:07:44" | |
Msg_code="1019" | |
C001-JBNV | |
<RESPONSE_PARAM SerialNumber="%s" /> | |
<RESPONSE_PARAM SerialNumber="C001-JBNV20e530e0825c8dc8" /> | |
Msg_code="206" | |
<MaintainConfig | |
Enable="%d" | |
Time="%d:%d:%d" | |
Msg_code="202" | |
<TimeConfig | |
TimeMode="NTP" | |
TimeMode="MANUAL" | |
TimeZone="%d" | |
<NTPConfig | |
ServerIP="%s" | |
ServerPort="%d" | |
RefreshInterval="%d" | |
ServerIP="time.windows.com" | |
ServerPort="123" | |
RefreshInterval="60" | |
<DST | |
StartTime="M01W1D0T00:00:00" | |
EndTime="M01W1D0T00:00:00" | |
Delta="30" | |
</TimeConfig> | |
Msg_code="300" | |
<NetworkConfig> | |
<LANConfig | |
MacAddress="%s" | |
DHCP="%d" | |
IPAddress="%s" | |
Netmask="%s" | |
Gateway="%s" | |
DNS1="%s" | |
DNS2="%s" | |
<WIFIConfig | |
Version="2.0" | |
DHCP="0" | |
IPAddress="" | |
Netmask="" | |
Gateway="" | |
OperationMode="managed" | |
MacAddress="" | |
ChannelNumber="0" | |
Region="CN" | |
ESSID="" | |
BitRate="33" | |
MacMode="9" | |
<WirelessEncrypt | |
EncryptType="" | |
<WEPEncrypt | |
AuthMode="" | |
KeyIndex="0" | |
KeyMode="" | |
KeyValue="" | |
<WPAEncrypt | |
</WirelessEncrypt> | |
<PingWatchConfig | |
PingAddress="" | |
MaxFail="0" | |
</WIFIConfig> | |
<ADSLConfig | |
Username="test@163.gd" | |
Password="88888888" | |
<DDNSConfig | |
DYNDNS:dyndns.org | |
3322:3322.org | |
Server="%s" | |
Domain="%s" | |
FreshInterval="%d" | |
DdnsTypeList="3322,0,http://www.3322.org,3322.org;DYNDNS,0,http://www.dyndns.org,dyndns.org;" | |
<UPNPConfig | |
Type="0" | |
DialNumber="*99***1#" | |
APN=""UNINET"" | |
Username="" | |
Password="" | |
DialOption="0" | |
CenterNumber="" | |
SMSC="" | |
Server="" | |
</NetworkConfig> | |
Msg_code="400" | |
<ServerConfig> | |
<FTPList> | |
<FTPConfig | |
ServerIP="192.168.1.1" | |
ServerPort="21" | |
Username="user1" | |
Password="pas1" | |
FilePath="filepath1" | |
FileSize="1000" | |
ServerIP="192.168.88.138" | |
Username="ling" | |
Password="123456" | |
FilePath="" | |
FilePath="alarm" | |
</FTPList> | |
<SMTPList | |
Auth="%d" | |
FromEmail="%s" | |
<SMTPConfig | |
ToEmail="%s" | |
CcEmail="%s" | |
Subject="alarm report" | |
ToEmail="root@192.168.88.8" | |
CcEmail="" | |
Subject="hello" | |
CcEmail="root@192.168.88.8" | |
</SMTPList> | |
</ServerConfig> | |
Msg_code="600" | |
<MediaStreamConfig> | |
<StreamAccess | |
Auth="1" | |
VideoPort="%ld" | |
VideoPort="554" | |
RTPOverRTSP="1" | |
PTZPort="8091" | |
WEBPort="%d" | |
WEBPort="80" | |
</MediaStreamConfig> | |
Msg_code="500" | |
<MediaConfig> | |
<Video> | |
<Capture | |
Brightness="%d" | |
Contrast="%d" | |
Saturation="%d" | |
Sharpness="%d" | |
DayNight="1" | |
WhiteBalance="0" | |
BackLight="%d" | |
Switch2A="1" | |
BinningSkip="0" | |
TVSystem="%d" | |
HFlip="%d" | |
VFlip="%d" | |
TNF="0" | |
SNF="0" | |
VSTAB="0" | |
LDC="0" | |
FD="0" | |
IrcutMode="2" | |
IrcutSensitivity="50" | |
IrcutNightStartTime="%02d:%02d:00" | |
IrcutNightEndTime="%02d:%02d:00" | |
IrcutKeepColor="0" | |
<Encode> | |
<EncodeConfig | |
Resolution="720P" | |
EncodeFormat="H264" | |
BitRateControl="CBR" | |
Initquant="50" | |
BitRate="1024" | |
FrameRate="15" | |
Stream="2" | |
Resolution="CIF" | |
BitRate="256" | |
FrameRate="9" | |
<AdvanceEncodeConfig | |
EncodeProfile="0" | |
WDRMode="0" | |
WDRStartTime="00:00:00" | |
WDREndTime="00:00:00" | |
DisablePrivateData="0" | |
</Encode> | |
<AdvacedMediaConfig> | |
<AEConfig | |
AEStep="48" | |
AETolerance="10" | |
<ExposureConfig | |
ExposureMode="%d" | |
ExposureTime="%d" | |
DaySystemGain="36" | |
NightSystemGain="48" | |
<AWBConfig | |
AWBMode="0" | |
AWBRGain="50" | |
AWBBGain="50" | |
<DRCConfig | |
StrenthTarget="40" | |
DRCStartTime="00:00:00" | |
DRCEndTime="00:00:00" | |
<DenoiseConfig | |
DenoiseMode="1" | |
DenoiseDayStrenth="5" | |
DenoiseNightStrenth="5" | |
<ColorStyle | |
ColorStyleMode="0" | |
<LDCConfig | |
enable="0" | |
centorX="0" | |
centorY="0" | |
ratio="0" | |
</AdvacedMediaConfig> | |
<JpegConfig | |
Quality="80" | |
Framerate="2" | |
<Overlay | |
Transparency="0" | |
<TimeOverlay | |
PosX="%d" | |
PosY="%d" | |
Format="yyyy/mm/dd hh:mm:ss" | |
Format="yyyy-mm-dd hh:mm:ss" | |
<TitleOverlay | |
Title="%s" | |
</Overlay> | |
<Mask> | |
<MainStream | |
Area1PosX="%d" | |
Area1PosY="%d" | |
Area1Width="%d" | |
Area1Height="%d" | |
Area2PosX="0" | |
Area2PosY="0" | |
Area2Width="0" | |
Area2Height="0" | |
Area3PosX="0" | |
Area3PosY="0" | |
Area3Width="0" | |
Area3Height="0" | |
Area4PosX="0" | |
Area4PosY="0" | |
Area4Width="0" | |
Area4Height="0" | |
<SubStream | |
</Mask> | |
</Video> | |
<Audio> | |
Volume="25" | |
<Encode | |
SampleRate="8000" | |
EncodeType="G.711" | |
BitRate="64000" | |
</Audio> | |
</MediaConfig> | |
Msg_code="1031" | |
><VideoCap | |
CapList=" | |
%s(%d) stream:0 | |
%s(%d) nWidth:%d,nHeight:%d | |
%s,H264,0,%ld,500,4000,%ld,1,%d,1,%d; | |
QCIF | |
QVGA | |
720P | |
130H | |
300H | |
QQVGA | |
UXGA | |
SVGA | |
1080P | |
960P | |
360P | |
960H | |
%s(%d) stream:1 | |
%s,H264,1,%ld,50,2000,%ld,1,%d,0,%d; | |
<AudioCap CapList="G.711,1,16,8,64,1;"/> | |
</RESPONSE_PARAM> | |
Msg_code="501" | |
Brightness="128" | |
Contrast="184" | |
Saturation="128" | |
Sharpness="128" | |
BackLight="128" | |
TVSystem="1" | |
HFlip="0" | |
VFlip="0" | |
IrcutNightStartTime="18:00:00" | |
IrcutNightEndTime="07:00:00" | |
640X360 | |
Resolution="%s" | |
BitRateControl="VBR" | |
Initquant="%ld" | |
BitRate="%ld" | |
FrameRate="%ld" | |
%s(%d) dwStreamFormat=%ld | |
%s(%d) wHeight=%d | |
%s(%d) wWidth=%d | |
ExposureMode="0" | |
ExposureTime="0" | |
centorX="0" | |
Transparency="1" | |
PosX="0" | |
PosY="1" | |
PosX="1" | |
PosY="0" | |
Title="4844495043414d" | |
Area1PosX="10" | |
Area1PosY="30" | |
Area1Width="10" | |
Area1Height="100" | |
Area1PosX="0" | |
Area1PosY="0" | |
Area1Width="0" | |
Area1Height="0" | |
</Video> | |
Msg_code="800" | |
<AlarmConfig> | |
<InputAlarm> | |
<AlarmChannel | |
PortIndex="1" | |
ChannelType="alarmoutput1" | |
TriggerType="HIGH-LOW" | |
Day="7" | |
<AlarmAction> | |
<AlarmOutputAction | |
PortIndex="0" | |
TriggerType="HIGH" | |
Duration="10" | |
<PTZAction | |
ActionType="PositionLoop" | |
<PositionLoop | |
Interval="1" | |
<PTZPosition | |
PositionIndex="1" | |
PositionIndex="2" | |
</PositionLoop> | |
</PTZAction> | |
</AlarmAction> | |
</AlarmChannel> | |
</InputAlarm> | |
<MotionDetectAlarm | |
BlockCount="65537" | |
BlockConfig="1" | |
Sensitivity="%d" | |
AlarmThreshold="20" | |
DayNightSwitch="0" | |
NightSensitivity="60" | |
NightAlarmThreshold="30" | |
NightStartTime=" 0: 0: 0" | |
NightEndTime="24: 0: 0" | |
StartTime=" %d: %d: 0" | |
EndTime="%d: %d: 0" | |
ChannelType="1" | |
ActionType="PositionWalk" | |
<PositionWalk | |
Interval="2" | |
WalkCount="1" | |
PositionIndex="3" | |
</PositionWalk> | |
</MotionDetectAlarm> | |
<VideoLostAlarm | |
ChannelType="0" | |
</VideoLostAlarm> | |
<VideoCoverAlarm | |
ChannelType="Alarm Bell" | |
Duration="300" | |
</VideoCoverAlarm> | |
<StorageFullAlarm | |
Threshold="95" | |
</StorageFullAlarm> | |
</AlarmConfig> | |
MESSAGE_BODY | |
%s(%d) param err | |
UserConfig | |
Account | |
Group | |
%s(%d) i=%d | |
%s(%d) xNodeSub[2]->data.text:%s | |
%s(%d) xNodeSub[3]->data.text:%s | |
%s(%d) xNodeSub[4]->data.text:%s | |
%s(%d) xNodeSub[5]->data.text:%s | |
user2 | |
Disable | |
user3 | |
user4 | |
user5 | |
user6 | |
user7 | |
user8 | |
user9 | |
user10 | |
%s(%d) user err | |
Msg_code="223" | |
Msg_flag="%d" | |
DDNSConfig | |
FreshInterval | |
SMTPList | |
ServerIP | |
ServerPort | |
Auth | |
FromEmail | |
SMTPConfig | |
ToEmail | |
CcEmail | |
Msg_code="422" | |
MediaStreamConfig | |
StreamAccess | |
WEBPort | |
Msg_code="620" | |
Encode | |
EncodeConfig | |
EncodeFormat | |
BitRateControl | |
Initquant | |
Msg_code="523" | |
Capture | |
Sharpness | |
BackLight | |
TVSystem | |
HFlip | |
VFlip | |
Msg_code="524" | |
JpegConfig | |
Quality | |
Framerate | |
Msg_code="526" | |
Area1PosX | |
Area1PosY | |
Area1Width | |
Area1Height | |
Msg_code="529" | |
VideoLostAlarm | |
Msg_code="824" | |
StorageFullAlarm | |
Msg_code="825" | |
MaintainConfig | |
Msg_code="228" | |
LANConfig | |
MacAddress | |
IPAddress | |
Netmask | |
DNS1 | |
DNS2 | |
%s(%d) GET NETCFG faile | |
%s(%d) SET NETCFG faile | |
Msg_code="325" | |
REQUEST_PARAM | |
%s(%d) Time:%s | |
%s(%d) GET SYSTIME faile | |
%s(%d) date-time:%d-%d-%d--%d:%d:%d | |
%s(%d) SET SYSTIME faile | |
Msg_code="1005" | |
<MESSAGE_BODY></MESSAGE_BODY> | |
Transparency | |
TimeOverlay | |
PosX | |
PosY | |
TitleOverlay | |
%s(%d) wWidth:%d | |
%s(%d) wHeight:%d | |
%s(%d) xNodeSub[6]->data.text:%s | |
yyyy/mm/dd hh:mm:ss | |
%s(%d) xNodeSub[10]->data.text:%s | |
Msg_code="525" | |
TimeConfig | |
TimeMode | |
%s(%d) TsZone--IPCZone:%d--%d | |
NTPConfig | |
RefreshInterval | |
Msg_code="222" | |
%0X:%0X:%0X:%0X:%0X:%0X | |
STATIC | |
Msg_code="1026" | |
<RESPONSE_PARAM> | |
<WIRE_NETWORK | |
IPType="%s" | |
Dns1="%s" | |
Dns2="%s" | |
<CLOUD | |
LoginStatus="1" | |
ID="1554267.seetong.com" | |
</RESPONSE_PARAM> | |
MotionDetectAlarm | |
EnableTimeList | |
Workday | |
TimeSpan | |
StartTime | |
EndTime | |
Msg_code="822" | |
tiltspeed | |
panspeed | |
zoomwide | |
zoomtele | |
FocusNearAutoOff | |
FocusFarAutoOff | |
IrisAutoOn | |
IrisAutoOff | |
IrisCloseAutoOff | |
IrisOpenAutoOff | |
setpreset | |
clearpreset | |
callpreset | |
BLCOff | |
BLCOn | |
MirrorOff | |
MirrorOn | |
ILLOff | |
ILLOn | |
AWBOn | |
AWBOff | |
%s(%d), dwCommand=%ld | |
%s(%d): DMS_NET_CMD_PTZ_CONTROL failure! | |
%s(%d): DMS_NET_SET_COLORCFG_SINGLE failure! | |
xNodeSub is NULL | |
%s %d, errno: %d, %s | |
%s(%d) Get pUserName faile | |
USER_AUTH_PARAM | |
%s(%d) UserInfo check err | |
Msg_type="USER_AUTH_MESSAGE" | |
Msg_code="CMD_USER_AUTH" | |
<USER_AUTH_RESPONSE | |
Sessionid="19700102040427_20e530e0825c8dc8" | |
UserInfo check ok | |
Sessionid="%04d%02d%02d%02d%02d%02d_20e5%x%x%x%x%x%x" | |
%s(%d) Get Password faile | |
%s(%d) Get Username faile | |
Msg_flag | |
%s(%d) Get Msg_code faile | |
Msg_code | |
Msg_type | |
%s(%d) Get Msg_type faile | |
TSSessionThread | |
TSSessionThread pid:%d tid:%d | |
XML_TOPSEE | |
MESSAGE_HEADER | |
"AUXPTZ_HEARTBEAT_MESSAGE" | |
MsgType-MsgCode:%s-%s | |
"USER_AUTH_MESSAGE" | |
"CMD_USER_AUTH" | |
"CMD_HEARTBEAT" | |
"SYSTEM_CONTROL_MESSAGE" | |
"1020" | |
"SYSTEM_CONFIG_GET_MESSAGE" | |
"203" | |
"SYSTEM_CONFIG_SET_MESSAGE" | |
"223" | |
"1030" | |
Msg_code="1030" | |
IPC_Type="101" | |
DefaultIP="192.168.0.123" | |
"1012" | |
"1019" | |
"205" | |
"227" | |
"206" | |
"228" | |
"204" | |
"224" | |
"202" | |
"222" | |
"1005" | |
"1026" | |
"300" | |
"325" | |
"1027" | |
"330" | |
"331" | |
"315" | |
"335" | |
"400" | |
"421" | |
"422" | |
"600" | |
"620" | |
"650" | |
"670" | |
"314" | |
"334" | |
"500" | |
"524" | |
"525" | |
"1031" | |
"501" | |
"523" | |
"526" | |
"529" | |
"800" | |
"700" | |
"822" | |
"824" | |
"825" | |
"PTZ_CONTROL_MESSAGE" | |
"PTZ_CMD" | |
"SYSTEM_SEARCHIPC_MESSAGE" | |
Msg_type="SYSTEM_SEARCHIPC_MESSAGE" | |
Msg_code="3" | |
<DEVICE_TYPE | |
DeviceType="NVS-HI3518" | |
<IPC_SERIALNUMBER | |
SerialNumber="4756%02d%02d%02d%02d%02d%02d" | |
MacAddress="%X:%X:%X:%X:%X:%X" | |
SerialNumber="4756736557496768" | |
MacAddress="00:18:A9:48:BB:9A" | |
IPAddress="192.168.1.100" | |
Netmask="255.255.255.0" | |
Gateway="192.168.1.1" | |
DNS1="8.8.8.8" | |
DNS2="4.4.4.4" | |
Username="admin" | |
Password="admin" | |
</UserConfig> | |
RTPOverRTSP="0" | |
</MediaStreamConfig> | |
TSSearch | |
TSSearch pid:%d tid:%d | |
TSSearch end! | |
%s %d, setsockopt SOL_SOCKET!err:%s(%d) | |
recvfrom error: %s(%d) | |
%s(%d) Get Msg_flag faile | |
TS_RecvWithHeader | |
TS_SendWithHeader | |
%s(%d) recv flag failed, ret=%d,errno:%d,fd:%d | |
recv_with_header() recv pack skip buffer size=%d | |
recv_with_header() recv len failed. ret =%d | |
recv_with_header() recv bad len=%d | |
recv_with_header() recv data error, ret=%d | |
TS_WaitForSock(%d) | |
%s(%d): send flag failed. ret=%d, errno=%d,fd=%d | |
send_with_header(): send len failed. ret=%d | |
send_with_header() send data error, ret=%d | |
<!--%s--> | |
<%s>%s</%s> | |
<%s>%s</%s> | |
</%s> | |
<%s> | |
<?xml version="1.0" encoding="%s"?> | |
%4d%02d%02d%02d%02d%02d | |
' | |
******** xTree struct, total node =%d, space node=%d ******** | |
nodenume fathernode nodelevle nodenume nodename nodedata | |
%d %d %d %d [%s] [%s] | |
***************************************************************** | |
<?xml version= | |
none xml head | |
none xml end | |
calloc node mem(%d) fail! | |
XML in not intact (%d) | |
none xml data | |
HikMainThread | |
HikStart | |
writen | |
fHikNetAlarmCallback | |
HikprocessClientRequest | |
HikSearchThread | |
127.0.0.1 | |
HikMainThread | |
[HikErr:%s-%s(%d)] dvrNetServer socket failed | |
./src/hik_net.c | |
[HikErr:%s-%s(%d)] | |
[HikErr:%s-%s(%d)] bind failed | |
[HikInfo:%s-%s(%d)] | |
[HikInfo:%s-%s(%d)] connfd=%d | |
[HikErr:%s-%s(%d)] listen failed | |
[HikErr:%s-%s(%d)] Accept() failed errno=%d. | |
[HikErr:%s-%s(%d)] ########################### goto flush_port ################################ | |
[HikErr:%s-%s(%d)] pthreadSpawn processClientRequest failed | |
[HikErr:%s-%s(%d)] erro:creat HikMainThread fail | |
[HikErr:%s-%s(%d)] erro:creat HikSearch fail | |
[HikErr:%s-%s(%d)] EINTR | |
[HikErr:%s-%s(%d)] Send() error, %d | |
[HikInfo:%s-%s(%d)] nChannel:%d AlarmType:%d, Action:%d | |
[HikInfo:%s-%s(%d)] Alarm: Type = %d | |
[HikErr:%s-%s(%d)] HiK alarm sockedfd is null. | |
[HikInfo:%s-%s(%d)] HiK upload alarm, nRet=%d | |
HikprocessClientRequest | |
[HikInfo:%s-%s(%d)] pid:%d tid:%d, connfd=%d | |
[HikErr:%s-%s(%d)] processClientRequest:readn() failed nread = %d, connfd = %d, errno=%d | |
[HikInfo:%s-%s(%d)] Command length = 0x%0x, connfd=%d | |
[HikErr:%s-%s(%d)] readn() length error: %d, %d | |
[HikInfo:%s-%s(%d)] netCmd: 0x%X, connfd=%d | |
[HikInfo:%s-%s(%d)] NETCMD_LOGIN. | |
[HikInfo:%s-%s(%d)] NETCMD_RELOGIN. | |
[HikInfo:%s-%s(%d)] NETCMD_LOGOUT. | |
[HikInfo:%s-%s(%d)] NETCMD_USEREXCHANGE, time = 0x%x. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_IPCORECFG_V31. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_IPALARMINCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_IPALARMINCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_IPALARMOUTCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_IPALARMOUTCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_ALARMCHAN. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_WORKSTATUS. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_WORKSTATUS_V30. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_DEVICECFG. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_DEVICECFG. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_DEVICECFG_V40. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_DEVICECFG_V40. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_ALARMINCFG_V30. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_ALARMINCFG_V30. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_ALARMOUTCFG_V30. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_ALARMOUTCFG_V30. | |
[HikInfo:%s-%s(%d)] DVR_PTZ. | |
[HikInfo:%s-%s(%d)] DVR_PTZWITHSPEED. | |
[HikInfo:%s-%s(%d)] NETCMD: NETCMD_SET_DEVICECAPACITY. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_COMPRESSCFG_V30. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_COMPRESSCFG_V30. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_NETCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_NETCFG. | |
[HikInfo:%s-%s(%d)] netClientGetPicCfgEx. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_PICCFG_EX. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_RTSPPORT. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_PICCFG 111111111111111111. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_PICCFG 2222222222222222222. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_VIDEOEFFECT | |
[HikInfo:%s-%s(%d)] NETCMD_SET_VIDEOEFFECT. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_COLORENHANCE. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_COLORENHANCE. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_ALARMINCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_ALARMINCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_NTPCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_NTPCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_DSTCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_DSTCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_SOFTRESTORE_CFG. | |
[HikInfo:%s-%s(%d)] NETCMD_REBOOT. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_NETWORKCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_NETWORKCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_FTPCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_FTPCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_GET_RTSPCFG. | |
[HikInfo:%s-%s(%d)] NETCMD_TCP_PREV. | |
[HikInfo:%s-%s(%d)] NETCMD_SET_TIMECFG. | |
[HikInfo:%s-%s(%d)] NETCMD_UNKNOWN_113305. | |
[HikInfo:%s-%s(%d)] ################# un support cmd: 0x%X | |
[HikErr:%s-%s(%d)] select failed. | |
[HikInfo:%s-%s(%d)] retVal=%d, netCmdHeader.netCmd=0x%X, connfd=%d tid=%d | |
[HikErr:%s-%s(%d)] Read %d byte. connfd=%d tid=%d | |
[HikErr:%s-%s(%d)] nread = %d | |
[HikErr:%s-%s(%d)] setsockopt() error, pid:%d tid:%d, connfd=%d, 0x%x | |
[HikInfo:%s-%s(%d)] HikprocessClientRequest exist tid=%d | |
HikSearchThread | |
[HikInfo:%s-%s(%d)] HikSearchThread start! | |
[HikInfo:%s-%s(%d)] recv len:%d | |
[HikInfo:%s-%s(%d)] start recv 1 | |
AAA1#### %s %d, %X:%X:%X:%X:%X:%X, %X:%X:%X:%X:%X:%X | |
AAA2#### %s %d, %X:%X:%X:%X:%X:%X, %X:%X:%X:%X:%X:%X | |
if_nametoindex() failed to obtain interface index | |
get_ip_addr: creat socket error | |
[HikInfo:%s-%s(%d)] ipaddr:%s | |
C001-JBNV%X | |
V%ld.%ld.%ld.%ld build %ld%ld%ld%ld%ld%ld | |
V4.0, build %ld%ld%ld%ld%ld%ld | |
%02d-%02d-%02d %02d:%02d:%02d | |
CS-C1-11WPFR | |
dst ip:%s | |
mask ip:%s | |
src gateway:%s | |
%u.%u.%u.1 | |
dst gateway:%s | |
HKvs-search modify ip failed. | |
HKvs-search modify ip success. | |
HKvs- save ip cfg failed. | |
HKvs-modify ip save cfg, and goto Fix_Ip_Respond. | |
HKvs-not local device. | |
getTimespec | |
pthreadGetPriorityScope | |
setPthreadAttr | |
pthreadCreate | |
pthreadSpawn | |
[HikInfo:%s-%s(%d)] getTimespec: clock_gettime call fail, error %d(%s) | |
./src/posixWrapper.c | |
[HikInfo:%s-%s(%d)] getTimespec: current time sec = %ld, time = %ld, nsec = %ld, total nsec = %lld | |
[HikInfo:%s-%s(%d)] getTimespec: after time sec = %ld, time = %ld, nsec = %ld | |
[HikInfo:%s-%s(%d)] priority: min = %d, max = %d | |
[HikInfo:%s-%s(%d)] The system does not support the %s scope, using %s | |
PTHREAD_SCOPE_SYSTEM | |
PTHREAD_SCOPE_PROCESS | |
[HikInfo:%s-%s(%d)] pthread create: tid = %d, priority = %d, stacksize = %d | |
[HikInfo:%s-%s(%d)] pthreadSpawn: arg[%d] = %d | |
netClientSetDeviceDatetime | |
netClientSetRtspCfg | |
netClientSetDstcfg | |
netClientSetNtpcfg | |
HikTZToAniTZ | |
netClientSetColorEnhance | |
netClientPTZControlWithSpeed | |
netClientGetDstcfg | |
netClientGetNtpcfg | |
netClientGetColorEnhance | |
Hik_CheckNtpServerType | |
netClientSetNetWorkCfg | |
netClientSetAlarmIncfg | |
netClientGetAlarmIncfg | |
netClientSetPicCfgEx | |
netClientGetPicCfgEx | |
netClientSetDeviceCfgV40 | |
netClientSetVideoEffect | |
netClientGetVideoEffect | |
netClientCmd11300b | |
netClientGetNetCfg | |
netClientGetCompressCfgV30 | |
netClientSetCompressCfgV30 | |
netClientGetDeviceCfg | |
netClientGetIpAlarmInCfg | |
netClientGetIpCoreCfgV31 | |
netClientGetDeviceCapacity | |
GetDevAbilityCmdType | |
netClientSetNetCfg | |
netClientSetDeviceCfg | |
netClientSetIpAlarmInCfg | |
netClientPTZControl | |
netClientPTZControl | |
netClientSetAlarmOutCfgV30 | |
netClientGetAlarmOutCfgV30 | |
netClientSetAlarmInCfgV30 | |
netClientGetAlarmInCfgV30 | |
getLoginRetval | |
netClientStartAlarmUpChannel | |
netClientUserExchange | |
unetClientReLogin | |
netClientLogin | |
[HikInfo:%s-%s(%d)] datetime:%d-%d-%d %d-%d-%d | |
./src/hik_netfuns.c | |
[HikInfo:%s-%s(%d)] HKvs-Protocol DMS_NET_CMD_GET_SYSTIME failed %d | |
[HikInfo:%s-%s(%d)] HKvs-Protocol DMS_NET_CMD_SET_SYSTIME failure %d | |
[HikInfo:%s-%s(%d)] wPort:%d | |
[HikInfo:%s-%s(%d)] nTimeZone:%d | |
[HikInfo:%s-%s(%d)] cTimeDifferenceH:%d,cTimeDifferenceM:%d | |
[HikInfo:%s-%s(%d)] timezone:%d | |
[HikInfo:%s-%s(%d)] st Mirror:0x%02X,spin:0x%02X | |
[HikInfo:%s-%s(%d)] channel:%d,command:%d,speed:%d | |
[HikInfo:%s-%s(%d)] TimeH=%d,TimeM=%d | |
[HikInfo:%s-%s(%d)] nMirror:%d | |
[HikErr:%s-%s(%d)] FTPIpAddress err | |
[HikInfo:%s-%s(%d)] strIPAddr:%08X | |
strIPMask:%08X | |
Enable:%d | |
[HikErr:%s-%s(%d)] check length err | |
[HikInfo:%s-%s(%d)] length:%d,AlarmType:%d,Enable:%d | |
[HikInfo:%s-%s(%d)] Check OK | |
[HikInfo:%s-%s(%d)] dwSize:%d,videoFormat:%d br:%d, contrast:%d stauration:%d hue:%d | |
[HikInfo:%s-%s(%d)] OSD Param: dwShowChanName:%d-%ld wShowNameTopLeftX:%d wShowNameTopLeftY:%d | |
dwShowDate:%d,wShowDateX:%d,wShowDateY:%d,byDateType:%d,byDispWeek:%d,byOSDAttrib:%d,byTimeFmt:%d | |
[HikInfo:%s-%s(%d)] VILOST Param: EnableVILostAlarm:%d,handleType:0x%08X | |
[HikInfo:%s-%s(%d)] Motion Param: motion area:-- stive:0x%02X enable:%d handleType:0x%08X AlarmOut:0x%08X | |
[HikInfo:%s-%s(%d)] HIDEALARM Param: EnableHideAlarm:%d,wHideAlarmAreaTopLeftX:%d,wHideAlarmAreaTopLeftY:%d | |
wHideAlarmAreaWidth:%d,wHideAlarmAreaHeight:%d,HandleType:0x%08X | |
[HikInfo:%s-%s(%d)] Hide Param: EnableHide:%d,X:%d,Y:%d,W:%d,H:%d | |
[HikInfo:%s-%s(%d)] Get OSD relevant param | |
[HikErr:%s-%s(%d)] Error length : %d, %d | |
[HikInfo:%s-%s(%d)] deviceID:%d,recycleRecord:%d | |
[HikInfo:%s-%s(%d)] HKvs Setup-nHue:%d nSaturation:%d nContrast:%d nBrightness:%d | |
[HikInfo:%s-%s(%d)] HKvs-Protocol get channel color param failed, result %d | |
[HikInfo:%s-%s(%d)] IPC-Color: nSaturation-%d,nContrast-%d,nBrightness-%d | |
[HikInfo:%s-%s(%d)] HKvs-Protocol set channel color param failed, result %d | |
[HikInfo:%s-%s(%d)] Get IPC color: nBrightness-%d,nContrast-%d,nSaturation-%d,nHue-%d | |
[HikInfo:%s-%s(%d)] HKvs-get nBrightness:%d,nContrast:%d,nSaturation:%d,nHue:%d | |
[HikInfo:%s-%s(%d)] header.retVal=0x%X, length=%d | |
[HikErr:%s-%s(%d)] netGetIpCompressCfgV30 failed! | |
[HikInfo:%s-%s(%d)] normHighCompPara: streamType:%d resolution:%d bitrateType:%d quality:%d, | |
maxBitRate:%08X maxBitRate:%d videoFrameRate:%08X intervalFrameI:%d videoEncType:%d audioEncType:%d | |
[HikInfo:%s-%s(%d)] netCompPara: streamType:%d resolution:%d bitrateType:%d quality:%d, | |
maxBitRate:%08X videoFrameRate:%08X intervalFrameI:%d videoEncType:%d audioEncType:%d | |
[HikErr:%s-%s(%d)] get channel pic info failed. ret:%d | |
[HikInfo:%s-%s(%d)] ipc: 1:frameRate:%ld resoloution:%ld bitRateType:%ld bitRate:%ld | |
[HikInfo:%s-%s(%d)] ipc: 2:frameRate:%ld resoloution:%ld bitRateType:%ld bitRate:%ld | |
[HikErr:%s-%s(%d)] set channel pic info failed. ret:%d | |
[HikInfo:%s-%s(%d)] netRetIpCfg.header.retVal=0x%X | |
<CAMERAPARA version="1.0"> | |
<PowerLineFrequencyMode> | |
<Range>0,1</Range> | |
</PowerLineFrequencyMode> | |
<WhiteBalance> | |
<WhiteBalanceMode> | |
<Range>0,1,3,6,14,15,16</Range> | |
</WhiteBalanceMode> | |
</WhiteBalance> | |
<Exposure> | |
<ExposureMode> | |
<Range>1</Range> | |
</ExposureMode> | |
<ExposureSet> | |
<Range>20,0,2,3,4,5,6,17,18,7,8,9,10,11,12,13,14</Range> | |
</ExposureSet> | |
<exposureUSERSET> | |
<Min>1</Min> | |
<Max>40000</Max> | |
</exposureUSERSET> | |
</Exposure> | |
<IrisMode> | |
</IrisMode> | |
<AutoApertureLevel> | |
<Min>0</Min> | |
<Max>100</Max> | |
<Default>50</Default> | |
</AutoApertureLevel> | |
<GainLevel> | |
<Default>100</Default> | |
</GainLevel> | |
<BrightnessLevel> | |
</BrightnessLevel> | |
<ContrastLevel> | |
</ContrastLevel> | |
<SharpnessLevel> | |
</SharpnessLevel> | |
<SaturationLevel> | |
</SaturationLevel> | |
<WDR> | |
<WDREnabled> | |
</WDREnabled> | |
<WDRLevel1> | |
<Max>15</Max> | |
</WDRLevel1> | |
</WDR> | |
<DayNightFilter> | |
<DayNightFilterType> | |
<Range>0,1,2,3,4</Range> | |
</DayNightFilterType> | |
<SwitchSchedule> | |
<SwitchScheduleEnabled> | |
</SwitchScheduleEnabled> | |
<DayToNightFilterLevel> | |
<Range>0,1,2,3,4,5,6,7</Range> | |
</DayToNightFilterLevel> | |
<NightToDayFilterLevel> | |
</NightToDayFilterLevel> | |
<DayNightFilterTime> | |
<Min>5</Min> | |
<Max>120</Max> | |
</DayNightFilterTime> | |
</SwitchSchedule> | |
</DayNightFilter> | |
<Backlight> | |
<BacklightMode> | |
<Range>0,1,2,3,4,5,6</Range> | |
</BacklightMode> | |
</Backlight> | |
<Mirror> | |
<Range>0,1,2,3</Range> | |
</Mirror> | |
<LOCALOUTPUT> | |
</LOCALOUTPUT> | |
<DigitalNoiseReduction> | |
<DigitalNoiseReductionEnable> | |
<Range>0,1,2</Range> | |
</DigitalNoiseReductionEnable> | |
<DigitalNoiseReductionLevel> | |
</DigitalNoiseReductionLevel> | |
<DigitalNoiseSpectralLevel> | |
</DigitalNoiseSpectralLevel> | |
<DigitalNoiseTemporalLevel> | |
</DigitalNoiseTemporalLevel> | |
</DigitalNoiseReduction> | |
<SceneMode> | |
</SceneMode> | |
<Dehaze> | |
<Range>0,2</Range> | |
</Dehaze> | |
<OnepushFocus>1</OnepushFocus> | |
</CAMERAPARA> | |
<CAMERAPARA version="2.0"> | |
<ChannelList> | |
<ChannelEntry> | |
<ChannelNumber>1</ChannelNumber> | |
<devType opt="ipc"/> | |
<CaptureMode> | |
<captureModeP opt="close,1920*1080@25fps,1920*1080@50fps"/> | |
<captureModeN opt="close,1920*1080@30fps,1920*1080@60fps"/> | |
<captureModePWithIndex opt="0-close,17-1920*1080@25fps,19-1920*1080@50fps"/> | |
<captureModeNWithIndex opt="0-close,18-1920*1080@30fps,20-1920*1080@60fps"/> | |
<CaptureModeIndex19> | |
<mutexAbility opt="WDR"/> | |
</CaptureModeIndex19> | |
<CaptureModeIndex20> | |
</CaptureModeIndex20> | |
</CaptureMode> | |
<Default>1</Default> | |
<WhiteBalanceModeRGain> | |
<Default>0</Default> | |
</WhiteBalanceModeRGain> | |
<WhiteBalanceModeBGain> | |
</WhiteBalanceModeBGain> | |
<ExposureSetIndex20> | |
</ExposureSetIndex20> | |
<ExposureSetIndex0> | |
</ExposureSetIndex0> | |
<ExposureSetIndex2> | |
</ExposureSetIndex2> | |
<ExposureSetIndex3> | |
</ExposureSetIndex3> | |
<Default>10</Default> | |
<mutexAbility opt="8-1280*720@60fps,7-1280*720@50fps,19-1920*1080@50fps,20-1920*1080@60fps,exposureIndex20,exposureIndex0,exposureIndex2,exposureI"/> | |
<Default>2</Default> | |
<Default>4</Default> | |
<Default>5</Default> | |
<TimeSchedule> | |
<BeginTime>1</BeginTime> | |
<EndTime>1</EndTime> | |
</TimeSchedule> | |
<AlarmInTrigType> | |
</AlarmInTrigType> | |
<DayNightFilterandGain> | |
<enabled>true</enabled> | |
</DayNightFilterandGain> | |
<DehazeEnable>0,2</DehazeEnable> | |
<SmartIR> | |
<modeType opt="automatic,manual"/> | |
<IRDistance min="1" max="100"/> | |
</SmartIR> | |
<LightInhibit> | |
<LightInhibitEnable opt="true,false"/> | |
</LightInhibit> | |
<GrayLevel> | |
</GrayLevel> | |
<FocusMode> | |
<FocusModeSet> | |
</FocusModeSet> | |
</FocusMode> | |
<CorridorMode> | |
<corridorModeFunEnable opt="true,false"/> | |
</CorridorMode> | |
<ISPAdvanceCfg> | |
<ISPSupportMode opt="dayMode,nightMode"/> | |
<workMode opt="auto,schedule"/> | |
<beginTime opt="hour,min,sec,millisec"/> | |
<endTime opt="hour,min,sec,millisec"/> | |
<ISPCfgSupport opt="whiteBalanceMode,whiteBalanceModeRGain,whiteBalanceModeBGain,exposureSet,exposureUserSet,gainLevel,brightnessLevel,contrastLevel,sharpnessLevel,WDREnabled,WDRLevel1,backlightMode,digitalNoiseReductionEnable,digitalNoiseReductionLevel,digitalNoiseSpectralLevel,digitalNoiseTemporalLevel,dehazeEnable,lightInhibitEnable,grayLevel"/> | |
</ISPAdvanceCfg> | |
</ChannelEntry> | |
</ChannelList> | |
<AlarmAbility version="2.0"> | |
<channelEntry> | |
<channelID>1</channelID> | |
</channelEntry> | |
</AlarmAbility> | |
<UserAbility version="2.0"> | |
<userNum>32</userNum> | |
<userNameLength min="1" max="32"/> | |
<userPasswordLength min="1" max="16"/> | |
<RemotePermission> | |
<permissionType type="admin" opt="preview,alarmOutOrUpload,record,playback,parameterConfig,logOrStateCheck,restartOrShutdown,upgrade,voiceTalk,PTZControl,contorlLocalOut,transParentChannel"/> | |
</RemotePermission> | |
<permissionType type="viewer" opt="preview,playback,logOrStateCheck"/> | |
<permissionType type="operator" opt="preview,alarmOutOrUpload,record,playback,parameterConfig,logOrStateCheck,restartOrShutdown,upgrade,voiceTalk,PTZControl,contorlLocalOut,transParentChannel"/> | |
<UserNet> | |
<IPV4Address>true</IPV4Address> | |
<IPV6Address>true</IPV6Address> | |
<MACAddress>true</MACAddress> | |
</UserNet> | |
<ViewerDefaultPermission> | |
<permissionType opt="preview"/> | |
</ViewerDefaultPermission> | |
<OperatorDefaultPermission> | |
<permissionType opt="preview,record,playback,logOrStateCheck,voiceTalk,PTZControl"/> | |
</OperatorDefaultPermission> | |
<PasswordManage> | |
<lockCount opt="0,3,5,10"/> | |
<lockTime opt="10,20,30"/> | |
<lockType opt="invalid,userName,IP"/> | |
<charNum opt="noLimit,limit"/> | |
<complexity opt="simple,complex"/> | |
</PasswordManage> | |
<UnlockUser> | |
<unLockType opt="userName,allUser,IP,allIP"/> | |
<ipVersion opt="ipV4,ipV6"/> | |
<ipAddress>true</ipAddress> | |
</UnlockUser> | |
</UserAbility> | |
<NetAppAbility version="2.0"> | |
<NTP> | |
<intervalUnit>hour</intervalUnit> | |
<serverTest>true</serverTest> | |
</NTP> | |
<Net> | |
<NetworkInterface> | |
<networkInterfaceNum>1</networkInterfaceNum> | |
<NetworkInterfaceEntry> | |
<id>1</id> | |
<type opt="10Mbase-T,10MBase-T-full,100MBase-TX,100M-full,10M/100M/1000M-adapt,1000M-full"/> | |
<MTU min="1280" max="1500"/> | |
</NetworkInterfaceEntry> | |
</NetworkInterface> | |
<multicastIpAddr opt="IPV4,IPV6"/> | |
<IPv6Address> | |
<IPv6List> | |
</IPv6List> | |
<IPv6Mode opt="routerAdvertisement,DHCP,manual"/> | |
</IPv6Address> | |
<DHCPandPPPoE> | |
</DHCPandPPPoE> | |
<IPTest>true</IPTest> | |
</Net> | |
<Email> | |
<receiverNum>3</receiverNum> | |
<emailTest>true</emailTest> | |
<emailTestWithParam>true</emailTestWithParam> | |
</Email> | |
<UPNP> | |
<NATType opt="manual,auto"/> | |
<friendNameLen min="1" max="64"/> | |
<serverPort> | |
</serverPort> | |
<HTTPPort> | |
</HTTPPort> | |
<RTSPPort> | |
</RTSPPort> | |
</UPNP> | |
<IPAddrFilter> | |
<IPAddrType opt="IPV4"/> | |
<filterType opt="forbid,permit"/> | |
</IPAddrFilter> | |
<FTP> | |
<AnonyFTP> | |
</AnonyFTP> | |
<dirLevel opt="rootDir,topDir,subDir"/> | |
<topDirMode opt="deviceName,deviceNO,deviceIP,custom"/> | |
<subDirMode opt="chanName,chanNO,custom"/> | |
</FTP> | |
<QoS> | |
<manageDscp> | |
<Max>63</Max> | |
</manageDscp> | |
<alarmDscp> | |
</alarmDscp> | |
<videoDscp> | |
</videoDscp> | |
<audioDscp > | |
</audioDscp > | |
<flagType opt="videoAudio"/> | |
</QoS> | |
<HTTPS> | |
<Certificate> | |
<certtype opt="CA,Certificate,privateKey"/> | |
<fileType opt="PEM,PFX"/> | |
<keyAlgorithm opt="RSA,DSA"/> | |
<keyLen opt="512,1024,2048"/> | |
<SignatureAlgorithm opt="MD5,RSA,DSA"/> | |
</Certificate> | |
</HTTPS> | |
<NAS> | |
</NAS> | |
<FuzzyUpgrade> | |
</FuzzyUpgrade> | |
<CMS> | |
<cmsNo min="1" max="1"/> | |
<ehomeNo min="1" max="1"/> | |
<CmsParam> | |
<serverIpv4>true</serverIpv4> | |
<serverIpv6>true</serverIpv6> | |
<serverPort min="1024" max="65535"/> | |
<serverProtocolType opt="private,EHome"/> | |
<deviceStatus opt="offline,online"/> | |
<deviceIdLength min="1" max="32"/> | |
<platformEhomeVersionLength attri="readonly" min="1" max="32"/> | |
<mutexAbility opt="gbt28181"/> | |
</CmsParam> | |
</CMS> | |
<NetCfg> | |
<Ethernet1> | |
<IPAddrType opt="IPV4,IPV6"/> | |
<IPAddrMaskType opt="IPV4,IPV6"/> | |
<netInterface opt="10MBase-T,10MBase-T_FullDuplex,100MBase-TX,100M_FullDuplex,Adaptive"/> | |
<mtu min="1280" max="1500"/> | |
<macAddrLen min="0" max="65535"/> | |
</Ethernet1> | |
<privateMulticastDiscovery opt="enable,disable"/> | |
<onvifMulticastDiscovery opt="enable,disable"/> | |
</NetCfg> | |
</NetAppAbility> | |
<VideoPicAbility version="2.0"> | |
<channelNO>1</channelNO> | |
<OSD> | |
<ChannelName> | |
</ChannelName> | |
<Week> | |
</Week> | |
<OSDType opt="xxxx-xx-xxYMD,xx-xx-xxxxMDY,xxxx/xx/xxY/M/D,xx/xx/xxxxM/D/Y,xx-xx-xxxxDMY,xx/xx/xxxxD/M/Y"/> | |
<OSDAttrib opt="1,2,3,4"/> | |
<OSDHourType opt="24Hour,12Hour"/> | |
<FontSize opt="16*16,32*32,48*48,64*64,adaptive"/> | |
<OSDColorType opt="0,1"/> | |
</OSD> | |
<MotionDetection> | |
<regionType opt="grid,area"/> | |
<Grid> | |
<VideoFormatP> | |
<rowGranularity>18</rowGranularity> | |
<columnGranularity>22</columnGranularity> | |
</VideoFormatP> | |
<VideoFormatN> | |
<rowGranularity>15</rowGranularity> | |
</VideoFormatN> | |
</Grid> | |
<Area> | |
<areaNo min="1" max="8"/> | |
<switchDayNightSet opt="off,autoSwitch,scheduleSwitch"/> | |
<Off> | |
<objectAreaProportion min="0" max="100"/> | |
<sensitivityLevel min="1" max="100"/> | |
</Off> | |
<AutoSwitch> | |
<supportType opt="day,night"/> | |
<dayObjectAreaProportion min="0" max="100"/> | |
<daySensitivityLevel min="1" max="100"/> | |
<nightObjectAreaProportion min="0" max="100"/> | |
<nightSensitivityLevel min="1" max="100"/> | |
</AutoSwitch> | |
<ScheduleSwitch> | |
</ScheduleSwitch> | |
</Area> | |
<sensitivityLevel min="0" max="100"/> | |
<NormalSensitivity> | |
<level min="0" max="5"/> | |
<step>20</step> | |
<offStatus>true</offStatus> | |
</NormalSensitivity> | |
<alarmTime>8</alarmTime> | |
<alarmHandleType opt="center,alarmout,picture,uploadftp"/> | |
<displayMotion opt="true,false"/> | |
</MotionDetection> | |
<HideDetection> | |
<HideAreaNum>1</HideAreaNum> | |
<HideArea> | |
<PAL> | |
<AreaX min="0" max="704"/> | |
<AreaY min="0" max="576"/> | |
</PAL> | |
<NTSC> | |
<AreaY min="0" max="480"/> | |
</NTSC> | |
</HideArea> | |
<sensitivity opt="none,low,middle,high"/> | |
<alarmHandleType opt="center,alarmout,picture"/> | |
</HideDetection> | |
<PrivacyMask> | |
<PrivacyMaskAreaNum>4</PrivacyMaskAreaNum> | |
<PrivacyMaskArea> | |
<id>2</id> | |
<id>3</id> | |
<id>4</id> | |
</PrivacyMaskArea> | |
</PrivacyMask> | |
<LogoOverlay> | |
<logoFormat opt="bmp"/> | |
<logoWidth min="4" max="128"/> | |
<logoHeight min="4" max="128"/> | |
</LogoOverlay> | |
</VideoPicAbility> | |
<JpegCaptureAbility version="2.0"> | |
<FindPicInfo> | |
<supportFileType opt="CMR,MOTION,ALARM,EDR,ALARMANDMOTION,manual,facedetection,LineDetection,FieldDetection,scenechangedetection,regionEntrance,regionExiting,loitering,group,rapidMove,parking,unattendedBaggage,attendedBaggage,allType"/> | |
<province opt="1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,0xff"/> | |
<StartTime> | |
<year min="1970" max="2038"/> | |
<month min="1" max="12"/> | |
<day min="1" max="30"/> | |
<hour min="1" max="24"/> | |
<minute min="1" max="60"/> | |
<second min="1" max="60"/> | |
</StartTime> | |
<StopTime> | |
</StopTime> | |
</FindPicInfo> | |
<ManualCapture> | |
<ResolutionEntry> | |
<resolutionName>HD1080P</resolutionName> | |
<index>9</index> | |
</ResolutionEntry> | |
</ManualCapture> | |
<SchedCapture> | |
<TimingCap> | |
<intervalUnit>ms</intervalUnit> | |
<interval min="500" max="604800000" opt="0"/> | |
<DayCapture> | |
<captureType>timing</captureType> | |
</DayCapture> | |
<TimeSlot> | |
<slotNum>8</slotNum> | |
</TimeSlot> | |
</TimingCap> | |
<EventCap> | |
<eventType opt="motion,faceDetect,lineDetection,fieldDetection,sceneChangeDetection,regionEntrance,regionExiting,loitering,group,rapidMove,parking,unattendedBaggage,attendedBaggage"/> | |
<interval min="500" max="65535" opt="0"/> | |
<capTimes min="1" max="120"/> | |
<eventCapChan opt="1"/> | |
<alarmInCapChan opt="1"/> | |
</EventCap> | |
</SchedCapture> | |
</JpegCaptureAbility> | |
<SerialAbility version="2.0"> | |
<RS232> | |
<RS232Num>1</RS232Num> | |
<RS232Entry> | |
<baudRate opt="2400,4800,9600,19200,38400,57600,76800,115.2k"/> | |
<dataBit opt="5,6,7,8"/> | |
<stopBit opt="1,2"/> | |
<parity opt="none,odd,even"/> | |
<flowcontrol opt="none,soft"/> | |
<workMode opt="transparentChan,console"/> | |
</RS232Entry> | |
</RS232> | |
</SerialAbility> | |
<EventAbility version="2.0"> | |
<ExceptionAlarm> | |
<exceptionType opt="diskFull,diskError,nicBroken,ipConflict,illAccess"/> | |
<DetailedExceptionAlarm> | |
<DiskFull> | |
</DiskFull> | |
<DiskError> | |
</DiskError> | |
<NicBroken> | |
<alarmHandleType opt="alarmout"/> | |
</NicBroken> | |
<IPConflict> | |
</IPConflict> | |
<IllAccess> | |
</IllAccess> | |
</DetailedExceptionAlarm> | |
</ExceptionAlarm> | |
<AlarmIn> | |
<notSupportPTZLinkage>true</notSupportPTZLinkage> | |
</AlarmIn> | |
<AlarmOut> | |
<pulseDuration opt="5,10,30,60,120,300,600,manual"/> | |
</AlarmOut> | |
<FaceDetection> | |
<detectFaceEnable opt="true,false"/> | |
<detectFaceSensitive min="1" max="5"/> | |
<alarmHandleType opt="center,picture,alarmout,uploadftp"/> | |
<triggerRecord>true</triggerRecord> | |
</FaceDetection> | |
<VoiceDetection> | |
<enable opt="true,false"/> | |
<Abnormal> | |
<audioMode opt="all"/> | |
<enable opt="true,false"/> | |
<threshold min="1" max="100"/> | |
</Abnormal> | |
<audioSteepDrop> | |
</audioSteepDrop> | |
</VoiceDetection> | |
<TraversingVirtualPlane> | |
<enableDualVca opt="true,false"/> | |
<alertlineNum>4</alertlineNum> | |
<AlertLine> | |
<crossDirection opt="bothway,leftToRight,rightToLeft"/> | |
</AlertLine> | |
</TraversingVirtualPlane> | |
<FieldDetection> | |
<intrusiongionNum>4</intrusiongionNum> | |
<Intrusiongion> | |
<regionNum min="4" max="4"/> | |
<duration min="0" max="10"/> | |
<sensitivityLevel min="1" max="100"/> | |
<rate min="1" max="100"/> | |
</Intrusiongion> | |
</FieldDetection> | |
<DefousDetection> | |
</DefousDetection> | |
<SceneChangeDetection> | |
<sensitiveLevel min="1" max="100"/> | |
<sceneChangeDetectionRecord>true</sceneChangeDetectionRecord> | |
</SceneChangeDetection> | |
</EventAbility> | |
<GBT28181AccessAbility version="2.0"> | |
<GBT28181AccessCfg> | |
<localSipPort min="1024" max="65535"/> | |
<serverIDLen min="1" max="64"/> | |
<serverDomainLen min="1" max="128"/> | |
<serverSipAddressLen min="1" max="128"/> | |
<serverSipPort min="1024" max="65535"/> | |
<sipUserNameLen min="1" max="64"/> | |
<sipAuthenticateIDLen min="1" max="64"/> | |
<SipAuthenticatePasswdLen min="1" max="32"/> | |
<registerValid min="3600" max="100000"/> | |
<heartbeatInterval min="5" max="255"/> | |
<maxHeartbeatTimeOut min="3" max="255"/> | |
<streamType opt="mainstream,substream,stream3"/> | |
<cameraNoCompressionIDLen min="13" max="64"/> | |
<alarmInputCompressionIDLen min="13" max="64"/> | |
<mutexAbility opt="ehome"/> | |
<deviceStatus attri="readonly" opt="offline,online"/> | |
</GBT28181AccessCfg> | |
</GBT28181AccessAbility> | |
<PTZAbility version="2.0"> | |
<PTZControl> | |
<controlType opt="light,wiper,fan,heater,aux1,aux2,zoomIn,zoomOut,focusNear,focusFar,irisOpen,irisClose,ttiltUp,tiltDown,panLeft,panRight,upLeft,upRight,downLeft,downRight,panAuto,panCircle"/> | |
</PTZControl> | |
<Patrol> | |
<patrolNum min="1" max="8"/> | |
<presetNum min="1" max="32"/> | |
<dwellTime min="0" max="120"/> | |
<speed min="1" max="40"/> | |
</Patrol> | |
<Preset> | |
<presetNum min="1" max="256"/> | |
</Preset> | |
</PTZAbility> | |
<RecordAbility version="2.0"> | |
<RecordScheduleNum>8</RecordScheduleNum> | |
<faceDetectionRecord>true</faceDetectionRecord> | |
<allAlarmTypeRecord>true</allAlarmTypeRecord> | |
<ANR>true</ANR> | |
</RecordAbility> | |
<ROIAbility version="2.0"> | |
<ROIRectCfg> | |
<MainStream> | |
<FixROIRectCfg> | |
<ROISupportEncodeType opt="standardh264"/> | |
<singleScreenFixROITotalNum>3</singleScreenFixROITotalNum> | |
<singleScreenFixROIID min="1" max="3"/> | |
<fixROINameLength min="1" max="32"/> | |
<fixROIDetectEnable opt="true,false"/> | |
<ROIImageQualityLevel min="1" max="6"/> | |
</FixROIRectCfg> | |
<TrackROIRectCfg> | |
<singleScreenTrackROITotalNum>1</singleScreenTrackROITotalNum> | |
<singleScreenTrackROIID min="1" max="1"/> | |
<trackROIDetectEnable opt="true,false"/> | |
<trackROIModeType opt="faceDetect"/> | |
</TrackROIRectCfg> | |
</MainStream> | |
<SubStream> | |
<singleScreenFixROIID min="1" max="2"/> | |
</SubStream> | |
<Stream3> | |
</Stream3> | |
</ROIRectCfg> | |
</ROIAbility> | |
<SecurityAbility version="2.0"> | |
<SecurityCfgParam> | |
<securityLevel opt="0-close,1-open,2-custom"/> | |
<commadCheckLevel opt="0-close,1-open"/> | |
<loginLevel opt="0-nolimit,1-MD5"/> | |
<sshServer opt="0-enable,1-disable"/> | |
<webAuthentication opt="0-digest,1-basic"/> | |
<rtspAuthentication opt="0-disable,1-basic"/> | |
<telnetServer opt="0-disable,1-enable"/> | |
</SecurityCfgParam> | |
</SecurityAbility> | |
[HikInfo:%s-%s(%d)] ClientVer:%X,Cmd:%x,CmdType:%s,CmdLen:%d | |
<BasicCapability version="2.0"> | |
<HardwareCapability> | |
<HardwareVersion>0x0</HardwareVersion> | |
<AlarmInPortNum>1</AlarmInPortNum> | |
<AlarmOutPortNum>1</AlarmOutPortNum> | |
<RS485Num>0</RS485Num> | |
<NetworkPortNum>1</NetworkPortNum> | |
<USBNum>0</USBNum> | |
<FlashSize>128</FlashSize> | |
<RamSize>1024</RamSize> | |
<USBVersion>0</USBVersion> | |
<SDNum>1</SDNum> | |
<HardDiskNum>0</HardDiskNum> | |
<SATANum>0</SATANum> | |
<eSATANum>0</eSATANum> | |
<miniSASNum>0</miniSASNum> | |
<VideoInNum>0</VideoInNum> | |
<AudioInNum>1</AudioInNum> | |
<VideoOutNum>1</VideoOutNum> | |
<AudioOutNum>1</AudioOutNum> | |
<AudioTalkNum>1</AudioTalkNum> | |
<SDSupport>1</SDSupport> | |
<POESupport>1</POESupport> | |
<IRSupport>1</IRSupport> | |
<VideoOutSupport>1</VideoOutSupport> | |
<ResetSupport>1</ResetSupport> | |
<CompleteRestoreSupport>1</CompleteRestoreSupport> | |
<AnalogChannelNum>1</AnalogChannelNum> | |
<CVBSNumber>1</CVBSNumber> | |
</HardwareCapability> | |
<SoftwareCapability> | |
<NewHdNo>1</NewHdNo> | |
<MaxNetworkHDNum>8</MaxNetworkHDNum> | |
<NasSupport>1</NasSupport> | |
<NasNumber>8</NasNumber> | |
<NetDiskIdentification> | |
<NASIdentification> | |
<NFSMountType>true</NFSMountType> | |
<CIFSMountType> | |
<usernameLen min="1" max="32"/> | |
<passwordLen min="1" max="16"/> | |
</CIFSMountType> | |
</NASIdentification> | |
</NetDiskIdentification> | |
<ShowStringNumber>4</ShowStringNumber> | |
<MotionDetectAlarmSupport>1</MotionDetectAlarmSupport> | |
<HideAlarmSupport>1</HideAlarmSupport> | |
<ShelterSupport>1</ShelterSupport> | |
<RtspSupport>1</RtspSupport> | |
<RtpoverRtspSupport>1</RtpoverRtspSupport> | |
<RtspoverHttpSupport>1</RtspoverHttpSupport> | |
<overHttpSupport>1</overHttpSupport> | |
<NtpSupport>1</NtpSupport> | |
<PtzSupport>1</PtzSupport> | |
<DDNSSupport>1</DDNSSupport> | |
<DDNSHostType>0,1,3,4</DDNSHostType> | |
<SNMPSupport>1</SNMPSupport> | |
<SNMPVersion>1,2,3</SNMPVersion> | |
<UPNPSupport>1</UPNPSupport> | |
<Ipv6Support>1</Ipv6Support> | |
<MultipleStreamSupport>1</MultipleStreamSupport> | |
<SubStreamSupport>1</SubStreamSupport> | |
<EmailSupport>1</EmailSupport> | |
<SADPVersion>0,1</SADPVersion> | |
<MaxLoginNum>128</MaxLoginNum> | |
<MaxPreviewNum>20</MaxPreviewNum> | |
<MaxPlayBackNum>2</MaxPlayBackNum> | |
<MaxChanLinkNum>24</MaxChanLinkNum> | |
<RS232Config>1</RS232Config> | |
<PPPoEConfig>1</PPPoEConfig> | |
<UploadFTP>1</UploadFTP> | |
<QuotaRatio>1</QuotaRatio> | |
<DevModuleServerCfg> | |
<irLampServer opt="disable,enable"/> | |
</DevModuleServerCfg> | |
<GBT28181AccessAbilitySupport>1</GBT28181AccessAbilitySupport> | |
<CameraParaDynamicAbilitySupport>1</CameraParaDynamicAbilitySupport> | |
<Language> | |
<supportType opt="1-chinese"/> | |
</Language> | |
<NeedReboot> | |
<ImportConfigurationFileReboot>2</ImportConfigurationFileReboot> | |
<RestoreConfig>2</RestoreConfig> | |
<RS232workModeChange>1</RS232workModeChange> | |
<NetPortChange>1</NetPortChange> | |
<DhcpEnableChange>1</DhcpEnableChange> | |
<HttpPortChange>1</HttpPortChange> | |
<PPPoEChange>1</PPPoEChange> | |
<StandardTypeChange>1</StandardTypeChange> | |
<LineCodingEnableChange>1</LineCodingEnableChange> | |
<NetworkCardTypeChange>0</NetworkCardTypeChange> | |
<CompleteRestoreReboot>1</CompleteRestoreReboot> | |
</NeedReboot> | |
</SoftwareCapability> | |
</BasicCapability> | |
<AudioVideoCompressInfo version="2.0"> | |
<AudioCompressInfo> | |
<MainAudioEncodeType> | |
<Range>1,2,6</Range> | |
</MainAudioEncodeType> | |
<SubAudioEncodeType> | |
</SubAudioEncodeType> | |
<AudioInType> | |
<Range>0</Range> | |
</AudioInType> | |
<AudioInVolume> | |
</AudioInVolume> | |
<VoiceTalk> | |
<VoiceTalkEncodeType> | |
</VoiceTalkEncodeType> | |
<VoiceTalkInType> | |
</VoiceTalkInType> | |
</VoiceTalk> | |
</AudioCompressInfo> | |
<VideoCompressInfo> | |
<MainChannel> | |
<VideoEncodeType> | |
<Range>1,2</Range> | |
</VideoEncodeType> | |
<VideoEncodeEfficiency> | |
</VideoEncodeEfficiency> | |
<VideoResolutionList> | |
i=%d,nWidth=%d,nHeight=%d | |
<VideoResolutionEntry> | |
<Index>27</Index> | |
<Name>HD1080P</Name> | |
<Resolution>1920*1080</Resolution> | |
<VideoFrameRate>0,1,2,3,4,5,6,7,8,9,10,11,14,12,15,13,16,17,22</VideoFrameRate> | |
<VideoBitrate> | |
<Min>32</Min> | |
<Max>16384</Max> | |
</VideoBitrate> | |
</VideoResolutionEntry> | |
<Index>20</Index> | |
<Name>XVGA</Name> | |
<Resolution>1280*960</Resolution> | |
<Index>19</Index> | |
<Name>720P</Name> | |
<Resolution>1280*720</Resolution> | |
<Index>18</Index> | |
<Name>SVGA</Name> | |
<Resolution>800*600</Resolution> | |
<Index>3</Index> | |
<Name>4CIF</Name> | |
<Resolution>704*576</Resolution> | |
<Index>16</Index> | |
<Name>VGA</Name> | |
<Resolution>640*480</Resolution> | |
</VideoResolutionList> | |
<IntervalBPFrame> | |
<Range>2</Range> | |
</IntervalBPFrame> | |
<EFrame>0</EFrame> | |
</MainChannel> | |
<SubChannelList> | |
<SubChannelEntry> | |
<index>1</index> | |
<Range>1,2,7</Range> | |
<Max>8192</Max> | |
<Index>86</Index> | |
<Name>360P</Name> | |
<Resolution>640*360</Resolution> | |
<Index>1</Index> | |
<Name>CIF</Name> | |
<Resolution>352*288</Resolution> | |
<Index>6</Index> | |
<Name>QVGA</Name> | |
<Resolution>320*240</Resolution> | |
</SubChannelEntry> | |
</SubChannelList> | |
</VideoCompressInfo> | |
</AudioVideoCompressInfo> | |
[HikErr:%s-%s(%d)] CmdType err | |
[HikInfo:%s-%s(%d)] AbilityType:%s | |
EventAbility | |
GBT28181AccessAbility | |
HardDiskAbility | |
<HardDiskAbility version="2.0"> | |
<hdAttribute opt="2"/> | |
</HardDiskAbility> | |
PTZAbility | |
RecordAbility | |
ROIAbility | |
SecurityAbility | |
[HikErr:%s-%s(%d)] Invalid mediaType(1--5): %d | |
[HikErr:%s-%s(%d)] Invalid portNo and httpPortNo. | |
[HikErr:%s-%s(%d)] get network cfg failed. | |
[HikErr:%s-%s(%d)] get pppoe cfg failed. | |
[HikErr:%s-%s(%d)] fix ip addr:%s result:%d tmp:%s ret:%d | |
[HikInfo:%s-%s(%d)] Error length : %d, %d | |
[HikInfo:%s-%s(%d)] PTZ control: cmd=%d, cruNum=%d, ListNum=%d, position=%d | |
dell pos | |
dell cru | |
add pos to cru | |
set cru time | |
set cru speed | |
start cru | |
stop cru | |
%s(%d) stop!!! | |
stPtzControl.byRes:%s | |
[HikErr:%s-%s(%d)] Invalid alarmOut channel %d | |
[HikInfo:%s-%s(%d)] netRetAlarmOutCfg.header.retVal=0x%X | |
[HikErr:%s-%s(%d)] Invalid alarmIn num %d | |
[HikErr:%s-%s(%d)] Invalid alarmIn channel %d | |
[HikInfo:%s-%s(%d)] IPC alarmInNum is %d | |
[HikInfo:%s-%s(%d)] netRetAlarmInCfg.header.retVal=0x%X | |
[HikInfo:%s-%s(%d)] netClientStartAlarmUpChannel. | |
[HikInfo:%s-%s(%d)] ....................alarm start. | |
[HikInfo:%s-%s(%d)] netClientStartAlarmUpChannel....................alarm stop. | |
[HikInfo:%s-%s(%d)] netCmdHeader.userID=%d | |
[HikErr:%s-%s(%d)] Invalid ifVer 0x%x | |
[HikInfo:%s-%s(%d)] netClientLogin: sdkVersion = 0x%x | |
[HikInfo:%s-%s(%d)] username:%s, password:%s | |
[HikErr:%s-%s(%d)] userLogin failed: retval = 0x%x | |
[HikInfo:%s-%s(%d)] loginRet.retVal=0x%X | |
[HikErr:%s-%s(%d)] DS9000 login failed, retVal=0x%X | |
[HikInfo:%s-%s(%d)] loginRet.retVal=0x%X, connfd=%d | |
genRandom | |
handleLegalAccess | |
challenge_login | |
genChallenge | |
verifyUser | |
verifyChallengePassword | |
verifyUserPasswd | |
[HikInfo:%s-%s(%d)] Cannot read random data, errno=%d | |
./src/hik_netlogin.c | |
[HikInfo:%s-%s(%d)] max users | |
[HikInfo:%s-%s(%d)] i=%d, userID=%d | |
[HikInfo:%s-%s(%d)] sdkVersion=0x%X | |
[HikInfo:%s-%s(%d)] userID=0x%X | |
[HikInfo:%s-%s(%d)] 0x%X, 0x%X, 0x%08X, connfd=%d | |
[HikInfo:%s-%s(%d)] random number: %u | |
[HikInfo:%s-%s(%d)] Original challenge string: %s | |
[HikInfo:%s-%s(%d)] Base64 challenge string: [%s] len:%d | |
[HikInfo:%s-%s(%d)] CMS Login | |
[HikInfo:%s-%s(%d)] NVR Login | |
[HikInfo:%s-%s(%d)] login_cha.retVal=0x%X, len=%d | |
[HikErr:%s-%s(%d)] send challenge to client failed | |
[HikInfo:%s-%s(%d)] send challenge success, waitting to recv response, connfd=%d | |
[HikErr:%s-%s(%d)] Waitting for client challenge password failed, ret=%d, errno=%d, connfd=%d | |
[HikInfo:%s-%s(%d)] len=%d, ifVer=%d, cmd=%d, ver=%d, ip=0x%X, mac:%X:%X:%X:%X:%X:%X | |
[HikInfo:%s-%s(%d)] usr:%s, tmp:%s, username:%s, challenge:%s | |
[HikInfo:%s-%s(%d)] Match user: %s | |
[HikInfo:%s-%s(%d)] original password: %s | |
[HikInfo:%s-%s(%d)] username:%s | |
[HikInfo:%s-%s(%d)] Correct user password, challenge success | |
[HikInfo:%s-%s(%d)] No user matched, challenge failed | |
[HikErr:%s-%s(%d)] Too many users logined. | |
[HikErr:%s-%s(%d)] ret=%d, errno=%d, %s, connfd=%d | |
[HikErr:%s-%s(%d)] timeout | |
[HikInfo:%s-%s(%d)] username/passwd verify passed. | |
[HikErr:%s-%s(%d)] username/passwd :%s/%s | |
[HikErr:%s-%s(%d)] verify fail. | |
getUserIdx | |
checkUserIdValid | |
userKeepAlive | |
userLogout | |
verifyUserID | |
getUserSDKVersion | |
userLogin | |
[HikInfo:%s-%s(%d)] getUserIdx is %d | |
./src/hik_security.c | |
[HikErr:%s-%s(%d)] not find user | |
[HikInfo:%s-%s(%d)] =====userID is %d======= | |
[HikInfo:%s-%s(%d)] userID:%d---%d | |
[HikInfo:%s-%s(%d)] checkUserIdValid is OK | |
[HikErr:%s-%s(%d)] checkUserIdValid is ERROR | |
[HikErr:%s-%s(%d)] Invalid userID %d | |
[HikInfo:%s-%s(%d)] #### | |
[HikInfo:%s-%s(%d)] User logout retVal =%d : userID = %d. | |
[HikInfo:%s-%s(%d)] userLogin. | |
[HikInfo:%s-%s(%d)] Empty user!!! | |
[HikInfo:%s-%s(%d)] Too many users logined. | |
[HikInfo:%s-%s(%d)] User login OK: userID = %d, username = %s | |
sendNetRetval | |
[HikInfo:%s-%s(%d)] netRetHeader.retVal=0x%X | |
./src/hik_netutil.c | |
ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/ | |
80( | |
91)! | |
:2*" | |
;3+#>6.& | |
=5-% | |
<4,$ | |
'2, /+0&7!4-)1# | |
0123456789abcdefZhiNuo_Unkown_Cmd_GetCfgInfo | |
ZhiNuo_Unkown_Cmd | |
======= Entry lib_zhinuo_start(%s %s) | |
11:29:46 | |
{ "id" : %s, "params" : { "method" : | |
[ "system.getAPIVersion", "system.listMethod", "system.listService", | |
"system.multicall", "RecordFinder.doFind", "RecordFinder.factory.create", | |
"RecordFinder.startFind", "RecordFinder.stopFind", "RecordUpdater.clear", | |
"RecordUpdater.factory.instance", "RecordUpdater.get", "RecordUpdater.import", | |
"RecordUpdater.insert", "RecordUpdater.remove", "RecordUpdater.update", | |
"alarm.factory.instance", "alarm.getAlarmCaps", "alarm.getExAlarmCaps", | |
"alarm.getInSlots", "alarm.getInState", "alarm.getOutSlots", "alarm.getOutState", | |
"alarm.start", "alarm.stop", "capsManager.factory.instance", "capsManager.get", | |
"commPort.getProtocolList", "configManager.deleteConfig", "configManager.destroy", | |
"configManager.factory.instance", "configManager.getConfig", | |
"configManager.getDefault", "configManager.getMemberNames", "configManager.restore", | |
"configManager.restoreExcept", "configManager.restoreTemporaryConfig", | |
"configManager.setConfig", "configManager.setTemporaryConfig", "ddnsClient.getStatus", | |
"devAudioEncode.getFormatCaps", "devAudioEncode.getState", | |
"devAudioEncode.getTemporaryFormat", "devAudioEncode.getTypes", | |
"devAudioEncode.restorePresetFormat", "devAudioEncode.setTemporaryFormat", | |
"devAudioEncode.start", "devAudioEncode.stop", "devAudioInput.factory.getCollect", | |
"devComm.factory.getCollect", "devComm.factory.instance", "devComm.getCaps", | |
"devStorage.addPartition", "devStorage.deletePartition", "devStorage.eject", | |
"devStorage.formatPatition", "devStorage.getDeviceInfo", "devStorage.load", | |
"devStorage.releaseDevice", "devStorage.standby", "devVideoDetect.getCaps", | |
"devVideoEncode.getBitrate", "devVideoEncode.getBufferLength", | |
"devVideoEncode.getChipId", "devVideoEncode.getChipsLadenBitrate", | |
"devVideoEncode.getCompressionTypes", "devVideoEncode.getCoverCount", | |
"devVideoEncode.getMaxSnapFps", "devVideoEncode.getState", | |
"devVideoEncode.getTempFmt", "devVideoEncode.getTemporaryFormat", | |
"devVideoEncode.getTitle", "devVideoEncode.getTitleCount", "devVideoEncode.isAlive", | |
"devVideoEncode.restorePresetFormat", "devVideoEncode.setBufferLength", | |
"devVideoEncode.setIFrame", "devVideoEncode.setTempFmt", | |
"devVideoEncode.setTemporaryFormat", "devVideoEncode.start", "devVideoEncode.stop", | |
"devVideoInput.adjustFocus", "devVideoInput.adjustFocusContinuously", | |
"devVideoInput.adjustIris", "devVideoInput.autoFocus", "devVideoInput.enableAutoIris", | |
"devVideoInput.factory.getCollect", "devVideoInput.factory.instance", | |
"devVideoInput.generateStrobe", "devVideoInput.getCaps", "devVideoInput.getChannels", | |
"devVideoInput.getCoverCount", "devVideoInput.getCoverType", | |
"devVideoInput.getCurrentWindow", "devVideoInput.getFocusStatus", | |
"devVideoInput.getMaxFrameRate", "devVideoInput.getMaxSize", | |
"devVideoInput.getTempVideoInOptions", "devVideoInput.getTitleCount", | |
"devVideoInput.getVideoInStatus", "devVideoInput.instance", "devVideoInput.ptz", | |
"devVideoInput.restoreVideoInOptions", "devVideoInput.setBackgroundColor", | |
"devVideoInput.setColor", "devVideoInput.setCover", "devVideoInput.setCurrentWindow", | |
"devVideoInput.setSensorType", "devVideoInput.setTempVideoInOptions", | |
"devVideoOut.enumModes", "devVideoOutput.factory.getCollect", | |
"deviceDiscovery.attach", "deviceDiscovery.destroy", "deviceDiscovery.detach", | |
"deviceDiscovery.factory.instance", "deviceDiscovery.ipScan", | |
"deviceDiscovery.refresh", "deviceDiscovery.setConfig", "deviceDiscovery.start", | |
"deviceDiscovery.stop", "encode.getConfigCaps", "eventManager.attach", | |
"eventManager.detach", "eventManager.factory.instance", "eventManager.getEventData", | |
"eventManager.getEventIndexes", "eventManager.getEventMask", "eventManager.notify", | |
"faceBoard.factory.instance", "faceBoard.getDevTemperature", "faceBoard.hasLoopBoard", | |
"faceBoard.hasMatrixBoard", "global.getCurrentTime", "global.keepAlive", | |
"global.login", "global.logout", "global.setCurrentTime", "log.clear", "log.doFind", | |
"log.factory.instance", "log.getSummary", "log.startFind", "log.stopFind", | |
"magicBox.destroy", "magicBox.factory.instance", "magicBox.getCPUCount", | |
"magicBox.getCPUUsage", "magicBox.getDeviceClass", "magicBox.getDeviceType", | |
"magicBox.getExitState", "magicBox.getExitTime", "magicBox.getFreeMemory", | |
"magicBox.getHardwareVersion", "magicBox.getLocalNo", "magicBox.getMachineName", | |
"magicBox.getMemoryInfo", "magicBox.getProcessInfo", "magicBox.getProductDefinition", | |
"magicBox.getSerialNo", "magicBox.getSubModules", "magicBox.getSystemInfo", | |
"magicBox.getTotalMemory", "magicBox.isAppAutoStart", "magicBox.reboot", | |
"media.getAudioEncodeDevice", "media.getAudioInputDeviceChannels", | |
"media.getAudioOutputDevice", "media.getAudioOutputDeviceChannels", "media.getSplit", | |
"media.getVideoDetectDevice", "media.getVideoEncodeDevice", | |
"media.getVideoInputDevice", "media.getVideoInputDeviceChannels", | |
"media.getVideoOutputDevice", "media.getVideoOutputDeviceChannels", | |
"mediaFile.IsOpened", "mediaFile.WriteEncodeSpec", "mediaFile.close", | |
"mediaFile.close1", "mediaFile.create", "mediaFile.flush", "mediaFile.getCurrentTime", | |
"mediaFile.getFilePath", "mediaFile.getInfo", "mediaFile.getLength", | |
"mediaFile.getPosition", "mediaFile.insertIndex", "mediaFile.open", "mediaFile.read", | |
"mediaFile.readEncodeSpec", "mediaFile.readIndex", "mediaFile.readSummary", | |
"mediaFile.seek", "mediaFile.seekByTime", "mediaFile.seekData", "mediaFile.write", | |
"mediaFile.writeIndex", "mediaFile.writeSummary", "mediaFileFind.close", | |
"mediaFileFind.findFile", "mediaFileFind.findNextFiles", "netApp.connectByWps", | |
"netApp.getDialInfo", "netApp.getMobileRSSI", "netApp.getNetInterfaces", | |
"netApp.getRemoteDeviceStatus", "netApp.getSocketAddress", "netApp.getUPnPStatus", | |
"netApp.refreshUpnpRouter", "netApp.scanWLanDevices", "netApp.sendTestMail", | |
"ptz.addTourPoint", "ptz.adjustIris", "ptz.autoTour", "ptz.auxControl", | |
"ptz.continueMoveDirectly", "ptz.destroy", "ptz.enableLimit", "ptz.factory.instance", | |
"ptz.focusManually", "ptz.getCurrentProtocolCaps", "ptz.getPatterns", | |
"ptz.getPresets", "ptz.getProtocolList", "ptz.getStatus", "ptz.getTours", | |
"ptz.gotoHomePosition", "ptz.gotoLimit", "ptz.gotoPreset", "ptz.isMoving", | |
"ptz.markLimit", "ptz.menuControl", "ptz.moveAbsolutely", "ptz.moveContinuously", | |
"ptz.moveDirectly", "ptz.moveRelatively", "ptz.removePattern", "ptz.removePreset", | |
"ptz.removeTour", "ptz.removeTourPoint", "ptz.reset", "ptz.restartCamera", | |
"ptz.restartPtz", "ptz.setFocusMode", "ptz.setFocusPoint", "ptz.setHomePosition", | |
"ptz.setIrisMode", "ptz.setIrisValue", "ptz.setPreset", "ptz.setScanLimit", | |
"ptz.setTour", "ptz.start", "ptz.startPatternRecord", "ptz.startPatternReplay", | |
"ptz.startScan", "ptz.startTour", "ptz.stop", "ptz.stopMove", "ptz.stopPatternRecord", | |
"ptz.stopPatternReplay", "ptz.stopScan", "ptz.stopTour", "rainBrush.moveContinuously", | |
"rainBrush.moveOnce", "rainBrush.start", "rainBrush.stop", "rainBrush.stopMove", | |
"recordManager.attachFileProc", "recordManager.detachFileProc", | |
"recordManager.getState", "recordManager.getStateAll", "recordManager.start", | |
"recordManager.startChannel", "recordManager.stop", "recordManager.stopChannel", | |
"snapManager.attachFileProc", "snapManager.detachFileProc", "snapManager.getState", | |
"snapManager.snapshot", "split.enableSwitch", "split.enableTour", | |
"split.getGroupCount", "split.getMode", "split.getRect", "split.isChannelLocked", | |
"split.isTourEnabled", "split.isTourStarted", "split.nextGroup", "split.nextMode", | |
"split.prevGroup", "split.prevMode", "split.recover", "split.setMode", | |
"split.setVisualbleRect", "mediaFileFind.factory.create", "storage.createDirectory", | |
"storage.createMediaFile", "storage.createMediaFileFind", | |
"storage.getCurrentDirectory", "storage.getDevice", "storage.getDeviceNames", | |
"storage.getDirectory", "storage.getGroupNames", "storage.getGroupPaths", | |
"storage.getiSCSITargets", "storage.isGroupFull", "storage.renameGroup", | |
"storage.setOverWriteMode", "storage.start", "storage.stop", "streamReader.create", | |
"streamReader.destroy", "streamReader.limit", "streamReader.pause", | |
"streamReader.resume", "streamReader.seek", "streamReader.seekByTime", | |
"streamReader.setSpeed", "streamReader.start", "streamReader.stop", | |
"system.getAPIVersion", "system.listMethod", "system.listService", | |
"system.methodHelp", "system.methodSignature", "system.multicall", | |
"upgrader.appendData", "upgrader.cancel", "upgrader.execute", "upgrader.getState", | |
"upgrader.prepare", "userManager.addGroup", "userManager.addUser", | |
"userManager.checkTemUser", "userManager.deleteGroup", "userManager.deleteUser", | |
"userManager.factory.instance", "userManager.getActiveUserInfoAll", | |
"userManager.getAuthorityList", "userManager.getGroupInfo", | |
"userManager.getGroupInfoAll", "userManager.getPassword", "userManager.getUserInfo", | |
"userManager.getUserInfoAll", "userManager.modifyGroup", "userManager.modifyPassword", | |
"userManager.modifyUser", "workDirectory.clear", "workDirectory.destroy", | |
"workDirectory.factory.getCollect", "workDirectory.factory.instance", | |
"workDirectory.getBitmap", "workDirectory.getBitmapEx", "workDirectory.getBoundTime", | |
"workDirectory.getFileNumber", "workDirectory.getFreeSpace", "workDirectory.getGroup", | |
"workDirectory.getPath", "workDirectory.getPosition", "workDirectory.getSerialNo", | |
"workDirectory.getTotalSpace", "workDirectory.getType", "workDirectory.isCurrent", | |
"workDirectory.isError", "workDirectory.refreshTime", | |
"workDirectory.releaseDirectory", "workDirectory.setGroup", "workDirectory.setType" | |
] }, "result" : true, "session" : %s } | |
ZhiNuo_Color_Save_Pthread | |
Dahua_Broadcast_Thread | |
ioctl error | |
10.1.0.2 | |
239.255.42.42 | |
IPC-IPVM3150F | |
Name:IPC%5d*%-5d | |
Device:IPC-IPVM3150F | |
IPv6Addr:2001:250:3000:1::1:2/112;gateway:2001:250:3000:1::1:1 | |
IPv6Addr:fe80::9202:a9ff:fe1b:f6b3/64;gateway:fe80:: | |
ZhiNuo_Broadcast_Thread | |
IPC%5d*%-5d | |
ZhiNuo_Main_Thread | |
%s(%d) get id faile | |
%s(%d) get method faile | |
%s(%d) get session faile | |
ZhiNuo_AudioSendPthread | |
VMOTION stop | |
{ "id" : %d, "params" : null, "result" : 1129658112, "session" : %ld } | |
%s(%d) param can not match | |
system.listMethod | |
configManager.factory.instance | |
{ "id" : %s, "params" : null, "result" : 1077790944, "session" : %s } | |
devVideoInput.factory.instance | |
{ "id" : %s, "params" : null, "result" : 1129958032, "session" : %s } | |
devVideoDetect.factory.instance | |
{ "error" : { "code" : 405, "message" : "Method not allowed" }, "id" : %s, "params" : null, "result" : false, "session" : %s } | |
configManager.destroy | |
{ "id" : %s, "params" : null, "result" : true, "session" : %s } | |
devVideoDetect.destroy | |
%s(%d) not dahua nvr change stream | |
SNAP&1&1::SIZE:3:4:5:6:8::FREQUENCE:2:3:4:5:6:7:8:9::MODE:0::FORMAT:1::QUALITY:4&1 | |
FTP:1:Record,Snap&&SMTP:1:AlarmText,AlarmSnap&&NTP:2:AdjustSysTime&&VideoCover:1:MutiCover&&AutoRegister:1:Login&&AutoMaintain:1:Reboot,DeleteFiles,ShutDown&&UPNP:1:SearchDevice&&DHCP:1:RequestIP&&STORE POSITION:1:FTP&&DefaultQuery:1:DQuery&&ACFControl:1:ACF&&ENCODE OPTION:1:AssiCompression&&DavinciModule:1:WorkSheetCFGApart,StandardGOP&&Dahua.a4.9:1:Login&&Dahua.Device.Record.General:1:General&&IPV6:1:IPV6Config&&Log:1:PageForPageLog&&QueryURL:1:CONFIG&&DriverTypeInfo:1:DriverType&&ProtocolFramework:1:V3_1 | |
%s&& | |
IPC&& | |
DHAV | |
anni | |
### search_type:%d, search_child_type=%d | |
eth0,%d,%d,%02x:%02x:%02x:%02x:%02x:%02x::&ð0 | |
### search_type:%d | |
ZhiNuo_session_Thread | |
close strem by connfd:%d | |
ZhiNuo_Send_Second_Stream_Pthread | |
/mnt/mmc/%04d%02d%02d/0/%02d%02d%02d.asf | |
/mnt/mmc%d/%04d%02d%02d/0/%02d%02d%02d.asf | |
ZhiNuo_Send_Main_Stream_Pthread | |
shutdown | |
XMaiSockRecv | |
XMaiTalkRecv | |
lib_xmai_stop | |
lib_xmai_start | |
PrintXMaiMsg | |
DoIncomingNetSearchHandle | |
SearchMessageParse | |
BoardCastSendTo | |
CreateBroadcastSock | |
XMaiBroadcastThread | |
XMaiMainThread | |
XMaiMakeMsg | |
XMaiSockSend | |
XMaiTalkCallBack | |
fXmaiNetAlarmCallback | |
XMaiSendSubStreamProcess | |
XMaiSendPFrame | |
XMaiSendIFrame | |
XMaiSendMainStreamProcess | |
XMaiRecvMsg | |
XMaiHandleMsg | |
XMaiSessionProcess | |
headFlag = %d | |
version = %d | |
reserved1 = %d | |
reserved2 = %d | |
sessionId = %d | |
sequenceNum = %d | |
totalPacket = %d | |
curPacket = %d | |
messageId = %d | |
dataLen = %d | |
[error -- File: %s, Line: %d, Function: %s] sock %d recv error:%s | |
src/xmai_session.c | |
[error -- File: %s, Line: %d, Function: %s] recv error:%s | |
XMaiTalkPthread | |
[error -- File: %s, Line: %d, Function: %s] DMS_NET_REG_ALARMCALLBACK error | |
[error -- File: %s, Line: %d, Function: %s] lib_xmai_close bye bye bye bye bye11111 | |
=============== Entry lib_xmai_start %s %s | |
09:29:32 | |
[error -- File: %s, Line: %d, Function: %s] | |
[error -- File: %s, Line: %d, Function: %s] erro:creat XMaiMainThread fail | |
[error -- File: %s, Line: %d, Function: %s] erro:creat XMaiBroadcastThread fail | |
XMai_DataThread | |
XMai_DataThread Save DMS Data | |
!!!!!stoping XMai_DataThread | |
Audio Frame Info: | |
flag1 = %d | |
flag2 = %d | |
flag3 = %d | |
flag4 = %d | |
flagT = %d | |
sampleRate = %d | |
len = %d | |
[error -- File: %s, Line: %d, Function: %s] Error before: [%s] | |
msg data len is 0 | |
[error -- File: %s, Line: %d, Function: %s] recvfrom error:%s | |
[error -- File: %s, Line: %d, Function: %s] *** udp, unknown msg id:%d *** | |
[error -- File: %s, Line: %d, Function: %s] Send() socket %d error :%s | |
[error -- File: %s, Line: %d, Function: %s] socket fail, error:%s | |
[error -- File: %s, Line: %d, Function: %s] setsockopt SO_BROADCAST fail, error:%s | |
[error -- File: %s, Line: %d, Function: %s] bind fail, error:%s | |
XMaiBroadcastThread | |
[error -- File: %s, Line: %d, Function: %s] Create Broadcast Sock error. | |
XMaiMainThread | |
[error -- File: %s, Line: %d, Function: %s] socket error%s | |
[error -- File: %s, Line: %d, Function: %s] bind err%s | |
[error -- File: %s, Line: %d, Function: %s] listen error%s | |
[error -- File: %s, Line: %d, Function: %s] Server: accept failed%s | |
[error -- File: %s, Line: %d, Function: %s] erro:creat XMaiSessionThread fail | |
[error -- File: %s, Line: %d, Function: %s] send buff too small. send jsonMsg: %s | |
[error -- File: %s, Line: %d, Function: %s] send buf size = %d, send msg len = %d | |
[error -- File: %s, Line: %d, Function: %s] SockSend Failed ret:%d, sock:%d, len:%d errno:%s | |
LocalIO | |
StorrageLowSpace | |
VideoLoss | |
VideoMotion | |
StorageNotExist | |
StorageFailure | |
VideoBlind | |
NetAbort | |
IPConfict | |
0x%08x | |
AlarmInfo | |
SessionID | |
[error -- File: %s, Line: %d, Function: %s] DMS_NET_GET_PLATFORMCFG fail | |
[error -- File: %s, Line: %d, Function: %s] dms_sysnetapi_MBUF_AddReader failure | |
[error -- File: %s, Line: %d, Function: %s] get DMS_NET_CMD_IFRAME_REQUEST fail:%d | |
[error -- File: %s, Line: %d, Function: %s] dms_sysnetapi_MBUF_GetReadPtrPos fail. | |
[error -- File: %s, Line: %d, Function: %s] dms_sysnetapi_MBUF_DelReader failure | |
XMaiSendSubStreamPthread | |
XMaiSendMainStreamPthread | |
[error -- File: %s, Line: %d, Function: %s] unknown msg id:%d, sock:%d, sessionType:%d | |
[error -- File: %s, Line: %d, Function: %s] unknown or error msg id:%d(0x%x) | |
[error -- File: %s, Line: %d, Function: %s] XMaiHandleMsg error, ret:%d. | |
XMai_session_Thread | |
resTalkReq | |
resTalkClaim | |
resMotionArea | |
resBlindCapability | |
resNetOrder | |
resMultiVstd | |
resMaxPreRecord | |
resPTZcontrol | |
resPtzReq | |
resGuard | |
ReqGuardHandle | |
resSysManagerReq | |
resSyncTime | |
resChannelTileDotSet | |
ReqChannelTileDotSetHandle | |
resChannelTileSet | |
resConfigSet | |
resAlarmOut | |
resSerialNo | |
resNatInfo | |
resAutoMaintain | |
resVideoWidget | |
resDigManagerShow | |
resCameraParam | |
resMonitorReq | |
resMonitorClaim | |
resKeepAlive | |
ReqSyncTimeHandle | |
ReqkeepAliveHandle | |
HandleTalkReq | |
ReqTalkReqHandle | |
HandleTalkClaim | |
ReqTalkClaimHandle | |
HandleGuard | |
HandleOPMachine | |
HandleGUISet | |
HandleLocationSet | |
HandleGeneralSet | |
HandleNetOrderSet | |
HandleLocalAlarmSet | |
HandleRecordSet | |
HandleNetFTPCfgSet | |
resLocationInfo | |
resGeneralInfo | |
resTalkAudioFormat | |
resStorageInfo | |
resEncodeStaticParam | |
resSimplifyEncode | |
resVideoColor | |
resEncodeCapability | |
resMultiLanguage | |
resCamera | |
resFullAuthorityList | |
ReqFullAuthorityListHandle | |
resGroupsGet | |
ReqGroupsGetHandle | |
resSystemFunction | |
resAbilityGet | |
ReqAbilityGetHandle | |
resUsersGet | |
ReqUsersGetHandle | |
resGUISetGet | |
resNetFTPGet | |
resNetEmailGet | |
resRecordConfigGet | |
resLocalAlarm | |
resNetDHCP | |
resStoragePosition | |
HandlePtzReq | |
ReqPtzHandle | |
HandleEncodeCfgSet | |
HandleOPTimeSetting | |
ReqSysManagerHandle | |
resSysTemInfo | |
ReqSysinfoHandle | |
resMotionDetect | |
resSetIframeReq | |
ReqSetIframeHandle | |
resTimeQuery | |
ReqTimeQueryHandle | |
HandleChannelTileSet | |
ReqChannelTileSetHandle | |
resChannelTileGet | |
ReqChannelTileGetHandle | |
HandleVideoColorSet | |
HandleAddr | |
HandleNetDNSSet | |
HandleNetCommonSet | |
HandleNetEmailCfgSet | |
HandleIpSet | |
HandleMotionDetectSet | |
resNetDNS | |
resNetCommon | |
ReqConfigGetHandle | |
ReqMonitorReqHandle | |
HandleMonitorAlarm | |
ReqMonitorClaimHandle | |
TcpSetSocketSendBufSize | |
resRegister | |
ReqRegisterHandle | |
ResIpSet | |
ReqIpSetReqHandle | |
ResIpsearch | |
HandleNetDHCPSet | |
ReqConfigSetHandle | |
OPTalk | |
src/xmai_message.c | |
MotionArea.[0] | |
GridColumn | |
GridRow | |
MultiVstd | |
PAL|NTSC | |
PTZcontrol | |
0x00000000 | |
PTZPositon | |
[error -- File: %s, Line: %d, Function: %s] dataLen == 0 no json | |
Alarm.AlarmOut | |
Ability.SerialNo | |
81XXF | |
ProductType | |
003e0b075838 | |
Status.NatInfo | |
NaInfoCode | |
Probing | |
NatStatus | |
General.AutoMaintain | |
Tuesday | |
AutoRebootDay | |
AutoDeleteFilesDays | |
AutoRebootHour | |
AVEnc.VideoWidget | |
NetWork.DigManagerShow | |
ShowAll | |
Camera.Param.[0] | |
OPMonitor | |
KeepAlive | |
OPTimeSettingNoRTC | |
EncodeType | |
SampleBit | |
SampleRate | |
[error -- File: %s, Line: %d, Function: %s] dataLen == 0 no json must have jason | |
OPMachine | |
Reboot | |
fVideo.GUISet | |
WindowAlpha | |
TimeTitleEnable | |
ChannelTitleEnable | |
General.Location | |
YYMMDD | |
MMDDYY | |
DDMMYY | |
DateSeparator | |
SimpChinese | |
TimeFormat | |
VideoFormat | |
WorkDay | |
DSTRule | |
DSTStart | |
Year | |
Minute | |
DSTEnd | |
General.General | |
AutoLogout | |
LocalNo | |
SnapInterval | |
OverWrite | |
StopRecord | |
MachineName | |
VideoOutPut | |
Alarm.LocalAlarm.[0] | |
[error -- File: %s, Line: %d, Function: %s] get Detect.LocalAlarm.[0] error | |
[error -- File: %s, Line: %d, Function: %s] get Detect.LocalAlarm.[0] Enable error | |
EventHandler | |
[error -- File: %s, Line: %d, Function: %s] get Detect.LocalAlarm.[0] EventHandler error | |
AlarmOutEnable | |
[error -- File: %s, Line: %d, Function: %s] get Detect.LocalAlarm.[0] AlarmOutEnable error | |
AlarmOutLatch | |
[error -- File: %s, Line: %d, Function: %s] get Detect.LocalAlarm.[0] AlarmOutLatch error | |
FTPEnable | |
[error -- File: %s, Line: %d, Function: %s] get Detect.LocalAlarm.[0] FTPEnable error | |
MailEnable | |
[error -- File: %s, Line: %d, Function: %s] get Detect.LocalAlarm.[0] MailEnable error | |
RecordEnable | |
[error -- File: %s, Line: %d, Function: %s] get Detect.LocalAlarm.[0] RecordEnable error | |
RecordLatch | |
SnapEnable | |
[error -- File: %s, Line: %d, Function: %s] get Detect.LocalAlarm.[0] SnapEnable error | |
VoiceEnable | |
[error -- File: %s, Line: %d, Function: %s] get Detect.MotionDetect.[0] VoiceEnable error | |
Record.[0] | |
[error -- File: %s, Line: %d, Function: %s] get Record.[0] error | |
PacketLength | |
PreRecord | |
ConfigRecord | |
ManualRecord | |
ClosedRecord | |
NetWork.NetFTP | |
[error -- File: %s, Line: %d, Function: %s] get NetWork.NetFTP error | |
[error -- File: %s, Line: %d, Function: %s] get Directory error | |
[error -- File: %s, Line: %d, Function: %s] get Server error | |
[error -- File: %s, Line: %d, Function: %s] get Password error | |
[error -- File: %s, Line: %d, Function: %s] get UserName error | |
English | |
ScreenAutoShutdown | |
ScreenSaveTime | |
LocalHost | |
TalkAudioFormat | |
G711_ALAW | |
StorageInfo | |
PartNumber | |
PlysicalNo | |
Partition | |
0000-00-00 00:00:00 | |
NewEndTime | |
NewStartTime | |
OldEndTime | |
OldStartTime | |
RemainSpace | |
TotalSpace | |
DirverType | |
LogicSerialNo | |
AVEnc.EncodeStaticParam | |
Simplify.Encode | |
MainFormat | |
AudioEnable | |
H.264 | |
Compression | |
MJPG | |
SVCD | |
650TVL | |
1_3M | |
VideoEnable | |
ExtraFormat | |
AVEnc.VideoColor.[0] | |
0 00:00:00-24:00:00 | |
TimeSection | |
VideoColorParam | |
Gain | |
EncodeCapability | |
ChannelMaxSetSync | |
CombEncodeInfo | |
CompressionMask | |
ResolutionMask | |
HaveAudio | |
ExtraStream2 | |
ImageSizePerChannel | |
ExImageSizePerChannelEx | |
ExImageSizePerChannel | |
MaxBitrate | |
MaxEncodePower | |
MaxEncodePowerPerChannel | |
MultiLanguage | |
Camera | |
Count | |
ElecLevel | |
Luminance | |
Speeds | |
AuthorityList | |
Groups | |
administrator group | |
Memo | |
user group | |
Net3G | |
NetARSP | |
NetAlarmCenter | |
NetDDNS | |
NetIPFilter | |
NetMobile | |
NetMutliCast | |
NetNTP | |
NetPPPoE | |
NetPlatMega | |
NetPlatShiSou | |
NetPlatVVEye | |
NetPlatXingWang | |
NetRTSP | |
NetDeviceDescUPNP | |
NetWifi | |
AlarmConfig | |
BlindDetect | |
LossDetect | |
MotionDetect | |
NetAlarm | |
NetIpConflict | |
StorageLowSpace | |
DoubleStream | |
CombineStream | |
SnapStream | |
SystemFunction | |
EncodeFunction | |
AlarmFunction | |
NetServerFunction | |
MaxPreRecord | |
BlindCapability | |
[error -- File: %s, Line: %d, Function: %s] Unknow:%s | |
admin 's account | |
tlJwpbo6 | |
Reserved | |
Sharable | |
guest 's account | |
guest | |
default account | |
OxhlwSG8 | |
AlarmStateEnable | |
CarInfo | |
ChanStateBitRateEnable | |
ChanStateLckEnable | |
ChanStateMtdEnable | |
ChanStateVlsEnable | |
Deflick | |
GPSInfo | |
RecordStateEnable | |
RemoteEnable | |
NNetWork.NetFTP | |
NetWork.NetEmail | |
UseSSL | |
IPCAlert | |
SendAddr | |
MailServer | |
Anonymity | |
Recievers | |
Schedule | |
Redundancy | |
0x00000001 | |
AlarmOutMask | |
BeepEnable | |
EventLatch | |
LogEnable | |
MatrixEnable | |
MatrixMask | |
MessageEnable | |
MsgtoNetEnable | |
MultimediaMsgEnable | |
PtzEnable | |
RecordMask | |
ShortMsgEnable | |
ShowInfo | |
ShowInfoMask | |
SnapShotMask | |
TipEnable | |
TourEnable | |
TourMask | |
[error -- File: %s, Line: %d, Function: %s] DMS_NET_GET_NETCFG fail | |
NetWork.NetDHCP | |
Interface | |
Storage.StoragePosition | |
SATA | |
OPPTZControl | |
[error -- File: %s, Line: %d, Function: %s] OPPTZControl empty | |
[error -- File: %s, Line: %d, Function: %s] Command empty | |
[error -- File: %s, Line: %d, Function: %s] pParameter empty | |
Step | |
DirectionUp | |
DirectionDown | |
DirectionLeft | |
DirectionRight | |
DirectionLeftUp | |
DirectionLeftDown | |
DirectionRightUp | |
DirectionRightDown | |
ZoomWide | |
ZoomTile | |
FocusNear | |
FocusFar | |
IRISLarge | |
IrisLarge | |
IRISSmall | |
IrisSmall | |
ClearPreset | |
AddTour | |
DeleteTour | |
ClearTour | |
StartTour | |
StopTour | |
AutoScanOn | |
AutoScanOff | |
AutoPanOn | |
AutoPanOff | |
SetLimitLeft | |
SetLimitRight | |
LightOn | |
LightOff | |
Simplify.Encode.[0] | |
[error -- File: %s, Line: %d, Function: %s] get Simplify.Encode.[0] error | |
[error -- File: %s, Line: %d, Function: %s] get Simplify.Encode.[0] ExtraFormat error | |
[error -- File: %s, Line: %d, Function: %s] get Simplify.Encode.[0] AlarmOutLatch error | |
[error -- File: %s, Line: %d, Function: %s] get Simplify.Encode.[0] FTPEnable error | |
OPTimeSetting | |
%hu-%02hu-%02hu %02hu:%02hu:%02hu | |
OPLogManager | |
OPDefaultConfig | |
HI3518 | |
SystemInfo | |
AlarmInChannel | |
AlarmOutChannel | |
AudioInChannel | |
2014-06-14 12:03:12 | |
BuildTime | |
CombineSwitch | |
0x0001CB2A | |
DeviceRunTime | |
DigChannel | |
EncryptVersion | |
ExtraChannel | |
HardWare | |
HardWareVersion | |
SoftWareVersion | |
TalkInChannel | |
TalkOutChannel | |
VideoInChannel | |
VideoOutChannel | |
UpdataTime | |
UpdataType | |
WorkState | |
[error -- File: %s, Line: %d, Function: %s] ***********dataLen == 0 must have json**************** | |
0x%08lx | |
Detect.MotionDetect.[0] | |
Region | |
1 %02u:%02u:00-%02u:%02u:00 | |
0 00:00:00-00:00:00 | |
OPTimeQuery | |
ChannelTitle | |
[error -- File: %s, Line: %d, Function: %s] get AVEnc.VideoColor.[0] error | |
[error -- File: %s, Line: %d, Function: %s] get AVEnc.VideoColor.[0] Array1 error | |
[error -- File: %s, Line: %d, Function: %s] error p == NULL | |
NetWork.NetDNS | |
[error -- File: %s, Line: %d, Function: %s] get NetWork.NetDHCP error | |
[error -- File: %s, Line: %d, Function: %s] get NetWork.NetDNS Address error | |
NetWork.NetCommon | |
[error -- File: %s, Line: %d, Function: %s] get NetWork.NetCommon error | |
[error -- File: %s, Line: %d, Function: %s] get NetWork.NetCommon HttpPort error | |
GateWay | |
[error -- File: %s, Line: %d, Function: %s] get NetWork.NetCommon GateWay error | |
HostIP | |
[error -- File: %s, Line: %d, Function: %s] get NetWork.NetCommon HostIP error | |
Submask | |
[error -- File: %s, Line: %d, Function: %s] get NetWork.NetCommon Submask error | |
[error -- File: %s, Line: %d, Function: %s] get NetWork.NetEmail error | |
[error -- File: %s, Line: %d, Function: %s] get MailServer error | |
[error -- File: %s, Line: %d, Function: %s] get serverName error | |
[error -- File: %s, Line: %d, Function: %s] get Recievers error | |
[error -- File: %s, Line: %d, Function: %s] get Detect.MotionDetect.[0] error | |
[error -- File: %s, Line: %d, Function: %s] get Detect.MotionDetect.[0] Level error | |
[error -- File: %s, Line: %d, Function: %s] get Detect.MotionDetect.[0] Enable error | |
[error -- File: %s, Line: %d, Function: %s] get Detect.MotionDetect.[0] EventHandler error | |
%d %02d:%02d:%02d-%02d:%02d:%02d | |
[error -- File: %s, Line: %d, Function: %s] get Detect.MotionDetect.[0] AlarmOutEnable error | |
[error -- File: %s, Line: %d, Function: %s] get Detect.MotionDetect.[0] AlarmOutLatch error | |
[error -- File: %s, Line: %d, Function: %s] get Detect.MotionDetect.[0] FTPEnable error | |
[error -- File: %s, Line: %d, Function: %s] get Detect.MotionDetect.[0] MailEnable error | |
[error -- File: %s, Line: %d, Function: %s] get Detect.MotionDetect.[0] RecordEnable error | |
[error -- File: %s, Line: %d, Function: %s] get Detect.MotionDetect.[0] SnapEnable error | |
SpareAddress | |
[error -- File: %s, Line: %d, Function: %s] DMS_NET_GET_WIFICFG fail | |
MaxBps | |
SSLPort | |
TCPMaxConn | |
TCPPort | |
UDPPort | |
HostName | |
MonMode | |
TransferPlan | |
UseHSDownLoad | |
######## nRet=%d | |
Extra1 | |
Extra | |
TransMode | |
[error -- File: %s, Line: %d, Function: %s] SetSocketRcvBufSize error | |
AliveInterval | |
ChannelNum | |
DeviceType | |
EncryptType | |
LoginType | |
[error -- File: %s, Line: %d, Function: %s] Stopsession close socket(%d)![send_ret:%d] | |
[error -- File: %s, Line: %d, Function: %s] get NetWork.NetDHCP Array0 error | |
[error -- File: %s, Line: %d, Function: %s] get NetWork.NetDHCP Enable error | |
udhcpc -ieth0 | |
NetWork.NetOrder | |
0x03441400 | |
0x00000019 | |
0x00004E20 | |
0x0000208D | |
0x00000FA0 | |
0x000007D0 | |
0x000003E8 | |
0x000001F4 | |
0x000000FA | |
0x00000064 | |
ShutDown | |
RecordConfig | |
StorageManager | |
SysInfo | |
QueryLog | |
DelLog | |
SysUpgrade | |
GeneralConfig | |
CommConfig | |
NetConfig | |
VideoConfig | |
PtzConfig | |
PTZControl | |
DefaultConfig | |
Talk_01 | |
IPCCamera | |
Monitor_01 | |
Replay_01 | |
1 00:00:00-24:00:00 | |
afxQueryFileMonthly | |
afxStopFindFile | |
afxFindNextFile | |
afxStartFindFile | |
afxStopHistoryStream | |
afxControlHistoryStream | |
afxStartHistoryStream | |
gfxInputDataNotice | |
gfxReboot | |
gfxStartVoice | |
gfxGetChannelBitRate | |
gfxCaptureJpeg | |
gfxGetPtzCruise | |
gfxPtzCruise | |
gfxPtzTrack | |
gfxPtzPreset | |
gfxPtzControl | |
antsNetServiceStart | |
ANTS_SERVER_DataThread | |
ANTS_SERVER_MediaThread | |
gfxSetParameter | |
gfxGetParameter | |
!!!!! antsNetServiceStop 1... | |
### %s:%d | |
FUN:%s LINE:%d Para Error %d | |
### gfxInputDataNotice: channel:%lu, streamtype:%lu, enb:%d | |
FUN:%s LINE:%d DMS_NET_CMD_REBOOT failure %d | |
FUN:%s LINE:%d DMS_NET_REG_AUDIOCALLBACK failure %d | |
FUN:%s LINE:%d DMS_NET_CMD_START_TALKAUDIO failure %d | |
FUN:%s LINE:%d DMS_NET_GET_PICCFG failure %d | |
FUN:%s LINE:%d DMS_NET_CMD_SNAPSHOT failure %d | |
FUN:%s LINE:%d gfxGetPtzCruise chn %d , route %d | |
FUN:%s LINE:%d gfxPtzCruise failure %d | |
num %d index %d route %d preset %d dwell %d speed %d | |
FUN:%s LINE:%d chn %d cmd %d route %d point %d input %d | |
FUN:%s LINE:%d Para Error failure %d | |
FUN:%s LINE:%d unknow cmd failure %d | |
FUN:%s LINE:%d DMS_NET_GET_RECORDCFG failure %d | |
ANTS_MID_ZOOM_IN | |
ANTS_MID_ZOOM_OUT | |
ANTS_MID_FOCUS_NEAR | |
ANTS_MID_FOCUS_FAR | |
ANTS_MID_IRIS_OPEN | |
ANTS_MID_IRIS_CLOSE | |
ANTS_MID_TILT_UP | |
ANTS_MID_TILT_DOWN | |
ANTS_MID_PAN_LEFT | |
ANTS_MID_PAN_RIGHT | |
FUN:%s LINE:%d DMS_NOT_MATCH_CMD %d failure | |
ANTS_SERVER Module Build:%s %s | |
11:29:00 | |
FUN:%s LINE:%d DMS_NET_REG_ALARMCALLBACK failure %d | |
[ANTS][%s:%08d:%s] Initialize Begin | |
./src/libants.cpp | |
[ANTS][%s:%08d:%s] Initialize | |
[ANTS][%s:%08d:%s] Initialize End | |
[ANTS][%s:%08d:%s] Create MediaThread fail | |
================== thread %s pthread_self %d getpid() %d | |
ANTS_SERVER_DataThread | |
ANTS_SERVER_DataThread Save DMS Data | |
!!!!!stoping ANTS_SERVER_DataThread | |
================== thread %s %d pthread_self %d getpid() %d | |
ANTS_SERVER_MediaThread | |
!!!!!stoping ANTS_SERVER_MediaThread %d | |
FUN:%sLINE:%d ANTS_MID_SET_DEVICECFG | |
FUN:%s LINE:%d DMS_NET_GET_DEVICECFG failure %d | |
FUN:%s LINE:%d DMS_NET_SET_DEVICECFG failure %d | |
FUN:%sLINE:%d ANTS_MID_SET_NETCFG | |
FUN:%s LINE:%d DMS_NET_SET_NETCFG failure %d | |
FUN:%sLINE:%d ANTS_MID_SET_PICCFG | |
FUN:%s LINE:%d DMS_NET_GET_COLORCFG failure %d | |
FUN:%s LINE:%d DMS_NET_GET_OSDCFG failure %d | |
FUN:%s LINE:%d DMS_NET_GET_DEF_COLORCFG failure %d | |
FUN:%sLINE:%d ANTS_MID_SET_PICCFG_V2 | |
FUN:%sLINE:%d ANTS_MID_SET_COMPRESSCFG | |
FUN:%sLINE:%d ANTS_MID_SET_RECORDCFG | |
FUN:%sLINE:%d ANTS_MID_SET_DECODERCFG | |
FUN:%s LINE:%d DMS_NET_GET_DECODERCFG failure %d | |
Pelco-D | |
Pelco-P | |
FUN:%s LINE:%d DMS_NET_SET_DECODERCFG failure %d | |
FUN:%sLINE:%d ANTS_MID_SET_ALARMINCFG | |
FUN:%sLINE:%d ANTS_MID_SET_ALARMINCFG_V2 | |
FUN:%sLINE:%d ANTS_MID_SET_ALARMOUTCFG | |
FUN:%sLINE:%d ANTS_MID_SET_TIMECFG | |
FUN:%sLINE:%d ANTS_MID_SET_USERCFG | |
DMS_NET_SET_USERCFG failure | |
FUN:%sLINE:%d ANTS_MID_SET_USERCFG_V2 | |
FUN:%sLINE:%d ANTS_MID_SET_SHOWSTRING | |
FUN:%sLINE:%d ANTS_MID_SET_VIDEOEFFECT | |
FUN:%sLINE:%d ANTS_MID_SET_MOTIONCFG | |
FUN:%s LINE:%d DMS_NET_GET_MOTIONCFG failure %d | |
exception handle %x | |
FUN:%s LINE:%d DMS_NET_SET_MOTIONCFG failure %d | |
FUN:%sLINE:%d ANTS_MID_SET_MOTIONCFG_V2 | |
FUN:%sLINE:%d ANTS_MID_SET_SHELTERCFG | |
FUN:%s LINE:%d DMS_NET_GET_SHELTERCFG failure %d | |
shelter %d top %d left %d w %d h %d enable %d | |
FUN:%s LINE:%d DMS_NET_SET_SHELTERCFG failure %d | |
FUN:%sLINE:%d ANTS_MID_SET_HIDEALARMCFG | |
FUN:%sLINE:%d ANTS_MID_SET_VIDEOLOSTCFG | |
FUN:%sLINE:%d ANTS_MID_SET_OSDCFG | |
showname %d show time %d x %d y %d formate %d | |
FUN:%sLINE:%d ANTS_MID_SET_VIDEOFORMAT | |
### ANTS_MID_SET_SENSORCFG......... | |
HD720p(1280*720) | |
HD960p(1280*960) | |
HD1080p(1920*1080) | |
SVGA(800*600) | |
VGA(640*480) | |
CIF(352*288) | |
CIF(352*240) | |
4CIF(704*576) | |
4CIF(704*480) | |
2CIF(704*288) | |
2CIF(704*240) | |
FUN:%sLINE:%d ANTS_MID_GET_DEVICECFG | |
%x%x%x%x%x%x | |
FUN:%sLINE:%d ANTS_MID_GET_NETCFG | |
FUN:%sLINE:%d ANTS_MID_GET_PICCFG | |
FUN:%sLINE:%d ANTS_MID_GET_PICCFG_V2 | |
FUN:%sLINE:%d ANTS_MID_GET_COMPRESSCFG | |
FUN:%sLINE:%d ANTS_MID_GET_RECORDCFG | |
FUN:%sLINE:%d ANTS_MID_GET_DECODERCFG | |
ANTS_MID_GET_DECODERCFG databit %d | |
pelco-p | |
FUN:%sLINE:%d ANTS_MID_GET_ALARMINCFG | |
FUN:%sLINE:%d ANTS_MID_GET_ALARMINCFG_V2 | |
FUN:%sLINE:%d ANTS_MID_GET_ALARMOUTCFG | |
FUN:%sLINE:%d ANTS_MID_GET_TIMECFG | |
FUN:%sLINE:%d ANTS_MID_GET_USERCFG | |
FUN:%sLINE:%d ANTS_MID_GET_USERCFG_V2 | |
index %d userName %s PassWord %s | |
FUN:%sLINE:%d ANTS_MID_GET_SHOWSTRING | |
FUN:%sLINE:%d ANTS_MID_GET_PTZCFG | |
PELCO-D | |
PELCO-P | |
FUN:%sLINE:%d ANTS_MID_GET_WORKSTATUS | |
FUN:%sLINE:%d ANTS_MID_GET_WORKSTATUS_V2 | |
FUN:%sLINE:%d ANTS_MID_GET_COMPRESS_ABILITY | |
FUN:%s LINE:%d DMS_NET_GET_SUPPORT_STREAM_FMT failure %d | |
Main Stream | |
Sub Stream | |
Self-Define(16-16000kbps) | |
FUN:%sLINE:%d ANTS_MID_GET_VIDEOEFFECT | |
FUN:%sLINE:%d ANTS_MID_GET_MOTIONCFG | |
FUN:%sLINE:%d ANTS_MID_GET_MOTIONCFG_V2 | |
FUN:%sLINE:%d ANTS_MID_GET_SHELTERCFG | |
FUN:%sLINE:%d ANTS_MID_GET_HIDEALARMCFG | |
FUN:%sLINE:%d ANTS_MID_GET_VIDEOLOSTCFG | |
FUN:%sLINE:%d ANTS_MID_GET_OSDCFG | |
FUN:%sLINE:%d ANTS_MID_GET_VIDEOFORMAT | |
### ANTS_MID_GET_SENSORCFG......... | |
ANTS_SERVER_InputDataV4 | |
ANTS_SERVER_InputOneAudioFrameV1 | |
ANTS_SERVER_InputOneAudioFrameV2 | |
I8Server_AlarmThreadX | |
[i8-server] [%s:%d] input param streamtype[%d] channel[%d] frametype[%d] framerate[%d] size[%d] invalid | |
[i8-server] [%s:%d] input param streamtype[%d] channel[%d] audiocodecid[%d] framerate[%d] size[%d] invalid | |
12TiXmlVisitor | |
OnNewEventProc | |
OnOldEventProc | |
/proc/net/wireless | |
Cannot parse /proc/net/wireless | |
IPC-HYVERSION | |
eth%d | |
[%s:%d] %s socket[%d] send len[%d] | |
I8Server_BroadCastThread | |
%s%d%d | |
0x%02x:0x%02x:0x%02x:0x%02x:0x%02x:0x%02x | |
CheckIPTime | |
UpdateIPTime | |
Res%d | |
PlayThreadDisable | |
0A80%s | |
I8Server_HeartBeatThread | |
I8Server_MainThread | |
I8Server_AlarmMainThread | |
StreamProc | |
I8Server_HistoryStreamThread | |
[%s:%d:%s] controlsession[0x%x] mediasession[0x%x] delete begin | |
src/AntsSVRControlSession.cpp | |
[%s:%d:%s] controlsession[0x%x] mediasession[0x%x] delete end | |
I8Server_StreamThread | |
I8Server_JpegMainThread | |
AddOneFrame | |
[ITMANLEE][%s:%d:%s] Voice Type[%d--%d] Error | |
src/AntsSVRVoiceSession.cpp | |
?456789:;<= | |
!"#$%&'()*+,-./0123 | |
')uB | |
* 5|z | |
lEd/ | |
6 PQ | |
pCRF | |
Yg:a | |
JZJ{. | |
#FLR | |
_QS} | |
MESSAGE | |
HEADER | |
PARAMETERS | |
ALARMER | |
ALARMCONTENT | |
JPEGCONTENT | |
ALARMCONTENTSIZE | |
JPEGCONTENTSIZE | |
Result | |
PATH | |
CODE | |
MULIP | |
PPPOE | |
HANDLE | |
PARAM | |
CONTENT | |
SIZE | |
TOTAL | |
TYPE | |
NAME | |
JPEG | |
LOCK | |
FILE | |
PROG | |
IPLNK | |
PORT | |
VALID3G | |
AUDENC | |
ELPB | |
ERPB | |
BMON | |
BHOU | |
BMIN | |
EMON | |
EHOU | |
EMIN | |
PDNS | |
ADNS | |
DHCP | |
HTTP | |
HTTPS | |
UPNP | |
DEFAULT | |
CARDNUM | |
RDNDC | |
DSPV | |
DSPBD | |
HDNO | |
IVAL | |
SMTP | |
POP3 | |
QLTY | |
MODE | |
MAJOR | |
MINOR | |
SMART | |
DECH | |
Switch | |
PoolTime | |
RATE | |
DISPCH | |
JoinDecChan | |
PROTOL | |
DISP | |
VGAWindowMode | |
BNCWindowMode | |
HDMIWindowMode | |
DVIWindowMode | |
SupportResolution | |
Channel | |
StreamMediaServer | |
DevChanInfo | |
Passive | |
DDNS | |
ADDR | |
ChanInfo | |
ABIL | |
VCATYPE | |
VCAMODE | |
LIP4 | |
LIP6 | |
RIP4 | |
RIP6 | |
MIP4 | |
MIP6 | |
AHIP4 | |
AHIP6 | |
DNS14 | |
DNS16 | |
DNS24 | |
DNS26 | |
MLIP4 | |
MLIP6 | |
MHIP4 | |
MHIP6 | |
SSID | |
SRNTH | |
WIFIETH | |
CELL | |
WIFIAPLIST | |
WIFICFG | |
WIFIWORKMODE | |
COUNT | |
AUTODNS | |
AUTH | |
TYPE | |
ACTIVE | |
G3CFG | |
VERSION | |
MSIPV4 | |
MSIPV6 | |
FSIPV4 | |
FSIPV6 | |
MSPORT | |
FSPORT | |
LOCALIPV4 | |
REMOTEIPV4 | |
CHANNUM | |
STARTCHAN | |
ENABLEMH | |
SVRVER | |
MANAGERHOSTCONFIG | |
USERVALID | |
SERIALVALID | |
VERSIONVALID | |
DEVICENAMEVALID | |
MACADDRVALID | |
LINKPORTVALID | |
DEVICEIPVALID | |
SOCKETIPVALID | |
USERHANDLE | |
DEVICENAME | |
LINKPORT | |
DEVICEIP | |
SOCKETIP | |
ALARMTYPE | |
ALARMINNO | |
ALARMOUTNUM | |
ALARMRELATECH | |
DISKNUM | |
YEAR | |
MONTH | |
PANELUSER | |
NETUSER | |
PARATYPE | |
ALARMIN | |
ALARMOUT | |
INFOLEN | |
INFO | |
STARTNO | |
Mask | |
DNS1 | |
DNS2 | |
WIFI | |
Private | |
Rtsp | |
Http | |
User | |
Model | |
Name | |
Password | |
Count | |
MAINRTSPADDR | |
SUBRTSPADDR | |
VMask | |
MMode | |
GMode | |
AMode | |
PQMode | |
WBMode | |
BLMode | |
SMode | |
IRISMode | |
SPMode | |
SPLevel | |
L3DNRMode | |
L3DNRLevel | |
L3DNRTFode | |
WDMode | |
GammaMode | |
AntiflickerFreqMode | |
DNMode | |
Delay | |
N2DT | |
D2NT | |
DEVTYPE | |
ENABLE | |
MANAGERHOST | |
FIXED | |
ITEM | |
ATTRIBUTE | |
SUPPORTHOSTCOUNT | |
LABLE | |
DEFAULTROUTE | |
NETWORKCARDNUM | |
DVRPORT | |
RESERVE | |
ETHARRAY | |
MASK | |
ALARMHOST | |
IPRESOLVER | |
MULTICAST | |
USERNAME | |
PASSWORD | |
PLAYBACKVER | |
StreamMediaServerValid | |
Res1 | |
Ipv4 | |
Ipv6 | |
Port | |
Type | |
TransmitType | |
Res2 | |
TranProtocol | |
TransMode | |
FactoryType | |
Enable | |
VideoStandard | |
JoinDecoderId | |
Audio | |
AudioWindowIndex | |
VgaResolution | |
VideoFormat | |
WindowMode | |
EnlargeStatus | |
EnlargeSubWindowIndex | |
Command | |
Parameter | |
Size | |
DecChanScalStatus | |
StreamType | |
BeginTime | |
EndTime | |
DecStatus | |
StreamMode | |
FileName | |
Year | |
Month | |
Hour | |
Minute | |
Second | |
IsLinked | |
StreamCpRate | |
AlarmInStatus | |
AlarmOutStatus | |
AudioInChanStatus | |
DecChanStatus | |
DispChanStatus | |
DecodeStatus | |
PacketType | |
RecvBufUsage | |
DecBufUsage | |
FpsDecV | |
FpsDecA | |
CpuLoad | |
DecodedV | |
DecodedA | |
ImageWidth | |
ImageHeight | |
DispStatus | |
BVGA | |
FpsDisp | |
DecNum | |
StartChan | |
VGANum | |
BNCNum | |
DSPNum | |
HDMINum | |
DVINum | |
Attribute | |
ProtocolNum | |
Protocol | |
ProtocolType | |
Describe | |
FirstDns | |
SecondDns | |
IpAlarmIn | |
IpAlarmOut | |
IpId | |
AlarmIn | |
AlarmOut | |
BadPixelNum | |
StopThreshold | |
Index | |
ServerIp | |
ServerPort | |
Status | |
Width | |
Height | |
Freq | |
VGAMode | |
Node | |
DualCh232 | |
DualCh485 | |
TranInfo | |
LocalSerial | |
RemoteSerial | |
Established | |
BaudRate | |
DataBit | |
StopBit | |
Parity | |
FlowControl | |
DecChannel | |
FileLen | |
FilePosition | |
Duration | |
PlayTime | |
IFrames | |
DataType | |
CorordinateX | |
CorordinateY | |
Flash | |
Translucent | |
LogoSize | |
AbilityType | |
Supported | |
Onvif | |
Rtmp | |
OnvifPort | |
RtmpPort | |
MulticastPort | |
Path | |
Sensitive | |
Precision | |
HandleType | |
SnapCount | |
SnapInterval | |
Date | |
StartHour | |
StartMinute | |
StopHour | |
StopMinute | |
MotionScope | |
RelAlarmOut | |
RelRecordChan | |
VideoEffect | |
Bright | |
Contrast | |
Saturation | |
VideoLost | |
VideoMotion | |
HideAlarm | |
Shelter | |
DispWeek | |
OsdAttribute | |
HourOsdType | |
AlarmTime | |
Version | |
8.6.0.0 Build 20130828 | |
ants_malloc | |
%s %d malloc error | |
compressed | |
bytes | |
/proc/net/dev | |
%63s%lx%lx%X%d%d%d%lx%d%d%d | |
%*[^ | |
ifconfig %s |grep Interrupt | |
cat /proc/interrupts | grep %d: | |
%n%llu%lu%lu%lu%lu%n%n%n%llu%lu%lu%lu%lu%lu | |
%llu%llu%lu%lu%lu%lu%n%n%llu%llu%lu%lu%lu%lu%lu | |
%llu%llu%lu%lu%lu%lu%lu%lu%llu%llu%lu%lu%lu%lu%lu%lu | |
SetSoSndtimeo | |
SetSoRcvtimeo | |
11AsyncSocket | |
[%s:%d:%s] SO_SNDTIMEO error | |
ants_socket.cpp | |
[%s:%d:%s] SO_RCVTIMEO error | |
Socket is not valid | |
Unable to resolve "%s" | |
SendData | |
ReceiveData | |
9TCPSocket | |
[%s:%d:%s] send err[%d] | |
ants_tcpsocket.cpp | |
[%s:%d:%s] socket select err[%d] | |
[%s:%d:%s] 1 socket recv err[%d] | |
[%s:%d:%s] 2 socket recv err[%d] | |
9UDPSocket | |
Error : %s! | |
9TiXmlBase | |
void TiXmlAttributeSet::Remove(TiXmlAttribute*) | |
void TiXmlAttributeSet::Add(TiXmlAttribute*) | |
const TiXmlNode* TiXmlNode::IterateChildren(const char*, const TiXmlNode*) const | |
const TiXmlNode* TiXmlNode::IterateChildren(const TiXmlNode*) const | |
bool TiXmlNode::RemoveChild(TiXmlNode*) | |
char& TiXmlString::operator[](size_t) const | |
virtual void TiXmlComment::Print(FILE*, int) const | |
virtual void TiXmlDocument::Print(FILE*, int) const | |
virtual void TiXmlElement::Print(FILE*, int) const | |
TiXmlNode* TiXmlNode::InsertAfterChild(TiXmlNode*, const TiXmlNode&) | |
TiXmlNode* TiXmlNode::InsertBeforeChild(TiXmlNode*, const TiXmlNode&) | |
TiXmlNode* TiXmlNode::LinkEndChild(TiXmlNode*) | |
bool TiXmlDocument::LoadFile(FILE*, TiXmlEncoding) | |
TiXmlAttributeSet::~TiXmlAttributeSet() | |
virtual void TiXmlText::Print(FILE*, int) const | |
12TiXmlPrinter | |
12TiXmlUnknown | |
16TiXmlDeclaration | |
9TiXmlText | |
12TiXmlComment | |
12TiXmlElement | |
9TiXmlNode | |
tinyxml.cpp | |
!Find( addMe->Name() ) | |
previous->parent == this | |
index < length() | |
/home/Lishiyong/svn/antsPublic/inc/tinyxml/tinystr.h | |
cfile | |
<!--%s--> | |
lastChild == afterThis | |
firstChild == beforeThis | |
node->parent == 0 || node->parent == this | |
node->GetDocument() == 0 || node->GetDocument() == this->GetDocument() | |
p < (buf+length) | |
q <= (buf+length) | |
q <= p | |
&#x%02X; | |
<!-- | |
sentinel.next == &sentinel | |
sentinel.prev == &sentinel | |
<![CDATA[%s]]> | |
<?xml | |
version=" | |
encoding="%s" | |
encoding=" | |
standalone="%s" | |
standalone=" | |
%s="%s" | |
%s='%s' | |
char& TiXmlString::operator[](size_t) const | |
void TiXmlParsingData::Stamp(const char*, TiXmlEncoding) | |
static bool TiXmlBase::StringEqual(const char*, const char*, bool, TiXmlEncoding) | |
static const char* TiXmlBase::GetEntity(const char*, char*, int*, TiXmlEncoding) | |
static const char* TiXmlBase::GetChar(const char*, char*, int*, TiXmlEncoding) | |
static const char* TiXmlBase::ReadName(const char*, TiXmlString*, TiXmlEncoding) | |
void TiXmlDocument::SetError(int, const char*, TiXmlParsingData*, TiXmlEncoding) | |
virtual const char* TiXmlDocument::Parse(const char*, TiXmlParsingData*, TiXmlEncoding) | |
13TiXmlDocument | |
14TiXmlAttribute | |
tinyxmlparser.cpp | |
cursor.row >= -1 | |
cursor.col >= -1 | |
strlen( entity[i].str ) == entity[i].strLength | |
/home/Lishiyong/svn/antsPublic/inc/tinyxml/tinyxml.h | |
*length >= 0 && *length < 5 | |
<?xml | |
err > 0 && err < TIXML_ERROR_STRING_COUNT | |
standalone | |
No error | |
Failed to open file | |
Error parsing Element. | |
Failed to read Element name | |
Error reading Element value. | |
Error reading Attributes. | |
Error: empty tag. | |
Error reading end tag. | |
Error parsing Unknown. | |
Error parsing Comment. | |
Error parsing Declaration. | |
Error document empty. | |
Error null (0) or unexpected EOF found in input stream. | |
Error parsing CDATA. | |
Error when TiXmlDocument added to document, because TiXmlDocument can only be at the root. | |
[ %s, %d ]=> | |
./src/HBgkProtocol.c | |
gHBgkHandle not open. val:%d | |
HBOpenAnniProtocolHandle() failed. | |
HBSearchThreadRun | |
./src/HBSearch.c | |
Handle HB search begin. | |
create socket failed. %d | |
HBneTautOf8inDp_@ | |
LoadDeviceBaseInfoPacket() error. ret %d | |
Handle HB search end. | |
./src/HBDeviceSetup.c | |
HBHandleSetIpcWorkParam() unhandle..... %d | |
HBHandleSetChannelPicInfo(), unhandle. | |
HBHandleGetChannelPicInfo(), unhandle. | |
HBHandleSaveConfirgParamToFlash(). | |
HP-Protocol save param to flash failed, msg %d result %d | |
HBHandleSetPtzPresetPollParam(), unhandle. | |
HP-Protocol setup ptz preset failed, result %d | |
HP-Protocol ptz cycle failed, msg %d result %d | |
HP-Protocol setup ptz info failed, result %d | |
HP-Protocol get network info failed, result %d | |
HBHandleGetPtzParam()... channel is %s baudrate %d | |
HB-protocol video param: Bright %d Contrast %d Saturation %d Hue %d | |
HP-Protocol set channel color param failed, result %d | |
HBHandleSetNetworkInfo() ip:%s mask:%s dns:%s gateway:%s | |
HP-Protocol get login device info failed, result %d | |
Channel-1 | |
channelNum %d | |
HP-Protocol get channel color param failed, result %d | |
user=%s passwd=%s unamelen=%d pwlen=%d | |
dms_sysnetapi_ioctrl() DMS_NET_GET_USERCFG failed. %d | |
uName %s passwd %s md5 %lu %d | |
2 uName %s passwd %s md5 %lu %s | |
login success. | |
dms_sysnetapi_close() hanbangGK protocol failed. %d | |
dms_sysnetapi_open() hanbangGK protocol failed. %d | |
dms_sysnetapi_start() hanbangGK protocol failed. %d | |
./src/HBMessageLayer.c | |
dms_sysnetapi_ioctrl() DMS_NET_GET_PLATFORMCFG failed. %d | |
server param changed ip:%s port:%d serial:%s | |
support net stream is %d | |
HB-protocol open net video failed. result %d | |
SDVR | |
NET_SDVR_SHAKEHAND failed. | |
malloc send buffer failed. | |
NET_SDVR_SHAKEHAND failed. ret:%d | |
msgid:%d chl:%d streamType:%d sMultiCastIP:%d port:%d | |
stream ip:%s port:%d | |
GXCreateSocket(): register failed. %d | |
create streamSocketfd:%d | |
respond NET_SDVR_REAL_PLAY failed, %d | |
get netvideo error. stop stream server. | |
create thread send net video stream failed. | |
create send netvideo thread succeed. | |
param error. | |
setup unkonw msgType %d | |
HB-Protocol ptz ctrl result %d | |
request I frame channel=%d | |
stop netVideo chl=%d mode=%d port=%d | |
HBHandleRealStop() success. streamType:%d socket:%d | |
chl=%d mode=%d transType=%d multicastAddr=%d port=%d | |
HB-protocol login failed. result %d | |
HB-protocol login result %d, userID %d | |
NET_SDVR_MD5ID_GET respond success | |
dms_sysnetapi_ioctrl() DMS_NET_GET_DEVICECFG failed. %d | |
dms_sysnetapi_ioctrl() DMS_NET_GET_NETCFG failed. %d | |
IPC-HB-IPC291B- | |
HBUserAgentCheckParamThreadRun | |
./src/HBUserAgent.c | |
input param error. | |
HBUserAgentStart()...begin. | |
HBUserAgentThreadRun() begin. | |
HBUserAgentThreadRun | |
Chl- | |
create register server connect failed. ret:%d | |
create register server connect success. socketfd:%d | |
request NET_SDVR_INITIATIVE_LOGIN Register ipc info failed. ret:%d | |
recv register result failed. %d | |
register recv result.cmd head: id=%lu msgType=%x len=%d result=%d | |
register failed. again send register message. | |
register success. | |
recv message head error. socket:%d | |
cmd head: id=%lu msgType=%x len=%d result=%d | |
recv message body error. socket %d | |
recv messager body success. len:%d | |
unhandle..... %d | |
HBUserAgentThreadRun() over. | |
./src/HBService.c | |
HBNodifyAlarm() in param error. | |
nodify alarm to client socket:%d uid:%d | |
HBNodifyAlarm() not find nodify client. | |
HBSessionThreadRun() begin. | |
HBSessionThreadRun | |
GXCreateSocket2() failed. result is %d | |
HBClientInfo malloc failed. | |
create thread failed. socketfd:%d | |
HBSessionThreadRun() stop. | |
HBRequestHandleThreadRun | |
create clientSession success. usrID %d | |
not find Available Client Session | |
HBHandleMD5Code() thread exit. threadId:%d | |
HBHandleRealPlay() thread exit. threadId:%d | |
handle thread msgRunFlag is stop. | |
HBRequestHandleThreadRun over. | |
HBServiceInit():%d | |
./src/GXThread.c | |
pthread_join error:%d | |
pthread_create error:%d | |
pthread_create2 error:%d | |
./src/GXNetwork.c | |
select() error2 nRt:%d errno:%d | |
0 > oneRecv recv() error:%d | |
send() error:%d | |
send() socketfd:%d error:%d | |
GXCheckSocket() error. | |
accept failed. errno %d | |
fcntl(sock, GETFL) | |
fcntl(sock,SETFL,opts) | |
IP address is %s, port is %d maxNum is %d | |
socket() error:%d | |
bind fail ! | |
setup beyond support listen number. | |
IP address is %s port %d | |
connect socket ip:%x port:%x ! | |
GXCreateSocket1 errno:%d | |
GXCreateSocket2 errno:%d | |
GXCreateSocket3 errno:%d | |
GXCreateSocket4 errno:%d | |
state :%d errno:%d | |
0 != state:%d | |
connect() error:%d | |
fcntl return -1 errno:%d | |
IP address is %s, port is %d | |
Bind current Port:%d | |
./src/HBHelper.c | |
random code %d | |
./src/HBPTZ.c | |
ptzCtrl: chl %d cmd %d index %d speed %d | |
unkonw ptz cmd. %d | |
HP-Protocol ptz ctrl failed, msg %d result %d | |
recv ptz ctrl msg have error. | |
./src/HBAlarm.c | |
HBRegisterAlarm(): handle:%d chlNum:%d | |
chl %d alarmType %d action %d | |
./inc/HBStreamHeaderV30.h | |
Stream_GenerateChecksum(): %d %d | |
./src/HBNetVideo.c | |
remove net video failed. %d | |
add net video failed. %d | |
HBVideoThreadRun_New(void *arg). begin. | |
start videothreadrun() failed. param is empty. | |
HBAVStreamThreadRun | |
mediasocketFD %d readvideoFD %d | |
malloc video stream buffer failed. | |
malloc audio stream buffer failed. | |
HBVideoThreadRun_New send netVideo data failed. result %d | |
left=%d right=%d | |
HBVideoThreadRun_New send netAudio data failed. result %d | |
close netVideo stream start. | |
close netVideo stream success. | |
decode_qrcode | |
scan_image | |
scan_image | |
ssid:%s, pCurr:%s | |
pKey:%s, pCurr:%s | |
maocam_qrc | |
processor | |
./src/zbarimg.c | |
zimage | |
Y800 | |
#### %s %d, symbol:%s | |
#### %s %d, addon:%s | |
#### %s %d, data:%s | |
_zbar_get_error_code | |
_zbar_error_string | |
_zbar_error_spew | |
err->magic == (0x5252457a) | |
zbar/error.c | |
<unknown> | |
unknown error | |
FATAL ERROR | |
image scanner | |
output window is closed | |
%s: zbar %s in %s(): | |
%s: | |
: %s (%d) | |
WARNING | |
NOTE | |
no error | |
out of memory | |
internal library error | |
unsupported request | |
invalid request | |
locking error | |
all resources busy | |
X11 display error | |
X11 protocol error | |
windows system error | |
zbar_symbol_xml | |
_zbar_refcnt | |
UPC-E | |
EAN-8 | |
ISBN-10 | |
UPC-A | |
EAN-13 | |
ISBN-13 | |
I2/5 | |
CODE-39 | |
CODE-128 | |
PDF417 | |
QR-Code | |
<symbol type='%s' quality='%d' | |
count='%d' | |
><data><![CDATA[ | |
]]></data></symbol> | |
n > 0 | |
zbar/symbol.c | |
n <= maxlen | |
i > 0 | |
rc >= 0 | |
zbar/refcnt.h | |
zbar_image_write | |
zbar_image_write | |
_zbar_refcnt | |
zbar_image_copy | |
zbar_image_free_data | |
%s.%.4s.zimg | |
%s.%08x.zimg | |
n < len | |
zbar/image.c | |
%s: dumping %.4s(%08x) image to %s | |
%s: ERROR opening %s: %s | |
%s: ERROR writing %s: %s | |
dst->data | |
img->refcnt | |
err_copy | |
err_capture | |
proc_input_thread | |
zbar_processor_set_visible | |
zbar_processor_user_wait | |
_zbar_processor_handle_input | |
_zbar_process_image | |
proc_video_thread | |
zbar_processor_set_active | |
zbar_process_one | |
zbar_processor_init | |
zbar_processor_destroy | |
err_cleanup | |
dst->magic == (0x5252457a) | |
zbar/error.h | |
src->magic == (0x5252457a) | |
zbar barcode reader | |
%s: spawned input thread | |
processor display window not initialized | |
display window not available for input | |
user closed display window | |
zbar | |
%s: processing: %.4s(%08x) %dx%d @%p | |
uncertain | |
duplicate | |
%s: %s%s: %s (%d pts) (q=%d) (%s) | |
unknown image format | |
%s: spawned video thread | |
video input not initialized | |
allocating window resources | |
allocating video resources | |
spawning video thread | |
spawning input thread | |
WARNING: no compatible input to output format | |
...trying again with output disabled | |
window output | |
video input | |
%s: ERROR: no compatible %s format | |
no compatible image format | |
!proc->wait_head | |
zbar/processor.c | |
!proc->wait_tail | |
!proc->wait_next | |
_zbar_processor_unlock | |
_zbar_processor_wait | |
_zbar_processor_lock | |
proc->lock_level > 0 | |
zbar/processor/lock.c | |
_zbar_thread_is_self(proc->lock_owner) | |
w == waiter | |
proc->lock_level == 1 | |
err_capture | |
window_lock | |
window_unlock | |
err_capture_int | |
zbar_window_redraw | |
_zbar_refcnt | |
err_cleanup | |
unable to acquire lock | |
unable to release lock | |
no conversion from %x to supported formats | |
%s: init: src=%.4s(%08x) %dx%d dst=%.4s(%08x) %dx%d | |
%s: scale: src=%dx%d win=%dx%d by %d/%d => %dx%d @%d,%d | |
%s: convert: %.4s(%08x) %dx%d => %.4s(%08x) %dx%d | |
%d.%01d fps | |
err_capture | |
video_lock | |
video_unlock | |
_zbar_video_recycle_shadow | |
_zbar_video_recycle_image | |
zbar_video_next_image | |
_zbar_refcnt | |
zbar_video_init | |
video_init_images | |
video_init_images | |
zbar_video_get_fd | |
zbar_video_request_interface | |
zbar_video_request_size | |
zbar_video_request_iomode | |
zbar_video_enable | |
zbar_video_open | |
err_cleanup | |
zbar/video.c | |
img->srcidx == -1 | |
img->srcidx >= 0 | |
already initialized, re-init unimplemented | |
vdo->datalen | |
!vdo->buf | |
unable to allocate image buffers | |
USERPTR | |
READ | |
%s: pre-allocated %d %s buffers size=0x%lx | |
%s: [%02d] @%08lx | |
video device not opened | |
video driver does not support polling | |
device already opened, unable to change interface | |
%s: request interface version %d | |
already initialized, unable to resize | |
%s: request size: %d x %d | |
device already opened, unable to change iomode | |
invalid iomode requested | |
%s: closed camera (fd=%d) | |
/dev/video0 | |
dump_stats | |
_zbar_image_scanner_alloc_sym | |
_zbar_refcnt | |
_zbar_image_scanner_recycle_syms | |
zbar_scan_image | |
zbar_scan_image | |
qr_handler | |
%s: symbol sets allocated = %-4d | |
%s: scanner syms in use = %-4d recycled = %-4d | |
%s: image syms in use = %-4d recycled = %-4d | |
%s: symbols allocated = %-4d | |
%s: recycled[%d] = %-4d | |
iscn->recycle[i].nsyms | |
zbar/img_scanner.c | |
!sym->syms | |
sym->data_alloc | |
sym->data | |
%s: img_x+: %04d,%04d @%p | |
p == data + x + y * (intptr_t)w | |
%s: img_x-: %04d,%04d @%p | |
%s: img_y+: %04d,%04d @%p | |
%s: img_y-: %04d,%04d @%p | |
_zbar_qr_destroy | |
3';> | |
A/!CC0 CCCCCCCCCCCCCC | |
0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZ $%*+-./: | |
_zbar_qr_decode | |
%s: max finder lines = %dx%d | |
%s: %dx%d finders, %d centers: | |
_zbar_refcnt | |
qr_code_data_list_extract_text | |
ISO8859-1 | |
SJIS | |
CP437 | |
ISO8859-%i | |
./zbar/refcnt.h | |
next > syms->datalen | |
zbar/qrcode/qrdectxt.c | |
proc_poll_inputs | |
proc_sleep | |
err_capture | |
_zbar_processor_init | |
add_poll | |
add_poll | |
proc_kick_handler | |
proc_kick_handler | |
remove_poll | |
p->num | |
zbar/processor/posix.c | |
timeout > 0 | |
./zbar/error.h | |
failed to open pipe | |
%s: [%d] fd=%d handler=%p | |
state->kick_fds[1] >= 0 | |
zbar/processor/posix.h | |
%s: kicking %d fds | |
proc->threaded | |
%s: [%d] fd=%d n=%d | |
err_capture | |
_zbar_video_open | |
not compiled with video input support | |
err_capture | |
_zbar_processor_close | |
_zbar_processor_open | |
_zbar_processor_invalidate | |
_zbar_processor_set_size | |
_zbar_processor_set_visible | |
not compiled with output window support | |
err_capture | |
_zbar_window_expose | |
_zbar_window_attach | |
_zbar_window_draw_logo | |
_zbar_window_fill_rect | |
_zbar_window_draw_text | |
_zbar_window_draw_polygon | |
_zbar_window_draw_marker | |
_zbar_window_end | |
_zbar_window_begin | |
_zbar_window_clear | |
RGB4 | |
BGR1 | |
422P | |
Y800 | |
YUY2 | |
JPEG | |
YVYU | |
NV21 | |
NV12 | |
BGR3 | |
YVU9 | |
RGBO | |
je`RGBQ | |
bmhGREY | |
Y8 | |
I420 | |
RGB1 | |
YU12 | |
YV12 | |
RGB3 | |
R444 | |
BGR4 | |
YUV9 | |
MJPG | |
411P | |
RGBP | |
kE`RGBR | |
cMhYUYV | |
UYVY | |
err_capture | |
_zbar_best_format | |
convert_rgb_resample | |
convert_yuv_to_rgb | |
convert_yuvp_to_rgb | |
convert_uvp_append | |
convert_uvp_append | |
convert_rgb_to_yuv | |
convert_yuv_pack | |
convert_rgb_to_yuvp | |
_zbar_refcnt | |
window_lock | |
window_unlock | |
zbar_negotiate_format | |
Y800 | |
422PI420YU12YV12411PNV12NV21YUYVUYVYYUY2YUV4RGB3 | |
BGR3RGB4BGR4RGBPRGBORGBRRGBQYUV9YVU9GREYY800Y8 Y8 | |
RGB1R444BA81Y41PY444YUVOHM12HI24JPEGMJPGMPEG | |
%s: shared format: %4.4s | |
%s: from %.4s(%08x) to | |
%.4s(%08x)=%d | |
src->datalen >= (src->width * src->height * srcfmt->p.rgb.bpp) | |
zbar/convert.c | |
src->datalen >= (src->width * src->height + uvp_size(src, srcfmt) * 2) | |
srcfmt->p.yuv.xsub2 == 1 | |
src->datalen >= srcn + 2 * srcm | |
src->datalen >= src->width * src->height | |
%s: dst=%dx%d (%lx) %lx src=%dx%d %lx | |
src->datalen >= srcn + 2 * srcn | |
ERROR: image format list is not sorted!? | |
image format list is not sorted!? | |
no input or output formats available | |
%s: %.4s(%08x) -> ? (unsupported) | |
%s: %.4s(%08x) -> %.4s(%08x) (%d) | |
no supported image formats available | |
%s: setting best format %.4s(%08x) (%d) | |
%s %d start lib_gt28181_open | |
src/gt28181.c | |
[FILE]:%s [Line]:%d: | |
src/sip_main.c | |
GB_platformCreate start | |
get DMS_NET_GET_PLATFORMCFG failed | |
stPlatform.enPlatManufacture != DMS_NETPT_GB28181 GB28181 model will exit | |
stPlatform.bEnable = false GB28181 model will exit | |
stPlatform GB28181 server_id= will exit | |
stPlatform GB28181 channel_id = NULL exit | |
stPlatform GB28181 register_addr = NULL exit | |
stPlatform GB28181 register_port = NULL exit | |
stPlatform GB28181 dev_port = NULL exit | |
GB_platformCreate start 2 | |
run pthead_create | |
GB_platformCreate start 3 | |
Notify | |
CmdType | |
Keepalive | |
sip:%s@%s:%d | |
MESSAGE | |
Application/MANSCDP+xml | |
?xml | |
Alarmstatus | |
RecordList | |
DeviceList | |
TeleBoot | |
mxmlFindElement failed | |
reboot step1 | |
reboot step2 | |
reboot step3 ret=%d | |
reboot step4 | |
reboot step5 | |
%s RTSP/1.0 | |
Scale | |
Scale:%f | |
Range: npt=%d- | |
PlayCTL play secale=%f,range=%d | |
PauseTime | |
PauseTime:%d | |
PlayCTL Pause PauseTime=%d | |
AlarmCmd | |
AlarmMethod | |
DeviceControl | |
mxmlloadstring failed %s | |
DeviceInfo | |
DeviceType | |
IPCamera | |
ANNI LTD | |
AN-IPX13-IDR2 | |
V4.3222 | |
MaxCarmera | |
MaxAlarm | |
GuardCmd | |
SetGuard | |
ResetGuard | |
RecordCmd | |
PTZCmd | |
DeviceStatus | |
Online | |
ONLINE | |
devicetime | |
DutyStatus | |
devicestatus.alarminfo[0].alarmstatus=%d | |
ALARM | |
OFFDUTY | |
ONDUTY | |
%d,%d,%d,%d | |
FilePath | |
Secrecy | |
RecorderID | |
RecordInfo | |
SumNum | |
Address 1 | |
handler msg sub catalog start | |
Catalog | |
ANNI LTD ORG | |
Owner | |
Owner 1 | |
CivilCode | |
Civilcode 1 | |
Block | |
Block 1 | |
Parental | |
ParentID | |
SafetyWay | |
RegisterWay | |
CertNum | |
CerNum 1 | |
Certifiable | |
ErrCode | |
2015-7-16T17:21:11 | |
Password 1 | |
Status 1 | |
Longitude | |
171.3 | |
Latitude | |
34.2 | |
handler msg sub catalog end | |
parser_msg msg=%s | |
mxmlFindElement | |
mxmlGetText | |
read is Catalog | |
read is RecordInfo | |
read is DeviceInfo | |
read is DeviceStatus | |
read is DeviceControl | |
mxmlDelete | |
build answer failed | |
get remote_sdp failed | |
media=%s,port=%s | |
video port=%s | |
Play | |
Playback | |
starttime=%s stoptime=%s | |
Download | |
reg build reg failed ret= %d | |
build count=%d ret=%d | |
handler_msg_reg_failure runend | |
sip:%s@%s | |
osip_message_to_str failed ret=%d | |
update alarm item=%d | |
AlarmPriority | |
%04u-%02u-%02uT%02u:%02u:%02u | |
AlarmTime | |
set alarmstatus=%d | |
alarm update end | |
MediaStatus Message recv............................................ | |
MediaStatus | |
NotifyType | |
MediaStatus Message recv Step 1 | |
MediaStatus Message recv Step 2 | |
MediaStatus Message recv Step 3 | |
MediaStatus Message recv Step 4 | |
MediaStatus Message recv Step 5 | |
MediaStatus Message recv Step 6 | |
MediaStatus Message recv Step 7 | |
sip_service Start | |
eXosip init failed ret=%d | |
eXosip listen failed port=%d ret=%d errno=%d | |
regsucc | |
regfailure | |
EXOSIP_REGISTRATION_REFRESHED | |
EXOSIP_CALL_INVITE | |
EXOSIP_CALL_CANCELLED | |
EXOSIP_CALL_NOANSWER | |
EXOSIP_CALL_REQUESTFAILURE | |
EXOSIP_CALL_RELEASED | |
EXOSIP_CALL_ANSWERED | |
EXOSIP_CALL_TIMEOUT | |
EXOSIP_ALL_ACK | |
EXOSIP_MESSAGE_NEW | |
EXOSIP_MESSAGE_NEW end | |
EXOSIP_MESSAGE_REQUESTFAILURE | |
je->tid=%d did=%d rid=%d regid=%d | |
EXOSIP_CALL_MESSAGE_NEW | |
EXOSIP_CALL_CLOSED | |
EXOSIP_MESSAGE_ANSWERED | |
EXOSIP_CALL_MESSAGE_ANSWERED | |
no handler message je->type=%d | |
eXosip_event_free start | |
eXosip_event_free end | |
GTThread Start | |
TE_platformGBT28181 | |
pt_api_ctl_reboot | |
pt_api_settime | |
src/sip_pt_api.c | |
param %s | |
DMS_NET_CMD_REC_CONTROL failed | |
%d ,%s | |
DMS_NET_GET_MOTIONCFG failed | |
step 1 return | |
address 1 | |
%04d-%02d-%02dT%02d:%02d:%02d | |
alarm | |
record type = manul | |
manul | |
record type = unknow type =%d | |
camera | |
%04u-%02u-%02uT%02u:%02u:%02u.%u | |
dwSize:%ld,dwChannel:%ld,bEnable:%d,dwSensitive:%ld,bManualDefence:%d,byMotionArea:%s,byStartHour:%d,byStartMin:%d, byStopHour:%d,byStopMin:%d | |
PTZ control fail!! | |
Not support PTZ command!! | |
pt_api_getGBParam start!!!!!!XXXXXXXXXXXXXXXX@@@@@@@@@@@@@@@@@@@ | |
step 1 | |
step 2 | |
step 3 heat_beart=%d | |
step 4 channel[0]=%s | |
step 8 channid[0]=%s,[1]=%s,[2]=%s,[3]=%s alarm[0]=%s,[1]=%s,[2]=%s,[3]=%s | |
step 9 deviceid=%s | |
step 10 devip=%s | |
step 11 devport=%d,express=%d | |
step 12 pwd=%s regip=%s | |
step 13 register_port=%d,serverid=%s,user=%s | |
pt_api_invite_playback step4 | |
playback ctl cid=%d,did=%d,op=%d,scale=%f,range=%d,pausetime=%d | |
set playspeed=%f data=%d scale=%f | |
param %s,%d,%s,%d,%d | |
%s(%d) REBOOT faile | |
Date: %4u-%2u-%2uT%2u:%2u:%2u.%u | |
sscanf failed str=%s | |
PTZ control fail!!:%d | |
PTZ control success===!!:%d | |
DMS_NET_GET_CRUISE_CFG fail!! | |
auto:%d,per_set:%d | |
pPtzCmd %s | |
stop all | |
=panSpeed %d tiltSpeed %d ZoomSpeed %d | |
right | |
left | |
down | |
up | |
zoom in | |
zoom out | |
----------> FI | |
focus far | |
focus near | |
iris open | |
iris close | |
oper & (0x1 << 7) | |
PTZ_PERSET_POINT %d | |
PTZ_GOTO_POINT %d | |
PTZ_CLEAR_POINT %d | |
add cruise point | |
del cruise point | |
set cruise speed | |
set cruise time (s) | |
start cruise | |
scanSpeed %d | |
to-tag= | |
from-tag= | |
early-only | |
%s;to-tag=%s;from-tag=%s | |
Replaces | |
transport | |
maddr | |
diversion | |
session-expires | |
min-se | |
Min-SE | |
INVITE | |
PRACK | |
RSeq | |
RAck | |
UPDATE | |
timer | |
refresher | |
Require | |
NOTIFY | |
pending;expires= | |
active;expires= | |
terminated;reason=noresource | |
Subscription-State | |
REFER | |
Refer-to | |
3.6.0 | |
217.12.3.11 | |
2001:638:500:101:2e0:81ff:fe24:37c6 | |
dialog | |
eXosip/3.6.0 | |
DTLS-UDP | |
192.168 | |
172.16. | |
172.17. | |
172.18. | |
172.19. | |
172.20. | |
172.21. | |
172.22. | |
172.23. | |
172.24. | |
172.25. | |
172.26. | |
172.27. | |
172.28. | |
172.29. | |
172.30. | |
172.31. | |
169.254 | |
branch | |
REGISTER | |
0a4f113b | |
SUBSCRIBE | |
sip-if-match | |
min-expires | |
PUBLISH | |
%i;refresher=uac | |
Session-Expires | |
content-length: | |
content-length | |
5060 | |
dtls-udp | |
rport | |
SIP+D2U | |
SIP+D2T | |
SIPS+D2U | |
SIPS+D2T | |
SIP+D2S | |
DEBUG: [get_output_if] setsockopt(SOL_SOCKET, SO_BROADCAST | |
DEBUG: [get_output_if] connect | |
DEBUG: [get_output_if] getsockname | |
SCTP | |
auth-int | |
auth | |
md5-sess | |
"MD5" | |
AKAv1-MD5 | |
"AKAv1-MD5" | |
AKAv2-MD5 | |
"AKAv2-MD5" | |
%.8i | |
subscription-state | |
No answer for this Call! | |
Call is being processed! | |
Remote phone is ringing! | |
Remote phone has answered! | |
Call is redirected! | |
4xx received for Call! | |
5xx received for Call! | |
6xx received for Call! | |
New call received! | |
ACK received! | |
Call has been cancelled! | |
Timeout. Gave up! | |
INVITE within call received! | |
Bye Received! | |
Call Context is released! | |
User is successfully registred! | |
Registration failed! | |
New request received! | |
request is being processed! | |
2xx received for request! | |
3xx received for request! | |
4xx received for request! | |
5xx received for request! | |
New request outside call received! | |
request outside call is being processed! | |
2xx received for request outside call! | |
3xx received for request outside call! | |
4xx received for request outside call! | |
5xx received for request outside call! | |
No answer for this SUBSCRIBE! | |
SUBSCRIBE is being processed! | |
2xx received for SUBSCRIBE! | |
3xx received for SUBSCRIBE! | |
4xx received for SUBSCRIBE! | |
5xx received for SUBSCRIBE! | |
NOTIFY request for subscription! | |
Subscription has terminate! | |
New incoming SUBSCRIBE! | |
Incoming Subscription has terminate! | |
SIP-ETag | |
CANCEL | |
SIP/2.0 | |
Max-Forwards | |
<sip:%s@[%s]:%s> | |
<sip:[%s]:%s> | |
<sip:%s@%s:%s> | |
<sip:%s:%s> | |
;transport= | |
SIP/2.0/%s [%s]:%s;branch=z9hG4bK%u | |
SIP/2.0/%s %s:%s;rport;branch=z9hG4bK%u | |
SIP/2.0/%s %s:%s;branch=z9hG4bK%u | |
call-id | |
cseq | |
contact | |
route | |
content-type | |
Subscription Does Not Exist | |
Accepted subscription | |
Dialog Establishement | |
Unknown code | |
event | |
presence | |
Unable to allocate memory for attribute '%s' in element %s! | |
Bad control character 0x%02x not allowed by XML standard! | |
Invalid UTF-8 sequence for character 0x%04x! | |
Entity name too long under parent <%s>! | |
Character entity "%s" not terminated under parent <%s>! | |
Entity name "%s;" not supported under parent <%s>! | |
Bad control character 0x%02x under parent <%s> not allowed by XML standard! | |
Unable to expand string buffer to %d bytes! | |
Unable to allocate string buffer! | |
Bad custom value '%s' in parent <%s>! | |
real | |
Bad %s value '%s' in parent <%s>! | |
Unable to add value node of type %s to parent <%s>! | |
Bare < in element! | |
Early EOF in comment node! | |
<%s> cannot be a second root node after <%s> | |
Unable to add comment node to parent <%s>! | |
Early EOF in CDATA node! | |
Unable to add CDATA node to parent <%s>! | |
Early EOF in processing instruction node! | |
Unable to add processing instruction node to parent <%s>! | |
Unable to add declaration node to parent <%s>! | |
(null) | |
Mismatched close tag <%s> under parent <%s>! | |
Unable to add element node to parent <%s>! | |
Unable to allocate memory for name! | |
Unable to allocate memory for value! | |
Expected '>' after '%c' for element %s, but got '%c'! | |
Bare < in element %s! | |
Missing value for attribute '%s' in element %s! | |
Expected > but got '%c' instead for element <%s/>! | |
Missing close tag </%s> under parent <%s>! | |
Early EOF in declaration node! | |
MXML_ELEMENT | |
MXML_INTEGER | |
MXML_OPAQUE | |
MXML_REAL | |
MXML_TEXT | |
MXML_CUSTOM | |
?xml version="%s" encoding="utf-8"? | |
![CDATA[%s]] | |
mxml: %s | |
; %s=%s | |
username= | |
, realm= | |
, nonce= | |
, uri= | |
, response= | |
, digest= | |
, algorithm= | |
, cnonce= | |
, opaque= | |
, qop= | |
, nc= | |
username | |
cnonce | |
opaque | |
content-type: | |
;%s=%s | |
%s <%s> | |
%s: %s | |
%s: | |
user-agent | |
www-authenticate | |
authentication-info | |
proxy-authenticate | |
proxy-authorization | |
proxy-authentication-info | |
authorization | |
SIP/ | |
multipart | |
application | |
Busy Everywhere | |
Decline | |
Does not exist anywhere | |
SIP Version not supported | |
Conditional Request Failed | |
Unsupported Uri Scheme | |
Extension Required | |
Session Interval Too Small | |
Interval Too Short | |
Temporarily not available | |
Call Leg/Transaction Does Not Exist | |
Loop Detected | |
Too Many Hops | |
Address Incomplete | |
Ambiguous | |
Busy Here | |
Request Cancelled | |
Not Acceptable Here | |
Bad Event | |
Request Pending | |
Undecipherable | |
Alternative Service | |
Trying | |
Ringing | |
Call Is Being Forwarded | |
Session Progress | |
Via: | |
Record-Route: | |
Route: | |
From: | |
To: | |
Call-ID: | |
CSeq: | |
Contact: | |
Authorization: | |
WWW-Authenticate: | |
Proxy-Authenticate: | |
Proxy-Authorization: | |
Content-Type: | |
Mime-Version: | |
Allow: | |
Content-Encoding: | |
Call-Info: | |
Alert-Info: | |
Error-Info: | |
Accept: | |
Accept-Encoding: | |
Accept-Language: | |
Authentication-Info: | |
Proxy-Authentication-Info: | |
Content-Length: | |
accept | |
accept-encoding | |
accept-language | |
alert-info | |
allow | |
call-info | |
content-encoding | |
content-length | |
error-info | |
mime-version | |
record-route | |
undefined error | |
bad parameter | |
wrong state | |
allocation failure | |
syntax error | |
not found | |
api not initialized | |
no network | |
busy port | |
unknown host | |
disk full | |
no rights | |
file not found | |
time out | |
too much call | |
wrong format | |
no common codec | |
z9hG4bK | |
-_.!~*'()&=+$,;?/ | |
-_.!~*'()&=+$, | |
-_.!~*'()[]/:&+$ | |
-_.!~*'()[]/?:+$ | |
%%%02X | |
[%s] | |
?%s=%s | |
&%s=%s | |
sips | |
SIP/%s/%s [%s] | |
SIP/%s/%s [%s]:%s | |
SIP/%s/%s %s | |
SIP/%s/%s %s:%s | |
(%s) | |
realm= | |
, domain= | |
, stale= | |
stale | |
T`00P | |
V++} | |
L&&jl66Z~??A | |
Oh44\Q | |
sb11S* | |
RF##e | |
&N''i | |
X,,t4 | |
v;;M | |
R)){ | |
>^//q | |
,@ ` | |
r99K | |
f33U | |
x<<D% | |
p88H | |
uB!!c | |
z==G | |
D""fT**~; | |
;d22Vt::N | |
H$$l | |
Cn77Y | |
J%%o\..r8 | |
|>>Bq | |
j55_ | |
P((x | |
Z--w | |
P`00 | |
gg}V++ | |
jL&&Zl66A~?? | |
\h44 | |
Sb11?* | |
eF##^ | |
iN'' | |
tX,,.4 | |
RRMv;;a | |
{R))> | |
q^// | |
`@ | |
Kr99 | |
MMUf33 | |
PPDx<< | |
Hp88 | |
cB!!0 | |
DD9. | |
~~Gz== | |
]]+2 | |
fD""~T** | |
Vd22Nt:: | |
lH$$ | |
Yn77 | |
xxoJ%%r\..$8 | |
tt!> | |
ppB|>> | |
aa_j55 | |
UUxP((z | |
wZ-- | |
0P`0 | |
g+}V+ | |
&jL&6Zl6?A~? | |
4\h4 | |
1Sb1 | |
#eF# | |
'iN' | |
,tX, | |
R;Mv; | |
){R) | |
/q^/ | |
`@ | |
9Kr9J | |
M3Uf3 | |
P<Dx< | |
8Hp8 | |
!cB! | |
~=Gz=d | |
"fD"*~T* | |
2Vd2:Nt: | |
$lH$\ | |
7Yn7m | |
x%oJ%.r\. | |
p>B|> | |
a5_j5W | |
U(xP( | |
-wZ- | |
00P` | |
++}V | |
=&&jL66Zl??A~ | |
44\h | |
11Sb | |
##eF | |
''iN | |
,,tX | |
-6nn | |
;;Mv | |
})){R | |
//q^ | |
`@ | |
g99KrJJ | |
33Uf | |
<<Dx | |
!88Hp | |
!!cB | |
==Gzdd | |
+2ss | |
""fD**~T | |
22Vd::Nt | |
$$lH\\ | |
77Ynmm | |
%%oJ..r\ | |
!>KK | |
>>B| | |
55_jWW | |
3"ii | |
((xP | |
)--wZ | |
:,Retry-After | |
Internal SIP Error | |
No dialog for this NOTIFY | |
Failed to build Answer for NOTIFY | |
pending | |
Wrong Lower CSeq | |
Retry Later | |
An INVITE is not terminated | |
Missing tags in BYE | |
Call Already Terminated | |
A pending BYE has already terminate this call | |
MESSAGEs within dialogs are not implemented. | |
A pending NOTIFY is not terminated | |
Just Not Implemented | |
A SUBSCRIBE is not terminated | |
Malloc failed! | |
src/sip_invite_sendstream.c | |
invite_list_add faild ret=%d | |
send_playbackrtp step1 | |
send_playbackrtp step2 | |
sendto ret=%d | |
TE_SendH264ThrFxn | |
malloc failure | |
==========enter TE_SendH264ThrFxnOK ================ | |
socket fail | |
dms_sysnetapi_MBUF_AddReader failure | |
get DMS_NET_CMD_IFRAME_REQUEST fail:%d | |
dms_sysnetapi_MBUF_GetFrame fail | |
!!!!!!!!!!!!!!!!end finish!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! | |
dms_sysnetapi_PlayBackStop err:%d | |
data=%d currplayspeed =%d, dataspeed=%f, value=%d,%f | |
currplayspeed = %d | |
add Enqueue list endmsg.................................................. | |
terminated;reason=deactivated | |
terminated;reason=probation | |
terminated;reason=rejected | |
terminated;reason=timeout | |
terminated;reason=giveup | |
<?xml version="1.0"?> | |
<dialog-info xmlns="urn:ietf:params:xml:ns:dialog-info" | |
version="2" state="full" | |
entity="%s"> | |
initiator | |
recipient | |
confirmed | |
early | |
<dialog id="%s" call-id="%s" | |
local-tag="%s" remote-tag="%s" | |
direction="%s"> | |
<state>%s</state> | |
<remote> | |
<identity>%s</identity> | |
</remote> | |
</dialog> | |
</dialog-info> | |
application/dialog-info+xml | |
Unable to add entity callback! | |
Beta | |
Dagger | |
Delta | |
Dstrok | |
Epsilon | |
Iota | |
Kappa | |
Lambda | |
OElig | |
Omega | |
Omicron | |
Scaron | |
Sigma | |
Theta | |
Upsilon | |
Yuml | |
Zeta | |
alefsym | |
alpha | |
asymp | |
bdquo | |
beta | |
brkbar | |
bull | |
circ | |
clubs | |
cong | |
crarr | |
dArr | |
dagger | |
darr | |
delta | |
diams | |
empty | |
emsp | |
ensp | |
epsilon | |
equiv | |
euro | |
fnof | |
forall | |
frasl | |
gamma | |
hArr | |
harr | |
hearts | |
hellip | |
hibar | |
image | |
infin | |
iota | |
isin | |
kappa | |
lArr | |
lambda | |
larr | |
lceil | |
ldquo | |
lfloor | |
lowast | |
lsaquo | |
lsquo | |
mdash | |
minus | |
nabla | |
ndash | |
notin | |
nsub | |
oelig | |
oline | |
omega | |
omicron | |
oplus | |
otimes | |
part | |
permil | |
perp | |
prime | |
prod | |
prop | |
rArr | |
radic | |
rang | |
rarr | |
rceil | |
rdquo | |
rfloor | |
rsaquo | |
rsquo | |
sbquo | |
scaron | |
sdot | |
sigma | |
sigmaf | |
spades | |
sube | |
supe | |
there4 | |
theta | |
thetasym | |
thinsp | |
tilde | |
trade | |
uArr | |
uarr | |
upsih | |
upsilon | |
weierp | |
zeta | |
zwnj | |
qop= | |
nextnonce= | |
rspauth= | |
cnonce= | |
nextnonce | |
rspauth | |
generate_pes_head_new frame type error %d | |
h264_to_ps cond fail | |
ptzmng_control | |
%s %d, dwCommand=%d,dwParam=%d | |
%s, CruiseStart failed!ret:%d,nChannel:%d,dwParam:%lu | |
### DMS_PTZ_CMD_DEL_POS_CRU point:%u(0x%x) | |
### DMS_PTZ_CMD_DEL_PRE_CRU point:%d | |
CruiseManageInit | |
CruiseStop | |
GetCruiseCfg | |
CruiseManage_UpdateFile | |
CruiseManage_ModifyPoint | |
SetCruiseInfo | |
CruiseStart | |
%s(%d) malloc failed:%d | |
/jb_config/jb_rootfs/channel%d_cruise.config | |
/mnt/nand/channel%d_cruise.cfg | |
CruiseManage_Load: CruiseManage has been inited! | |
CruiseManage_Load: fopen failed:%s! | |
%s, Stop cruise index:%u,chn:%u | |
%s, Error:CruiseManage module have been deinit! | |
%s(%d) fopen failed:%s | |
CruiseManage_UpdateFile: fwrite DMS_NET_CRUISE_INFO err! | |
%s %d, Invalid point param! | |
%s, Cruise module have not been init! | |
%s, Cruise module have been deinit! | |
%s, Start cruise index:%u,chn:%u | |
%s %d, pthread_create failed!ret=%d | |
dms_ptz_get_protocol | |
/usr/netview/app/ptz | |
%s/%s.cod | |
Down_Start | |
Up_Start | |
Left_Start | |
Right_Start | |
FDEC_Start | |
FADD_Start | |
ADEC_Start | |
AADD_Start | |
DDEC_Start | |
DADD_Start | |
Up_Stop | |
SetPoint | |
GotoPoint | |
Rotation_Start | |
Rotation_Stop | |
Light_Start | |
Light_Stop | |
Rain_Start | |
Rain_Stop | |
Track_Start | |
Track_Stop | |
Track_Run | |
Cruise_Add | |
Cruise_Del | |
Cruise_Start | |
Cruise_Stop | |
Address= | |
(%x-%x) | |
%s/pelco-d.cod | |
%s/pelco-p.cod | |
szFileName:%s | |
<%s,line:%d>, errno:%d | |
dms_ptz_control | |
Call point:%lu, speed:%lu | |
jguo### %s %s(%d) | |
PTZ_Control.c | |
PresetManage_UpdateFile | |
PresetManage_SetPreset | |
PresetManage_Free: PresetManage is not init! | |
/jb_config/jb_rootfs/channel%d_preset.config | |
/mnt/nand/channel%d_preset.cfg | |
PresetManage_UpdateFile: fwrite PresetNode err! | |
%s(%d) %s Error | |
PresetManage.c | |
PresetManage_Ioctrl: PresetManage is not init! | |
PresetManage_Ioctrl: para err,chn=%d! | |
PresetManage_Ioctrl: unknown cmd(0x%08x)! | |
PresetManage_Load: PresetManage has been inited! | |
PresetManage_Load: fopen failed:%s! | |
PresetManage_Load: malloc PresetNode failure! | |
PresetManage_Load: fread PresetNode err! | |
%02x | |
#### SYSTEM_MSG_CLIENT: msgsend err:%d %s | |
#### SYSTEM_MSG_CLIENT: msgrcv err:%d %s | |
/etc/systemmsg | |
#### SYSTEM_MSG_CLIENT:key generation | |
#### SYSTEM_MSG_CLIENT: create mes err:%d %s | |
ParseDomainName | |
bool ParseDomainName(char*, size_t&) | |
SRDKGetHostbyname | |
hostent* SRDKGetHostbyname(const char*, char*) | |
8.8.8.8 | |
%s:%s:%d, the length is too short | |
./src/libdomain.cpp | |
%s:%s:%d, New error | |
%s:%s:%d, The dns %s is invalid | |
0 != pHost->h_addr_list | |
0 != pHost->h_addr_list[index1] | |
0 != pParseName | |
0 != pDadagram | |
(%s %d) Failed: open socket failed,%s! | |
(%s %d) Failed: setsockopt failed,%s | |
%$%,%4%<% | |
"H"d"e" | |
P%Q%R%Q | |
S%T%U%V%W%X%Y%Z%[%\%]%^%_%`%a% | |
b%c%d%e%f%g%h%i%j%k%l% | |
%$%a%b%V%U%c%Q%W%]%\%[% | |
%4%,% | |
%<%^%_%Z%T%i%f%`%P%l%g%h%d%e%Y%X%R%S%k%j% | |
6"'"(" | |
"*")" | |
"%" " | |
"+"."a"L"H"=" | |
"`"n"o"d"e" | |
"5"4"B&@& | |
2 3 | |
$t$u$v$w$x$y$z${$|$}$~$ | |
$`$a$b$c$d$e$f$g$h$i$ | |
2!2"2#2$2%2&2'2(2)2 | |
`!a!b!c!d!e!f!g!h!i!j!k! | |
A0B0C0D0E0F0G0H0I0J0K0L0M0N0O0P0Q0R0S0T0U0V0W0X0Y0Z0[0\0]0^0_0`0a0b0c0d0e0f0g0h0i0j0k0l0m0n0o0p0q0r0s0t0u0v0w0x0y0z0{0|0}0~0 | |
1 1!1"1#1$1%1&1'1(1)1 | |
% %!%"%#%$%%%&%'%(%)%*%+%,%-%.%/%0%1%2%3%4%5%6%7%8%9%:%;%<%=%>%?%@%A%B%C%D%E%F%G%H%I%J%K% | |
vLv< | |
LcRb | |
8r}v | |
g~vFdpO% | |
s,dsb, | |
gHrnb | |
O!Xq | |
,g({)] | |
a+R*vl_ | |
[HduQ | |
Uc\S | |
^ek?| | |
PgMb" | |
QKmB\m | |
S^eEu1U!P | |
g2Vno | |
bHTXN | |
O:\d | |
Zi@x | |
z=i O9 | |
pvc$ | |
W%f?i | |
dk:RP | |
QgX[ | |
T{)vSb'YFTyk | |
P4b&^ | |
b9NUS | |
e.lFO | |
S_!cZQa | |
RccH | |
[0R;z | |
op{vI{ | |
$XNO | |
pxQ[ | |
W5uCO8u | |
5XywL | |
X(Tr | |
%Zv` | |
S|bO | |
Q[O&T+Ywe | |
u[vb | |
ybec | |
\/n`g | |
?zJT | |
urRi | |
`Lp/ | |
-WExR_ | |
xvBh | |
i[wm&l | |
qWlIl/Ymg* | |
SimuT | |
N*ja | |
O4s<T | |
T|TNN | |
|Vn'_N | |
TNS>s | |
mOW"k | |
[{^R | |
`LqCfL^M` | |
pp%c | |
`gaIS | |
`ff? | |
fZZB | |
W:gxu=z | |
urlsS | |
OmyBR | |
g9YsO | |
GP<z | |
Nq|Q | |
NeP0 | |
\Fm_l | |
hhVY | |
RYeu | |
Thpgwckw | |
N%m_ | |
pxm=\ | |
[wvf | |
Xle\ | |
ENxp]NR | |
uE\y | |
pgRPcC | |
Z&P7wwS | |
S4nKQ;R | |
Ws`QW-TzzP`T[ | |
WWw{ | |
[>k!SP{ | |
gjm^c | |
x/}!Q | |
^[e8 | |
Qupu | |
R$vAm | |
cdSO | |
yU_F | |
ee\a\ | |
nuSqN | |
fba+o) | |
h_[/w | |
%_s| | |
T}T, | |
xdyd | |
xidT | |
RUa(g | |
vfwgrFz | |
lCNvY | |
HYWS7u | |
b`O?S{ | |
?\OcB | |
}[nUJ | |
l[rmb | |
T'k% | |
UTvP | |
_Cn>m | |
vTu$R | |
kdU> | |
PA\l | |
{OPGr | |
RNjW | |
O\aW | |
FZ4xD | |
|VRQb | |
Wnffm1 | |
hGYgkfu | |
eHyAy | |
O/TQY | |
cp`=murfb | |
MR\oc | |
XL] kIk | |
g[TT | |
bGj9 | |
"l>P | |
dtf0l | |
^<twz | |
p8vtSJ | |
sN]leQ% | |
OceQh | |
Z_tr | |
x@g9R | |
PeU^q[{Rf | |
Igq\ R}qk | |
UUlGb. | |
X$OFUO | |
~bYJ | |
7x3u{T8O | |
u%urrGS | |
ON\v | |
6eKb | |
S&v}Q, | |
ufNN | |
^\/g | |
^pe1oU`7R | |
4law | |
V:O<Or | |
]~g8 | |
\WzB | |
_yY[_c | |
@bLX | |
[yYTXms | |
`plMWJd* | |
umo- | |
pdlXX*d | |
WYyr | |
hTR" | |
|USO | |
mCRI\)Y | |
mkX0u | |
^:cG | |
zvhEcR{ | |
TTQMn | |
bXb1 | |
/_~n | |
x=cZf | |
`:NMo | |
O*O>\ | |
sTOu | |
MO-n | |
\pakS | |
~;T3z | |
LNal | |
h>T4T | |
NBcHS | |
dfir | |
wpf;V8T! | |
-^`N | |
Z>fi | |
XnaN | |
\][!h | |
{HeTi | |
NGkN | |
x^Og'` | |
^\ud`n} | |
cv)w | |
f[tz | |
@T+N | |
c<wM | |
Uf_0q | |
k.Y/ | |
yhglboO | |
u{Q7h>o | |
YvtGd'\e | |
0iNV6 | |
Q_Nu | |
1jtZp | |
lx f | |
R(u}^ | |
_$\1u | |
l8nI | |
?a(`b | |
S8xBg=h | |
U#n-gg | |
-]U\8 | |
zp_3o _ | |
b-f~b | |
#cAw | |
bck?e'^ | |
g/e1T | |
AlKN | |
kgb<P | |
\6Rzf | |
1g*s | |
w1V;NW | |
Q{OO | |
l]y{ | |
bSSLh"t | |
DU@w|pJmyQ | |
m\[+} | |
gZP\OPW | |
l[iV(N | |
SGN-Y;rnS | |
\NiN | |
[[lU | |
S&S.S>S\ | |
fScS | |
R-R3R?R@RLR^RaR\R | |
N"OdO | |
N%O'O O+O^OgO8eZO]O_OWO2O=OvOtO | |
O~O{O | |
O)PLP | |
P.P-P | |
P%P(P~PCPUPHPNPlP{P | |
N=lXOeO | |
Flt|nQ | |
iSzS | |
X)W,W*W3W9W.W/W\W;WBWiW | |
W|W{WhWmWvWsW | |
XDX XeXlX | |
_<YAY7 | |
UYZYXY | |
S"\%\,\4\Lbjb | |
b9cKcCc | |
cqczc | |
cEdAd | |
d&d!d^d | |
d e%e.e | |
TKTRTSTTTVTCT!TWTYT#T2T | |
TwTqTdT | |
TvTfT | |
T"U#U | |
U'U*UgU | |
UIUmUAUUU?UPU<U7UVUuUvUwU3U0U\U | |
V$V#V | |
V'V-VXV9VWV,VMVbVYV\VLVTV | |
VdVqVkV{V|V | |
^1^;^<^7^D^T^[^^^a^ | |
]']&].]$] | |
]X]>]4]=]l][]o]]]k]K]J]i]t] | |
]s_w_ | |
s"s9s%s,s8s1sPsMsWs`slsos~s | |
`5`&` | |
`)`+` | |
`?`!`x`y`{`z`B`j`}` | |
` a&a | |
a+aJaua | |
,N?r | |
b5lTl\lJl | |
lhliltlvl | |
l9m'm | |
mCmHm | |
m+mMm.m5m | |
mOmRmTm3m | |
m\m`m|mcm | |
m+nnnNnkn | |
nSnTn2n%nDn | |
nboFoGo$o | |
n/o6oKoto*o o)o | |
oxoro|ozo | |
p9p5pOp^p | |
P_W_V_X_;\ | |
TP\Y\q[c\f\ | |
*_)_-_t | |
Z Z2Z4Z | |
Z@ZgZJZUZ<ZbZuZ | |
ZwZzZ | |
[2[7[@[ | |
\Z[e[s[Q[S[b[u | |
t*t[t&t%t(t0t.t,t | |
tAt\tWtUtYtwtmt~t | |
LgSg^gHgig | |
gjgsg | |
gwg|g | |
g2h3h`hahNhbhDhdh | |
hUhfhAhgh@h>hJhIh)h | |
hthwh | |
iqi9i`iBi]i | |
ixi4i | |
ificiyi | |
iDj>j | |
jPj[j5j | |
jyj=j(jXj|j | |
j7sRs | |
b"b!b%b$b,b | |
f4f1f6f5f | |
_fTfAfOfVfafWfwf | |
r]rfror~r | |
l!l)l$l*l2l5eUekeMrRrVr0rb | |
$k7k9kCkFkYk | |
q/q1qsq\qhqEqrqJqxqzq | |
r(rlp | |
q>b=bCbHbIb;y@yFyIy[y\ySyZybyWy`yoygyzy | |
_<`]`Z`g`A`Y`c` | |
x9x:x;x | |
x<x%x,x#x)xNxmxVxWx&xPxGxLxjx | |
w-w&w5w8wPwQwGwCwZwhwbwew | |
w:u@uNuKuHu[uruyu | |
z9z7zQz | |
t,u | |
v<v"v v@v-v0v?v5vCv>v3vMv^vTv\vVvkvov | |
zxzyz | |
{G{8{*{ | |
{.{1{ {%{${3{>{ | |
{X{Z{E{u{L{]{`{n{{{b{r{q{ | |
|*|&|8|A|@| | |
||Ie | |
l " | |
2 t:: | |
(M %&S | |
2m T | |
h!l!'!c!@!A!$("(((&(:(,(*(0(.(B!4(2(9(!(%('()(-(1(#(+(/(3(5(6(7(8(&!%!!&"&#&$&%&&&'&(&)&*&+&,&-&.&/&0&1&2&3&4&5&6&7&8&A&B&C&D&E&F&G&H&I&J&K&L&M&N&O&P&Q&R&S&T&U&V&W&X&''!'"'#'$'%'&'(')'*'+','-'.'/'0'1'2'3'4'5'6'7'8'9':';'<'='>'?'@'A'Q'R'S'T'U'V'X'Y'Z'['\']'^'_'`'a'b'c'd'e'f'g'h'i'j'k'l'm'n'o'p'q'W'*!,!.!/!0!1!-!k!d!e!y!f!m!q"r"s"t"u"v"w"x"y"z"{"|"{!|!z!}!J!G!F!L!X!^!O!N!D!E!I!H!R!S!`!_!C!K!W!V!U!Y!T!\!]!Z![!Q!M!P!Y"Z"["\"]"^"_"`"a"b"E"F"G"H"I"J"K"L"M"N"O"P"Q"R"S"T"U"V"W"X"1"2"3"4"5"6"7"8"9":";"<"=">"?"@"A"B"C"D"$)%)&)')()))*)+),)-).)/)0)1)2)3)4)5)6)7)8)9):);)<)=)>)?)@)A)B)C)D)E)F)G)H)I)J)K)L)M)N)O)P)Q)R)S)T)U)V)W)X)Y)Z)[)\)])^)_)`)a)b)c)d)e)f)g)h)i)j)k)l)m)n)o)v!u!x!w!t!s!p!r!q!o!n!b!a!!!"!#!(!)!4!5!6!7!8!9!:!;!>!?!~!2!3!<!=!!$"$#$$$%$&$'$($)$*$+$,$-$.$/$0$1$2$3$4$5$6$7$8$9$:$;$<$=$>$?$@$A$B$C$D$E$F$G$H$I$J$K$L$M$N$O$P$Q$R$S$T$U$V$W$X$Y$Z$[$\$]$^$_$`$a$b$c$d$e$f$g$h$i$j$k$l$m$n$o$p$q$r$s$!%"%#%$%%%&%'%(%)%*%+%,%-%.%/%0%1%2%3%4%5%6%7%8%9%:%;%<%=%>%?%@%A%B%C%D%E%F%G%H%I%J%K%L%M%N%O%P%Q%R%S%T%U%V%W%X%Y%Z%[%\%]%^%_%`%a%b%c%d%e%f%g%h%i%j%k%l%m%n%o%p%q%r%s%t%u%v%$!E(F(G(H(I(J(K(L(M(N(O(P(Q(R(S(T(U(V(W(X(Y(Z([(\(](^(_(`(a(b(c(d(e(f(g(h(i(e"f"g"h"i"j"k"l"m"n";R!6_FrMIU}HOIBO"X;2kS$Xs3(WRG'X@JpG{15RT4+6?K)X*6=AOQ%I-Xv8>Q\cPVa7.4YA<XhM$5*NwVv@Y>/XKDC>1X4CeR.VZN'Uu:&7V@9FREGGT9K3RR?XE>rF2R0OgOiJ@XrBRBiH,GKAhSyUBJ~6!XZSw?FT%;AXeN.>(XGQ)P=XoYvM:?;=%:`Rz2`:6DmO)>$MAAWGqYtYKHiXZR2JJHlXjXFXv=MFp3kXq=i=THS4XBV2PWKJ{KLU68IOZYpX*GnXz4nATRmXGRoXGCvQYVrXuX~<[<NH]7B7sFxXARiN?<|7%7]PZVESo;a;qX!I0N+4sXKIvXWBwX1NyX.2@9#Yi0fAlIEKFK$Yh5+5;NM5!WtWSSeLN:"Y\Y`S}Xp7wW~XzX!YcD6StX]Y{XeEP@pQ[0Q<&Y%Y,Y.Y+Y9J)Y6V^3(Y}@LJ*Y'Y0Y16)9@R@OBBD=lU`2HGk?-Y/YjNn:VGc1Y4m64Y!?^YNG~@8YWK}75Y7Y#1aS9YEP6Y1Y2Y)A3Ys<^P)8c>=Y:Y30BYDY61?Y95s>HLr:PRCYh=+3EYk>FY;Y_D>YAY@Y.U5VcGHYY<JY<YKY+FIYvW#M!=LY<E5MMYGY%3~?58|@x0v4NYOY"4PY_4A0QY5IqORYEAVY.IUYTYWY[K)='FSYXYYYeH\@y6#XJT*TVPd3WUHOb9K?bCR6CMnYpY3556$>kH+HK0+9yAbY<@29X9KPx1dF_>d5HWxQf<^J=<fYgXZDT8=Ha2YT0CaC"Z_H4P|>)EZ9#Z)T$Z{Y,6k7y1|Ye3v>v?1Rd@36~Y}Y;>`F<W!Z9Ar5hAu<U4]A}D8<27o7lY>F-?K;J5I[WP9M<0v3w;J[/:dT65s5VXPHV7PGWX/?;[XXLP.;>kPAuArTU844u3>IPEYE{@p1YXN9=5ZXFV"K/H2IL4L?t9[X\Xg6A<jLwO]X0GP9#=^LJF`X^X_X~0g>#Jt<18n8bXK=dXcX|EeXfX&A0Hl0&9S<qN=[SA/6zV,EY=>[?[x@">M@@[FJ*2BScC+QB[U@C[1?<DZGD[hYWI49pNHT|0R4YPiYK^kY0X/;11W3NXQT3=o?;OPXK7QX%FxG=RRXdD.J'G&X}IgN\;k0*;-P01dW?W%5tBOD)272e12_<U(?,BUX1BTXTN`Z@N4X.C!S#N4<4HQBm>6PaZdG'3r6|Lz@w@9QaQGX^2e@q:HX-TaOIXJXCOx3G>KXL[%HXO~HN2VSf20<QS+K47"7eJ!H\Jd1pPQEE[~5Z?E9d>mA6_5_;VP=YUH0#6I?(L3_7JRSOX6RE:>K>L7_p54_uST3w8:_O:*<u5,M{Cs:t@BMrO8_EO@B9_pB}>_ALMwRM7A_D_q7I0V6T7,:}LT?1KtF(VE_bN33|N54GNp:aN=Q@_t4J3f8;_ED<_=_>_;E?_B_1TC_:GXNXDJ_O_\VI_Z_6NG:N_H_^EkIt:|CW>F_M_XE&UM:L>=S@8dVG_>9'?|AK_L_P_[_e_W_V_IWc_d_ke'RR_)?[TH?T_LO]_JQ^_'07FS_e:_6[M~9UT__lO%0g_Q_FQU_X_Y_\_);`_a_b_f_h_4Sg86Ej_ZI(ADD^?xO\Un_82_:l_A[dQtK=4&0q_FLr_m_i_k_o_p_=;s_t_#;[J(N'`*3&`!`~_YM|_z_P?DWLIx_!0}_{_"`(`H7!F6I2@u_>EDXy_vD#`$`%`%P4`dL1`&?/`9N+`FI.@.`m:0:)`v_3`8`-49`2OH:0`zP,`{Tw_gE-`wS6`7`D`aP<`I`J`>`*`$IA`2`HJC`5`KNCKM`F`B`K`:`?`@`E`G`H`L`;`TKU`V`R`P`N<Q`B8EXjPoBO`=`T`S`W`\`X`vV03lW;KZ`{NY:a`]`-Rb`[`Y`_```^`d`wF,XkTf`IJe`A8g`h`i`c`?:gLj`yOk`BH@=RDl`m`tGDKn`X;6XrRo`EMZ6q`0T'@Q4'Np`r`L9z9<Ms`TFt`2T&Hv`u`w`AM%JZTW[Y[X[g9\[][X5Z[[[!3_[x;7V`[y>;7P[.L2?5;xWS?i?a<3L^[S0kNX79WBF$@9Lg[a[:Fc[h[wEj[i[@?f[e[94,@"Bb[d[MPm[]@r[b6s[R[89+Tl[Q?p[Q[f5k[e?n[q[y[!9#0qBG3o[x[RFt[u[w[v[~[rS:2}[$\{[z[|[`Ey;#\%\CLQ6@]!\"\5Gi6'\&\)\$1L50?_QB6(\zKsk\K~KAL{H*\nL+\S[/\,\3>{J-\JI9D=G.\vTfP+DU6T[Z1U[V[>:@H?JIH3WyIG?x:<R:b&48148DOgY&ObMmY`69R;99b7bs4lL+Lr72XkQ;:'J7MDRd?P<a6E^F^<[YQfFNDn7\7|?`WuF<1H^1=WLJ^I^l5]IB0.E+ELDi<}KC:yegHze}M1W>8hBQH{eJ6K<}Q!fnC$f~e%fWMA7|e}e#f]D(f'fCC^F*f7D"f<Jc=C9&fUP/N)f0f&R*=-f/fQ@LR'<1fvRKW~M^M&B+f,f?=.f3f2f6f8foDHDj>oI7fp6dCiS4f5f"H=f9fEFqM;f<fi;>f:f7@$S?ftICfDfvP=CDCBfAfGf1OtkJfEf^<)I5<SOHfIfNfPfQfKfU5LfOf[DFfMfRfTfSfUfxYVfWfSW]f^fW?PTVWf4oKZfCXNW"POC_f><B9[f'Q":OB+XkJne\fu7fHuD2e~D|K3e,UnSXJ20NKjMj:5e4eZWY9fV(6pMKR&15Jh3sIM?{PRJ6eB;\O,9WT&:gQ|OR<7e]Hm?v1^KE<D<zR\C\?;8BC.:"T^G/Dl2Q9;eHA/U<e>eg4T6BK0Q<5YJb7dI+=>NpW!PYI{6Xfb<>3PIYf"3L^HSM^"RN^M>O^,J|R_3jeaD!>2NrDV>(Fc2S>|GkLl=]N:JAFle<P9UmetJ@MEBoeDBpexeMM=IYR(alSjKqF,a'a)a*a/am2+aZ8-a.a0a:51a3a8aRQ6a5akA7a@T2a:a604ay?9a;a>a<aEV?O=a?aMBk6xSMGe7~>@aAaGag3iF^4BQHaFaEaCaBa@18UDaKaLaJazoSaRa6GIaNaPaTaQaMaOaUaVaWaXaZa[a!N]g(4]V2Q23$9sWIG^>.9WNn2O[:<QRHKM0oOcYm=R1PJ<2'K+7&J#Ox`JU{`z`AE{L1Ay`cV/2DV[5x4!V/Oo0|`!a#3}`~`1C]C"ay7O;#a;D$a%a&a14I8=FjD"2RP[gC;WSDSc9Ob/WlGS124QbrP.BPbb?&SW5Rbj5mC}8.8SEO7TbSbH6yW%MXbVb|J5?9SUbWb.AH@[bZb*@NA\b]b^bH[SQ"M(=C^%X*?M[lRzF*ED^W1._=J1_-9}R%8k:Z3\5EUVCRO!;seretedMuH/5?Gve0lfei915<BhegeieMRjaNP.MeQJ2k1r1mECU0S\a]a[R93K1yMwU^a6>}4_a\:`a2;IBaalP=MbaC5GEcadaySea-Qfa"NgaB5haU;DP`bX1dRabI<LHcb~l}l/_bb>V|M&CCcRVgbhbGSlbl?mbeb@3nDnbCPv:ib^73;,LKKdbfbjbkbwbtbuTsb-EzUBE@2obrb/A<K!5yb1<qbTP9TubV9vbSGpb\W!mxb%m~bQJ5AP;V?c:!K&m#m"mV;'mtP$m^:w6!c26qL'9"O!GR?q6zb{b}b|bUD"cAS'cDG$O)c7:(cZ;#c$c*c&crNFS<;CTzD(m|P%cuC-c/12cB<,c?5iG0c*>oMs;hL/c1c'O.c)N];k5e>R2M391+cQ2,5_9h6kO7cL;GHJP8cn3)mzSdS*m9cbR5c^SP83c6c_74c"@:c8TH4;cE;wIeI=D+m}B[;.??N<c6?o1wT>c-m?c):,m=c@c6:.68PC0.m/mA@Ac3EBc2\0mj8lN'jgPyJVH7OI3RNd=^cr;(j=U]F)j*j,j+j.j-jX=/j>BA4w4';flel?7yKb1glHIhlilVJP^E2zTKFG0r4SHPM8?[?$G4V)@Q^(IoQ$Eg063EHb0v7zEs6RUP3<<-3q>Q0VRcJ%W6M669?[U'8WER^Y?UB@G$;(1jE{E'L'1V5(DS^:Qi3rCw7tV#5p24DiD-@T^h0DE`AU9\>XMN0OMV^P>>WU^PU]0bD#Bp<5S9@!E&2qT(@CJW^|U09-H)KY^=?4F'W0JCDV3R98V|j40f?tLZM?VNBNN"L.PSD25X^uU7<S;$02El4qU}jZ^&MlMfN\^1M&@=W[^F04:SIsDh>62L@pKq<;;75uEf^c^]>_^74]=`^mDFO`5^6ZJt5e^FUa^ML~FEE4Rr>SB=L83S=X?FMZQk4d^]^g^~j0Bb^@V'5t2h^r^m^q^`HaWo^hCaLe2>Rn^k^UN'4+?>>R=i^.T^^j^?@l^s2i8'BA=u^x^+2$4j4&Iv^QKc8w^z^y^BLa0n4:e/Pk2!kt^cIs^Z0!Rw1/Lp^$K*U{^]4&D}^~C!D!_LA|^o>2FE3vH:K~^$_2W73CAKG%2i4+WlD"_#_%_3:&_^@CIY2fG'_\G(_"kSK*_)_A2JE+_\TAH,_p>-_'V7j6kUJ|XD8%9E7~UJ9'PMtP5tCH>7k=0L=2AV1(3R8"IX68k4>}JCG{Us7DN+Us13l_05l76OAzu1PeUSNo=b3+86U=mO69KBP=76l)JTE9l8lCB7l}P:l;leW<l=llF^NH<UH)5I><VgT.QqP8j9j:j5:1Ju?zM@j:0>j%@;j}2wCh;WRtN?j<jCjGP3S:4ACrWQUGJEjDjGjFjgVTOKjN;z=NILj9I~OJjNTMjOjmMIjNjnN^;?3UF0>zNgG'>PjGV@A]TQj>ORjnJ/E50TjSj_t:D)1_eUjoJVjWjXFXjYj;TzG7R|8Bj\2|BxTfLnWBTPSCksE~7Tk7K^kJ@{M/3ZF|k>D4N)D>1}TuJlVSFd6z;`P1IST(HK8>h<I;hn@SPD2e4<hHUE6=hxJ\8uL4@nQ?hBh<:-1\==jChFhKhLhIKe0+<99AhwMJhvNmUVADh6C{9&VHh`JfT@hEhGh9Gc7Ih]?RhWhUh\<O<[h^hZhz1X03DL8bF>HaHOhThVhq9XhuW{D\hi2Qhm<B?MhyVxAq2_hAJYh$Uj1;UNhPh06Sh]h8@wJ(K\Fu@ih#PrhjV`hahyQK:y8q8TTohnhlhp9RLfh&Nr?80qhph@Wdh)M#I8;[=jhbhcheh55ghEGkhmh0=.Wxhuh0Mvh:Ahh7Cp0thwh#9RINC`Nf@sK]L5PaJshl<yh^CeFw9t0XW,<oEDL&i-I"ib@C?~hW9{h$iNR#i2V5W'i7=|h}h!iVM,R2i)i*4;4+i(P%i~3,ic@*i9i8i.izh(i,?1i:i%B/iE8-i\S4i5i7iGiF@Ei0i;iq0<i%U>i?iAiqA6H=iBiCi3i6i1;@iw<DiFiJiNi[2Hi.7KiLiAU#DXia:Ii#STiWiPiOiAGRiYiH3SipOMiw3ViZi4L-OUi\i[i^iQi]i_iJC7GN46;@P#l7E{S$l%l[Fn?&l'l*P8Gh8(l9V}UK4=2dNgFaMu4@K_<bicijQeiy4di3QbJP2hifigi3Viijikili/l9EN6sRn5Y;1lcRcN8D?C>69XH1O1Q1~EP1+C1U$kA::L%k'k(k&k)k+k*k,kOJ5XqC%CxF-kJD.k/k0kU7z71kbG3k$:uQ102k4k*5HBhG5k.K_c@S[Y!M-VsG`Yc;::bc+O`cGI9:4QacjH/9-=X3[N@LhcictM-L3<jckcZP{FZ7_GJRVNdclcrIA3gccFec3mfc3IfE59;Ccc=E$AYBW2mc&;-DpcZ>{cucS:P7MSNVSUA94UXQ9PvG*H42ZCnc|coc(7wctc:7"Evc]E(2|F`D"Wa@yczc}c)Lsc>SC14mqcrcxc:PCFsT~c`='d&dsQ#d)dwH4O(d.deB46r="di:*d,d}6^V2d-d!dn;]M"GIEwA$d3G,===%dGWb2+dC</dk;0d(E1dcU#?:d7d;d=dVFF:K@!84d!T#:~=<d?MyD{OfI?SQO3d8d9diLNLT@5d0A6dPNA;S5sH'=GU,I"8JdLdDQ:R-:T:Cdm5MW@d}O?d\AJLgJWDTLHdGdAdDd-5YSFdyRc44;nI>4l;MQmL5meG(TKdUWBd%=EdfSIdxI>deS~GI6|T32WdBNMd<N[8VdJ?NSlCHEXdDMOdTdUd~:fO?URdPdNdeM*J#@&=SdH8gd4T[doAidgR_d`d*O]KZdQded\HcdgDbdad|3hda5LWfd,;RWOLxkddv9MVYd\dzB^dKBD@PBu12LN5od/FaFud)Bl@]Qnd.Dmdvdtd~B]dpd~JDUqdzQkdldrd+NKE1G:BjdJA6L13{dsdzd}d|dN3:3wdydxdlE=@hT"eD0$e#e$<%e!e~dt1(e)e&e'e*eYF+e-e,e/e.e`90e1ep;alpCF5R;iAnTD>FWVTS2>lAj/B64WQ432H;?@lKV?lAlElf>?LZE<>Fl~1Dl(Uc5Bl6Ac3Cl8KC@~LRAHlf:S@rVLQ>?37UIGlb;LL}=HH)OiMkEi7IQ8:IlJl@;Klbl:1Y79=LlfQMl;HQlSlM;e<Ol7I:CclUUPlsVRlNlTlUl?I(O\P,Q[HVluNlJZlYl>0WlXldl<HGA\l`Q[loT]lF[^l,1_l`l&W@E<k.0t>88/RV0y53X,K]c,Ff0FE9k:k;k@Q#Erj2D5DN@sjADoNpjtj|I#GXL~Nujvj,Og@wj?6xjyjzj{jqj.Hka87lama4WnaoaLSqaq?paR571sara|:ta79Q>|D]:F=uawa@6AO(JvaxU|Sxa|ayazaj@~a!bG@{a}a%bTA#b(b~2"bMCB2'b&b$b)b+bIPmV(C,bWO.bo:`i-b*b+;3T0b/bai1b2b3b!L4b5b~PJBqSuM`gagA>jBdgcgfM5Cbg7;VOaAighgtg#2jgfglgkg:IdUeg)7ggngsgiVmgrgqg`0ugrGE@m@pApgvgvK"h!hAWzgyg{gwg~g}g|gUAYG}ECEmG#h&h%h'hw:xg$hpH*I)he9~Q(h*h-h.h'A/h0h,h4h+h1h5h2h3h7h6hO9,p-p0Fj0?H_MMN1j2j?FI43jgUy]4j5j6jJ80_uIpLzI{ICS&K&8.pB18eoLISW<jIg5PDi5.n-;^g/n)32n1ng=0n7NOEtAN[3nsPTBhF,74nk3{;5n\g6n.=bqhJIRZp[p\pFAm8N>^p1E]pqQ`pL0j=_R_p/4h7fpep#FapbpC4cpnU[LR>2<hpgpdp!2"V8S7>,HjpwQLV[:ip;64M&F!Akpnpmppplp>;op5LrpU3T1sptpvpa4qpwpzpxpup}pyp|p~p!qAN$q#qvA{p]Jq4q11L&q'q,qNU)q3H"q+q(q%q*q)0-q/q1q0q.q"Q2q3qo9G5W0Y0mTD5T=J;'p^8(p(0)pnM*p+p$FeVdqeqsC[SQVhE/SfRAn;05UNQ`<P:x?G8A5LE"JKCBn?D"6lm$C1V`OomNE\6!Jmmpmqm<C4?nmtmrmfU_Csmvm#U#QumPCwmt?l>xmwL[QEWvU|m{mymzm}m&>/K!n=6"n@D~m^=G2C6%n:X#n&niCr3'n$n9O(nwB)n*n+^3FFGuVI52K+n+M,n0U-nDvG[#4,Cfq8JSR*VroX>C=soL6+0/J6m7myN/7s?8mkB0I9mvF3?<mxEPQ)W:m;mbQ?m@mDmHmFmNmhUImGm>miEFFiIRTAmBmCmEmy@!4h9PmQmJmOmxN6KLmMmuORmrA2SKm7Ho<pEVmo55B-0iK.1TmkMb5UmSmWmz5XmYm\mL1vEn<Zm<Lj2[mkDE4u0_mZ@h4ME]mD?^m%D`mamcmWAG;8=bmdmfmemgm>Jjlq@gIklnFllmFmlplfWslqlnlol#WqInKtlrliOvl1F@<ul;5v;wlwY{=;Bxlyl#8zl{l|lmS.Xk@]GL:cP=K:MQ8|1oGVVF?kCuoXCbWwoS3XGmQHVxovo};F3U=FR`;!O|o{oyoL3TI0K~o^0IV}om3UvHN"p!p>5Z<|;e8BD#pkK&p(Q?>nG6q7qU?)48q;MTG-U9q:qOG$ROV;qQ=04=>\4QN_?=qz?<q?q>q@qAq~A"AzJ>U:>9>BU"?/M5q_=K6qVCsDsM8FsGsJ0EsIsqKKs&PJ1HsOsQ5WsRsTsSs{7?1NsJsZ5PsQsUsMsc<}AVsZsLsH5n=\s$7p?~V2Mp4_2XsYs8I]s^sas_scsbs[sj?o3`s)Gr<ks?9ds-2~;cKmsis\9nsesfsjsaBlsoshs}<dOpsgsrs-W*Fssqs(B]8usts[4vswsxs:@i@qE{szsX4~sys|s}s!t#tI;"t$t>2&t%t.<WCaY`@LtQW[7Nt#AIFV43UPtOtQtZKRtAT`V`78A;ASt,>b4TtUt+>Vt[tWtZt}:XtYtb8GL\tZ2SCcT7?]t4Eit5OINXKwKt=OW[@uPjtktltcw17mtkWntyf@>zfl:{fKO|f<T6<}f~fM<RH3N!g?4"g4IY8ID]WZBW7=VFND7&E#g_O$g%g&g7AiWpI8O/VUV'gm0(g)g\IoR->*gs0^Ha=+gFH,gf;x8$Q-ggBx>J=3M.g/gn>ePgKPLL<0g(<wP1gxP2g3gB44g5g~I,N`C7gA1q38g9g[W@U:gLB:W;g<g=gj<eCB@>g?g)<@gAg6gP6BgCgDg:;^5FB`1Eg5TFg?8HgGgl7Igx2JgKgLgMgNgOgPg'SuKQgRgSgTgIIUgVgWgXgYgI=Zg>sW81H?s@sAs^9xMhX1:^B7n#79n8nU0;nVUoWCV=npJ<n>n@n?nrQ<G@Ca8gAFt_PGt[O:HHtItJtKtzY~8qepS`tLNa34qnRathObtLGT5d4dtctetftgt2:?0ht-7mR+RO@<?#k_UHjsqx6#KMDgqhq{8iqD:ETR0jqkqlqmqnqoqqqpqUErqz6tq.RG^JK\3"5"9tDuqvqDA{A0Vwqxq*A8F[>yqO4zq2m1m`K^RAKXUbH_@!<Ak$PbVG6X8@kN8?k&3I9+Vt7J7g<>7FkGk90O?Ek}SHkIkN7BkDkvIWVMU2POk8NPk(531Rk%LVESkQk_ENk$JUk{0z:7XcqJkKkLkMkVk@fYkh?HRWk\kl8Xk:=XP70]k\D,V`4vB9<Zk[k`TjFTD_k'EuY12dkE=bkck,8QMekak3A"FsLfk0@8Rgk/8-8hk;GsMjkkkmkHPrknkqkyH|Qlkik98YOeDokpkZLHMr0vkuk22`8wkl1EL$D%Oyk"lrEzkEI_b~kNM!l[17S\R}k{k<30jTW+tt3AVBViUJ>'t(R(t)t*tK>_S`IaIBsfJrL6b4KhN[V-t.t/t2t=:3tc00t1t"=U26t7tf602OO4t,45t8t9t'M:t;t<tRK=t>t?t^t<Ah<+I^Que3\UR4\,05\Z=9\BX7\sSVI:\6\;\"C<\E\=\_N%VO\M\R\f=+B8\K\N\>\R7E0G\>PA\(;<7L\F\?\[G?Q@\J\P\-NB\C\H\I\T2Q\UK7T[\_\&Lf\gC\\A?Y\z069e\S\D\V\tH`?;I=1"SZ\U\;F^\BW/C67QG)Cb\X\k\T\]\%>W\`\c\d\x\a\"]g\k<D4#Cg2z\r\o\|\n\pRh2WHcH{\m\w\u\#>t\]2s\v<h\D;s@T<i\j\q\v\y\45YHg;~\}\+S!]#]%]qR$]&]'])RI:)]6]1]4]0]NFr@/Il\.]7]p\/]8],]9]3]-]*D(]3@+A*]+]2]q;5](S:];]'CR]<]Q]=9U>z>J:J]E]?]K2C]K]$2U]>]PFP]T]bAF7N]O]D]=]M]QLI]B]HC<F.NL]H]A]F]\B)S*SS]tOxHf]G]`]dBa]W]xVY]X]p8V]OF-6b]y:aTg]P4Z]{?c]_]]]Y5[]\]^]/=d]e]u]ICbKr]aXQFt]tUs]p]l]o]h]nPXHn]i]j]rKm]M16@;<q]w]v]k]nE{]$^#^x]oC{BaU5N}]L2hD_J>Gz]|]~]"^*0N1,^&^6=oH!^%^)^(^'^-^LT3^*^.^Y@!16^1^2^&Q5^/^0^=P4^mJ9^8^7^;^e=X2jC:^:E<^YL*7eT=^?^"DA^>^@^:UB^.r";2B0EGB/riP]S=kf30r1r-Jg:3r5r4rdK:O2r4JORlBCN8rv07r>rO2AQ:r<riT;r6r?r=r9rGrDrFrJrBr@rEr{VAryG_IHrF905CrIrPrVrW;Ur\MkVRrTrr8KrNryB]ULrMrOrSrYr<Sj6qJd7WrXrZr]r[r\rQQQrIMON)Vcr[C`r/@lr^rarhrbrgrfrir_rdrjr,Seru2rr+PurH;yrprvrxrzrsrqr{:{5orwrmrnrkr&s#s"strZH{r%sxC}r's)s$s|r+s*s]B.s0s!s1s,s/s~r-s2s4s(s3s5s7P8syY9s7sdH6s:s;s@4Cn<s=s*Q,tFPPP\QNOV=CQb:iaBRBq92m1Cq@ID3rY%KDqTVEq@tFq,TGq@0AtBt|4[E;LdP`MHqsY;1.O$8JqKqC2QA0WIqLqNqvYaR#TCt9HDtMqOqc?PqTqVqQqQIaEcB|9SqUqS9[qV:}0YqXqRqZqWqlHJM]q=e\q^q_qeOEts=`qaqwN*R{q28{<[9f9YCSJhj@@u>ijjjkjljmjnjojG={u}u~u|ub=!v%4"v#v2lTQjY$v:n2U~S\LDJ@e%v/>)F%ZF<)6<8OH%<&Z'ZVLCH(Z}F5QiR6QG<2=d;)Z*ZHQ+ZmPo6[BOKm7hIC7w>$V,Z-Z@FgW6J)U_KoU.Z_VJ40Z/ZkR1Z2Z3ZTJ4Z+J5Z6ZO3oV7Z0;.58Z9Zn9/QhR:ZC8jOo2;Z<Zk=\NoS=ZsN>ZUSe;?Z5KPK@ZkGnVAZ5EA6BZL7N?CZDZ-KEZw5FZBA;WGZ8LjR1DHZ}5Q;IZ3PJZKZ=NLZMZNZw2QZOZhQPZUCRZSZTZUZ;P%Ry0VZ+GWZw=!CXZYZ}C7LZZ[Z>@WF\Z]Z4G^Z_ZH9m;96xtytcM9u`ksO?;@:%TYatu*1r2uuwuQ:vu2Cyuxu41jU:819F2pTMO\0KUu;JV770L6Fa1:9|Va9!7z<Zj[jyLs9\j{43CQ7X:]jtT^jV<_;_j^A8B_TJW`jajdjbjcj^I38D6ejjJMIM4YbbEfj5@8Wgj,W|HSXMX^TyTDI.SS8`3bIvtU:wt_Wqt08TUO8pFC3rt,3=TwGttstKL$HutcW?E@u;uCuBu:VAu>TDuLuO0x5IuJu\EEuFuGuKu`>Huz8PuSug?r9<uMu7BxLy<NuOuQue6RuUu=uTu;Sl3$LVuWua>Xu_L[uH2YWYuZu\ubu`u_u]uau^udueucL?e85cuhu#Lfugu>uD1?uE5d2luiuW6mujukuZ4jTnuy3ouqupurusumI*9{Gc6IL&j53~Tl9yPmi*WniVBmHd:oipiqiaVrisiuitiviwiaGxiXTyiN=zi{iO=|i(8>A}i21T;u9~i!j"j#jx7-<dJN`/T=O7U$j^U%jAP<9G4Y11@f1g1h1=3hHAe_1IAo4(GXSyF8Q}9uB-SKT|=Be57Ce9;bUx=6T%N,AY3vLFeDeHeJeGeO5HF|5EevJIeTCE1#<7WKMMKJJSLLeKefD!Q7QMePe8MpVOe]5>MQe:6(Md9EJQ3YKlTRej7NeUe~4VeSeTe]R_BF1bS]6lKWevSi1t6ZeXeYe@5ER\e^e]e2G#R[ebTZU`eqWae\1{QbedeceeeXRK5_guZxZvZwZzZOPGDn00PyZJS*:"[qG|Z{Z[I}Z![^W~ZZA%[tS'[$[([<=I@#[&[#V)[-[.[,[B:$?+[*[GT?2/[y90[;3&5<61[u62[I14[3[5[7[6[8[9[:[OSztuGCWdE|t}t{tF>oPS7MT*L"u!u(:~tVK$uR@j3*M%u#u4=(u)uM=8Ca?aK*u&u'upD,u<4mWW4+u.u-u/uQPQC)H0u1u2u3u4u5u7u6u8uI2TSMJo@XV0R?Ap=*8x<FvGvHvIvJvLvKviwMvNvDnEnFnkU$6HnGnInJn%GKnLn07v5MnOnNnF8PnQnRn[6.3SVFD51V8SnTn?TUG{>YN39VnUnXnWn%EYnZn.G[n/G\n'2]n^n_n`nanjWbncnX<dnKSzL,2eAen&G-Cfngnhninjnknlnmnnnonpnqnrntnsnun-MABvnwnxn!Uyn3Ozn{n|n}n!o~n"ou8zC#o$oB=?Ry2%o&o'oxR(o}V)oLF*o+o4A,ozOxK.o-oz3x9/o0obP1o2of7?P3o4o5oqH`L6o7o8o9o:o`U;om4*C<o=o>o?o}N@o`B846Wu=GOCoAoBoDo'6|<b>LCEoFoGoOoHoIoJoBGqoM6KoLoMoF6>CNoPoQoRorUSowDToxDUoVod8w0WoXoYoZo[o\o]o^o5>ao_o`obocoMAdoeofogohoiojokoloX@mo-AnooopobO$3ECEcAIFcU1JN34rHGcPOHcd<IcJcFC"UVDk9ENKcvCLc'7s8R:McNcDTOcPcKQQcRcScTcVQUc{2;@Vc+@WcXcYcZc[c78bZS6dZcZfZnHeZ@7tQuRsUW=hWhZgZ"0SMiZ=8J<=B$BB3jZ*B0D5=^OkZBI]1lZ86:T}3mZITUOcEnZoZpZjAUL]OgS!BqZeKrZfK~Rt8sZ/06OOUmKtZDc%A?v@vAvQD8HcQ[PEQ/<M9toF4:SBv{3Cvq5EvjS'v)Q)v(vcAW@"1mNhP+vvO*vpU,v9Ct;.v-v^DXA*K<O/v0v1v6BT0yE2v`G&v8>2>e5G7??RCfCLXo8y=%QP00w1w,P002w3w4wJGO>7w6w^15w8w9w$NMH+:8h9h:hB>tROTXI3R%6jG|qnO3KkPoggMK9Y6}qd0LK~q$T-BlADF1>!rU<"r#r$rCR5FGM%r1SE?bL&r'rUQn6(r)r_5*r+r|2,r-r'Hg7)l*l+l,l.F-l.lI73J8bOwPwM2QwSwRw;b"<<b=b>b?b@bAb97{R$=NJ%1GKBb|6DHCbH=}1Dbv6EbYDFbZO]9Gb!@Hbv2IbsAJbKbxBLbMbNbWJ8XeYcO%p0\mB&TTM1Q[3}G52?B`f;JafbfT>cf$WUMef]<dfffgfnB>=hffB':ifjfR3iQ%?kfoFlfmfnf-Fof'Ipfqfrf9esftfbBufvfhVwfxfG9;w:w>w<w!:?w@wBwAwDwCwEwFwGwhK_8TwUwVwXwZwWw[wYwWW\w]w^w_w`wK[*Xwem9}?j;IwGFHwJwLwKwMw:NNw'DcSOv3BPvQvRvSvTvVv+1WvXvYvZv[v\v]v^vJO_v`vavbvcvdvp@evfvgvhvivjvkvlvmvnvovpvqvrvsvtv(>uvvvwvxvzHyvzv{v|v}v~v!w"w#w$w%w&w'w(wn1)w*w+w,w-w[A.w/wqD/p&<0pyC8E;Q1p2p3p4p5p<QlQ7p6p'TRM8p:p9p;p<pk8=ph:>p?pi>@pl6ApBpCpDp5HEpFpGptEHpIpJp=wKpLpMpNpOpW:PpQpRpSpTpUpVpXp%SWpYp:u9Bdwewfwgwhw4BjwkwsBptotiBawbwF;dYrJh@$pZ:-G,Dlwmwnwpwowqwtwswrwuwvwimjmkm<v=v>v&6>XD9;X1\sJwwxwyw{wzwG1|w}w~wkF4l]33v4vdA5v6v7v8v9v:v#H;vzA(9hmj9_Y!#"###g!%#&#'#(#)#*#+#,#-#.#/#0#1#2#3#4#5#6#7#8#9#:#;#<#=#>#?#@#A#B#C#D#E#F#G#H#I#J#K#L#M#N#O#P#Q#R#S#T#U#V#W#X#Y#Z#[#\#]#^#_#`#a#b#c#d#e#f#g#h#i#j#k#l#m#n#o#p#q#r#s#t#u#v#w#x#y#z#{#|#}#+!i!j!~#$# | |
& % | |
f"g" | |
"4"B&@& | |
2 3 | |
"*")" | |
'"(" | |
"a"R"j"k" | |
"5"+"," | |
+!0 o&m&j& ! | |
A0B0C0D0E0F0G0H0I0J0K0L0M0N0O0P0Q0R0S0T0U0V0W0X0Y0Z0[0\0]0^0_0`0a0b0c0d0e0f0g0h0i0j0k0l0m0n0o0p0q0r0s0t0u0v0w0x0y0z0{0|0}0~0 | |
%,%$%4%<% | |
%#%3%+%;%K% %/%(%7%?% | |
%0%%%8%B% | |
pOupu | |
AQpS | |
U0[q_ f | |
l)m[t | |
vNz4 | |
W0XDY | |
eZl%u | |
Q.YeY | |
e*j'k | |
vharYN | |
OxSi`)nOz | |
NUO=O | |
bYr;u | |
b9eA | |
hwmppLu | |
d<h8h | |
\}iM | |
c {+j | |
_orR | |
*h\Q | |
[r^y^ | |
h>kSkWl"o | |
8N+T | |
sLv<w | |
WGY [ | |
h_j0^ | |
uHyc[ | |
UThXjp | |
'xug | |
_%`Qe=gBlrl | |
c nZ | |
QTS!S | |
\7_J_/`P`m` | |
cYeKj | |
fmi@\ | |
e#k=k4t | |
]N6P | |
UzzvP | |
Q\H\ | |
hp~Qhl | |
RDQSU-W | |
WQYb_ | |
_u`vaga | |
c:dleofBh | |
nfu=z | |
}K~k | |
P kzlTotzP}@ | |
N9P&PeP|Q8RcR | |
i)j}r | |
xoxy} | |
S{^&_ | |
sC}7 | |
^'_8bEe | |
OHSIT>T/Z | |
PIQlQ | |
W}YT[][ | |
_R`La | |
fmg!h | |
i_l*mim/n | |
vlx?z | |
KQ;RJT | |
V@zw | |
Ds op | |
XZZh` | |
u:}n | |
[i_Mb | |
c=hsk | |
x&xmy | |
dR(WPgj | |
QBW* | |
\OJR | |
T>d(f | |
zV{"}/ | |
vRf N | |
dce_h | |
YP[M\ | |
c/e\[ | |
gbk{k | |
lEsIy | |
OPQW[ | |
cBf!k | |
\hcf | |
enq>y | |
R:\Sg|p5rL | |
[Kb1g | |
s.zk | |
yB}M~ | |
NOOEQAS | |
ncs&~ | |
m]y.~ | |
R SGS | |
TFU1U | |
f-fvf~g | |
m nXn<q&qgq | |
X"[8^ | |
dagVgDm | |
rsucz | |
qT~w | |
;\8O | |
_Na/c | |
u=\N | |
]i]pe | |
ncIg | |
N,p]u/f | |
b?ete | |
wMzM|>~ | |
NHQCS`S | |
]&bGb | |
g\oNq}q | |
U8o6qhQ | |
|LVQX | |
| }D} | |
XOY=r | |
OtPGRsSo`Ic_g,n | |
cX[k[ | |
dQg\ | |
Y*YplQ | |
_ `Ka4b | |
S'Y,{ | |
n'pSSDU | |
SFOT | |
9NXS | |
_e`zf`l | |
Z@w-N | |
j&p*s | |
_5_k_ | |
gnoRr:u:wt | |
iCO,o | |
?ipojW | |
X,[,}*r | |
NNO\PuPCR | |
HT$X | |
xQkX)YU\ | |
T5XWX | |
e\g!n{v | |
%x:x | |
UTXXXWY | |
b-dqgCh | |
uwyI{T{R{ | |
|q}0Rc | |
myrcw | |
z4iJ\ | |
pxVo\ | |
XpzcK | |
~wuWS`i | |
esNeQ | |
l>m6t4xFZu | |
cWeog | |
hsidq | |
/OeRZS | |
Qu`ukQb | |
zVYX | |
4O$RJS | |
g>lNlHr | |
sTuA~, | |
=cifju | |
*SQS&T | |
`Ibyb | |
k5t w | |
_buF{< | |
}~v, | |
thyh | |
W+YfZ | |
`vbwe | |
enfnm6r&{P | |
R;TtV | |
NuOuQ@Xc^s^ | |
g&N= | |
{OP YGr | |
WUcik+u | |
SFT1XIY | |
bgc>e | |
p2x+~ | |
PVRJW | |
d4ggrfwFz | |
XL^TY,g | |
sT*gE | |
R"Y!q_r | |
xd!j | |
2Q(g | |
$\;b~| | |
Y:r6 | |
/UQO*Q | |
m6s7s1uPy | |
ma}= | |
qNuSP] | |
Te\Ng | |
n tYukx | |
`tAX | |
m/}^ | |
a#oIq>| | |
N*N1N6N<N?NBNVNXN | |
N OZO0O[O]OWOGOvO | |
O{OiOpO | |
P*P%P | |
O!P)P,P | |
PCPGP | |
gUPPPHPZPVPlPxP | |
Q!Q:Q7Q<Q;Q?Q@QRQLQTQbQ | |
ziQjQnQ | |
R'R*R.R3R9RORDRKRLR^RTRjRtRiRsR | |
S#S/S1S3S8S@SFSES | |
NISMS | |
Q^SiSnS | |
Y{SwS | |
T=T@T,T-T<T.T6T)T | |
T_TqTwTpT | |
T9U@UcULU.U\UEUVUWU8U3U]U | |
U{U~U | |
UNVPV | |
q4V6V2V8VkVdV/VlVjV | |
W&W7W8WNW;W@WOWiW | |
XrX!XbXKXpX | |
kRX=XyX | |
h%Y,Y-Y2Y8Y>Y | |
zUYPYNYZYXYbY`YgYlYiYxY | |
Z@ZlZIZ5Z6ZbZjZ | |
Z*[6[>[C[E[@[Q[U[Z[[[e[i[p[s[u[x[ | |
\ \"\(\8\9\A\F\N\S\P\O\q[l\n\bNv\y\ | |
]L]R]N]K]l]s]v] | |
^6^7^D^C^@^N^W^T^_^b^d^G^u^v^z^ | |
_ _]_\_ | |
_)_-_8_A_H_L_N_/_Q_V_W_Y_a_m_s_w_ | |
_!``` | |
`+`&` | |
`:`Z`A`j`w`_`J`F`M`c`C`d`B`l`k`Y` | |
aGa>a(a'aJa?a<a,a4a=aBaDasawaXaYaZakataoaeaqa_a]aSaua | |
b!b*b.b0b2b3bAbNb^bcb[b`bhb|b | |
bPc>cMc | |
ckcic | |
d&d6d | |
dgdodvdNd*e | |
e$e#e+e4e5e7e6e8eKuHeVeUeMeXe^e]erexe | |
esg5f6f4f | |
fOfDfIfAf^f]fdfgfhf_fbfpf | |
g&g'g8 | |
.g?g6gAg8g7gFg^g`gYgcgdg | |
g|gjg | |
hFh)h@hMh2hNh | |
h+hYhchwh | |
h"i&i | |
h(i*i | |
i#i!i | |
hyiwi\ixikiTi~ini9iti=iYi0iai^i]i | |
jrj6jxjGjbjYjfjHj8j"j | |
k8k7k | |
GkCkIkPkYkTk[k_kakxkyk | |
l$l#l^lUlbljl | |
l~lhlsl | |
6m+m=m8m | |
m5m3m | |
mdmZmymYm | |
m-nnn.n | |
nrn_n>n#nkn+nvnMn | |
nCn:nNn$n | |
ozoxo | |
ooo[o | |
o|oXo | |
p0p>p2pQpcp | |
qeqUq | |
qfqbqLqVqlq | |
r(r-r,r0r2r;r<r?r@rFrKrXrtr~r | |
s4s/s)s%s>sNsOs | |
Wsjshspsxsus{szs | |
tot%t | |
s2t:tUt?t_tYtAt\titptctjtvt~t | |
u&u,u<uDuMuJuIu[uFuZuiudugukumuxuvu | |
v'v v!v"v$v4v0v;vGvHvFv\vXvavbvhvivjvgvlvpvrvvvxv|v | |
w)w$w | |
w%w&w | |
w7w8wGwZwhwkw[wew | |
w~wyw | |
x&y x*yEx | |
y,y+y@y`yWy_yZyUySyzy | |
y1z;z>z7zCzWzIzazbziz | |
pzyz}z | |
{5{({6{P{z{ | |
{L{E{u{e{t{g{p{q{l{n{ | |
{#|'|*| | |
|7|+|=|L|C|T|O|@|P|X|_|d|V|e|l|u| | |
}E}K}.}2}?}5}F}s}V}N}r}h}n}O}c} | |
~#~!~ | |
~"~F~f~;~5~9~C~7~2~:~g~]~V~^~Y~Z~y~j~i~|~{~ | |
& % P | |
0 0? | |
05 2 | |
f"g"`" | |
"R"a"b | |
<")"*" | |
3+"."5"4"@&B&A& & | |
!%"#" | |
! !i | |
YQ[Q^Q]QaQcQ | |
%<%4%,%$% | |
%m%n%p%o%P%^%j%a% | |
%q%r%s% | |
`!a!b!c!d!e!f!g!h!i!!0"0#0$0%0&0'0(0)0 | |
1 1!1"1#1$1%1&1'1(1)1 | |
NCN]N | |
N?QeQkQ | |
SAS\S | |
N+N8N | |
QENHN_N^N | |
Y'YsYP[Q[S[ | |
\"\8\q\ | |
N-N0N9NKN9\ | |
NCQAQgQmQnQlQ | |
S9SHSGSES^S | |
X)Y+Y*Y-YT[ | |
\$\:\o\ | |
b6bKbNb/e | |
g(g kbkyk | |
l4lkp*r6r;rGrYr[r | |
N;NMNONNN | |
NEQDQ | |
NJSISaS`SoSnS | |
Y.Y1YtYvYU[ | |
^s^|^ | |
bSbTbRbQb | |
e.g,g*g+g-gck | |
l8lAl@l>l | |
u(u)u0u1u2u3u | |
NRNSNiN | |
OIQGQFQHQhQqQ | |
S!S SpSqS T | |
V3W0W(W-W,W/W)W | |
Y7Y8Y | |
Y}YyY | |
YW[X[ | |
^v^t^ | |
bcb[bXb6e | |
f g=g4g1g5g!kdk{k | |
l]lWlYl_l`lPlUlal[lMlNlpp_r]r~v | |
NMOOOGOWO^O4O[OUO0OPOQO=O:O8OCOTO<OFOcO\O`O/ONO6OYO]OHOZOLQKQMQuQ | |
Q%R$R)R*R(R | |
R#SsSuS | |
T>T&TNT'TFTCT3THTBT | |
T)TJT9T;T8T.T5T6T T<T@T1T+T | |
VJWQW@WMWGWNW>WPWOW;W | |
Y][\[Z[[[ | |
[,\@\A\?\>\ | |
_d_b_w_y_ | |
b|b~bybsb | |
b9e;e8e | |
f_gNgOgPgQg\gVg^gIgFg`gSgWgek | |
kBl^l | |
ljlzl | |
lrl~ltl | |
lvp|p}pxpbrar`r | |
s,u+u7u8u | |
&NVNsN | |
OpOuO | |
OiO{O | |
OzOTQRQUQiQwQvQxQ | |
Q;R8R7R:R0R.R6RAR | |
RRSTSSSQSfSwSxSyS | |
SsTuT | |
T{TwT | |
TqTvT | |
TbThT | |
WwWjWiWaWfWdW|W | |
YIYGYHYDYTY | |
Y_[d[c[ | |
\H\E\F\ | |
^&_'_)_ | |
`/`5` | |
`!`'`)`+` | |
b?b>b@b | |
gsgwg | |
gogpg | |
g|gjgrg#kfkgk | |
p,r-r8rHrgrir | |
w>y@yAy | |
yzzyz | |
QNRCRJRMRLRKRGR | |
SWS{S | |
WUYQYOYNYPY | |
\N\O\M\K\ | |
_-_e_ | |
` `%` | |
`(`M`p`h`b`F`C`l`k`j`d`Ab | |
c?eEe | |
e%f-f f'f/f | |
f(f1f$f | |
m2m*mAm%m | |
m;m=m>m6m | |
l9m'm8m)m.m5m | |
p0rrrortr | |
u-uOuLuNuKu | |
xFyIyHyGy | |
O&P%P | |
O-P*P | |
O+P P|Q | |
QVR\RTR[R]R*S | |
YWYXYZY | |
Y Z#Z)Z%Z | |
Z Zk[X\ | |
\Q\U\P\ | |
]-^+^ | |
_Y`c`e`P`U`m`i`o` | |
bNc>c/cUcBcFcOcIc:cPc=c*c+c(cMcLcHeIe | |
eBfIfOfCfRfLfEfAf | |
g!h8hHhFhSh9hBhTh)h | |
hLhQh=h | |
gPh@h<hCh*hEh | |
k#l'l(l&l$l | |
mfmxmwmYm | |
mnmZmtmim | |
p9ryr | |
sTu]u\uZuYu | |
w w(w | |
w0x'x8x | |
x4x7x%x-x x | |
x2xUyPy`y_yVy^y]yWyZy | |
} }"} | |
~NzP}P\PGPCPLPZPIPePvPNPUPuPtPwPOP | |
PoPmP\Q | |
QjRoR | |
S?S@S>S | |
fFUjUfUDU^UaUCUJU1UVUOUUU/UdU8U.U\U,UcU3UAUWU | |
W YbY6ZAZIZfZjZ@Z<ZbZZZFZJZp[ | |
\`\\\]\ | |
]$]'] | |
]8^6^3^7^ | |
^5_7_W_l_i_k_ | |
cwcgc | |
c{cichczc]eVeQeYeWe_UOeXeUeTe | |
e]fZfdfhfff^f | |
p=r}r | |
u"ueufubupu | |
v7w>w<w6w8w:wkxCxNxeyhymy | |
z {({ | |
{,{&{ | |
|F}C}q}.}9}<}@}0}3}D}/}B}2}1}= | |
QrRtRuRiR | |
W/X*X4X$X0X1X!X | |
X`YwZ | |
Zs[q[ | |
\1\L]P]4]G] | |
]E^=^@^C^~^ | |
^<_m_ | |
c^efebece | |
enfpftfvfof | |
fzf~fwf | |
h>k:k=k | |
k.l/l,l/n8nTn!n2ngnJn n%n#n | |
n[nXn$nVnnn-n&non4nMn:n,nCn | |
nNncnDnrnin_n | |
q&q0q!q6qnq | |
r6s%s4s)s:t*t3t"t%t5t6t4t/t | |
t&t(t%u&ukuju | |
u{v|v | |
w]xlxox | |
zI{V{F{P{R{T{M{K{O{Q{ | |
|^}P}h}U}+}n}r}a}f}b}p}s} | |
RwR}R | |
W^XQXXXWXZXTXkXLXmXJXbXRXKXgY | |
Zi]o]L^y^ | |
aNaLaDaMa>a4a'a | |
a7a!b"b | |
d*d-d=d,d | |
imiZiwi`iTiui0i | |
iJihiki^iSiyi | |
i]ici[iGkrk | |
nNqYqiqdqIqgq\qlqfqLqeq^qFqhqVq:rRr7sEs?s>sotZtUt_t^tAt?tYt[t\tvuxu | |
v[wkwfw^wcwywjwlw\wewhwbw | |
{`{n{g{ | |
}[}n | |
WuX~X | |
X%Y"Y$YjYiY | |
][^c^U^W^T^ | |
_F_p_ | |
_Ga?aKawabaca_aZaXaua*b | |
dXdTd | |
dxd_dzdQdgd4dmd{dre | |
iIkLk3l3o | |
n)o>o o,o | |
o1o8o2o#o | |
o+o/o | |
rDsPsdtctjtptmt | |
y.z1z | |
S.V;V9V2V?V4V)VSVNVWVtV6V/V0V | |
XmY [ | |
[d\e\ | |
]b^_^a^ | |
^H_q_ | |
_vagana]aUa | |
a|apaka~a | |
a.bidodyd | |
duewexe | |
jPkNk | |
k?o|o | |
oQofoTo | |
omo[oxono | |
ozopodo | |
noo`o_o | |
rNsWsit | |
u v)v | |
v$v&v!v"v | |
x?z<z@z=z7z;z | |
RYVkVyViVdVxVjVhVeVqVoVlVbVvV | |
[4[x[ | |
f=j8j:jYjkjXj9jDjbjajKjGj5j_jHjYkwk | |
u4v8v:v | |
yMzNzFzLzKz | |
Q!Q2Q | |
X0[*[$[z[7\h\ | |
]k^L_ | |
a2b4b | |
q5rFrpsrs | |
tFvBvLv | |
|.~>~F~7~2~C~+~=~1~E~A~4~9~H~5~?~/~D | |
X8[]_ | |
j_kxk | |
qwsus | |
uVvXvRv | |
yazbz`z | |
z+|'|*| | |
|#|!| | |
|T~U~^~Z~a~R~Y~H | |
rxszs | |
u_vav | |
ykziz>|?|8|=|7|@|k~m~y~i~j~ | |
X@[C[}[ | |
j>p0p2p | |
tbvev&y*y,y+y | |
zL|C|M| | |
}~|~ | |
7Q8Q | |
<Q;Q | |
kakQpXp | |
unvlv | |
y`|_|~ | |
b#e+e*e | |
zd|c|e| | |
X,e^pqvrv | |
kcpl|n|; | |
0A0B0C0D0E0F0G0H0I0J0K0L0M0N0O0P0Q0R0S0T0U0V0W0X0Y0Z0[0\0]0^0_0`0a0b0c0d0e0f0g0h0i0j0k0l0m0n0o0p0q0r0s0t0u0v0w0x0y0z0{0|0}0~0 | |
`$a$b$c$d$e$f$g$h$i$t$u$v$w$x$y$z${$|$}$ | |
BN\N | |
n\s_ | |
l?r1N<N | |
SLS"W#W | |
\;\t\s\ | |
_ bPb | |
l6lCl?l;l | |
V.W*W4W<Y | |
Y{Y~YwY | |
\%\|\z\{\~\ | |
_\b^bdbabfbbbYb`bZbeb | |
e>g9g8g;g:g?g<g3g | |
lFlRl\lOlJlTlKlLlqp^r | |
vuzQ | |
VO;ObOIOSOdO>OgORO_OAOXO-O3O?OaO | |
R ScSrS | |
S0T7T*TTTET | |
T=TOTAT(T$TGT | |
VAWEWLWIWKWRW | |
[(\*\ | |
_x_v_ | |
bqb{bzbpb | |
bwb}brbtb7e | |
eEgGgYgUgLgHg]gMgZgKg | |
lxlglkl | |
lqlolil | |
lflslel{l | |
ltpzpcr | |
s:u9u | |
v=y4 | |
OvOtO | |
OwOLO | |
OkOnO | |
Q5R2R3RFR1R | |
TkTzT~TeTlTtTfT | |
ToTaT`T | |
TcTgTdT | |
VoWrWmWkWqWpWvW | |
WuW{WsWtWbWhW}W | |
Yb[e[ | |
[D\G\ | |
^(_"_#_$_T_ | |
_~_}_ | |
_-`&` | |
`,`"` | |
gvg{g | |
gxgyg | |
t?u@u>u | |
wBy?y | |
yxz{z | |
ODRIR | |
R=S|S | |
]!^"^#^ ^$^ | |
_._V_ | |
_7`9`T`r`^`E`S`G`I`[`L`@`B`_`$`D`X`f`n`BbCb | |
bAeCe | |
e6f!f2f5f | |
f&f"f3f+f:f | |
f4f9f.f | |
k l!l(m4m-m | |
m<m?m | |
m m,m | |
m"m m | |
pArIrJrlrprsrnr | |
t.uGuHu | |
xJyLyKyEyDy | |
{z|x|y| | |
P"P0P | |
O3P7P,P | |
P P'P5P/P1P | |
QaRZRRR^R_RURbR | |
Z-Z.Z | |
Z3Zl[ | |
\V\T\ | |
\)^(^ | |
^3_0_g_]`Z`g`A` | |
cVc,cDcEc6cCc | |
c9cKcJc<c)cAc4cXcTcYc-cGc3cZcQc8cWc@cHcJeFe | |
eJf_fGfQf | |
hIh2h3h;hKhOh | |
h5h+h-h/hNhDh4h | |
h&h(h.hMh:h%h h,k/k-k1k4kmk | |
k%lzmcmdmvm | |
mXmbmmmom | |
m^mgm`m | |
mpm|m_m | |
m/mhm | |
m{m}mum | |
pBrxrwrvr | |
t!u[u_u | |
w"w'w#x,x"x5x/x(x.x+x!x)x3x*x1xTy[yOy\ySyRyQy | |
NpPjPaP^P`PSPKP]PrPHPMPAP[PJPbP | |
PEP_PiPkPcPdPFP@PnPsPWPQP | |
QkRmRlRnR | |
SuUvU<UMUPU4U*UQUbU6U5U0URUEU | |
U2UeUNU9UHU-U;U@UKU | |
X\Y`ZXZUZgZ^Z8Z5ZmZPZ_ZeZlZSZdZWZCZ]ZRZDZ[ZHZ | |
Z>ZMZ9ZLZpZiZGZQZVZBZ\Zr[n[ | |
]&]%] | |
].]>^4^ | |
^6_8_ | |
`2cec | |
cpcSe | |
eefaf[fYf\fbf | |
hmhnh | |
hVioh | |
huhth | |
h|hkhrh | |
hqh~h | |
hxh{h | |
h}h6k3k7k8k | |
q~r{r|r | |
tducu | |
v9w/w-w1w2w4w3w=w%w;w5wHxRxIxMxJxLx&xExPxdygyiyjycykyay | |
z5{G{4{%{0{"{${3{ | |
{1{+{-{/{2{8{ | |
|5}=}8}6}:}E},})}A}G}>}?}J};}(}c | |
UwUEV | |
W)X7X | |
X'X#X(X | |
WHX%X | |
X3X?X6X.X9X8X-X,X;XaY | |
Z{Z}Z | |
\0\7]C]k]A]K]?]5]Q]N]U]3]:]R]=]1]Y]B]9]I]8]<]2]6]@]E]D^A^X_ | |
c2egejede\eheee | |
e|flf{f | |
fqfyfjfrf | |
h9k;k?k<k | |
mFnGn | |
n<n=nEnbn+n?nAn]nsn | |
n3nKn@nQn;n | |
n.n^nhn\nan1n(n`nqnkn9n"n0nSnen'nxndnwnUnynRnfn5n6nZn q | |
p.q1q#q%q"q2q | |
q(q:q | |
qKrZr | |
s0s"s1s3s's2s-s&s#s5s | |
s.t,t0t+t | |
t!t-t1t$t#t | |
t)t t2t | |
t/uoulu | |
vFwGwDwMwEwJwNwKwLw | |
w`xdxex\xmxqxjxnxpxixhx^xbxtysyrypy | |
zJ{;{D{H{L{N{@{X{E{ | |
|X}o}c}S}V}g}j}O}m}\}k}R}T}i}Q}_}N}> | |
QzRxR{R|R | |
WSXhXdXOXMXIXoXUXNX]XYXeX[X=XcXqX | |
\3\q]c]J]e]r]l]^]h]g]b] | |
]O^N^J^M^K^ | |
`IaJa+aEa6a2a.aFa/aOa)a@a bh | |
#b%b$b | |
d d d$d3dCd | |
d9d7d"d#d | |
d&d0d(dAd5d/d | |
d@d%d'd | |
d.d!d | |
fxf gfi_i8iNibiqi?iEiji9iBiWiYiziHiIi5ili3i=iei | |
hxi4iii@ioiDiviXiAitiLi;iKi7i\iOiQi2iRi/i{i<iFkEkCkBkHkAk | |
nGqTqRqcq`qAq]qbqrqxqjqaqBqXqCqKqpq_qPqSqDqMqZqOr | |
r<sBs;s:s@sJsIsDtJtKtRtQtWt@tOtPtNtBtFtMtTt | |
uyuwu | |
vUw_w`wRwVwZwiwgwTwYwmw | |
x{x|y | |
y}yyy | |
zf{d{m{t{i{r{e{s{q{p{a{x{v{c{ | |
]~]|] | |
]X^Y^S^ | |
^D_C_o_ | |
_,a(aAa^aqasaRaSarala | |
ataTaza[aea;ajaaaVa)b'b+b+dMd[d]dtdvdrdsd}dudfd | |
d^d\dKdSd`dPd | |
d?dldkdYdedwdse | |
iJkMkKk | |
n.o oNo | |
o6oso | |
n-o@o0o<o5o | |
qDrSr | |
rCsMsQsLsbtstqtutrtgtnt | |
wow~w | |
y+zJz0z/z(z&z | |
RHVBVLV5VAVJVIVFVXVZV@V3V=V,V>V8V*V:V | |
]i^]^`^\^ | |
a-bndpd | |
dvezeye{e | |
lAo&o~o | |
oboOo | |
ovolo | |
oUoroRoPoWo | |
oaoko}ogo | |
ocowojo{o | |
rXsRs^s_s`s]s[sasZsYsbs | |
t|tyt | |
u~u%v | |
yvk9z | |
SpV`VnVsVfVcVmVrV^VwV | |
]g^h^f^o^ | |
f#g4jfjIjgj2jhj>j]jmjvj[jQj(jZj;j?jAjjjdjPjOjTjojij`j<j^jVjUjMjNjFjUkTkVk | |
risfsgslsesksjs | |
u/v-v1v=v3v<v5v2v0v | |
yDzHzGz | |
~%~$~C | |
&Q%Q"Q$Q Q)Q | |
X-[%[2[#[,['[&[/[.[{[ | |
]l^j^ | |
qssnsos | |
uCvHvIvGv | |
y\z[zVzXzTzZz | |
|-~<~B~3~H | |
8~*~I~@~G~)~L~0~;~6~D~:~E | |
1Q-Q.Q | |
VpY<[i\j\ | |
]m^n^ | |
u\vdvYvPvSvWvZv | |
|&|(|"|%|0|\~P~V~c~X~b~_~Q~`~W~S~ | |
4Q5Q | |
Y=[>[?[ | |
p'p p | |
p+p!p"p#p)p | |
ygzhz3|<|9|,|;| | |
|v~u~x~p~w~o~z~r~t~h~K | |
j<p5p/p7p4p1pBp8p?p:p9p@p;p3pAp | |
r}s|s | |
w%y#y'y(y$y)y | |
ynzlzmz | |
zI|H|J|G|E| | |
|{~~~ | |
:Q9Q | |
VH[G[ | |
kCpDpJpHpIpEpFp | |
w-y1y/yT|S| | |
VqYK[L[ | |
^!e e&e"e | |
lUpVpWpRp | |
ypzqzW|\|Y|[|Z| | |
XrYM[ | |
b)e%e | |
k[pZp"r | |
wg|f| | |
VN[m\-e | |
k_pap]p`p#r | |
kbp&r | |
w9yi|k| | |
Wfpo|< | |
hpep | |
k'rL | |
ipjp | |
ASCII | |
BIG5 | |
UTF-8 | |
CSBIG5 | |
BIG-5 | |
ISO8859-5 | |
ISO8859-1 | |
LATIN1 | |
ISO-8859-5 | |
ISO-8859-1 | |
EUCCN | |
CP866 | |
IBM866 | |
EUC-CN | |
CSUNICODE11 | |
UCS-2 | |
ISO-IR-58 | |
ISO_8859-5 | |
ISO_8859-1 | |
ISO-IR-6 | |
CYRILLIC | |
ISO_8859-5:1988 | |
CSASCII | |
ISO-IR-144 | |
KOI8-R | |
CSKOI8R | |
UCS-4-INTERNAL | |
UCS-2-INTERNAL | |
CSUNICODE | |
CN-BIG5 | |
GB2312 | |
SJIS | |
BIG-FIVE | |
ISO646-US | |
ISO_646.IRV:1991 | |
UCS-2LE | |
UCS-2-SWAPPED | |
SHIFT-JIS | |
ISO-IR-100 | |
MS_KANJI | |
UNICODEBIG | |
ISO-10646-UCS-2 | |
UNICODE-1-1 | |
ISO_8859-1:1987 | |
CSISOLATIN1 | |
ANSI_X3.4-1968 | |
CP367 | |
SHIFT_JIS | |
GB_2312-80 | |
ANSI_X3.4-1986 | |
CP819 | |
IBM819 | |
BIGFIVE | |
CN-GB | |
CSISOLATINCYRILLIC | |
UCS-2BE | |
CHINESE | |
CSGB2312 | |
US-ASCII | |
CSIBM866 | |
UNICODELITTLE | |
CSISO58GB231280 | |
IBM367 | |
CSSHIFTJIS | |
GGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGG | |
GGGGGGG# | |
GGGGGG | |
GGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGGA | |
!"# | |
$%&'() | |
*+,-./ | |
0123 | |
2 6 8 > | |
? @ | |
C E | |
M O | |
U V | |
\ ] | |
^ ` | |
d g h i k | |
m o | |
p s v | |
y z { | | |
# % | |
( ) + , | |
9 : ; | |
> ? @ A C | |
F H | |
J K M O P Q | |
T U | |
V X Y | |
[ ] | |
b d e g i | |
n o | |
q r | |
w y z { | } ~ | |
! !!!"!#!$! | |
'!*! | |
9!=! | |
D!E! | |
H!I!J! | |
O!P!Q!S! | |
T!U!V! | |
X!Y![!]!^!a!b!d! | |
e!f!g!h!i!j!k!n!q!r! | |
s!t!w! | |
x!y!z! | |
{!|!}!~! | |
" "!"""#"$"'"+","-"."/"0" | |
4"5" | |
6"7" | |
>"?" | |
I"J" | |
M"O" | |
S"T"U"V"W"X"Y"Z"[" | |
`"a"c" | |
e"f"g"h"i" | |
j"k" | |
o"q" | |
s"t" | |
w"x" | |
|"~" | |
# #!#"###$#%#&#'#(#*#+#,#-#.#/#0#1#2#4#5#7#8#:#;#<#=#>#?#A#B#C#D#E#F#G#H#I#J#K#L# | |
M#P#S#T#V# | |
\#]#_#a# | |
e#h#i# | |
m#n# | |
o#r# | |
u#v# | |
x#y#z# | |
{#|#}# | |
($)$ | |
+$,$ | |
0$1$3$4$ | |
;$>$ | |
E$F$G$ | |
K$L$M$ | |
P$Q$R$T$W$ | |
^$`$ | |
g$i$ | |
k$m$ | |
p$r$ | |
t$v$x$ | |
|$}$ | |
%!%"%#%$%%%'% | |
(%)%*% | |
/%0%1% | |
B%D%E%F% | |
G%L%N% | |
Q%S%T%U%V% | |
_%`%a% | |
b%d% | |
g%h%j%k% | |
l%m%n%o% | |
r%s% | |
t%u% | |
x%y% | |
z%|% | |
}%~% | |
&!&"&#& | |
$&&&+& | |
/&0&1& | |
4&8& | |
9&:&;&<& | |
A&B&D&E& | |
F&H& | |
I&K&N&O&P&Q&R&S&T&U&V&W&X&Y&Z&[&\&]&^&_&`&a&b&c&d&e&f&j&k&l&m&n&o&q&r&s&t&v&w&x&y&z&{&|&}& | |
' '!'"'$'%'&'''(')'*'+','-'.'/'0'2'3'4'5'6'8'9':'<'='>'?'@' | |
A'B'C'D'E'F'G'H'I'J'K'L'M'O'P'Q'R'S'T'U'V'W'X'Y'Z'['\'^'_'`'a'b'c'd'h'l' | |
n'r' | |
s't' | |
u'v'x'y' | |
{'|' | |
}'~' | |
( ($(%( | |
)(+( | |
-(.(/(0(1( | |
3(6( | |
8(:(;(=( | |
@(A( | |
H(I( | |
Q(R( | |
S(V( | |
\(^( | |
f(h(i( | |
l(n( | |
x(y( | |
*)+),) | |
.)/) | |
1)3)5) | |
7)9) | |
<)=) | |
B)D) | |
E)F)G) | |
K)N)O) | |
R)S)V)X)Y)Z)[)])^)_) | |
`)a) | |
f)g)h) | |
i)j)k)l) | |
o)p)q)r)s)t) | |
u)v) | |
{)}) | |
(*.*/*0*1*2*3*4*5*6*7*9*:*;*<* | |
=*>*A*D*E*F* | |
H*I*J*K*M*N*O*Q*S* | |
X*Y*Z*[* | |
\*]*^* | |
`*c* | |
f*g*h*i*j*k*l*n* | |
o*p* | |
s*t*u* | |
v*w*x*z* | |
)+*+ | |
.+/+1+ | |
4+5+6+7+8+9+ | |
?+@+ | |
B+E+ | |
J+K+ | |
Q+R+T+ | |
U+V+W+X+Y+Z+\+]+^+b+c+e+g+h+i+j+k+l+m+n+p+q+r+t+u+v+y+z+{+|+}+~+ | |
!,",#,$,%,&,', | |
),*,-, | |
.,/, | |
1,2, | |
3,4, | |
:,;, | |
=,>, | |
@,A, | |
D,E,G, | |
I,J,K,L,N, | |
R,S, | |
U,V, | |
W,X, | |
Z,[, | |
a,b,d,e,f, | |
g,i, | |
j,l, | |
n,o, | |
q,r, | |
s,u, | |
v,w, | |
x,y,z, | |
|,~, | |
-!-"-#-$-%-&- | |
,-.- | |
/-0-1- | |
4-5-6-8- | |
?-A-B- | |
I-J- | |
K-L- | |
M-N- | |
P-Q-R- | |
S-T-U-V- | |
X-Y-[- | |
]-^- | |
a-b-c- | |
e-g- | |
l-m- | |
v-w- | |
x-y-z-|- | |
. .!.". | |
#.$.%.&.'.(.). | |
+...0.1.2.5.7. | |
8.9.:. | |
@.B.C. | |
D.F.K.P.R. | |
W.[. | |
`.b.f.k.n.r. | |
v.w. | |
|.}. | |
#7: ; | |
J\P\;gJg | |
5>GF | |
,W-r;s | |
5JoP | |
FERE]E^ | |
O!wexe | |
# w/ | |
%f4fpf | |
wexe | |
))Tg] | |
2,4,6,7,P | |
W'J( | |
"1"O"Y"u | |
'"<" | |
&"<" | |
Kbdd | |
W"w" | |
"O"Y"u | |
&"'" | |
"1"Y"u | |
c"q" | |
,"w" | |
"1"O"u | |
Q"q" | |
Q"c" | |
"1"O"Y | |
,"W" | |
Q"c"q" | |
Q"c"q" | |
Q"c"q" | |
Q"c"q" | |
&"'"< | |
K!K" | |
3#A)i | |
2#A)i | |
6)f^ | |
e#w( | |
6t;w | |
6t;w | |
zF|F | |
7: ; | |
!P"n | |
O#T# | |
+%V&! | |
%S%T%_% | |
&VV< | |
/$S%T%_% | |
%T%_% | |
%S%_% | |
%S%T% | |
TXXX | |
\X_XS | |
n%[& | |
(HON | |
/(',- | |
0'T' | |
'',- | |
!W'J | |
(HON | |
(HON | |
(HON | |
r!Tg] | |
2#3#i | |
h)l)N | |
V)l)N | |
2#3#A | |
V)h)N | |
)?*P | |
0+F+~ | |
t*F+~ | |
t*0+~ | |
x+i5 | |
f+i5 | |
t*0+F | |
`BuV | |
fMgNgOg | |
K!K" | |
,{] | |
#,$,# | |
'/(- | |
'/(' | |
!4,6,7,P | |
!2,6,7,P | |
!2,4,7,P | |
!2,4,6,P | |
W-r;s | |
R-S- | |
,r;s | |
0'T' | |
p#c.d | |
G.Z.k | |
R/x; | |
..Z.k | |
..G.k | |
..G.Z | |
0.x; | |
\/]/^ | |
[/]/^ | |
[/\/^ | |
[/\/] | |
UMvM | |
'KVK^K | |
f+x+ | |
iEjq | |
f+x+i5 | |
f+x+i5 | |
f+x+i5 | |
5JoP | |
5JoP | |
e%k&k*k- | |
O#T# | |
d!?6 | |
8z8n | |
7z8n | |
:cRj | |
`0k1 | |
1S;a;i | |
,W-s | |
,W-r | |
0.R/ | |
='~; | |
='~; | |
/#Y/Z/ | |
='~; | |
>Q?z | |
>?\@ | |
<Q?z | |
>?\@ | |
N@T@g | |
B)bj | |
IA,cJ | |
@,cJ | |
V)h)l | |
D`D | |
C D` | |
"kEu | |
RE]E^ | |
FE]E^ | |
BEFERE^ | |
FERE] | |
>Q?|Ffa | |
0.R/x | |
=Obb | |
?H&Iqb | |
G&Iqb | |
xn{n| | |
,R-S | |
ifzf | |
@2H. | |
G?Hqb | |
>J?J | |
&E#J | |
9h:h=h | |
NBUB | |
NBUB | |
NBUB | |
!G5VK^K | |
G5'K^K | |
G5'KVK | |
=LVLd | |
G5'KVK^ | |
NKNk | |
;0`4 | |
;0`4 | |
LKNk | |
xM'S | |
EN+O2 | |
/M2N' | |
4NJN | |
4UMv | |
MMNa | |
/M2N | |
;OPOu | |
MROS | |
LPwP | |
@PwP | |
fPjPp | |
aPjPp | |
aPfPp | |
TPhPkPn | |
aPfPj | |
@PLP | |
vRwRS\T | |
sRwRS\T | |
sRvRS\T | |
&&ELJ | |
FiU/ | |
J>J?J | |
#7: | |
J>J?J | |
&ELJ | |
EW6X: | |
V6X: | |
xMmN' | |
VEW: | |
VEW6 | |
c%XX | |
c%TX | |
u&_XS | |
u&\XS | |
%S%T%_% | |
P\;gJ | |
J\;gJ | |
sRvRwRT | |
sRvRwRS | |
@PLPw | |
]E`r | |
u&\X_ | |
;0k1 | |
zFfa | |
zFfa | |
Q"c"q" | |
Q"c"q" | |
b!d5d | |
G?H&I | |
scQdRdl | |
b!d5 | |
c%TXX | |
G?H&Iqb[ | |
b!d5d | |
@IAJ | |
@IA, | |
tbQdRdl | |
,"W"w" | |
tbscRdl | |
tbscQdl | |
G?H&Iqb | |
tbscQdR | |
!b~c | |
F=Ob | |
FbZd} | |
Db!d5 | |
,"W"w" | |
O!xe | |
O!we | |
O!wex | |
5%k&k*k- | |
%S%T%_% | |
4fpf | |
%fpf | |
\f]f | |
%f4f | |
%f4fp | |
Iifz | |
+MgNgOg | |
k/1Dp | |
J\P\J | |
J\P\; | |
fNgOg | |
fMgOg | |
fMgNg | |
r!))] | |
r!))T | |
kgqg | |
kgmg | |
mgqg | |
hJ:h=h | |
hJ9h=h | |
hJ9h:h | |
hJ9h:h= | |
\d_iw | |
\d iw | |
iEjq | |
iEjq | |
e&k*k- | |
e%k*k- | |
e%k&k- | |
e%k&k* | |
!2,4,6,7 | |
, ,{]{l | |
, ,{] | |
, ,{] | |
fMgNgOg | |
fMgNgOg | |
fMgNgOg | |
! # % ' ) + - / 1 3 5 7 9 ; = ? A C E G I K M O Q S U W Y [ ] _ a c e g i k m o q s u w y { } | |
" $ & ( * , . 0 2 4 6 8 : < > @ B D F H J L N P R T V X Z \ ^ ` b d f h j l n p r t v x z | ~ | |
! !"!$!&!(!*!,!.!0!2!4!6!8!:!<!>!@!B!D!F!H!J!L!N!P!R!T!V!X!Z!\!^!`!b!d!f!h!j!l!n!p!r!t!v!x!z!|!~! | |
" """$"&"("*","."0"2"4"6"8":"<">"@"B"D"F"H"J"L"N"P"R"T"V"X"Z"\"^"`"b"d"f"h"j"l"n"p"r"t"v"x"z"|"~" | |
# #"#$#&#(#*#,#.#0#2#4#6#8#:#<#>#@#B#D#F#H#J#L#N#P#R#T#V#X#Z#\#^#`#b#d#f#h#j#l#n#p#r#t#v#x#z#|#~# | |
= )bC | |
v!v| | |
!"m?,". | |
|&\? | |
S'o?_' | |
y4(V | |
ub*; | |
_,?{k, | |
<\/M | |
q/:{{/ | |
s0D]z0GW | |
S1Tv[1 | |
~s2z}~2 | |
3:;!3 | |
P 4HU Y | |
Bd P | |
n @1r PDv | |
q!r!x!/!L"k!^!-!y"_!`!!&"&#&$&%&&&'&(&)&*&+&,&-&.&/&0&1&2&3&4&5&6&7&8&A&B&C&D&E&F&G&H&I&J&K&L&M&N&O&P&Q&R&S&T&U&V&W&X&''!'"'#'$'%'&'(')'*'+','-'.'/'0'1'2'3'4'5'6'7'8'9':';'<'='>'?'@'A'Q'R'S'T'U'V'X'Y'Z'['\']'^'_'`'a'b'c'd'e'f'g'h'i'j'k'l'm'n'o'p'q'W'>!=!B!F!G!H!I!w"x"E!D!s"l!m!("n!r"+","*"-"M"N"O"_"P"`":";"]!e"g"g!\"J"K"A"@"i"j"h!h"f"b"b!a"e!f!c"d">"?"<"="]"^"!(,("(-(#(.($(/(&(1(%(0('(<(7(2()(>(9(4(((8(=(3(*(:(?(5(+(;(@(6(#"""%"$"'"&"!"~!{!}!|!~"z!y!j!i!v"u"t"!!"!#!7!9!:!;!R!S!T!U!V!W!X!Y!Z![!)"."L!M!A!!$"$#$$$%$&$'$($)$*$+$,$-$.$/$0$1$2$3$4$5$6$7$8$9$:$;$<$=$>$?$@$A$B$C$D$E$F$G$H$I$J$K$L$M$N$O$P$Q$R$S$T$U$V$W$X$Y$Z$[$\$]$^$_$`$a$b$c$d$e$f$g$h$i$j$k$l$m$n$o$p$q$r$s$+!,!5!6!!%"%#%$%%%&%'%(%)%*%+%,%-%.%/%0%1%2%3%4%5%6%7%8%9%:%;%<%=%>%?%@%A%B%C%D%E%F%G%H%I%J%K%L%M%N%O%P%Q%R%S%T%U%V%W%X%Y%Z%[%\%]%^%_%`%a%b%c%d%e%f%g%h%i%j%k%l%m%n%o%p%q%r%s%t%u%v%&!<!3!4!l0zC7<|Kf>0;e><2TI?M"P/1n3#P$@BRV5:Jg>>NBJ$PfC%Pz6&P]40Cg<'P(P)P5GW57GcFC83KIi*Ph>+P52e6p8iL&VpM}F%455,P-P;N=MhA/Pv;sF2P>1_8^8f0KOJO3:!03P4P5P4K6Pr8g0rK|5}5~5bD<N7P8P9PM?:=N?>P<P=PX5#:p2;P:P)JF;E;>B?PUIg@8!@PBPeBaNJ0AP>2D6gCo7CP$Gk4DPK0`8l4zI2HY5q2gPAElGFP<HbN-?G;w;@2QD"CJPL0cD;=4:$MNB?2IP>MEPGPn:HP$UPPSPQPB2;JKPOPs8H;&4TPLPcNx;MPRPUPNP!6M0"6A2%UyKnIt8/?7NXJ87%Bd2S=YP^P\PWP/BZP]P[P]JXP.?sK_P`P$=mPPG6IhPpJ62lPfPoPRAD8\GG`nP]EcPv8u8aPZ<iPoJMCePq7bPjPdPQNkPAOf6p7pPqPuPN0PJtPsPwPvPdDr7xPE<&BeDv6yP65zP|P5Kf71;wH{PE:CM~P#Q}PD:}=97$QO6!Q"Q/F|A#6MK%Q=N&Q)Q'QNA(Q*Q,Q+QHJ75.Q/Q/2-Qt<2Q1Q0QVP3Q~=4Q%MYL6Q5Q8Q7Q9Q:Qt058;7<={C$6h@w8n9<QHLFEy;;Q=Q^Eu3>Q~F4A@QAQ,Hx8;OBQ&6<J6Bq65Es7CQDQbF_1GQ}:FQF:HQnfIQAKJQKQLQi>L<'4OQMQ=LNQZIPQQQRQ_EVQTQUQSQc:WQjLdNXQ(@YQZ=ZQ|C?N`EER[Q%tE6\Q^Kh=|B^QdF_Q`Q.3aQ'6LFz1P=!HbQaEO?cQ,JZ@"4)4dQfQ:7eQsNi==HLJgQxMhQiQ~EjQ)@~:t7kQI;o9fDmQ'Bo:nQoQ0AlQqQ6Kd9pQu7^:mGtQrQ{Ij>{Qd3uQsQOAwQvQD3`7|Q-NxQ}QzQyQONy8C2tNu=XEe9"R#ReN+O%Rz8$R/3&RVK<D&MYJ'RUp0F(R*43L!>)RgJ-R*@*RP6+R+4.7.R/R0R1R[<{8^LhLwFqJ2R3R5R7R6R8R=2LK|:9RYA">)6:R[H;R<R=R>R$Ih6e0?F?R==i@AR@R#>a8CR>HDR\H4BnB(6nF1CnGNKFRj@57GRHR,1u0m4(BQ5qMKR72JR*6LRqLMRRN|868NRPROR_?91^1QRRR78SRn52;TRtK5:Z5'MPA?H}<G=h<u<v=@HWRC1QA}8E8g6[R!C~B+6$>\RZRD2fB8<K;&1p3f9J;]R^RI5F3g9H5_D%11F>L!9yMGE~8/7gRc6JK]HfR^4aRbRdReR[5a?-JcR_Rc8`R$OrJhDb8p9hR]FlR~<v<oRmR#LjRsRnRqRF8?LrRtRvRp:BOkRiRuRpRxR#SzR~R!S{R>Si:13yR%Sv0$S%0JI"S|RwR}RH:&Sw0/S'S(S%>iK-S,S/E.S+S416:0?)SbE*S"04S#M'>:S9S0SCB1SoB6S&>3SdL<77S8S5S;S2SASFSBS=SGS1AIS"9?S}CCS<S-4n4e3DS@Sv7JSHSSAJ5,6ESt6D1NSLS'TQSKSOSMSL;PSSSXSVSUS2CE2RSTS(>31WS^2bS|>^S\S]S_S=19AYSZSz3aSo4dS`ScS.JUF8HfSeSE3gSjSiShS9GkSlSnSmSpSsSqSoSrStSuSvSwSxSEQ|<M;s2x0DCyS$:O0^?zSG8q9|S{S`J}S!T~S"T#Tw7`1$T&T%T(TZE)T50_:=7OC*T+T-T.Td:Q67K,T/TA:#93T%:3C0TZD4Tb?2T5T?76T7T$9@39T:T;T8T1T<T=TdKk>?T@T>TBT8Gh0VICT}>9<]Gp4k:YK2Fx7OBATDTDBETFTHTiD.4!ta1sJl>HEf:NT=J]Nt2JT:AMTcEIEdE9HMDI:ITv16EKTGTP?OTN=-6PThJ}AFDRTOKSTXT/JWTQTTTVT&:IJYTECu2m>[TZTh9\T^T]T`TUTbTaT_TN;Q?TAcT<@m0dG[DeTdTfTgThTiTQJjTF2kT<M03IRH=?BlTkL4LnTgB7E@BWIoTpT{1:<qTP0rTsTb1q4`FtJwTUAvT@7[KuTeEyTxT{TzT|1|T)>~T%C}T3Jw=[E!U%9"U!G^HQL%G+U85EM/L,V#U&UEB8KJE'UeKJ:*>(UP;O;90H8+@Q0,U-U*U81/4)UEL1I(0y0Q;R0#02U0U<L3U1U/U1?.UZJd87U8U+>4U,OLG6U':9UXI:U5U;L^G;U2I<U@U=UG2?U;<>Uy7LUEUBUdCAUCUDUFUGUr4IUHUJUn>MU\DE1KUNUOURUPUQUR;SU&9TUz;8BUUVUZ;'9RL(5I8WUX3XU9BYU#VZU[U\U^U_U`UpB'1i<B0WA045<(9fE!=14hCjD8095uJB<R5k@<<(MaU\5K:23c1,>H2bUFMI=d<cUs4RF)LdUeUYIgU(4w6fU242?kU!;I2jUhUlUiU+GM\3?mU@NnUpU~CoU#@{;PBw<uIl@M<qU->rUsUS0:BR?tU3F.>/>uUm@0>vUwU`LxUF6"=yUzU\<,?tFT?xH"GI6{Uo5|U~6OF02S;}U"V!V}6~U8E0BKEH<XAzM$V%VVF3;'V(V)Vt4*V+V,2;Ad4-V(LRBY3/V1V_4.V0V3V2V4V5V=F.6e26V;V9VwJvJgE8VT=7Vr?<Vj:BVCV=V33>VGVFVEVAV@VDVxJKVHVJVrMIV?Vs?LV7:MVNVQVPVOVhE:VWVSVRVTVUVXVfNYVVVZV`4[V]V\V^V_Vn@#=d=cA)98:*9p5`V9:J8aV&LCGbV+9,4'CR6T;[IAHcVu4fV!DeVdVgVkDc?U;J@SB"5"DhViVo>9KlVkVjV}IsVZKmVoVkKnVpV(HqV>JrV34?J/GtVuV,944vV88DM)Mv4xV#D-91>_H2>x=lDyJ9E.9\IyVYEB:K8mDC0n=/9GMzV{VQG|VwN-O~V}VG3!W$W%W#W@I3>'W&W"W(W)W*W-W+W,W.Wd1nD/Wz7v26G0W{F[J1W.O2W@J5W!P1P0<uF6W]5$Dz07W&J09PCoDoL98L88W9W?We<%D/6:W+IFC;W<W06=W>W@WvEAWBWCW4W3WDWA7'IL:7I&DKIEW4>F1FWGWrL`HJW}1,@IWHWB7TBNWLWKW'Ne8y=MWLE>=@FQWPWOWRWf8SW|I[=TWyHAF'D0EUW+54?,Iw4&GVWV;:K;K~1[WiCXWw2-XZW0GYWWWz9]WcWiWaW\EfW]I`WeWgNW;UB^W^5hW-@e1bWx2gW16dWjWlWvWtWqWpWxNrW2619z=yWkWoW_Wz2sWuWQC(:82mWxWwW36)Bf3C7nWzW}W!X=<'XpD{W%Xy2#X$X~W"Xg8*M54Y1&X:G-0aH\W,X0XeL)XiE.Xp>/XWFGO+X1X{9K@T0*X(XZA|W4;FB=X[A8X5X6Xf<9X<X7X%=:X4X|L{L>X?XU03Xr6&064;XCXBXGXHXFXIXAXEXJXKX@X|;DXVB292X5?XXiJNXOXPXWXVX}K74TXE743QX8NSXV0UXLXRXYXD7MX]M+M\X`X~AyNaX^X[XZX_X0J4FF7bX]XcX{712kX84iXjX):hXfXeXlXdXnX{2pXoX(DsXqXgX|7rXvXuXwXtXxXyXzXjJ|X{X?=.@f2|2}X?0L@~XCl!Ya7"Yo@#Y$Y:5%Y&Y'YWBM8aL<Kj=(Yp@=nbHj<M:)YGB'JqB,Y*Y-Y+Y.Y1J70^IcH/Y2Y5>;50Y7Y6>1YDG^M3Y4Y8YjE5Y39^@FY4HrBdH-ZzJqDuK;Y!2jCDY4C>YEY@YGYCYBYoG<Y}2:Yq5sB6Y9Y49[@7>AYRGr5H3g3!?IYNYJY}7OY";i9&==Y};LYX;MYD0HY)Ds546KY'0C:6?rDTHQY^A*B+;RYTYPYaJ=D\A{JN<`Y_Yx?~7YY9>hF1GWY]Ax<\Y8>VY[YSGUY!7]3]Y+NN:5CZY\@59d?f1<AXYE5G7OD^Y_AaYcY7BiYdYfYAIsDgY,MHM94.0eYbYx4g1hYIMlY;BsYmYjYqYSYnYrYBHkEkYoYH7q:]@wY&EtY`KuYvYNL"@b7}Y5;zYyY2G5F1E{Y|YoIEG#;q@PKI3%Z~YJM'Z#Z$Z`A"Z?Y&Z!Z+Z,Z'E.Z$;)Z<5/Z(Z3Z2Z1Z4Z6Zq>5Z9Z7Z8ZpY;Z:ZxY<Z0ZY;=Z>Z@Z?ZAZ~269|J/@N8CZFZRI_5EZDZTGGZ56IZHZ:46;XFI7t?JZ0@(E_IKZLZMZ8J]UF@LIX:eHCHMEANOZP<PZ60T6M@`IQZB;GC[;7?RZ}Jw1\;UZSZVZ9NTZ{@WZ2BXZz4ZZYZ[Z\Z{4|F6Cl5];aA\=00]Z"2aZ79`Z+::>_Z;>@L*:W0N@fZ1@G1U=fKr:<>'@eZcZdZkC&[jZ~;89hZiZ8?gZ/;lZkZpZqZmZ"3nZoZUHaIJ7rZ2@=>RCG6sZwZK2tZvZuZk=HCE0xZyZ*DqNC;kJ=K"[{Z~Z}ZzZ![^F|Z#[l=$[KMxG%['[([)[J6H199*[+[q=bAXR>A=AXBG:rPn7-M~J~I,[s:?D-[/O>K+D.[|4/[0[ZL$LvK\K%;2[k<QK4[7[6[y4`53[5[8[y?{MI0`:<B]<s>;[NE9[+B:[r>]L<[=[hMB[:9UG?[lE^ZbZO5GGA[>>DHG[zH>[D[C[O@mKSNgKL2^;HOF[u?E[@[O8L[J[M2H[N[T[HBAJV["IU[pG?K;4w@@=SD.MQ[P[R[O[W[M[K[S[I[lCxLF<t:::oKA3NDJFI1r@4@*7Y[;9|3[[t3a[^[s@K3,:J3O:\[e7K7mEZ[F0][_[M6,7<4K5b[y:qK7;c[0Io[32d[u[e[BNl[_Gt[g[40i[<9k[j[f[q[?>mTh8|Mh[tD#3-:`[p[a3n[r[nE~42\ILw[}4~[@K!\#\'\y[*CoE+\|[(\"\9?,\3@*\=4POv[&\X0x[:L}["?GDs[%\z?/\q3!81\z[0\)\{[-\.\?\NF$\;\=\XDLMvI8\JB>\?A5\B\A\oF@\jFD\7\H6:\]=`G<\K64\6\3\0OZ39\C\53g:]1T\1OW\:?V\U\R\F\c\E\X\P\K\H\I\Q\"tN\=9HDdAL\G\J\MMjKO\Y\a\Z\g\e\`\_\PDeA]\[\b\h\uHn\i\l\f\tC8I\\d\@>OLx\k\"8#2_3S\A>p\w\y<r3.Cm\r\v\66L5t\!5KFs\u\o\q\`3IC|\z\i8y\!]X[{\}\~\,](]m[']&]#]j\%]$]*]&O-]{6)]+]'H.]2]/]sM0]^\3]4]516]g7!<U6$2_M8]7]:]=5V6>4=]<]>]N27C?]?4A]@]B]C]D]_;5@!:pIbJDOu;P:rNE]F]`;G]H]J]I]XK^=l<D;K]M]#?L]N]O]P]Q]R]T]S]U]%2JCV]&;L3W]BELT#5X]Y]lJhKGFZ]fH{HSL[]]]\]_]^]a]a;1Lb]c]$5d]f]e]e?9IJ1EHuDA=a5FH.<h]@4x1rFg]>9SCi]q]j]ABb5r]h7%5p]n]k]`M@DYFl]t]s]#7-2;:m]o]WKtBwK|]}]O2(J}L!^#<B>x]~]h176u]z]t@qGgHw]!Ky]$^"^{]"KHGc5%EmC%^#^YBv]K1NM0^/^v@,^lM6F&^EDL1?9)^'=.^-^(^+^h3*^IG.Nt>u@6^4^MI1^3^:1@92O=3bIaM$3;?5^:^C>0M7^2^8^^NsEBF63U1>^A^CNdMH^B^?^TNE^J=G^L^qEJ^D^8CK^@^F^M^|0C^N^<?_=%J.:;^I^:E6@i3Q:D>=^B=L7<^R^m=:8a^[^t5OEV^_^/02192X^,BO^Q^A9b^]^U^\^+LZ^^^P8E>9CT^/MW^P^rES^Y^QO><~Kc^.Ho^;8`=e^/NB9r^n0p^d^j^l^OMg^.Ei^q^k^GLf^"<~^j3h^m^n^lBZBv^|^z^)E#_w^x^`^y5:I?<w93Ot^"_i1fAyGA4zN!LRD{^}^2A!_y^s^C4i7/_*_x@c3a=3_,_,D)_YDL_&_%_._(_'_-_!@$_0_1_B46_5_7_:_CE4_8_c7yB2_;G9_>_<_?_B_;_j9(G9^tM=_A_uB@_+_ioE_I_G_C_D_H_F_NIN_K_J_M_TFO_uCmB%@P_R_Q_u^S_gFT_P2tE%3d5^<R:'Of?j1V_U_Y_:C\_W_[_Z_@EY0uN^_(1`___]_X_#Kb_a_k1d_2Jc_5LG>3AF>{Nj_y@f_k_l1i_aGe_h_H>QHl_Q<z@o_g_'7m_PMp_&tO=q_r_.Gt_u_3GuEw_y_UNv_x_m1s_[Sz_gA8;|_{_$?YR}_!`n_~_"`zG#`$`%`&`^D(`'`)`*`_<cIlL+`,`VA$<-`.`/`RJGH0`WG-D1`g2m5FL6L424ORK*J7@2`CF#83`T:5`4`6`7`8`>59`:`$8HH<`u>;`86=`?`>`@`Q8A`i6@A}9C`D`B`m<HF96F`,CE`5ObGI`K`H`TLJ`L`DNP`O`vC-G%8N`M`1M2MQ`n1v9b;R`S`U`C=W`V`X`M3Z`Y`\`[`<8(NL6&2j6a4hN^```a`Q2]`9;AD_`d`n<b`>7IHc`~`i`=8e5f`}M0NvBh`j`VNW6|HJGk`m`p`l`o`j8M1q`p?n`\Nt`$tr`u`g`s`<:v`w`~Mx`y`e`z`D4%<{`|`}`;1!a;I"a$4#a$a%a'a(a&aSI*a)a,a+a-a.a0a/ay92a1aE4S?<E3a8@:;y14aQMcJ5aDE3MC9=?KC4R.Dh26a7a<a:a9aBZ&38aZ0*HJH1N=a;a\C&@+H-I?a,NM7@a>aVHAaBa[0v>GaDamFCa&5JaEaFaIaHa%IBAAA?5KaLaMaOaNaV1WahHQaSaUa>?VaTa@<PaRaBII>YaXaZa&</:wE[aKD]a!N\aiAbadaeaTCca`a^a_aaahafagaiakalamanajapaoaqaENtarasab4~LJJvauawaxa|ayaza{a}a~a!b"b#b/HPE$brG4I%b&b*E'3D9'b(b)b);+b*b,b-biH.b/bis0b1b2b.;3bVG_KN1W14b6b5bpE9@9]7bAL8bF4WH9b:b;b\LUL>DjA=bb=J>@b?b>b}HG4)8FbCb??2LBbDbEbAbGbHb/Dc4eCIbJbMbg?DFNbSKKbLbQbPbObSbRbTbVbUbMJV=FNWb7FXbYb]b[b\bZb^b_b`bab7LbbpLcbNCjGk6;Cdb:6P@eb=:fbgb&8U:ibVEV:N5$KKGWE\9kbK>2NE9'8#Hmbobk8nbvDqb73lbjH01l:ROpbrbKJY@tbubsbN3{bzb'<|bwb}bxbXHvbyb"c!caK~bk0$c#cL>%cCA'c&c(chbjb*c)c(<iNR<+c77@5'5c;4M1c0cDA-c/cK=@?.c,c*GM><IW:xE2c3cIcX6=O5A4cR2wD!J5cz56c8c9c)G:c;c<cY6S2EF(=d;=c)=J2CI>ckHEAAcBciGA??caC@cN>\0)5CcxDDcG@-L#IEcFcUCGNHcGco<Jcp0McKcT2N7LcF9r9fJNcTKPcQ@O1:2,0OcQcRcw>ScO3Ucj7f5Vcu6Wc|@MF`@u:XcbCkAZc\cYc[c"7]c&7g5RM_c`c.1ccv3bcacec^cfc)NgchctTjcickclc5NmcopO>ncocW=8Fpc(Cqc<Crc%6?Q]C3<H4sc"dvch5uc$dtcP>xcyc+Ezc^3Z?dI|chBwc{c}c{:&d.I&HyEZ6%d#d5H~c^C{EzEv:8d(d*d-d.d+d,d)d'd!dOJU25d2d7d6dsG'L;;0d9d4d3d/d1dI4=C}@"H>d$Ha@;dOH?dSJ[C:d<d=d@dD<FFEdDdAd6OJdNdKdGdHdMdBdURIdCdLdRdJ4OdPdQdTdSdvHUd|NmJZdWdVdR@Yd[dXd_d\d]dFd^d`dadFJbdbLN6)7cd4Jh?0Ldd3NtGFA4GM=@0idgded!4Q>jdhdfdndmdldkdodpd:@qdsdrdR88Aud|Etdvd5JlAG9wdHNydzd{d|de;}dO7j5*5!esLH9~d$efL<G3Ic=#eS<I9f;i56J"eGABKw:g;]D'e_NY:(eB?*eR>0:)e*=>8HA%e+e&eP7.e2ek7-e6eJ9mM<03ek50e1e}E/e,e(3d@(88e5e7e4eQ73B9enAFeBe<e@ez<]0;eCeGeK9VLVD=eEe:e>C?e=0JL>e[6lHmAPNo=neHe~@DeIeKeyDNeJeTJK4KL^0Me}NLeo1lFOeVePeWeSe{GJ<UeReXeQeD=%KL=Te`e\e_e]eae[eAeS@KH^eYe!AR7+=%?6AdefegeceeeZebejeiezK+7helekeoeqe<;mereseteze;Eveuewexeye{e|eL4}e~e!f"f#f$f%f&f(f'f)f*f+f.f,f-fa:S7VC3Hp=MGmH/fmX0f2feM1f4f3fSM5f~H6f9f8f7f:f27"AA5>f;f<f?f@f=f)1'2BfCfDfbM,=FfEfi?GfHfIfe4M4JfKf]KcMTM7OM9NfT<MfOf)<QBPfL9WLQfRfSfTfUf*<mLWf?CVfYfXfZf;@[f\f9J]foA^f_f~Nbfaf`f0Dcf&?dfef8Offgfifhf%HyF>O)HkfS>*IlfjfN4T8h;nH*8CKofmfN9O9i0h:YG_0tf@CXG[Bvfrfufpfsf&KU8}0qfxfyf9F;6&g=Gi;<6H@FO.LwfT@S5zf|f{f}f&C>G1D#g"g~fU?eI%g$gP9SO5g)g*gp<(gx9'g+g2D"J#A\B/g0g,g-g.gQ96g2gfIlK(I1g4g3gDK7g8g7A9g;g?g<g:g?G=g>g22Eg@gAgBg!BDgCgFgGgHgC?i2IgWN+<-=j;WCJgKg11LgMgNgOgPg=6*ZQge@RgK<Sg0PTg^J\4$AX=qI.=UgR9VgLHdgXgIBuG?8Wg%AYgzD[gZg]g\g^g`g_gO4agbgcg1:INeg'?p1fggghgr0igjggIG<lg)320kgngNGD?V2'K]7\6mgj2#4q1rgjN]BDI~gW2|gzgqgogpgc<l6wCQFQ1tgsgygugxgPLwgX2}3{g}gT7#h,h-h+04hq0+h*h%h$h"h!hcC{B'h&h)hpAU7A1(hS9qA:h;hY2.28h.h6h=h7h5hvg3h/hP41h<h2h>h0h|GiM9hOhGh{?F5]6Bh[2T>EhZ:QEJhnJAhZ2V8)IKh?hHhRhChDh:FIhFh(KLh`0@hNhMhkGTh_h~3bhPhUhnM^hUM*NxCk3rIdh!F10]hYhrASh[h`h,G*0XhahxI\hWhU>/=,<XLGIghphZhw3x>ehjhsAfhmh_CnhVMch83ihlh,Lohhhkh)K!OshzhrhC<QhNJ"Lyhxhthuh61whqhUDvh~0"BCJ{h!iYH~hV>I<#i>6$iyI}hVh|hOO"FsI+i1i2i%ivG/i'i)i3i(i,ir1eF-i0i&i&A*i';E?07tLyLr=7i5iNO4iuM6i8i9i<i:i#F;iMH.is==iBitAAi"iCiIA>i@i?i1]"]EiDivM<bFiGiHiW8T5Ji]Qu5:Ns6KiLinCMizF:0c2RiSiNi=;OiBGPiQi[iUiXiTiViWiX<YiACV7B3\i?3ai]i`i:H^i_iHIZHbi}Blihik2fi*KgidieijimikiiiciXCti*Lrisinipiqioif@9Oxiyi!j*?{i~iviui"j\2|i#j}izi3DwihG'j;M&j%j.j(j0jfM3j*j+j/j2j1j)j,j=j6j4j5j:j;j*3B59j$j8j<j7j>j@j?jBjAjZiFjCjDjEjGjl7IjHj0=T9'^JjQ=93KjR1W>LjU9Mja0=INjj?UjRjoCSjPj^6OjVj67^B\jXj5BWjZjQj[j]joHYj^j`jS8TjA0_j[:vNajbjuA"Ncj5MdjejdJfj@:#NkjljX>jjgMgjij=@~?hjmj#Jojnjl3+Kpj|jrjsjtjujyjzjxjvjqjwj{j7p(2~j_6}j"k!k$k#k%k1=&k'k(k>@WM)k$JFG*k+k+8,5,kk;AG-kP3.k0kwM/kF?1k2k3kQ44k5k6k7kQ38k9k:kr2(?;k<k=k@8{D>kW7V?Ak$F@k17?kwB-5BkCkY>m7Dk,K_@v5uLJAEkG?pCZ>FkIkJk>:BBHk[>>IGkl;S1NkX7n;m;MOMkLk'AM5CO:3\>KkPkQkOkX8@Mo;'GTk@@BC6MWkl8?@SkXkm8UkVkRkb@IF/C]2pHC54D[kYkLCA@R4Zk[?JN@O\kgk5Dfkckkkdk`k|D_k]k!Mp;ak^kekt=A8zBEKZ1b0%FikhkfFmkbklknk,8jkV9U<okXMrkuksk5Ipk`6tkvkzkwkykxk{k1<}k|khI!lY7~k"l#lD5Afy>$ln8%l&l>;NZ'l(l2=)l*l+l,l-l+C.l0l/l&F1l-K2l3l4l5lZF]>6lk9.P7l8l?I9lAl:l<l;l=lFK>l?l@lBl-3gDiIb:W9OI_2NHElS4U@DlIlyCcLGlHl.5JlcG_BqH=EFlGKl2Ll(OBDEOq;Kl1B\l(AxFPIOl?;r;^>eG-8NlMljIA<REQlRlX9PlSlTlVl#BUlf4XlWlYl[l]l^lV@O<_lR3`lvAalblkI/5cl6D[1dlq<v?-Bglflelmlklhljlilllw5plW@qlY8nlol)O7D)ArlulsltlYM'Fxlvlwlyl)m|l}l{lzl}D!m%m"m~l#m$m+m&mX@(m*m'm-m3=,m.m/m2m1m0m4m3mvL6m5m7m8m:m9mH?;mm6<m>m?m@m=mAmV<Bm0537.8CmpF>EDmGm4<FmEmZ7HmS3Jm\:ImRmLmNmeJKmMmQmOm15PmSmZGXN4=Tm"MVmUmYmAMXmm3Wm\m[mZm2E]m^m_ml9%7`mambmI?cm-<dmem!R~Qfmpegm$C+?@GhmUJTD~9)C*1xKW?^7a6VJimkmjm`2vFlmwG3EmmR=omBL~mqmrmID`BwA(FpmU5ymvm%n)F`Csm~DSEtmxm`?gGLDB@wm.B$Bum)0"OzmaB5=J?|m{mo0}m/I'n[Fk?YCx6&n7M?1WJa2!n"n#n$n;F#Cc0(n)n#t=B*ns1LA/8ZM+n,ExAW<,n/ne=-n+A*Ad0KN1nrH3n2n0ndcT4nm5n4n6n8MaF.K7nY<8n9n:n!Ej0Y9:O>n47;n<ntIT39M?6TE?n@nAn"ECnBnSFDn6=`<[GqCr<l?EnFn]?GnHnInoM7=KnJnZ9s9@;Nnf=MnLniBo8C@0H9=On_>RnPnQnTnSnz>UnVnWnPHS:a<XnYn$NE=nLLNZnb6[n#E^nx3K?\n]n`DUK|6`nan_ncn_FC3gndnfnbnOoenkNZ8on4Ejnmnknpnqninvnt1hn-Hln`>[9HKd6F=<F-AtnnnsnCL8Dunrn,Aynxnwn/K{=zn_JT1FIrCx5|n]9,;{nm?n?!o#o{>"o$oS6EIb<#O~nx:?O&o%o'o}niFUEWD,oCC(o)o-7+o08*oa>y30o?:yAJD;3.o/oCD-o1o7o:o9o-E2o3o6o8o@6;o5o4o?o@oAo>o=ob>*F<oEoCoDoBoxBFoGoIoU4HozLToJoMoKoLoNoPoQoRoUoSoVoXoWo9DgLYo.AZoDJ[o+3<1W4V4\o]o^o_o`oX4U3^96Hboaoco\1foeodogojoG0holokonomooo.FpoqosorolItouoe:vowoIKKA$0KBxomI{oyo_9zoB8EJ}o!p~o"p!1X?|=Y4#pfG%p"1$pDDMN+F|o&N18[My64N(7bB!g&p,3o?V3(p)p'pd7]:c>#1YN+p.n*p.p,p-p/p0plN1p2pI@;H}?g4:Mm28=[85p4ps;6p3p(;:p-jVRw?8p%NqF+1c@6<7J@1mNkM;pEE{<<p=pL?>pnN9p@pBpAp?pCpDpzAb2Ep8LFpGp*O1[HpIpJpNpKpLpMpOpD@wLE@PpsHQpSsLLRpSpTpW3VpY?Wp$7Xp\pZp[ps3Yp]p^pH0_p`pd>apG5dpcpbpqk\JepfpgphpipjpZ4kplp#Gnp;2qppp$1A6GJ:D":`9g=\?sprpBMh4RH\F|?NN[7vpupKK,FP1wptpQIjMxpyp{pjB[3\3zpi428j4?E`N\8|p}p~p!q#q"qwI$q%q&q'q)q(q*qtHLf)?25+q,q,R;]SH{0;0t;0K~>-q_L.q\MB1A;/qn20q1q3q4q6q2q5q[47q8q9q:q;q=q<q?qBq>q@qAqCqB6s<DqEqa9Fq>3OGGqHqZCkFIq}GLBX1n6o6sCNqp6o2MqKqLqJqXqOqPqQqRqTqSqY=UqWq35Vq{A38YqMBZq-F[q`q^q]q_q\qbqaqdqC6cqeqfqhqgqiqkqjq|9lqmq<3nqoqq?pqqqrqsqb9tquqvqwqxq1Hzq&I{qyq}q|q~q!r"r#r$r%r&r'r(r)r*r+r,r-r.r5]/rxd45!32:1r0r%L3r4r2r5rbK6r{5%O7r9r>0:r+J8r;r<r=r>r?rnK-;z:/A@rCrArDrq8BrErFrGrKr*;dBLrIrHrJr_7PrOrNr30ZrVrWrSrYrUrb3LOXrTrRrQr\r_r^r]rII[rs0`rbro3Mr71drcrar-CpKZNerfrgrhrir;Djr7Horkrlr1KDLPFprqr>Fnrmr*2yrxru1vrursr{3rr2<)2c9|r{rzrwr}r~r%s$s&s-1!s"st99L#s2K+s's,s)s(s\7-s.s/s*str0saD4s5s3s2s8s1s6s7s:s9s<s=s>sIO;skBm:?s@sAsBsCs48DsEs/<FsGsHsIsLsJs<OKsoNMs[NNs~GOsQsRsPsm9MLcKwV`]{K+2TsP5UsVsWsu9XsT`[LcBYs[sZs\s]s^s_s`sasbscsdsesfsgshs$E]8jsMAksls!Imsns7cZlmpospsrssstspNqsusvsxswszs{sys6N|s}sTc~s*!t!p!s!u!J!K!v!\!$!%!?!0#1#2#3#4#5#6#7#8#9#'!(!c!a!d!)!w!A#B#C#D#E#F#G#H#I#J#K#L#M#N#O#P#Q#R#S#T#U#V#W#X#Y#Z#N!@!O!0!2!.!a#b#c#d#e#f#g#h#i#j#k#l#m#n#o#p#q#r#s#t#u#v#w#x#y#z#P!C!Q!1!o! | |
a U^j | |
#6}"# | |
Z#\kc# | |
B$u{M$ | |
u%gh}% | |
+,i_5,p | |
u,M;~,t | |
w{0i | |
&4A\,4 | |
7Zy#7 | |
N N!N#N&N)N.N/N1N3N5N7N<N@NANBNDNFNJNQNUNWNZN[NbNcNdNeNgNhNjNkNlNmNnNoNrNtNuNvNwNxNyNzN{N|N}N | |
O!O#O(O)O,O-O.O1O3O5O7O9O;O>O?O@OAOBODOEOGOHOIOJOKOLOROTOVOaObOfOhOjOkOmOnOqOrOuOwOxOyOzO}O | |
P P"P#P$P'P+P/P0P1P2P3P4P5P6P7P8P9P;P=P?P@PAPBPDPEPFPIPJPKPMPPPQPRPSPTPVPWPXPYP[P]P^P_P`PaPbPcPdPfPgPhPiPjPkPmPnPoPpPqPrPsPtPuPxPyPzP|P}P | |
Q Q"Q#Q$Q%Q&Q'Q(Q)Q*Q+Q,Q-Q.Q/Q0Q1Q2Q3Q4Q5Q6Q7Q8Q9Q:Q;Q<Q=Q>QBQGQJQLQNQOQPQRQSQWQXQYQ[Q]Q^Q_Q`QaQcQdQfQgQiQjQoQrQzQ~Q | |
R!R"R#R%R&R'R*R,R/R1R2R4R5R<R>RDRERFRGRHRIRKRNRORRRSRURWRXRYRZR[R]R_R`RbRcRdRfRhRkRlRmRnRpRqRsRtRuRvRwRxRyRzR{R|R~R | |
S"S$S%S'S(S)S+S,S-S/S0S1S2S3S4S5S6S7S8S<S=S@SBSDSFSKSLSMSPSTSXSYS[S]SeShSjSlSmSrSvSyS{S|S}S~S | |
T"T$T%T*T0T3T6T7T:T=T?TATBTDTETGTITLTMTNTOTQTZT]T^T_T`TaTcTeTgTiTjTkTlTmTnToTpTtTyTzT~T | |
U!U%U&U(U)U+U-U2U4U5U6U8U9U:U;U=U@UBUEUGUHUKULUMUNUOUQURUSUTUWUXUYUZU[U]U^U_U`UbUcUhUiUkUoUpUqUrUsUtUyUzU}U | |
V V!V"V%V&V(V)V*V+V.V/V0V3V5V7V8V:V<V=V>V@VAVBVCVDVEVFVGVHVIVJVKVOVPVQVRVSVUVVVZV[V]V^V_V`VaVcVeVfVgVmVnVoVpVrVsVtVuVwVxVyVzV}V~V | |
W W!W"W$W%W&W'W+W1W2W4W5W6W7W8W<W=W?WAWCWDWEWFWHWIWKWRWSWTWUWVWXWYWbWcWeWgWlWnWpWqWrWtWuWxWyWzW}W~W | |
X"X#X%X&X'X(X)X+X,X-X.X/X1X2X3X4X6X7X8X9X:X;X<X=X>X?X@XAXBXCXEXFXGXHXIXJXKXNXOXPXRXSXUXVXWXYXZX[X\X]X_X`XaXbXcXdXfXgXhXiXjXmXnXoXpXqXrXsXtXuXvXwXxXyXzX{X|X}X | |
Y Y!Y"Y#Y&Y(Y,Y0Y2Y3Y5Y6Y;Y=Y>Y?Y@YCYEYFYJYLYMYPYRYSYYY[Y\Y]Y^Y_YaYcYdYfYgYhYiYjYkYlYmYnYoYpYqYrYuYwYzY{Y|Y~Y | |
Z!Z"Z$Z&Z'Z(Z*Z+Z,Z-Z.Z/Z0Z3Z5Z7Z8Z9Z:Z;Z=Z>Z?ZAZBZCZDZEZGZHZKZLZMZNZOZPZQZRZSZTZVZWZXZYZ[Z\Z]Z^Z_Z`ZaZcZdZeZfZhZiZkZlZmZnZoZpZqZrZsZxZyZ{Z|Z}Z~Z | |
[ [!["[#[$[%[&['[([)[*[+[,[-[.[/[0[1[3[5[6[8[9[:[;[<[=[>[?[A[B[C[D[E[F[G[H[I[J[K[L[M[N[O[R[V[^[`[a[g[h[k[m[n[o[r[t[v[w[x[y[{[|[~[ | |
\ \!\#\&\(\)\*\+\-\.\/\0\2\3\5\6\7\C\D\F\G\L\M\R\S\T\V\W\X\Z\[\\\]\_\b\d\g\h\i\j\k\l\m\p\r\s\t\u\v\w\x\{\|\}\~\ | |
] ]!]"]#]%](]*]+],]/]0]1]2]3]5]6]7]8]9]:];]<]?]@]A]B]C]D]E]F]H]I]M]N]O]P]Q]R]S]T]U]V]W]Y]Z]\]^]_]`]a]b]c]d]e]f]g]h]j]m]n]p]q]r]s]u]v]w]x]y]z]{]|]}]~] | |
^ ^!^"^#^$^%^(^)^*^+^,^/^0^2^3^4^5^6^9^:^>^?^@^A^C^F^G^H^I^J^K^M^N^O^P^Q^R^S^V^W^X^Y^Z^\^]^_^`^c^d^e^f^g^h^i^j^k^l^m^n^o^p^q^u^w^y^~^ | |
_!_"_#_$_(_+_,_._0_2_3_4_5_6_7_8_;_=_>_?_A_B_C_D_E_F_G_H_I_J_K_L_M_N_O_Q_T_Y_Z_[_\_^___`_c_e_g_h_k_n_o_r_t_u_v_x_z_}_~_ | |
`"`#`$`,`-`.`0`1`2`3`4`6`7`8`9`:`=`>`@`D`E`F`G`H`I`J`L`N`O`Q`S`T`V`W`X`[`\`^`_```a`e`f`n`q`r`t`u`w`~` | |
a!a"a%a(a)a*a,a-a.a/a0a1a2a3a4a5a6a7a8a9a:a;a<a=a>a@aAaBaCaDaEaFaGaIaKaMaOaPaRaSaTaVaWaXaYaZa[a\a^a_a`aaacadaeafaiajakalamanaoaqarasatavaxayaza{a|a}a~a | |
b b#b&b'b(b)b+b-b/b0b1b2b5b6b8b9b:b;b<bBbDbEbFbJbObPbUbVbWbYbZb\b]b^b_b`babbbdbebhbqbrbtbubwbxbzb{b}b | |
c&c'c)c,c-c.c0c1c3c4c5c6c7c8c;c<c>c?c@cAcDcGcHcJcQcRcScTcVcWcXcYcZc[c\c]c`cdcecfchcjckclcocpcrcsctcucxcyc|c}c~c | |
d"d#d$d%d'd(d)d+d.d/d0d1d2d3d5d6d7d8d9d;d<d>d@dBdCdIdKdLdMdNdOdPdQdSdUdVdWdYdZd[d\d]d_d`dadbdcdddedfdhdjdkdldndodpdqdrdsdtdudvdwd{d|d}d~d | |
e e!e"e#e$e&e'e(e)e*e,e-e0e1e2e3e7e:e<e=e@eAeBeCeDeFeGeJeKeMeNePeReSeTeWeXeZe\e_e`eaedeeegeheiejemeneoeqeseuevexeyeze{e|e}e~e | |
f!f"f#f$f&f)f*f+f,f.f0f2f3f7f8f9f:f;f=f?f@fBfDfEfFfGfHfIfJfMfNfPfQfXfYf[f\f]f^f`fbfcfefgfifjfkflfmfqfrfsfufxfyf{f|f}f | |
g g!g"g#g$g%g'g)g.g0g2g3g6g7g8g9g;g<g>g?gAgDgEgGgJgKgMgRgTgUgWgXgYgZg[g]gbgcgdgfgggkglgngqgtgvgxgygzg{g}g | |
h h"h#h$h%h&h'h(h+h,h-h.h/h0h1h4h5h6h:h;h?hGhKhMhOhRhVhWhXhYhZh[h\h]h^h_hjhlhmhnhohphqhrhshuhxhyhzh{h|h}h~h | |
i!i"i#i%i&i'i(i)i*i+i,i.i/i1i2i3i5i6i7i8i:i;i<i>i@iAiCiDiEiFiGiHiIiJiKiLiMiNiOiPiQiRiSiUiViXiYi[i\i_iaibidieigihiiijilimioipirisitiuivizi{i}i~i | |
j j"j#j$j%j&j'j)j+j,j-j.j0j2j3j4j6j7j8j9j:j;j<j?j@jAjBjCjEjFjHjIjJjKjLjMjNjOjQjRjSjTjUjVjWjZj\j]j^j_j`jbjcjdjfjgjhjijjjkjljmjnjojpjrjsjtjujvjwjxjzj{j}j~j | |
k%k&k(k)k*k+k,k-k.k/k0k1k3k4k5k6k8k;k<k=k?k@kAkBkDkEkHkJkKkMkNkOkPkQkRkSkTkUkVkWkXkZk[k\k]k^k_k`kakhkikkklkmknkokpkqkrksktkukvkwkxkzk}k~k | |
l l#l%l+l,l-l1l3l6l7l9l:l;l<l>l?lClDlElHlKlLlMlNlOlQlRlSlVlXlYlZlblclelflglklllmlnlolqlslulwlxlzl{l|l | |
m m!m"m#m$m&m(m)m,m-m/m0m4m6m7m8m:m?m@mBmDmImLmPmUmVmWmXm[m]m_mambmdmemgmhmkmlmmmpmqmrmsmumvmymzm{m}m~m | |
n"n&n'n(n*n,n.n0n1n3n5n6n7n9n;n<n=n>n?n@nAnBnEnFnGnHnInJnKnLnOnPnQnRnUnWnYnZn\n]n^n`nanbncndnenfngnhninjnlnmnonpnqnrnsntnunvnwnxnynzn{n|n}n | |
o!o"o#o%o&o'o(o,o.o0o2o4o5o7o8o9o:o;o<o=o?o@oAoBoCoDoEoHoIoJoLoNoOoPoQoRoSoToUoVoWoYoZo[o]o_o`oaocodoeogohoiojokolooopoqosouovowoyo{o}o~o | |
p p!p"p$p%p&p'p(p)p*p+p,p-p.p/p0p1p2p3p4p6p7p8p:p;p<p=p>p?p@pApBpCpDpEpFpGpHpIpJpKpMpNpPpQpRpSpTpUpVpWpXpYpZp[p\p]p_p`papbpcpdpepfpgphpipjpnpqprpsptpwpypzp{p}p | |
q q!q"q#q$q%q'q(q)q*q+q,q-q.q2q3q4q5q7q8q9q:q;q<q=q>q?q@qAqBqCqDqFqGqHqIqKqMqOqPqQqRqSqTqUqVqWqXqYqZq[q]q_q`qaqbqcqeqiqjqkqlqmqoqpqqqtquqvqwqyq{q|q~q | |
r r!r"r#r$r%r&r'r)r+r-r.r/r2r3r4r:r<r>r@rArBrCrDrErFrIrJrKrNrOrPrQrSrTrUrWrXrZr\r^r`rcrdrerhrjrkrlrmrprqrsrtrvrwrxr{r|r}r | |
% 5 | |
"#"R"f"g" | |
"P%Q%R%S%T%U%V%W%X%Y%Z%[%\%]%^%_%`%a%b%c%d%e%f%g%h%i%j%k%l%m%n%o%p%q%r%s% | |
!0"0#0$0%0&0'0(0)0 | |
!!12 | |
s s#s$s&s's(s-s/s0s2s3s5s6s:s;s<s=s@sAsBsCsDsEsFsGsHsIsJsKsLsNsOsQsSsTsUsVsXsYsZs[s\s]s^s_sasbscsdsesfsgshsisjsksnspsqsrssstsusvswsxsyszs{s|s}s | |
t t!t#t$t't)t+t-t/t1t2t7t8t9t:t;t=t>t?t@tBtCtDtEtFtGtHtItJtKtLtMtNtOtPtQtRtStTtVtXt]t`tatbtctdtetftgthtitjtktltntotqtrtstttutxtytzt{t|t}t | |
u u!u"u#u$u&u'u*u.u4u6u9u<u=u?uAuBuCuDuFuGuIuJuMuPuQuRuSuUuVuWuXu]u^u_u`uaubucuduguhuiukulumunuoupuqusuuuvuwuzu{u|u}u~u | |
v!v#v'v(v,v.v/v1v2v6v7v9v:v;v=vAvBvDvEvFvGvHvIvJvKvNvOvPvQvRvSvUvWvXvYvZv[v]v_v`vavbvdvevfvgvhvivjvlvmvnvpvqvrvsvtvuvvvwvyvzv|v | |
w!w#w$w%w'w*w+w,w.w0w1w2w3w4w9w;w=w>w?wBwDwEwFwHwIwJwKwLwMwNwOwRwSwTwUwVwWwXwYw\w]w^w_w`wdwgwiwjwmwnwowpwqwrwswtwuwvwwwxwzw{w|w | |
x x!x"x$x(x*x+x.x/x1x2x3x5x6x=x?xAxBxCxDxFxHxIxJxKxMxOxQxSxTxXxYxZx[x\x^x_x`xaxbxcxdxexfxgxhxixoxpxqxrxsxtxuxvxxxyxzx{x}x~x | |
y y!y"y#y%y&y'y(y)y*y+y,y-y.y/y0y1y2y3y5y6y7y8y9y=y?yByCyDyEyGyJyKyLyMyNyOyPyQyRyTyUyXyYyaycydyfyiyjykylynypyqyrysytyuyvyyy{y|y}y~y | |
z!z"z$z%z&z'z(z)z*z+z,z-z.z/z0z1z2z4z5z6z8z:z>z@zAzBzCzDzEzGzHzIzJzKzLzMzNzOzPzRzSzTzUzVzXzYzZz[z\z]z^z_z`zazbzczdzezfzgzhzizjzkzlzmznzozqzrzszuz{z|z}z~z | |
{!{"{#{'{){-{/{0{2{4{5{6{7{9{;{={?{@{A{B{C{D{F{H{J{M{N{S{U{W{Y{\{^{_{a{c{d{e{f{g{h{i{j{k{l{m{o{p{s{t{v{x{z{|{}{ | |
| |!|"|#|$|%|(|)|+|,|-|.|/|0|1|2|3|4|5|6|7|9|:|;|<|=|>|B|C|D|E|F|G|H|I|J|K|L|N|O|P|Q|R|S|T|U|V|W|X|Y|Z|[|\|]|^|_|`|a|b|c|d|e|f|g|h|i|j|k|l|m|n|o|p|q|r|u|v|w|x|y|z|~| | |
}!}#}$}%}&}(})}*},}-}.}0}1}2}3}4}5}6}7}8}9}:};}<}=}>}?}@}A}B}C}D}E}F}G}H}I}J}K}L}M}N}O}P}Q}R}S}T}U}V}W}X}Y}Z}[}\}]}^}_}`}a}b}c}d}e}f}g}h}i}j}k}l}m}o}p}q}r}s}t}u}v}x}y}z}{}|}}}~} | |
~ ~!~"~#~$~%~&~'~(~)~*~+~,~-~.~/~0~1~2~3~4~5~6~7~8~9~:~<~=~>~?~@~B~C~D~E~F~H~I~J~K~L~M~N~O~P~Q~R~S~T~U~V~W~X~Y~Z~[~\~]~^~_~`~a~b~c~d~e~f~g~h~i~j~k~l~m~n~o~p~q~r~s~t~u~v~w~x~y~z~{~|~}~~~ | |
//TRANSLIT | |
//IGNORE | |
CHARSETALIASDIR | |
/usr/local/lib | |
charset.alias | |
%50s %50s | |
AdecCheckAttr | |
HI_MPI_ADEC_GetOutputMode | |
HI_MPI_ADEC_SetOutputMode | |
HI_MPI_ADEC_GetFrmInfo | |
HI_MPI_ADEC_ReleaseFrame | |
HI_MPI_ADEC_GetFrame | |
adec_sendao | |
HI_MPI_ADEC_RegeisterDecoder | |
MPI_ADEC_SendStream | |
AdecSendPack | |
AdecSendStream | |
HI_MPI_ADEC_SendStream | |
MPI_ADEC_ClearChnBuf | |
HI_MPI_ADEC_ClearChnBuf | |
MPI_ADEC_DestroyChn | |
HI_MPI_ADEC_DestroyChn | |
MPI_ADEC_CreateChn | |
HI_MPI_ADEC_CreateChn | |
MPI_ADEC_Init | |
[Func]:%s [Line]:%d [Info]: | |
Audio some err:0x%x | |
invalid param: payload type%d | |
invalid param: u32BufSize%d | |
invalid param: enMode%d | |
/dev/adec | |
open adec dev fail | |
adec chn %d enOutputMode %d error. | |
ASSERT failed at: | |
>File name: %s | |
>Function : %s | |
>Line No. : %d | |
>Condition: %s | |
/home/pub/platform_h3/mpp/code/mpi/src/mpi_adec.c | |
HI_INVALID_HANDLE != pstAdecChn->s32Handle | |
The decoder has been unregistered! | |
u32Len:%d, maxlen:%d | |
adec chn: %d has no free buffer to save decode frame data! | |
HI_INVALID_HANDLE != pstMpiAdecCtx->s32Handle | |
audio decoder internal err 0x%x! | |
Func:%s,LINE:%d,AdChn:%d,semWrite=%d | |
Func:%s,LINE:%d, AdChn:%d, read=%d, write=%d, cycle count=%d | |
destroy semRead err %d! | |
destroy semWrite err %d! | |
adec chn%d has been created | |
adec chn%d is being destroyed | |
the decoder maybe has not been registered, AdChn%d. | |
open the decoder failed, AdChn%d. | |
adec chn %d malloc AF buffer failed! | |
HI_SUCCESS == s32Ret | |
AencCheckFrame | |
MPI_AENC_ReleaseFrame | |
HI_MPI_AENC_GetFd | |
HI_MPI_AENC_ReleaseStream | |
HI_MPI_AENC_GetStream | |
MPI_AENC_ReadBufPhy2Vir | |
MPI_AENC_SetDbgInfo | |
MPI_AENC_GetFrame | |
HI_MPI_AENC_Save_File | |
AencCheckAttr | |
HI_MPI_AENC_RegeisterEncoder | |
MPI_AENC_MallocTmpBuffer | |
MPI_AENC_DestroyChn | |
HI_MPI_AENC_DestroyChn | |
MPI_AENC_CreateChn | |
MPI_AENC_StrmBufInit | |
MPI_AENC_ReadBufInit | |
HI_MPI_AENC_CreateChn | |
MPI_AENC_Init | |
HI_MPI_AENC_SendFrame | |
VALG_CB_UpdateWrHead | |
MPI_AENC_UpDateStreamBufWrTail | |
MPI_AENC_SendFrmToVoie | |
aenc_get | |
MPI_AENC_ChnGetFrmProc | |
/dev/aenc | |
open aenc dev fail | |
[Func]:%s [Line]:%d [Info]:%s | |
/home/pub/platform_h3/mpp/code/mpi/src/mpi_aenc.c | |
g_stAenc[AeChn].stReadBuf.pu8VirtAddr | |
invalid payload type | |
invalid u32BufSize | |
No enough mem for aenc saving file. | |
HI_INVALID_HANDLE != pstAencChn->s32Handle | |
The encoder has been unregistered! | |
the payload type%d not registered | |
the payload type%d invalid | |
alloc mmb fail, len:%d | |
Error! Length of buffer must be multiples of word (32-bit)! | |
Error! Lenght reserved in buffer must be multiples of word (32-bit)! | |
VALG_CB_Init fail | |
the frame has no data | |
get aenc dumpfile cfg error! | |
do vqe failed! | |
%s/Sin%d_%d.pcm | |
%s/Rin%d_%d.pcm | |
%s/Sou%d_%d.pcm | |
pu8WriteAddr | |
(u32StrmLen+sizeof(AENC_STREAM_HEADER_S)) <= pstAencChn->u32CbPackLen | |
%s err! Len(%d) must be multiples of word(32-bit)! | |
/home/pub/platform_h3/mpp/code/mkp/include/valg_ext.h | |
point num (%d) of this frame is larger than MAX_VOICE_POINT_NUM(%d) for voie encode | |
s32Ret == HI_SUCCESS | |
MPI_AI_MallocTmpBuffer | |
MPI_AI_DisableReSmpEx | |
MPI_AI_DisableReSmp | |
MPI_AI_EnableReSmpEx | |
MPI_AI_EnableReSmp | |
HI_MPI_AI_Enable | |
HI_MPI_AI_Disable | |
HI_MPI_AI_GetVqeAttr | |
HI_MPI_AI_SetVqeAttr | |
AiCheckVqe | |
AiCheckAlc | |
AiCheckVqeAec | |
HI_MPI_AI_SetPubAttr | |
HI_MPI_AI_GetPubAttr | |
HI_MPI_AI_EnableChn | |
MPI_AI_AecInit | |
HI_MPI_AI_EnableAec | |
HI_MPI_AI_DisableAec | |
HI_MPI_AI_EnableReSmp | |
MPI_AI_CheckReSmp | |
MPI_AI_SetAnrDbgInfo | |
HI_MPI_AI_ReleaseFrame | |
HI_MPI_AI_SetChnParam | |
HI_MPI_AI_GetChnParam | |
HI_MPI_AI_GetFrame | |
MPI_AI_ProcAnr | |
MPI_AI_ProcReSmp | |
MPI_AI_ProcReSmpEx | |
HI_MPI_AI_GetFd | |
HI_MPI_AI_GetFileHandle | |
HI_MPI_AI_ClrPubAttr | |
HI_MPI_AI_Save_File | |
HI_MPI_AI_EnableVqe | |
HI_MPI_AI_DisableAnr | |
HI_MPI_AI_DisableReSmpEx | |
HI_MPI_AI_DisableReSmp | |
HI_MPI_AI_EnableAnr | |
HI_MPI_AI_DisableVqe | |
HI_MPI_AI_DisableChn | |
HI_MPI_AI_EnableReSmpEx | |
MPI_AI_CheckReSmpEx | |
No enough mem for ai saving file. | |
failed to unmap Resmp VB pool for AiDev%d AiChn%d! | |
failed to destroy Resmp VB pool for AiDev%d AiChn%d! | |
failed to release Resmp VB pool for AiDev%d AiChn%d! | |
AiDev%d AiChn%d resampler create failed! | |
get mem config for AiDev%d AiChn%d failed! | |
create Resmp VB pool for AiDev%d AiChn%d failed! | |
mmap Resmp VB pool for AiDev%d AiChn%d failed! | |
ResmpEx has been enable! | |
/home/pub/platform_h3/mpp/code/mpi/src/mpi_ai.c | |
HI_SUCCESS == HI_MPI_VB_MmapPool(pstAiChn->VbPool) | |
failed to unmap VB pool for AiDev%d AiChn%d! | |
aidev%d is not supported | |
/dev/ai | |
ai chnid %d is invalid | |
NULL != pstAiChn | |
AI chn %d is not config vqe! | |
Ai dev: %d, ai chn:%d, get vqe attr fail, s32Ret: 0x%x. | |
AI chn %d is not enable | |
AI chn %d has enable vqe! Please disable vqe then config it! | |
AiDev: %d get vqe attr failed! | |
frame length: %d is invalid, ai chn:%d. | |
sample rate: %d is invalid, ai chn:%d. | |
frame length: %d is invalid when sample rate is %d, ai chn:%d. | |
flag of alc: %d, aec: %d, anr: %d is invalid, ai chn:%d | |
all flag of alc: %d, aec: %d, anr: %d is false, ai chn:%d | |
AI chn %d check vqe parameter failed! | |
Ai dev: %d, ai chn:%d, enable alc failed! s32MaxLev: %d, s32MinLev: %d, u32MaxGain: %d | |
AI chn %d check vqe alc parameter failed! | |
ao dev %d is invalid | |
ao chnid %d is invalid | |
Ai dev: %d, ai chn:%d, enable aec failed! Aec mode:%d error. | |
AI chn %d check vqe aec parameter failed! | |
Ai dev: %d, ai chn:%d, create vqe fail. | |
HI_MPI_AI_GetPubAttr error, use default AEC attr. | |
aec open fail. | |
aodev %d is not supported | |
the AUDIO_RESAMPLE_ATTR_S pointer is NULL! | |
Resmp has been enabled but the attributes not the same as before | |
AiChn %d u32InPointNum:%d should smaller than %d | |
enInSampleRate:%d is invalid | |
resample PtNumPerFrm%d is not equal to AI's PtNumPerFrm%d! | |
resample SampleRate %d is not equal to AI's SampleRate %d! | |
resample don't support stereo! | |
enable aec fail,Aidev%d don't have chn%d | |
Resmp attr check failed! | |
Ai Resmp enable failed! | |
set ai:%d chn:%d resample debug info failed! | |
illegal param: bBlock(%d)! | |
get ai frame error! | |
get ai dumpfile cfg error! | |
chn%d malloc err! | |
s32ChnId :%d process anr failed! | |
pstAiChn->pReSmpHdl | |
can't do resample for stereo! | |
can't do resample and aec at the same time! | |
get a resmp vb failed! | |
get resmp vb physical addr failed! | |
get resmp vb virtual addr failed! | |
resmp process failed! After resample process OutPointNum:%d. | |
calculate resample multiple failed! | |
resmp process failed! | |
pstAecFrm is NULL when AEC is open! | |
ai chn %d malloc error. | |
do aec failed! | |
can't do aec,enSoundmode:%d,data len:(%d,%d),bitwidth(%d,%d),stp interval:%llu | |
AI chn %d is not config vqe attr! | |
AiDev: %d haven't set attr! | |
vqe don't support stereo! | |
enable vqe fail, Aidev%d don't have chn%d | |
vqe's sample rate:%d and device's sample rate:%d must be same! | |
vqe's frame:%d and device's frame:%d must be same! | |
set ai:%d chn:%d anr debug info failed! | |
Ai dev: %d, enable aec fail, ai chn:%d | |
set ai:%d chn:%d vqe debug info failed! | |
AiDev: %d, anr should be 80 or 160 or 320 point per frm! | |
AiDev: %d, anr should be 8k or 11k or 16k sample rate! | |
anr don't support stereo! | |
Ai[%d %d] init anr failed! | |
Ai dev: %d, disable aec fail, ai chn:%d | |
Resmp has been enable! | |
enInSampleRate is same as enOutSampleRate, it's not allowed. | |
enable resample fail,Aidev%d don't have chn%d | |
MPI_AO_EnableReSmp | |
MPI_AO_EnableReSmpEx | |
MPI_AO_Init | |
HI_MPI_AO_EnableChn | |
HI_MPI_AO_SetPubAttr | |
HI_MPI_AO_GetPubAttr | |
MPI_AO_CheckReSmpEx | |
MPI_AO_CheckReSmp | |
HI_MPI_AO_Enable | |
HI_MPI_AO_Disable | |
HI_MPI_AO_PauseChn | |
HI_MPI_AO_ResumeChn | |
HI_MPI_AO_EnableReSmpEx | |
HI_MPI_AO_ClearChnBuf | |
HI_MPI_AO_QueryChnStat | |
HI_MPI_AO_SetVolume | |
HI_MPI_AO_GetVolume | |
HI_MPI_AO_ClrPubAttr | |
HI_MPI_AO_GetFd | |
HI_MPI_AO_GetFileHandle | |
HI_MPI_AO_SendFrame | |
MPI_AO_ProcReSmp | |
MPI_AO_ProcReSmpEx | |
MPI_AO_ReceiveFrm | |
HI_MPI_AO_DisableReSmp | |
HI_MPI_AO_DisableReSmpEx | |
HI_MPI_AO_DisableChn | |
HI_MPI_AO_EnableReSmp | |
ResamplerCreate failed! | |
/home/pub/platform_h3/mpp/code/mpi/src/mpi_ao.c | |
NULL != pstAoChn | |
Cannot identify '%s': %d, %s | |
%s is no device | |
/dev/ao | |
the AIO_ATTR_S pointer for AoDev%d is NULL! | |
AoChn %d resample u32InPointNum %d is larger than MAXFRAMESIZE %d! | |
AoChn %d resample in rate is illegal! | |
AoChn %d resample out rate is illegal! | |
resample out rate is the same as resample in rate, it's not allowed! | |
can't get aodev%d's attribute! | |
AO's samplerate is not equal to resample's out samplerate! | |
enable aec fail,Aodev%d don't have chn%d | |
AoChn %d resample rate is illegal! | |
AO's enReSampleType %d is illegal! | |
AO's PtNumPerFrm is not equal to the result of resample! | |
AO's samplerate is not equal to the result of resample! | |
the AUDIO_RESAMPLE_ATTR_EX_S pointer for is Ao(%d, %d) NULL! | |
AO chn %d is not enable | |
Resmp has been enable but the attributes not the same as before | |
set ao:%d chn:%d resample debug info failed! | |
the AO_CHN_STATE_S pointer for AoDev%d is NULL! | |
the ps32VolumeDb pointer for Ao(%d) is NULL! | |
the AUDIO_FRAME_S pointer for is Ao(%d, %d) NULL! | |
invalid param: bBlock %d! | |
s_stMpiAoChn[s32ChnId].pReSmpHdl | |
s32ChnId: %d hasn't enable resample! | |
pstAoChn->pReSmpHdl | |
ResamplerGetMaxOutputNum error! InPointNum:%d, OutPointNum:%d, u32Len:%d, enBitwidth:%d. | |
It's no free buffer to save data! InPointNum:%d, OutPointNum:%d, u32Write:%d, u32Read:%d | |
MPP_DATA_AUDIO_FRAME == enDataType | |
NULL != pData | |
the AUDIO_RESAMPLE_ATTR_S pointer for is Ao(%d, %d) NULL! | |
/dev/rgn | |
open /dev/rgn err | |
PTR is NULL! | |
/dev/logmpp | |
/dev/sys | |
open sys | |
Null point | |
System get chip customer ID failed! | |
Get virtual reg address failed! | |
null ptr! | |
System get Kernel Config failed! | |
mmz name len:%d,it's too long | |
/dev/mmz_userdev | |
System unmap mmz memory failed! | |
System free mmz memory failed! | |
System alloc mmz memory failed! | |
System remap mmz memory failed! | |
Close Log Fail | |
Close SYS Fail | |
Close mem/dev Fail | |
Open dev/mem error | |
mmap error | |
Get Kernel Config failed! | |
initialize sys bind failed! | |
initialize ai mpi failed! | |
initialize ao mpi failed! | |
initialize aenc mpi failed! | |
initialize adec mpi failed! | |
initialize venc mpi failed! | |
HI_MPI_VB_GetBlkVirAddr | |
HI_MPI_VB_MunmapPool | |
Illegal poolid %d! | |
Pool %d hasn't mapped! | |
/home/pub/platform_h3/mpp/code/mpi/src/mpi_vb.c | |
NULL != pstPoolInfo->pPoolVirAddr | |
/dev/vb | |
Query vb pool %d used stat failed! | |
Vb pool %d is used by some modules! | |
Pool %d has mapped! | |
Get vb pool %d's info failed! | |
Get vb pool %d' mmap user addr failed! | |
/dev/vda | |
open mem device failed | |
mmap err,page addr:%d u32PagePhy size:%d | |
HI_MPI_VENC_EnableInterPskip | |
HI_MPI_VENC_SetJpegSnapMode | |
HI_MPI_VENC_GetJpegSnapMode | |
HI_MPI_VENC_StartRecvPicEx | |
HI_MPI_VENC_SendFrame | |
HI_MPI_VENC_VpssQuery | |
HI_MPI_VENC_VpssSend | |
HI_MPI_VENC_SetGrpFrmRate | |
HI_MPI_VENC_GetGrpFrmRate | |
HI_MPI_VENC_SetGrpColor2Grey | |
HI_MPI_VENC_GetGrpColor2Grey | |
HI_MPI_VENC_SetGrpCrop | |
HI_MPI_VENC_GetGrpCrop | |
HI_MPI_VENC_GetColor2GreyConf | |
HI_MPI_VENC_SetColor2GreyConf | |
HI_MPI_VENC_GetCapability | |
HI_MPI_VENC_InsertUserData | |
HI_MPI_VENC_GetStreamBufInfo | |
HI_MPI_VENC_SetRcPriority | |
HI_MPI_VENC_GetRcPriority | |
HI_MPI_VENC_SetLostFrameStrategy | |
HI_MPI_VENC_GetLostFrameStrategy | |
HI_MPI_VENC_GetStream | |
HI_MPI_VENC_ReleaseStream | |
HI_MPI_VENC_GetChnAttr | |
HI_MPI_VENC_SetChnAttr | |
HI_MPI_VENC_SetRcPara | |
HI_MPI_VENC_GetRcPara | |
HI_MPI_VENC_SetMaxStreamCnt | |
HI_MPI_VENC_GetMaxStreamCnt | |
HI_MPI_VENC_RequestIDR | |
HI_MPI_VENC_RequestIDRInst | |
HI_MPI_VENC_GetFd | |
HI_MPI_VENC_GetRoiCfg | |
HI_MPI_VENC_SetRoiCfg | |
HI_MPI_VENC_SetH264SliceSplit | |
HI_MPI_VENC_GetH264SliceSplit | |
HI_MPI_VENC_SetH264InterPred | |
HI_MPI_VENC_GetH264InterPred | |
HI_MPI_VENC_SetH264IntraPred | |
HI_MPI_VENC_GetH264IntraPred | |
HI_MPI_VENC_SetH264Trans | |
HI_MPI_VENC_GetH264Trans | |
HI_MPI_VENC_SetH264Entropy | |
HI_MPI_VENC_GetH264Entropy | |
HI_MPI_VENC_SetH264Poc | |
HI_MPI_VENC_GetH264Poc | |
HI_MPI_VENC_SetH264Dblk | |
HI_MPI_VENC_GetH264Dblk | |
HI_MPI_VENC_SetH264RDO | |
HI_MPI_VENC_GetH264RDO | |
HI_MPI_VENC_SetH264Vui | |
HI_MPI_VENC_CreateChn | |
HI_MPI_VENC_RegisterChn | |
HI_MPI_VENC_UnRegisterChn | |
HI_MPI_VENC_StartRecvPic | |
HI_MPI_VENC_StopRecvPic | |
HI_MPI_VENC_Query | |
HI_MPI_VENC_DestroyChn | |
HI_MPI_VENC_GetH264Vui | |
HI_MPI_VENC_SetJpegParam | |
HI_MPI_VENC_GetJpegParam | |
HI_MPI_VENC_SetMjpegParam | |
HI_MPI_VENC_GetMjpegParam | |
HI_MPI_VENC_SetMpeg4Param | |
HI_MPI_VENC_GetMpeg4Param | |
HI_MPI_VENC_SetH264eRefMode | |
HI_MPI_VENC_GetH264eRefMode | |
HI_MPI_VENC_SetH264eRefParam | |
HI_MPI_VENC_GetH264eRefParam | |
HI_MPI_VENC_EnableIDR | |
Mpi venc init failed in line %d | |
func:%s, chnid %d err,should in [0,VENC_MAX_CHN_NUM) | |
func:%s, sys not ready in line:%d | |
/dev/venc | |
func:%s, Chn %d open err | |
func:%s,NULL pointer detected | |
Check group %d err, should be in [0 , VENC_MAX_GRP_NUM] | |
/dev/grp | |
Open group err,system may be not ready | |
/home/pub/platform_h3/mpp/code/mpi/src/mpi_venc.c | |
pstPack->u32Len[0] >= VENC_STREAM_OFFSET | |
func:%s, RoiIndex %d err,should in [0,VENC_MAX_ROI_NUM) | |
File:%s | |
Line:%d: | |
Function:%s | |
<MPI DEBUG>: | |
HI_MPI_VENC_Open: open mem device failed | |
HI_MPI_VI_DisableChn422to420 | |
HI_MPI_VI_EnableChn422to420 | |
HI_MPI_VI_SetRotate | |
HI_MPI_VI_FlashTrigger | |
HI_MPI_VI_GetFd | |
HI_MPI_VI_DisableUserPic | |
HI_MPI_VI_EnableUserPic | |
HI_MPI_VI_ChnUnBind | |
HI_MPI_VI_DisableCascadeChn | |
HI_MPI_VI_EnableCascadeChn | |
HI_MPI_VI_DisableCascade | |
HI_MPI_VI_EnableCascade | |
HI_MPI_VI_DisableVbi | |
HI_MPI_VI_EnableVbi | |
HI_MPI_VI_SetFrameDepth | |
HI_MPI_VI_DisableChnInterrupt | |
HI_MPI_VI_EnableChnInterrupt | |
HI_MPI_VI_DisableUserPicRegion | |
HI_MPI_VI_EnableUserPicRegion | |
HI_MPI_VI_DisableChn | |
HI_MPI_VI_EnableChn | |
HI_MPI_VI_ClearChnMinorAttr | |
HI_MPI_VI_DisableDev | |
HI_MPI_VI_EnableDev | |
HI_MPI_VI_SetDevAntifogAttr | |
HI_MPI_VI_GetChnLuma | |
HI_MPI_VI_GetRotate | |
HI_MPI_VI_GetLDCAttr | |
HI_MPI_VI_SetLDCAttr | |
HI_MPI_VI_GetExtChnAttr | |
HI_MPI_VI_SetExtChnAttr | |
HI_MPI_VI_GetCSCAttr | |
HI_MPI_VI_SetCSCAttr | |
HI_MPI_VI_GetFlashConfig | |
HI_MPI_VI_SetFlashConfig | |
HI_MPI_VI_Query | |
HI_MPI_VI_SetUserPic | |
HI_MPI_VI_GetDevAttrEx | |
HI_MPI_VI_SetDevAttrEx | |
HI_MPI_VI_GetChnBind | |
HI_MPI_VI_ChnBind | |
HI_MPI_VI_GetVbiAttr | |
HI_MPI_VI_SetVbiAttr | |
HI_MPI_VI_GetFrameDepth | |
HI_MPI_VI_ReleaseFrame | |
HI_MPI_VI_GetFrameTimeOut | |
HI_MPI_VI_GetFrame | |
HI_MPI_VI_GetChnMinorAttr | |
HI_MPI_VI_SetChnMinorAttr | |
HI_MPI_VI_GetChnAttr | |
HI_MPI_VI_SetChnAttr | |
HI_MPI_VI_GetDevAttr | |
HI_MPI_VI_SetDevAttr | |
VIChnID(%d) is invalid | |
/dev/vi | |
open chn %d err, ret:%d | |
ViPortId(%d) is invalid | |
open vi(%d,%d) err, ret:%d | |
VbiId(%d) is invalid | |
NULL point | |
VIChnID(%d) is invalid ext chn | |
HI_MPI_VO_DBG | |
HI_MPI_VO_DisableRecvFrameRateMatch | |
HI_MPI_VO_EnableRecvFrameRateMatch | |
HI_MPI_VO_SetDevFramerate | |
HI_MPI_VO_SetVtth | |
HI_MPI_VO_CascadePosUnBindChn | |
HI_MPI_VO_CascadePosBindChn | |
HI_MPI_VO_SetCascadePattern | |
HI_MPI_VO_DisableCascadeDev | |
HI_MPI_VO_EnableCascadeDev | |
HI_MPI_VO_GfxLayerUnBindDev | |
HI_MPI_VO_GfxLayerBindDev | |
HI_MPI_VO_SetWbcMode | |
HI_MPI_VO_SetWbcDepth | |
HI_MPI_VO_DisableWbc | |
HI_MPI_VO_EnableWbc | |
HI_MPI_VO_SetDispBufLen | |
HI_MPI_VO_SetPlayToleration | |
HI_MPI_VO_SetAttrEnd | |
HI_MPI_VO_SetAttrBegin | |
HI_MPI_VO_DisableChnDoubleFrame | |
HI_MPI_VO_EnableChnDoubleFrame | |
HI_MPI_VO_SetChnDispThreshold | |
HI_MPI_VO_InitChnDispPts | |
HI_MPI_VO_ClearChnBuffer | |
HI_MPI_VO_ChnHide | |
HI_MPI_VO_ChnShow | |
HI_MPI_VO_ChnRefresh | |
HI_MPI_VO_ChnStep | |
HI_MPI_VO_ChnResume | |
HI_MPI_VO_ChnPause | |
HI_MPI_VO_SetChnFrameRate | |
HI_MPI_VO_SetChnField | |
HI_MPI_VO_DisableSdTdeBypass | |
HI_MPI_VO_EnableSdTdeBypass | |
HI_MPI_VO_DisableChn | |
HI_MPI_VO_EnableChn | |
HI_MPI_VO_PipLayerUnBindDev | |
HI_MPI_VO_PipLayerBindDev | |
HI_MPI_VO_DisableVideoLayer | |
HI_MPI_VO_EnableVideoLayer | |
HI_MPI_VO_Disable | |
HI_MPI_VO_Enable | |
HI_MPI_VO_GetDevFramerate | |
HI_MPI_VO_GetVtth | |
HI_MPI_VO_GetCascadePattern | |
HI_MPI_VO_GetCascadeAttr | |
HI_MPI_VO_SetCascadeAttr | |
HI_MPI_VO_GetGfxLayerCSC | |
HI_MPI_VO_SetGfxLayerCSC | |
HI_MPI_VO_WbcReleaseScreenFrame | |
HI_MPI_VO_WbcGetScreenFrame | |
HI_MPI_VO_GetWbcAttr | |
HI_MPI_VO_GetWbcMode | |
HI_MPI_VO_GetWbcDepth | |
HI_MPI_VO_SetWbcAttr | |
HI_MPI_VO_GetVgaParam | |
HI_MPI_VO_SetVgaParam | |
HI_MPI_VO_GetDevCSC | |
HI_MPI_VO_SetDevCSC | |
HI_MPI_VO_GetDispBufLen | |
HI_MPI_VO_ReleaseScreenFrame | |
HI_MPI_VO_GetScreenFrame | |
HI_MPI_VO_GetPlayToleration | |
HI_MPI_VO_GetChnDispThreshold | |
HI_MPI_VO_SendFrameTimeOut | |
HI_MPI_VO_SendFrame | |
HI_MPI_VO_QueryChnStat | |
HI_MPI_VO_GetChnPts | |
HI_MPI_VO_GetZoomInWindow | |
HI_MPI_VO_SetZoomInWindow | |
HI_MPI_VO_ReleaseChnFrame | |
HI_MPI_VO_GetChnFrame | |
HI_MPI_VO_GetChnFrameRate | |
HI_MPI_VO_GetChnField | |
HI_MPI_VO_GetChnDispPos | |
HI_MPI_VO_SetChnDispPos | |
HI_MPI_VO_GetChnAttr | |
HI_MPI_VO_SetChnAttr | |
HI_MPI_VO_GetPipLayerAttr | |
HI_MPI_VO_SetPipLayerAttr | |
HI_MPI_VO_GetVideoLayerAttr | |
HI_MPI_VO_SetVideoLayerAttr | |
HI_MPI_VO_GetPubAttr | |
HI_MPI_VO_SetPubAttr | |
VoDev(%d) is invalid | |
VoChn(%d) is invalid | |
/dev/vo | |
open vou device error! | |
Close VO Channel Fail | |
NULL addr! | |
u32Layer(%d) is invalid | |
HI_MPI_VPSS_GetDelay | |
HI_MPI_VPSS_SetDelay | |
HI_MPI_VPSS_GetImageQualityCfg | |
HI_MPI_VPSS_SetImageQualityCfg | |
HI_MPI_VPSS_GetExtChnAttr | |
HI_MPI_VPSS_SetExtChnAttr | |
HI_MPI_VPSS_GetGrpFrameRate | |
HI_MPI_VPSS_SetGrpFrameRate | |
HI_MPI_VPSS_GetGrpSizer | |
HI_MPI_VPSS_SetGrpSizer | |
HI_MPI_VPSS_GetGrpField | |
HI_MPI_VPSS_SetGrpField | |
HI_MPI_VPSS_GetChnField | |
HI_MPI_VPSS_SetChnField | |
HI_MPI_VPSS_GetPreScale | |
HI_MPI_VPSS_SetPreScale | |
HI_MPI_VPSS_GetChnSpParam | |
HI_MPI_VPSS_SetChnSpParam | |
HI_MPI_VPSS_GetChnNrParam | |
HI_MPI_VPSS_SetChnNrParam | |
HI_MPI_VPSS_GetDepth | |
HI_MPI_VPSS_SetDepth | |
HI_MPI_VPSS_GetChnMode | |
HI_MPI_VPSS_SetChnMode | |
HI_MPI_VPSS_GetGrpParam | |
HI_MPI_VPSS_SetGrpParam | |
HI_MPI_VPSS_SetChnAttr | |
HI_MPI_VPSS_GetChnAttr | |
HI_MPI_VPSS_UserReleaseGrpFrame | |
HI_MPI_VPSS_UserGetGrpFrame | |
HI_MPI_VPSS_UserReleaseFrame | |
HI_MPI_VPSS_UserGetFrame | |
HI_MPI_VPSS_UserSendFrameTimeout | |
HI_MPI_VPSS_UserSendFrame | |
HI_MPI_VPSS_GetCropCfg | |
HI_MPI_VPSS_SetCropCfg | |
HI_MPI_VPSS_DisableBackupFrame | |
HI_MPI_VPSS_EnableBackupFrame | |
HI_MPI_VPSS_DisableChn | |
HI_MPI_VPSS_EnableChn | |
HI_MPI_VPSS_ResetGrp | |
HI_MPI_VPSS_StopGrp | |
HI_MPI_VPSS_StartGrp | |
HI_MPI_VPSS_SetGrpAttr | |
HI_MPI_VPSS_GetGrpAttr | |
HI_MPI_VPSS_DestroyGrp | |
HI_MPI_VPSS_CreateGrp | |
VpssGrpid(%d) is invalid | |
NULL pointer | |
/dev/vpss | |
open vpss(%d) err, ret:%d | |
VpssChnID(%d) is invalid | |
open vpss(%d,%d) err, ret:%d | |
open /dev/mmz_userdev | |
CloseG726Decoder | |
CloseADPCMDecoder | |
CloseG711UDecoder | |
CloseG711ADecoder | |
DecodeG726Frm | |
DecodeADPCMFrm | |
DecodeG711UFrm | |
DecodeG711AFrm | |
OpenG726Decoder | |
OpenG711UDecoder | |
OpenG711ADecoder | |
OpenADPCMDecoder | |
DecodeLPCMFrm | |
EncodeLPCMFrm | |
CloseG726Encoder | |
OpenG726Encoder | |
CloseADPCMEncoder | |
OpenADPCMEncoder | |
CloseG711UEncoder | |
OpenG711UEncoder | |
CloseG711AEncoder | |
OpenG711AEncoder | |
EncodeG726Frm | |
EncodeADPCMFrm | |
EncodeG711UFrm | |
EncodeG711AFrm | |
Lpcm | |
G711a | |
G711u | |
Adpcm | |
/home/pub/platform_h3/mpp/code/mpi/audio/audio_voice_adp.c | |
pDecoder != NULL | |
pu8Inbuf != NULL | |
ps32LeftByte != NULL | |
pu16Outbuf != NULL | |
pu32OutLen != NULL | |
pu32Chns != NULL | |
pDecoderAttr != NULL | |
ppDecoder != NULL | |
pstData != NULL | |
pu8Outbuf != NULL | |
pEncoder != NULL | |
pEncoderAttr != NULL | |
ppEncoder != NULL | |
[Func]:%s [Line]:%d [Info]:the u32PtNumPerFrm%d is illegal for ADPCM_TYPE_DVI4 | |
[Func]:%s [Line]:%d [Info]:the u32PtNumPerFrm%d is illegal for ADPCM_TYPE_IMA | |
SysGetDevChnByIdx | |
SYS_BIND_ResetData | |
SYS_BIND_SendData | |
SYS_UnBind | |
/home/pub/platform_h3/mpp/code/mkp/bind/sys_bind.c | |
0 != pstBinderCtx->u32MaxDevCnt | |
ModId:%d is invalid ! | |
ModId:%d(%s) is not supported ! | |
Bind dev or chn is invalid, dev:%d, chn:%d ! | |
Mod:%d have not register ! | |
bind src(mod:%d,dev:%d,chn:%d) too many | |
enModId < HI_ID_BUTT | |
Mod %d have not register ! | |
Mod %d, dev %d, chn %d, have not bind ! | |
have not Binder ! | |
pstSendBindSrc->astMppChn[i].enModId < HI_ID_BUTT | |
enDataType < MPP_DATA_BUTT | |
pstSrcBind->u32DestNum > 0 | |
HI_TRUE == bFind | |
Dest have bind Src:(%s,%d,%d) ! | |
src bind max(%d) err! | |
No memory for bind SRC! | |
BIND_MALLOC err! | |
Mod %d have register ! | |
u32MaxDevCnt or u32MaxChnCnt invalid ! | |
No memory for bind table! | |
HiBVT_AUDIO_VERSION_V3.0.0.0 Build Time:[Aug 5 2014, 14:04:57] | |
ChipIdMemMap | |
Func: %s, line: %d, open fd error! | |
Func: %s, line: %d, mmap error! | |
HiBVT_AUDIO_VERSION_V3.0.0.0 Build Time:[Aug 5 2014, 14:05:02] | |
ChipIdMemMap | |
AEC invalid SampleRate(%d), FrameLen(%d) | |
AEC_Init error framelen(%d) | |
AEC_Init error tailen(%d) | |
52:W>AB | |
L P?SBV+Y | |
ChipIdMemMap | |
Invalid Input Param outrate(%d) | |
Invalid Input Param outrate(%d) | |
Invalid Input Param | |
Invalid Input Param inrate(%d) | |
Invalid Input Param inrate(%d) outrate(%d) | |
GetOutSamperRate fail outsamplerate(%d) | |
ResamplerGetMaxOutputNum_Core | |
%s line[%d] error insamps(%d/%d) | |
%s line[%d] error insamps(%d) chans(%d) | |
RES_LinearSRC_GetMaxOutputNum | |
%s line[%d] null handle | |
w` | |
ChipIdMemMap | |
ANR_Init invalid SampleRate(%d), FrameLen(%d) | |
ANR_Init error frame len(%d) | |
52:W>AB | |
L P?SBV+Y | |
HiBVT_AUDIO_VERSION_V3.0.0.0 Build Time:[Aug 5 2014, 14:04:59] | |
ChipIdMemMap | |
VQEV2 invalid hVqe | |
VQEV2 invalid ps16SinBuf(%p)/ps16SouBuf(%p) | |
VQEV2 invalid ps16RinBuf | |
VQEV2 invalid inputSample(%d), VqeFrame(%d) | |
VQEV2 fail to process up line(%d) err(%x) | |
HI_HMEANR_ProcessFrame fail to process up (%x) | |
HI_HMEALC_ProcessFrame fail to process up (%x) | |
VQEV2 invalid s32SampleRate(%d) | |
VQEV2 invalid s32FrameSample(%d) | |
VQEV2 iChnSize (%d) must less than(%d) | |
Size(0x%x) should align to(0x%x) | |
malloc(0x%x) failed | |
HI_HMEANR_Create Init failure | |
HI_HMEALC_Create Init failure | |
HSE_SCHEDULE_Check Fail to check %d | |
HSE_SCHEDULE_Init Fail to initial %x | |
ChipIdMemMap | |
ALC invalid hAlc | |
ALC invalid ps16SinBuf | |
ALC invalid ps16SouBuf | |
ALC invalid s32Sample(%d) VQE_10MS_FRAME_LEN(%d) | |
ALC invalid s32Sample(%d) | |
ALC invalid MaxLev(%d) | |
ALC invalid MaxLev(%d), MinLev(%d) | |
ANR invalid hAnr | |
ANR invalid ps16SinBuf | |
ANR invalid ps16SouBuf | |
ANR invalid s32Sample(%d) VQE_10MS_FRAME_LEN(%d) | |
ANR invalid s32Sample(%d) | |
ANR vqe_AnrCheck fail(%sReturn) | |
t!w"z | |
@ @S? | |
< <S; | |
8 8S7 | |
4 4S3 | |
0 0S/ | |
, ,S+ | |
( (S' | |
$ $S# | |
S | |
8e?!G | |
v g | |
Division Error var1=%d var2=%d | |
Division by 0, Fatal error | |
ERROR: Invalid input into L_divide! | |
D5H}K | |
[._vb | |
r'vpy | |
;/D|L | |
p6uey | |
|ey6u | |
T|L/D | |
.$//021-2!3 | |
6m708 | |
>3?m? | |
$|%(& | |
&|'#( | |
=&>X> | |
?'?H?g? | |
"%#~# | |
(-)~) | |
) *q* | |
,.-z- | |
.5/}/ | |
0"1f1 | |
102r2 | |
253u3 | |
314o4 | |
4$5`5 | |
6%7[7 | |
7-8`8 | |
8&9V9 | |
:;:h: | |
;:;c; | |
;"<F<j< | |
=2=Q=o= | |
>1>J>b>y> | |
?/???O?_?m?{? | |
c1esf | |
h"jUk | |
p#qCras{t | |
d$Qp | |
]vzD | |
TT:9 | |
f]7^ | |
!q`}L | |
RPy? | |
<j$} | |
&b=k' | |
007y} | |
[4Aw | |
@ -` | |
F{|VV | |
yJ}:Nz | |
jZT(0 | |
2ykJ | |
P^ZTd' | |
T)lx | |
JJ{_ | |
pLkEn | |
J@LFg | |
H :A | |
WNDn | |
lHh] | |
D Hsb3 | |
BLnB | |
+&;Cx& | |
tf; | |
x)Q | |
HMtr | |
_~yW+ | |
r{M} | |
yQ64 | |
gOs | |
?z@|0} | |
<h,I | |
Zzy? | |
.kQ1f | |
E'<x | |
NEk9 | |
Pk>Q | |
iMedia Audio V100R002C01 ARMv5 AEC | |
16:00:28 Jul 14 2014 | |
iMedia Audio V100R002C01 ARMv5 VQE | |
16:00:54 Jul 14 2014 | |
!V" | |
023&6v95={AdF | |
!N#<%a' | |
/23Y7;< | |
e^f1g | |
<~]} | |
yAxmw | |
t)t[s | |
p4pmo | |
m"mal | |
j&jki | |
U UrT | |
<A-f | |
<A-f | |
<A-f | |
<A-Bt | |
65Bt | |
eq8g | |
d 5S | |
$&l05 | |
$&l05 | |
AOS4 | |
eq8X | |
>lXM | |
eq89] | |
*vOx | |
n!,pN | |
<A-f | |
<A-{ | |
Z.pN | |
k/vOx | |
N?`yW | |
f="Bt | |
>=j/ | |
BB<Y | |
AOS4 | |
65Bt | |
eq8g | |
*9-@ | |
(lXM | |
q>AP | |
?$&l0 | |
>7$P9 | |
XF43 | |
d 5S | |
$&l05 | |
XF43 | |
cp[1 | |
$&l05 | |
1&8' | |
>7$P9 | |
!d*7 | |
(AK | |
XF43 | |
!d*7 | |
cp[1 | |
$&l05 | |
f="Rm | |
AOS4 | |
1&8' | |
e*rn/%~ | |
/:^V | |
!d*7 | |
<_+s | |
(AK | |
!=`yW | |
AOS4 | |
TK7= | |
9 C-8 | |
eq8X | |
/?|gd | |
=lXM | |
D>n( | |
*vOx | |
n!,pN | |
<A-f | |
<A-C-8 | |
Z.pN | |
)f'2 | |
k/vOx | |
?_+s | |
g640: | |
N?`yW | |
f="^R | |
>=j/ | |
BB<Y | |
AOS4 | |
l;r0 | |
65Bt | |
dn5* | |
TK7C-8 | |
5l$B | |
eq8g | |
AOS4 | |
*9-@ | |
W9x4A | |
BdY:o | |
Z.|gd | |
n!,m | |
(lXM | |
e[=V | |
w=_+s | |
q>AP | |
0,x? | |
'j+{ | |
?$&l0 | |
?XF43 | |
El5> | |
1!O? | |
El5> | |
e=.G | |
<8 V | |
8O>K5 | |
El5> | |
e=.G | |
>7$P9 | |
<8 V | |
!+y<19o | |
:4 F | |
XF43 | |
w7Wt | |
>7$P9 | |
89;<7 | |
d 5S | |
$&l05 | |
0\HO | |
XF43 | |
UL* | |
cp[1 | |
$&l05 | |
1&8' | |
]j>/ | |
92p% | |
w7Wt | |
>7$P9 | |
"7%<R | |
!d*7 | |
q Eq | |
(AK | |
L2 L[F | |
6'+K | |
| gk | |
.}[5 | |
:4 F | |
1&8' | |
3@L; | |
92p% | |
rn/%~ | |
XF43 | |
2u`2 | |
0]f2 | |
!d*7 | |
cp[1 | |
P De | |
(AK | |
p&L[F | |
nh$' | |
$&l05 | |
0\HO | |
]j>/ | |
k,._ | |
-Ki7 | |
\e 5W | |
?,:qZ | |
f="Rm | |
(8U0 | |
0<My | |
UL* | |
,62U7K | |
AOS4p{ | |
(F8+ | |
ZR(S | |
G8'S | |
66|5AP | |
G6j< | |
go67 | |
1&8' | |
*92p% | |
:P?*6 | |
~:}8 | |
e*rn/%~ | |
TL9Z | |
O: ~ | |
Y@"Dz | |
,Y7.k | |
!d*7 | |
`@1<v3 | |
q Eq | |
P De | |
]/ ;U4 | |
=_+s | |
(AK | |
!=O9, | |
E27= | |
g640 | |
M=$` | |
(8U0-U | |
b=`yW | |
0L[F | |
1dl\ | |
oJ>_ | |
[>Ou | |
,62* | |
|>S@2 | |
@HU2 | |
3?n. | |
AOS4 | |
dn5% | |
G6E! | |
?%v[ | |
L+b6 | |
?lh3 | |
TK7= | |
d7Fgx | |
9 C-8 | |
\e ] | |
?l$B | |
eq8X | |
jx}! | |
A9y# | |
!l?z | |
!Q)6 | |
?((" | |
?L5? | |
b{?oc | |
]?Fa4 | |
,VR? | |
BdY: | |
Y7G?Ll | |
:<My | |
#M1) | |
?|gd | |
4;Sx | |
:dw>y | |
$"gb | |
7 $N | |
D>El | |
;q,n | |
;U7K | |
y!!> | |
`@1< | |
=lXM | |
S<f>V | |
BB<r | |
e[=p{ | |
i|P; | |
4;m? | |
:=j/ | |
nh$' | |
G8'c | |
y!!> | |
c:gF | |
D>n( | |
/P>] | |
f>q9 | |
$( b% | |
M8x4A | |
)8Wg | |
%q7-@ | |
37%7 | |
6!v4 | |
n)'N+ | |
??Ii | |
L+b6 | |
Y7G?{ | |
E:69] | |
q?c> | |
k,*4 | |
0,x? | |
:P?*Z | |
?NZi | |
?,c" | |
4 G: | |
*vOx | |
?ukM | |
j+-/# | |
@HU2 | |
?%R1 | |
1tNv | |
n!,pN | |
|/7I | |
H.cJ | |
s/-5 | |
<A-f | |
,C-8 | |
?SIN | |
3,,3 | |
W+Q" | |
,Y7. | |
:P?*5 | |
Z.pN | |
Zak.+e | |
J!)f'2 | |
/-/# | |
&Q)6 | |
d\& | |
k/vOx | |
?_+s | |
0,x?O9, | |
g640: | |
]?$` | |
(8U0P | |
e0#e | |
N?`yW | |
Y7G? | |
jx}!^R | |
0'N+ | |
>dR | |
M1) | |
?)s_ | |
9 *T | |
(1X[ | |
>XED | |
1 b% | |
[>Ou | |
->S@2 | |
@HU2 | |
y!!>1 | |
>=j/ | |
gt<0 | |
M64ni | |
BB<Y | |
AOS4 | |
`@1<{ | |
0p4a | |
~4fB | |
4"gb | |
l;r0 | |
65Bt | |
dn5* | |
66|5S | |
5M1) | |
m:C] | |
BdY: | |
'+K | |
W9%v[ | |
L+b6Q)6 | |
go6l?z | |
37%7 | |
7lh3 | |
TK7C-8 | |
L+b6^ | |
5l$B | |
eq8g | |
~:}8 | |
8 G: | |
0p45E | |
AOS4 | |
9!v4 | |
*9-@ | |
W9x4A | |
@HU2 | |
81L5? | |
9=j/ | |
(8U0 | |
g640Fa4 | |
BdY:o | |
Z.|gd | |
,Y7. | |
;#\6 | |
-N7< | |
=q*;0 | |
i|P; | |
j,ze | |
Y;Ll | |
#Kc; | |
n!,m | |
+#\6 | |
;L5? | |
:P?* | |
(<~G | |
`@1<lh3 | |
(lXM | |
~#l< | |
CH&V | |
Z^$y | |
#u(= | |
E27= | |
d#-.6 | |
E=% | |
7;T=)s_ | |
e[=V | |
i=$` | |
w=_+s | |
h!H6 | |
=!38 | |
>%R1 | |
y!!>% | |
8>Ii | |
/P>kY | |
6a>H | |
q>AP | |
:dw>A | |
>q,n | |
><My | |
3?u2 | |
Y7G?* | |
J?gk | |
,VR? | |
U?L[F | |
Y?-U | |
0,x? | |
?92p%+9 | |
'j+{ | |
)r(V | |
f+]a | |
,,)D | |
\/~- | |
?$&l0 | |
L2 ~ | |
B+2l | |
?XF43 | |
?El5> | |
<A-f | |
65Bt | |
eq8X | |
BB<~, | |
eq8g | |
*vOx | |
<A-f | |
<A- | |
k/vOx | |
>=j/ | |
65Bt | |
eq8g | |
(lXM | |
d L5 | |
XF43 | |
d 5S | |
$&l05 | |
$&l05 | |
!d*7 | |
XF43 | |
cp[1 | |
$&l05 | |
f="Rm | |
AOS4AP | |
;:^ | |
!d*7 | |
<`yW | |
AOS4 | |
9 C-8 | |
eq8X | |
D>lXM | |
eq8-@ | |
TK79] | |
*vOx | |
n!,pN | |
<A-f | |
Z.pN | |
k/vOx | |
?_+s | |
N?`yW | |
9 Bt | |
>=j/ | |
BB<Y | |
AOS4 | |
65Bt | |
TK7C-8 | |
eq8g | |
AOS4 | |
*9-@ | |
Z.|gd | |
n!,m | |
(lXM | |
w=_+s | |
q>AP | |
'j+{ | |
?$&l0 | |
?XF43 | |
El5> | |
El5> | |
e=.G | |
>7$P9 | |
<8 V | |
XF43 | |
>7$P9 | |
d 5S | |
$&l05 | |
XF43 | |
cp[1 | |
$&l05 | |
1&8' | |
92p% | |
w7Wt | |
>7$P9 | |
!d*7 | |
(AK | |
L2 L[F | |
1&8' | |
rn/%~ | |
XF43 | |
!d*7 | |
cp[1 | |
(AK | |
$&l05 | |
]j>/ | |
f="Rm | |
(8U0u | |
AOS4D | |
R5AP | |
1&8' | |
*92p% | |
e*rn/%~ | |
/: ~ | |
m:^V | |
!d*7 | |
`@1< | |
P De | |
<_+s | |
(AK | |
g640 | |
M=`yW | |
0L[F | |
,62* | |
'?n. | |
AOS4 | |
dn5% | |
G6E! | |
TK7= | |
9 C-8 | |
\e ] | |
?l$B | |
eq8X | |
!Q)6 | |
BdY: | |
Y7G? | |
:<My | |
#M1) | |
?|gd | |
$"gb | |
;U7K | |
y!!> | |
=lXM | |
e[=p{ | |
G8'c | |
D>n( | |
$( b% | |
eq8x4A | |
??Ii | |
L+b69] | |
0,x? | |
:P?*Z | |
0p4w | |
*vOx | |
j+-/# | |
@HU2 | |
1tNv | |
n!,pN | |
|.cJ | |
<A-f | |
<A-1 | |
,C-8 | |
j,,3 | |
,Y7. | |
:P?*{ | |
Z.pN | |
Z)f'2 | |
/-/# | |
k/vOx | |
,%ss | |
?_+s | |
0,x?O9, | |
g640: | |
:#yW | |
]?$` | |
(8U0P | |
N?`yW | |
f="| | |
=!>dR | |
1 b% | |
[>Ou | |
->S@2 | |
@HU2 | |
>=j/ | |
M64ni | |
BB<Y | |
AOS4 | |
0p4a | |
4"gb | |
l;r0 | |
65Bt | |
dn5* | |
5M1) | |
BdY: | |
W9%v[ | |
L+b6Q)6 | |
7lh3 | |
TK7C-8 | |
5l$B | |
eq8g | |
8 G: | |
AOS4 | |
9!v4 | |
*9-@ | |
W9x4A | |
81L5? | |
9=j/ | |
g640Fa4 | |
BdY:o | |
Z.|gd | |
j,ze | |
Y;Ll | |
n!,m | |
;L5? | |
`@1<lh3 | |
(lXM | |
e[=V | |
i=$` | |
w=_+s | |
=!38 | |
y!!>% | |
8>Ii | |
/P>kY | |
q>AP | |
><My | |
Y7G?* | |
U?L[F | |
0,x? | |
?92p%+9 | |
'j+{ | |
)r(V | |
f+]a | |
,,)D | |
?$&l0 | |
?XF43 | |
?El5> | |
1!O? | |
8O>K5 | |
El5> | |
e=.G | |
<8 V | |
!+y<19o | |
89;<7 | |
w7Wt | |
>7$P9 | |
"7%<R | |
6'+K | |
| \y | |
.}[5 | |
:4 F | |
3@L; | |
XF43 | |
2u`2 | |
0]f2 | |
cp[1 | |
$&l05 | |
0\HO | |
]j>/ | |
k,._ | |
-Ki7 | |
?,:qZ | |
UL* | |
(F8+ | |
ZR(S | |
1&8' | |
92p% | |
rn/%~ | |
Y@"Dz | |
!d*7 | |
q Eq | |
P De | |
]/ ;U4 | |
(AK | |
\e 50 | |
jx}! | |
?((" | |
"<My | |
4$q,n | |
I$U7K | |
$f>V | |
4&p{ | |
d\&D | |
nh$' | |
!L'AP | |
t8(7 | |
:P?* | |
e*NZi | |
*,c" | |
*ukM | |
E+lc | |
+%R1 | |
n!,R | |
W, ~ | |
mv-" | |
-SIN | |
%.to | |
,Y7. | |
H.:^ | |
Zak.`N | |
/_+s | |
0O9, | |
g640 | |
D0$` | |
(8U0A | |
e0`yW | |
0)s_ | |
81% | |
Y1XED | |
,62 | |
E2S@2 | |
@HU21 | |
X3j/ | |
AOS4{ | |
`5bO | |
66|5 | |
T6%v[ | |
L+b6 | |
37%7lh3 | |
TK7~G | |
58l$B | |
eq8# | |
~:}8 | |
TL9v | |
9L5? | |
S%:C | |
A::Fa4 | |
BdY: | |
c:Ll | |
m:v; | |
:|gd | |
;N7< | |
=q*; | |
i|P;ze | |
#Kc;m | |
l;#\6 | |
`@1< | |
9<lXM | |
~#l< | |
#u(= | |
E27= | |
>=-.6 | |
7;T= | |
~=fY | |
==j/ | |
y!!> | |
$'>gF | |
8>-H | |
6a>u | |
:dw>" | |
>x4A | |
#?!v4 | |
Y7G? | |
J?9] | |
,VR? | |
Y?Nn | |
0,x? | |
b{?9 | |
? G: | |
?1Yy | |
?tNv | |
?~K} | |
?C-8 | |
?f'2 | |
?l?z | |
?Q)6 | |
0,x?Q | |
`?yW | |
,VR? | |
Y7G?s | |
nC?| | |
7?6* | |
3?^R | |
#?>dR | |
?M1) | |
>=W5 | |
|>La | |
:dw>rW | |
q>cYu | |
`l>"gb | |
/P>P] | |
3>I| | |
y!!> | |
e[== | |
7;T=? | |
E=$w- | |
E27=E | |
#u(= | |
|<K4 | |
~#l< | |
~[<e | |
S<%\= | |
BB<z | |
`@1<R | |
;~;^ | |
;aSA | |
#Kc; | |
i|P; | |
=q*; | |
;q+F | |
BdY: | |
TL9 b% | |
~:}8 | |
eq8D | |
A8rM0 | |
)8VK | |
%q7. | |
37%7 | |
6'N+ | |
64e | |
|6KU | |
go6D3 | |
L+b6 | |
5SO{ | |
5GNe | |
66|5: | |
dn55 | |
5u-& | |
AOS4p | |
M64J | |
v3vOx | |
3, U | |
2L5B | |
Dt27t' | |
d2-/# | |
@HU2 | |
,62; | |
81?[ | |
(8U0 | |
D0ZH | |
g640 | |
|/Ro | |
(/Ce | |
|.-g | |
Zak. | |
,Y7. | |
%.Ts | |
mv-P | |
<A-a | |
s/-P | |
|,Ts | |
n!,-g | |
j+Ce | |
:P?* | |
k,*ZH | |
_(kw | |
'-/# | |
'7t' | |
!L'q | |
nh$'+ | |
'L5B | |
&, U | |
CH&C | |
4&vOx | |
}%.n | |
Ti%M( | |
#u-& | |
%#GNe | |
"SO{ | |
?((" | |
jx}! | |
h!4e | |
!'N+ | |
?$ . | |
'+K | |
@(p | |
@(p | |
Cell | |
Protocol: | |
ESSID: | |
Mode: | |
Frequency: | |
Quality | |
Encryption key: | |
Group Cipher : | |
@OA&410& | |
! / > L Z h v | |
! / = K Y g t | |
6 ` | |
2 E X k } | |
2 D W j | | |
/ ? O _ o | |
! 0 ? M \ k y | |
* 8 F T b p ~ | |
" 0 > K Y g t | |
* 8 E S a o | | |
$ : P f | | |
2 E X k } | |
abcdefghijklmnopqrstuvwxyz | |
0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZ!?#&(),.:;~*%+-X/="`_@ | |
203.195.157.36 | |
lbs1.goolink.org | |
ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/ | |
666666666666666666666666666666666666666666666666\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\\6 | |
`H?f | |
F/p^ | |
+QQ 3K% | |
0A/8 | |
Hp!v | |
kNGY|( | |
wl]azW | |
6.F^ | |
Qf(I | |
~^bv | |
Qmm5 | |
`H?f | |
F/p^ | |
+QQ 3K% | |
0A/8 | |
Hp!v | |
kNGY|( | |
wl]azW | |
6.F^ | |
Qf(I | |
~^bv | |
Qmm5 | |
Hp!v | |
kNGY|( | |
wl]azW | |
6.F^ | |
Qf(I | |
~^bv | |
Qmm5 | |
wl]azW | |
6.F^ | |
Qf(I | |
~^bv | |
Qmm5 | |
uT_Rm# | |
'`ax | |
#ETHw | |
dlCz | |
l}C.we | |
SK?Nv | |
'nU_O_M | |
WWW-Authenticate: Basic realm=" | |
Location: | |
0.0.0.0 | |
0.0.0.0 | |
0123456789abcdefABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/ | |
HI_VERSION=Hi3518_MPP_V1.0.9.0 | |
|}|y|u|q|m|i|e|a|]|Y|U|Q|M|I|E|A|>|<|:|8|6|4|2|0|.|,|*|(|&|$|"| | |
Q6Q6 | |
aeabi | |
ARM926EJ-S | |
GCC: (GNU) 3.3.2 20031005 (Debian prerelease) | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v300) 4.8.3 20131202 (prerelease) | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\aec_m_table.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\aec_m_table.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\Aec_Schedule_init.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\Aec_Schedule_init.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\HSE_Schedule_init.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535 --diag_error=3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\schedule\HSE_Schedule_init.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\HSE_Schedule_proc.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535 --diag_error=3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\schedule\HSE_Schedule_proc.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\HSE_Schedule_table.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535 --diag_error=3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\schedule\HSE_Schedule_table.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\HSE_Schedule_trace.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535 --diag_error=3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\schedule\HSE_Schedule_trace.c | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\aec_m_api.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\aec_m_api.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\aec_m_Processblock.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\aec_m_Processblock.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\aec_m_UpdateChannel.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\aec_m_UpdateChannel.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\aec_nlp_op.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\aec_nlp_op.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\aec_oper_32b.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\aec_oper_32b.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\aec_realfft.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\aec_realfft.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\Aec_Schedule_proc.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\Aec_Schedule_proc.c | |
ARM Assembler, RVCT4.0 [Build 400] | |
armasm --diag_style=ide --diag_suppress=2535,1602,1073 --diag_error=3007 --cpu=ARM926EJ-S --fpu=SoftVFP --apcs=/interwork --no_divide -o..\..\o_file\HSE_FFT_40FQ30.o ..\..\..\src\fft\HSE_FFT_40FQ30.s | |
ARM Assembler, RVCT4.0 [Build 400] | |
armasm --diag_style=ide --diag_suppress=2535,1602,1073 --diag_error=3007 --cpu=ARM926EJ-S --fpu=SoftVFP --apcs=/interwork --no_divide -o..\..\o_file\HSE_FFT_4EFQ30.o ..\..\..\src\fft\HSE_FFT_4EFQ30.s | |
ARM Assembler, RVCT4.0 [Build 400] | |
armasm --diag_style=ide --diag_suppress=2535,1602,1073 --diag_error=3007 --cpu=ARM926EJ-S --fpu=SoftVFP --apcs=/interwork --no_divide -o..\..\o_file\HSE_FFT_4EIQ30.o ..\..\..\src\fft\HSE_FFT_4EIQ30.s | |
ARM Assembler, RVCT4.0 [Build 400] | |
armasm --diag_style=ide --diag_suppress=2535,1602,1073 --diag_error=3007 --cpu=ARM926EJ-S --fpu=SoftVFP --apcs=/interwork --no_divide -o..\..\o_file\HSE_FFT_4OIQ30.o ..\..\..\src\fft\HSE_FFT_4OIQ30.s | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\HSE_t_04096_4.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535 --diag_error=3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\fft\HSE_t_04096_4.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\HSE_t_04096_8.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535 --diag_error=3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\fft\HSE_t_04096_8.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\HSE_t_rad.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535 --diag_error=3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\fft\HSE_t_rad.c | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\aec_basic_op.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\aec_basic_op.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\aec_m_CalcEnergies.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\aec_m_CalcEnergies.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\aec_m_CalcStepSize.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\aec_m_CalcStepSize.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\aec_m_CalcSupGain.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\aec_m_CalcSupGain.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\aec_m_ComfortNoise_Mobile.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\aec_m_ComfortNoise_Mobile.c | |
ARM C/C++ Compiler, RVCT4.0 [Build 400] | |
armcc --c99 --forceinline -c --asm --no_hide_all --library_interface=aeabi_glibc -o..\..\o_file\aec_m_Estdelay.o --cpu=ARM926EJ-S -O3 -Otime -Ono_memcpy --diag_style=ide --diag_suppress=2535,3007 --enum_is_int --wchar32 --signed_chars --depend_format=unix_escaped --no_depend_system_headers ..\..\..\src\aec\aec_m_Estdelay.c | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (Hisilicon_v100(gcc4.4-290+uclibc_0.9.32.1+eabi+linuxpthread)) 4.4.1 | |
GCC: (GNU) 3.3.2 20031005 (Debian prerelease) | |
.shstrtab | |
.interp | |
.hash | |
.dynsym | |
.dynstr | |
.gnu.version | |
.gnu.version_r | |
.rel.dyn | |
.rel.plt | |
.init | |
.text | |
.asm_text | |
.fini | |
.rodata | |
.constdata | |
.ARM.extab | |
.ARM.exidx | |
.init_array | |
.fini_array | |
.jcr | |
.data.rel.ro | |
.dynamic | |
.got | |
.data | |
.bss | |
.ARM.attributes | |
.arm_vfe_header | |
.comment |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment