Created
August 1, 2012 16:07
-
-
Save jfrux/3228262 to your computer and use it in GitHub Desktop.
My Inject.js Implementation with Issues
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| Inject.setModuleRoot("/static/injectjs/"); | |
| Inject.addRule(/jquery/, { | |
| path: "jquery.js", | |
| pointcuts: { | |
| after: function(module) { | |
| module.setExports(jQuery.noConflict()); | |
| } | |
| } | |
| }); | |
| Inject.addRule(/jqueryui/, { | |
| path: "jquery-ui.js", | |
| pointcuts: { | |
| before: function(module) { | |
| var jQuery; | |
| jQuery = require("jquery"); | |
| }, | |
| after: function(module) { | |
| module.setExports(jQuery); | |
| } | |
| } | |
| }); | |
| Inject.addRule(/bootstrap/, { | |
| path: "bootstrap.js", | |
| pointcuts: { | |
| before: function(module) { | |
| var jQuery; | |
| jQuery = require("jquery"); | |
| }, | |
| after: function(module) { | |
| module.setExports(jQuery); | |
| } | |
| } | |
| }); | |
| require.run("bootloader"); |
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| define("bootloader", ["jquery", "bootstrap", "jqueryui","backbone"], function(require, module, exports) { | |
| var Bootloader; | |
| Bootloader = {}; | |
| console.log("bootloader"); | |
| module.setExports(Bootloader); | |
| }); |
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| /* =================================================== | |
| * bootstrap-transition.js v2.0.4 | |
| * http://twitter.github.com/bootstrap/javascript.html#transitions | |
| * =================================================== | |
| * Copyright 2012 Twitter, Inc. | |
| * | |
| * Licensed under the Apache License, Version 2.0 (the "License"); | |
| * you may not use this file except in compliance with the License. | |
| * You may obtain a copy of the License at | |
| * | |
| * http://www.apache.org/licenses/LICENSE-2.0 | |
| * | |
| * Unless required by applicable law or agreed to in writing, software | |
| * distributed under the License is distributed on an "AS IS" BASIS, | |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| * See the License for the specific language governing permissions and | |
| * limitations under the License. | |
| * ========================================================== */ | |
| !function ($) { | |
| $(function () { | |
| "use strict"; // jshint ;_; | |
| /* CSS TRANSITION SUPPORT (http://www.modernizr.com/) | |
| * ======================================================= */ | |
| $.support.transition = (function () { | |
| var transitionEnd = (function () { | |
| var el = document.createElement('bootstrap') | |
| , transEndEventNames = { | |
| 'WebkitTransition' : 'webkitTransitionEnd' | |
| , 'MozTransition' : 'transitionend' | |
| , 'OTransition' : 'oTransitionEnd' | |
| , 'msTransition' : 'MSTransitionEnd' | |
| , 'transition' : 'transitionend' | |
| } | |
| , name | |
| for (name in transEndEventNames){ | |
| if (el.style[name] !== undefined) { | |
| return transEndEventNames[name] | |
| } | |
| } | |
| }()) | |
| return transitionEnd && { | |
| end: transitionEnd | |
| } | |
| })() | |
| }) | |
| }(window.jQuery); | |
| /* ========================================================= | |
| * bootstrap-modal.js v2.0.4 | |
| * http://twitter.github.com/bootstrap/javascript.html#modals | |
| * ========================================================= | |
| * Copyright 2012 Twitter, Inc. | |
| * | |
| * Licensed under the Apache License, Version 2.0 (the "License"); | |
| * you may not use this file except in compliance with the License. | |
| * You may obtain a copy of the License at | |
| * | |
| * http://www.apache.org/licenses/LICENSE-2.0 | |
| * | |
| * Unless required by applicable law or agreed to in writing, software | |
| * distributed under the License is distributed on an "AS IS" BASIS, | |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| * See the License for the specific language governing permissions and | |
| * limitations under the License. | |
| * ========================================================= */ | |
| !function ($) { | |
| "use strict"; // jshint ;_; | |
| /* MODAL CLASS DEFINITION | |
| * ====================== */ | |
| var Modal = function (content, options) { | |
| this.options = options | |
| this.$element = $(content) | |
| .delegate('[data-dismiss="modal"]', 'click.dismiss.modal', $.proxy(this.hide, this)) | |
| } | |
| Modal.prototype = { | |
| constructor: Modal | |
| , toggle: function () { | |
| return this[!this.isShown ? 'show' : 'hide']() | |
| } | |
| , show: function () { | |
| var that = this | |
| , e = $.Event('show') | |
| this.$element.trigger(e) | |
| if (this.isShown || e.isDefaultPrevented()) return | |
| $('body').addClass('modal-open') | |
| this.isShown = true | |
| escape.call(this) | |
| backdrop.call(this, function () { | |
| var transition = $.support.transition && that.$element.hasClass('fade') | |
| if (!that.$element.parent().length) { | |
| that.$element.appendTo(document.body) //don't move modals dom position | |
| } | |
| that.$element | |
| .show() | |
| if (transition) { | |
| that.$element[0].offsetWidth // force reflow | |
| } | |
| that.$element.addClass('in') | |
| transition ? | |
| that.$element.one($.support.transition.end, function () { that.$element.trigger('shown') }) : | |
| that.$element.trigger('shown') | |
| }) | |
| } | |
| , hide: function (e) { | |
| e && e.preventDefault() | |
| var that = this | |
| e = $.Event('hide') | |
| this.$element.trigger(e) | |
| if (!this.isShown || e.isDefaultPrevented()) return | |
| this.isShown = false | |
| $('body').removeClass('modal-open') | |
| escape.call(this) | |
| this.$element.removeClass('in') | |
| $.support.transition && this.$element.hasClass('fade') ? | |
| hideWithTransition.call(this) : | |
| hideModal.call(this) | |
| } | |
| } | |
| /* MODAL PRIVATE METHODS | |
| * ===================== */ | |
| function hideWithTransition() { | |
| var that = this | |
| , timeout = setTimeout(function () { | |
| that.$element.off($.support.transition.end) | |
| hideModal.call(that) | |
| }, 500) | |
| this.$element.one($.support.transition.end, function () { | |
| clearTimeout(timeout) | |
| hideModal.call(that) | |
| }) | |
| } | |
| function hideModal(that) { | |
| this.$element | |
| .hide() | |
| .trigger('hidden') | |
| backdrop.call(this) | |
| } | |
| function backdrop(callback) { | |
| var that = this | |
| , animate = this.$element.hasClass('fade') ? 'fade' : '' | |
| if (this.isShown && this.options.backdrop) { | |
| var doAnimate = $.support.transition && animate | |
| this.$backdrop = $('<div class="modal-backdrop ' + animate + '" />') | |
| .appendTo(document.body) | |
| if (this.options.backdrop != 'static') { | |
| this.$backdrop.click($.proxy(this.hide, this)) | |
| } | |
| if (doAnimate) this.$backdrop[0].offsetWidth // force reflow | |
| this.$backdrop.addClass('in') | |
| doAnimate ? | |
| this.$backdrop.one($.support.transition.end, callback) : | |
| callback() | |
| } else if (!this.isShown && this.$backdrop) { | |
| this.$backdrop.removeClass('in') | |
| $.support.transition && this.$element.hasClass('fade')? | |
| this.$backdrop.one($.support.transition.end, $.proxy(removeBackdrop, this)) : | |
| removeBackdrop.call(this) | |
| } else if (callback) { | |
| callback() | |
| } | |
| } | |
| function removeBackdrop() { | |
| this.$backdrop.remove() | |
| this.$backdrop = null | |
| } | |
| function escape() { | |
| var that = this | |
| if (this.isShown && this.options.keyboard) { | |
| $(document).on('keyup.dismiss.modal', function ( e ) { | |
| e.which == 27 && that.hide() | |
| }) | |
| } else if (!this.isShown) { | |
| $(document).off('keyup.dismiss.modal') | |
| } | |
| } | |
| /* MODAL PLUGIN DEFINITION | |
| * ======================= */ | |
| $.fn.modal = function (option) { | |
| return this.each(function () { | |
| var $this = $(this) | |
| , data = $this.data('modal') | |
| , options = $.extend({}, $.fn.modal.defaults, $this.data(), typeof option == 'object' && option) | |
| if (!data) $this.data('modal', (data = new Modal(this, options))) | |
| if (typeof option == 'string') data[option]() | |
| else if (options.show) data.show() | |
| }) | |
| } | |
| $.fn.modal.defaults = { | |
| backdrop: true | |
| , keyboard: true | |
| , show: true | |
| } | |
| $.fn.modal.Constructor = Modal | |
| /* MODAL DATA-API | |
| * ============== */ | |
| $(function () { | |
| $('body').on('click.modal.data-api', '[data-toggle="modal"]', function ( e ) { | |
| var $this = $(this), href | |
| , $target = $($this.attr('data-target') || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7 | |
| , option = $target.data('modal') ? 'toggle' : $.extend({}, $target.data(), $this.data()) | |
| e.preventDefault() | |
| $target.modal(option) | |
| }) | |
| }) | |
| }(window.jQuery); | |
| /* ============================================================ | |
| * bootstrap-dropdown.js v2.0.4 | |
| * http://twitter.github.com/bootstrap/javascript.html#dropdowns | |
| * ============================================================ | |
| * Copyright 2012 Twitter, Inc. | |
| * | |
| * Licensed under the Apache License, Version 2.0 (the "License"); | |
| * you may not use this file except in compliance with the License. | |
| * You may obtain a copy of the License at | |
| * | |
| * http://www.apache.org/licenses/LICENSE-2.0 | |
| * | |
| * Unless required by applicable law or agreed to in writing, software | |
| * distributed under the License is distributed on an "AS IS" BASIS, | |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| * See the License for the specific language governing permissions and | |
| * limitations under the License. | |
| * ============================================================ */ | |
| !function ($) { | |
| "use strict"; // jshint ;_; | |
| /* DROPDOWN CLASS DEFINITION | |
| * ========================= */ | |
| var toggle = '[data-toggle="dropdown"]' | |
| , Dropdown = function (element) { | |
| var $el = $(element).on('click.dropdown.data-api', this.toggle) | |
| $('html').on('click.dropdown.data-api', function () { | |
| $el.parent().removeClass('open') | |
| }) | |
| } | |
| Dropdown.prototype = { | |
| constructor: Dropdown | |
| , toggle: function (e) { | |
| var $this = $(this) | |
| , $parent | |
| , selector | |
| , isActive | |
| if ($this.is('.disabled, :disabled')) return | |
| selector = $this.attr('data-target') | |
| if (!selector) { | |
| selector = $this.attr('href') | |
| selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7 | |
| } | |
| $parent = $(selector) | |
| $parent.length || ($parent = $this.parent()) | |
| isActive = $parent.hasClass('open') | |
| clearMenus() | |
| if (!isActive) $parent.toggleClass('open') | |
| return false | |
| } | |
| } | |
| function clearMenus() { | |
| $(toggle).parent().removeClass('open') | |
| } | |
| /* DROPDOWN PLUGIN DEFINITION | |
| * ========================== */ | |
| $.fn.dropdown = function (option) { | |
| return this.each(function () { | |
| var $this = $(this) | |
| , data = $this.data('dropdown') | |
| if (!data) $this.data('dropdown', (data = new Dropdown(this))) | |
| if (typeof option == 'string') data[option].call($this) | |
| }) | |
| } | |
| $.fn.dropdown.Constructor = Dropdown | |
| /* APPLY TO STANDARD DROPDOWN ELEMENTS | |
| * =================================== */ | |
| $(function () { | |
| $('html').on('click.dropdown.data-api', clearMenus) | |
| $('body') | |
| .on('click.dropdown', '.dropdown form', function (e) { e.stopPropagation() }) | |
| .on('click.dropdown.data-api', toggle, Dropdown.prototype.toggle) | |
| }) | |
| }(window.jQuery); | |
| /* ============================================================= | |
| * bootstrap-scrollspy.js v2.0.4 | |
| * http://twitter.github.com/bootstrap/javascript.html#scrollspy | |
| * ============================================================= | |
| * Copyright 2012 Twitter, Inc. | |
| * | |
| * Licensed under the Apache License, Version 2.0 (the "License"); | |
| * you may not use this file except in compliance with the License. | |
| * You may obtain a copy of the License at | |
| * | |
| * http://www.apache.org/licenses/LICENSE-2.0 | |
| * | |
| * Unless required by applicable law or agreed to in writing, software | |
| * distributed under the License is distributed on an "AS IS" BASIS, | |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| * See the License for the specific language governing permissions and | |
| * limitations under the License. | |
| * ============================================================== */ | |
| !function ($) { | |
| "use strict"; // jshint ;_; | |
| /* SCROLLSPY CLASS DEFINITION | |
| * ========================== */ | |
| function ScrollSpy( element, options) { | |
| var process = $.proxy(this.process, this) | |
| , $element = $(element).is('body') ? $(window) : $(element) | |
| , href | |
| this.options = $.extend({}, $.fn.scrollspy.defaults, options) | |
| this.$scrollElement = $element.on('scroll.scroll.data-api', process) | |
| this.selector = (this.options.target | |
| || ((href = $(element).attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7 | |
| || '') + ' .nav li > a' | |
| this.$body = $('body') | |
| this.refresh() | |
| this.process() | |
| } | |
| ScrollSpy.prototype = { | |
| constructor: ScrollSpy | |
| , refresh: function () { | |
| var self = this | |
| , $targets | |
| this.offsets = $([]) | |
| this.targets = $([]) | |
| $targets = this.$body | |
| .find(this.selector) | |
| .map(function () { | |
| var $el = $(this) | |
| , href = $el.data('target') || $el.attr('href') | |
| , $href = /^#\w/.test(href) && $(href) | |
| return ( $href | |
| && href.length | |
| && [[ $href.position().top, href ]] ) || null | |
| }) | |
| .sort(function (a, b) { return a[0] - b[0] }) | |
| .each(function () { | |
| self.offsets.push(this[0]) | |
| self.targets.push(this[1]) | |
| }) | |
| } | |
| , process: function () { | |
| var scrollTop = this.$scrollElement.scrollTop() + this.options.offset | |
| , scrollHeight = this.$scrollElement[0].scrollHeight || this.$body[0].scrollHeight | |
| , maxScroll = scrollHeight - this.$scrollElement.height() | |
| , offsets = this.offsets | |
| , targets = this.targets | |
| , activeTarget = this.activeTarget | |
| , i | |
| if (scrollTop >= maxScroll) { | |
| return activeTarget != (i = targets.last()[0]) | |
| && this.activate ( i ) | |
| } | |
| for (i = offsets.length; i--;) { | |
| activeTarget != targets[i] | |
| && scrollTop >= offsets[i] | |
| && (!offsets[i + 1] || scrollTop <= offsets[i + 1]) | |
| && this.activate( targets[i] ) | |
| } | |
| } | |
| , activate: function (target) { | |
| var active | |
| , selector | |
| this.activeTarget = target | |
| $(this.selector) | |
| .parent('.active') | |
| .removeClass('active') | |
| selector = this.selector | |
| + '[data-target="' + target + '"],' | |
| + this.selector + '[href="' + target + '"]' | |
| active = $(selector) | |
| .parent('li') | |
| .addClass('active') | |
| if (active.parent('.dropdown-menu')) { | |
| active = active.closest('li.dropdown').addClass('active') | |
| } | |
| active.trigger('activate') | |
| } | |
| } | |
| /* SCROLLSPY PLUGIN DEFINITION | |
| * =========================== */ | |
| $.fn.scrollspy = function ( option ) { | |
| return this.each(function () { | |
| var $this = $(this) | |
| , data = $this.data('scrollspy') | |
| , options = typeof option == 'object' && option | |
| if (!data) $this.data('scrollspy', (data = new ScrollSpy(this, options))) | |
| if (typeof option == 'string') data[option]() | |
| }) | |
| } | |
| $.fn.scrollspy.Constructor = ScrollSpy | |
| $.fn.scrollspy.defaults = { | |
| offset: 10 | |
| } | |
| /* SCROLLSPY DATA-API | |
| * ================== */ | |
| $(function () { | |
| $('[data-spy="scroll"]').each(function () { | |
| var $spy = $(this) | |
| $spy.scrollspy($spy.data()) | |
| }) | |
| }) | |
| }(window.jQuery); | |
| /* ======================================================== | |
| * bootstrap-tab.js v2.0.4 | |
| * http://twitter.github.com/bootstrap/javascript.html#tabs | |
| * ======================================================== | |
| * Copyright 2012 Twitter, Inc. | |
| * | |
| * Licensed under the Apache License, Version 2.0 (the "License"); | |
| * you may not use this file except in compliance with the License. | |
| * You may obtain a copy of the License at | |
| * | |
| * http://www.apache.org/licenses/LICENSE-2.0 | |
| * | |
| * Unless required by applicable law or agreed to in writing, software | |
| * distributed under the License is distributed on an "AS IS" BASIS, | |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| * See the License for the specific language governing permissions and | |
| * limitations under the License. | |
| * ======================================================== */ | |
| !function ($) { | |
| "use strict"; // jshint ;_; | |
| /* TAB CLASS DEFINITION | |
| * ==================== */ | |
| var Tab = function ( element ) { | |
| this.element = $(element) | |
| } | |
| Tab.prototype = { | |
| constructor: Tab | |
| , show: function () { | |
| var $this = this.element | |
| , $ul = $this.closest('ul:not(.dropdown-menu)') | |
| , selector = $this.attr('data-target') | |
| , previous | |
| , $target | |
| , e | |
| if (!selector) { | |
| selector = $this.attr('href') | |
| selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7 | |
| } | |
| if ( $this.parent('li').hasClass('active') ) return | |
| previous = $ul.find('.active a').last()[0] | |
| e = $.Event('show', { | |
| relatedTarget: previous | |
| }) | |
| $this.trigger(e) | |
| if (e.isDefaultPrevented()) return | |
| $target = $(selector) | |
| this.activate($this.parent('li'), $ul) | |
| this.activate($target, $target.parent(), function () { | |
| $this.trigger({ | |
| type: 'shown' | |
| , relatedTarget: previous | |
| }) | |
| }) | |
| } | |
| , activate: function ( element, container, callback) { | |
| var $active = container.find('> .active') | |
| , transition = callback | |
| && $.support.transition | |
| && $active.hasClass('fade') | |
| function next() { | |
| $active | |
| .removeClass('active') | |
| .find('> .dropdown-menu > .active') | |
| .removeClass('active') | |
| element.addClass('active') | |
| if (transition) { | |
| element[0].offsetWidth // reflow for transition | |
| element.addClass('in') | |
| } else { | |
| element.removeClass('fade') | |
| } | |
| if ( element.parent('.dropdown-menu') ) { | |
| element.closest('li.dropdown').addClass('active') | |
| } | |
| callback && callback() | |
| } | |
| transition ? | |
| $active.one($.support.transition.end, next) : | |
| next() | |
| $active.removeClass('in') | |
| } | |
| } | |
| /* TAB PLUGIN DEFINITION | |
| * ===================== */ | |
| $.fn.tab = function ( option ) { | |
| return this.each(function () { | |
| var $this = $(this) | |
| , data = $this.data('tab') | |
| if (!data) $this.data('tab', (data = new Tab(this))) | |
| if (typeof option == 'string') data[option]() | |
| }) | |
| } | |
| $.fn.tab.Constructor = Tab | |
| /* TAB DATA-API | |
| * ============ */ | |
| $(function () { | |
| $('body').on('click.tab.data-api', '[data-toggle="tab"], [data-toggle="pill"]', function (e) { | |
| e.preventDefault() | |
| $(this).tab('show') | |
| }) | |
| }) | |
| }(window.jQuery); | |
| /* =========================================================== | |
| * bootstrap-tooltip.js v2.0.4 | |
| * http://twitter.github.com/bootstrap/javascript.html#tooltips | |
| * Inspired by the original jQuery.tipsy by Jason Frame | |
| * =========================================================== | |
| * Copyright 2012 Twitter, Inc. | |
| * | |
| * Licensed under the Apache License, Version 2.0 (the "License"); | |
| * you may not use this file except in compliance with the License. | |
| * You may obtain a copy of the License at | |
| * | |
| * http://www.apache.org/licenses/LICENSE-2.0 | |
| * | |
| * Unless required by applicable law or agreed to in writing, software | |
| * distributed under the License is distributed on an "AS IS" BASIS, | |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| * See the License for the specific language governing permissions and | |
| * limitations under the License. | |
| * ========================================================== */ | |
| !function ($) { | |
| "use strict"; // jshint ;_; | |
| /* TOOLTIP PUBLIC CLASS DEFINITION | |
| * =============================== */ | |
| var Tooltip = function (element, options) { | |
| this.init('tooltip', element, options) | |
| } | |
| Tooltip.prototype = { | |
| constructor: Tooltip | |
| , init: function (type, element, options) { | |
| var eventIn | |
| , eventOut | |
| this.type = type | |
| this.$element = $(element) | |
| this.options = this.getOptions(options) | |
| this.enabled = true | |
| if (this.options.trigger != 'manual') { | |
| eventIn = this.options.trigger == 'hover' ? 'mouseenter' : 'focus' | |
| eventOut = this.options.trigger == 'hover' ? 'mouseleave' : 'blur' | |
| this.$element.on(eventIn, this.options.selector, $.proxy(this.enter, this)) | |
| this.$element.on(eventOut, this.options.selector, $.proxy(this.leave, this)) | |
| } | |
| this.options.selector ? | |
| (this._options = $.extend({}, this.options, { trigger: 'manual', selector: '' })) : | |
| this.fixTitle() | |
| } | |
| , getOptions: function (options) { | |
| options = $.extend({}, $.fn[this.type].defaults, options, this.$element.data()) | |
| if (options.delay && typeof options.delay == 'number') { | |
| options.delay = { | |
| show: options.delay | |
| , hide: options.delay | |
| } | |
| } | |
| return options | |
| } | |
| , enter: function (e) { | |
| var self = $(e.currentTarget)[this.type](this._options).data(this.type) | |
| if (!self.options.delay || !self.options.delay.show) return self.show() | |
| clearTimeout(this.timeout) | |
| self.hoverState = 'in' | |
| this.timeout = setTimeout(function() { | |
| if (self.hoverState == 'in') self.show() | |
| }, self.options.delay.show) | |
| } | |
| , leave: function (e) { | |
| var self = $(e.currentTarget)[this.type](this._options).data(this.type) | |
| if (this.timeout) clearTimeout(this.timeout) | |
| if (!self.options.delay || !self.options.delay.hide) return self.hide() | |
| self.hoverState = 'out' | |
| this.timeout = setTimeout(function() { | |
| if (self.hoverState == 'out') self.hide() | |
| }, self.options.delay.hide) | |
| } | |
| , show: function () { | |
| var $tip | |
| , inside | |
| , pos | |
| , actualWidth | |
| , actualHeight | |
| , placement | |
| , tp | |
| if (this.hasContent() && this.enabled) { | |
| $tip = this.tip() | |
| this.setContent() | |
| if (this.options.animation) { | |
| $tip.addClass('fade') | |
| } | |
| placement = typeof this.options.placement == 'function' ? | |
| this.options.placement.call(this, $tip[0], this.$element[0]) : | |
| this.options.placement | |
| inside = /in/.test(placement) | |
| $tip | |
| .remove() | |
| .css({ top: 0, left: 0, display: 'block' }) | |
| .appendTo(inside ? this.$element : document.body) | |
| pos = this.getPosition(inside) | |
| actualWidth = $tip[0].offsetWidth | |
| actualHeight = $tip[0].offsetHeight | |
| switch (inside ? placement.split(' ')[1] : placement) { | |
| case 'bottom': | |
| tp = {top: pos.top + pos.height, left: pos.left + pos.width / 2 - actualWidth / 2} | |
| break | |
| case 'top': | |
| tp = {top: pos.top - actualHeight, left: pos.left + pos.width / 2 - actualWidth / 2} | |
| break | |
| case 'left': | |
| tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left - actualWidth} | |
| break | |
| case 'right': | |
| tp = {top: pos.top + pos.height / 2 - actualHeight / 2, left: pos.left + pos.width} | |
| break | |
| } | |
| $tip | |
| .css(tp) | |
| .addClass(placement) | |
| .addClass('in') | |
| } | |
| } | |
| , isHTML: function(text) { | |
| // html string detection logic adapted from jQuery | |
| return typeof text != 'string' | |
| || ( text.charAt(0) === "<" | |
| && text.charAt( text.length - 1 ) === ">" | |
| && text.length >= 3 | |
| ) || /^(?:[^<]*<[\w\W]+>[^>]*$)/.exec(text) | |
| } | |
| , setContent: function () { | |
| var $tip = this.tip() | |
| , title = this.getTitle() | |
| $tip.find('.tooltip-inner')[this.isHTML(title) ? 'html' : 'text'](title) | |
| $tip.removeClass('fade in top bottom left right') | |
| } | |
| , hide: function () { | |
| var that = this | |
| , $tip = this.tip() | |
| $tip.removeClass('in') | |
| function removeWithAnimation() { | |
| var timeout = setTimeout(function () { | |
| $tip.off($.support.transition.end).remove() | |
| }, 500) | |
| $tip.one($.support.transition.end, function () { | |
| clearTimeout(timeout) | |
| $tip.remove() | |
| }) | |
| } | |
| $.support.transition && this.$tip.hasClass('fade') ? | |
| removeWithAnimation() : | |
| $tip.remove() | |
| } | |
| , fixTitle: function () { | |
| var $e = this.$element | |
| if ($e.attr('title') || typeof($e.attr('data-original-title')) != 'string') { | |
| $e.attr('data-original-title', $e.attr('title') || '').removeAttr('title') | |
| } | |
| } | |
| , hasContent: function () { | |
| return this.getTitle() | |
| } | |
| , getPosition: function (inside) { | |
| return $.extend({}, (inside ? {top: 0, left: 0} : this.$element.offset()), { | |
| width: this.$element[0].offsetWidth | |
| , height: this.$element[0].offsetHeight | |
| }) | |
| } | |
| , getTitle: function () { | |
| var title | |
| , $e = this.$element | |
| , o = this.options | |
| title = $e.attr('data-original-title') | |
| || (typeof o.title == 'function' ? o.title.call($e[0]) : o.title) | |
| return title | |
| } | |
| , tip: function () { | |
| return this.$tip = this.$tip || $(this.options.template) | |
| } | |
| , validate: function () { | |
| if (!this.$element[0].parentNode) { | |
| this.hide() | |
| this.$element = null | |
| this.options = null | |
| } | |
| } | |
| , enable: function () { | |
| this.enabled = true | |
| } | |
| , disable: function () { | |
| this.enabled = false | |
| } | |
| , toggleEnabled: function () { | |
| this.enabled = !this.enabled | |
| } | |
| , toggle: function () { | |
| this[this.tip().hasClass('in') ? 'hide' : 'show']() | |
| } | |
| } | |
| /* TOOLTIP PLUGIN DEFINITION | |
| * ========================= */ | |
| $.fn.tooltip = function ( option ) { | |
| return this.each(function () { | |
| var $this = $(this) | |
| , data = $this.data('tooltip') | |
| , options = typeof option == 'object' && option | |
| if (!data) $this.data('tooltip', (data = new Tooltip(this, options))) | |
| if (typeof option == 'string') data[option]() | |
| }) | |
| } | |
| $.fn.tooltip.Constructor = Tooltip | |
| $.fn.tooltip.defaults = { | |
| animation: true | |
| , placement: 'top' | |
| , selector: false | |
| , template: '<div class="tooltip"><div class="tooltip-arrow"></div><div class="tooltip-inner"></div></div>' | |
| , trigger: 'hover' | |
| , title: '' | |
| , delay: 0 | |
| } | |
| }(window.jQuery); | |
| /* =========================================================== | |
| * bootstrap-popover.js v2.0.4 | |
| * http://twitter.github.com/bootstrap/javascript.html#popovers | |
| * =========================================================== | |
| * Copyright 2012 Twitter, Inc. | |
| * | |
| * Licensed under the Apache License, Version 2.0 (the "License"); | |
| * you may not use this file except in compliance with the License. | |
| * You may obtain a copy of the License at | |
| * | |
| * http://www.apache.org/licenses/LICENSE-2.0 | |
| * | |
| * Unless required by applicable law or agreed to in writing, software | |
| * distributed under the License is distributed on an "AS IS" BASIS, | |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| * See the License for the specific language governing permissions and | |
| * limitations under the License. | |
| * =========================================================== */ | |
| !function ($) { | |
| "use strict"; // jshint ;_; | |
| /* POPOVER PUBLIC CLASS DEFINITION | |
| * =============================== */ | |
| var Popover = function ( element, options ) { | |
| this.init('popover', element, options) | |
| } | |
| /* NOTE: POPOVER EXTENDS BOOTSTRAP-TOOLTIP.js | |
| ========================================== */ | |
| Popover.prototype = $.extend({}, $.fn.tooltip.Constructor.prototype, { | |
| constructor: Popover | |
| , setContent: function () { | |
| var $tip = this.tip() | |
| , title = this.getTitle() | |
| , content = this.getContent() | |
| $tip.find('.popover-title')[this.isHTML(title) ? 'html' : 'text'](title) | |
| $tip.find('.popover-content > *')[this.isHTML(content) ? 'html' : 'text'](content) | |
| $tip.removeClass('fade top bottom left right in') | |
| } | |
| , hasContent: function () { | |
| return this.getTitle() || this.getContent() | |
| } | |
| , getContent: function () { | |
| var content | |
| , $e = this.$element | |
| , o = this.options | |
| content = $e.attr('data-content') | |
| || (typeof o.content == 'function' ? o.content.call($e[0]) : o.content) | |
| return content | |
| } | |
| , tip: function () { | |
| if (!this.$tip) { | |
| this.$tip = $(this.options.template) | |
| } | |
| return this.$tip | |
| } | |
| }) | |
| /* POPOVER PLUGIN DEFINITION | |
| * ======================= */ | |
| $.fn.popover = function (option) { | |
| return this.each(function () { | |
| var $this = $(this) | |
| , data = $this.data('popover') | |
| , options = typeof option == 'object' && option | |
| if (!data) $this.data('popover', (data = new Popover(this, options))) | |
| if (typeof option == 'string') data[option]() | |
| }) | |
| } | |
| $.fn.popover.Constructor = Popover | |
| $.fn.popover.defaults = $.extend({} , $.fn.tooltip.defaults, { | |
| placement: 'right' | |
| , content: '' | |
| , template: '<div class="popover"><div class="arrow"></div><div class="popover-inner"><h3 class="popover-title"></h3><div class="popover-content"><p></p></div></div></div>' | |
| }) | |
| }(window.jQuery); | |
| /* ========================================================== | |
| * bootstrap-alert.js v2.0.4 | |
| * http://twitter.github.com/bootstrap/javascript.html#alerts | |
| * ========================================================== | |
| * Copyright 2012 Twitter, Inc. | |
| * | |
| * Licensed under the Apache License, Version 2.0 (the "License"); | |
| * you may not use this file except in compliance with the License. | |
| * You may obtain a copy of the License at | |
| * | |
| * http://www.apache.org/licenses/LICENSE-2.0 | |
| * | |
| * Unless required by applicable law or agreed to in writing, software | |
| * distributed under the License is distributed on an "AS IS" BASIS, | |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| * See the License for the specific language governing permissions and | |
| * limitations under the License. | |
| * ========================================================== */ | |
| !function ($) { | |
| "use strict"; // jshint ;_; | |
| /* ALERT CLASS DEFINITION | |
| * ====================== */ | |
| var dismiss = '[data-dismiss="alert"]' | |
| , Alert = function (el) { | |
| $(el).on('click', dismiss, this.close) | |
| } | |
| Alert.prototype.close = function (e) { | |
| var $this = $(this) | |
| , selector = $this.attr('data-target') | |
| , $parent | |
| if (!selector) { | |
| selector = $this.attr('href') | |
| selector = selector && selector.replace(/.*(?=#[^\s]*$)/, '') //strip for ie7 | |
| } | |
| $parent = $(selector) | |
| e && e.preventDefault() | |
| $parent.length || ($parent = $this.hasClass('alert') ? $this : $this.parent()) | |
| $parent.trigger(e = $.Event('close')) | |
| if (e.isDefaultPrevented()) return | |
| $parent.removeClass('in') | |
| function removeElement() { | |
| $parent | |
| .trigger('closed') | |
| .remove() | |
| } | |
| $.support.transition && $parent.hasClass('fade') ? | |
| $parent.on($.support.transition.end, removeElement) : | |
| removeElement() | |
| } | |
| /* ALERT PLUGIN DEFINITION | |
| * ======================= */ | |
| $.fn.alert = function (option) { | |
| return this.each(function () { | |
| var $this = $(this) | |
| , data = $this.data('alert') | |
| if (!data) $this.data('alert', (data = new Alert(this))) | |
| if (typeof option == 'string') data[option].call($this) | |
| }) | |
| } | |
| $.fn.alert.Constructor = Alert | |
| /* ALERT DATA-API | |
| * ============== */ | |
| $(function () { | |
| $('body').on('click.alert.data-api', dismiss, Alert.prototype.close) | |
| }) | |
| }(window.jQuery); | |
| /* ============================================================ | |
| * bootstrap-button.js v2.0.4 | |
| * http://twitter.github.com/bootstrap/javascript.html#buttons | |
| * ============================================================ | |
| * Copyright 2012 Twitter, Inc. | |
| * | |
| * Licensed under the Apache License, Version 2.0 (the "License"); | |
| * you may not use this file except in compliance with the License. | |
| * You may obtain a copy of the License at | |
| * | |
| * http://www.apache.org/licenses/LICENSE-2.0 | |
| * | |
| * Unless required by applicable law or agreed to in writing, software | |
| * distributed under the License is distributed on an "AS IS" BASIS, | |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| * See the License for the specific language governing permissions and | |
| * limitations under the License. | |
| * ============================================================ */ | |
| !function ($) { | |
| "use strict"; // jshint ;_; | |
| /* BUTTON PUBLIC CLASS DEFINITION | |
| * ============================== */ | |
| var Button = function (element, options) { | |
| this.$element = $(element) | |
| this.options = $.extend({}, $.fn.button.defaults, options) | |
| } | |
| Button.prototype.setState = function (state) { | |
| var d = 'disabled' | |
| , $el = this.$element | |
| , data = $el.data() | |
| , val = $el.is('input') ? 'val' : 'html' | |
| state = state + 'Text' | |
| data.resetText || $el.data('resetText', $el[val]()) | |
| $el[val](data[state] || this.options[state]) | |
| // push to event loop to allow forms to submit | |
| setTimeout(function () { | |
| state == 'loadingText' ? | |
| $el.addClass(d).attr(d, d) : | |
| $el.removeClass(d).removeAttr(d) | |
| }, 0) | |
| } | |
| Button.prototype.toggle = function () { | |
| var $parent = this.$element.parent('[data-toggle="buttons-radio"]') | |
| $parent && $parent | |
| .find('.active') | |
| .removeClass('active') | |
| this.$element.toggleClass('active') | |
| } | |
| /* BUTTON PLUGIN DEFINITION | |
| * ======================== */ | |
| $.fn.button = function (option) { | |
| return this.each(function () { | |
| var $this = $(this) | |
| , data = $this.data('button') | |
| , options = typeof option == 'object' && option | |
| if (!data) $this.data('button', (data = new Button(this, options))) | |
| if (option == 'toggle') data.toggle() | |
| else if (option) data.setState(option) | |
| }) | |
| } | |
| $.fn.button.defaults = { | |
| loadingText: 'loading...' | |
| } | |
| $.fn.button.Constructor = Button | |
| /* BUTTON DATA-API | |
| * =============== */ | |
| $(function () { | |
| $('body').on('click.button.data-api', '[data-toggle^=button]', function ( e ) { | |
| var $btn = $(e.target) | |
| if (!$btn.hasClass('btn')) $btn = $btn.closest('.btn') | |
| $btn.button('toggle') | |
| }) | |
| }) | |
| }(window.jQuery); | |
| /* ============================================================= | |
| * bootstrap-collapse.js v2.0.4 | |
| * http://twitter.github.com/bootstrap/javascript.html#collapse | |
| * ============================================================= | |
| * Copyright 2012 Twitter, Inc. | |
| * | |
| * Licensed under the Apache License, Version 2.0 (the "License"); | |
| * you may not use this file except in compliance with the License. | |
| * You may obtain a copy of the License at | |
| * | |
| * http://www.apache.org/licenses/LICENSE-2.0 | |
| * | |
| * Unless required by applicable law or agreed to in writing, software | |
| * distributed under the License is distributed on an "AS IS" BASIS, | |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| * See the License for the specific language governing permissions and | |
| * limitations under the License. | |
| * ============================================================ */ | |
| !function ($) { | |
| "use strict"; // jshint ;_; | |
| /* COLLAPSE PUBLIC CLASS DEFINITION | |
| * ================================ */ | |
| var Collapse = function (element, options) { | |
| this.$element = $(element) | |
| this.options = $.extend({}, $.fn.collapse.defaults, options) | |
| if (this.options.parent) { | |
| this.$parent = $(this.options.parent) | |
| } | |
| this.options.toggle && this.toggle() | |
| } | |
| Collapse.prototype = { | |
| constructor: Collapse | |
| , dimension: function () { | |
| var hasWidth = this.$element.hasClass('width') | |
| return hasWidth ? 'width' : 'height' | |
| } | |
| , show: function () { | |
| var dimension | |
| , scroll | |
| , actives | |
| , hasData | |
| if (this.transitioning) return | |
| dimension = this.dimension() | |
| scroll = $.camelCase(['scroll', dimension].join('-')) | |
| actives = this.$parent && this.$parent.find('> .accordion-group > .in') | |
| if (actives && actives.length) { | |
| hasData = actives.data('collapse') | |
| if (hasData && hasData.transitioning) return | |
| actives.collapse('hide') | |
| hasData || actives.data('collapse', null) | |
| } | |
| this.$element[dimension](0) | |
| this.transition('addClass', $.Event('show'), 'shown') | |
| this.$element[dimension](this.$element[0][scroll]) | |
| } | |
| , hide: function () { | |
| var dimension | |
| if (this.transitioning) return | |
| dimension = this.dimension() | |
| this.reset(this.$element[dimension]()) | |
| this.transition('removeClass', $.Event('hide'), 'hidden') | |
| this.$element[dimension](0) | |
| } | |
| , reset: function (size) { | |
| var dimension = this.dimension() | |
| this.$element | |
| .removeClass('collapse') | |
| [dimension](size || 'auto') | |
| [0].offsetWidth | |
| this.$element[size !== null ? 'addClass' : 'removeClass']('collapse') | |
| return this | |
| } | |
| , transition: function (method, startEvent, completeEvent) { | |
| var that = this | |
| , complete = function () { | |
| if (startEvent.type == 'show') that.reset() | |
| that.transitioning = 0 | |
| that.$element.trigger(completeEvent) | |
| } | |
| this.$element.trigger(startEvent) | |
| if (startEvent.isDefaultPrevented()) return | |
| this.transitioning = 1 | |
| this.$element[method]('in') | |
| $.support.transition && this.$element.hasClass('collapse') ? | |
| this.$element.one($.support.transition.end, complete) : | |
| complete() | |
| } | |
| , toggle: function () { | |
| this[this.$element.hasClass('in') ? 'hide' : 'show']() | |
| } | |
| } | |
| /* COLLAPSIBLE PLUGIN DEFINITION | |
| * ============================== */ | |
| $.fn.collapse = function (option) { | |
| return this.each(function () { | |
| var $this = $(this) | |
| , data = $this.data('collapse') | |
| , options = typeof option == 'object' && option | |
| if (!data) $this.data('collapse', (data = new Collapse(this, options))) | |
| if (typeof option == 'string') data[option]() | |
| }) | |
| } | |
| $.fn.collapse.defaults = { | |
| toggle: true | |
| } | |
| $.fn.collapse.Constructor = Collapse | |
| /* COLLAPSIBLE DATA-API | |
| * ==================== */ | |
| $(function () { | |
| $('body').on('click.collapse.data-api', '[data-toggle=collapse]', function ( e ) { | |
| var $this = $(this), href | |
| , target = $this.attr('data-target') | |
| || e.preventDefault() | |
| || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '') //strip for ie7 | |
| , option = $(target).data('collapse') ? 'toggle' : $this.data() | |
| $(target).collapse(option) | |
| }) | |
| }) | |
| }(window.jQuery); | |
| /* ========================================================== | |
| * bootstrap-carousel.js v2.0.4 | |
| * http://twitter.github.com/bootstrap/javascript.html#carousel | |
| * ========================================================== | |
| * Copyright 2012 Twitter, Inc. | |
| * | |
| * Licensed under the Apache License, Version 2.0 (the "License"); | |
| * you may not use this file except in compliance with the License. | |
| * You may obtain a copy of the License at | |
| * | |
| * http://www.apache.org/licenses/LICENSE-2.0 | |
| * | |
| * Unless required by applicable law or agreed to in writing, software | |
| * distributed under the License is distributed on an "AS IS" BASIS, | |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| * See the License for the specific language governing permissions and | |
| * limitations under the License. | |
| * ========================================================== */ | |
| !function ($) { | |
| "use strict"; // jshint ;_; | |
| /* CAROUSEL CLASS DEFINITION | |
| * ========================= */ | |
| var Carousel = function (element, options) { | |
| this.$element = $(element) | |
| this.options = options | |
| this.options.slide && this.slide(this.options.slide) | |
| this.options.pause == 'hover' && this.$element | |
| .on('mouseenter', $.proxy(this.pause, this)) | |
| .on('mouseleave', $.proxy(this.cycle, this)) | |
| } | |
| Carousel.prototype = { | |
| cycle: function (e) { | |
| if (!e) this.paused = false | |
| this.options.interval | |
| && !this.paused | |
| && (this.interval = setInterval($.proxy(this.next, this), this.options.interval)) | |
| return this | |
| } | |
| , to: function (pos) { | |
| var $active = this.$element.find('.active') | |
| , children = $active.parent().children() | |
| , activePos = children.index($active) | |
| , that = this | |
| if (pos > (children.length - 1) || pos < 0) return | |
| if (this.sliding) { | |
| return this.$element.one('slid', function () { | |
| that.to(pos) | |
| }) | |
| } | |
| if (activePos == pos) { | |
| return this.pause().cycle() | |
| } | |
| return this.slide(pos > activePos ? 'next' : 'prev', $(children[pos])) | |
| } | |
| , pause: function (e) { | |
| if (!e) this.paused = true | |
| clearInterval(this.interval) | |
| this.interval = null | |
| return this | |
| } | |
| , next: function () { | |
| if (this.sliding) return | |
| return this.slide('next') | |
| } | |
| , prev: function () { | |
| if (this.sliding) return | |
| return this.slide('prev') | |
| } | |
| , slide: function (type, next) { | |
| var $active = this.$element.find('.active') | |
| , $next = next || $active[type]() | |
| , isCycling = this.interval | |
| , direction = type == 'next' ? 'left' : 'right' | |
| , fallback = type == 'next' ? 'first' : 'last' | |
| , that = this | |
| , e = $.Event('slide') | |
| this.sliding = true | |
| isCycling && this.pause() | |
| $next = $next.length ? $next : this.$element.find('.item')[fallback]() | |
| if ($next.hasClass('active')) return | |
| if ($.support.transition && this.$element.hasClass('slide')) { | |
| this.$element.trigger(e) | |
| if (e.isDefaultPrevented()) return | |
| $next.addClass(type) | |
| $next[0].offsetWidth // force reflow | |
| $active.addClass(direction) | |
| $next.addClass(direction) | |
| this.$element.one($.support.transition.end, function () { | |
| $next.removeClass([type, direction].join(' ')).addClass('active') | |
| $active.removeClass(['active', direction].join(' ')) | |
| that.sliding = false | |
| setTimeout(function () { that.$element.trigger('slid') }, 0) | |
| }) | |
| } else { | |
| this.$element.trigger(e) | |
| if (e.isDefaultPrevented()) return | |
| $active.removeClass('active') | |
| $next.addClass('active') | |
| this.sliding = false | |
| this.$element.trigger('slid') | |
| } | |
| isCycling && this.cycle() | |
| return this | |
| } | |
| } | |
| /* CAROUSEL PLUGIN DEFINITION | |
| * ========================== */ | |
| $.fn.carousel = function (option) { | |
| return this.each(function () { | |
| var $this = $(this) | |
| , data = $this.data('carousel') | |
| , options = $.extend({}, $.fn.carousel.defaults, typeof option == 'object' && option) | |
| if (!data) $this.data('carousel', (data = new Carousel(this, options))) | |
| if (typeof option == 'number') data.to(option) | |
| else if (typeof option == 'string' || (option = options.slide)) data[option]() | |
| else if (options.interval) data.cycle() | |
| }) | |
| } | |
| $.fn.carousel.defaults = { | |
| interval: 5000 | |
| , pause: 'hover' | |
| } | |
| $.fn.carousel.Constructor = Carousel | |
| /* CAROUSEL DATA-API | |
| * ================= */ | |
| $(function () { | |
| $('body').on('click.carousel.data-api', '[data-slide]', function ( e ) { | |
| var $this = $(this), href | |
| , $target = $($this.attr('data-target') || (href = $this.attr('href')) && href.replace(/.*(?=#[^\s]+$)/, '')) //strip for ie7 | |
| , options = !$target.data('modal') && $.extend({}, $target.data(), $this.data()) | |
| $target.carousel(options) | |
| e.preventDefault() | |
| }) | |
| }) | |
| }(window.jQuery); | |
| /* ============================================================= | |
| * bootstrap-typeahead.js v2.0.4 | |
| * http://twitter.github.com/bootstrap/javascript.html#typeahead | |
| * ============================================================= | |
| * Copyright 2012 Twitter, Inc. | |
| * | |
| * Licensed under the Apache License, Version 2.0 (the "License"); | |
| * you may not use this file except in compliance with the License. | |
| * You may obtain a copy of the License at | |
| * | |
| * http://www.apache.org/licenses/LICENSE-2.0 | |
| * | |
| * Unless required by applicable law or agreed to in writing, software | |
| * distributed under the License is distributed on an "AS IS" BASIS, | |
| * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. | |
| * See the License for the specific language governing permissions and | |
| * limitations under the License. | |
| * ============================================================ */ | |
| !function($){ | |
| "use strict"; // jshint ;_; | |
| /* TYPEAHEAD PUBLIC CLASS DEFINITION | |
| * ================================= */ | |
| var Typeahead = function (element, options) { | |
| this.$element = $(element) | |
| this.options = $.extend({}, $.fn.typeahead.defaults, options) | |
| this.matcher = this.options.matcher || this.matcher | |
| this.sorter = this.options.sorter || this.sorter | |
| this.highlighter = this.options.highlighter || this.highlighter | |
| this.updater = this.options.updater || this.updater | |
| this.$menu = $(this.options.menu).appendTo('body') | |
| this.source = this.options.source | |
| this.shown = false | |
| this.listen() | |
| } | |
| Typeahead.prototype = { | |
| constructor: Typeahead | |
| , select: function () { | |
| var val = this.$menu.find('.active').attr('data-value') | |
| this.$element | |
| .val(this.updater(val)) | |
| .change() | |
| return this.hide() | |
| } | |
| , updater: function (item) { | |
| return item | |
| } | |
| , show: function () { | |
| var pos = $.extend({}, this.$element.offset(), { | |
| height: this.$element[0].offsetHeight | |
| }) | |
| this.$menu.css({ | |
| top: pos.top + pos.height | |
| , left: pos.left | |
| }) | |
| this.$menu.show() | |
| this.shown = true | |
| return this | |
| } | |
| , hide: function () { | |
| this.$menu.hide() | |
| this.shown = false | |
| return this | |
| } | |
| , lookup: function (event) { | |
| var that = this | |
| , items | |
| , q | |
| this.query = this.$element.val() | |
| if (!this.query) { | |
| return this.shown ? this.hide() : this | |
| } | |
| items = $.grep(this.source, function (item) { | |
| return that.matcher(item) | |
| }) | |
| items = this.sorter(items) | |
| if (!items.length) { | |
| return this.shown ? this.hide() : this | |
| } | |
| return this.render(items.slice(0, this.options.items)).show() | |
| } | |
| , matcher: function (item) { | |
| return ~item.toLowerCase().indexOf(this.query.toLowerCase()) | |
| } | |
| , sorter: function (items) { | |
| var beginswith = [] | |
| , caseSensitive = [] | |
| , caseInsensitive = [] | |
| , item | |
| while (item = items.shift()) { | |
| if (!item.toLowerCase().indexOf(this.query.toLowerCase())) beginswith.push(item) | |
| else if (~item.indexOf(this.query)) caseSensitive.push(item) | |
| else caseInsensitive.push(item) | |
| } | |
| return beginswith.concat(caseSensitive, caseInsensitive) | |
| } | |
| , highlighter: function (item) { | |
| var query = this.query.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, '\\$&') | |
| return item.replace(new RegExp('(' + query + ')', 'ig'), function ($1, match) { | |
| return '<strong>' + match + '</strong>' | |
| }) | |
| } | |
| , render: function (items) { | |
| var that = this | |
| items = $(items).map(function (i, item) { | |
| i = $(that.options.item).attr('data-value', item) | |
| i.find('a').html(that.highlighter(item)) | |
| return i[0] | |
| }) | |
| items.first().addClass('active') | |
| this.$menu.html(items) | |
| return this | |
| } | |
| , next: function (event) { | |
| var active = this.$menu.find('.active').removeClass('active') | |
| , next = active.next() | |
| if (!next.length) { | |
| next = $(this.$menu.find('li')[0]) | |
| } | |
| next.addClass('active') | |
| } | |
| , prev: function (event) { | |
| var active = this.$menu.find('.active').removeClass('active') | |
| , prev = active.prev() | |
| if (!prev.length) { | |
| prev = this.$menu.find('li').last() | |
| } | |
| prev.addClass('active') | |
| } | |
| , listen: function () { | |
| this.$element | |
| .on('blur', $.proxy(this.blur, this)) | |
| .on('keypress', $.proxy(this.keypress, this)) | |
| .on('keyup', $.proxy(this.keyup, this)) | |
| if ($.browser.webkit || $.browser.msie) { | |
| this.$element.on('keydown', $.proxy(this.keypress, this)) | |
| } | |
| this.$menu | |
| .on('click', $.proxy(this.click, this)) | |
| .on('mouseenter', 'li', $.proxy(this.mouseenter, this)) | |
| } | |
| , keyup: function (e) { | |
| switch(e.keyCode) { | |
| case 40: // down arrow | |
| case 38: // up arrow | |
| break | |
| case 9: // tab | |
| case 13: // enter | |
| if (!this.shown) return | |
| this.select() | |
| break | |
| case 27: // escape | |
| if (!this.shown) return | |
| this.hide() | |
| break | |
| default: | |
| this.lookup() | |
| } | |
| e.stopPropagation() | |
| e.preventDefault() | |
| } | |
| , keypress: function (e) { | |
| if (!this.shown) return | |
| switch(e.keyCode) { | |
| case 9: // tab | |
| case 13: // enter | |
| case 27: // escape | |
| e.preventDefault() | |
| break | |
| case 38: // up arrow | |
| if (e.type != 'keydown') break | |
| e.preventDefault() | |
| this.prev() | |
| break | |
| case 40: // down arrow | |
| if (e.type != 'keydown') break | |
| e.preventDefault() | |
| this.next() | |
| break | |
| } | |
| e.stopPropagation() | |
| } | |
| , blur: function (e) { | |
| var that = this | |
| setTimeout(function () { that.hide() }, 150) | |
| } | |
| , click: function (e) { | |
| e.stopPropagation() | |
| e.preventDefault() | |
| this.select() | |
| } | |
| , mouseenter: function (e) { | |
| this.$menu.find('.active').removeClass('active') | |
| $(e.currentTarget).addClass('active') | |
| } | |
| } | |
| /* TYPEAHEAD PLUGIN DEFINITION | |
| * =========================== */ | |
| $.fn.typeahead = function (option) { | |
| return this.each(function () { | |
| var $this = $(this) | |
| , data = $this.data('typeahead') | |
| , options = typeof option == 'object' && option | |
| if (!data) $this.data('typeahead', (data = new Typeahead(this, options))) | |
| if (typeof option == 'string') data[option]() | |
| }) | |
| } | |
| $.fn.typeahead.defaults = { | |
| source: [] | |
| , items: 8 | |
| , menu: '<ul class="typeahead dropdown-menu"></ul>' | |
| , item: '<li><a href="#"></a></li>' | |
| } | |
| $.fn.typeahead.Constructor = Typeahead | |
| /* TYPEAHEAD DATA-API | |
| * ================== */ | |
| $(function () { | |
| $('body').on('focus.typeahead.data-api', '[data-provide="typeahead"]', function (e) { | |
| var $this = $(this) | |
| if ($this.data('typeahead')) return | |
| e.preventDefault() | |
| $this.typeahead($this.data()) | |
| }) | |
| }) | |
| }(window.jQuery); |
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| <!DOCTYPE html> | |
| <html lang="en"> | |
| <head> | |
| <meta charset="utf-8"> | |
| <title>InjectJS Test Implementation</title> | |
| <meta name="viewport" content="width=device-width, initial-scale=1.0"> | |
| <meta name="description" content=""> | |
| <meta name="author" content=""> | |
| <!-- Le styles --> | |
| <link href="http://twitter.github.com/bootstrap/assets/css/bootstrap.css" rel="stylesheet"> | |
| <style type="text/css"> | |
| body { padding-top: 60px; padding-bottom: 40px; } | |
| </style> | |
| <link href="http://twitter.github.com/bootstrap/assets/css/bootstrap-responsive.css" rel="stylesheet"> | |
| <!-- Le HTML5 shim, for IE6-8 support of HTML5 elements --> | |
| <!--[if lt IE 9]> | |
| <script src="//html5shim.googlecode.com/svn/trunk/html5.js"></script> | |
| <![endif]--> | |
| <!-- Le fav and touch icons --> | |
| <link rel="shortcut icon" href="http://twitter.github.com/bootstrap/assets/images/favicon.ico"> | |
| <link rel="apple-touch-icon" href="images/apple-touch-icon.png"> | |
| <link rel="apple-touch-icon" sizes="72x72" href="http://twitter.github.com/bootstrap/assets/images/apple-touch-icon-72x72.png"> | |
| <link rel="apple-touch-icon" sizes="114x114" href="http://twitter.github.com/bootstrap/assets/images/apple-touch-icon-114x114.png"> | |
| <script src="inject.js" type="text/javascript"></script> | |
| <script src="app.js" type="text/javascript"></script> | |
| </head> | |
| <body> | |
| <div class="navbar navbar-fixed-top"> | |
| <div class="navbar-inner"> | |
| <div class="container"> | |
| <a class="btn btn-navbar" data-toggle="collapse" data-target=".nav-collapse"> | |
| <span class="icon-bar"></span> | |
| <span class="icon-bar"></span> | |
| <span class="icon-bar"></span> | |
| </a> | |
| <a class="brand" href="#">Project name</a> | |
| <div class="nav-collapse"> | |
| <ul class="nav"> | |
| <li class="active"><a href="#">Home</a></li> | |
| <li><a href="#about">About</a></li> | |
| <li><a href="#contact">Contact</a></li> | |
| </ul> | |
| </div><!--/.nav-collapse --> | |
| </div> | |
| </div> | |
| </div> | |
| <div class="container"> | |
| <!-- Main hero unit for a primary marketing message or call to action --> | |
| <div class="hero-unit"> | |
| <h1>Hello, world!</h1> | |
| <p>This is a template for a simple marketing or informational website. It includes a large callout called the hero unit and three supporting pieces of content. Use it as a starting point to create something more unique.</p> | |
| <p><a class="btn btn-primary btn-large">Learn more »</a></p> | |
| </div> | |
| <!-- Example row of columns --> | |
| <div class="row"> | |
| <div class="span4"> | |
| <h2>Heading</h2> | |
| <p>Donec id elit non mi porta gravida at eget metus. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Etiam porta sem malesuada magna mollis euismod. Donec sed odio dui. </p> | |
| <p><a class="btn" href="#">View details »</a></p> | |
| </div> | |
| <div class="span4"> | |
| <h2>Heading</h2> | |
| <p>Donec id elit non mi porta gravida at eget metus. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus. Etiam porta sem malesuada magna mollis euismod. Donec sed odio dui. </p> | |
| <p><a class="btn" href="#">View details »</a></p> | |
| </div> | |
| <div class="span4"> | |
| <h2>Heading</h2> | |
| <p>Donec sed odio dui. Cras justo odio, dapibus ac facilisis in, egestas eget quam. Vestibulum id ligula porta felis euismod semper. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit amet risus.</p> | |
| <p><a class="btn" href="#">View details »</a></p> | |
| </div> | |
| </div> | |
| <hr> | |
| <footer> | |
| <p>© Company 2012</p> | |
| </footer> | |
| </div> <!-- /container --> | |
| <!-- Le javascript | |
| ================================================== --> | |
| <!-- Placed at the end of the document so the pages load faster --> | |
| </body> | |
| </html> |
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| /*! | |
| * jQuery UI 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI | |
| */ | |
| (function( $, undefined ) { | |
| // prevent duplicate loading | |
| // this is only a problem because we proxy existing functions | |
| // and we don't want to double proxy them | |
| $.ui = $.ui || {}; | |
| if ( $.ui.version ) { | |
| return; | |
| } | |
| $.extend( $.ui, { | |
| version: "1.8.22", | |
| keyCode: { | |
| ALT: 18, | |
| BACKSPACE: 8, | |
| CAPS_LOCK: 20, | |
| COMMA: 188, | |
| COMMAND: 91, | |
| COMMAND_LEFT: 91, // COMMAND | |
| COMMAND_RIGHT: 93, | |
| CONTROL: 17, | |
| DELETE: 46, | |
| DOWN: 40, | |
| END: 35, | |
| ENTER: 13, | |
| ESCAPE: 27, | |
| HOME: 36, | |
| INSERT: 45, | |
| LEFT: 37, | |
| MENU: 93, // COMMAND_RIGHT | |
| NUMPAD_ADD: 107, | |
| NUMPAD_DECIMAL: 110, | |
| NUMPAD_DIVIDE: 111, | |
| NUMPAD_ENTER: 108, | |
| NUMPAD_MULTIPLY: 106, | |
| NUMPAD_SUBTRACT: 109, | |
| PAGE_DOWN: 34, | |
| PAGE_UP: 33, | |
| PERIOD: 190, | |
| RIGHT: 39, | |
| SHIFT: 16, | |
| SPACE: 32, | |
| TAB: 9, | |
| UP: 38, | |
| WINDOWS: 91 // COMMAND | |
| } | |
| }); | |
| // plugins | |
| $.fn.extend({ | |
| propAttr: $.fn.prop || $.fn.attr, | |
| _focus: $.fn.focus, | |
| focus: function( delay, fn ) { | |
| return typeof delay === "number" ? | |
| this.each(function() { | |
| var elem = this; | |
| setTimeout(function() { | |
| $( elem ).focus(); | |
| if ( fn ) { | |
| fn.call( elem ); | |
| } | |
| }, delay ); | |
| }) : | |
| this._focus.apply( this, arguments ); | |
| }, | |
| scrollParent: function() { | |
| var scrollParent; | |
| if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) { | |
| scrollParent = this.parents().filter(function() { | |
| return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); | |
| }).eq(0); | |
| } else { | |
| scrollParent = this.parents().filter(function() { | |
| return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1)); | |
| }).eq(0); | |
| } | |
| return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent; | |
| }, | |
| zIndex: function( zIndex ) { | |
| if ( zIndex !== undefined ) { | |
| return this.css( "zIndex", zIndex ); | |
| } | |
| if ( this.length ) { | |
| var elem = $( this[ 0 ] ), position, value; | |
| while ( elem.length && elem[ 0 ] !== document ) { | |
| // Ignore z-index if position is set to a value where z-index is ignored by the browser | |
| // This makes behavior of this function consistent across browsers | |
| // WebKit always returns auto if the element is positioned | |
| position = elem.css( "position" ); | |
| if ( position === "absolute" || position === "relative" || position === "fixed" ) { | |
| // IE returns 0 when zIndex is not specified | |
| // other browsers return a string | |
| // we ignore the case of nested elements with an explicit value of 0 | |
| // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> | |
| value = parseInt( elem.css( "zIndex" ), 10 ); | |
| if ( !isNaN( value ) && value !== 0 ) { | |
| return value; | |
| } | |
| } | |
| elem = elem.parent(); | |
| } | |
| } | |
| return 0; | |
| }, | |
| disableSelection: function() { | |
| return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + | |
| ".ui-disableSelection", function( event ) { | |
| event.preventDefault(); | |
| }); | |
| }, | |
| enableSelection: function() { | |
| return this.unbind( ".ui-disableSelection" ); | |
| } | |
| }); | |
| // support: jQuery <1.8 | |
| if ( !$( "<a>" ).outerWidth( 1 ).jquery ) { | |
| $.each( [ "Width", "Height" ], function( i, name ) { | |
| var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], | |
| type = name.toLowerCase(), | |
| orig = { | |
| innerWidth: $.fn.innerWidth, | |
| innerHeight: $.fn.innerHeight, | |
| outerWidth: $.fn.outerWidth, | |
| outerHeight: $.fn.outerHeight | |
| }; | |
| function reduce( elem, size, border, margin ) { | |
| $.each( side, function() { | |
| size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0; | |
| if ( border ) { | |
| size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0; | |
| } | |
| if ( margin ) { | |
| size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0; | |
| } | |
| }); | |
| return size; | |
| } | |
| $.fn[ "inner" + name ] = function( size ) { | |
| if ( size === undefined ) { | |
| return orig[ "inner" + name ].call( this ); | |
| } | |
| return this.each(function() { | |
| $( this ).css( type, reduce( this, size ) + "px" ); | |
| }); | |
| }; | |
| $.fn[ "outer" + name] = function( size, margin ) { | |
| if ( typeof size !== "number" ) { | |
| return orig[ "outer" + name ].call( this, size ); | |
| } | |
| return this.each(function() { | |
| $( this).css( type, reduce( this, size, true, margin ) + "px" ); | |
| }); | |
| }; | |
| }); | |
| } | |
| // selectors | |
| function focusable( element, isTabIndexNotNaN ) { | |
| var nodeName = element.nodeName.toLowerCase(); | |
| if ( "area" === nodeName ) { | |
| var map = element.parentNode, | |
| mapName = map.name, | |
| img; | |
| if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { | |
| return false; | |
| } | |
| img = $( "img[usemap=#" + mapName + "]" )[0]; | |
| return !!img && visible( img ); | |
| } | |
| return ( /input|select|textarea|button|object/.test( nodeName ) | |
| ? !element.disabled | |
| : "a" == nodeName | |
| ? element.href || isTabIndexNotNaN | |
| : isTabIndexNotNaN) | |
| // the element and all of its ancestors must be visible | |
| && visible( element ); | |
| } | |
| function visible( element ) { | |
| return !$( element ).parents().andSelf().filter(function() { | |
| return $.curCSS( this, "visibility" ) === "hidden" || | |
| $.expr.filters.hidden( this ); | |
| }).length; | |
| } | |
| $.extend( $.expr[ ":" ], { | |
| data: $.expr.createPseudo ? | |
| $.expr.createPseudo(function( dataName ) { | |
| return function( elem ) { | |
| return !!$.data( elem, dataName ); | |
| }; | |
| }) : | |
| // support: jQuery <1.8 | |
| function( elem, i, match ) { | |
| return !!$.data( elem, match[ 3 ] ); | |
| }, | |
| focusable: function( element ) { | |
| return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); | |
| }, | |
| tabbable: function( element ) { | |
| var tabIndex = $.attr( element, "tabindex" ), | |
| isTabIndexNaN = isNaN( tabIndex ); | |
| return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); | |
| } | |
| }); | |
| // support | |
| $(function() { | |
| var body = document.body, | |
| div = body.appendChild( div = document.createElement( "div" ) ); | |
| // access offsetHeight before setting the style to prevent a layout bug | |
| // in IE 9 which causes the elemnt to continue to take up space even | |
| // after it is removed from the DOM (#8026) | |
| div.offsetHeight; | |
| $.extend( div.style, { | |
| minHeight: "100px", | |
| height: "auto", | |
| padding: 0, | |
| borderWidth: 0 | |
| }); | |
| $.support.minHeight = div.offsetHeight === 100; | |
| $.support.selectstart = "onselectstart" in div; | |
| // set display to none to avoid a layout bug in IE | |
| // http://dev.jquery.com/ticket/4014 | |
| body.removeChild( div ).style.display = "none"; | |
| }); | |
| // jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css | |
| if ( !$.curCSS ) { | |
| $.curCSS = $.css; | |
| } | |
| // deprecated | |
| $.extend( $.ui, { | |
| // $.ui.plugin is deprecated. Use the proxy pattern instead. | |
| plugin: { | |
| add: function( module, option, set ) { | |
| var proto = $.ui[ module ].prototype; | |
| for ( var i in set ) { | |
| proto.plugins[ i ] = proto.plugins[ i ] || []; | |
| proto.plugins[ i ].push( [ option, set[ i ] ] ); | |
| } | |
| }, | |
| call: function( instance, name, args ) { | |
| var set = instance.plugins[ name ]; | |
| if ( !set || !instance.element[ 0 ].parentNode ) { | |
| return; | |
| } | |
| for ( var i = 0; i < set.length; i++ ) { | |
| if ( instance.options[ set[ i ][ 0 ] ] ) { | |
| set[ i ][ 1 ].apply( instance.element, args ); | |
| } | |
| } | |
| } | |
| }, | |
| // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains() | |
| contains: function( a, b ) { | |
| return document.compareDocumentPosition ? | |
| a.compareDocumentPosition( b ) & 16 : | |
| a !== b && a.contains( b ); | |
| }, | |
| // only used by resizable | |
| hasScroll: function( el, a ) { | |
| //If overflow is hidden, the element might have extra content, but the user wants to hide it | |
| if ( $( el ).css( "overflow" ) === "hidden") { | |
| return false; | |
| } | |
| var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", | |
| has = false; | |
| if ( el[ scroll ] > 0 ) { | |
| return true; | |
| } | |
| // TODO: determine which cases actually cause this to happen | |
| // if the element doesn't have the scroll set, see if it's possible to | |
| // set the scroll | |
| el[ scroll ] = 1; | |
| has = ( el[ scroll ] > 0 ); | |
| el[ scroll ] = 0; | |
| return has; | |
| }, | |
| // these are odd functions, fix the API or move into individual plugins | |
| isOverAxis: function( x, reference, size ) { | |
| //Determines when x coordinate is over "b" element axis | |
| return ( x > reference ) && ( x < ( reference + size ) ); | |
| }, | |
| isOver: function( y, x, top, left, height, width ) { | |
| //Determines when x, y coordinates is over "b" element | |
| return $.ui.isOverAxis( y, top, height ) && $.ui.isOverAxis( x, left, width ); | |
| } | |
| }); | |
| })( jQuery ); | |
| /*! | |
| * jQuery UI Widget 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Widget | |
| */ | |
| (function( $, undefined ) { | |
| // jQuery 1.4+ | |
| if ( $.cleanData ) { | |
| var _cleanData = $.cleanData; | |
| $.cleanData = function( elems ) { | |
| for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { | |
| try { | |
| $( elem ).triggerHandler( "remove" ); | |
| // http://bugs.jquery.com/ticket/8235 | |
| } catch( e ) {} | |
| } | |
| _cleanData( elems ); | |
| }; | |
| } else { | |
| var _remove = $.fn.remove; | |
| $.fn.remove = function( selector, keepData ) { | |
| return this.each(function() { | |
| if ( !keepData ) { | |
| if ( !selector || $.filter( selector, [ this ] ).length ) { | |
| $( "*", this ).add( [ this ] ).each(function() { | |
| try { | |
| $( this ).triggerHandler( "remove" ); | |
| // http://bugs.jquery.com/ticket/8235 | |
| } catch( e ) {} | |
| }); | |
| } | |
| } | |
| return _remove.call( $(this), selector, keepData ); | |
| }); | |
| }; | |
| } | |
| $.widget = function( name, base, prototype ) { | |
| var namespace = name.split( "." )[ 0 ], | |
| fullName; | |
| name = name.split( "." )[ 1 ]; | |
| fullName = namespace + "-" + name; | |
| if ( !prototype ) { | |
| prototype = base; | |
| base = $.Widget; | |
| } | |
| // create selector for plugin | |
| $.expr[ ":" ][ fullName ] = function( elem ) { | |
| return !!$.data( elem, name ); | |
| }; | |
| $[ namespace ] = $[ namespace ] || {}; | |
| $[ namespace ][ name ] = function( options, element ) { | |
| // allow instantiation without initializing for simple inheritance | |
| if ( arguments.length ) { | |
| this._createWidget( options, element ); | |
| } | |
| }; | |
| var basePrototype = new base(); | |
| // we need to make the options hash a property directly on the new instance | |
| // otherwise we'll modify the options hash on the prototype that we're | |
| // inheriting from | |
| // $.each( basePrototype, function( key, val ) { | |
| // if ( $.isPlainObject(val) ) { | |
| // basePrototype[ key ] = $.extend( {}, val ); | |
| // } | |
| // }); | |
| basePrototype.options = $.extend( true, {}, basePrototype.options ); | |
| $[ namespace ][ name ].prototype = $.extend( true, basePrototype, { | |
| namespace: namespace, | |
| widgetName: name, | |
| widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name, | |
| widgetBaseClass: fullName | |
| }, prototype ); | |
| $.widget.bridge( name, $[ namespace ][ name ] ); | |
| }; | |
| $.widget.bridge = function( name, object ) { | |
| $.fn[ name ] = function( options ) { | |
| var isMethodCall = typeof options === "string", | |
| args = Array.prototype.slice.call( arguments, 1 ), | |
| returnValue = this; | |
| // allow multiple hashes to be passed on init | |
| options = !isMethodCall && args.length ? | |
| $.extend.apply( null, [ true, options ].concat(args) ) : | |
| options; | |
| // prevent calls to internal methods | |
| if ( isMethodCall && options.charAt( 0 ) === "_" ) { | |
| return returnValue; | |
| } | |
| if ( isMethodCall ) { | |
| this.each(function() { | |
| var instance = $.data( this, name ), | |
| methodValue = instance && $.isFunction( instance[options] ) ? | |
| instance[ options ].apply( instance, args ) : | |
| instance; | |
| // TODO: add this back in 1.9 and use $.error() (see #5972) | |
| // if ( !instance ) { | |
| // throw "cannot call methods on " + name + " prior to initialization; " + | |
| // "attempted to call method '" + options + "'"; | |
| // } | |
| // if ( !$.isFunction( instance[options] ) ) { | |
| // throw "no such method '" + options + "' for " + name + " widget instance"; | |
| // } | |
| // var methodValue = instance[ options ].apply( instance, args ); | |
| if ( methodValue !== instance && methodValue !== undefined ) { | |
| returnValue = methodValue; | |
| return false; | |
| } | |
| }); | |
| } else { | |
| this.each(function() { | |
| var instance = $.data( this, name ); | |
| if ( instance ) { | |
| instance.option( options || {} )._init(); | |
| } else { | |
| $.data( this, name, new object( options, this ) ); | |
| } | |
| }); | |
| } | |
| return returnValue; | |
| }; | |
| }; | |
| $.Widget = function( options, element ) { | |
| // allow instantiation without initializing for simple inheritance | |
| if ( arguments.length ) { | |
| this._createWidget( options, element ); | |
| } | |
| }; | |
| $.Widget.prototype = { | |
| widgetName: "widget", | |
| widgetEventPrefix: "", | |
| options: { | |
| disabled: false | |
| }, | |
| _createWidget: function( options, element ) { | |
| // $.widget.bridge stores the plugin instance, but we do it anyway | |
| // so that it's stored even before the _create function runs | |
| $.data( element, this.widgetName, this ); | |
| this.element = $( element ); | |
| this.options = $.extend( true, {}, | |
| this.options, | |
| this._getCreateOptions(), | |
| options ); | |
| var self = this; | |
| this.element.bind( "remove." + this.widgetName, function() { | |
| self.destroy(); | |
| }); | |
| this._create(); | |
| this._trigger( "create" ); | |
| this._init(); | |
| }, | |
| _getCreateOptions: function() { | |
| return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ]; | |
| }, | |
| _create: function() {}, | |
| _init: function() {}, | |
| destroy: function() { | |
| this.element | |
| .unbind( "." + this.widgetName ) | |
| .removeData( this.widgetName ); | |
| this.widget() | |
| .unbind( "." + this.widgetName ) | |
| .removeAttr( "aria-disabled" ) | |
| .removeClass( | |
| this.widgetBaseClass + "-disabled " + | |
| "ui-state-disabled" ); | |
| }, | |
| widget: function() { | |
| return this.element; | |
| }, | |
| option: function( key, value ) { | |
| var options = key; | |
| if ( arguments.length === 0 ) { | |
| // don't return a reference to the internal hash | |
| return $.extend( {}, this.options ); | |
| } | |
| if (typeof key === "string" ) { | |
| if ( value === undefined ) { | |
| return this.options[ key ]; | |
| } | |
| options = {}; | |
| options[ key ] = value; | |
| } | |
| this._setOptions( options ); | |
| return this; | |
| }, | |
| _setOptions: function( options ) { | |
| var self = this; | |
| $.each( options, function( key, value ) { | |
| self._setOption( key, value ); | |
| }); | |
| return this; | |
| }, | |
| _setOption: function( key, value ) { | |
| this.options[ key ] = value; | |
| if ( key === "disabled" ) { | |
| this.widget() | |
| [ value ? "addClass" : "removeClass"]( | |
| this.widgetBaseClass + "-disabled" + " " + | |
| "ui-state-disabled" ) | |
| .attr( "aria-disabled", value ); | |
| } | |
| return this; | |
| }, | |
| enable: function() { | |
| return this._setOption( "disabled", false ); | |
| }, | |
| disable: function() { | |
| return this._setOption( "disabled", true ); | |
| }, | |
| _trigger: function( type, event, data ) { | |
| var prop, orig, | |
| callback = this.options[ type ]; | |
| data = data || {}; | |
| event = $.Event( event ); | |
| event.type = ( type === this.widgetEventPrefix ? | |
| type : | |
| this.widgetEventPrefix + type ).toLowerCase(); | |
| // the original event may come from any element | |
| // so we need to reset the target on the new event | |
| event.target = this.element[ 0 ]; | |
| // copy original event properties over to the new event | |
| orig = event.originalEvent; | |
| if ( orig ) { | |
| for ( prop in orig ) { | |
| if ( !( prop in event ) ) { | |
| event[ prop ] = orig[ prop ]; | |
| } | |
| } | |
| } | |
| this.element.trigger( event, data ); | |
| return !( $.isFunction(callback) && | |
| callback.call( this.element[0], event, data ) === false || | |
| event.isDefaultPrevented() ); | |
| } | |
| }; | |
| })( jQuery ); | |
| /*! | |
| * jQuery UI Mouse 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Mouse | |
| * | |
| * Depends: | |
| * jquery.ui.widget.js | |
| */ | |
| (function( $, undefined ) { | |
| var mouseHandled = false; | |
| $( document ).mouseup( function( e ) { | |
| mouseHandled = false; | |
| }); | |
| $.widget("ui.mouse", { | |
| options: { | |
| cancel: ':input,option', | |
| distance: 1, | |
| delay: 0 | |
| }, | |
| _mouseInit: function() { | |
| var self = this; | |
| this.element | |
| .bind('mousedown.'+this.widgetName, function(event) { | |
| return self._mouseDown(event); | |
| }) | |
| .bind('click.'+this.widgetName, function(event) { | |
| if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) { | |
| $.removeData(event.target, self.widgetName + '.preventClickEvent'); | |
| event.stopImmediatePropagation(); | |
| return false; | |
| } | |
| }); | |
| this.started = false; | |
| }, | |
| // TODO: make sure destroying one instance of mouse doesn't mess with | |
| // other instances of mouse | |
| _mouseDestroy: function() { | |
| this.element.unbind('.'+this.widgetName); | |
| $(document) | |
| .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) | |
| .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); | |
| }, | |
| _mouseDown: function(event) { | |
| // don't let more than one widget handle mouseStart | |
| if( mouseHandled ) { return }; | |
| // we may have missed mouseup (out of window) | |
| (this._mouseStarted && this._mouseUp(event)); | |
| this._mouseDownEvent = event; | |
| var self = this, | |
| btnIsLeft = (event.which == 1), | |
| // event.target.nodeName works around a bug in IE 8 with | |
| // disabled inputs (#7620) | |
| elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); | |
| if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { | |
| return true; | |
| } | |
| this.mouseDelayMet = !this.options.delay; | |
| if (!this.mouseDelayMet) { | |
| this._mouseDelayTimer = setTimeout(function() { | |
| self.mouseDelayMet = true; | |
| }, this.options.delay); | |
| } | |
| if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { | |
| this._mouseStarted = (this._mouseStart(event) !== false); | |
| if (!this._mouseStarted) { | |
| event.preventDefault(); | |
| return true; | |
| } | |
| } | |
| // Click event may never have fired (Gecko & Opera) | |
| if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) { | |
| $.removeData(event.target, this.widgetName + '.preventClickEvent'); | |
| } | |
| // these delegates are required to keep context | |
| this._mouseMoveDelegate = function(event) { | |
| return self._mouseMove(event); | |
| }; | |
| this._mouseUpDelegate = function(event) { | |
| return self._mouseUp(event); | |
| }; | |
| $(document) | |
| .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate) | |
| .bind('mouseup.'+this.widgetName, this._mouseUpDelegate); | |
| event.preventDefault(); | |
| mouseHandled = true; | |
| return true; | |
| }, | |
| _mouseMove: function(event) { | |
| // IE mouseup check - mouseup happened when mouse was out of window | |
| if ($.browser.msie && !(document.documentMode >= 9) && !event.button) { | |
| return this._mouseUp(event); | |
| } | |
| if (this._mouseStarted) { | |
| this._mouseDrag(event); | |
| return event.preventDefault(); | |
| } | |
| if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { | |
| this._mouseStarted = | |
| (this._mouseStart(this._mouseDownEvent, event) !== false); | |
| (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); | |
| } | |
| return !this._mouseStarted; | |
| }, | |
| _mouseUp: function(event) { | |
| $(document) | |
| .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate) | |
| .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate); | |
| if (this._mouseStarted) { | |
| this._mouseStarted = false; | |
| if (event.target == this._mouseDownEvent.target) { | |
| $.data(event.target, this.widgetName + '.preventClickEvent', true); | |
| } | |
| this._mouseStop(event); | |
| } | |
| return false; | |
| }, | |
| _mouseDistanceMet: function(event) { | |
| return (Math.max( | |
| Math.abs(this._mouseDownEvent.pageX - event.pageX), | |
| Math.abs(this._mouseDownEvent.pageY - event.pageY) | |
| ) >= this.options.distance | |
| ); | |
| }, | |
| _mouseDelayMet: function(event) { | |
| return this.mouseDelayMet; | |
| }, | |
| // These are placeholder methods, to be overriden by extending plugin | |
| _mouseStart: function(event) {}, | |
| _mouseDrag: function(event) {}, | |
| _mouseStop: function(event) {}, | |
| _mouseCapture: function(event) { return true; } | |
| }); | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Position 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Position | |
| */ | |
| (function( $, undefined ) { | |
| $.ui = $.ui || {}; | |
| var horizontalPositions = /left|center|right/, | |
| verticalPositions = /top|center|bottom/, | |
| center = "center", | |
| support = {}, | |
| _position = $.fn.position, | |
| _offset = $.fn.offset; | |
| $.fn.position = function( options ) { | |
| if ( !options || !options.of ) { | |
| return _position.apply( this, arguments ); | |
| } | |
| // make a copy, we don't want to modify arguments | |
| options = $.extend( {}, options ); | |
| var target = $( options.of ), | |
| targetElem = target[0], | |
| collision = ( options.collision || "flip" ).split( " " ), | |
| offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], | |
| targetWidth, | |
| targetHeight, | |
| basePosition; | |
| if ( targetElem.nodeType === 9 ) { | |
| targetWidth = target.width(); | |
| targetHeight = target.height(); | |
| basePosition = { top: 0, left: 0 }; | |
| // TODO: use $.isWindow() in 1.9 | |
| } else if ( targetElem.setTimeout ) { | |
| targetWidth = target.width(); | |
| targetHeight = target.height(); | |
| basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; | |
| } else if ( targetElem.preventDefault ) { | |
| // force left top to allow flipping | |
| options.at = "left top"; | |
| targetWidth = targetHeight = 0; | |
| basePosition = { top: options.of.pageY, left: options.of.pageX }; | |
| } else { | |
| targetWidth = target.outerWidth(); | |
| targetHeight = target.outerHeight(); | |
| basePosition = target.offset(); | |
| } | |
| // force my and at to have valid horizontal and veritcal positions | |
| // if a value is missing or invalid, it will be converted to center | |
| $.each( [ "my", "at" ], function() { | |
| var pos = ( options[this] || "" ).split( " " ); | |
| if ( pos.length === 1) { | |
| pos = horizontalPositions.test( pos[0] ) ? | |
| pos.concat( [center] ) : | |
| verticalPositions.test( pos[0] ) ? | |
| [ center ].concat( pos ) : | |
| [ center, center ]; | |
| } | |
| pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; | |
| pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; | |
| options[ this ] = pos; | |
| }); | |
| // normalize collision option | |
| if ( collision.length === 1 ) { | |
| collision[ 1 ] = collision[ 0 ]; | |
| } | |
| // normalize offset option | |
| offset[ 0 ] = parseInt( offset[0], 10 ) || 0; | |
| if ( offset.length === 1 ) { | |
| offset[ 1 ] = offset[ 0 ]; | |
| } | |
| offset[ 1 ] = parseInt( offset[1], 10 ) || 0; | |
| if ( options.at[0] === "right" ) { | |
| basePosition.left += targetWidth; | |
| } else if ( options.at[0] === center ) { | |
| basePosition.left += targetWidth / 2; | |
| } | |
| if ( options.at[1] === "bottom" ) { | |
| basePosition.top += targetHeight; | |
| } else if ( options.at[1] === center ) { | |
| basePosition.top += targetHeight / 2; | |
| } | |
| basePosition.left += offset[ 0 ]; | |
| basePosition.top += offset[ 1 ]; | |
| return this.each(function() { | |
| var elem = $( this ), | |
| elemWidth = elem.outerWidth(), | |
| elemHeight = elem.outerHeight(), | |
| marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, | |
| marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, | |
| collisionWidth = elemWidth + marginLeft + | |
| ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), | |
| collisionHeight = elemHeight + marginTop + | |
| ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), | |
| position = $.extend( {}, basePosition ), | |
| collisionPosition; | |
| if ( options.my[0] === "right" ) { | |
| position.left -= elemWidth; | |
| } else if ( options.my[0] === center ) { | |
| position.left -= elemWidth / 2; | |
| } | |
| if ( options.my[1] === "bottom" ) { | |
| position.top -= elemHeight; | |
| } else if ( options.my[1] === center ) { | |
| position.top -= elemHeight / 2; | |
| } | |
| // prevent fractions if jQuery version doesn't support them (see #5280) | |
| if ( !support.fractions ) { | |
| position.left = Math.round( position.left ); | |
| position.top = Math.round( position.top ); | |
| } | |
| collisionPosition = { | |
| left: position.left - marginLeft, | |
| top: position.top - marginTop | |
| }; | |
| $.each( [ "left", "top" ], function( i, dir ) { | |
| if ( $.ui.position[ collision[i] ] ) { | |
| $.ui.position[ collision[i] ][ dir ]( position, { | |
| targetWidth: targetWidth, | |
| targetHeight: targetHeight, | |
| elemWidth: elemWidth, | |
| elemHeight: elemHeight, | |
| collisionPosition: collisionPosition, | |
| collisionWidth: collisionWidth, | |
| collisionHeight: collisionHeight, | |
| offset: offset, | |
| my: options.my, | |
| at: options.at | |
| }); | |
| } | |
| }); | |
| if ( $.fn.bgiframe ) { | |
| elem.bgiframe(); | |
| } | |
| elem.offset( $.extend( position, { using: options.using } ) ); | |
| }); | |
| }; | |
| $.ui.position = { | |
| fit: { | |
| left: function( position, data ) { | |
| var win = $( window ), | |
| over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); | |
| position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); | |
| }, | |
| top: function( position, data ) { | |
| var win = $( window ), | |
| over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); | |
| position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); | |
| } | |
| }, | |
| flip: { | |
| left: function( position, data ) { | |
| if ( data.at[0] === center ) { | |
| return; | |
| } | |
| var win = $( window ), | |
| over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), | |
| myOffset = data.my[ 0 ] === "left" ? | |
| -data.elemWidth : | |
| data.my[ 0 ] === "right" ? | |
| data.elemWidth : | |
| 0, | |
| atOffset = data.at[ 0 ] === "left" ? | |
| data.targetWidth : | |
| -data.targetWidth, | |
| offset = -2 * data.offset[ 0 ]; | |
| position.left += data.collisionPosition.left < 0 ? | |
| myOffset + atOffset + offset : | |
| over > 0 ? | |
| myOffset + atOffset + offset : | |
| 0; | |
| }, | |
| top: function( position, data ) { | |
| if ( data.at[1] === center ) { | |
| return; | |
| } | |
| var win = $( window ), | |
| over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), | |
| myOffset = data.my[ 1 ] === "top" ? | |
| -data.elemHeight : | |
| data.my[ 1 ] === "bottom" ? | |
| data.elemHeight : | |
| 0, | |
| atOffset = data.at[ 1 ] === "top" ? | |
| data.targetHeight : | |
| -data.targetHeight, | |
| offset = -2 * data.offset[ 1 ]; | |
| position.top += data.collisionPosition.top < 0 ? | |
| myOffset + atOffset + offset : | |
| over > 0 ? | |
| myOffset + atOffset + offset : | |
| 0; | |
| } | |
| } | |
| }; | |
| // offset setter from jQuery 1.4 | |
| if ( !$.offset.setOffset ) { | |
| $.offset.setOffset = function( elem, options ) { | |
| // set position first, in-case top/left are set even on static elem | |
| if ( /static/.test( $.curCSS( elem, "position" ) ) ) { | |
| elem.style.position = "relative"; | |
| } | |
| var curElem = $( elem ), | |
| curOffset = curElem.offset(), | |
| curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, | |
| curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, | |
| props = { | |
| top: (options.top - curOffset.top) + curTop, | |
| left: (options.left - curOffset.left) + curLeft | |
| }; | |
| if ( 'using' in options ) { | |
| options.using.call( elem, props ); | |
| } else { | |
| curElem.css( props ); | |
| } | |
| }; | |
| $.fn.offset = function( options ) { | |
| var elem = this[ 0 ]; | |
| if ( !elem || !elem.ownerDocument ) { return null; } | |
| if ( options ) { | |
| if ( $.isFunction( options ) ) { | |
| return this.each(function( i ) { | |
| $( this ).offset( options.call( this, i, $( this ).offset() ) ); | |
| }); | |
| } | |
| return this.each(function() { | |
| $.offset.setOffset( this, options ); | |
| }); | |
| } | |
| return _offset.call( this ); | |
| }; | |
| } | |
| // fraction support test (older versions of jQuery don't support fractions) | |
| (function () { | |
| var body = document.getElementsByTagName( "body" )[ 0 ], | |
| div = document.createElement( "div" ), | |
| testElement, testElementParent, testElementStyle, offset, offsetTotal; | |
| //Create a "fake body" for testing based on method used in jQuery.support | |
| testElement = document.createElement( body ? "div" : "body" ); | |
| testElementStyle = { | |
| visibility: "hidden", | |
| width: 0, | |
| height: 0, | |
| border: 0, | |
| margin: 0, | |
| background: "none" | |
| }; | |
| if ( body ) { | |
| $.extend( testElementStyle, { | |
| position: "absolute", | |
| left: "-1000px", | |
| top: "-1000px" | |
| }); | |
| } | |
| for ( var i in testElementStyle ) { | |
| testElement.style[ i ] = testElementStyle[ i ]; | |
| } | |
| testElement.appendChild( div ); | |
| testElementParent = body || document.documentElement; | |
| testElementParent.insertBefore( testElement, testElementParent.firstChild ); | |
| div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;"; | |
| offset = $( div ).offset( function( _, offset ) { | |
| return offset; | |
| }).offset(); | |
| testElement.innerHTML = ""; | |
| testElementParent.removeChild( testElement ); | |
| offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 ); | |
| support.fractions = offsetTotal > 21 && offsetTotal < 22; | |
| })(); | |
| }( jQuery )); | |
| /*! | |
| * jQuery UI Draggable 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Draggables | |
| * | |
| * Depends: | |
| * jquery.ui.core.js | |
| * jquery.ui.mouse.js | |
| * jquery.ui.widget.js | |
| */ | |
| (function( $, undefined ) { | |
| $.widget("ui.draggable", $.ui.mouse, { | |
| widgetEventPrefix: "drag", | |
| options: { | |
| addClasses: true, | |
| appendTo: "parent", | |
| axis: false, | |
| connectToSortable: false, | |
| containment: false, | |
| cursor: "auto", | |
| cursorAt: false, | |
| grid: false, | |
| handle: false, | |
| helper: "original", | |
| iframeFix: false, | |
| opacity: false, | |
| refreshPositions: false, | |
| revert: false, | |
| revertDuration: 500, | |
| scope: "default", | |
| scroll: true, | |
| scrollSensitivity: 20, | |
| scrollSpeed: 20, | |
| snap: false, | |
| snapMode: "both", | |
| snapTolerance: 20, | |
| stack: false, | |
| zIndex: false | |
| }, | |
| _create: function() { | |
| if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) | |
| this.element[0].style.position = 'relative'; | |
| (this.options.addClasses && this.element.addClass("ui-draggable")); | |
| (this.options.disabled && this.element.addClass("ui-draggable-disabled")); | |
| this._mouseInit(); | |
| }, | |
| destroy: function() { | |
| if(!this.element.data('draggable')) return; | |
| this.element | |
| .removeData("draggable") | |
| .unbind(".draggable") | |
| .removeClass("ui-draggable" | |
| + " ui-draggable-dragging" | |
| + " ui-draggable-disabled"); | |
| this._mouseDestroy(); | |
| return this; | |
| }, | |
| _mouseCapture: function(event) { | |
| var o = this.options; | |
| // among others, prevent a drag on a resizable-handle | |
| if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) | |
| return false; | |
| //Quit if we're not on a valid handle | |
| this.handle = this._getHandle(event); | |
| if (!this.handle) | |
| return false; | |
| if ( o.iframeFix ) { | |
| $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { | |
| $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>') | |
| .css({ | |
| width: this.offsetWidth+"px", height: this.offsetHeight+"px", | |
| position: "absolute", opacity: "0.001", zIndex: 1000 | |
| }) | |
| .css($(this).offset()) | |
| .appendTo("body"); | |
| }); | |
| } | |
| return true; | |
| }, | |
| _mouseStart: function(event) { | |
| var o = this.options; | |
| //Create and append the visible helper | |
| this.helper = this._createHelper(event); | |
| this.helper.addClass("ui-draggable-dragging"); | |
| //Cache the helper size | |
| this._cacheHelperProportions(); | |
| //If ddmanager is used for droppables, set the global draggable | |
| if($.ui.ddmanager) | |
| $.ui.ddmanager.current = this; | |
| /* | |
| * - Position generation - | |
| * This block generates everything position related - it's the core of draggables. | |
| */ | |
| //Cache the margins of the original element | |
| this._cacheMargins(); | |
| //Store the helper's css position | |
| this.cssPosition = this.helper.css("position"); | |
| this.scrollParent = this.helper.scrollParent(); | |
| //The element's absolute position on the page minus margins | |
| this.offset = this.positionAbs = this.element.offset(); | |
| this.offset = { | |
| top: this.offset.top - this.margins.top, | |
| left: this.offset.left - this.margins.left | |
| }; | |
| $.extend(this.offset, { | |
| click: { //Where the click happened, relative to the element | |
| left: event.pageX - this.offset.left, | |
| top: event.pageY - this.offset.top | |
| }, | |
| parent: this._getParentOffset(), | |
| relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper | |
| }); | |
| //Generate the original position | |
| this.originalPosition = this.position = this._generatePosition(event); | |
| this.originalPageX = event.pageX; | |
| this.originalPageY = event.pageY; | |
| //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied | |
| (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); | |
| //Set a containment if given in the options | |
| if(o.containment) | |
| this._setContainment(); | |
| //Trigger event + callbacks | |
| if(this._trigger("start", event) === false) { | |
| this._clear(); | |
| return false; | |
| } | |
| //Recache the helper size | |
| this._cacheHelperProportions(); | |
| //Prepare the droppable offsets | |
| if ($.ui.ddmanager && !o.dropBehaviour) | |
| $.ui.ddmanager.prepareOffsets(this, event); | |
| this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position | |
| //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) | |
| if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event); | |
| return true; | |
| }, | |
| _mouseDrag: function(event, noPropagation) { | |
| //Compute the helpers position | |
| this.position = this._generatePosition(event); | |
| this.positionAbs = this._convertPositionTo("absolute"); | |
| //Call plugins and callbacks and use the resulting position if something is returned | |
| if (!noPropagation) { | |
| var ui = this._uiHash(); | |
| if(this._trigger('drag', event, ui) === false) { | |
| this._mouseUp({}); | |
| return false; | |
| } | |
| this.position = ui.position; | |
| } | |
| if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; | |
| if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; | |
| if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); | |
| return false; | |
| }, | |
| _mouseStop: function(event) { | |
| //If we are using droppables, inform the manager about the drop | |
| var dropped = false; | |
| if ($.ui.ddmanager && !this.options.dropBehaviour) | |
| dropped = $.ui.ddmanager.drop(this, event); | |
| //if a drop comes from outside (a sortable) | |
| if(this.dropped) { | |
| dropped = this.dropped; | |
| this.dropped = false; | |
| } | |
| //if the original element is no longer in the DOM don't bother to continue (see #8269) | |
| var element = this.element[0], elementInDom = false; | |
| while ( element && (element = element.parentNode) ) { | |
| if (element == document ) { | |
| elementInDom = true; | |
| } | |
| } | |
| if ( !elementInDom && this.options.helper === "original" ) | |
| return false; | |
| if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { | |
| var self = this; | |
| $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { | |
| if(self._trigger("stop", event) !== false) { | |
| self._clear(); | |
| } | |
| }); | |
| } else { | |
| if(this._trigger("stop", event) !== false) { | |
| this._clear(); | |
| } | |
| } | |
| return false; | |
| }, | |
| _mouseUp: function(event) { | |
| if (this.options.iframeFix === true) { | |
| $("div.ui-draggable-iframeFix").each(function() { | |
| this.parentNode.removeChild(this); | |
| }); //Remove frame helpers | |
| } | |
| //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) | |
| if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event); | |
| return $.ui.mouse.prototype._mouseUp.call(this, event); | |
| }, | |
| cancel: function() { | |
| if(this.helper.is(".ui-draggable-dragging")) { | |
| this._mouseUp({}); | |
| } else { | |
| this._clear(); | |
| } | |
| return this; | |
| }, | |
| _getHandle: function(event) { | |
| var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; | |
| $(this.options.handle, this.element) | |
| .find("*") | |
| .andSelf() | |
| .each(function() { | |
| if(this == event.target) handle = true; | |
| }); | |
| return handle; | |
| }, | |
| _createHelper: function(event) { | |
| var o = this.options; | |
| var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone().removeAttr('id') : this.element); | |
| if(!helper.parents('body').length) | |
| helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); | |
| if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) | |
| helper.css("position", "absolute"); | |
| return helper; | |
| }, | |
| _adjustOffsetFromHelper: function(obj) { | |
| if (typeof obj == 'string') { | |
| obj = obj.split(' '); | |
| } | |
| if ($.isArray(obj)) { | |
| obj = {left: +obj[0], top: +obj[1] || 0}; | |
| } | |
| if ('left' in obj) { | |
| this.offset.click.left = obj.left + this.margins.left; | |
| } | |
| if ('right' in obj) { | |
| this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; | |
| } | |
| if ('top' in obj) { | |
| this.offset.click.top = obj.top + this.margins.top; | |
| } | |
| if ('bottom' in obj) { | |
| this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; | |
| } | |
| }, | |
| _getParentOffset: function() { | |
| //Get the offsetParent and cache its position | |
| this.offsetParent = this.helper.offsetParent(); | |
| var po = this.offsetParent.offset(); | |
| // This is a special case where we need to modify a offset calculated on start, since the following happened: | |
| // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent | |
| // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that | |
| // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag | |
| if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { | |
| po.left += this.scrollParent.scrollLeft(); | |
| po.top += this.scrollParent.scrollTop(); | |
| } | |
| if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information | |
| || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix | |
| po = { top: 0, left: 0 }; | |
| return { | |
| top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), | |
| left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) | |
| }; | |
| }, | |
| _getRelativeOffset: function() { | |
| if(this.cssPosition == "relative") { | |
| var p = this.element.position(); | |
| return { | |
| top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), | |
| left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() | |
| }; | |
| } else { | |
| return { top: 0, left: 0 }; | |
| } | |
| }, | |
| _cacheMargins: function() { | |
| this.margins = { | |
| left: (parseInt(this.element.css("marginLeft"),10) || 0), | |
| top: (parseInt(this.element.css("marginTop"),10) || 0), | |
| right: (parseInt(this.element.css("marginRight"),10) || 0), | |
| bottom: (parseInt(this.element.css("marginBottom"),10) || 0) | |
| }; | |
| }, | |
| _cacheHelperProportions: function() { | |
| this.helperProportions = { | |
| width: this.helper.outerWidth(), | |
| height: this.helper.outerHeight() | |
| }; | |
| }, | |
| _setContainment: function() { | |
| var o = this.options; | |
| if(o.containment == 'parent') o.containment = this.helper[0].parentNode; | |
| if(o.containment == 'document' || o.containment == 'window') this.containment = [ | |
| o.containment == 'document' ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, | |
| o.containment == 'document' ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, | |
| (o.containment == 'document' ? 0 : $(window).scrollLeft()) + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, | |
| (o.containment == 'document' ? 0 : $(window).scrollTop()) + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top | |
| ]; | |
| if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { | |
| var c = $(o.containment); | |
| var ce = c[0]; if(!ce) return; | |
| var co = c.offset(); | |
| var over = ($(ce).css("overflow") != 'hidden'); | |
| this.containment = [ | |
| (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), | |
| (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), | |
| (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, | |
| (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom | |
| ]; | |
| this.relative_container = c; | |
| } else if(o.containment.constructor == Array) { | |
| this.containment = o.containment; | |
| } | |
| }, | |
| _convertPositionTo: function(d, pos) { | |
| if(!pos) pos = this.position; | |
| var mod = d == "absolute" ? 1 : -1; | |
| var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); | |
| return { | |
| top: ( | |
| pos.top // The absolute mouse position | |
| + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent | |
| + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) | |
| - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) | |
| ), | |
| left: ( | |
| pos.left // The absolute mouse position | |
| + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent | |
| + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) | |
| - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) | |
| ) | |
| }; | |
| }, | |
| _generatePosition: function(event) { | |
| var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); | |
| var pageX = event.pageX; | |
| var pageY = event.pageY; | |
| /* | |
| * - Position constraining - | |
| * Constrain the position to a mix of grid, containment. | |
| */ | |
| if(this.originalPosition) { //If we are not dragging yet, we won't check for options | |
| var containment; | |
| if(this.containment) { | |
| if (this.relative_container){ | |
| var co = this.relative_container.offset(); | |
| containment = [ this.containment[0] + co.left, | |
| this.containment[1] + co.top, | |
| this.containment[2] + co.left, | |
| this.containment[3] + co.top ]; | |
| } | |
| else { | |
| containment = this.containment; | |
| } | |
| if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left; | |
| if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top; | |
| if(event.pageX - this.offset.click.left > containment[2]) pageX = containment[2] + this.offset.click.left; | |
| if(event.pageY - this.offset.click.top > containment[3]) pageY = containment[3] + this.offset.click.top; | |
| } | |
| if(o.grid) { | |
| //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) | |
| var top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; | |
| pageY = containment ? (!(top - this.offset.click.top < containment[1] || top - this.offset.click.top > containment[3]) ? top : (!(top - this.offset.click.top < containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; | |
| var left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; | |
| pageX = containment ? (!(left - this.offset.click.left < containment[0] || left - this.offset.click.left > containment[2]) ? left : (!(left - this.offset.click.left < containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; | |
| } | |
| } | |
| return { | |
| top: ( | |
| pageY // The absolute mouse position | |
| - this.offset.click.top // Click offset (relative to the element) | |
| - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent | |
| - this.offset.parent.top // The offsetParent's offset without borders (offset + border) | |
| + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) | |
| ), | |
| left: ( | |
| pageX // The absolute mouse position | |
| - this.offset.click.left // Click offset (relative to the element) | |
| - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent | |
| - this.offset.parent.left // The offsetParent's offset without borders (offset + border) | |
| + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) | |
| ) | |
| }; | |
| }, | |
| _clear: function() { | |
| this.helper.removeClass("ui-draggable-dragging"); | |
| if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); | |
| //if($.ui.ddmanager) $.ui.ddmanager.current = null; | |
| this.helper = null; | |
| this.cancelHelperRemoval = false; | |
| }, | |
| // From now on bulk stuff - mainly helpers | |
| _trigger: function(type, event, ui) { | |
| ui = ui || this._uiHash(); | |
| $.ui.plugin.call(this, type, [event, ui]); | |
| if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins | |
| return $.Widget.prototype._trigger.call(this, type, event, ui); | |
| }, | |
| plugins: {}, | |
| _uiHash: function(event) { | |
| return { | |
| helper: this.helper, | |
| position: this.position, | |
| originalPosition: this.originalPosition, | |
| offset: this.positionAbs | |
| }; | |
| } | |
| }); | |
| $.extend($.ui.draggable, { | |
| version: "1.8.22" | |
| }); | |
| $.ui.plugin.add("draggable", "connectToSortable", { | |
| start: function(event, ui) { | |
| var inst = $(this).data("draggable"), o = inst.options, | |
| uiSortable = $.extend({}, ui, { item: inst.element }); | |
| inst.sortables = []; | |
| $(o.connectToSortable).each(function() { | |
| var sortable = $.data(this, 'sortable'); | |
| if (sortable && !sortable.options.disabled) { | |
| inst.sortables.push({ | |
| instance: sortable, | |
| shouldRevert: sortable.options.revert | |
| }); | |
| sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). | |
| sortable._trigger("activate", event, uiSortable); | |
| } | |
| }); | |
| }, | |
| stop: function(event, ui) { | |
| //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper | |
| var inst = $(this).data("draggable"), | |
| uiSortable = $.extend({}, ui, { item: inst.element }); | |
| $.each(inst.sortables, function() { | |
| if(this.instance.isOver) { | |
| this.instance.isOver = 0; | |
| inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance | |
| this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) | |
| //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' | |
| if(this.shouldRevert) this.instance.options.revert = true; | |
| //Trigger the stop of the sortable | |
| this.instance._mouseStop(event); | |
| this.instance.options.helper = this.instance.options._helper; | |
| //If the helper has been the original item, restore properties in the sortable | |
| if(inst.options.helper == 'original') | |
| this.instance.currentItem.css({ top: 'auto', left: 'auto' }); | |
| } else { | |
| this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance | |
| this.instance._trigger("deactivate", event, uiSortable); | |
| } | |
| }); | |
| }, | |
| drag: function(event, ui) { | |
| var inst = $(this).data("draggable"), self = this; | |
| var checkPos = function(o) { | |
| var dyClick = this.offset.click.top, dxClick = this.offset.click.left; | |
| var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; | |
| var itemHeight = o.height, itemWidth = o.width; | |
| var itemTop = o.top, itemLeft = o.left; | |
| return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); | |
| }; | |
| $.each(inst.sortables, function(i) { | |
| //Copy over some variables to allow calling the sortable's native _intersectsWith | |
| this.instance.positionAbs = inst.positionAbs; | |
| this.instance.helperProportions = inst.helperProportions; | |
| this.instance.offset.click = inst.offset.click; | |
| if(this.instance._intersectsWith(this.instance.containerCache)) { | |
| //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once | |
| if(!this.instance.isOver) { | |
| this.instance.isOver = 1; | |
| //Now we fake the start of dragging for the sortable instance, | |
| //by cloning the list group item, appending it to the sortable and using it as inst.currentItem | |
| //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) | |
| this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true); | |
| this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it | |
| this.instance.options.helper = function() { return ui.helper[0]; }; | |
| event.target = this.instance.currentItem[0]; | |
| this.instance._mouseCapture(event, true); | |
| this.instance._mouseStart(event, true, true); | |
| //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes | |
| this.instance.offset.click.top = inst.offset.click.top; | |
| this.instance.offset.click.left = inst.offset.click.left; | |
| this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; | |
| this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; | |
| inst._trigger("toSortable", event); | |
| inst.dropped = this.instance.element; //draggable revert needs that | |
| //hack so receive/update callbacks work (mostly) | |
| inst.currentItem = inst.element; | |
| this.instance.fromOutside = inst; | |
| } | |
| //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable | |
| if(this.instance.currentItem) this.instance._mouseDrag(event); | |
| } else { | |
| //If it doesn't intersect with the sortable, and it intersected before, | |
| //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval | |
| if(this.instance.isOver) { | |
| this.instance.isOver = 0; | |
| this.instance.cancelHelperRemoval = true; | |
| //Prevent reverting on this forced stop | |
| this.instance.options.revert = false; | |
| // The out event needs to be triggered independently | |
| this.instance._trigger('out', event, this.instance._uiHash(this.instance)); | |
| this.instance._mouseStop(event, true); | |
| this.instance.options.helper = this.instance.options._helper; | |
| //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size | |
| this.instance.currentItem.remove(); | |
| if(this.instance.placeholder) this.instance.placeholder.remove(); | |
| inst._trigger("fromSortable", event); | |
| inst.dropped = false; //draggable revert needs that | |
| } | |
| }; | |
| }); | |
| } | |
| }); | |
| $.ui.plugin.add("draggable", "cursor", { | |
| start: function(event, ui) { | |
| var t = $('body'), o = $(this).data('draggable').options; | |
| if (t.css("cursor")) o._cursor = t.css("cursor"); | |
| t.css("cursor", o.cursor); | |
| }, | |
| stop: function(event, ui) { | |
| var o = $(this).data('draggable').options; | |
| if (o._cursor) $('body').css("cursor", o._cursor); | |
| } | |
| }); | |
| $.ui.plugin.add("draggable", "opacity", { | |
| start: function(event, ui) { | |
| var t = $(ui.helper), o = $(this).data('draggable').options; | |
| if(t.css("opacity")) o._opacity = t.css("opacity"); | |
| t.css('opacity', o.opacity); | |
| }, | |
| stop: function(event, ui) { | |
| var o = $(this).data('draggable').options; | |
| if(o._opacity) $(ui.helper).css('opacity', o._opacity); | |
| } | |
| }); | |
| $.ui.plugin.add("draggable", "scroll", { | |
| start: function(event, ui) { | |
| var i = $(this).data("draggable"); | |
| if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); | |
| }, | |
| drag: function(event, ui) { | |
| var i = $(this).data("draggable"), o = i.options, scrolled = false; | |
| if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { | |
| if(!o.axis || o.axis != 'x') { | |
| if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) | |
| i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; | |
| else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) | |
| i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; | |
| } | |
| if(!o.axis || o.axis != 'y') { | |
| if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) | |
| i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; | |
| else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) | |
| i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; | |
| } | |
| } else { | |
| if(!o.axis || o.axis != 'x') { | |
| if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) | |
| scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); | |
| else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) | |
| scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); | |
| } | |
| if(!o.axis || o.axis != 'y') { | |
| if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) | |
| scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); | |
| else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) | |
| scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); | |
| } | |
| } | |
| if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) | |
| $.ui.ddmanager.prepareOffsets(i, event); | |
| } | |
| }); | |
| $.ui.plugin.add("draggable", "snap", { | |
| start: function(event, ui) { | |
| var i = $(this).data("draggable"), o = i.options; | |
| i.snapElements = []; | |
| $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { | |
| var $t = $(this); var $o = $t.offset(); | |
| if(this != i.element[0]) i.snapElements.push({ | |
| item: this, | |
| width: $t.outerWidth(), height: $t.outerHeight(), | |
| top: $o.top, left: $o.left | |
| }); | |
| }); | |
| }, | |
| drag: function(event, ui) { | |
| var inst = $(this).data("draggable"), o = inst.options; | |
| var d = o.snapTolerance; | |
| var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, | |
| y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; | |
| for (var i = inst.snapElements.length - 1; i >= 0; i--){ | |
| var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, | |
| t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; | |
| //Yes, I know, this is insane ;) | |
| if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { | |
| if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); | |
| inst.snapElements[i].snapping = false; | |
| continue; | |
| } | |
| if(o.snapMode != 'inner') { | |
| var ts = Math.abs(t - y2) <= d; | |
| var bs = Math.abs(b - y1) <= d; | |
| var ls = Math.abs(l - x2) <= d; | |
| var rs = Math.abs(r - x1) <= d; | |
| if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; | |
| if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; | |
| if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; | |
| if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; | |
| } | |
| var first = (ts || bs || ls || rs); | |
| if(o.snapMode != 'outer') { | |
| var ts = Math.abs(t - y1) <= d; | |
| var bs = Math.abs(b - y2) <= d; | |
| var ls = Math.abs(l - x1) <= d; | |
| var rs = Math.abs(r - x2) <= d; | |
| if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; | |
| if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; | |
| if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; | |
| if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; | |
| } | |
| if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) | |
| (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); | |
| inst.snapElements[i].snapping = (ts || bs || ls || rs || first); | |
| }; | |
| } | |
| }); | |
| $.ui.plugin.add("draggable", "stack", { | |
| start: function(event, ui) { | |
| var o = $(this).data("draggable").options; | |
| var group = $.makeArray($(o.stack)).sort(function(a,b) { | |
| return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); | |
| }); | |
| if (!group.length) { return; } | |
| var min = parseInt(group[0].style.zIndex) || 0; | |
| $(group).each(function(i) { | |
| this.style.zIndex = min + i; | |
| }); | |
| this[0].style.zIndex = min + group.length; | |
| } | |
| }); | |
| $.ui.plugin.add("draggable", "zIndex", { | |
| start: function(event, ui) { | |
| var t = $(ui.helper), o = $(this).data("draggable").options; | |
| if(t.css("zIndex")) o._zIndex = t.css("zIndex"); | |
| t.css('zIndex', o.zIndex); | |
| }, | |
| stop: function(event, ui) { | |
| var o = $(this).data("draggable").options; | |
| if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); | |
| } | |
| }); | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Droppable 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Droppables | |
| * | |
| * Depends: | |
| * jquery.ui.core.js | |
| * jquery.ui.widget.js | |
| * jquery.ui.mouse.js | |
| * jquery.ui.draggable.js | |
| */ | |
| (function( $, undefined ) { | |
| $.widget("ui.droppable", { | |
| widgetEventPrefix: "drop", | |
| options: { | |
| accept: '*', | |
| activeClass: false, | |
| addClasses: true, | |
| greedy: false, | |
| hoverClass: false, | |
| scope: 'default', | |
| tolerance: 'intersect' | |
| }, | |
| _create: function() { | |
| var o = this.options, accept = o.accept; | |
| this.isover = 0; this.isout = 1; | |
| this.accept = $.isFunction(accept) ? accept : function(d) { | |
| return d.is(accept); | |
| }; | |
| //Store the droppable's proportions | |
| this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; | |
| // Add the reference and positions to the manager | |
| $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; | |
| $.ui.ddmanager.droppables[o.scope].push(this); | |
| (o.addClasses && this.element.addClass("ui-droppable")); | |
| }, | |
| destroy: function() { | |
| var drop = $.ui.ddmanager.droppables[this.options.scope]; | |
| for ( var i = 0; i < drop.length; i++ ) | |
| if ( drop[i] == this ) | |
| drop.splice(i, 1); | |
| this.element | |
| .removeClass("ui-droppable ui-droppable-disabled") | |
| .removeData("droppable") | |
| .unbind(".droppable"); | |
| return this; | |
| }, | |
| _setOption: function(key, value) { | |
| if(key == 'accept') { | |
| this.accept = $.isFunction(value) ? value : function(d) { | |
| return d.is(value); | |
| }; | |
| } | |
| $.Widget.prototype._setOption.apply(this, arguments); | |
| }, | |
| _activate: function(event) { | |
| var draggable = $.ui.ddmanager.current; | |
| if(this.options.activeClass) this.element.addClass(this.options.activeClass); | |
| (draggable && this._trigger('activate', event, this.ui(draggable))); | |
| }, | |
| _deactivate: function(event) { | |
| var draggable = $.ui.ddmanager.current; | |
| if(this.options.activeClass) this.element.removeClass(this.options.activeClass); | |
| (draggable && this._trigger('deactivate', event, this.ui(draggable))); | |
| }, | |
| _over: function(event) { | |
| var draggable = $.ui.ddmanager.current; | |
| if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element | |
| if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { | |
| if(this.options.hoverClass) this.element.addClass(this.options.hoverClass); | |
| this._trigger('over', event, this.ui(draggable)); | |
| } | |
| }, | |
| _out: function(event) { | |
| var draggable = $.ui.ddmanager.current; | |
| if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element | |
| if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { | |
| if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); | |
| this._trigger('out', event, this.ui(draggable)); | |
| } | |
| }, | |
| _drop: function(event,custom) { | |
| var draggable = custom || $.ui.ddmanager.current; | |
| if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element | |
| var childrenIntersection = false; | |
| this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() { | |
| var inst = $.data(this, 'droppable'); | |
| if( | |
| inst.options.greedy | |
| && !inst.options.disabled | |
| && inst.options.scope == draggable.options.scope | |
| && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) | |
| && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) | |
| ) { childrenIntersection = true; return false; } | |
| }); | |
| if(childrenIntersection) return false; | |
| if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { | |
| if(this.options.activeClass) this.element.removeClass(this.options.activeClass); | |
| if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass); | |
| this._trigger('drop', event, this.ui(draggable)); | |
| return this.element; | |
| } | |
| return false; | |
| }, | |
| ui: function(c) { | |
| return { | |
| draggable: (c.currentItem || c.element), | |
| helper: c.helper, | |
| position: c.position, | |
| offset: c.positionAbs | |
| }; | |
| } | |
| }); | |
| $.extend($.ui.droppable, { | |
| version: "1.8.22" | |
| }); | |
| $.ui.intersect = function(draggable, droppable, toleranceMode) { | |
| if (!droppable.offset) return false; | |
| var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, | |
| y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height; | |
| var l = droppable.offset.left, r = l + droppable.proportions.width, | |
| t = droppable.offset.top, b = t + droppable.proportions.height; | |
| switch (toleranceMode) { | |
| case 'fit': | |
| return (l <= x1 && x2 <= r | |
| && t <= y1 && y2 <= b); | |
| break; | |
| case 'intersect': | |
| return (l < x1 + (draggable.helperProportions.width / 2) // Right Half | |
| && x2 - (draggable.helperProportions.width / 2) < r // Left Half | |
| && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half | |
| && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half | |
| break; | |
| case 'pointer': | |
| var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left), | |
| draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top), | |
| isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width); | |
| return isOver; | |
| break; | |
| case 'touch': | |
| return ( | |
| (y1 >= t && y1 <= b) || // Top edge touching | |
| (y2 >= t && y2 <= b) || // Bottom edge touching | |
| (y1 < t && y2 > b) // Surrounded vertically | |
| ) && ( | |
| (x1 >= l && x1 <= r) || // Left edge touching | |
| (x2 >= l && x2 <= r) || // Right edge touching | |
| (x1 < l && x2 > r) // Surrounded horizontally | |
| ); | |
| break; | |
| default: | |
| return false; | |
| break; | |
| } | |
| }; | |
| /* | |
| This manager tracks offsets of draggables and droppables | |
| */ | |
| $.ui.ddmanager = { | |
| current: null, | |
| droppables: { 'default': [] }, | |
| prepareOffsets: function(t, event) { | |
| var m = $.ui.ddmanager.droppables[t.options.scope] || []; | |
| var type = event ? event.type : null; // workaround for #2317 | |
| var list = (t.currentItem || t.element).find(":data(droppable)").andSelf(); | |
| droppablesLoop: for (var i = 0; i < m.length; i++) { | |
| if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted | |
| for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item | |
| m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue | |
| if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables | |
| m[i].offset = m[i].element.offset(); | |
| m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; | |
| } | |
| }, | |
| drop: function(draggable, event) { | |
| var dropped = false; | |
| $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { | |
| if(!this.options) return; | |
| if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) | |
| dropped = this._drop.call(this, event) || dropped; | |
| if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { | |
| this.isout = 1; this.isover = 0; | |
| this._deactivate.call(this, event); | |
| } | |
| }); | |
| return dropped; | |
| }, | |
| dragStart: function( draggable, event ) { | |
| //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) | |
| draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() { | |
| if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); | |
| }); | |
| }, | |
| drag: function(draggable, event) { | |
| //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. | |
| if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event); | |
| //Run through all droppables and check their positions based on specific tolerance options | |
| $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { | |
| if(this.options.disabled || this.greedyChild || !this.visible) return; | |
| var intersects = $.ui.intersect(draggable, this, this.options.tolerance); | |
| var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null); | |
| if(!c) return; | |
| var parentInstance; | |
| if (this.options.greedy) { | |
| var parent = this.element.parents(':data(droppable):eq(0)'); | |
| if (parent.length) { | |
| parentInstance = $.data(parent[0], 'droppable'); | |
| parentInstance.greedyChild = (c == 'isover' ? 1 : 0); | |
| } | |
| } | |
| // we just moved into a greedy child | |
| if (parentInstance && c == 'isover') { | |
| parentInstance['isover'] = 0; | |
| parentInstance['isout'] = 1; | |
| parentInstance._out.call(parentInstance, event); | |
| } | |
| this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0; | |
| this[c == "isover" ? "_over" : "_out"].call(this, event); | |
| // we just moved out of a greedy child | |
| if (parentInstance && c == 'isout') { | |
| parentInstance['isout'] = 0; | |
| parentInstance['isover'] = 1; | |
| parentInstance._over.call(parentInstance, event); | |
| } | |
| }); | |
| }, | |
| dragStop: function( draggable, event ) { | |
| draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" ); | |
| //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) | |
| if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event ); | |
| } | |
| }; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Resizable 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Resizables | |
| * | |
| * Depends: | |
| * jquery.ui.core.js | |
| * jquery.ui.mouse.js | |
| * jquery.ui.widget.js | |
| */ | |
| (function( $, undefined ) { | |
| $.widget("ui.resizable", $.ui.mouse, { | |
| widgetEventPrefix: "resize", | |
| options: { | |
| alsoResize: false, | |
| animate: false, | |
| animateDuration: "slow", | |
| animateEasing: "swing", | |
| aspectRatio: false, | |
| autoHide: false, | |
| containment: false, | |
| ghost: false, | |
| grid: false, | |
| handles: "e,s,se", | |
| helper: false, | |
| maxHeight: null, | |
| maxWidth: null, | |
| minHeight: 10, | |
| minWidth: 10, | |
| zIndex: 1000 | |
| }, | |
| _create: function() { | |
| var self = this, o = this.options; | |
| this.element.addClass("ui-resizable"); | |
| $.extend(this, { | |
| _aspectRatio: !!(o.aspectRatio), | |
| aspectRatio: o.aspectRatio, | |
| originalElement: this.element, | |
| _proportionallyResizeElements: [], | |
| _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null | |
| }); | |
| //Wrap the element if it cannot hold child nodes | |
| if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { | |
| //Create a wrapper element and set the wrapper to the new current internal element | |
| this.element.wrap( | |
| $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({ | |
| position: this.element.css('position'), | |
| width: this.element.outerWidth(), | |
| height: this.element.outerHeight(), | |
| top: this.element.css('top'), | |
| left: this.element.css('left') | |
| }) | |
| ); | |
| //Overwrite the original this.element | |
| this.element = this.element.parent().data( | |
| "resizable", this.element.data('resizable') | |
| ); | |
| this.elementIsWrapper = true; | |
| //Move margins to the wrapper | |
| this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); | |
| this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); | |
| //Prevent Safari textarea resize | |
| this.originalResizeStyle = this.originalElement.css('resize'); | |
| this.originalElement.css('resize', 'none'); | |
| //Push the actual element to our proportionallyResize internal array | |
| this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' })); | |
| // avoid IE jump (hard set the margin) | |
| this.originalElement.css({ margin: this.originalElement.css('margin') }); | |
| // fix handlers offset | |
| this._proportionallyResize(); | |
| } | |
| this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' }); | |
| if(this.handles.constructor == String) { | |
| if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw'; | |
| var n = this.handles.split(","); this.handles = {}; | |
| for(var i = 0; i < n.length; i++) { | |
| var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle; | |
| var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>'); | |
| // Apply zIndex to all handles - see #7960 | |
| axis.css({ zIndex: o.zIndex }); | |
| //TODO : What's going on here? | |
| if ('se' == handle) { | |
| axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se'); | |
| }; | |
| //Insert into internal handles object and append to element | |
| this.handles[handle] = '.ui-resizable-'+handle; | |
| this.element.append(axis); | |
| } | |
| } | |
| this._renderAxis = function(target) { | |
| target = target || this.element; | |
| for(var i in this.handles) { | |
| if(this.handles[i].constructor == String) | |
| this.handles[i] = $(this.handles[i], this.element).show(); | |
| //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) | |
| if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { | |
| var axis = $(this.handles[i], this.element), padWrapper = 0; | |
| //Checking the correct pad and border | |
| padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); | |
| //The padding type i have to apply... | |
| var padPos = [ 'padding', | |
| /ne|nw|n/.test(i) ? 'Top' : | |
| /se|sw|s/.test(i) ? 'Bottom' : | |
| /^e$/.test(i) ? 'Right' : 'Left' ].join(""); | |
| target.css(padPos, padWrapper); | |
| this._proportionallyResize(); | |
| } | |
| //TODO: What's that good for? There's not anything to be executed left | |
| if(!$(this.handles[i]).length) | |
| continue; | |
| } | |
| }; | |
| //TODO: make renderAxis a prototype function | |
| this._renderAxis(this.element); | |
| this._handles = $('.ui-resizable-handle', this.element) | |
| .disableSelection(); | |
| //Matching axis name | |
| this._handles.mouseover(function() { | |
| if (!self.resizing) { | |
| if (this.className) | |
| var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); | |
| //Axis, default = se | |
| self.axis = axis && axis[1] ? axis[1] : 'se'; | |
| } | |
| }); | |
| //If we want to auto hide the elements | |
| if (o.autoHide) { | |
| this._handles.hide(); | |
| $(this.element) | |
| .addClass("ui-resizable-autohide") | |
| .hover(function() { | |
| if (o.disabled) return; | |
| $(this).removeClass("ui-resizable-autohide"); | |
| self._handles.show(); | |
| }, | |
| function(){ | |
| if (o.disabled) return; | |
| if (!self.resizing) { | |
| $(this).addClass("ui-resizable-autohide"); | |
| self._handles.hide(); | |
| } | |
| }); | |
| } | |
| //Initialize the mouse interaction | |
| this._mouseInit(); | |
| }, | |
| destroy: function() { | |
| this._mouseDestroy(); | |
| var _destroy = function(exp) { | |
| $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") | |
| .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove(); | |
| }; | |
| //TODO: Unwrap at same DOM position | |
| if (this.elementIsWrapper) { | |
| _destroy(this.element); | |
| var wrapper = this.element; | |
| wrapper.after( | |
| this.originalElement.css({ | |
| position: wrapper.css('position'), | |
| width: wrapper.outerWidth(), | |
| height: wrapper.outerHeight(), | |
| top: wrapper.css('top'), | |
| left: wrapper.css('left') | |
| }) | |
| ).remove(); | |
| } | |
| this.originalElement.css('resize', this.originalResizeStyle); | |
| _destroy(this.originalElement); | |
| return this; | |
| }, | |
| _mouseCapture: function(event) { | |
| var handle = false; | |
| for (var i in this.handles) { | |
| if ($(this.handles[i])[0] == event.target) { | |
| handle = true; | |
| } | |
| } | |
| return !this.options.disabled && handle; | |
| }, | |
| _mouseStart: function(event) { | |
| var o = this.options, iniPos = this.element.position(), el = this.element; | |
| this.resizing = true; | |
| this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() }; | |
| // bugfix for http://dev.jquery.com/ticket/1749 | |
| if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) { | |
| el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left }); | |
| } | |
| this._renderProxy(); | |
| var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top')); | |
| if (o.containment) { | |
| curleft += $(o.containment).scrollLeft() || 0; | |
| curtop += $(o.containment).scrollTop() || 0; | |
| } | |
| //Store needed variables | |
| this.offset = this.helper.offset(); | |
| this.position = { left: curleft, top: curtop }; | |
| this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; | |
| this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; | |
| this.originalPosition = { left: curleft, top: curtop }; | |
| this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; | |
| this.originalMousePosition = { left: event.pageX, top: event.pageY }; | |
| //Aspect Ratio | |
| this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); | |
| var cursor = $('.ui-resizable-' + this.axis).css('cursor'); | |
| $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor); | |
| el.addClass("ui-resizable-resizing"); | |
| this._propagate("start", event); | |
| return true; | |
| }, | |
| _mouseDrag: function(event) { | |
| //Increase performance, avoid regex | |
| var el = this.helper, o = this.options, props = {}, | |
| self = this, smp = this.originalMousePosition, a = this.axis; | |
| var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0; | |
| var trigger = this._change[a]; | |
| if (!trigger) return false; | |
| // Calculate the attrs that will be change | |
| var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff; | |
| // Put this in the mouseDrag handler since the user can start pressing shift while resizing | |
| this._updateVirtualBoundaries(event.shiftKey); | |
| if (this._aspectRatio || event.shiftKey) | |
| data = this._updateRatio(data, event); | |
| data = this._respectSize(data, event); | |
| // plugins callbacks need to be called first | |
| this._propagate("resize", event); | |
| el.css({ | |
| top: this.position.top + "px", left: this.position.left + "px", | |
| width: this.size.width + "px", height: this.size.height + "px" | |
| }); | |
| if (!this._helper && this._proportionallyResizeElements.length) | |
| this._proportionallyResize(); | |
| this._updateCache(data); | |
| // calling the user callback at the end | |
| this._trigger('resize', event, this.ui()); | |
| return false; | |
| }, | |
| _mouseStop: function(event) { | |
| this.resizing = false; | |
| var o = this.options, self = this; | |
| if(this._helper) { | |
| var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), | |
| soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, | |
| soffsetw = ista ? 0 : self.sizeDiff.width; | |
| var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) }, | |
| left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, | |
| top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; | |
| if (!o.animate) | |
| this.element.css($.extend(s, { top: top, left: left })); | |
| self.helper.height(self.size.height); | |
| self.helper.width(self.size.width); | |
| if (this._helper && !o.animate) this._proportionallyResize(); | |
| } | |
| $('body').css('cursor', 'auto'); | |
| this.element.removeClass("ui-resizable-resizing"); | |
| this._propagate("stop", event); | |
| if (this._helper) this.helper.remove(); | |
| return false; | |
| }, | |
| _updateVirtualBoundaries: function(forceAspectRatio) { | |
| var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b; | |
| b = { | |
| minWidth: isNumber(o.minWidth) ? o.minWidth : 0, | |
| maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, | |
| minHeight: isNumber(o.minHeight) ? o.minHeight : 0, | |
| maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity | |
| }; | |
| if(this._aspectRatio || forceAspectRatio) { | |
| // We want to create an enclosing box whose aspect ration is the requested one | |
| // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension | |
| pMinWidth = b.minHeight * this.aspectRatio; | |
| pMinHeight = b.minWidth / this.aspectRatio; | |
| pMaxWidth = b.maxHeight * this.aspectRatio; | |
| pMaxHeight = b.maxWidth / this.aspectRatio; | |
| if(pMinWidth > b.minWidth) b.minWidth = pMinWidth; | |
| if(pMinHeight > b.minHeight) b.minHeight = pMinHeight; | |
| if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth; | |
| if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight; | |
| } | |
| this._vBoundaries = b; | |
| }, | |
| _updateCache: function(data) { | |
| var o = this.options; | |
| this.offset = this.helper.offset(); | |
| if (isNumber(data.left)) this.position.left = data.left; | |
| if (isNumber(data.top)) this.position.top = data.top; | |
| if (isNumber(data.height)) this.size.height = data.height; | |
| if (isNumber(data.width)) this.size.width = data.width; | |
| }, | |
| _updateRatio: function(data, event) { | |
| var o = this.options, cpos = this.position, csize = this.size, a = this.axis; | |
| if (isNumber(data.height)) data.width = (data.height * this.aspectRatio); | |
| else if (isNumber(data.width)) data.height = (data.width / this.aspectRatio); | |
| if (a == 'sw') { | |
| data.left = cpos.left + (csize.width - data.width); | |
| data.top = null; | |
| } | |
| if (a == 'nw') { | |
| data.top = cpos.top + (csize.height - data.height); | |
| data.left = cpos.left + (csize.width - data.width); | |
| } | |
| return data; | |
| }, | |
| _respectSize: function(data, event) { | |
| var el = this.helper, o = this._vBoundaries, pRatio = this._aspectRatio || event.shiftKey, a = this.axis, | |
| ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), | |
| isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height); | |
| if (isminw) data.width = o.minWidth; | |
| if (isminh) data.height = o.minHeight; | |
| if (ismaxw) data.width = o.maxWidth; | |
| if (ismaxh) data.height = o.maxHeight; | |
| var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height; | |
| var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); | |
| if (isminw && cw) data.left = dw - o.minWidth; | |
| if (ismaxw && cw) data.left = dw - o.maxWidth; | |
| if (isminh && ch) data.top = dh - o.minHeight; | |
| if (ismaxh && ch) data.top = dh - o.maxHeight; | |
| // fixing jump error on top/left - bug #2330 | |
| var isNotwh = !data.width && !data.height; | |
| if (isNotwh && !data.left && data.top) data.top = null; | |
| else if (isNotwh && !data.top && data.left) data.left = null; | |
| return data; | |
| }, | |
| _proportionallyResize: function() { | |
| var o = this.options; | |
| if (!this._proportionallyResizeElements.length) return; | |
| var element = this.helper || this.element; | |
| for (var i=0; i < this._proportionallyResizeElements.length; i++) { | |
| var prel = this._proportionallyResizeElements[i]; | |
| if (!this.borderDif) { | |
| var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')], | |
| p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')]; | |
| this.borderDif = $.map(b, function(v, i) { | |
| var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0; | |
| return border + padding; | |
| }); | |
| } | |
| if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length))) | |
| continue; | |
| prel.css({ | |
| height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, | |
| width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 | |
| }); | |
| }; | |
| }, | |
| _renderProxy: function() { | |
| var el = this.element, o = this.options; | |
| this.elementOffset = el.offset(); | |
| if(this._helper) { | |
| this.helper = this.helper || $('<div style="overflow:hidden;"></div>'); | |
| // fix ie6 offset TODO: This seems broken | |
| var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0), | |
| pxyoffset = ( ie6 ? 2 : -1 ); | |
| this.helper.addClass(this._helper).css({ | |
| width: this.element.outerWidth() + pxyoffset, | |
| height: this.element.outerHeight() + pxyoffset, | |
| position: 'absolute', | |
| left: this.elementOffset.left - ie6offset +'px', | |
| top: this.elementOffset.top - ie6offset +'px', | |
| zIndex: ++o.zIndex //TODO: Don't modify option | |
| }); | |
| this.helper | |
| .appendTo("body") | |
| .disableSelection(); | |
| } else { | |
| this.helper = this.element; | |
| } | |
| }, | |
| _change: { | |
| e: function(event, dx, dy) { | |
| return { width: this.originalSize.width + dx }; | |
| }, | |
| w: function(event, dx, dy) { | |
| var o = this.options, cs = this.originalSize, sp = this.originalPosition; | |
| return { left: sp.left + dx, width: cs.width - dx }; | |
| }, | |
| n: function(event, dx, dy) { | |
| var o = this.options, cs = this.originalSize, sp = this.originalPosition; | |
| return { top: sp.top + dy, height: cs.height - dy }; | |
| }, | |
| s: function(event, dx, dy) { | |
| return { height: this.originalSize.height + dy }; | |
| }, | |
| se: function(event, dx, dy) { | |
| return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); | |
| }, | |
| sw: function(event, dx, dy) { | |
| return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); | |
| }, | |
| ne: function(event, dx, dy) { | |
| return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); | |
| }, | |
| nw: function(event, dx, dy) { | |
| return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); | |
| } | |
| }, | |
| _propagate: function(n, event) { | |
| $.ui.plugin.call(this, n, [event, this.ui()]); | |
| (n != "resize" && this._trigger(n, event, this.ui())); | |
| }, | |
| plugins: {}, | |
| ui: function() { | |
| return { | |
| originalElement: this.originalElement, | |
| element: this.element, | |
| helper: this.helper, | |
| position: this.position, | |
| size: this.size, | |
| originalSize: this.originalSize, | |
| originalPosition: this.originalPosition | |
| }; | |
| } | |
| }); | |
| $.extend($.ui.resizable, { | |
| version: "1.8.22" | |
| }); | |
| /* | |
| * Resizable Extensions | |
| */ | |
| $.ui.plugin.add("resizable", "alsoResize", { | |
| start: function (event, ui) { | |
| var self = $(this).data("resizable"), o = self.options; | |
| var _store = function (exp) { | |
| $(exp).each(function() { | |
| var el = $(this); | |
| el.data("resizable-alsoresize", { | |
| width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), | |
| left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10) | |
| }); | |
| }); | |
| }; | |
| if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) { | |
| if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } | |
| else { $.each(o.alsoResize, function (exp) { _store(exp); }); } | |
| }else{ | |
| _store(o.alsoResize); | |
| } | |
| }, | |
| resize: function (event, ui) { | |
| var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition; | |
| var delta = { | |
| height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0, | |
| top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0 | |
| }, | |
| _alsoResize = function (exp, c) { | |
| $(exp).each(function() { | |
| var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, | |
| css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left']; | |
| $.each(css, function (i, prop) { | |
| var sum = (start[prop]||0) + (delta[prop]||0); | |
| if (sum && sum >= 0) | |
| style[prop] = sum || null; | |
| }); | |
| el.css(style); | |
| }); | |
| }; | |
| if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) { | |
| $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); | |
| }else{ | |
| _alsoResize(o.alsoResize); | |
| } | |
| }, | |
| stop: function (event, ui) { | |
| $(this).removeData("resizable-alsoresize"); | |
| } | |
| }); | |
| $.ui.plugin.add("resizable", "animate", { | |
| stop: function(event, ui) { | |
| var self = $(this).data("resizable"), o = self.options; | |
| var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName), | |
| soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height, | |
| soffsetw = ista ? 0 : self.sizeDiff.width; | |
| var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) }, | |
| left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null, | |
| top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null; | |
| self.element.animate( | |
| $.extend(style, top && left ? { top: top, left: left } : {}), { | |
| duration: o.animateDuration, | |
| easing: o.animateEasing, | |
| step: function() { | |
| var data = { | |
| width: parseInt(self.element.css('width'), 10), | |
| height: parseInt(self.element.css('height'), 10), | |
| top: parseInt(self.element.css('top'), 10), | |
| left: parseInt(self.element.css('left'), 10) | |
| }; | |
| if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height }); | |
| // propagating resize, and updating values for each animation step | |
| self._updateCache(data); | |
| self._propagate("resize", event); | |
| } | |
| } | |
| ); | |
| } | |
| }); | |
| $.ui.plugin.add("resizable", "containment", { | |
| start: function(event, ui) { | |
| var self = $(this).data("resizable"), o = self.options, el = self.element; | |
| var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; | |
| if (!ce) return; | |
| self.containerElement = $(ce); | |
| if (/document/.test(oc) || oc == document) { | |
| self.containerOffset = { left: 0, top: 0 }; | |
| self.containerPosition = { left: 0, top: 0 }; | |
| self.parentData = { | |
| element: $(document), left: 0, top: 0, | |
| width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight | |
| }; | |
| } | |
| // i'm a node, so compute top, left, right, bottom | |
| else { | |
| var element = $(ce), p = []; | |
| $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); | |
| self.containerOffset = element.offset(); | |
| self.containerPosition = element.position(); | |
| self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; | |
| var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width, | |
| width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); | |
| self.parentData = { | |
| element: ce, left: co.left, top: co.top, width: width, height: height | |
| }; | |
| } | |
| }, | |
| resize: function(event, ui) { | |
| var self = $(this).data("resizable"), o = self.options, | |
| ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position, | |
| pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement; | |
| if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co; | |
| if (cp.left < (self._helper ? co.left : 0)) { | |
| self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left)); | |
| if (pRatio) self.size.height = self.size.width / self.aspectRatio; | |
| self.position.left = o.helper ? co.left : 0; | |
| } | |
| if (cp.top < (self._helper ? co.top : 0)) { | |
| self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top); | |
| if (pRatio) self.size.width = self.size.height * self.aspectRatio; | |
| self.position.top = self._helper ? co.top : 0; | |
| } | |
| self.offset.left = self.parentData.left+self.position.left; | |
| self.offset.top = self.parentData.top+self.position.top; | |
| var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ), | |
| hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height ); | |
| var isParent = self.containerElement.get(0) == self.element.parent().get(0), | |
| isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position')); | |
| if(isParent && isOffsetRelative) woset -= self.parentData.left; | |
| if (woset + self.size.width >= self.parentData.width) { | |
| self.size.width = self.parentData.width - woset; | |
| if (pRatio) self.size.height = self.size.width / self.aspectRatio; | |
| } | |
| if (hoset + self.size.height >= self.parentData.height) { | |
| self.size.height = self.parentData.height - hoset; | |
| if (pRatio) self.size.width = self.size.height * self.aspectRatio; | |
| } | |
| }, | |
| stop: function(event, ui){ | |
| var self = $(this).data("resizable"), o = self.options, cp = self.position, | |
| co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement; | |
| var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height; | |
| if (self._helper && !o.animate && (/relative/).test(ce.css('position'))) | |
| $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); | |
| if (self._helper && !o.animate && (/static/).test(ce.css('position'))) | |
| $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); | |
| } | |
| }); | |
| $.ui.plugin.add("resizable", "ghost", { | |
| start: function(event, ui) { | |
| var self = $(this).data("resizable"), o = self.options, cs = self.size; | |
| self.ghost = self.originalElement.clone(); | |
| self.ghost | |
| .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) | |
| .addClass('ui-resizable-ghost') | |
| .addClass(typeof o.ghost == 'string' ? o.ghost : ''); | |
| self.ghost.appendTo(self.helper); | |
| }, | |
| resize: function(event, ui){ | |
| var self = $(this).data("resizable"), o = self.options; | |
| if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width }); | |
| }, | |
| stop: function(event, ui){ | |
| var self = $(this).data("resizable"), o = self.options; | |
| if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0)); | |
| } | |
| }); | |
| $.ui.plugin.add("resizable", "grid", { | |
| resize: function(event, ui) { | |
| var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey; | |
| o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid; | |
| var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1); | |
| if (/^(se|s|e)$/.test(a)) { | |
| self.size.width = os.width + ox; | |
| self.size.height = os.height + oy; | |
| } | |
| else if (/^(ne)$/.test(a)) { | |
| self.size.width = os.width + ox; | |
| self.size.height = os.height + oy; | |
| self.position.top = op.top - oy; | |
| } | |
| else if (/^(sw)$/.test(a)) { | |
| self.size.width = os.width + ox; | |
| self.size.height = os.height + oy; | |
| self.position.left = op.left - ox; | |
| } | |
| else { | |
| self.size.width = os.width + ox; | |
| self.size.height = os.height + oy; | |
| self.position.top = op.top - oy; | |
| self.position.left = op.left - ox; | |
| } | |
| } | |
| }); | |
| var num = function(v) { | |
| return parseInt(v, 10) || 0; | |
| }; | |
| var isNumber = function(value) { | |
| return !isNaN(parseInt(value, 10)); | |
| }; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Selectable 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Selectables | |
| * | |
| * Depends: | |
| * jquery.ui.core.js | |
| * jquery.ui.mouse.js | |
| * jquery.ui.widget.js | |
| */ | |
| (function( $, undefined ) { | |
| $.widget("ui.selectable", $.ui.mouse, { | |
| options: { | |
| appendTo: 'body', | |
| autoRefresh: true, | |
| distance: 0, | |
| filter: '*', | |
| tolerance: 'touch' | |
| }, | |
| _create: function() { | |
| var self = this; | |
| this.element.addClass("ui-selectable"); | |
| this.dragged = false; | |
| // cache selectee children based on filter | |
| var selectees; | |
| this.refresh = function() { | |
| selectees = $(self.options.filter, self.element[0]); | |
| selectees.addClass("ui-selectee"); | |
| selectees.each(function() { | |
| var $this = $(this); | |
| var pos = $this.offset(); | |
| $.data(this, "selectable-item", { | |
| element: this, | |
| $element: $this, | |
| left: pos.left, | |
| top: pos.top, | |
| right: pos.left + $this.outerWidth(), | |
| bottom: pos.top + $this.outerHeight(), | |
| startselected: false, | |
| selected: $this.hasClass('ui-selected'), | |
| selecting: $this.hasClass('ui-selecting'), | |
| unselecting: $this.hasClass('ui-unselecting') | |
| }); | |
| }); | |
| }; | |
| this.refresh(); | |
| this.selectees = selectees.addClass("ui-selectee"); | |
| this._mouseInit(); | |
| this.helper = $("<div class='ui-selectable-helper'></div>"); | |
| }, | |
| destroy: function() { | |
| this.selectees | |
| .removeClass("ui-selectee") | |
| .removeData("selectable-item"); | |
| this.element | |
| .removeClass("ui-selectable ui-selectable-disabled") | |
| .removeData("selectable") | |
| .unbind(".selectable"); | |
| this._mouseDestroy(); | |
| return this; | |
| }, | |
| _mouseStart: function(event) { | |
| var self = this; | |
| this.opos = [event.pageX, event.pageY]; | |
| if (this.options.disabled) | |
| return; | |
| var options = this.options; | |
| this.selectees = $(options.filter, this.element[0]); | |
| this._trigger("start", event); | |
| $(options.appendTo).append(this.helper); | |
| // position helper (lasso) | |
| this.helper.css({ | |
| "left": event.clientX, | |
| "top": event.clientY, | |
| "width": 0, | |
| "height": 0 | |
| }); | |
| if (options.autoRefresh) { | |
| this.refresh(); | |
| } | |
| this.selectees.filter('.ui-selected').each(function() { | |
| var selectee = $.data(this, "selectable-item"); | |
| selectee.startselected = true; | |
| if (!event.metaKey && !event.ctrlKey) { | |
| selectee.$element.removeClass('ui-selected'); | |
| selectee.selected = false; | |
| selectee.$element.addClass('ui-unselecting'); | |
| selectee.unselecting = true; | |
| // selectable UNSELECTING callback | |
| self._trigger("unselecting", event, { | |
| unselecting: selectee.element | |
| }); | |
| } | |
| }); | |
| $(event.target).parents().andSelf().each(function() { | |
| var selectee = $.data(this, "selectable-item"); | |
| if (selectee) { | |
| var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected'); | |
| selectee.$element | |
| .removeClass(doSelect ? "ui-unselecting" : "ui-selected") | |
| .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); | |
| selectee.unselecting = !doSelect; | |
| selectee.selecting = doSelect; | |
| selectee.selected = doSelect; | |
| // selectable (UN)SELECTING callback | |
| if (doSelect) { | |
| self._trigger("selecting", event, { | |
| selecting: selectee.element | |
| }); | |
| } else { | |
| self._trigger("unselecting", event, { | |
| unselecting: selectee.element | |
| }); | |
| } | |
| return false; | |
| } | |
| }); | |
| }, | |
| _mouseDrag: function(event) { | |
| var self = this; | |
| this.dragged = true; | |
| if (this.options.disabled) | |
| return; | |
| var options = this.options; | |
| var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY; | |
| if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; } | |
| if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; } | |
| this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); | |
| this.selectees.each(function() { | |
| var selectee = $.data(this, "selectable-item"); | |
| //prevent helper from being selected if appendTo: selectable | |
| if (!selectee || selectee.element == self.element[0]) | |
| return; | |
| var hit = false; | |
| if (options.tolerance == 'touch') { | |
| hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); | |
| } else if (options.tolerance == 'fit') { | |
| hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); | |
| } | |
| if (hit) { | |
| // SELECT | |
| if (selectee.selected) { | |
| selectee.$element.removeClass('ui-selected'); | |
| selectee.selected = false; | |
| } | |
| if (selectee.unselecting) { | |
| selectee.$element.removeClass('ui-unselecting'); | |
| selectee.unselecting = false; | |
| } | |
| if (!selectee.selecting) { | |
| selectee.$element.addClass('ui-selecting'); | |
| selectee.selecting = true; | |
| // selectable SELECTING callback | |
| self._trigger("selecting", event, { | |
| selecting: selectee.element | |
| }); | |
| } | |
| } else { | |
| // UNSELECT | |
| if (selectee.selecting) { | |
| if ((event.metaKey || event.ctrlKey) && selectee.startselected) { | |
| selectee.$element.removeClass('ui-selecting'); | |
| selectee.selecting = false; | |
| selectee.$element.addClass('ui-selected'); | |
| selectee.selected = true; | |
| } else { | |
| selectee.$element.removeClass('ui-selecting'); | |
| selectee.selecting = false; | |
| if (selectee.startselected) { | |
| selectee.$element.addClass('ui-unselecting'); | |
| selectee.unselecting = true; | |
| } | |
| // selectable UNSELECTING callback | |
| self._trigger("unselecting", event, { | |
| unselecting: selectee.element | |
| }); | |
| } | |
| } | |
| if (selectee.selected) { | |
| if (!event.metaKey && !event.ctrlKey && !selectee.startselected) { | |
| selectee.$element.removeClass('ui-selected'); | |
| selectee.selected = false; | |
| selectee.$element.addClass('ui-unselecting'); | |
| selectee.unselecting = true; | |
| // selectable UNSELECTING callback | |
| self._trigger("unselecting", event, { | |
| unselecting: selectee.element | |
| }); | |
| } | |
| } | |
| } | |
| }); | |
| return false; | |
| }, | |
| _mouseStop: function(event) { | |
| var self = this; | |
| this.dragged = false; | |
| var options = this.options; | |
| $('.ui-unselecting', this.element[0]).each(function() { | |
| var selectee = $.data(this, "selectable-item"); | |
| selectee.$element.removeClass('ui-unselecting'); | |
| selectee.unselecting = false; | |
| selectee.startselected = false; | |
| self._trigger("unselected", event, { | |
| unselected: selectee.element | |
| }); | |
| }); | |
| $('.ui-selecting', this.element[0]).each(function() { | |
| var selectee = $.data(this, "selectable-item"); | |
| selectee.$element.removeClass('ui-selecting').addClass('ui-selected'); | |
| selectee.selecting = false; | |
| selectee.selected = true; | |
| selectee.startselected = true; | |
| self._trigger("selected", event, { | |
| selected: selectee.element | |
| }); | |
| }); | |
| this._trigger("stop", event); | |
| this.helper.remove(); | |
| return false; | |
| } | |
| }); | |
| $.extend($.ui.selectable, { | |
| version: "1.8.22" | |
| }); | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Sortable 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Sortables | |
| * | |
| * Depends: | |
| * jquery.ui.core.js | |
| * jquery.ui.mouse.js | |
| * jquery.ui.widget.js | |
| */ | |
| (function( $, undefined ) { | |
| $.widget("ui.sortable", $.ui.mouse, { | |
| widgetEventPrefix: "sort", | |
| ready: false, | |
| options: { | |
| appendTo: "parent", | |
| axis: false, | |
| connectWith: false, | |
| containment: false, | |
| cursor: 'auto', | |
| cursorAt: false, | |
| dropOnEmpty: true, | |
| forcePlaceholderSize: false, | |
| forceHelperSize: false, | |
| grid: false, | |
| handle: false, | |
| helper: "original", | |
| items: '> *', | |
| opacity: false, | |
| placeholder: false, | |
| revert: false, | |
| scroll: true, | |
| scrollSensitivity: 20, | |
| scrollSpeed: 20, | |
| scope: "default", | |
| tolerance: "intersect", | |
| zIndex: 1000 | |
| }, | |
| _create: function() { | |
| var o = this.options; | |
| this.containerCache = {}; | |
| this.element.addClass("ui-sortable"); | |
| //Get the items | |
| this.refresh(); | |
| //Let's determine if the items are being displayed horizontally | |
| this.floating = this.items.length ? o.axis === 'x' || (/left|right/).test(this.items[0].item.css('float')) || (/inline|table-cell/).test(this.items[0].item.css('display')) : false; | |
| //Let's determine the parent's offset | |
| this.offset = this.element.offset(); | |
| //Initialize mouse events for interaction | |
| this._mouseInit(); | |
| //We're ready to go | |
| this.ready = true | |
| }, | |
| destroy: function() { | |
| $.Widget.prototype.destroy.call( this ); | |
| this.element | |
| .removeClass("ui-sortable ui-sortable-disabled"); | |
| this._mouseDestroy(); | |
| for ( var i = this.items.length - 1; i >= 0; i-- ) | |
| this.items[i].item.removeData(this.widgetName + "-item"); | |
| return this; | |
| }, | |
| _setOption: function(key, value){ | |
| if ( key === "disabled" ) { | |
| this.options[ key ] = value; | |
| this.widget() | |
| [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" ); | |
| } else { | |
| // Don't call widget base _setOption for disable as it adds ui-state-disabled class | |
| $.Widget.prototype._setOption.apply(this, arguments); | |
| } | |
| }, | |
| _mouseCapture: function(event, overrideHandle) { | |
| var that = this; | |
| if (this.reverting) { | |
| return false; | |
| } | |
| if(this.options.disabled || this.options.type == 'static') return false; | |
| //We have to refresh the items data once first | |
| this._refreshItems(event); | |
| //Find out if the clicked node (or one of its parents) is a actual item in this.items | |
| var currentItem = null, self = this, nodes = $(event.target).parents().each(function() { | |
| if($.data(this, that.widgetName + '-item') == self) { | |
| currentItem = $(this); | |
| return false; | |
| } | |
| }); | |
| if($.data(event.target, that.widgetName + '-item') == self) currentItem = $(event.target); | |
| if(!currentItem) return false; | |
| if(this.options.handle && !overrideHandle) { | |
| var validHandle = false; | |
| $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; }); | |
| if(!validHandle) return false; | |
| } | |
| this.currentItem = currentItem; | |
| this._removeCurrentsFromItems(); | |
| return true; | |
| }, | |
| _mouseStart: function(event, overrideHandle, noActivation) { | |
| var o = this.options, self = this; | |
| this.currentContainer = this; | |
| //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture | |
| this.refreshPositions(); | |
| //Create and append the visible helper | |
| this.helper = this._createHelper(event); | |
| //Cache the helper size | |
| this._cacheHelperProportions(); | |
| /* | |
| * - Position generation - | |
| * This block generates everything position related - it's the core of draggables. | |
| */ | |
| //Cache the margins of the original element | |
| this._cacheMargins(); | |
| //Get the next scrolling parent | |
| this.scrollParent = this.helper.scrollParent(); | |
| //The element's absolute position on the page minus margins | |
| this.offset = this.currentItem.offset(); | |
| this.offset = { | |
| top: this.offset.top - this.margins.top, | |
| left: this.offset.left - this.margins.left | |
| }; | |
| $.extend(this.offset, { | |
| click: { //Where the click happened, relative to the element | |
| left: event.pageX - this.offset.left, | |
| top: event.pageY - this.offset.top | |
| }, | |
| parent: this._getParentOffset(), | |
| relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper | |
| }); | |
| // Only after we got the offset, we can change the helper's position to absolute | |
| // TODO: Still need to figure out a way to make relative sorting possible | |
| this.helper.css("position", "absolute"); | |
| this.cssPosition = this.helper.css("position"); | |
| //Generate the original position | |
| this.originalPosition = this._generatePosition(event); | |
| this.originalPageX = event.pageX; | |
| this.originalPageY = event.pageY; | |
| //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied | |
| (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); | |
| //Cache the former DOM position | |
| this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; | |
| //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way | |
| if(this.helper[0] != this.currentItem[0]) { | |
| this.currentItem.hide(); | |
| } | |
| //Create the placeholder | |
| this._createPlaceholder(); | |
| //Set a containment if given in the options | |
| if(o.containment) | |
| this._setContainment(); | |
| if(o.cursor) { // cursor option | |
| if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor"); | |
| $('body').css("cursor", o.cursor); | |
| } | |
| if(o.opacity) { // opacity option | |
| if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity"); | |
| this.helper.css("opacity", o.opacity); | |
| } | |
| if(o.zIndex) { // zIndex option | |
| if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex"); | |
| this.helper.css("zIndex", o.zIndex); | |
| } | |
| //Prepare scrolling | |
| if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') | |
| this.overflowOffset = this.scrollParent.offset(); | |
| //Call callbacks | |
| this._trigger("start", event, this._uiHash()); | |
| //Recache the helper size | |
| if(!this._preserveHelperProportions) | |
| this._cacheHelperProportions(); | |
| //Post 'activate' events to possible containers | |
| if(!noActivation) { | |
| for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); } | |
| } | |
| //Prepare possible droppables | |
| if($.ui.ddmanager) | |
| $.ui.ddmanager.current = this; | |
| if ($.ui.ddmanager && !o.dropBehaviour) | |
| $.ui.ddmanager.prepareOffsets(this, event); | |
| this.dragging = true; | |
| this.helper.addClass("ui-sortable-helper"); | |
| this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position | |
| return true; | |
| }, | |
| _mouseDrag: function(event) { | |
| //Compute the helpers position | |
| this.position = this._generatePosition(event); | |
| this.positionAbs = this._convertPositionTo("absolute"); | |
| if (!this.lastPositionAbs) { | |
| this.lastPositionAbs = this.positionAbs; | |
| } | |
| //Do scrolling | |
| if(this.options.scroll) { | |
| var o = this.options, scrolled = false; | |
| if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') { | |
| if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) | |
| this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; | |
| else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) | |
| this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; | |
| if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) | |
| this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; | |
| else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) | |
| this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; | |
| } else { | |
| if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) | |
| scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); | |
| else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) | |
| scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); | |
| if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) | |
| scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); | |
| else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) | |
| scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); | |
| } | |
| if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) | |
| $.ui.ddmanager.prepareOffsets(this, event); | |
| } | |
| //Regenerate the absolute position used for position checks | |
| this.positionAbs = this._convertPositionTo("absolute"); | |
| //Set the helper position | |
| if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; | |
| if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; | |
| //Rearrange | |
| for (var i = this.items.length - 1; i >= 0; i--) { | |
| //Cache variables and intersection, continue if no intersection | |
| var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item); | |
| if (!intersection) continue; | |
| if(itemElement != this.currentItem[0] //cannot intersect with itself | |
| && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before | |
| && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked | |
| && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true) | |
| //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container | |
| ) { | |
| this.direction = intersection == 1 ? "down" : "up"; | |
| if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) { | |
| this._rearrange(event, item); | |
| } else { | |
| break; | |
| } | |
| this._trigger("change", event, this._uiHash()); | |
| break; | |
| } | |
| } | |
| //Post events to containers | |
| this._contactContainers(event); | |
| //Interconnect with droppables | |
| if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); | |
| //Call callbacks | |
| this._trigger('sort', event, this._uiHash()); | |
| this.lastPositionAbs = this.positionAbs; | |
| return false; | |
| }, | |
| _mouseStop: function(event, noPropagation) { | |
| if(!event) return; | |
| //If we are using droppables, inform the manager about the drop | |
| if ($.ui.ddmanager && !this.options.dropBehaviour) | |
| $.ui.ddmanager.drop(this, event); | |
| if(this.options.revert) { | |
| var self = this; | |
| var cur = self.placeholder.offset(); | |
| self.reverting = true; | |
| $(this.helper).animate({ | |
| left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft), | |
| top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop) | |
| }, parseInt(this.options.revert, 10) || 500, function() { | |
| self._clear(event); | |
| }); | |
| } else { | |
| this._clear(event, noPropagation); | |
| } | |
| return false; | |
| }, | |
| cancel: function() { | |
| var self = this; | |
| if(this.dragging) { | |
| this._mouseUp({ target: null }); | |
| if(this.options.helper == "original") | |
| this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); | |
| else | |
| this.currentItem.show(); | |
| //Post deactivating events to containers | |
| for (var i = this.containers.length - 1; i >= 0; i--){ | |
| this.containers[i]._trigger("deactivate", null, self._uiHash(this)); | |
| if(this.containers[i].containerCache.over) { | |
| this.containers[i]._trigger("out", null, self._uiHash(this)); | |
| this.containers[i].containerCache.over = 0; | |
| } | |
| } | |
| } | |
| if (this.placeholder) { | |
| //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! | |
| if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]); | |
| if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove(); | |
| $.extend(this, { | |
| helper: null, | |
| dragging: false, | |
| reverting: false, | |
| _noFinalSort: null | |
| }); | |
| if(this.domPosition.prev) { | |
| $(this.domPosition.prev).after(this.currentItem); | |
| } else { | |
| $(this.domPosition.parent).prepend(this.currentItem); | |
| } | |
| } | |
| return this; | |
| }, | |
| serialize: function(o) { | |
| var items = this._getItemsAsjQuery(o && o.connected); | |
| var str = []; o = o || {}; | |
| $(items).each(function() { | |
| var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/)); | |
| if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2])); | |
| }); | |
| if(!str.length && o.key) { | |
| str.push(o.key + '='); | |
| } | |
| return str.join('&'); | |
| }, | |
| toArray: function(o) { | |
| var items = this._getItemsAsjQuery(o && o.connected); | |
| var ret = []; o = o || {}; | |
| items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); }); | |
| return ret; | |
| }, | |
| /* Be careful with the following core functions */ | |
| _intersectsWith: function(item) { | |
| var x1 = this.positionAbs.left, | |
| x2 = x1 + this.helperProportions.width, | |
| y1 = this.positionAbs.top, | |
| y2 = y1 + this.helperProportions.height; | |
| var l = item.left, | |
| r = l + item.width, | |
| t = item.top, | |
| b = t + item.height; | |
| var dyClick = this.offset.click.top, | |
| dxClick = this.offset.click.left; | |
| var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; | |
| if( this.options.tolerance == "pointer" | |
| || this.options.forcePointerForContainers | |
| || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height']) | |
| ) { | |
| return isOverElement; | |
| } else { | |
| return (l < x1 + (this.helperProportions.width / 2) // Right Half | |
| && x2 - (this.helperProportions.width / 2) < r // Left Half | |
| && t < y1 + (this.helperProportions.height / 2) // Bottom Half | |
| && y2 - (this.helperProportions.height / 2) < b ); // Top Half | |
| } | |
| }, | |
| _intersectsWithPointer: function(item) { | |
| var isOverElementHeight = (this.options.axis === 'x') || $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), | |
| isOverElementWidth = (this.options.axis === 'y') || $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), | |
| isOverElement = isOverElementHeight && isOverElementWidth, | |
| verticalDirection = this._getDragVerticalDirection(), | |
| horizontalDirection = this._getDragHorizontalDirection(); | |
| if (!isOverElement) | |
| return false; | |
| return this.floating ? | |
| ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 ) | |
| : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) ); | |
| }, | |
| _intersectsWithSides: function(item) { | |
| var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), | |
| isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), | |
| verticalDirection = this._getDragVerticalDirection(), | |
| horizontalDirection = this._getDragHorizontalDirection(); | |
| if (this.floating && horizontalDirection) { | |
| return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf)); | |
| } else { | |
| return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf)); | |
| } | |
| }, | |
| _getDragVerticalDirection: function() { | |
| var delta = this.positionAbs.top - this.lastPositionAbs.top; | |
| return delta != 0 && (delta > 0 ? "down" : "up"); | |
| }, | |
| _getDragHorizontalDirection: function() { | |
| var delta = this.positionAbs.left - this.lastPositionAbs.left; | |
| return delta != 0 && (delta > 0 ? "right" : "left"); | |
| }, | |
| refresh: function(event) { | |
| this._refreshItems(event); | |
| this.refreshPositions(); | |
| return this; | |
| }, | |
| _connectWith: function() { | |
| var options = this.options; | |
| return options.connectWith.constructor == String | |
| ? [options.connectWith] | |
| : options.connectWith; | |
| }, | |
| _getItemsAsjQuery: function(connected) { | |
| var self = this; | |
| var items = []; | |
| var queries = []; | |
| var connectWith = this._connectWith(); | |
| if(connectWith && connected) { | |
| for (var i = connectWith.length - 1; i >= 0; i--){ | |
| var cur = $(connectWith[i]); | |
| for (var j = cur.length - 1; j >= 0; j--){ | |
| var inst = $.data(cur[j], this.widgetName); | |
| if(inst && inst != this && !inst.options.disabled) { | |
| queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]); | |
| } | |
| }; | |
| }; | |
| } | |
| queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]); | |
| for (var i = queries.length - 1; i >= 0; i--){ | |
| queries[i][0].each(function() { | |
| items.push(this); | |
| }); | |
| }; | |
| return $(items); | |
| }, | |
| _removeCurrentsFromItems: function() { | |
| var list = this.currentItem.find(":data(" + this.widgetName + "-item)"); | |
| for (var i=0; i < this.items.length; i++) { | |
| for (var j=0; j < list.length; j++) { | |
| if(list[j] == this.items[i].item[0]) | |
| this.items.splice(i,1); | |
| }; | |
| }; | |
| }, | |
| _refreshItems: function(event) { | |
| this.items = []; | |
| this.containers = [this]; | |
| var items = this.items; | |
| var self = this; | |
| var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]]; | |
| var connectWith = this._connectWith(); | |
| if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down | |
| for (var i = connectWith.length - 1; i >= 0; i--){ | |
| var cur = $(connectWith[i]); | |
| for (var j = cur.length - 1; j >= 0; j--){ | |
| var inst = $.data(cur[j], this.widgetName); | |
| if(inst && inst != this && !inst.options.disabled) { | |
| queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); | |
| this.containers.push(inst); | |
| } | |
| }; | |
| }; | |
| } | |
| for (var i = queries.length - 1; i >= 0; i--) { | |
| var targetData = queries[i][1]; | |
| var _queries = queries[i][0]; | |
| for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) { | |
| var item = $(_queries[j]); | |
| item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager) | |
| items.push({ | |
| item: item, | |
| instance: targetData, | |
| width: 0, height: 0, | |
| left: 0, top: 0 | |
| }); | |
| }; | |
| }; | |
| }, | |
| refreshPositions: function(fast) { | |
| //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change | |
| if(this.offsetParent && this.helper) { | |
| this.offset.parent = this._getParentOffset(); | |
| } | |
| for (var i = this.items.length - 1; i >= 0; i--){ | |
| var item = this.items[i]; | |
| //We ignore calculating positions of all connected containers when we're not over them | |
| if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0]) | |
| continue; | |
| var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; | |
| if (!fast) { | |
| item.width = t.outerWidth(); | |
| item.height = t.outerHeight(); | |
| } | |
| var p = t.offset(); | |
| item.left = p.left; | |
| item.top = p.top; | |
| }; | |
| if(this.options.custom && this.options.custom.refreshContainers) { | |
| this.options.custom.refreshContainers.call(this); | |
| } else { | |
| for (var i = this.containers.length - 1; i >= 0; i--){ | |
| var p = this.containers[i].element.offset(); | |
| this.containers[i].containerCache.left = p.left; | |
| this.containers[i].containerCache.top = p.top; | |
| this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); | |
| this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); | |
| }; | |
| } | |
| return this; | |
| }, | |
| _createPlaceholder: function(that) { | |
| var self = that || this, o = self.options; | |
| if(!o.placeholder || o.placeholder.constructor == String) { | |
| var className = o.placeholder; | |
| o.placeholder = { | |
| element: function() { | |
| var el = $(document.createElement(self.currentItem[0].nodeName)) | |
| .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder") | |
| .removeClass("ui-sortable-helper")[0]; | |
| if(!className) | |
| el.style.visibility = "hidden"; | |
| return el; | |
| }, | |
| update: function(container, p) { | |
| // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that | |
| // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified | |
| if(className && !o.forcePlaceholderSize) return; | |
| //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item | |
| if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); }; | |
| if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); }; | |
| } | |
| }; | |
| } | |
| //Create the placeholder | |
| self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem)); | |
| //Append it after the actual current item | |
| self.currentItem.after(self.placeholder); | |
| //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) | |
| o.placeholder.update(self, self.placeholder); | |
| }, | |
| _contactContainers: function(event) { | |
| // get innermost container that intersects with item | |
| var innermostContainer = null, innermostIndex = null; | |
| for (var i = this.containers.length - 1; i >= 0; i--){ | |
| // never consider a container that's located within the item itself | |
| if($.ui.contains(this.currentItem[0], this.containers[i].element[0])) | |
| continue; | |
| if(this._intersectsWith(this.containers[i].containerCache)) { | |
| // if we've already found a container and it's more "inner" than this, then continue | |
| if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0])) | |
| continue; | |
| innermostContainer = this.containers[i]; | |
| innermostIndex = i; | |
| } else { | |
| // container doesn't intersect. trigger "out" event if necessary | |
| if(this.containers[i].containerCache.over) { | |
| this.containers[i]._trigger("out", event, this._uiHash(this)); | |
| this.containers[i].containerCache.over = 0; | |
| } | |
| } | |
| } | |
| // if no intersecting containers found, return | |
| if(!innermostContainer) return; | |
| // move the item into the container if it's not there already | |
| if(this.containers.length === 1) { | |
| this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); | |
| this.containers[innermostIndex].containerCache.over = 1; | |
| } else if(this.currentContainer != this.containers[innermostIndex]) { | |
| //When entering a new container, we will find the item with the least distance and append our item near it | |
| var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; | |
| for (var j = this.items.length - 1; j >= 0; j--) { | |
| if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; | |
| var cur = this.containers[innermostIndex].floating ? this.items[j].item.offset().left : this.items[j].item.offset().top; | |
| if(Math.abs(cur - base) < dist) { | |
| dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; | |
| this.direction = (cur - base > 0) ? 'down' : 'up'; | |
| } | |
| } | |
| if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled | |
| return; | |
| this.currentContainer = this.containers[innermostIndex]; | |
| itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); | |
| this._trigger("change", event, this._uiHash()); | |
| this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); | |
| //Update the placeholder | |
| this.options.placeholder.update(this.currentContainer, this.placeholder); | |
| this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); | |
| this.containers[innermostIndex].containerCache.over = 1; | |
| } | |
| }, | |
| _createHelper: function(event) { | |
| var o = this.options; | |
| var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem); | |
| if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already | |
| $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); | |
| if(helper[0] == this.currentItem[0]) | |
| this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; | |
| if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width()); | |
| if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height()); | |
| return helper; | |
| }, | |
| _adjustOffsetFromHelper: function(obj) { | |
| if (typeof obj == 'string') { | |
| obj = obj.split(' '); | |
| } | |
| if ($.isArray(obj)) { | |
| obj = {left: +obj[0], top: +obj[1] || 0}; | |
| } | |
| if ('left' in obj) { | |
| this.offset.click.left = obj.left + this.margins.left; | |
| } | |
| if ('right' in obj) { | |
| this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; | |
| } | |
| if ('top' in obj) { | |
| this.offset.click.top = obj.top + this.margins.top; | |
| } | |
| if ('bottom' in obj) { | |
| this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; | |
| } | |
| }, | |
| _getParentOffset: function() { | |
| //Get the offsetParent and cache its position | |
| this.offsetParent = this.helper.offsetParent(); | |
| var po = this.offsetParent.offset(); | |
| // This is a special case where we need to modify a offset calculated on start, since the following happened: | |
| // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent | |
| // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that | |
| // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag | |
| if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { | |
| po.left += this.scrollParent.scrollLeft(); | |
| po.top += this.scrollParent.scrollTop(); | |
| } | |
| if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information | |
| || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix | |
| po = { top: 0, left: 0 }; | |
| return { | |
| top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), | |
| left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) | |
| }; | |
| }, | |
| _getRelativeOffset: function() { | |
| if(this.cssPosition == "relative") { | |
| var p = this.currentItem.position(); | |
| return { | |
| top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), | |
| left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() | |
| }; | |
| } else { | |
| return { top: 0, left: 0 }; | |
| } | |
| }, | |
| _cacheMargins: function() { | |
| this.margins = { | |
| left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), | |
| top: (parseInt(this.currentItem.css("marginTop"),10) || 0) | |
| }; | |
| }, | |
| _cacheHelperProportions: function() { | |
| this.helperProportions = { | |
| width: this.helper.outerWidth(), | |
| height: this.helper.outerHeight() | |
| }; | |
| }, | |
| _setContainment: function() { | |
| var o = this.options; | |
| if(o.containment == 'parent') o.containment = this.helper[0].parentNode; | |
| if(o.containment == 'document' || o.containment == 'window') this.containment = [ | |
| 0 - this.offset.relative.left - this.offset.parent.left, | |
| 0 - this.offset.relative.top - this.offset.parent.top, | |
| $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, | |
| ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top | |
| ]; | |
| if(!(/^(document|window|parent)$/).test(o.containment)) { | |
| var ce = $(o.containment)[0]; | |
| var co = $(o.containment).offset(); | |
| var over = ($(ce).css("overflow") != 'hidden'); | |
| this.containment = [ | |
| co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, | |
| co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, | |
| co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, | |
| co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top | |
| ]; | |
| } | |
| }, | |
| _convertPositionTo: function(d, pos) { | |
| if(!pos) pos = this.position; | |
| var mod = d == "absolute" ? 1 : -1; | |
| var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); | |
| return { | |
| top: ( | |
| pos.top // The absolute mouse position | |
| + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent | |
| + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) | |
| - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) | |
| ), | |
| left: ( | |
| pos.left // The absolute mouse position | |
| + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent | |
| + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) | |
| - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) | |
| ) | |
| }; | |
| }, | |
| _generatePosition: function(event) { | |
| var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); | |
| // This is another very weird special case that only happens for relative elements: | |
| // 1. If the css position is relative | |
| // 2. and the scroll parent is the document or similar to the offset parent | |
| // we have to refresh the relative offset during the scroll so there are no jumps | |
| if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { | |
| this.offset.relative = this._getRelativeOffset(); | |
| } | |
| var pageX = event.pageX; | |
| var pageY = event.pageY; | |
| /* | |
| * - Position constraining - | |
| * Constrain the position to a mix of grid, containment. | |
| */ | |
| if(this.originalPosition) { //If we are not dragging yet, we won't check for options | |
| if(this.containment) { | |
| if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; | |
| if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; | |
| if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; | |
| if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; | |
| } | |
| if(o.grid) { | |
| var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; | |
| pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; | |
| var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; | |
| pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; | |
| } | |
| } | |
| return { | |
| top: ( | |
| pageY // The absolute mouse position | |
| - this.offset.click.top // Click offset (relative to the element) | |
| - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent | |
| - this.offset.parent.top // The offsetParent's offset without borders (offset + border) | |
| + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) | |
| ), | |
| left: ( | |
| pageX // The absolute mouse position | |
| - this.offset.click.left // Click offset (relative to the element) | |
| - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent | |
| - this.offset.parent.left // The offsetParent's offset without borders (offset + border) | |
| + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) | |
| ) | |
| }; | |
| }, | |
| _rearrange: function(event, i, a, hardRefresh) { | |
| a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling)); | |
| //Various things done here to improve the performance: | |
| // 1. we create a setTimeout, that calls refreshPositions | |
| // 2. on the instance, we have a counter variable, that get's higher after every append | |
| // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same | |
| // 4. this lets only the last addition to the timeout stack through | |
| this.counter = this.counter ? ++this.counter : 1; | |
| var self = this, counter = this.counter; | |
| window.setTimeout(function() { | |
| if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove | |
| },0); | |
| }, | |
| _clear: function(event, noPropagation) { | |
| this.reverting = false; | |
| // We delay all events that have to be triggered to after the point where the placeholder has been removed and | |
| // everything else normalized again | |
| var delayedTriggers = [], self = this; | |
| // We first have to update the dom position of the actual currentItem | |
| // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) | |
| if(!this._noFinalSort && this.currentItem.parent().length) this.placeholder.before(this.currentItem); | |
| this._noFinalSort = null; | |
| if(this.helper[0] == this.currentItem[0]) { | |
| for(var i in this._storedCSS) { | |
| if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = ''; | |
| } | |
| this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); | |
| } else { | |
| this.currentItem.show(); | |
| } | |
| if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); | |
| if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed | |
| if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element | |
| if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); | |
| for (var i = this.containers.length - 1; i >= 0; i--){ | |
| if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) { | |
| delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i])); | |
| delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i])); | |
| } | |
| }; | |
| }; | |
| //Post events to containers | |
| for (var i = this.containers.length - 1; i >= 0; i--){ | |
| if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); | |
| if(this.containers[i].containerCache.over) { | |
| delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); | |
| this.containers[i].containerCache.over = 0; | |
| } | |
| } | |
| //Do what was originally in plugins | |
| if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor | |
| if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity | |
| if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index | |
| this.dragging = false; | |
| if(this.cancelHelperRemoval) { | |
| if(!noPropagation) { | |
| this._trigger("beforeStop", event, this._uiHash()); | |
| for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events | |
| this._trigger("stop", event, this._uiHash()); | |
| } | |
| this.fromOutside = false; | |
| return false; | |
| } | |
| if(!noPropagation) this._trigger("beforeStop", event, this._uiHash()); | |
| //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! | |
| this.placeholder[0].parentNode.removeChild(this.placeholder[0]); | |
| if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null; | |
| if(!noPropagation) { | |
| for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events | |
| this._trigger("stop", event, this._uiHash()); | |
| } | |
| this.fromOutside = false; | |
| return true; | |
| }, | |
| _trigger: function() { | |
| if ($.Widget.prototype._trigger.apply(this, arguments) === false) { | |
| this.cancel(); | |
| } | |
| }, | |
| _uiHash: function(inst) { | |
| var self = inst || this; | |
| return { | |
| helper: self.helper, | |
| placeholder: self.placeholder || $([]), | |
| position: self.position, | |
| originalPosition: self.originalPosition, | |
| offset: self.positionAbs, | |
| item: self.currentItem, | |
| sender: inst ? inst.element : null | |
| }; | |
| } | |
| }); | |
| $.extend($.ui.sortable, { | |
| version: "1.8.22" | |
| }); | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Accordion 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Accordion | |
| * | |
| * Depends: | |
| * jquery.ui.core.js | |
| * jquery.ui.widget.js | |
| */ | |
| (function( $, undefined ) { | |
| $.widget( "ui.accordion", { | |
| options: { | |
| active: 0, | |
| animated: "slide", | |
| autoHeight: true, | |
| clearStyle: false, | |
| collapsible: false, | |
| event: "click", | |
| fillSpace: false, | |
| header: "> li > :first-child,> :not(li):even", | |
| icons: { | |
| header: "ui-icon-triangle-1-e", | |
| headerSelected: "ui-icon-triangle-1-s" | |
| }, | |
| navigation: false, | |
| navigationFilter: function() { | |
| return this.href.toLowerCase() === location.href.toLowerCase(); | |
| } | |
| }, | |
| _create: function() { | |
| var self = this, | |
| options = self.options; | |
| self.running = 0; | |
| self.element | |
| .addClass( "ui-accordion ui-widget ui-helper-reset" ) | |
| // in lack of child-selectors in CSS | |
| // we need to mark top-LIs in a UL-accordion for some IE-fix | |
| .children( "li" ) | |
| .addClass( "ui-accordion-li-fix" ); | |
| self.headers = self.element.find( options.header ) | |
| .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ) | |
| .bind( "mouseenter.accordion", function() { | |
| if ( options.disabled ) { | |
| return; | |
| } | |
| $( this ).addClass( "ui-state-hover" ); | |
| }) | |
| .bind( "mouseleave.accordion", function() { | |
| if ( options.disabled ) { | |
| return; | |
| } | |
| $( this ).removeClass( "ui-state-hover" ); | |
| }) | |
| .bind( "focus.accordion", function() { | |
| if ( options.disabled ) { | |
| return; | |
| } | |
| $( this ).addClass( "ui-state-focus" ); | |
| }) | |
| .bind( "blur.accordion", function() { | |
| if ( options.disabled ) { | |
| return; | |
| } | |
| $( this ).removeClass( "ui-state-focus" ); | |
| }); | |
| self.headers.next() | |
| .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ); | |
| if ( options.navigation ) { | |
| var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 ); | |
| if ( current.length ) { | |
| var header = current.closest( ".ui-accordion-header" ); | |
| if ( header.length ) { | |
| // anchor within header | |
| self.active = header; | |
| } else { | |
| // anchor within content | |
| self.active = current.closest( ".ui-accordion-content" ).prev(); | |
| } | |
| } | |
| } | |
| self.active = self._findActive( self.active || options.active ) | |
| .addClass( "ui-state-default ui-state-active" ) | |
| .toggleClass( "ui-corner-all" ) | |
| .toggleClass( "ui-corner-top" ); | |
| self.active.next().addClass( "ui-accordion-content-active" ); | |
| self._createIcons(); | |
| self.resize(); | |
| // ARIA | |
| self.element.attr( "role", "tablist" ); | |
| self.headers | |
| .attr( "role", "tab" ) | |
| .bind( "keydown.accordion", function( event ) { | |
| return self._keydown( event ); | |
| }) | |
| .next() | |
| .attr( "role", "tabpanel" ); | |
| self.headers | |
| .not( self.active || "" ) | |
| .attr({ | |
| "aria-expanded": "false", | |
| "aria-selected": "false", | |
| tabIndex: -1 | |
| }) | |
| .next() | |
| .hide(); | |
| // make sure at least one header is in the tab order | |
| if ( !self.active.length ) { | |
| self.headers.eq( 0 ).attr( "tabIndex", 0 ); | |
| } else { | |
| self.active | |
| .attr({ | |
| "aria-expanded": "true", | |
| "aria-selected": "true", | |
| tabIndex: 0 | |
| }); | |
| } | |
| // only need links in tab order for Safari | |
| if ( !$.browser.safari ) { | |
| self.headers.find( "a" ).attr( "tabIndex", -1 ); | |
| } | |
| if ( options.event ) { | |
| self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) { | |
| self._clickHandler.call( self, event, this ); | |
| event.preventDefault(); | |
| }); | |
| } | |
| }, | |
| _createIcons: function() { | |
| var options = this.options; | |
| if ( options.icons ) { | |
| $( "<span></span>" ) | |
| .addClass( "ui-icon " + options.icons.header ) | |
| .prependTo( this.headers ); | |
| this.active.children( ".ui-icon" ) | |
| .toggleClass(options.icons.header) | |
| .toggleClass(options.icons.headerSelected); | |
| this.element.addClass( "ui-accordion-icons" ); | |
| } | |
| }, | |
| _destroyIcons: function() { | |
| this.headers.children( ".ui-icon" ).remove(); | |
| this.element.removeClass( "ui-accordion-icons" ); | |
| }, | |
| destroy: function() { | |
| var options = this.options; | |
| this.element | |
| .removeClass( "ui-accordion ui-widget ui-helper-reset" ) | |
| .removeAttr( "role" ); | |
| this.headers | |
| .unbind( ".accordion" ) | |
| .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) | |
| .removeAttr( "role" ) | |
| .removeAttr( "aria-expanded" ) | |
| .removeAttr( "aria-selected" ) | |
| .removeAttr( "tabIndex" ); | |
| this.headers.find( "a" ).removeAttr( "tabIndex" ); | |
| this._destroyIcons(); | |
| var contents = this.headers.next() | |
| .css( "display", "" ) | |
| .removeAttr( "role" ) | |
| .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" ); | |
| if ( options.autoHeight || options.fillHeight ) { | |
| contents.css( "height", "" ); | |
| } | |
| return $.Widget.prototype.destroy.call( this ); | |
| }, | |
| _setOption: function( key, value ) { | |
| $.Widget.prototype._setOption.apply( this, arguments ); | |
| if ( key == "active" ) { | |
| this.activate( value ); | |
| } | |
| if ( key == "icons" ) { | |
| this._destroyIcons(); | |
| if ( value ) { | |
| this._createIcons(); | |
| } | |
| } | |
| // #5332 - opacity doesn't cascade to positioned elements in IE | |
| // so we need to add the disabled class to the headers and panels | |
| if ( key == "disabled" ) { | |
| this.headers.add(this.headers.next()) | |
| [ value ? "addClass" : "removeClass" ]( | |
| "ui-accordion-disabled ui-state-disabled" ); | |
| } | |
| }, | |
| _keydown: function( event ) { | |
| if ( this.options.disabled || event.altKey || event.ctrlKey ) { | |
| return; | |
| } | |
| var keyCode = $.ui.keyCode, | |
| length = this.headers.length, | |
| currentIndex = this.headers.index( event.target ), | |
| toFocus = false; | |
| switch ( event.keyCode ) { | |
| case keyCode.RIGHT: | |
| case keyCode.DOWN: | |
| toFocus = this.headers[ ( currentIndex + 1 ) % length ]; | |
| break; | |
| case keyCode.LEFT: | |
| case keyCode.UP: | |
| toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; | |
| break; | |
| case keyCode.SPACE: | |
| case keyCode.ENTER: | |
| this._clickHandler( { target: event.target }, event.target ); | |
| event.preventDefault(); | |
| } | |
| if ( toFocus ) { | |
| $( event.target ).attr( "tabIndex", -1 ); | |
| $( toFocus ).attr( "tabIndex", 0 ); | |
| toFocus.focus(); | |
| return false; | |
| } | |
| return true; | |
| }, | |
| resize: function() { | |
| var options = this.options, | |
| maxHeight; | |
| if ( options.fillSpace ) { | |
| if ( $.browser.msie ) { | |
| var defOverflow = this.element.parent().css( "overflow" ); | |
| this.element.parent().css( "overflow", "hidden"); | |
| } | |
| maxHeight = this.element.parent().height(); | |
| if ($.browser.msie) { | |
| this.element.parent().css( "overflow", defOverflow ); | |
| } | |
| this.headers.each(function() { | |
| maxHeight -= $( this ).outerHeight( true ); | |
| }); | |
| this.headers.next() | |
| .each(function() { | |
| $( this ).height( Math.max( 0, maxHeight - | |
| $( this ).innerHeight() + $( this ).height() ) ); | |
| }) | |
| .css( "overflow", "auto" ); | |
| } else if ( options.autoHeight ) { | |
| maxHeight = 0; | |
| this.headers.next() | |
| .each(function() { | |
| maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); | |
| }) | |
| .height( maxHeight ); | |
| } | |
| return this; | |
| }, | |
| activate: function( index ) { | |
| // TODO this gets called on init, changing the option without an explicit call for that | |
| this.options.active = index; | |
| // call clickHandler with custom event | |
| var active = this._findActive( index )[ 0 ]; | |
| this._clickHandler( { target: active }, active ); | |
| return this; | |
| }, | |
| _findActive: function( selector ) { | |
| return selector | |
| ? typeof selector === "number" | |
| ? this.headers.filter( ":eq(" + selector + ")" ) | |
| : this.headers.not( this.headers.not( selector ) ) | |
| : selector === false | |
| ? $( [] ) | |
| : this.headers.filter( ":eq(0)" ); | |
| }, | |
| // TODO isn't event.target enough? why the separate target argument? | |
| _clickHandler: function( event, target ) { | |
| var options = this.options; | |
| if ( options.disabled ) { | |
| return; | |
| } | |
| // called only when using activate(false) to close all parts programmatically | |
| if ( !event.target ) { | |
| if ( !options.collapsible ) { | |
| return; | |
| } | |
| this.active | |
| .removeClass( "ui-state-active ui-corner-top" ) | |
| .addClass( "ui-state-default ui-corner-all" ) | |
| .children( ".ui-icon" ) | |
| .removeClass( options.icons.headerSelected ) | |
| .addClass( options.icons.header ); | |
| this.active.next().addClass( "ui-accordion-content-active" ); | |
| var toHide = this.active.next(), | |
| data = { | |
| options: options, | |
| newHeader: $( [] ), | |
| oldHeader: options.active, | |
| newContent: $( [] ), | |
| oldContent: toHide | |
| }, | |
| toShow = ( this.active = $( [] ) ); | |
| this._toggle( toShow, toHide, data ); | |
| return; | |
| } | |
| // get the click target | |
| var clicked = $( event.currentTarget || target ), | |
| clickedIsActive = clicked[0] === this.active[0]; | |
| // TODO the option is changed, is that correct? | |
| // TODO if it is correct, shouldn't that happen after determining that the click is valid? | |
| options.active = options.collapsible && clickedIsActive ? | |
| false : | |
| this.headers.index( clicked ); | |
| // if animations are still active, or the active header is the target, ignore click | |
| if ( this.running || ( !options.collapsible && clickedIsActive ) ) { | |
| return; | |
| } | |
| // find elements to show and hide | |
| var active = this.active, | |
| toShow = clicked.next(), | |
| toHide = this.active.next(), | |
| data = { | |
| options: options, | |
| newHeader: clickedIsActive && options.collapsible ? $([]) : clicked, | |
| oldHeader: this.active, | |
| newContent: clickedIsActive && options.collapsible ? $([]) : toShow, | |
| oldContent: toHide | |
| }, | |
| down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] ); | |
| // when the call to ._toggle() comes after the class changes | |
| // it causes a very odd bug in IE 8 (see #6720) | |
| this.active = clickedIsActive ? $([]) : clicked; | |
| this._toggle( toShow, toHide, data, clickedIsActive, down ); | |
| // switch classes | |
| active | |
| .removeClass( "ui-state-active ui-corner-top" ) | |
| .addClass( "ui-state-default ui-corner-all" ) | |
| .children( ".ui-icon" ) | |
| .removeClass( options.icons.headerSelected ) | |
| .addClass( options.icons.header ); | |
| if ( !clickedIsActive ) { | |
| clicked | |
| .removeClass( "ui-state-default ui-corner-all" ) | |
| .addClass( "ui-state-active ui-corner-top" ) | |
| .children( ".ui-icon" ) | |
| .removeClass( options.icons.header ) | |
| .addClass( options.icons.headerSelected ); | |
| clicked | |
| .next() | |
| .addClass( "ui-accordion-content-active" ); | |
| } | |
| return; | |
| }, | |
| _toggle: function( toShow, toHide, data, clickedIsActive, down ) { | |
| var self = this, | |
| options = self.options; | |
| self.toShow = toShow; | |
| self.toHide = toHide; | |
| self.data = data; | |
| var complete = function() { | |
| if ( !self ) { | |
| return; | |
| } | |
| return self._completed.apply( self, arguments ); | |
| }; | |
| // trigger changestart event | |
| self._trigger( "changestart", null, self.data ); | |
| // count elements to animate | |
| self.running = toHide.size() === 0 ? toShow.size() : toHide.size(); | |
| if ( options.animated ) { | |
| var animOptions = {}; | |
| if ( options.collapsible && clickedIsActive ) { | |
| animOptions = { | |
| toShow: $( [] ), | |
| toHide: toHide, | |
| complete: complete, | |
| down: down, | |
| autoHeight: options.autoHeight || options.fillSpace | |
| }; | |
| } else { | |
| animOptions = { | |
| toShow: toShow, | |
| toHide: toHide, | |
| complete: complete, | |
| down: down, | |
| autoHeight: options.autoHeight || options.fillSpace | |
| }; | |
| } | |
| if ( !options.proxied ) { | |
| options.proxied = options.animated; | |
| } | |
| if ( !options.proxiedDuration ) { | |
| options.proxiedDuration = options.duration; | |
| } | |
| options.animated = $.isFunction( options.proxied ) ? | |
| options.proxied( animOptions ) : | |
| options.proxied; | |
| options.duration = $.isFunction( options.proxiedDuration ) ? | |
| options.proxiedDuration( animOptions ) : | |
| options.proxiedDuration; | |
| var animations = $.ui.accordion.animations, | |
| duration = options.duration, | |
| easing = options.animated; | |
| if ( easing && !animations[ easing ] && !$.easing[ easing ] ) { | |
| easing = "slide"; | |
| } | |
| if ( !animations[ easing ] ) { | |
| animations[ easing ] = function( options ) { | |
| this.slide( options, { | |
| easing: easing, | |
| duration: duration || 700 | |
| }); | |
| }; | |
| } | |
| animations[ easing ]( animOptions ); | |
| } else { | |
| if ( options.collapsible && clickedIsActive ) { | |
| toShow.toggle(); | |
| } else { | |
| toHide.hide(); | |
| toShow.show(); | |
| } | |
| complete( true ); | |
| } | |
| // TODO assert that the blur and focus triggers are really necessary, remove otherwise | |
| toHide.prev() | |
| .attr({ | |
| "aria-expanded": "false", | |
| "aria-selected": "false", | |
| tabIndex: -1 | |
| }) | |
| .blur(); | |
| toShow.prev() | |
| .attr({ | |
| "aria-expanded": "true", | |
| "aria-selected": "true", | |
| tabIndex: 0 | |
| }) | |
| .focus(); | |
| }, | |
| _completed: function( cancel ) { | |
| this.running = cancel ? 0 : --this.running; | |
| if ( this.running ) { | |
| return; | |
| } | |
| if ( this.options.clearStyle ) { | |
| this.toShow.add( this.toHide ).css({ | |
| height: "", | |
| overflow: "" | |
| }); | |
| } | |
| // other classes are removed before the animation; this one needs to stay until completed | |
| this.toHide.removeClass( "ui-accordion-content-active" ); | |
| // Work around for rendering bug in IE (#5421) | |
| if ( this.toHide.length ) { | |
| this.toHide.parent()[0].className = this.toHide.parent()[0].className; | |
| } | |
| this._trigger( "change", null, this.data ); | |
| } | |
| }); | |
| $.extend( $.ui.accordion, { | |
| version: "1.8.22", | |
| animations: { | |
| slide: function( options, additions ) { | |
| options = $.extend({ | |
| easing: "swing", | |
| duration: 300 | |
| }, options, additions ); | |
| if ( !options.toHide.size() ) { | |
| options.toShow.animate({ | |
| height: "show", | |
| paddingTop: "show", | |
| paddingBottom: "show" | |
| }, options ); | |
| return; | |
| } | |
| if ( !options.toShow.size() ) { | |
| options.toHide.animate({ | |
| height: "hide", | |
| paddingTop: "hide", | |
| paddingBottom: "hide" | |
| }, options ); | |
| return; | |
| } | |
| var overflow = options.toShow.css( "overflow" ), | |
| percentDone = 0, | |
| showProps = {}, | |
| hideProps = {}, | |
| fxAttrs = [ "height", "paddingTop", "paddingBottom" ], | |
| originalWidth; | |
| // fix width before calculating height of hidden element | |
| var s = options.toShow; | |
| originalWidth = s[0].style.width; | |
| s.width( s.parent().width() | |
| - parseFloat( s.css( "paddingLeft" ) ) | |
| - parseFloat( s.css( "paddingRight" ) ) | |
| - ( parseFloat( s.css( "borderLeftWidth" ) ) || 0 ) | |
| - ( parseFloat( s.css( "borderRightWidth" ) ) || 0 ) ); | |
| $.each( fxAttrs, function( i, prop ) { | |
| hideProps[ prop ] = "hide"; | |
| var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ ); | |
| showProps[ prop ] = { | |
| value: parts[ 1 ], | |
| unit: parts[ 2 ] || "px" | |
| }; | |
| }); | |
| options.toShow.css({ height: 0, overflow: "hidden" }).show(); | |
| options.toHide | |
| .filter( ":hidden" ) | |
| .each( options.complete ) | |
| .end() | |
| .filter( ":visible" ) | |
| .animate( hideProps, { | |
| step: function( now, settings ) { | |
| // only calculate the percent when animating height | |
| // IE gets very inconsistent results when animating elements | |
| // with small values, which is common for padding | |
| if ( settings.prop == "height" ) { | |
| percentDone = ( settings.end - settings.start === 0 ) ? 0 : | |
| ( settings.now - settings.start ) / ( settings.end - settings.start ); | |
| } | |
| options.toShow[ 0 ].style[ settings.prop ] = | |
| ( percentDone * showProps[ settings.prop ].value ) | |
| + showProps[ settings.prop ].unit; | |
| }, | |
| duration: options.duration, | |
| easing: options.easing, | |
| complete: function() { | |
| if ( !options.autoHeight ) { | |
| options.toShow.css( "height", "" ); | |
| } | |
| options.toShow.css({ | |
| width: originalWidth, | |
| overflow: overflow | |
| }); | |
| options.complete(); | |
| } | |
| }); | |
| }, | |
| bounceslide: function( options ) { | |
| this.slide( options, { | |
| easing: options.down ? "easeOutBounce" : "swing", | |
| duration: options.down ? 1000 : 200 | |
| }); | |
| } | |
| } | |
| }); | |
| })( jQuery ); | |
| /*! | |
| * jQuery UI Autocomplete 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Autocomplete | |
| * | |
| * Depends: | |
| * jquery.ui.core.js | |
| * jquery.ui.widget.js | |
| * jquery.ui.position.js | |
| */ | |
| (function( $, undefined ) { | |
| // used to prevent race conditions with remote data sources | |
| var requestIndex = 0; | |
| $.widget( "ui.autocomplete", { | |
| options: { | |
| appendTo: "body", | |
| autoFocus: false, | |
| delay: 300, | |
| minLength: 1, | |
| position: { | |
| my: "left top", | |
| at: "left bottom", | |
| collision: "none" | |
| }, | |
| source: null | |
| }, | |
| pending: 0, | |
| _create: function() { | |
| var self = this, | |
| doc = this.element[ 0 ].ownerDocument, | |
| suppressKeyPress; | |
| this.isMultiLine = this.element.is( "textarea" ); | |
| this.element | |
| .addClass( "ui-autocomplete-input" ) | |
| .attr( "autocomplete", "off" ) | |
| // TODO verify these actually work as intended | |
| .attr({ | |
| role: "textbox", | |
| "aria-autocomplete": "list", | |
| "aria-haspopup": "true" | |
| }) | |
| .bind( "keydown.autocomplete", function( event ) { | |
| if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) { | |
| return; | |
| } | |
| suppressKeyPress = false; | |
| var keyCode = $.ui.keyCode; | |
| switch( event.keyCode ) { | |
| case keyCode.PAGE_UP: | |
| self._move( "previousPage", event ); | |
| break; | |
| case keyCode.PAGE_DOWN: | |
| self._move( "nextPage", event ); | |
| break; | |
| case keyCode.UP: | |
| self._keyEvent( "previous", event ); | |
| break; | |
| case keyCode.DOWN: | |
| self._keyEvent( "next", event ); | |
| break; | |
| case keyCode.ENTER: | |
| case keyCode.NUMPAD_ENTER: | |
| // when menu is open and has focus | |
| if ( self.menu.active ) { | |
| // #6055 - Opera still allows the keypress to occur | |
| // which causes forms to submit | |
| suppressKeyPress = true; | |
| event.preventDefault(); | |
| } | |
| //passthrough - ENTER and TAB both select the current element | |
| case keyCode.TAB: | |
| if ( !self.menu.active ) { | |
| return; | |
| } | |
| self.menu.select( event ); | |
| break; | |
| case keyCode.ESCAPE: | |
| self.element.val( self.term ); | |
| self.close( event ); | |
| break; | |
| default: | |
| // keypress is triggered before the input value is changed | |
| clearTimeout( self.searching ); | |
| self.searching = setTimeout(function() { | |
| // only search if the value has changed | |
| if ( self.term != self.element.val() ) { | |
| self.selectedItem = null; | |
| self.search( null, event ); | |
| } | |
| }, self.options.delay ); | |
| break; | |
| } | |
| }) | |
| .bind( "keypress.autocomplete", function( event ) { | |
| if ( suppressKeyPress ) { | |
| suppressKeyPress = false; | |
| event.preventDefault(); | |
| } | |
| }) | |
| .bind( "focus.autocomplete", function() { | |
| if ( self.options.disabled ) { | |
| return; | |
| } | |
| self.selectedItem = null; | |
| self.previous = self.element.val(); | |
| }) | |
| .bind( "blur.autocomplete", function( event ) { | |
| if ( self.options.disabled ) { | |
| return; | |
| } | |
| clearTimeout( self.searching ); | |
| // clicks on the menu (or a button to trigger a search) will cause a blur event | |
| self.closing = setTimeout(function() { | |
| self.close( event ); | |
| self._change( event ); | |
| }, 150 ); | |
| }); | |
| this._initSource(); | |
| this.menu = $( "<ul></ul>" ) | |
| .addClass( "ui-autocomplete" ) | |
| .appendTo( $( this.options.appendTo || "body", doc )[0] ) | |
| // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown) | |
| .mousedown(function( event ) { | |
| // clicking on the scrollbar causes focus to shift to the body | |
| // but we can't detect a mouseup or a click immediately afterward | |
| // so we have to track the next mousedown and close the menu if | |
| // the user clicks somewhere outside of the autocomplete | |
| var menuElement = self.menu.element[ 0 ]; | |
| if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { | |
| setTimeout(function() { | |
| $( document ).one( 'mousedown', function( event ) { | |
| if ( event.target !== self.element[ 0 ] && | |
| event.target !== menuElement && | |
| !$.ui.contains( menuElement, event.target ) ) { | |
| self.close(); | |
| } | |
| }); | |
| }, 1 ); | |
| } | |
| // use another timeout to make sure the blur-event-handler on the input was already triggered | |
| setTimeout(function() { | |
| clearTimeout( self.closing ); | |
| }, 13); | |
| }) | |
| .menu({ | |
| focus: function( event, ui ) { | |
| var item = ui.item.data( "item.autocomplete" ); | |
| if ( false !== self._trigger( "focus", event, { item: item } ) ) { | |
| // use value to match what will end up in the input, if it was a key event | |
| if ( /^key/.test(event.originalEvent.type) ) { | |
| self.element.val( item.value ); | |
| } | |
| } | |
| }, | |
| selected: function( event, ui ) { | |
| var item = ui.item.data( "item.autocomplete" ), | |
| previous = self.previous; | |
| // only trigger when focus was lost (click on menu) | |
| if ( self.element[0] !== doc.activeElement ) { | |
| self.element.focus(); | |
| self.previous = previous; | |
| // #6109 - IE triggers two focus events and the second | |
| // is asynchronous, so we need to reset the previous | |
| // term synchronously and asynchronously :-( | |
| setTimeout(function() { | |
| self.previous = previous; | |
| self.selectedItem = item; | |
| }, 1); | |
| } | |
| if ( false !== self._trigger( "select", event, { item: item } ) ) { | |
| self.element.val( item.value ); | |
| } | |
| // reset the term after the select event | |
| // this allows custom select handling to work properly | |
| self.term = self.element.val(); | |
| self.close( event ); | |
| self.selectedItem = item; | |
| }, | |
| blur: function( event, ui ) { | |
| // don't set the value of the text field if it's already correct | |
| // this prevents moving the cursor unnecessarily | |
| if ( self.menu.element.is(":visible") && | |
| ( self.element.val() !== self.term ) ) { | |
| self.element.val( self.term ); | |
| } | |
| } | |
| }) | |
| .zIndex( this.element.zIndex() + 1 ) | |
| // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 | |
| .css({ top: 0, left: 0 }) | |
| .hide() | |
| .data( "menu" ); | |
| if ( $.fn.bgiframe ) { | |
| this.menu.element.bgiframe(); | |
| } | |
| // turning off autocomplete prevents the browser from remembering the | |
| // value when navigating through history, so we re-enable autocomplete | |
| // if the page is unloaded before the widget is destroyed. #7790 | |
| self.beforeunloadHandler = function() { | |
| self.element.removeAttr( "autocomplete" ); | |
| }; | |
| $( window ).bind( "beforeunload", self.beforeunloadHandler ); | |
| }, | |
| destroy: function() { | |
| this.element | |
| .removeClass( "ui-autocomplete-input" ) | |
| .removeAttr( "autocomplete" ) | |
| .removeAttr( "role" ) | |
| .removeAttr( "aria-autocomplete" ) | |
| .removeAttr( "aria-haspopup" ); | |
| this.menu.element.remove(); | |
| $( window ).unbind( "beforeunload", this.beforeunloadHandler ); | |
| $.Widget.prototype.destroy.call( this ); | |
| }, | |
| _setOption: function( key, value ) { | |
| $.Widget.prototype._setOption.apply( this, arguments ); | |
| if ( key === "source" ) { | |
| this._initSource(); | |
| } | |
| if ( key === "appendTo" ) { | |
| this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] ) | |
| } | |
| if ( key === "disabled" && value && this.xhr ) { | |
| this.xhr.abort(); | |
| } | |
| }, | |
| _initSource: function() { | |
| var self = this, | |
| array, | |
| url; | |
| if ( $.isArray(this.options.source) ) { | |
| array = this.options.source; | |
| this.source = function( request, response ) { | |
| response( $.ui.autocomplete.filter(array, request.term) ); | |
| }; | |
| } else if ( typeof this.options.source === "string" ) { | |
| url = this.options.source; | |
| this.source = function( request, response ) { | |
| if ( self.xhr ) { | |
| self.xhr.abort(); | |
| } | |
| self.xhr = $.ajax({ | |
| url: url, | |
| data: request, | |
| dataType: "json", | |
| success: function( data, status ) { | |
| response( data ); | |
| }, | |
| error: function() { | |
| response( [] ); | |
| } | |
| }); | |
| }; | |
| } else { | |
| this.source = this.options.source; | |
| } | |
| }, | |
| search: function( value, event ) { | |
| value = value != null ? value : this.element.val(); | |
| // always save the actual value, not the one passed as an argument | |
| this.term = this.element.val(); | |
| if ( value.length < this.options.minLength ) { | |
| return this.close( event ); | |
| } | |
| clearTimeout( this.closing ); | |
| if ( this._trigger( "search", event ) === false ) { | |
| return; | |
| } | |
| return this._search( value ); | |
| }, | |
| _search: function( value ) { | |
| this.pending++; | |
| this.element.addClass( "ui-autocomplete-loading" ); | |
| this.source( { term: value }, this._response() ); | |
| }, | |
| _response: function() { | |
| var that = this, | |
| index = ++requestIndex; | |
| return function( content ) { | |
| if ( index === requestIndex ) { | |
| that.__response( content ); | |
| } | |
| that.pending--; | |
| if ( !that.pending ) { | |
| that.element.removeClass( "ui-autocomplete-loading" ); | |
| } | |
| }; | |
| }, | |
| __response: function( content ) { | |
| if ( !this.options.disabled && content && content.length ) { | |
| content = this._normalize( content ); | |
| this._suggest( content ); | |
| this._trigger( "open" ); | |
| } else { | |
| this.close(); | |
| } | |
| }, | |
| close: function( event ) { | |
| clearTimeout( this.closing ); | |
| if ( this.menu.element.is(":visible") ) { | |
| this.menu.element.hide(); | |
| this.menu.deactivate(); | |
| this._trigger( "close", event ); | |
| } | |
| }, | |
| _change: function( event ) { | |
| if ( this.previous !== this.element.val() ) { | |
| this._trigger( "change", event, { item: this.selectedItem } ); | |
| } | |
| }, | |
| _normalize: function( items ) { | |
| // assume all items have the right format when the first item is complete | |
| if ( items.length && items[0].label && items[0].value ) { | |
| return items; | |
| } | |
| return $.map( items, function(item) { | |
| if ( typeof item === "string" ) { | |
| return { | |
| label: item, | |
| value: item | |
| }; | |
| } | |
| return $.extend({ | |
| label: item.label || item.value, | |
| value: item.value || item.label | |
| }, item ); | |
| }); | |
| }, | |
| _suggest: function( items ) { | |
| var ul = this.menu.element | |
| .empty() | |
| .zIndex( this.element.zIndex() + 1 ); | |
| this._renderMenu( ul, items ); | |
| // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate | |
| this.menu.deactivate(); | |
| this.menu.refresh(); | |
| // size and position menu | |
| ul.show(); | |
| this._resizeMenu(); | |
| ul.position( $.extend({ | |
| of: this.element | |
| }, this.options.position )); | |
| if ( this.options.autoFocus ) { | |
| this.menu.next( new $.Event("mouseover") ); | |
| } | |
| }, | |
| _resizeMenu: function() { | |
| var ul = this.menu.element; | |
| ul.outerWidth( Math.max( | |
| // Firefox wraps long text (possibly a rounding bug) | |
| // so we add 1px to avoid the wrapping (#7513) | |
| ul.width( "" ).outerWidth() + 1, | |
| this.element.outerWidth() | |
| ) ); | |
| }, | |
| _renderMenu: function( ul, items ) { | |
| var self = this; | |
| $.each( items, function( index, item ) { | |
| self._renderItem( ul, item ); | |
| }); | |
| }, | |
| _renderItem: function( ul, item) { | |
| return $( "<li></li>" ) | |
| .data( "item.autocomplete", item ) | |
| .append( $( "<a></a>" ).text( item.label ) ) | |
| .appendTo( ul ); | |
| }, | |
| _move: function( direction, event ) { | |
| if ( !this.menu.element.is(":visible") ) { | |
| this.search( null, event ); | |
| return; | |
| } | |
| if ( this.menu.first() && /^previous/.test(direction) || | |
| this.menu.last() && /^next/.test(direction) ) { | |
| this.element.val( this.term ); | |
| this.menu.deactivate(); | |
| return; | |
| } | |
| this.menu[ direction ]( event ); | |
| }, | |
| widget: function() { | |
| return this.menu.element; | |
| }, | |
| _keyEvent: function( keyEvent, event ) { | |
| if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { | |
| this._move( keyEvent, event ); | |
| // prevents moving cursor to beginning/end of the text field in some browsers | |
| event.preventDefault(); | |
| } | |
| } | |
| }); | |
| $.extend( $.ui.autocomplete, { | |
| escapeRegex: function( value ) { | |
| return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&"); | |
| }, | |
| filter: function(array, term) { | |
| var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); | |
| return $.grep( array, function(value) { | |
| return matcher.test( value.label || value.value || value ); | |
| }); | |
| } | |
| }); | |
| }( jQuery )); | |
| /* | |
| * jQuery UI Menu (not officially released) | |
| * | |
| * This widget isn't yet finished and the API is subject to change. We plan to finish | |
| * it for the next release. You're welcome to give it a try anyway and give us feedback, | |
| * as long as you're okay with migrating your code later on. We can help with that, too. | |
| * | |
| * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Menu | |
| * | |
| * Depends: | |
| * jquery.ui.core.js | |
| * jquery.ui.widget.js | |
| */ | |
| (function($) { | |
| $.widget("ui.menu", { | |
| _create: function() { | |
| var self = this; | |
| this.element | |
| .addClass("ui-menu ui-widget ui-widget-content ui-corner-all") | |
| .attr({ | |
| role: "listbox", | |
| "aria-activedescendant": "ui-active-menuitem" | |
| }) | |
| .click(function( event ) { | |
| if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) { | |
| return; | |
| } | |
| // temporary | |
| event.preventDefault(); | |
| self.select( event ); | |
| }); | |
| this.refresh(); | |
| }, | |
| refresh: function() { | |
| var self = this; | |
| // don't refresh list items that are already adapted | |
| var items = this.element.children("li:not(.ui-menu-item):has(a)") | |
| .addClass("ui-menu-item") | |
| .attr("role", "menuitem"); | |
| items.children("a") | |
| .addClass("ui-corner-all") | |
| .attr("tabindex", -1) | |
| // mouseenter doesn't work with event delegation | |
| .mouseenter(function( event ) { | |
| self.activate( event, $(this).parent() ); | |
| }) | |
| .mouseleave(function() { | |
| self.deactivate(); | |
| }); | |
| }, | |
| activate: function( event, item ) { | |
| this.deactivate(); | |
| if (this.hasScroll()) { | |
| var offset = item.offset().top - this.element.offset().top, | |
| scroll = this.element.scrollTop(), | |
| elementHeight = this.element.height(); | |
| if (offset < 0) { | |
| this.element.scrollTop( scroll + offset); | |
| } else if (offset >= elementHeight) { | |
| this.element.scrollTop( scroll + offset - elementHeight + item.height()); | |
| } | |
| } | |
| this.active = item.eq(0) | |
| .children("a") | |
| .addClass("ui-state-hover") | |
| .attr("id", "ui-active-menuitem") | |
| .end(); | |
| this._trigger("focus", event, { item: item }); | |
| }, | |
| deactivate: function() { | |
| if (!this.active) { return; } | |
| this.active.children("a") | |
| .removeClass("ui-state-hover") | |
| .removeAttr("id"); | |
| this._trigger("blur"); | |
| this.active = null; | |
| }, | |
| next: function(event) { | |
| this.move("next", ".ui-menu-item:first", event); | |
| }, | |
| previous: function(event) { | |
| this.move("prev", ".ui-menu-item:last", event); | |
| }, | |
| first: function() { | |
| return this.active && !this.active.prevAll(".ui-menu-item").length; | |
| }, | |
| last: function() { | |
| return this.active && !this.active.nextAll(".ui-menu-item").length; | |
| }, | |
| move: function(direction, edge, event) { | |
| if (!this.active) { | |
| this.activate(event, this.element.children(edge)); | |
| return; | |
| } | |
| var next = this.active[direction + "All"](".ui-menu-item").eq(0); | |
| if (next.length) { | |
| this.activate(event, next); | |
| } else { | |
| this.activate(event, this.element.children(edge)); | |
| } | |
| }, | |
| // TODO merge with previousPage | |
| nextPage: function(event) { | |
| if (this.hasScroll()) { | |
| // TODO merge with no-scroll-else | |
| if (!this.active || this.last()) { | |
| this.activate(event, this.element.children(".ui-menu-item:first")); | |
| return; | |
| } | |
| var base = this.active.offset().top, | |
| height = this.element.height(), | |
| result = this.element.children(".ui-menu-item").filter(function() { | |
| var close = $(this).offset().top - base - height + $(this).height(); | |
| // TODO improve approximation | |
| return close < 10 && close > -10; | |
| }); | |
| // TODO try to catch this earlier when scrollTop indicates the last page anyway | |
| if (!result.length) { | |
| result = this.element.children(".ui-menu-item:last"); | |
| } | |
| this.activate(event, result); | |
| } else { | |
| this.activate(event, this.element.children(".ui-menu-item") | |
| .filter(!this.active || this.last() ? ":first" : ":last")); | |
| } | |
| }, | |
| // TODO merge with nextPage | |
| previousPage: function(event) { | |
| if (this.hasScroll()) { | |
| // TODO merge with no-scroll-else | |
| if (!this.active || this.first()) { | |
| this.activate(event, this.element.children(".ui-menu-item:last")); | |
| return; | |
| } | |
| var base = this.active.offset().top, | |
| height = this.element.height(), | |
| result = this.element.children(".ui-menu-item").filter(function() { | |
| var close = $(this).offset().top - base + height - $(this).height(); | |
| // TODO improve approximation | |
| return close < 10 && close > -10; | |
| }); | |
| // TODO try to catch this earlier when scrollTop indicates the last page anyway | |
| if (!result.length) { | |
| result = this.element.children(".ui-menu-item:first"); | |
| } | |
| this.activate(event, result); | |
| } else { | |
| this.activate(event, this.element.children(".ui-menu-item") | |
| .filter(!this.active || this.first() ? ":last" : ":first")); | |
| } | |
| }, | |
| hasScroll: function() { | |
| return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight"); | |
| }, | |
| select: function( event ) { | |
| this._trigger("selected", event, { item: this.active }); | |
| } | |
| }); | |
| }(jQuery)); | |
| /*! | |
| * jQuery UI Button 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Button | |
| * | |
| * Depends: | |
| * jquery.ui.core.js | |
| * jquery.ui.widget.js | |
| */ | |
| (function( $, undefined ) { | |
| var lastActive, startXPos, startYPos, clickDragged, | |
| baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", | |
| stateClasses = "ui-state-hover ui-state-active ", | |
| typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", | |
| formResetHandler = function() { | |
| var buttons = $( this ).find( ":ui-button" ); | |
| setTimeout(function() { | |
| buttons.button( "refresh" ); | |
| }, 1 ); | |
| }, | |
| radioGroup = function( radio ) { | |
| var name = radio.name, | |
| form = radio.form, | |
| radios = $( [] ); | |
| if ( name ) { | |
| if ( form ) { | |
| radios = $( form ).find( "[name='" + name + "']" ); | |
| } else { | |
| radios = $( "[name='" + name + "']", radio.ownerDocument ) | |
| .filter(function() { | |
| return !this.form; | |
| }); | |
| } | |
| } | |
| return radios; | |
| }; | |
| $.widget( "ui.button", { | |
| options: { | |
| disabled: null, | |
| text: true, | |
| label: null, | |
| icons: { | |
| primary: null, | |
| secondary: null | |
| } | |
| }, | |
| _create: function() { | |
| this.element.closest( "form" ) | |
| .unbind( "reset.button" ) | |
| .bind( "reset.button", formResetHandler ); | |
| if ( typeof this.options.disabled !== "boolean" ) { | |
| this.options.disabled = !!this.element.propAttr( "disabled" ); | |
| } else { | |
| this.element.propAttr( "disabled", this.options.disabled ); | |
| } | |
| this._determineButtonType(); | |
| this.hasTitle = !!this.buttonElement.attr( "title" ); | |
| var self = this, | |
| options = this.options, | |
| toggleButton = this.type === "checkbox" || this.type === "radio", | |
| hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ), | |
| focusClass = "ui-state-focus"; | |
| if ( options.label === null ) { | |
| options.label = this.buttonElement.html(); | |
| } | |
| this.buttonElement | |
| .addClass( baseClasses ) | |
| .attr( "role", "button" ) | |
| .bind( "mouseenter.button", function() { | |
| if ( options.disabled ) { | |
| return; | |
| } | |
| $( this ).addClass( "ui-state-hover" ); | |
| if ( this === lastActive ) { | |
| $( this ).addClass( "ui-state-active" ); | |
| } | |
| }) | |
| .bind( "mouseleave.button", function() { | |
| if ( options.disabled ) { | |
| return; | |
| } | |
| $( this ).removeClass( hoverClass ); | |
| }) | |
| .bind( "click.button", function( event ) { | |
| if ( options.disabled ) { | |
| event.preventDefault(); | |
| event.stopImmediatePropagation(); | |
| } | |
| }); | |
| this.element | |
| .bind( "focus.button", function() { | |
| // no need to check disabled, focus won't be triggered anyway | |
| self.buttonElement.addClass( focusClass ); | |
| }) | |
| .bind( "blur.button", function() { | |
| self.buttonElement.removeClass( focusClass ); | |
| }); | |
| if ( toggleButton ) { | |
| this.element.bind( "change.button", function() { | |
| if ( clickDragged ) { | |
| return; | |
| } | |
| self.refresh(); | |
| }); | |
| // if mouse moves between mousedown and mouseup (drag) set clickDragged flag | |
| // prevents issue where button state changes but checkbox/radio checked state | |
| // does not in Firefox (see ticket #6970) | |
| this.buttonElement | |
| .bind( "mousedown.button", function( event ) { | |
| if ( options.disabled ) { | |
| return; | |
| } | |
| clickDragged = false; | |
| startXPos = event.pageX; | |
| startYPos = event.pageY; | |
| }) | |
| .bind( "mouseup.button", function( event ) { | |
| if ( options.disabled ) { | |
| return; | |
| } | |
| if ( startXPos !== event.pageX || startYPos !== event.pageY ) { | |
| clickDragged = true; | |
| } | |
| }); | |
| } | |
| if ( this.type === "checkbox" ) { | |
| this.buttonElement.bind( "click.button", function() { | |
| if ( options.disabled || clickDragged ) { | |
| return false; | |
| } | |
| $( this ).toggleClass( "ui-state-active" ); | |
| self.buttonElement.attr( "aria-pressed", self.element[0].checked ); | |
| }); | |
| } else if ( this.type === "radio" ) { | |
| this.buttonElement.bind( "click.button", function() { | |
| if ( options.disabled || clickDragged ) { | |
| return false; | |
| } | |
| $( this ).addClass( "ui-state-active" ); | |
| self.buttonElement.attr( "aria-pressed", "true" ); | |
| var radio = self.element[ 0 ]; | |
| radioGroup( radio ) | |
| .not( radio ) | |
| .map(function() { | |
| return $( this ).button( "widget" )[ 0 ]; | |
| }) | |
| .removeClass( "ui-state-active" ) | |
| .attr( "aria-pressed", "false" ); | |
| }); | |
| } else { | |
| this.buttonElement | |
| .bind( "mousedown.button", function() { | |
| if ( options.disabled ) { | |
| return false; | |
| } | |
| $( this ).addClass( "ui-state-active" ); | |
| lastActive = this; | |
| $( document ).one( "mouseup", function() { | |
| lastActive = null; | |
| }); | |
| }) | |
| .bind( "mouseup.button", function() { | |
| if ( options.disabled ) { | |
| return false; | |
| } | |
| $( this ).removeClass( "ui-state-active" ); | |
| }) | |
| .bind( "keydown.button", function(event) { | |
| if ( options.disabled ) { | |
| return false; | |
| } | |
| if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) { | |
| $( this ).addClass( "ui-state-active" ); | |
| } | |
| }) | |
| .bind( "keyup.button", function() { | |
| $( this ).removeClass( "ui-state-active" ); | |
| }); | |
| if ( this.buttonElement.is("a") ) { | |
| this.buttonElement.keyup(function(event) { | |
| if ( event.keyCode === $.ui.keyCode.SPACE ) { | |
| // TODO pass through original event correctly (just as 2nd argument doesn't work) | |
| $( this ).click(); | |
| } | |
| }); | |
| } | |
| } | |
| // TODO: pull out $.Widget's handling for the disabled option into | |
| // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can | |
| // be overridden by individual plugins | |
| this._setOption( "disabled", options.disabled ); | |
| this._resetButton(); | |
| }, | |
| _determineButtonType: function() { | |
| if ( this.element.is(":checkbox") ) { | |
| this.type = "checkbox"; | |
| } else if ( this.element.is(":radio") ) { | |
| this.type = "radio"; | |
| } else if ( this.element.is("input") ) { | |
| this.type = "input"; | |
| } else { | |
| this.type = "button"; | |
| } | |
| if ( this.type === "checkbox" || this.type === "radio" ) { | |
| // we don't search against the document in case the element | |
| // is disconnected from the DOM | |
| var ancestor = this.element.parents().filter(":last"), | |
| labelSelector = "label[for='" + this.element.attr("id") + "']"; | |
| this.buttonElement = ancestor.find( labelSelector ); | |
| if ( !this.buttonElement.length ) { | |
| ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); | |
| this.buttonElement = ancestor.filter( labelSelector ); | |
| if ( !this.buttonElement.length ) { | |
| this.buttonElement = ancestor.find( labelSelector ); | |
| } | |
| } | |
| this.element.addClass( "ui-helper-hidden-accessible" ); | |
| var checked = this.element.is( ":checked" ); | |
| if ( checked ) { | |
| this.buttonElement.addClass( "ui-state-active" ); | |
| } | |
| this.buttonElement.attr( "aria-pressed", checked ); | |
| } else { | |
| this.buttonElement = this.element; | |
| } | |
| }, | |
| widget: function() { | |
| return this.buttonElement; | |
| }, | |
| destroy: function() { | |
| this.element | |
| .removeClass( "ui-helper-hidden-accessible" ); | |
| this.buttonElement | |
| .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) | |
| .removeAttr( "role" ) | |
| .removeAttr( "aria-pressed" ) | |
| .html( this.buttonElement.find(".ui-button-text").html() ); | |
| if ( !this.hasTitle ) { | |
| this.buttonElement.removeAttr( "title" ); | |
| } | |
| $.Widget.prototype.destroy.call( this ); | |
| }, | |
| _setOption: function( key, value ) { | |
| $.Widget.prototype._setOption.apply( this, arguments ); | |
| if ( key === "disabled" ) { | |
| if ( value ) { | |
| this.element.propAttr( "disabled", true ); | |
| } else { | |
| this.element.propAttr( "disabled", false ); | |
| } | |
| return; | |
| } | |
| this._resetButton(); | |
| }, | |
| refresh: function() { | |
| var isDisabled = this.element.is( ":disabled" ); | |
| if ( isDisabled !== this.options.disabled ) { | |
| this._setOption( "disabled", isDisabled ); | |
| } | |
| if ( this.type === "radio" ) { | |
| radioGroup( this.element[0] ).each(function() { | |
| if ( $( this ).is( ":checked" ) ) { | |
| $( this ).button( "widget" ) | |
| .addClass( "ui-state-active" ) | |
| .attr( "aria-pressed", "true" ); | |
| } else { | |
| $( this ).button( "widget" ) | |
| .removeClass( "ui-state-active" ) | |
| .attr( "aria-pressed", "false" ); | |
| } | |
| }); | |
| } else if ( this.type === "checkbox" ) { | |
| if ( this.element.is( ":checked" ) ) { | |
| this.buttonElement | |
| .addClass( "ui-state-active" ) | |
| .attr( "aria-pressed", "true" ); | |
| } else { | |
| this.buttonElement | |
| .removeClass( "ui-state-active" ) | |
| .attr( "aria-pressed", "false" ); | |
| } | |
| } | |
| }, | |
| _resetButton: function() { | |
| if ( this.type === "input" ) { | |
| if ( this.options.label ) { | |
| this.element.val( this.options.label ); | |
| } | |
| return; | |
| } | |
| var buttonElement = this.buttonElement.removeClass( typeClasses ), | |
| buttonText = $( "<span></span>", this.element[0].ownerDocument ) | |
| .addClass( "ui-button-text" ) | |
| .html( this.options.label ) | |
| .appendTo( buttonElement.empty() ) | |
| .text(), | |
| icons = this.options.icons, | |
| multipleIcons = icons.primary && icons.secondary, | |
| buttonClasses = []; | |
| if ( icons.primary || icons.secondary ) { | |
| if ( this.options.text ) { | |
| buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); | |
| } | |
| if ( icons.primary ) { | |
| buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" ); | |
| } | |
| if ( icons.secondary ) { | |
| buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" ); | |
| } | |
| if ( !this.options.text ) { | |
| buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); | |
| if ( !this.hasTitle ) { | |
| buttonElement.attr( "title", buttonText ); | |
| } | |
| } | |
| } else { | |
| buttonClasses.push( "ui-button-text-only" ); | |
| } | |
| buttonElement.addClass( buttonClasses.join( " " ) ); | |
| } | |
| }); | |
| $.widget( "ui.buttonset", { | |
| options: { | |
| items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" | |
| }, | |
| _create: function() { | |
| this.element.addClass( "ui-buttonset" ); | |
| }, | |
| _init: function() { | |
| this.refresh(); | |
| }, | |
| _setOption: function( key, value ) { | |
| if ( key === "disabled" ) { | |
| this.buttons.button( "option", key, value ); | |
| } | |
| $.Widget.prototype._setOption.apply( this, arguments ); | |
| }, | |
| refresh: function() { | |
| var rtl = this.element.css( "direction" ) === "rtl"; | |
| this.buttons = this.element.find( this.options.items ) | |
| .filter( ":ui-button" ) | |
| .button( "refresh" ) | |
| .end() | |
| .not( ":ui-button" ) | |
| .button() | |
| .end() | |
| .map(function() { | |
| return $( this ).button( "widget" )[ 0 ]; | |
| }) | |
| .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) | |
| .filter( ":first" ) | |
| .addClass( rtl ? "ui-corner-right" : "ui-corner-left" ) | |
| .end() | |
| .filter( ":last" ) | |
| .addClass( rtl ? "ui-corner-left" : "ui-corner-right" ) | |
| .end() | |
| .end(); | |
| }, | |
| destroy: function() { | |
| this.element.removeClass( "ui-buttonset" ); | |
| this.buttons | |
| .map(function() { | |
| return $( this ).button( "widget" )[ 0 ]; | |
| }) | |
| .removeClass( "ui-corner-left ui-corner-right" ) | |
| .end() | |
| .button( "destroy" ); | |
| $.Widget.prototype.destroy.call( this ); | |
| } | |
| }); | |
| }( jQuery ) ); | |
| /*! | |
| * jQuery UI Dialog 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Dialog | |
| * | |
| * Depends: | |
| * jquery.ui.core.js | |
| * jquery.ui.widget.js | |
| * jquery.ui.button.js | |
| * jquery.ui.draggable.js | |
| * jquery.ui.mouse.js | |
| * jquery.ui.position.js | |
| * jquery.ui.resizable.js | |
| */ | |
| (function( $, undefined ) { | |
| var uiDialogClasses = | |
| 'ui-dialog ' + | |
| 'ui-widget ' + | |
| 'ui-widget-content ' + | |
| 'ui-corner-all ', | |
| sizeRelatedOptions = { | |
| buttons: true, | |
| height: true, | |
| maxHeight: true, | |
| maxWidth: true, | |
| minHeight: true, | |
| minWidth: true, | |
| width: true | |
| }, | |
| resizableRelatedOptions = { | |
| maxHeight: true, | |
| maxWidth: true, | |
| minHeight: true, | |
| minWidth: true | |
| }, | |
| // support for jQuery 1.3.2 - handle common attrFn methods for dialog | |
| attrFn = $.attrFn || { | |
| val: true, | |
| css: true, | |
| html: true, | |
| text: true, | |
| data: true, | |
| width: true, | |
| height: true, | |
| offset: true, | |
| click: true | |
| }; | |
| $.widget("ui.dialog", { | |
| options: { | |
| autoOpen: true, | |
| buttons: {}, | |
| closeOnEscape: true, | |
| closeText: 'close', | |
| dialogClass: '', | |
| draggable: true, | |
| hide: null, | |
| height: 'auto', | |
| maxHeight: false, | |
| maxWidth: false, | |
| minHeight: 150, | |
| minWidth: 150, | |
| modal: false, | |
| position: { | |
| my: 'center', | |
| at: 'center', | |
| collision: 'fit', | |
| // ensure that the titlebar is never outside the document | |
| using: function(pos) { | |
| var topOffset = $(this).css(pos).offset().top; | |
| if (topOffset < 0) { | |
| $(this).css('top', pos.top - topOffset); | |
| } | |
| } | |
| }, | |
| resizable: true, | |
| show: null, | |
| stack: true, | |
| title: '', | |
| width: 300, | |
| zIndex: 1000 | |
| }, | |
| _create: function() { | |
| this.originalTitle = this.element.attr('title'); | |
| // #5742 - .attr() might return a DOMElement | |
| if ( typeof this.originalTitle !== "string" ) { | |
| this.originalTitle = ""; | |
| } | |
| this.options.title = this.options.title || this.originalTitle; | |
| var self = this, | |
| options = self.options, | |
| title = options.title || ' ', | |
| titleId = $.ui.dialog.getTitleId(self.element), | |
| uiDialog = (self.uiDialog = $('<div></div>')) | |
| .appendTo(document.body) | |
| .hide() | |
| .addClass(uiDialogClasses + options.dialogClass) | |
| .css({ | |
| zIndex: options.zIndex | |
| }) | |
| // setting tabIndex makes the div focusable | |
| // setting outline to 0 prevents a border on focus in Mozilla | |
| .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { | |
| if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && | |
| event.keyCode === $.ui.keyCode.ESCAPE) { | |
| self.close(event); | |
| event.preventDefault(); | |
| } | |
| }) | |
| .attr({ | |
| role: 'dialog', | |
| 'aria-labelledby': titleId | |
| }) | |
| .mousedown(function(event) { | |
| self.moveToTop(false, event); | |
| }), | |
| uiDialogContent = self.element | |
| .show() | |
| .removeAttr('title') | |
| .addClass( | |
| 'ui-dialog-content ' + | |
| 'ui-widget-content') | |
| .appendTo(uiDialog), | |
| uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>')) | |
| .addClass( | |
| 'ui-dialog-titlebar ' + | |
| 'ui-widget-header ' + | |
| 'ui-corner-all ' + | |
| 'ui-helper-clearfix' | |
| ) | |
| .prependTo(uiDialog), | |
| uiDialogTitlebarClose = $('<a href="#"></a>') | |
| .addClass( | |
| 'ui-dialog-titlebar-close ' + | |
| 'ui-corner-all' | |
| ) | |
| .attr('role', 'button') | |
| .hover( | |
| function() { | |
| uiDialogTitlebarClose.addClass('ui-state-hover'); | |
| }, | |
| function() { | |
| uiDialogTitlebarClose.removeClass('ui-state-hover'); | |
| } | |
| ) | |
| .focus(function() { | |
| uiDialogTitlebarClose.addClass('ui-state-focus'); | |
| }) | |
| .blur(function() { | |
| uiDialogTitlebarClose.removeClass('ui-state-focus'); | |
| }) | |
| .click(function(event) { | |
| self.close(event); | |
| return false; | |
| }) | |
| .appendTo(uiDialogTitlebar), | |
| uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>')) | |
| .addClass( | |
| 'ui-icon ' + | |
| 'ui-icon-closethick' | |
| ) | |
| .text(options.closeText) | |
| .appendTo(uiDialogTitlebarClose), | |
| uiDialogTitle = $('<span></span>') | |
| .addClass('ui-dialog-title') | |
| .attr('id', titleId) | |
| .html(title) | |
| .prependTo(uiDialogTitlebar); | |
| //handling of deprecated beforeclose (vs beforeClose) option | |
| //Ticket #4669 http://dev.jqueryui.com/ticket/4669 | |
| //TODO: remove in 1.9pre | |
| if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { | |
| options.beforeClose = options.beforeclose; | |
| } | |
| uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); | |
| if (options.draggable && $.fn.draggable) { | |
| self._makeDraggable(); | |
| } | |
| if (options.resizable && $.fn.resizable) { | |
| self._makeResizable(); | |
| } | |
| self._createButtons(options.buttons); | |
| self._isOpen = false; | |
| if ($.fn.bgiframe) { | |
| uiDialog.bgiframe(); | |
| } | |
| }, | |
| _init: function() { | |
| if ( this.options.autoOpen ) { | |
| this.open(); | |
| } | |
| }, | |
| destroy: function() { | |
| var self = this; | |
| if (self.overlay) { | |
| self.overlay.destroy(); | |
| } | |
| self.uiDialog.hide(); | |
| self.element | |
| .unbind('.dialog') | |
| .removeData('dialog') | |
| .removeClass('ui-dialog-content ui-widget-content') | |
| .hide().appendTo('body'); | |
| self.uiDialog.remove(); | |
| if (self.originalTitle) { | |
| self.element.attr('title', self.originalTitle); | |
| } | |
| return self; | |
| }, | |
| widget: function() { | |
| return this.uiDialog; | |
| }, | |
| close: function(event) { | |
| var self = this, | |
| maxZ, thisZ; | |
| if (false === self._trigger('beforeClose', event)) { | |
| return; | |
| } | |
| if (self.overlay) { | |
| self.overlay.destroy(); | |
| } | |
| self.uiDialog.unbind('keypress.ui-dialog'); | |
| self._isOpen = false; | |
| if (self.options.hide) { | |
| self.uiDialog.hide(self.options.hide, function() { | |
| self._trigger('close', event); | |
| }); | |
| } else { | |
| self.uiDialog.hide(); | |
| self._trigger('close', event); | |
| } | |
| $.ui.dialog.overlay.resize(); | |
| // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) | |
| if (self.options.modal) { | |
| maxZ = 0; | |
| $('.ui-dialog').each(function() { | |
| if (this !== self.uiDialog[0]) { | |
| thisZ = $(this).css('z-index'); | |
| if(!isNaN(thisZ)) { | |
| maxZ = Math.max(maxZ, thisZ); | |
| } | |
| } | |
| }); | |
| $.ui.dialog.maxZ = maxZ; | |
| } | |
| return self; | |
| }, | |
| isOpen: function() { | |
| return this._isOpen; | |
| }, | |
| // the force parameter allows us to move modal dialogs to their correct | |
| // position on open | |
| moveToTop: function(force, event) { | |
| var self = this, | |
| options = self.options, | |
| saveScroll; | |
| if ((options.modal && !force) || | |
| (!options.stack && !options.modal)) { | |
| return self._trigger('focus', event); | |
| } | |
| if (options.zIndex > $.ui.dialog.maxZ) { | |
| $.ui.dialog.maxZ = options.zIndex; | |
| } | |
| if (self.overlay) { | |
| $.ui.dialog.maxZ += 1; | |
| self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); | |
| } | |
| //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. | |
| // http://ui.jquery.com/bugs/ticket/3193 | |
| saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; | |
| $.ui.dialog.maxZ += 1; | |
| self.uiDialog.css('z-index', $.ui.dialog.maxZ); | |
| self.element.attr(saveScroll); | |
| self._trigger('focus', event); | |
| return self; | |
| }, | |
| open: function() { | |
| if (this._isOpen) { return; } | |
| var self = this, | |
| options = self.options, | |
| uiDialog = self.uiDialog; | |
| self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; | |
| self._size(); | |
| self._position(options.position); | |
| uiDialog.show(options.show); | |
| self.moveToTop(true); | |
| // prevent tabbing out of modal dialogs | |
| if ( options.modal ) { | |
| uiDialog.bind( "keydown.ui-dialog", function( event ) { | |
| if ( event.keyCode !== $.ui.keyCode.TAB ) { | |
| return; | |
| } | |
| var tabbables = $(':tabbable', this), | |
| first = tabbables.filter(':first'), | |
| last = tabbables.filter(':last'); | |
| if (event.target === last[0] && !event.shiftKey) { | |
| first.focus(1); | |
| return false; | |
| } else if (event.target === first[0] && event.shiftKey) { | |
| last.focus(1); | |
| return false; | |
| } | |
| }); | |
| } | |
| // set focus to the first tabbable element in the content area or the first button | |
| // if there are no tabbable elements, set focus on the dialog itself | |
| $(self.element.find(':tabbable').get().concat( | |
| uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( | |
| uiDialog.get()))).eq(0).focus(); | |
| self._isOpen = true; | |
| self._trigger('open'); | |
| return self; | |
| }, | |
| _createButtons: function(buttons) { | |
| var self = this, | |
| hasButtons = false, | |
| uiDialogButtonPane = $('<div></div>') | |
| .addClass( | |
| 'ui-dialog-buttonpane ' + | |
| 'ui-widget-content ' + | |
| 'ui-helper-clearfix' | |
| ), | |
| uiButtonSet = $( "<div></div>" ) | |
| .addClass( "ui-dialog-buttonset" ) | |
| .appendTo( uiDialogButtonPane ); | |
| // if we already have a button pane, remove it | |
| self.uiDialog.find('.ui-dialog-buttonpane').remove(); | |
| if (typeof buttons === 'object' && buttons !== null) { | |
| $.each(buttons, function() { | |
| return !(hasButtons = true); | |
| }); | |
| } | |
| if (hasButtons) { | |
| $.each(buttons, function(name, props) { | |
| props = $.isFunction( props ) ? | |
| { click: props, text: name } : | |
| props; | |
| var button = $('<button type="button"></button>') | |
| .click(function() { | |
| props.click.apply(self.element[0], arguments); | |
| }) | |
| .appendTo(uiButtonSet); | |
| // can't use .attr( props, true ) with jQuery 1.3.2. | |
| $.each( props, function( key, value ) { | |
| if ( key === "click" ) { | |
| return; | |
| } | |
| if ( key in attrFn ) { | |
| button[ key ]( value ); | |
| } else { | |
| button.attr( key, value ); | |
| } | |
| }); | |
| if ($.fn.button) { | |
| button.button(); | |
| } | |
| }); | |
| uiDialogButtonPane.appendTo(self.uiDialog); | |
| } | |
| }, | |
| _makeDraggable: function() { | |
| var self = this, | |
| options = self.options, | |
| doc = $(document), | |
| heightBeforeDrag; | |
| function filteredUi(ui) { | |
| return { | |
| position: ui.position, | |
| offset: ui.offset | |
| }; | |
| } | |
| self.uiDialog.draggable({ | |
| cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', | |
| handle: '.ui-dialog-titlebar', | |
| containment: 'document', | |
| start: function(event, ui) { | |
| heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); | |
| $(this).height($(this).height()).addClass("ui-dialog-dragging"); | |
| self._trigger('dragStart', event, filteredUi(ui)); | |
| }, | |
| drag: function(event, ui) { | |
| self._trigger('drag', event, filteredUi(ui)); | |
| }, | |
| stop: function(event, ui) { | |
| options.position = [ui.position.left - doc.scrollLeft(), | |
| ui.position.top - doc.scrollTop()]; | |
| $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); | |
| self._trigger('dragStop', event, filteredUi(ui)); | |
| $.ui.dialog.overlay.resize(); | |
| } | |
| }); | |
| }, | |
| _makeResizable: function(handles) { | |
| handles = (handles === undefined ? this.options.resizable : handles); | |
| var self = this, | |
| options = self.options, | |
| // .ui-resizable has position: relative defined in the stylesheet | |
| // but dialogs have to use absolute or fixed positioning | |
| position = self.uiDialog.css('position'), | |
| resizeHandles = (typeof handles === 'string' ? | |
| handles : | |
| 'n,e,s,w,se,sw,ne,nw' | |
| ); | |
| function filteredUi(ui) { | |
| return { | |
| originalPosition: ui.originalPosition, | |
| originalSize: ui.originalSize, | |
| position: ui.position, | |
| size: ui.size | |
| }; | |
| } | |
| self.uiDialog.resizable({ | |
| cancel: '.ui-dialog-content', | |
| containment: 'document', | |
| alsoResize: self.element, | |
| maxWidth: options.maxWidth, | |
| maxHeight: options.maxHeight, | |
| minWidth: options.minWidth, | |
| minHeight: self._minHeight(), | |
| handles: resizeHandles, | |
| start: function(event, ui) { | |
| $(this).addClass("ui-dialog-resizing"); | |
| self._trigger('resizeStart', event, filteredUi(ui)); | |
| }, | |
| resize: function(event, ui) { | |
| self._trigger('resize', event, filteredUi(ui)); | |
| }, | |
| stop: function(event, ui) { | |
| $(this).removeClass("ui-dialog-resizing"); | |
| options.height = $(this).height(); | |
| options.width = $(this).width(); | |
| self._trigger('resizeStop', event, filteredUi(ui)); | |
| $.ui.dialog.overlay.resize(); | |
| } | |
| }) | |
| .css('position', position) | |
| .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); | |
| }, | |
| _minHeight: function() { | |
| var options = this.options; | |
| if (options.height === 'auto') { | |
| return options.minHeight; | |
| } else { | |
| return Math.min(options.minHeight, options.height); | |
| } | |
| }, | |
| _position: function(position) { | |
| var myAt = [], | |
| offset = [0, 0], | |
| isVisible; | |
| if (position) { | |
| // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( | |
| // if (typeof position == 'string' || $.isArray(position)) { | |
| // myAt = $.isArray(position) ? position : position.split(' '); | |
| if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { | |
| myAt = position.split ? position.split(' ') : [position[0], position[1]]; | |
| if (myAt.length === 1) { | |
| myAt[1] = myAt[0]; | |
| } | |
| $.each(['left', 'top'], function(i, offsetPosition) { | |
| if (+myAt[i] === myAt[i]) { | |
| offset[i] = myAt[i]; | |
| myAt[i] = offsetPosition; | |
| } | |
| }); | |
| position = { | |
| my: myAt.join(" "), | |
| at: myAt.join(" "), | |
| offset: offset.join(" ") | |
| }; | |
| } | |
| position = $.extend({}, $.ui.dialog.prototype.options.position, position); | |
| } else { | |
| position = $.ui.dialog.prototype.options.position; | |
| } | |
| // need to show the dialog to get the actual offset in the position plugin | |
| isVisible = this.uiDialog.is(':visible'); | |
| if (!isVisible) { | |
| this.uiDialog.show(); | |
| } | |
| this.uiDialog | |
| // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 | |
| .css({ top: 0, left: 0 }) | |
| .position($.extend({ of: window }, position)); | |
| if (!isVisible) { | |
| this.uiDialog.hide(); | |
| } | |
| }, | |
| _setOptions: function( options ) { | |
| var self = this, | |
| resizableOptions = {}, | |
| resize = false; | |
| $.each( options, function( key, value ) { | |
| self._setOption( key, value ); | |
| if ( key in sizeRelatedOptions ) { | |
| resize = true; | |
| } | |
| if ( key in resizableRelatedOptions ) { | |
| resizableOptions[ key ] = value; | |
| } | |
| }); | |
| if ( resize ) { | |
| this._size(); | |
| } | |
| if ( this.uiDialog.is( ":data(resizable)" ) ) { | |
| this.uiDialog.resizable( "option", resizableOptions ); | |
| } | |
| }, | |
| _setOption: function(key, value){ | |
| var self = this, | |
| uiDialog = self.uiDialog; | |
| switch (key) { | |
| //handling of deprecated beforeclose (vs beforeClose) option | |
| //Ticket #4669 http://dev.jqueryui.com/ticket/4669 | |
| //TODO: remove in 1.9pre | |
| case "beforeclose": | |
| key = "beforeClose"; | |
| break; | |
| case "buttons": | |
| self._createButtons(value); | |
| break; | |
| case "closeText": | |
| // ensure that we always pass a string | |
| self.uiDialogTitlebarCloseText.text("" + value); | |
| break; | |
| case "dialogClass": | |
| uiDialog | |
| .removeClass(self.options.dialogClass) | |
| .addClass(uiDialogClasses + value); | |
| break; | |
| case "disabled": | |
| if (value) { | |
| uiDialog.addClass('ui-dialog-disabled'); | |
| } else { | |
| uiDialog.removeClass('ui-dialog-disabled'); | |
| } | |
| break; | |
| case "draggable": | |
| var isDraggable = uiDialog.is( ":data(draggable)" ); | |
| if ( isDraggable && !value ) { | |
| uiDialog.draggable( "destroy" ); | |
| } | |
| if ( !isDraggable && value ) { | |
| self._makeDraggable(); | |
| } | |
| break; | |
| case "position": | |
| self._position(value); | |
| break; | |
| case "resizable": | |
| // currently resizable, becoming non-resizable | |
| var isResizable = uiDialog.is( ":data(resizable)" ); | |
| if (isResizable && !value) { | |
| uiDialog.resizable('destroy'); | |
| } | |
| // currently resizable, changing handles | |
| if (isResizable && typeof value === 'string') { | |
| uiDialog.resizable('option', 'handles', value); | |
| } | |
| // currently non-resizable, becoming resizable | |
| if (!isResizable && value !== false) { | |
| self._makeResizable(value); | |
| } | |
| break; | |
| case "title": | |
| // convert whatever was passed in o a string, for html() to not throw up | |
| $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); | |
| break; | |
| } | |
| $.Widget.prototype._setOption.apply(self, arguments); | |
| }, | |
| _size: function() { | |
| /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content | |
| * divs will both have width and height set, so we need to reset them | |
| */ | |
| var options = this.options, | |
| nonContentHeight, | |
| minContentHeight, | |
| isVisible = this.uiDialog.is( ":visible" ); | |
| // reset content sizing | |
| this.element.show().css({ | |
| width: 'auto', | |
| minHeight: 0, | |
| height: 0 | |
| }); | |
| if (options.minWidth > options.width) { | |
| options.width = options.minWidth; | |
| } | |
| // reset wrapper sizing | |
| // determine the height of all the non-content elements | |
| nonContentHeight = this.uiDialog.css({ | |
| height: 'auto', | |
| width: options.width | |
| }) | |
| .height(); | |
| minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); | |
| if ( options.height === "auto" ) { | |
| // only needed for IE6 support | |
| if ( $.support.minHeight ) { | |
| this.element.css({ | |
| minHeight: minContentHeight, | |
| height: "auto" | |
| }); | |
| } else { | |
| this.uiDialog.show(); | |
| var autoHeight = this.element.css( "height", "auto" ).height(); | |
| if ( !isVisible ) { | |
| this.uiDialog.hide(); | |
| } | |
| this.element.height( Math.max( autoHeight, minContentHeight ) ); | |
| } | |
| } else { | |
| this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); | |
| } | |
| if (this.uiDialog.is(':data(resizable)')) { | |
| this.uiDialog.resizable('option', 'minHeight', this._minHeight()); | |
| } | |
| } | |
| }); | |
| $.extend($.ui.dialog, { | |
| version: "1.8.22", | |
| uuid: 0, | |
| maxZ: 0, | |
| getTitleId: function($el) { | |
| var id = $el.attr('id'); | |
| if (!id) { | |
| this.uuid += 1; | |
| id = this.uuid; | |
| } | |
| return 'ui-dialog-title-' + id; | |
| }, | |
| overlay: function(dialog) { | |
| this.$el = $.ui.dialog.overlay.create(dialog); | |
| } | |
| }); | |
| $.extend($.ui.dialog.overlay, { | |
| instances: [], | |
| // reuse old instances due to IE memory leak with alpha transparency (see #5185) | |
| oldInstances: [], | |
| maxZ: 0, | |
| events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), | |
| function(event) { return event + '.dialog-overlay'; }).join(' '), | |
| create: function(dialog) { | |
| if (this.instances.length === 0) { | |
| // prevent use of anchors and inputs | |
| // we use a setTimeout in case the overlay is created from an | |
| // event that we're going to be cancelling (see #2804) | |
| setTimeout(function() { | |
| // handle $(el).dialog().dialog('close') (see #4065) | |
| if ($.ui.dialog.overlay.instances.length) { | |
| $(document).bind($.ui.dialog.overlay.events, function(event) { | |
| // stop events if the z-index of the target is < the z-index of the overlay | |
| // we cannot return true when we don't want to cancel the event (#3523) | |
| if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { | |
| return false; | |
| } | |
| }); | |
| } | |
| }, 1); | |
| // allow closing by pressing the escape key | |
| $(document).bind('keydown.dialog-overlay', function(event) { | |
| if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && | |
| event.keyCode === $.ui.keyCode.ESCAPE) { | |
| dialog.close(event); | |
| event.preventDefault(); | |
| } | |
| }); | |
| // handle window resize | |
| $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); | |
| } | |
| var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay')) | |
| .appendTo(document.body) | |
| .css({ | |
| width: this.width(), | |
| height: this.height() | |
| }); | |
| if ($.fn.bgiframe) { | |
| $el.bgiframe(); | |
| } | |
| this.instances.push($el); | |
| return $el; | |
| }, | |
| destroy: function($el) { | |
| var indexOf = $.inArray($el, this.instances); | |
| if (indexOf != -1){ | |
| this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); | |
| } | |
| if (this.instances.length === 0) { | |
| $([document, window]).unbind('.dialog-overlay'); | |
| } | |
| $el.remove(); | |
| // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) | |
| var maxZ = 0; | |
| $.each(this.instances, function() { | |
| maxZ = Math.max(maxZ, this.css('z-index')); | |
| }); | |
| this.maxZ = maxZ; | |
| }, | |
| height: function() { | |
| var scrollHeight, | |
| offsetHeight; | |
| // handle IE 6 | |
| if ($.browser.msie && $.browser.version < 7) { | |
| scrollHeight = Math.max( | |
| document.documentElement.scrollHeight, | |
| document.body.scrollHeight | |
| ); | |
| offsetHeight = Math.max( | |
| document.documentElement.offsetHeight, | |
| document.body.offsetHeight | |
| ); | |
| if (scrollHeight < offsetHeight) { | |
| return $(window).height() + 'px'; | |
| } else { | |
| return scrollHeight + 'px'; | |
| } | |
| // handle "good" browsers | |
| } else { | |
| return $(document).height() + 'px'; | |
| } | |
| }, | |
| width: function() { | |
| var scrollWidth, | |
| offsetWidth; | |
| // handle IE | |
| if ( $.browser.msie ) { | |
| scrollWidth = Math.max( | |
| document.documentElement.scrollWidth, | |
| document.body.scrollWidth | |
| ); | |
| offsetWidth = Math.max( | |
| document.documentElement.offsetWidth, | |
| document.body.offsetWidth | |
| ); | |
| if (scrollWidth < offsetWidth) { | |
| return $(window).width() + 'px'; | |
| } else { | |
| return scrollWidth + 'px'; | |
| } | |
| // handle "good" browsers | |
| } else { | |
| return $(document).width() + 'px'; | |
| } | |
| }, | |
| resize: function() { | |
| /* If the dialog is draggable and the user drags it past the | |
| * right edge of the window, the document becomes wider so we | |
| * need to stretch the overlay. If the user then drags the | |
| * dialog back to the left, the document will become narrower, | |
| * so we need to shrink the overlay to the appropriate size. | |
| * This is handled by shrinking the overlay before setting it | |
| * to the full document size. | |
| */ | |
| var $overlays = $([]); | |
| $.each($.ui.dialog.overlay.instances, function() { | |
| $overlays = $overlays.add(this); | |
| }); | |
| $overlays.css({ | |
| width: 0, | |
| height: 0 | |
| }).css({ | |
| width: $.ui.dialog.overlay.width(), | |
| height: $.ui.dialog.overlay.height() | |
| }); | |
| } | |
| }); | |
| $.extend($.ui.dialog.overlay.prototype, { | |
| destroy: function() { | |
| $.ui.dialog.overlay.destroy(this.$el); | |
| } | |
| }); | |
| }(jQuery)); | |
| /*! | |
| * jQuery UI Slider 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Slider | |
| * | |
| * Depends: | |
| * jquery.ui.core.js | |
| * jquery.ui.mouse.js | |
| * jquery.ui.widget.js | |
| */ | |
| (function( $, undefined ) { | |
| // number of pages in a slider | |
| // (how many times can you page up/down to go through the whole range) | |
| var numPages = 5; | |
| $.widget( "ui.slider", $.ui.mouse, { | |
| widgetEventPrefix: "slide", | |
| options: { | |
| animate: false, | |
| distance: 0, | |
| max: 100, | |
| min: 0, | |
| orientation: "horizontal", | |
| range: false, | |
| step: 1, | |
| value: 0, | |
| values: null | |
| }, | |
| _create: function() { | |
| var self = this, | |
| o = this.options, | |
| existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), | |
| handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>", | |
| handleCount = ( o.values && o.values.length ) || 1, | |
| handles = []; | |
| this._keySliding = false; | |
| this._mouseSliding = false; | |
| this._animateOff = true; | |
| this._handleIndex = null; | |
| this._detectOrientation(); | |
| this._mouseInit(); | |
| this.element | |
| .addClass( "ui-slider" + | |
| " ui-slider-" + this.orientation + | |
| " ui-widget" + | |
| " ui-widget-content" + | |
| " ui-corner-all" + | |
| ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); | |
| this.range = $([]); | |
| if ( o.range ) { | |
| if ( o.range === true ) { | |
| if ( !o.values ) { | |
| o.values = [ this._valueMin(), this._valueMin() ]; | |
| } | |
| if ( o.values.length && o.values.length !== 2 ) { | |
| o.values = [ o.values[0], o.values[0] ]; | |
| } | |
| } | |
| this.range = $( "<div></div>" ) | |
| .appendTo( this.element ) | |
| .addClass( "ui-slider-range" + | |
| // note: this isn't the most fittingly semantic framework class for this element, | |
| // but worked best visually with a variety of themes | |
| " ui-widget-header" + | |
| ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); | |
| } | |
| for ( var i = existingHandles.length; i < handleCount; i += 1 ) { | |
| handles.push( handle ); | |
| } | |
| this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); | |
| this.handle = this.handles.eq( 0 ); | |
| this.handles.add( this.range ).filter( "a" ) | |
| .click(function( event ) { | |
| event.preventDefault(); | |
| }) | |
| .hover(function() { | |
| if ( !o.disabled ) { | |
| $( this ).addClass( "ui-state-hover" ); | |
| } | |
| }, function() { | |
| $( this ).removeClass( "ui-state-hover" ); | |
| }) | |
| .focus(function() { | |
| if ( !o.disabled ) { | |
| $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); | |
| $( this ).addClass( "ui-state-focus" ); | |
| } else { | |
| $( this ).blur(); | |
| } | |
| }) | |
| .blur(function() { | |
| $( this ).removeClass( "ui-state-focus" ); | |
| }); | |
| this.handles.each(function( i ) { | |
| $( this ).data( "index.ui-slider-handle", i ); | |
| }); | |
| this.handles | |
| .keydown(function( event ) { | |
| var index = $( this ).data( "index.ui-slider-handle" ), | |
| allowed, | |
| curVal, | |
| newVal, | |
| step; | |
| if ( self.options.disabled ) { | |
| return; | |
| } | |
| switch ( event.keyCode ) { | |
| case $.ui.keyCode.HOME: | |
| case $.ui.keyCode.END: | |
| case $.ui.keyCode.PAGE_UP: | |
| case $.ui.keyCode.PAGE_DOWN: | |
| case $.ui.keyCode.UP: | |
| case $.ui.keyCode.RIGHT: | |
| case $.ui.keyCode.DOWN: | |
| case $.ui.keyCode.LEFT: | |
| event.preventDefault(); | |
| if ( !self._keySliding ) { | |
| self._keySliding = true; | |
| $( this ).addClass( "ui-state-active" ); | |
| allowed = self._start( event, index ); | |
| if ( allowed === false ) { | |
| return; | |
| } | |
| } | |
| break; | |
| } | |
| step = self.options.step; | |
| if ( self.options.values && self.options.values.length ) { | |
| curVal = newVal = self.values( index ); | |
| } else { | |
| curVal = newVal = self.value(); | |
| } | |
| switch ( event.keyCode ) { | |
| case $.ui.keyCode.HOME: | |
| newVal = self._valueMin(); | |
| break; | |
| case $.ui.keyCode.END: | |
| newVal = self._valueMax(); | |
| break; | |
| case $.ui.keyCode.PAGE_UP: | |
| newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); | |
| break; | |
| case $.ui.keyCode.PAGE_DOWN: | |
| newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); | |
| break; | |
| case $.ui.keyCode.UP: | |
| case $.ui.keyCode.RIGHT: | |
| if ( curVal === self._valueMax() ) { | |
| return; | |
| } | |
| newVal = self._trimAlignValue( curVal + step ); | |
| break; | |
| case $.ui.keyCode.DOWN: | |
| case $.ui.keyCode.LEFT: | |
| if ( curVal === self._valueMin() ) { | |
| return; | |
| } | |
| newVal = self._trimAlignValue( curVal - step ); | |
| break; | |
| } | |
| self._slide( event, index, newVal ); | |
| }) | |
| .keyup(function( event ) { | |
| var index = $( this ).data( "index.ui-slider-handle" ); | |
| if ( self._keySliding ) { | |
| self._keySliding = false; | |
| self._stop( event, index ); | |
| self._change( event, index ); | |
| $( this ).removeClass( "ui-state-active" ); | |
| } | |
| }); | |
| this._refreshValue(); | |
| this._animateOff = false; | |
| }, | |
| destroy: function() { | |
| this.handles.remove(); | |
| this.range.remove(); | |
| this.element | |
| .removeClass( "ui-slider" + | |
| " ui-slider-horizontal" + | |
| " ui-slider-vertical" + | |
| " ui-slider-disabled" + | |
| " ui-widget" + | |
| " ui-widget-content" + | |
| " ui-corner-all" ) | |
| .removeData( "slider" ) | |
| .unbind( ".slider" ); | |
| this._mouseDestroy(); | |
| return this; | |
| }, | |
| _mouseCapture: function( event ) { | |
| var o = this.options, | |
| position, | |
| normValue, | |
| distance, | |
| closestHandle, | |
| self, | |
| index, | |
| allowed, | |
| offset, | |
| mouseOverHandle; | |
| if ( o.disabled ) { | |
| return false; | |
| } | |
| this.elementSize = { | |
| width: this.element.outerWidth(), | |
| height: this.element.outerHeight() | |
| }; | |
| this.elementOffset = this.element.offset(); | |
| position = { x: event.pageX, y: event.pageY }; | |
| normValue = this._normValueFromMouse( position ); | |
| distance = this._valueMax() - this._valueMin() + 1; | |
| self = this; | |
| this.handles.each(function( i ) { | |
| var thisDistance = Math.abs( normValue - self.values(i) ); | |
| if ( distance > thisDistance ) { | |
| distance = thisDistance; | |
| closestHandle = $( this ); | |
| index = i; | |
| } | |
| }); | |
| // workaround for bug #3736 (if both handles of a range are at 0, | |
| // the first is always used as the one with least distance, | |
| // and moving it is obviously prevented by preventing negative ranges) | |
| if( o.range === true && this.values(1) === o.min ) { | |
| index += 1; | |
| closestHandle = $( this.handles[index] ); | |
| } | |
| allowed = this._start( event, index ); | |
| if ( allowed === false ) { | |
| return false; | |
| } | |
| this._mouseSliding = true; | |
| self._handleIndex = index; | |
| closestHandle | |
| .addClass( "ui-state-active" ) | |
| .focus(); | |
| offset = closestHandle.offset(); | |
| mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); | |
| this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { | |
| left: event.pageX - offset.left - ( closestHandle.width() / 2 ), | |
| top: event.pageY - offset.top - | |
| ( closestHandle.height() / 2 ) - | |
| ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - | |
| ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + | |
| ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) | |
| }; | |
| if ( !this.handles.hasClass( "ui-state-hover" ) ) { | |
| this._slide( event, index, normValue ); | |
| } | |
| this._animateOff = true; | |
| return true; | |
| }, | |
| _mouseStart: function( event ) { | |
| return true; | |
| }, | |
| _mouseDrag: function( event ) { | |
| var position = { x: event.pageX, y: event.pageY }, | |
| normValue = this._normValueFromMouse( position ); | |
| this._slide( event, this._handleIndex, normValue ); | |
| return false; | |
| }, | |
| _mouseStop: function( event ) { | |
| this.handles.removeClass( "ui-state-active" ); | |
| this._mouseSliding = false; | |
| this._stop( event, this._handleIndex ); | |
| this._change( event, this._handleIndex ); | |
| this._handleIndex = null; | |
| this._clickOffset = null; | |
| this._animateOff = false; | |
| return false; | |
| }, | |
| _detectOrientation: function() { | |
| this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; | |
| }, | |
| _normValueFromMouse: function( position ) { | |
| var pixelTotal, | |
| pixelMouse, | |
| percentMouse, | |
| valueTotal, | |
| valueMouse; | |
| if ( this.orientation === "horizontal" ) { | |
| pixelTotal = this.elementSize.width; | |
| pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); | |
| } else { | |
| pixelTotal = this.elementSize.height; | |
| pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); | |
| } | |
| percentMouse = ( pixelMouse / pixelTotal ); | |
| if ( percentMouse > 1 ) { | |
| percentMouse = 1; | |
| } | |
| if ( percentMouse < 0 ) { | |
| percentMouse = 0; | |
| } | |
| if ( this.orientation === "vertical" ) { | |
| percentMouse = 1 - percentMouse; | |
| } | |
| valueTotal = this._valueMax() - this._valueMin(); | |
| valueMouse = this._valueMin() + percentMouse * valueTotal; | |
| return this._trimAlignValue( valueMouse ); | |
| }, | |
| _start: function( event, index ) { | |
| var uiHash = { | |
| handle: this.handles[ index ], | |
| value: this.value() | |
| }; | |
| if ( this.options.values && this.options.values.length ) { | |
| uiHash.value = this.values( index ); | |
| uiHash.values = this.values(); | |
| } | |
| return this._trigger( "start", event, uiHash ); | |
| }, | |
| _slide: function( event, index, newVal ) { | |
| var otherVal, | |
| newValues, | |
| allowed; | |
| if ( this.options.values && this.options.values.length ) { | |
| otherVal = this.values( index ? 0 : 1 ); | |
| if ( ( this.options.values.length === 2 && this.options.range === true ) && | |
| ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) | |
| ) { | |
| newVal = otherVal; | |
| } | |
| if ( newVal !== this.values( index ) ) { | |
| newValues = this.values(); | |
| newValues[ index ] = newVal; | |
| // A slide can be canceled by returning false from the slide callback | |
| allowed = this._trigger( "slide", event, { | |
| handle: this.handles[ index ], | |
| value: newVal, | |
| values: newValues | |
| } ); | |
| otherVal = this.values( index ? 0 : 1 ); | |
| if ( allowed !== false ) { | |
| this.values( index, newVal, true ); | |
| } | |
| } | |
| } else { | |
| if ( newVal !== this.value() ) { | |
| // A slide can be canceled by returning false from the slide callback | |
| allowed = this._trigger( "slide", event, { | |
| handle: this.handles[ index ], | |
| value: newVal | |
| } ); | |
| if ( allowed !== false ) { | |
| this.value( newVal ); | |
| } | |
| } | |
| } | |
| }, | |
| _stop: function( event, index ) { | |
| var uiHash = { | |
| handle: this.handles[ index ], | |
| value: this.value() | |
| }; | |
| if ( this.options.values && this.options.values.length ) { | |
| uiHash.value = this.values( index ); | |
| uiHash.values = this.values(); | |
| } | |
| this._trigger( "stop", event, uiHash ); | |
| }, | |
| _change: function( event, index ) { | |
| if ( !this._keySliding && !this._mouseSliding ) { | |
| var uiHash = { | |
| handle: this.handles[ index ], | |
| value: this.value() | |
| }; | |
| if ( this.options.values && this.options.values.length ) { | |
| uiHash.value = this.values( index ); | |
| uiHash.values = this.values(); | |
| } | |
| this._trigger( "change", event, uiHash ); | |
| } | |
| }, | |
| value: function( newValue ) { | |
| if ( arguments.length ) { | |
| this.options.value = this._trimAlignValue( newValue ); | |
| this._refreshValue(); | |
| this._change( null, 0 ); | |
| return; | |
| } | |
| return this._value(); | |
| }, | |
| values: function( index, newValue ) { | |
| var vals, | |
| newValues, | |
| i; | |
| if ( arguments.length > 1 ) { | |
| this.options.values[ index ] = this._trimAlignValue( newValue ); | |
| this._refreshValue(); | |
| this._change( null, index ); | |
| return; | |
| } | |
| if ( arguments.length ) { | |
| if ( $.isArray( arguments[ 0 ] ) ) { | |
| vals = this.options.values; | |
| newValues = arguments[ 0 ]; | |
| for ( i = 0; i < vals.length; i += 1 ) { | |
| vals[ i ] = this._trimAlignValue( newValues[ i ] ); | |
| this._change( null, i ); | |
| } | |
| this._refreshValue(); | |
| } else { | |
| if ( this.options.values && this.options.values.length ) { | |
| return this._values( index ); | |
| } else { | |
| return this.value(); | |
| } | |
| } | |
| } else { | |
| return this._values(); | |
| } | |
| }, | |
| _setOption: function( key, value ) { | |
| var i, | |
| valsLength = 0; | |
| if ( $.isArray( this.options.values ) ) { | |
| valsLength = this.options.values.length; | |
| } | |
| $.Widget.prototype._setOption.apply( this, arguments ); | |
| switch ( key ) { | |
| case "disabled": | |
| if ( value ) { | |
| this.handles.filter( ".ui-state-focus" ).blur(); | |
| this.handles.removeClass( "ui-state-hover" ); | |
| this.handles.propAttr( "disabled", true ); | |
| this.element.addClass( "ui-disabled" ); | |
| } else { | |
| this.handles.propAttr( "disabled", false ); | |
| this.element.removeClass( "ui-disabled" ); | |
| } | |
| break; | |
| case "orientation": | |
| this._detectOrientation(); | |
| this.element | |
| .removeClass( "ui-slider-horizontal ui-slider-vertical" ) | |
| .addClass( "ui-slider-" + this.orientation ); | |
| this._refreshValue(); | |
| break; | |
| case "value": | |
| this._animateOff = true; | |
| this._refreshValue(); | |
| this._change( null, 0 ); | |
| this._animateOff = false; | |
| break; | |
| case "values": | |
| this._animateOff = true; | |
| this._refreshValue(); | |
| for ( i = 0; i < valsLength; i += 1 ) { | |
| this._change( null, i ); | |
| } | |
| this._animateOff = false; | |
| break; | |
| } | |
| }, | |
| //internal value getter | |
| // _value() returns value trimmed by min and max, aligned by step | |
| _value: function() { | |
| var val = this.options.value; | |
| val = this._trimAlignValue( val ); | |
| return val; | |
| }, | |
| //internal values getter | |
| // _values() returns array of values trimmed by min and max, aligned by step | |
| // _values( index ) returns single value trimmed by min and max, aligned by step | |
| _values: function( index ) { | |
| var val, | |
| vals, | |
| i; | |
| if ( arguments.length ) { | |
| val = this.options.values[ index ]; | |
| val = this._trimAlignValue( val ); | |
| return val; | |
| } else { | |
| // .slice() creates a copy of the array | |
| // this copy gets trimmed by min and max and then returned | |
| vals = this.options.values.slice(); | |
| for ( i = 0; i < vals.length; i+= 1) { | |
| vals[ i ] = this._trimAlignValue( vals[ i ] ); | |
| } | |
| return vals; | |
| } | |
| }, | |
| // returns the step-aligned value that val is closest to, between (inclusive) min and max | |
| _trimAlignValue: function( val ) { | |
| if ( val <= this._valueMin() ) { | |
| return this._valueMin(); | |
| } | |
| if ( val >= this._valueMax() ) { | |
| return this._valueMax(); | |
| } | |
| var step = ( this.options.step > 0 ) ? this.options.step : 1, | |
| valModStep = (val - this._valueMin()) % step, | |
| alignValue = val - valModStep; | |
| if ( Math.abs(valModStep) * 2 >= step ) { | |
| alignValue += ( valModStep > 0 ) ? step : ( -step ); | |
| } | |
| // Since JavaScript has problems with large floats, round | |
| // the final value to 5 digits after the decimal point (see #4124) | |
| return parseFloat( alignValue.toFixed(5) ); | |
| }, | |
| _valueMin: function() { | |
| return this.options.min; | |
| }, | |
| _valueMax: function() { | |
| return this.options.max; | |
| }, | |
| _refreshValue: function() { | |
| var oRange = this.options.range, | |
| o = this.options, | |
| self = this, | |
| animate = ( !this._animateOff ) ? o.animate : false, | |
| valPercent, | |
| _set = {}, | |
| lastValPercent, | |
| value, | |
| valueMin, | |
| valueMax; | |
| if ( this.options.values && this.options.values.length ) { | |
| this.handles.each(function( i, j ) { | |
| valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; | |
| _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; | |
| $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); | |
| if ( self.options.range === true ) { | |
| if ( self.orientation === "horizontal" ) { | |
| if ( i === 0 ) { | |
| self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); | |
| } | |
| if ( i === 1 ) { | |
| self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); | |
| } | |
| } else { | |
| if ( i === 0 ) { | |
| self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); | |
| } | |
| if ( i === 1 ) { | |
| self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); | |
| } | |
| } | |
| } | |
| lastValPercent = valPercent; | |
| }); | |
| } else { | |
| value = this.value(); | |
| valueMin = this._valueMin(); | |
| valueMax = this._valueMax(); | |
| valPercent = ( valueMax !== valueMin ) ? | |
| ( value - valueMin ) / ( valueMax - valueMin ) * 100 : | |
| 0; | |
| _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; | |
| this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); | |
| if ( oRange === "min" && this.orientation === "horizontal" ) { | |
| this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); | |
| } | |
| if ( oRange === "max" && this.orientation === "horizontal" ) { | |
| this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); | |
| } | |
| if ( oRange === "min" && this.orientation === "vertical" ) { | |
| this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); | |
| } | |
| if ( oRange === "max" && this.orientation === "vertical" ) { | |
| this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); | |
| } | |
| } | |
| } | |
| }); | |
| $.extend( $.ui.slider, { | |
| version: "1.8.22" | |
| }); | |
| }(jQuery)); | |
| /*! | |
| * jQuery UI Tabs 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Tabs | |
| * | |
| * Depends: | |
| * jquery.ui.core.js | |
| * jquery.ui.widget.js | |
| */ | |
| (function( $, undefined ) { | |
| var tabId = 0, | |
| listId = 0; | |
| function getNextTabId() { | |
| return ++tabId; | |
| } | |
| function getNextListId() { | |
| return ++listId; | |
| } | |
| $.widget( "ui.tabs", { | |
| options: { | |
| add: null, | |
| ajaxOptions: null, | |
| cache: false, | |
| cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } | |
| collapsible: false, | |
| disable: null, | |
| disabled: [], | |
| enable: null, | |
| event: "click", | |
| fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } | |
| idPrefix: "ui-tabs-", | |
| load: null, | |
| panelTemplate: "<div></div>", | |
| remove: null, | |
| select: null, | |
| show: null, | |
| spinner: "<em>Loading…</em>", | |
| tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>" | |
| }, | |
| _create: function() { | |
| this._tabify( true ); | |
| }, | |
| _setOption: function( key, value ) { | |
| if ( key == "selected" ) { | |
| if (this.options.collapsible && value == this.options.selected ) { | |
| return; | |
| } | |
| this.select( value ); | |
| } else { | |
| this.options[ key ] = value; | |
| this._tabify(); | |
| } | |
| }, | |
| _tabId: function( a ) { | |
| return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || | |
| this.options.idPrefix + getNextTabId(); | |
| }, | |
| _sanitizeSelector: function( hash ) { | |
| // we need this because an id may contain a ":" | |
| return hash.replace( /:/g, "\\:" ); | |
| }, | |
| _cookie: function() { | |
| var cookie = this.cookie || | |
| ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); | |
| return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); | |
| }, | |
| _ui: function( tab, panel ) { | |
| return { | |
| tab: tab, | |
| panel: panel, | |
| index: this.anchors.index( tab ) | |
| }; | |
| }, | |
| _cleanup: function() { | |
| // restore all former loading tabs labels | |
| this.lis.filter( ".ui-state-processing" ) | |
| .removeClass( "ui-state-processing" ) | |
| .find( "span:data(label.tabs)" ) | |
| .each(function() { | |
| var el = $( this ); | |
| el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); | |
| }); | |
| }, | |
| _tabify: function( init ) { | |
| var self = this, | |
| o = this.options, | |
| fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash | |
| this.list = this.element.find( "ol,ul" ).eq( 0 ); | |
| this.lis = $( " > li:has(a[href])", this.list ); | |
| this.anchors = this.lis.map(function() { | |
| return $( "a", this )[ 0 ]; | |
| }); | |
| this.panels = $( [] ); | |
| this.anchors.each(function( i, a ) { | |
| var href = $( a ).attr( "href" ); | |
| // For dynamically created HTML that contains a hash as href IE < 8 expands | |
| // such href to the full page url with hash and then misinterprets tab as ajax. | |
| // Same consideration applies for an added tab with a fragment identifier | |
| // since a[href=#fragment-identifier] does unexpectedly not match. | |
| // Thus normalize href attribute... | |
| var hrefBase = href.split( "#" )[ 0 ], | |
| baseEl; | |
| if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || | |
| ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { | |
| href = a.hash; | |
| a.href = href; | |
| } | |
| // inline tab | |
| if ( fragmentId.test( href ) ) { | |
| self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); | |
| // remote tab | |
| // prevent loading the page itself if href is just "#" | |
| } else if ( href && href !== "#" ) { | |
| // required for restore on destroy | |
| $.data( a, "href.tabs", href ); | |
| // TODO until #3808 is fixed strip fragment identifier from url | |
| // (IE fails to load from such url) | |
| $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); | |
| var id = self._tabId( a ); | |
| a.href = "#" + id; | |
| var $panel = self.element.find( "#" + id ); | |
| if ( !$panel.length ) { | |
| $panel = $( o.panelTemplate ) | |
| .attr( "id", id ) | |
| .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) | |
| .insertAfter( self.panels[ i - 1 ] || self.list ); | |
| $panel.data( "destroy.tabs", true ); | |
| } | |
| self.panels = self.panels.add( $panel ); | |
| // invalid tab href | |
| } else { | |
| o.disabled.push( i ); | |
| } | |
| }); | |
| // initialization from scratch | |
| if ( init ) { | |
| // attach necessary classes for styling | |
| this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); | |
| this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); | |
| this.lis.addClass( "ui-state-default ui-corner-top" ); | |
| this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); | |
| // Selected tab | |
| // use "selected" option or try to retrieve: | |
| // 1. from fragment identifier in url | |
| // 2. from cookie | |
| // 3. from selected class attribute on <li> | |
| if ( o.selected === undefined ) { | |
| if ( location.hash ) { | |
| this.anchors.each(function( i, a ) { | |
| if ( a.hash == location.hash ) { | |
| o.selected = i; | |
| return false; | |
| } | |
| }); | |
| } | |
| if ( typeof o.selected !== "number" && o.cookie ) { | |
| o.selected = parseInt( self._cookie(), 10 ); | |
| } | |
| if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { | |
| o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); | |
| } | |
| o.selected = o.selected || ( this.lis.length ? 0 : -1 ); | |
| } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release | |
| o.selected = -1; | |
| } | |
| // sanity check - default to first tab... | |
| o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) | |
| ? o.selected | |
| : 0; | |
| // Take disabling tabs via class attribute from HTML | |
| // into account and update option properly. | |
| // A selected tab cannot become disabled. | |
| o.disabled = $.unique( o.disabled.concat( | |
| $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { | |
| return self.lis.index( n ); | |
| }) | |
| ) ).sort(); | |
| if ( $.inArray( o.selected, o.disabled ) != -1 ) { | |
| o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); | |
| } | |
| // highlight selected tab | |
| this.panels.addClass( "ui-tabs-hide" ); | |
| this.lis.removeClass( "ui-tabs-selected ui-state-active" ); | |
| // check for length avoids error when initializing empty list | |
| if ( o.selected >= 0 && this.anchors.length ) { | |
| self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); | |
| this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); | |
| // seems to be expected behavior that the show callback is fired | |
| self.element.queue( "tabs", function() { | |
| self._trigger( "show", null, | |
| self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); | |
| }); | |
| this.load( o.selected ); | |
| } | |
| // clean up to avoid memory leaks in certain versions of IE 6 | |
| // TODO: namespace this event | |
| $( window ).bind( "unload", function() { | |
| self.lis.add( self.anchors ).unbind( ".tabs" ); | |
| self.lis = self.anchors = self.panels = null; | |
| }); | |
| // update selected after add/remove | |
| } else { | |
| o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); | |
| } | |
| // update collapsible | |
| // TODO: use .toggleClass() | |
| this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); | |
| // set or update cookie after init and add/remove respectively | |
| if ( o.cookie ) { | |
| this._cookie( o.selected, o.cookie ); | |
| } | |
| // disable tabs | |
| for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { | |
| $( li )[ $.inArray( i, o.disabled ) != -1 && | |
| // TODO: use .toggleClass() | |
| !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); | |
| } | |
| // reset cache if switching from cached to not cached | |
| if ( o.cache === false ) { | |
| this.anchors.removeData( "cache.tabs" ); | |
| } | |
| // remove all handlers before, tabify may run on existing tabs after add or option change | |
| this.lis.add( this.anchors ).unbind( ".tabs" ); | |
| if ( o.event !== "mouseover" ) { | |
| var addState = function( state, el ) { | |
| if ( el.is( ":not(.ui-state-disabled)" ) ) { | |
| el.addClass( "ui-state-" + state ); | |
| } | |
| }; | |
| var removeState = function( state, el ) { | |
| el.removeClass( "ui-state-" + state ); | |
| }; | |
| this.lis.bind( "mouseover.tabs" , function() { | |
| addState( "hover", $( this ) ); | |
| }); | |
| this.lis.bind( "mouseout.tabs", function() { | |
| removeState( "hover", $( this ) ); | |
| }); | |
| this.anchors.bind( "focus.tabs", function() { | |
| addState( "focus", $( this ).closest( "li" ) ); | |
| }); | |
| this.anchors.bind( "blur.tabs", function() { | |
| removeState( "focus", $( this ).closest( "li" ) ); | |
| }); | |
| } | |
| // set up animations | |
| var hideFx, showFx; | |
| if ( o.fx ) { | |
| if ( $.isArray( o.fx ) ) { | |
| hideFx = o.fx[ 0 ]; | |
| showFx = o.fx[ 1 ]; | |
| } else { | |
| hideFx = showFx = o.fx; | |
| } | |
| } | |
| // Reset certain styles left over from animation | |
| // and prevent IE's ClearType bug... | |
| function resetStyle( $el, fx ) { | |
| $el.css( "display", "" ); | |
| if ( !$.support.opacity && fx.opacity ) { | |
| $el[ 0 ].style.removeAttribute( "filter" ); | |
| } | |
| } | |
| // Show a tab... | |
| var showTab = showFx | |
| ? function( clicked, $show ) { | |
| $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); | |
| $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way | |
| .animate( showFx, showFx.duration || "normal", function() { | |
| resetStyle( $show, showFx ); | |
| self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); | |
| }); | |
| } | |
| : function( clicked, $show ) { | |
| $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); | |
| $show.removeClass( "ui-tabs-hide" ); | |
| self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); | |
| }; | |
| // Hide a tab, $show is optional... | |
| var hideTab = hideFx | |
| ? function( clicked, $hide ) { | |
| $hide.animate( hideFx, hideFx.duration || "normal", function() { | |
| self.lis.removeClass( "ui-tabs-selected ui-state-active" ); | |
| $hide.addClass( "ui-tabs-hide" ); | |
| resetStyle( $hide, hideFx ); | |
| self.element.dequeue( "tabs" ); | |
| }); | |
| } | |
| : function( clicked, $hide, $show ) { | |
| self.lis.removeClass( "ui-tabs-selected ui-state-active" ); | |
| $hide.addClass( "ui-tabs-hide" ); | |
| self.element.dequeue( "tabs" ); | |
| }; | |
| // attach tab event handler, unbind to avoid duplicates from former tabifying... | |
| this.anchors.bind( o.event + ".tabs", function() { | |
| var el = this, | |
| $li = $(el).closest( "li" ), | |
| $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), | |
| $show = self.element.find( self._sanitizeSelector( el.hash ) ); | |
| // If tab is already selected and not collapsible or tab disabled or | |
| // or is already loading or click callback returns false stop here. | |
| // Check if click handler returns false last so that it is not executed | |
| // for a disabled or loading tab! | |
| if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || | |
| $li.hasClass( "ui-state-disabled" ) || | |
| $li.hasClass( "ui-state-processing" ) || | |
| self.panels.filter( ":animated" ).length || | |
| self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { | |
| this.blur(); | |
| return false; | |
| } | |
| o.selected = self.anchors.index( this ); | |
| self.abort(); | |
| // if tab may be closed | |
| if ( o.collapsible ) { | |
| if ( $li.hasClass( "ui-tabs-selected" ) ) { | |
| o.selected = -1; | |
| if ( o.cookie ) { | |
| self._cookie( o.selected, o.cookie ); | |
| } | |
| self.element.queue( "tabs", function() { | |
| hideTab( el, $hide ); | |
| }).dequeue( "tabs" ); | |
| this.blur(); | |
| return false; | |
| } else if ( !$hide.length ) { | |
| if ( o.cookie ) { | |
| self._cookie( o.selected, o.cookie ); | |
| } | |
| self.element.queue( "tabs", function() { | |
| showTab( el, $show ); | |
| }); | |
| // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 | |
| self.load( self.anchors.index( this ) ); | |
| this.blur(); | |
| return false; | |
| } | |
| } | |
| if ( o.cookie ) { | |
| self._cookie( o.selected, o.cookie ); | |
| } | |
| // show new tab | |
| if ( $show.length ) { | |
| if ( $hide.length ) { | |
| self.element.queue( "tabs", function() { | |
| hideTab( el, $hide ); | |
| }); | |
| } | |
| self.element.queue( "tabs", function() { | |
| showTab( el, $show ); | |
| }); | |
| self.load( self.anchors.index( this ) ); | |
| } else { | |
| throw "jQuery UI Tabs: Mismatching fragment identifier."; | |
| } | |
| // Prevent IE from keeping other link focussed when using the back button | |
| // and remove dotted border from clicked link. This is controlled via CSS | |
| // in modern browsers; blur() removes focus from address bar in Firefox | |
| // which can become a usability and annoying problem with tabs('rotate'). | |
| if ( $.browser.msie ) { | |
| this.blur(); | |
| } | |
| }); | |
| // disable click in any case | |
| this.anchors.bind( "click.tabs", function(){ | |
| return false; | |
| }); | |
| }, | |
| _getIndex: function( index ) { | |
| // meta-function to give users option to provide a href string instead of a numerical index. | |
| // also sanitizes numerical indexes to valid values. | |
| if ( typeof index == "string" ) { | |
| index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); | |
| } | |
| return index; | |
| }, | |
| destroy: function() { | |
| var o = this.options; | |
| this.abort(); | |
| this.element | |
| .unbind( ".tabs" ) | |
| .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) | |
| .removeData( "tabs" ); | |
| this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); | |
| this.anchors.each(function() { | |
| var href = $.data( this, "href.tabs" ); | |
| if ( href ) { | |
| this.href = href; | |
| } | |
| var $this = $( this ).unbind( ".tabs" ); | |
| $.each( [ "href", "load", "cache" ], function( i, prefix ) { | |
| $this.removeData( prefix + ".tabs" ); | |
| }); | |
| }); | |
| this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { | |
| if ( $.data( this, "destroy.tabs" ) ) { | |
| $( this ).remove(); | |
| } else { | |
| $( this ).removeClass([ | |
| "ui-state-default", | |
| "ui-corner-top", | |
| "ui-tabs-selected", | |
| "ui-state-active", | |
| "ui-state-hover", | |
| "ui-state-focus", | |
| "ui-state-disabled", | |
| "ui-tabs-panel", | |
| "ui-widget-content", | |
| "ui-corner-bottom", | |
| "ui-tabs-hide" | |
| ].join( " " ) ); | |
| } | |
| }); | |
| if ( o.cookie ) { | |
| this._cookie( null, o.cookie ); | |
| } | |
| return this; | |
| }, | |
| add: function( url, label, index ) { | |
| if ( index === undefined ) { | |
| index = this.anchors.length; | |
| } | |
| var self = this, | |
| o = this.options, | |
| $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), | |
| id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); | |
| $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); | |
| // try to find an existing element before creating a new one | |
| var $panel = self.element.find( "#" + id ); | |
| if ( !$panel.length ) { | |
| $panel = $( o.panelTemplate ) | |
| .attr( "id", id ) | |
| .data( "destroy.tabs", true ); | |
| } | |
| $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); | |
| if ( index >= this.lis.length ) { | |
| $li.appendTo( this.list ); | |
| $panel.appendTo( this.list[ 0 ].parentNode ); | |
| } else { | |
| $li.insertBefore( this.lis[ index ] ); | |
| $panel.insertBefore( this.panels[ index ] ); | |
| } | |
| o.disabled = $.map( o.disabled, function( n, i ) { | |
| return n >= index ? ++n : n; | |
| }); | |
| this._tabify(); | |
| if ( this.anchors.length == 1 ) { | |
| o.selected = 0; | |
| $li.addClass( "ui-tabs-selected ui-state-active" ); | |
| $panel.removeClass( "ui-tabs-hide" ); | |
| this.element.queue( "tabs", function() { | |
| self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); | |
| }); | |
| this.load( 0 ); | |
| } | |
| this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); | |
| return this; | |
| }, | |
| remove: function( index ) { | |
| index = this._getIndex( index ); | |
| var o = this.options, | |
| $li = this.lis.eq( index ).remove(), | |
| $panel = this.panels.eq( index ).remove(); | |
| // If selected tab was removed focus tab to the right or | |
| // in case the last tab was removed the tab to the left. | |
| if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { | |
| this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); | |
| } | |
| o.disabled = $.map( | |
| $.grep( o.disabled, function(n, i) { | |
| return n != index; | |
| }), | |
| function( n, i ) { | |
| return n >= index ? --n : n; | |
| }); | |
| this._tabify(); | |
| this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); | |
| return this; | |
| }, | |
| enable: function( index ) { | |
| index = this._getIndex( index ); | |
| var o = this.options; | |
| if ( $.inArray( index, o.disabled ) == -1 ) { | |
| return; | |
| } | |
| this.lis.eq( index ).removeClass( "ui-state-disabled" ); | |
| o.disabled = $.grep( o.disabled, function( n, i ) { | |
| return n != index; | |
| }); | |
| this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); | |
| return this; | |
| }, | |
| disable: function( index ) { | |
| index = this._getIndex( index ); | |
| var self = this, o = this.options; | |
| // cannot disable already selected tab | |
| if ( index != o.selected ) { | |
| this.lis.eq( index ).addClass( "ui-state-disabled" ); | |
| o.disabled.push( index ); | |
| o.disabled.sort(); | |
| this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); | |
| } | |
| return this; | |
| }, | |
| select: function( index ) { | |
| index = this._getIndex( index ); | |
| if ( index == -1 ) { | |
| if ( this.options.collapsible && this.options.selected != -1 ) { | |
| index = this.options.selected; | |
| } else { | |
| return this; | |
| } | |
| } | |
| this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); | |
| return this; | |
| }, | |
| load: function( index ) { | |
| index = this._getIndex( index ); | |
| var self = this, | |
| o = this.options, | |
| a = this.anchors.eq( index )[ 0 ], | |
| url = $.data( a, "load.tabs" ); | |
| this.abort(); | |
| // not remote or from cache | |
| if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { | |
| this.element.dequeue( "tabs" ); | |
| return; | |
| } | |
| // load remote from here on | |
| this.lis.eq( index ).addClass( "ui-state-processing" ); | |
| if ( o.spinner ) { | |
| var span = $( "span", a ); | |
| span.data( "label.tabs", span.html() ).html( o.spinner ); | |
| } | |
| this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { | |
| url: url, | |
| success: function( r, s ) { | |
| self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); | |
| // take care of tab labels | |
| self._cleanup(); | |
| if ( o.cache ) { | |
| $.data( a, "cache.tabs", true ); | |
| } | |
| self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); | |
| try { | |
| o.ajaxOptions.success( r, s ); | |
| } | |
| catch ( e ) {} | |
| }, | |
| error: function( xhr, s, e ) { | |
| // take care of tab labels | |
| self._cleanup(); | |
| self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); | |
| try { | |
| // Passing index avoid a race condition when this method is | |
| // called after the user has selected another tab. | |
| // Pass the anchor that initiated this request allows | |
| // loadError to manipulate the tab content panel via $(a.hash) | |
| o.ajaxOptions.error( xhr, s, index, a ); | |
| } | |
| catch ( e ) {} | |
| } | |
| } ) ); | |
| // last, so that load event is fired before show... | |
| self.element.dequeue( "tabs" ); | |
| return this; | |
| }, | |
| abort: function() { | |
| // stop possibly running animations | |
| this.element.queue( [] ); | |
| this.panels.stop( false, true ); | |
| // "tabs" queue must not contain more than two elements, | |
| // which are the callbacks for the latest clicked tab... | |
| this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); | |
| // terminate pending requests from other tabs | |
| if ( this.xhr ) { | |
| this.xhr.abort(); | |
| delete this.xhr; | |
| } | |
| // take care of tab labels | |
| this._cleanup(); | |
| return this; | |
| }, | |
| url: function( index, url ) { | |
| this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); | |
| return this; | |
| }, | |
| length: function() { | |
| return this.anchors.length; | |
| } | |
| }); | |
| $.extend( $.ui.tabs, { | |
| version: "1.8.22" | |
| }); | |
| /* | |
| * Tabs Extensions | |
| */ | |
| /* | |
| * Rotate | |
| */ | |
| $.extend( $.ui.tabs.prototype, { | |
| rotation: null, | |
| rotate: function( ms, continuing ) { | |
| var self = this, | |
| o = this.options; | |
| var rotate = self._rotate || ( self._rotate = function( e ) { | |
| clearTimeout( self.rotation ); | |
| self.rotation = setTimeout(function() { | |
| var t = o.selected; | |
| self.select( ++t < self.anchors.length ? t : 0 ); | |
| }, ms ); | |
| if ( e ) { | |
| e.stopPropagation(); | |
| } | |
| }); | |
| var stop = self._unrotate || ( self._unrotate = !continuing | |
| ? function(e) { | |
| if (e.clientX) { // in case of a true click | |
| self.rotate(null); | |
| } | |
| } | |
| : function( e ) { | |
| rotate(); | |
| }); | |
| // start rotation | |
| if ( ms ) { | |
| this.element.bind( "tabsshow", rotate ); | |
| this.anchors.bind( o.event + ".tabs", stop ); | |
| rotate(); | |
| // stop rotation | |
| } else { | |
| clearTimeout( self.rotation ); | |
| this.element.unbind( "tabsshow", rotate ); | |
| this.anchors.unbind( o.event + ".tabs", stop ); | |
| delete this._rotate; | |
| delete this._unrotate; | |
| } | |
| return this; | |
| } | |
| }); | |
| })( jQuery ); | |
| /*! | |
| * jQuery UI Datepicker 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Datepicker | |
| * | |
| * Depends: | |
| * jquery.ui.core.js | |
| */ | |
| (function( $, undefined ) { | |
| $.extend($.ui, { datepicker: { version: "1.8.22" } }); | |
| var PROP_NAME = 'datepicker'; | |
| var dpuuid = new Date().getTime(); | |
| var instActive; | |
| /* Date picker manager. | |
| Use the singleton instance of this class, $.datepicker, to interact with the date picker. | |
| Settings for (groups of) date pickers are maintained in an instance object, | |
| allowing multiple different settings on the same page. */ | |
| function Datepicker() { | |
| this.debug = false; // Change this to true to start debugging | |
| this._curInst = null; // The current instance in use | |
| this._keyEvent = false; // If the last event was a key event | |
| this._disabledInputs = []; // List of date picker inputs that have been disabled | |
| this._datepickerShowing = false; // True if the popup picker is showing , false if not | |
| this._inDialog = false; // True if showing within a "dialog", false if not | |
| this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division | |
| this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class | |
| this._appendClass = 'ui-datepicker-append'; // The name of the append marker class | |
| this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class | |
| this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class | |
| this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class | |
| this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class | |
| this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class | |
| this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class | |
| this.regional = []; // Available regional settings, indexed by language code | |
| this.regional[''] = { // Default regional settings | |
| closeText: 'Done', // Display text for close link | |
| prevText: 'Prev', // Display text for previous month link | |
| nextText: 'Next', // Display text for next month link | |
| currentText: 'Today', // Display text for current month link | |
| monthNames: ['January','February','March','April','May','June', | |
| 'July','August','September','October','November','December'], // Names of months for drop-down and formatting | |
| monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting | |
| dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting | |
| dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting | |
| dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday | |
| weekHeader: 'Wk', // Column header for week of the year | |
| dateFormat: 'mm/dd/yy', // See format options on parseDate | |
| firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... | |
| isRTL: false, // True if right-to-left language, false if left-to-right | |
| showMonthAfterYear: false, // True if the year select precedes month, false for month then year | |
| yearSuffix: '' // Additional text to append to the year in the month headers | |
| }; | |
| this._defaults = { // Global defaults for all the date picker instances | |
| showOn: 'focus', // 'focus' for popup on focus, | |
| // 'button' for trigger button, or 'both' for either | |
| showAnim: 'fadeIn', // Name of jQuery animation for popup | |
| showOptions: {}, // Options for enhanced animations | |
| defaultDate: null, // Used when field is blank: actual date, | |
| // +/-number for offset from today, null for today | |
| appendText: '', // Display text following the input box, e.g. showing the format | |
| buttonText: '...', // Text for trigger button | |
| buttonImage: '', // URL for trigger button image | |
| buttonImageOnly: false, // True if the image appears alone, false if it appears on a button | |
| hideIfNoPrevNext: false, // True to hide next/previous month links | |
| // if not applicable, false to just disable them | |
| navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links | |
| gotoCurrent: false, // True if today link goes back to current selection instead | |
| changeMonth: false, // True if month can be selected directly, false if only prev/next | |
| changeYear: false, // True if year can be selected directly, false if only prev/next | |
| yearRange: 'c-10:c+10', // Range of years to display in drop-down, | |
| // either relative to today's year (-nn:+nn), relative to currently displayed year | |
| // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) | |
| showOtherMonths: false, // True to show dates in other months, false to leave blank | |
| selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable | |
| showWeek: false, // True to show week of the year, false to not show it | |
| calculateWeek: this.iso8601Week, // How to calculate the week of the year, | |
| // takes a Date and returns the number of the week for it | |
| shortYearCutoff: '+10', // Short year values < this are in the current century, | |
| // > this are in the previous century, | |
| // string value starting with '+' for current year + value | |
| minDate: null, // The earliest selectable date, or null for no limit | |
| maxDate: null, // The latest selectable date, or null for no limit | |
| duration: 'fast', // Duration of display/closure | |
| beforeShowDay: null, // Function that takes a date and returns an array with | |
| // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '', | |
| // [2] = cell title (optional), e.g. $.datepicker.noWeekends | |
| beforeShow: null, // Function that takes an input field and | |
| // returns a set of custom settings for the date picker | |
| onSelect: null, // Define a callback function when a date is selected | |
| onChangeMonthYear: null, // Define a callback function when the month or year is changed | |
| onClose: null, // Define a callback function when the datepicker is closed | |
| numberOfMonths: 1, // Number of months to show at a time | |
| showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) | |
| stepMonths: 1, // Number of months to step back/forward | |
| stepBigMonths: 12, // Number of months to step back/forward for the big links | |
| altField: '', // Selector for an alternate field to store selected dates into | |
| altFormat: '', // The date format to use for the alternate field | |
| constrainInput: true, // The input is constrained by the current date format | |
| showButtonPanel: false, // True to show button panel, false to not show it | |
| autoSize: false, // True to size the input for the date format, false to leave as is | |
| disabled: false // The initial disabled state | |
| }; | |
| $.extend(this._defaults, this.regional['']); | |
| this.dpDiv = bindHover($('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')); | |
| } | |
| $.extend(Datepicker.prototype, { | |
| /* Class name added to elements to indicate already configured with a date picker. */ | |
| markerClassName: 'hasDatepicker', | |
| //Keep track of the maximum number of rows displayed (see #7043) | |
| maxRows: 4, | |
| /* Debug logging (if enabled). */ | |
| log: function () { | |
| if (this.debug) | |
| console.log.apply('', arguments); | |
| }, | |
| // TODO rename to "widget" when switching to widget factory | |
| _widgetDatepicker: function() { | |
| return this.dpDiv; | |
| }, | |
| /* Override the default settings for all instances of the date picker. | |
| @param settings object - the new settings to use as defaults (anonymous object) | |
| @return the manager object */ | |
| setDefaults: function(settings) { | |
| extendRemove(this._defaults, settings || {}); | |
| return this; | |
| }, | |
| /* Attach the date picker to a jQuery selection. | |
| @param target element - the target input field or division or span | |
| @param settings object - the new settings to use for this date picker instance (anonymous) */ | |
| _attachDatepicker: function(target, settings) { | |
| // check for settings on the control itself - in namespace 'date:' | |
| var inlineSettings = null; | |
| for (var attrName in this._defaults) { | |
| var attrValue = target.getAttribute('date:' + attrName); | |
| if (attrValue) { | |
| inlineSettings = inlineSettings || {}; | |
| try { | |
| inlineSettings[attrName] = eval(attrValue); | |
| } catch (err) { | |
| inlineSettings[attrName] = attrValue; | |
| } | |
| } | |
| } | |
| var nodeName = target.nodeName.toLowerCase(); | |
| var inline = (nodeName == 'div' || nodeName == 'span'); | |
| if (!target.id) { | |
| this.uuid += 1; | |
| target.id = 'dp' + this.uuid; | |
| } | |
| var inst = this._newInst($(target), inline); | |
| inst.settings = $.extend({}, settings || {}, inlineSettings || {}); | |
| if (nodeName == 'input') { | |
| this._connectDatepicker(target, inst); | |
| } else if (inline) { | |
| this._inlineDatepicker(target, inst); | |
| } | |
| }, | |
| /* Create a new instance object. */ | |
| _newInst: function(target, inline) { | |
| var id = target[0].id.replace(/([^A-Za-z0-9_-])/g, '\\\\$1'); // escape jQuery meta chars | |
| return {id: id, input: target, // associated target | |
| selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection | |
| drawMonth: 0, drawYear: 0, // month being drawn | |
| inline: inline, // is datepicker inline or not | |
| dpDiv: (!inline ? this.dpDiv : // presentation div | |
| bindHover($('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')))}; | |
| }, | |
| /* Attach the date picker to an input field. */ | |
| _connectDatepicker: function(target, inst) { | |
| var input = $(target); | |
| inst.append = $([]); | |
| inst.trigger = $([]); | |
| if (input.hasClass(this.markerClassName)) | |
| return; | |
| this._attachments(input, inst); | |
| input.addClass(this.markerClassName).keydown(this._doKeyDown). | |
| keypress(this._doKeyPress).keyup(this._doKeyUp). | |
| bind("setData.datepicker", function(event, key, value) { | |
| inst.settings[key] = value; | |
| }).bind("getData.datepicker", function(event, key) { | |
| return this._get(inst, key); | |
| }); | |
| this._autoSize(inst); | |
| $.data(target, PROP_NAME, inst); | |
| //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) | |
| if( inst.settings.disabled ) { | |
| this._disableDatepicker( target ); | |
| } | |
| }, | |
| /* Make attachments based on settings. */ | |
| _attachments: function(input, inst) { | |
| var appendText = this._get(inst, 'appendText'); | |
| var isRTL = this._get(inst, 'isRTL'); | |
| if (inst.append) | |
| inst.append.remove(); | |
| if (appendText) { | |
| inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>'); | |
| input[isRTL ? 'before' : 'after'](inst.append); | |
| } | |
| input.unbind('focus', this._showDatepicker); | |
| if (inst.trigger) | |
| inst.trigger.remove(); | |
| var showOn = this._get(inst, 'showOn'); | |
| if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field | |
| input.focus(this._showDatepicker); | |
| if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked | |
| var buttonText = this._get(inst, 'buttonText'); | |
| var buttonImage = this._get(inst, 'buttonImage'); | |
| inst.trigger = $(this._get(inst, 'buttonImageOnly') ? | |
| $('<img/>').addClass(this._triggerClass). | |
| attr({ src: buttonImage, alt: buttonText, title: buttonText }) : | |
| $('<button type="button"></button>').addClass(this._triggerClass). | |
| html(buttonImage == '' ? buttonText : $('<img/>').attr( | |
| { src:buttonImage, alt:buttonText, title:buttonText }))); | |
| input[isRTL ? 'before' : 'after'](inst.trigger); | |
| inst.trigger.click(function() { | |
| if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0]) | |
| $.datepicker._hideDatepicker(); | |
| else if ($.datepicker._datepickerShowing && $.datepicker._lastInput != input[0]) { | |
| $.datepicker._hideDatepicker(); | |
| $.datepicker._showDatepicker(input[0]); | |
| } else | |
| $.datepicker._showDatepicker(input[0]); | |
| return false; | |
| }); | |
| } | |
| }, | |
| /* Apply the maximum length for the date format. */ | |
| _autoSize: function(inst) { | |
| if (this._get(inst, 'autoSize') && !inst.inline) { | |
| var date = new Date(2009, 12 - 1, 20); // Ensure double digits | |
| var dateFormat = this._get(inst, 'dateFormat'); | |
| if (dateFormat.match(/[DM]/)) { | |
| var findMax = function(names) { | |
| var max = 0; | |
| var maxI = 0; | |
| for (var i = 0; i < names.length; i++) { | |
| if (names[i].length > max) { | |
| max = names[i].length; | |
| maxI = i; | |
| } | |
| } | |
| return maxI; | |
| }; | |
| date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? | |
| 'monthNames' : 'monthNamesShort')))); | |
| date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? | |
| 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay()); | |
| } | |
| inst.input.attr('size', this._formatDate(inst, date).length); | |
| } | |
| }, | |
| /* Attach an inline date picker to a div. */ | |
| _inlineDatepicker: function(target, inst) { | |
| var divSpan = $(target); | |
| if (divSpan.hasClass(this.markerClassName)) | |
| return; | |
| divSpan.addClass(this.markerClassName).append(inst.dpDiv). | |
| bind("setData.datepicker", function(event, key, value){ | |
| inst.settings[key] = value; | |
| }).bind("getData.datepicker", function(event, key){ | |
| return this._get(inst, key); | |
| }); | |
| $.data(target, PROP_NAME, inst); | |
| this._setDate(inst, this._getDefaultDate(inst), true); | |
| this._updateDatepicker(inst); | |
| this._updateAlternate(inst); | |
| //If disabled option is true, disable the datepicker before showing it (see ticket #5665) | |
| if( inst.settings.disabled ) { | |
| this._disableDatepicker( target ); | |
| } | |
| // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements | |
| // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height | |
| inst.dpDiv.css( "display", "block" ); | |
| }, | |
| /* Pop-up the date picker in a "dialog" box. | |
| @param input element - ignored | |
| @param date string or Date - the initial date to display | |
| @param onSelect function - the function to call when a date is selected | |
| @param settings object - update the dialog date picker instance's settings (anonymous object) | |
| @param pos int[2] - coordinates for the dialog's position within the screen or | |
| event - with x/y coordinates or | |
| leave empty for default (screen centre) | |
| @return the manager object */ | |
| _dialogDatepicker: function(input, date, onSelect, settings, pos) { | |
| var inst = this._dialogInst; // internal instance | |
| if (!inst) { | |
| this.uuid += 1; | |
| var id = 'dp' + this.uuid; | |
| this._dialogInput = $('<input type="text" id="' + id + | |
| '" style="position: absolute; top: -100px; width: 0px;"/>'); | |
| this._dialogInput.keydown(this._doKeyDown); | |
| $('body').append(this._dialogInput); | |
| inst = this._dialogInst = this._newInst(this._dialogInput, false); | |
| inst.settings = {}; | |
| $.data(this._dialogInput[0], PROP_NAME, inst); | |
| } | |
| extendRemove(inst.settings, settings || {}); | |
| date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); | |
| this._dialogInput.val(date); | |
| this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); | |
| if (!this._pos) { | |
| var browserWidth = document.documentElement.clientWidth; | |
| var browserHeight = document.documentElement.clientHeight; | |
| var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; | |
| var scrollY = document.documentElement.scrollTop || document.body.scrollTop; | |
| this._pos = // should use actual width/height below | |
| [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; | |
| } | |
| // move input on screen for focus, but hidden behind dialog | |
| this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); | |
| inst.settings.onSelect = onSelect; | |
| this._inDialog = true; | |
| this.dpDiv.addClass(this._dialogClass); | |
| this._showDatepicker(this._dialogInput[0]); | |
| if ($.blockUI) | |
| $.blockUI(this.dpDiv); | |
| $.data(this._dialogInput[0], PROP_NAME, inst); | |
| return this; | |
| }, | |
| /* Detach a datepicker from its control. | |
| @param target element - the target input field or division or span */ | |
| _destroyDatepicker: function(target) { | |
| var $target = $(target); | |
| var inst = $.data(target, PROP_NAME); | |
| if (!$target.hasClass(this.markerClassName)) { | |
| return; | |
| } | |
| var nodeName = target.nodeName.toLowerCase(); | |
| $.removeData(target, PROP_NAME); | |
| if (nodeName == 'input') { | |
| inst.append.remove(); | |
| inst.trigger.remove(); | |
| $target.removeClass(this.markerClassName). | |
| unbind('focus', this._showDatepicker). | |
| unbind('keydown', this._doKeyDown). | |
| unbind('keypress', this._doKeyPress). | |
| unbind('keyup', this._doKeyUp); | |
| } else if (nodeName == 'div' || nodeName == 'span') | |
| $target.removeClass(this.markerClassName).empty(); | |
| }, | |
| /* Enable the date picker to a jQuery selection. | |
| @param target element - the target input field or division or span */ | |
| _enableDatepicker: function(target) { | |
| var $target = $(target); | |
| var inst = $.data(target, PROP_NAME); | |
| if (!$target.hasClass(this.markerClassName)) { | |
| return; | |
| } | |
| var nodeName = target.nodeName.toLowerCase(); | |
| if (nodeName == 'input') { | |
| target.disabled = false; | |
| inst.trigger.filter('button'). | |
| each(function() { this.disabled = false; }).end(). | |
| filter('img').css({opacity: '1.0', cursor: ''}); | |
| } | |
| else if (nodeName == 'div' || nodeName == 'span') { | |
| var inline = $target.children('.' + this._inlineClass); | |
| inline.children().removeClass('ui-state-disabled'); | |
| inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). | |
| removeAttr("disabled"); | |
| } | |
| this._disabledInputs = $.map(this._disabledInputs, | |
| function(value) { return (value == target ? null : value); }); // delete entry | |
| }, | |
| /* Disable the date picker to a jQuery selection. | |
| @param target element - the target input field or division or span */ | |
| _disableDatepicker: function(target) { | |
| var $target = $(target); | |
| var inst = $.data(target, PROP_NAME); | |
| if (!$target.hasClass(this.markerClassName)) { | |
| return; | |
| } | |
| var nodeName = target.nodeName.toLowerCase(); | |
| if (nodeName == 'input') { | |
| target.disabled = true; | |
| inst.trigger.filter('button'). | |
| each(function() { this.disabled = true; }).end(). | |
| filter('img').css({opacity: '0.5', cursor: 'default'}); | |
| } | |
| else if (nodeName == 'div' || nodeName == 'span') { | |
| var inline = $target.children('.' + this._inlineClass); | |
| inline.children().addClass('ui-state-disabled'); | |
| inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). | |
| attr("disabled", "disabled"); | |
| } | |
| this._disabledInputs = $.map(this._disabledInputs, | |
| function(value) { return (value == target ? null : value); }); // delete entry | |
| this._disabledInputs[this._disabledInputs.length] = target; | |
| }, | |
| /* Is the first field in a jQuery collection disabled as a datepicker? | |
| @param target element - the target input field or division or span | |
| @return boolean - true if disabled, false if enabled */ | |
| _isDisabledDatepicker: function(target) { | |
| if (!target) { | |
| return false; | |
| } | |
| for (var i = 0; i < this._disabledInputs.length; i++) { | |
| if (this._disabledInputs[i] == target) | |
| return true; | |
| } | |
| return false; | |
| }, | |
| /* Retrieve the instance data for the target control. | |
| @param target element - the target input field or division or span | |
| @return object - the associated instance data | |
| @throws error if a jQuery problem getting data */ | |
| _getInst: function(target) { | |
| try { | |
| return $.data(target, PROP_NAME); | |
| } | |
| catch (err) { | |
| throw 'Missing instance data for this datepicker'; | |
| } | |
| }, | |
| /* Update or retrieve the settings for a date picker attached to an input field or division. | |
| @param target element - the target input field or division or span | |
| @param name object - the new settings to update or | |
| string - the name of the setting to change or retrieve, | |
| when retrieving also 'all' for all instance settings or | |
| 'defaults' for all global defaults | |
| @param value any - the new value for the setting | |
| (omit if above is an object or to retrieve a value) */ | |
| _optionDatepicker: function(target, name, value) { | |
| var inst = this._getInst(target); | |
| if (arguments.length == 2 && typeof name == 'string') { | |
| return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : | |
| (inst ? (name == 'all' ? $.extend({}, inst.settings) : | |
| this._get(inst, name)) : null)); | |
| } | |
| var settings = name || {}; | |
| if (typeof name == 'string') { | |
| settings = {}; | |
| settings[name] = value; | |
| } | |
| if (inst) { | |
| if (this._curInst == inst) { | |
| this._hideDatepicker(); | |
| } | |
| var date = this._getDateDatepicker(target, true); | |
| var minDate = this._getMinMaxDate(inst, 'min'); | |
| var maxDate = this._getMinMaxDate(inst, 'max'); | |
| extendRemove(inst.settings, settings); | |
| // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided | |
| if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) | |
| inst.settings.minDate = this._formatDate(inst, minDate); | |
| if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) | |
| inst.settings.maxDate = this._formatDate(inst, maxDate); | |
| this._attachments($(target), inst); | |
| this._autoSize(inst); | |
| this._setDate(inst, date); | |
| this._updateAlternate(inst); | |
| this._updateDatepicker(inst); | |
| } | |
| }, | |
| // change method deprecated | |
| _changeDatepicker: function(target, name, value) { | |
| this._optionDatepicker(target, name, value); | |
| }, | |
| /* Redraw the date picker attached to an input field or division. | |
| @param target element - the target input field or division or span */ | |
| _refreshDatepicker: function(target) { | |
| var inst = this._getInst(target); | |
| if (inst) { | |
| this._updateDatepicker(inst); | |
| } | |
| }, | |
| /* Set the dates for a jQuery selection. | |
| @param target element - the target input field or division or span | |
| @param date Date - the new date */ | |
| _setDateDatepicker: function(target, date) { | |
| var inst = this._getInst(target); | |
| if (inst) { | |
| this._setDate(inst, date); | |
| this._updateDatepicker(inst); | |
| this._updateAlternate(inst); | |
| } | |
| }, | |
| /* Get the date(s) for the first entry in a jQuery selection. | |
| @param target element - the target input field or division or span | |
| @param noDefault boolean - true if no default date is to be used | |
| @return Date - the current date */ | |
| _getDateDatepicker: function(target, noDefault) { | |
| var inst = this._getInst(target); | |
| if (inst && !inst.inline) | |
| this._setDateFromField(inst, noDefault); | |
| return (inst ? this._getDate(inst) : null); | |
| }, | |
| /* Handle keystrokes. */ | |
| _doKeyDown: function(event) { | |
| var inst = $.datepicker._getInst(event.target); | |
| var handled = true; | |
| var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); | |
| inst._keyEvent = true; | |
| if ($.datepicker._datepickerShowing) | |
| switch (event.keyCode) { | |
| case 9: $.datepicker._hideDatepicker(); | |
| handled = false; | |
| break; // hide on tab out | |
| case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + | |
| $.datepicker._currentClass + ')', inst.dpDiv); | |
| if (sel[0]) | |
| $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); | |
| var onSelect = $.datepicker._get(inst, 'onSelect'); | |
| if (onSelect) { | |
| var dateStr = $.datepicker._formatDate(inst); | |
| // trigger custom callback | |
| onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); | |
| } | |
| else | |
| $.datepicker._hideDatepicker(); | |
| return false; // don't submit the form | |
| break; // select the value on enter | |
| case 27: $.datepicker._hideDatepicker(); | |
| break; // hide on escape | |
| case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? | |
| -$.datepicker._get(inst, 'stepBigMonths') : | |
| -$.datepicker._get(inst, 'stepMonths')), 'M'); | |
| break; // previous month/year on page up/+ ctrl | |
| case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? | |
| +$.datepicker._get(inst, 'stepBigMonths') : | |
| +$.datepicker._get(inst, 'stepMonths')), 'M'); | |
| break; // next month/year on page down/+ ctrl | |
| case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); | |
| handled = event.ctrlKey || event.metaKey; | |
| break; // clear on ctrl or command +end | |
| case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); | |
| handled = event.ctrlKey || event.metaKey; | |
| break; // current on ctrl or command +home | |
| case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); | |
| handled = event.ctrlKey || event.metaKey; | |
| // -1 day on ctrl or command +left | |
| if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? | |
| -$.datepicker._get(inst, 'stepBigMonths') : | |
| -$.datepicker._get(inst, 'stepMonths')), 'M'); | |
| // next month/year on alt +left on Mac | |
| break; | |
| case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); | |
| handled = event.ctrlKey || event.metaKey; | |
| break; // -1 week on ctrl or command +up | |
| case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); | |
| handled = event.ctrlKey || event.metaKey; | |
| // +1 day on ctrl or command +right | |
| if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? | |
| +$.datepicker._get(inst, 'stepBigMonths') : | |
| +$.datepicker._get(inst, 'stepMonths')), 'M'); | |
| // next month/year on alt +right | |
| break; | |
| case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); | |
| handled = event.ctrlKey || event.metaKey; | |
| break; // +1 week on ctrl or command +down | |
| default: handled = false; | |
| } | |
| else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home | |
| $.datepicker._showDatepicker(this); | |
| else { | |
| handled = false; | |
| } | |
| if (handled) { | |
| event.preventDefault(); | |
| event.stopPropagation(); | |
| } | |
| }, | |
| /* Filter entered characters - based on date format. */ | |
| _doKeyPress: function(event) { | |
| var inst = $.datepicker._getInst(event.target); | |
| if ($.datepicker._get(inst, 'constrainInput')) { | |
| var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); | |
| var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); | |
| return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); | |
| } | |
| }, | |
| /* Synchronise manual entry and field/alternate field. */ | |
| _doKeyUp: function(event) { | |
| var inst = $.datepicker._getInst(event.target); | |
| if (inst.input.val() != inst.lastVal) { | |
| try { | |
| var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), | |
| (inst.input ? inst.input.val() : null), | |
| $.datepicker._getFormatConfig(inst)); | |
| if (date) { // only if valid | |
| $.datepicker._setDateFromField(inst); | |
| $.datepicker._updateAlternate(inst); | |
| $.datepicker._updateDatepicker(inst); | |
| } | |
| } | |
| catch (err) { | |
| $.datepicker.log(err); | |
| } | |
| } | |
| return true; | |
| }, | |
| /* Pop-up the date picker for a given input field. | |
| If false returned from beforeShow event handler do not show. | |
| @param input element - the input field attached to the date picker or | |
| event - if triggered by focus */ | |
| _showDatepicker: function(input) { | |
| input = input.target || input; | |
| if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger | |
| input = $('input', input.parentNode)[0]; | |
| if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here | |
| return; | |
| var inst = $.datepicker._getInst(input); | |
| if ($.datepicker._curInst && $.datepicker._curInst != inst) { | |
| $.datepicker._curInst.dpDiv.stop(true, true); | |
| if ( inst && $.datepicker._datepickerShowing ) { | |
| $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] ); | |
| } | |
| } | |
| var beforeShow = $.datepicker._get(inst, 'beforeShow'); | |
| var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; | |
| if(beforeShowSettings === false){ | |
| //false | |
| return; | |
| } | |
| extendRemove(inst.settings, beforeShowSettings); | |
| inst.lastVal = null; | |
| $.datepicker._lastInput = input; | |
| $.datepicker._setDateFromField(inst); | |
| if ($.datepicker._inDialog) // hide cursor | |
| input.value = ''; | |
| if (!$.datepicker._pos) { // position below input | |
| $.datepicker._pos = $.datepicker._findPos(input); | |
| $.datepicker._pos[1] += input.offsetHeight; // add the height | |
| } | |
| var isFixed = false; | |
| $(input).parents().each(function() { | |
| isFixed |= $(this).css('position') == 'fixed'; | |
| return !isFixed; | |
| }); | |
| if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled | |
| $.datepicker._pos[0] -= document.documentElement.scrollLeft; | |
| $.datepicker._pos[1] -= document.documentElement.scrollTop; | |
| } | |
| var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; | |
| $.datepicker._pos = null; | |
| //to avoid flashes on Firefox | |
| inst.dpDiv.empty(); | |
| // determine sizing offscreen | |
| inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); | |
| $.datepicker._updateDatepicker(inst); | |
| // fix width for dynamic number of date pickers | |
| // and adjust position before showing | |
| offset = $.datepicker._checkOffset(inst, offset, isFixed); | |
| inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? | |
| 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', | |
| left: offset.left + 'px', top: offset.top + 'px'}); | |
| if (!inst.inline) { | |
| var showAnim = $.datepicker._get(inst, 'showAnim'); | |
| var duration = $.datepicker._get(inst, 'duration'); | |
| var postProcess = function() { | |
| var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only | |
| if( !! cover.length ){ | |
| var borders = $.datepicker._getBorders(inst.dpDiv); | |
| cover.css({left: -borders[0], top: -borders[1], | |
| width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); | |
| } | |
| }; | |
| inst.dpDiv.zIndex($(input).zIndex()+1); | |
| $.datepicker._datepickerShowing = true; | |
| if ($.effects && $.effects[showAnim]) | |
| inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); | |
| else | |
| inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); | |
| if (!showAnim || !duration) | |
| postProcess(); | |
| if (inst.input.is(':visible') && !inst.input.is(':disabled')) | |
| inst.input.focus(); | |
| $.datepicker._curInst = inst; | |
| } | |
| }, | |
| /* Generate the date picker content. */ | |
| _updateDatepicker: function(inst) { | |
| var self = this; | |
| self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) | |
| var borders = $.datepicker._getBorders(inst.dpDiv); | |
| instActive = inst; // for delegate hover events | |
| inst.dpDiv.empty().append(this._generateHTML(inst)); | |
| this._attachHandlers(inst); | |
| var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only | |
| if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 | |
| cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) | |
| } | |
| inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); | |
| var numMonths = this._getNumberOfMonths(inst); | |
| var cols = numMonths[1]; | |
| var width = 17; | |
| inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); | |
| if (cols > 1) | |
| inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); | |
| inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + | |
| 'Class']('ui-datepicker-multi'); | |
| inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + | |
| 'Class']('ui-datepicker-rtl'); | |
| if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && | |
| // #6694 - don't focus the input if it's already focused | |
| // this breaks the change event in IE | |
| inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) | |
| inst.input.focus(); | |
| // deffered render of the years select (to avoid flashes on Firefox) | |
| if( inst.yearshtml ){ | |
| var origyearshtml = inst.yearshtml; | |
| setTimeout(function(){ | |
| //assure that inst.yearshtml didn't change. | |
| if( origyearshtml === inst.yearshtml && inst.yearshtml ){ | |
| inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); | |
| } | |
| origyearshtml = inst.yearshtml = null; | |
| }, 0); | |
| } | |
| }, | |
| /* Retrieve the size of left and top borders for an element. | |
| @param elem (jQuery object) the element of interest | |
| @return (number[2]) the left and top borders */ | |
| _getBorders: function(elem) { | |
| var convert = function(value) { | |
| return {thin: 1, medium: 2, thick: 3}[value] || value; | |
| }; | |
| return [parseFloat(convert(elem.css('border-left-width'))), | |
| parseFloat(convert(elem.css('border-top-width')))]; | |
| }, | |
| /* Check positioning to remain on screen. */ | |
| _checkOffset: function(inst, offset, isFixed) { | |
| var dpWidth = inst.dpDiv.outerWidth(); | |
| var dpHeight = inst.dpDiv.outerHeight(); | |
| var inputWidth = inst.input ? inst.input.outerWidth() : 0; | |
| var inputHeight = inst.input ? inst.input.outerHeight() : 0; | |
| var viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()); | |
| var viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop()); | |
| offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); | |
| offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; | |
| offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; | |
| // now check if datepicker is showing outside window viewport - move to a better place if so. | |
| offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? | |
| Math.abs(offset.left + dpWidth - viewWidth) : 0); | |
| offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? | |
| Math.abs(dpHeight + inputHeight) : 0); | |
| return offset; | |
| }, | |
| /* Find an object's position on the screen. */ | |
| _findPos: function(obj) { | |
| var inst = this._getInst(obj); | |
| var isRTL = this._get(inst, 'isRTL'); | |
| while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { | |
| obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; | |
| } | |
| var position = $(obj).offset(); | |
| return [position.left, position.top]; | |
| }, | |
| /* Hide the date picker from view. | |
| @param input element - the input field attached to the date picker */ | |
| _hideDatepicker: function(input) { | |
| var inst = this._curInst; | |
| if (!inst || (input && inst != $.data(input, PROP_NAME))) | |
| return; | |
| if (this._datepickerShowing) { | |
| var showAnim = this._get(inst, 'showAnim'); | |
| var duration = this._get(inst, 'duration'); | |
| var postProcess = function() { | |
| $.datepicker._tidyDialog(inst); | |
| }; | |
| if ($.effects && $.effects[showAnim]) | |
| inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); | |
| else | |
| inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : | |
| (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); | |
| if (!showAnim) | |
| postProcess(); | |
| this._datepickerShowing = false; | |
| var onClose = this._get(inst, 'onClose'); | |
| if (onClose) | |
| onClose.apply((inst.input ? inst.input[0] : null), | |
| [(inst.input ? inst.input.val() : ''), inst]); | |
| this._lastInput = null; | |
| if (this._inDialog) { | |
| this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); | |
| if ($.blockUI) { | |
| $.unblockUI(); | |
| $('body').append(this.dpDiv); | |
| } | |
| } | |
| this._inDialog = false; | |
| } | |
| }, | |
| /* Tidy up after a dialog display. */ | |
| _tidyDialog: function(inst) { | |
| inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); | |
| }, | |
| /* Close date picker if clicked elsewhere. */ | |
| _checkExternalClick: function(event) { | |
| if (!$.datepicker._curInst) | |
| return; | |
| var $target = $(event.target), | |
| inst = $.datepicker._getInst($target[0]); | |
| if ( ( ( $target[0].id != $.datepicker._mainDivId && | |
| $target.parents('#' + $.datepicker._mainDivId).length == 0 && | |
| !$target.hasClass($.datepicker.markerClassName) && | |
| !$target.closest("." + $.datepicker._triggerClass).length && | |
| $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) || | |
| ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) ) | |
| $.datepicker._hideDatepicker(); | |
| }, | |
| /* Adjust one of the date sub-fields. */ | |
| _adjustDate: function(id, offset, period) { | |
| var target = $(id); | |
| var inst = this._getInst(target[0]); | |
| if (this._isDisabledDatepicker(target[0])) { | |
| return; | |
| } | |
| this._adjustInstDate(inst, offset + | |
| (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning | |
| period); | |
| this._updateDatepicker(inst); | |
| }, | |
| /* Action for current link. */ | |
| _gotoToday: function(id) { | |
| var target = $(id); | |
| var inst = this._getInst(target[0]); | |
| if (this._get(inst, 'gotoCurrent') && inst.currentDay) { | |
| inst.selectedDay = inst.currentDay; | |
| inst.drawMonth = inst.selectedMonth = inst.currentMonth; | |
| inst.drawYear = inst.selectedYear = inst.currentYear; | |
| } | |
| else { | |
| var date = new Date(); | |
| inst.selectedDay = date.getDate(); | |
| inst.drawMonth = inst.selectedMonth = date.getMonth(); | |
| inst.drawYear = inst.selectedYear = date.getFullYear(); | |
| } | |
| this._notifyChange(inst); | |
| this._adjustDate(target); | |
| }, | |
| /* Action for selecting a new month/year. */ | |
| _selectMonthYear: function(id, select, period) { | |
| var target = $(id); | |
| var inst = this._getInst(target[0]); | |
| inst['selected' + (period == 'M' ? 'Month' : 'Year')] = | |
| inst['draw' + (period == 'M' ? 'Month' : 'Year')] = | |
| parseInt(select.options[select.selectedIndex].value,10); | |
| this._notifyChange(inst); | |
| this._adjustDate(target); | |
| }, | |
| /* Action for selecting a day. */ | |
| _selectDay: function(id, month, year, td) { | |
| var target = $(id); | |
| if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { | |
| return; | |
| } | |
| var inst = this._getInst(target[0]); | |
| inst.selectedDay = inst.currentDay = $('a', td).html(); | |
| inst.selectedMonth = inst.currentMonth = month; | |
| inst.selectedYear = inst.currentYear = year; | |
| this._selectDate(id, this._formatDate(inst, | |
| inst.currentDay, inst.currentMonth, inst.currentYear)); | |
| }, | |
| /* Erase the input field and hide the date picker. */ | |
| _clearDate: function(id) { | |
| var target = $(id); | |
| var inst = this._getInst(target[0]); | |
| this._selectDate(target, ''); | |
| }, | |
| /* Update the input field with the selected date. */ | |
| _selectDate: function(id, dateStr) { | |
| var target = $(id); | |
| var inst = this._getInst(target[0]); | |
| dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); | |
| if (inst.input) | |
| inst.input.val(dateStr); | |
| this._updateAlternate(inst); | |
| var onSelect = this._get(inst, 'onSelect'); | |
| if (onSelect) | |
| onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback | |
| else if (inst.input) | |
| inst.input.trigger('change'); // fire the change event | |
| if (inst.inline) | |
| this._updateDatepicker(inst); | |
| else { | |
| this._hideDatepicker(); | |
| this._lastInput = inst.input[0]; | |
| if (typeof(inst.input[0]) != 'object') | |
| inst.input.focus(); // restore focus | |
| this._lastInput = null; | |
| } | |
| }, | |
| /* Update any alternate field to synchronise with the main field. */ | |
| _updateAlternate: function(inst) { | |
| var altField = this._get(inst, 'altField'); | |
| if (altField) { // update alternate field too | |
| var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); | |
| var date = this._getDate(inst); | |
| var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); | |
| $(altField).each(function() { $(this).val(dateStr); }); | |
| } | |
| }, | |
| /* Set as beforeShowDay function to prevent selection of weekends. | |
| @param date Date - the date to customise | |
| @return [boolean, string] - is this date selectable?, what is its CSS class? */ | |
| noWeekends: function(date) { | |
| var day = date.getDay(); | |
| return [(day > 0 && day < 6), '']; | |
| }, | |
| /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. | |
| @param date Date - the date to get the week for | |
| @return number - the number of the week within the year that contains this date */ | |
| iso8601Week: function(date) { | |
| var checkDate = new Date(date.getTime()); | |
| // Find Thursday of this week starting on Monday | |
| checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); | |
| var time = checkDate.getTime(); | |
| checkDate.setMonth(0); // Compare with Jan 1 | |
| checkDate.setDate(1); | |
| return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; | |
| }, | |
| /* Parse a string value into a date object. | |
| See formatDate below for the possible formats. | |
| @param format string - the expected format of the date | |
| @param value string - the date in the above format | |
| @param settings Object - attributes include: | |
| shortYearCutoff number - the cutoff year for determining the century (optional) | |
| dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) | |
| dayNames string[7] - names of the days from Sunday (optional) | |
| monthNamesShort string[12] - abbreviated names of the months (optional) | |
| monthNames string[12] - names of the months (optional) | |
| @return Date - the extracted date value or null if value is blank */ | |
| parseDate: function (format, value, settings) { | |
| if (format == null || value == null) | |
| throw 'Invalid arguments'; | |
| value = (typeof value == 'object' ? value.toString() : value + ''); | |
| if (value == '') | |
| return null; | |
| var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; | |
| shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : | |
| new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); | |
| var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; | |
| var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; | |
| var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; | |
| var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; | |
| var year = -1; | |
| var month = -1; | |
| var day = -1; | |
| var doy = -1; | |
| var literal = false; | |
| // Check whether a format character is doubled | |
| var lookAhead = function(match) { | |
| var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); | |
| if (matches) | |
| iFormat++; | |
| return matches; | |
| }; | |
| // Extract a number from the string value | |
| var getNumber = function(match) { | |
| var isDoubled = lookAhead(match); | |
| var size = (match == '@' ? 14 : (match == '!' ? 20 : | |
| (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); | |
| var digits = new RegExp('^\\d{1,' + size + '}'); | |
| var num = value.substring(iValue).match(digits); | |
| if (!num) | |
| throw 'Missing number at position ' + iValue; | |
| iValue += num[0].length; | |
| return parseInt(num[0], 10); | |
| }; | |
| // Extract a name from the string value and convert to an index | |
| var getName = function(match, shortNames, longNames) { | |
| var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { | |
| return [ [k, v] ]; | |
| }).sort(function (a, b) { | |
| return -(a[1].length - b[1].length); | |
| }); | |
| var index = -1; | |
| $.each(names, function (i, pair) { | |
| var name = pair[1]; | |
| if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { | |
| index = pair[0]; | |
| iValue += name.length; | |
| return false; | |
| } | |
| }); | |
| if (index != -1) | |
| return index + 1; | |
| else | |
| throw 'Unknown name at position ' + iValue; | |
| }; | |
| // Confirm that a literal character matches the string value | |
| var checkLiteral = function() { | |
| if (value.charAt(iValue) != format.charAt(iFormat)) | |
| throw 'Unexpected literal at position ' + iValue; | |
| iValue++; | |
| }; | |
| var iValue = 0; | |
| for (var iFormat = 0; iFormat < format.length; iFormat++) { | |
| if (literal) | |
| if (format.charAt(iFormat) == "'" && !lookAhead("'")) | |
| literal = false; | |
| else | |
| checkLiteral(); | |
| else | |
| switch (format.charAt(iFormat)) { | |
| case 'd': | |
| day = getNumber('d'); | |
| break; | |
| case 'D': | |
| getName('D', dayNamesShort, dayNames); | |
| break; | |
| case 'o': | |
| doy = getNumber('o'); | |
| break; | |
| case 'm': | |
| month = getNumber('m'); | |
| break; | |
| case 'M': | |
| month = getName('M', monthNamesShort, monthNames); | |
| break; | |
| case 'y': | |
| year = getNumber('y'); | |
| break; | |
| case '@': | |
| var date = new Date(getNumber('@')); | |
| year = date.getFullYear(); | |
| month = date.getMonth() + 1; | |
| day = date.getDate(); | |
| break; | |
| case '!': | |
| var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); | |
| year = date.getFullYear(); | |
| month = date.getMonth() + 1; | |
| day = date.getDate(); | |
| break; | |
| case "'": | |
| if (lookAhead("'")) | |
| checkLiteral(); | |
| else | |
| literal = true; | |
| break; | |
| default: | |
| checkLiteral(); | |
| } | |
| } | |
| if (iValue < value.length){ | |
| throw "Extra/unparsed characters found in date: " + value.substring(iValue); | |
| } | |
| if (year == -1) | |
| year = new Date().getFullYear(); | |
| else if (year < 100) | |
| year += new Date().getFullYear() - new Date().getFullYear() % 100 + | |
| (year <= shortYearCutoff ? 0 : -100); | |
| if (doy > -1) { | |
| month = 1; | |
| day = doy; | |
| do { | |
| var dim = this._getDaysInMonth(year, month - 1); | |
| if (day <= dim) | |
| break; | |
| month++; | |
| day -= dim; | |
| } while (true); | |
| } | |
| var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); | |
| if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) | |
| throw 'Invalid date'; // E.g. 31/02/00 | |
| return date; | |
| }, | |
| /* Standard date formats. */ | |
| ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) | |
| COOKIE: 'D, dd M yy', | |
| ISO_8601: 'yy-mm-dd', | |
| RFC_822: 'D, d M y', | |
| RFC_850: 'DD, dd-M-y', | |
| RFC_1036: 'D, d M y', | |
| RFC_1123: 'D, d M yy', | |
| RFC_2822: 'D, d M yy', | |
| RSS: 'D, d M y', // RFC 822 | |
| TICKS: '!', | |
| TIMESTAMP: '@', | |
| W3C: 'yy-mm-dd', // ISO 8601 | |
| _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + | |
| Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), | |
| /* Format a date object into a string value. | |
| The format can be combinations of the following: | |
| d - day of month (no leading zero) | |
| dd - day of month (two digit) | |
| o - day of year (no leading zeros) | |
| oo - day of year (three digit) | |
| D - day name short | |
| DD - day name long | |
| m - month of year (no leading zero) | |
| mm - month of year (two digit) | |
| M - month name short | |
| MM - month name long | |
| y - year (two digit) | |
| yy - year (four digit) | |
| @ - Unix timestamp (ms since 01/01/1970) | |
| ! - Windows ticks (100ns since 01/01/0001) | |
| '...' - literal text | |
| '' - single quote | |
| @param format string - the desired format of the date | |
| @param date Date - the date value to format | |
| @param settings Object - attributes include: | |
| dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) | |
| dayNames string[7] - names of the days from Sunday (optional) | |
| monthNamesShort string[12] - abbreviated names of the months (optional) | |
| monthNames string[12] - names of the months (optional) | |
| @return string - the date in the above format */ | |
| formatDate: function (format, date, settings) { | |
| if (!date) | |
| return ''; | |
| var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; | |
| var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; | |
| var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; | |
| var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; | |
| // Check whether a format character is doubled | |
| var lookAhead = function(match) { | |
| var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); | |
| if (matches) | |
| iFormat++; | |
| return matches; | |
| }; | |
| // Format a number, with leading zero if necessary | |
| var formatNumber = function(match, value, len) { | |
| var num = '' + value; | |
| if (lookAhead(match)) | |
| while (num.length < len) | |
| num = '0' + num; | |
| return num; | |
| }; | |
| // Format a name, short or long as requested | |
| var formatName = function(match, value, shortNames, longNames) { | |
| return (lookAhead(match) ? longNames[value] : shortNames[value]); | |
| }; | |
| var output = ''; | |
| var literal = false; | |
| if (date) | |
| for (var iFormat = 0; iFormat < format.length; iFormat++) { | |
| if (literal) | |
| if (format.charAt(iFormat) == "'" && !lookAhead("'")) | |
| literal = false; | |
| else | |
| output += format.charAt(iFormat); | |
| else | |
| switch (format.charAt(iFormat)) { | |
| case 'd': | |
| output += formatNumber('d', date.getDate(), 2); | |
| break; | |
| case 'D': | |
| output += formatName('D', date.getDay(), dayNamesShort, dayNames); | |
| break; | |
| case 'o': | |
| output += formatNumber('o', | |
| Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); | |
| break; | |
| case 'm': | |
| output += formatNumber('m', date.getMonth() + 1, 2); | |
| break; | |
| case 'M': | |
| output += formatName('M', date.getMonth(), monthNamesShort, monthNames); | |
| break; | |
| case 'y': | |
| output += (lookAhead('y') ? date.getFullYear() : | |
| (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); | |
| break; | |
| case '@': | |
| output += date.getTime(); | |
| break; | |
| case '!': | |
| output += date.getTime() * 10000 + this._ticksTo1970; | |
| break; | |
| case "'": | |
| if (lookAhead("'")) | |
| output += "'"; | |
| else | |
| literal = true; | |
| break; | |
| default: | |
| output += format.charAt(iFormat); | |
| } | |
| } | |
| return output; | |
| }, | |
| /* Extract all possible characters from the date format. */ | |
| _possibleChars: function (format) { | |
| var chars = ''; | |
| var literal = false; | |
| // Check whether a format character is doubled | |
| var lookAhead = function(match) { | |
| var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); | |
| if (matches) | |
| iFormat++; | |
| return matches; | |
| }; | |
| for (var iFormat = 0; iFormat < format.length; iFormat++) | |
| if (literal) | |
| if (format.charAt(iFormat) == "'" && !lookAhead("'")) | |
| literal = false; | |
| else | |
| chars += format.charAt(iFormat); | |
| else | |
| switch (format.charAt(iFormat)) { | |
| case 'd': case 'm': case 'y': case '@': | |
| chars += '0123456789'; | |
| break; | |
| case 'D': case 'M': | |
| return null; // Accept anything | |
| case "'": | |
| if (lookAhead("'")) | |
| chars += "'"; | |
| else | |
| literal = true; | |
| break; | |
| default: | |
| chars += format.charAt(iFormat); | |
| } | |
| return chars; | |
| }, | |
| /* Get a setting value, defaulting if necessary. */ | |
| _get: function(inst, name) { | |
| return inst.settings[name] !== undefined ? | |
| inst.settings[name] : this._defaults[name]; | |
| }, | |
| /* Parse existing date and initialise date picker. */ | |
| _setDateFromField: function(inst, noDefault) { | |
| if (inst.input.val() == inst.lastVal) { | |
| return; | |
| } | |
| var dateFormat = this._get(inst, 'dateFormat'); | |
| var dates = inst.lastVal = inst.input ? inst.input.val() : null; | |
| var date, defaultDate; | |
| date = defaultDate = this._getDefaultDate(inst); | |
| var settings = this._getFormatConfig(inst); | |
| try { | |
| date = this.parseDate(dateFormat, dates, settings) || defaultDate; | |
| } catch (event) { | |
| this.log(event); | |
| dates = (noDefault ? '' : dates); | |
| } | |
| inst.selectedDay = date.getDate(); | |
| inst.drawMonth = inst.selectedMonth = date.getMonth(); | |
| inst.drawYear = inst.selectedYear = date.getFullYear(); | |
| inst.currentDay = (dates ? date.getDate() : 0); | |
| inst.currentMonth = (dates ? date.getMonth() : 0); | |
| inst.currentYear = (dates ? date.getFullYear() : 0); | |
| this._adjustInstDate(inst); | |
| }, | |
| /* Retrieve the default date shown on opening. */ | |
| _getDefaultDate: function(inst) { | |
| return this._restrictMinMax(inst, | |
| this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); | |
| }, | |
| /* A date may be specified as an exact value or a relative one. */ | |
| _determineDate: function(inst, date, defaultDate) { | |
| var offsetNumeric = function(offset) { | |
| var date = new Date(); | |
| date.setDate(date.getDate() + offset); | |
| return date; | |
| }; | |
| var offsetString = function(offset) { | |
| try { | |
| return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), | |
| offset, $.datepicker._getFormatConfig(inst)); | |
| } | |
| catch (e) { | |
| // Ignore | |
| } | |
| var date = (offset.toLowerCase().match(/^c/) ? | |
| $.datepicker._getDate(inst) : null) || new Date(); | |
| var year = date.getFullYear(); | |
| var month = date.getMonth(); | |
| var day = date.getDate(); | |
| var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; | |
| var matches = pattern.exec(offset); | |
| while (matches) { | |
| switch (matches[2] || 'd') { | |
| case 'd' : case 'D' : | |
| day += parseInt(matches[1],10); break; | |
| case 'w' : case 'W' : | |
| day += parseInt(matches[1],10) * 7; break; | |
| case 'm' : case 'M' : | |
| month += parseInt(matches[1],10); | |
| day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); | |
| break; | |
| case 'y': case 'Y' : | |
| year += parseInt(matches[1],10); | |
| day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); | |
| break; | |
| } | |
| matches = pattern.exec(offset); | |
| } | |
| return new Date(year, month, day); | |
| }; | |
| var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : | |
| (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); | |
| newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); | |
| if (newDate) { | |
| newDate.setHours(0); | |
| newDate.setMinutes(0); | |
| newDate.setSeconds(0); | |
| newDate.setMilliseconds(0); | |
| } | |
| return this._daylightSavingAdjust(newDate); | |
| }, | |
| /* Handle switch to/from daylight saving. | |
| Hours may be non-zero on daylight saving cut-over: | |
| > 12 when midnight changeover, but then cannot generate | |
| midnight datetime, so jump to 1AM, otherwise reset. | |
| @param date (Date) the date to check | |
| @return (Date) the corrected date */ | |
| _daylightSavingAdjust: function(date) { | |
| if (!date) return null; | |
| date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); | |
| return date; | |
| }, | |
| /* Set the date(s) directly. */ | |
| _setDate: function(inst, date, noChange) { | |
| var clear = !date; | |
| var origMonth = inst.selectedMonth; | |
| var origYear = inst.selectedYear; | |
| var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); | |
| inst.selectedDay = inst.currentDay = newDate.getDate(); | |
| inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); | |
| inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); | |
| if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) | |
| this._notifyChange(inst); | |
| this._adjustInstDate(inst); | |
| if (inst.input) { | |
| inst.input.val(clear ? '' : this._formatDate(inst)); | |
| } | |
| }, | |
| /* Retrieve the date(s) directly. */ | |
| _getDate: function(inst) { | |
| var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : | |
| this._daylightSavingAdjust(new Date( | |
| inst.currentYear, inst.currentMonth, inst.currentDay))); | |
| return startDate; | |
| }, | |
| /* Attach the onxxx handlers. These are declared statically so | |
| * they work with static code transformers like Caja. | |
| */ | |
| _attachHandlers: function(inst) { | |
| var stepMonths = this._get(inst, 'stepMonths'); | |
| var id = '#' + inst.id; | |
| inst.dpDiv.find('[data-handler]').map(function () { | |
| var handler = { | |
| prev: function () { | |
| window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, -stepMonths, 'M'); | |
| }, | |
| next: function () { | |
| window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, +stepMonths, 'M'); | |
| }, | |
| hide: function () { | |
| window['DP_jQuery_' + dpuuid].datepicker._hideDatepicker(); | |
| }, | |
| today: function () { | |
| window['DP_jQuery_' + dpuuid].datepicker._gotoToday(id); | |
| }, | |
| selectDay: function () { | |
| window['DP_jQuery_' + dpuuid].datepicker._selectDay(id, +this.getAttribute('data-month'), +this.getAttribute('data-year'), this); | |
| return false; | |
| }, | |
| selectMonth: function () { | |
| window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'M'); | |
| return false; | |
| }, | |
| selectYear: function () { | |
| window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'Y'); | |
| return false; | |
| } | |
| }; | |
| $(this).bind(this.getAttribute('data-event'), handler[this.getAttribute('data-handler')]); | |
| }); | |
| }, | |
| /* Generate the HTML for the current state of the date picker. */ | |
| _generateHTML: function(inst) { | |
| var today = new Date(); | |
| today = this._daylightSavingAdjust( | |
| new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time | |
| var isRTL = this._get(inst, 'isRTL'); | |
| var showButtonPanel = this._get(inst, 'showButtonPanel'); | |
| var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); | |
| var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); | |
| var numMonths = this._getNumberOfMonths(inst); | |
| var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); | |
| var stepMonths = this._get(inst, 'stepMonths'); | |
| var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); | |
| var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : | |
| new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); | |
| var minDate = this._getMinMaxDate(inst, 'min'); | |
| var maxDate = this._getMinMaxDate(inst, 'max'); | |
| var drawMonth = inst.drawMonth - showCurrentAtPos; | |
| var drawYear = inst.drawYear; | |
| if (drawMonth < 0) { | |
| drawMonth += 12; | |
| drawYear--; | |
| } | |
| if (maxDate) { | |
| var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), | |
| maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); | |
| maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); | |
| while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { | |
| drawMonth--; | |
| if (drawMonth < 0) { | |
| drawMonth = 11; | |
| drawYear--; | |
| } | |
| } | |
| } | |
| inst.drawMonth = drawMonth; | |
| inst.drawYear = drawYear; | |
| var prevText = this._get(inst, 'prevText'); | |
| prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, | |
| this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), | |
| this._getFormatConfig(inst))); | |
| var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? | |
| '<a class="ui-datepicker-prev ui-corner-all" data-handler="prev" data-event="click"' + | |
| ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' : | |
| (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>')); | |
| var nextText = this._get(inst, 'nextText'); | |
| nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, | |
| this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), | |
| this._getFormatConfig(inst))); | |
| var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? | |
| '<a class="ui-datepicker-next ui-corner-all" data-handler="next" data-event="click"' + | |
| ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' : | |
| (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>')); | |
| var currentText = this._get(inst, 'currentText'); | |
| var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); | |
| currentText = (!navigationAsDateFormat ? currentText : | |
| this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); | |
| var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" data-handler="hide" data-event="click">' + | |
| this._get(inst, 'closeText') + '</button>' : ''); | |
| var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') + | |
| (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" data-handler="today" data-event="click"' + | |
| '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : ''; | |
| var firstDay = parseInt(this._get(inst, 'firstDay'),10); | |
| firstDay = (isNaN(firstDay) ? 0 : firstDay); | |
| var showWeek = this._get(inst, 'showWeek'); | |
| var dayNames = this._get(inst, 'dayNames'); | |
| var dayNamesShort = this._get(inst, 'dayNamesShort'); | |
| var dayNamesMin = this._get(inst, 'dayNamesMin'); | |
| var monthNames = this._get(inst, 'monthNames'); | |
| var monthNamesShort = this._get(inst, 'monthNamesShort'); | |
| var beforeShowDay = this._get(inst, 'beforeShowDay'); | |
| var showOtherMonths = this._get(inst, 'showOtherMonths'); | |
| var selectOtherMonths = this._get(inst, 'selectOtherMonths'); | |
| var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; | |
| var defaultDate = this._getDefaultDate(inst); | |
| var html = ''; | |
| for (var row = 0; row < numMonths[0]; row++) { | |
| var group = ''; | |
| this.maxRows = 4; | |
| for (var col = 0; col < numMonths[1]; col++) { | |
| var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); | |
| var cornerClass = ' ui-corner-all'; | |
| var calender = ''; | |
| if (isMultiMonth) { | |
| calender += '<div class="ui-datepicker-group'; | |
| if (numMonths[1] > 1) | |
| switch (col) { | |
| case 0: calender += ' ui-datepicker-group-first'; | |
| cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break; | |
| case numMonths[1]-1: calender += ' ui-datepicker-group-last'; | |
| cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break; | |
| default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break; | |
| } | |
| calender += '">'; | |
| } | |
| calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' + | |
| (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + | |
| (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + | |
| this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, | |
| row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers | |
| '</div><table class="ui-datepicker-calendar"><thead>' + | |
| '<tr>'; | |
| var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : ''); | |
| for (var dow = 0; dow < 7; dow++) { // days of the week | |
| var day = (dow + firstDay) % 7; | |
| thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + | |
| '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>'; | |
| } | |
| calender += thead + '</tr></thead><tbody>'; | |
| var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); | |
| if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) | |
| inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); | |
| var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; | |
| var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate | |
| var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) | |
| this.maxRows = numRows; | |
| var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); | |
| for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows | |
| calender += '<tr>'; | |
| var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' + | |
| this._get(inst, 'calculateWeek')(printDate) + '</td>'); | |
| for (var dow = 0; dow < 7; dow++) { // create date picker days | |
| var daySettings = (beforeShowDay ? | |
| beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); | |
| var otherMonth = (printDate.getMonth() != drawMonth); | |
| var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || | |
| (minDate && printDate < minDate) || (maxDate && printDate > maxDate); | |
| tbody += '<td class="' + | |
| ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends | |
| (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months | |
| ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key | |
| (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ? | |
| // or defaultDate is current printedDate and defaultDate is selectedDate | |
| ' ' + this._dayOverClass : '') + // highlight selected day | |
| (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days | |
| (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates | |
| (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day | |
| (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different) | |
| ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title | |
| (unselectable ? '' : ' data-handler="selectDay" data-event="click" data-month="' + printDate.getMonth() + '" data-year="' + printDate.getFullYear() + '"') + '>' + // actions | |
| (otherMonth && !showOtherMonths ? ' ' : // display for other months | |
| (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' + | |
| (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') + | |
| (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day | |
| (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months | |
| '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date | |
| printDate.setDate(printDate.getDate() + 1); | |
| printDate = this._daylightSavingAdjust(printDate); | |
| } | |
| calender += tbody + '</tr>'; | |
| } | |
| drawMonth++; | |
| if (drawMonth > 11) { | |
| drawMonth = 0; | |
| drawYear++; | |
| } | |
| calender += '</tbody></table>' + (isMultiMonth ? '</div>' + | |
| ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : ''); | |
| group += calender; | |
| } | |
| html += group; | |
| } | |
| html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? | |
| '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : ''); | |
| inst._keyEvent = false; | |
| return html; | |
| }, | |
| /* Generate the month and year header. */ | |
| _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, | |
| secondary, monthNames, monthNamesShort) { | |
| var changeMonth = this._get(inst, 'changeMonth'); | |
| var changeYear = this._get(inst, 'changeYear'); | |
| var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); | |
| var html = '<div class="ui-datepicker-title">'; | |
| var monthHtml = ''; | |
| // month selection | |
| if (secondary || !changeMonth) | |
| monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>'; | |
| else { | |
| var inMinYear = (minDate && minDate.getFullYear() == drawYear); | |
| var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); | |
| monthHtml += '<select class="ui-datepicker-month" data-handler="selectMonth" data-event="change">'; | |
| for (var month = 0; month < 12; month++) { | |
| if ((!inMinYear || month >= minDate.getMonth()) && | |
| (!inMaxYear || month <= maxDate.getMonth())) | |
| monthHtml += '<option value="' + month + '"' + | |
| (month == drawMonth ? ' selected="selected"' : '') + | |
| '>' + monthNamesShort[month] + '</option>'; | |
| } | |
| monthHtml += '</select>'; | |
| } | |
| if (!showMonthAfterYear) | |
| html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); | |
| // year selection | |
| if ( !inst.yearshtml ) { | |
| inst.yearshtml = ''; | |
| if (secondary || !changeYear) | |
| html += '<span class="ui-datepicker-year">' + drawYear + '</span>'; | |
| else { | |
| // determine range of years to display | |
| var years = this._get(inst, 'yearRange').split(':'); | |
| var thisYear = new Date().getFullYear(); | |
| var determineYear = function(value) { | |
| var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : | |
| (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : | |
| parseInt(value, 10))); | |
| return (isNaN(year) ? thisYear : year); | |
| }; | |
| var year = determineYear(years[0]); | |
| var endYear = Math.max(year, determineYear(years[1] || '')); | |
| year = (minDate ? Math.max(year, minDate.getFullYear()) : year); | |
| endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); | |
| inst.yearshtml += '<select class="ui-datepicker-year" data-handler="selectYear" data-event="change">'; | |
| for (; year <= endYear; year++) { | |
| inst.yearshtml += '<option value="' + year + '"' + | |
| (year == drawYear ? ' selected="selected"' : '') + | |
| '>' + year + '</option>'; | |
| } | |
| inst.yearshtml += '</select>'; | |
| html += inst.yearshtml; | |
| inst.yearshtml = null; | |
| } | |
| } | |
| html += this._get(inst, 'yearSuffix'); | |
| if (showMonthAfterYear) | |
| html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; | |
| html += '</div>'; // Close datepicker_header | |
| return html; | |
| }, | |
| /* Adjust one of the date sub-fields. */ | |
| _adjustInstDate: function(inst, offset, period) { | |
| var year = inst.drawYear + (period == 'Y' ? offset : 0); | |
| var month = inst.drawMonth + (period == 'M' ? offset : 0); | |
| var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + | |
| (period == 'D' ? offset : 0); | |
| var date = this._restrictMinMax(inst, | |
| this._daylightSavingAdjust(new Date(year, month, day))); | |
| inst.selectedDay = date.getDate(); | |
| inst.drawMonth = inst.selectedMonth = date.getMonth(); | |
| inst.drawYear = inst.selectedYear = date.getFullYear(); | |
| if (period == 'M' || period == 'Y') | |
| this._notifyChange(inst); | |
| }, | |
| /* Ensure a date is within any min/max bounds. */ | |
| _restrictMinMax: function(inst, date) { | |
| var minDate = this._getMinMaxDate(inst, 'min'); | |
| var maxDate = this._getMinMaxDate(inst, 'max'); | |
| var newDate = (minDate && date < minDate ? minDate : date); | |
| newDate = (maxDate && newDate > maxDate ? maxDate : newDate); | |
| return newDate; | |
| }, | |
| /* Notify change of month/year. */ | |
| _notifyChange: function(inst) { | |
| var onChange = this._get(inst, 'onChangeMonthYear'); | |
| if (onChange) | |
| onChange.apply((inst.input ? inst.input[0] : null), | |
| [inst.selectedYear, inst.selectedMonth + 1, inst]); | |
| }, | |
| /* Determine the number of months to show. */ | |
| _getNumberOfMonths: function(inst) { | |
| var numMonths = this._get(inst, 'numberOfMonths'); | |
| return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); | |
| }, | |
| /* Determine the current maximum date - ensure no time components are set. */ | |
| _getMinMaxDate: function(inst, minMax) { | |
| return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); | |
| }, | |
| /* Find the number of days in a given month. */ | |
| _getDaysInMonth: function(year, month) { | |
| return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); | |
| }, | |
| /* Find the day of the week of the first of a month. */ | |
| _getFirstDayOfMonth: function(year, month) { | |
| return new Date(year, month, 1).getDay(); | |
| }, | |
| /* Determines if we should allow a "next/prev" month display change. */ | |
| _canAdjustMonth: function(inst, offset, curYear, curMonth) { | |
| var numMonths = this._getNumberOfMonths(inst); | |
| var date = this._daylightSavingAdjust(new Date(curYear, | |
| curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); | |
| if (offset < 0) | |
| date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); | |
| return this._isInRange(inst, date); | |
| }, | |
| /* Is the given date in the accepted range? */ | |
| _isInRange: function(inst, date) { | |
| var minDate = this._getMinMaxDate(inst, 'min'); | |
| var maxDate = this._getMinMaxDate(inst, 'max'); | |
| return ((!minDate || date.getTime() >= minDate.getTime()) && | |
| (!maxDate || date.getTime() <= maxDate.getTime())); | |
| }, | |
| /* Provide the configuration settings for formatting/parsing. */ | |
| _getFormatConfig: function(inst) { | |
| var shortYearCutoff = this._get(inst, 'shortYearCutoff'); | |
| shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : | |
| new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); | |
| return {shortYearCutoff: shortYearCutoff, | |
| dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), | |
| monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; | |
| }, | |
| /* Format the given date for display. */ | |
| _formatDate: function(inst, day, month, year) { | |
| if (!day) { | |
| inst.currentDay = inst.selectedDay; | |
| inst.currentMonth = inst.selectedMonth; | |
| inst.currentYear = inst.selectedYear; | |
| } | |
| var date = (day ? (typeof day == 'object' ? day : | |
| this._daylightSavingAdjust(new Date(year, month, day))) : | |
| this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); | |
| return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); | |
| } | |
| }); | |
| /* | |
| * Bind hover events for datepicker elements. | |
| * Done via delegate so the binding only occurs once in the lifetime of the parent div. | |
| * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. | |
| */ | |
| function bindHover(dpDiv) { | |
| var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; | |
| return dpDiv.bind('mouseout', function(event) { | |
| var elem = $( event.target ).closest( selector ); | |
| if ( !elem.length ) { | |
| return; | |
| } | |
| elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); | |
| }) | |
| .bind('mouseover', function(event) { | |
| var elem = $( event.target ).closest( selector ); | |
| if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || | |
| !elem.length ) { | |
| return; | |
| } | |
| elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); | |
| elem.addClass('ui-state-hover'); | |
| if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); | |
| if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); | |
| }); | |
| } | |
| /* jQuery extend now ignores nulls! */ | |
| function extendRemove(target, props) { | |
| $.extend(target, props); | |
| for (var name in props) | |
| if (props[name] == null || props[name] == undefined) | |
| target[name] = props[name]; | |
| return target; | |
| }; | |
| /* Determine whether an object is an array. */ | |
| function isArray(a) { | |
| return (a && (($.browser.safari && typeof a == 'object' && a.length) || | |
| (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); | |
| }; | |
| /* Invoke the datepicker functionality. | |
| @param options string - a command, optionally followed by additional parameters or | |
| Object - settings for attaching new datepicker functionality | |
| @return jQuery object */ | |
| $.fn.datepicker = function(options){ | |
| /* Verify an empty collection wasn't passed - Fixes #6976 */ | |
| if ( !this.length ) { | |
| return this; | |
| } | |
| /* Initialise the date picker. */ | |
| if (!$.datepicker.initialized) { | |
| $(document).mousedown($.datepicker._checkExternalClick). | |
| find('body').append($.datepicker.dpDiv); | |
| $.datepicker.initialized = true; | |
| } | |
| var otherArgs = Array.prototype.slice.call(arguments, 1); | |
| if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) | |
| return $.datepicker['_' + options + 'Datepicker']. | |
| apply($.datepicker, [this[0]].concat(otherArgs)); | |
| if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') | |
| return $.datepicker['_' + options + 'Datepicker']. | |
| apply($.datepicker, [this[0]].concat(otherArgs)); | |
| return this.each(function() { | |
| typeof options == 'string' ? | |
| $.datepicker['_' + options + 'Datepicker']. | |
| apply($.datepicker, [this].concat(otherArgs)) : | |
| $.datepicker._attachDatepicker(this, options); | |
| }); | |
| }; | |
| $.datepicker = new Datepicker(); // singleton instance | |
| $.datepicker.initialized = false; | |
| $.datepicker.uuid = new Date().getTime(); | |
| $.datepicker.version = "1.8.22"; | |
| // Workaround for #4055 | |
| // Add another global to avoid noConflict issues with inline event handlers | |
| window['DP_jQuery_' + dpuuid] = $; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Progressbar 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Progressbar | |
| * | |
| * Depends: | |
| * jquery.ui.core.js | |
| * jquery.ui.widget.js | |
| */ | |
| (function( $, undefined ) { | |
| $.widget( "ui.progressbar", { | |
| options: { | |
| value: 0, | |
| max: 100 | |
| }, | |
| min: 0, | |
| _create: function() { | |
| this.element | |
| .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) | |
| .attr({ | |
| role: "progressbar", | |
| "aria-valuemin": this.min, | |
| "aria-valuemax": this.options.max, | |
| "aria-valuenow": this._value() | |
| }); | |
| this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" ) | |
| .appendTo( this.element ); | |
| this.oldValue = this._value(); | |
| this._refreshValue(); | |
| }, | |
| destroy: function() { | |
| this.element | |
| .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) | |
| .removeAttr( "role" ) | |
| .removeAttr( "aria-valuemin" ) | |
| .removeAttr( "aria-valuemax" ) | |
| .removeAttr( "aria-valuenow" ); | |
| this.valueDiv.remove(); | |
| $.Widget.prototype.destroy.apply( this, arguments ); | |
| }, | |
| value: function( newValue ) { | |
| if ( newValue === undefined ) { | |
| return this._value(); | |
| } | |
| this._setOption( "value", newValue ); | |
| return this; | |
| }, | |
| _setOption: function( key, value ) { | |
| if ( key === "value" ) { | |
| this.options.value = value; | |
| this._refreshValue(); | |
| if ( this._value() === this.options.max ) { | |
| this._trigger( "complete" ); | |
| } | |
| } | |
| $.Widget.prototype._setOption.apply( this, arguments ); | |
| }, | |
| _value: function() { | |
| var val = this.options.value; | |
| // normalize invalid value | |
| if ( typeof val !== "number" ) { | |
| val = 0; | |
| } | |
| return Math.min( this.options.max, Math.max( this.min, val ) ); | |
| }, | |
| _percentage: function() { | |
| return 100 * this._value() / this.options.max; | |
| }, | |
| _refreshValue: function() { | |
| var value = this.value(); | |
| var percentage = this._percentage(); | |
| if ( this.oldValue !== value ) { | |
| this.oldValue = value; | |
| this._trigger( "change" ); | |
| } | |
| this.valueDiv | |
| .toggle( value > this.min ) | |
| .toggleClass( "ui-corner-right", value === this.options.max ) | |
| .width( percentage.toFixed(0) + "%" ); | |
| this.element.attr( "aria-valuenow", value ); | |
| } | |
| }); | |
| $.extend( $.ui.progressbar, { | |
| version: "1.8.22" | |
| }); | |
| })( jQuery ); | |
| /*! | |
| * jQuery UI Effects 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Effects/ | |
| */ | |
| ;jQuery.effects || (function($, undefined) { | |
| $.effects = {}; | |
| /******************************************************************************/ | |
| /****************************** COLOR ANIMATIONS ******************************/ | |
| /******************************************************************************/ | |
| // override the animation for color styles | |
| $.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', | |
| 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'], | |
| function(i, attr) { | |
| $.fx.step[attr] = function(fx) { | |
| if (!fx.colorInit) { | |
| fx.start = getColor(fx.elem, attr); | |
| fx.end = getRGB(fx.end); | |
| fx.colorInit = true; | |
| } | |
| fx.elem.style[attr] = 'rgb(' + | |
| Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' + | |
| Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' + | |
| Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')'; | |
| }; | |
| }); | |
| // Color Conversion functions from highlightFade | |
| // By Blair Mitchelmore | |
| // http://jquery.offput.ca/highlightFade/ | |
| // Parse strings looking for color tuples [255,255,255] | |
| function getRGB(color) { | |
| var result; | |
| // Check if we're already dealing with an array of colors | |
| if ( color && color.constructor == Array && color.length == 3 ) | |
| return color; | |
| // Look for rgb(num,num,num) | |
| if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color)) | |
| return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)]; | |
| // Look for rgb(num%,num%,num%) | |
| if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color)) | |
| return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55]; | |
| // Look for #a0b1c2 | |
| if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color)) | |
| return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)]; | |
| // Look for #fff | |
| if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color)) | |
| return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)]; | |
| // Look for rgba(0, 0, 0, 0) == transparent in Safari 3 | |
| if (result = /rgba\(0, 0, 0, 0\)/.exec(color)) | |
| return colors['transparent']; | |
| // Otherwise, we're most likely dealing with a named color | |
| return colors[$.trim(color).toLowerCase()]; | |
| } | |
| function getColor(elem, attr) { | |
| var color; | |
| do { | |
| // jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css | |
| color = ($.curCSS || $.css)(elem, attr); | |
| // Keep going until we find an element that has color, or we hit the body | |
| if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") ) | |
| break; | |
| attr = "backgroundColor"; | |
| } while ( elem = elem.parentNode ); | |
| return getRGB(color); | |
| }; | |
| // Some named colors to work with | |
| // From Interface by Stefan Petre | |
| // http://interface.eyecon.ro/ | |
| var colors = { | |
| aqua:[0,255,255], | |
| azure:[240,255,255], | |
| beige:[245,245,220], | |
| black:[0,0,0], | |
| blue:[0,0,255], | |
| brown:[165,42,42], | |
| cyan:[0,255,255], | |
| darkblue:[0,0,139], | |
| darkcyan:[0,139,139], | |
| darkgrey:[169,169,169], | |
| darkgreen:[0,100,0], | |
| darkkhaki:[189,183,107], | |
| darkmagenta:[139,0,139], | |
| darkolivegreen:[85,107,47], | |
| darkorange:[255,140,0], | |
| darkorchid:[153,50,204], | |
| darkred:[139,0,0], | |
| darksalmon:[233,150,122], | |
| darkviolet:[148,0,211], | |
| fuchsia:[255,0,255], | |
| gold:[255,215,0], | |
| green:[0,128,0], | |
| indigo:[75,0,130], | |
| khaki:[240,230,140], | |
| lightblue:[173,216,230], | |
| lightcyan:[224,255,255], | |
| lightgreen:[144,238,144], | |
| lightgrey:[211,211,211], | |
| lightpink:[255,182,193], | |
| lightyellow:[255,255,224], | |
| lime:[0,255,0], | |
| magenta:[255,0,255], | |
| maroon:[128,0,0], | |
| navy:[0,0,128], | |
| olive:[128,128,0], | |
| orange:[255,165,0], | |
| pink:[255,192,203], | |
| purple:[128,0,128], | |
| violet:[128,0,128], | |
| red:[255,0,0], | |
| silver:[192,192,192], | |
| white:[255,255,255], | |
| yellow:[255,255,0], | |
| transparent: [255,255,255] | |
| }; | |
| /******************************************************************************/ | |
| /****************************** CLASS ANIMATIONS ******************************/ | |
| /******************************************************************************/ | |
| var classAnimationActions = ['add', 'remove', 'toggle'], | |
| shorthandStyles = { | |
| border: 1, | |
| borderBottom: 1, | |
| borderColor: 1, | |
| borderLeft: 1, | |
| borderRight: 1, | |
| borderTop: 1, | |
| borderWidth: 1, | |
| margin: 1, | |
| padding: 1 | |
| }; | |
| function getElementStyles() { | |
| var style = document.defaultView | |
| ? document.defaultView.getComputedStyle(this, null) | |
| : this.currentStyle, | |
| newStyle = {}, | |
| key, | |
| camelCase; | |
| // webkit enumerates style porperties | |
| if (style && style.length && style[0] && style[style[0]]) { | |
| var len = style.length; | |
| while (len--) { | |
| key = style[len]; | |
| if (typeof style[key] == 'string') { | |
| camelCase = key.replace(/\-(\w)/g, function(all, letter){ | |
| return letter.toUpperCase(); | |
| }); | |
| newStyle[camelCase] = style[key]; | |
| } | |
| } | |
| } else { | |
| for (key in style) { | |
| if (typeof style[key] === 'string') { | |
| newStyle[key] = style[key]; | |
| } | |
| } | |
| } | |
| return newStyle; | |
| } | |
| function filterStyles(styles) { | |
| var name, value; | |
| for (name in styles) { | |
| value = styles[name]; | |
| if ( | |
| // ignore null and undefined values | |
| value == null || | |
| // ignore functions (when does this occur?) | |
| $.isFunction(value) || | |
| // shorthand styles that need to be expanded | |
| name in shorthandStyles || | |
| // ignore scrollbars (break in IE) | |
| (/scrollbar/).test(name) || | |
| // only colors or values that can be converted to numbers | |
| (!(/color/i).test(name) && isNaN(parseFloat(value))) | |
| ) { | |
| delete styles[name]; | |
| } | |
| } | |
| return styles; | |
| } | |
| function styleDifference(oldStyle, newStyle) { | |
| var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459 | |
| name; | |
| for (name in newStyle) { | |
| if (oldStyle[name] != newStyle[name]) { | |
| diff[name] = newStyle[name]; | |
| } | |
| } | |
| return diff; | |
| } | |
| $.effects.animateClass = function(value, duration, easing, callback) { | |
| if ($.isFunction(easing)) { | |
| callback = easing; | |
| easing = null; | |
| } | |
| return this.queue(function() { | |
| var that = $(this), | |
| originalStyleAttr = that.attr('style') || ' ', | |
| originalStyle = filterStyles(getElementStyles.call(this)), | |
| newStyle, | |
| className = that.attr('class') || ""; | |
| $.each(classAnimationActions, function(i, action) { | |
| if (value[action]) { | |
| that[action + 'Class'](value[action]); | |
| } | |
| }); | |
| newStyle = filterStyles(getElementStyles.call(this)); | |
| that.attr('class', className); | |
| that.animate(styleDifference(originalStyle, newStyle), { | |
| queue: false, | |
| duration: duration, | |
| easing: easing, | |
| complete: function() { | |
| $.each(classAnimationActions, function(i, action) { | |
| if (value[action]) { that[action + 'Class'](value[action]); } | |
| }); | |
| // work around bug in IE by clearing the cssText before setting it | |
| if (typeof that.attr('style') == 'object') { | |
| that.attr('style').cssText = ''; | |
| that.attr('style').cssText = originalStyleAttr; | |
| } else { | |
| that.attr('style', originalStyleAttr); | |
| } | |
| if (callback) { callback.apply(this, arguments); } | |
| $.dequeue( this ); | |
| } | |
| }); | |
| }); | |
| }; | |
| $.fn.extend({ | |
| _addClass: $.fn.addClass, | |
| addClass: function(classNames, speed, easing, callback) { | |
| return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames); | |
| }, | |
| _removeClass: $.fn.removeClass, | |
| removeClass: function(classNames,speed,easing,callback) { | |
| return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames); | |
| }, | |
| _toggleClass: $.fn.toggleClass, | |
| toggleClass: function(classNames, force, speed, easing, callback) { | |
| if ( typeof force == "boolean" || force === undefined ) { | |
| if ( !speed ) { | |
| // without speed parameter; | |
| return this._toggleClass(classNames, force); | |
| } else { | |
| return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]); | |
| } | |
| } else { | |
| // without switch parameter; | |
| return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]); | |
| } | |
| }, | |
| switchClass: function(remove,add,speed,easing,callback) { | |
| return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]); | |
| } | |
| }); | |
| /******************************************************************************/ | |
| /*********************************** EFFECTS **********************************/ | |
| /******************************************************************************/ | |
| $.extend($.effects, { | |
| version: "1.8.22", | |
| // Saves a set of properties in a data storage | |
| save: function(element, set) { | |
| for(var i=0; i < set.length; i++) { | |
| if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]); | |
| } | |
| }, | |
| // Restores a set of previously saved properties from a data storage | |
| restore: function(element, set) { | |
| for(var i=0; i < set.length; i++) { | |
| if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i])); | |
| } | |
| }, | |
| setMode: function(el, mode) { | |
| if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle | |
| return mode; | |
| }, | |
| getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value | |
| // this should be a little more flexible in the future to handle a string & hash | |
| var y, x; | |
| switch (origin[0]) { | |
| case 'top': y = 0; break; | |
| case 'middle': y = 0.5; break; | |
| case 'bottom': y = 1; break; | |
| default: y = origin[0] / original.height; | |
| }; | |
| switch (origin[1]) { | |
| case 'left': x = 0; break; | |
| case 'center': x = 0.5; break; | |
| case 'right': x = 1; break; | |
| default: x = origin[1] / original.width; | |
| }; | |
| return {x: x, y: y}; | |
| }, | |
| // Wraps the element around a wrapper that copies position properties | |
| createWrapper: function(element) { | |
| // if the element is already wrapped, return it | |
| if (element.parent().is('.ui-effects-wrapper')) { | |
| return element.parent(); | |
| } | |
| // wrap the element | |
| var props = { | |
| width: element.outerWidth(true), | |
| height: element.outerHeight(true), | |
| 'float': element.css('float') | |
| }, | |
| wrapper = $('<div></div>') | |
| .addClass('ui-effects-wrapper') | |
| .css({ | |
| fontSize: '100%', | |
| background: 'transparent', | |
| border: 'none', | |
| margin: 0, | |
| padding: 0 | |
| }), | |
| active = document.activeElement; | |
| // support: Firefox | |
| // Firefox incorrectly exposes anonymous content | |
| // https://bugzilla.mozilla.org/show_bug.cgi?id=561664 | |
| try { | |
| active.id; | |
| } catch( e ) { | |
| active = document.body; | |
| } | |
| element.wrap( wrapper ); | |
| // Fixes #7595 - Elements lose focus when wrapped. | |
| if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { | |
| $( active ).focus(); | |
| } | |
| wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element | |
| // transfer positioning properties to the wrapper | |
| if (element.css('position') == 'static') { | |
| wrapper.css({ position: 'relative' }); | |
| element.css({ position: 'relative' }); | |
| } else { | |
| $.extend(props, { | |
| position: element.css('position'), | |
| zIndex: element.css('z-index') | |
| }); | |
| $.each(['top', 'left', 'bottom', 'right'], function(i, pos) { | |
| props[pos] = element.css(pos); | |
| if (isNaN(parseInt(props[pos], 10))) { | |
| props[pos] = 'auto'; | |
| } | |
| }); | |
| element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' }); | |
| } | |
| return wrapper.css(props).show(); | |
| }, | |
| removeWrapper: function(element) { | |
| var parent, | |
| active = document.activeElement; | |
| if (element.parent().is('.ui-effects-wrapper')) { | |
| parent = element.parent().replaceWith(element); | |
| // Fixes #7595 - Elements lose focus when wrapped. | |
| if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { | |
| $( active ).focus(); | |
| } | |
| return parent; | |
| } | |
| return element; | |
| }, | |
| setTransition: function(element, list, factor, value) { | |
| value = value || {}; | |
| $.each(list, function(i, x){ | |
| var unit = element.cssUnit(x); | |
| if (unit[0] > 0) value[x] = unit[0] * factor + unit[1]; | |
| }); | |
| return value; | |
| } | |
| }); | |
| function _normalizeArguments(effect, options, speed, callback) { | |
| // shift params for method overloading | |
| if (typeof effect == 'object') { | |
| callback = options; | |
| speed = null; | |
| options = effect; | |
| effect = options.effect; | |
| } | |
| if ($.isFunction(options)) { | |
| callback = options; | |
| speed = null; | |
| options = {}; | |
| } | |
| if (typeof options == 'number' || $.fx.speeds[options]) { | |
| callback = speed; | |
| speed = options; | |
| options = {}; | |
| } | |
| if ($.isFunction(speed)) { | |
| callback = speed; | |
| speed = null; | |
| } | |
| options = options || {}; | |
| speed = speed || options.duration; | |
| speed = $.fx.off ? 0 : typeof speed == 'number' | |
| ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default; | |
| callback = callback || options.complete; | |
| return [effect, options, speed, callback]; | |
| } | |
| function standardSpeed( speed ) { | |
| // valid standard speeds | |
| if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { | |
| return true; | |
| } | |
| // invalid strings - treat as "normal" speed | |
| if ( typeof speed === "string" && !$.effects[ speed ] ) { | |
| return true; | |
| } | |
| return false; | |
| } | |
| $.fn.extend({ | |
| effect: function(effect, options, speed, callback) { | |
| var args = _normalizeArguments.apply(this, arguments), | |
| // TODO: make effects take actual parameters instead of a hash | |
| args2 = { | |
| options: args[1], | |
| duration: args[2], | |
| callback: args[3] | |
| }, | |
| mode = args2.options.mode, | |
| effectMethod = $.effects[effect]; | |
| if ( $.fx.off || !effectMethod ) { | |
| // delegate to the original method (e.g., .show()) if possible | |
| if ( mode ) { | |
| return this[ mode ]( args2.duration, args2.callback ); | |
| } else { | |
| return this.each(function() { | |
| if ( args2.callback ) { | |
| args2.callback.call( this ); | |
| } | |
| }); | |
| } | |
| } | |
| return effectMethod.call(this, args2); | |
| }, | |
| _show: $.fn.show, | |
| show: function(speed) { | |
| if ( standardSpeed( speed ) ) { | |
| return this._show.apply(this, arguments); | |
| } else { | |
| var args = _normalizeArguments.apply(this, arguments); | |
| args[1].mode = 'show'; | |
| return this.effect.apply(this, args); | |
| } | |
| }, | |
| _hide: $.fn.hide, | |
| hide: function(speed) { | |
| if ( standardSpeed( speed ) ) { | |
| return this._hide.apply(this, arguments); | |
| } else { | |
| var args = _normalizeArguments.apply(this, arguments); | |
| args[1].mode = 'hide'; | |
| return this.effect.apply(this, args); | |
| } | |
| }, | |
| // jQuery core overloads toggle and creates _toggle | |
| __toggle: $.fn.toggle, | |
| toggle: function(speed) { | |
| if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { | |
| return this.__toggle.apply(this, arguments); | |
| } else { | |
| var args = _normalizeArguments.apply(this, arguments); | |
| args[1].mode = 'toggle'; | |
| return this.effect.apply(this, args); | |
| } | |
| }, | |
| // helper functions | |
| cssUnit: function(key) { | |
| var style = this.css(key), val = []; | |
| $.each( ['em','px','%','pt'], function(i, unit){ | |
| if(style.indexOf(unit) > 0) | |
| val = [parseFloat(style), unit]; | |
| }); | |
| return val; | |
| } | |
| }); | |
| /******************************************************************************/ | |
| /*********************************** EASING ***********************************/ | |
| /******************************************************************************/ | |
| /* | |
| * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/ | |
| * | |
| * Uses the built in easing capabilities added In jQuery 1.1 | |
| * to offer multiple easing options | |
| * | |
| * TERMS OF USE - jQuery Easing | |
| * | |
| * Open source under the BSD License. | |
| * | |
| * Copyright 2008 George McGinley Smith | |
| * All rights reserved. | |
| * | |
| * Redistribution and use in source and binary forms, with or without modification, | |
| * are permitted provided that the following conditions are met: | |
| * | |
| * Redistributions of source code must retain the above copyright notice, this list of | |
| * conditions and the following disclaimer. | |
| * Redistributions in binary form must reproduce the above copyright notice, this list | |
| * of conditions and the following disclaimer in the documentation and/or other materials | |
| * provided with the distribution. | |
| * | |
| * Neither the name of the author nor the names of contributors may be used to endorse | |
| * or promote products derived from this software without specific prior written permission. | |
| * | |
| * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY | |
| * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF | |
| * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE | |
| * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, | |
| * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE | |
| * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED | |
| * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING | |
| * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED | |
| * OF THE POSSIBILITY OF SUCH DAMAGE. | |
| * | |
| */ | |
| // t: current time, b: begInnIng value, c: change In value, d: duration | |
| $.easing.jswing = $.easing.swing; | |
| $.extend($.easing, | |
| { | |
| def: 'easeOutQuad', | |
| swing: function (x, t, b, c, d) { | |
| //alert($.easing.default); | |
| return $.easing[$.easing.def](x, t, b, c, d); | |
| }, | |
| easeInQuad: function (x, t, b, c, d) { | |
| return c*(t/=d)*t + b; | |
| }, | |
| easeOutQuad: function (x, t, b, c, d) { | |
| return -c *(t/=d)*(t-2) + b; | |
| }, | |
| easeInOutQuad: function (x, t, b, c, d) { | |
| if ((t/=d/2) < 1) return c/2*t*t + b; | |
| return -c/2 * ((--t)*(t-2) - 1) + b; | |
| }, | |
| easeInCubic: function (x, t, b, c, d) { | |
| return c*(t/=d)*t*t + b; | |
| }, | |
| easeOutCubic: function (x, t, b, c, d) { | |
| return c*((t=t/d-1)*t*t + 1) + b; | |
| }, | |
| easeInOutCubic: function (x, t, b, c, d) { | |
| if ((t/=d/2) < 1) return c/2*t*t*t + b; | |
| return c/2*((t-=2)*t*t + 2) + b; | |
| }, | |
| easeInQuart: function (x, t, b, c, d) { | |
| return c*(t/=d)*t*t*t + b; | |
| }, | |
| easeOutQuart: function (x, t, b, c, d) { | |
| return -c * ((t=t/d-1)*t*t*t - 1) + b; | |
| }, | |
| easeInOutQuart: function (x, t, b, c, d) { | |
| if ((t/=d/2) < 1) return c/2*t*t*t*t + b; | |
| return -c/2 * ((t-=2)*t*t*t - 2) + b; | |
| }, | |
| easeInQuint: function (x, t, b, c, d) { | |
| return c*(t/=d)*t*t*t*t + b; | |
| }, | |
| easeOutQuint: function (x, t, b, c, d) { | |
| return c*((t=t/d-1)*t*t*t*t + 1) + b; | |
| }, | |
| easeInOutQuint: function (x, t, b, c, d) { | |
| if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b; | |
| return c/2*((t-=2)*t*t*t*t + 2) + b; | |
| }, | |
| easeInSine: function (x, t, b, c, d) { | |
| return -c * Math.cos(t/d * (Math.PI/2)) + c + b; | |
| }, | |
| easeOutSine: function (x, t, b, c, d) { | |
| return c * Math.sin(t/d * (Math.PI/2)) + b; | |
| }, | |
| easeInOutSine: function (x, t, b, c, d) { | |
| return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b; | |
| }, | |
| easeInExpo: function (x, t, b, c, d) { | |
| return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b; | |
| }, | |
| easeOutExpo: function (x, t, b, c, d) { | |
| return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b; | |
| }, | |
| easeInOutExpo: function (x, t, b, c, d) { | |
| if (t==0) return b; | |
| if (t==d) return b+c; | |
| if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b; | |
| return c/2 * (-Math.pow(2, -10 * --t) + 2) + b; | |
| }, | |
| easeInCirc: function (x, t, b, c, d) { | |
| return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b; | |
| }, | |
| easeOutCirc: function (x, t, b, c, d) { | |
| return c * Math.sqrt(1 - (t=t/d-1)*t) + b; | |
| }, | |
| easeInOutCirc: function (x, t, b, c, d) { | |
| if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b; | |
| return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b; | |
| }, | |
| easeInElastic: function (x, t, b, c, d) { | |
| var s=1.70158;var p=0;var a=c; | |
| if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; | |
| if (a < Math.abs(c)) { a=c; var s=p/4; } | |
| else var s = p/(2*Math.PI) * Math.asin (c/a); | |
| return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; | |
| }, | |
| easeOutElastic: function (x, t, b, c, d) { | |
| var s=1.70158;var p=0;var a=c; | |
| if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3; | |
| if (a < Math.abs(c)) { a=c; var s=p/4; } | |
| else var s = p/(2*Math.PI) * Math.asin (c/a); | |
| return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b; | |
| }, | |
| easeInOutElastic: function (x, t, b, c, d) { | |
| var s=1.70158;var p=0;var a=c; | |
| if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5); | |
| if (a < Math.abs(c)) { a=c; var s=p/4; } | |
| else var s = p/(2*Math.PI) * Math.asin (c/a); | |
| if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b; | |
| return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b; | |
| }, | |
| easeInBack: function (x, t, b, c, d, s) { | |
| if (s == undefined) s = 1.70158; | |
| return c*(t/=d)*t*((s+1)*t - s) + b; | |
| }, | |
| easeOutBack: function (x, t, b, c, d, s) { | |
| if (s == undefined) s = 1.70158; | |
| return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b; | |
| }, | |
| easeInOutBack: function (x, t, b, c, d, s) { | |
| if (s == undefined) s = 1.70158; | |
| if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b; | |
| return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b; | |
| }, | |
| easeInBounce: function (x, t, b, c, d) { | |
| return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b; | |
| }, | |
| easeOutBounce: function (x, t, b, c, d) { | |
| if ((t/=d) < (1/2.75)) { | |
| return c*(7.5625*t*t) + b; | |
| } else if (t < (2/2.75)) { | |
| return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b; | |
| } else if (t < (2.5/2.75)) { | |
| return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b; | |
| } else { | |
| return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b; | |
| } | |
| }, | |
| easeInOutBounce: function (x, t, b, c, d) { | |
| if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b; | |
| return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b; | |
| } | |
| }); | |
| /* | |
| * | |
| * TERMS OF USE - EASING EQUATIONS | |
| * | |
| * Open source under the BSD License. | |
| * | |
| * Copyright 2001 Robert Penner | |
| * All rights reserved. | |
| * | |
| * Redistribution and use in source and binary forms, with or without modification, | |
| * are permitted provided that the following conditions are met: | |
| * | |
| * Redistributions of source code must retain the above copyright notice, this list of | |
| * conditions and the following disclaimer. | |
| * Redistributions in binary form must reproduce the above copyright notice, this list | |
| * of conditions and the following disclaimer in the documentation and/or other materials | |
| * provided with the distribution. | |
| * | |
| * Neither the name of the author nor the names of contributors may be used to endorse | |
| * or promote products derived from this software without specific prior written permission. | |
| * | |
| * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY | |
| * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF | |
| * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE | |
| * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, | |
| * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE | |
| * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED | |
| * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING | |
| * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED | |
| * OF THE POSSIBILITY OF SUCH DAMAGE. | |
| * | |
| */ | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Effects Blind 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Effects/Blind | |
| * | |
| * Depends: | |
| * jquery.effects.core.js | |
| */ | |
| (function( $, undefined ) { | |
| $.effects.blind = function(o) { | |
| return this.queue(function() { | |
| // Create element | |
| var el = $(this), props = ['position','top','bottom','left','right']; | |
| // Set options | |
| var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode | |
| var direction = o.options.direction || 'vertical'; // Default direction | |
| // Adjust | |
| $.effects.save(el, props); el.show(); // Save & Show | |
| var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper | |
| var ref = (direction == 'vertical') ? 'height' : 'width'; | |
| var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width(); | |
| if(mode == 'show') wrapper.css(ref, 0); // Shift | |
| // Animation | |
| var animation = {}; | |
| animation[ref] = mode == 'show' ? distance : 0; | |
| // Animate | |
| wrapper.animate(animation, o.duration, o.options.easing, function() { | |
| if(mode == 'hide') el.hide(); // Hide | |
| $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore | |
| if(o.callback) o.callback.apply(el[0], arguments); // Callback | |
| el.dequeue(); | |
| }); | |
| }); | |
| }; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Effects Bounce 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Effects/Bounce | |
| * | |
| * Depends: | |
| * jquery.effects.core.js | |
| */ | |
| (function( $, undefined ) { | |
| $.effects.bounce = function(o) { | |
| return this.queue(function() { | |
| // Create element | |
| var el = $(this), props = ['position','top','bottom','left','right']; | |
| // Set options | |
| var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode | |
| var direction = o.options.direction || 'up'; // Default direction | |
| var distance = o.options.distance || 20; // Default distance | |
| var times = o.options.times || 5; // Default # of times | |
| var speed = o.duration || 250; // Default speed per bounce | |
| if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE | |
| // Adjust | |
| $.effects.save(el, props); el.show(); // Save & Show | |
| $.effects.createWrapper(el); // Create Wrapper | |
| var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; | |
| var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; | |
| var distance = o.options.distance || (ref == 'top' ? el.outerHeight(true) / 3 : el.outerWidth(true) / 3); | |
| if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift | |
| if (mode == 'hide') distance = distance / (times * 2); | |
| if (mode != 'hide') times--; | |
| // Animate | |
| if (mode == 'show') { // Show Bounce | |
| var animation = {opacity: 1}; | |
| animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance; | |
| el.animate(animation, speed / 2, o.options.easing); | |
| distance = distance / 2; | |
| times--; | |
| }; | |
| for (var i = 0; i < times; i++) { // Bounces | |
| var animation1 = {}, animation2 = {}; | |
| animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; | |
| animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; | |
| el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing); | |
| distance = (mode == 'hide') ? distance * 2 : distance / 2; | |
| }; | |
| if (mode == 'hide') { // Last Bounce | |
| var animation = {opacity: 0}; | |
| animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; | |
| el.animate(animation, speed / 2, o.options.easing, function(){ | |
| el.hide(); // Hide | |
| $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore | |
| if(o.callback) o.callback.apply(this, arguments); // Callback | |
| }); | |
| } else { | |
| var animation1 = {}, animation2 = {}; | |
| animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance; | |
| animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance; | |
| el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){ | |
| $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore | |
| if(o.callback) o.callback.apply(this, arguments); // Callback | |
| }); | |
| }; | |
| el.queue('fx', function() { el.dequeue(); }); | |
| el.dequeue(); | |
| }); | |
| }; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Effects Clip 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Effects/Clip | |
| * | |
| * Depends: | |
| * jquery.effects.core.js | |
| */ | |
| (function( $, undefined ) { | |
| $.effects.clip = function(o) { | |
| return this.queue(function() { | |
| // Create element | |
| var el = $(this), props = ['position','top','bottom','left','right','height','width']; | |
| // Set options | |
| var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode | |
| var direction = o.options.direction || 'vertical'; // Default direction | |
| // Adjust | |
| $.effects.save(el, props); el.show(); // Save & Show | |
| var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper | |
| var animate = el[0].tagName == 'IMG' ? wrapper : el; | |
| var ref = { | |
| size: (direction == 'vertical') ? 'height' : 'width', | |
| position: (direction == 'vertical') ? 'top' : 'left' | |
| }; | |
| var distance = (direction == 'vertical') ? animate.height() : animate.width(); | |
| if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift | |
| // Animation | |
| var animation = {}; | |
| animation[ref.size] = mode == 'show' ? distance : 0; | |
| animation[ref.position] = mode == 'show' ? 0 : distance / 2; | |
| // Animate | |
| animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { | |
| if(mode == 'hide') el.hide(); // Hide | |
| $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore | |
| if(o.callback) o.callback.apply(el[0], arguments); // Callback | |
| el.dequeue(); | |
| }}); | |
| }); | |
| }; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Effects Drop 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Effects/Drop | |
| * | |
| * Depends: | |
| * jquery.effects.core.js | |
| */ | |
| (function( $, undefined ) { | |
| $.effects.drop = function(o) { | |
| return this.queue(function() { | |
| // Create element | |
| var el = $(this), props = ['position','top','bottom','left','right','opacity']; | |
| // Set options | |
| var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode | |
| var direction = o.options.direction || 'left'; // Default Direction | |
| // Adjust | |
| $.effects.save(el, props); el.show(); // Save & Show | |
| $.effects.createWrapper(el); // Create Wrapper | |
| var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; | |
| var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; | |
| var distance = o.options.distance || (ref == 'top' ? el.outerHeight( true ) / 2 : el.outerWidth( true ) / 2); | |
| if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift | |
| // Animation | |
| var animation = {opacity: mode == 'show' ? 1 : 0}; | |
| animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; | |
| // Animate | |
| el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { | |
| if(mode == 'hide') el.hide(); // Hide | |
| $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore | |
| if(o.callback) o.callback.apply(this, arguments); // Callback | |
| el.dequeue(); | |
| }}); | |
| }); | |
| }; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Effects Explode 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Effects/Explode | |
| * | |
| * Depends: | |
| * jquery.effects.core.js | |
| */ | |
| (function( $, undefined ) { | |
| $.effects.explode = function(o) { | |
| return this.queue(function() { | |
| var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; | |
| var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3; | |
| o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode; | |
| var el = $(this).show().css('visibility', 'hidden'); | |
| var offset = el.offset(); | |
| //Substract the margins - not fixing the problem yet. | |
| offset.top -= parseInt(el.css("marginTop"),10) || 0; | |
| offset.left -= parseInt(el.css("marginLeft"),10) || 0; | |
| var width = el.outerWidth(true); | |
| var height = el.outerHeight(true); | |
| for(var i=0;i<rows;i++) { // = | |
| for(var j=0;j<cells;j++) { // || | |
| el | |
| .clone() | |
| .appendTo('body') | |
| .wrap('<div></div>') | |
| .css({ | |
| position: 'absolute', | |
| visibility: 'visible', | |
| left: -j*(width/cells), | |
| top: -i*(height/rows) | |
| }) | |
| .parent() | |
| .addClass('ui-effects-explode') | |
| .css({ | |
| position: 'absolute', | |
| overflow: 'hidden', | |
| width: width/cells, | |
| height: height/rows, | |
| left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0), | |
| top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0), | |
| opacity: o.options.mode == 'show' ? 0 : 1 | |
| }).animate({ | |
| left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)), | |
| top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)), | |
| opacity: o.options.mode == 'show' ? 1 : 0 | |
| }, o.duration || 500); | |
| } | |
| } | |
| // Set a timeout, to call the callback approx. when the other animations have finished | |
| setTimeout(function() { | |
| o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide(); | |
| if(o.callback) o.callback.apply(el[0]); // Callback | |
| el.dequeue(); | |
| $('div.ui-effects-explode').remove(); | |
| }, o.duration || 500); | |
| }); | |
| }; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Effects Fade 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Effects/Fade | |
| * | |
| * Depends: | |
| * jquery.effects.core.js | |
| */ | |
| (function( $, undefined ) { | |
| $.effects.fade = function(o) { | |
| return this.queue(function() { | |
| var elem = $(this), | |
| mode = $.effects.setMode(elem, o.options.mode || 'hide'); | |
| elem.animate({ opacity: mode }, { | |
| queue: false, | |
| duration: o.duration, | |
| easing: o.options.easing, | |
| complete: function() { | |
| (o.callback && o.callback.apply(this, arguments)); | |
| elem.dequeue(); | |
| } | |
| }); | |
| }); | |
| }; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Effects Fold 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Effects/Fold | |
| * | |
| * Depends: | |
| * jquery.effects.core.js | |
| */ | |
| (function( $, undefined ) { | |
| $.effects.fold = function(o) { | |
| return this.queue(function() { | |
| // Create element | |
| var el = $(this), props = ['position','top','bottom','left','right']; | |
| // Set options | |
| var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode | |
| var size = o.options.size || 15; // Default fold size | |
| var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value | |
| var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2; | |
| // Adjust | |
| $.effects.save(el, props); el.show(); // Save & Show | |
| var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper | |
| var widthFirst = ((mode == 'show') != horizFirst); | |
| var ref = widthFirst ? ['width', 'height'] : ['height', 'width']; | |
| var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()]; | |
| var percent = /([0-9]+)%/.exec(size); | |
| if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1]; | |
| if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift | |
| // Animation | |
| var animation1 = {}, animation2 = {}; | |
| animation1[ref[0]] = mode == 'show' ? distance[0] : size; | |
| animation2[ref[1]] = mode == 'show' ? distance[1] : 0; | |
| // Animate | |
| wrapper.animate(animation1, duration, o.options.easing) | |
| .animate(animation2, duration, o.options.easing, function() { | |
| if(mode == 'hide') el.hide(); // Hide | |
| $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore | |
| if(o.callback) o.callback.apply(el[0], arguments); // Callback | |
| el.dequeue(); | |
| }); | |
| }); | |
| }; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Effects Highlight 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Effects/Highlight | |
| * | |
| * Depends: | |
| * jquery.effects.core.js | |
| */ | |
| (function( $, undefined ) { | |
| $.effects.highlight = function(o) { | |
| return this.queue(function() { | |
| var elem = $(this), | |
| props = ['backgroundImage', 'backgroundColor', 'opacity'], | |
| mode = $.effects.setMode(elem, o.options.mode || 'show'), | |
| animation = { | |
| backgroundColor: elem.css('backgroundColor') | |
| }; | |
| if (mode == 'hide') { | |
| animation.opacity = 0; | |
| } | |
| $.effects.save(elem, props); | |
| elem | |
| .show() | |
| .css({ | |
| backgroundImage: 'none', | |
| backgroundColor: o.options.color || '#ffff99' | |
| }) | |
| .animate(animation, { | |
| queue: false, | |
| duration: o.duration, | |
| easing: o.options.easing, | |
| complete: function() { | |
| (mode == 'hide' && elem.hide()); | |
| $.effects.restore(elem, props); | |
| (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter')); | |
| (o.callback && o.callback.apply(this, arguments)); | |
| elem.dequeue(); | |
| } | |
| }); | |
| }); | |
| }; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Effects Pulsate 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Effects/Pulsate | |
| * | |
| * Depends: | |
| * jquery.effects.core.js | |
| */ | |
| (function( $, undefined ) { | |
| $.effects.pulsate = function(o) { | |
| return this.queue(function() { | |
| var elem = $(this), | |
| mode = $.effects.setMode(elem, o.options.mode || 'show'), | |
| times = ((o.options.times || 5) * 2) - 1, | |
| duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2, | |
| isVisible = elem.is(':visible'), | |
| animateTo = 0; | |
| if (!isVisible) { | |
| elem.css('opacity', 0).show(); | |
| animateTo = 1; | |
| } | |
| if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) { | |
| times--; | |
| } | |
| for (var i = 0; i < times; i++) { | |
| elem.animate({ opacity: animateTo }, duration, o.options.easing); | |
| animateTo = (animateTo + 1) % 2; | |
| } | |
| elem.animate({ opacity: animateTo }, duration, o.options.easing, function() { | |
| if (animateTo == 0) { | |
| elem.hide(); | |
| } | |
| (o.callback && o.callback.apply(this, arguments)); | |
| }); | |
| elem | |
| .queue('fx', function() { elem.dequeue(); }) | |
| .dequeue(); | |
| }); | |
| }; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Effects Scale 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Effects/Scale | |
| * | |
| * Depends: | |
| * jquery.effects.core.js | |
| */ | |
| (function( $, undefined ) { | |
| $.effects.puff = function(o) { | |
| return this.queue(function() { | |
| var elem = $(this), | |
| mode = $.effects.setMode(elem, o.options.mode || 'hide'), | |
| percent = parseInt(o.options.percent, 10) || 150, | |
| factor = percent / 100, | |
| original = { height: elem.height(), width: elem.width() }; | |
| $.extend(o.options, { | |
| fade: true, | |
| mode: mode, | |
| percent: mode == 'hide' ? percent : 100, | |
| from: mode == 'hide' | |
| ? original | |
| : { | |
| height: original.height * factor, | |
| width: original.width * factor | |
| } | |
| }); | |
| elem.effect('scale', o.options, o.duration, o.callback); | |
| elem.dequeue(); | |
| }); | |
| }; | |
| $.effects.scale = function(o) { | |
| return this.queue(function() { | |
| // Create element | |
| var el = $(this); | |
| // Set options | |
| var options = $.extend(true, {}, o.options); | |
| var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode | |
| var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent | |
| var direction = o.options.direction || 'both'; // Set default axis | |
| var origin = o.options.origin; // The origin of the scaling | |
| if (mode != 'effect') { // Set default origin and restore for show/hide | |
| options.origin = origin || ['middle','center']; | |
| options.restore = true; | |
| } | |
| var original = {height: el.height(), width: el.width()}; // Save original | |
| el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state | |
| // Adjust | |
| var factor = { // Set scaling factor | |
| y: direction != 'horizontal' ? (percent / 100) : 1, | |
| x: direction != 'vertical' ? (percent / 100) : 1 | |
| }; | |
| el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state | |
| if (o.options.fade) { // Fade option to support puff | |
| if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;}; | |
| if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;}; | |
| }; | |
| // Animation | |
| options.from = el.from; options.to = el.to; options.mode = mode; | |
| // Animate | |
| el.effect('size', options, o.duration, o.callback); | |
| el.dequeue(); | |
| }); | |
| }; | |
| $.effects.size = function(o) { | |
| return this.queue(function() { | |
| // Create element | |
| var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity']; | |
| var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore | |
| var props2 = ['width','height','overflow']; // Copy for children | |
| var cProps = ['fontSize']; | |
| var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom']; | |
| var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight']; | |
| // Set options | |
| var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode | |
| var restore = o.options.restore || false; // Default restore | |
| var scale = o.options.scale || 'both'; // Default scale mode | |
| var origin = o.options.origin; // The origin of the sizing | |
| var original = {height: el.height(), width: el.width()}; // Save original | |
| el.from = o.options.from || original; // Default from state | |
| el.to = o.options.to || original; // Default to state | |
| // Adjust | |
| if (origin) { // Calculate baseline shifts | |
| var baseline = $.effects.getBaseline(origin, original); | |
| el.from.top = (original.height - el.from.height) * baseline.y; | |
| el.from.left = (original.width - el.from.width) * baseline.x; | |
| el.to.top = (original.height - el.to.height) * baseline.y; | |
| el.to.left = (original.width - el.to.width) * baseline.x; | |
| }; | |
| var factor = { // Set scaling factor | |
| from: {y: el.from.height / original.height, x: el.from.width / original.width}, | |
| to: {y: el.to.height / original.height, x: el.to.width / original.width} | |
| }; | |
| if (scale == 'box' || scale == 'both') { // Scale the css box | |
| if (factor.from.y != factor.to.y) { // Vertical props scaling | |
| props = props.concat(vProps); | |
| el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from); | |
| el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to); | |
| }; | |
| if (factor.from.x != factor.to.x) { // Horizontal props scaling | |
| props = props.concat(hProps); | |
| el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from); | |
| el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to); | |
| }; | |
| }; | |
| if (scale == 'content' || scale == 'both') { // Scale the content | |
| if (factor.from.y != factor.to.y) { // Vertical props scaling | |
| props = props.concat(cProps); | |
| el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from); | |
| el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to); | |
| }; | |
| }; | |
| $.effects.save(el, restore ? props : props1); el.show(); // Save & Show | |
| $.effects.createWrapper(el); // Create Wrapper | |
| el.css('overflow','hidden').css(el.from); // Shift | |
| // Animate | |
| if (scale == 'content' || scale == 'both') { // Scale the children | |
| vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size | |
| hProps = hProps.concat(['marginLeft','marginRight']); // Add margins | |
| props2 = props.concat(vProps).concat(hProps); // Concat | |
| el.find("*[width]").each(function(){ | |
| var child = $(this); | |
| if (restore) $.effects.save(child, props2); | |
| var c_original = {height: child.height(), width: child.width()}; // Save original | |
| child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x}; | |
| child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x}; | |
| if (factor.from.y != factor.to.y) { // Vertical props scaling | |
| child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from); | |
| child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to); | |
| }; | |
| if (factor.from.x != factor.to.x) { // Horizontal props scaling | |
| child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from); | |
| child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to); | |
| }; | |
| child.css(child.from); // Shift children | |
| child.animate(child.to, o.duration, o.options.easing, function(){ | |
| if (restore) $.effects.restore(child, props2); // Restore children | |
| }); // Animate children | |
| }); | |
| }; | |
| // Animate | |
| el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { | |
| if (el.to.opacity === 0) { | |
| el.css('opacity', el.from.opacity); | |
| } | |
| if(mode == 'hide') el.hide(); // Hide | |
| $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore | |
| if(o.callback) o.callback.apply(this, arguments); // Callback | |
| el.dequeue(); | |
| }}); | |
| }); | |
| }; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Effects Shake 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Effects/Shake | |
| * | |
| * Depends: | |
| * jquery.effects.core.js | |
| */ | |
| (function( $, undefined ) { | |
| $.effects.shake = function(o) { | |
| return this.queue(function() { | |
| // Create element | |
| var el = $(this), props = ['position','top','bottom','left','right']; | |
| // Set options | |
| var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode | |
| var direction = o.options.direction || 'left'; // Default direction | |
| var distance = o.options.distance || 20; // Default distance | |
| var times = o.options.times || 3; // Default # of times | |
| var speed = o.duration || o.options.duration || 140; // Default speed per shake | |
| // Adjust | |
| $.effects.save(el, props); el.show(); // Save & Show | |
| $.effects.createWrapper(el); // Create Wrapper | |
| var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; | |
| var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; | |
| // Animation | |
| var animation = {}, animation1 = {}, animation2 = {}; | |
| animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance; | |
| animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2; | |
| animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2; | |
| // Animate | |
| el.animate(animation, speed, o.options.easing); | |
| for (var i = 1; i < times; i++) { // Shakes | |
| el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing); | |
| }; | |
| el.animate(animation1, speed, o.options.easing). | |
| animate(animation, speed / 2, o.options.easing, function(){ // Last shake | |
| $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore | |
| if(o.callback) o.callback.apply(this, arguments); // Callback | |
| }); | |
| el.queue('fx', function() { el.dequeue(); }); | |
| el.dequeue(); | |
| }); | |
| }; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Effects Slide 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Effects/Slide | |
| * | |
| * Depends: | |
| * jquery.effects.core.js | |
| */ | |
| (function( $, undefined ) { | |
| $.effects.slide = function(o) { | |
| return this.queue(function() { | |
| // Create element | |
| var el = $(this), props = ['position','top','bottom','left','right']; | |
| // Set options | |
| var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode | |
| var direction = o.options.direction || 'left'; // Default Direction | |
| // Adjust | |
| $.effects.save(el, props); el.show(); // Save & Show | |
| $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper | |
| var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left'; | |
| var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg'; | |
| var distance = o.options.distance || (ref == 'top' ? el.outerHeight( true ) : el.outerWidth( true )); | |
| if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift | |
| // Animation | |
| var animation = {}; | |
| animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance; | |
| // Animate | |
| el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() { | |
| if(mode == 'hide') el.hide(); // Hide | |
| $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore | |
| if(o.callback) o.callback.apply(this, arguments); // Callback | |
| el.dequeue(); | |
| }}); | |
| }); | |
| }; | |
| })(jQuery); | |
| /*! | |
| * jQuery UI Effects Transfer 1.8.22 | |
| * | |
| * Copyright 2012, AUTHORS.txt (http://jqueryui.com/about) | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * http://docs.jquery.com/UI/Effects/Transfer | |
| * | |
| * Depends: | |
| * jquery.effects.core.js | |
| */ | |
| (function( $, undefined ) { | |
| $.effects.transfer = function(o) { | |
| return this.queue(function() { | |
| var elem = $(this), | |
| target = $(o.options.to), | |
| endPosition = target.offset(), | |
| animation = { | |
| top: endPosition.top, | |
| left: endPosition.left, | |
| height: target.innerHeight(), | |
| width: target.innerWidth() | |
| }, | |
| startPosition = elem.offset(), | |
| transfer = $('<div class="ui-effects-transfer"></div>') | |
| .appendTo(document.body) | |
| .addClass(o.options.className) | |
| .css({ | |
| top: startPosition.top, | |
| left: startPosition.left, | |
| height: elem.innerHeight(), | |
| width: elem.innerWidth(), | |
| position: 'absolute' | |
| }) | |
| .animate(animation, o.duration, o.options.easing, function() { | |
| transfer.remove(); | |
| (o.callback && o.callback.apply(elem[0], arguments)); | |
| elem.dequeue(); | |
| }); | |
| }); | |
| }; | |
| })(jQuery); |
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| /*! | |
| * jQuery JavaScript Library v1.7.2 | |
| * http://jquery.com/ | |
| * | |
| * Copyright 2011, John Resig | |
| * Dual licensed under the MIT or GPL Version 2 licenses. | |
| * http://jquery.org/license | |
| * | |
| * Includes Sizzle.js | |
| * http://sizzlejs.com/ | |
| * Copyright 2011, The Dojo Foundation | |
| * Released under the MIT, BSD, and GPL Licenses. | |
| * | |
| * Date: Wed Mar 21 12:46:34 2012 -0700 | |
| */ | |
| (function( window, undefined ) { | |
| // Use the correct document accordingly with window argument (sandbox) | |
| var document = window.document, | |
| navigator = window.navigator, | |
| location = window.location; | |
| var jQuery = (function() { | |
| // Define a local copy of jQuery | |
| var jQuery = function( selector, context ) { | |
| // The jQuery object is actually just the init constructor 'enhanced' | |
| return new jQuery.fn.init( selector, context, rootjQuery ); | |
| }, | |
| // Map over jQuery in case of overwrite | |
| _jQuery = window.jQuery, | |
| // Map over the $ in case of overwrite | |
| _$ = window.$, | |
| // A central reference to the root jQuery(document) | |
| rootjQuery, | |
| // A simple way to check for HTML strings or ID strings | |
| // Prioritize #id over <tag> to avoid XSS via location.hash (#9521) | |
| quickExpr = /^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/, | |
| // Check if a string has a non-whitespace character in it | |
| rnotwhite = /\S/, | |
| // Used for trimming whitespace | |
| trimLeft = /^\s+/, | |
| trimRight = /\s+$/, | |
| // Match a standalone tag | |
| rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>)?$/, | |
| // JSON RegExp | |
| rvalidchars = /^[\],:{}\s]*$/, | |
| rvalidescape = /\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, | |
| rvalidtokens = /"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, | |
| rvalidbraces = /(?:^|:|,)(?:\s*\[)+/g, | |
| // Useragent RegExp | |
| rwebkit = /(webkit)[ \/]([\w.]+)/, | |
| ropera = /(opera)(?:.*version)?[ \/]([\w.]+)/, | |
| rmsie = /(msie) ([\w.]+)/, | |
| rmozilla = /(mozilla)(?:.*? rv:([\w.]+))?/, | |
| // Matches dashed string for camelizing | |
| rdashAlpha = /-([a-z]|[0-9])/ig, | |
| rmsPrefix = /^-ms-/, | |
| // Used by jQuery.camelCase as callback to replace() | |
| fcamelCase = function( all, letter ) { | |
| return ( letter + "" ).toUpperCase(); | |
| }, | |
| // Keep a UserAgent string for use with jQuery.browser | |
| userAgent = navigator.userAgent, | |
| // For matching the engine and version of the browser | |
| browserMatch, | |
| // The deferred used on DOM ready | |
| readyList, | |
| // The ready event handler | |
| DOMContentLoaded, | |
| // Save a reference to some core methods | |
| toString = Object.prototype.toString, | |
| hasOwn = Object.prototype.hasOwnProperty, | |
| push = Array.prototype.push, | |
| slice = Array.prototype.slice, | |
| trim = String.prototype.trim, | |
| indexOf = Array.prototype.indexOf, | |
| // [[Class]] -> type pairs | |
| class2type = {}; | |
| jQuery.fn = jQuery.prototype = { | |
| constructor: jQuery, | |
| init: function( selector, context, rootjQuery ) { | |
| var match, elem, ret, doc; | |
| // Handle $(""), $(null), or $(undefined) | |
| if ( !selector ) { | |
| return this; | |
| } | |
| // Handle $(DOMElement) | |
| if ( selector.nodeType ) { | |
| this.context = this[0] = selector; | |
| this.length = 1; | |
| return this; | |
| } | |
| // The body element only exists once, optimize finding it | |
| if ( selector === "body" && !context && document.body ) { | |
| this.context = document; | |
| this[0] = document.body; | |
| this.selector = selector; | |
| this.length = 1; | |
| return this; | |
| } | |
| // Handle HTML strings | |
| if ( typeof selector === "string" ) { | |
| // Are we dealing with HTML string or an ID? | |
| if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { | |
| // Assume that strings that start and end with <> are HTML and skip the regex check | |
| match = [ null, selector, null ]; | |
| } else { | |
| match = quickExpr.exec( selector ); | |
| } | |
| // Verify a match, and that no context was specified for #id | |
| if ( match && (match[1] || !context) ) { | |
| // HANDLE: $(html) -> $(array) | |
| if ( match[1] ) { | |
| context = context instanceof jQuery ? context[0] : context; | |
| doc = ( context ? context.ownerDocument || context : document ); | |
| // If a single string is passed in and it's a single tag | |
| // just do a createElement and skip the rest | |
| ret = rsingleTag.exec( selector ); | |
| if ( ret ) { | |
| if ( jQuery.isPlainObject( context ) ) { | |
| selector = [ document.createElement( ret[1] ) ]; | |
| jQuery.fn.attr.call( selector, context, true ); | |
| } else { | |
| selector = [ doc.createElement( ret[1] ) ]; | |
| } | |
| } else { | |
| ret = jQuery.buildFragment( [ match[1] ], [ doc ] ); | |
| selector = ( ret.cacheable ? jQuery.clone(ret.fragment) : ret.fragment ).childNodes; | |
| } | |
| return jQuery.merge( this, selector ); | |
| // HANDLE: $("#id") | |
| } else { | |
| elem = document.getElementById( match[2] ); | |
| // Check parentNode to catch when Blackberry 4.6 returns | |
| // nodes that are no longer in the document #6963 | |
| if ( elem && elem.parentNode ) { | |
| // Handle the case where IE and Opera return items | |
| // by name instead of ID | |
| if ( elem.id !== match[2] ) { | |
| return rootjQuery.find( selector ); | |
| } | |
| // Otherwise, we inject the element directly into the jQuery object | |
| this.length = 1; | |
| this[0] = elem; | |
| } | |
| this.context = document; | |
| this.selector = selector; | |
| return this; | |
| } | |
| // HANDLE: $(expr, $(...)) | |
| } else if ( !context || context.jquery ) { | |
| return ( context || rootjQuery ).find( selector ); | |
| // HANDLE: $(expr, context) | |
| // (which is just equivalent to: $(context).find(expr) | |
| } else { | |
| return this.constructor( context ).find( selector ); | |
| } | |
| // HANDLE: $(function) | |
| // Shortcut for document ready | |
| } else if ( jQuery.isFunction( selector ) ) { | |
| return rootjQuery.ready( selector ); | |
| } | |
| if ( selector.selector !== undefined ) { | |
| this.selector = selector.selector; | |
| this.context = selector.context; | |
| } | |
| return jQuery.makeArray( selector, this ); | |
| }, | |
| // Start with an empty selector | |
| selector: "", | |
| // The current version of jQuery being used | |
| jquery: "1.7.2", | |
| // The default length of a jQuery object is 0 | |
| length: 0, | |
| // The number of elements contained in the matched element set | |
| size: function() { | |
| return this.length; | |
| }, | |
| toArray: function() { | |
| return slice.call( this, 0 ); | |
| }, | |
| // Get the Nth element in the matched element set OR | |
| // Get the whole matched element set as a clean array | |
| get: function( num ) { | |
| return num == null ? | |
| // Return a 'clean' array | |
| this.toArray() : | |
| // Return just the object | |
| ( num < 0 ? this[ this.length + num ] : this[ num ] ); | |
| }, | |
| // Take an array of elements and push it onto the stack | |
| // (returning the new matched element set) | |
| pushStack: function( elems, name, selector ) { | |
| // Build a new jQuery matched element set | |
| var ret = this.constructor(); | |
| if ( jQuery.isArray( elems ) ) { | |
| push.apply( ret, elems ); | |
| } else { | |
| jQuery.merge( ret, elems ); | |
| } | |
| // Add the old object onto the stack (as a reference) | |
| ret.prevObject = this; | |
| ret.context = this.context; | |
| if ( name === "find" ) { | |
| ret.selector = this.selector + ( this.selector ? " " : "" ) + selector; | |
| } else if ( name ) { | |
| ret.selector = this.selector + "." + name + "(" + selector + ")"; | |
| } | |
| // Return the newly-formed element set | |
| return ret; | |
| }, | |
| // Execute a callback for every element in the matched set. | |
| // (You can seed the arguments with an array of args, but this is | |
| // only used internally.) | |
| each: function( callback, args ) { | |
| return jQuery.each( this, callback, args ); | |
| }, | |
| ready: function( fn ) { | |
| // Attach the listeners | |
| jQuery.bindReady(); | |
| // Add the callback | |
| readyList.add( fn ); | |
| return this; | |
| }, | |
| eq: function( i ) { | |
| i = +i; | |
| return i === -1 ? | |
| this.slice( i ) : | |
| this.slice( i, i + 1 ); | |
| }, | |
| first: function() { | |
| return this.eq( 0 ); | |
| }, | |
| last: function() { | |
| return this.eq( -1 ); | |
| }, | |
| slice: function() { | |
| return this.pushStack( slice.apply( this, arguments ), | |
| "slice", slice.call(arguments).join(",") ); | |
| }, | |
| map: function( callback ) { | |
| return this.pushStack( jQuery.map(this, function( elem, i ) { | |
| return callback.call( elem, i, elem ); | |
| })); | |
| }, | |
| end: function() { | |
| return this.prevObject || this.constructor(null); | |
| }, | |
| // For internal use only. | |
| // Behaves like an Array's method, not like a jQuery method. | |
| push: push, | |
| sort: [].sort, | |
| splice: [].splice | |
| }; | |
| // Give the init function the jQuery prototype for later instantiation | |
| jQuery.fn.init.prototype = jQuery.fn; | |
| jQuery.extend = jQuery.fn.extend = function() { | |
| var options, name, src, copy, copyIsArray, clone, | |
| target = arguments[0] || {}, | |
| i = 1, | |
| length = arguments.length, | |
| deep = false; | |
| // Handle a deep copy situation | |
| if ( typeof target === "boolean" ) { | |
| deep = target; | |
| target = arguments[1] || {}; | |
| // skip the boolean and the target | |
| i = 2; | |
| } | |
| // Handle case when target is a string or something (possible in deep copy) | |
| if ( typeof target !== "object" && !jQuery.isFunction(target) ) { | |
| target = {}; | |
| } | |
| // extend jQuery itself if only one argument is passed | |
| if ( length === i ) { | |
| target = this; | |
| --i; | |
| } | |
| for ( ; i < length; i++ ) { | |
| // Only deal with non-null/undefined values | |
| if ( (options = arguments[ i ]) != null ) { | |
| // Extend the base object | |
| for ( name in options ) { | |
| src = target[ name ]; | |
| copy = options[ name ]; | |
| // Prevent never-ending loop | |
| if ( target === copy ) { | |
| continue; | |
| } | |
| // Recurse if we're merging plain objects or arrays | |
| if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { | |
| if ( copyIsArray ) { | |
| copyIsArray = false; | |
| clone = src && jQuery.isArray(src) ? src : []; | |
| } else { | |
| clone = src && jQuery.isPlainObject(src) ? src : {}; | |
| } | |
| // Never move original objects, clone them | |
| target[ name ] = jQuery.extend( deep, clone, copy ); | |
| // Don't bring in undefined values | |
| } else if ( copy !== undefined ) { | |
| target[ name ] = copy; | |
| } | |
| } | |
| } | |
| } | |
| // Return the modified object | |
| return target; | |
| }; | |
| jQuery.extend({ | |
| noConflict: function( deep ) { | |
| if ( window.$ === jQuery ) { | |
| window.$ = _$; | |
| } | |
| if ( deep && window.jQuery === jQuery ) { | |
| window.jQuery = _jQuery; | |
| } | |
| return jQuery; | |
| }, | |
| // Is the DOM ready to be used? Set to true once it occurs. | |
| isReady: false, | |
| // A counter to track how many items to wait for before | |
| // the ready event fires. See #6781 | |
| readyWait: 1, | |
| // Hold (or release) the ready event | |
| holdReady: function( hold ) { | |
| if ( hold ) { | |
| jQuery.readyWait++; | |
| } else { | |
| jQuery.ready( true ); | |
| } | |
| }, | |
| // Handle when the DOM is ready | |
| ready: function( wait ) { | |
| // Either a released hold or an DOMready/load event and not yet ready | |
| if ( (wait === true && !--jQuery.readyWait) || (wait !== true && !jQuery.isReady) ) { | |
| // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). | |
| if ( !document.body ) { | |
| return setTimeout( jQuery.ready, 1 ); | |
| } | |
| // Remember that the DOM is ready | |
| jQuery.isReady = true; | |
| // If a normal DOM Ready event fired, decrement, and wait if need be | |
| if ( wait !== true && --jQuery.readyWait > 0 ) { | |
| return; | |
| } | |
| // If there are functions bound, to execute | |
| readyList.fireWith( document, [ jQuery ] ); | |
| // Trigger any bound ready events | |
| if ( jQuery.fn.trigger ) { | |
| jQuery( document ).trigger( "ready" ).off( "ready" ); | |
| } | |
| } | |
| }, | |
| bindReady: function() { | |
| if ( readyList ) { | |
| return; | |
| } | |
| readyList = jQuery.Callbacks( "once memory" ); | |
| // Catch cases where $(document).ready() is called after the | |
| // browser event has already occurred. | |
| if ( document.readyState === "complete" ) { | |
| // Handle it asynchronously to allow scripts the opportunity to delay ready | |
| return setTimeout( jQuery.ready, 1 ); | |
| } | |
| // Mozilla, Opera and webkit nightlies currently support this event | |
| if ( document.addEventListener ) { | |
| // Use the handy event callback | |
| document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); | |
| // A fallback to window.onload, that will always work | |
| window.addEventListener( "load", jQuery.ready, false ); | |
| // If IE event model is used | |
| } else if ( document.attachEvent ) { | |
| // ensure firing before onload, | |
| // maybe late but safe also for iframes | |
| document.attachEvent( "onreadystatechange", DOMContentLoaded ); | |
| // A fallback to window.onload, that will always work | |
| window.attachEvent( "onload", jQuery.ready ); | |
| // If IE and not a frame | |
| // continually check to see if the document is ready | |
| var toplevel = false; | |
| try { | |
| toplevel = window.frameElement == null; | |
| } catch(e) {} | |
| if ( document.documentElement.doScroll && toplevel ) { | |
| doScrollCheck(); | |
| } | |
| } | |
| }, | |
| // See test/unit/core.js for details concerning isFunction. | |
| // Since version 1.3, DOM methods and functions like alert | |
| // aren't supported. They return false on IE (#2968). | |
| isFunction: function( obj ) { | |
| return jQuery.type(obj) === "function"; | |
| }, | |
| isArray: Array.isArray || function( obj ) { | |
| return jQuery.type(obj) === "array"; | |
| }, | |
| isWindow: function( obj ) { | |
| return obj != null && obj == obj.window; | |
| }, | |
| isNumeric: function( obj ) { | |
| return !isNaN( parseFloat(obj) ) && isFinite( obj ); | |
| }, | |
| type: function( obj ) { | |
| return obj == null ? | |
| String( obj ) : | |
| class2type[ toString.call(obj) ] || "object"; | |
| }, | |
| isPlainObject: function( obj ) { | |
| // Must be an Object. | |
| // Because of IE, we also have to check the presence of the constructor property. | |
| // Make sure that DOM nodes and window objects don't pass through, as well | |
| if ( !obj || jQuery.type(obj) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { | |
| return false; | |
| } | |
| try { | |
| // Not own constructor property must be Object | |
| if ( obj.constructor && | |
| !hasOwn.call(obj, "constructor") && | |
| !hasOwn.call(obj.constructor.prototype, "isPrototypeOf") ) { | |
| return false; | |
| } | |
| } catch ( e ) { | |
| // IE8,9 Will throw exceptions on certain host objects #9897 | |
| return false; | |
| } | |
| // Own properties are enumerated firstly, so to speed up, | |
| // if last one is own, then all properties are own. | |
| var key; | |
| for ( key in obj ) {} | |
| return key === undefined || hasOwn.call( obj, key ); | |
| }, | |
| isEmptyObject: function( obj ) { | |
| for ( var name in obj ) { | |
| return false; | |
| } | |
| return true; | |
| }, | |
| error: function( msg ) { | |
| throw new Error( msg ); | |
| }, | |
| parseJSON: function( data ) { | |
| if ( typeof data !== "string" || !data ) { | |
| return null; | |
| } | |
| // Make sure leading/trailing whitespace is removed (IE can't handle it) | |
| data = jQuery.trim( data ); | |
| // Attempt to parse using the native JSON parser first | |
| if ( window.JSON && window.JSON.parse ) { | |
| return window.JSON.parse( data ); | |
| } | |
| // Make sure the incoming data is actual JSON | |
| // Logic borrowed from http://json.org/json2.js | |
| if ( rvalidchars.test( data.replace( rvalidescape, "@" ) | |
| .replace( rvalidtokens, "]" ) | |
| .replace( rvalidbraces, "")) ) { | |
| return ( new Function( "return " + data ) )(); | |
| } | |
| jQuery.error( "Invalid JSON: " + data ); | |
| }, | |
| // Cross-browser xml parsing | |
| parseXML: function( data ) { | |
| if ( typeof data !== "string" || !data ) { | |
| return null; | |
| } | |
| var xml, tmp; | |
| try { | |
| if ( window.DOMParser ) { // Standard | |
| tmp = new DOMParser(); | |
| xml = tmp.parseFromString( data , "text/xml" ); | |
| } else { // IE | |
| xml = new ActiveXObject( "Microsoft.XMLDOM" ); | |
| xml.async = "false"; | |
| xml.loadXML( data ); | |
| } | |
| } catch( e ) { | |
| xml = undefined; | |
| } | |
| if ( !xml || !xml.documentElement || xml.getElementsByTagName( "parsererror" ).length ) { | |
| jQuery.error( "Invalid XML: " + data ); | |
| } | |
| return xml; | |
| }, | |
| noop: function() {}, | |
| // Evaluates a script in a global context | |
| // Workarounds based on findings by Jim Driscoll | |
| // http://weblogs.java.net/blog/driscoll/archive/2009/09/08/eval-javascript-global-context | |
| globalEval: function( data ) { | |
| if ( data && rnotwhite.test( data ) ) { | |
| // We use execScript on Internet Explorer | |
| // We use an anonymous function so that context is window | |
| // rather than jQuery in Firefox | |
| ( window.execScript || function( data ) { | |
| window[ "eval" ].call( window, data ); | |
| } )( data ); | |
| } | |
| }, | |
| // Convert dashed to camelCase; used by the css and data modules | |
| // Microsoft forgot to hump their vendor prefix (#9572) | |
| camelCase: function( string ) { | |
| return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); | |
| }, | |
| nodeName: function( elem, name ) { | |
| return elem.nodeName && elem.nodeName.toUpperCase() === name.toUpperCase(); | |
| }, | |
| // args is for internal usage only | |
| each: function( object, callback, args ) { | |
| var name, i = 0, | |
| length = object.length, | |
| isObj = length === undefined || jQuery.isFunction( object ); | |
| if ( args ) { | |
| if ( isObj ) { | |
| for ( name in object ) { | |
| if ( callback.apply( object[ name ], args ) === false ) { | |
| break; | |
| } | |
| } | |
| } else { | |
| for ( ; i < length; ) { | |
| if ( callback.apply( object[ i++ ], args ) === false ) { | |
| break; | |
| } | |
| } | |
| } | |
| // A special, fast, case for the most common use of each | |
| } else { | |
| if ( isObj ) { | |
| for ( name in object ) { | |
| if ( callback.call( object[ name ], name, object[ name ] ) === false ) { | |
| break; | |
| } | |
| } | |
| } else { | |
| for ( ; i < length; ) { | |
| if ( callback.call( object[ i ], i, object[ i++ ] ) === false ) { | |
| break; | |
| } | |
| } | |
| } | |
| } | |
| return object; | |
| }, | |
| // Use native String.trim function wherever possible | |
| trim: trim ? | |
| function( text ) { | |
| return text == null ? | |
| "" : | |
| trim.call( text ); | |
| } : | |
| // Otherwise use our own trimming functionality | |
| function( text ) { | |
| return text == null ? | |
| "" : | |
| text.toString().replace( trimLeft, "" ).replace( trimRight, "" ); | |
| }, | |
| // results is for internal usage only | |
| makeArray: function( array, results ) { | |
| var ret = results || []; | |
| if ( array != null ) { | |
| // The window, strings (and functions) also have 'length' | |
| // Tweaked logic slightly to handle Blackberry 4.7 RegExp issues #6930 | |
| var type = jQuery.type( array ); | |
| if ( array.length == null || type === "string" || type === "function" || type === "regexp" || jQuery.isWindow( array ) ) { | |
| push.call( ret, array ); | |
| } else { | |
| jQuery.merge( ret, array ); | |
| } | |
| } | |
| return ret; | |
| }, | |
| inArray: function( elem, array, i ) { | |
| var len; | |
| if ( array ) { | |
| if ( indexOf ) { | |
| return indexOf.call( array, elem, i ); | |
| } | |
| len = array.length; | |
| i = i ? i < 0 ? Math.max( 0, len + i ) : i : 0; | |
| for ( ; i < len; i++ ) { | |
| // Skip accessing in sparse arrays | |
| if ( i in array && array[ i ] === elem ) { | |
| return i; | |
| } | |
| } | |
| } | |
| return -1; | |
| }, | |
| merge: function( first, second ) { | |
| var i = first.length, | |
| j = 0; | |
| if ( typeof second.length === "number" ) { | |
| for ( var l = second.length; j < l; j++ ) { | |
| first[ i++ ] = second[ j ]; | |
| } | |
| } else { | |
| while ( second[j] !== undefined ) { | |
| first[ i++ ] = second[ j++ ]; | |
| } | |
| } | |
| first.length = i; | |
| return first; | |
| }, | |
| grep: function( elems, callback, inv ) { | |
| var ret = [], retVal; | |
| inv = !!inv; | |
| // Go through the array, only saving the items | |
| // that pass the validator function | |
| for ( var i = 0, length = elems.length; i < length; i++ ) { | |
| retVal = !!callback( elems[ i ], i ); | |
| if ( inv !== retVal ) { | |
| ret.push( elems[ i ] ); | |
| } | |
| } | |
| return ret; | |
| }, | |
| // arg is for internal usage only | |
| map: function( elems, callback, arg ) { | |
| var value, key, ret = [], | |
| i = 0, | |
| length = elems.length, | |
| // jquery objects are treated as arrays | |
| isArray = elems instanceof jQuery || length !== undefined && typeof length === "number" && ( ( length > 0 && elems[ 0 ] && elems[ length -1 ] ) || length === 0 || jQuery.isArray( elems ) ) ; | |
| // Go through the array, translating each of the items to their | |
| if ( isArray ) { | |
| for ( ; i < length; i++ ) { | |
| value = callback( elems[ i ], i, arg ); | |
| if ( value != null ) { | |
| ret[ ret.length ] = value; | |
| } | |
| } | |
| // Go through every key on the object, | |
| } else { | |
| for ( key in elems ) { | |
| value = callback( elems[ key ], key, arg ); | |
| if ( value != null ) { | |
| ret[ ret.length ] = value; | |
| } | |
| } | |
| } | |
| // Flatten any nested arrays | |
| return ret.concat.apply( [], ret ); | |
| }, | |
| // A global GUID counter for objects | |
| guid: 1, | |
| // Bind a function to a context, optionally partially applying any | |
| // arguments. | |
| proxy: function( fn, context ) { | |
| if ( typeof context === "string" ) { | |
| var tmp = fn[ context ]; | |
| context = fn; | |
| fn = tmp; | |
| } | |
| // Quick check to determine if target is callable, in the spec | |
| // this throws a TypeError, but we will just return undefined. | |
| if ( !jQuery.isFunction( fn ) ) { | |
| return undefined; | |
| } | |
| // Simulated bind | |
| var args = slice.call( arguments, 2 ), | |
| proxy = function() { | |
| return fn.apply( context, args.concat( slice.call( arguments ) ) ); | |
| }; | |
| // Set the guid of unique handler to the same of original handler, so it can be removed | |
| proxy.guid = fn.guid = fn.guid || proxy.guid || jQuery.guid++; | |
| return proxy; | |
| }, | |
| // Mutifunctional method to get and set values to a collection | |
| // The value/s can optionally be executed if it's a function | |
| access: function( elems, fn, key, value, chainable, emptyGet, pass ) { | |
| var exec, | |
| bulk = key == null, | |
| i = 0, | |
| length = elems.length; | |
| // Sets many values | |
| if ( key && typeof key === "object" ) { | |
| for ( i in key ) { | |
| jQuery.access( elems, fn, i, key[i], 1, emptyGet, value ); | |
| } | |
| chainable = 1; | |
| // Sets one value | |
| } else if ( value !== undefined ) { | |
| // Optionally, function values get executed if exec is true | |
| exec = pass === undefined && jQuery.isFunction( value ); | |
| if ( bulk ) { | |
| // Bulk operations only iterate when executing function values | |
| if ( exec ) { | |
| exec = fn; | |
| fn = function( elem, key, value ) { | |
| return exec.call( jQuery( elem ), value ); | |
| }; | |
| // Otherwise they run against the entire set | |
| } else { | |
| fn.call( elems, value ); | |
| fn = null; | |
| } | |
| } | |
| if ( fn ) { | |
| for (; i < length; i++ ) { | |
| fn( elems[i], key, exec ? value.call( elems[i], i, fn( elems[i], key ) ) : value, pass ); | |
| } | |
| } | |
| chainable = 1; | |
| } | |
| return chainable ? | |
| elems : | |
| // Gets | |
| bulk ? | |
| fn.call( elems ) : | |
| length ? fn( elems[0], key ) : emptyGet; | |
| }, | |
| now: function() { | |
| return ( new Date() ).getTime(); | |
| }, | |
| // Use of jQuery.browser is frowned upon. | |
| // More details: http://docs.jquery.com/Utilities/jQuery.browser | |
| uaMatch: function( ua ) { | |
| ua = ua.toLowerCase(); | |
| var match = rwebkit.exec( ua ) || | |
| ropera.exec( ua ) || | |
| rmsie.exec( ua ) || | |
| ua.indexOf("compatible") < 0 && rmozilla.exec( ua ) || | |
| []; | |
| return { browser: match[1] || "", version: match[2] || "0" }; | |
| }, | |
| sub: function() { | |
| function jQuerySub( selector, context ) { | |
| return new jQuerySub.fn.init( selector, context ); | |
| } | |
| jQuery.extend( true, jQuerySub, this ); | |
| jQuerySub.superclass = this; | |
| jQuerySub.fn = jQuerySub.prototype = this(); | |
| jQuerySub.fn.constructor = jQuerySub; | |
| jQuerySub.sub = this.sub; | |
| jQuerySub.fn.init = function init( selector, context ) { | |
| if ( context && context instanceof jQuery && !(context instanceof jQuerySub) ) { | |
| context = jQuerySub( context ); | |
| } | |
| return jQuery.fn.init.call( this, selector, context, rootjQuerySub ); | |
| }; | |
| jQuerySub.fn.init.prototype = jQuerySub.fn; | |
| var rootjQuerySub = jQuerySub(document); | |
| return jQuerySub; | |
| }, | |
| browser: {} | |
| }); | |
| // Populate the class2type map | |
| jQuery.each("Boolean Number String Function Array Date RegExp Object".split(" "), function(i, name) { | |
| class2type[ "[object " + name + "]" ] = name.toLowerCase(); | |
| }); | |
| browserMatch = jQuery.uaMatch( userAgent ); | |
| if ( browserMatch.browser ) { | |
| jQuery.browser[ browserMatch.browser ] = true; | |
| jQuery.browser.version = browserMatch.version; | |
| } | |
| // Deprecated, use jQuery.browser.webkit instead | |
| if ( jQuery.browser.webkit ) { | |
| jQuery.browser.safari = true; | |
| } | |
| // IE doesn't match non-breaking spaces with \s | |
| if ( rnotwhite.test( "\xA0" ) ) { | |
| trimLeft = /^[\s\xA0]+/; | |
| trimRight = /[\s\xA0]+$/; | |
| } | |
| // All jQuery objects should point back to these | |
| rootjQuery = jQuery(document); | |
| // Cleanup functions for the document ready method | |
| if ( document.addEventListener ) { | |
| DOMContentLoaded = function() { | |
| document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); | |
| jQuery.ready(); | |
| }; | |
| } else if ( document.attachEvent ) { | |
| DOMContentLoaded = function() { | |
| // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443). | |
| if ( document.readyState === "complete" ) { | |
| document.detachEvent( "onreadystatechange", DOMContentLoaded ); | |
| jQuery.ready(); | |
| } | |
| }; | |
| } | |
| // The DOM ready check for Internet Explorer | |
| function doScrollCheck() { | |
| if ( jQuery.isReady ) { | |
| return; | |
| } | |
| try { | |
| // If IE is used, use the trick by Diego Perini | |
| // http://javascript.nwbox.com/IEContentLoaded/ | |
| document.documentElement.doScroll("left"); | |
| } catch(e) { | |
| setTimeout( doScrollCheck, 1 ); | |
| return; | |
| } | |
| // and execute any waiting functions | |
| jQuery.ready(); | |
| } | |
| return jQuery; | |
| })(); | |
| // String to Object flags format cache | |
| var flagsCache = {}; | |
| // Convert String-formatted flags into Object-formatted ones and store in cache | |
| function createFlags( flags ) { | |
| var object = flagsCache[ flags ] = {}, | |
| i, length; | |
| flags = flags.split( /\s+/ ); | |
| for ( i = 0, length = flags.length; i < length; i++ ) { | |
| object[ flags[i] ] = true; | |
| } | |
| return object; | |
| } | |
| /* | |
| * Create a callback list using the following parameters: | |
| * | |
| * flags: an optional list of space-separated flags that will change how | |
| * the callback list behaves | |
| * | |
| * By default a callback list will act like an event callback list and can be | |
| * "fired" multiple times. | |
| * | |
| * Possible flags: | |
| * | |
| * once: will ensure the callback list can only be fired once (like a Deferred) | |
| * | |
| * memory: will keep track of previous values and will call any callback added | |
| * after the list has been fired right away with the latest "memorized" | |
| * values (like a Deferred) | |
| * | |
| * unique: will ensure a callback can only be added once (no duplicate in the list) | |
| * | |
| * stopOnFalse: interrupt callings when a callback returns false | |
| * | |
| */ | |
| jQuery.Callbacks = function( flags ) { | |
| // Convert flags from String-formatted to Object-formatted | |
| // (we check in cache first) | |
| flags = flags ? ( flagsCache[ flags ] || createFlags( flags ) ) : {}; | |
| var // Actual callback list | |
| list = [], | |
| // Stack of fire calls for repeatable lists | |
| stack = [], | |
| // Last fire value (for non-forgettable lists) | |
| memory, | |
| // Flag to know if list was already fired | |
| fired, | |
| // Flag to know if list is currently firing | |
| firing, | |
| // First callback to fire (used internally by add and fireWith) | |
| firingStart, | |
| // End of the loop when firing | |
| firingLength, | |
| // Index of currently firing callback (modified by remove if needed) | |
| firingIndex, | |
| // Add one or several callbacks to the list | |
| add = function( args ) { | |
| var i, | |
| length, | |
| elem, | |
| type, | |
| actual; | |
| for ( i = 0, length = args.length; i < length; i++ ) { | |
| elem = args[ i ]; | |
| type = jQuery.type( elem ); | |
| if ( type === "array" ) { | |
| // Inspect recursively | |
| add( elem ); | |
| } else if ( type === "function" ) { | |
| // Add if not in unique mode and callback is not in | |
| if ( !flags.unique || !self.has( elem ) ) { | |
| list.push( elem ); | |
| } | |
| } | |
| } | |
| }, | |
| // Fire callbacks | |
| fire = function( context, args ) { | |
| args = args || []; | |
| memory = !flags.memory || [ context, args ]; | |
| fired = true; | |
| firing = true; | |
| firingIndex = firingStart || 0; | |
| firingStart = 0; | |
| firingLength = list.length; | |
| for ( ; list && firingIndex < firingLength; firingIndex++ ) { | |
| if ( list[ firingIndex ].apply( context, args ) === false && flags.stopOnFalse ) { | |
| memory = true; // Mark as halted | |
| break; | |
| } | |
| } | |
| firing = false; | |
| if ( list ) { | |
| if ( !flags.once ) { | |
| if ( stack && stack.length ) { | |
| memory = stack.shift(); | |
| self.fireWith( memory[ 0 ], memory[ 1 ] ); | |
| } | |
| } else if ( memory === true ) { | |
| self.disable(); | |
| } else { | |
| list = []; | |
| } | |
| } | |
| }, | |
| // Actual Callbacks object | |
| self = { | |
| // Add a callback or a collection of callbacks to the list | |
| add: function() { | |
| if ( list ) { | |
| var length = list.length; | |
| add( arguments ); | |
| // Do we need to add the callbacks to the | |
| // current firing batch? | |
| if ( firing ) { | |
| firingLength = list.length; | |
| // With memory, if we're not firing then | |
| // we should call right away, unless previous | |
| // firing was halted (stopOnFalse) | |
| } else if ( memory && memory !== true ) { | |
| firingStart = length; | |
| fire( memory[ 0 ], memory[ 1 ] ); | |
| } | |
| } | |
| return this; | |
| }, | |
| // Remove a callback from the list | |
| remove: function() { | |
| if ( list ) { | |
| var args = arguments, | |
| argIndex = 0, | |
| argLength = args.length; | |
| for ( ; argIndex < argLength ; argIndex++ ) { | |
| for ( var i = 0; i < list.length; i++ ) { | |
| if ( args[ argIndex ] === list[ i ] ) { | |
| // Handle firingIndex and firingLength | |
| if ( firing ) { | |
| if ( i <= firingLength ) { | |
| firingLength--; | |
| if ( i <= firingIndex ) { | |
| firingIndex--; | |
| } | |
| } | |
| } | |
| // Remove the element | |
| list.splice( i--, 1 ); | |
| // If we have some unicity property then | |
| // we only need to do this once | |
| if ( flags.unique ) { | |
| break; | |
| } | |
| } | |
| } | |
| } | |
| } | |
| return this; | |
| }, | |
| // Control if a given callback is in the list | |
| has: function( fn ) { | |
| if ( list ) { | |
| var i = 0, | |
| length = list.length; | |
| for ( ; i < length; i++ ) { | |
| if ( fn === list[ i ] ) { | |
| return true; | |
| } | |
| } | |
| } | |
| return false; | |
| }, | |
| // Remove all callbacks from the list | |
| empty: function() { | |
| list = []; | |
| return this; | |
| }, | |
| // Have the list do nothing anymore | |
| disable: function() { | |
| list = stack = memory = undefined; | |
| return this; | |
| }, | |
| // Is it disabled? | |
| disabled: function() { | |
| return !list; | |
| }, | |
| // Lock the list in its current state | |
| lock: function() { | |
| stack = undefined; | |
| if ( !memory || memory === true ) { | |
| self.disable(); | |
| } | |
| return this; | |
| }, | |
| // Is it locked? | |
| locked: function() { | |
| return !stack; | |
| }, | |
| // Call all callbacks with the given context and arguments | |
| fireWith: function( context, args ) { | |
| if ( stack ) { | |
| if ( firing ) { | |
| if ( !flags.once ) { | |
| stack.push( [ context, args ] ); | |
| } | |
| } else if ( !( flags.once && memory ) ) { | |
| fire( context, args ); | |
| } | |
| } | |
| return this; | |
| }, | |
| // Call all the callbacks with the given arguments | |
| fire: function() { | |
| self.fireWith( this, arguments ); | |
| return this; | |
| }, | |
| // To know if the callbacks have already been called at least once | |
| fired: function() { | |
| return !!fired; | |
| } | |
| }; | |
| return self; | |
| }; | |
| var // Static reference to slice | |
| sliceDeferred = [].slice; | |
| jQuery.extend({ | |
| Deferred: function( func ) { | |
| var doneList = jQuery.Callbacks( "once memory" ), | |
| failList = jQuery.Callbacks( "once memory" ), | |
| progressList = jQuery.Callbacks( "memory" ), | |
| state = "pending", | |
| lists = { | |
| resolve: doneList, | |
| reject: failList, | |
| notify: progressList | |
| }, | |
| promise = { | |
| done: doneList.add, | |
| fail: failList.add, | |
| progress: progressList.add, | |
| state: function() { | |
| return state; | |
| }, | |
| // Deprecated | |
| isResolved: doneList.fired, | |
| isRejected: failList.fired, | |
| then: function( doneCallbacks, failCallbacks, progressCallbacks ) { | |
| deferred.done( doneCallbacks ).fail( failCallbacks ).progress( progressCallbacks ); | |
| return this; | |
| }, | |
| always: function() { | |
| deferred.done.apply( deferred, arguments ).fail.apply( deferred, arguments ); | |
| return this; | |
| }, | |
| pipe: function( fnDone, fnFail, fnProgress ) { | |
| return jQuery.Deferred(function( newDefer ) { | |
| jQuery.each( { | |
| done: [ fnDone, "resolve" ], | |
| fail: [ fnFail, "reject" ], | |
| progress: [ fnProgress, "notify" ] | |
| }, function( handler, data ) { | |
| var fn = data[ 0 ], | |
| action = data[ 1 ], | |
| returned; | |
| if ( jQuery.isFunction( fn ) ) { | |
| deferred[ handler ](function() { | |
| returned = fn.apply( this, arguments ); | |
| if ( returned && jQuery.isFunction( returned.promise ) ) { | |
| returned.promise().then( newDefer.resolve, newDefer.reject, newDefer.notify ); | |
| } else { | |
| newDefer[ action + "With" ]( this === deferred ? newDefer : this, [ returned ] ); | |
| } | |
| }); | |
| } else { | |
| deferred[ handler ]( newDefer[ action ] ); | |
| } | |
| }); | |
| }).promise(); | |
| }, | |
| // Get a promise for this deferred | |
| // If obj is provided, the promise aspect is added to the object | |
| promise: function( obj ) { | |
| if ( obj == null ) { | |
| obj = promise; | |
| } else { | |
| for ( var key in promise ) { | |
| obj[ key ] = promise[ key ]; | |
| } | |
| } | |
| return obj; | |
| } | |
| }, | |
| deferred = promise.promise({}), | |
| key; | |
| for ( key in lists ) { | |
| deferred[ key ] = lists[ key ].fire; | |
| deferred[ key + "With" ] = lists[ key ].fireWith; | |
| } | |
| // Handle state | |
| deferred.done( function() { | |
| state = "resolved"; | |
| }, failList.disable, progressList.lock ).fail( function() { | |
| state = "rejected"; | |
| }, doneList.disable, progressList.lock ); | |
| // Call given func if any | |
| if ( func ) { | |
| func.call( deferred, deferred ); | |
| } | |
| // All done! | |
| return deferred; | |
| }, | |
| // Deferred helper | |
| when: function( firstParam ) { | |
| var args = sliceDeferred.call( arguments, 0 ), | |
| i = 0, | |
| length = args.length, | |
| pValues = new Array( length ), | |
| count = length, | |
| pCount = length, | |
| deferred = length <= 1 && firstParam && jQuery.isFunction( firstParam.promise ) ? | |
| firstParam : | |
| jQuery.Deferred(), | |
| promise = deferred.promise(); | |
| function resolveFunc( i ) { | |
| return function( value ) { | |
| args[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; | |
| if ( !( --count ) ) { | |
| deferred.resolveWith( deferred, args ); | |
| } | |
| }; | |
| } | |
| function progressFunc( i ) { | |
| return function( value ) { | |
| pValues[ i ] = arguments.length > 1 ? sliceDeferred.call( arguments, 0 ) : value; | |
| deferred.notifyWith( promise, pValues ); | |
| }; | |
| } | |
| if ( length > 1 ) { | |
| for ( ; i < length; i++ ) { | |
| if ( args[ i ] && args[ i ].promise && jQuery.isFunction( args[ i ].promise ) ) { | |
| args[ i ].promise().then( resolveFunc(i), deferred.reject, progressFunc(i) ); | |
| } else { | |
| --count; | |
| } | |
| } | |
| if ( !count ) { | |
| deferred.resolveWith( deferred, args ); | |
| } | |
| } else if ( deferred !== firstParam ) { | |
| deferred.resolveWith( deferred, length ? [ firstParam ] : [] ); | |
| } | |
| return promise; | |
| } | |
| }); | |
| jQuery.support = (function() { | |
| var support, | |
| all, | |
| a, | |
| select, | |
| opt, | |
| input, | |
| fragment, | |
| tds, | |
| events, | |
| eventName, | |
| i, | |
| isSupported, | |
| div = document.createElement( "div" ), | |
| documentElement = document.documentElement; | |
| // Preliminary tests | |
| div.setAttribute("className", "t"); | |
| div.innerHTML = " <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>"; | |
| all = div.getElementsByTagName( "*" ); | |
| a = div.getElementsByTagName( "a" )[ 0 ]; | |
| // Can't get basic test support | |
| if ( !all || !all.length || !a ) { | |
| return {}; | |
| } | |
| // First batch of supports tests | |
| select = document.createElement( "select" ); | |
| opt = select.appendChild( document.createElement("option") ); | |
| input = div.getElementsByTagName( "input" )[ 0 ]; | |
| support = { | |
| // IE strips leading whitespace when .innerHTML is used | |
| leadingWhitespace: ( div.firstChild.nodeType === 3 ), | |
| // Make sure that tbody elements aren't automatically inserted | |
| // IE will insert them into empty tables | |
| tbody: !div.getElementsByTagName("tbody").length, | |
| // Make sure that link elements get serialized correctly by innerHTML | |
| // This requires a wrapper element in IE | |
| htmlSerialize: !!div.getElementsByTagName("link").length, | |
| // Get the style information from getAttribute | |
| // (IE uses .cssText instead) | |
| style: /top/.test( a.getAttribute("style") ), | |
| // Make sure that URLs aren't manipulated | |
| // (IE normalizes it by default) | |
| hrefNormalized: ( a.getAttribute("href") === "/a" ), | |
| // Make sure that element opacity exists | |
| // (IE uses filter instead) | |
| // Use a regex to work around a WebKit issue. See #5145 | |
| opacity: /^0.55/.test( a.style.opacity ), | |
| // Verify style float existence | |
| // (IE uses styleFloat instead of cssFloat) | |
| cssFloat: !!a.style.cssFloat, | |
| // Make sure that if no value is specified for a checkbox | |
| // that it defaults to "on". | |
| // (WebKit defaults to "" instead) | |
| checkOn: ( input.value === "on" ), | |
| // Make sure that a selected-by-default option has a working selected property. | |
| // (WebKit defaults to false instead of true, IE too, if it's in an optgroup) | |
| optSelected: opt.selected, | |
| // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) | |
| getSetAttribute: div.className !== "t", | |
| // Tests for enctype support on a form(#6743) | |
| enctype: !!document.createElement("form").enctype, | |
| // Makes sure cloning an html5 element does not cause problems | |
| // Where outerHTML is undefined, this still works | |
| html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav></:nav>", | |
| // Will be defined later | |
| submitBubbles: true, | |
| changeBubbles: true, | |
| focusinBubbles: false, | |
| deleteExpando: true, | |
| noCloneEvent: true, | |
| inlineBlockNeedsLayout: false, | |
| shrinkWrapBlocks: false, | |
| reliableMarginRight: true, | |
| pixelMargin: true | |
| }; | |
| // jQuery.boxModel DEPRECATED in 1.3, use jQuery.support.boxModel instead | |
| jQuery.boxModel = support.boxModel = (document.compatMode === "CSS1Compat"); | |
| // Make sure checked status is properly cloned | |
| input.checked = true; | |
| support.noCloneChecked = input.cloneNode( true ).checked; | |
| // Make sure that the options inside disabled selects aren't marked as disabled | |
| // (WebKit marks them as disabled) | |
| select.disabled = true; | |
| support.optDisabled = !opt.disabled; | |
| // Test to see if it's possible to delete an expando from an element | |
| // Fails in Internet Explorer | |
| try { | |
| delete div.test; | |
| } catch( e ) { | |
| support.deleteExpando = false; | |
| } | |
| if ( !div.addEventListener && div.attachEvent && div.fireEvent ) { | |
| div.attachEvent( "onclick", function() { | |
| // Cloning a node shouldn't copy over any | |
| // bound event handlers (IE does this) | |
| support.noCloneEvent = false; | |
| }); | |
| div.cloneNode( true ).fireEvent( "onclick" ); | |
| } | |
| // Check if a radio maintains its value | |
| // after being appended to the DOM | |
| input = document.createElement("input"); | |
| input.value = "t"; | |
| input.setAttribute("type", "radio"); | |
| support.radioValue = input.value === "t"; | |
| input.setAttribute("checked", "checked"); | |
| // #11217 - WebKit loses check when the name is after the checked attribute | |
| input.setAttribute( "name", "t" ); | |
| div.appendChild( input ); | |
| fragment = document.createDocumentFragment(); | |
| fragment.appendChild( div.lastChild ); | |
| // WebKit doesn't clone checked state correctly in fragments | |
| support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; | |
| // Check if a disconnected checkbox will retain its checked | |
| // value of true after appended to the DOM (IE6/7) | |
| support.appendChecked = input.checked; | |
| fragment.removeChild( input ); | |
| fragment.appendChild( div ); | |
| // Technique from Juriy Zaytsev | |
| // http://perfectionkills.com/detecting-event-support-without-browser-sniffing/ | |
| // We only care about the case where non-standard event systems | |
| // are used, namely in IE. Short-circuiting here helps us to | |
| // avoid an eval call (in setAttribute) which can cause CSP | |
| // to go haywire. See: https://developer.mozilla.org/en/Security/CSP | |
| if ( div.attachEvent ) { | |
| for ( i in { | |
| submit: 1, | |
| change: 1, | |
| focusin: 1 | |
| }) { | |
| eventName = "on" + i; | |
| isSupported = ( eventName in div ); | |
| if ( !isSupported ) { | |
| div.setAttribute( eventName, "return;" ); | |
| isSupported = ( typeof div[ eventName ] === "function" ); | |
| } | |
| support[ i + "Bubbles" ] = isSupported; | |
| } | |
| } | |
| fragment.removeChild( div ); | |
| // Null elements to avoid leaks in IE | |
| fragment = select = opt = div = input = null; | |
| // Run tests that need a body at doc ready | |
| jQuery(function() { | |
| var container, outer, inner, table, td, offsetSupport, | |
| marginDiv, conMarginTop, style, html, positionTopLeftWidthHeight, | |
| paddingMarginBorderVisibility, paddingMarginBorder, | |
| body = document.getElementsByTagName("body")[0]; | |
| if ( !body ) { | |
| // Return for frameset docs that don't have a body | |
| return; | |
| } | |
| conMarginTop = 1; | |
| paddingMarginBorder = "padding:0;margin:0;border:"; | |
| positionTopLeftWidthHeight = "position:absolute;top:0;left:0;width:1px;height:1px;"; | |
| paddingMarginBorderVisibility = paddingMarginBorder + "0;visibility:hidden;"; | |
| style = "style='" + positionTopLeftWidthHeight + paddingMarginBorder + "5px solid #000;"; | |
| html = "<div " + style + "display:block;'><div style='" + paddingMarginBorder + "0;display:block;overflow:hidden;'></div></div>" + | |
| "<table " + style + "' cellpadding='0' cellspacing='0'>" + | |
| "<tr><td></td></tr></table>"; | |
| container = document.createElement("div"); | |
| container.style.cssText = paddingMarginBorderVisibility + "width:0;height:0;position:static;top:0;margin-top:" + conMarginTop + "px"; | |
| body.insertBefore( container, body.firstChild ); | |
| // Construct the test element | |
| div = document.createElement("div"); | |
| container.appendChild( div ); | |
| // Check if table cells still have offsetWidth/Height when they are set | |
| // to display:none and there are still other visible table cells in a | |
| // table row; if so, offsetWidth/Height are not reliable for use when | |
| // determining if an element has been hidden directly using | |
| // display:none (it is still safe to use offsets if a parent element is | |
| // hidden; don safety goggles and see bug #4512 for more information). | |
| // (only IE 8 fails this test) | |
| div.innerHTML = "<table><tr><td style='" + paddingMarginBorder + "0;display:none'></td><td>t</td></tr></table>"; | |
| tds = div.getElementsByTagName( "td" ); | |
| isSupported = ( tds[ 0 ].offsetHeight === 0 ); | |
| tds[ 0 ].style.display = ""; | |
| tds[ 1 ].style.display = "none"; | |
| // Check if empty table cells still have offsetWidth/Height | |
| // (IE <= 8 fail this test) | |
| support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); | |
| // Check if div with explicit width and no margin-right incorrectly | |
| // gets computed margin-right based on width of container. For more | |
| // info see bug #3333 | |
| // Fails in WebKit before Feb 2011 nightlies | |
| // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right | |
| if ( window.getComputedStyle ) { | |
| div.innerHTML = ""; | |
| marginDiv = document.createElement( "div" ); | |
| marginDiv.style.width = "0"; | |
| marginDiv.style.marginRight = "0"; | |
| div.style.width = "2px"; | |
| div.appendChild( marginDiv ); | |
| support.reliableMarginRight = | |
| ( parseInt( ( window.getComputedStyle( marginDiv, null ) || { marginRight: 0 } ).marginRight, 10 ) || 0 ) === 0; | |
| } | |
| if ( typeof div.style.zoom !== "undefined" ) { | |
| // Check if natively block-level elements act like inline-block | |
| // elements when setting their display to 'inline' and giving | |
| // them layout | |
| // (IE < 8 does this) | |
| div.innerHTML = ""; | |
| div.style.width = div.style.padding = "1px"; | |
| div.style.border = 0; | |
| div.style.overflow = "hidden"; | |
| div.style.display = "inline"; | |
| div.style.zoom = 1; | |
| support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 ); | |
| // Check if elements with layout shrink-wrap their children | |
| // (IE 6 does this) | |
| div.style.display = "block"; | |
| div.style.overflow = "visible"; | |
| div.innerHTML = "<div style='width:5px;'></div>"; | |
| support.shrinkWrapBlocks = ( div.offsetWidth !== 3 ); | |
| } | |
| div.style.cssText = positionTopLeftWidthHeight + paddingMarginBorderVisibility; | |
| div.innerHTML = html; | |
| outer = div.firstChild; | |
| inner = outer.firstChild; | |
| td = outer.nextSibling.firstChild.firstChild; | |
| offsetSupport = { | |
| doesNotAddBorder: ( inner.offsetTop !== 5 ), | |
| doesAddBorderForTableAndCells: ( td.offsetTop === 5 ) | |
| }; | |
| inner.style.position = "fixed"; | |
| inner.style.top = "20px"; | |
| // safari subtracts parent border width here which is 5px | |
| offsetSupport.fixedPosition = ( inner.offsetTop === 20 || inner.offsetTop === 15 ); | |
| inner.style.position = inner.style.top = ""; | |
| outer.style.overflow = "hidden"; | |
| outer.style.position = "relative"; | |
| offsetSupport.subtractsBorderForOverflowNotVisible = ( inner.offsetTop === -5 ); | |
| offsetSupport.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== conMarginTop ); | |
| if ( window.getComputedStyle ) { | |
| div.style.marginTop = "1%"; | |
| support.pixelMargin = ( window.getComputedStyle( div, null ) || { marginTop: 0 } ).marginTop !== "1%"; | |
| } | |
| if ( typeof container.style.zoom !== "undefined" ) { | |
| container.style.zoom = 1; | |
| } | |
| body.removeChild( container ); | |
| marginDiv = div = container = null; | |
| jQuery.extend( support, offsetSupport ); | |
| }); | |
| return support; | |
| })(); | |
| var rbrace = /^(?:\{.*\}|\[.*\])$/, | |
| rmultiDash = /([A-Z])/g; | |
| jQuery.extend({ | |
| cache: {}, | |
| // Please use with caution | |
| uuid: 0, | |
| // Unique for each copy of jQuery on the page | |
| // Non-digits removed to match rinlinejQuery | |
| expando: "jQuery" + ( jQuery.fn.jquery + Math.random() ).replace( /\D/g, "" ), | |
| // The following elements throw uncatchable exceptions if you | |
| // attempt to add expando properties to them. | |
| noData: { | |
| "embed": true, | |
| // Ban all objects except for Flash (which handle expandos) | |
| "object": "clsid:D27CDB6E-AE6D-11cf-96B8-444553540000", | |
| "applet": true | |
| }, | |
| hasData: function( elem ) { | |
| elem = elem.nodeType ? jQuery.cache[ elem[jQuery.expando] ] : elem[ jQuery.expando ]; | |
| return !!elem && !isEmptyDataObject( elem ); | |
| }, | |
| data: function( elem, name, data, pvt /* Internal Use Only */ ) { | |
| if ( !jQuery.acceptData( elem ) ) { | |
| return; | |
| } | |
| var privateCache, thisCache, ret, | |
| internalKey = jQuery.expando, | |
| getByName = typeof name === "string", | |
| // We have to handle DOM nodes and JS objects differently because IE6-7 | |
| // can't GC object references properly across the DOM-JS boundary | |
| isNode = elem.nodeType, | |
| // Only DOM nodes need the global jQuery cache; JS object data is | |
| // attached directly to the object so GC can occur automatically | |
| cache = isNode ? jQuery.cache : elem, | |
| // Only defining an ID for JS objects if its cache already exists allows | |
| // the code to shortcut on the same path as a DOM node with no cache | |
| id = isNode ? elem[ internalKey ] : elem[ internalKey ] && internalKey, | |
| isEvents = name === "events"; | |
| // Avoid doing any more work than we need to when trying to get data on an | |
| // object that has no data at all | |
| if ( (!id || !cache[id] || (!isEvents && !pvt && !cache[id].data)) && getByName && data === undefined ) { | |
| return; | |
| } | |
| if ( !id ) { | |
| // Only DOM nodes need a new unique ID for each element since their data | |
| // ends up in the global cache | |
| if ( isNode ) { | |
| elem[ internalKey ] = id = ++jQuery.uuid; | |
| } else { | |
| id = internalKey; | |
| } | |
| } | |
| if ( !cache[ id ] ) { | |
| cache[ id ] = {}; | |
| // Avoids exposing jQuery metadata on plain JS objects when the object | |
| // is serialized using JSON.stringify | |
| if ( !isNode ) { | |
| cache[ id ].toJSON = jQuery.noop; | |
| } | |
| } | |
| // An object can be passed to jQuery.data instead of a key/value pair; this gets | |
| // shallow copied over onto the existing cache | |
| if ( typeof name === "object" || typeof name === "function" ) { | |
| if ( pvt ) { | |
| cache[ id ] = jQuery.extend( cache[ id ], name ); | |
| } else { | |
| cache[ id ].data = jQuery.extend( cache[ id ].data, name ); | |
| } | |
| } | |
| privateCache = thisCache = cache[ id ]; | |
| // jQuery data() is stored in a separate object inside the object's internal data | |
| // cache in order to avoid key collisions between internal data and user-defined | |
| // data. | |
| if ( !pvt ) { | |
| if ( !thisCache.data ) { | |
| thisCache.data = {}; | |
| } | |
| thisCache = thisCache.data; | |
| } | |
| if ( data !== undefined ) { | |
| thisCache[ jQuery.camelCase( name ) ] = data; | |
| } | |
| // Users should not attempt to inspect the internal events object using jQuery.data, | |
| // it is undocumented and subject to change. But does anyone listen? No. | |
| if ( isEvents && !thisCache[ name ] ) { | |
| return privateCache.events; | |
| } | |
| // Check for both converted-to-camel and non-converted data property names | |
| // If a data property was specified | |
| if ( getByName ) { | |
| // First Try to find as-is property data | |
| ret = thisCache[ name ]; | |
| // Test for null|undefined property data | |
| if ( ret == null ) { | |
| // Try to find the camelCased property | |
| ret = thisCache[ jQuery.camelCase( name ) ]; | |
| } | |
| } else { | |
| ret = thisCache; | |
| } | |
| return ret; | |
| }, | |
| removeData: function( elem, name, pvt /* Internal Use Only */ ) { | |
| if ( !jQuery.acceptData( elem ) ) { | |
| return; | |
| } | |
| var thisCache, i, l, | |
| // Reference to internal data cache key | |
| internalKey = jQuery.expando, | |
| isNode = elem.nodeType, | |
| // See jQuery.data for more information | |
| cache = isNode ? jQuery.cache : elem, | |
| // See jQuery.data for more information | |
| id = isNode ? elem[ internalKey ] : internalKey; | |
| // If there is already no cache entry for this object, there is no | |
| // purpose in continuing | |
| if ( !cache[ id ] ) { | |
| return; | |
| } | |
| if ( name ) { | |
| thisCache = pvt ? cache[ id ] : cache[ id ].data; | |
| if ( thisCache ) { | |
| // Support array or space separated string names for data keys | |
| if ( !jQuery.isArray( name ) ) { | |
| // try the string as a key before any manipulation | |
| if ( name in thisCache ) { | |
| name = [ name ]; | |
| } else { | |
| // split the camel cased version by spaces unless a key with the spaces exists | |
| name = jQuery.camelCase( name ); | |
| if ( name in thisCache ) { | |
| name = [ name ]; | |
| } else { | |
| name = name.split( " " ); | |
| } | |
| } | |
| } | |
| for ( i = 0, l = name.length; i < l; i++ ) { | |
| delete thisCache[ name[i] ]; | |
| } | |
| // If there is no data left in the cache, we want to continue | |
| // and let the cache object itself get destroyed | |
| if ( !( pvt ? isEmptyDataObject : jQuery.isEmptyObject )( thisCache ) ) { | |
| return; | |
| } | |
| } | |
| } | |
| // See jQuery.data for more information | |
| if ( !pvt ) { | |
| delete cache[ id ].data; | |
| // Don't destroy the parent cache unless the internal data object | |
| // had been the only thing left in it | |
| if ( !isEmptyDataObject(cache[ id ]) ) { | |
| return; | |
| } | |
| } | |
| // Browsers that fail expando deletion also refuse to delete expandos on | |
| // the window, but it will allow it on all other JS objects; other browsers | |
| // don't care | |
| // Ensure that `cache` is not a window object #10080 | |
| if ( jQuery.support.deleteExpando || !cache.setInterval ) { | |
| delete cache[ id ]; | |
| } else { | |
| cache[ id ] = null; | |
| } | |
| // We destroyed the cache and need to eliminate the expando on the node to avoid | |
| // false lookups in the cache for entries that no longer exist | |
| if ( isNode ) { | |
| // IE does not allow us to delete expando properties from nodes, | |
| // nor does it have a removeAttribute function on Document nodes; | |
| // we must handle all of these cases | |
| if ( jQuery.support.deleteExpando ) { | |
| delete elem[ internalKey ]; | |
| } else if ( elem.removeAttribute ) { | |
| elem.removeAttribute( internalKey ); | |
| } else { | |
| elem[ internalKey ] = null; | |
| } | |
| } | |
| }, | |
| // For internal use only. | |
| _data: function( elem, name, data ) { | |
| return jQuery.data( elem, name, data, true ); | |
| }, | |
| // A method for determining if a DOM node can handle the data expando | |
| acceptData: function( elem ) { | |
| if ( elem.nodeName ) { | |
| var match = jQuery.noData[ elem.nodeName.toLowerCase() ]; | |
| if ( match ) { | |
| return !(match === true || elem.getAttribute("classid") !== match); | |
| } | |
| } | |
| return true; | |
| } | |
| }); | |
| jQuery.fn.extend({ | |
| data: function( key, value ) { | |
| var parts, part, attr, name, l, | |
| elem = this[0], | |
| i = 0, | |
| data = null; | |
| // Gets all values | |
| if ( key === undefined ) { | |
| if ( this.length ) { | |
| data = jQuery.data( elem ); | |
| if ( elem.nodeType === 1 && !jQuery._data( elem, "parsedAttrs" ) ) { | |
| attr = elem.attributes; | |
| for ( l = attr.length; i < l; i++ ) { | |
| name = attr[i].name; | |
| if ( name.indexOf( "data-" ) === 0 ) { | |
| name = jQuery.camelCase( name.substring(5) ); | |
| dataAttr( elem, name, data[ name ] ); | |
| } | |
| } | |
| jQuery._data( elem, "parsedAttrs", true ); | |
| } | |
| } | |
| return data; | |
| } | |
| // Sets multiple values | |
| if ( typeof key === "object" ) { | |
| return this.each(function() { | |
| jQuery.data( this, key ); | |
| }); | |
| } | |
| parts = key.split( ".", 2 ); | |
| parts[1] = parts[1] ? "." + parts[1] : ""; | |
| part = parts[1] + "!"; | |
| return jQuery.access( this, function( value ) { | |
| if ( value === undefined ) { | |
| data = this.triggerHandler( "getData" + part, [ parts[0] ] ); | |
| // Try to fetch any internally stored data first | |
| if ( data === undefined && elem ) { | |
| data = jQuery.data( elem, key ); | |
| data = dataAttr( elem, key, data ); | |
| } | |
| return data === undefined && parts[1] ? | |
| this.data( parts[0] ) : | |
| data; | |
| } | |
| parts[1] = value; | |
| this.each(function() { | |
| var self = jQuery( this ); | |
| self.triggerHandler( "setData" + part, parts ); | |
| jQuery.data( this, key, value ); | |
| self.triggerHandler( "changeData" + part, parts ); | |
| }); | |
| }, null, value, arguments.length > 1, null, false ); | |
| }, | |
| removeData: function( key ) { | |
| return this.each(function() { | |
| jQuery.removeData( this, key ); | |
| }); | |
| } | |
| }); | |
| function dataAttr( elem, key, data ) { | |
| // If nothing was found internally, try to fetch any | |
| // data from the HTML5 data-* attribute | |
| if ( data === undefined && elem.nodeType === 1 ) { | |
| var name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); | |
| data = elem.getAttribute( name ); | |
| if ( typeof data === "string" ) { | |
| try { | |
| data = data === "true" ? true : | |
| data === "false" ? false : | |
| data === "null" ? null : | |
| jQuery.isNumeric( data ) ? +data : | |
| rbrace.test( data ) ? jQuery.parseJSON( data ) : | |
| data; | |
| } catch( e ) {} | |
| // Make sure we set the data so it isn't changed later | |
| jQuery.data( elem, key, data ); | |
| } else { | |
| data = undefined; | |
| } | |
| } | |
| return data; | |
| } | |
| // checks a cache object for emptiness | |
| function isEmptyDataObject( obj ) { | |
| for ( var name in obj ) { | |
| // if the public data object is empty, the private is still empty | |
| if ( name === "data" && jQuery.isEmptyObject( obj[name] ) ) { | |
| continue; | |
| } | |
| if ( name !== "toJSON" ) { | |
| return false; | |
| } | |
| } | |
| return true; | |
| } | |
| function handleQueueMarkDefer( elem, type, src ) { | |
| var deferDataKey = type + "defer", | |
| queueDataKey = type + "queue", | |
| markDataKey = type + "mark", | |
| defer = jQuery._data( elem, deferDataKey ); | |
| if ( defer && | |
| ( src === "queue" || !jQuery._data(elem, queueDataKey) ) && | |
| ( src === "mark" || !jQuery._data(elem, markDataKey) ) ) { | |
| // Give room for hard-coded callbacks to fire first | |
| // and eventually mark/queue something else on the element | |
| setTimeout( function() { | |
| if ( !jQuery._data( elem, queueDataKey ) && | |
| !jQuery._data( elem, markDataKey ) ) { | |
| jQuery.removeData( elem, deferDataKey, true ); | |
| defer.fire(); | |
| } | |
| }, 0 ); | |
| } | |
| } | |
| jQuery.extend({ | |
| _mark: function( elem, type ) { | |
| if ( elem ) { | |
| type = ( type || "fx" ) + "mark"; | |
| jQuery._data( elem, type, (jQuery._data( elem, type ) || 0) + 1 ); | |
| } | |
| }, | |
| _unmark: function( force, elem, type ) { | |
| if ( force !== true ) { | |
| type = elem; | |
| elem = force; | |
| force = false; | |
| } | |
| if ( elem ) { | |
| type = type || "fx"; | |
| var key = type + "mark", | |
| count = force ? 0 : ( (jQuery._data( elem, key ) || 1) - 1 ); | |
| if ( count ) { | |
| jQuery._data( elem, key, count ); | |
| } else { | |
| jQuery.removeData( elem, key, true ); | |
| handleQueueMarkDefer( elem, type, "mark" ); | |
| } | |
| } | |
| }, | |
| queue: function( elem, type, data ) { | |
| var q; | |
| if ( elem ) { | |
| type = ( type || "fx" ) + "queue"; | |
| q = jQuery._data( elem, type ); | |
| // Speed up dequeue by getting out quickly if this is just a lookup | |
| if ( data ) { | |
| if ( !q || jQuery.isArray(data) ) { | |
| q = jQuery._data( elem, type, jQuery.makeArray(data) ); | |
| } else { | |
| q.push( data ); | |
| } | |
| } | |
| return q || []; | |
| } | |
| }, | |
| dequeue: function( elem, type ) { | |
| type = type || "fx"; | |
| var queue = jQuery.queue( elem, type ), | |
| fn = queue.shift(), | |
| hooks = {}; | |
| // If the fx queue is dequeued, always remove the progress sentinel | |
| if ( fn === "inprogress" ) { | |
| fn = queue.shift(); | |
| } | |
| if ( fn ) { | |
| // Add a progress sentinel to prevent the fx queue from being | |
| // automatically dequeued | |
| if ( type === "fx" ) { | |
| queue.unshift( "inprogress" ); | |
| } | |
| jQuery._data( elem, type + ".run", hooks ); | |
| fn.call( elem, function() { | |
| jQuery.dequeue( elem, type ); | |
| }, hooks ); | |
| } | |
| if ( !queue.length ) { | |
| jQuery.removeData( elem, type + "queue " + type + ".run", true ); | |
| handleQueueMarkDefer( elem, type, "queue" ); | |
| } | |
| } | |
| }); | |
| jQuery.fn.extend({ | |
| queue: function( type, data ) { | |
| var setter = 2; | |
| if ( typeof type !== "string" ) { | |
| data = type; | |
| type = "fx"; | |
| setter--; | |
| } | |
| if ( arguments.length < setter ) { | |
| return jQuery.queue( this[0], type ); | |
| } | |
| return data === undefined ? | |
| this : | |
| this.each(function() { | |
| var queue = jQuery.queue( this, type, data ); | |
| if ( type === "fx" && queue[0] !== "inprogress" ) { | |
| jQuery.dequeue( this, type ); | |
| } | |
| }); | |
| }, | |
| dequeue: function( type ) { | |
| return this.each(function() { | |
| jQuery.dequeue( this, type ); | |
| }); | |
| }, | |
| // Based off of the plugin by Clint Helfers, with permission. | |
| // http://blindsignals.com/index.php/2009/07/jquery-delay/ | |
| delay: function( time, type ) { | |
| time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; | |
| type = type || "fx"; | |
| return this.queue( type, function( next, hooks ) { | |
| var timeout = setTimeout( next, time ); | |
| hooks.stop = function() { | |
| clearTimeout( timeout ); | |
| }; | |
| }); | |
| }, | |
| clearQueue: function( type ) { | |
| return this.queue( type || "fx", [] ); | |
| }, | |
| // Get a promise resolved when queues of a certain type | |
| // are emptied (fx is the type by default) | |
| promise: function( type, object ) { | |
| if ( typeof type !== "string" ) { | |
| object = type; | |
| type = undefined; | |
| } | |
| type = type || "fx"; | |
| var defer = jQuery.Deferred(), | |
| elements = this, | |
| i = elements.length, | |
| count = 1, | |
| deferDataKey = type + "defer", | |
| queueDataKey = type + "queue", | |
| markDataKey = type + "mark", | |
| tmp; | |
| function resolve() { | |
| if ( !( --count ) ) { | |
| defer.resolveWith( elements, [ elements ] ); | |
| } | |
| } | |
| while( i-- ) { | |
| if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || | |
| ( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || | |
| jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && | |
| jQuery.data( elements[ i ], deferDataKey, jQuery.Callbacks( "once memory" ), true ) )) { | |
| count++; | |
| tmp.add( resolve ); | |
| } | |
| } | |
| resolve(); | |
| return defer.promise( object ); | |
| } | |
| }); | |
| var rclass = /[\n\t\r]/g, | |
| rspace = /\s+/, | |
| rreturn = /\r/g, | |
| rtype = /^(?:button|input)$/i, | |
| rfocusable = /^(?:button|input|object|select|textarea)$/i, | |
| rclickable = /^a(?:rea)?$/i, | |
| rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i, | |
| getSetAttribute = jQuery.support.getSetAttribute, | |
| nodeHook, boolHook, fixSpecified; | |
| jQuery.fn.extend({ | |
| attr: function( name, value ) { | |
| return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 ); | |
| }, | |
| removeAttr: function( name ) { | |
| return this.each(function() { | |
| jQuery.removeAttr( this, name ); | |
| }); | |
| }, | |
| prop: function( name, value ) { | |
| return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 ); | |
| }, | |
| removeProp: function( name ) { | |
| name = jQuery.propFix[ name ] || name; | |
| return this.each(function() { | |
| // try/catch handles cases where IE balks (such as removing a property on window) | |
| try { | |
| this[ name ] = undefined; | |
| delete this[ name ]; | |
| } catch( e ) {} | |
| }); | |
| }, | |
| addClass: function( value ) { | |
| var classNames, i, l, elem, | |
| setClass, c, cl; | |
| if ( jQuery.isFunction( value ) ) { | |
| return this.each(function( j ) { | |
| jQuery( this ).addClass( value.call(this, j, this.className) ); | |
| }); | |
| } | |
| if ( value && typeof value === "string" ) { | |
| classNames = value.split( rspace ); | |
| for ( i = 0, l = this.length; i < l; i++ ) { | |
| elem = this[ i ]; | |
| if ( elem.nodeType === 1 ) { | |
| if ( !elem.className && classNames.length === 1 ) { | |
| elem.className = value; | |
| } else { | |
| setClass = " " + elem.className + " "; | |
| for ( c = 0, cl = classNames.length; c < cl; c++ ) { | |
| if ( !~setClass.indexOf( " " + classNames[ c ] + " " ) ) { | |
| setClass += classNames[ c ] + " "; | |
| } | |
| } | |
| elem.className = jQuery.trim( setClass ); | |
| } | |
| } | |
| } | |
| } | |
| return this; | |
| }, | |
| removeClass: function( value ) { | |
| var classNames, i, l, elem, className, c, cl; | |
| if ( jQuery.isFunction( value ) ) { | |
| return this.each(function( j ) { | |
| jQuery( this ).removeClass( value.call(this, j, this.className) ); | |
| }); | |
| } | |
| if ( (value && typeof value === "string") || value === undefined ) { | |
| classNames = ( value || "" ).split( rspace ); | |
| for ( i = 0, l = this.length; i < l; i++ ) { | |
| elem = this[ i ]; | |
| if ( elem.nodeType === 1 && elem.className ) { | |
| if ( value ) { | |
| className = (" " + elem.className + " ").replace( rclass, " " ); | |
| for ( c = 0, cl = classNames.length; c < cl; c++ ) { | |
| className = className.replace(" " + classNames[ c ] + " ", " "); | |
| } | |
| elem.className = jQuery.trim( className ); | |
| } else { | |
| elem.className = ""; | |
| } | |
| } | |
| } | |
| } | |
| return this; | |
| }, | |
| toggleClass: function( value, stateVal ) { | |
| var type = typeof value, | |
| isBool = typeof stateVal === "boolean"; | |
| if ( jQuery.isFunction( value ) ) { | |
| return this.each(function( i ) { | |
| jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); | |
| }); | |
| } | |
| return this.each(function() { | |
| if ( type === "string" ) { | |
| // toggle individual class names | |
| var className, | |
| i = 0, | |
| self = jQuery( this ), | |
| state = stateVal, | |
| classNames = value.split( rspace ); | |
| while ( (className = classNames[ i++ ]) ) { | |
| // check each className given, space seperated list | |
| state = isBool ? state : !self.hasClass( className ); | |
| self[ state ? "addClass" : "removeClass" ]( className ); | |
| } | |
| } else if ( type === "undefined" || type === "boolean" ) { | |
| if ( this.className ) { | |
| // store className if set | |
| jQuery._data( this, "__className__", this.className ); | |
| } | |
| // toggle whole className | |
| this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; | |
| } | |
| }); | |
| }, | |
| hasClass: function( selector ) { | |
| var className = " " + selector + " ", | |
| i = 0, | |
| l = this.length; | |
| for ( ; i < l; i++ ) { | |
| if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) > -1 ) { | |
| return true; | |
| } | |
| } | |
| return false; | |
| }, | |
| val: function( value ) { | |
| var hooks, ret, isFunction, | |
| elem = this[0]; | |
| if ( !arguments.length ) { | |
| if ( elem ) { | |
| hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ]; | |
| if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { | |
| return ret; | |
| } | |
| ret = elem.value; | |
| return typeof ret === "string" ? | |
| // handle most common string cases | |
| ret.replace(rreturn, "") : | |
| // handle cases where value is null/undef or number | |
| ret == null ? "" : ret; | |
| } | |
| return; | |
| } | |
| isFunction = jQuery.isFunction( value ); | |
| return this.each(function( i ) { | |
| var self = jQuery(this), val; | |
| if ( this.nodeType !== 1 ) { | |
| return; | |
| } | |
| if ( isFunction ) { | |
| val = value.call( this, i, self.val() ); | |
| } else { | |
| val = value; | |
| } | |
| // Treat null/undefined as ""; convert numbers to string | |
| if ( val == null ) { | |
| val = ""; | |
| } else if ( typeof val === "number" ) { | |
| val += ""; | |
| } else if ( jQuery.isArray( val ) ) { | |
| val = jQuery.map(val, function ( value ) { | |
| return value == null ? "" : value + ""; | |
| }); | |
| } | |
| hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; | |
| // If set returns undefined, fall back to normal setting | |
| if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { | |
| this.value = val; | |
| } | |
| }); | |
| } | |
| }); | |
| jQuery.extend({ | |
| valHooks: { | |
| option: { | |
| get: function( elem ) { | |
| // attributes.value is undefined in Blackberry 4.7 but | |
| // uses .value. See #6932 | |
| var val = elem.attributes.value; | |
| return !val || val.specified ? elem.value : elem.text; | |
| } | |
| }, | |
| select: { | |
| get: function( elem ) { | |
| var value, i, max, option, | |
| index = elem.selectedIndex, | |
| values = [], | |
| options = elem.options, | |
| one = elem.type === "select-one"; | |
| // Nothing was selected | |
| if ( index < 0 ) { | |
| return null; | |
| } | |
| // Loop through all the selected options | |
| i = one ? index : 0; | |
| max = one ? index + 1 : options.length; | |
| for ( ; i < max; i++ ) { | |
| option = options[ i ]; | |
| // Don't return options that are disabled or in a disabled optgroup | |
| if ( option.selected && (jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null) && | |
| (!option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" )) ) { | |
| // Get the specific value for the option | |
| value = jQuery( option ).val(); | |
| // We don't need an array for one selects | |
| if ( one ) { | |
| return value; | |
| } | |
| // Multi-Selects return an array | |
| values.push( value ); | |
| } | |
| } | |
| // Fixes Bug #2551 -- select.val() broken in IE after form.reset() | |
| if ( one && !values.length && options.length ) { | |
| return jQuery( options[ index ] ).val(); | |
| } | |
| return values; | |
| }, | |
| set: function( elem, value ) { | |
| var values = jQuery.makeArray( value ); | |
| jQuery(elem).find("option").each(function() { | |
| this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; | |
| }); | |
| if ( !values.length ) { | |
| elem.selectedIndex = -1; | |
| } | |
| return values; | |
| } | |
| } | |
| }, | |
| attrFn: { | |
| val: true, | |
| css: true, | |
| html: true, | |
| text: true, | |
| data: true, | |
| width: true, | |
| height: true, | |
| offset: true | |
| }, | |
| attr: function( elem, name, value, pass ) { | |
| var ret, hooks, notxml, | |
| nType = elem.nodeType; | |
| // don't get/set attributes on text, comment and attribute nodes | |
| if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { | |
| return; | |
| } | |
| if ( pass && name in jQuery.attrFn ) { | |
| return jQuery( elem )[ name ]( value ); | |
| } | |
| // Fallback to prop when attributes are not supported | |
| if ( typeof elem.getAttribute === "undefined" ) { | |
| return jQuery.prop( elem, name, value ); | |
| } | |
| notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); | |
| // All attributes are lowercase | |
| // Grab necessary hook if one is defined | |
| if ( notxml ) { | |
| name = name.toLowerCase(); | |
| hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); | |
| } | |
| if ( value !== undefined ) { | |
| if ( value === null ) { | |
| jQuery.removeAttr( elem, name ); | |
| return; | |
| } else if ( hooks && "set" in hooks && notxml && (ret = hooks.set( elem, value, name )) !== undefined ) { | |
| return ret; | |
| } else { | |
| elem.setAttribute( name, "" + value ); | |
| return value; | |
| } | |
| } else if ( hooks && "get" in hooks && notxml && (ret = hooks.get( elem, name )) !== null ) { | |
| return ret; | |
| } else { | |
| ret = elem.getAttribute( name ); | |
| // Non-existent attributes return null, we normalize to undefined | |
| return ret === null ? | |
| undefined : | |
| ret; | |
| } | |
| }, | |
| removeAttr: function( elem, value ) { | |
| var propName, attrNames, name, l, isBool, | |
| i = 0; | |
| if ( value && elem.nodeType === 1 ) { | |
| attrNames = value.toLowerCase().split( rspace ); | |
| l = attrNames.length; | |
| for ( ; i < l; i++ ) { | |
| name = attrNames[ i ]; | |
| if ( name ) { | |
| propName = jQuery.propFix[ name ] || name; | |
| isBool = rboolean.test( name ); | |
| // See #9699 for explanation of this approach (setting first, then removal) | |
| // Do not do this for boolean attributes (see #10870) | |
| if ( !isBool ) { | |
| jQuery.attr( elem, name, "" ); | |
| } | |
| elem.removeAttribute( getSetAttribute ? name : propName ); | |
| // Set corresponding property to false for boolean attributes | |
| if ( isBool && propName in elem ) { | |
| elem[ propName ] = false; | |
| } | |
| } | |
| } | |
| } | |
| }, | |
| attrHooks: { | |
| type: { | |
| set: function( elem, value ) { | |
| // We can't allow the type property to be changed (since it causes problems in IE) | |
| if ( rtype.test( elem.nodeName ) && elem.parentNode ) { | |
| jQuery.error( "type property can't be changed" ); | |
| } else if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { | |
| // Setting the type on a radio button after the value resets the value in IE6-9 | |
| // Reset value to it's default in case type is set after value | |
| // This is for element creation | |
| var val = elem.value; | |
| elem.setAttribute( "type", value ); | |
| if ( val ) { | |
| elem.value = val; | |
| } | |
| return value; | |
| } | |
| } | |
| }, | |
| // Use the value property for back compat | |
| // Use the nodeHook for button elements in IE6/7 (#1954) | |
| value: { | |
| get: function( elem, name ) { | |
| if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { | |
| return nodeHook.get( elem, name ); | |
| } | |
| return name in elem ? | |
| elem.value : | |
| null; | |
| }, | |
| set: function( elem, value, name ) { | |
| if ( nodeHook && jQuery.nodeName( elem, "button" ) ) { | |
| return nodeHook.set( elem, value, name ); | |
| } | |
| // Does not return so that setAttribute is also used | |
| elem.value = value; | |
| } | |
| } | |
| }, | |
| propFix: { | |
| tabindex: "tabIndex", | |
| readonly: "readOnly", | |
| "for": "htmlFor", | |
| "class": "className", | |
| maxlength: "maxLength", | |
| cellspacing: "cellSpacing", | |
| cellpadding: "cellPadding", | |
| rowspan: "rowSpan", | |
| colspan: "colSpan", | |
| usemap: "useMap", | |
| frameborder: "frameBorder", | |
| contenteditable: "contentEditable" | |
| }, | |
| prop: function( elem, name, value ) { | |
| var ret, hooks, notxml, | |
| nType = elem.nodeType; | |
| // don't get/set properties on text, comment and attribute nodes | |
| if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { | |
| return; | |
| } | |
| notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); | |
| if ( notxml ) { | |
| // Fix name and attach hooks | |
| name = jQuery.propFix[ name ] || name; | |
| hooks = jQuery.propHooks[ name ]; | |
| } | |
| if ( value !== undefined ) { | |
| if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { | |
| return ret; | |
| } else { | |
| return ( elem[ name ] = value ); | |
| } | |
| } else { | |
| if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { | |
| return ret; | |
| } else { | |
| return elem[ name ]; | |
| } | |
| } | |
| }, | |
| propHooks: { | |
| tabIndex: { | |
| get: function( elem ) { | |
| // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set | |
| // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ | |
| var attributeNode = elem.getAttributeNode("tabindex"); | |
| return attributeNode && attributeNode.specified ? | |
| parseInt( attributeNode.value, 10 ) : | |
| rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? | |
| 0 : | |
| undefined; | |
| } | |
| } | |
| } | |
| }); | |
| // Add the tabIndex propHook to attrHooks for back-compat (different case is intentional) | |
| jQuery.attrHooks.tabindex = jQuery.propHooks.tabIndex; | |
| // Hook for boolean attributes | |
| boolHook = { | |
| get: function( elem, name ) { | |
| // Align boolean attributes with corresponding properties | |
| // Fall back to attribute presence where some booleans are not supported | |
| var attrNode, | |
| property = jQuery.prop( elem, name ); | |
| return property === true || typeof property !== "boolean" && ( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ? | |
| name.toLowerCase() : | |
| undefined; | |
| }, | |
| set: function( elem, value, name ) { | |
| var propName; | |
| if ( value === false ) { | |
| // Remove boolean attributes when set to false | |
| jQuery.removeAttr( elem, name ); | |
| } else { | |
| // value is true since we know at this point it's type boolean and not false | |
| // Set boolean attributes to the same name and set the DOM property | |
| propName = jQuery.propFix[ name ] || name; | |
| if ( propName in elem ) { | |
| // Only set the IDL specifically if it already exists on the element | |
| elem[ propName ] = true; | |
| } | |
| elem.setAttribute( name, name.toLowerCase() ); | |
| } | |
| return name; | |
| } | |
| }; | |
| // IE6/7 do not support getting/setting some attributes with get/setAttribute | |
| if ( !getSetAttribute ) { | |
| fixSpecified = { | |
| name: true, | |
| id: true, | |
| coords: true | |
| }; | |
| // Use this for any attribute in IE6/7 | |
| // This fixes almost every IE6/7 issue | |
| nodeHook = jQuery.valHooks.button = { | |
| get: function( elem, name ) { | |
| var ret; | |
| ret = elem.getAttributeNode( name ); | |
| return ret && ( fixSpecified[ name ] ? ret.nodeValue !== "" : ret.specified ) ? | |
| ret.nodeValue : | |
| undefined; | |
| }, | |
| set: function( elem, value, name ) { | |
| // Set the existing or create a new attribute node | |
| var ret = elem.getAttributeNode( name ); | |
| if ( !ret ) { | |
| ret = document.createAttribute( name ); | |
| elem.setAttributeNode( ret ); | |
| } | |
| return ( ret.nodeValue = value + "" ); | |
| } | |
| }; | |
| // Apply the nodeHook to tabindex | |
| jQuery.attrHooks.tabindex.set = nodeHook.set; | |
| // Set width and height to auto instead of 0 on empty string( Bug #8150 ) | |
| // This is for removals | |
| jQuery.each([ "width", "height" ], function( i, name ) { | |
| jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { | |
| set: function( elem, value ) { | |
| if ( value === "" ) { | |
| elem.setAttribute( name, "auto" ); | |
| return value; | |
| } | |
| } | |
| }); | |
| }); | |
| // Set contenteditable to false on removals(#10429) | |
| // Setting to empty string throws an error as an invalid value | |
| jQuery.attrHooks.contenteditable = { | |
| get: nodeHook.get, | |
| set: function( elem, value, name ) { | |
| if ( value === "" ) { | |
| value = "false"; | |
| } | |
| nodeHook.set( elem, value, name ); | |
| } | |
| }; | |
| } | |
| // Some attributes require a special call on IE | |
| if ( !jQuery.support.hrefNormalized ) { | |
| jQuery.each([ "href", "src", "width", "height" ], function( i, name ) { | |
| jQuery.attrHooks[ name ] = jQuery.extend( jQuery.attrHooks[ name ], { | |
| get: function( elem ) { | |
| var ret = elem.getAttribute( name, 2 ); | |
| return ret === null ? undefined : ret; | |
| } | |
| }); | |
| }); | |
| } | |
| if ( !jQuery.support.style ) { | |
| jQuery.attrHooks.style = { | |
| get: function( elem ) { | |
| // Return undefined in the case of empty string | |
| // Normalize to lowercase since IE uppercases css property names | |
| return elem.style.cssText.toLowerCase() || undefined; | |
| }, | |
| set: function( elem, value ) { | |
| return ( elem.style.cssText = "" + value ); | |
| } | |
| }; | |
| } | |
| // Safari mis-reports the default selected property of an option | |
| // Accessing the parent's selectedIndex property fixes it | |
| if ( !jQuery.support.optSelected ) { | |
| jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { | |
| get: function( elem ) { | |
| var parent = elem.parentNode; | |
| if ( parent ) { | |
| parent.selectedIndex; | |
| // Make sure that it also works with optgroups, see #5701 | |
| if ( parent.parentNode ) { | |
| parent.parentNode.selectedIndex; | |
| } | |
| } | |
| return null; | |
| } | |
| }); | |
| } | |
| // IE6/7 call enctype encoding | |
| if ( !jQuery.support.enctype ) { | |
| jQuery.propFix.enctype = "encoding"; | |
| } | |
| // Radios and checkboxes getter/setter | |
| if ( !jQuery.support.checkOn ) { | |
| jQuery.each([ "radio", "checkbox" ], function() { | |
| jQuery.valHooks[ this ] = { | |
| get: function( elem ) { | |
| // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified | |
| return elem.getAttribute("value") === null ? "on" : elem.value; | |
| } | |
| }; | |
| }); | |
| } | |
| jQuery.each([ "radio", "checkbox" ], function() { | |
| jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { | |
| set: function( elem, value ) { | |
| if ( jQuery.isArray( value ) ) { | |
| return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); | |
| } | |
| } | |
| }); | |
| }); | |
| var rformElems = /^(?:textarea|input|select)$/i, | |
| rtypenamespace = /^([^\.]*)?(?:\.(.+))?$/, | |
| rhoverHack = /(?:^|\s)hover(\.\S+)?\b/, | |
| rkeyEvent = /^key/, | |
| rmouseEvent = /^(?:mouse|contextmenu)|click/, | |
| rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, | |
| rquickIs = /^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/, | |
| quickParse = function( selector ) { | |
| var quick = rquickIs.exec( selector ); | |
| if ( quick ) { | |
| // 0 1 2 3 | |
| // [ _, tag, id, class ] | |
| quick[1] = ( quick[1] || "" ).toLowerCase(); | |
| quick[3] = quick[3] && new RegExp( "(?:^|\\s)" + quick[3] + "(?:\\s|$)" ); | |
| } | |
| return quick; | |
| }, | |
| quickIs = function( elem, m ) { | |
| var attrs = elem.attributes || {}; | |
| return ( | |
| (!m[1] || elem.nodeName.toLowerCase() === m[1]) && | |
| (!m[2] || (attrs.id || {}).value === m[2]) && | |
| (!m[3] || m[3].test( (attrs[ "class" ] || {}).value )) | |
| ); | |
| }, | |
| hoverHack = function( events ) { | |
| return jQuery.event.special.hover ? events : events.replace( rhoverHack, "mouseenter$1 mouseleave$1" ); | |
| }; | |
| /* | |
| * Helper functions for managing events -- not part of the public interface. | |
| * Props to Dean Edwards' addEvent library for many of the ideas. | |
| */ | |
| jQuery.event = { | |
| add: function( elem, types, handler, data, selector ) { | |
| var elemData, eventHandle, events, | |
| t, tns, type, namespaces, handleObj, | |
| handleObjIn, quick, handlers, special; | |
| // Don't attach events to noData or text/comment nodes (allow plain objects tho) | |
| if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = jQuery._data( elem )) ) { | |
| return; | |
| } | |
| // Caller can pass in an object of custom data in lieu of the handler | |
| if ( handler.handler ) { | |
| handleObjIn = handler; | |
| handler = handleObjIn.handler; | |
| selector = handleObjIn.selector; | |
| } | |
| // Make sure that the handler has a unique ID, used to find/remove it later | |
| if ( !handler.guid ) { | |
| handler.guid = jQuery.guid++; | |
| } | |
| // Init the element's event structure and main handler, if this is the first | |
| events = elemData.events; | |
| if ( !events ) { | |
| elemData.events = events = {}; | |
| } | |
| eventHandle = elemData.handle; | |
| if ( !eventHandle ) { | |
| elemData.handle = eventHandle = function( e ) { | |
| // Discard the second event of a jQuery.event.trigger() and | |
| // when an event is called after a page has unloaded | |
| return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? | |
| jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : | |
| undefined; | |
| }; | |
| // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events | |
| eventHandle.elem = elem; | |
| } | |
| // Handle multiple events separated by a space | |
| // jQuery(...).bind("mouseover mouseout", fn); | |
| types = jQuery.trim( hoverHack(types) ).split( " " ); | |
| for ( t = 0; t < types.length; t++ ) { | |
| tns = rtypenamespace.exec( types[t] ) || []; | |
| type = tns[1]; | |
| namespaces = ( tns[2] || "" ).split( "." ).sort(); | |
| // If event changes its type, use the special event handlers for the changed type | |
| special = jQuery.event.special[ type ] || {}; | |
| // If selector defined, determine special event api type, otherwise given type | |
| type = ( selector ? special.delegateType : special.bindType ) || type; | |
| // Update special based on newly reset type | |
| special = jQuery.event.special[ type ] || {}; | |
| // handleObj is passed to all event handlers | |
| handleObj = jQuery.extend({ | |
| type: type, | |
| origType: tns[1], | |
| data: data, | |
| handler: handler, | |
| guid: handler.guid, | |
| selector: selector, | |
| quick: selector && quickParse( selector ), | |
| namespace: namespaces.join(".") | |
| }, handleObjIn ); | |
| // Init the event handler queue if we're the first | |
| handlers = events[ type ]; | |
| if ( !handlers ) { | |
| handlers = events[ type ] = []; | |
| handlers.delegateCount = 0; | |
| // Only use addEventListener/attachEvent if the special events handler returns false | |
| if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { | |
| // Bind the global event handler to the element | |
| if ( elem.addEventListener ) { | |
| elem.addEventListener( type, eventHandle, false ); | |
| } else if ( elem.attachEvent ) { | |
| elem.attachEvent( "on" + type, eventHandle ); | |
| } | |
| } | |
| } | |
| if ( special.add ) { | |
| special.add.call( elem, handleObj ); | |
| if ( !handleObj.handler.guid ) { | |
| handleObj.handler.guid = handler.guid; | |
| } | |
| } | |
| // Add to the element's handler list, delegates in front | |
| if ( selector ) { | |
| handlers.splice( handlers.delegateCount++, 0, handleObj ); | |
| } else { | |
| handlers.push( handleObj ); | |
| } | |
| // Keep track of which events have ever been used, for event optimization | |
| jQuery.event.global[ type ] = true; | |
| } | |
| // Nullify elem to prevent memory leaks in IE | |
| elem = null; | |
| }, | |
| global: {}, | |
| // Detach an event or set of events from an element | |
| remove: function( elem, types, handler, selector, mappedTypes ) { | |
| var elemData = jQuery.hasData( elem ) && jQuery._data( elem ), | |
| t, tns, type, origType, namespaces, origCount, | |
| j, events, special, handle, eventType, handleObj; | |
| if ( !elemData || !(events = elemData.events) ) { | |
| return; | |
| } | |
| // Once for each type.namespace in types; type may be omitted | |
| types = jQuery.trim( hoverHack( types || "" ) ).split(" "); | |
| for ( t = 0; t < types.length; t++ ) { | |
| tns = rtypenamespace.exec( types[t] ) || []; | |
| type = origType = tns[1]; | |
| namespaces = tns[2]; | |
| // Unbind all events (on this namespace, if provided) for the element | |
| if ( !type ) { | |
| for ( type in events ) { | |
| jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); | |
| } | |
| continue; | |
| } | |
| special = jQuery.event.special[ type ] || {}; | |
| type = ( selector? special.delegateType : special.bindType ) || type; | |
| eventType = events[ type ] || []; | |
| origCount = eventType.length; | |
| namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.)?") + "(\\.|$)") : null; | |
| // Remove matching events | |
| for ( j = 0; j < eventType.length; j++ ) { | |
| handleObj = eventType[ j ]; | |
| if ( ( mappedTypes || origType === handleObj.origType ) && | |
| ( !handler || handler.guid === handleObj.guid ) && | |
| ( !namespaces || namespaces.test( handleObj.namespace ) ) && | |
| ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { | |
| eventType.splice( j--, 1 ); | |
| if ( handleObj.selector ) { | |
| eventType.delegateCount--; | |
| } | |
| if ( special.remove ) { | |
| special.remove.call( elem, handleObj ); | |
| } | |
| } | |
| } | |
| // Remove generic event handler if we removed something and no more handlers exist | |
| // (avoids potential for endless recursion during removal of special event handlers) | |
| if ( eventType.length === 0 && origCount !== eventType.length ) { | |
| if ( !special.teardown || special.teardown.call( elem, namespaces ) === false ) { | |
| jQuery.removeEvent( elem, type, elemData.handle ); | |
| } | |
| delete events[ type ]; | |
| } | |
| } | |
| // Remove the expando if it's no longer used | |
| if ( jQuery.isEmptyObject( events ) ) { | |
| handle = elemData.handle; | |
| if ( handle ) { | |
| handle.elem = null; | |
| } | |
| // removeData also checks for emptiness and clears the expando if empty | |
| // so use it instead of delete | |
| jQuery.removeData( elem, [ "events", "handle" ], true ); | |
| } | |
| }, | |
| // Events that are safe to short-circuit if no handlers are attached. | |
| // Native DOM events should not be added, they may have inline handlers. | |
| customEvent: { | |
| "getData": true, | |
| "setData": true, | |
| "changeData": true | |
| }, | |
| trigger: function( event, data, elem, onlyHandlers ) { | |
| // Don't do events on text and comment nodes | |
| if ( elem && (elem.nodeType === 3 || elem.nodeType === 8) ) { | |
| return; | |
| } | |
| // Event object or event type | |
| var type = event.type || event, | |
| namespaces = [], | |
| cache, exclusive, i, cur, old, ontype, special, handle, eventPath, bubbleType; | |
| // focus/blur morphs to focusin/out; ensure we're not firing them right now | |
| if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { | |
| return; | |
| } | |
| if ( type.indexOf( "!" ) >= 0 ) { | |
| // Exclusive events trigger only for the exact event (no namespaces) | |
| type = type.slice(0, -1); | |
| exclusive = true; | |
| } | |
| if ( type.indexOf( "." ) >= 0 ) { | |
| // Namespaced trigger; create a regexp to match event type in handle() | |
| namespaces = type.split("."); | |
| type = namespaces.shift(); | |
| namespaces.sort(); | |
| } | |
| if ( (!elem || jQuery.event.customEvent[ type ]) && !jQuery.event.global[ type ] ) { | |
| // No jQuery handlers for this event type, and it can't have inline handlers | |
| return; | |
| } | |
| // Caller can pass in an Event, Object, or just an event type string | |
| event = typeof event === "object" ? | |
| // jQuery.Event object | |
| event[ jQuery.expando ] ? event : | |
| // Object literal | |
| new jQuery.Event( type, event ) : | |
| // Just the event type (string) | |
| new jQuery.Event( type ); | |
| event.type = type; | |
| event.isTrigger = true; | |
| event.exclusive = exclusive; | |
| event.namespace = namespaces.join( "." ); | |
| event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.)?") + "(\\.|$)") : null; | |
| ontype = type.indexOf( ":" ) < 0 ? "on" + type : ""; | |
| // Handle a global trigger | |
| if ( !elem ) { | |
| // TODO: Stop taunting the data cache; remove global events and always attach to document | |
| cache = jQuery.cache; | |
| for ( i in cache ) { | |
| if ( cache[ i ].events && cache[ i ].events[ type ] ) { | |
| jQuery.event.trigger( event, data, cache[ i ].handle.elem, true ); | |
| } | |
| } | |
| return; | |
| } | |
| // Clean up the event in case it is being reused | |
| event.result = undefined; | |
| if ( !event.target ) { | |
| event.target = elem; | |
| } | |
| // Clone any incoming data and prepend the event, creating the handler arg list | |
| data = data != null ? jQuery.makeArray( data ) : []; | |
| data.unshift( event ); | |
| // Allow special events to draw outside the lines | |
| special = jQuery.event.special[ type ] || {}; | |
| if ( special.trigger && special.trigger.apply( elem, data ) === false ) { | |
| return; | |
| } | |
| // Determine event propagation path in advance, per W3C events spec (#9951) | |
| // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) | |
| eventPath = [[ elem, special.bindType || type ]]; | |
| if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { | |
| bubbleType = special.delegateType || type; | |
| cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode; | |
| old = null; | |
| for ( ; cur; cur = cur.parentNode ) { | |
| eventPath.push([ cur, bubbleType ]); | |
| old = cur; | |
| } | |
| // Only add window if we got to document (e.g., not plain obj or detached DOM) | |
| if ( old && old === elem.ownerDocument ) { | |
| eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); | |
| } | |
| } | |
| // Fire handlers on the event path | |
| for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) { | |
| cur = eventPath[i][0]; | |
| event.type = eventPath[i][1]; | |
| handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); | |
| if ( handle ) { | |
| handle.apply( cur, data ); | |
| } | |
| // Note that this is a bare JS function and not a jQuery handler | |
| handle = ontype && cur[ ontype ]; | |
| if ( handle && jQuery.acceptData( cur ) && handle.apply( cur, data ) === false ) { | |
| event.preventDefault(); | |
| } | |
| } | |
| event.type = type; | |
| // If nobody prevented the default action, do it now | |
| if ( !onlyHandlers && !event.isDefaultPrevented() ) { | |
| if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && | |
| !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { | |
| // Call a native DOM method on the target with the same name name as the event. | |
| // Can't use an .isFunction() check here because IE6/7 fails that test. | |
| // Don't do default actions on window, that's where global variables be (#6170) | |
| // IE<9 dies on focus/blur to hidden element (#1486) | |
| if ( ontype && elem[ type ] && ((type !== "focus" && type !== "blur") || event.target.offsetWidth !== 0) && !jQuery.isWindow( elem ) ) { | |
| // Don't re-trigger an onFOO event when we call its FOO() method | |
| old = elem[ ontype ]; | |
| if ( old ) { | |
| elem[ ontype ] = null; | |
| } | |
| // Prevent re-triggering of the same event, since we already bubbled it above | |
| jQuery.event.triggered = type; | |
| elem[ type ](); | |
| jQuery.event.triggered = undefined; | |
| if ( old ) { | |
| elem[ ontype ] = old; | |
| } | |
| } | |
| } | |
| } | |
| return event.result; | |
| }, | |
| dispatch: function( event ) { | |
| // Make a writable jQuery.Event from the native event object | |
| event = jQuery.event.fix( event || window.event ); | |
| var handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), | |
| delegateCount = handlers.delegateCount, | |
| args = [].slice.call( arguments, 0 ), | |
| run_all = !event.exclusive && !event.namespace, | |
| special = jQuery.event.special[ event.type ] || {}, | |
| handlerQueue = [], | |
| i, j, cur, jqcur, ret, selMatch, matched, matches, handleObj, sel, related; | |
| // Use the fix-ed jQuery.Event rather than the (read-only) native event | |
| args[0] = event; | |
| event.delegateTarget = this; | |
| // Call the preDispatch hook for the mapped type, and let it bail if desired | |
| if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { | |
| return; | |
| } | |
| // Determine handlers that should run if there are delegated events | |
| // Avoid non-left-click bubbling in Firefox (#3861) | |
| if ( delegateCount && !(event.button && event.type === "click") ) { | |
| // Pregenerate a single jQuery object for reuse with .is() | |
| jqcur = jQuery(this); | |
| jqcur.context = this.ownerDocument || this; | |
| for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { | |
| // Don't process events on disabled elements (#6911, #8165) | |
| if ( cur.disabled !== true ) { | |
| selMatch = {}; | |
| matches = []; | |
| jqcur[0] = cur; | |
| for ( i = 0; i < delegateCount; i++ ) { | |
| handleObj = handlers[ i ]; | |
| sel = handleObj.selector; | |
| if ( selMatch[ sel ] === undefined ) { | |
| selMatch[ sel ] = ( | |
| handleObj.quick ? quickIs( cur, handleObj.quick ) : jqcur.is( sel ) | |
| ); | |
| } | |
| if ( selMatch[ sel ] ) { | |
| matches.push( handleObj ); | |
| } | |
| } | |
| if ( matches.length ) { | |
| handlerQueue.push({ elem: cur, matches: matches }); | |
| } | |
| } | |
| } | |
| } | |
| // Add the remaining (directly-bound) handlers | |
| if ( handlers.length > delegateCount ) { | |
| handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); | |
| } | |
| // Run delegates first; they may want to stop propagation beneath us | |
| for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { | |
| matched = handlerQueue[ i ]; | |
| event.currentTarget = matched.elem; | |
| for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { | |
| handleObj = matched.matches[ j ]; | |
| // Triggered event must either 1) be non-exclusive and have no namespace, or | |
| // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). | |
| if ( run_all || (!event.namespace && !handleObj.namespace) || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { | |
| event.data = handleObj.data; | |
| event.handleObj = handleObj; | |
| ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) | |
| .apply( matched.elem, args ); | |
| if ( ret !== undefined ) { | |
| event.result = ret; | |
| if ( ret === false ) { | |
| event.preventDefault(); | |
| event.stopPropagation(); | |
| } | |
| } | |
| } | |
| } | |
| } | |
| // Call the postDispatch hook for the mapped type | |
| if ( special.postDispatch ) { | |
| special.postDispatch.call( this, event ); | |
| } | |
| return event.result; | |
| }, | |
| // Includes some event props shared by KeyEvent and MouseEvent | |
| // *** attrChange attrName relatedNode srcElement are not normalized, non-W3C, deprecated, will be removed in 1.8 *** | |
| props: "attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), | |
| fixHooks: {}, | |
| keyHooks: { | |
| props: "char charCode key keyCode".split(" "), | |
| filter: function( event, original ) { | |
| // Add which for key events | |
| if ( event.which == null ) { | |
| event.which = original.charCode != null ? original.charCode : original.keyCode; | |
| } | |
| return event; | |
| } | |
| }, | |
| mouseHooks: { | |
| props: "button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "), | |
| filter: function( event, original ) { | |
| var eventDoc, doc, body, | |
| button = original.button, | |
| fromElement = original.fromElement; | |
| // Calculate pageX/Y if missing and clientX/Y available | |
| if ( event.pageX == null && original.clientX != null ) { | |
| eventDoc = event.target.ownerDocument || document; | |
| doc = eventDoc.documentElement; | |
| body = eventDoc.body; | |
| event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); | |
| event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); | |
| } | |
| // Add relatedTarget, if necessary | |
| if ( !event.relatedTarget && fromElement ) { | |
| event.relatedTarget = fromElement === event.target ? original.toElement : fromElement; | |
| } | |
| // Add which for click: 1 === left; 2 === middle; 3 === right | |
| // Note: button is not normalized, so don't use it | |
| if ( !event.which && button !== undefined ) { | |
| event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); | |
| } | |
| return event; | |
| } | |
| }, | |
| fix: function( event ) { | |
| if ( event[ jQuery.expando ] ) { | |
| return event; | |
| } | |
| // Create a writable copy of the event object and normalize some properties | |
| var i, prop, | |
| originalEvent = event, | |
| fixHook = jQuery.event.fixHooks[ event.type ] || {}, | |
| copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; | |
| event = jQuery.Event( originalEvent ); | |
| for ( i = copy.length; i; ) { | |
| prop = copy[ --i ]; | |
| event[ prop ] = originalEvent[ prop ]; | |
| } | |
| // Fix target property, if necessary (#1925, IE 6/7/8 & Safari2) | |
| if ( !event.target ) { | |
| event.target = originalEvent.srcElement || document; | |
| } | |
| // Target should not be a text node (#504, Safari) | |
| if ( event.target.nodeType === 3 ) { | |
| event.target = event.target.parentNode; | |
| } | |
| // For mouse/key events; add metaKey if it's not there (#3368, IE6/7/8) | |
| if ( event.metaKey === undefined ) { | |
| event.metaKey = event.ctrlKey; | |
| } | |
| return fixHook.filter? fixHook.filter( event, originalEvent ) : event; | |
| }, | |
| special: { | |
| ready: { | |
| // Make sure the ready event is setup | |
| setup: jQuery.bindReady | |
| }, | |
| load: { | |
| // Prevent triggered image.load events from bubbling to window.load | |
| noBubble: true | |
| }, | |
| focus: { | |
| delegateType: "focusin" | |
| }, | |
| blur: { | |
| delegateType: "focusout" | |
| }, | |
| beforeunload: { | |
| setup: function( data, namespaces, eventHandle ) { | |
| // We only want to do this special case on windows | |
| if ( jQuery.isWindow( this ) ) { | |
| this.onbeforeunload = eventHandle; | |
| } | |
| }, | |
| teardown: function( namespaces, eventHandle ) { | |
| if ( this.onbeforeunload === eventHandle ) { | |
| this.onbeforeunload = null; | |
| } | |
| } | |
| } | |
| }, | |
| simulate: function( type, elem, event, bubble ) { | |
| // Piggyback on a donor event to simulate a different one. | |
| // Fake originalEvent to avoid donor's stopPropagation, but if the | |
| // simulated event prevents default then we do the same on the donor. | |
| var e = jQuery.extend( | |
| new jQuery.Event(), | |
| event, | |
| { type: type, | |
| isSimulated: true, | |
| originalEvent: {} | |
| } | |
| ); | |
| if ( bubble ) { | |
| jQuery.event.trigger( e, null, elem ); | |
| } else { | |
| jQuery.event.dispatch.call( elem, e ); | |
| } | |
| if ( e.isDefaultPrevented() ) { | |
| event.preventDefault(); | |
| } | |
| } | |
| }; | |
| // Some plugins are using, but it's undocumented/deprecated and will be removed. | |
| // The 1.7 special event interface should provide all the hooks needed now. | |
| jQuery.event.handle = jQuery.event.dispatch; | |
| jQuery.removeEvent = document.removeEventListener ? | |
| function( elem, type, handle ) { | |
| if ( elem.removeEventListener ) { | |
| elem.removeEventListener( type, handle, false ); | |
| } | |
| } : | |
| function( elem, type, handle ) { | |
| if ( elem.detachEvent ) { | |
| elem.detachEvent( "on" + type, handle ); | |
| } | |
| }; | |
| jQuery.Event = function( src, props ) { | |
| // Allow instantiation without the 'new' keyword | |
| if ( !(this instanceof jQuery.Event) ) { | |
| return new jQuery.Event( src, props ); | |
| } | |
| // Event object | |
| if ( src && src.type ) { | |
| this.originalEvent = src; | |
| this.type = src.type; | |
| // Events bubbling up the document may have been marked as prevented | |
| // by a handler lower down the tree; reflect the correct value. | |
| this.isDefaultPrevented = ( src.defaultPrevented || src.returnValue === false || | |
| src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; | |
| // Event type | |
| } else { | |
| this.type = src; | |
| } | |
| // Put explicitly provided properties onto the event object | |
| if ( props ) { | |
| jQuery.extend( this, props ); | |
| } | |
| // Create a timestamp if incoming event doesn't have one | |
| this.timeStamp = src && src.timeStamp || jQuery.now(); | |
| // Mark it as fixed | |
| this[ jQuery.expando ] = true; | |
| }; | |
| function returnFalse() { | |
| return false; | |
| } | |
| function returnTrue() { | |
| return true; | |
| } | |
| // jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding | |
| // http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html | |
| jQuery.Event.prototype = { | |
| preventDefault: function() { | |
| this.isDefaultPrevented = returnTrue; | |
| var e = this.originalEvent; | |
| if ( !e ) { | |
| return; | |
| } | |
| // if preventDefault exists run it on the original event | |
| if ( e.preventDefault ) { | |
| e.preventDefault(); | |
| // otherwise set the returnValue property of the original event to false (IE) | |
| } else { | |
| e.returnValue = false; | |
| } | |
| }, | |
| stopPropagation: function() { | |
| this.isPropagationStopped = returnTrue; | |
| var e = this.originalEvent; | |
| if ( !e ) { | |
| return; | |
| } | |
| // if stopPropagation exists run it on the original event | |
| if ( e.stopPropagation ) { | |
| e.stopPropagation(); | |
| } | |
| // otherwise set the cancelBubble property of the original event to true (IE) | |
| e.cancelBubble = true; | |
| }, | |
| stopImmediatePropagation: function() { | |
| this.isImmediatePropagationStopped = returnTrue; | |
| this.stopPropagation(); | |
| }, | |
| isDefaultPrevented: returnFalse, | |
| isPropagationStopped: returnFalse, | |
| isImmediatePropagationStopped: returnFalse | |
| }; | |
| // Create mouseenter/leave events using mouseover/out and event-time checks | |
| jQuery.each({ | |
| mouseenter: "mouseover", | |
| mouseleave: "mouseout" | |
| }, function( orig, fix ) { | |
| jQuery.event.special[ orig ] = { | |
| delegateType: fix, | |
| bindType: fix, | |
| handle: function( event ) { | |
| var target = this, | |
| related = event.relatedTarget, | |
| handleObj = event.handleObj, | |
| selector = handleObj.selector, | |
| ret; | |
| // For mousenter/leave call the handler if related is outside the target. | |
| // NB: No relatedTarget if the mouse left/entered the browser window | |
| if ( !related || (related !== target && !jQuery.contains( target, related )) ) { | |
| event.type = handleObj.origType; | |
| ret = handleObj.handler.apply( this, arguments ); | |
| event.type = fix; | |
| } | |
| return ret; | |
| } | |
| }; | |
| }); | |
| // IE submit delegation | |
| if ( !jQuery.support.submitBubbles ) { | |
| jQuery.event.special.submit = { | |
| setup: function() { | |
| // Only need this for delegated form submit events | |
| if ( jQuery.nodeName( this, "form" ) ) { | |
| return false; | |
| } | |
| // Lazy-add a submit handler when a descendant form may potentially be submitted | |
| jQuery.event.add( this, "click._submit keypress._submit", function( e ) { | |
| // Node name check avoids a VML-related crash in IE (#9807) | |
| var elem = e.target, | |
| form = jQuery.nodeName( elem, "input" ) || jQuery.nodeName( elem, "button" ) ? elem.form : undefined; | |
| if ( form && !form._submit_attached ) { | |
| jQuery.event.add( form, "submit._submit", function( event ) { | |
| event._submit_bubble = true; | |
| }); | |
| form._submit_attached = true; | |
| } | |
| }); | |
| // return undefined since we don't need an event listener | |
| }, | |
| postDispatch: function( event ) { | |
| // If form was submitted by the user, bubble the event up the tree | |
| if ( event._submit_bubble ) { | |
| delete event._submit_bubble; | |
| if ( this.parentNode && !event.isTrigger ) { | |
| jQuery.event.simulate( "submit", this.parentNode, event, true ); | |
| } | |
| } | |
| }, | |
| teardown: function() { | |
| // Only need this for delegated form submit events | |
| if ( jQuery.nodeName( this, "form" ) ) { | |
| return false; | |
| } | |
| // Remove delegated handlers; cleanData eventually reaps submit handlers attached above | |
| jQuery.event.remove( this, "._submit" ); | |
| } | |
| }; | |
| } | |
| // IE change delegation and checkbox/radio fix | |
| if ( !jQuery.support.changeBubbles ) { | |
| jQuery.event.special.change = { | |
| setup: function() { | |
| if ( rformElems.test( this.nodeName ) ) { | |
| // IE doesn't fire change on a check/radio until blur; trigger it on click | |
| // after a propertychange. Eat the blur-change in special.change.handle. | |
| // This still fires onchange a second time for check/radio after blur. | |
| if ( this.type === "checkbox" || this.type === "radio" ) { | |
| jQuery.event.add( this, "propertychange._change", function( event ) { | |
| if ( event.originalEvent.propertyName === "checked" ) { | |
| this._just_changed = true; | |
| } | |
| }); | |
| jQuery.event.add( this, "click._change", function( event ) { | |
| if ( this._just_changed && !event.isTrigger ) { | |
| this._just_changed = false; | |
| jQuery.event.simulate( "change", this, event, true ); | |
| } | |
| }); | |
| } | |
| return false; | |
| } | |
| // Delegated event; lazy-add a change handler on descendant inputs | |
| jQuery.event.add( this, "beforeactivate._change", function( e ) { | |
| var elem = e.target; | |
| if ( rformElems.test( elem.nodeName ) && !elem._change_attached ) { | |
| jQuery.event.add( elem, "change._change", function( event ) { | |
| if ( this.parentNode && !event.isSimulated && !event.isTrigger ) { | |
| jQuery.event.simulate( "change", this.parentNode, event, true ); | |
| } | |
| }); | |
| elem._change_attached = true; | |
| } | |
| }); | |
| }, | |
| handle: function( event ) { | |
| var elem = event.target; | |
| // Swallow native change events from checkbox/radio, we already triggered them above | |
| if ( this !== elem || event.isSimulated || event.isTrigger || (elem.type !== "radio" && elem.type !== "checkbox") ) { | |
| return event.handleObj.handler.apply( this, arguments ); | |
| } | |
| }, | |
| teardown: function() { | |
| jQuery.event.remove( this, "._change" ); | |
| return rformElems.test( this.nodeName ); | |
| } | |
| }; | |
| } | |
| // Create "bubbling" focus and blur events | |
| if ( !jQuery.support.focusinBubbles ) { | |
| jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { | |
| // Attach a single capturing handler while someone wants focusin/focusout | |
| var attaches = 0, | |
| handler = function( event ) { | |
| jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); | |
| }; | |
| jQuery.event.special[ fix ] = { | |
| setup: function() { | |
| if ( attaches++ === 0 ) { | |
| document.addEventListener( orig, handler, true ); | |
| } | |
| }, | |
| teardown: function() { | |
| if ( --attaches === 0 ) { | |
| document.removeEventListener( orig, handler, true ); | |
| } | |
| } | |
| }; | |
| }); | |
| } | |
| jQuery.fn.extend({ | |
| on: function( types, selector, data, fn, /*INTERNAL*/ one ) { | |
| var origFn, type; | |
| // Types can be a map of types/handlers | |
| if ( typeof types === "object" ) { | |
| // ( types-Object, selector, data ) | |
| if ( typeof selector !== "string" ) { // && selector != null | |
| // ( types-Object, data ) | |
| data = data || selector; | |
| selector = undefined; | |
| } | |
| for ( type in types ) { | |
| this.on( type, selector, data, types[ type ], one ); | |
| } | |
| return this; | |
| } | |
| if ( data == null && fn == null ) { | |
| // ( types, fn ) | |
| fn = selector; | |
| data = selector = undefined; | |
| } else if ( fn == null ) { | |
| if ( typeof selector === "string" ) { | |
| // ( types, selector, fn ) | |
| fn = data; | |
| data = undefined; | |
| } else { | |
| // ( types, data, fn ) | |
| fn = data; | |
| data = selector; | |
| selector = undefined; | |
| } | |
| } | |
| if ( fn === false ) { | |
| fn = returnFalse; | |
| } else if ( !fn ) { | |
| return this; | |
| } | |
| if ( one === 1 ) { | |
| origFn = fn; | |
| fn = function( event ) { | |
| // Can use an empty set, since event contains the info | |
| jQuery().off( event ); | |
| return origFn.apply( this, arguments ); | |
| }; | |
| // Use same guid so caller can remove using origFn | |
| fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); | |
| } | |
| return this.each( function() { | |
| jQuery.event.add( this, types, fn, data, selector ); | |
| }); | |
| }, | |
| one: function( types, selector, data, fn ) { | |
| return this.on( types, selector, data, fn, 1 ); | |
| }, | |
| off: function( types, selector, fn ) { | |
| if ( types && types.preventDefault && types.handleObj ) { | |
| // ( event ) dispatched jQuery.Event | |
| var handleObj = types.handleObj; | |
| jQuery( types.delegateTarget ).off( | |
| handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType, | |
| handleObj.selector, | |
| handleObj.handler | |
| ); | |
| return this; | |
| } | |
| if ( typeof types === "object" ) { | |
| // ( types-object [, selector] ) | |
| for ( var type in types ) { | |
| this.off( type, selector, types[ type ] ); | |
| } | |
| return this; | |
| } | |
| if ( selector === false || typeof selector === "function" ) { | |
| // ( types [, fn] ) | |
| fn = selector; | |
| selector = undefined; | |
| } | |
| if ( fn === false ) { | |
| fn = returnFalse; | |
| } | |
| return this.each(function() { | |
| jQuery.event.remove( this, types, fn, selector ); | |
| }); | |
| }, | |
| bind: function( types, data, fn ) { | |
| return this.on( types, null, data, fn ); | |
| }, | |
| unbind: function( types, fn ) { | |
| return this.off( types, null, fn ); | |
| }, | |
| live: function( types, data, fn ) { | |
| jQuery( this.context ).on( types, this.selector, data, fn ); | |
| return this; | |
| }, | |
| die: function( types, fn ) { | |
| jQuery( this.context ).off( types, this.selector || "**", fn ); | |
| return this; | |
| }, | |
| delegate: function( selector, types, data, fn ) { | |
| return this.on( types, selector, data, fn ); | |
| }, | |
| undelegate: function( selector, types, fn ) { | |
| // ( namespace ) or ( selector, types [, fn] ) | |
| return arguments.length == 1? this.off( selector, "**" ) : this.off( types, selector, fn ); | |
| }, | |
| trigger: function( type, data ) { | |
| return this.each(function() { | |
| jQuery.event.trigger( type, data, this ); | |
| }); | |
| }, | |
| triggerHandler: function( type, data ) { | |
| if ( this[0] ) { | |
| return jQuery.event.trigger( type, data, this[0], true ); | |
| } | |
| }, | |
| toggle: function( fn ) { | |
| // Save reference to arguments for access in closure | |
| var args = arguments, | |
| guid = fn.guid || jQuery.guid++, | |
| i = 0, | |
| toggler = function( event ) { | |
| // Figure out which function to execute | |
| var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i; | |
| jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 ); | |
| // Make sure that clicks stop | |
| event.preventDefault(); | |
| // and execute the function | |
| return args[ lastToggle ].apply( this, arguments ) || false; | |
| }; | |
| // link all the functions, so any of them can unbind this click handler | |
| toggler.guid = guid; | |
| while ( i < args.length ) { | |
| args[ i++ ].guid = guid; | |
| } | |
| return this.click( toggler ); | |
| }, | |
| hover: function( fnOver, fnOut ) { | |
| return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); | |
| } | |
| }); | |
| jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + | |
| "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + | |
| "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { | |
| // Handle event binding | |
| jQuery.fn[ name ] = function( data, fn ) { | |
| if ( fn == null ) { | |
| fn = data; | |
| data = null; | |
| } | |
| return arguments.length > 0 ? | |
| this.on( name, null, data, fn ) : | |
| this.trigger( name ); | |
| }; | |
| if ( jQuery.attrFn ) { | |
| jQuery.attrFn[ name ] = true; | |
| } | |
| if ( rkeyEvent.test( name ) ) { | |
| jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; | |
| } | |
| if ( rmouseEvent.test( name ) ) { | |
| jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; | |
| } | |
| }); | |
| /*! | |
| * Sizzle CSS Selector Engine | |
| * Copyright 2011, The Dojo Foundation | |
| * Released under the MIT, BSD, and GPL Licenses. | |
| * More information: http://sizzlejs.com/ | |
| */ | |
| (function(){ | |
| var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, | |
| expando = "sizcache" + (Math.random() + '').replace('.', ''), | |
| done = 0, | |
| toString = Object.prototype.toString, | |
| hasDuplicate = false, | |
| baseHasDuplicate = true, | |
| rBackslash = /\\/g, | |
| rReturn = /\r\n/g, | |
| rNonWord = /\W/; | |
| // Here we check if the JavaScript engine is using some sort of | |
| // optimization where it does not always call our comparision | |
| // function. If that is the case, discard the hasDuplicate value. | |
| // Thus far that includes Google Chrome. | |
| [0, 0].sort(function() { | |
| baseHasDuplicate = false; | |
| return 0; | |
| }); | |
| var Sizzle = function( selector, context, results, seed ) { | |
| results = results || []; | |
| context = context || document; | |
| var origContext = context; | |
| if ( context.nodeType !== 1 && context.nodeType !== 9 ) { | |
| return []; | |
| } | |
| if ( !selector || typeof selector !== "string" ) { | |
| return results; | |
| } | |
| var m, set, checkSet, extra, ret, cur, pop, i, | |
| prune = true, | |
| contextXML = Sizzle.isXML( context ), | |
| parts = [], | |
| soFar = selector; | |
| // Reset the position of the chunker regexp (start from head) | |
| do { | |
| chunker.exec( "" ); | |
| m = chunker.exec( soFar ); | |
| if ( m ) { | |
| soFar = m[3]; | |
| parts.push( m[1] ); | |
| if ( m[2] ) { | |
| extra = m[3]; | |
| break; | |
| } | |
| } | |
| } while ( m ); | |
| if ( parts.length > 1 && origPOS.exec( selector ) ) { | |
| if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { | |
| set = posProcess( parts[0] + parts[1], context, seed ); | |
| } else { | |
| set = Expr.relative[ parts[0] ] ? | |
| [ context ] : | |
| Sizzle( parts.shift(), context ); | |
| while ( parts.length ) { | |
| selector = parts.shift(); | |
| if ( Expr.relative[ selector ] ) { | |
| selector += parts.shift(); | |
| } | |
| set = posProcess( selector, set, seed ); | |
| } | |
| } | |
| } else { | |
| // Take a shortcut and set the context if the root selector is an ID | |
| // (but not if it'll be faster if the inner selector is an ID) | |
| if ( !seed && parts.length > 1 && context.nodeType === 9 && !contextXML && | |
| Expr.match.ID.test(parts[0]) && !Expr.match.ID.test(parts[parts.length - 1]) ) { | |
| ret = Sizzle.find( parts.shift(), context, contextXML ); | |
| context = ret.expr ? | |
| Sizzle.filter( ret.expr, ret.set )[0] : | |
| ret.set[0]; | |
| } | |
| if ( context ) { | |
| ret = seed ? | |
| { expr: parts.pop(), set: makeArray(seed) } : | |
| Sizzle.find( parts.pop(), parts.length === 1 && (parts[0] === "~" || parts[0] === "+") && context.parentNode ? context.parentNode : context, contextXML ); | |
| set = ret.expr ? | |
| Sizzle.filter( ret.expr, ret.set ) : | |
| ret.set; | |
| if ( parts.length > 0 ) { | |
| checkSet = makeArray( set ); | |
| } else { | |
| prune = false; | |
| } | |
| while ( parts.length ) { | |
| cur = parts.pop(); | |
| pop = cur; | |
| if ( !Expr.relative[ cur ] ) { | |
| cur = ""; | |
| } else { | |
| pop = parts.pop(); | |
| } | |
| if ( pop == null ) { | |
| pop = context; | |
| } | |
| Expr.relative[ cur ]( checkSet, pop, contextXML ); | |
| } | |
| } else { | |
| checkSet = parts = []; | |
| } | |
| } | |
| if ( !checkSet ) { | |
| checkSet = set; | |
| } | |
| if ( !checkSet ) { | |
| Sizzle.error( cur || selector ); | |
| } | |
| if ( toString.call(checkSet) === "[object Array]" ) { | |
| if ( !prune ) { | |
| results.push.apply( results, checkSet ); | |
| } else if ( context && context.nodeType === 1 ) { | |
| for ( i = 0; checkSet[i] != null; i++ ) { | |
| if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && Sizzle.contains(context, checkSet[i])) ) { | |
| results.push( set[i] ); | |
| } | |
| } | |
| } else { | |
| for ( i = 0; checkSet[i] != null; i++ ) { | |
| if ( checkSet[i] && checkSet[i].nodeType === 1 ) { | |
| results.push( set[i] ); | |
| } | |
| } | |
| } | |
| } else { | |
| makeArray( checkSet, results ); | |
| } | |
| if ( extra ) { | |
| Sizzle( extra, origContext, results, seed ); | |
| Sizzle.uniqueSort( results ); | |
| } | |
| return results; | |
| }; | |
| Sizzle.uniqueSort = function( results ) { | |
| if ( sortOrder ) { | |
| hasDuplicate = baseHasDuplicate; | |
| results.sort( sortOrder ); | |
| if ( hasDuplicate ) { | |
| for ( var i = 1; i < results.length; i++ ) { | |
| if ( results[i] === results[ i - 1 ] ) { | |
| results.splice( i--, 1 ); | |
| } | |
| } | |
| } | |
| } | |
| return results; | |
| }; | |
| Sizzle.matches = function( expr, set ) { | |
| return Sizzle( expr, null, null, set ); | |
| }; | |
| Sizzle.matchesSelector = function( node, expr ) { | |
| return Sizzle( expr, null, null, [node] ).length > 0; | |
| }; | |
| Sizzle.find = function( expr, context, isXML ) { | |
| var set, i, len, match, type, left; | |
| if ( !expr ) { | |
| return []; | |
| } | |
| for ( i = 0, len = Expr.order.length; i < len; i++ ) { | |
| type = Expr.order[i]; | |
| if ( (match = Expr.leftMatch[ type ].exec( expr )) ) { | |
| left = match[1]; | |
| match.splice( 1, 1 ); | |
| if ( left.substr( left.length - 1 ) !== "\\" ) { | |
| match[1] = (match[1] || "").replace( rBackslash, "" ); | |
| set = Expr.find[ type ]( match, context, isXML ); | |
| if ( set != null ) { | |
| expr = expr.replace( Expr.match[ type ], "" ); | |
| break; | |
| } | |
| } | |
| } | |
| } | |
| if ( !set ) { | |
| set = typeof context.getElementsByTagName !== "undefined" ? | |
| context.getElementsByTagName( "*" ) : | |
| []; | |
| } | |
| return { set: set, expr: expr }; | |
| }; | |
| Sizzle.filter = function( expr, set, inplace, not ) { | |
| var match, anyFound, | |
| type, found, item, filter, left, | |
| i, pass, | |
| old = expr, | |
| result = [], | |
| curLoop = set, | |
| isXMLFilter = set && set[0] && Sizzle.isXML( set[0] ); | |
| while ( expr && set.length ) { | |
| for ( type in Expr.filter ) { | |
| if ( (match = Expr.leftMatch[ type ].exec( expr )) != null && match[2] ) { | |
| filter = Expr.filter[ type ]; | |
| left = match[1]; | |
| anyFound = false; | |
| match.splice(1,1); | |
| if ( left.substr( left.length - 1 ) === "\\" ) { | |
| continue; | |
| } | |
| if ( curLoop === result ) { | |
| result = []; | |
| } | |
| if ( Expr.preFilter[ type ] ) { | |
| match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); | |
| if ( !match ) { | |
| anyFound = found = true; | |
| } else if ( match === true ) { | |
| continue; | |
| } | |
| } | |
| if ( match ) { | |
| for ( i = 0; (item = curLoop[i]) != null; i++ ) { | |
| if ( item ) { | |
| found = filter( item, match, i, curLoop ); | |
| pass = not ^ found; | |
| if ( inplace && found != null ) { | |
| if ( pass ) { | |
| anyFound = true; | |
| } else { | |
| curLoop[i] = false; | |
| } | |
| } else if ( pass ) { | |
| result.push( item ); | |
| anyFound = true; | |
| } | |
| } | |
| } | |
| } | |
| if ( found !== undefined ) { | |
| if ( !inplace ) { | |
| curLoop = result; | |
| } | |
| expr = expr.replace( Expr.match[ type ], "" ); | |
| if ( !anyFound ) { | |
| return []; | |
| } | |
| break; | |
| } | |
| } | |
| } | |
| // Improper expression | |
| if ( expr === old ) { | |
| if ( anyFound == null ) { | |
| Sizzle.error( expr ); | |
| } else { | |
| break; | |
| } | |
| } | |
| old = expr; | |
| } | |
| return curLoop; | |
| }; | |
| Sizzle.error = function( msg ) { | |
| throw new Error( "Syntax error, unrecognized expression: " + msg ); | |
| }; | |
| /** | |
| * Utility function for retreiving the text value of an array of DOM nodes | |
| * @param {Array|Element} elem | |
| */ | |
| var getText = Sizzle.getText = function( elem ) { | |
| var i, node, | |
| nodeType = elem.nodeType, | |
| ret = ""; | |
| if ( nodeType ) { | |
| if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { | |
| // Use textContent || innerText for elements | |
| if ( typeof elem.textContent === 'string' ) { | |
| return elem.textContent; | |
| } else if ( typeof elem.innerText === 'string' ) { | |
| // Replace IE's carriage returns | |
| return elem.innerText.replace( rReturn, '' ); | |
| } else { | |
| // Traverse it's children | |
| for ( elem = elem.firstChild; elem; elem = elem.nextSibling) { | |
| ret += getText( elem ); | |
| } | |
| } | |
| } else if ( nodeType === 3 || nodeType === 4 ) { | |
| return elem.nodeValue; | |
| } | |
| } else { | |
| // If no nodeType, this is expected to be an array | |
| for ( i = 0; (node = elem[i]); i++ ) { | |
| // Do not traverse comment nodes | |
| if ( node.nodeType !== 8 ) { | |
| ret += getText( node ); | |
| } | |
| } | |
| } | |
| return ret; | |
| }; | |
| var Expr = Sizzle.selectors = { | |
| order: [ "ID", "NAME", "TAG" ], | |
| match: { | |
| ID: /#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, | |
| CLASS: /\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/, | |
| NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/, | |
| ATTR: /\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/, | |
| TAG: /^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/, | |
| CHILD: /:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/, | |
| POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/, | |
| PSEUDO: /:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/ | |
| }, | |
| leftMatch: {}, | |
| attrMap: { | |
| "class": "className", | |
| "for": "htmlFor" | |
| }, | |
| attrHandle: { | |
| href: function( elem ) { | |
| return elem.getAttribute( "href" ); | |
| }, | |
| type: function( elem ) { | |
| return elem.getAttribute( "type" ); | |
| } | |
| }, | |
| relative: { | |
| "+": function(checkSet, part){ | |
| var isPartStr = typeof part === "string", | |
| isTag = isPartStr && !rNonWord.test( part ), | |
| isPartStrNotTag = isPartStr && !isTag; | |
| if ( isTag ) { | |
| part = part.toLowerCase(); | |
| } | |
| for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { | |
| if ( (elem = checkSet[i]) ) { | |
| while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} | |
| checkSet[i] = isPartStrNotTag || elem && elem.nodeName.toLowerCase() === part ? | |
| elem || false : | |
| elem === part; | |
| } | |
| } | |
| if ( isPartStrNotTag ) { | |
| Sizzle.filter( part, checkSet, true ); | |
| } | |
| }, | |
| ">": function( checkSet, part ) { | |
| var elem, | |
| isPartStr = typeof part === "string", | |
| i = 0, | |
| l = checkSet.length; | |
| if ( isPartStr && !rNonWord.test( part ) ) { | |
| part = part.toLowerCase(); | |
| for ( ; i < l; i++ ) { | |
| elem = checkSet[i]; | |
| if ( elem ) { | |
| var parent = elem.parentNode; | |
| checkSet[i] = parent.nodeName.toLowerCase() === part ? parent : false; | |
| } | |
| } | |
| } else { | |
| for ( ; i < l; i++ ) { | |
| elem = checkSet[i]; | |
| if ( elem ) { | |
| checkSet[i] = isPartStr ? | |
| elem.parentNode : | |
| elem.parentNode === part; | |
| } | |
| } | |
| if ( isPartStr ) { | |
| Sizzle.filter( part, checkSet, true ); | |
| } | |
| } | |
| }, | |
| "": function(checkSet, part, isXML){ | |
| var nodeCheck, | |
| doneName = done++, | |
| checkFn = dirCheck; | |
| if ( typeof part === "string" && !rNonWord.test( part ) ) { | |
| part = part.toLowerCase(); | |
| nodeCheck = part; | |
| checkFn = dirNodeCheck; | |
| } | |
| checkFn( "parentNode", part, doneName, checkSet, nodeCheck, isXML ); | |
| }, | |
| "~": function( checkSet, part, isXML ) { | |
| var nodeCheck, | |
| doneName = done++, | |
| checkFn = dirCheck; | |
| if ( typeof part === "string" && !rNonWord.test( part ) ) { | |
| part = part.toLowerCase(); | |
| nodeCheck = part; | |
| checkFn = dirNodeCheck; | |
| } | |
| checkFn( "previousSibling", part, doneName, checkSet, nodeCheck, isXML ); | |
| } | |
| }, | |
| find: { | |
| ID: function( match, context, isXML ) { | |
| if ( typeof context.getElementById !== "undefined" && !isXML ) { | |
| var m = context.getElementById(match[1]); | |
| // Check parentNode to catch when Blackberry 4.6 returns | |
| // nodes that are no longer in the document #6963 | |
| return m && m.parentNode ? [m] : []; | |
| } | |
| }, | |
| NAME: function( match, context ) { | |
| if ( typeof context.getElementsByName !== "undefined" ) { | |
| var ret = [], | |
| results = context.getElementsByName( match[1] ); | |
| for ( var i = 0, l = results.length; i < l; i++ ) { | |
| if ( results[i].getAttribute("name") === match[1] ) { | |
| ret.push( results[i] ); | |
| } | |
| } | |
| return ret.length === 0 ? null : ret; | |
| } | |
| }, | |
| TAG: function( match, context ) { | |
| if ( typeof context.getElementsByTagName !== "undefined" ) { | |
| return context.getElementsByTagName( match[1] ); | |
| } | |
| } | |
| }, | |
| preFilter: { | |
| CLASS: function( match, curLoop, inplace, result, not, isXML ) { | |
| match = " " + match[1].replace( rBackslash, "" ) + " "; | |
| if ( isXML ) { | |
| return match; | |
| } | |
| for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { | |
| if ( elem ) { | |
| if ( not ^ (elem.className && (" " + elem.className + " ").replace(/[\t\n\r]/g, " ").indexOf(match) >= 0) ) { | |
| if ( !inplace ) { | |
| result.push( elem ); | |
| } | |
| } else if ( inplace ) { | |
| curLoop[i] = false; | |
| } | |
| } | |
| } | |
| return false; | |
| }, | |
| ID: function( match ) { | |
| return match[1].replace( rBackslash, "" ); | |
| }, | |
| TAG: function( match, curLoop ) { | |
| return match[1].replace( rBackslash, "" ).toLowerCase(); | |
| }, | |
| CHILD: function( match ) { | |
| if ( match[1] === "nth" ) { | |
| if ( !match[2] ) { | |
| Sizzle.error( match[0] ); | |
| } | |
| match[2] = match[2].replace(/^\+|\s*/g, ''); | |
| // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' | |
| var test = /(-?)(\d*)(?:n([+\-]?\d*))?/.exec( | |
| match[2] === "even" && "2n" || match[2] === "odd" && "2n+1" || | |
| !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); | |
| // calculate the numbers (first)n+(last) including if they are negative | |
| match[2] = (test[1] + (test[2] || 1)) - 0; | |
| match[3] = test[3] - 0; | |
| } | |
| else if ( match[2] ) { | |
| Sizzle.error( match[0] ); | |
| } | |
| // TODO: Move to normal caching system | |
| match[0] = done++; | |
| return match; | |
| }, | |
| ATTR: function( match, curLoop, inplace, result, not, isXML ) { | |
| var name = match[1] = match[1].replace( rBackslash, "" ); | |
| if ( !isXML && Expr.attrMap[name] ) { | |
| match[1] = Expr.attrMap[name]; | |
| } | |
| // Handle if an un-quoted value was used | |
| match[4] = ( match[4] || match[5] || "" ).replace( rBackslash, "" ); | |
| if ( match[2] === "~=" ) { | |
| match[4] = " " + match[4] + " "; | |
| } | |
| return match; | |
| }, | |
| PSEUDO: function( match, curLoop, inplace, result, not ) { | |
| if ( match[1] === "not" ) { | |
| // If we're dealing with a complex expression, or a simple one | |
| if ( ( chunker.exec(match[3]) || "" ).length > 1 || /^\w/.test(match[3]) ) { | |
| match[3] = Sizzle(match[3], null, null, curLoop); | |
| } else { | |
| var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); | |
| if ( !inplace ) { | |
| result.push.apply( result, ret ); | |
| } | |
| return false; | |
| } | |
| } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { | |
| return true; | |
| } | |
| return match; | |
| }, | |
| POS: function( match ) { | |
| match.unshift( true ); | |
| return match; | |
| } | |
| }, | |
| filters: { | |
| enabled: function( elem ) { | |
| return elem.disabled === false && elem.type !== "hidden"; | |
| }, | |
| disabled: function( elem ) { | |
| return elem.disabled === true; | |
| }, | |
| checked: function( elem ) { | |
| return elem.checked === true; | |
| }, | |
| selected: function( elem ) { | |
| // Accessing this property makes selected-by-default | |
| // options in Safari work properly | |
| if ( elem.parentNode ) { | |
| elem.parentNode.selectedIndex; | |
| } | |
| return elem.selected === true; | |
| }, | |
| parent: function( elem ) { | |
| return !!elem.firstChild; | |
| }, | |
| empty: function( elem ) { | |
| return !elem.firstChild; | |
| }, | |
| has: function( elem, i, match ) { | |
| return !!Sizzle( match[3], elem ).length; | |
| }, | |
| header: function( elem ) { | |
| return (/h\d/i).test( elem.nodeName ); | |
| }, | |
| text: function( elem ) { | |
| var attr = elem.getAttribute( "type" ), type = elem.type; | |
| // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) | |
| // use getAttribute instead to test this case | |
| return elem.nodeName.toLowerCase() === "input" && "text" === type && ( attr === type || attr === null ); | |
| }, | |
| radio: function( elem ) { | |
| return elem.nodeName.toLowerCase() === "input" && "radio" === elem.type; | |
| }, | |
| checkbox: function( elem ) { | |
| return elem.nodeName.toLowerCase() === "input" && "checkbox" === elem.type; | |
| }, | |
| file: function( elem ) { | |
| return elem.nodeName.toLowerCase() === "input" && "file" === elem.type; | |
| }, | |
| password: function( elem ) { | |
| return elem.nodeName.toLowerCase() === "input" && "password" === elem.type; | |
| }, | |
| submit: function( elem ) { | |
| var name = elem.nodeName.toLowerCase(); | |
| return (name === "input" || name === "button") && "submit" === elem.type; | |
| }, | |
| image: function( elem ) { | |
| return elem.nodeName.toLowerCase() === "input" && "image" === elem.type; | |
| }, | |
| reset: function( elem ) { | |
| var name = elem.nodeName.toLowerCase(); | |
| return (name === "input" || name === "button") && "reset" === elem.type; | |
| }, | |
| button: function( elem ) { | |
| var name = elem.nodeName.toLowerCase(); | |
| return name === "input" && "button" === elem.type || name === "button"; | |
| }, | |
| input: function( elem ) { | |
| return (/input|select|textarea|button/i).test( elem.nodeName ); | |
| }, | |
| focus: function( elem ) { | |
| return elem === elem.ownerDocument.activeElement; | |
| } | |
| }, | |
| setFilters: { | |
| first: function( elem, i ) { | |
| return i === 0; | |
| }, | |
| last: function( elem, i, match, array ) { | |
| return i === array.length - 1; | |
| }, | |
| even: function( elem, i ) { | |
| return i % 2 === 0; | |
| }, | |
| odd: function( elem, i ) { | |
| return i % 2 === 1; | |
| }, | |
| lt: function( elem, i, match ) { | |
| return i < match[3] - 0; | |
| }, | |
| gt: function( elem, i, match ) { | |
| return i > match[3] - 0; | |
| }, | |
| nth: function( elem, i, match ) { | |
| return match[3] - 0 === i; | |
| }, | |
| eq: function( elem, i, match ) { | |
| return match[3] - 0 === i; | |
| } | |
| }, | |
| filter: { | |
| PSEUDO: function( elem, match, i, array ) { | |
| var name = match[1], | |
| filter = Expr.filters[ name ]; | |
| if ( filter ) { | |
| return filter( elem, i, match, array ); | |
| } else if ( name === "contains" ) { | |
| return (elem.textContent || elem.innerText || getText([ elem ]) || "").indexOf(match[3]) >= 0; | |
| } else if ( name === "not" ) { | |
| var not = match[3]; | |
| for ( var j = 0, l = not.length; j < l; j++ ) { | |
| if ( not[j] === elem ) { | |
| return false; | |
| } | |
| } | |
| return true; | |
| } else { | |
| Sizzle.error( name ); | |
| } | |
| }, | |
| CHILD: function( elem, match ) { | |
| var first, last, | |
| doneName, parent, cache, | |
| count, diff, | |
| type = match[1], | |
| node = elem; | |
| switch ( type ) { | |
| case "only": | |
| case "first": | |
| while ( (node = node.previousSibling) ) { | |
| if ( node.nodeType === 1 ) { | |
| return false; | |
| } | |
| } | |
| if ( type === "first" ) { | |
| return true; | |
| } | |
| node = elem; | |
| /* falls through */ | |
| case "last": | |
| while ( (node = node.nextSibling) ) { | |
| if ( node.nodeType === 1 ) { | |
| return false; | |
| } | |
| } | |
| return true; | |
| case "nth": | |
| first = match[2]; | |
| last = match[3]; | |
| if ( first === 1 && last === 0 ) { | |
| return true; | |
| } | |
| doneName = match[0]; | |
| parent = elem.parentNode; | |
| if ( parent && (parent[ expando ] !== doneName || !elem.nodeIndex) ) { | |
| count = 0; | |
| for ( node = parent.firstChild; node; node = node.nextSibling ) { | |
| if ( node.nodeType === 1 ) { | |
| node.nodeIndex = ++count; | |
| } | |
| } | |
| parent[ expando ] = doneName; | |
| } | |
| diff = elem.nodeIndex - last; | |
| if ( first === 0 ) { | |
| return diff === 0; | |
| } else { | |
| return ( diff % first === 0 && diff / first >= 0 ); | |
| } | |
| } | |
| }, | |
| ID: function( elem, match ) { | |
| return elem.nodeType === 1 && elem.getAttribute("id") === match; | |
| }, | |
| TAG: function( elem, match ) { | |
| return (match === "*" && elem.nodeType === 1) || !!elem.nodeName && elem.nodeName.toLowerCase() === match; | |
| }, | |
| CLASS: function( elem, match ) { | |
| return (" " + (elem.className || elem.getAttribute("class")) + " ") | |
| .indexOf( match ) > -1; | |
| }, | |
| ATTR: function( elem, match ) { | |
| var name = match[1], | |
| result = Sizzle.attr ? | |
| Sizzle.attr( elem, name ) : | |
| Expr.attrHandle[ name ] ? | |
| Expr.attrHandle[ name ]( elem ) : | |
| elem[ name ] != null ? | |
| elem[ name ] : | |
| elem.getAttribute( name ), | |
| value = result + "", | |
| type = match[2], | |
| check = match[4]; | |
| return result == null ? | |
| type === "!=" : | |
| !type && Sizzle.attr ? | |
| result != null : | |
| type === "=" ? | |
| value === check : | |
| type === "*=" ? | |
| value.indexOf(check) >= 0 : | |
| type === "~=" ? | |
| (" " + value + " ").indexOf(check) >= 0 : | |
| !check ? | |
| value && result !== false : | |
| type === "!=" ? | |
| value !== check : | |
| type === "^=" ? | |
| value.indexOf(check) === 0 : | |
| type === "$=" ? | |
| value.substr(value.length - check.length) === check : | |
| type === "|=" ? | |
| value === check || value.substr(0, check.length + 1) === check + "-" : | |
| false; | |
| }, | |
| POS: function( elem, match, i, array ) { | |
| var name = match[2], | |
| filter = Expr.setFilters[ name ]; | |
| if ( filter ) { | |
| return filter( elem, i, match, array ); | |
| } | |
| } | |
| } | |
| }; | |
| var origPOS = Expr.match.POS, | |
| fescape = function(all, num){ | |
| return "\\" + (num - 0 + 1); | |
| }; | |
| for ( var type in Expr.match ) { | |
| Expr.match[ type ] = new RegExp( Expr.match[ type ].source + (/(?![^\[]*\])(?![^\(]*\))/.source) ); | |
| Expr.leftMatch[ type ] = new RegExp( /(^(?:.|\r|\n)*?)/.source + Expr.match[ type ].source.replace(/\\(\d+)/g, fescape) ); | |
| } | |
| // Expose origPOS | |
| // "global" as in regardless of relation to brackets/parens | |
| Expr.match.globalPOS = origPOS; | |
| var makeArray = function( array, results ) { | |
| array = Array.prototype.slice.call( array, 0 ); | |
| if ( results ) { | |
| results.push.apply( results, array ); | |
| return results; | |
| } | |
| return array; | |
| }; | |
| // Perform a simple check to determine if the browser is capable of | |
| // converting a NodeList to an array using builtin methods. | |
| // Also verifies that the returned array holds DOM nodes | |
| // (which is not the case in the Blackberry browser) | |
| try { | |
| Array.prototype.slice.call( document.documentElement.childNodes, 0 )[0].nodeType; | |
| // Provide a fallback method if it does not work | |
| } catch( e ) { | |
| makeArray = function( array, results ) { | |
| var i = 0, | |
| ret = results || []; | |
| if ( toString.call(array) === "[object Array]" ) { | |
| Array.prototype.push.apply( ret, array ); | |
| } else { | |
| if ( typeof array.length === "number" ) { | |
| for ( var l = array.length; i < l; i++ ) { | |
| ret.push( array[i] ); | |
| } | |
| } else { | |
| for ( ; array[i]; i++ ) { | |
| ret.push( array[i] ); | |
| } | |
| } | |
| } | |
| return ret; | |
| }; | |
| } | |
| var sortOrder, siblingCheck; | |
| if ( document.documentElement.compareDocumentPosition ) { | |
| sortOrder = function( a, b ) { | |
| if ( a === b ) { | |
| hasDuplicate = true; | |
| return 0; | |
| } | |
| if ( !a.compareDocumentPosition || !b.compareDocumentPosition ) { | |
| return a.compareDocumentPosition ? -1 : 1; | |
| } | |
| return a.compareDocumentPosition(b) & 4 ? -1 : 1; | |
| }; | |
| } else { | |
| sortOrder = function( a, b ) { | |
| // The nodes are identical, we can exit early | |
| if ( a === b ) { | |
| hasDuplicate = true; | |
| return 0; | |
| // Fallback to using sourceIndex (in IE) if it's available on both nodes | |
| } else if ( a.sourceIndex && b.sourceIndex ) { | |
| return a.sourceIndex - b.sourceIndex; | |
| } | |
| var al, bl, | |
| ap = [], | |
| bp = [], | |
| aup = a.parentNode, | |
| bup = b.parentNode, | |
| cur = aup; | |
| // If the nodes are siblings (or identical) we can do a quick check | |
| if ( aup === bup ) { | |
| return siblingCheck( a, b ); | |
| // If no parents were found then the nodes are disconnected | |
| } else if ( !aup ) { | |
| return -1; | |
| } else if ( !bup ) { | |
| return 1; | |
| } | |
| // Otherwise they're somewhere else in the tree so we need | |
| // to build up a full list of the parentNodes for comparison | |
| while ( cur ) { | |
| ap.unshift( cur ); | |
| cur = cur.parentNode; | |
| } | |
| cur = bup; | |
| while ( cur ) { | |
| bp.unshift( cur ); | |
| cur = cur.parentNode; | |
| } | |
| al = ap.length; | |
| bl = bp.length; | |
| // Start walking down the tree looking for a discrepancy | |
| for ( var i = 0; i < al && i < bl; i++ ) { | |
| if ( ap[i] !== bp[i] ) { | |
| return siblingCheck( ap[i], bp[i] ); | |
| } | |
| } | |
| // We ended someplace up the tree so do a sibling check | |
| return i === al ? | |
| siblingCheck( a, bp[i], -1 ) : | |
| siblingCheck( ap[i], b, 1 ); | |
| }; | |
| siblingCheck = function( a, b, ret ) { | |
| if ( a === b ) { | |
| return ret; | |
| } | |
| var cur = a.nextSibling; | |
| while ( cur ) { | |
| if ( cur === b ) { | |
| return -1; | |
| } | |
| cur = cur.nextSibling; | |
| } | |
| return 1; | |
| }; | |
| } | |
| // Check to see if the browser returns elements by name when | |
| // querying by getElementById (and provide a workaround) | |
| (function(){ | |
| // We're going to inject a fake input element with a specified name | |
| var form = document.createElement("div"), | |
| id = "script" + (new Date()).getTime(), | |
| root = document.documentElement; | |
| form.innerHTML = "<a name='" + id + "'/>"; | |
| // Inject it into the root element, check its status, and remove it quickly | |
| root.insertBefore( form, root.firstChild ); | |
| // The workaround has to do additional checks after a getElementById | |
| // Which slows things down for other browsers (hence the branching) | |
| if ( document.getElementById( id ) ) { | |
| Expr.find.ID = function( match, context, isXML ) { | |
| if ( typeof context.getElementById !== "undefined" && !isXML ) { | |
| var m = context.getElementById(match[1]); | |
| return m ? | |
| m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? | |
| [m] : | |
| undefined : | |
| []; | |
| } | |
| }; | |
| Expr.filter.ID = function( elem, match ) { | |
| var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); | |
| return elem.nodeType === 1 && node && node.nodeValue === match; | |
| }; | |
| } | |
| root.removeChild( form ); | |
| // release memory in IE | |
| root = form = null; | |
| })(); | |
| (function(){ | |
| // Check to see if the browser returns only elements | |
| // when doing getElementsByTagName("*") | |
| // Create a fake element | |
| var div = document.createElement("div"); | |
| div.appendChild( document.createComment("") ); | |
| // Make sure no comments are found | |
| if ( div.getElementsByTagName("*").length > 0 ) { | |
| Expr.find.TAG = function( match, context ) { | |
| var results = context.getElementsByTagName( match[1] ); | |
| // Filter out possible comments | |
| if ( match[1] === "*" ) { | |
| var tmp = []; | |
| for ( var i = 0; results[i]; i++ ) { | |
| if ( results[i].nodeType === 1 ) { | |
| tmp.push( results[i] ); | |
| } | |
| } | |
| results = tmp; | |
| } | |
| return results; | |
| }; | |
| } | |
| // Check to see if an attribute returns normalized href attributes | |
| div.innerHTML = "<a href='#'></a>"; | |
| if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && | |
| div.firstChild.getAttribute("href") !== "#" ) { | |
| Expr.attrHandle.href = function( elem ) { | |
| return elem.getAttribute( "href", 2 ); | |
| }; | |
| } | |
| // release memory in IE | |
| div = null; | |
| })(); | |
| if ( document.querySelectorAll ) { | |
| (function(){ | |
| var oldSizzle = Sizzle, | |
| div = document.createElement("div"), | |
| id = "__sizzle__"; | |
| div.innerHTML = "<p class='TEST'></p>"; | |
| // Safari can't handle uppercase or unicode characters when | |
| // in quirks mode. | |
| if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { | |
| return; | |
| } | |
| Sizzle = function( query, context, extra, seed ) { | |
| context = context || document; | |
| // Only use querySelectorAll on non-XML documents | |
| // (ID selectors don't work in non-HTML documents) | |
| if ( !seed && !Sizzle.isXML(context) ) { | |
| // See if we find a selector to speed up | |
| var match = /^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec( query ); | |
| if ( match && (context.nodeType === 1 || context.nodeType === 9) ) { | |
| // Speed-up: Sizzle("TAG") | |
| if ( match[1] ) { | |
| return makeArray( context.getElementsByTagName( query ), extra ); | |
| // Speed-up: Sizzle(".CLASS") | |
| } else if ( match[2] && Expr.find.CLASS && context.getElementsByClassName ) { | |
| return makeArray( context.getElementsByClassName( match[2] ), extra ); | |
| } | |
| } | |
| if ( context.nodeType === 9 ) { | |
| // Speed-up: Sizzle("body") | |
| // The body element only exists once, optimize finding it | |
| if ( query === "body" && context.body ) { | |
| return makeArray( [ context.body ], extra ); | |
| // Speed-up: Sizzle("#ID") | |
| } else if ( match && match[3] ) { | |
| var elem = context.getElementById( match[3] ); | |
| // Check parentNode to catch when Blackberry 4.6 returns | |
| // nodes that are no longer in the document #6963 | |
| if ( elem && elem.parentNode ) { | |
| // Handle the case where IE and Opera return items | |
| // by name instead of ID | |
| if ( elem.id === match[3] ) { | |
| return makeArray( [ elem ], extra ); | |
| } | |
| } else { | |
| return makeArray( [], extra ); | |
| } | |
| } | |
| try { | |
| return makeArray( context.querySelectorAll(query), extra ); | |
| } catch(qsaError) {} | |
| // qSA works strangely on Element-rooted queries | |
| // We can work around this by specifying an extra ID on the root | |
| // and working up from there (Thanks to Andrew Dupont for the technique) | |
| // IE 8 doesn't work on object elements | |
| } else if ( context.nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { | |
| var oldContext = context, | |
| old = context.getAttribute( "id" ), | |
| nid = old || id, | |
| hasParent = context.parentNode, | |
| relativeHierarchySelector = /^\s*[+~]/.test( query ); | |
| if ( !old ) { | |
| context.setAttribute( "id", nid ); | |
| } else { | |
| nid = nid.replace( /'/g, "\\$&" ); | |
| } | |
| if ( relativeHierarchySelector && hasParent ) { | |
| context = context.parentNode; | |
| } | |
| try { | |
| if ( !relativeHierarchySelector || hasParent ) { | |
| return makeArray( context.querySelectorAll( "[id='" + nid + "'] " + query ), extra ); | |
| } | |
| } catch(pseudoError) { | |
| } finally { | |
| if ( !old ) { | |
| oldContext.removeAttribute( "id" ); | |
| } | |
| } | |
| } | |
| } | |
| return oldSizzle(query, context, extra, seed); | |
| }; | |
| for ( var prop in oldSizzle ) { | |
| Sizzle[ prop ] = oldSizzle[ prop ]; | |
| } | |
| // release memory in IE | |
| div = null; | |
| })(); | |
| } | |
| (function(){ | |
| var html = document.documentElement, | |
| matches = html.matchesSelector || html.mozMatchesSelector || html.webkitMatchesSelector || html.msMatchesSelector; | |
| if ( matches ) { | |
| // Check to see if it's possible to do matchesSelector | |
| // on a disconnected node (IE 9 fails this) | |
| var disconnectedMatch = !matches.call( document.createElement( "div" ), "div" ), | |
| pseudoWorks = false; | |
| try { | |
| // This should fail with an exception | |
| // Gecko does not error, returns false instead | |
| matches.call( document.documentElement, "[test!='']:sizzle" ); | |
| } catch( pseudoError ) { | |
| pseudoWorks = true; | |
| } | |
| Sizzle.matchesSelector = function( node, expr ) { | |
| // Make sure that attribute selectors are quoted | |
| expr = expr.replace(/\=\s*([^'"\]]*)\s*\]/g, "='$1']"); | |
| if ( !Sizzle.isXML( node ) ) { | |
| try { | |
| if ( pseudoWorks || !Expr.match.PSEUDO.test( expr ) && !/!=/.test( expr ) ) { | |
| var ret = matches.call( node, expr ); | |
| // IE 9's matchesSelector returns false on disconnected nodes | |
| if ( ret || !disconnectedMatch || | |
| // As well, disconnected nodes are said to be in a document | |
| // fragment in IE 9, so check for that | |
| node.document && node.document.nodeType !== 11 ) { | |
| return ret; | |
| } | |
| } | |
| } catch(e) {} | |
| } | |
| return Sizzle(expr, null, null, [node]).length > 0; | |
| }; | |
| } | |
| })(); | |
| (function(){ | |
| var div = document.createElement("div"); | |
| div.innerHTML = "<div class='test e'></div><div class='test'></div>"; | |
| // Opera can't find a second classname (in 9.6) | |
| // Also, make sure that getElementsByClassName actually exists | |
| if ( !div.getElementsByClassName || div.getElementsByClassName("e").length === 0 ) { | |
| return; | |
| } | |
| // Safari caches class attributes, doesn't catch changes (in 3.2) | |
| div.lastChild.className = "e"; | |
| if ( div.getElementsByClassName("e").length === 1 ) { | |
| return; | |
| } | |
| Expr.order.splice(1, 0, "CLASS"); | |
| Expr.find.CLASS = function( match, context, isXML ) { | |
| if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { | |
| return context.getElementsByClassName(match[1]); | |
| } | |
| }; | |
| // release memory in IE | |
| div = null; | |
| })(); | |
| function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { | |
| for ( var i = 0, l = checkSet.length; i < l; i++ ) { | |
| var elem = checkSet[i]; | |
| if ( elem ) { | |
| var match = false; | |
| elem = elem[dir]; | |
| while ( elem ) { | |
| if ( elem[ expando ] === doneName ) { | |
| match = checkSet[elem.sizset]; | |
| break; | |
| } | |
| if ( elem.nodeType === 1 && !isXML ){ | |
| elem[ expando ] = doneName; | |
| elem.sizset = i; | |
| } | |
| if ( elem.nodeName.toLowerCase() === cur ) { | |
| match = elem; | |
| break; | |
| } | |
| elem = elem[dir]; | |
| } | |
| checkSet[i] = match; | |
| } | |
| } | |
| } | |
| function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { | |
| for ( var i = 0, l = checkSet.length; i < l; i++ ) { | |
| var elem = checkSet[i]; | |
| if ( elem ) { | |
| var match = false; | |
| elem = elem[dir]; | |
| while ( elem ) { | |
| if ( elem[ expando ] === doneName ) { | |
| match = checkSet[elem.sizset]; | |
| break; | |
| } | |
| if ( elem.nodeType === 1 ) { | |
| if ( !isXML ) { | |
| elem[ expando ] = doneName; | |
| elem.sizset = i; | |
| } | |
| if ( typeof cur !== "string" ) { | |
| if ( elem === cur ) { | |
| match = true; | |
| break; | |
| } | |
| } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { | |
| match = elem; | |
| break; | |
| } | |
| } | |
| elem = elem[dir]; | |
| } | |
| checkSet[i] = match; | |
| } | |
| } | |
| } | |
| if ( document.documentElement.contains ) { | |
| Sizzle.contains = function( a, b ) { | |
| return a !== b && (a.contains ? a.contains(b) : true); | |
| }; | |
| } else if ( document.documentElement.compareDocumentPosition ) { | |
| Sizzle.contains = function( a, b ) { | |
| return !!(a.compareDocumentPosition(b) & 16); | |
| }; | |
| } else { | |
| Sizzle.contains = function() { | |
| return false; | |
| }; | |
| } | |
| Sizzle.isXML = function( elem ) { | |
| // documentElement is verified for cases where it doesn't yet exist | |
| // (such as loading iframes in IE - #4833) | |
| var documentElement = (elem ? elem.ownerDocument || elem : 0).documentElement; | |
| return documentElement ? documentElement.nodeName !== "HTML" : false; | |
| }; | |
| var posProcess = function( selector, context, seed ) { | |
| var match, | |
| tmpSet = [], | |
| later = "", | |
| root = context.nodeType ? [context] : context; | |
| // Position selectors must be done after the filter | |
| // And so must :not(positional) so we move all PSEUDOs to the end | |
| while ( (match = Expr.match.PSEUDO.exec( selector )) ) { | |
| later += match[0]; | |
| selector = selector.replace( Expr.match.PSEUDO, "" ); | |
| } | |
| selector = Expr.relative[selector] ? selector + "*" : selector; | |
| for ( var i = 0, l = root.length; i < l; i++ ) { | |
| Sizzle( selector, root[i], tmpSet, seed ); | |
| } | |
| return Sizzle.filter( later, tmpSet ); | |
| }; | |
| // EXPOSE | |
| // Override sizzle attribute retrieval | |
| Sizzle.attr = jQuery.attr; | |
| Sizzle.selectors.attrMap = {}; | |
| jQuery.find = Sizzle; | |
| jQuery.expr = Sizzle.selectors; | |
| jQuery.expr[":"] = jQuery.expr.filters; | |
| jQuery.unique = Sizzle.uniqueSort; | |
| jQuery.text = Sizzle.getText; | |
| jQuery.isXMLDoc = Sizzle.isXML; | |
| jQuery.contains = Sizzle.contains; | |
| })(); | |
| var runtil = /Until$/, | |
| rparentsprev = /^(?:parents|prevUntil|prevAll)/, | |
| // Note: This RegExp should be improved, or likely pulled from Sizzle | |
| rmultiselector = /,/, | |
| isSimple = /^.[^:#\[\.,]*$/, | |
| slice = Array.prototype.slice, | |
| POS = jQuery.expr.match.globalPOS, | |
| // methods guaranteed to produce a unique set when starting from a unique set | |
| guaranteedUnique = { | |
| children: true, | |
| contents: true, | |
| next: true, | |
| prev: true | |
| }; | |
| jQuery.fn.extend({ | |
| find: function( selector ) { | |
| var self = this, | |
| i, l; | |
| if ( typeof selector !== "string" ) { | |
| return jQuery( selector ).filter(function() { | |
| for ( i = 0, l = self.length; i < l; i++ ) { | |
| if ( jQuery.contains( self[ i ], this ) ) { | |
| return true; | |
| } | |
| } | |
| }); | |
| } | |
| var ret = this.pushStack( "", "find", selector ), | |
| length, n, r; | |
| for ( i = 0, l = this.length; i < l; i++ ) { | |
| length = ret.length; | |
| jQuery.find( selector, this[i], ret ); | |
| if ( i > 0 ) { | |
| // Make sure that the results are unique | |
| for ( n = length; n < ret.length; n++ ) { | |
| for ( r = 0; r < length; r++ ) { | |
| if ( ret[r] === ret[n] ) { | |
| ret.splice(n--, 1); | |
| break; | |
| } | |
| } | |
| } | |
| } | |
| } | |
| return ret; | |
| }, | |
| has: function( target ) { | |
| var targets = jQuery( target ); | |
| return this.filter(function() { | |
| for ( var i = 0, l = targets.length; i < l; i++ ) { | |
| if ( jQuery.contains( this, targets[i] ) ) { | |
| return true; | |
| } | |
| } | |
| }); | |
| }, | |
| not: function( selector ) { | |
| return this.pushStack( winnow(this, selector, false), "not", selector); | |
| }, | |
| filter: function( selector ) { | |
| return this.pushStack( winnow(this, selector, true), "filter", selector ); | |
| }, | |
| is: function( selector ) { | |
| return !!selector && ( | |
| typeof selector === "string" ? | |
| // If this is a positional selector, check membership in the returned set | |
| // so $("p:first").is("p:last") won't return true for a doc with two "p". | |
| POS.test( selector ) ? | |
| jQuery( selector, this.context ).index( this[0] ) >= 0 : | |
| jQuery.filter( selector, this ).length > 0 : | |
| this.filter( selector ).length > 0 ); | |
| }, | |
| closest: function( selectors, context ) { | |
| var ret = [], i, l, cur = this[0]; | |
| // Array (deprecated as of jQuery 1.7) | |
| if ( jQuery.isArray( selectors ) ) { | |
| var level = 1; | |
| while ( cur && cur.ownerDocument && cur !== context ) { | |
| for ( i = 0; i < selectors.length; i++ ) { | |
| if ( jQuery( cur ).is( selectors[ i ] ) ) { | |
| ret.push({ selector: selectors[ i ], elem: cur, level: level }); | |
| } | |
| } | |
| cur = cur.parentNode; | |
| level++; | |
| } | |
| return ret; | |
| } | |
| // String | |
| var pos = POS.test( selectors ) || typeof selectors !== "string" ? | |
| jQuery( selectors, context || this.context ) : | |
| 0; | |
| for ( i = 0, l = this.length; i < l; i++ ) { | |
| cur = this[i]; | |
| while ( cur ) { | |
| if ( pos ? pos.index(cur) > -1 : jQuery.find.matchesSelector(cur, selectors) ) { | |
| ret.push( cur ); | |
| break; | |
| } else { | |
| cur = cur.parentNode; | |
| if ( !cur || !cur.ownerDocument || cur === context || cur.nodeType === 11 ) { | |
| break; | |
| } | |
| } | |
| } | |
| } | |
| ret = ret.length > 1 ? jQuery.unique( ret ) : ret; | |
| return this.pushStack( ret, "closest", selectors ); | |
| }, | |
| // Determine the position of an element within | |
| // the matched set of elements | |
| index: function( elem ) { | |
| // No argument, return index in parent | |
| if ( !elem ) { | |
| return ( this[0] && this[0].parentNode ) ? this.prevAll().length : -1; | |
| } | |
| // index in selector | |
| if ( typeof elem === "string" ) { | |
| return jQuery.inArray( this[0], jQuery( elem ) ); | |
| } | |
| // Locate the position of the desired element | |
| return jQuery.inArray( | |
| // If it receives a jQuery object, the first element is used | |
| elem.jquery ? elem[0] : elem, this ); | |
| }, | |
| add: function( selector, context ) { | |
| var set = typeof selector === "string" ? | |
| jQuery( selector, context ) : | |
| jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), | |
| all = jQuery.merge( this.get(), set ); | |
| return this.pushStack( isDisconnected( set[0] ) || isDisconnected( all[0] ) ? | |
| all : | |
| jQuery.unique( all ) ); | |
| }, | |
| andSelf: function() { | |
| return this.add( this.prevObject ); | |
| } | |
| }); | |
| // A painfully simple check to see if an element is disconnected | |
| // from a document (should be improved, where feasible). | |
| function isDisconnected( node ) { | |
| return !node || !node.parentNode || node.parentNode.nodeType === 11; | |
| } | |
| jQuery.each({ | |
| parent: function( elem ) { | |
| var parent = elem.parentNode; | |
| return parent && parent.nodeType !== 11 ? parent : null; | |
| }, | |
| parents: function( elem ) { | |
| return jQuery.dir( elem, "parentNode" ); | |
| }, | |
| parentsUntil: function( elem, i, until ) { | |
| return jQuery.dir( elem, "parentNode", until ); | |
| }, | |
| next: function( elem ) { | |
| return jQuery.nth( elem, 2, "nextSibling" ); | |
| }, | |
| prev: function( elem ) { | |
| return jQuery.nth( elem, 2, "previousSibling" ); | |
| }, | |
| nextAll: function( elem ) { | |
| return jQuery.dir( elem, "nextSibling" ); | |
| }, | |
| prevAll: function( elem ) { | |
| return jQuery.dir( elem, "previousSibling" ); | |
| }, | |
| nextUntil: function( elem, i, until ) { | |
| return jQuery.dir( elem, "nextSibling", until ); | |
| }, | |
| prevUntil: function( elem, i, until ) { | |
| return jQuery.dir( elem, "previousSibling", until ); | |
| }, | |
| siblings: function( elem ) { | |
| return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem ); | |
| }, | |
| children: function( elem ) { | |
| return jQuery.sibling( elem.firstChild ); | |
| }, | |
| contents: function( elem ) { | |
| return jQuery.nodeName( elem, "iframe" ) ? | |
| elem.contentDocument || elem.contentWindow.document : | |
| jQuery.makeArray( elem.childNodes ); | |
| } | |
| }, function( name, fn ) { | |
| jQuery.fn[ name ] = function( until, selector ) { | |
| var ret = jQuery.map( this, fn, until ); | |
| if ( !runtil.test( name ) ) { | |
| selector = until; | |
| } | |
| if ( selector && typeof selector === "string" ) { | |
| ret = jQuery.filter( selector, ret ); | |
| } | |
| ret = this.length > 1 && !guaranteedUnique[ name ] ? jQuery.unique( ret ) : ret; | |
| if ( (this.length > 1 || rmultiselector.test( selector )) && rparentsprev.test( name ) ) { | |
| ret = ret.reverse(); | |
| } | |
| return this.pushStack( ret, name, slice.call( arguments ).join(",") ); | |
| }; | |
| }); | |
| jQuery.extend({ | |
| filter: function( expr, elems, not ) { | |
| if ( not ) { | |
| expr = ":not(" + expr + ")"; | |
| } | |
| return elems.length === 1 ? | |
| jQuery.find.matchesSelector(elems[0], expr) ? [ elems[0] ] : [] : | |
| jQuery.find.matches(expr, elems); | |
| }, | |
| dir: function( elem, dir, until ) { | |
| var matched = [], | |
| cur = elem[ dir ]; | |
| while ( cur && cur.nodeType !== 9 && (until === undefined || cur.nodeType !== 1 || !jQuery( cur ).is( until )) ) { | |
| if ( cur.nodeType === 1 ) { | |
| matched.push( cur ); | |
| } | |
| cur = cur[dir]; | |
| } | |
| return matched; | |
| }, | |
| nth: function( cur, result, dir, elem ) { | |
| result = result || 1; | |
| var num = 0; | |
| for ( ; cur; cur = cur[dir] ) { | |
| if ( cur.nodeType === 1 && ++num === result ) { | |
| break; | |
| } | |
| } | |
| return cur; | |
| }, | |
| sibling: function( n, elem ) { | |
| var r = []; | |
| for ( ; n; n = n.nextSibling ) { | |
| if ( n.nodeType === 1 && n !== elem ) { | |
| r.push( n ); | |
| } | |
| } | |
| return r; | |
| } | |
| }); | |
| // Implement the identical functionality for filter and not | |
| function winnow( elements, qualifier, keep ) { | |
| // Can't pass null or undefined to indexOf in Firefox 4 | |
| // Set to 0 to skip string check | |
| qualifier = qualifier || 0; | |
| if ( jQuery.isFunction( qualifier ) ) { | |
| return jQuery.grep(elements, function( elem, i ) { | |
| var retVal = !!qualifier.call( elem, i, elem ); | |
| return retVal === keep; | |
| }); | |
| } else if ( qualifier.nodeType ) { | |
| return jQuery.grep(elements, function( elem, i ) { | |
| return ( elem === qualifier ) === keep; | |
| }); | |
| } else if ( typeof qualifier === "string" ) { | |
| var filtered = jQuery.grep(elements, function( elem ) { | |
| return elem.nodeType === 1; | |
| }); | |
| if ( isSimple.test( qualifier ) ) { | |
| return jQuery.filter(qualifier, filtered, !keep); | |
| } else { | |
| qualifier = jQuery.filter( qualifier, filtered ); | |
| } | |
| } | |
| return jQuery.grep(elements, function( elem, i ) { | |
| return ( jQuery.inArray( elem, qualifier ) >= 0 ) === keep; | |
| }); | |
| } | |
| function createSafeFragment( document ) { | |
| var list = nodeNames.split( "|" ), | |
| safeFrag = document.createDocumentFragment(); | |
| if ( safeFrag.createElement ) { | |
| while ( list.length ) { | |
| safeFrag.createElement( | |
| list.pop() | |
| ); | |
| } | |
| } | |
| return safeFrag; | |
| } | |
| var nodeNames = "abbr|article|aside|audio|bdi|canvas|data|datalist|details|figcaption|figure|footer|" + | |
| "header|hgroup|mark|meter|nav|output|progress|section|summary|time|video", | |
| rinlinejQuery = / jQuery\d+="(?:\d+|null)"/g, | |
| rleadingWhitespace = /^\s+/, | |
| rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig, | |
| rtagName = /<([\w:]+)/, | |
| rtbody = /<tbody/i, | |
| rhtml = /<|&#?\w+;/, | |
| rnoInnerhtml = /<(?:script|style)/i, | |
| rnocache = /<(?:script|object|embed|option|style)/i, | |
| rnoshimcache = new RegExp("<(?:" + nodeNames + ")[\\s/>]", "i"), | |
| // checked="checked" or checked | |
| rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, | |
| rscriptType = /\/(java|ecma)script/i, | |
| rcleanScript = /^\s*<!(?:\[CDATA\[|\-\-)/, | |
| wrapMap = { | |
| option: [ 1, "<select multiple='multiple'>", "</select>" ], | |
| legend: [ 1, "<fieldset>", "</fieldset>" ], | |
| thead: [ 1, "<table>", "</table>" ], | |
| tr: [ 2, "<table><tbody>", "</tbody></table>" ], | |
| td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], | |
| col: [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ], | |
| area: [ 1, "<map>", "</map>" ], | |
| _default: [ 0, "", "" ] | |
| }, | |
| safeFragment = createSafeFragment( document ); | |
| wrapMap.optgroup = wrapMap.option; | |
| wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; | |
| wrapMap.th = wrapMap.td; | |
| // IE can't serialize <link> and <script> tags normally | |
| if ( !jQuery.support.htmlSerialize ) { | |
| wrapMap._default = [ 1, "div<div>", "</div>" ]; | |
| } | |
| jQuery.fn.extend({ | |
| text: function( value ) { | |
| return jQuery.access( this, function( value ) { | |
| return value === undefined ? | |
| jQuery.text( this ) : | |
| this.empty().append( ( this[0] && this[0].ownerDocument || document ).createTextNode( value ) ); | |
| }, null, value, arguments.length ); | |
| }, | |
| wrapAll: function( html ) { | |
| if ( jQuery.isFunction( html ) ) { | |
| return this.each(function(i) { | |
| jQuery(this).wrapAll( html.call(this, i) ); | |
| }); | |
| } | |
| if ( this[0] ) { | |
| // The elements to wrap the target around | |
| var wrap = jQuery( html, this[0].ownerDocument ).eq(0).clone(true); | |
| if ( this[0].parentNode ) { | |
| wrap.insertBefore( this[0] ); | |
| } | |
| wrap.map(function() { | |
| var elem = this; | |
| while ( elem.firstChild && elem.firstChild.nodeType === 1 ) { | |
| elem = elem.firstChild; | |
| } | |
| return elem; | |
| }).append( this ); | |
| } | |
| return this; | |
| }, | |
| wrapInner: function( html ) { | |
| if ( jQuery.isFunction( html ) ) { | |
| return this.each(function(i) { | |
| jQuery(this).wrapInner( html.call(this, i) ); | |
| }); | |
| } | |
| return this.each(function() { | |
| var self = jQuery( this ), | |
| contents = self.contents(); | |
| if ( contents.length ) { | |
| contents.wrapAll( html ); | |
| } else { | |
| self.append( html ); | |
| } | |
| }); | |
| }, | |
| wrap: function( html ) { | |
| var isFunction = jQuery.isFunction( html ); | |
| return this.each(function(i) { | |
| jQuery( this ).wrapAll( isFunction ? html.call(this, i) : html ); | |
| }); | |
| }, | |
| unwrap: function() { | |
| return this.parent().each(function() { | |
| if ( !jQuery.nodeName( this, "body" ) ) { | |
| jQuery( this ).replaceWith( this.childNodes ); | |
| } | |
| }).end(); | |
| }, | |
| append: function() { | |
| return this.domManip(arguments, true, function( elem ) { | |
| if ( this.nodeType === 1 ) { | |
| this.appendChild( elem ); | |
| } | |
| }); | |
| }, | |
| prepend: function() { | |
| return this.domManip(arguments, true, function( elem ) { | |
| if ( this.nodeType === 1 ) { | |
| this.insertBefore( elem, this.firstChild ); | |
| } | |
| }); | |
| }, | |
| before: function() { | |
| if ( this[0] && this[0].parentNode ) { | |
| return this.domManip(arguments, false, function( elem ) { | |
| this.parentNode.insertBefore( elem, this ); | |
| }); | |
| } else if ( arguments.length ) { | |
| var set = jQuery.clean( arguments ); | |
| set.push.apply( set, this.toArray() ); | |
| return this.pushStack( set, "before", arguments ); | |
| } | |
| }, | |
| after: function() { | |
| if ( this[0] && this[0].parentNode ) { | |
| return this.domManip(arguments, false, function( elem ) { | |
| this.parentNode.insertBefore( elem, this.nextSibling ); | |
| }); | |
| } else if ( arguments.length ) { | |
| var set = this.pushStack( this, "after", arguments ); | |
| set.push.apply( set, jQuery.clean(arguments) ); | |
| return set; | |
| } | |
| }, | |
| // keepData is for internal use only--do not document | |
| remove: function( selector, keepData ) { | |
| for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { | |
| if ( !selector || jQuery.filter( selector, [ elem ] ).length ) { | |
| if ( !keepData && elem.nodeType === 1 ) { | |
| jQuery.cleanData( elem.getElementsByTagName("*") ); | |
| jQuery.cleanData( [ elem ] ); | |
| } | |
| if ( elem.parentNode ) { | |
| elem.parentNode.removeChild( elem ); | |
| } | |
| } | |
| } | |
| return this; | |
| }, | |
| empty: function() { | |
| for ( var i = 0, elem; (elem = this[i]) != null; i++ ) { | |
| // Remove element nodes and prevent memory leaks | |
| if ( elem.nodeType === 1 ) { | |
| jQuery.cleanData( elem.getElementsByTagName("*") ); | |
| } | |
| // Remove any remaining nodes | |
| while ( elem.firstChild ) { | |
| elem.removeChild( elem.firstChild ); | |
| } | |
| } | |
| return this; | |
| }, | |
| clone: function( dataAndEvents, deepDataAndEvents ) { | |
| dataAndEvents = dataAndEvents == null ? false : dataAndEvents; | |
| deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; | |
| return this.map( function () { | |
| return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); | |
| }); | |
| }, | |
| html: function( value ) { | |
| return jQuery.access( this, function( value ) { | |
| var elem = this[0] || {}, | |
| i = 0, | |
| l = this.length; | |
| if ( value === undefined ) { | |
| return elem.nodeType === 1 ? | |
| elem.innerHTML.replace( rinlinejQuery, "" ) : | |
| null; | |
| } | |
| if ( typeof value === "string" && !rnoInnerhtml.test( value ) && | |
| ( jQuery.support.leadingWhitespace || !rleadingWhitespace.test( value ) ) && | |
| !wrapMap[ ( rtagName.exec( value ) || ["", ""] )[1].toLowerCase() ] ) { | |
| value = value.replace( rxhtmlTag, "<$1></$2>" ); | |
| try { | |
| for (; i < l; i++ ) { | |
| // Remove element nodes and prevent memory leaks | |
| elem = this[i] || {}; | |
| if ( elem.nodeType === 1 ) { | |
| jQuery.cleanData( elem.getElementsByTagName( "*" ) ); | |
| elem.innerHTML = value; | |
| } | |
| } | |
| elem = 0; | |
| // If using innerHTML throws an exception, use the fallback method | |
| } catch(e) {} | |
| } | |
| if ( elem ) { | |
| this.empty().append( value ); | |
| } | |
| }, null, value, arguments.length ); | |
| }, | |
| replaceWith: function( value ) { | |
| if ( this[0] && this[0].parentNode ) { | |
| // Make sure that the elements are removed from the DOM before they are inserted | |
| // this can help fix replacing a parent with child elements | |
| if ( jQuery.isFunction( value ) ) { | |
| return this.each(function(i) { | |
| var self = jQuery(this), old = self.html(); | |
| self.replaceWith( value.call( this, i, old ) ); | |
| }); | |
| } | |
| if ( typeof value !== "string" ) { | |
| value = jQuery( value ).detach(); | |
| } | |
| return this.each(function() { | |
| var next = this.nextSibling, | |
| parent = this.parentNode; | |
| jQuery( this ).remove(); | |
| if ( next ) { | |
| jQuery(next).before( value ); | |
| } else { | |
| jQuery(parent).append( value ); | |
| } | |
| }); | |
| } else { | |
| return this.length ? | |
| this.pushStack( jQuery(jQuery.isFunction(value) ? value() : value), "replaceWith", value ) : | |
| this; | |
| } | |
| }, | |
| detach: function( selector ) { | |
| return this.remove( selector, true ); | |
| }, | |
| domManip: function( args, table, callback ) { | |
| var results, first, fragment, parent, | |
| value = args[0], | |
| scripts = []; | |
| // We can't cloneNode fragments that contain checked, in WebKit | |
| if ( !jQuery.support.checkClone && arguments.length === 3 && typeof value === "string" && rchecked.test( value ) ) { | |
| return this.each(function() { | |
| jQuery(this).domManip( args, table, callback, true ); | |
| }); | |
| } | |
| if ( jQuery.isFunction(value) ) { | |
| return this.each(function(i) { | |
| var self = jQuery(this); | |
| args[0] = value.call(this, i, table ? self.html() : undefined); | |
| self.domManip( args, table, callback ); | |
| }); | |
| } | |
| if ( this[0] ) { | |
| parent = value && value.parentNode; | |
| // If we're in a fragment, just use that instead of building a new one | |
| if ( jQuery.support.parentNode && parent && parent.nodeType === 11 && parent.childNodes.length === this.length ) { | |
| results = { fragment: parent }; | |
| } else { | |
| results = jQuery.buildFragment( args, this, scripts ); | |
| } | |
| fragment = results.fragment; | |
| if ( fragment.childNodes.length === 1 ) { | |
| first = fragment = fragment.firstChild; | |
| } else { | |
| first = fragment.firstChild; | |
| } | |
| if ( first ) { | |
| table = table && jQuery.nodeName( first, "tr" ); | |
| for ( var i = 0, l = this.length, lastIndex = l - 1; i < l; i++ ) { | |
| callback.call( | |
| table ? | |
| root(this[i], first) : | |
| this[i], | |
| // Make sure that we do not leak memory by inadvertently discarding | |
| // the original fragment (which might have attached data) instead of | |
| // using it; in addition, use the original fragment object for the last | |
| // item instead of first because it can end up being emptied incorrectly | |
| // in certain situations (Bug #8070). | |
| // Fragments from the fragment cache must always be cloned and never used | |
| // in place. | |
| results.cacheable || ( l > 1 && i < lastIndex ) ? | |
| jQuery.clone( fragment, true, true ) : | |
| fragment | |
| ); | |
| } | |
| } | |
| if ( scripts.length ) { | |
| jQuery.each( scripts, function( i, elem ) { | |
| if ( elem.src ) { | |
| jQuery.ajax({ | |
| type: "GET", | |
| global: false, | |
| url: elem.src, | |
| async: false, | |
| dataType: "script" | |
| }); | |
| } else { | |
| jQuery.globalEval( ( elem.text || elem.textContent || elem.innerHTML || "" ).replace( rcleanScript, "/*$0*/" ) ); | |
| } | |
| if ( elem.parentNode ) { | |
| elem.parentNode.removeChild( elem ); | |
| } | |
| }); | |
| } | |
| } | |
| return this; | |
| } | |
| }); | |
| function root( elem, cur ) { | |
| return jQuery.nodeName(elem, "table") ? | |
| (elem.getElementsByTagName("tbody")[0] || | |
| elem.appendChild(elem.ownerDocument.createElement("tbody"))) : | |
| elem; | |
| } | |
| function cloneCopyEvent( src, dest ) { | |
| if ( dest.nodeType !== 1 || !jQuery.hasData( src ) ) { | |
| return; | |
| } | |
| var type, i, l, | |
| oldData = jQuery._data( src ), | |
| curData = jQuery._data( dest, oldData ), | |
| events = oldData.events; | |
| if ( events ) { | |
| delete curData.handle; | |
| curData.events = {}; | |
| for ( type in events ) { | |
| for ( i = 0, l = events[ type ].length; i < l; i++ ) { | |
| jQuery.event.add( dest, type, events[ type ][ i ] ); | |
| } | |
| } | |
| } | |
| // make the cloned public data object a copy from the original | |
| if ( curData.data ) { | |
| curData.data = jQuery.extend( {}, curData.data ); | |
| } | |
| } | |
| function cloneFixAttributes( src, dest ) { | |
| var nodeName; | |
| // We do not need to do anything for non-Elements | |
| if ( dest.nodeType !== 1 ) { | |
| return; | |
| } | |
| // clearAttributes removes the attributes, which we don't want, | |
| // but also removes the attachEvent events, which we *do* want | |
| if ( dest.clearAttributes ) { | |
| dest.clearAttributes(); | |
| } | |
| // mergeAttributes, in contrast, only merges back on the | |
| // original attributes, not the events | |
| if ( dest.mergeAttributes ) { | |
| dest.mergeAttributes( src ); | |
| } | |
| nodeName = dest.nodeName.toLowerCase(); | |
| // IE6-8 fail to clone children inside object elements that use | |
| // the proprietary classid attribute value (rather than the type | |
| // attribute) to identify the type of content to display | |
| if ( nodeName === "object" ) { | |
| dest.outerHTML = src.outerHTML; | |
| } else if ( nodeName === "input" && (src.type === "checkbox" || src.type === "radio") ) { | |
| // IE6-8 fails to persist the checked state of a cloned checkbox | |
| // or radio button. Worse, IE6-7 fail to give the cloned element | |
| // a checked appearance if the defaultChecked value isn't also set | |
| if ( src.checked ) { | |
| dest.defaultChecked = dest.checked = src.checked; | |
| } | |
| // IE6-7 get confused and end up setting the value of a cloned | |
| // checkbox/radio button to an empty string instead of "on" | |
| if ( dest.value !== src.value ) { | |
| dest.value = src.value; | |
| } | |
| // IE6-8 fails to return the selected option to the default selected | |
| // state when cloning options | |
| } else if ( nodeName === "option" ) { | |
| dest.selected = src.defaultSelected; | |
| // IE6-8 fails to set the defaultValue to the correct value when | |
| // cloning other types of input fields | |
| } else if ( nodeName === "input" || nodeName === "textarea" ) { | |
| dest.defaultValue = src.defaultValue; | |
| // IE blanks contents when cloning scripts | |
| } else if ( nodeName === "script" && dest.text !== src.text ) { | |
| dest.text = src.text; | |
| } | |
| // Event data gets referenced instead of copied if the expando | |
| // gets copied too | |
| dest.removeAttribute( jQuery.expando ); | |
| // Clear flags for bubbling special change/submit events, they must | |
| // be reattached when the newly cloned events are first activated | |
| dest.removeAttribute( "_submit_attached" ); | |
| dest.removeAttribute( "_change_attached" ); | |
| } | |
| jQuery.buildFragment = function( args, nodes, scripts ) { | |
| var fragment, cacheable, cacheresults, doc, | |
| first = args[ 0 ]; | |
| // nodes may contain either an explicit document object, | |
| // a jQuery collection or context object. | |
| // If nodes[0] contains a valid object to assign to doc | |
| if ( nodes && nodes[0] ) { | |
| doc = nodes[0].ownerDocument || nodes[0]; | |
| } | |
| // Ensure that an attr object doesn't incorrectly stand in as a document object | |
| // Chrome and Firefox seem to allow this to occur and will throw exception | |
| // Fixes #8950 | |
| if ( !doc.createDocumentFragment ) { | |
| doc = document; | |
| } | |
| // Only cache "small" (1/2 KB) HTML strings that are associated with the main document | |
| // Cloning options loses the selected state, so don't cache them | |
| // IE 6 doesn't like it when you put <object> or <embed> elements in a fragment | |
| // Also, WebKit does not clone 'checked' attributes on cloneNode, so don't cache | |
| // Lastly, IE6,7,8 will not correctly reuse cached fragments that were created from unknown elems #10501 | |
| if ( args.length === 1 && typeof first === "string" && first.length < 512 && doc === document && | |
| first.charAt(0) === "<" && !rnocache.test( first ) && | |
| (jQuery.support.checkClone || !rchecked.test( first )) && | |
| (jQuery.support.html5Clone || !rnoshimcache.test( first )) ) { | |
| cacheable = true; | |
| cacheresults = jQuery.fragments[ first ]; | |
| if ( cacheresults && cacheresults !== 1 ) { | |
| fragment = cacheresults; | |
| } | |
| } | |
| if ( !fragment ) { | |
| fragment = doc.createDocumentFragment(); | |
| jQuery.clean( args, doc, fragment, scripts ); | |
| } | |
| if ( cacheable ) { | |
| jQuery.fragments[ first ] = cacheresults ? fragment : 1; | |
| } | |
| return { fragment: fragment, cacheable: cacheable }; | |
| }; | |
| jQuery.fragments = {}; | |
| jQuery.each({ | |
| appendTo: "append", | |
| prependTo: "prepend", | |
| insertBefore: "before", | |
| insertAfter: "after", | |
| replaceAll: "replaceWith" | |
| }, function( name, original ) { | |
| jQuery.fn[ name ] = function( selector ) { | |
| var ret = [], | |
| insert = jQuery( selector ), | |
| parent = this.length === 1 && this[0].parentNode; | |
| if ( parent && parent.nodeType === 11 && parent.childNodes.length === 1 && insert.length === 1 ) { | |
| insert[ original ]( this[0] ); | |
| return this; | |
| } else { | |
| for ( var i = 0, l = insert.length; i < l; i++ ) { | |
| var elems = ( i > 0 ? this.clone(true) : this ).get(); | |
| jQuery( insert[i] )[ original ]( elems ); | |
| ret = ret.concat( elems ); | |
| } | |
| return this.pushStack( ret, name, insert.selector ); | |
| } | |
| }; | |
| }); | |
| function getAll( elem ) { | |
| if ( typeof elem.getElementsByTagName !== "undefined" ) { | |
| return elem.getElementsByTagName( "*" ); | |
| } else if ( typeof elem.querySelectorAll !== "undefined" ) { | |
| return elem.querySelectorAll( "*" ); | |
| } else { | |
| return []; | |
| } | |
| } | |
| // Used in clean, fixes the defaultChecked property | |
| function fixDefaultChecked( elem ) { | |
| if ( elem.type === "checkbox" || elem.type === "radio" ) { | |
| elem.defaultChecked = elem.checked; | |
| } | |
| } | |
| // Finds all inputs and passes them to fixDefaultChecked | |
| function findInputs( elem ) { | |
| var nodeName = ( elem.nodeName || "" ).toLowerCase(); | |
| if ( nodeName === "input" ) { | |
| fixDefaultChecked( elem ); | |
| // Skip scripts, get other children | |
| } else if ( nodeName !== "script" && typeof elem.getElementsByTagName !== "undefined" ) { | |
| jQuery.grep( elem.getElementsByTagName("input"), fixDefaultChecked ); | |
| } | |
| } | |
| // Derived From: http://www.iecss.com/shimprove/javascript/shimprove.1-0-1.js | |
| function shimCloneNode( elem ) { | |
| var div = document.createElement( "div" ); | |
| safeFragment.appendChild( div ); | |
| div.innerHTML = elem.outerHTML; | |
| return div.firstChild; | |
| } | |
| jQuery.extend({ | |
| clone: function( elem, dataAndEvents, deepDataAndEvents ) { | |
| var srcElements, | |
| destElements, | |
| i, | |
| // IE<=8 does not properly clone detached, unknown element nodes | |
| clone = jQuery.support.html5Clone || jQuery.isXMLDoc(elem) || !rnoshimcache.test( "<" + elem.nodeName + ">" ) ? | |
| elem.cloneNode( true ) : | |
| shimCloneNode( elem ); | |
| if ( (!jQuery.support.noCloneEvent || !jQuery.support.noCloneChecked) && | |
| (elem.nodeType === 1 || elem.nodeType === 11) && !jQuery.isXMLDoc(elem) ) { | |
| // IE copies events bound via attachEvent when using cloneNode. | |
| // Calling detachEvent on the clone will also remove the events | |
| // from the original. In order to get around this, we use some | |
| // proprietary methods to clear the events. Thanks to MooTools | |
| // guys for this hotness. | |
| cloneFixAttributes( elem, clone ); | |
| // Using Sizzle here is crazy slow, so we use getElementsByTagName instead | |
| srcElements = getAll( elem ); | |
| destElements = getAll( clone ); | |
| // Weird iteration because IE will replace the length property | |
| // with an element if you are cloning the body and one of the | |
| // elements on the page has a name or id of "length" | |
| for ( i = 0; srcElements[i]; ++i ) { | |
| // Ensure that the destination node is not null; Fixes #9587 | |
| if ( destElements[i] ) { | |
| cloneFixAttributes( srcElements[i], destElements[i] ); | |
| } | |
| } | |
| } | |
| // Copy the events from the original to the clone | |
| if ( dataAndEvents ) { | |
| cloneCopyEvent( elem, clone ); | |
| if ( deepDataAndEvents ) { | |
| srcElements = getAll( elem ); | |
| destElements = getAll( clone ); | |
| for ( i = 0; srcElements[i]; ++i ) { | |
| cloneCopyEvent( srcElements[i], destElements[i] ); | |
| } | |
| } | |
| } | |
| srcElements = destElements = null; | |
| // Return the cloned set | |
| return clone; | |
| }, | |
| clean: function( elems, context, fragment, scripts ) { | |
| var checkScriptType, script, j, | |
| ret = []; | |
| context = context || document; | |
| // !context.createElement fails in IE with an error but returns typeof 'object' | |
| if ( typeof context.createElement === "undefined" ) { | |
| context = context.ownerDocument || context[0] && context[0].ownerDocument || document; | |
| } | |
| for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { | |
| if ( typeof elem === "number" ) { | |
| elem += ""; | |
| } | |
| if ( !elem ) { | |
| continue; | |
| } | |
| // Convert html string into DOM nodes | |
| if ( typeof elem === "string" ) { | |
| if ( !rhtml.test( elem ) ) { | |
| elem = context.createTextNode( elem ); | |
| } else { | |
| // Fix "XHTML"-style tags in all browsers | |
| elem = elem.replace(rxhtmlTag, "<$1></$2>"); | |
| // Trim whitespace, otherwise indexOf won't work as expected | |
| var tag = ( rtagName.exec( elem ) || ["", ""] )[1].toLowerCase(), | |
| wrap = wrapMap[ tag ] || wrapMap._default, | |
| depth = wrap[0], | |
| div = context.createElement("div"), | |
| safeChildNodes = safeFragment.childNodes, | |
| remove; | |
| // Append wrapper element to unknown element safe doc fragment | |
| if ( context === document ) { | |
| // Use the fragment we've already created for this document | |
| safeFragment.appendChild( div ); | |
| } else { | |
| // Use a fragment created with the owner document | |
| createSafeFragment( context ).appendChild( div ); | |
| } | |
| // Go to html and back, then peel off extra wrappers | |
| div.innerHTML = wrap[1] + elem + wrap[2]; | |
| // Move to the right depth | |
| while ( depth-- ) { | |
| div = div.lastChild; | |
| } | |
| // Remove IE's autoinserted <tbody> from table fragments | |
| if ( !jQuery.support.tbody ) { | |
| // String was a <table>, *may* have spurious <tbody> | |
| var hasBody = rtbody.test(elem), | |
| tbody = tag === "table" && !hasBody ? | |
| div.firstChild && div.firstChild.childNodes : | |
| // String was a bare <thead> or <tfoot> | |
| wrap[1] === "<table>" && !hasBody ? | |
| div.childNodes : | |
| []; | |
| for ( j = tbody.length - 1; j >= 0 ; --j ) { | |
| if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) { | |
| tbody[ j ].parentNode.removeChild( tbody[ j ] ); | |
| } | |
| } | |
| } | |
| // IE completely kills leading whitespace when innerHTML is used | |
| if ( !jQuery.support.leadingWhitespace && rleadingWhitespace.test( elem ) ) { | |
| div.insertBefore( context.createTextNode( rleadingWhitespace.exec(elem)[0] ), div.firstChild ); | |
| } | |
| elem = div.childNodes; | |
| // Clear elements from DocumentFragment (safeFragment or otherwise) | |
| // to avoid hoarding elements. Fixes #11356 | |
| if ( div ) { | |
| div.parentNode.removeChild( div ); | |
| // Guard against -1 index exceptions in FF3.6 | |
| if ( safeChildNodes.length > 0 ) { | |
| remove = safeChildNodes[ safeChildNodes.length - 1 ]; | |
| if ( remove && remove.parentNode ) { | |
| remove.parentNode.removeChild( remove ); | |
| } | |
| } | |
| } | |
| } | |
| } | |
| // Resets defaultChecked for any radios and checkboxes | |
| // about to be appended to the DOM in IE 6/7 (#8060) | |
| var len; | |
| if ( !jQuery.support.appendChecked ) { | |
| if ( elem[0] && typeof (len = elem.length) === "number" ) { | |
| for ( j = 0; j < len; j++ ) { | |
| findInputs( elem[j] ); | |
| } | |
| } else { | |
| findInputs( elem ); | |
| } | |
| } | |
| if ( elem.nodeType ) { | |
| ret.push( elem ); | |
| } else { | |
| ret = jQuery.merge( ret, elem ); | |
| } | |
| } | |
| if ( fragment ) { | |
| checkScriptType = function( elem ) { | |
| return !elem.type || rscriptType.test( elem.type ); | |
| }; | |
| for ( i = 0; ret[i]; i++ ) { | |
| script = ret[i]; | |
| if ( scripts && jQuery.nodeName( script, "script" ) && (!script.type || rscriptType.test( script.type )) ) { | |
| scripts.push( script.parentNode ? script.parentNode.removeChild( script ) : script ); | |
| } else { | |
| if ( script.nodeType === 1 ) { | |
| var jsTags = jQuery.grep( script.getElementsByTagName( "script" ), checkScriptType ); | |
| ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) ); | |
| } | |
| fragment.appendChild( script ); | |
| } | |
| } | |
| } | |
| return ret; | |
| }, | |
| cleanData: function( elems ) { | |
| var data, id, | |
| cache = jQuery.cache, | |
| special = jQuery.event.special, | |
| deleteExpando = jQuery.support.deleteExpando; | |
| for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { | |
| if ( elem.nodeName && jQuery.noData[elem.nodeName.toLowerCase()] ) { | |
| continue; | |
| } | |
| id = elem[ jQuery.expando ]; | |
| if ( id ) { | |
| data = cache[ id ]; | |
| if ( data && data.events ) { | |
| for ( var type in data.events ) { | |
| if ( special[ type ] ) { | |
| jQuery.event.remove( elem, type ); | |
| // This is a shortcut to avoid jQuery.event.remove's overhead | |
| } else { | |
| jQuery.removeEvent( elem, type, data.handle ); | |
| } | |
| } | |
| // Null the DOM reference to avoid IE6/7/8 leak (#7054) | |
| if ( data.handle ) { | |
| data.handle.elem = null; | |
| } | |
| } | |
| if ( deleteExpando ) { | |
| delete elem[ jQuery.expando ]; | |
| } else if ( elem.removeAttribute ) { | |
| elem.removeAttribute( jQuery.expando ); | |
| } | |
| delete cache[ id ]; | |
| } | |
| } | |
| } | |
| }); | |
| var ralpha = /alpha\([^)]*\)/i, | |
| ropacity = /opacity=([^)]*)/, | |
| // fixed for IE9, see #8346 | |
| rupper = /([A-Z]|^ms)/g, | |
| rnum = /^[\-+]?(?:\d*\.)?\d+$/i, | |
| rnumnonpx = /^-?(?:\d*\.)?\d+(?!px)[^\d\s]+$/i, | |
| rrelNum = /^([\-+])=([\-+.\de]+)/, | |
| rmargin = /^margin/, | |
| cssShow = { position: "absolute", visibility: "hidden", display: "block" }, | |
| // order is important! | |
| cssExpand = [ "Top", "Right", "Bottom", "Left" ], | |
| curCSS, | |
| getComputedStyle, | |
| currentStyle; | |
| jQuery.fn.css = function( name, value ) { | |
| return jQuery.access( this, function( elem, name, value ) { | |
| return value !== undefined ? | |
| jQuery.style( elem, name, value ) : | |
| jQuery.css( elem, name ); | |
| }, name, value, arguments.length > 1 ); | |
| }; | |
| jQuery.extend({ | |
| // Add in style property hooks for overriding the default | |
| // behavior of getting and setting a style property | |
| cssHooks: { | |
| opacity: { | |
| get: function( elem, computed ) { | |
| if ( computed ) { | |
| // We should always get a number back from opacity | |
| var ret = curCSS( elem, "opacity" ); | |
| return ret === "" ? "1" : ret; | |
| } else { | |
| return elem.style.opacity; | |
| } | |
| } | |
| } | |
| }, | |
| // Exclude the following css properties to add px | |
| cssNumber: { | |
| "fillOpacity": true, | |
| "fontWeight": true, | |
| "lineHeight": true, | |
| "opacity": true, | |
| "orphans": true, | |
| "widows": true, | |
| "zIndex": true, | |
| "zoom": true | |
| }, | |
| // Add in properties whose names you wish to fix before | |
| // setting or getting the value | |
| cssProps: { | |
| // normalize float css property | |
| "float": jQuery.support.cssFloat ? "cssFloat" : "styleFloat" | |
| }, | |
| // Get and set the style property on a DOM Node | |
| style: function( elem, name, value, extra ) { | |
| // Don't set styles on text and comment nodes | |
| if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { | |
| return; | |
| } | |
| // Make sure that we're working with the right name | |
| var ret, type, origName = jQuery.camelCase( name ), | |
| style = elem.style, hooks = jQuery.cssHooks[ origName ]; | |
| name = jQuery.cssProps[ origName ] || origName; | |
| // Check if we're setting a value | |
| if ( value !== undefined ) { | |
| type = typeof value; | |
| // convert relative number strings (+= or -=) to relative numbers. #7345 | |
| if ( type === "string" && (ret = rrelNum.exec( value )) ) { | |
| value = ( +( ret[1] + 1) * +ret[2] ) + parseFloat( jQuery.css( elem, name ) ); | |
| // Fixes bug #9237 | |
| type = "number"; | |
| } | |
| // Make sure that NaN and null values aren't set. See: #7116 | |
| if ( value == null || type === "number" && isNaN( value ) ) { | |
| return; | |
| } | |
| // If a number was passed in, add 'px' to the (except for certain CSS properties) | |
| if ( type === "number" && !jQuery.cssNumber[ origName ] ) { | |
| value += "px"; | |
| } | |
| // If a hook was provided, use that value, otherwise just set the specified value | |
| if ( !hooks || !("set" in hooks) || (value = hooks.set( elem, value )) !== undefined ) { | |
| // Wrapped to prevent IE from throwing errors when 'invalid' values are provided | |
| // Fixes bug #5509 | |
| try { | |
| style[ name ] = value; | |
| } catch(e) {} | |
| } | |
| } else { | |
| // If a hook was provided get the non-computed value from there | |
| if ( hooks && "get" in hooks && (ret = hooks.get( elem, false, extra )) !== undefined ) { | |
| return ret; | |
| } | |
| // Otherwise just get the value from the style object | |
| return style[ name ]; | |
| } | |
| }, | |
| css: function( elem, name, extra ) { | |
| var ret, hooks; | |
| // Make sure that we're working with the right name | |
| name = jQuery.camelCase( name ); | |
| hooks = jQuery.cssHooks[ name ]; | |
| name = jQuery.cssProps[ name ] || name; | |
| // cssFloat needs a special treatment | |
| if ( name === "cssFloat" ) { | |
| name = "float"; | |
| } | |
| // If a hook was provided get the computed value from there | |
| if ( hooks && "get" in hooks && (ret = hooks.get( elem, true, extra )) !== undefined ) { | |
| return ret; | |
| // Otherwise, if a way to get the computed value exists, use that | |
| } else if ( curCSS ) { | |
| return curCSS( elem, name ); | |
| } | |
| }, | |
| // A method for quickly swapping in/out CSS properties to get correct calculations | |
| swap: function( elem, options, callback ) { | |
| var old = {}, | |
| ret, name; | |
| // Remember the old values, and insert the new ones | |
| for ( name in options ) { | |
| old[ name ] = elem.style[ name ]; | |
| elem.style[ name ] = options[ name ]; | |
| } | |
| ret = callback.call( elem ); | |
| // Revert the old values | |
| for ( name in options ) { | |
| elem.style[ name ] = old[ name ]; | |
| } | |
| return ret; | |
| } | |
| }); | |
| // DEPRECATED in 1.3, Use jQuery.css() instead | |
| jQuery.curCSS = jQuery.css; | |
| if ( document.defaultView && document.defaultView.getComputedStyle ) { | |
| getComputedStyle = function( elem, name ) { | |
| var ret, defaultView, computedStyle, width, | |
| style = elem.style; | |
| name = name.replace( rupper, "-$1" ).toLowerCase(); | |
| if ( (defaultView = elem.ownerDocument.defaultView) && | |
| (computedStyle = defaultView.getComputedStyle( elem, null )) ) { | |
| ret = computedStyle.getPropertyValue( name ); | |
| if ( ret === "" && !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { | |
| ret = jQuery.style( elem, name ); | |
| } | |
| } | |
| // A tribute to the "awesome hack by Dean Edwards" | |
| // WebKit uses "computed value (percentage if specified)" instead of "used value" for margins | |
| // which is against the CSSOM draft spec: http://dev.w3.org/csswg/cssom/#resolved-values | |
| if ( !jQuery.support.pixelMargin && computedStyle && rmargin.test( name ) && rnumnonpx.test( ret ) ) { | |
| width = style.width; | |
| style.width = ret; | |
| ret = computedStyle.width; | |
| style.width = width; | |
| } | |
| return ret; | |
| }; | |
| } | |
| if ( document.documentElement.currentStyle ) { | |
| currentStyle = function( elem, name ) { | |
| var left, rsLeft, uncomputed, | |
| ret = elem.currentStyle && elem.currentStyle[ name ], | |
| style = elem.style; | |
| // Avoid setting ret to empty string here | |
| // so we don't default to auto | |
| if ( ret == null && style && (uncomputed = style[ name ]) ) { | |
| ret = uncomputed; | |
| } | |
| // From the awesome hack by Dean Edwards | |
| // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 | |
| // If we're not dealing with a regular pixel number | |
| // but a number that has a weird ending, we need to convert it to pixels | |
| if ( rnumnonpx.test( ret ) ) { | |
| // Remember the original values | |
| left = style.left; | |
| rsLeft = elem.runtimeStyle && elem.runtimeStyle.left; | |
| // Put in the new values to get a computed value out | |
| if ( rsLeft ) { | |
| elem.runtimeStyle.left = elem.currentStyle.left; | |
| } | |
| style.left = name === "fontSize" ? "1em" : ret; | |
| ret = style.pixelLeft + "px"; | |
| // Revert the changed values | |
| style.left = left; | |
| if ( rsLeft ) { | |
| elem.runtimeStyle.left = rsLeft; | |
| } | |
| } | |
| return ret === "" ? "auto" : ret; | |
| }; | |
| } | |
| curCSS = getComputedStyle || currentStyle; | |
| function getWidthOrHeight( elem, name, extra ) { | |
| // Start with offset property | |
| var val = name === "width" ? elem.offsetWidth : elem.offsetHeight, | |
| i = name === "width" ? 1 : 0, | |
| len = 4; | |
| if ( val > 0 ) { | |
| if ( extra !== "border" ) { | |
| for ( ; i < len; i += 2 ) { | |
| if ( !extra ) { | |
| val -= parseFloat( jQuery.css( elem, "padding" + cssExpand[ i ] ) ) || 0; | |
| } | |
| if ( extra === "margin" ) { | |
| val += parseFloat( jQuery.css( elem, extra + cssExpand[ i ] ) ) || 0; | |
| } else { | |
| val -= parseFloat( jQuery.css( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0; | |
| } | |
| } | |
| } | |
| return val + "px"; | |
| } | |
| // Fall back to computed then uncomputed css if necessary | |
| val = curCSS( elem, name ); | |
| if ( val < 0 || val == null ) { | |
| val = elem.style[ name ]; | |
| } | |
| // Computed unit is not pixels. Stop here and return. | |
| if ( rnumnonpx.test(val) ) { | |
| return val; | |
| } | |
| // Normalize "", auto, and prepare for extra | |
| val = parseFloat( val ) || 0; | |
| // Add padding, border, margin | |
| if ( extra ) { | |
| for ( ; i < len; i += 2 ) { | |
| val += parseFloat( jQuery.css( elem, "padding" + cssExpand[ i ] ) ) || 0; | |
| if ( extra !== "padding" ) { | |
| val += parseFloat( jQuery.css( elem, "border" + cssExpand[ i ] + "Width" ) ) || 0; | |
| } | |
| if ( extra === "margin" ) { | |
| val += parseFloat( jQuery.css( elem, extra + cssExpand[ i ]) ) || 0; | |
| } | |
| } | |
| } | |
| return val + "px"; | |
| } | |
| jQuery.each([ "height", "width" ], function( i, name ) { | |
| jQuery.cssHooks[ name ] = { | |
| get: function( elem, computed, extra ) { | |
| if ( computed ) { | |
| if ( elem.offsetWidth !== 0 ) { | |
| return getWidthOrHeight( elem, name, extra ); | |
| } else { | |
| return jQuery.swap( elem, cssShow, function() { | |
| return getWidthOrHeight( elem, name, extra ); | |
| }); | |
| } | |
| } | |
| }, | |
| set: function( elem, value ) { | |
| return rnum.test( value ) ? | |
| value + "px" : | |
| value; | |
| } | |
| }; | |
| }); | |
| if ( !jQuery.support.opacity ) { | |
| jQuery.cssHooks.opacity = { | |
| get: function( elem, computed ) { | |
| // IE uses filters for opacity | |
| return ropacity.test( (computed && elem.currentStyle ? elem.currentStyle.filter : elem.style.filter) || "" ) ? | |
| ( parseFloat( RegExp.$1 ) / 100 ) + "" : | |
| computed ? "1" : ""; | |
| }, | |
| set: function( elem, value ) { | |
| var style = elem.style, | |
| currentStyle = elem.currentStyle, | |
| opacity = jQuery.isNumeric( value ) ? "alpha(opacity=" + value * 100 + ")" : "", | |
| filter = currentStyle && currentStyle.filter || style.filter || ""; | |
| // IE has trouble with opacity if it does not have layout | |
| // Force it by setting the zoom level | |
| style.zoom = 1; | |
| // if setting opacity to 1, and no other filters exist - attempt to remove filter attribute #6652 | |
| if ( value >= 1 && jQuery.trim( filter.replace( ralpha, "" ) ) === "" ) { | |
| // Setting style.filter to null, "" & " " still leave "filter:" in the cssText | |
| // if "filter:" is present at all, clearType is disabled, we want to avoid this | |
| // style.removeAttribute is IE Only, but so apparently is this code path... | |
| style.removeAttribute( "filter" ); | |
| // if there there is no filter style applied in a css rule, we are done | |
| if ( currentStyle && !currentStyle.filter ) { | |
| return; | |
| } | |
| } | |
| // otherwise, set new filter values | |
| style.filter = ralpha.test( filter ) ? | |
| filter.replace( ralpha, opacity ) : | |
| filter + " " + opacity; | |
| } | |
| }; | |
| } | |
| jQuery(function() { | |
| // This hook cannot be added until DOM ready because the support test | |
| // for it is not run until after DOM ready | |
| if ( !jQuery.support.reliableMarginRight ) { | |
| jQuery.cssHooks.marginRight = { | |
| get: function( elem, computed ) { | |
| // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right | |
| // Work around by temporarily setting element display to inline-block | |
| return jQuery.swap( elem, { "display": "inline-block" }, function() { | |
| if ( computed ) { | |
| return curCSS( elem, "margin-right" ); | |
| } else { | |
| return elem.style.marginRight; | |
| } | |
| }); | |
| } | |
| }; | |
| } | |
| }); | |
| if ( jQuery.expr && jQuery.expr.filters ) { | |
| jQuery.expr.filters.hidden = function( elem ) { | |
| var width = elem.offsetWidth, | |
| height = elem.offsetHeight; | |
| return ( width === 0 && height === 0 ) || (!jQuery.support.reliableHiddenOffsets && ((elem.style && elem.style.display) || jQuery.css( elem, "display" )) === "none"); | |
| }; | |
| jQuery.expr.filters.visible = function( elem ) { | |
| return !jQuery.expr.filters.hidden( elem ); | |
| }; | |
| } | |
| // These hooks are used by animate to expand properties | |
| jQuery.each({ | |
| margin: "", | |
| padding: "", | |
| border: "Width" | |
| }, function( prefix, suffix ) { | |
| jQuery.cssHooks[ prefix + suffix ] = { | |
| expand: function( value ) { | |
| var i, | |
| // assumes a single number if not a string | |
| parts = typeof value === "string" ? value.split(" ") : [ value ], | |
| expanded = {}; | |
| for ( i = 0; i < 4; i++ ) { | |
| expanded[ prefix + cssExpand[ i ] + suffix ] = | |
| parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; | |
| } | |
| return expanded; | |
| } | |
| }; | |
| }); | |
| var r20 = /%20/g, | |
| rbracket = /\[\]$/, | |
| rCRLF = /\r?\n/g, | |
| rhash = /#.*$/, | |
| rheaders = /^(.*?):[ \t]*([^\r\n]*)\r?$/mg, // IE leaves an \r character at EOL | |
| rinput = /^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i, | |
| // #7653, #8125, #8152: local protocol detection | |
| rlocalProtocol = /^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/, | |
| rnoContent = /^(?:GET|HEAD)$/, | |
| rprotocol = /^\/\//, | |
| rquery = /\?/, | |
| rscript = /<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, | |
| rselectTextarea = /^(?:select|textarea)/i, | |
| rspacesAjax = /\s+/, | |
| rts = /([?&])_=[^&]*/, | |
| rurl = /^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/, | |
| // Keep a copy of the old load method | |
| _load = jQuery.fn.load, | |
| /* Prefilters | |
| * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) | |
| * 2) These are called: | |
| * - BEFORE asking for a transport | |
| * - AFTER param serialization (s.data is a string if s.processData is true) | |
| * 3) key is the dataType | |
| * 4) the catchall symbol "*" can be used | |
| * 5) execution will start with transport dataType and THEN continue down to "*" if needed | |
| */ | |
| prefilters = {}, | |
| /* Transports bindings | |
| * 1) key is the dataType | |
| * 2) the catchall symbol "*" can be used | |
| * 3) selection will start with transport dataType and THEN go to "*" if needed | |
| */ | |
| transports = {}, | |
| // Document location | |
| ajaxLocation, | |
| // Document location segments | |
| ajaxLocParts, | |
| // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression | |
| allTypes = ["*/"] + ["*"]; | |
| // #8138, IE may throw an exception when accessing | |
| // a field from window.location if document.domain has been set | |
| try { | |
| ajaxLocation = location.href; | |
| } catch( e ) { | |
| // Use the href attribute of an A element | |
| // since IE will modify it given document.location | |
| ajaxLocation = document.createElement( "a" ); | |
| ajaxLocation.href = ""; | |
| ajaxLocation = ajaxLocation.href; | |
| } | |
| // Segment location into parts | |
| ajaxLocParts = rurl.exec( ajaxLocation.toLowerCase() ) || []; | |
| // Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport | |
| function addToPrefiltersOrTransports( structure ) { | |
| // dataTypeExpression is optional and defaults to "*" | |
| return function( dataTypeExpression, func ) { | |
| if ( typeof dataTypeExpression !== "string" ) { | |
| func = dataTypeExpression; | |
| dataTypeExpression = "*"; | |
| } | |
| if ( jQuery.isFunction( func ) ) { | |
| var dataTypes = dataTypeExpression.toLowerCase().split( rspacesAjax ), | |
| i = 0, | |
| length = dataTypes.length, | |
| dataType, | |
| list, | |
| placeBefore; | |
| // For each dataType in the dataTypeExpression | |
| for ( ; i < length; i++ ) { | |
| dataType = dataTypes[ i ]; | |
| // We control if we're asked to add before | |
| // any existing element | |
| placeBefore = /^\+/.test( dataType ); | |
| if ( placeBefore ) { | |
| dataType = dataType.substr( 1 ) || "*"; | |
| } | |
| list = structure[ dataType ] = structure[ dataType ] || []; | |
| // then we add to the structure accordingly | |
| list[ placeBefore ? "unshift" : "push" ]( func ); | |
| } | |
| } | |
| }; | |
| } | |
| // Base inspection function for prefilters and transports | |
| function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR, | |
| dataType /* internal */, inspected /* internal */ ) { | |
| dataType = dataType || options.dataTypes[ 0 ]; | |
| inspected = inspected || {}; | |
| inspected[ dataType ] = true; | |
| var list = structure[ dataType ], | |
| i = 0, | |
| length = list ? list.length : 0, | |
| executeOnly = ( structure === prefilters ), | |
| selection; | |
| for ( ; i < length && ( executeOnly || !selection ); i++ ) { | |
| selection = list[ i ]( options, originalOptions, jqXHR ); | |
| // If we got redirected to another dataType | |
| // we try there if executing only and not done already | |
| if ( typeof selection === "string" ) { | |
| if ( !executeOnly || inspected[ selection ] ) { | |
| selection = undefined; | |
| } else { | |
| options.dataTypes.unshift( selection ); | |
| selection = inspectPrefiltersOrTransports( | |
| structure, options, originalOptions, jqXHR, selection, inspected ); | |
| } | |
| } | |
| } | |
| // If we're only executing or nothing was selected | |
| // we try the catchall dataType if not done already | |
| if ( ( executeOnly || !selection ) && !inspected[ "*" ] ) { | |
| selection = inspectPrefiltersOrTransports( | |
| structure, options, originalOptions, jqXHR, "*", inspected ); | |
| } | |
| // unnecessary when only executing (prefilters) | |
| // but it'll be ignored by the caller in that case | |
| return selection; | |
| } | |
| // A special extend for ajax options | |
| // that takes "flat" options (not to be deep extended) | |
| // Fixes #9887 | |
| function ajaxExtend( target, src ) { | |
| var key, deep, | |
| flatOptions = jQuery.ajaxSettings.flatOptions || {}; | |
| for ( key in src ) { | |
| if ( src[ key ] !== undefined ) { | |
| ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; | |
| } | |
| } | |
| if ( deep ) { | |
| jQuery.extend( true, target, deep ); | |
| } | |
| } | |
| jQuery.fn.extend({ | |
| load: function( url, params, callback ) { | |
| if ( typeof url !== "string" && _load ) { | |
| return _load.apply( this, arguments ); | |
| // Don't do a request if no elements are being requested | |
| } else if ( !this.length ) { | |
| return this; | |
| } | |
| var off = url.indexOf( " " ); | |
| if ( off >= 0 ) { | |
| var selector = url.slice( off, url.length ); | |
| url = url.slice( 0, off ); | |
| } | |
| // Default to a GET request | |
| var type = "GET"; | |
| // If the second parameter was provided | |
| if ( params ) { | |
| // If it's a function | |
| if ( jQuery.isFunction( params ) ) { | |
| // We assume that it's the callback | |
| callback = params; | |
| params = undefined; | |
| // Otherwise, build a param string | |
| } else if ( typeof params === "object" ) { | |
| params = jQuery.param( params, jQuery.ajaxSettings.traditional ); | |
| type = "POST"; | |
| } | |
| } | |
| var self = this; | |
| // Request the remote document | |
| jQuery.ajax({ | |
| url: url, | |
| type: type, | |
| dataType: "html", | |
| data: params, | |
| // Complete callback (responseText is used internally) | |
| complete: function( jqXHR, status, responseText ) { | |
| // Store the response as specified by the jqXHR object | |
| responseText = jqXHR.responseText; | |
| // If successful, inject the HTML into all the matched elements | |
| if ( jqXHR.isResolved() ) { | |
| // #4825: Get the actual response in case | |
| // a dataFilter is present in ajaxSettings | |
| jqXHR.done(function( r ) { | |
| responseText = r; | |
| }); | |
| // See if a selector was specified | |
| self.html( selector ? | |
| // Create a dummy div to hold the results | |
| jQuery("<div>") | |
| // inject the contents of the document in, removing the scripts | |
| // to avoid any 'Permission Denied' errors in IE | |
| .append(responseText.replace(rscript, "")) | |
| // Locate the specified elements | |
| .find(selector) : | |
| // If not, just inject the full result | |
| responseText ); | |
| } | |
| if ( callback ) { | |
| self.each( callback, [ responseText, status, jqXHR ] ); | |
| } | |
| } | |
| }); | |
| return this; | |
| }, | |
| serialize: function() { | |
| return jQuery.param( this.serializeArray() ); | |
| }, | |
| serializeArray: function() { | |
| return this.map(function(){ | |
| return this.elements ? jQuery.makeArray( this.elements ) : this; | |
| }) | |
| .filter(function(){ | |
| return this.name && !this.disabled && | |
| ( this.checked || rselectTextarea.test( this.nodeName ) || | |
| rinput.test( this.type ) ); | |
| }) | |
| .map(function( i, elem ){ | |
| var val = jQuery( this ).val(); | |
| return val == null ? | |
| null : | |
| jQuery.isArray( val ) ? | |
| jQuery.map( val, function( val, i ){ | |
| return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; | |
| }) : | |
| { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; | |
| }).get(); | |
| } | |
| }); | |
| // Attach a bunch of functions for handling common AJAX events | |
| jQuery.each( "ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split( " " ), function( i, o ){ | |
| jQuery.fn[ o ] = function( f ){ | |
| return this.on( o, f ); | |
| }; | |
| }); | |
| jQuery.each( [ "get", "post" ], function( i, method ) { | |
| jQuery[ method ] = function( url, data, callback, type ) { | |
| // shift arguments if data argument was omitted | |
| if ( jQuery.isFunction( data ) ) { | |
| type = type || callback; | |
| callback = data; | |
| data = undefined; | |
| } | |
| return jQuery.ajax({ | |
| type: method, | |
| url: url, | |
| data: data, | |
| success: callback, | |
| dataType: type | |
| }); | |
| }; | |
| }); | |
| jQuery.extend({ | |
| getScript: function( url, callback ) { | |
| return jQuery.get( url, undefined, callback, "script" ); | |
| }, | |
| getJSON: function( url, data, callback ) { | |
| return jQuery.get( url, data, callback, "json" ); | |
| }, | |
| // Creates a full fledged settings object into target | |
| // with both ajaxSettings and settings fields. | |
| // If target is omitted, writes into ajaxSettings. | |
| ajaxSetup: function( target, settings ) { | |
| if ( settings ) { | |
| // Building a settings object | |
| ajaxExtend( target, jQuery.ajaxSettings ); | |
| } else { | |
| // Extending ajaxSettings | |
| settings = target; | |
| target = jQuery.ajaxSettings; | |
| } | |
| ajaxExtend( target, settings ); | |
| return target; | |
| }, | |
| ajaxSettings: { | |
| url: ajaxLocation, | |
| isLocal: rlocalProtocol.test( ajaxLocParts[ 1 ] ), | |
| global: true, | |
| type: "GET", | |
| contentType: "application/x-www-form-urlencoded; charset=UTF-8", | |
| processData: true, | |
| async: true, | |
| /* | |
| timeout: 0, | |
| data: null, | |
| dataType: null, | |
| username: null, | |
| password: null, | |
| cache: null, | |
| traditional: false, | |
| headers: {}, | |
| */ | |
| accepts: { | |
| xml: "application/xml, text/xml", | |
| html: "text/html", | |
| text: "text/plain", | |
| json: "application/json, text/javascript", | |
| "*": allTypes | |
| }, | |
| contents: { | |
| xml: /xml/, | |
| html: /html/, | |
| json: /json/ | |
| }, | |
| responseFields: { | |
| xml: "responseXML", | |
| text: "responseText" | |
| }, | |
| // List of data converters | |
| // 1) key format is "source_type destination_type" (a single space in-between) | |
| // 2) the catchall symbol "*" can be used for source_type | |
| converters: { | |
| // Convert anything to text | |
| "* text": window.String, | |
| // Text to html (true = no transformation) | |
| "text html": true, | |
| // Evaluate text as a json expression | |
| "text json": jQuery.parseJSON, | |
| // Parse text as xml | |
| "text xml": jQuery.parseXML | |
| }, | |
| // For options that shouldn't be deep extended: | |
| // you can add your own custom options here if | |
| // and when you create one that shouldn't be | |
| // deep extended (see ajaxExtend) | |
| flatOptions: { | |
| context: true, | |
| url: true | |
| } | |
| }, | |
| ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), | |
| ajaxTransport: addToPrefiltersOrTransports( transports ), | |
| // Main method | |
| ajax: function( url, options ) { | |
| // If url is an object, simulate pre-1.5 signature | |
| if ( typeof url === "object" ) { | |
| options = url; | |
| url = undefined; | |
| } | |
| // Force options to be an object | |
| options = options || {}; | |
| var // Create the final options object | |
| s = jQuery.ajaxSetup( {}, options ), | |
| // Callbacks context | |
| callbackContext = s.context || s, | |
| // Context for global events | |
| // It's the callbackContext if one was provided in the options | |
| // and if it's a DOM node or a jQuery collection | |
| globalEventContext = callbackContext !== s && | |
| ( callbackContext.nodeType || callbackContext instanceof jQuery ) ? | |
| jQuery( callbackContext ) : jQuery.event, | |
| // Deferreds | |
| deferred = jQuery.Deferred(), | |
| completeDeferred = jQuery.Callbacks( "once memory" ), | |
| // Status-dependent callbacks | |
| statusCode = s.statusCode || {}, | |
| // ifModified key | |
| ifModifiedKey, | |
| // Headers (they are sent all at once) | |
| requestHeaders = {}, | |
| requestHeadersNames = {}, | |
| // Response headers | |
| responseHeadersString, | |
| responseHeaders, | |
| // transport | |
| transport, | |
| // timeout handle | |
| timeoutTimer, | |
| // Cross-domain detection vars | |
| parts, | |
| // The jqXHR state | |
| state = 0, | |
| // To know if global events are to be dispatched | |
| fireGlobals, | |
| // Loop variable | |
| i, | |
| // Fake xhr | |
| jqXHR = { | |
| readyState: 0, | |
| // Caches the header | |
| setRequestHeader: function( name, value ) { | |
| if ( !state ) { | |
| var lname = name.toLowerCase(); | |
| name = requestHeadersNames[ lname ] = requestHeadersNames[ lname ] || name; | |
| requestHeaders[ name ] = value; | |
| } | |
| return this; | |
| }, | |
| // Raw string | |
| getAllResponseHeaders: function() { | |
| return state === 2 ? responseHeadersString : null; | |
| }, | |
| // Builds headers hashtable if needed | |
| getResponseHeader: function( key ) { | |
| var match; | |
| if ( state === 2 ) { | |
| if ( !responseHeaders ) { | |
| responseHeaders = {}; | |
| while( ( match = rheaders.exec( responseHeadersString ) ) ) { | |
| responseHeaders[ match[1].toLowerCase() ] = match[ 2 ]; | |
| } | |
| } | |
| match = responseHeaders[ key.toLowerCase() ]; | |
| } | |
| return match === undefined ? null : match; | |
| }, | |
| // Overrides response content-type header | |
| overrideMimeType: function( type ) { | |
| if ( !state ) { | |
| s.mimeType = type; | |
| } | |
| return this; | |
| }, | |
| // Cancel the request | |
| abort: function( statusText ) { | |
| statusText = statusText || "abort"; | |
| if ( transport ) { | |
| transport.abort( statusText ); | |
| } | |
| done( 0, statusText ); | |
| return this; | |
| } | |
| }; | |
| // Callback for when everything is done | |
| // It is defined here because jslint complains if it is declared | |
| // at the end of the function (which would be more logical and readable) | |
| function done( status, nativeStatusText, responses, headers ) { | |
| // Called once | |
| if ( state === 2 ) { | |
| return; | |
| } | |
| // State is "done" now | |
| state = 2; | |
| // Clear timeout if it exists | |
| if ( timeoutTimer ) { | |
| clearTimeout( timeoutTimer ); | |
| } | |
| // Dereference transport for early garbage collection | |
| // (no matter how long the jqXHR object will be used) | |
| transport = undefined; | |
| // Cache response headers | |
| responseHeadersString = headers || ""; | |
| // Set readyState | |
| jqXHR.readyState = status > 0 ? 4 : 0; | |
| var isSuccess, | |
| success, | |
| error, | |
| statusText = nativeStatusText, | |
| response = responses ? ajaxHandleResponses( s, jqXHR, responses ) : undefined, | |
| lastModified, | |
| etag; | |
| // If successful, handle type chaining | |
| if ( status >= 200 && status < 300 || status === 304 ) { | |
| // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. | |
| if ( s.ifModified ) { | |
| if ( ( lastModified = jqXHR.getResponseHeader( "Last-Modified" ) ) ) { | |
| jQuery.lastModified[ ifModifiedKey ] = lastModified; | |
| } | |
| if ( ( etag = jqXHR.getResponseHeader( "Etag" ) ) ) { | |
| jQuery.etag[ ifModifiedKey ] = etag; | |
| } | |
| } | |
| // If not modified | |
| if ( status === 304 ) { | |
| statusText = "notmodified"; | |
| isSuccess = true; | |
| // If we have data | |
| } else { | |
| try { | |
| success = ajaxConvert( s, response ); | |
| statusText = "success"; | |
| isSuccess = true; | |
| } catch(e) { | |
| // We have a parsererror | |
| statusText = "parsererror"; | |
| error = e; | |
| } | |
| } | |
| } else { | |
| // We extract error from statusText | |
| // then normalize statusText and status for non-aborts | |
| error = statusText; | |
| if ( !statusText || status ) { | |
| statusText = "error"; | |
| if ( status < 0 ) { | |
| status = 0; | |
| } | |
| } | |
| } | |
| // Set data for the fake xhr object | |
| jqXHR.status = status; | |
| jqXHR.statusText = "" + ( nativeStatusText || statusText ); | |
| // Success/Error | |
| if ( isSuccess ) { | |
| deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); | |
| } else { | |
| deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); | |
| } | |
| // Status-dependent callbacks | |
| jqXHR.statusCode( statusCode ); | |
| statusCode = undefined; | |
| if ( fireGlobals ) { | |
| globalEventContext.trigger( "ajax" + ( isSuccess ? "Success" : "Error" ), | |
| [ jqXHR, s, isSuccess ? success : error ] ); | |
| } | |
| // Complete | |
| completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); | |
| if ( fireGlobals ) { | |
| globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); | |
| // Handle the global AJAX counter | |
| if ( !( --jQuery.active ) ) { | |
| jQuery.event.trigger( "ajaxStop" ); | |
| } | |
| } | |
| } | |
| // Attach deferreds | |
| deferred.promise( jqXHR ); | |
| jqXHR.success = jqXHR.done; | |
| jqXHR.error = jqXHR.fail; | |
| jqXHR.complete = completeDeferred.add; | |
| // Status-dependent callbacks | |
| jqXHR.statusCode = function( map ) { | |
| if ( map ) { | |
| var tmp; | |
| if ( state < 2 ) { | |
| for ( tmp in map ) { | |
| statusCode[ tmp ] = [ statusCode[tmp], map[tmp] ]; | |
| } | |
| } else { | |
| tmp = map[ jqXHR.status ]; | |
| jqXHR.then( tmp, tmp ); | |
| } | |
| } | |
| return this; | |
| }; | |
| // Remove hash character (#7531: and string promotion) | |
| // Add protocol if not provided (#5866: IE7 issue with protocol-less urls) | |
| // We also use the url parameter if available | |
| s.url = ( ( url || s.url ) + "" ).replace( rhash, "" ).replace( rprotocol, ajaxLocParts[ 1 ] + "//" ); | |
| // Extract dataTypes list | |
| s.dataTypes = jQuery.trim( s.dataType || "*" ).toLowerCase().split( rspacesAjax ); | |
| // Determine if a cross-domain request is in order | |
| if ( s.crossDomain == null ) { | |
| parts = rurl.exec( s.url.toLowerCase() ); | |
| s.crossDomain = !!( parts && | |
| ( parts[ 1 ] != ajaxLocParts[ 1 ] || parts[ 2 ] != ajaxLocParts[ 2 ] || | |
| ( parts[ 3 ] || ( parts[ 1 ] === "http:" ? 80 : 443 ) ) != | |
| ( ajaxLocParts[ 3 ] || ( ajaxLocParts[ 1 ] === "http:" ? 80 : 443 ) ) ) | |
| ); | |
| } | |
| // Convert data if not already a string | |
| if ( s.data && s.processData && typeof s.data !== "string" ) { | |
| s.data = jQuery.param( s.data, s.traditional ); | |
| } | |
| // Apply prefilters | |
| inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); | |
| // If request was aborted inside a prefilter, stop there | |
| if ( state === 2 ) { | |
| return false; | |
| } | |
| // We can fire global events as of now if asked to | |
| fireGlobals = s.global; | |
| // Uppercase the type | |
| s.type = s.type.toUpperCase(); | |
| // Determine if request has content | |
| s.hasContent = !rnoContent.test( s.type ); | |
| // Watch for a new set of requests | |
| if ( fireGlobals && jQuery.active++ === 0 ) { | |
| jQuery.event.trigger( "ajaxStart" ); | |
| } | |
| // More options handling for requests with no content | |
| if ( !s.hasContent ) { | |
| // If data is available, append data to url | |
| if ( s.data ) { | |
| s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.data; | |
| // #9682: remove data so that it's not used in an eventual retry | |
| delete s.data; | |
| } | |
| // Get ifModifiedKey before adding the anti-cache parameter | |
| ifModifiedKey = s.url; | |
| // Add anti-cache in url if needed | |
| if ( s.cache === false ) { | |
| var ts = jQuery.now(), | |
| // try replacing _= if it is there | |
| ret = s.url.replace( rts, "$1_=" + ts ); | |
| // if nothing was replaced, add timestamp to the end | |
| s.url = ret + ( ( ret === s.url ) ? ( rquery.test( s.url ) ? "&" : "?" ) + "_=" + ts : "" ); | |
| } | |
| } | |
| // Set the correct header, if data is being sent | |
| if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { | |
| jqXHR.setRequestHeader( "Content-Type", s.contentType ); | |
| } | |
| // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. | |
| if ( s.ifModified ) { | |
| ifModifiedKey = ifModifiedKey || s.url; | |
| if ( jQuery.lastModified[ ifModifiedKey ] ) { | |
| jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ ifModifiedKey ] ); | |
| } | |
| if ( jQuery.etag[ ifModifiedKey ] ) { | |
| jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ ifModifiedKey ] ); | |
| } | |
| } | |
| // Set the Accepts header for the server, depending on the dataType | |
| jqXHR.setRequestHeader( | |
| "Accept", | |
| s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[0] ] ? | |
| s.accepts[ s.dataTypes[0] ] + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : | |
| s.accepts[ "*" ] | |
| ); | |
| // Check for headers option | |
| for ( i in s.headers ) { | |
| jqXHR.setRequestHeader( i, s.headers[ i ] ); | |
| } | |
| // Allow custom headers/mimetypes and early abort | |
| if ( s.beforeSend && ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || state === 2 ) ) { | |
| // Abort if not done already | |
| jqXHR.abort(); | |
| return false; | |
| } | |
| // Install callbacks on deferreds | |
| for ( i in { success: 1, error: 1, complete: 1 } ) { | |
| jqXHR[ i ]( s[ i ] ); | |
| } | |
| // Get transport | |
| transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); | |
| // If no transport, we auto-abort | |
| if ( !transport ) { | |
| done( -1, "No Transport" ); | |
| } else { | |
| jqXHR.readyState = 1; | |
| // Send global event | |
| if ( fireGlobals ) { | |
| globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); | |
| } | |
| // Timeout | |
| if ( s.async && s.timeout > 0 ) { | |
| timeoutTimer = setTimeout( function(){ | |
| jqXHR.abort( "timeout" ); | |
| }, s.timeout ); | |
| } | |
| try { | |
| state = 1; | |
| transport.send( requestHeaders, done ); | |
| } catch (e) { | |
| // Propagate exception as error if not done | |
| if ( state < 2 ) { | |
| done( -1, e ); | |
| // Simply rethrow otherwise | |
| } else { | |
| throw e; | |
| } | |
| } | |
| } | |
| return jqXHR; | |
| }, | |
| // Serialize an array of form elements or a set of | |
| // key/values into a query string | |
| param: function( a, traditional ) { | |
| var s = [], | |
| add = function( key, value ) { | |
| // If value is a function, invoke it and return its value | |
| value = jQuery.isFunction( value ) ? value() : value; | |
| s[ s.length ] = encodeURIComponent( key ) + "=" + encodeURIComponent( value ); | |
| }; | |
| // Set traditional to true for jQuery <= 1.3.2 behavior. | |
| if ( traditional === undefined ) { | |
| traditional = jQuery.ajaxSettings.traditional; | |
| } | |
| // If an array was passed in, assume that it is an array of form elements. | |
| if ( jQuery.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { | |
| // Serialize the form elements | |
| jQuery.each( a, function() { | |
| add( this.name, this.value ); | |
| }); | |
| } else { | |
| // If traditional, encode the "old" way (the way 1.3.2 or older | |
| // did it), otherwise encode params recursively. | |
| for ( var prefix in a ) { | |
| buildParams( prefix, a[ prefix ], traditional, add ); | |
| } | |
| } | |
| // Return the resulting serialization | |
| return s.join( "&" ).replace( r20, "+" ); | |
| } | |
| }); | |
| function buildParams( prefix, obj, traditional, add ) { | |
| if ( jQuery.isArray( obj ) ) { | |
| // Serialize array item. | |
| jQuery.each( obj, function( i, v ) { | |
| if ( traditional || rbracket.test( prefix ) ) { | |
| // Treat each array item as a scalar. | |
| add( prefix, v ); | |
| } else { | |
| // If array item is non-scalar (array or object), encode its | |
| // numeric index to resolve deserialization ambiguity issues. | |
| // Note that rack (as of 1.0.0) can't currently deserialize | |
| // nested arrays properly, and attempting to do so may cause | |
| // a server error. Possible fixes are to modify rack's | |
| // deserialization algorithm or to provide an option or flag | |
| // to force array serialization to be shallow. | |
| buildParams( prefix + "[" + ( typeof v === "object" ? i : "" ) + "]", v, traditional, add ); | |
| } | |
| }); | |
| } else if ( !traditional && jQuery.type( obj ) === "object" ) { | |
| // Serialize object item. | |
| for ( var name in obj ) { | |
| buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); | |
| } | |
| } else { | |
| // Serialize scalar item. | |
| add( prefix, obj ); | |
| } | |
| } | |
| // This is still on the jQuery object... for now | |
| // Want to move this to jQuery.ajax some day | |
| jQuery.extend({ | |
| // Counter for holding the number of active queries | |
| active: 0, | |
| // Last-Modified header cache for next request | |
| lastModified: {}, | |
| etag: {} | |
| }); | |
| /* Handles responses to an ajax request: | |
| * - sets all responseXXX fields accordingly | |
| * - finds the right dataType (mediates between content-type and expected dataType) | |
| * - returns the corresponding response | |
| */ | |
| function ajaxHandleResponses( s, jqXHR, responses ) { | |
| var contents = s.contents, | |
| dataTypes = s.dataTypes, | |
| responseFields = s.responseFields, | |
| ct, | |
| type, | |
| finalDataType, | |
| firstDataType; | |
| // Fill responseXXX fields | |
| for ( type in responseFields ) { | |
| if ( type in responses ) { | |
| jqXHR[ responseFields[type] ] = responses[ type ]; | |
| } | |
| } | |
| // Remove auto dataType and get content-type in the process | |
| while( dataTypes[ 0 ] === "*" ) { | |
| dataTypes.shift(); | |
| if ( ct === undefined ) { | |
| ct = s.mimeType || jqXHR.getResponseHeader( "content-type" ); | |
| } | |
| } | |
| // Check if we're dealing with a known content-type | |
| if ( ct ) { | |
| for ( type in contents ) { | |
| if ( contents[ type ] && contents[ type ].test( ct ) ) { | |
| dataTypes.unshift( type ); | |
| break; | |
| } | |
| } | |
| } | |
| // Check to see if we have a response for the expected dataType | |
| if ( dataTypes[ 0 ] in responses ) { | |
| finalDataType = dataTypes[ 0 ]; | |
| } else { | |
| // Try convertible dataTypes | |
| for ( type in responses ) { | |
| if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[0] ] ) { | |
| finalDataType = type; | |
| break; | |
| } | |
| if ( !firstDataType ) { | |
| firstDataType = type; | |
| } | |
| } | |
| // Or just use first one | |
| finalDataType = finalDataType || firstDataType; | |
| } | |
| // If we found a dataType | |
| // We add the dataType to the list if needed | |
| // and return the corresponding response | |
| if ( finalDataType ) { | |
| if ( finalDataType !== dataTypes[ 0 ] ) { | |
| dataTypes.unshift( finalDataType ); | |
| } | |
| return responses[ finalDataType ]; | |
| } | |
| } | |
| // Chain conversions given the request and the original response | |
| function ajaxConvert( s, response ) { | |
| // Apply the dataFilter if provided | |
| if ( s.dataFilter ) { | |
| response = s.dataFilter( response, s.dataType ); | |
| } | |
| var dataTypes = s.dataTypes, | |
| converters = {}, | |
| i, | |
| key, | |
| length = dataTypes.length, | |
| tmp, | |
| // Current and previous dataTypes | |
| current = dataTypes[ 0 ], | |
| prev, | |
| // Conversion expression | |
| conversion, | |
| // Conversion function | |
| conv, | |
| // Conversion functions (transitive conversion) | |
| conv1, | |
| conv2; | |
| // For each dataType in the chain | |
| for ( i = 1; i < length; i++ ) { | |
| // Create converters map | |
| // with lowercased keys | |
| if ( i === 1 ) { | |
| for ( key in s.converters ) { | |
| if ( typeof key === "string" ) { | |
| converters[ key.toLowerCase() ] = s.converters[ key ]; | |
| } | |
| } | |
| } | |
| // Get the dataTypes | |
| prev = current; | |
| current = dataTypes[ i ]; | |
| // If current is auto dataType, update it to prev | |
| if ( current === "*" ) { | |
| current = prev; | |
| // If no auto and dataTypes are actually different | |
| } else if ( prev !== "*" && prev !== current ) { | |
| // Get the converter | |
| conversion = prev + " " + current; | |
| conv = converters[ conversion ] || converters[ "* " + current ]; | |
| // If there is no direct converter, search transitively | |
| if ( !conv ) { | |
| conv2 = undefined; | |
| for ( conv1 in converters ) { | |
| tmp = conv1.split( " " ); | |
| if ( tmp[ 0 ] === prev || tmp[ 0 ] === "*" ) { | |
| conv2 = converters[ tmp[1] + " " + current ]; | |
| if ( conv2 ) { | |
| conv1 = converters[ conv1 ]; | |
| if ( conv1 === true ) { | |
| conv = conv2; | |
| } else if ( conv2 === true ) { | |
| conv = conv1; | |
| } | |
| break; | |
| } | |
| } | |
| } | |
| } | |
| // If we found no converter, dispatch an error | |
| if ( !( conv || conv2 ) ) { | |
| jQuery.error( "No conversion from " + conversion.replace(" "," to ") ); | |
| } | |
| // If found converter is not an equivalence | |
| if ( conv !== true ) { | |
| // Convert with 1 or 2 converters accordingly | |
| response = conv ? conv( response ) : conv2( conv1(response) ); | |
| } | |
| } | |
| } | |
| return response; | |
| } | |
| var jsc = jQuery.now(), | |
| jsre = /(\=)\?(&|$)|\?\?/i; | |
| // Default jsonp settings | |
| jQuery.ajaxSetup({ | |
| jsonp: "callback", | |
| jsonpCallback: function() { | |
| return jQuery.expando + "_" + ( jsc++ ); | |
| } | |
| }); | |
| // Detect, normalize options and install callbacks for jsonp requests | |
| jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { | |
| var inspectData = ( typeof s.data === "string" ) && /^application\/x\-www\-form\-urlencoded/.test( s.contentType ); | |
| if ( s.dataTypes[ 0 ] === "jsonp" || | |
| s.jsonp !== false && ( jsre.test( s.url ) || | |
| inspectData && jsre.test( s.data ) ) ) { | |
| var responseContainer, | |
| jsonpCallback = s.jsonpCallback = | |
| jQuery.isFunction( s.jsonpCallback ) ? s.jsonpCallback() : s.jsonpCallback, | |
| previous = window[ jsonpCallback ], | |
| url = s.url, | |
| data = s.data, | |
| replace = "$1" + jsonpCallback + "$2"; | |
| if ( s.jsonp !== false ) { | |
| url = url.replace( jsre, replace ); | |
| if ( s.url === url ) { | |
| if ( inspectData ) { | |
| data = data.replace( jsre, replace ); | |
| } | |
| if ( s.data === data ) { | |
| // Add callback manually | |
| url += (/\?/.test( url ) ? "&" : "?") + s.jsonp + "=" + jsonpCallback; | |
| } | |
| } | |
| } | |
| s.url = url; | |
| s.data = data; | |
| // Install callback | |
| window[ jsonpCallback ] = function( response ) { | |
| responseContainer = [ response ]; | |
| }; | |
| // Clean-up function | |
| jqXHR.always(function() { | |
| // Set callback back to previous value | |
| window[ jsonpCallback ] = previous; | |
| // Call if it was a function and we have a response | |
| if ( responseContainer && jQuery.isFunction( previous ) ) { | |
| window[ jsonpCallback ]( responseContainer[ 0 ] ); | |
| } | |
| }); | |
| // Use data converter to retrieve json after script execution | |
| s.converters["script json"] = function() { | |
| if ( !responseContainer ) { | |
| jQuery.error( jsonpCallback + " was not called" ); | |
| } | |
| return responseContainer[ 0 ]; | |
| }; | |
| // force json dataType | |
| s.dataTypes[ 0 ] = "json"; | |
| // Delegate to script | |
| return "script"; | |
| } | |
| }); | |
| // Install script dataType | |
| jQuery.ajaxSetup({ | |
| accepts: { | |
| script: "text/javascript, application/javascript, application/ecmascript, application/x-ecmascript" | |
| }, | |
| contents: { | |
| script: /javascript|ecmascript/ | |
| }, | |
| converters: { | |
| "text script": function( text ) { | |
| jQuery.globalEval( text ); | |
| return text; | |
| } | |
| } | |
| }); | |
| // Handle cache's special case and global | |
| jQuery.ajaxPrefilter( "script", function( s ) { | |
| if ( s.cache === undefined ) { | |
| s.cache = false; | |
| } | |
| if ( s.crossDomain ) { | |
| s.type = "GET"; | |
| s.global = false; | |
| } | |
| }); | |
| // Bind script tag hack transport | |
| jQuery.ajaxTransport( "script", function(s) { | |
| // This transport only deals with cross domain requests | |
| if ( s.crossDomain ) { | |
| var script, | |
| head = document.head || document.getElementsByTagName( "head" )[0] || document.documentElement; | |
| return { | |
| send: function( _, callback ) { | |
| script = document.createElement( "script" ); | |
| script.async = "async"; | |
| if ( s.scriptCharset ) { | |
| script.charset = s.scriptCharset; | |
| } | |
| script.src = s.url; | |
| // Attach handlers for all browsers | |
| script.onload = script.onreadystatechange = function( _, isAbort ) { | |
| if ( isAbort || !script.readyState || /loaded|complete/.test( script.readyState ) ) { | |
| // Handle memory leak in IE | |
| script.onload = script.onreadystatechange = null; | |
| // Remove the script | |
| if ( head && script.parentNode ) { | |
| head.removeChild( script ); | |
| } | |
| // Dereference the script | |
| script = undefined; | |
| // Callback if not abort | |
| if ( !isAbort ) { | |
| callback( 200, "success" ); | |
| } | |
| } | |
| }; | |
| // Use insertBefore instead of appendChild to circumvent an IE6 bug. | |
| // This arises when a base node is used (#2709 and #4378). | |
| head.insertBefore( script, head.firstChild ); | |
| }, | |
| abort: function() { | |
| if ( script ) { | |
| script.onload( 0, 1 ); | |
| } | |
| } | |
| }; | |
| } | |
| }); | |
| var // #5280: Internet Explorer will keep connections alive if we don't abort on unload | |
| xhrOnUnloadAbort = window.ActiveXObject ? function() { | |
| // Abort all pending requests | |
| for ( var key in xhrCallbacks ) { | |
| xhrCallbacks[ key ]( 0, 1 ); | |
| } | |
| } : false, | |
| xhrId = 0, | |
| xhrCallbacks; | |
| // Functions to create xhrs | |
| function createStandardXHR() { | |
| try { | |
| return new window.XMLHttpRequest(); | |
| } catch( e ) {} | |
| } | |
| function createActiveXHR() { | |
| try { | |
| return new window.ActiveXObject( "Microsoft.XMLHTTP" ); | |
| } catch( e ) {} | |
| } | |
| // Create the request object | |
| // (This is still attached to ajaxSettings for backward compatibility) | |
| jQuery.ajaxSettings.xhr = window.ActiveXObject ? | |
| /* Microsoft failed to properly | |
| * implement the XMLHttpRequest in IE7 (can't request local files), | |
| * so we use the ActiveXObject when it is available | |
| * Additionally XMLHttpRequest can be disabled in IE7/IE8 so | |
| * we need a fallback. | |
| */ | |
| function() { | |
| return !this.isLocal && createStandardXHR() || createActiveXHR(); | |
| } : | |
| // For all other browsers, use the standard XMLHttpRequest object | |
| createStandardXHR; | |
| // Determine support properties | |
| (function( xhr ) { | |
| jQuery.extend( jQuery.support, { | |
| ajax: !!xhr, | |
| cors: !!xhr && ( "withCredentials" in xhr ) | |
| }); | |
| })( jQuery.ajaxSettings.xhr() ); | |
| // Create transport if the browser can provide an xhr | |
| if ( jQuery.support.ajax ) { | |
| jQuery.ajaxTransport(function( s ) { | |
| // Cross domain only allowed if supported through XMLHttpRequest | |
| if ( !s.crossDomain || jQuery.support.cors ) { | |
| var callback; | |
| return { | |
| send: function( headers, complete ) { | |
| // Get a new xhr | |
| var xhr = s.xhr(), | |
| handle, | |
| i; | |
| // Open the socket | |
| // Passing null username, generates a login popup on Opera (#2865) | |
| if ( s.username ) { | |
| xhr.open( s.type, s.url, s.async, s.username, s.password ); | |
| } else { | |
| xhr.open( s.type, s.url, s.async ); | |
| } | |
| // Apply custom fields if provided | |
| if ( s.xhrFields ) { | |
| for ( i in s.xhrFields ) { | |
| xhr[ i ] = s.xhrFields[ i ]; | |
| } | |
| } | |
| // Override mime type if needed | |
| if ( s.mimeType && xhr.overrideMimeType ) { | |
| xhr.overrideMimeType( s.mimeType ); | |
| } | |
| // X-Requested-With header | |
| // For cross-domain requests, seeing as conditions for a preflight are | |
| // akin to a jigsaw puzzle, we simply never set it to be sure. | |
| // (it can always be set on a per-request basis or even using ajaxSetup) | |
| // For same-domain requests, won't change header if already provided. | |
| if ( !s.crossDomain && !headers["X-Requested-With"] ) { | |
| headers[ "X-Requested-With" ] = "XMLHttpRequest"; | |
| } | |
| // Need an extra try/catch for cross domain requests in Firefox 3 | |
| try { | |
| for ( i in headers ) { | |
| xhr.setRequestHeader( i, headers[ i ] ); | |
| } | |
| } catch( _ ) {} | |
| // Do send the request | |
| // This may raise an exception which is actually | |
| // handled in jQuery.ajax (so no try/catch here) | |
| xhr.send( ( s.hasContent && s.data ) || null ); | |
| // Listener | |
| callback = function( _, isAbort ) { | |
| var status, | |
| statusText, | |
| responseHeaders, | |
| responses, | |
| xml; | |
| // Firefox throws exceptions when accessing properties | |
| // of an xhr when a network error occured | |
| // http://helpful.knobs-dials.com/index.php/Component_returned_failure_code:_0x80040111_(NS_ERROR_NOT_AVAILABLE) | |
| try { | |
| // Was never called and is aborted or complete | |
| if ( callback && ( isAbort || xhr.readyState === 4 ) ) { | |
| // Only called once | |
| callback = undefined; | |
| // Do not keep as active anymore | |
| if ( handle ) { | |
| xhr.onreadystatechange = jQuery.noop; | |
| if ( xhrOnUnloadAbort ) { | |
| delete xhrCallbacks[ handle ]; | |
| } | |
| } | |
| // If it's an abort | |
| if ( isAbort ) { | |
| // Abort it manually if needed | |
| if ( xhr.readyState !== 4 ) { | |
| xhr.abort(); | |
| } | |
| } else { | |
| status = xhr.status; | |
| responseHeaders = xhr.getAllResponseHeaders(); | |
| responses = {}; | |
| xml = xhr.responseXML; | |
| // Construct response list | |
| if ( xml && xml.documentElement /* #4958 */ ) { | |
| responses.xml = xml; | |
| } | |
| // When requesting binary data, IE6-9 will throw an exception | |
| // on any attempt to access responseText (#11426) | |
| try { | |
| responses.text = xhr.responseText; | |
| } catch( _ ) { | |
| } | |
| // Firefox throws an exception when accessing | |
| // statusText for faulty cross-domain requests | |
| try { | |
| statusText = xhr.statusText; | |
| } catch( e ) { | |
| // We normalize with Webkit giving an empty statusText | |
| statusText = ""; | |
| } | |
| // Filter status for non standard behaviors | |
| // If the request is local and we have data: assume a success | |
| // (success with no data won't get notified, that's the best we | |
| // can do given current implementations) | |
| if ( !status && s.isLocal && !s.crossDomain ) { | |
| status = responses.text ? 200 : 404; | |
| // IE - #1450: sometimes returns 1223 when it should be 204 | |
| } else if ( status === 1223 ) { | |
| status = 204; | |
| } | |
| } | |
| } | |
| } catch( firefoxAccessException ) { | |
| if ( !isAbort ) { | |
| complete( -1, firefoxAccessException ); | |
| } | |
| } | |
| // Call complete if needed | |
| if ( responses ) { | |
| complete( status, statusText, responses, responseHeaders ); | |
| } | |
| }; | |
| // if we're in sync mode or it's in cache | |
| // and has been retrieved directly (IE6 & IE7) | |
| // we need to manually fire the callback | |
| if ( !s.async || xhr.readyState === 4 ) { | |
| callback(); | |
| } else { | |
| handle = ++xhrId; | |
| if ( xhrOnUnloadAbort ) { | |
| // Create the active xhrs callbacks list if needed | |
| // and attach the unload handler | |
| if ( !xhrCallbacks ) { | |
| xhrCallbacks = {}; | |
| jQuery( window ).unload( xhrOnUnloadAbort ); | |
| } | |
| // Add to list of active xhrs callbacks | |
| xhrCallbacks[ handle ] = callback; | |
| } | |
| xhr.onreadystatechange = callback; | |
| } | |
| }, | |
| abort: function() { | |
| if ( callback ) { | |
| callback(0,1); | |
| } | |
| } | |
| }; | |
| } | |
| }); | |
| } | |
| var elemdisplay = {}, | |
| iframe, iframeDoc, | |
| rfxtypes = /^(?:toggle|show|hide)$/, | |
| rfxnum = /^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i, | |
| timerId, | |
| fxAttrs = [ | |
| // height animations | |
| [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], | |
| // width animations | |
| [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], | |
| // opacity animations | |
| [ "opacity" ] | |
| ], | |
| fxNow; | |
| jQuery.fn.extend({ | |
| show: function( speed, easing, callback ) { | |
| var elem, display; | |
| if ( speed || speed === 0 ) { | |
| return this.animate( genFx("show", 3), speed, easing, callback ); | |
| } else { | |
| for ( var i = 0, j = this.length; i < j; i++ ) { | |
| elem = this[ i ]; | |
| if ( elem.style ) { | |
| display = elem.style.display; | |
| // Reset the inline display of this element to learn if it is | |
| // being hidden by cascaded rules or not | |
| if ( !jQuery._data(elem, "olddisplay") && display === "none" ) { | |
| display = elem.style.display = ""; | |
| } | |
| // Set elements which have been overridden with display: none | |
| // in a stylesheet to whatever the default browser style is | |
| // for such an element | |
| if ( (display === "" && jQuery.css(elem, "display") === "none") || | |
| !jQuery.contains( elem.ownerDocument.documentElement, elem ) ) { | |
| jQuery._data( elem, "olddisplay", defaultDisplay(elem.nodeName) ); | |
| } | |
| } | |
| } | |
| // Set the display of most of the elements in a second loop | |
| // to avoid the constant reflow | |
| for ( i = 0; i < j; i++ ) { | |
| elem = this[ i ]; | |
| if ( elem.style ) { | |
| display = elem.style.display; | |
| if ( display === "" || display === "none" ) { | |
| elem.style.display = jQuery._data( elem, "olddisplay" ) || ""; | |
| } | |
| } | |
| } | |
| return this; | |
| } | |
| }, | |
| hide: function( speed, easing, callback ) { | |
| if ( speed || speed === 0 ) { | |
| return this.animate( genFx("hide", 3), speed, easing, callback); | |
| } else { | |
| var elem, display, | |
| i = 0, | |
| j = this.length; | |
| for ( ; i < j; i++ ) { | |
| elem = this[i]; | |
| if ( elem.style ) { | |
| display = jQuery.css( elem, "display" ); | |
| if ( display !== "none" && !jQuery._data( elem, "olddisplay" ) ) { | |
| jQuery._data( elem, "olddisplay", display ); | |
| } | |
| } | |
| } | |
| // Set the display of the elements in a second loop | |
| // to avoid the constant reflow | |
| for ( i = 0; i < j; i++ ) { | |
| if ( this[i].style ) { | |
| this[i].style.display = "none"; | |
| } | |
| } | |
| return this; | |
| } | |
| }, | |
| // Save the old toggle function | |
| _toggle: jQuery.fn.toggle, | |
| toggle: function( fn, fn2, callback ) { | |
| var bool = typeof fn === "boolean"; | |
| if ( jQuery.isFunction(fn) && jQuery.isFunction(fn2) ) { | |
| this._toggle.apply( this, arguments ); | |
| } else if ( fn == null || bool ) { | |
| this.each(function() { | |
| var state = bool ? fn : jQuery(this).is(":hidden"); | |
| jQuery(this)[ state ? "show" : "hide" ](); | |
| }); | |
| } else { | |
| this.animate(genFx("toggle", 3), fn, fn2, callback); | |
| } | |
| return this; | |
| }, | |
| fadeTo: function( speed, to, easing, callback ) { | |
| return this.filter(":hidden").css("opacity", 0).show().end() | |
| .animate({opacity: to}, speed, easing, callback); | |
| }, | |
| animate: function( prop, speed, easing, callback ) { | |
| var optall = jQuery.speed( speed, easing, callback ); | |
| if ( jQuery.isEmptyObject( prop ) ) { | |
| return this.each( optall.complete, [ false ] ); | |
| } | |
| // Do not change referenced properties as per-property easing will be lost | |
| prop = jQuery.extend( {}, prop ); | |
| function doAnimation() { | |
| // XXX 'this' does not always have a nodeName when running the | |
| // test suite | |
| if ( optall.queue === false ) { | |
| jQuery._mark( this ); | |
| } | |
| var opt = jQuery.extend( {}, optall ), | |
| isElement = this.nodeType === 1, | |
| hidden = isElement && jQuery(this).is(":hidden"), | |
| name, val, p, e, hooks, replace, | |
| parts, start, end, unit, | |
| method; | |
| // will store per property easing and be used to determine when an animation is complete | |
| opt.animatedProperties = {}; | |
| // first pass over propertys to expand / normalize | |
| for ( p in prop ) { | |
| name = jQuery.camelCase( p ); | |
| if ( p !== name ) { | |
| prop[ name ] = prop[ p ]; | |
| delete prop[ p ]; | |
| } | |
| if ( ( hooks = jQuery.cssHooks[ name ] ) && "expand" in hooks ) { | |
| replace = hooks.expand( prop[ name ] ); | |
| delete prop[ name ]; | |
| // not quite $.extend, this wont overwrite keys already present. | |
| // also - reusing 'p' from above because we have the correct "name" | |
| for ( p in replace ) { | |
| if ( ! ( p in prop ) ) { | |
| prop[ p ] = replace[ p ]; | |
| } | |
| } | |
| } | |
| } | |
| for ( name in prop ) { | |
| val = prop[ name ]; | |
| // easing resolution: per property > opt.specialEasing > opt.easing > 'swing' (default) | |
| if ( jQuery.isArray( val ) ) { | |
| opt.animatedProperties[ name ] = val[ 1 ]; | |
| val = prop[ name ] = val[ 0 ]; | |
| } else { | |
| opt.animatedProperties[ name ] = opt.specialEasing && opt.specialEasing[ name ] || opt.easing || 'swing'; | |
| } | |
| if ( val === "hide" && hidden || val === "show" && !hidden ) { | |
| return opt.complete.call( this ); | |
| } | |
| if ( isElement && ( name === "height" || name === "width" ) ) { | |
| // Make sure that nothing sneaks out | |
| // Record all 3 overflow attributes because IE does not | |
| // change the overflow attribute when overflowX and | |
| // overflowY are set to the same value | |
| opt.overflow = [ this.style.overflow, this.style.overflowX, this.style.overflowY ]; | |
| // Set display property to inline-block for height/width | |
| // animations on inline elements that are having width/height animated | |
| if ( jQuery.css( this, "display" ) === "inline" && | |
| jQuery.css( this, "float" ) === "none" ) { | |
| // inline-level elements accept inline-block; | |
| // block-level elements need to be inline with layout | |
| if ( !jQuery.support.inlineBlockNeedsLayout || defaultDisplay( this.nodeName ) === "inline" ) { | |
| this.style.display = "inline-block"; | |
| } else { | |
| this.style.zoom = 1; | |
| } | |
| } | |
| } | |
| } | |
| if ( opt.overflow != null ) { | |
| this.style.overflow = "hidden"; | |
| } | |
| for ( p in prop ) { | |
| e = new jQuery.fx( this, opt, p ); | |
| val = prop[ p ]; | |
| if ( rfxtypes.test( val ) ) { | |
| // Tracks whether to show or hide based on private | |
| // data attached to the element | |
| method = jQuery._data( this, "toggle" + p ) || ( val === "toggle" ? hidden ? "show" : "hide" : 0 ); | |
| if ( method ) { | |
| jQuery._data( this, "toggle" + p, method === "show" ? "hide" : "show" ); | |
| e[ method ](); | |
| } else { | |
| e[ val ](); | |
| } | |
| } else { | |
| parts = rfxnum.exec( val ); | |
| start = e.cur(); | |
| if ( parts ) { | |
| end = parseFloat( parts[2] ); | |
| unit = parts[3] || ( jQuery.cssNumber[ p ] ? "" : "px" ); | |
| // We need to compute starting value | |
| if ( unit !== "px" ) { | |
| jQuery.style( this, p, (end || 1) + unit); | |
| start = ( (end || 1) / e.cur() ) * start; | |
| jQuery.style( this, p, start + unit); | |
| } | |
| // If a +=/-= token was provided, we're doing a relative animation | |
| if ( parts[1] ) { | |
| end = ( (parts[ 1 ] === "-=" ? -1 : 1) * end ) + start; | |
| } | |
| e.custom( start, end, unit ); | |
| } else { | |
| e.custom( start, val, "" ); | |
| } | |
| } | |
| } | |
| // For JS strict compliance | |
| return true; | |
| } | |
| return optall.queue === false ? | |
| this.each( doAnimation ) : | |
| this.queue( optall.queue, doAnimation ); | |
| }, | |
| stop: function( type, clearQueue, gotoEnd ) { | |
| if ( typeof type !== "string" ) { | |
| gotoEnd = clearQueue; | |
| clearQueue = type; | |
| type = undefined; | |
| } | |
| if ( clearQueue && type !== false ) { | |
| this.queue( type || "fx", [] ); | |
| } | |
| return this.each(function() { | |
| var index, | |
| hadTimers = false, | |
| timers = jQuery.timers, | |
| data = jQuery._data( this ); | |
| // clear marker counters if we know they won't be | |
| if ( !gotoEnd ) { | |
| jQuery._unmark( true, this ); | |
| } | |
| function stopQueue( elem, data, index ) { | |
| var hooks = data[ index ]; | |
| jQuery.removeData( elem, index, true ); | |
| hooks.stop( gotoEnd ); | |
| } | |
| if ( type == null ) { | |
| for ( index in data ) { | |
| if ( data[ index ] && data[ index ].stop && index.indexOf(".run") === index.length - 4 ) { | |
| stopQueue( this, data, index ); | |
| } | |
| } | |
| } else if ( data[ index = type + ".run" ] && data[ index ].stop ){ | |
| stopQueue( this, data, index ); | |
| } | |
| for ( index = timers.length; index--; ) { | |
| if ( timers[ index ].elem === this && (type == null || timers[ index ].queue === type) ) { | |
| if ( gotoEnd ) { | |
| // force the next step to be the last | |
| timers[ index ]( true ); | |
| } else { | |
| timers[ index ].saveState(); | |
| } | |
| hadTimers = true; | |
| timers.splice( index, 1 ); | |
| } | |
| } | |
| // start the next in the queue if the last step wasn't forced | |
| // timers currently will call their complete callbacks, which will dequeue | |
| // but only if they were gotoEnd | |
| if ( !( gotoEnd && hadTimers ) ) { | |
| jQuery.dequeue( this, type ); | |
| } | |
| }); | |
| } | |
| }); | |
| // Animations created synchronously will run synchronously | |
| function createFxNow() { | |
| setTimeout( clearFxNow, 0 ); | |
| return ( fxNow = jQuery.now() ); | |
| } | |
| function clearFxNow() { | |
| fxNow = undefined; | |
| } | |
| // Generate parameters to create a standard animation | |
| function genFx( type, num ) { | |
| var obj = {}; | |
| jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice( 0, num )), function() { | |
| obj[ this ] = type; | |
| }); | |
| return obj; | |
| } | |
| // Generate shortcuts for custom animations | |
| jQuery.each({ | |
| slideDown: genFx( "show", 1 ), | |
| slideUp: genFx( "hide", 1 ), | |
| slideToggle: genFx( "toggle", 1 ), | |
| fadeIn: { opacity: "show" }, | |
| fadeOut: { opacity: "hide" }, | |
| fadeToggle: { opacity: "toggle" } | |
| }, function( name, props ) { | |
| jQuery.fn[ name ] = function( speed, easing, callback ) { | |
| return this.animate( props, speed, easing, callback ); | |
| }; | |
| }); | |
| jQuery.extend({ | |
| speed: function( speed, easing, fn ) { | |
| var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { | |
| complete: fn || !fn && easing || | |
| jQuery.isFunction( speed ) && speed, | |
| duration: speed, | |
| easing: fn && easing || easing && !jQuery.isFunction( easing ) && easing | |
| }; | |
| opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : | |
| opt.duration in jQuery.fx.speeds ? jQuery.fx.speeds[ opt.duration ] : jQuery.fx.speeds._default; | |
| // normalize opt.queue - true/undefined/null -> "fx" | |
| if ( opt.queue == null || opt.queue === true ) { | |
| opt.queue = "fx"; | |
| } | |
| // Queueing | |
| opt.old = opt.complete; | |
| opt.complete = function( noUnmark ) { | |
| if ( jQuery.isFunction( opt.old ) ) { | |
| opt.old.call( this ); | |
| } | |
| if ( opt.queue ) { | |
| jQuery.dequeue( this, opt.queue ); | |
| } else if ( noUnmark !== false ) { | |
| jQuery._unmark( this ); | |
| } | |
| }; | |
| return opt; | |
| }, | |
| easing: { | |
| linear: function( p ) { | |
| return p; | |
| }, | |
| swing: function( p ) { | |
| return ( -Math.cos( p*Math.PI ) / 2 ) + 0.5; | |
| } | |
| }, | |
| timers: [], | |
| fx: function( elem, options, prop ) { | |
| this.options = options; | |
| this.elem = elem; | |
| this.prop = prop; | |
| options.orig = options.orig || {}; | |
| } | |
| }); | |
| jQuery.fx.prototype = { | |
| // Simple function for setting a style value | |
| update: function() { | |
| if ( this.options.step ) { | |
| this.options.step.call( this.elem, this.now, this ); | |
| } | |
| ( jQuery.fx.step[ this.prop ] || jQuery.fx.step._default )( this ); | |
| }, | |
| // Get the current size | |
| cur: function() { | |
| if ( this.elem[ this.prop ] != null && (!this.elem.style || this.elem.style[ this.prop ] == null) ) { | |
| return this.elem[ this.prop ]; | |
| } | |
| var parsed, | |
| r = jQuery.css( this.elem, this.prop ); | |
| // Empty strings, null, undefined and "auto" are converted to 0, | |
| // complex values such as "rotate(1rad)" are returned as is, | |
| // simple values such as "10px" are parsed to Float. | |
| return isNaN( parsed = parseFloat( r ) ) ? !r || r === "auto" ? 0 : r : parsed; | |
| }, | |
| // Start an animation from one number to another | |
| custom: function( from, to, unit ) { | |
| var self = this, | |
| fx = jQuery.fx; | |
| this.startTime = fxNow || createFxNow(); | |
| this.end = to; | |
| this.now = this.start = from; | |
| this.pos = this.state = 0; | |
| this.unit = unit || this.unit || ( jQuery.cssNumber[ this.prop ] ? "" : "px" ); | |
| function t( gotoEnd ) { | |
| return self.step( gotoEnd ); | |
| } | |
| t.queue = this.options.queue; | |
| t.elem = this.elem; | |
| t.saveState = function() { | |
| if ( jQuery._data( self.elem, "fxshow" + self.prop ) === undefined ) { | |
| if ( self.options.hide ) { | |
| jQuery._data( self.elem, "fxshow" + self.prop, self.start ); | |
| } else if ( self.options.show ) { | |
| jQuery._data( self.elem, "fxshow" + self.prop, self.end ); | |
| } | |
| } | |
| }; | |
| if ( t() && jQuery.timers.push(t) && !timerId ) { | |
| timerId = setInterval( fx.tick, fx.interval ); | |
| } | |
| }, | |
| // Simple 'show' function | |
| show: function() { | |
| var dataShow = jQuery._data( this.elem, "fxshow" + this.prop ); | |
| // Remember where we started, so that we can go back to it later | |
| this.options.orig[ this.prop ] = dataShow || jQuery.style( this.elem, this.prop ); | |
| this.options.show = true; | |
| // Begin the animation | |
| // Make sure that we start at a small width/height to avoid any flash of content | |
| if ( dataShow !== undefined ) { | |
| // This show is picking up where a previous hide or show left off | |
| this.custom( this.cur(), dataShow ); | |
| } else { | |
| this.custom( this.prop === "width" || this.prop === "height" ? 1 : 0, this.cur() ); | |
| } | |
| // Start by showing the element | |
| jQuery( this.elem ).show(); | |
| }, | |
| // Simple 'hide' function | |
| hide: function() { | |
| // Remember where we started, so that we can go back to it later | |
| this.options.orig[ this.prop ] = jQuery._data( this.elem, "fxshow" + this.prop ) || jQuery.style( this.elem, this.prop ); | |
| this.options.hide = true; | |
| // Begin the animation | |
| this.custom( this.cur(), 0 ); | |
| }, | |
| // Each step of an animation | |
| step: function( gotoEnd ) { | |
| var p, n, complete, | |
| t = fxNow || createFxNow(), | |
| done = true, | |
| elem = this.elem, | |
| options = this.options; | |
| if ( gotoEnd || t >= options.duration + this.startTime ) { | |
| this.now = this.end; | |
| this.pos = this.state = 1; | |
| this.update(); | |
| options.animatedProperties[ this.prop ] = true; | |
| for ( p in options.animatedProperties ) { | |
| if ( options.animatedProperties[ p ] !== true ) { | |
| done = false; | |
| } | |
| } | |
| if ( done ) { | |
| // Reset the overflow | |
| if ( options.overflow != null && !jQuery.support.shrinkWrapBlocks ) { | |
| jQuery.each( [ "", "X", "Y" ], function( index, value ) { | |
| elem.style[ "overflow" + value ] = options.overflow[ index ]; | |
| }); | |
| } | |
| // Hide the element if the "hide" operation was done | |
| if ( options.hide ) { | |
| jQuery( elem ).hide(); | |
| } | |
| // Reset the properties, if the item has been hidden or shown | |
| if ( options.hide || options.show ) { | |
| for ( p in options.animatedProperties ) { | |
| jQuery.style( elem, p, options.orig[ p ] ); | |
| jQuery.removeData( elem, "fxshow" + p, true ); | |
| // Toggle data is no longer needed | |
| jQuery.removeData( elem, "toggle" + p, true ); | |
| } | |
| } | |
| // Execute the complete function | |
| // in the event that the complete function throws an exception | |
| // we must ensure it won't be called twice. #5684 | |
| complete = options.complete; | |
| if ( complete ) { | |
| options.complete = false; | |
| complete.call( elem ); | |
| } | |
| } | |
| return false; | |
| } else { | |
| // classical easing cannot be used with an Infinity duration | |
| if ( options.duration == Infinity ) { | |
| this.now = t; | |
| } else { | |
| n = t - this.startTime; | |
| this.state = n / options.duration; | |
| // Perform the easing function, defaults to swing | |
| this.pos = jQuery.easing[ options.animatedProperties[this.prop] ]( this.state, n, 0, 1, options.duration ); | |
| this.now = this.start + ( (this.end - this.start) * this.pos ); | |
| } | |
| // Perform the next step of the animation | |
| this.update(); | |
| } | |
| return true; | |
| } | |
| }; | |
| jQuery.extend( jQuery.fx, { | |
| tick: function() { | |
| var timer, | |
| timers = jQuery.timers, | |
| i = 0; | |
| for ( ; i < timers.length; i++ ) { | |
| timer = timers[ i ]; | |
| // Checks the timer has not already been removed | |
| if ( !timer() && timers[ i ] === timer ) { | |
| timers.splice( i--, 1 ); | |
| } | |
| } | |
| if ( !timers.length ) { | |
| jQuery.fx.stop(); | |
| } | |
| }, | |
| interval: 13, | |
| stop: function() { | |
| clearInterval( timerId ); | |
| timerId = null; | |
| }, | |
| speeds: { | |
| slow: 600, | |
| fast: 200, | |
| // Default speed | |
| _default: 400 | |
| }, | |
| step: { | |
| opacity: function( fx ) { | |
| jQuery.style( fx.elem, "opacity", fx.now ); | |
| }, | |
| _default: function( fx ) { | |
| if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) { | |
| fx.elem.style[ fx.prop ] = fx.now + fx.unit; | |
| } else { | |
| fx.elem[ fx.prop ] = fx.now; | |
| } | |
| } | |
| } | |
| }); | |
| // Ensure props that can't be negative don't go there on undershoot easing | |
| jQuery.each( fxAttrs.concat.apply( [], fxAttrs ), function( i, prop ) { | |
| // exclude marginTop, marginLeft, marginBottom and marginRight from this list | |
| if ( prop.indexOf( "margin" ) ) { | |
| jQuery.fx.step[ prop ] = function( fx ) { | |
| jQuery.style( fx.elem, prop, Math.max(0, fx.now) + fx.unit ); | |
| }; | |
| } | |
| }); | |
| if ( jQuery.expr && jQuery.expr.filters ) { | |
| jQuery.expr.filters.animated = function( elem ) { | |
| return jQuery.grep(jQuery.timers, function( fn ) { | |
| return elem === fn.elem; | |
| }).length; | |
| }; | |
| } | |
| // Try to restore the default display value of an element | |
| function defaultDisplay( nodeName ) { | |
| if ( !elemdisplay[ nodeName ] ) { | |
| var body = document.body, | |
| elem = jQuery( "<" + nodeName + ">" ).appendTo( body ), | |
| display = elem.css( "display" ); | |
| elem.remove(); | |
| // If the simple way fails, | |
| // get element's real default display by attaching it to a temp iframe | |
| if ( display === "none" || display === "" ) { | |
| // No iframe to use yet, so create it | |
| if ( !iframe ) { | |
| iframe = document.createElement( "iframe" ); | |
| iframe.frameBorder = iframe.width = iframe.height = 0; | |
| } | |
| body.appendChild( iframe ); | |
| // Create a cacheable copy of the iframe document on first call. | |
| // IE and Opera will allow us to reuse the iframeDoc without re-writing the fake HTML | |
| // document to it; WebKit & Firefox won't allow reusing the iframe document. | |
| if ( !iframeDoc || !iframe.createElement ) { | |
| iframeDoc = ( iframe.contentWindow || iframe.contentDocument ).document; | |
| iframeDoc.write( ( jQuery.support.boxModel ? "<!doctype html>" : "" ) + "<html><body>" ); | |
| iframeDoc.close(); | |
| } | |
| elem = iframeDoc.createElement( nodeName ); | |
| iframeDoc.body.appendChild( elem ); | |
| display = jQuery.css( elem, "display" ); | |
| body.removeChild( iframe ); | |
| } | |
| // Store the correct default display | |
| elemdisplay[ nodeName ] = display; | |
| } | |
| return elemdisplay[ nodeName ]; | |
| } | |
| var getOffset, | |
| rtable = /^t(?:able|d|h)$/i, | |
| rroot = /^(?:body|html)$/i; | |
| if ( "getBoundingClientRect" in document.documentElement ) { | |
| getOffset = function( elem, doc, docElem, box ) { | |
| try { | |
| box = elem.getBoundingClientRect(); | |
| } catch(e) {} | |
| // Make sure we're not dealing with a disconnected DOM node | |
| if ( !box || !jQuery.contains( docElem, elem ) ) { | |
| return box ? { top: box.top, left: box.left } : { top: 0, left: 0 }; | |
| } | |
| var body = doc.body, | |
| win = getWindow( doc ), | |
| clientTop = docElem.clientTop || body.clientTop || 0, | |
| clientLeft = docElem.clientLeft || body.clientLeft || 0, | |
| scrollTop = win.pageYOffset || jQuery.support.boxModel && docElem.scrollTop || body.scrollTop, | |
| scrollLeft = win.pageXOffset || jQuery.support.boxModel && docElem.scrollLeft || body.scrollLeft, | |
| top = box.top + scrollTop - clientTop, | |
| left = box.left + scrollLeft - clientLeft; | |
| return { top: top, left: left }; | |
| }; | |
| } else { | |
| getOffset = function( elem, doc, docElem ) { | |
| var computedStyle, | |
| offsetParent = elem.offsetParent, | |
| prevOffsetParent = elem, | |
| body = doc.body, | |
| defaultView = doc.defaultView, | |
| prevComputedStyle = defaultView ? defaultView.getComputedStyle( elem, null ) : elem.currentStyle, | |
| top = elem.offsetTop, | |
| left = elem.offsetLeft; | |
| while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { | |
| if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) { | |
| break; | |
| } | |
| computedStyle = defaultView ? defaultView.getComputedStyle(elem, null) : elem.currentStyle; | |
| top -= elem.scrollTop; | |
| left -= elem.scrollLeft; | |
| if ( elem === offsetParent ) { | |
| top += elem.offsetTop; | |
| left += elem.offsetLeft; | |
| if ( jQuery.support.doesNotAddBorder && !(jQuery.support.doesAddBorderForTableAndCells && rtable.test(elem.nodeName)) ) { | |
| top += parseFloat( computedStyle.borderTopWidth ) || 0; | |
| left += parseFloat( computedStyle.borderLeftWidth ) || 0; | |
| } | |
| prevOffsetParent = offsetParent; | |
| offsetParent = elem.offsetParent; | |
| } | |
| if ( jQuery.support.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) { | |
| top += parseFloat( computedStyle.borderTopWidth ) || 0; | |
| left += parseFloat( computedStyle.borderLeftWidth ) || 0; | |
| } | |
| prevComputedStyle = computedStyle; | |
| } | |
| if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) { | |
| top += body.offsetTop; | |
| left += body.offsetLeft; | |
| } | |
| if ( jQuery.support.fixedPosition && prevComputedStyle.position === "fixed" ) { | |
| top += Math.max( docElem.scrollTop, body.scrollTop ); | |
| left += Math.max( docElem.scrollLeft, body.scrollLeft ); | |
| } | |
| return { top: top, left: left }; | |
| }; | |
| } | |
| jQuery.fn.offset = function( options ) { | |
| if ( arguments.length ) { | |
| return options === undefined ? | |
| this : | |
| this.each(function( i ) { | |
| jQuery.offset.setOffset( this, options, i ); | |
| }); | |
| } | |
| var elem = this[0], | |
| doc = elem && elem.ownerDocument; | |
| if ( !doc ) { | |
| return null; | |
| } | |
| if ( elem === doc.body ) { | |
| return jQuery.offset.bodyOffset( elem ); | |
| } | |
| return getOffset( elem, doc, doc.documentElement ); | |
| }; | |
| jQuery.offset = { | |
| bodyOffset: function( body ) { | |
| var top = body.offsetTop, | |
| left = body.offsetLeft; | |
| if ( jQuery.support.doesNotIncludeMarginInBodyOffset ) { | |
| top += parseFloat( jQuery.css(body, "marginTop") ) || 0; | |
| left += parseFloat( jQuery.css(body, "marginLeft") ) || 0; | |
| } | |
| return { top: top, left: left }; | |
| }, | |
| setOffset: function( elem, options, i ) { | |
| var position = jQuery.css( elem, "position" ); | |
| // set position first, in-case top/left are set even on static elem | |
| if ( position === "static" ) { | |
| elem.style.position = "relative"; | |
| } | |
| var curElem = jQuery( elem ), | |
| curOffset = curElem.offset(), | |
| curCSSTop = jQuery.css( elem, "top" ), | |
| curCSSLeft = jQuery.css( elem, "left" ), | |
| calculatePosition = ( position === "absolute" || position === "fixed" ) && jQuery.inArray("auto", [curCSSTop, curCSSLeft]) > -1, | |
| props = {}, curPosition = {}, curTop, curLeft; | |
| // need to be able to calculate position if either top or left is auto and position is either absolute or fixed | |
| if ( calculatePosition ) { | |
| curPosition = curElem.position(); | |
| curTop = curPosition.top; | |
| curLeft = curPosition.left; | |
| } else { | |
| curTop = parseFloat( curCSSTop ) || 0; | |
| curLeft = parseFloat( curCSSLeft ) || 0; | |
| } | |
| if ( jQuery.isFunction( options ) ) { | |
| options = options.call( elem, i, curOffset ); | |
| } | |
| if ( options.top != null ) { | |
| props.top = ( options.top - curOffset.top ) + curTop; | |
| } | |
| if ( options.left != null ) { | |
| props.left = ( options.left - curOffset.left ) + curLeft; | |
| } | |
| if ( "using" in options ) { | |
| options.using.call( elem, props ); | |
| } else { | |
| curElem.css( props ); | |
| } | |
| } | |
| }; | |
| jQuery.fn.extend({ | |
| position: function() { | |
| if ( !this[0] ) { | |
| return null; | |
| } | |
| var elem = this[0], | |
| // Get *real* offsetParent | |
| offsetParent = this.offsetParent(), | |
| // Get correct offsets | |
| offset = this.offset(), | |
| parentOffset = rroot.test(offsetParent[0].nodeName) ? { top: 0, left: 0 } : offsetParent.offset(); | |
| // Subtract element margins | |
| // note: when an element has margin: auto the offsetLeft and marginLeft | |
| // are the same in Safari causing offset.left to incorrectly be 0 | |
| offset.top -= parseFloat( jQuery.css(elem, "marginTop") ) || 0; | |
| offset.left -= parseFloat( jQuery.css(elem, "marginLeft") ) || 0; | |
| // Add offsetParent borders | |
| parentOffset.top += parseFloat( jQuery.css(offsetParent[0], "borderTopWidth") ) || 0; | |
| parentOffset.left += parseFloat( jQuery.css(offsetParent[0], "borderLeftWidth") ) || 0; | |
| // Subtract the two offsets | |
| return { | |
| top: offset.top - parentOffset.top, | |
| left: offset.left - parentOffset.left | |
| }; | |
| }, | |
| offsetParent: function() { | |
| return this.map(function() { | |
| var offsetParent = this.offsetParent || document.body; | |
| while ( offsetParent && (!rroot.test(offsetParent.nodeName) && jQuery.css(offsetParent, "position") === "static") ) { | |
| offsetParent = offsetParent.offsetParent; | |
| } | |
| return offsetParent; | |
| }); | |
| } | |
| }); | |
| // Create scrollLeft and scrollTop methods | |
| jQuery.each( {scrollLeft: "pageXOffset", scrollTop: "pageYOffset"}, function( method, prop ) { | |
| var top = /Y/.test( prop ); | |
| jQuery.fn[ method ] = function( val ) { | |
| return jQuery.access( this, function( elem, method, val ) { | |
| var win = getWindow( elem ); | |
| if ( val === undefined ) { | |
| return win ? (prop in win) ? win[ prop ] : | |
| jQuery.support.boxModel && win.document.documentElement[ method ] || | |
| win.document.body[ method ] : | |
| elem[ method ]; | |
| } | |
| if ( win ) { | |
| win.scrollTo( | |
| !top ? val : jQuery( win ).scrollLeft(), | |
| top ? val : jQuery( win ).scrollTop() | |
| ); | |
| } else { | |
| elem[ method ] = val; | |
| } | |
| }, method, val, arguments.length, null ); | |
| }; | |
| }); | |
| function getWindow( elem ) { | |
| return jQuery.isWindow( elem ) ? | |
| elem : | |
| elem.nodeType === 9 ? | |
| elem.defaultView || elem.parentWindow : | |
| false; | |
| } | |
| // Create width, height, innerHeight, innerWidth, outerHeight and outerWidth methods | |
| jQuery.each( { Height: "height", Width: "width" }, function( name, type ) { | |
| var clientProp = "client" + name, | |
| scrollProp = "scroll" + name, | |
| offsetProp = "offset" + name; | |
| // innerHeight and innerWidth | |
| jQuery.fn[ "inner" + name ] = function() { | |
| var elem = this[0]; | |
| return elem ? | |
| elem.style ? | |
| parseFloat( jQuery.css( elem, type, "padding" ) ) : | |
| this[ type ]() : | |
| null; | |
| }; | |
| // outerHeight and outerWidth | |
| jQuery.fn[ "outer" + name ] = function( margin ) { | |
| var elem = this[0]; | |
| return elem ? | |
| elem.style ? | |
| parseFloat( jQuery.css( elem, type, margin ? "margin" : "border" ) ) : | |
| this[ type ]() : | |
| null; | |
| }; | |
| jQuery.fn[ type ] = function( value ) { | |
| return jQuery.access( this, function( elem, type, value ) { | |
| var doc, docElemProp, orig, ret; | |
| if ( jQuery.isWindow( elem ) ) { | |
| // 3rd condition allows Nokia support, as it supports the docElem prop but not CSS1Compat | |
| doc = elem.document; | |
| docElemProp = doc.documentElement[ clientProp ]; | |
| return jQuery.support.boxModel && docElemProp || | |
| doc.body && doc.body[ clientProp ] || docElemProp; | |
| } | |
| // Get document width or height | |
| if ( elem.nodeType === 9 ) { | |
| // Either scroll[Width/Height] or offset[Width/Height], whichever is greater | |
| doc = elem.documentElement; | |
| // when a window > document, IE6 reports a offset[Width/Height] > client[Width/Height] | |
| // so we can't use max, as it'll choose the incorrect offset[Width/Height] | |
| // instead we use the correct client[Width/Height] | |
| // support:IE6 | |
| if ( doc[ clientProp ] >= doc[ scrollProp ] ) { | |
| return doc[ clientProp ]; | |
| } | |
| return Math.max( | |
| elem.body[ scrollProp ], doc[ scrollProp ], | |
| elem.body[ offsetProp ], doc[ offsetProp ] | |
| ); | |
| } | |
| // Get width or height on the element | |
| if ( value === undefined ) { | |
| orig = jQuery.css( elem, type ); | |
| ret = parseFloat( orig ); | |
| return jQuery.isNumeric( ret ) ? ret : orig; | |
| } | |
| // Set the width or height on the element | |
| jQuery( elem ).css( type, value ); | |
| }, type, value, arguments.length, null ); | |
| }; | |
| }); | |
| // Expose jQuery to the global object | |
| window.jQuery = window.$ = jQuery; | |
| // Expose jQuery as an AMD module, but only for AMD loaders that | |
| // understand the issues with loading multiple versions of jQuery | |
| // in a page that all might call define(). The loader will indicate | |
| // they have special allowances for multiple jQuery versions by | |
| // specifying define.amd.jQuery = true. Register as a named module, | |
| // since jQuery can be concatenated with other files that may use define, | |
| // but not use a proper concatenation script that understands anonymous | |
| // AMD modules. A named AMD is safest and most robust way to register. | |
| // Lowercase jquery is used because AMD module names are derived from | |
| // file names, and jQuery is normally delivered in a lowercase file name. | |
| // Do this after creating the global so that if an AMD module wants to call | |
| // noConflict to hide this version of jQuery, it will work. | |
| if ( typeof define === "function" && define.amd && define.amd.jQuery ) { | |
| define( "jquery", [], function () { return jQuery; } ); | |
| } | |
| })( window ); |
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| // Underscore.js 1.3.3 | |
| // (c) 2009-2012 Jeremy Ashkenas, DocumentCloud Inc. | |
| // Underscore is freely distributable under the MIT license. | |
| // Portions of Underscore are inspired or borrowed from Prototype, | |
| // Oliver Steele's Functional, and John Resig's Micro-Templating. | |
| // For all details and documentation: | |
| // http://documentcloud.github.com/underscore | |
| (function() { | |
| // Baseline setup | |
| // -------------- | |
| // Establish the root object, `window` in the browser, or `global` on the server. | |
| var root = this; | |
| // Save the previous value of the `_` variable. | |
| var previousUnderscore = root._; | |
| // Establish the object that gets returned to break out of a loop iteration. | |
| var breaker = {}; | |
| // Save bytes in the minified (but not gzipped) version: | |
| var ArrayProto = Array.prototype, ObjProto = Object.prototype, FuncProto = Function.prototype; | |
| // Create quick reference variables for speed access to core prototypes. | |
| var push = ArrayProto.push, | |
| slice = ArrayProto.slice, | |
| unshift = ArrayProto.unshift, | |
| toString = ObjProto.toString, | |
| hasOwnProperty = ObjProto.hasOwnProperty; | |
| // All **ECMAScript 5** native function implementations that we hope to use | |
| // are declared here. | |
| var | |
| nativeForEach = ArrayProto.forEach, | |
| nativeMap = ArrayProto.map, | |
| nativeReduce = ArrayProto.reduce, | |
| nativeReduceRight = ArrayProto.reduceRight, | |
| nativeFilter = ArrayProto.filter, | |
| nativeEvery = ArrayProto.every, | |
| nativeSome = ArrayProto.some, | |
| nativeIndexOf = ArrayProto.indexOf, | |
| nativeLastIndexOf = ArrayProto.lastIndexOf, | |
| nativeIsArray = Array.isArray, | |
| nativeKeys = Object.keys, | |
| nativeBind = FuncProto.bind; | |
| // Create a safe reference to the Underscore object for use below. | |
| var _ = function(obj) { return new wrapper(obj); }; | |
| // Export the Underscore object for **Node.js**, with | |
| // backwards-compatibility for the old `require()` API. If we're in | |
| // the browser, add `_` as a global object via a string identifier, | |
| // for Closure Compiler "advanced" mode. | |
| if (typeof exports !== 'undefined') { | |
| if (typeof module !== 'undefined' && module.exports) { | |
| exports = module.exports = _; | |
| } | |
| exports._ = _; | |
| } else { | |
| root['_'] = _; | |
| } | |
| // Current version. | |
| _.VERSION = '1.3.3'; | |
| // Collection Functions | |
| // -------------------- | |
| // The cornerstone, an `each` implementation, aka `forEach`. | |
| // Handles objects with the built-in `forEach`, arrays, and raw objects. | |
| // Delegates to **ECMAScript 5**'s native `forEach` if available. | |
| var each = _.each = _.forEach = function(obj, iterator, context) { | |
| if (obj == null) return; | |
| if (nativeForEach && obj.forEach === nativeForEach) { | |
| obj.forEach(iterator, context); | |
| } else if (obj.length === +obj.length) { | |
| for (var i = 0, l = obj.length; i < l; i++) { | |
| if (iterator.call(context, obj[i], i, obj) === breaker) return; | |
| } | |
| } else { | |
| for (var key in obj) { | |
| if (_.has(obj, key)) { | |
| if (iterator.call(context, obj[key], key, obj) === breaker) return; | |
| } | |
| } | |
| } | |
| }; | |
| // Return the results of applying the iterator to each element. | |
| // Delegates to **ECMAScript 5**'s native `map` if available. | |
| _.map = _.collect = function(obj, iterator, context) { | |
| var results = []; | |
| if (obj == null) return results; | |
| if (nativeMap && obj.map === nativeMap) return obj.map(iterator, context); | |
| each(obj, function(value, index, list) { | |
| results[results.length] = iterator.call(context, value, index, list); | |
| }); | |
| return results; | |
| }; | |
| // **Reduce** builds up a single result from a list of values, aka `inject`, | |
| // or `foldl`. Delegates to **ECMAScript 5**'s native `reduce` if available. | |
| _.reduce = _.foldl = _.inject = function(obj, iterator, memo, context) { | |
| var initial = arguments.length > 2; | |
| if (obj == null) obj = []; | |
| if (nativeReduce && obj.reduce === nativeReduce) { | |
| if (context) iterator = _.bind(iterator, context); | |
| return initial ? obj.reduce(iterator, memo) : obj.reduce(iterator); | |
| } | |
| each(obj, function(value, index, list) { | |
| if (!initial) { | |
| memo = value; | |
| initial = true; | |
| } else { | |
| memo = iterator.call(context, memo, value, index, list); | |
| } | |
| }); | |
| if (!initial) throw new TypeError('Reduce of empty array with no initial value'); | |
| return memo; | |
| }; | |
| // The right-associative version of reduce, also known as `foldr`. | |
| // Delegates to **ECMAScript 5**'s native `reduceRight` if available. | |
| _.reduceRight = _.foldr = function(obj, iterator, memo, context) { | |
| var initial = arguments.length > 2; | |
| if (obj == null) obj = []; | |
| if (nativeReduceRight && obj.reduceRight === nativeReduceRight) { | |
| if (context) iterator = _.bind(iterator, context); | |
| return initial ? obj.reduceRight(iterator, memo) : obj.reduceRight(iterator); | |
| } | |
| var reversed = _.toArray(obj).reverse(); | |
| if (context && !initial) iterator = _.bind(iterator, context); | |
| return initial ? _.reduce(reversed, iterator, memo, context) : _.reduce(reversed, iterator); | |
| }; | |
| // Return the first value which passes a truth test. Aliased as `detect`. | |
| _.find = _.detect = function(obj, iterator, context) { | |
| var result; | |
| any(obj, function(value, index, list) { | |
| if (iterator.call(context, value, index, list)) { | |
| result = value; | |
| return true; | |
| } | |
| }); | |
| return result; | |
| }; | |
| // Return all the elements that pass a truth test. | |
| // Delegates to **ECMAScript 5**'s native `filter` if available. | |
| // Aliased as `select`. | |
| _.filter = _.select = function(obj, iterator, context) { | |
| var results = []; | |
| if (obj == null) return results; | |
| if (nativeFilter && obj.filter === nativeFilter) return obj.filter(iterator, context); | |
| each(obj, function(value, index, list) { | |
| if (iterator.call(context, value, index, list)) results[results.length] = value; | |
| }); | |
| return results; | |
| }; | |
| // Return all the elements for which a truth test fails. | |
| _.reject = function(obj, iterator, context) { | |
| var results = []; | |
| if (obj == null) return results; | |
| each(obj, function(value, index, list) { | |
| if (!iterator.call(context, value, index, list)) results[results.length] = value; | |
| }); | |
| return results; | |
| }; | |
| // Determine whether all of the elements match a truth test. | |
| // Delegates to **ECMAScript 5**'s native `every` if available. | |
| // Aliased as `all`. | |
| _.every = _.all = function(obj, iterator, context) { | |
| var result = true; | |
| if (obj == null) return result; | |
| if (nativeEvery && obj.every === nativeEvery) return obj.every(iterator, context); | |
| each(obj, function(value, index, list) { | |
| if (!(result = result && iterator.call(context, value, index, list))) return breaker; | |
| }); | |
| return !!result; | |
| }; | |
| // Determine if at least one element in the object matches a truth test. | |
| // Delegates to **ECMAScript 5**'s native `some` if available. | |
| // Aliased as `any`. | |
| var any = _.some = _.any = function(obj, iterator, context) { | |
| iterator || (iterator = _.identity); | |
| var result = false; | |
| if (obj == null) return result; | |
| if (nativeSome && obj.some === nativeSome) return obj.some(iterator, context); | |
| each(obj, function(value, index, list) { | |
| if (result || (result = iterator.call(context, value, index, list))) return breaker; | |
| }); | |
| return !!result; | |
| }; | |
| // Determine if a given value is included in the array or object using `===`. | |
| // Aliased as `contains`. | |
| _.include = _.contains = function(obj, target) { | |
| var found = false; | |
| if (obj == null) return found; | |
| if (nativeIndexOf && obj.indexOf === nativeIndexOf) return obj.indexOf(target) != -1; | |
| found = any(obj, function(value) { | |
| return value === target; | |
| }); | |
| return found; | |
| }; | |
| // Invoke a method (with arguments) on every item in a collection. | |
| _.invoke = function(obj, method) { | |
| var args = slice.call(arguments, 2); | |
| return _.map(obj, function(value) { | |
| return (_.isFunction(method) ? method : value[method]).apply(value, args); | |
| }); | |
| }; | |
| // Convenience version of a common use case of `map`: fetching a property. | |
| _.pluck = function(obj, key) { | |
| return _.map(obj, function(value){ return value[key]; }); | |
| }; | |
| // Return the maximum element or (element-based computation). | |
| // Can't optimize arrays of integers longer than 65,535 elements. | |
| // See: https://bugs.webkit.org/show_bug.cgi?id=80797 | |
| _.max = function(obj, iterator, context) { | |
| if (!iterator && _.isArray(obj) && obj[0] === +obj[0] && obj.length < 65535) { | |
| return Math.max.apply(Math, obj); | |
| } | |
| if (!iterator && _.isEmpty(obj)) return -Infinity; | |
| var result = {computed : -Infinity}; | |
| each(obj, function(value, index, list) { | |
| var computed = iterator ? iterator.call(context, value, index, list) : value; | |
| computed >= result.computed && (result = {value : value, computed : computed}); | |
| }); | |
| return result.value; | |
| }; | |
| // Return the minimum element (or element-based computation). | |
| _.min = function(obj, iterator, context) { | |
| if (!iterator && _.isArray(obj) && obj[0] === +obj[0] && obj.length < 65535) { | |
| return Math.min.apply(Math, obj); | |
| } | |
| if (!iterator && _.isEmpty(obj)) return Infinity; | |
| var result = {computed : Infinity}; | |
| each(obj, function(value, index, list) { | |
| var computed = iterator ? iterator.call(context, value, index, list) : value; | |
| computed < result.computed && (result = {value : value, computed : computed}); | |
| }); | |
| return result.value; | |
| }; | |
| // Shuffle an array. | |
| _.shuffle = function(obj) { | |
| var rand; | |
| var index = 0; | |
| var shuffled = []; | |
| each(obj, function(value) { | |
| rand = Math.floor(Math.random() * ++index); | |
| shuffled[index - 1] = shuffled[rand]; | |
| shuffled[rand] = value; | |
| }); | |
| return shuffled; | |
| }; | |
| // Sort the object's values by a criterion produced by an iterator. | |
| _.sortBy = function(obj, val, context) { | |
| var iterator = _.isFunction(val) ? val : function(obj) { return obj[val]; }; | |
| return _.pluck(_.map(obj, function(value, index, list) { | |
| return { | |
| value : value, | |
| criteria : iterator.call(context, value, index, list) | |
| }; | |
| }).sort(function(left, right) { | |
| var a = left.criteria, b = right.criteria; | |
| if (a === void 0) return 1; | |
| if (b === void 0) return -1; | |
| return a < b ? -1 : a > b ? 1 : 0; | |
| }), 'value'); | |
| }; | |
| // Groups the object's values by a criterion. Pass either a string attribute | |
| // to group by, or a function that returns the criterion. | |
| _.groupBy = function(obj, val) { | |
| var result = {}; | |
| var iterator = _.isFunction(val) ? val : function(obj) { return obj[val]; }; | |
| each(obj, function(value, index) { | |
| var key = iterator(value, index); | |
| (result[key] || (result[key] = [])).push(value); | |
| }); | |
| return result; | |
| }; | |
| // Use a comparator function to figure out the smallest index at which | |
| // an object should be inserted so as to maintain order. Uses binary search. | |
| _.sortedIndex = function(array, obj, iterator) { | |
| iterator || (iterator = _.identity); | |
| var value = iterator(obj); | |
| var low = 0, high = array.length; | |
| while (low < high) { | |
| var mid = (low + high) >> 1; | |
| iterator(array[mid]) < value ? low = mid + 1 : high = mid; | |
| } | |
| return low; | |
| }; | |
| // Safely convert anything iterable into a real, live array. | |
| _.toArray = function(obj) { | |
| if (!obj) return []; | |
| if (_.isArray(obj)) return slice.call(obj); | |
| if (_.isArguments(obj)) return slice.call(obj); | |
| if (obj.toArray && _.isFunction(obj.toArray)) return obj.toArray(); | |
| return _.values(obj); | |
| }; | |
| // Return the number of elements in an object. | |
| _.size = function(obj) { | |
| return _.isArray(obj) ? obj.length : _.keys(obj).length; | |
| }; | |
| // Array Functions | |
| // --------------- | |
| // Get the first element of an array. Passing **n** will return the first N | |
| // values in the array. Aliased as `head` and `take`. The **guard** check | |
| // allows it to work with `_.map`. | |
| _.first = _.head = _.take = function(array, n, guard) { | |
| return (n != null) && !guard ? slice.call(array, 0, n) : array[0]; | |
| }; | |
| // Returns everything but the last entry of the array. Especially useful on | |
| // the arguments object. Passing **n** will return all the values in | |
| // the array, excluding the last N. The **guard** check allows it to work with | |
| // `_.map`. | |
| _.initial = function(array, n, guard) { | |
| return slice.call(array, 0, array.length - ((n == null) || guard ? 1 : n)); | |
| }; | |
| // Get the last element of an array. Passing **n** will return the last N | |
| // values in the array. The **guard** check allows it to work with `_.map`. | |
| _.last = function(array, n, guard) { | |
| if ((n != null) && !guard) { | |
| return slice.call(array, Math.max(array.length - n, 0)); | |
| } else { | |
| return array[array.length - 1]; | |
| } | |
| }; | |
| // Returns everything but the first entry of the array. Aliased as `tail`. | |
| // Especially useful on the arguments object. Passing an **index** will return | |
| // the rest of the values in the array from that index onward. The **guard** | |
| // check allows it to work with `_.map`. | |
| _.rest = _.tail = function(array, index, guard) { | |
| return slice.call(array, (index == null) || guard ? 1 : index); | |
| }; | |
| // Trim out all falsy values from an array. | |
| _.compact = function(array) { | |
| return _.filter(array, function(value){ return !!value; }); | |
| }; | |
| // Internal implementation of a recursive `flatten` function. | |
| var flatten = function(input, shallow, output) { | |
| each(input, function(value) { | |
| if (_.isArray(value)) { | |
| shallow ? push.apply(output, value) : flatten(value, shallow, output); | |
| } else { | |
| output.push(value); | |
| } | |
| }); | |
| return output; | |
| }; | |
| // Return a completely flattened version of an array. | |
| _.flatten = function(array, shallow) { | |
| return flatten(array, shallow, []); | |
| }; | |
| // Return a version of the array that does not contain the specified value(s). | |
| _.without = function(array) { | |
| return _.difference(array, slice.call(arguments, 1)); | |
| }; | |
| // Produce a duplicate-free version of the array. If the array has already | |
| // been sorted, you have the option of using a faster algorithm. | |
| // Aliased as `unique`. | |
| _.uniq = _.unique = function(array, isSorted, iterator) { | |
| var initial = iterator ? _.map(array, iterator) : array; | |
| var results = []; | |
| _.reduce(initial, function(memo, value, index) { | |
| if (isSorted ? (_.last(memo) !== value || !memo.length) : !_.include(memo, value)) { | |
| memo.push(value); | |
| results.push(array[index]); | |
| } | |
| return memo; | |
| }, []); | |
| return results; | |
| }; | |
| // Produce an array that contains the union: each distinct element from all of | |
| // the passed-in arrays. | |
| _.union = function() { | |
| return _.uniq(flatten(arguments, true, [])); | |
| }; | |
| // Produce an array that contains every item shared between all the | |
| // passed-in arrays. | |
| _.intersection = function(array) { | |
| var rest = slice.call(arguments, 1); | |
| return _.filter(_.uniq(array), function(item) { | |
| return _.every(rest, function(other) { | |
| return _.indexOf(other, item) >= 0; | |
| }); | |
| }); | |
| }; | |
| // Take the difference between one array and a number of other arrays. | |
| // Only the elements present in just the first array will remain. | |
| _.difference = function(array) { | |
| var rest = flatten(slice.call(arguments, 1), true, []); | |
| return _.filter(array, function(value){ return !_.include(rest, value); }); | |
| }; | |
| // Zip together multiple lists into a single array -- elements that share | |
| // an index go together. | |
| _.zip = function() { | |
| var args = slice.call(arguments); | |
| var length = _.max(_.pluck(args, 'length')); | |
| var results = new Array(length); | |
| for (var i = 0; i < length; i++) { | |
| results[i] = _.pluck(args, "" + i); | |
| } | |
| return results; | |
| }; | |
| // Zip together two arrays -- an array of keys and an array of values -- into | |
| // a single object. | |
| _.zipObject = function(keys, values) { | |
| var result = {}; | |
| for (var i = 0, l = keys.length; i < l; i++) { | |
| result[keys[i]] = values[i]; | |
| } | |
| return result; | |
| }; | |
| // If the browser doesn't supply us with indexOf (I'm looking at you, **MSIE**), | |
| // we need this function. Return the position of the first occurrence of an | |
| // item in an array, or -1 if the item is not included in the array. | |
| // Delegates to **ECMAScript 5**'s native `indexOf` if available. | |
| // If the array is large and already in sort order, pass `true` | |
| // for **isSorted** to use binary search. | |
| _.indexOf = function(array, item, isSorted) { | |
| if (array == null) return -1; | |
| var i, l; | |
| if (isSorted) { | |
| i = _.sortedIndex(array, item); | |
| return array[i] === item ? i : -1; | |
| } | |
| if (nativeIndexOf && array.indexOf === nativeIndexOf) return array.indexOf(item); | |
| for (i = 0, l = array.length; i < l; i++) if (array[i] === item) return i; | |
| return -1; | |
| }; | |
| // Delegates to **ECMAScript 5**'s native `lastIndexOf` if available. | |
| _.lastIndexOf = function(array, item) { | |
| if (array == null) return -1; | |
| if (nativeLastIndexOf && array.lastIndexOf === nativeLastIndexOf) return array.lastIndexOf(item); | |
| var i = array.length; | |
| while (i--) if (array[i] === item) return i; | |
| return -1; | |
| }; | |
| // Generate an integer Array containing an arithmetic progression. A port of | |
| // the native Python `range()` function. See | |
| // [the Python documentation](http://docs.python.org/library/functions.html#range). | |
| _.range = function(start, stop, step) { | |
| if (arguments.length <= 1) { | |
| stop = start || 0; | |
| start = 0; | |
| } | |
| step = arguments[2] || 1; | |
| var len = Math.max(Math.ceil((stop - start) / step), 0); | |
| var idx = 0; | |
| var range = new Array(len); | |
| while(idx < len) { | |
| range[idx++] = start; | |
| start += step; | |
| } | |
| return range; | |
| }; | |
| // Function (ahem) Functions | |
| // ------------------ | |
| // Reusable constructor function for prototype setting. | |
| var ctor = function(){}; | |
| // Create a function bound to a given object (assigning `this`, and arguments, | |
| // optionally). Binding with arguments is also known as `curry`. | |
| // Delegates to **ECMAScript 5**'s native `Function.bind` if available. | |
| // We check for `func.bind` first, to fail fast when `func` is undefined. | |
| _.bind = function bind(func, context) { | |
| var bound, args; | |
| if (func.bind === nativeBind && nativeBind) return nativeBind.apply(func, slice.call(arguments, 1)); | |
| if (!_.isFunction(func)) throw new TypeError; | |
| args = slice.call(arguments, 2); | |
| return bound = function() { | |
| if (!(this instanceof bound)) return func.apply(context, args.concat(slice.call(arguments))); | |
| ctor.prototype = func.prototype; | |
| var self = new ctor; | |
| var result = func.apply(self, args.concat(slice.call(arguments))); | |
| if (Object(result) === result) return result; | |
| return self; | |
| }; | |
| }; | |
| // Bind all of an object's methods to that object. Useful for ensuring that | |
| // all callbacks defined on an object belong to it. | |
| _.bindAll = function(obj) { | |
| var funcs = slice.call(arguments, 1); | |
| if (funcs.length == 0) funcs = _.functions(obj); | |
| each(funcs, function(f) { obj[f] = _.bind(obj[f], obj); }); | |
| return obj; | |
| }; | |
| // Memoize an expensive function by storing its results. | |
| _.memoize = function(func, hasher) { | |
| var memo = {}; | |
| hasher || (hasher = _.identity); | |
| return function() { | |
| var key = hasher.apply(this, arguments); | |
| return _.has(memo, key) ? memo[key] : (memo[key] = func.apply(this, arguments)); | |
| }; | |
| }; | |
| // Delays a function for the given number of milliseconds, and then calls | |
| // it with the arguments supplied. | |
| _.delay = function(func, wait) { | |
| var args = slice.call(arguments, 2); | |
| return setTimeout(function(){ return func.apply(null, args); }, wait); | |
| }; | |
| // Defers a function, scheduling it to run after the current call stack has | |
| // cleared. | |
| _.defer = function(func) { | |
| return _.delay.apply(_, [func, 1].concat(slice.call(arguments, 1))); | |
| }; | |
| // Returns a function, that, when invoked, will only be triggered at most once | |
| // during a given window of time. | |
| _.throttle = function(func, wait) { | |
| var context, args, timeout, throttling, more, result; | |
| var whenDone = _.debounce(function(){ more = throttling = false; }, wait); | |
| return function() { | |
| context = this; args = arguments; | |
| var later = function() { | |
| timeout = null; | |
| if (more) func.apply(context, args); | |
| whenDone(); | |
| }; | |
| if (!timeout) timeout = setTimeout(later, wait); | |
| if (throttling) { | |
| more = true; | |
| } else { | |
| throttling = true; | |
| result = func.apply(context, args); | |
| } | |
| whenDone(); | |
| return result; | |
| }; | |
| }; | |
| // Returns a function, that, as long as it continues to be invoked, will not | |
| // be triggered. The function will be called after it stops being called for | |
| // N milliseconds. If `immediate` is passed, trigger the function on the | |
| // leading edge, instead of the trailing. | |
| _.debounce = function(func, wait, immediate) { | |
| var timeout; | |
| return function() { | |
| var context = this, args = arguments; | |
| var later = function() { | |
| timeout = null; | |
| if (!immediate) func.apply(context, args); | |
| }; | |
| var callNow = immediate && !timeout; | |
| clearTimeout(timeout); | |
| timeout = setTimeout(later, wait); | |
| if (callNow) func.apply(context, args); | |
| }; | |
| }; | |
| // Returns a function that will be executed at most one time, no matter how | |
| // often you call it. Useful for lazy initialization. | |
| _.once = function(func) { | |
| var ran = false, memo; | |
| return function() { | |
| if (ran) return memo; | |
| ran = true; | |
| return memo = func.apply(this, arguments); | |
| }; | |
| }; | |
| // Returns the first function passed as an argument to the second, | |
| // allowing you to adjust arguments, run code before and after, and | |
| // conditionally execute the original function. | |
| _.wrap = function(func, wrapper) { | |
| return function() { | |
| var args = [func].concat(slice.call(arguments, 0)); | |
| return wrapper.apply(this, args); | |
| }; | |
| }; | |
| // Returns a function that is the composition of a list of functions, each | |
| // consuming the return value of the function that follows. | |
| _.compose = function() { | |
| var funcs = arguments; | |
| return function() { | |
| var args = arguments; | |
| for (var i = funcs.length - 1; i >= 0; i--) { | |
| args = [funcs[i].apply(this, args)]; | |
| } | |
| return args[0]; | |
| }; | |
| }; | |
| // Returns a function that will only be executed after being called N times. | |
| _.after = function(times, func) { | |
| if (times <= 0) return func(); | |
| return function() { | |
| if (--times < 1) { | |
| return func.apply(this, arguments); | |
| } | |
| }; | |
| }; | |
| // Object Functions | |
| // ---------------- | |
| // Retrieve the names of an object's properties. | |
| // Delegates to **ECMAScript 5**'s native `Object.keys` | |
| _.keys = nativeKeys || function(obj) { | |
| if (obj !== Object(obj)) throw new TypeError('Invalid object'); | |
| var keys = []; | |
| for (var key in obj) if (_.has(obj, key)) keys[keys.length] = key; | |
| return keys; | |
| }; | |
| // Retrieve the values of an object's properties. | |
| _.values = function(obj) { | |
| return _.map(obj, _.identity); | |
| }; | |
| // Return a sorted list of the function names available on the object. | |
| // Aliased as `methods` | |
| _.functions = _.methods = function(obj) { | |
| var names = []; | |
| for (var key in obj) { | |
| if (_.isFunction(obj[key])) names.push(key); | |
| } | |
| return names.sort(); | |
| }; | |
| // Extend a given object with all the properties in passed-in object(s). | |
| _.extend = function(obj) { | |
| each(slice.call(arguments, 1), function(source) { | |
| for (var prop in source) { | |
| obj[prop] = source[prop]; | |
| } | |
| }); | |
| return obj; | |
| }; | |
| // Return a copy of the object only containing the whitelisted properties. | |
| _.pick = function(obj) { | |
| var result = {}; | |
| each(flatten(slice.call(arguments, 1), true, []), function(key) { | |
| if (key in obj) result[key] = obj[key]; | |
| }); | |
| return result; | |
| }; | |
| // Fill in a given object with default properties. | |
| _.defaults = function(obj) { | |
| each(slice.call(arguments, 1), function(source) { | |
| for (var prop in source) { | |
| if (obj[prop] == null) obj[prop] = source[prop]; | |
| } | |
| }); | |
| return obj; | |
| }; | |
| // Create a (shallow-cloned) duplicate of an object. | |
| _.clone = function(obj) { | |
| if (!_.isObject(obj)) return obj; | |
| return _.isArray(obj) ? obj.slice() : _.extend({}, obj); | |
| }; | |
| // Invokes interceptor with the obj, and then returns obj. | |
| // The primary purpose of this method is to "tap into" a method chain, in | |
| // order to perform operations on intermediate results within the chain. | |
| _.tap = function(obj, interceptor) { | |
| interceptor(obj); | |
| return obj; | |
| }; | |
| // Internal recursive comparison function for `isEqual`. | |
| function eq(a, b, stack) { | |
| // Identical objects are equal. `0 === -0`, but they aren't identical. | |
| // See the Harmony `egal` proposal: http://wiki.ecmascript.org/doku.php?id=harmony:egal. | |
| if (a === b) return a !== 0 || 1 / a == 1 / b; | |
| // A strict comparison is necessary because `null == undefined`. | |
| if (a == null || b == null) return a === b; | |
| // Unwrap any wrapped objects. | |
| if (a._chain) a = a._wrapped; | |
| if (b._chain) b = b._wrapped; | |
| // Invoke a custom `isEqual` method if one is provided. | |
| if (a.isEqual && _.isFunction(a.isEqual)) return a.isEqual(b); | |
| if (b.isEqual && _.isFunction(b.isEqual)) return b.isEqual(a); | |
| // Compare `[[Class]]` names. | |
| var className = toString.call(a); | |
| if (className != toString.call(b)) return false; | |
| switch (className) { | |
| // Strings, numbers, dates, and booleans are compared by value. | |
| case '[object String]': | |
| // Primitives and their corresponding object wrappers are equivalent; thus, `"5"` is | |
| // equivalent to `new String("5")`. | |
| return a == String(b); | |
| case '[object Number]': | |
| // `NaN`s are equivalent, but non-reflexive. An `egal` comparison is performed for | |
| // other numeric values. | |
| return a != +a ? b != +b : (a == 0 ? 1 / a == 1 / b : a == +b); | |
| case '[object Date]': | |
| case '[object Boolean]': | |
| // Coerce dates and booleans to numeric primitive values. Dates are compared by their | |
| // millisecond representations. Note that invalid dates with millisecond representations | |
| // of `NaN` are not equivalent. | |
| return +a == +b; | |
| // RegExps are compared by their source patterns and flags. | |
| case '[object RegExp]': | |
| return a.source == b.source && | |
| a.global == b.global && | |
| a.multiline == b.multiline && | |
| a.ignoreCase == b.ignoreCase; | |
| } | |
| if (typeof a != 'object' || typeof b != 'object') return false; | |
| // Assume equality for cyclic structures. The algorithm for detecting cyclic | |
| // structures is adapted from ES 5.1 section 15.12.3, abstract operation `JO`. | |
| var length = stack.length; | |
| while (length--) { | |
| // Linear search. Performance is inversely proportional to the number of | |
| // unique nested structures. | |
| if (stack[length] == a) return true; | |
| } | |
| // Add the first object to the stack of traversed objects. | |
| stack.push(a); | |
| var size = 0, result = true; | |
| // Recursively compare objects and arrays. | |
| if (className == '[object Array]') { | |
| // Compare array lengths to determine if a deep comparison is necessary. | |
| size = a.length; | |
| result = size == b.length; | |
| if (result) { | |
| // Deep compare the contents, ignoring non-numeric properties. | |
| while (size--) { | |
| // Ensure commutative equality for sparse arrays. | |
| if (!(result = size in a == size in b && eq(a[size], b[size], stack))) break; | |
| } | |
| } | |
| } else { | |
| // Objects with different constructors are not equivalent. | |
| if ('constructor' in a != 'constructor' in b || a.constructor != b.constructor) return false; | |
| // Deep compare objects. | |
| for (var key in a) { | |
| if (_.has(a, key)) { | |
| // Count the expected number of properties. | |
| size++; | |
| // Deep compare each member. | |
| if (!(result = _.has(b, key) && eq(a[key], b[key], stack))) break; | |
| } | |
| } | |
| // Ensure that both objects contain the same number of properties. | |
| if (result) { | |
| for (key in b) { | |
| if (_.has(b, key) && !(size--)) break; | |
| } | |
| result = !size; | |
| } | |
| } | |
| // Remove the first object from the stack of traversed objects. | |
| stack.pop(); | |
| return result; | |
| } | |
| // Perform a deep comparison to check if two objects are equal. | |
| _.isEqual = function(a, b) { | |
| return eq(a, b, []); | |
| }; | |
| // Is a given array, string, or object empty? | |
| // An "empty" object has no enumerable own-properties. | |
| _.isEmpty = function(obj) { | |
| if (obj == null) return true; | |
| if (_.isArray(obj) || _.isString(obj)) return obj.length === 0; | |
| for (var key in obj) if (_.has(obj, key)) return false; | |
| return true; | |
| }; | |
| // Is a given value a DOM element? | |
| _.isElement = function(obj) { | |
| return !!(obj && obj.nodeType == 1); | |
| }; | |
| // Is a given value an array? | |
| // Delegates to ECMA5's native Array.isArray | |
| _.isArray = nativeIsArray || function(obj) { | |
| return toString.call(obj) == '[object Array]'; | |
| }; | |
| // Is a given variable an object? | |
| _.isObject = function(obj) { | |
| return obj === Object(obj); | |
| }; | |
| // Add some isType methods: isArguments, isFunction, isString, isNumber, isDate, isRegExp. | |
| each(['Arguments', 'Function', 'String', 'Number', 'Date', 'RegExp'], function(name) { | |
| _['is' + name] = function(obj) { | |
| return toString.call(obj) == '[object ' + name + ']'; | |
| }; | |
| }); | |
| // Define a fallback version of the method in browsers (ahem, IE), where | |
| // there isn't any inspectable "Arguments" type. | |
| if (!_.isArguments(arguments)) { | |
| _.isArguments = function(obj) { | |
| return !!(obj && _.has(obj, 'callee')); | |
| }; | |
| } | |
| // Is a given object a finite number? | |
| _.isFinite = function(obj) { | |
| return _.isNumber(obj) && isFinite(obj); | |
| }; | |
| // Is the given value `NaN`? | |
| _.isNaN = function(obj) { | |
| // `NaN` is the only value for which `===` is not reflexive. | |
| return obj !== obj; | |
| }; | |
| // Is a given value a boolean? | |
| _.isBoolean = function(obj) { | |
| return obj === true || obj === false || toString.call(obj) == '[object Boolean]'; | |
| }; | |
| // Is a given value equal to null? | |
| _.isNull = function(obj) { | |
| return obj === null; | |
| }; | |
| // Is a given variable undefined? | |
| _.isUndefined = function(obj) { | |
| return obj === void 0; | |
| }; | |
| // Shortcut function for checking if an object has a given property directly | |
| // on itself (in other words, not on a prototype). | |
| _.has = function(obj, key) { | |
| return hasOwnProperty.call(obj, key); | |
| }; | |
| // Utility Functions | |
| // ----------------- | |
| // Run Underscore.js in *noConflict* mode, returning the `_` variable to its | |
| // previous owner. Returns a reference to the Underscore object. | |
| _.noConflict = function() { | |
| root._ = previousUnderscore; | |
| return this; | |
| }; | |
| // Keep the identity function around for default iterators. | |
| _.identity = function(value) { | |
| return value; | |
| }; | |
| // Run a function **n** times. | |
| _.times = function(n, iterator, context) { | |
| for (var i = 0; i < n; i++) iterator.call(context, i); | |
| }; | |
| // List of HTML entities for escaping. | |
| var htmlEscapes = { | |
| '&': '&', | |
| '<': '<', | |
| '>': '>', | |
| '"': '"', | |
| "'": ''', | |
| '/': '/' | |
| }; | |
| // Regex containing the keys listed immediately above. | |
| var htmlEscaper = /[&<>"'\/]/g; | |
| // Escape a string for HTML interpolation. | |
| _.escape = function(string) { | |
| return ('' + string).replace(htmlEscaper, function(match) { | |
| return htmlEscapes[match]; | |
| }); | |
| }; | |
| // If the value of the named property is a function then invoke it; | |
| // otherwise, return it. | |
| _.result = function(object, property) { | |
| if (object == null) return null; | |
| var value = object[property]; | |
| return _.isFunction(value) ? value.call(object) : value; | |
| }; | |
| // Add your own custom functions to the Underscore object, ensuring that | |
| // they're correctly added to the OOP wrapper as well. | |
| _.mixin = function(obj) { | |
| each(_.functions(obj), function(name){ | |
| addToWrapper(name, _[name] = obj[name]); | |
| }); | |
| }; | |
| // Generate a unique integer id (unique within the entire client session). | |
| // Useful for temporary DOM ids. | |
| var idCounter = 0; | |
| _.uniqueId = function(prefix) { | |
| var id = idCounter++; | |
| return prefix ? prefix + id : id; | |
| }; | |
| // By default, Underscore uses ERB-style template delimiters, change the | |
| // following template settings to use alternative delimiters. | |
| _.templateSettings = { | |
| evaluate : /<%([\s\S]+?)%>/g, | |
| interpolate : /<%=([\s\S]+?)%>/g, | |
| escape : /<%-([\s\S]+?)%>/g | |
| }; | |
| // When customizing `templateSettings`, if you don't want to define an | |
| // interpolation, evaluation or escaping regex, we need one that is | |
| // guaranteed not to match. | |
| var noMatch = /.^/; | |
| // Certain characters need to be escaped so that they can be put into a | |
| // string literal. | |
| var escapes = { | |
| '\\': '\\', | |
| "'": "'", | |
| r: '\r', | |
| n: '\n', | |
| t: '\t', | |
| u2028: '\u2028', | |
| u2029: '\u2029' | |
| }; | |
| for (var key in escapes) escapes[escapes[key]] = key; | |
| var escaper = /\\|'|\r|\n|\t|\u2028|\u2029/g; | |
| var unescaper = /\\(\\|'|r|n|t|u2028|u2029)/g; | |
| // Within an interpolation, evaluation, or escaping, remove HTML escaping | |
| // that had been previously added. | |
| var unescape = function(code) { | |
| return code.replace(unescaper, function(match, escape) { | |
| return escapes[escape]; | |
| }); | |
| }; | |
| // JavaScript micro-templating, similar to John Resig's implementation. | |
| // Underscore templating handles arbitrary delimiters, preserves whitespace, | |
| // and correctly escapes quotes within interpolated code. | |
| _.template = function(text, data, settings) { | |
| settings = _.defaults(settings || {}, _.templateSettings); | |
| // Compile the template source, taking care to escape characters that | |
| // cannot be included in a string literal and then unescape them in code | |
| // blocks. | |
| var source = "__p+='" + text | |
| .replace(escaper, function(match) { | |
| return '\\' + escapes[match]; | |
| }) | |
| .replace(settings.escape || noMatch, function(match, code) { | |
| return "'+\n((__t=(" + unescape(code) + "))==null?'':_.escape(__t))+\n'"; | |
| }) | |
| .replace(settings.interpolate || noMatch, function(match, code) { | |
| return "'+\n((__t=(" + unescape(code) + "))==null?'':__t)+\n'"; | |
| }) | |
| .replace(settings.evaluate || noMatch, function(match, code) { | |
| return "';\n" + unescape(code) + "\n__p+='"; | |
| }) + "';\n"; | |
| // If a variable is not specified, place data values in local scope. | |
| if (!settings.variable) source = 'with(obj||{}){\n' + source + '}\n'; | |
| source = "var __t,__p='',__j=Array.prototype.join," + | |
| "print=function(){__p+=__j.call(arguments,'')};\n" + | |
| source + "return __p;\n"; | |
| var render = new Function(settings.variable || 'obj', '_', source); | |
| if (data) return render(data, _); | |
| var template = function(data) { | |
| return render.call(this, data, _); | |
| }; | |
| // Provide the compiled function source as a convenience for precompilation. | |
| template.source = 'function(' + (settings.variable || 'obj') + '){\n' + source + '}'; | |
| return template; | |
| }; | |
| // Add a "chain" function, which will delegate to the wrapper. | |
| _.chain = function(obj) { | |
| return _(obj).chain(); | |
| }; | |
| // The OOP Wrapper | |
| // --------------- | |
| // If Underscore is called as a function, it returns a wrapped object that | |
| // can be used OO-style. This wrapper holds altered versions of all the | |
| // underscore functions. Wrapped objects may be chained. | |
| var wrapper = function(obj) { this._wrapped = obj; }; | |
| // Expose `wrapper.prototype` as `_.prototype` | |
| _.prototype = wrapper.prototype; | |
| // Helper function to continue chaining intermediate results. | |
| var result = function(obj, chain) { | |
| return chain ? _(obj).chain() : obj; | |
| }; | |
| // A method to easily add functions to the OOP wrapper. | |
| var addToWrapper = function(name, func) { | |
| wrapper.prototype[name] = function() { | |
| var args = slice.call(arguments); | |
| unshift.call(args, this._wrapped); | |
| return result(func.apply(_, args), this._chain); | |
| }; | |
| }; | |
| // Add all of the Underscore functions to the wrapper object. | |
| _.mixin(_); | |
| // Add all mutator Array functions to the wrapper. | |
| each(['pop', 'push', 'reverse', 'shift', 'sort', 'splice', 'unshift'], function(name) { | |
| var method = ArrayProto[name]; | |
| wrapper.prototype[name] = function() { | |
| var obj = this._wrapped; | |
| method.apply(obj, arguments); | |
| if ((name == 'shift' || name == 'splice') && obj.length === 0) delete obj[0]; | |
| return result(obj, this._chain); | |
| }; | |
| }); | |
| // Add all accessor Array functions to the wrapper. | |
| each(['concat', 'join', 'slice'], function(name) { | |
| var method = ArrayProto[name]; | |
| wrapper.prototype[name] = function() { | |
| return result(method.apply(this._wrapped, arguments), this._chain); | |
| }; | |
| }); | |
| // Start chaining a wrapped Underscore object. | |
| wrapper.prototype.chain = function() { | |
| this._chain = true; | |
| return this; | |
| }; | |
| // Extracts the result from a wrapped and chained object. | |
| wrapper.prototype.value = function() { | |
| return this._wrapped; | |
| }; | |
| }).call(this); |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment