Created
July 13, 2012 02:20
-
-
Save mbohun/3102307 to your computer and use it in GitHub Desktop.
Martin Bohun's SMILES tokenizer
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
// spidermonkey: /usr/local/spider-monkey-1.8.5/bin/js -f ./test.js | |
// rhino: java -jar /usr/local/rhino/js.jar -f ./test.js | |
// | |
var smiles_tokenize = function ( ) { | |
var PTE = [ | |
"H", "He", "Li", "Be", "B", "C", "N", "O", "F", "Ne", "Na", | |
"Mg", "Al", "Si", "P", "S", "Cl", "Ar", "K", "Ca", "Sc", "Ti", | |
"V", "Cr", "Mn", "Fe", "Co", "Ni", "Cu", "Zn", "Ga", "Ge", | |
"As", "Se", "Br", "Kr", "Rb", "Sr", "Y", "Zr", "Nb", "Mo", | |
"Tc", "Ru", "Rh", "Pd", "Ag", "Cd", "In", "Sn", "Sb", "Te", | |
"I", "Xe", "Cs", "Ba", "La", "Ce", "Pr", "Nd", "Pm", "Sm", | |
"Eu", "Gd", "Tb", "Dy", "Ho", "Er", "Tm", "Yb", "Lu", "Hf", | |
"Ta", "W", "Re", "Os", "Ir", "Pt", "Au", "Hg", "Tl", "Pb", | |
"Bi", "Po", "At", "Rn", "Fr", "Ra", "Ac", "Th", "Pa", "U", | |
"Np", "Pu", "Am", "Cm", "Bk", "Cf", "Es", "Fm", "Md", "No", | |
"Lr", "Rf", "Db", "Sg", "Bh", "Hs", "Mt", "Ds", "Rg", "Cn", | |
"Uut", "Uuq", "Uup", "Uuh", "Uus", "Uuo" | |
], | |
special = [ //aromatic: C, N, O, P, S, As, Se, and * | |
"(", ")", "[", "]", "=", "#", "@", "*", "%", "1", "2", "3", "4", | |
"5", "6", "7", "8", "9", ".", "/", "\\", "+", "-", "c", "n", | |
"o" | |
], | |
table = PTE.sort().reverse().concat(special), | |
match_symbol = function (smiles, offset, tokens) { | |
for (var i = 0; i < table.length; i++) { | |
var symbol = table[i]; | |
if (symbol === smiles.substr(offset, symbol.length)) { | |
tokens.push(symbol); | |
return symbol.length; | |
} | |
} | |
return 0; | |
}; | |
return function (smiles) { | |
var tok = [], i = 0; | |
while (i < smiles.length) { | |
var match = match_symbol(smiles, i, tok); | |
if (match > 0) { | |
i = i + match; | |
} else { | |
print("smiles_tokenize error - no match[" + i + "]:" | |
+ smiles.substr(i, 1)); | |
i = i + 1; | |
} | |
} | |
return tok; | |
}; | |
}( ); | |
// spidermonkey (1.8.5) requires the explicit this.hasOwnProperty | |
print("read():" + this.hasOwnProperty("read")); | |
print("readFile():" + this.hasOwnProperty("readFile")); | |
if (this.hasOwnProperty("read")) { | |
read_file = read; | |
} | |
if (this.hasOwnProperty("readFile")) { | |
read_file = readFile; | |
} | |
// what if read_file is udnefined? | |
// print(typeof read_file); | |
var smiles = read_file("data.smi").trim().split("\n"); | |
for (var i = 0; i < smiles.length; i++) { | |
print("smiles[" + i + "]:" + smiles[i] | |
+ " " + smiles_tokenize(smiles[i])); | |
} | |
// | |
// bash-3.1$ cat data.smi | |
// COc1c(OC)c(OC)cc(c1)CCN | |
// COc(c1)cccc1C#N | |
// COc1ccc(Br)cc1 | |
// C1CN(C)[C@@H]2CC(=O)CC[C@@]21c3ccc(OC)c(OC)c3 | |
// bash-3.1$ java -jar /usr/local/rhino/js.jar -f ./smiles.js | |
// Picked up _JAVA_OPTIONS: -Dawt.useSystemAAFontSettings=on | |
// read():false | |
// readFile():true | |
// smiles[0]:COc1c(OC)c(OC)cc(c1)CCN C,O,c,1,c,(,O,C,),c,(,O,C,),c,c,(,c,1,),C,C,N | |
// smiles[1]:COc(c1)cccc1C#N C,O,c,(,c,1,),c,c,c,c,1,C,#,N | |
// smiles[2]:COc1ccc(Br)cc1 C,O,c,1,c,c,c,(,Br,),c,c,1 | |
// smiles[3]:C1CN(C)[C@@H]2CC(=O)CC[C@@]21c3ccc(OC)c(OC)c3 C,1,C,N,(,C,),[,C,@,@,H,],2,C,C,(,=,O,),C,C,[,C,@,@,],2,1,c,3,c,c,c,(,O,C,),c,(,O,C,),c,3 | |
// | |
// bash-3.1$ /usr/local/spider-monkey-1.8.5/bin/js -f ./smiles.js | |
// read():true | |
// readFile():false | |
// smiles[0]:COc1c(OC)c(OC)cc(c1)CCN C,O,c,1,c,(,O,C,),c,(,O,C,),c,c,(,c,1,),C,C,N | |
// smiles[1]:COc(c1)cccc1C#N C,O,c,(,c,1,),c,c,c,c,1,C,#,N | |
// smiles[2]:COc1ccc(Br)cc1 C,O,c,1,c,c,c,(,Br,),c,c,1 | |
// smiles[3]:C1CN(C)[C@@H]2CC(=O)CC[C@@]21c3ccc(OC)c(OC)c3 C,1,C,N,(,C,),[,C,@,@,H,],2,C,C,(,=,O,),C,C,[,C,@,@,],2,1,c,3,c,c,c,(,O,C,),c,(,O,C,),c,3 | |
// |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment