Created
September 14, 2024 01:21
-
-
Save mxnmnm/1cb1f8d192b17fa377b45cec84500c03 to your computer and use it in GitHub Desktop.
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| 1.21 Paintings backport(paintings_backport)@1.0.0 | |
| AEInfinityBooster(aeinfinitybooster)@1.20.1-1.0.0+21 | |
| AI-Improvements(aiimprovements)@0.5.2 | |
| Alex's Caves Delight(alexscavesdelight)@1.0.15-1.20.1 | |
| Alex's Caves(alexscaves)@1.1.5 | |
| Alex's Delight(alexsdelight)@1.5 | |
| Alex's Mobs(alexsmobs)@1.22.8 | |
| Alexs Mobs Interaction(alexsmobsinteraction)@3.4 | |
| AlmostUnified(almostunified)@1.20.1-0.9.4 | |
| Alternate Current(alternate_current)@1.7.0 | |
| Amecs API(amecsapi)@1.5.3+mc1.20-pre1 | |
| Amendments(amendments)@1.20-1.2.11 | |
| Angry Mobs(angrymobs)@4.1.2 | |
| AntiBlocksReChiseled(antiblocksrechiseled)@0.4.4 | |
| Apotheosis(apotheosis)@7.4.2 | |
| Apothic Attributes(attributeslib)@1.3.7 | |
| AppleSkin(appleskin)@2.5.1+mc1.20.1 | |
| Applied Energistics 2(ae2)@15.2.13 | |
| Applied Mekanistics(appmek)@1.4.2 | |
| Aquamirae(aquamirae)@6.API15 | |
| Archer's Paradox(archers_paradox)@5.0.0 | |
| Architectury(architectury)@9.2.14 | |
| Ars Creo(ars_creo)@4.1.0 | |
| Ars Elemental(ars_elemental)@1.20.1-0.6.5.0.1 | |
| Ars Instrumentum(ars_instrumentum)@0.0NONE | |
| Ars Nouveau Compats Collection(ars_scalaes)@1.20.1-1.10.6 | |
| Ars Nouveau(ars_nouveau)@4.12.4 | |
| Ars Énergistique(arseng)@1.2.0 | |
| Athena(athena)@3.1.2 | |
| AttributeFix(attributefix)@21.0.4 | |
| Awesome dungeon edition ocean(awesomedungeonocean)@3.3.0 | |
| BCLib(bclib)@3.0.14 | |
| BadOptimizations(badoptimizations)@2.1.4 | |
| Bagus Lib(bagus_lib)@1.20.1-5.2.3 | |
| BagusMob(bagusmob)@1.20.1-4.0.2 | |
| Balm(balm)@7.3.9 | |
| Bee Fix(beefix)@1.0.7 | |
| Better Archeology(betterarcheology)@1.2.1-1.20.1 | |
| Better Compatibility Checker(bcc)@4.0.8 | |
| Better Cooked Axolotls(bca)@1.0-1.20.1 | |
| Better End(betterend)@4.0.11 | |
| Better Invisibility(betterinvisibility)@1.0.4 | |
| Better Nether(betternether)@9.0.10 | |
| BetterBurning(betterburning)@9.0.2 | |
| BetterEnd Anvil Repair(beanvilrepair)@1.0.0 | |
| Big F&$%ing End Cities(bfendcities)@1.0 | |
| Biome Makeover(biomemakeover)@1.20.1-1.11.4 | |
| Block Of Sky(blockofsky)@0.3.0 | |
| Blue Flame Burning(blueflame)@1.20.0-1.0.3 | |
| Blueprint(blueprint)@7.1.0 | |
| Boat Break Fix(boatbreakfix)@1.0.2 | |
| Bobby Reforged(bobby)@5.0.0 | |
| Bookshelf(bookshelf)@20.2.13 | |
| Butterfly Mod(butterflies)@5.0.1 | |
| Bygone Nether(bygonenether)@1.3.2 | |
| CBMicroblock(cb_microblock)@3.3.0.146 | |
| CBMultipart Minecraft(cb_multipart_minecraft)@3.3.0.146 | |
| CBMultipart(cb_multipart)@3.3.0.146 | |
| Camera Mod(camera)@1.20.1-1.0.14 | |
| Carry On(carryon)@2.1.2.7 | |
| Cataclysm Mod(cataclysm)@1.99.5 | |
| Cave Spider Spawn(cavespiderspawn)@1.2 | |
| Chipped(chipped)@3.0.6 | |
| Chisels-and-bits(chiselsandbits)@1.4.148 | |
| Chunksending mod(chunksending)@1.20.1-2.8 | |
| Chunky(chunky)@1.3.146 | |
| Citadel(citadel)@2.6.0 | |
| Click Machine(clickmachine)@8.0.2 | |
| Cloth Config v10 API(cloth_config)@11.1.118 | |
| Clumps(clumps)@12.0.0.4 | |
| CoFH Core(cofh_core)@11.0.2 | |
| CodeChicken Lib(codechickenlib)@4.4.0.512 | |
| Collective(collective)@7.84 | |
| Comforts(comforts)@6.4.0+1.20.1 | |
| CommonCapabilities(commoncapabilities)@2.9.3 | |
| Conditional mixin(conditional_mixin)@0.6.2 | |
| Connector Extras Architectury Bridge(connectorextras_architectury_bridge)@1.11.2+1.20.1 | |
| Connector Extras EMI Bridge(connectorextras_emi_bridge)@1.11.2+1.20.1 | |
| Connector Extras Energy Bridge(connectorextras_energy_bridge)@1.11.2+1.20.1 | |
| Connector Extras Geckolib-Fabric Compat(connectorextras_geckolib_fabric_compat)@1.11.2+1.20.1 | |
| Connector Extras JEI Bridge(connectorextras_jei_bridge)@1.11.2+1.20.1 | |
| Connector Extras KubeJS Bridge(connectorextras_kubejs_bridge)@1.11.2+1.20.1 | |
| Connector Extras ModMenu Bridge(connectorextras_modmenu_bridge)@1.11.2+1.20.1 | |
| Connector Extras Pehkui Bridge(connectorextras_pehkui_bridge)@1.11.2+1.20.1 | |
| Connector Extras REI Bridge(connectorextras_rei_bridge)@1.11.2+1.20.1 | |
| Connector Extras Terrablender Bridge(connectorextras_terrablender_bridge)@1.11.2+1.20.1 | |
| Connector Extras(connectorextras)@1.11.2+1.20.1 | |
| Connector(connectormod)@1.0.0-beta.45+1.20.1 | |
| CookingForBlockheads(cookingforblockheads)@16.0.6 | |
| Corn Delight(corn_delight)@1.0.4-1.20.1 | |
| Corpse(corpse)@1.20.1-1.0.14 | |
| CosmeticArmorReworked(cosmeticarmorreworked)@1.20.1-v1a | |
| CrackersLib(crackerslib)@1.20.1-0.3.2.1 | |
| CraftTweaker(crafttweaker)@14.0.43 | |
| Create Big Cannons(createbigcannons)@5.5.1+mc.1.20.1-forge | |
| Create Confectionery(create_confectionery)@1.1.0 | |
| Create Crafts & Additions(createaddition)@1.20.1-1.2.4e | |
| Create Fiberglass(createfiberglass)@1.0.0 | |
| Create Slice & Dice(sliceanddice)@3.2.1 | |
| Create(create)@0.5.1.h | |
| Create: Addon Compatibility(createaddoncompatibility)@0.2.1b | |
| Create: Central Kitchen(create_central_kitchen)@1.3.12 | |
| Create: Connected(create_connected)@0.8.2-mc1.20.1 | |
| Create: Copycats+(copycats)@2.1.2+mc.1.20.1-forge | |
| Create: Dragon Lib(create_dragon_lib)@1.4.3 | |
| Create: Framed(createframed)@1.4.5.1 | |
| Create: Interiors(interiors)@0.5.6 | |
| Create: Oppenheimered(create_oppenheimered)@1.0.3 | |
| Create: Power Loader(create_power_loader)@1.5.0-mc1.20.1 | |
| Create: Steam 'n' Rails(railways)@1.6.5+forge-mc1.20.1 | |
| Create: Structures(create_structures)@0.1.1 | |
| Create: Trains on Trains(create_trains_on_trains)@1.0.0 | |
| Create: WooderWheels(create_wooderwheels)@1.20.1-1.1.0 | |
| CreateTagsFix(mr_createccmodemfix)@3.0 | |
| CreativeCore(creativecore)@2.11.37 | |
| Creature Compendium(creature_compendium)@1.2.1 | |
| Creeper Overhaul(creeperoverhaul)@3.0.2 | |
| Cristel Lib(cristellib)@1.1.5 | |
| Critters and Companions(crittersandcompanions)@1.20.1-2.1.6 | |
| Crust(crust)@2.3.4 | |
| Cuisine Delight(cuisinedelight)@1.1.14 | |
| Cupboard utilities(cupboard)@1.20.1-2.7 | |
| Curios API(curios)@5.10.0+1.20.1 | |
| Cursery Mod(cursery)@1.20.1-4.2 | |
| Cut Through(cutthrough)@8.0.2 | |
| Cyclops Core(cyclopscore)@1.19.5 | |
| DarkPaintings(darkpaintings)@17.0.4 | |
| DarkUtilities(darkutils)@17.0.3 | |
| DeathKnell(deathknell)@10.0.4 | |
| Deeper and Darker(deeperdarker)@1.3.2 | |
| Diagonal Blocks(diagonalblocks)@8.0.5 | |
| Diagonal Fences(diagonalfences)@8.1.4 | |
| Dimensional Dungeons(dimdungeons)@194 | |
| Domestication Innovation(domesticationinnovation)@1.7.1 | |
| Drip Sounds(waterdripsound)@0.3.2 | |
| DucLib(duclib)@1.1.4 | |
| Dungeon Now Loading(dungeonnowloading)@1.5 | |
| Dungeons Enhanced(dungeons_enhanced)@5.2.2 | |
| Dungeons Plus(dungeons_plus)@1.5.0 | |
| Dungeons and Taverns(mr_dungeons_andtaverns)@3.0.3.f | |
| Dynamic view distance(dynview)@2.3 | |
| DynamicTrim(dynamictrim)@1.4.1 | |
| EMI(emi)@1.1.13+1.20.1+forge | |
| EMI: Create Schematics(emi_create_schematics)@1.0.1 | |
| Ears(ears)@1.4.6 | |
| Eccentric Tome(eccentrictome)@1.20.1-1.10.2 | |
| Elytra Trims Extensions(elytratrims_extensions)@2.2.1 | |
| Elytra Trims(elytratrims)@3.5.2 | |
| End's Delight(ends_delight)@2.4 | |
| Ender Trigon(endertrigon)@1.20.1-1.1 | |
| Ender Zoology(enderzoology)@8.0.2 | |
| EnderStorage(enderstorage)@2.11.0.188 | |
| Enderman Overhaul(endermanoverhaul)@1.0.4 | |
| Enhanced AI(enhancedai)@2.4.10 | |
| Ensorcellation(ensorcellation)@5.0.2 | |
| Entangled(entangled)@1.3.19 | |
| Every Compat(everycomp)@1.20-2.6.75 | |
| FTB Backups 2(ftbbackups2)@1.0.23 | |
| Fabric API Base(fabric_api_base)@0.4.31+ef105b4977 | |
| Fabric API Lookup API (v1)(fabric_api_lookup_api_v1)@1.6.36+67f9824077 | |
| Fabric Biome API (v1)(fabric_biome_api_v1)@13.0.13+dc36698e77 | |
| Fabric Block API (v1)(fabric_block_api_v1)@1.0.11+0e6cb7f777 | |
| Fabric BlockRenderLayer Registration (v1)(fabric_blockrenderlayer_v1)@1.1.41+1d0da21e77 | |
| Fabric BlockView API (v2)(fabric_block_view_api_v2)@1.0.1+0767707077 | |
| Fabric Client Tags(fabric_client_tags_api_v1)@1.1.2+5d6761b877 | |
| Fabric Command API (v1)(fabric_command_api_v1)@1.2.34+f71b366f77 | |
| Fabric Command API (v2)(fabric_command_api_v2)@2.2.13+561530ec77 | |
| Fabric Content Registries (v0)(fabric_content_registries_v0)@4.0.11+a670df1e77 | |
| Fabric Convention Tags(fabric_convention_tags_v1)@1.5.5+fa3d1c0177 | |
| Fabric Data Attachment API (v1)(fabric_data_attachment_api_v1)@1.0.0+30ef839e77 | |
| Fabric Data Generation API (v1)(fabric_data_generation_api_v1)@12.3.4+369cb3a477 | |
| Fabric Dimensions API (v1)(fabric_dimensions_v1)@2.1.54+8005d10d77 | |
| Fabric Entity Events (v1)(fabric_entity_events_v1)@1.6.0+6274ab9d77 | |
| Fabric Events Interaction (v0)(fabric_events_interaction_v0)@0.6.2+0d0bd5a777 | |
| Fabric Game Rule API (v1)(fabric_game_rule_api_v1)@1.0.40+683d4da877 | |
| Fabric Item API (v1)(fabric_item_api_v1)@2.1.28+4d0bbcfa77 | |
| Fabric Item Group API (v1)(fabric_item_group_api_v1)@4.0.12+c9161c2d77 | |
| Fabric Key Binding API (v1)(fabric_key_binding_api_v1)@1.0.37+561530ec77 | |
| Fabric Lifecycle Events (v1)(fabric_lifecycle_events_v1)@2.2.22+afab492177 | |
| Fabric Loot API (v2)(fabric_loot_api_v2)@1.2.1+eb28f93e77 | |
| Fabric Message API (v1)(fabric_message_api_v1)@5.1.9+52cc178c77 | |
| Fabric Mining Level API (v1)(fabric_mining_level_api_v1)@2.1.50+561530ec77 | |
| Fabric Model Loading API (v1)(fabric_model_loading_api_v1)@1.0.3+6274ab9d77 | |
| Fabric Models (v0)(fabric_models_v0)@0.4.2+7c3892a477 | |
| Fabric Networking API (v1)(fabric_networking_api_v1)@1.3.11+503a202477 | |
| Fabric Object Builder API (v1)(fabric_object_builder_api_v1)@11.1.3+2174fc8477 | |
| Fabric Particles (v1)(fabric_particles_v1)@1.1.2+78e1ecb877 | |
| Fabric Recipe API (v1)(fabric_recipe_api_v1)@1.0.21+514a076577 | |
| Fabric Registry Sync (v0)(fabric_registry_sync_v0)@2.3.3+1c0ea72177 | |
| Fabric Renderer - Indigo(fabric_renderer_indigo)@1.5.2+b5b2da4177 | |
| Fabric Renderer API (v1)(fabric_renderer_api_v1)@3.2.1+1d29b44577 | |
| Fabric Rendering (v1)(fabric_rendering_v1)@3.0.8+66e9a48f77 | |
| Fabric Rendering Data Attachment (v1)(fabric_rendering_data_attachment_v1)@0.3.37+a6081afc77 | |
| Fabric Rendering Fluids (v1)(fabric_rendering_fluids_v1)@3.0.28+4ac5e37a77 | |
| Fabric Resource Conditions API (v1)(fabric_resource_conditions_api_v1)@2.3.8+9ad825cd77 | |
| Fabric Resource Loader (v0)(fabric_resource_loader_v0)@0.11.10+bcd08ed377 | |
| Fabric Screen API (v1)(fabric_screen_api_v1)@2.0.8+45a670a577 | |
| Fabric Screen Handler API (v1)(fabric_screen_handler_api_v1)@1.3.30+561530ec77 | |
| Fabric Sound API (v1)(fabric_sound_api_v1)@1.0.13+4f23bd8477 | |
| Fabric Transfer API (v1)(fabric_transfer_api_v1)@3.3.5+631c9cd677 | |
| Fabric Transitive Access Wideners (v1)(fabric_transitive_access_wideners_v1)@4.3.1+1880499877 | |
| FallingTree(fallingtree)@4.3.4 | |
| Fancy Fluid Storage(ffs)@3.4.11 | |
| Farmer's Delight(farmersdelight)@1.20.1-1.2.4 | |
| Fast Paintings(fastpaintings)@1.20-1.2.7 | |
| Fast Suite(fastsuite)@5.0.1 | |
| Fast Workbench(fastbench)@8.0.4 | |
| FastFurnace(fastfurnace)@8.0.2 | |
| Faster Random(faster_random)@5.0.1-SNAPSHOT | |
| Fennec Fox(fennecfox)@1.0.0 | |
| Ferrite Core(ferritecore)@6.0.1 | |
| FindMe(findme)@3.2.1 | |
| Fish No Stuck(fishnostuck)@1.0.3 | |
| Flywheel(flywheel)@0.6.11-13 | |
| Forge Config API Port (ConnectorExtras)(forgeconfigapiport)@8.0.0 | |
| Forge(forge)@47.3.7 | |
| Forgery(fabrication)@3.4.20+1.20 | |
| Forgified Fabric API(fabric_api)@0.92.2+1.11.8+1.20.1 | |
| Fruitful Fun(fruitfulfun)@7.5.3+forge | |
| Fruits Delight(fruitsdelight)@1.0.11 | |
| Fzzy Config(fzzy_config)@0.4.1-fix1+1.20.1+forge | |
| GeckoLib 4(geckolib)@4.4.9 | |
| Ghosts(ghosts)@1.1.0 | |
| Glassential Renewed(glassential)@2.4.1 | |
| GoodEnding(goodending)@1.20.1-1.0.1 | |
| Guard Villagers(guardvillagers)@1.20.1-1.6.7 | |
| Hang Glider(hangglider)@8.0.1 | |
| Hanger System Change(hangersystemchange)@1.4.0 | |
| HerdMentality(herdmentality)@12.0.3 | |
| Hole(hole)@0.1.1.1 | |
| Hunters Returns(hunters_return)@1.20.1-11.5.0 | |
| I See What You Did There!(iswydt)@1.0.5 | |
| Ice and Fire(iceandfire)@2.1.13-1.20.1 | |
| IceAndFire Patcher(iaf_patcher)@0.1.2 | |
| iChunUtil(ichunutil)@1.0.0 | |
| Illager Invasion(illagerinvasion)@8.0.5 | |
| ImmediatelyFast(immediatelyfast)@1.2.21+1.20.4 | |
| Immersive Aircraft(immersive_aircraft)@1.0.1+1.20.1 | |
| InControl(incontrol)@1.20-9.2.7 | |
| Incendium(incendium)@5.3.5 | |
| InsaneLib(insanelib)@1.14.0 | |
| Integrated API(integrated_api)@1.5.1+1.20.1-forge | |
| Integrated Dungeons and Structures(idas)@1.10.1+1.20.1 | |
| Integrated Stronghold(integrated_stronghold)@1.1.1+1.20.1-forge | |
| Integrated Villages(integrated_villages)@1.0.1+1.20.1-forge | |
| IntegratedDynamics(integrateddynamics)@1.23.3 | |
| IntegratedDynamics-Compat(integrateddynamicscompat)@1.23.3 | |
| It Takes A Pillage(takesapillage)@1.0.3 | |
| Item Obliterator(item_obliterator)@2.3.0 | |
| JAOPCA(jaopca)@4.4.11.21 | |
| Jade Addons(jadeaddons)@5.3.1+forge | |
| Jade(jade)@11.11.1+forge | |
| Jagm's Kiwis(jagmkiwis)@1.20.1-1.1.1 | |
| Just Enough Items(jei)@15.18.0.79 | |
| Kiwi Library(kiwi)@11.8.20+forge | |
| Kotlin For Forge(kotlinforforge)@4.11.0 | |
| KubeJS(kubejs)@2001.6.5-build.14 | |
| KumaAPI(kuma_api)@20.1.8 | |
| L2 Library(l2library)@2.4.16 | |
| Leashable Players(leashmod)@1.0.6 | |
| LegendaryMonsters(legendary_monsters)@1.20.1 | |
| Library ferret(libraryferret)@4.0.0 | |
| LionfishAPI(lionfishapi)@1.9 | |
| Little Contraptions(littlecontraptions)@1.20.1.2 | |
| Little Logistics(littlelogistics)@1.20.1.2 | |
| LittleTiles(littletiles)@1.6.0-pre120 | |
| Logprot(logprot)@1.4 | |
| LootJS(lootjs)@1.20.1-2.12.0 | |
| Lootr(lootr)@0.7.34.87 | |
| Lovely Snails(lovely_snails)@1.1.31.20.1 | |
| Lychee Tweaker(lychee)@5.1.14 | |
| MEGA Cells(megacells)@2.4.4-1.20.1 | |
| Macaw's Paintings(mcwpaintings)@1.0.5 | |
| Mahou Tsukai(mahoutsukai)@1.20.1-v1.34.71 | |
| Marvelous Menagerie(marvelous_menagerie)@2.4-1.20.1 | |
| MaxHealthFix(maxhealthfix)@12.0.3 | |
| McJtyLib(mcjtylib)@1.20-8.0.6 | |
| Mekanism(mekanism)@10.4.9 | |
| Mekanism: Additions(mekanismadditions)@10.4.9 | |
| Mekanism: Generators(mekanismgenerators)@10.4.9 | |
| Memory Leak Fix(memoryleakfix)@1.1.5 | |
| Minecraft(minecraft)@1.20.1 | |
| Miner's Delight(miners_delight)@1.20.1-1.2.3 | |
| MixinExtras(mixinextras)@0.4.1 | |
| MixinSquared(mixinsquared)@0.1.2-beta.4 | |
| Mob Crossing(mobcrossing)@1.0.1 | |
| Mobs Properties Randomness(mobspropertiesrandomness)@4.10.9 | |
| ModMenu (Connector Extras)(modmenu)@7.2.2 | |
| ModernFix(modernfix)@5.19.4+mc1.20.1 | |
| Monster Plus(monsterplus)@1.0 | |
| Moonlight Library(moonlight)@1.20-2.12.20 | |
| More Axolotl Variants API(mavapi)@1.1.4 | |
| More Axolotl Variants Mod(mavm)@1.2.6 | |
| More Frogs(morefrogs)@1.20.1-1.2.5-fabric | |
| More Mobs(moremobs)@1.5.2+mod | |
| More Sniffer Flowers(moresnifferflowers)@1.4.5.2 | |
| Mouse Tweaks(mousetweaks)@2.25.1 | |
| Mowzie's Mobs(mowziesmobs)@1.6.4 | |
| Multiplayer Server Pause(serverpause)@1.3.0 | |
| Musket Mod(musketmod)@1.5.2 | |
| Mutant Monsters(mutantmonsters)@8.0.7 | |
| Mysterious Mountain Lib(mysterious_mountain_lib)@1.4.7-1.20.1 | |
| NaNny(nanny)@1.0.1 | |
| Necronomicon(necronomicon)@1.4.2 | |
| Neruina(neruina)@2.1.2 | |
| Nether Depths Upgrade(netherdepthsupgrade)@3.1.5-1.20 | |
| Nether's Delight(nethersdelight)@1.20.1-4.0 | |
| NetherPortalFix(netherportalfix)@13.0.1 | |
| No Chat Reports(nochatreports)@1.20.1-v2.2.2 | |
| Noisium(noisium)@2.3.0+mc1.20-1.20.1 | |
| Not Enough Crashes(notenoughcrashes)@4.4.7+1.20.1 | |
| Nuclear Bomb Bay(nuke_bay)@1.20.1-SNAPSHOT | |
| Nutritional Balance(nutritionalbalance)@1.20-5.1.3 | |
| Nyf's Spiders(nyfsspiders)@2.1.1 | |
| Obscure API(obscure_api)@15 | |
| Ocean's Delight(oceansdelight)@1.0.2-1.20 | |
| OctoLib(octolib)@0.4.2 | |
| Odd Organisms(oddorganisms)@1.20.1-0.3.0 | |
| OhMySherd(ohmysherd)@1.0.3 | |
| Overflowing Bars(overflowingbars)@8.0.0 | |
| Packet Fixer(packetfixer)@1.4.2 | |
| Paladin's Furniture(pfm)@1.2.1 | |
| Particle Mimicry(particlemimicry)@0.4.2 | |
| Patchouli(patchouli)@1.20.1-84-FORGE | |
| Path Under Gates(pathundergates)@1.20.1-1.0.2-release | |
| Paxi(paxi)@1.20-Forge-4.0 | |
| Pehkui Resizer(pehkui_resizer)@3.5.4 | |
| Pehkui(pehkui)@3.8.2+1.20.1-forge | |
| PigPen(pigpen)@15.0.2 | |
| Pineapple Delight(pineapple_delight)@1.0.8 | |
| Placebo(placebo)@8.6.2 | |
| PlayerRevive(playerrevive)@2.0.27 | |
| PneumaticCraft: Repressurized(pneumaticcraft)@6.0.17+mc1.20.1 | |
| PolyLib(polylib)@2000.0.3-build.143 | |
| Polymorph(polymorph)@0.49.5+1.20.1 | |
| Polymorphic Energistics(polyeng)@0.1.1-1.20.1 | |
| Portfolio(portfolio)@1.20.1-1.4.0-forge | |
| ProjectRed Core(projectred_core)@4.20.0-beta+4 | |
| ProjectRed Expansion(projectred_expansion)@4.20.0-beta+4 | |
| ProjectRed Integration(projectred_integration)@4.20.0-beta+4 | |
| ProjectRed Transmission(projectred_transmission)@4.20.0-beta+4 | |
| Puzzles Access Api(puzzlesaccessapi)@8.0.7 | |
| Puzzles Lib(puzzleslib)@8.1.23 | |
| Quark Oddities(quarkoddities)@1.20.1 | |
| Quark(quark)@4.0-460 | |
| RAC-Compat(raccompat)@0.1.3 | |
| RAM-Compat(ramcompat)@0.1.4 | |
| RFToolsBase(rftoolsbase)@1.20-5.0.5 | |
| RFToolsBuilder(rftoolsbuilder)@1.20-6.0.8 | |
| RFToolsControl(rftoolscontrol)@1.20-7.0.2 | |
| RFToolsDimensions(rftoolsdim)@1.20-11.0.9 | |
| RFToolsUtility(rftoolsutility)@1.20-6.0.6 | |
| Radiant Gear(radiantgear)@2.1.5+1.20.1 | |
| Raided(raided)@0.1.4 | |
| Rats(rats)@1.20.1-8.1.2 | |
| Reach Entity Attributes(reach_entity_attributes)@2.4.0 | |
| Recrafted Creatures(recrafted_creatures)@1.4.5-1.20.1 | |
| Regions Unexplored(regions_unexplored)@0.5.6 | |
| Relics(relics)@0.8.0.7 | |
| Resourceful Lib(resourcefullib)@2.1.29 | |
| Resourcefulconfig(resourcefulconfig)@2.1.2 | |
| Restrictions(restrictions)@1.20-6.0.2 | |
| Rhino(rhino)@2001.2.3-build.6 | |
| Ritchie's Projectile Library(ritchiesprojectilelib)@2.0.0-dev+mc.1.20.1-forge-build.182 | |
| Runelic(runelic)@18.0.2 | |
| Saturn(saturn)@0.1.3 | |
| Scena(scena)@1.0.103 | |
| Sculk Horde(sculkhorde)@1.20.1-0.9.13 | |
| Server Tab Info(servertabinfo)@1.3.8 | |
| ServerCore(servercore)@1.5.1+1.20.1 | |
| Silent's Delight(silentsdelight)@1.20.1-1.0.0 | |
| Simple World Timer(simpleworldtimer)@1.20.1-1.1.2-beta | |
| Sit(sit)@1.3.5 | |
| Skinned Carts(skinnedcarts)@2.0.1 | |
| Skinned Lanterns(skinnedlanterns)@1.20.1-1.3.5 | |
| Sky Villages(skyvillages)@1.0.4 | |
| Smarter Farmers(smarterfarmers)@1.20-2.1.0 | |
| Smoothchunk mod(smoothchunk)@1.20.1-3.6 | |
| Snowballs Freeze Mobs(snowballsfreezemobs)@3.7 | |
| Snuffles(snuffles)@1.0.7 | |
| Sophisticated Backpacks(sophisticatedbackpacks)@3.20.6.1064 | |
| Sophisticated Core(sophisticatedcore)@0.6.25.632 | |
| Sophisticated Storage(sophisticatedstorage)@0.10.26.817 | |
| Sound Physics Remastered(sound_physics_remastered)@1.20.1-1.4.5 | |
| Spark(spark)@1.10.53 | |
| Spawn(spawn)@1.20.1-1.0.2 | |
| Special Mobs(specialmobs)@1.20.1-3.1.6 | |
| Species(species)@1.20.1-1.3 | |
| SpectreLib(spectrelib)@0.13.15+1.20.1 | |
| Spooky Paintings 1.20.1(spooky_paintings_)@1.0.0 | |
| Squid No Glitch(squidnoglitch)@1.0.3 | |
| Structure Gel API(structure_gel)@2.16.2 | |
| SuperMartijn642's Config Library(supermartijn642configlib)@1.1.8 | |
| SuperMartijn642's Core Lib(supermartijn642corelib)@1.1.17+a | |
| Supplementaries(supplementaries)@1.20-2.8.17 | |
| Taniwha(taniwha)@1.20.0-5.4.4 | |
| Tectonic(tectonic)@2.4.1 | |
| TerraBlender(terrablender)@3.0.1.7 | |
| Terralith(terralith)@2.5.4 | |
| The Conjurer(conjurer_illager)@1.1.6 | |
| The Ghast Cow mod(ghastcow)@2.0.0 | |
| The Graveyard(graveyard)@3.1 | |
| The Outer End(outer_end)@1.0.8 | |
| The Twilight Forest(twilightforest)@4.3.2508 | |
| The Undergarden(undergarden)@0.8.14 | |
| Tiny Gates(tinygates)@1.20-4.0.0 | |
| Tiny Redstone(tinyredstone)@1.20-5.0.3 | |
| Too Fast(toofast)@0.4.3.5 | |
| Too Many Glyphs(toomanyglyphs)@2.3.2.12345 | |
| Too Many Paintings!(toomanypaintings)@1.0.2-1.20-1.20.4-forge | |
| Towns and Towers(t_and_t)@0.0NONE | |
| Twilight Forest: The Lost Blocks(tflostblocks)@1.20.1-1.5.0 | |
| Twilight Tweaks(twilighttweaks)@1.2 | |
| Twilight's Flavor & Delight(twilightdelight)@2.0.12 | |
| U Team Core(uteamcore)@5.1.4.312 | |
| Universal Sawmill(sawmill)@1.20-1.4.3 | |
| Unusual Fish Mod(unusualfishmod)@1.0.7 | |
| Unusual Prehistory(unusualprehistory)@1.5.0.3 | |
| Upgrade Aquatic(upgrade_aquatic)@6.0.1 | |
| Useful Railroads(usefulrailroads)@1.5.6.56 | |
| VMH - Variable Mob Height(vmh)@1.2.2-forge-1.20.1 | |
| Vanilla Cookbook(vanillacookbook)@2.2.2 | |
| Vanilla Degus(vanilla_degus)@1.5.1 | |
| Variants & Ventures(variantsandventures)@1.0.5 | |
| Vintage Delight(vintagedelight)@0.0.1 | |
| Visual Workbench(visualworkbench)@8.0.0 | |
| WF's Cave Overhaul(caveoverhaul)@1.3.2 | |
| WaterFrames(waterframes)@2.1.5 | |
| What Are You Voting For? 2023(whatareyouvotingfor)@1.2.5 | |
| What The Fox(what_the_fox)@0.2-1.20 | |
| When Dungeons Arise(dungeons_arise)@2.1.58-1.20.x | |
| Whisperwoods(whisperwoods)@1.20.1-2.1.2 | |
| WunderLib(wunderlib)@1.1.5 | |
| Xaero's Minimap(xaerominimap)@24.4.0 | |
| Xaero's World Map(xaeroworldmap)@1.39.0 | |
| YUNG's API(yungsapi)@1.20-Forge-4.0.5 | |
| YUNG's Better Desert Temples(betterdeserttemples)@1.20-Forge-3.0.3 | |
| YUNG's Better Dungeons(betterdungeons)@1.20-Forge-4.0.4 | |
| YUNG's Better End Island(betterendisland)@1.20-Forge-2.0.6 | |
| YUNG's Better Jungle Temples(betterjungletemples)@1.20-Forge-2.0.5 | |
| YUNG's Better Mineshafts(bettermineshafts)@1.20-Forge-4.0.4 | |
| YUNG's Better Nether Fortresses(betterfortresses)@1.20-Forge-2.0.6 | |
| YUNG's Better Ocean Monuments(betteroceanmonuments)@1.20-Forge-3.0.4 | |
| YUNG's Better Witch Huts(betterwitchhuts)@1.20-Forge-3.0.3 | |
| Zeta(zeta)@1.0-24 |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment