Skip to content

Instantly share code, notes, and snippets.

@sdan

sdan/templatev2.js

Created July 22, 2018 23:28
Show Gist options
  • Star 0 You must be signed in to star a gist
  • Fork 0 You must be signed in to fork a gist
  • Save sdan/ace85f2497ea1f79b14add81a7509fed to your computer and use it in GitHub Desktop.
Save sdan/ace85f2497ea1f79b14add81a7509fed to your computer and use it in GitHub Desktop.
Download ZIP
Raw
templatev2.js
// modified distill.pub template v1 for world models.
(function (global, factory) {
typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports) :
typeof define === 'function' && define.amd ? define(['exports'], factory) :
(factory((global.dl = global.dl || {})));
}(this, (function (exports) { 'use strict';
var html = function(dom) {
if (!dom.querySelector("html").getAttribute("lang")) {
dom.querySelector("html").setAttribute("lang", "en");
}
var head = dom.querySelector("head");
if (!dom.querySelector("meta[charset]")) {
var meta = dom.createElement("meta");
meta.setAttribute("charset", "utf-8");
head.appendChild(meta);
}
if (!dom.querySelector("meta[name=viewport]")) {
var meta$1 = dom.createElement("meta");
meta$1.setAttribute("name", "viewport");
meta$1.setAttribute("content", "width=device-width, initial-scale=1");
head.appendChild(meta$1);
}
};
var base = "html {\n font: 400 16px/1.55em -apple-system, BlinkMacSystemFont, \"Roboto\", Helvetica, sans-serif;\n /*background-color: hsl(223, 9%, 25%);*/\n -ms-text-size-adjust: 100%;\n -webkit-text-size-adjust: 100%;\n text-size-adjust: 100%;\n}\nbody {\n margin: 0;\n /*background-color: hsl(223, 9%, 25%);*/\n}\n\na {\n color: #004276;\n}\n\nfigure {\n margin: 0;\n}\n\nh1 {\n font-family: Roboto, Helvetica Neue, Helvetica,sans-serif;\n}\n\n/*\nhtml, body, div, span, applet, object, iframe,\nh1, h2, h3, h4, h5, h6, p, blockquote, pre,\na, abbr, acronym, address, big, cite, code,\ndel, dfn, em, img, ins, kbd, q, s, samp,\nsmall, strike, strong, sub, sup, tt, var,\nb, u, i, center,\ndl, dt, dd, ol, ul, li,\nfieldset, form, label, legend,\ntable, caption, tbody, tfoot, thead, tr, th, td,\narticle, aside, canvas, details, embed,\nfigure, figcaption, footer, header, hgroup,\nmenu, nav, output, ruby, section, summary,\ntime, mark, audio, video {\n\tmargin: 0;\n\tpadding: 0;\n\tborder: 0;\n\tfont-size: 100%;\n\tfont: inherit;\n\tvertical-align: baseline;\n}\narticle, aside, details, figcaption, figure,\nfooter, header, hgroup, menu, nav, section {\n\tdisplay: block;\n}\nbody {\n\tline-height: 1;\n}\nol, ul {\n\tlist-style: none;\n}\nblockquote, q {\n\tquotes: none;\n}\nblockquote:before, blockquote:after,\nq:before, q:after {\n\tcontent: '';\n\tcontent: none;\n}\ntable {\n\tborder-collapse: collapse;\n\tborder-spacing: 0;\n}*/\n";
var layout = "/*\n Column: 60px\n Gutter: 24px\n\n Body: 648px\n - 8 columns\n - 7 gutters\n Middle: 816px\n Page: 984px\n - 12 columns\n - 11 gutters\n*/\n\n.l-body,\n.l-body-outset,\n.l-page,\n.l-page-outset,\n.l-middle,\n.l-middle-outset,\ndt-article > div,\ndt-article > p,\ndt-article > h1,\ndt-article > h2,\ndt-article > h3,\ndt-article > h4,\ndt-article > figure,\ndt-article > table,\ndt-article > ol,\ndt-article > ul,\ndt-article > dt-byline,\ndt-article > dt-math,\ndt-article > dt-code,\ndt-article section > div,\ndt-article section > p,\ndt-article section > h1,\ndt-article section > h2,\ndt-article section > h3,\ndt-article section > h4,\ndt-article section > figure,\ndt-article section > table,\ndt-article section > ol,\ndt-article section > ul,\ndt-article section > dt-byline,\ndt-article section > dt-code {\n width: auto;\n margin-left: 24px;\n margin-right: 24px;\n box-sizing: border-box;\n}\n\n@media(min-width: 768px) {\n .l-body,\n .l-body-outset,\n .l-page,\n .l-page-outset,\n .l-middle,\n .l-middle-outset,\n dt-article > div,\n dt-article > p,\n dt-article > h1,\n dt-article > h2,\n dt-article > h3,\n dt-article > h4,\n dt-article > figure,\n dt-article > table,\n dt-article > ol,\n dt-article > ul,\n dt-article > dt-byline,\n dt-article > dt-math,\n dt-article > dt-code,\n dt-article section > div,\n dt-article section > p,\n dt-article section > h1,\n dt-article section > h2,\n dt-article section > h3,\n dt-article section > h4,\n dt-article section > figure,\n dt-article section > table,\n dt-article section > ol,\n dt-article section > ul,\n dt-article section > dt-byline,\n dt-article section > dt-code {\n margin-left: 72px;\n margin-right: 72px;\n }\n}\n\n@media(min-width: 1080px) {\n .l-body,\n dt-article > div,\n dt-article > p,\n dt-article > h2,\n dt-article > h3,\n dt-article > h4,\n dt-article > figure,\n dt-article > table,\n dt-article > ol,\n dt-article > ul,\n dt-article > dt-byline,\n dt-article > dt-math,\n dt-article > dt-code,\n dt-article section > div,\n dt-article section > p,\n dt-article section > h2,\n dt-article section > h3,\n dt-article section > h4,\n dt-article section > figure,\n dt-article section > table,\n dt-article section > ol,\n dt-article section > ul,\n dt-article section > dt-byline,\n dt-article section > dt-code {\n margin-left: calc(50% - 984px / 2);\n width: 648px;\n }\n .l-body-outset,\n dt-article .l-body-outset {\n margin-left: calc(50% - 984px / 2 - 96px/2);\n width: calc(648px + 96px);\n }\n .l-middle,\n dt-article .l-middle {\n width: 816px;\n margin-left: calc(50% - 984px / 2);\n margin-right: auto;\n }\n .l-middle-outset,\n dt-article .l-middle-outset {\n width: calc(816px + 96px);\n margin-left: calc(50% - 984px / 2 - 48px);\n margin-right: auto;\n }\n dt-article > h1,\n dt-article section > h1,\n .l-page,\n dt-article .l-page,\n dt-article.centered .l-page {\n width: 984px;\n margin-left: auto;\n margin-right: auto;\n }\n .l-page-outset,\n dt-article .l-page-outset,\n dt-article.centered .l-page-outset {\n width: 1080px;\n margin-left: auto;\n margin-right: auto;\n }\n .l-screen,\n dt-article .l-screen,\n dt-article.centered .l-screen {\n margin-left: auto;\n margin-right: auto;\n width: auto;\n }\n .l-screen-inset,\n dt-article .l-screen-inset,\n dt-article.centered .l-screen-inset {\n margin-left: 24px;\n margin-right: 24px;\n width: auto;\n }\n .l-gutter,\n dt-article .l-gutter {\n clear: both;\n float: right;\n margin-top: 0;\n margin-left: 24px;\n margin-right: calc((100vw - 984px) / 2 + 168px);\n width: calc((984px - 648px) / 2 - 24px);\n }\n\n /* Side */\n .side.l-body,\n dt-article .side.l-body {\n clear: both;\n float: right;\n margin-top: 0;\n margin-left: 48px;\n margin-right: calc((100vw - 984px + 648px) / 2);\n width: calc(648px / 2 - 24px - 84px);\n }\n .side.l-body-outset,\n dt-article .side.l-body-outset {\n clear: both;\n float: right;\n margin-top: 0;\n margin-left: 48px;\n margin-right: calc((100vw - 984px + 648px - 48px) / 2);\n width: calc(648px / 2 - 48px + 24px);\n }\n .side.l-middle,\n dt-article .side.l-middle {\n clear: both;\n float: right;\n width: calc(456px - 84px);\n margin-left: 48px;\n margin-right: calc((100vw - 984px) / 2 + 168px);\n }\n .side.l-middle-outset,\n dt-article .side.l-middle-outset {\n clear: both;\n float: right;\n width: 456px;\n margin-left: 48px;\n margin-right: calc((100vw - 984px) / 2 + 168px);\n }\n .side.l-page,\n dt-article .side.l-page {\n clear: both;\n float: right;\n margin-left: 48px;\n width: calc(624px - 84px);\n margin-right: calc((100vw - 984px) / 2);\n }\n .side.l-page-outset,\n dt-article .side.l-page-outset {\n clear: both;\n float: right;\n width: 624px;\n margin-right: calc((100vw - 984px) / 2);\n }\n}\n\n/* Centered */\n\n@media(min-width: 1080px) {\n .centered .l-body,\n .centered.l-body,\n dt-article.centered > div,\n dt-article.centered > p,\n dt-article.centered > h2,\n dt-article.centered > h3,\n dt-article.centered > h4,\n dt-article.centered > figure,\n dt-article.centered > table,\n dt-article.centered > ol,\n dt-article.centered > ul,\n dt-article.centered > dt-byline,\n dt-article.centered > dt-code,\n dt-article.centered section > div,\n dt-article.centered section > p,\n dt-article.centered section > h2,\n dt-article.centered section > h3,\n dt-article.centered section > h4,\n dt-article.centered section > figure,\n dt-article.centered section > table,\n dt-article.cebtered section > ol,\n dt-article.centered section > ul,\n dt-article.centered section > dt-byline,\n dt-article.centered section > dt-code,\n dt-article section.centered > div,\n dt-article section.centered > p,\n dt-article section.centered > h2,\n dt-article section.centered > h3,\n dt-article section.centered > h4,\n dt-article section.centered > figure,\n dt-article section.centered > table,\n dt-article section.centered > ol,\n dt-article section.centered > ul,\n dt-article section.centered > dt-byline,\n dt-article section.centered > dt-code {\n margin-left: auto;\n margin-right: auto;\n width: 648px;\n }\n .centered .l-body-outset,\n .centered.l-body-outset,\n dt-article.centered .l-body-outset {\n margin-left: auto;\n margin-right: auto;\n width: calc(648px + 96px);\n }\n dt-article.centered > h1,\n dt-article.centered section > h1,\n dt-article section.centered > h1,\n .centered .l-middle,\n .centered.l-middle,\n dt-article.centered .l-middle {\n width: 816px;\n margin-left: auto;\n margin-right: auto;\n }\n\n .centered .l-middle-outset,\n .centered.l-middle-outset,\n dt-article.centered .l-middle-outset {\n width: calc(816px + 96px);\n margin-left: auto;\n margin-right: auto;\n }\n\n /* page and screen are already centered */\n\n /* Side */\n\n .centered .side.l-body,\n .centered dt-article .side.l-body {\n clear: both;\n float: right;\n margin-top: 0;\n margin-left: 48px;\n margin-right: calc((100vw - 648px) / 2);\n width: calc(4 * 60px + 3 * 24px);\n }\n .centered .side.l-body-outset,\n .centered dt-article .side.l-body-outset {\n clear: both;\n float: right;\n margin-top: 0;\n margin-left: 48px;\n margin-right: calc((100vw - 648px) / 2);\n width: calc(4 * 60px + 3 * 24px);\n }\n .centered .side.l-middle,\n .centered dt-article .side.l-middle {\n clear: both;\n float: right;\n width: 396px;\n margin-left: 48px;\n margin-right: calc((100vw - 984px) / 2 + 168px / 2);\n }\n .centered .side.l-middle-outset,\n .centered dt-article .side.l-middle-outset {\n clear: both;\n float: right;\n width: 456px;\n margin-left: 48px;\n margin-right: calc((100vw - 984px) / 2 + 168px);\n }\n .centered .side.l-page,\n .centered dt-article .side.l-page {\n clear: both;\n float: right;\n width: 480px;\n margin-right: calc((100vw - 984px) / 2);\n }\n .centered .side.l-page-outset,\n .centered dt-article .side.l-page-outset {\n clear: both;\n float: right;\n width: 480px;\n margin-right: calc((100vw - 984px) / 2);\n }\n .centered .l-gutter,\n .centered.l-gutter,\n dt-article.centered .l-gutter {\n clear: both;\n float: right;\n margin-top: 0;\n margin-left: 24px;\n margin-right: calc((100vw - 984px) / 2);\n width: calc((984px - 648px) / 2 - 24px);\n }\n\n}\n\n/* Rows and Columns */\n\n.row {\n display: flex;\n}\n.column {\n flex: 1;\n box-sizing: border-box;\n margin-right: 24px;\n margin-left: 24px;\n}\n.row > .column:first-of-type {\n margin-left: 0;\n}\n.row > .column:last-of-type {\n margin-right: 0;\n}\n";
var article = "dt-article {\n display: block;\n color: rgba(0, 0, 0, 0.8);\n font: 17px/1.55em -apple-system, BlinkMacSystemFont, \"Roboto\", sans-serif;\n padding-bottom: 72px;\n background: white;\n}\n\n@media(min-width: 1024px) {\n dt-article {\n font-size: 20px;\n }\n}\n\n/* H1 */\n\ndt-article h1 {\n margin-top: 18px;\n font-weight: 400;\n font-size: 40px;\n line-height: 1em;\n font-family: 'Roboto', sans-serif; \n}\n@media(min-width: 768px) {\n dt-article h1 {\n font-size: 46px;\n margin-top: 48px;\n margin-bottom: 12px;\n }\n}\n\n@media(min-width: 1080px) {\n .centered h1 {\n text-align: center;\n }\n\n dt-article h1 {\n font-size: 50px;\n letter-spacing: -0.02em;\n }\n\n dt-article > h1:first-of-type,\n dt-article section > h1:first-of-type {\n margin-top: 80px;\n }\n}\n\n\n@media(min-width: 1200px) {\n dt-article h1 {\n font-size: 56px;\n }\n\n dt-article > h1:first-of-type {\n margin-top: 100px;\n }\n}\n\n/* H2 */\n\ndt-article h2 {\n font-family: 'Roboto', sans-serif;\n font-weight: 400;\n font-size: 26px;\n line-height: 1.25em;\n margin-top: 36px;\n margin-bottom: 24px;\n}\n\n@media(min-width: 1024px) {\n dt-article h2 {\n margin-top: 48px;\n font-size: 30px;\n }\n}\n\ndt-article h1 + h2 {\n font-weight: 300;\n font-size: 20px;\n line-height: 1.4em;\n margin-top: 8px;\n font-style: normal;\n}\n\n\n@media(min-width: 1080px) {\n .centered h1 + h2 {\n text-align: center;\n }\n dt-article h1 + h2 {\n margin-top: 12px;\n font-size: 24px;\n }\n}\n\n/* H3 */\n\ndt-article h3 {\n font-family: HoeflerText-Regular, Georgia, serif;\n font-weight: 400;\n font-size: 20px;\n line-height: 1.4em;\n margin-top: 36px;\n margin-bottom: 18px;\n font-style: italic;\n}\n\ndt-article h1 + h3 {\n margin-top: 48px;\n}\n\n@media(min-width: 1024px) {\n dt-article h3 {\n font-size: 26px;\n }\n}\n\n/* H4 */\n\ndt-article h4 {\n font-weight: 600;\n text-transform: uppercase;\n font-size: 14px;\n line-height: 1.4em;\n}\n\ndt-article a {\n color: inherit;\n}\n\ndt-article p,\ndt-article ul,\ndt-article ol {\n margin-bottom: 24px;\n font-family: Georgia, serif;\n}\n\ndt-article p b,\ndt-article ul b,\ndt-article ol b {\n -webkit-font-smoothing: antialiased;\n}\n\ndt-article a {\n border-bottom: 1px solid rgba(0, 0, 0, 0.4);\n text-decoration: none;\n}\n\ndt-article a:hover {\n border-bottom: 1px solid rgba(0, 0, 0, 0.8);\n}\n\ndt-article .link {\n text-decoration: underline;\n cursor: pointer;\n}\n\ndt-article ul,\ndt-article ol {\n padding-left: 24px;\n}\n\ndt-article li {\n margin-bottom: 24px;\n margin-left: 0;\n padding-left: 0;\n}\n\ndt-article pre {\n font-size: 14px;\n margin-bottom: 20px;\n}\n\n\ndt-article hr {\n border: none;\n border-bottom: 1px solid rgba(0, 0, 0, 0.2);\n margin-top: 60px;\n margin-bottom: 60px;\n}\n\ndt-article section {\n margin-top: 60px;\n margin-bottom: 60px;\n}\n\n/* Tables */\n\ndt-article table {\n border-collapse: collapse;\n}\n\ndt-article table th {\n border-bottom: 1px solid rgba(0, 0, 0, 0.1);\n}\n\ndt-article table td {\n border-bottom: 1px solid rgba(0, 0, 0, 0.05);\n}\n\ndt-article table th,\ndt-article table td {\n font-size: 15px;\n padding: 2px 0;\n}\n\n/* Figure */\n\ndt-article figure {\n position: relative;\n margin-top: 30px;\n margin-bottom: 30px;\n}\n\n@media(min-width: 1024px) {\n dt-article figure {\n margin-top: 48px;\n margin-bottom: 48px;\n }\n}\n\ndt-article figure img {\n width: 100%;\n}\n\ndt-article figure svg text,\ndt-article figure svg tspan {\n}\n\ndt-article figure figcaption {\n color: rgba(0, 0, 0, 0.6);\n font-size: 12px;\n line-height: 1.5em;\n}\n@media(min-width: 1024px) {\n dt-article figure figcaption {\n font-size: 13px;\n }\n}\n\ndt-article figure.external img {\n background: white;\n border: 1px solid rgba(0, 0, 0, 0.1);\n box-shadow: 0 1px 8px rgba(0, 0, 0, 0.1);\n padding: 18px;\n box-sizing: border-box;\n}\n\ndt-article figure figcaption a {\n color: rgba(0, 0, 0, 0.6);\n}\n\ndt-article span.equation-mimic {\n font-family: georgia;\n font-size: 115%;\n font-style: italic;\n}\n\ndt-article figure figcaption b {\n font-weight: 600;\n color: rgba(0, 0, 0, 1.0);\n}\n\ndt-article > dt-code,\ndt-article section > dt-code {\n display: block;\n}\n\ndt-article .citation {\n color: #668;\n cursor: pointer;\n}\n\ndt-include {\n width: auto;\n display: block;\n}\n";
var code = "/**\n * prism.js default theme for JavaScript, CSS and HTML\n * Based on dabblet (http://dabblet.com)\n * @author Lea Verou\n */\n\ncode {\n white-space: nowrap;\n background: rgba(0, 0, 0, 0.04);\n border-radius: 2px;\n padding: 4px 7px;\n font-size: 15px;\n color: rgba(0, 0, 0, 0.6);\n}\n\npre code {\n display: block;\n background: white;\n border-left: 3px solid rgba(0, 0, 0, 0.05);\n padding: 0 0 0 24px;\n}\n\n\ncode[class*=\"language-\"],\npre[class*=\"language-\"] {\n text-shadow: 0 1px white;\n font-family: Consolas, Monaco, 'Andale Mono', 'Ubuntu Mono', monospace;\n text-align: left;\n white-space: pre;\n word-spacing: normal;\n word-break: normal;\n word-wrap: normal;\n line-height: 1.5;\n\n -moz-tab-size: 4;\n -o-tab-size: 4;\n tab-size: 4;\n\n -webkit-hyphens: none;\n -moz-hyphens: none;\n -ms-hyphens: none;\n hyphens: none;\n}\n\npre[class*=\"language-\"]::-moz-selection, pre[class*=\"language-\"] ::-moz-selection,\ncode[class*=\"language-\"]::-moz-selection, code[class*=\"language-\"] ::-moz-selection {\n text-shadow: none;\n background: #b3d4fc;\n}\n\npre[class*=\"language-\"]::selection, pre[class*=\"language-\"] ::selection,\ncode[class*=\"language-\"]::selection, code[class*=\"language-\"] ::selection {\n text-shadow: none;\n background: #b3d4fc;\n}\n\n@media print {\n code[class*=\"language-\"],\n pre[class*=\"language-\"] {\n text-shadow: none;\n }\n}\n\n/* Code blocks */\npre[class*=\"language-\"] {\n overflow: auto;\n}\n\n:not(pre) > code[class*=\"language-\"],\npre[class*=\"language-\"] {\n}\n\n/* Inline code */\n:not(pre) > code[class*=\"language-\"] {\n white-space: normal;\n}\n\n.token.comment,\n.token.prolog,\n.token.doctype,\n.token.cdata {\n color: slategray;\n}\n\n.token.punctuation {\n color: #999;\n}\n\n.namespace {\n opacity: .7;\n}\n\n.token.property,\n.token.tag,\n.token.boolean,\n.token.number,\n.token.constant,\n.token.symbol,\n.token.deleted {\n color: #905;\n}\n\n.token.selector,\n.token.attr-name,\n.token.string,\n.token.char,\n.token.builtin,\n.token.inserted {\n color: #690;\n}\n\n.token.operator,\n.token.entity,\n.token.url,\n.language-css .token.string,\n.style .token.string {\n color: #a67f59;\n background: hsla(0, 0%, 100%, .5);\n}\n\n.token.atrule,\n.token.attr-value,\n.token.keyword {\n color: #07a;\n}\n\n.token.function {\n color: #DD4A68;\n}\n\n.token.regex,\n.token.important,\n.token.variable {\n color: #e90;\n}\n\n.token.important,\n.token.bold {\n font-weight: bold;\n}\n.token.italic {\n font-style: italic;\n}\n\n.token.entity {\n cursor: help;\n}\n";
var print = "\n@media print {\n @page {\n size: 8in 11in;\n }\n html {\n }\n p, code {\n page-break-inside: avoid;\n }\n h2, h3 {\n page-break-after: avoid;\n }\n dt-header {\n visibility: hidden;\n }\n dt-footer {\n display: none!important;\n }\n}\n";
var styles = function(dom) {
var s = dom.createElement("style");
s.textContent = base + layout + article + code + print;
dom.querySelector("head").appendChild(s);
};
function isNothing(subject) {
return (typeof subject === 'undefined') || (subject === null);
}
function isObject(subject) {
return (typeof subject === 'object') && (subject !== null);
}
function toArray(sequence) {
if (Array.isArray(sequence)) { return sequence; }
else if (isNothing(sequence)) { return []; }
return [ sequence ];
}
function extend(target, source) {
var index, length, key, sourceKeys;
if (source) {
sourceKeys = Object.keys(source);
for (index = 0, length = sourceKeys.length; index < length; index += 1) {
key = sourceKeys[index];
target[key] = source[key];
}
}
return target;
}
function repeat(string, count) {
var result = '', cycle;
for (cycle = 0; cycle < count; cycle += 1) {
result += string;
}
return result;
}
function isNegativeZero(number) {
return (number === 0) && (Number.NEGATIVE_INFINITY === 1 / number);
}
var isNothing_1 = isNothing;
var isObject_1 = isObject;
var toArray_1 = toArray;
var repeat_1 = repeat;
var isNegativeZero_1 = isNegativeZero;
var extend_1 = extend;
var common$1 = {
isNothing: isNothing_1,
isObject: isObject_1,
toArray: toArray_1,
repeat: repeat_1,
isNegativeZero: isNegativeZero_1,
extend: extend_1
};
// YAML error class. http://stackoverflow.com/questions/8458984
//
function YAMLException$2(reason, mark) {
// Super constructor
Error.call(this);
// Include stack trace in error object
if (Error.captureStackTrace) {
// Chrome and NodeJS
Error.captureStackTrace(this, this.constructor);
} else {
// FF, IE 10+ and Safari 6+. Fallback for others
this.stack = (new Error()).stack || '';
}
this.name = 'YAMLException';
this.reason = reason;
this.mark = mark;
this.message = (this.reason || '(unknown reason)') + (this.mark ? ' ' + this.mark.toString() : '');
}
// Inherit from Error
YAMLException$2.prototype = Object.create(Error.prototype);
YAMLException$2.prototype.constructor = YAMLException$2;
YAMLException$2.prototype.toString = function toString(compact) {
var result = this.name + ': ';
result += this.reason || '(unknown reason)';
if (!compact && this.mark) {
result += ' ' + this.mark.toString();
}
return result;
};
var exception = YAMLException$2;
var common$3 = common$1;
function Mark$1(name, buffer, position, line, column) {
this.name = name;
this.buffer = buffer;
this.position = position;
this.line = line;
this.column = column;
}
Mark$1.prototype.getSnippet = function getSnippet(indent, maxLength) {
var this$1 = this;
var head, start, tail, end, snippet;
if (!this.buffer) { return null; }
indent = indent || 4;
maxLength = maxLength || 75;
head = '';
start = this.position;
while (start > 0 && '\x00\r\n\x85\u2028\u2029'.indexOf(this.buffer.charAt(start - 1)) === -1) {
start -= 1;
if (this$1.position - start > (maxLength / 2 - 1)) {
head = ' ... ';
start += 5;
break;
}
}
tail = '';
end = this.position;
while (end < this.buffer.length && '\x00\r\n\x85\u2028\u2029'.indexOf(this.buffer.charAt(end)) === -1) {
end += 1;
if (end - this$1.position > (maxLength / 2 - 1)) {
tail = ' ... ';
end -= 5;
break;
}
}
snippet = this.buffer.slice(start, end);
return common$3.repeat(' ', indent) + head + snippet + tail + '\n' +
common$3.repeat(' ', indent + this.position - start + head.length) + '^';
};
Mark$1.prototype.toString = function toString(compact) {
var snippet, where = '';
if (this.name) {
where += 'in "' + this.name + '" ';
}
where += 'at line ' + (this.line + 1) + ', column ' + (this.column + 1);
if (!compact) {
snippet = this.getSnippet();
if (snippet) {
where += ':\n' + snippet;
}
}
return where;
};
var mark = Mark$1;
var YAMLException$4 = exception;
var TYPE_CONSTRUCTOR_OPTIONS = [
'kind',
'resolve',
'construct',
'instanceOf',
'predicate',
'represent',
'defaultStyle',
'styleAliases'
];
var YAML_NODE_KINDS = [
'scalar',
'sequence',
'mapping'
];
function compileStyleAliases(map) {
var result = {};
if (map !== null) {
Object.keys(map).forEach(function (style) {
map[style].forEach(function (alias) {
result[String(alias)] = style;
});
});
}
return result;
}
function Type$2(tag, options) {
options = options || {};
Object.keys(options).forEach(function (name) {
if (TYPE_CONSTRUCTOR_OPTIONS.indexOf(name) === -1) {
throw new YAMLException$4('Unknown option "' + name + '" is met in definition of "' + tag + '" YAML type.');
}
});
// TODO: Add tag format check.
this.tag = tag;
this.kind = options['kind'] || null;
this.resolve = options['resolve'] || function () { return true; };
this.construct = options['construct'] || function (data) { return data; };
this.instanceOf = options['instanceOf'] || null;
this.predicate = options['predicate'] || null;
this.represent = options['represent'] || null;
this.defaultStyle = options['defaultStyle'] || null;
this.styleAliases = compileStyleAliases(options['styleAliases'] || null);
if (YAML_NODE_KINDS.indexOf(this.kind) === -1) {
throw new YAMLException$4('Unknown kind "' + this.kind + '" is specified for "' + tag + '" YAML type.');
}
}
var type = Type$2;
/*eslint-disable max-len*/
var common$4 = common$1;
var YAMLException$3 = exception;
var Type$1 = type;
function compileList(schema, name, result) {
var exclude = [];
schema.include.forEach(function (includedSchema) {
result = compileList(includedSchema, name, result);
});
schema[name].forEach(function (currentType) {
result.forEach(function (previousType, previousIndex) {
if (previousType.tag === currentType.tag && previousType.kind === currentType.kind) {
exclude.push(previousIndex);
}
});
result.push(currentType);
});
return result.filter(function (type$$1, index) {
return exclude.indexOf(index) === -1;
});
}
function compileMap(/* lists... */) {
var arguments$1 = arguments;
var result = {
scalar: {},
sequence: {},
mapping: {},
fallback: {}
}, index, length;
function collectType(type$$1) {
result[type$$1.kind][type$$1.tag] = result['fallback'][type$$1.tag] = type$$1;
}
for (index = 0, length = arguments.length; index < length; index += 1) {
arguments$1[index].forEach(collectType);
}
return result;
}
function Schema$2(definition) {
this.include = definition.include || [];
this.implicit = definition.implicit || [];
this.explicit = definition.explicit || [];
this.implicit.forEach(function (type$$1) {
if (type$$1.loadKind && type$$1.loadKind !== 'scalar') {
throw new YAMLException$3('There is a non-scalar type in the implicit list of a schema. Implicit resolving of such types is not supported.');
}
});
this.compiledImplicit = compileList(this, 'implicit', []);
this.compiledExplicit = compileList(this, 'explicit', []);
this.compiledTypeMap = compileMap(this.compiledImplicit, this.compiledExplicit);
}
Schema$2.DEFAULT = null;
Schema$2.create = function createSchema() {
var schemas, types;
switch (arguments.length) {
case 1:
schemas = Schema$2.DEFAULT;
types = arguments[0];
break;
case 2:
schemas = arguments[0];
types = arguments[1];
break;
default:
throw new YAMLException$3('Wrong number of arguments for Schema.create function');
}
schemas = common$4.toArray(schemas);
types = common$4.toArray(types);
if (!schemas.every(function (schema) { return schema instanceof Schema$2; })) {
throw new YAMLException$3('Specified list of super schemas (or a single Schema object) contains a non-Schema object.');
}
if (!types.every(function (type$$1) { return type$$1 instanceof Type$1; })) {
throw new YAMLException$3('Specified list of YAML types (or a single Type object) contains a non-Type object.');
}
return new Schema$2({
include: schemas,
explicit: types
});
};
var schema = Schema$2;
var Type$3 = type;
var str = new Type$3('tag:yaml.org,2002:str', {
kind: 'scalar',
construct: function (data) { return data !== null ? data : ''; }
});
var Type$4 = type;
var seq = new Type$4('tag:yaml.org,2002:seq', {
kind: 'sequence',
construct: function (data) { return data !== null ? data : []; }
});
var Type$5 = type;
var map = new Type$5('tag:yaml.org,2002:map', {
kind: 'mapping',
construct: function (data) { return data !== null ? data : {}; }
});
var Schema$5 = schema;
var failsafe = new Schema$5({
explicit: [
str,
seq,
map
]
});
var Type$6 = type;
function resolveYamlNull(data) {
if (data === null) { return true; }
var max = data.length;
return (max === 1 && data === '~') ||
(max === 4 && (data === 'null' || data === 'Null' || data === 'NULL'));
}
function constructYamlNull() {
return null;
}
function isNull(object) {
return object === null;
}
var _null = new Type$6('tag:yaml.org,2002:null', {
kind: 'scalar',
resolve: resolveYamlNull,
construct: constructYamlNull,
predicate: isNull,
represent: {
canonical: function () { return '~'; },
lowercase: function () { return 'null'; },
uppercase: function () { return 'NULL'; },
camelcase: function () { return 'Null'; }
},
defaultStyle: 'lowercase'
});
var Type$7 = type;
function resolveYamlBoolean(data) {
if (data === null) { return false; }
var max = data.length;
return (max === 4 && (data === 'true' || data === 'True' || data === 'TRUE')) ||
(max === 5 && (data === 'false' || data === 'False' || data === 'FALSE'));
}
function constructYamlBoolean(data) {
return data === 'true' ||
data === 'True' ||
data === 'TRUE';
}
function isBoolean(object) {
return Object.prototype.toString.call(object) === '[object Boolean]';
}
var bool = new Type$7('tag:yaml.org,2002:bool', {
kind: 'scalar',
resolve: resolveYamlBoolean,
construct: constructYamlBoolean,
predicate: isBoolean,
represent: {
lowercase: function (object) { return object ? 'true' : 'false'; },
uppercase: function (object) { return object ? 'TRUE' : 'FALSE'; },
camelcase: function (object) { return object ? 'True' : 'False'; }
},
defaultStyle: 'lowercase'
});
var common$5 = common$1;
var Type$8 = type;
function isHexCode(c) {
return ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)) ||
((0x41/* A */ <= c) && (c <= 0x46/* F */)) ||
((0x61/* a */ <= c) && (c <= 0x66/* f */));
}
function isOctCode(c) {
return ((0x30/* 0 */ <= c) && (c <= 0x37/* 7 */));
}
function isDecCode(c) {
return ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */));
}
function resolveYamlInteger(data) {
if (data === null) { return false; }
var max = data.length,
index = 0,
hasDigits = false,
ch;
if (!max) { return false; }
ch = data[index];
// sign
if (ch === '-' || ch === '+') {
ch = data[++index];
}
if (ch === '0') {
// 0
if (index + 1 === max) { return true; }
ch = data[++index];
// base 2, base 8, base 16
if (ch === 'b') {
// base 2
index++;
for (; index < max; index++) {
ch = data[index];
if (ch === '_') { continue; }
if (ch !== '0' && ch !== '1') { return false; }
hasDigits = true;
}
return hasDigits;
}
if (ch === 'x') {
// base 16
index++;
for (; index < max; index++) {
ch = data[index];
if (ch === '_') { continue; }
if (!isHexCode(data.charCodeAt(index))) { return false; }
hasDigits = true;
}
return hasDigits;
}
// base 8
for (; index < max; index++) {
ch = data[index];
if (ch === '_') { continue; }
if (!isOctCode(data.charCodeAt(index))) { return false; }
hasDigits = true;
}
return hasDigits;
}
// base 10 (except 0) or base 60
for (; index < max; index++) {
ch = data[index];
if (ch === '_') { continue; }
if (ch === ':') { break; }
if (!isDecCode(data.charCodeAt(index))) {
return false;
}
hasDigits = true;
}
if (!hasDigits) { return false; }
// if !base60 - done;
if (ch !== ':') { return true; }
// base60 almost not used, no needs to optimize
return /^(:[0-5]?[0-9])+$/.test(data.slice(index));
}
function constructYamlInteger(data) {
var value = data, sign = 1, ch, base, digits = [];
if (value.indexOf('_') !== -1) {
value = value.replace(/_/g, '');
}
ch = value[0];
if (ch === '-' || ch === '+') {
if (ch === '-') { sign = -1; }
value = value.slice(1);
ch = value[0];
}
if (value === '0') { return 0; }
if (ch === '0') {
if (value[1] === 'b') { return sign * parseInt(value.slice(2), 2); }
if (value[1] === 'x') { return sign * parseInt(value, 16); }
return sign * parseInt(value, 8);
}
if (value.indexOf(':') !== -1) {
value.split(':').forEach(function (v) {
digits.unshift(parseInt(v, 10));
});
value = 0;
base = 1;
digits.forEach(function (d) {
value += (d * base);
base *= 60;
});
return sign * value;
}
return sign * parseInt(value, 10);
}
function isInteger(object) {
return (Object.prototype.toString.call(object)) === '[object Number]' &&
(object % 1 === 0 && !common$5.isNegativeZero(object));
}
var int_1 = new Type$8('tag:yaml.org,2002:int', {
kind: 'scalar',
resolve: resolveYamlInteger,
construct: constructYamlInteger,
predicate: isInteger,
represent: {
binary: function (object) { return '0b' + object.toString(2); },
octal: function (object) { return '0' + object.toString(8); },
decimal: function (object) { return object.toString(10); },
hexadecimal: function (object) { return '0x' + object.toString(16).toUpperCase(); }
},
defaultStyle: 'decimal',
styleAliases: {
binary: [ 2, 'bin' ],
octal: [ 8, 'oct' ],
decimal: [ 10, 'dec' ],
hexadecimal: [ 16, 'hex' ]
}
});
var common$6 = common$1;
var Type$9 = type;
var YAML_FLOAT_PATTERN = new RegExp(
'^(?:[-+]?(?:[0-9][0-9_]*)\\.[0-9_]*(?:[eE][-+][0-9]+)?' +
'|\\.[0-9_]+(?:[eE][-+][0-9]+)?' +
'|[-+]?[0-9][0-9_]*(?::[0-5]?[0-9])+\\.[0-9_]*' +
'|[-+]?\\.(?:inf|Inf|INF)' +
'|\\.(?:nan|NaN|NAN))$');
function resolveYamlFloat(data) {
if (data === null) { return false; }
if (!YAML_FLOAT_PATTERN.test(data)) { return false; }
return true;
}
function constructYamlFloat(data) {
var value, sign, base, digits;
value = data.replace(/_/g, '').toLowerCase();
sign = value[0] === '-' ? -1 : 1;
digits = [];
if ('+-'.indexOf(value[0]) >= 0) {
value = value.slice(1);
}
if (value === '.inf') {
return (sign === 1) ? Number.POSITIVE_INFINITY : Number.NEGATIVE_INFINITY;
} else if (value === '.nan') {
return NaN;
} else if (value.indexOf(':') >= 0) {
value.split(':').forEach(function (v) {
digits.unshift(parseFloat(v, 10));
});
value = 0.0;
base = 1;
digits.forEach(function (d) {
value += d * base;
base *= 60;
});
return sign * value;
}
return sign * parseFloat(value, 10);
}
var SCIENTIFIC_WITHOUT_DOT = /^[-+]?[0-9]+e/;
function representYamlFloat(object, style) {
var res;
if (isNaN(object)) {
switch (style) {
case 'lowercase': return '.nan';
case 'uppercase': return '.NAN';
case 'camelcase': return '.NaN';
}
} else if (Number.POSITIVE_INFINITY === object) {
switch (style) {
case 'lowercase': return '.inf';
case 'uppercase': return '.INF';
case 'camelcase': return '.Inf';
}
} else if (Number.NEGATIVE_INFINITY === object) {
switch (style) {
case 'lowercase': return '-.inf';
case 'uppercase': return '-.INF';
case 'camelcase': return '-.Inf';
}
} else if (common$6.isNegativeZero(object)) {
return '-0.0';
}
res = object.toString(10);
// JS stringifier can build scientific format without dots: 5e-100,
// while YAML requres dot: 5.e-100. Fix it with simple hack
return SCIENTIFIC_WITHOUT_DOT.test(res) ? res.replace('e', '.e') : res;
}
function isFloat(object) {
return (Object.prototype.toString.call(object) === '[object Number]') &&
(object % 1 !== 0 || common$6.isNegativeZero(object));
}
var float_1 = new Type$9('tag:yaml.org,2002:float', {
kind: 'scalar',
resolve: resolveYamlFloat,
construct: constructYamlFloat,
predicate: isFloat,
represent: representYamlFloat,
defaultStyle: 'lowercase'
});
var Schema$4 = schema;
var json = new Schema$4({
include: [
failsafe
],
implicit: [
_null,
bool,
int_1,
float_1
]
});
var Schema$3 = schema;
var core = new Schema$3({
include: [
json
]
});
var Type$10 = type;
var YAML_DATE_REGEXP = new RegExp(
'^([0-9][0-9][0-9][0-9])' + // [1] year
'-([0-9][0-9])' + // [2] month
'-([0-9][0-9])$'); // [3] day
var YAML_TIMESTAMP_REGEXP = new RegExp(
'^([0-9][0-9][0-9][0-9])' + // [1] year
'-([0-9][0-9]?)' + // [2] month
'-([0-9][0-9]?)' + // [3] day
'(?:[Tt]|[ \\t]+)' + // ...
'([0-9][0-9]?)' + // [4] hour
':([0-9][0-9])' + // [5] minute
':([0-9][0-9])' + // [6] second
'(?:\\.([0-9]*))?' + // [7] fraction
'(?:[ \\t]*(Z|([-+])([0-9][0-9]?)' + // [8] tz [9] tz_sign [10] tz_hour
'(?::([0-9][0-9]))?))?$'); // [11] tz_minute
function resolveYamlTimestamp(data) {
if (data === null) { return false; }
if (YAML_DATE_REGEXP.exec(data) !== null) { return true; }
if (YAML_TIMESTAMP_REGEXP.exec(data) !== null) { return true; }
return false;
}
function constructYamlTimestamp(data) {
var match, year, month, day, hour, minute, second, fraction = 0,
delta = null, tz_hour, tz_minute, date;
match = YAML_DATE_REGEXP.exec(data);
if (match === null) { match = YAML_TIMESTAMP_REGEXP.exec(data); }
if (match === null) { throw new Error('Date resolve error'); }
// match: [1] year [2] month [3] day
year = +(match[1]);
month = +(match[2]) - 1; // JS month starts with 0
day = +(match[3]);
if (!match[4]) { // no hour
return new Date(Date.UTC(year, month, day));
}
// match: [4] hour [5] minute [6] second [7] fraction
hour = +(match[4]);
minute = +(match[5]);
second = +(match[6]);
if (match[7]) {
fraction = match[7].slice(0, 3);
while (fraction.length < 3) { // milli-seconds
fraction += '0';
}
fraction = +fraction;
}
// match: [8] tz [9] tz_sign [10] tz_hour [11] tz_minute
if (match[9]) {
tz_hour = +(match[10]);
tz_minute = +(match[11] || 0);
delta = (tz_hour * 60 + tz_minute) * 60000; // delta in mili-seconds
if (match[9] === '-') { delta = -delta; }
}
date = new Date(Date.UTC(year, month, day, hour, minute, second, fraction));
if (delta) { date.setTime(date.getTime() - delta); }
return date;
}
function representYamlTimestamp(object /*, style*/) {
return object.toISOString();
}
var timestamp = new Type$10('tag:yaml.org,2002:timestamp', {
kind: 'scalar',
resolve: resolveYamlTimestamp,
construct: constructYamlTimestamp,
instanceOf: Date,
represent: representYamlTimestamp
});
var Type$11 = type;
function resolveYamlMerge(data) {
return data === '<<' || data === null;
}
var merge = new Type$11('tag:yaml.org,2002:merge', {
kind: 'scalar',
resolve: resolveYamlMerge
});
var commonjsGlobal = typeof window !== 'undefined' ? window : typeof global !== 'undefined' ? global : typeof self !== 'undefined' ? self : {};
function commonjsRequire () {
throw new Error('Dynamic requires are not currently supported by rollup-plugin-commonjs');
}
function createCommonjsModule(fn, module) {
return module = { exports: {} }, fn(module, module.exports), module.exports;
}
/*eslint-disable no-bitwise*/
var NodeBuffer;
try {
// A trick for browserified version, to not include `Buffer` shim
var _require = commonjsRequire;
NodeBuffer = _require('buffer').Buffer;
} catch (__) {}
var Type$12 = type;
// [ 64, 65, 66 ] -> [ padding, CR, LF ]
var BASE64_MAP = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=\n\r';
function resolveYamlBinary(data) {
if (data === null) { return false; }
var code, idx, bitlen = 0, max = data.length, map = BASE64_MAP;
// Convert one by one.
for (idx = 0; idx < max; idx++) {
code = map.indexOf(data.charAt(idx));
// Skip CR/LF
if (code > 64) { continue; }
// Fail on illegal characters
if (code < 0) { return false; }
bitlen += 6;
}
// If there are any bits left, source was corrupted
return (bitlen % 8) === 0;
}
function constructYamlBinary(data) {
var idx, tailbits,
input = data.replace(/[\r\n=]/g, ''), // remove CR/LF & padding to simplify scan
max = input.length,
map = BASE64_MAP,
bits = 0,
result = [];
// Collect by 6*4 bits (3 bytes)
for (idx = 0; idx < max; idx++) {
if ((idx % 4 === 0) && idx) {
result.push((bits >> 16) & 0xFF);
result.push((bits >> 8) & 0xFF);
result.push(bits & 0xFF);
}
bits = (bits << 6) | map.indexOf(input.charAt(idx));
}
// Dump tail
tailbits = (max % 4) * 6;
if (tailbits === 0) {
result.push((bits >> 16) & 0xFF);
result.push((bits >> 8) & 0xFF);
result.push(bits & 0xFF);
} else if (tailbits === 18) {
result.push((bits >> 10) & 0xFF);
result.push((bits >> 2) & 0xFF);
} else if (tailbits === 12) {
result.push((bits >> 4) & 0xFF);
}
// Wrap into Buffer for NodeJS and leave Array for browser
if (NodeBuffer) { return new NodeBuffer(result); }
return result;
}
function representYamlBinary(object /*, style*/) {
var result = '', bits = 0, idx, tail,
max = object.length,
map = BASE64_MAP;
// Convert every three bytes to 4 ASCII characters.
for (idx = 0; idx < max; idx++) {
if ((idx % 3 === 0) && idx) {
result += map[(bits >> 18) & 0x3F];
result += map[(bits >> 12) & 0x3F];
result += map[(bits >> 6) & 0x3F];
result += map[bits & 0x3F];
}
bits = (bits << 8) + object[idx];
}
// Dump tail
tail = max % 3;
if (tail === 0) {
result += map[(bits >> 18) & 0x3F];
result += map[(bits >> 12) & 0x3F];
result += map[(bits >> 6) & 0x3F];
result += map[bits & 0x3F];
} else if (tail === 2) {
result += map[(bits >> 10) & 0x3F];
result += map[(bits >> 4) & 0x3F];
result += map[(bits << 2) & 0x3F];
result += map[64];
} else if (tail === 1) {
result += map[(bits >> 2) & 0x3F];
result += map[(bits << 4) & 0x3F];
result += map[64];
result += map[64];
}
return result;
}
function isBinary(object) {
return NodeBuffer && NodeBuffer.isBuffer(object);
}
var binary = new Type$12('tag:yaml.org,2002:binary', {
kind: 'scalar',
resolve: resolveYamlBinary,
construct: constructYamlBinary,
predicate: isBinary,
represent: representYamlBinary
});
var Type$13 = type;
var _hasOwnProperty$1 = Object.prototype.hasOwnProperty;
var _toString = Object.prototype.toString;
function resolveYamlOmap(data) {
if (data === null) { return true; }
var objectKeys = [], index, length, pair, pairKey, pairHasKey,
object = data;
for (index = 0, length = object.length; index < length; index += 1) {
pair = object[index];
pairHasKey = false;
if (_toString.call(pair) !== '[object Object]') { return false; }
for (pairKey in pair) {
if (_hasOwnProperty$1.call(pair, pairKey)) {
if (!pairHasKey) { pairHasKey = true; }
else { return false; }
}
}
if (!pairHasKey) { return false; }
if (objectKeys.indexOf(pairKey) === -1) { objectKeys.push(pairKey); }
else { return false; }
}
return true;
}
function constructYamlOmap(data) {
return data !== null ? data : [];
}
var omap = new Type$13('tag:yaml.org,2002:omap', {
kind: 'sequence',
resolve: resolveYamlOmap,
construct: constructYamlOmap
});
var Type$14 = type;
var _toString$1 = Object.prototype.toString;
function resolveYamlPairs(data) {
if (data === null) { return true; }
var index, length, pair, keys, result,
object = data;
result = new Array(object.length);
for (index = 0, length = object.length; index < length; index += 1) {
pair = object[index];
if (_toString$1.call(pair) !== '[object Object]') { return false; }
keys = Object.keys(pair);
if (keys.length !== 1) { return false; }
result[index] = [ keys[0], pair[keys[0]] ];
}
return true;
}
function constructYamlPairs(data) {
if (data === null) { return []; }
var index, length, pair, keys, result,
object = data;
result = new Array(object.length);
for (index = 0, length = object.length; index < length; index += 1) {
pair = object[index];
keys = Object.keys(pair);
result[index] = [ keys[0], pair[keys[0]] ];
}
return result;
}
var pairs = new Type$14('tag:yaml.org,2002:pairs', {
kind: 'sequence',
resolve: resolveYamlPairs,
construct: constructYamlPairs
});
var Type$15 = type;
var _hasOwnProperty$2 = Object.prototype.hasOwnProperty;
function resolveYamlSet(data) {
if (data === null) { return true; }
var key, object = data;
for (key in object) {
if (_hasOwnProperty$2.call(object, key)) {
if (object[key] !== null) { return false; }
}
}
return true;
}
function constructYamlSet(data) {
return data !== null ? data : {};
}
var set = new Type$15('tag:yaml.org,2002:set', {
kind: 'mapping',
resolve: resolveYamlSet,
construct: constructYamlSet
});
var Schema$1 = schema;
var default_safe = new Schema$1({
include: [
core
],
implicit: [
timestamp,
merge
],
explicit: [
binary,
omap,
pairs,
set
]
});
var Type$16 = type;
function resolveJavascriptUndefined() {
return true;
}
function constructJavascriptUndefined() {
/*eslint-disable no-undefined*/
return undefined;
}
function representJavascriptUndefined() {
return '';
}
function isUndefined(object) {
return typeof object === 'undefined';
}
var _undefined = new Type$16('tag:yaml.org,2002:js/undefined', {
kind: 'scalar',
resolve: resolveJavascriptUndefined,
construct: constructJavascriptUndefined,
predicate: isUndefined,
represent: representJavascriptUndefined
});
var Type$17 = type;
function resolveJavascriptRegExp(data) {
if (data === null) { return false; }
if (data.length === 0) { return false; }
var regexp = data,
tail = /\/([gim]*)$/.exec(data),
modifiers = '';
// if regexp starts with '/' it can have modifiers and must be properly closed
// `/foo/gim` - modifiers tail can be maximum 3 chars
if (regexp[0] === '/') {
if (tail) { modifiers = tail[1]; }
if (modifiers.length > 3) { return false; }
// if expression starts with /, is should be properly terminated
if (regexp[regexp.length - modifiers.length - 1] !== '/') { return false; }
}
return true;
}
function constructJavascriptRegExp(data) {
var regexp = data,
tail = /\/([gim]*)$/.exec(data),
modifiers = '';
// `/foo/gim` - tail can be maximum 4 chars
if (regexp[0] === '/') {
if (tail) { modifiers = tail[1]; }
regexp = regexp.slice(1, regexp.length - modifiers.length - 1);
}
return new RegExp(regexp, modifiers);
}
function representJavascriptRegExp(object /*, style*/) {
var result = '/' + object.source + '/';
if (object.global) { result += 'g'; }
if (object.multiline) { result += 'm'; }
if (object.ignoreCase) { result += 'i'; }
return result;
}
function isRegExp(object) {
return Object.prototype.toString.call(object) === '[object RegExp]';
}
var regexp = new Type$17('tag:yaml.org,2002:js/regexp', {
kind: 'scalar',
resolve: resolveJavascriptRegExp,
construct: constructJavascriptRegExp,
predicate: isRegExp,
represent: representJavascriptRegExp
});
var esprima;
// Browserified version does not have esprima
//
// 1. For node.js just require module as deps
// 2. For browser try to require mudule via external AMD system.
// If not found - try to fallback to window.esprima. If not
// found too - then fail to parse.
//
try {
// workaround to exclude package from browserify list.
var _require$1 = commonjsRequire;
esprima = _require$1('esprima');
} catch (_) {
/*global window */
if (typeof window !== 'undefined') { esprima = window.esprima; }
}
var Type$18 = type;
function resolveJavascriptFunction(data) {
if (data === null) { return false; }
try {
var source = '(' + data + ')',
ast = esprima.parse(source, { range: true });
if (ast.type !== 'Program' ||
ast.body.length !== 1 ||
ast.body[0].type !== 'ExpressionStatement' ||
ast.body[0].expression.type !== 'FunctionExpression') {
return false;
}
return true;
} catch (err) {
return false;
}
}
function constructJavascriptFunction(data) {
/*jslint evil:true*/
var source = '(' + data + ')',
ast = esprima.parse(source, { range: true }),
params = [],
body;
if (ast.type !== 'Program' ||
ast.body.length !== 1 ||
ast.body[0].type !== 'ExpressionStatement' ||
ast.body[0].expression.type !== 'FunctionExpression') {
throw new Error('Failed to resolve function');
}
ast.body[0].expression.params.forEach(function (param) {
params.push(param.name);
});
body = ast.body[0].expression.body.range;
// Esprima's ranges include the first '{' and the last '}' characters on
// function expressions. So cut them out.
/*eslint-disable no-new-func*/
return new Function(params, source.slice(body[0] + 1, body[1] - 1));
}
function representJavascriptFunction(object /*, style*/) {
return object.toString();
}
function isFunction(object) {
return Object.prototype.toString.call(object) === '[object Function]';
}
var _function = new Type$18('tag:yaml.org,2002:js/function', {
kind: 'scalar',
resolve: resolveJavascriptFunction,
construct: constructJavascriptFunction,
predicate: isFunction,
represent: representJavascriptFunction
});
var Schema$6 = schema;
var default_full = Schema$6.DEFAULT = new Schema$6({
include: [
default_safe
],
explicit: [
_undefined,
regexp,
_function
]
});
/*eslint-disable max-len,no-use-before-define*/
var common = common$1;
var YAMLException$1 = exception;
var Mark = mark;
var DEFAULT_SAFE_SCHEMA$1 = default_safe;
var DEFAULT_FULL_SCHEMA$1 = default_full;
var _hasOwnProperty = Object.prototype.hasOwnProperty;
var CONTEXT_FLOW_IN = 1;
var CONTEXT_FLOW_OUT = 2;
var CONTEXT_BLOCK_IN = 3;
var CONTEXT_BLOCK_OUT = 4;
var CHOMPING_CLIP = 1;
var CHOMPING_STRIP = 2;
var CHOMPING_KEEP = 3;
var PATTERN_NON_PRINTABLE = /[\x00-\x08\x0B\x0C\x0E-\x1F\x7F-\x84\x86-\x9F\uFFFE\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/;
var PATTERN_NON_ASCII_LINE_BREAKS = /[\x85\u2028\u2029]/;
var PATTERN_FLOW_INDICATORS = /[,\[\]\{\}]/;
var PATTERN_TAG_HANDLE = /^(?:!|!!|![a-z\-]+!)$/i;
var PATTERN_TAG_URI = /^(?:!|[^,\[\]\{\}])(?:%[0-9a-f]{2}|[0-9a-z\-#;\/\?:@&=\+\$,_\.!~\*'\(\)\[\]])*$/i;
function is_EOL(c) {
return (c === 0x0A/* LF */) || (c === 0x0D/* CR */);
}
function is_WHITE_SPACE(c) {
return (c === 0x09/* Tab */) || (c === 0x20/* Space */);
}
function is_WS_OR_EOL(c) {
return (c === 0x09/* Tab */) ||
(c === 0x20/* Space */) ||
(c === 0x0A/* LF */) ||
(c === 0x0D/* CR */);
}
function is_FLOW_INDICATOR(c) {
return c === 0x2C/* , */ ||
c === 0x5B/* [ */ ||
c === 0x5D/* ] */ ||
c === 0x7B/* { */ ||
c === 0x7D/* } */;
}
function fromHexCode(c) {
var lc;
if ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)) {
return c - 0x30;
}
/*eslint-disable no-bitwise*/
lc = c | 0x20;
if ((0x61/* a */ <= lc) && (lc <= 0x66/* f */)) {
return lc - 0x61 + 10;
}
return -1;
}
function escapedHexLen(c) {
if (c === 0x78/* x */) { return 2; }
if (c === 0x75/* u */) { return 4; }
if (c === 0x55/* U */) { return 8; }
return 0;
}
function fromDecimalCode(c) {
if ((0x30/* 0 */ <= c) && (c <= 0x39/* 9 */)) {
return c - 0x30;
}
return -1;
}
function simpleEscapeSequence(c) {
return (c === 0x30/* 0 */) ? '\x00' :
(c === 0x61/* a */) ? '\x07' :
(c === 0x62/* b */) ? '\x08' :
(c === 0x74/* t */) ? '\x09' :
(c === 0x09/* Tab */) ? '\x09' :
(c === 0x6E/* n */) ? '\x0A' :
(c === 0x76/* v */) ? '\x0B' :
(c === 0x66/* f */) ? '\x0C' :
(c === 0x72/* r */) ? '\x0D' :
(c === 0x65/* e */) ? '\x1B' :
(c === 0x20/* Space */) ? ' ' :
(c === 0x22/* " */) ? '\x22' :
(c === 0x2F/* / */) ? '/' :
(c === 0x5C/* \ */) ? '\x5C' :
(c === 0x4E/* N */) ? '\x85' :
(c === 0x5F/* _ */) ? '\xA0' :
(c === 0x4C/* L */) ? '\u2028' :
(c === 0x50/* P */) ? '\u2029' : '';
}
function charFromCodepoint(c) {
if (c <= 0xFFFF) {
return String.fromCharCode(c);
}
// Encode UTF-16 surrogate pair
// https://en.wikipedia.org/wiki/UTF-16#Code_points_U.2B010000_to_U.2B10FFFF
return String.fromCharCode(((c - 0x010000) >> 10) + 0xD800,
((c - 0x010000) & 0x03FF) + 0xDC00);
}
var simpleEscapeCheck = new Array(256); // integer, for fast access
var simpleEscapeMap = new Array(256);
for (var i = 0; i < 256; i++) {
simpleEscapeCheck[i] = simpleEscapeSequence(i) ? 1 : 0;
simpleEscapeMap[i] = simpleEscapeSequence(i);
}
function State(input, options) {
this.input = input;
this.filename = options['filename'] || null;
this.schema = options['schema'] || DEFAULT_FULL_SCHEMA$1;
this.onWarning = options['onWarning'] || null;
this.legacy = options['legacy'] || false;
this.json = options['json'] || false;
this.listener = options['listener'] || null;
this.implicitTypes = this.schema.compiledImplicit;
this.typeMap = this.schema.compiledTypeMap;
this.length = input.length;
this.position = 0;
this.line = 0;
this.lineStart = 0;
this.lineIndent = 0;
this.documents = [];
/*
this.version;
this.checkLineBreaks;
this.tagMap;
this.anchorMap;
this.tag;
this.anchor;
this.kind;
this.result;*/
}
function generateError(state, message) {
return new YAMLException$1(
message,
new Mark(state.filename, state.input, state.position, state.line, (state.position - state.lineStart)));
}
function throwError(state, message) {
throw generateError(state, message);
}
function throwWarning(state, message) {
if (state.onWarning) {
state.onWarning.call(null, generateError(state, message));
}
}
var directiveHandlers = {
YAML: function handleYamlDirective(state, name, args) {
var match, major, minor;
if (state.version !== null) {
throwError(state, 'duplication of %YAML directive');
}
if (args.length !== 1) {
throwError(state, 'YAML directive accepts exactly one argument');
}
match = /^([0-9]+)\.([0-9]+)$/.exec(args[0]);
if (match === null) {
throwError(state, 'ill-formed argument of the YAML directive');
}
major = parseInt(match[1], 10);
minor = parseInt(match[2], 10);
if (major !== 1) {
throwError(state, 'unacceptable YAML version of the document');
}
state.version = args[0];
state.checkLineBreaks = (minor < 2);
if (minor !== 1 && minor !== 2) {
throwWarning(state, 'unsupported YAML version of the document');
}
},
TAG: function handleTagDirective(state, name, args) {
var handle, prefix;
if (args.length !== 2) {
throwError(state, 'TAG directive accepts exactly two arguments');
}
handle = args[0];
prefix = args[1];
if (!PATTERN_TAG_HANDLE.test(handle)) {
throwError(state, 'ill-formed tag handle (first argument) of the TAG directive');
}
if (_hasOwnProperty.call(state.tagMap, handle)) {
throwError(state, 'there is a previously declared suffix for "' + handle + '" tag handle');
}
if (!PATTERN_TAG_URI.test(prefix)) {
throwError(state, 'ill-formed tag prefix (second argument) of the TAG directive');
}
state.tagMap[handle] = prefix;
}
};
function captureSegment(state, start, end, checkJson) {
var _position, _length, _character, _result;
if (start < end) {
_result = state.input.slice(start, end);
if (checkJson) {
for (_position = 0, _length = _result.length;
_position < _length;
_position += 1) {
_character = _result.charCodeAt(_position);
if (!(_character === 0x09 ||
(0x20 <= _character && _character <= 0x10FFFF))) {
throwError(state, 'expected valid JSON character');
}
}
} else if (PATTERN_NON_PRINTABLE.test(_result)) {
throwError(state, 'the stream contains non-printable characters');
}
state.result += _result;
}
}
function mergeMappings(state, destination, source, overridableKeys) {
var sourceKeys, key, index, quantity;
if (!common.isObject(source)) {
throwError(state, 'cannot merge mappings; the provided source object is unacceptable');
}
sourceKeys = Object.keys(source);
for (index = 0, quantity = sourceKeys.length; index < quantity; index += 1) {
key = sourceKeys[index];
if (!_hasOwnProperty.call(destination, key)) {
destination[key] = source[key];
overridableKeys[key] = true;
}
}
}
function storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode) {
var index, quantity;
keyNode = String(keyNode);
if (_result === null) {
_result = {};
}
if (keyTag === 'tag:yaml.org,2002:merge') {
if (Array.isArray(valueNode)) {
for (index = 0, quantity = valueNode.length; index < quantity; index += 1) {
mergeMappings(state, _result, valueNode[index], overridableKeys);
}
} else {
mergeMappings(state, _result, valueNode, overridableKeys);
}
} else {
if (!state.json &&
!_hasOwnProperty.call(overridableKeys, keyNode) &&
_hasOwnProperty.call(_result, keyNode)) {
throwError(state, 'duplicated mapping key');
}
_result[keyNode] = valueNode;
delete overridableKeys[keyNode];
}
return _result;
}
function readLineBreak(state) {
var ch;
ch = state.input.charCodeAt(state.position);
if (ch === 0x0A/* LF */) {
state.position++;
} else if (ch === 0x0D/* CR */) {
state.position++;
if (state.input.charCodeAt(state.position) === 0x0A/* LF */) {
state.position++;
}
} else {
throwError(state, 'a line break is expected');
}
state.line += 1;
state.lineStart = state.position;
}
function skipSeparationSpace(state, allowComments, checkIndent) {
var lineBreaks = 0,
ch = state.input.charCodeAt(state.position);
while (ch !== 0) {
while (is_WHITE_SPACE(ch)) {
ch = state.input.charCodeAt(++state.position);
}
if (allowComments && ch === 0x23/* # */) {
do {
ch = state.input.charCodeAt(++state.position);
} while (ch !== 0x0A/* LF */ && ch !== 0x0D/* CR */ && ch !== 0);
}
if (is_EOL(ch)) {
readLineBreak(state);
ch = state.input.charCodeAt(state.position);
lineBreaks++;
state.lineIndent = 0;
while (ch === 0x20/* Space */) {
state.lineIndent++;
ch = state.input.charCodeAt(++state.position);
}
} else {
break;
}
}
if (checkIndent !== -1 && lineBreaks !== 0 && state.lineIndent < checkIndent) {
throwWarning(state, 'deficient indentation');
}
return lineBreaks;
}
function testDocumentSeparator(state) {
var _position = state.position,
ch;
ch = state.input.charCodeAt(_position);
// Condition state.position === state.lineStart is tested
// in parent on each call, for efficiency. No needs to test here again.
if ((ch === 0x2D/* - */ || ch === 0x2E/* . */) &&
ch === state.input.charCodeAt(_position + 1) &&
ch === state.input.charCodeAt(_position + 2)) {
_position += 3;
ch = state.input.charCodeAt(_position);
if (ch === 0 || is_WS_OR_EOL(ch)) {
return true;
}
}
return false;
}
function writeFoldedLines(state, count) {
if (count === 1) {
state.result += ' ';
} else if (count > 1) {
state.result += common.repeat('\n', count - 1);
}
}
function readPlainScalar(state, nodeIndent, withinFlowCollection) {
var preceding,
following,
captureStart,
captureEnd,
hasPendingContent,
_line,
_lineStart,
_lineIndent,
_kind = state.kind,
_result = state.result,
ch;
ch = state.input.charCodeAt(state.position);
if (is_WS_OR_EOL(ch) ||
is_FLOW_INDICATOR(ch) ||
ch === 0x23/* # */ ||
ch === 0x26/* & */ ||
ch === 0x2A/* * */ ||
ch === 0x21/* ! */ ||
ch === 0x7C/* | */ ||
ch === 0x3E/* > */ ||
ch === 0x27/* ' */ ||
ch === 0x22/* " */ ||
ch === 0x25/* % */ ||
ch === 0x40/* @ */ ||
ch === 0x60/* ` */) {
return false;
}
if (ch === 0x3F/* ? */ || ch === 0x2D/* - */) {
following = state.input.charCodeAt(state.position + 1);
if (is_WS_OR_EOL(following) ||
withinFlowCollection && is_FLOW_INDICATOR(following)) {
return false;
}
}
state.kind = 'scalar';
state.result = '';
captureStart = captureEnd = state.position;
hasPendingContent = false;
while (ch !== 0) {
if (ch === 0x3A/* : */) {
following = state.input.charCodeAt(state.position + 1);
if (is_WS_OR_EOL(following) ||
withinFlowCollection && is_FLOW_INDICATOR(following)) {
break;
}
} else if (ch === 0x23/* # */) {
preceding = state.input.charCodeAt(state.position - 1);
if (is_WS_OR_EOL(preceding)) {
break;
}
} else if ((state.position === state.lineStart && testDocumentSeparator(state)) ||
withinFlowCollection && is_FLOW_INDICATOR(ch)) {
break;
} else if (is_EOL(ch)) {
_line = state.line;
_lineStart = state.lineStart;
_lineIndent = state.lineIndent;
skipSeparationSpace(state, false, -1);
if (state.lineIndent >= nodeIndent) {
hasPendingContent = true;
ch = state.input.charCodeAt(state.position);
continue;
} else {
state.position = captureEnd;
state.line = _line;
state.lineStart = _lineStart;
state.lineIndent = _lineIndent;
break;
}
}
if (hasPendingContent) {
captureSegment(state, captureStart, captureEnd, false);
writeFoldedLines(state, state.line - _line);
captureStart = captureEnd = state.position;
hasPendingContent = false;
}
if (!is_WHITE_SPACE(ch)) {
captureEnd = state.position + 1;
}
ch = state.input.charCodeAt(++state.position);
}
captureSegment(state, captureStart, captureEnd, false);
if (state.result) {
return true;
}
state.kind = _kind;
state.result = _result;
return false;
}
function readSingleQuotedScalar(state, nodeIndent) {
var ch,
captureStart, captureEnd;
ch = state.input.charCodeAt(state.position);
if (ch !== 0x27/* ' */) {
return false;
}
state.kind = 'scalar';
state.result = '';
state.position++;
captureStart = captureEnd = state.position;
while ((ch = state.input.charCodeAt(state.position)) !== 0) {
if (ch === 0x27/* ' */) {
captureSegment(state, captureStart, state.position, true);
ch = state.input.charCodeAt(++state.position);
if (ch === 0x27/* ' */) {
captureStart = state.position;
state.position++;
captureEnd = state.position;
} else {
return true;
}
} else if (is_EOL(ch)) {
captureSegment(state, captureStart, captureEnd, true);
writeFoldedLines(state, skipSeparationSpace(state, false, nodeIndent));
captureStart = captureEnd = state.position;
} else if (state.position === state.lineStart && testDocumentSeparator(state)) {
throwError(state, 'unexpected end of the document within a single quoted scalar');
} else {
state.position++;
captureEnd = state.position;
}
}
throwError(state, 'unexpected end of the stream within a single quoted scalar');
}
function readDoubleQuotedScalar(state, nodeIndent) {
var captureStart,
captureEnd,
hexLength,
hexResult,
tmp,
ch;
ch = state.input.charCodeAt(state.position);
if (ch !== 0x22/* " */) {
return false;
}
state.kind = 'scalar';
state.result = '';
state.position++;
captureStart = captureEnd = state.position;
while ((ch = state.input.charCodeAt(state.position)) !== 0) {
if (ch === 0x22/* " */) {
captureSegment(state, captureStart, state.position, true);
state.position++;
return true;
} else if (ch === 0x5C/* \ */) {
captureSegment(state, captureStart, state.position, true);
ch = state.input.charCodeAt(++state.position);
if (is_EOL(ch)) {
skipSeparationSpace(state, false, nodeIndent);
// TODO: rework to inline fn with no type cast?
} else if (ch < 256 && simpleEscapeCheck[ch]) {
state.result += simpleEscapeMap[ch];
state.position++;
} else if ((tmp = escapedHexLen(ch)) > 0) {
hexLength = tmp;
hexResult = 0;
for (; hexLength > 0; hexLength--) {
ch = state.input.charCodeAt(++state.position);
if ((tmp = fromHexCode(ch)) >= 0) {
hexResult = (hexResult << 4) + tmp;
} else {
throwError(state, 'expected hexadecimal character');
}
}
state.result += charFromCodepoint(hexResult);
state.position++;
} else {
throwError(state, 'unknown escape sequence');
}
captureStart = captureEnd = state.position;
} else if (is_EOL(ch)) {
captureSegment(state, captureStart, captureEnd, true);
writeFoldedLines(state, skipSeparationSpace(state, false, nodeIndent));
captureStart = captureEnd = state.position;
} else if (state.position === state.lineStart && testDocumentSeparator(state)) {
throwError(state, 'unexpected end of the document within a double quoted scalar');
} else {
state.position++;
captureEnd = state.position;
}
}
throwError(state, 'unexpected end of the stream within a double quoted scalar');
}
function readFlowCollection(state, nodeIndent) {
var readNext = true,
_line,
_tag = state.tag,
_result,
_anchor = state.anchor,
following,
terminator,
isPair,
isExplicitPair,
isMapping,
overridableKeys = {},
keyNode,
keyTag,
valueNode,
ch;
ch = state.input.charCodeAt(state.position);
if (ch === 0x5B/* [ */) {
terminator = 0x5D;/* ] */
isMapping = false;
_result = [];
} else if (ch === 0x7B/* { */) {
terminator = 0x7D;/* } */
isMapping = true;
_result = {};
} else {
return false;
}
if (state.anchor !== null) {
state.anchorMap[state.anchor] = _result;
}
ch = state.input.charCodeAt(++state.position);
while (ch !== 0) {
skipSeparationSpace(state, true, nodeIndent);
ch = state.input.charCodeAt(state.position);
if (ch === terminator) {
state.position++;
state.tag = _tag;
state.anchor = _anchor;
state.kind = isMapping ? 'mapping' : 'sequence';
state.result = _result;
return true;
} else if (!readNext) {
throwError(state, 'missed comma between flow collection entries');
}
keyTag = keyNode = valueNode = null;
isPair = isExplicitPair = false;
if (ch === 0x3F/* ? */) {
following = state.input.charCodeAt(state.position + 1);
if (is_WS_OR_EOL(following)) {
isPair = isExplicitPair = true;
state.position++;
skipSeparationSpace(state, true, nodeIndent);
}
}
_line = state.line;
composeNode(state, nodeIndent, CONTEXT_FLOW_IN, false, true);
keyTag = state.tag;
keyNode = state.result;
skipSeparationSpace(state, true, nodeIndent);
ch = state.input.charCodeAt(state.position);
if ((isExplicitPair || state.line === _line) && ch === 0x3A/* : */) {
isPair = true;
ch = state.input.charCodeAt(++state.position);
skipSeparationSpace(state, true, nodeIndent);
composeNode(state, nodeIndent, CONTEXT_FLOW_IN, false, true);
valueNode = state.result;
}
if (isMapping) {
storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode);
} else if (isPair) {
_result.push(storeMappingPair(state, null, overridableKeys, keyTag, keyNode, valueNode));
} else {
_result.push(keyNode);
}
skipSeparationSpace(state, true, nodeIndent);
ch = state.input.charCodeAt(state.position);
if (ch === 0x2C/* , */) {
readNext = true;
ch = state.input.charCodeAt(++state.position);
} else {
readNext = false;
}
}
throwError(state, 'unexpected end of the stream within a flow collection');
}
function readBlockScalar(state, nodeIndent) {
var captureStart,
folding,
chomping = CHOMPING_CLIP,
didReadContent = false,
detectedIndent = false,
textIndent = nodeIndent,
emptyLines = 0,
atMoreIndented = false,
tmp,
ch;
ch = state.input.charCodeAt(state.position);
if (ch === 0x7C/* | */) {
folding = false;
} else if (ch === 0x3E/* > */) {
folding = true;
} else {
return false;
}
state.kind = 'scalar';
state.result = '';
while (ch !== 0) {
ch = state.input.charCodeAt(++state.position);
if (ch === 0x2B/* + */ || ch === 0x2D/* - */) {
if (CHOMPING_CLIP === chomping) {
chomping = (ch === 0x2B/* + */) ? CHOMPING_KEEP : CHOMPING_STRIP;
} else {
throwError(state, 'repeat of a chomping mode identifier');
}
} else if ((tmp = fromDecimalCode(ch)) >= 0) {
if (tmp === 0) {
throwError(state, 'bad explicit indentation width of a block scalar; it cannot be less than one');
} else if (!detectedIndent) {
textIndent = nodeIndent + tmp - 1;
detectedIndent = true;
} else {
throwError(state, 'repeat of an indentation width identifier');
}
} else {
break;
}
}
if (is_WHITE_SPACE(ch)) {
do { ch = state.input.charCodeAt(++state.position); }
while (is_WHITE_SPACE(ch));
if (ch === 0x23/* # */) {
do { ch = state.input.charCodeAt(++state.position); }
while (!is_EOL(ch) && (ch !== 0));
}
}
while (ch !== 0) {
readLineBreak(state);
state.lineIndent = 0;
ch = state.input.charCodeAt(state.position);
while ((!detectedIndent || state.lineIndent < textIndent) &&
(ch === 0x20/* Space */)) {
state.lineIndent++;
ch = state.input.charCodeAt(++state.position);
}
if (!detectedIndent && state.lineIndent > textIndent) {
textIndent = state.lineIndent;
}
if (is_EOL(ch)) {
emptyLines++;
continue;
}
// End of the scalar.
if (state.lineIndent < textIndent) {
// Perform the chomping.
if (chomping === CHOMPING_KEEP) {
state.result += common.repeat('\n', didReadContent ? 1 + emptyLines : emptyLines);
} else if (chomping === CHOMPING_CLIP) {
if (didReadContent) { // i.e. only if the scalar is not empty.
state.result += '\n';
}
}
// Break this `while` cycle and go to the funciton's epilogue.
break;
}
// Folded style: use fancy rules to handle line breaks.
if (folding) {
// Lines starting with white space characters (more-indented lines) are not folded.
if (is_WHITE_SPACE(ch)) {
atMoreIndented = true;
// except for the first content line (cf. Example 8.1)
state.result += common.repeat('\n', didReadContent ? 1 + emptyLines : emptyLines);
// End of more-indented block.
} else if (atMoreIndented) {
atMoreIndented = false;
state.result += common.repeat('\n', emptyLines + 1);
// Just one line break - perceive as the same line.
} else if (emptyLines === 0) {
if (didReadContent) { // i.e. only if we have already read some scalar content.
state.result += ' ';
}
// Several line breaks - perceive as different lines.
} else {
state.result += common.repeat('\n', emptyLines);
}
// Literal style: just add exact number of line breaks between content lines.
} else {
// Keep all line breaks except the header line break.
state.result += common.repeat('\n', didReadContent ? 1 + emptyLines : emptyLines);
}
didReadContent = true;
detectedIndent = true;
emptyLines = 0;
captureStart = state.position;
while (!is_EOL(ch) && (ch !== 0)) {
ch = state.input.charCodeAt(++state.position);
}
captureSegment(state, captureStart, state.position, false);
}
return true;
}
function readBlockSequence(state, nodeIndent) {
var _line,
_tag = state.tag,
_anchor = state.anchor,
_result = [],
following,
detected = false,
ch;
if (state.anchor !== null) {
state.anchorMap[state.anchor] = _result;
}
ch = state.input.charCodeAt(state.position);
while (ch !== 0) {
if (ch !== 0x2D/* - */) {
break;
}
following = state.input.charCodeAt(state.position + 1);
if (!is_WS_OR_EOL(following)) {
break;
}
detected = true;
state.position++;
if (skipSeparationSpace(state, true, -1)) {
if (state.lineIndent <= nodeIndent) {
_result.push(null);
ch = state.input.charCodeAt(state.position);
continue;
}
}
_line = state.line;
composeNode(state, nodeIndent, CONTEXT_BLOCK_IN, false, true);
_result.push(state.result);
skipSeparationSpace(state, true, -1);
ch = state.input.charCodeAt(state.position);
if ((state.line === _line || state.lineIndent > nodeIndent) && (ch !== 0)) {
throwError(state, 'bad indentation of a sequence entry');
} else if (state.lineIndent < nodeIndent) {
break;
}
}
if (detected) {
state.tag = _tag;
state.anchor = _anchor;
state.kind = 'sequence';
state.result = _result;
return true;
}
return false;
}
function readBlockMapping(state, nodeIndent, flowIndent) {
var following,
allowCompact,
_line,
_tag = state.tag,
_anchor = state.anchor,
_result = {},
overridableKeys = {},
keyTag = null,
keyNode = null,
valueNode = null,
atExplicitKey = false,
detected = false,
ch;
if (state.anchor !== null) {
state.anchorMap[state.anchor] = _result;
}
ch = state.input.charCodeAt(state.position);
while (ch !== 0) {
following = state.input.charCodeAt(state.position + 1);
_line = state.line; // Save the current line.
//
// Explicit notation case. There are two separate blocks:
// first for the key (denoted by "?") and second for the value (denoted by ":")
//
if ((ch === 0x3F/* ? */ || ch === 0x3A/* : */) && is_WS_OR_EOL(following)) {
if (ch === 0x3F/* ? */) {
if (atExplicitKey) {
storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null);
keyTag = keyNode = valueNode = null;
}
detected = true;
atExplicitKey = true;
allowCompact = true;
} else if (atExplicitKey) {
// i.e. 0x3A/* : */ === character after the explicit key.
atExplicitKey = false;
allowCompact = true;
} else {
throwError(state, 'incomplete explicit mapping pair; a key node is missed');
}
state.position += 1;
ch = following;
//
// Implicit notation case. Flow-style node as the key first, then ":", and the value.
//
} else if (composeNode(state, flowIndent, CONTEXT_FLOW_OUT, false, true)) {
if (state.line === _line) {
ch = state.input.charCodeAt(state.position);
while (is_WHITE_SPACE(ch)) {
ch = state.input.charCodeAt(++state.position);
}
if (ch === 0x3A/* : */) {
ch = state.input.charCodeAt(++state.position);
if (!is_WS_OR_EOL(ch)) {
throwError(state, 'a whitespace character is expected after the key-value separator within a block mapping');
}
if (atExplicitKey) {
storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null);
keyTag = keyNode = valueNode = null;
}
detected = true;
atExplicitKey = false;
allowCompact = false;
keyTag = state.tag;
keyNode = state.result;
} else if (detected) {
throwError(state, 'can not read an implicit mapping pair; a colon is missed');
} else {
state.tag = _tag;
state.anchor = _anchor;
return true; // Keep the result of `composeNode`.
}
} else if (detected) {
throwError(state, 'can not read a block mapping entry; a multiline key may not be an implicit key');
} else {
state.tag = _tag;
state.anchor = _anchor;
return true; // Keep the result of `composeNode`.
}
} else {
break; // Reading is done. Go to the epilogue.
}
//
// Common reading code for both explicit and implicit notations.
//
if (state.line === _line || state.lineIndent > nodeIndent) {
if (composeNode(state, nodeIndent, CONTEXT_BLOCK_OUT, true, allowCompact)) {
if (atExplicitKey) {
keyNode = state.result;
} else {
valueNode = state.result;
}
}
if (!atExplicitKey) {
storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode);
keyTag = keyNode = valueNode = null;
}
skipSeparationSpace(state, true, -1);
ch = state.input.charCodeAt(state.position);
}
if (state.lineIndent > nodeIndent && (ch !== 0)) {
throwError(state, 'bad indentation of a mapping entry');
} else if (state.lineIndent < nodeIndent) {
break;
}
}
//
// Epilogue.
//
// Special case: last mapping's node contains only the key in explicit notation.
if (atExplicitKey) {
storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null);
}
// Expose the resulting mapping.
if (detected) {
state.tag = _tag;
state.anchor = _anchor;
state.kind = 'mapping';
state.result = _result;
}
return detected;
}
function readTagProperty(state) {
var _position,
isVerbatim = false,
isNamed = false,
tagHandle,
tagName,
ch;
ch = state.input.charCodeAt(state.position);
if (ch !== 0x21/* ! */) { return false; }
if (state.tag !== null) {
throwError(state, 'duplication of a tag property');
}
ch = state.input.charCodeAt(++state.position);
if (ch === 0x3C/* < */) {
isVerbatim = true;
ch = state.input.charCodeAt(++state.position);
} else if (ch === 0x21/* ! */) {
isNamed = true;
tagHandle = '!!';
ch = state.input.charCodeAt(++state.position);
} else {
tagHandle = '!';
}
_position = state.position;
if (isVerbatim) {
do { ch = state.input.charCodeAt(++state.position); }
while (ch !== 0 && ch !== 0x3E/* > */);
if (state.position < state.length) {
tagName = state.input.slice(_position, state.position);
ch = state.input.charCodeAt(++state.position);
} else {
throwError(state, 'unexpected end of the stream within a verbatim tag');
}
} else {
while (ch !== 0 && !is_WS_OR_EOL(ch)) {
if (ch === 0x21/* ! */) {
if (!isNamed) {
tagHandle = state.input.slice(_position - 1, state.position + 1);
if (!PATTERN_TAG_HANDLE.test(tagHandle)) {
throwError(state, 'named tag handle cannot contain such characters');
}
isNamed = true;
_position = state.position + 1;
} else {
throwError(state, 'tag suffix cannot contain exclamation marks');
}
}
ch = state.input.charCodeAt(++state.position);
}
tagName = state.input.slice(_position, state.position);
if (PATTERN_FLOW_INDICATORS.test(tagName)) {
throwError(state, 'tag suffix cannot contain flow indicator characters');
}
}
if (tagName && !PATTERN_TAG_URI.test(tagName)) {
throwError(state, 'tag name cannot contain such characters: ' + tagName);
}
if (isVerbatim) {
state.tag = tagName;
} else if (_hasOwnProperty.call(state.tagMap, tagHandle)) {
state.tag = state.tagMap[tagHandle] + tagName;
} else if (tagHandle === '!') {
state.tag = '!' + tagName;
} else if (tagHandle === '!!') {
state.tag = 'tag:yaml.org,2002:' + tagName;
} else {
throwError(state, 'undeclared tag handle "' + tagHandle + '"');
}
return true;
}
function readAnchorProperty(state) {
var _position,
ch;
ch = state.input.charCodeAt(state.position);
if (ch !== 0x26/* & */) { return false; }
if (state.anchor !== null) {
throwError(state, 'duplication of an anchor property');
}
ch = state.input.charCodeAt(++state.position);
_position = state.position;
while (ch !== 0 && !is_WS_OR_EOL(ch) && !is_FLOW_INDICATOR(ch)) {
ch = state.input.charCodeAt(++state.position);
}
if (state.position === _position) {
throwError(state, 'name of an anchor node must contain at least one character');
}
state.anchor = state.input.slice(_position, state.position);
return true;
}
function readAlias(state) {
var _position, alias,
ch;
ch = state.input.charCodeAt(state.position);
if (ch !== 0x2A/* * */) { return false; }
ch = state.input.charCodeAt(++state.position);
_position = state.position;
while (ch !== 0 && !is_WS_OR_EOL(ch) && !is_FLOW_INDICATOR(ch)) {
ch = state.input.charCodeAt(++state.position);
}
if (state.position === _position) {
throwError(state, 'name of an alias node must contain at least one character');
}
alias = state.input.slice(_position, state.position);
if (!state.anchorMap.hasOwnProperty(alias)) {
throwError(state, 'unidentified alias "' + alias + '"');
}
state.result = state.anchorMap[alias];
skipSeparationSpace(state, true, -1);
return true;
}
function composeNode(state, parentIndent, nodeContext, allowToSeek, allowCompact) {
var allowBlockStyles,
allowBlockScalars,
allowBlockCollections,
indentStatus = 1, // 1: this>parent, 0: this=parent, -1: this<parent
atNewLine = false,
hasContent = false,
typeIndex,
typeQuantity,
type,
flowIndent,
blockIndent;
if (state.listener !== null) {
state.listener('open', state);
}
state.tag = null;
state.anchor = null;
state.kind = null;
state.result = null;
allowBlockStyles = allowBlockScalars = allowBlockCollections =
CONTEXT_BLOCK_OUT === nodeContext ||
CONTEXT_BLOCK_IN === nodeContext;
if (allowToSeek) {
if (skipSeparationSpace(state, true, -1)) {
atNewLine = true;
if (state.lineIndent > parentIndent) {
indentStatus = 1;
} else if (state.lineIndent === parentIndent) {
indentStatus = 0;
} else if (state.lineIndent < parentIndent) {
indentStatus = -1;
}
}
}
if (indentStatus === 1) {
while (readTagProperty(state) || readAnchorProperty(state)) {
if (skipSeparationSpace(state, true, -1)) {
atNewLine = true;
allowBlockCollections = allowBlockStyles;
if (state.lineIndent > parentIndent) {
indentStatus = 1;
} else if (state.lineIndent === parentIndent) {
indentStatus = 0;
} else if (state.lineIndent < parentIndent) {
indentStatus = -1;
}
} else {
allowBlockCollections = false;
}
}
}
if (allowBlockCollections) {
allowBlockCollections = atNewLine || allowCompact;
}
if (indentStatus === 1 || CONTEXT_BLOCK_OUT === nodeContext) {
if (CONTEXT_FLOW_IN === nodeContext || CONTEXT_FLOW_OUT === nodeContext) {
flowIndent = parentIndent;
} else {
flowIndent = parentIndent + 1;
}
blockIndent = state.position - state.lineStart;
if (indentStatus === 1) {
if (allowBlockCollections &&
(readBlockSequence(state, blockIndent) ||
readBlockMapping(state, blockIndent, flowIndent)) ||
readFlowCollection(state, flowIndent)) {
hasContent = true;
} else {
if ((allowBlockScalars && readBlockScalar(state, flowIndent)) ||
readSingleQuotedScalar(state, flowIndent) ||
readDoubleQuotedScalar(state, flowIndent)) {
hasContent = true;
} else if (readAlias(state)) {
hasContent = true;
if (state.tag !== null || state.anchor !== null) {
throwError(state, 'alias node should not have any properties');
}
} else if (readPlainScalar(state, flowIndent, CONTEXT_FLOW_IN === nodeContext)) {
hasContent = true;
if (state.tag === null) {
state.tag = '?';
}
}
if (state.anchor !== null) {
state.anchorMap[state.anchor] = state.result;
}
}
} else if (indentStatus === 0) {
// Special case: block sequences are allowed to have same indentation level as the parent.
// http://www.yaml.org/spec/1.2/spec.html#id2799784
hasContent = allowBlockCollections && readBlockSequence(state, blockIndent);
}
}
if (state.tag !== null && state.tag !== '!') {
if (state.tag === '?') {
for (typeIndex = 0, typeQuantity = state.implicitTypes.length;
typeIndex < typeQuantity;
typeIndex += 1) {
type = state.implicitTypes[typeIndex];
// Implicit resolving is not allowed for non-scalar types, and '?'
// non-specific tag is only assigned to plain scalars. So, it isn't
// needed to check for 'kind' conformity.
if (type.resolve(state.result)) { // `state.result` updated in resolver if matched
state.result = type.construct(state.result);
state.tag = type.tag;
if (state.anchor !== null) {
state.anchorMap[state.anchor] = state.result;
}
break;
}
}
} else if (_hasOwnProperty.call(state.typeMap[state.kind || 'fallback'], state.tag)) {
type = state.typeMap[state.kind || 'fallback'][state.tag];
if (state.result !== null && type.kind !== state.kind) {
throwError(state, 'unacceptable node kind for !<' + state.tag + '> tag; it should be "' + type.kind + '", not "' + state.kind + '"');
}
if (!type.resolve(state.result)) { // `state.result` updated in resolver if matched
throwError(state, 'cannot resolve a node with !<' + state.tag + '> explicit tag');
} else {
state.result = type.construct(state.result);
if (state.anchor !== null) {
state.anchorMap[state.anchor] = state.result;
}
}
} else {
throwError(state, 'unknown tag !<' + state.tag + '>');
}
}
if (state.listener !== null) {
state.listener('close', state);
}
return state.tag !== null || state.anchor !== null || hasContent;
}
function readDocument(state) {
var documentStart = state.position,
_position,
directiveName,
directiveArgs,
hasDirectives = false,
ch;
state.version = null;
state.checkLineBreaks = state.legacy;
state.tagMap = {};
state.anchorMap = {};
while ((ch = state.input.charCodeAt(state.position)) !== 0) {
skipSeparationSpace(state, true, -1);
ch = state.input.charCodeAt(state.position);
if (state.lineIndent > 0 || ch !== 0x25/* % */) {
break;
}
hasDirectives = true;
ch = state.input.charCodeAt(++state.position);
_position = state.position;
while (ch !== 0 && !is_WS_OR_EOL(ch)) {
ch = state.input.charCodeAt(++state.position);
}
directiveName = state.input.slice(_position, state.position);
directiveArgs = [];
if (directiveName.length < 1) {
throwError(state, 'directive name must not be less than one character in length');
}
while (ch !== 0) {
while (is_WHITE_SPACE(ch)) {
ch = state.input.charCodeAt(++state.position);
}
if (ch === 0x23/* # */) {
do { ch = state.input.charCodeAt(++state.position); }
while (ch !== 0 && !is_EOL(ch));
break;
}
if (is_EOL(ch)) { break; }
_position = state.position;
while (ch !== 0 && !is_WS_OR_EOL(ch)) {
ch = state.input.charCodeAt(++state.position);
}
directiveArgs.push(state.input.slice(_position, state.position));
}
if (ch !== 0) { readLineBreak(state); }
if (_hasOwnProperty.call(directiveHandlers, directiveName)) {
directiveHandlers[directiveName](state, directiveName, directiveArgs);
} else {
throwWarning(state, 'unknown document directive "' + directiveName + '"');
}
}
skipSeparationSpace(state, true, -1);
if (state.lineIndent === 0 &&
state.input.charCodeAt(state.position) === 0x2D/* - */ &&
state.input.charCodeAt(state.position + 1) === 0x2D/* - */ &&
state.input.charCodeAt(state.position + 2) === 0x2D/* - */) {
state.position += 3;
skipSeparationSpace(state, true, -1);
} else if (hasDirectives) {
throwError(state, 'directives end mark is expected');
}
composeNode(state, state.lineIndent - 1, CONTEXT_BLOCK_OUT, false, true);
skipSeparationSpace(state, true, -1);
if (state.checkLineBreaks &&
PATTERN_NON_ASCII_LINE_BREAKS.test(state.input.slice(documentStart, state.position))) {
throwWarning(state, 'non-ASCII line breaks are interpreted as content');
}
state.documents.push(state.result);
if (state.position === state.lineStart && testDocumentSeparator(state)) {
if (state.input.charCodeAt(state.position) === 0x2E/* . */) {
state.position += 3;
skipSeparationSpace(state, true, -1);
}
return;
}
if (state.position < (state.length - 1)) {
throwError(state, 'end of the stream or a document separator is expected');
} else {
return;
}
}
function loadDocuments(input, options) {
input = String(input);
options = options || {};
if (input.length !== 0) {
// Add tailing `\n` if not exists
if (input.charCodeAt(input.length - 1) !== 0x0A/* LF */ &&
input.charCodeAt(input.length - 1) !== 0x0D/* CR */) {
input += '\n';
}
// Strip BOM
if (input.charCodeAt(0) === 0xFEFF) {
input = input.slice(1);
}
}
var state = new State(input, options);
// Use 0 as string terminator. That significantly simplifies bounds check.
state.input += '\0';
while (state.input.charCodeAt(state.position) === 0x20/* Space */) {
state.lineIndent += 1;
state.position += 1;
}
while (state.position < (state.length - 1)) {
readDocument(state);
}
return state.documents;
}
function loadAll$1(input, iterator, options) {
var documents = loadDocuments(input, options), index, length;
for (index = 0, length = documents.length; index < length; index += 1) {
iterator(documents[index]);
}
}
function load$1(input, options) {
var documents = loadDocuments(input, options);
if (documents.length === 0) {
/*eslint-disable no-undefined*/
return undefined;
} else if (documents.length === 1) {
return documents[0];
}
throw new YAMLException$1('expected a single document in the stream, but found more');
}
function safeLoadAll$1(input, output, options) {
loadAll$1(input, output, common.extend({ schema: DEFAULT_SAFE_SCHEMA$1 }, options));
}
function safeLoad$1(input, options) {
return load$1(input, common.extend({ schema: DEFAULT_SAFE_SCHEMA$1 }, options));
}
var loadAll_1 = loadAll$1;
var load_1 = load$1;
var safeLoadAll_1 = safeLoadAll$1;
var safeLoad_1 = safeLoad$1;
var loader$1 = {
loadAll: loadAll_1,
load: load_1,
safeLoadAll: safeLoadAll_1,
safeLoad: safeLoad_1
};
/*eslint-disable no-use-before-define*/
var common$7 = common$1;
var YAMLException$5 = exception;
var DEFAULT_FULL_SCHEMA$2 = default_full;
var DEFAULT_SAFE_SCHEMA$2 = default_safe;
var _toString$2 = Object.prototype.toString;
var _hasOwnProperty$3 = Object.prototype.hasOwnProperty;
var CHAR_TAB = 0x09; /* Tab */
var CHAR_LINE_FEED = 0x0A; /* LF */
var CHAR_SPACE = 0x20; /* Space */
var CHAR_EXCLAMATION = 0x21; /* ! */
var CHAR_DOUBLE_QUOTE = 0x22; /* " */
var CHAR_SHARP = 0x23; /* # */
var CHAR_PERCENT = 0x25; /* % */
var CHAR_AMPERSAND = 0x26; /* & */
var CHAR_SINGLE_QUOTE = 0x27; /* ' */
var CHAR_ASTERISK = 0x2A; /* * */
var CHAR_COMMA = 0x2C; /* , */
var CHAR_MINUS = 0x2D; /* - */
var CHAR_COLON = 0x3A; /* : */
var CHAR_GREATER_THAN = 0x3E; /* > */
var CHAR_QUESTION = 0x3F; /* ? */
var CHAR_COMMERCIAL_AT = 0x40; /* @ */
var CHAR_LEFT_SQUARE_BRACKET = 0x5B; /* [ */
var CHAR_RIGHT_SQUARE_BRACKET = 0x5D; /* ] */
var CHAR_GRAVE_ACCENT = 0x60; /* ` */
var CHAR_LEFT_CURLY_BRACKET = 0x7B; /* { */
var CHAR_VERTICAL_LINE = 0x7C; /* | */
var CHAR_RIGHT_CURLY_BRACKET = 0x7D; /* } */
var ESCAPE_SEQUENCES = {};
ESCAPE_SEQUENCES[0x00] = '\\0';
ESCAPE_SEQUENCES[0x07] = '\\a';
ESCAPE_SEQUENCES[0x08] = '\\b';
ESCAPE_SEQUENCES[0x09] = '\\t';
ESCAPE_SEQUENCES[0x0A] = '\\n';
ESCAPE_SEQUENCES[0x0B] = '\\v';
ESCAPE_SEQUENCES[0x0C] = '\\f';
ESCAPE_SEQUENCES[0x0D] = '\\r';
ESCAPE_SEQUENCES[0x1B] = '\\e';
ESCAPE_SEQUENCES[0x22] = '\\"';
ESCAPE_SEQUENCES[0x5C] = '\\\\';
ESCAPE_SEQUENCES[0x85] = '\\N';
ESCAPE_SEQUENCES[0xA0] = '\\_';
ESCAPE_SEQUENCES[0x2028] = '\\L';
ESCAPE_SEQUENCES[0x2029] = '\\P';
var DEPRECATED_BOOLEANS_SYNTAX = [
'y', 'Y', 'yes', 'Yes', 'YES', 'on', 'On', 'ON',
'n', 'N', 'no', 'No', 'NO', 'off', 'Off', 'OFF'
];
function compileStyleMap(schema, map) {
var result, keys, index, length, tag, style, type;
if (map === null) { return {}; }
result = {};
keys = Object.keys(map);
for (index = 0, length = keys.length; index < length; index += 1) {
tag = keys[index];
style = String(map[tag]);
if (tag.slice(0, 2) === '!!') {
tag = 'tag:yaml.org,2002:' + tag.slice(2);
}
type = schema.compiledTypeMap['fallback'][tag];
if (type && _hasOwnProperty$3.call(type.styleAliases, style)) {
style = type.styleAliases[style];
}
result[tag] = style;
}
return result;
}
function encodeHex(character) {
var string, handle, length;
string = character.toString(16).toUpperCase();
if (character <= 0xFF) {
handle = 'x';
length = 2;
} else if (character <= 0xFFFF) {
handle = 'u';
length = 4;
} else if (character <= 0xFFFFFFFF) {
handle = 'U';
length = 8;
} else {
throw new YAMLException$5('code point within a string may not be greater than 0xFFFFFFFF');
}
return '\\' + handle + common$7.repeat('0', length - string.length) + string;
}
function State$1(options) {
this.schema = options['schema'] || DEFAULT_FULL_SCHEMA$2;
this.indent = Math.max(1, (options['indent'] || 2));
this.skipInvalid = options['skipInvalid'] || false;
this.flowLevel = (common$7.isNothing(options['flowLevel']) ? -1 : options['flowLevel']);
this.styleMap = compileStyleMap(this.schema, options['styles'] || null);
this.sortKeys = options['sortKeys'] || false;
this.lineWidth = options['lineWidth'] || 80;
this.noRefs = options['noRefs'] || false;
this.noCompatMode = options['noCompatMode'] || false;
this.implicitTypes = this.schema.compiledImplicit;
this.explicitTypes = this.schema.compiledExplicit;
this.tag = null;
this.result = '';
this.duplicates = [];
this.usedDuplicates = null;
}
// Indents every line in a string. Empty lines (\n only) are not indented.
function indentString(string, spaces) {
var ind = common$7.repeat(' ', spaces),
position = 0,
next = -1,
result = '',
line,
length = string.length;
while (position < length) {
next = string.indexOf('\n', position);
if (next === -1) {
line = string.slice(position);
position = length;
} else {
line = string.slice(position, next + 1);
position = next + 1;
}
if (line.length && line !== '\n') { result += ind; }
result += line;
}
return result;
}
function generateNextLine(state, level) {
return '\n' + common$7.repeat(' ', state.indent * level);
}
function testImplicitResolving(state, str) {
var index, length, type;
for (index = 0, length = state.implicitTypes.length; index < length; index += 1) {
type = state.implicitTypes[index];
if (type.resolve(str)) {
return true;
}
}
return false;
}
// [33] s-white ::= s-space | s-tab
function isWhitespace(c) {
return c === CHAR_SPACE || c === CHAR_TAB;
}
// Returns true if the character can be printed without escaping.
// From YAML 1.2: "any allowed characters known to be non-printable
// should also be escaped. [However,] This isn’t mandatory"
// Derived from nb-char - \t - #x85 - #xA0 - #x2028 - #x2029.
function isPrintable(c) {
return (0x00020 <= c && c <= 0x00007E)
|| ((0x000A1 <= c && c <= 0x00D7FF) && c !== 0x2028 && c !== 0x2029)
|| ((0x0E000 <= c && c <= 0x00FFFD) && c !== 0xFEFF /* BOM */)
|| (0x10000 <= c && c <= 0x10FFFF);
}
// Simplified test for values allowed after the first character in plain style.
function isPlainSafe(c) {
// Uses a subset of nb-char - c-flow-indicator - ":" - "#"
// where nb-char ::= c-printable - b-char - c-byte-order-mark.
return isPrintable(c) && c !== 0xFEFF
// - c-flow-indicator
&& c !== CHAR_COMMA
&& c !== CHAR_LEFT_SQUARE_BRACKET
&& c !== CHAR_RIGHT_SQUARE_BRACKET
&& c !== CHAR_LEFT_CURLY_BRACKET
&& c !== CHAR_RIGHT_CURLY_BRACKET
// - ":" - "#"
&& c !== CHAR_COLON
&& c !== CHAR_SHARP;
}
// Simplified test for values allowed as the first character in plain style.
function isPlainSafeFirst(c) {
// Uses a subset of ns-char - c-indicator
// where ns-char = nb-char - s-white.
return isPrintable(c) && c !== 0xFEFF
&& !isWhitespace(c) // - s-white
// - (c-indicator ::=
// “-” | “?” | “:” | “,” | “[” | “]” | “{” | “}”
&& c !== CHAR_MINUS
&& c !== CHAR_QUESTION
&& c !== CHAR_COLON
&& c !== CHAR_COMMA
&& c !== CHAR_LEFT_SQUARE_BRACKET
&& c !== CHAR_RIGHT_SQUARE_BRACKET
&& c !== CHAR_LEFT_CURLY_BRACKET
&& c !== CHAR_RIGHT_CURLY_BRACKET
// | “#” | “&” | “*” | “!” | “|” | “>” | “'” | “"”
&& c !== CHAR_SHARP
&& c !== CHAR_AMPERSAND
&& c !== CHAR_ASTERISK
&& c !== CHAR_EXCLAMATION
&& c !== CHAR_VERTICAL_LINE
&& c !== CHAR_GREATER_THAN
&& c !== CHAR_SINGLE_QUOTE
&& c !== CHAR_DOUBLE_QUOTE
// | “%” | “@” | “`”)
&& c !== CHAR_PERCENT
&& c !== CHAR_COMMERCIAL_AT
&& c !== CHAR_GRAVE_ACCENT;
}
var STYLE_PLAIN = 1;
var STYLE_SINGLE = 2;
var STYLE_LITERAL = 3;
var STYLE_FOLDED = 4;
var STYLE_DOUBLE = 5;
// Determines which scalar styles are possible and returns the preferred style.
// lineWidth = -1 => no limit.
// Pre-conditions: str.length > 0.
// Post-conditions:
// STYLE_PLAIN or STYLE_SINGLE => no \n are in the string.
// STYLE_LITERAL => no lines are suitable for folding (or lineWidth is -1).
// STYLE_FOLDED => a line > lineWidth and can be folded (and lineWidth != -1).
function chooseScalarStyle(string, singleLineOnly, indentPerLevel, lineWidth, testAmbiguousType) {
var i;
var char;
var hasLineBreak = false;
var hasFoldableLine = false; // only checked if shouldTrackWidth
var shouldTrackWidth = lineWidth !== -1;
var previousLineBreak = -1; // count the first line correctly
var plain = isPlainSafeFirst(string.charCodeAt(0))
&& !isWhitespace(string.charCodeAt(string.length - 1));
if (singleLineOnly) {
// Case: no block styles.
// Check for disallowed characters to rule out plain and single.
for (i = 0; i < string.length; i++) {
char = string.charCodeAt(i);
if (!isPrintable(char)) {
return STYLE_DOUBLE;
}
plain = plain && isPlainSafe(char);
}
} else {
// Case: block styles permitted.
for (i = 0; i < string.length; i++) {
char = string.charCodeAt(i);
if (char === CHAR_LINE_FEED) {
hasLineBreak = true;
// Check if any line can be folded.
if (shouldTrackWidth) {
hasFoldableLine = hasFoldableLine ||
// Foldable line = too long, and not more-indented.
(i - previousLineBreak - 1 > lineWidth &&
string[previousLineBreak + 1] !== ' ');
previousLineBreak = i;
}
} else if (!isPrintable(char)) {
return STYLE_DOUBLE;
}
plain = plain && isPlainSafe(char);
}
// in case the end is missing a \n
hasFoldableLine = hasFoldableLine || (shouldTrackWidth &&
(i - previousLineBreak - 1 > lineWidth &&
string[previousLineBreak + 1] !== ' '));
}
// Although every style can represent \n without escaping, prefer block styles
// for multiline, since they're more readable and they don't add empty lines.
// Also prefer folding a super-long line.
if (!hasLineBreak && !hasFoldableLine) {
// Strings interpretable as another type have to be quoted;
// e.g. the string 'true' vs. the boolean true.
return plain && !testAmbiguousType(string)
? STYLE_PLAIN : STYLE_SINGLE;
}
// Edge case: block indentation indicator can only have one digit.
if (string[0] === ' ' && indentPerLevel > 9) {
return STYLE_DOUBLE;
}
// At this point we know block styles are valid.
// Prefer literal style unless we want to fold.
return hasFoldableLine ? STYLE_FOLDED : STYLE_LITERAL;
}
// Note: line breaking/folding is implemented for only the folded style.
// NB. We drop the last trailing newline (if any) of a returned block scalar
// since the dumper adds its own newline. This always works:
// • No ending newline => unaffected; already using strip "-" chomping.
// • Ending newline => removed then restored.
// Importantly, this keeps the "+" chomp indicator from gaining an extra line.
function writeScalar(state, string, level, iskey) {
state.dump = (function () {
if (string.length === 0) {
return "''";
}
if (!state.noCompatMode &&
DEPRECATED_BOOLEANS_SYNTAX.indexOf(string) !== -1) {
return "'" + string + "'";
}
var indent = state.indent * Math.max(1, level); // no 0-indent scalars
// As indentation gets deeper, let the width decrease monotonically
// to the lower bound min(state.lineWidth, 40).
// Note that this implies
// state.lineWidth ≤ 40 + state.indent: width is fixed at the lower bound.
// state.lineWidth > 40 + state.indent: width decreases until the lower bound.
// This behaves better than a constant minimum width which disallows narrower options,
// or an indent threshold which causes the width to suddenly increase.
var lineWidth = state.lineWidth === -1
? -1 : Math.max(Math.min(state.lineWidth, 40), state.lineWidth - indent);
// Without knowing if keys are implicit/explicit, assume implicit for safety.
var singleLineOnly = iskey
// No block styles in flow mode.
|| (state.flowLevel > -1 && level >= state.flowLevel);
function testAmbiguity(string) {
return testImplicitResolving(state, string);
}
switch (chooseScalarStyle(string, singleLineOnly, state.indent, lineWidth, testAmbiguity)) {
case STYLE_PLAIN:
return string;
case STYLE_SINGLE:
return "'" + string.replace(/'/g, "''") + "'";
case STYLE_LITERAL:
return '|' + blockHeader(string, state.indent)
+ dropEndingNewline(indentString(string, indent));
case STYLE_FOLDED:
return '>' + blockHeader(string, state.indent)
+ dropEndingNewline(indentString(foldString(string, lineWidth), indent));
case STYLE_DOUBLE:
return '"' + escapeString(string, lineWidth) + '"';
default:
throw new YAMLException$5('impossible error: invalid scalar style');
}
}());
}
// Pre-conditions: string is valid for a block scalar, 1 <= indentPerLevel <= 9.
function blockHeader(string, indentPerLevel) {
var indentIndicator = (string[0] === ' ') ? String(indentPerLevel) : '';
// note the special case: the string '\n' counts as a "trailing" empty line.
var clip = string[string.length - 1] === '\n';
var keep = clip && (string[string.length - 2] === '\n' || string === '\n');
var chomp = keep ? '+' : (clip ? '' : '-');
return indentIndicator + chomp + '\n';
}
// (See the note for writeScalar.)
function dropEndingNewline(string) {
return string[string.length - 1] === '\n' ? string.slice(0, -1) : string;
}
// Note: a long line without a suitable break point will exceed the width limit.
// Pre-conditions: every char in str isPrintable, str.length > 0, width > 0.
function foldString(string, width) {
// In folded style, $k$ consecutive newlines output as $k+1$ newlines—
// unless they're before or after a more-indented line, or at the very
// beginning or end, in which case $k$ maps to $k$.
// Therefore, parse each chunk as newline(s) followed by a content line.
var lineRe = /(\n+)([^\n]*)/g;
// first line (possibly an empty line)
var result = (function () {
var nextLF = string.indexOf('\n');
nextLF = nextLF !== -1 ? nextLF : string.length;
lineRe.lastIndex = nextLF;
return foldLine(string.slice(0, nextLF), width);
}());
// If we haven't reached the first content line yet, don't add an extra \n.
var prevMoreIndented = string[0] === '\n' || string[0] === ' ';
var moreIndented;
// rest of the lines
var match;
while ((match = lineRe.exec(string))) {
var prefix = match[1], line = match[2];
moreIndented = (line[0] === ' ');
result += prefix
+ (!prevMoreIndented && !moreIndented && line !== ''
? '\n' : '')
+ foldLine(line, width);
prevMoreIndented = moreIndented;
}
return result;
}
// Greedy line breaking.
// Picks the longest line under the limit each time,
// otherwise settles for the shortest line over the limit.
// NB. More-indented lines *cannot* be folded, as that would add an extra \n.
function foldLine(line, width) {
if (line === '' || line[0] === ' ') { return line; }
// Since a more-indented line adds a \n, breaks can't be followed by a space.
var breakRe = / [^ ]/g; // note: the match index will always be <= length-2.
var match;
// start is an inclusive index. end, curr, and next are exclusive.
var start = 0, end, curr = 0, next = 0;
var result = '';
// Invariants: 0 <= start <= length-1.
// 0 <= curr <= next <= max(0, length-2). curr - start <= width.
// Inside the loop:
// A match implies length >= 2, so curr and next are <= length-2.
while ((match = breakRe.exec(line))) {
next = match.index;
// maintain invariant: curr - start <= width
if (next - start > width) {
end = (curr > start) ? curr : next; // derive end <= length-2
result += '\n' + line.slice(start, end);
// skip the space that was output as \n
start = end + 1; // derive start <= length-1
}
curr = next;
}
// By the invariants, start <= length-1, so there is something left over.
// It is either the whole string or a part starting from non-whitespace.
result += '\n';
// Insert a break if the remainder is too long and there is a break available.
if (line.length - start > width && curr > start) {
result += line.slice(start, curr) + '\n' + line.slice(curr + 1);
} else {
result += line.slice(start);
}
return result.slice(1); // drop extra \n joiner
}
// Escapes a double-quoted string.
function escapeString(string) {
var result = '';
var char;
var escapeSeq;
for (var i = 0; i < string.length; i++) {
char = string.charCodeAt(i);
escapeSeq = ESCAPE_SEQUENCES[char];
result += !escapeSeq && isPrintable(char)
? string[i]
: escapeSeq || encodeHex(char);
}
return result;
}
function writeFlowSequence(state, level, object) {
var _result = '',
_tag = state.tag,
index,
length;
for (index = 0, length = object.length; index < length; index += 1) {
// Write only valid elements.
if (writeNode(state, level, object[index], false, false)) {
if (index !== 0) { _result += ', '; }
_result += state.dump;
}
}
state.tag = _tag;
state.dump = '[' + _result + ']';
}
function writeBlockSequence(state, level, object, compact) {
var _result = '',
_tag = state.tag,
index,
length;
for (index = 0, length = object.length; index < length; index += 1) {
// Write only valid elements.
if (writeNode(state, level + 1, object[index], true, true)) {
if (!compact || index !== 0) {
_result += generateNextLine(state, level);
}
_result += '- ' + state.dump;
}
}
state.tag = _tag;
state.dump = _result || '[]'; // Empty sequence if no valid values.
}
function writeFlowMapping(state, level, object) {
var _result = '',
_tag = state.tag,
objectKeyList = Object.keys(object),
index,
length,
objectKey,
objectValue,
pairBuffer;
for (index = 0, length = objectKeyList.length; index < length; index += 1) {
pairBuffer = '';
if (index !== 0) { pairBuffer += ', '; }
objectKey = objectKeyList[index];
objectValue = object[objectKey];
if (!writeNode(state, level, objectKey, false, false)) {
continue; // Skip this pair because of invalid key;
}
if (state.dump.length > 1024) { pairBuffer += '? '; }
pairBuffer += state.dump + ': ';
if (!writeNode(state, level, objectValue, false, false)) {
continue; // Skip this pair because of invalid value.
}
pairBuffer += state.dump;
// Both key and value are valid.
_result += pairBuffer;
}
state.tag = _tag;
state.dump = '{' + _result + '}';
}
function writeBlockMapping(state, level, object, compact) {
var _result = '',
_tag = state.tag,
objectKeyList = Object.keys(object),
index,
length,
objectKey,
objectValue,
explicitPair,
pairBuffer;
// Allow sorting keys so that the output file is deterministic
if (state.sortKeys === true) {
// Default sorting
objectKeyList.sort();
} else if (typeof state.sortKeys === 'function') {
// Custom sort function
objectKeyList.sort(state.sortKeys);
} else if (state.sortKeys) {
// Something is wrong
throw new YAMLException$5('sortKeys must be a boolean or a function');
}
for (index = 0, length = objectKeyList.length; index < length; index += 1) {
pairBuffer = '';
if (!compact || index !== 0) {
pairBuffer += generateNextLine(state, level);
}
objectKey = objectKeyList[index];
objectValue = object[objectKey];
if (!writeNode(state, level + 1, objectKey, true, true, true)) {
continue; // Skip this pair because of invalid key.
}
explicitPair = (state.tag !== null && state.tag !== '?') ||
(state.dump && state.dump.length > 1024);
if (explicitPair) {
if (state.dump && CHAR_LINE_FEED === state.dump.charCodeAt(0)) {
pairBuffer += '?';
} else {
pairBuffer += '? ';
}
}
pairBuffer += state.dump;
if (explicitPair) {
pairBuffer += generateNextLine(state, level);
}
if (!writeNode(state, level + 1, objectValue, true, explicitPair)) {
continue; // Skip this pair because of invalid value.
}
if (state.dump && CHAR_LINE_FEED === state.dump.charCodeAt(0)) {
pairBuffer += ':';
} else {
pairBuffer += ': ';
}
pairBuffer += state.dump;
// Both key and value are valid.
_result += pairBuffer;
}
state.tag = _tag;
state.dump = _result || '{}'; // Empty mapping if no valid pairs.
}
function detectType(state, object, explicit) {
var _result, typeList, index, length, type, style;
typeList = explicit ? state.explicitTypes : state.implicitTypes;
for (index = 0, length = typeList.length; index < length; index += 1) {
type = typeList[index];
if ((type.instanceOf || type.predicate) &&
(!type.instanceOf || ((typeof object === 'object') && (object instanceof type.instanceOf))) &&
(!type.predicate || type.predicate(object))) {
state.tag = explicit ? type.tag : '?';
if (type.represent) {
style = state.styleMap[type.tag] || type.defaultStyle;
if (_toString$2.call(type.represent) === '[object Function]') {
_result = type.represent(object, style);
} else if (_hasOwnProperty$3.call(type.represent, style)) {
_result = type.represent[style](object, style);
} else {
throw new YAMLException$5('!<' + type.tag + '> tag resolver accepts not "' + style + '" style');
}
state.dump = _result;
}
return true;
}
}
return false;
}
// Serializes `object` and writes it to global `result`.
// Returns true on success, or false on invalid object.
//
function writeNode(state, level, object, block, compact, iskey) {
state.tag = null;
state.dump = object;
if (!detectType(state, object, false)) {
detectType(state, object, true);
}
var type = _toString$2.call(state.dump);
if (block) {
block = (state.flowLevel < 0 || state.flowLevel > level);
}
var objectOrArray = type === '[object Object]' || type === '[object Array]',
duplicateIndex,
duplicate;
if (objectOrArray) {
duplicateIndex = state.duplicates.indexOf(object);
duplicate = duplicateIndex !== -1;
}
if ((state.tag !== null && state.tag !== '?') || duplicate || (state.indent !== 2 && level > 0)) {
compact = false;
}
if (duplicate && state.usedDuplicates[duplicateIndex]) {
state.dump = '*ref_' + duplicateIndex;
} else {
if (objectOrArray && duplicate && !state.usedDuplicates[duplicateIndex]) {
state.usedDuplicates[duplicateIndex] = true;
}
if (type === '[object Object]') {
if (block && (Object.keys(state.dump).length !== 0)) {
writeBlockMapping(state, level, state.dump, compact);
if (duplicate) {
state.dump = '&ref_' + duplicateIndex + state.dump;
}
} else {
writeFlowMapping(state, level, state.dump);
if (duplicate) {
state.dump = '&ref_' + duplicateIndex + ' ' + state.dump;
}
}
} else if (type === '[object Array]') {
if (block && (state.dump.length !== 0)) {
writeBlockSequence(state, level, state.dump, compact);
if (duplicate) {
state.dump = '&ref_' + duplicateIndex + state.dump;
}
} else {
writeFlowSequence(state, level, state.dump);
if (duplicate) {
state.dump = '&ref_' + duplicateIndex + ' ' + state.dump;
}
}
} else if (type === '[object String]') {
if (state.tag !== '?') {
writeScalar(state, state.dump, level, iskey);
}
} else {
if (state.skipInvalid) { return false; }
throw new YAMLException$5('unacceptable kind of an object to dump ' + type);
}
if (state.tag !== null && state.tag !== '?') {
state.dump = '!<' + state.tag + '> ' + state.dump;
}
}
return true;
}
function getDuplicateReferences(object, state) {
var objects = [],
duplicatesIndexes = [],
index,
length;
inspectNode(object, objects, duplicatesIndexes);
for (index = 0, length = duplicatesIndexes.length; index < length; index += 1) {
state.duplicates.push(objects[duplicatesIndexes[index]]);
}
state.usedDuplicates = new Array(length);
}
function inspectNode(object, objects, duplicatesIndexes) {
var objectKeyList,
index,
length;
if (object !== null && typeof object === 'object') {
index = objects.indexOf(object);
if (index !== -1) {
if (duplicatesIndexes.indexOf(index) === -1) {
duplicatesIndexes.push(index);
}
} else {
objects.push(object);
if (Array.isArray(object)) {
for (index = 0, length = object.length; index < length; index += 1) {
inspectNode(object[index], objects, duplicatesIndexes);
}
} else {
objectKeyList = Object.keys(object);
for (index = 0, length = objectKeyList.length; index < length; index += 1) {
inspectNode(object[objectKeyList[index]], objects, duplicatesIndexes);
}
}
}
}
}
function dump$1(input, options) {
options = options || {};
var state = new State$1(options);
if (!state.noRefs) { getDuplicateReferences(input, state); }
if (writeNode(state, 0, input, true, true)) { return state.dump + '\n'; }
return '';
}
function safeDump$1(input, options) {
return dump$1(input, common$7.extend({ schema: DEFAULT_SAFE_SCHEMA$2 }, options));
}
var dump_1 = dump$1;
var safeDump_1 = safeDump$1;
var dumper$1 = {
dump: dump_1,
safeDump: safeDump_1
};
var loader = loader$1;
var dumper = dumper$1;
function deprecated(name) {
return function () {
throw new Error('Function ' + name + ' is deprecated and cannot be used.');
};
}
var Type = type;
var Schema = schema;
var FAILSAFE_SCHEMA = failsafe;
var JSON_SCHEMA = json;
var CORE_SCHEMA = core;
var DEFAULT_SAFE_SCHEMA = default_safe;
var DEFAULT_FULL_SCHEMA = default_full;
var load = loader.load;
var loadAll = loader.loadAll;
var safeLoad = loader.safeLoad;
var safeLoadAll = loader.safeLoadAll;
var dump = dumper.dump;
var safeDump = dumper.safeDump;
var YAMLException = exception;
// Deprecated schema names from JS-YAML 2.0.x
var MINIMAL_SCHEMA = failsafe;
var SAFE_SCHEMA = default_safe;
var DEFAULT_SCHEMA = default_full;
// Deprecated functions from JS-YAML 1.x.x
var scan$1 = deprecated('scan');
var parse$1 = deprecated('parse');
var compose = deprecated('compose');
var addConstructor = deprecated('addConstructor');
var jsYaml = {
Type: Type,
Schema: Schema,
FAILSAFE_SCHEMA: FAILSAFE_SCHEMA,
JSON_SCHEMA: JSON_SCHEMA,
CORE_SCHEMA: CORE_SCHEMA,
DEFAULT_SAFE_SCHEMA: DEFAULT_SAFE_SCHEMA,
DEFAULT_FULL_SCHEMA: DEFAULT_FULL_SCHEMA,
load: load,
loadAll: loadAll,
safeLoad: safeLoad,
safeLoadAll: safeLoadAll,
dump: dump,
safeDump: safeDump,
YAMLException: YAMLException,
MINIMAL_SCHEMA: MINIMAL_SCHEMA,
SAFE_SCHEMA: SAFE_SCHEMA,
DEFAULT_SCHEMA: DEFAULT_SCHEMA,
scan: scan$1,
parse: parse$1,
compose: compose,
addConstructor: addConstructor
};
var yaml = jsYaml;
var index = yaml;
var frontMatter = function(dom, data) {
var localData = {};
var el = dom.querySelector('script[type="text/front-matter"]');
if (el) {
var text = el.textContent;
localData = index.safeLoad(text);
}
data.title = localData.title ? localData.title : "Untitled";
data.description = localData.description ? localData.description : "No description.";
data.authors = localData.authors ? localData.authors : [];
data.authors = data.authors.map(function (author, i) {
var a = {};
var name = Object.keys(author)[0];
if ((typeof author) === "string") {
name = author;
} else {
a.personalURL = author[name];
}
var names = name.split(" ");
a.name = name;
a.firstName = names.slice(0, names.length - 1).join(" ");
a.lastName = names[names.length -1];
if(localData.affiliations[i]) {
var affiliation = Object.keys(localData.affiliations[i])[0];
if ((typeof localData.affiliations[i]) === "string") {
affiliation = localData.affiliations[i];
} else {
a.affiliationURL = localData.affiliations[i][affiliation];
}
a.affiliation = affiliation;
}
return a;
});
};
var bibtexParse = createCommonjsModule(function (module, exports) {
/* start bibtexParse 0.0.22 */
//Original work by Henrik Muehe (c) 2010
//
//CommonJS port by Mikola Lysenko 2013
//
//Port to Browser lib by ORCID / RCPETERS
//
//Issues:
//no comment handling within strings
//no string concatenation
//no variable values yet
//Grammar implemented here:
//bibtex -> (string | preamble | comment | entry)*;
//string -> '@STRING' '{' key_equals_value '}';
//preamble -> '@PREAMBLE' '{' value '}';
//comment -> '@COMMENT' '{' value '}';
//entry -> '@' key '{' key ',' key_value_list '}';
//key_value_list -> key_equals_value (',' key_equals_value)*;
//key_equals_value -> key '=' value;
//value -> value_quotes | value_braces | key;
//value_quotes -> '"' .*? '"'; // not quite
//value_braces -> '{' .*? '"'; // not quite
(function(exports) {
function BibtexParser() {
this.months = ["jan", "feb", "mar", "apr", "may", "jun", "jul", "aug", "sep", "oct", "nov", "dec"];
this.notKey = [',','{','}',' ','='];
this.pos = 0;
this.input = "";
this.entries = new Array();
this.currentEntry = "";
this.setInput = function(t) {
this.input = t;
};
this.getEntries = function() {
return this.entries;
};
this.isWhitespace = function(s) {
return (s == ' ' || s == '\r' || s == '\t' || s == '\n');
};
this.match = function(s, canCommentOut) {
if (canCommentOut == undefined || canCommentOut == null)
{ canCommentOut = true; }
this.skipWhitespace(canCommentOut);
if (this.input.substring(this.pos, this.pos + s.length) == s) {
this.pos += s.length;
} else {
throw "Token mismatch, expected " + s + ", found "
+ this.input.substring(this.pos);
}
this.skipWhitespace(canCommentOut);
};
this.tryMatch = function(s, canCommentOut) {
if (canCommentOut == undefined || canCommentOut == null)
{ canCommentOut = true; }
this.skipWhitespace(canCommentOut);
if (this.input.substring(this.pos, this.pos + s.length) == s) {
return true;
} else {
return false;
}
this.skipWhitespace(canCommentOut);
};
/* when search for a match all text can be ignored, not just white space */
this.matchAt = function() {
var this$1 = this;
while (this.input.length > this.pos && this.input[this.pos] != '@') {
this$1.pos++;
}
if (this.input[this.pos] == '@') {
return true;
}
return false;
};
this.skipWhitespace = function(canCommentOut) {
var this$1 = this;
while (this.isWhitespace(this.input[this.pos])) {
this$1.pos++;
}
if (this.input[this.pos] == "%" && canCommentOut == true) {
while (this.input[this.pos] != "\n") {
this$1.pos++;
}
this.skipWhitespace(canCommentOut);
}
};
this.value_braces = function() {
var this$1 = this;
var bracecount = 0;
this.match("{", false);
var start = this.pos;
var escaped = false;
while (true) {
if (!escaped) {
if (this$1.input[this$1.pos] == '}') {
if (bracecount > 0) {
bracecount--;
} else {
var end = this$1.pos;
this$1.match("}", false);
return this$1.input.substring(start, end);
}
} else if (this$1.input[this$1.pos] == '{') {
bracecount++;
} else if (this$1.pos >= this$1.input.length - 1) {
throw "Unterminated value";
}
}
if (this$1.input[this$1.pos] == '\\' && escaped == false)
{ escaped = true; }
else
{ escaped = false; }
this$1.pos++;
}
};
this.value_comment = function() {
var this$1 = this;
var str = '';
var brcktCnt = 0;
while (!(this.tryMatch("}", false) && brcktCnt == 0)) {
str = str + this$1.input[this$1.pos];
if (this$1.input[this$1.pos] == '{')
{ brcktCnt++; }
if (this$1.input[this$1.pos] == '}')
{ brcktCnt--; }
if (this$1.pos >= this$1.input.length - 1) {
throw "Unterminated value:" + this$1.input.substring(start);
}
this$1.pos++;
}
return str;
};
this.value_quotes = function() {
var this$1 = this;
this.match('"', false);
var start = this.pos;
var escaped = false;
while (true) {
if (!escaped) {
if (this$1.input[this$1.pos] == '"') {
var end = this$1.pos;
this$1.match('"', false);
return this$1.input.substring(start, end);
} else if (this$1.pos >= this$1.input.length - 1) {
throw "Unterminated value:" + this$1.input.substring(start);
}
}
if (this$1.input[this$1.pos] == '\\' && escaped == false)
{ escaped = true; }
else
{ escaped = false; }
this$1.pos++;
}
};
this.single_value = function() {
var start = this.pos;
if (this.tryMatch("{")) {
return this.value_braces();
} else if (this.tryMatch('"')) {
return this.value_quotes();
} else {
var k = this.key();
if (k.match("^[0-9]+$"))
{ return k; }
else if (this.months.indexOf(k.toLowerCase()) >= 0)
{ return k.toLowerCase(); }
else
{ throw "Value expected:" + this.input.substring(start) + ' for key: ' + k; }
}
};
this.value = function() {
var this$1 = this;
var values = [];
values.push(this.single_value());
while (this.tryMatch("#")) {
this$1.match("#");
values.push(this$1.single_value());
}
return values.join("");
};
this.key = function() {
var this$1 = this;
var start = this.pos;
while (true) {
if (this$1.pos >= this$1.input.length) {
throw "Runaway key";
}
// а-яА-Я is Cyrillic
//console.log(this.input[this.pos]);
if (this$1.notKey.indexOf(this$1.input[this$1.pos]) >= 0) {
return this$1.input.substring(start, this$1.pos);
} else {
this$1.pos++;
}
}
};
this.key_equals_value = function() {
var key = this.key();
if (this.tryMatch("=")) {
this.match("=");
var val = this.value();
return [ key, val ];
} else {
throw "... = value expected, equals sign missing:"
+ this.input.substring(this.pos);
}
};
this.key_value_list = function() {
var this$1 = this;
var kv = this.key_equals_value();
this.currentEntry['entryTags'] = {};
this.currentEntry['entryTags'][kv[0]] = kv[1];
while (this.tryMatch(",")) {
this$1.match(",");
// fixes problems with commas at the end of a list
if (this$1.tryMatch("}")) {
break;
}
kv = this$1.key_equals_value();
this$1.currentEntry['entryTags'][kv[0]] = kv[1];
}
};
this.entry_body = function(d) {
this.currentEntry = {};
this.currentEntry['citationKey'] = this.key();
this.currentEntry['entryType'] = d.substring(1);
this.match(",");
this.key_value_list();
this.entries.push(this.currentEntry);
};
this.directive = function() {
this.match("@");
return "@" + this.key();
};
this.preamble = function() {
this.currentEntry = {};
this.currentEntry['entryType'] = 'PREAMBLE';
this.currentEntry['entry'] = this.value_comment();
this.entries.push(this.currentEntry);
};
this.comment = function() {
this.currentEntry = {};
this.currentEntry['entryType'] = 'COMMENT';
this.currentEntry['entry'] = this.value_comment();
this.entries.push(this.currentEntry);
};
this.entry = function(d) {
this.entry_body(d);
};
this.bibtex = function() {
var this$1 = this;
while (this.matchAt()) {
var d = this$1.directive();
this$1.match("{");
if (d == "@STRING") {
this$1.string();
} else if (d == "@PREAMBLE") {
this$1.preamble();
} else if (d == "@COMMENT") {
this$1.comment();
} else {
this$1.entry(d);
}
this$1.match("}");
}
};
}
exports.toJSON = function(bibtex) {
var b = new BibtexParser();
b.setInput(bibtex);
b.bibtex();
return b.entries;
};
/* added during hackathon don't hate on me */
exports.toBibtex = function(json) {
var out = '';
for ( var i in json) {
out += "@" + json[i].entryType;
out += '{';
if (json[i].citationKey)
{ out += json[i].citationKey + ', '; }
if (json[i].entry)
{ out += json[i].entry ; }
if (json[i].entryTags) {
var tags = '';
for (var jdx in json[i].entryTags) {
if (tags.length != 0)
{ tags += ', '; }
tags += jdx + '= {' + json[i].entryTags[jdx] + '}';
}
out += tags;
}
out += '}\n\n';
}
return out;
};
})(exports);
/* end bibtexParse */
});
var bibliography = function(dom, data) {
var el = dom.querySelector('script[type="text/bibliography"]');
var bibliography = {};
//TODO If we don't have a local element, make a request for the document.
if (el) {
var rawBib = el.textContent;
var parsed = bibtexParse.toJSON(rawBib);
if(parsed) {
parsed.forEach(function (e) {
for (var k in e.entryTags){
var val = e.entryTags[k];
val = val.replace(/[\t\n ]+/g, " ");
val = val.replace(/{\\["^`\.'acu~Hvs]( )?([a-zA-Z])}/g,
function (full, x, char) { return char; });
val = val.replace(/{\\([a-zA-Z])}/g,
function (full, char) { return char; });
e.entryTags[k.toLowerCase()] = val;
}
bibliography[e.citationKey] = e.entryTags;
bibliography[e.citationKey].type = e.entryType;
});
}
}
data.bibliography = bibliography;
};
var t0 = new Date;
var t1 = new Date;
function newInterval(floori, offseti, count, field) {
function interval(date) {
return floori(date = new Date(+date)), date;
}
interval.floor = interval;
interval.ceil = function(date) {
return floori(date = new Date(date - 1)), offseti(date, 1), floori(date), date;
};
interval.round = function(date) {
var d0 = interval(date),
d1 = interval.ceil(date);
return date - d0 < d1 - date ? d0 : d1;
};
interval.offset = function(date, step) {
return offseti(date = new Date(+date), step == null ? 1 : Math.floor(step)), date;
};
interval.range = function(start, stop, step) {
var range = [];
start = interval.ceil(start);
step = step == null ? 1 : Math.floor(step);
if (!(start < stop) || !(step > 0)) { return range; } // also handles Invalid Date
do { range.push(new Date(+start)); } while (offseti(start, step), floori(start), start < stop)
return range;
};
interval.filter = function(test) {
return newInterval(function(date) {
if (date >= date) { while (floori(date), !test(date)) { date.setTime(date - 1); } }
}, function(date, step) {
if (date >= date) { while (--step >= 0) { while (offseti(date, 1), !test(date)) {} } } // eslint-disable-line no-empty
});
};
if (count) {
interval.count = function(start, end) {
t0.setTime(+start), t1.setTime(+end);
floori(t0), floori(t1);
return Math.floor(count(t0, t1));
};
interval.every = function(step) {
step = Math.floor(step);
return !isFinite(step) || !(step > 0) ? null
: !(step > 1) ? interval
: interval.filter(field
? function(d) { return field(d) % step === 0; }
: function(d) { return interval.count(0, d) % step === 0; });
};
}
return interval;
}
var millisecond = newInterval(function() {
// noop
}, function(date, step) {
date.setTime(+date + step);
}, function(start, end) {
return end - start;
});
// An optimized implementation for this simple case.
millisecond.every = function(k) {
k = Math.floor(k);
if (!isFinite(k) || !(k > 0)) { return null; }
if (!(k > 1)) { return millisecond; }
return newInterval(function(date) {
date.setTime(Math.floor(date / k) * k);
}, function(date, step) {
date.setTime(+date + step * k);
}, function(start, end) {
return (end - start) / k;
});
};
var durationSecond = 1e3;
var durationMinute = 6e4;
var durationHour = 36e5;
var durationDay = 864e5;
var durationWeek = 6048e5;
var second = newInterval(function(date) {
date.setTime(Math.floor(date / durationSecond) * durationSecond);
}, function(date, step) {
date.setTime(+date + step * durationSecond);
}, function(start, end) {
return (end - start) / durationSecond;
}, function(date) {
return date.getUTCSeconds();
});
var minute = newInterval(function(date) {
date.setTime(Math.floor(date / durationMinute) * durationMinute);
}, function(date, step) {
date.setTime(+date + step * durationMinute);
}, function(start, end) {
return (end - start) / durationMinute;
}, function(date) {
return date.getMinutes();
});
var hour = newInterval(function(date) {
var offset = date.getTimezoneOffset() * durationMinute % durationHour;
if (offset < 0) { offset += durationHour; }
date.setTime(Math.floor((+date - offset) / durationHour) * durationHour + offset);
}, function(date, step) {
date.setTime(+date + step * durationHour);
}, function(start, end) {
return (end - start) / durationHour;
}, function(date) {
return date.getHours();
});
var day = newInterval(function(date) {
date.setHours(0, 0, 0, 0);
}, function(date, step) {
date.setDate(date.getDate() + step);
}, function(start, end) {
return (end - start - (end.getTimezoneOffset() - start.getTimezoneOffset()) * durationMinute) / durationDay;
}, function(date) {
return date.getDate() - 1;
});
function weekday(i) {
return newInterval(function(date) {
date.setDate(date.getDate() - (date.getDay() + 7 - i) % 7);
date.setHours(0, 0, 0, 0);
}, function(date, step) {
date.setDate(date.getDate() + step * 7);
}, function(start, end) {
return (end - start - (end.getTimezoneOffset() - start.getTimezoneOffset()) * durationMinute) / durationWeek;
});
}
var sunday = weekday(0);
var monday = weekday(1);
var tuesday = weekday(2);
var wednesday = weekday(3);
var thursday = weekday(4);
var friday = weekday(5);
var saturday = weekday(6);
var month = newInterval(function(date) {
date.setDate(1);
date.setHours(0, 0, 0, 0);
}, function(date, step) {
date.setMonth(date.getMonth() + step);
}, function(start, end) {
return end.getMonth() - start.getMonth() + (end.getFullYear() - start.getFullYear()) * 12;
}, function(date) {
return date.getMonth();
});
var year = newInterval(function(date) {
date.setMonth(0, 1);
date.setHours(0, 0, 0, 0);
}, function(date, step) {
date.setFullYear(date.getFullYear() + step);
}, function(start, end) {
return end.getFullYear() - start.getFullYear();
}, function(date) {
return date.getFullYear();
});
// An optimized implementation for this simple case.
year.every = function(k) {
return !isFinite(k = Math.floor(k)) || !(k > 0) ? null : newInterval(function(date) {
date.setFullYear(Math.floor(date.getFullYear() / k) * k);
date.setMonth(0, 1);
date.setHours(0, 0, 0, 0);
}, function(date, step) {
date.setFullYear(date.getFullYear() + step * k);
});
};
var utcMinute = newInterval(function(date) {
date.setUTCSeconds(0, 0);
}, function(date, step) {
date.setTime(+date + step * durationMinute);
}, function(start, end) {
return (end - start) / durationMinute;
}, function(date) {
return date.getUTCMinutes();
});
var utcHour = newInterval(function(date) {
date.setUTCMinutes(0, 0, 0);
}, function(date, step) {
date.setTime(+date + step * durationHour);
}, function(start, end) {
return (end - start) / durationHour;
}, function(date) {
return date.getUTCHours();
});
var utcDay = newInterval(function(date) {
date.setUTCHours(0, 0, 0, 0);
}, function(date, step) {
date.setUTCDate(date.getUTCDate() + step);
}, function(start, end) {
return (end - start) / durationDay;
}, function(date) {
return date.getUTCDate() - 1;
});
function utcWeekday(i) {
return newInterval(function(date) {
date.setUTCDate(date.getUTCDate() - (date.getUTCDay() + 7 - i) % 7);
date.setUTCHours(0, 0, 0, 0);
}, function(date, step) {
date.setUTCDate(date.getUTCDate() + step * 7);
}, function(start, end) {
return (end - start) / durationWeek;
});
}
var utcSunday = utcWeekday(0);
var utcMonday = utcWeekday(1);
var utcTuesday = utcWeekday(2);
var utcWednesday = utcWeekday(3);
var utcThursday = utcWeekday(4);
var utcFriday = utcWeekday(5);
var utcSaturday = utcWeekday(6);
var utcMonth = newInterval(function(date) {
date.setUTCDate(1);
date.setUTCHours(0, 0, 0, 0);
}, function(date, step) {
date.setUTCMonth(date.getUTCMonth() + step);
}, function(start, end) {
return end.getUTCMonth() - start.getUTCMonth() + (end.getUTCFullYear() - start.getUTCFullYear()) * 12;
}, function(date) {
return date.getUTCMonth();
});
var utcYear = newInterval(function(date) {
date.setUTCMonth(0, 1);
date.setUTCHours(0, 0, 0, 0);
}, function(date, step) {
date.setUTCFullYear(date.getUTCFullYear() + step);
}, function(start, end) {
return end.getUTCFullYear() - start.getUTCFullYear();
}, function(date) {
return date.getUTCFullYear();
});
// An optimized implementation for this simple case.
utcYear.every = function(k) {
return !isFinite(k = Math.floor(k)) || !(k > 0) ? null : newInterval(function(date) {
date.setUTCFullYear(Math.floor(date.getUTCFullYear() / k) * k);
date.setUTCMonth(0, 1);
date.setUTCHours(0, 0, 0, 0);
}, function(date, step) {
date.setUTCFullYear(date.getUTCFullYear() + step * k);
});
};
function localDate(d) {
if (0 <= d.y && d.y < 100) {
var date = new Date(-1, d.m, d.d, d.H, d.M, d.S, d.L);
date.setFullYear(d.y);
return date;
}
return new Date(d.y, d.m, d.d, d.H, d.M, d.S, d.L);
}
function utcDate(d) {
if (0 <= d.y && d.y < 100) {
var date = new Date(Date.UTC(-1, d.m, d.d, d.H, d.M, d.S, d.L));
date.setUTCFullYear(d.y);
return date;
}
return new Date(Date.UTC(d.y, d.m, d.d, d.H, d.M, d.S, d.L));
}
function newYear(y) {
return {y: y, m: 0, d: 1, H: 0, M: 0, S: 0, L: 0};
}
function formatLocale(locale) {
var locale_dateTime = locale.dateTime,
locale_date = locale.date,
locale_time = locale.time,
locale_periods = locale.periods,
locale_weekdays = locale.days,
locale_shortWeekdays = locale.shortDays,
locale_months = locale.months,
locale_shortMonths = locale.shortMonths;
var periodRe = formatRe(locale_periods),
periodLookup = formatLookup(locale_periods),
weekdayRe = formatRe(locale_weekdays),
weekdayLookup = formatLookup(locale_weekdays),
shortWeekdayRe = formatRe(locale_shortWeekdays),
shortWeekdayLookup = formatLookup(locale_shortWeekdays),
monthRe = formatRe(locale_months),
monthLookup = formatLookup(locale_months),
shortMonthRe = formatRe(locale_shortMonths),
shortMonthLookup = formatLookup(locale_shortMonths);
var formats = {
"a": formatShortWeekday,
"A": formatWeekday,
"b": formatShortMonth,
"B": formatMonth,
"c": null,
"d": formatDayOfMonth,
"e": formatDayOfMonth,
"H": formatHour24,
"I": formatHour12,
"j": formatDayOfYear,
"L": formatMilliseconds,
"m": formatMonthNumber,
"M": formatMinutes,
"p": formatPeriod,
"S": formatSeconds,
"U": formatWeekNumberSunday,
"w": formatWeekdayNumber,
"W": formatWeekNumberMonday,
"x": null,
"X": null,
"y": formatYear,
"Y": formatFullYear,
"Z": formatZone,
"%": formatLiteralPercent
};
var utcFormats = {
"a": formatUTCShortWeekday,
"A": formatUTCWeekday,
"b": formatUTCShortMonth,
"B": formatUTCMonth,
"c": null,
"d": formatUTCDayOfMonth,
"e": formatUTCDayOfMonth,
"H": formatUTCHour24,
"I": formatUTCHour12,
"j": formatUTCDayOfYear,
"L": formatUTCMilliseconds,
"m": formatUTCMonthNumber,
"M": formatUTCMinutes,
"p": formatUTCPeriod,
"S": formatUTCSeconds,
"U": formatUTCWeekNumberSunday,
"w": formatUTCWeekdayNumber,
"W": formatUTCWeekNumberMonday,
"x": null,
"X": null,
"y": formatUTCYear,
"Y": formatUTCFullYear,
"Z": formatUTCZone,
"%": formatLiteralPercent
};
var parses = {
"a": parseShortWeekday,
"A": parseWeekday,
"b": parseShortMonth,
"B": parseMonth,
"c": parseLocaleDateTime,
"d": parseDayOfMonth,
"e": parseDayOfMonth,
"H": parseHour24,
"I": parseHour24,
"j": parseDayOfYear,
"L": parseMilliseconds,
"m": parseMonthNumber,
"M": parseMinutes,
"p": parsePeriod,
"S": parseSeconds,
"U": parseWeekNumberSunday,
"w": parseWeekdayNumber,
"W": parseWeekNumberMonday,
"x": parseLocaleDate,
"X": parseLocaleTime,
"y": parseYear,
"Y": parseFullYear,
"Z": parseZone,
"%": parseLiteralPercent
};
// These recursive directive definitions must be deferred.
formats.x = newFormat(locale_date, formats);
formats.X = newFormat(locale_time, formats);
formats.c = newFormat(locale_dateTime, formats);
utcFormats.x = newFormat(locale_date, utcFormats);
utcFormats.X = newFormat(locale_time, utcFormats);
utcFormats.c = newFormat(locale_dateTime, utcFormats);
function newFormat(specifier, formats) {
return function(date) {
var string = [],
i = -1,
j = 0,
n = specifier.length,
c,
pad,
format;
if (!(date instanceof Date)) { date = new Date(+date); }
while (++i < n) {
if (specifier.charCodeAt(i) === 37) {
string.push(specifier.slice(j, i));
if ((pad = pads[c = specifier.charAt(++i)]) != null) { c = specifier.charAt(++i); }
else { pad = c === "e" ? " " : "0"; }
if (format = formats[c]) { c = format(date, pad); }
string.push(c);
j = i + 1;
}
}
string.push(specifier.slice(j, i));
return string.join("");
};
}
function newParse(specifier, newDate) {
return function(string) {
var d = newYear(1900),
i = parseSpecifier(d, specifier, string += "", 0);
if (i != string.length) { return null; }
// The am-pm flag is 0 for AM, and 1 for PM.
if ("p" in d) { d.H = d.H % 12 + d.p * 12; }
// Convert day-of-week and week-of-year to day-of-year.
if ("W" in d || "U" in d) {
if (!("w" in d)) { d.w = "W" in d ? 1 : 0; }
var day$$1 = "Z" in d ? utcDate(newYear(d.y)).getUTCDay() : newDate(newYear(d.y)).getDay();
d.m = 0;
d.d = "W" in d ? (d.w + 6) % 7 + d.W * 7 - (day$$1 + 5) % 7 : d.w + d.U * 7 - (day$$1 + 6) % 7;
}
// If a time zone is specified, all fields are interpreted as UTC and then
// offset according to the specified time zone.
if ("Z" in d) {
d.H += d.Z / 100 | 0;
d.M += d.Z % 100;
return utcDate(d);
}
// Otherwise, all fields are in local time.
return newDate(d);
};
}
function parseSpecifier(d, specifier, string, j) {
var i = 0,
n = specifier.length,
m = string.length,
c,
parse;
while (i < n) {
if (j >= m) { return -1; }
c = specifier.charCodeAt(i++);
if (c === 37) {
c = specifier.charAt(i++);
parse = parses[c in pads ? specifier.charAt(i++) : c];
if (!parse || ((j = parse(d, string, j)) < 0)) { return -1; }
} else if (c != string.charCodeAt(j++)) {
return -1;
}
}
return j;
}
function parsePeriod(d, string, i) {
var n = periodRe.exec(string.slice(i));
return n ? (d.p = periodLookup[n[0].toLowerCase()], i + n[0].length) : -1;
}
function parseShortWeekday(d, string, i) {
var n = shortWeekdayRe.exec(string.slice(i));
return n ? (d.w = shortWeekdayLookup[n[0].toLowerCase()], i + n[0].length) : -1;
}
function parseWeekday(d, string, i) {
var n = weekdayRe.exec(string.slice(i));
return n ? (d.w = weekdayLookup[n[0].toLowerCase()], i + n[0].length) : -1;
}
function parseShortMonth(d, string, i) {
var n = shortMonthRe.exec(string.slice(i));
return n ? (d.m = shortMonthLookup[n[0].toLowerCase()], i + n[0].length) : -1;
}
function parseMonth(d, string, i) {
var n = monthRe.exec(string.slice(i));
return n ? (d.m = monthLookup[n[0].toLowerCase()], i + n[0].length) : -1;
}
function parseLocaleDateTime(d, string, i) {
return parseSpecifier(d, locale_dateTime, string, i);
}
function parseLocaleDate(d, string, i) {
return parseSpecifier(d, locale_date, string, i);
}
function parseLocaleTime(d, string, i) {
return parseSpecifier(d, locale_time, string, i);
}
function formatShortWeekday(d) {
return locale_shortWeekdays[d.getDay()];
}
function formatWeekday(d) {
return locale_weekdays[d.getDay()];
}
function formatShortMonth(d) {
return locale_shortMonths[d.getMonth()];
}
function formatMonth(d) {
return locale_months[d.getMonth()];
}
function formatPeriod(d) {
return locale_periods[+(d.getHours() >= 12)];
}
function formatUTCShortWeekday(d) {
return locale_shortWeekdays[d.getUTCDay()];
}
function formatUTCWeekday(d) {
return locale_weekdays[d.getUTCDay()];
}
function formatUTCShortMonth(d) {
return locale_shortMonths[d.getUTCMonth()];
}
function formatUTCMonth(d) {
return locale_months[d.getUTCMonth()];
}
function formatUTCPeriod(d) {
return locale_periods[+(d.getUTCHours() >= 12)];
}
return {
format: function(specifier) {
var f = newFormat(specifier += "", formats);
f.toString = function() { return specifier; };
return f;
},
parse: function(specifier) {
var p = newParse(specifier += "", localDate);
p.toString = function() { return specifier; };
return p;
},
utcFormat: function(specifier) {
var f = newFormat(specifier += "", utcFormats);
f.toString = function() { return specifier; };
return f;
},
utcParse: function(specifier) {
var p = newParse(specifier, utcDate);
p.toString = function() { return specifier; };
return p;
}
};
}
var pads = {"-": "", "_": " ", "0": "0"};
var numberRe = /^\s*\d+/;
var percentRe = /^%/;
var requoteRe = /[\\\^\$\*\+\?\|\[\]\(\)\.\{\}]/g;
function pad(value, fill, width) {
var sign = value < 0 ? "-" : "",
string = (sign ? -value : value) + "",
length = string.length;
return sign + (length < width ? new Array(width - length + 1).join(fill) + string : string);
}
function requote(s) {
return s.replace(requoteRe, "\\$&");
}
function formatRe(names) {
return new RegExp("^(?:" + names.map(requote).join("|") + ")", "i");
}
function formatLookup(names) {
var map = {}, i = -1, n = names.length;
while (++i < n) { map[names[i].toLowerCase()] = i; }
return map;
}
function parseWeekdayNumber(d, string, i) {
var n = numberRe.exec(string.slice(i, i + 1));
return n ? (d.w = +n[0], i + n[0].length) : -1;
}
function parseWeekNumberSunday(d, string, i) {
var n = numberRe.exec(string.slice(i));
return n ? (d.U = +n[0], i + n[0].length) : -1;
}
function parseWeekNumberMonday(d, string, i) {
var n = numberRe.exec(string.slice(i));
return n ? (d.W = +n[0], i + n[0].length) : -1;
}
function parseFullYear(d, string, i) {
var n = numberRe.exec(string.slice(i, i + 4));
return n ? (d.y = +n[0], i + n[0].length) : -1;
}
function parseYear(d, string, i) {
var n = numberRe.exec(string.slice(i, i + 2));
return n ? (d.y = +n[0] + (+n[0] > 68 ? 1900 : 2000), i + n[0].length) : -1;
}
function parseZone(d, string, i) {
var n = /^(Z)|([+-]\d\d)(?:\:?(\d\d))?/.exec(string.slice(i, i + 6));
return n ? (d.Z = n[1] ? 0 : -(n[2] + (n[3] || "00")), i + n[0].length) : -1;
}
function parseMonthNumber(d, string, i) {
var n = numberRe.exec(string.slice(i, i + 2));
return n ? (d.m = n[0] - 1, i + n[0].length) : -1;
}
function parseDayOfMonth(d, string, i) {
var n = numberRe.exec(string.slice(i, i + 2));
return n ? (d.d = +n[0], i + n[0].length) : -1;
}
function parseDayOfYear(d, string, i) {
var n = numberRe.exec(string.slice(i, i + 3));
return n ? (d.m = 0, d.d = +n[0], i + n[0].length) : -1;
}
function parseHour24(d, string, i) {
var n = numberRe.exec(string.slice(i, i + 2));
return n ? (d.H = +n[0], i + n[0].length) : -1;
}
function parseMinutes(d, string, i) {
var n = numberRe.exec(string.slice(i, i + 2));
return n ? (d.M = +n[0], i + n[0].length) : -1;
}
function parseSeconds(d, string, i) {
var n = numberRe.exec(string.slice(i, i + 2));
return n ? (d.S = +n[0], i + n[0].length) : -1;
}
function parseMilliseconds(d, string, i) {
var n = numberRe.exec(string.slice(i, i + 3));
return n ? (d.L = +n[0], i + n[0].length) : -1;
}
function parseLiteralPercent(d, string, i) {
var n = percentRe.exec(string.slice(i, i + 1));
return n ? i + n[0].length : -1;
}
function formatDayOfMonth(d, p) {
return pad(d.getDate(), p, 2);
}
function formatHour24(d, p) {
return pad(d.getHours(), p, 2);
}
function formatHour12(d, p) {
return pad(d.getHours() % 12 || 12, p, 2);
}
function formatDayOfYear(d, p) {
return pad(1 + day.count(year(d), d), p, 3);
}
function formatMilliseconds(d, p) {
return pad(d.getMilliseconds(), p, 3);
}
function formatMonthNumber(d, p) {
return pad(d.getMonth() + 1, p, 2);
}
function formatMinutes(d, p) {
return pad(d.getMinutes(), p, 2);
}
function formatSeconds(d, p) {
return pad(d.getSeconds(), p, 2);
}
function formatWeekNumberSunday(d, p) {
return pad(sunday.count(year(d), d), p, 2);
}
function formatWeekdayNumber(d) {
return d.getDay();
}
function formatWeekNumberMonday(d, p) {
return pad(monday.count(year(d), d), p, 2);
}
function formatYear(d, p) {
return pad(d.getFullYear() % 100, p, 2);
}
function formatFullYear(d, p) {
return pad(d.getFullYear() % 10000, p, 4);
}
function formatZone(d) {
var z = d.getTimezoneOffset();
return (z > 0 ? "-" : (z *= -1, "+"))
+ pad(z / 60 | 0, "0", 2)
+ pad(z % 60, "0", 2);
}
function formatUTCDayOfMonth(d, p) {
return pad(d.getUTCDate(), p, 2);
}
function formatUTCHour24(d, p) {
return pad(d.getUTCHours(), p, 2);
}
function formatUTCHour12(d, p) {
return pad(d.getUTCHours() % 12 || 12, p, 2);
}
function formatUTCDayOfYear(d, p) {
return pad(1 + utcDay.count(utcYear(d), d), p, 3);
}
function formatUTCMilliseconds(d, p) {
return pad(d.getUTCMilliseconds(), p, 3);
}
function formatUTCMonthNumber(d, p) {
return pad(d.getUTCMonth() + 1, p, 2);
}
function formatUTCMinutes(d, p) {
return pad(d.getUTCMinutes(), p, 2);
}
function formatUTCSeconds(d, p) {
return pad(d.getUTCSeconds(), p, 2);
}
function formatUTCWeekNumberSunday(d, p) {
return pad(utcSunday.count(utcYear(d), d), p, 2);
}
function formatUTCWeekdayNumber(d) {
return d.getUTCDay();
}
function formatUTCWeekNumberMonday(d, p) {
return pad(utcMonday.count(utcYear(d), d), p, 2);
}
function formatUTCYear(d, p) {
return pad(d.getUTCFullYear() % 100, p, 2);
}
function formatUTCFullYear(d, p) {
return pad(d.getUTCFullYear() % 10000, p, 4);
}
function formatUTCZone() {
return "+0000";
}
function formatLiteralPercent() {
return "%";
}
var locale$1;
var timeFormat;
var timeParse;
var utcFormat;
var utcParse;
defaultLocale({
dateTime: "%x, %X",
date: "%-m/%-d/%Y",
time: "%-I:%M:%S %p",
periods: ["AM", "PM"],
days: ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"],
shortDays: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"],
months: ["January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"],
shortMonths: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]
});
function defaultLocale(definition) {
locale$1 = formatLocale(definition);
timeFormat = locale$1.format;
timeParse = locale$1.parse;
utcFormat = locale$1.utcFormat;
utcParse = locale$1.utcParse;
return locale$1;
}
var isoSpecifier = "%Y-%m-%dT%H:%M:%S.%LZ";
function formatIsoNative(date) {
return date.toISOString();
}
var formatIso = Date.prototype.toISOString
? formatIsoNative
: utcFormat(isoSpecifier);
function parseIsoNative(string) {
var date = new Date(string);
return isNaN(date) ? null : date;
}
var parseIso = +new Date("2000-01-01T00:00:00.000Z")
? parseIsoNative
: utcParse(isoSpecifier);
var expandData = function(dom, data) {
//
// Properties from source
//
// title: 'Attention and Augmented Recurrent Neural Networks',
// description: 'A visual overview of neural attention, and the powerful extensions of neural networks being built on top of it.',
// url: 'http://distill.pub/2016/augmented-rnns',
// tags: [ 'rnn' ],
// doiSuffix: 1,
// doi: '10.23915/distill.00001',
// volume: 1,
// issue: 9,
// distillPath: '2016/augmented-rnns',
// githubPath: 'distillpub/post--augmented-rnns',
// githubCompareUpdatesUrl: 'https://github.com/distillpub/post--augmented-rnns/compare/1596e094d8943d2dc0ea445d92071129c6419c59...3bd9209e0c24d020f87cf6152dcecc6017cbc193',
// updatedDate: 2017-03-21T07:13:16.000Z,
// publishedDate: 2016-09-08T07:00:00.000Z,
// journal: {
// "title": "Distill",
// "full_title": "Distill",
// "abbrev_title": "Distill",
// "url": "http://distill.pub",
// "doi": "10.23915/distill",
// "publisherName": "Distill Working Group",
// "publisherEmail": "admin@distill.pub",
// "issn": "2476-0757",
// "editors": [...],
// "committee": [...]
// }
//
// Computed Properties
//
// githubUrl: 'https://github.com/distillpub/post--augmented-rnns',
// previewURL: 'http://distill.pub/2016/augmented-rnns/thumbnail.jpg',
// publishedDateRFC: 'Thu, 08 Sep 2016 00:00:00 -0700',
// publishedYear: 2016,
// publishedMonth: 'Sept',
// publishedDay: 8,
// publishedMonthPadded: '09',
// publishedDayPadded: '08',
// updatedDateRFC: 'Tue, 21 Mar 2017 00:13:16 -0700',
// concatenatedAuthors: 'Olah & Carter',
// bibtexAuthors: 'Olah, Chris and Carter, Shan',
// slug: 'olah2016attention'
// authors: [
// {
// "personalURL": null,
// "name": "Chris Olah",
// "firstName": "Chris",
// "lastName": "Olah",
// "affiliationURL": null,
// "affiliation": "Google Brain"
// }
// ],
// bibliography: {
// "gregor2015draw": {
// "title": "DRAW: A recurrent neural network for image generation",
// "author": "Gregor, Karol and Danihelka, Ivo and Graves, Alex and Rezende, Danilo Jimenez and Wierstra, Daan",
// "journal": "arXiv preprint arXiv:1502.04623",
// "year": "2015",
// "url": "https://arxiv.org/pdf/1502.04623.pdf",
// "type": "article"
// },
// ...
// },
// citations: [
// "gregor2015draw",
// "mercier2011humans",
// "dong2014image",
// "dumoulin2016guide",
// "mordvintsev2015inceptionism"
// ],
// citations:
var citations = [];
var citeTags = [].slice.apply(dom.querySelectorAll("dt-cite"));
citeTags.forEach(function (el) {
var key = el.getAttribute("key");
if (key) {
var citationKeys = key.split(",");
citationKeys.forEach(function (key) {
if (citations.indexOf(key) == -1){
citations.push(key);
if (!(key in data.bibliography)){
console.warn("No bibliography entry found for: " + key);
}
}
});
}
});
data.citations = citations;
data.authors = data.authors || [];
// paths
if (!data.distillPath && !data.url) {
data.url = "http://distill.pub/";
} else if (!data.url) {
data.url = "http://distill.pub/" + data.distillPath;
}
data.githubUrl = "https://github.com/" + data.githubPath;
data.previewURL = data.previewURL ? data.previewURL : data.url + "/thumbnail.jpg";
// Homepage
//data.homepage = !post.noHomepage;
data.journal = data.journal || {};
// Dates
if (data.publishedDate){//} && data.journal) {
data.volume = data.publishedDate.getFullYear() - 2015;
data.issue = data.publishedDate.getMonth() + 1;
}
data.publishedDate = data.publishedDate ? data.publishedDate : new Date("Invalid");
data.updatedDate = data.updatedDate ? data.updatedDate : new Date("Invalid");
data.publishedDateRFC;
var RFC = timeFormat("%a, %d %b %Y %H:%M:%S %Z");
var months = ["Jan", "Feb", "March", "April", "May", "June", "July", "Aug", "Sept", "Oct", "Nov", "Dec"];
var zeroPad = function (n) { return n < 10 ? "0" + n : n; };
data.publishedDateRFC = RFC(data.publishedDate);
data.publishedYear = data.publishedDate.getFullYear();
data.publishedMonth = months[data.publishedDate.getMonth()];
data.publishedDay = data.publishedDate.getDate();
data.publishedMonthPadded = zeroPad(data.publishedDate.getMonth() + 1);
data.publishedDayPadded = zeroPad(data.publishedDate.getDate());
data.updatedDateRFC = RFC(data.updatedDate);
if (data.authors.length > 2) {
data.concatenatedAuthors = data.authors[0].lastName + ", et al.";
} else if (data.authors.length === 2) {
data.concatenatedAuthors = data.authors[0].lastName + " & " + data.authors[1].lastName;
} else if (data.authors.length === 1) {
data.concatenatedAuthors = data.authors[0].lastName;
}
data.bibtexAuthors = data.authors.map(function(author){
return author.lastName + ", " + author.firstName;
}).join(" and ");
data.slug = data.authors.length ? data.authors[0].lastName.toLowerCase() + data.publishedYear + data.title.split(" ")[0].toLowerCase() : "Untitled";
};
// public domain globe icon from noun project.
var favicon = "iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAMAAABEpIrGAAAABGdBTUEAALGPC/xhBQAAAAFzUkdCAK7OHOkAAAAgY0hSTQAAeiYAAICEAAD6AAAAgOgAAHUwAADqYAAAOpgAABdwnLpRPAAAAmRQTFRFAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA////D1IORgAAAMp0Uk5TAAIpe67M3vbkvKx+LgM9ltu+h9JNT4zPm2aIspg+HLbjoBoSATqqfwofah07sYGFohamYgaJR1UjszmUdh6wYARdukVIeXc4tzJTG1gMq0RKuA10lwVwvQ4lxCYUCY3nhjytcoJMF5KdQZGTaZ8Yr5pUjkvTUggtwDCAxqRnMXE2B1HNj6iEJ54vtZWcqe1sE2HOISRobnzyv2/D+2SKUCJzWaO5NMo/XDcqme8spWMoxRWQ3aHJEX2LIEYzTmU1Ql546Mjc5f7z2mrbutMAAAABYktHRMuEswZwAAAACXBIWXMAAAsTAAALEwEAmpwYAAAC+klEQVQ4y2VT+yNTcRQ/K6pdmzWyZGYe12tsNGN5bJbXVmx5DEnezzy2hZDmMaFSIqKiB7G8KpUQpff7r+r7vfei9P3hfD/nc8493+/53s8B2FqsPXsdHPft/32ATThxuLB7sZx5B/kurofcBIfdj3gIPUW7Urw8xN4+vn58EZD+AYFBwRKhIOTveKhUFhZ+FLjyCOSEyGUKCI4U+u/Eo8TKY9ExCMTGYVeljgfQHE9I3P5enATJkSRCKZ4UodWdQPYkm6mRqk4DveEUhukZmRSVZcxGNidXhR3SJYwLMQGnMc47k08lnFVHARQUFhWzkFNSivLKyqmAXldBV5XEsiqrqs+xRahAjQQRtXV0oJ7ZTeYUqcAEshoWcAhUgLScpwMNgdQW1NjkeKEZoKX1IrRdygNQWEV0QruVC80dyQZ5rY8CuRp5J1hzhYKKfKKLem9b9+XOnl5zX2OmSXoFM2FXIdr5Wll9v3fpdSOPd2Mg4Wb4YOIQzq1W4oRbw9A6gk64ndEWUTca76bNi05jXq9wDNs7d+FeJZXPtAeWcQYMyvBvmbgPfJwAxgcM3/eQAY+MJHgNWJsgYRK7HlMM/1hto4FoWiGa6bE/AfMsdudqSZrvmPCiwTy7kC9pDuVDQA9ueEFdSfNDfOpFsu2Woh4OuskiZD1dfMYCmzydkd7zJdDb4+RCwtCM75YDL15aE+rH5nkyrkaj0JtapOxYwlysfJW2jOIjUg6QVXX57VVSx9eGlRU5ISxddWwvWUOxNynIxK2jq4WqN4DMnCRi3ybNvhvRb+r01FmeS6hAP9YUGRmJJe7Wu0YF8mnN+DnYQbPcR/Xma55D1rYiYTTTiLfN8AJ4TzAta3VuyHbp7DuaYS22g1L3YUvWH8WfNACjRCqlGSdkEh1UETrRzmDMlzaowOZi9UV4dJoLXtLP64T9n9Hri55S6csNMSSU8P021F/Y5am7hjdUoOblWIZ53RWuvK/f1rX/zze3Zdxz5vuPn79W3QcXWNv0HyS7tfF6BtqkAAAAJXRFWHRkYXRlOmNyZWF0ZQAyMDE4LTAzLTE4VDAzOjUwOjIwKzAwOjAwGmFsmwAAACV0RVh0ZGF0ZTptb2RpZnkAMjAxOC0wMy0xOFQwMzo1MDoyMCswMDowMGs81CcAAABGdEVYdHNvZnR3YXJlAEltYWdlTWFnaWNrIDYuNy44LTkgMjAxNC0wNS0xMiBRMTYgaHR0cDovL3d3dy5pbWFnZW1hZ2ljay5vcmfchu0AAAAAGHRFWHRUaHVtYjo6RG9jdW1lbnQ6OlBhZ2VzADGn/7svAAAAGHRFWHRUaHVtYjo6SW1hZ2U6OmhlaWdodAAxOTIPAHKFAAAAF3RFWHRUaHVtYjo6SW1hZ2U6OldpZHRoADE5MtOsIQgAAAAZdEVYdFRodW1iOjpNaW1ldHlwZQBpbWFnZS9wbmc/slZOAAAAF3RFWHRUaHVtYjo6TVRpbWUAMTUyMTM0NTAyMKksCbEAAAAPdEVYdFRodW1iOjpTaXplADBCQpSiPuwAAABWdEVYdFRodW1iOjpVUkkAZmlsZTovLy9tbnRsb2cvZmF2aWNvbnMvMjAxOC0wMy0xOC8zYjM5OTBjZjQ5ZmM0ZDAxN2ZkOWUyMDdlZjVkZmI0My5pY28ucG5nfb1JtgAAAABJRU5ErkJggg==\n";
/*!
* escape-html
* Copyright(c) 2012-2013 TJ Holowaychuk
* Copyright(c) 2015 Andreas Lubbe
* Copyright(c) 2015 Tiancheng "Timothy" Gu
* MIT Licensed
*/
/**
* Module variables.
* @private
*/
var matchHtmlRegExp = /["'&<>]/;
/**
* Module exports.
* @public
*/
var index$1 = escapeHtml;
/**
* Escape special characters in the given string of html.
*
* @param {string} string The string to escape for inserting into HTML
* @return {string}
* @public
*/
function escapeHtml(string) {
var str = '' + string;
var match = matchHtmlRegExp.exec(str);
if (!match) {
return str;
}
var escape;
var html = '';
var index = 0;
var lastIndex = 0;
for (index = match.index; index < str.length; index++) {
switch (str.charCodeAt(index)) {
case 34: // "
escape = '&quot;';
break;
case 38: // &
escape = '&amp;';
break;
case 39: // '
escape = '&#39;';
break;
case 60: // <
escape = '&lt;';
break;
case 62: // >
escape = '&gt;';
break;
default:
continue;
}
if (lastIndex !== index) {
html += str.substring(lastIndex, index);
}
lastIndex = index + 1;
html += escape;
}
return lastIndex !== index
? html + str.substring(lastIndex, index)
: html;
}
var meta = function(dom, data) {
var head = dom.querySelector("head");
var appendHead = function (html) { return appendHtml(head, html); };
function meta(name, content, force) {
if (content || force)
{ appendHead((" <meta name=\"" + name + "\" content=\"" + (index$1(content)) + "\" >\n")); }
}
appendHead(("\n <meta http-equiv=\"X-UA-Compatible\" content=\"IE=Edge,chrome=1\">\n <link rel=\"icon\" type=\"image/png\" href=\"data:image/png;base64," + favicon + "\">\n <link href=\"/rss.xml\" rel=\"alternate\" type=\"application/rss+xml\" title=\"Articles from Distill\">\n <link rel=\"canonical\" href=\"" + (data.url) + "\">\n <title>" + (data.title) + "</title>\n "));
appendHead(("\n <!-- https://schema.org/Article -->\n <meta property=\"article:published\" itemprop=\"datePublished\" content=\"" + (data.publishedYear) + "-" + (data.publishedMonthPadded) + "-" + (data.publishedDayPadded) + "\" />\n <meta property=\"article:created\" itemprop=\"dateCreated\" content=\"" + (data.publishedDate) + "\" />\n <meta property=\"article:modified\" itemprop=\"dateModified\" content=\"" + (data.updatedDate) + "\" />\n "));
data.authors.forEach(function (a) {
appendHtml(head, ("\n <meta property=\"article:author\" content=\"" + (a.firstName) + " " + (a.lastName) + "\" />"));
});
/* do this on my own.
appendHead(("\n <!-- https://developers.facebook.com/docs/sharing/webmasters#markup -->\n <meta property=\"og:type\" content=\"article\"/>\n <meta property=\"og:title\" content=\"" + (data.title) + "\"/>\n <meta property=\"og:description\" content=\"" + (data.description) + "\">\n <meta property=\"og:url\" content=\"" + (data.url) + "\"/>\n <meta property=\"og:image\" content=\"" + (data.previewURL) + "\"/>\n <meta property=\"og:locale\" content=\"en_US\" />\n <meta property=\"og:site_name\" content=\"Distill\" />\n "));
appendHead(("\n <!-- https://dev.twitter.com/cards/types/summary -->\n <meta name=\"twitter:card\" content=\"summary_large_image\">\n <meta name=\"twitter:title\" content=\"" + (data.title) + "\">\n <meta name=\"twitter:description\" content=\"" + (data.description) + "\">\n <meta name=\"twitter:url\" content=\"" + (data.url) + "\">\n <meta name=\"twitter:image\" content=\"" + (data.previewURL) + "\">\n <meta name=\"twitter:image:width\" content=\"560\">\n <meta name=\"twitter:image:height\" content=\"295\">\n "));
*/
// if this is a proprer article, generate Google Scholar meta data
if (data.doiSuffix){
appendHead("\n <!-- https://scholar.google.com/intl/en/scholar/inclusion.html#indexing -->\n");
meta("citation_title", data.title);
//meta("citation_fulltext_html_url", data.url);
meta("citation_volume", data.volume);
meta("citation_issue", data.issue);
meta("citation_firstpage", data.doiSuffix? ("e" + (data.doiSuffix)) : undefined);
meta("citation_doi", data.doi);
var journal = data.journal || {};
meta("citation_journal_title", journal.full_title || journal.title);
meta("citation_journal_abbrev", journal.abbrev_title);
meta("citation_issn", journal.issn);
meta("citation_publisher", journal.publisher);
meta("citation_fulltext_world_readable", "", true);
if (data.publishedDate){
var zeroPad = function (n) { return n < 10 ? "0" + n : n; };
meta("citation_online_date", ((data.publishedYear) + "/" + (data.publishedMonthPadded) + "/" + (data.publishedDayPadded)));
// Should we do something different here?
meta("citation_publication_date", ((data.publishedYear) + "/" + (data.publishedMonthPadded) + "/" + (data.publishedDayPadded)));
}
(data.authors || []).forEach(function (a) {
meta("citation_author", ((a.lastName) + ", " + (a.firstName)));
meta("citation_author_institution", a.affiliation);
});
if (data.citations) {
data.citations.forEach(function (key) {
var d = data.bibliography[key];
if(!d) {
console.warn("No bibliography data fround for " + key);
} else {
meta("citation_reference", citation_meta_content(data.bibliography[key]) );
}
});
}
}
};
function appendHtml(el, html) {
el.innerHTML += html;
}
function citation_meta_content(ref){
// Special test for arxiv
var content = "citation_title=" + (ref.title) + ";";
var name_strings = ref.author.split(" and ").forEach(function (name) {
name = name.trim();
if (name.indexOf(",") != -1){
var last = name.split(",")[0].trim();
var firsts = name.split(",")[1].trim();
} else {
var last = name.split(" ").slice(-1)[0].trim();
var firsts = name.split(" ").slice(0,-1).join(" ");
}
content += "citation_author=" + firsts + " " + last + ";";
});
if ("year" in ref) {
content += "citation_publication_date=" + (ref.year) + ";";
}
var arxiv_id_search = /https?:\/\/arxiv\.org\/pdf\/([0-9]*\.[0-9]*)\.pdf/.exec(ref.url);
arxiv_id_search = arxiv_id_search || /https?:\/\/arxiv\.org\/abs\/([0-9]*\.[0-9]*)/.exec(ref.url);
arxiv_id_search = arxiv_id_search || /arXiv preprint arXiv:([0-9]*\.[0-9]*)/.exec(ref.journal);
if (arxiv_id_search && arxiv_id_search[1]){
content += "citation_arxiv_id=" + (arxiv_id_search[1]) + ";";
return content;
}
if ("journal" in ref){
content += "citation_journal_title=" + (ref.journal) + ";";
}
if ("volume" in ref) {
content += "citation_volume=" + (ref.volume) + ";";
}
if ("issue" in ref || "number" in ref){
content += "citation_number=" + (ref.issue || ref.number) + ";";
}
/*content += `citation_first_page=${};`;
content += `citation_publication_date=${};`;*/
return content;
}
var html$1 = "";
//var html$1 = "\n<style>\n dt-banner {\n background: #FFF59D;\n display: block;\n text-align: center;\n color: black;\n height: 70px;\n line-height: 70px;\n }\n</style>\n<div>This article is a draft. Please do not share the URL. Thanks!</div>\n";
var banner = function(dom, data) {
var banner = dom.createElement("dt-banner");
banner.innerHTML = html$1;
var b = dom.querySelector("body");
b.insertBefore(banner, b.firstChild);
banner.addEventListener("click", function() {
banner.style.display = "none";
});
};
var mustache = createCommonjsModule(function (module, exports) {
/*!
* mustache.js - Logic-less {{mustache}} templates with JavaScript
* http://github.com/janl/mustache.js
*/
/*global define: false Mustache: true*/
(function defineMustache (global, factory) {
if ('object' === 'object' && exports && typeof exports.nodeName !== 'string') {
factory(exports); // CommonJS
} else if (typeof undefined === 'function' && undefined.amd) {
undefined(['exports'], factory); // AMD
} else {
global.Mustache = {};
factory(global.Mustache); // script, wsh, asp
}
}(commonjsGlobal, function mustacheFactory (mustache) {
var objectToString = Object.prototype.toString;
var isArray = Array.isArray || function isArrayPolyfill (object) {
return objectToString.call(object) === '[object Array]';
};
function isFunction (object) {
return typeof object === 'function';
}
/**
* More correct typeof string handling array
* which normally returns typeof 'object'
*/
function typeStr (obj) {
return isArray(obj) ? 'array' : typeof obj;
}
function escapeRegExp (string) {
return string.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, '\\$&');
}
/**
* Null safe way of checking whether or not an object,
* including its prototype, has a given property
*/
function hasProperty (obj, propName) {
return obj != null && typeof obj === 'object' && (propName in obj);
}
// Workaround for https://issues.apache.org/jira/browse/COUCHDB-577
// See https://github.com/janl/mustache.js/issues/189
var regExpTest = RegExp.prototype.test;
function testRegExp (re, string) {
return regExpTest.call(re, string);
}
var nonSpaceRe = /\S/;
function isWhitespace (string) {
return !testRegExp(nonSpaceRe, string);
}
var entityMap = {
'&': '&amp;',
'<': '&lt;',
'>': '&gt;',
'"': '&quot;',
"'": '&#39;',
'/': '&#x2F;',
'`': '&#x60;',
'=': '&#x3D;'
};
function escapeHtml (string) {
return String(string).replace(/[&<>"'`=\/]/g, function fromEntityMap (s) {
return entityMap[s];
});
}
var whiteRe = /\s*/;
var spaceRe = /\s+/;
var equalsRe = /\s*=/;
var curlyRe = /\s*\}/;
var tagRe = /#|\^|\/|>|\{|&|=|!/;
/**
* Breaks up the given `template` string into a tree of tokens. If the `tags`
* argument is given here it must be an array with two string values: the
* opening and closing tags used in the template (e.g. [ "<%", "%>" ]). Of
* course, the default is to use mustaches (i.e. mustache.tags).
*
* A token is an array with at least 4 elements. The first element is the
* mustache symbol that was used inside the tag, e.g. "#" or "&". If the tag
* did not contain a symbol (i.e. {{myValue}}) this element is "name". For
* all text that appears outside a symbol this element is "text".
*
* The second element of a token is its "value". For mustache tags this is
* whatever else was inside the tag besides the opening symbol. For text tokens
* this is the text itself.
*
* The third and fourth elements of the token are the start and end indices,
* respectively, of the token in the original template.
*
* Tokens that are the root node of a subtree contain two more elements: 1) an
* array of tokens in the subtree and 2) the index in the original template at
* which the closing tag for that section begins.
*/
function parseTemplate (template, tags) {
if (!template)
{ return []; }
var sections = []; // Stack to hold section tokens
var tokens = []; // Buffer to hold the tokens
var spaces = []; // Indices of whitespace tokens on the current line
var hasTag = false; // Is there a {{tag}} on the current line?
var nonSpace = false; // Is there a non-space char on the current line?
// Strips all whitespace tokens array for the current line
// if there was a {{#tag}} on it and otherwise only space.
function stripSpace () {
if (hasTag && !nonSpace) {
while (spaces.length)
{ delete tokens[spaces.pop()]; }
} else {
spaces = [];
}
hasTag = false;
nonSpace = false;
}
var openingTagRe, closingTagRe, closingCurlyRe;
function compileTags (tagsToCompile) {
if (typeof tagsToCompile === 'string')
{ tagsToCompile = tagsToCompile.split(spaceRe, 2); }
if (!isArray(tagsToCompile) || tagsToCompile.length !== 2)
{ throw new Error('Invalid tags: ' + tagsToCompile); }
openingTagRe = new RegExp(escapeRegExp(tagsToCompile[0]) + '\\s*');
closingTagRe = new RegExp('\\s*' + escapeRegExp(tagsToCompile[1]));
closingCurlyRe = new RegExp('\\s*' + escapeRegExp('}' + tagsToCompile[1]));
}
compileTags(tags || mustache.tags);
var scanner = new Scanner(template);
var start, type, value, chr, token, openSection;
while (!scanner.eos()) {
start = scanner.pos;
// Match any text between tags.
value = scanner.scanUntil(openingTagRe);
if (value) {
for (var i = 0, valueLength = value.length; i < valueLength; ++i) {
chr = value.charAt(i);
if (isWhitespace(chr)) {
spaces.push(tokens.length);
} else {
nonSpace = true;
}
tokens.push([ 'text', chr, start, start + 1 ]);
start += 1;
// Check for whitespace on the current line.
if (chr === '\n')
{ stripSpace(); }
}
}
// Match the opening tag.
if (!scanner.scan(openingTagRe))
{ break; }
hasTag = true;
// Get the tag type.
type = scanner.scan(tagRe) || 'name';
scanner.scan(whiteRe);
// Get the tag value.
if (type === '=') {
value = scanner.scanUntil(equalsRe);
scanner.scan(equalsRe);
scanner.scanUntil(closingTagRe);
} else if (type === '{') {
value = scanner.scanUntil(closingCurlyRe);
scanner.scan(curlyRe);
scanner.scanUntil(closingTagRe);
type = '&';
} else {
value = scanner.scanUntil(closingTagRe);
}
// Match the closing tag.
if (!scanner.scan(closingTagRe))
{ throw new Error('Unclosed tag at ' + scanner.pos); }
token = [ type, value, start, scanner.pos ];
tokens.push(token);
if (type === '#' || type === '^') {
sections.push(token);
} else if (type === '/') {
// Check section nesting.
openSection = sections.pop();
if (!openSection)
{ throw new Error('Unopened section "' + value + '" at ' + start); }
if (openSection[1] !== value)
{ throw new Error('Unclosed section "' + openSection[1] + '" at ' + start); }
} else if (type === 'name' || type === '{' || type === '&') {
nonSpace = true;
} else if (type === '=') {
// Set the tags for the next time around.
compileTags(value);
}
}
// Make sure there are no open sections when we're done.
openSection = sections.pop();
if (openSection)
{ throw new Error('Unclosed section "' + openSection[1] + '" at ' + scanner.pos); }
return nestTokens(squashTokens(tokens));
}
/**
* Combines the values of consecutive text tokens in the given `tokens` array
* to a single token.
*/
function squashTokens (tokens) {
var squashedTokens = [];
var token, lastToken;
for (var i = 0, numTokens = tokens.length; i < numTokens; ++i) {
token = tokens[i];
if (token) {
if (token[0] === 'text' && lastToken && lastToken[0] === 'text') {
lastToken[1] += token[1];
lastToken[3] = token[3];
} else {
squashedTokens.push(token);
lastToken = token;
}
}
}
return squashedTokens;
}
/**
* Forms the given array of `tokens` into a nested tree structure where
* tokens that represent a section have two additional items: 1) an array of
* all tokens that appear in that section and 2) the index in the original
* template that represents the end of that section.
*/
function nestTokens (tokens) {
var nestedTokens = [];
var collector = nestedTokens;
var sections = [];
var token, section;
for (var i = 0, numTokens = tokens.length; i < numTokens; ++i) {
token = tokens[i];
switch (token[0]) {
case '#':
case '^':
collector.push(token);
sections.push(token);
collector = token[4] = [];
break;
case '/':
section = sections.pop();
section[5] = token[2];
collector = sections.length > 0 ? sections[sections.length - 1][4] : nestedTokens;
break;
default:
collector.push(token);
}
}
return nestedTokens;
}
/**
* A simple string scanner that is used by the template parser to find
* tokens in template strings.
*/
function Scanner (string) {
this.string = string;
this.tail = string;
this.pos = 0;
}
/**
* Returns `true` if the tail is empty (end of string).
*/
Scanner.prototype.eos = function eos () {
return this.tail === '';
};
/**
* Tries to match the given regular expression at the current position.
* Returns the matched text if it can match, the empty string otherwise.
*/
Scanner.prototype.scan = function scan (re) {
var match = this.tail.match(re);
if (!match || match.index !== 0)
{ return ''; }
var string = match[0];
this.tail = this.tail.substring(string.length);
this.pos += string.length;
return string;
};
/**
* Skips all text until the given regular expression can be matched. Returns
* the skipped string, which is the entire tail if no match can be made.
*/
Scanner.prototype.scanUntil = function scanUntil (re) {
var index = this.tail.search(re), match;
switch (index) {
case -1:
match = this.tail;
this.tail = '';
break;
case 0:
match = '';
break;
default:
match = this.tail.substring(0, index);
this.tail = this.tail.substring(index);
}
this.pos += match.length;
return match;
};
/**
* Represents a rendering context by wrapping a view object and
* maintaining a reference to the parent context.
*/
function Context (view, parentContext) {
this.view = view;
this.cache = { '.': this.view };
this.parent = parentContext;
}
/**
* Creates a new context using the given view with this context
* as the parent.
*/
Context.prototype.push = function push (view) {
return new Context(view, this);
};
/**
* Returns the value of the given name in this context, traversing
* up the context hierarchy if the value is absent in this context's view.
*/
Context.prototype.lookup = function lookup (name) {
var cache = this.cache;
var value;
if (cache.hasOwnProperty(name)) {
value = cache[name];
} else {
var context = this, names, index, lookupHit = false;
while (context) {
if (name.indexOf('.') > 0) {
value = context.view;
names = name.split('.');
index = 0;
/**
* Using the dot notion path in `name`, we descend through the
* nested objects.
*
* To be certain that the lookup has been successful, we have to
* check if the last object in the path actually has the property
* we are looking for. We store the result in `lookupHit`.
*
* This is specially necessary for when the value has been set to
* `undefined` and we want to avoid looking up parent contexts.
**/
while (value != null && index < names.length) {
if (index === names.length - 1)
{ lookupHit = hasProperty(value, names[index]); }
value = value[names[index++]];
}
} else {
value = context.view[name];
lookupHit = hasProperty(context.view, name);
}
if (lookupHit)
{ break; }
context = context.parent;
}
cache[name] = value;
}
if (isFunction(value))
{ value = value.call(this.view); }
return value;
};
/**
* A Writer knows how to take a stream of tokens and render them to a
* string, given a context. It also maintains a cache of templates to
* avoid the need to parse the same template twice.
*/
function Writer () {
this.cache = {};
}
/**
* Clears all cached templates in this writer.
*/
Writer.prototype.clearCache = function clearCache () {
this.cache = {};
};
/**
* Parses and caches the given `template` and returns the array of tokens
* that is generated from the parse.
*/
Writer.prototype.parse = function parse (template, tags) {
var cache = this.cache;
var tokens = cache[template];
if (tokens == null)
{ tokens = cache[template] = parseTemplate(template, tags); }
return tokens;
};
/**
* High-level method that is used to render the given `template` with
* the given `view`.
*
* The optional `partials` argument may be an object that contains the
* names and templates of partials that are used in the template. It may
* also be a function that is used to load partial templates on the fly
* that takes a single argument: the name of the partial.
*/
Writer.prototype.render = function render (template, view, partials) {
var tokens = this.parse(template);
var context = (view instanceof Context) ? view : new Context(view);
return this.renderTokens(tokens, context, partials, template);
};
/**
* Low-level method that renders the given array of `tokens` using
* the given `context` and `partials`.
*
* Note: The `originalTemplate` is only ever used to extract the portion
* of the original template that was contained in a higher-order section.
* If the template doesn't use higher-order sections, this argument may
* be omitted.
*/
Writer.prototype.renderTokens = function renderTokens (tokens, context, partials, originalTemplate) {
var this$1 = this;
var buffer = '';
var token, symbol, value;
for (var i = 0, numTokens = tokens.length; i < numTokens; ++i) {
value = undefined;
token = tokens[i];
symbol = token[0];
if (symbol === '#') { value = this$1.renderSection(token, context, partials, originalTemplate); }
else if (symbol === '^') { value = this$1.renderInverted(token, context, partials, originalTemplate); }
else if (symbol === '>') { value = this$1.renderPartial(token, context, partials, originalTemplate); }
else if (symbol === '&') { value = this$1.unescapedValue(token, context); }
else if (symbol === 'name') { value = this$1.escapedValue(token, context); }
else if (symbol === 'text') { value = this$1.rawValue(token); }
if (value !== undefined)
{ buffer += value; }
}
return buffer;
};
Writer.prototype.renderSection = function renderSection (token, context, partials, originalTemplate) {
var this$1 = this;
var self = this;
var buffer = '';
var value = context.lookup(token[1]);
// This function is used to render an arbitrary template
// in the current context by higher-order sections.
function subRender (template) {
return self.render(template, context, partials);
}
if (!value) { return; }
if (isArray(value)) {
for (var j = 0, valueLength = value.length; j < valueLength; ++j) {
buffer += this$1.renderTokens(token[4], context.push(value[j]), partials, originalTemplate);
}
} else if (typeof value === 'object' || typeof value === 'string' || typeof value === 'number') {
buffer += this.renderTokens(token[4], context.push(value), partials, originalTemplate);
} else if (isFunction(value)) {
if (typeof originalTemplate !== 'string')
{ throw new Error('Cannot use higher-order sections without the original template'); }
// Extract the portion of the original template that the section contains.
value = value.call(context.view, originalTemplate.slice(token[3], token[5]), subRender);
if (value != null)
{ buffer += value; }
} else {
buffer += this.renderTokens(token[4], context, partials, originalTemplate);
}
return buffer;
};
Writer.prototype.renderInverted = function renderInverted (token, context, partials, originalTemplate) {
var value = context.lookup(token[1]);
// Use JavaScript's definition of falsy. Include empty arrays.
// See https://github.com/janl/mustache.js/issues/186
if (!value || (isArray(value) && value.length === 0))
{ return this.renderTokens(token[4], context, partials, originalTemplate); }
};
Writer.prototype.renderPartial = function renderPartial (token, context, partials) {
if (!partials) { return; }
var value = isFunction(partials) ? partials(token[1]) : partials[token[1]];
if (value != null)
{ return this.renderTokens(this.parse(value), context, partials, value); }
};
Writer.prototype.unescapedValue = function unescapedValue (token, context) {
var value = context.lookup(token[1]);
if (value != null)
{ return value; }
};
Writer.prototype.escapedValue = function escapedValue (token, context) {
var value = context.lookup(token[1]);
if (value != null)
{ return mustache.escape(value); }
};
Writer.prototype.rawValue = function rawValue (token) {
return token[1];
};
mustache.name = 'mustache.js';
mustache.version = '2.3.0';
mustache.tags = [ '{{', '}}' ];
// All high-level mustache.* functions use this writer.
var defaultWriter = new Writer();
/**
* Clears all cached templates in the default writer.
*/
mustache.clearCache = function clearCache () {
return defaultWriter.clearCache();
};
/**
* Parses and caches the given template in the default writer and returns the
* array of tokens it contains. Doing this ahead of time avoids the need to
* parse templates on the fly as they are rendered.
*/
mustache.parse = function parse (template, tags) {
return defaultWriter.parse(template, tags);
};
/**
* Renders the `template` with the given `view` and `partials` using the
* default writer.
*/
mustache.render = function render (template, view, partials) {
if (typeof template !== 'string') {
throw new TypeError('Invalid template! Template should be a "string" ' +
'but "' + typeStr(template) + '" was given as the first ' +
'argument for mustache#render(template, view, partials)');
}
return defaultWriter.render(template, view, partials);
};
// This is here for backwards compatibility with 0.4.x.,
/*eslint-disable */ // eslint wants camel cased function name
mustache.to_html = function to_html (template, view, partials, send) {
/*eslint-enable*/
var result = mustache.render(template, view, partials);
if (isFunction(send)) {
send(result);
} else {
return result;
}
};
// Export the escaping function so that the user may override it.
// See https://github.com/janl/mustache.js/issues/244
mustache.escape = escapeHtml;
// Export these mainly for testing, but also for advanced usage.
mustache.Scanner = Scanner;
mustache.Context = Context;
mustache.Writer = Writer;
return mustache;
}));
});
var html$2 = "\n<style>\n dt-byline {\n font-size: 12px;\n line-height: 18px;\n display: block;\n border-top: 1px solid rgba(0, 0, 0, 0.1);\n border-bottom: 1px solid rgba(0, 0, 0, 0.1);\n color: rgba(0, 0, 0, 0.5);\n padding-top: 12px;\n padding-bottom: 12px;\n }\n dt-article.centered dt-byline {\n text-align: center;\n\n }\n dt-byline a,\n dt-article dt-byline a {\n text-decoration: none;\n border-bottom: none;\n }\n dt-article dt-byline a:hover {\n text-decoration: underline;\n border-bottom: none;\n }\n dt-byline .authors {\n text-align: left;\n }\n dt-byline .name {\n display: inline;\n text-transform: uppercase;\n }\n dt-byline .affiliation {\n display: inline;\n }\n dt-byline .date {\n display: block;\n text-align: left;\n }\n dt-byline .year, dt-byline .month {\n display: inline;\n }\n dt-byline .citation {\n display: block;\n text-align: left;\n }\n dt-byline .citation div {\n display: inline;\n }\n\n @media(min-width: 768px) {\n dt-byline {\n }\n }\n\n @media(min-width: 1080px) {\n dt-byline {\n border-bottom: none;\n margin-bottom: 70px;\n }\n\n dt-byline a:hover {\n color: rgba(0, 0, 0, 0.9);\n }\n\n dt-byline .authors {\n display: inline-block;\n }\n\n dt-byline .author {\n display: inline-block;\n margin-right: 12px;\n /*padding-left: 20px;*/\n /*border-left: 1px solid #ddd;*/\n }\n\n dt-byline .affiliation {\n display: block;\n }\n\n dt-byline .author:last-child {\n margin-right: 0;\n }\n\n dt-byline .name {\n display: block;\n }\n\n dt-byline .date {\n border-left: 1px solid rgba(0, 0, 0, 0.1);\n padding-left: 15px;\n margin-left: 15px;\n display: inline-block;\n }\n dt-byline .year, dt-byline .month {\n display: block;\n }\n\n dt-byline .citation {\n border-left: 1px solid rgba(0, 0, 0, 0.15);\n padding-left: 15px;\n margin-left: 15px;\n display: inline-block;\n }\n dt-byline .citation div {\n display: block;\n }\n }\n</style>\n\n";
var template = "\n<div class=\"byline\">\n <div class=\"authors\">\n {{#authors}}\n <div class=\"author\">\n {{#personalURL}}\n <a class=\"name\" href=\"{{personalURL}}\">{{name}}</a>\n {{/personalURL}}\n {{^personalURL}}\n <div class=\"name\">{{name}}</div>\n {{/personalURL}}\n {{#affiliation}}\n {{#affiliationURL}}\n <a class=\"affiliation\" href=\"{{affiliationURL}}\">{{affiliation}}</a>\n {{/affiliationURL}}\n {{^affiliationURL}}\n <div class=\"affiliation\">{{affiliation}}</div>\n {{/affiliationURL}}\n {{/affiliation}}\n </div>\n {{/authors}}\n </div>\n {{#publishedYear}}\n <div class=\"date\">\n <div class=\"month\">{{publishedMonth}}. {{publishedDay}}</div>\n <div class=\"year\">{{publishedYear}}</div>\n </div>\n {{/publishedYear}}\n {{#publishedYear}}\n <a class=\"citation\" href=\"#citation\">\n <div>Citation:</div>\n <div>{{concatenatedAuthors}}, {{publishedYear}}</div>\n </a>\n {{/publishedYear}}\n</div>\n";
var byline = function(dom, data) {
var el = dom.querySelector('dt-byline');
if (el) {
el.innerHTML = html$2 + mustache.render(template, data);
}
};
var templateHTML = "\n<style>\n dt-appendix {\n display: block;\n font-size: 14px;\n line-height: 24px;\n margin-bottom: 0;\n border-top: 1px solid rgba(0,0,0,0.1);\n color: rgba(0,0,0,0.5);\n background: rgb(250, 250, 250);\n padding-top: 36px;\n padding-bottom: 60px;\n }\n dt-appendix h3 {\n font-size: 16px;\n font-weight: 500;\n margin-top: 18px;\n margin-bottom: 18px;\n color: rgba(0,0,0,0.65);\n }\n dt-appendix .citation {\n font-size: 11px;\n line-height: 15px;\n border-left: 1px solid rgba(0, 0, 0, 0.1);\n padding-left: 18px;\n border: 1px solid rgba(0,0,0,0.1);\n background: rgba(0, 0, 0, 0.02);\n padding: 10px 18px;\n border-radius: 3px;\n color: rgba(150, 150, 150, 1);\n overflow: hidden;\n margin-top: -12px;\n }\n dt-appendix .references {\n font-size: 12px;\n line-height: 20px;\n }\n dt-appendix a {\n color: rgba(0, 0, 0, 0.6);\n }\n dt-appendix ol,\n dt-appendix ul {\n padding-left: 24px;\n }\n</style>\n\n<div class=\"l-body\">\n</div>\n";
var appendix = function(dom, data) {
var el = dom.querySelector('dt-appendix');
if (el) {
var userHTML = el.innerHTML;
el.innerHTML = templateHTML;
var newHTML = "";
// If we have some footnotes on the page, render a container for the footnote list.
if (dom.querySelector("dt-fn")) {
newHTML = newHTML + "<h3>Footnotes</h3><dt-fn-list></dt-fn-list>";
}
// If we have any citations on the page, render a container for the bibliography.
if (dom.querySelector("dt-cite")) {
newHTML = newHTML + "<h3>References</h3><dt-bibliography></dt-bibliography>";
}
var div = el.querySelector("div.l-body");
div.innerHTML = userHTML + newHTML;
}
};
var appendixDistill = function(dom, data) {
var el = dom.querySelector('dt-appendix > div');
if (el) {
var newHTML = "";
newHTML += "<h3>Updates and Corrections</h3>\n <p><a href=\"" + (data.githubCompareUpdatesUrl) + "\">View all changes</a> to this article since it was first published. If you see a mistake or want to suggest a change, please <a class=\"github-issue\" href=\"" + (data.githubUrl) + "/issues/new\">create an issue on GitHub</a>.</p>";
newHTML += "<h3 id=\"citation\">Citations and Reuse</h3>\n <p>Diagrams and text are licensed under Creative Commons Attribution <a href=\"https://creativecommons.org/licenses/by/2.0/\">CC-BY 2.0</a>, unless noted otherwise, with the <a class=\"github\" href=\"" + (data.githubUrl) + "\">source available on GitHub</a>. The figures that have been reused from other sources don't fall under this license and can be recognized by a note in their caption: “Figure from …”.</p>\n\n <p>For attribution in academic contexts, please cite this work as</p>\n <pre class=\"citation short\">" + (data.concatenatedAuthors) + ", \"" + (data.title) + "\", " + (data.journal.title) + ", " + (data.publishedYear) + ". http://doi.org/" + (data.doi) + "</pre>\n\n <p>BibTeX citation</p>\n<pre class=\"citation long\">@article{" + (data.slug) + ",\n author = {" + (data.bibtexAuthors) + "},\n title = {" + (data.title) + "},\n journal = {" + (data.journal.title) + "},\n year = {" + (data.publishedYear) + "},\n url = {" + (data.url) + "},\n doi = {" + (data.doi) + "}\n}</pre>";
var existingHTML = el.innerHTML;
el.innerHTML = existingHTML + newHTML;
}
};
var citation = function(dom, data) {
var css = "\n dt-cite {\n color: hsla(206, 90%, 20%, 0.7);\n }\n dt-cite .citation-number {\n cursor: default;\n white-space: nowrap;\n font-family: -apple-system, BlinkMacSystemFont, \"Roboto\", Helvetica, sans-serif;\n font-size: 75%;\n color: hsla(206, 90%, 20%, 0.7);\n display: inline-block;\n line-height: 1.1em;\n text-align: center;\n position: relative;\n top: -2px;\n margin: 0 2px;\n }\n figcaption dt-cite .citation-number {\n font-size: 11px;\n font-weight: normal;\n top: -2px;\n line-height: 1em;\n }\n ";
var style = dom.createElement("style");
style.textContent = css;
dom.querySelector("body").appendChild(style);
var citations = data.citations;
/*if (data.citations) {
citations = Object.keys(data.citations).map(c => data.citations[c]);
citations.sort((a, b) => {
return a.author.localeCompare(b.author);
});
}*/
var appendCiteHoverDiv = (function() {
function nodeFromString(str) {
var div = dom.createElement("div");
div.innerHTML = str;
return div.firstChild;
}
var hover_boxes_container = nodeFromString("<div id=\"cite-hover-boxes-container\"></div>");
dom.querySelector("body").appendChild(hover_boxes_container);
var hover_n = 0;
return function appendHoverDiv(content) {
var id = "dt-cite-hover-box-" + hover_n;
hover_n += 1;
var str = "<div style=\"display:none;\" class=\"dt-hover-box\" id=\"" + id + "\" >" + content + "</div>";
var div = nodeFromString(str);
hover_boxes_container.appendChild(div);
return id;
}
})();
var citeTags = [].slice.apply(dom.querySelectorAll("dt-cite"));
citeTags.forEach(function (el,n) {
var key = el.getAttribute("key");
if (key) {
var keys = key.split(",");
var cite_string = inline_cite_short(keys);
var cite_hover_str = "";
keys.map(function (key,n) {
if (n>0) { cite_hover_str += "<br><br>"; }
cite_hover_str += hover_cite(data.bibliography[key]);
});
var ref_id = appendCiteHoverDiv(cite_hover_str);
//cite_hover_str = cite_hover_str.replace(/"/g, "&#39;")
var orig_string = el.innerHTML;
if (orig_string != "") { orig_string += " "; }
el.innerHTML = "<span id=\"citation-" + n + "\" data-hover-ref=\"" + ref_id + "\">" + orig_string + "<span class=\"citation-number\">" + cite_string + "</span></span>";
}
});
var bibEl = dom.querySelector("dt-bibliography");
if (bibEl) {
var ol = dom.createElement("ol");
citations.forEach(function (key) {
var el = dom.createElement("li");
el.innerHTML = bibliography_cite(data.bibliography[key]);
ol.appendChild(el);
});
bibEl.appendChild(ol);
}
function inline_cite_short(keys){
function cite_string(key){
if (key in data.bibliography){
var n = data.citations.indexOf(key)+1;
return ""+n;
} else {
return "?";
}
}
return "["+keys.map(cite_string).join(", ")+"]";
}
function inline_cite_long(keys){
function cite_string(key){
if (key in data.bibliography){
var ent = data.bibliography[key];
var names = ent.author.split(" and ");
names = names.map(function (name) { return name.split(",")[0].trim(); });
var year = ent.year;
if (names.length == 1) { return names[0] + ", " + year; }
if (names.length == 2) { return names[0] + " & " + names[1] + ", " + year; }
if (names.length > 2) { return names[0] + ", et al., " + year; }
} else {
return "?";
}
}
return keys.map(cite_string).join(", ");
}
function author_string(ent, template, sep, finalSep){
var names = ent.author.split(" and ");
var name_strings = names.map(function (name) {
name = name.trim();
if (name.indexOf(",") != -1){
var last = name.split(",")[0].trim();
var firsts = name.split(",")[1];
} else {
var last = name.split(" ").slice(-1)[0].trim();
var firsts = name.split(" ").slice(0,-1).join(" ");
}
var initials = "";
if (firsts != undefined) {
initials = firsts.trim().split(" ").map(function (s) { return s.trim()[0]; });
initials = initials.join(".")+".";
}
return template.replace("${F}", firsts)
.replace("${L}", last)
.replace("${I}", initials);
});
if (names.length > 1) {
var str = name_strings.slice(0, names.length-1).join(sep);
str += (finalSep || sep) + name_strings[names.length-1];
return str;
} else {
return name_strings[0];
}
}
function venue_string(ent) {
var cite = (ent.journal || ent.booktitle || "");
if ("volume" in ent){
var issue = ent.issue || ent.number;
issue = (issue != undefined)? "("+issue+")" : "";
cite += ", Vol " + ent.volume + issue;
}
if ("pages" in ent){
cite += ", pp. " + ent.pages;
}
if (cite != "") { cite += ". "; }
if ("publisher" in ent){
cite += ent.publisher;
if (cite[cite.length-1] != ".") { cite += "."; }
}
return cite;
}
function link_string(ent){
if ("url" in ent){
var url = ent.url;
var arxiv_match = (/arxiv\.org\/abs\/([0-9\.]*)/).exec(url);
if (arxiv_match != null){
url = "http://arxiv.org/pdf/" + (arxiv_match[1]) + ".pdf";
}
if (url.slice(-4) == ".pdf"){
var label = "PDF";
} else if (url.slice(-5) == ".html") {
var label = "HTML";
}
return (" &ensp;<a href=\"" + url + "\">[" + (label||"link") + "]</a>");
}/* else if ("doi" in ent){
return ` &ensp;<a href="https://doi.org/${ent.doi}" >[DOI]</a>`;
}*/ else {
return "";
}
}
function doi_string(ent, new_line){
if ("doi" in ent) {
return ((new_line?"<br>":"") + " <a href=\"https://doi.org/" + (ent.doi) + "\" style=\"text-decoration:inherit;\">DOI: " + (ent.doi) + "</a>");
} else {
return "";
}
}
function bibliography_cite(ent, fancy){
if (ent){
var cite = "<b>" + ent.title + "</b> ";
cite += link_string(ent) + "<br>";
cite += author_string(ent, "${L}, ${I}", ", ", " and ");
if (ent.year || ent.date){
cite += ", " + (ent.year || ent.date) + ". ";
} else {
cite += ". ";
}
cite += venue_string(ent);
cite += doi_string(ent);
return cite
/*var cite = author_string(ent, "${L}, ${I}", ", ", " and ");
if (ent.year || ent.date){
cite += ", " + (ent.year || ent.date) + ". "
} else {
cite += ". "
}
cite += "<b>" + ent.title + "</b>. ";
cite += venue_string(ent);
cite += doi_string(ent);
cite += link_string(ent);
return cite*/
} else {
return "?";
}
}
function hover_cite(ent){
if (ent){
var cite = "";
cite += "<b>" + ent.title + "</b>";
cite += link_string(ent);
cite += "<br>";
var a_str = author_string(ent, "${I} ${L}", ", ") + ".";
var v_str = venue_string(ent).trim() + " " + ent.year + ". " + doi_string(ent, true);
if ((a_str+v_str).length < Math.min(40, ent.title.length)) {
cite += a_str + " " + v_str;
} else {
cite += a_str + "<br>" + v_str;
}
return cite;
} else {
return "?";
}
}
//https://scholar.google.com/scholar?q=allintitle%3ADocument+author%3Aolah
function get_GS_URL(ent){
if (ent){
var names = ent.author.split(" and ");
names = names.map(function (name) { return name.split(",")[0].trim(); });
var title = ent.title.split(" ");//.replace(/[,:]/, "")
var url = "http://search.labs.crossref.org/dois?";//""https://scholar.google.com/scholar?"
url += uris({q: names.join(" ") + " " + title.join(" ")});
}
}
};
var footnote = function(dom, data) {
var appendFootnoteHoverDiv = (function() {
function nodeFromString(str) {
var div = dom.createElement("div");
div.innerHTML = str;
return div.firstChild;
}
var hover_boxes_container = nodeFromString("<div id=\"footnote-hover-boxes-container\"></div>");
dom.querySelector("body").appendChild(hover_boxes_container);
var hover_n = 0;
return function appendHoverDiv(content) {
var id = "dt-fn-hover-box-" + hover_n;
hover_n += 1;
var str = "<div style=\"display:none;\" class=\"dt-hover-box\" id=\"" + id + "\" >" + content + "</div>";
var div = nodeFromString(str);
hover_boxes_container.appendChild(div);
return id;
}
})();
var fnTags = [].slice.apply(dom.querySelectorAll("dt-fn"));
var fnContent = [];
fnTags.forEach(function (el,n) {
var content = el.innerHTML;
var ref_id = appendFootnoteHoverDiv(content);
fnContent.push(content);
n = (n+1)+"";
var key = "fn-"+n;
var escaped_content = content.replace(/"/g, "&#39;");
el.innerHTML = "<sup><span id=\"" + key + "\" data-hover-ref=\"" + ref_id + "\" style=\"cursor:pointer\">" + n + "</span></sup>";
});
var fnList = dom.querySelector("dt-fn-list");
if (fnList) {
var ol = dom.createElement("ol");
fnContent.forEach(function (content) {
var el = dom.createElement("li");
el.innerHTML = content;
ol.appendChild(el);
});
fnList.appendChild(ol);
}
};
/**
* This is the ParseError class, which is the main error thrown by KaTeX
* functions when something has gone wrong. This is used to distinguish internal
* errors from errors in the expression that the user provided.
*
* If possible, a caller should provide a Token or ParseNode with information
* about where in the source string the problem occurred.
*
* @param {string} message The error message
* @param {(Token|ParseNode)=} token An object providing position information
*/
function ParseError$1(message, token) {
var error = "KaTeX parse error: " + message;
var start;
var end;
if (token && token.lexer && token.start <= token.end) {
// If we have the input and a position, make the error a bit fancier
// Get the input
var input = token.lexer.input;
// Prepend some information
start = token.start;
end = token.end;
if (start === input.length) {
error += " at end of input: ";
} else {
error += " at position " + (start + 1) + ": ";
}
// Underline token in question using combining underscores
var underlined = input.slice(start, end).replace(/[^]/g, "$&\u0332");
// Extract some context from the input and add it to the error
var left;
if (start > 15) {
left = "…" + input.slice(start - 15, start);
} else {
left = input.slice(0, start);
}
var right;
if (end + 15 < input.length) {
right = input.slice(end, end + 15) + "…";
} else {
right = input.slice(end);
}
error += left + underlined + right;
}
// Some hackery to make ParseError a prototype of Error
// See http://stackoverflow.com/a/8460753
var self = new Error(error);
self.name = "ParseError";
self.__proto__ = ParseError$1.prototype;
self.position = start;
return self;
}
// More hackery
ParseError$1.prototype.__proto__ = Error.prototype;
var ParseError_1 = ParseError$1;
/**
* This is a module for storing settings passed into KaTeX. It correctly handles
* default settings.
*/
/**
* Helper function for getting a default value if the value is undefined
*/
function get(option, defaultValue) {
return option === undefined ? defaultValue : option;
}
/**
* The main Settings object
*
* The current options stored are:
* - displayMode: Whether the expression should be typeset by default in
* textstyle or displaystyle (default false)
*/
function Settings$1(options) {
// allow null options
options = options || {};
this.displayMode = get(options.displayMode, false);
this.throwOnError = get(options.throwOnError, true);
this.errorColor = get(options.errorColor, "#cc0000");
this.macros = options.macros || {};
}
var Settings_1 = Settings$1;
var hangulRegex = /[\uAC00-\uD7AF]/;
// This regex combines
// - Hiragana: [\u3040-\u309F]
// - Katakana: [\u30A0-\u30FF]
// - CJK ideograms: [\u4E00-\u9FAF]
// - Hangul syllables: [\uAC00-\uD7AF]
// Notably missing are halfwidth Katakana and Romanji glyphs.
var cjkRegex$1 =
/[\u3040-\u309F]|[\u30A0-\u30FF]|[\u4E00-\u9FAF]|[\uAC00-\uD7AF]/;
var unicodeRegexes = {
cjkRegex: cjkRegex$1,
hangulRegex: hangulRegex
};
var fontMetricsData = {
"AMS-Regular": {
"65": [0, 0.68889, 0, 0],
"66": [0, 0.68889, 0, 0],
"67": [0, 0.68889, 0, 0],
"68": [0, 0.68889, 0, 0],
"69": [0, 0.68889, 0, 0],
"70": [0, 0.68889, 0, 0],
"71": [0, 0.68889, 0, 0],
"72": [0, 0.68889, 0, 0],
"73": [0, 0.68889, 0, 0],
"74": [0.16667, 0.68889, 0, 0],
"75": [0, 0.68889, 0, 0],
"76": [0, 0.68889, 0, 0],
"77": [0, 0.68889, 0, 0],
"78": [0, 0.68889, 0, 0],
"79": [0.16667, 0.68889, 0, 0],
"80": [0, 0.68889, 0, 0],
"81": [0.16667, 0.68889, 0, 0],
"82": [0, 0.68889, 0, 0],
"83": [0, 0.68889, 0, 0],
"84": [0, 0.68889, 0, 0],
"85": [0, 0.68889, 0, 0],
"86": [0, 0.68889, 0, 0],
"87": [0, 0.68889, 0, 0],
"88": [0, 0.68889, 0, 0],
"89": [0, 0.68889, 0, 0],
"90": [0, 0.68889, 0, 0],
"107": [0, 0.68889, 0, 0],
"165": [0, 0.675, 0.025, 0],
"174": [0.15559, 0.69224, 0, 0],
"240": [0, 0.68889, 0, 0],
"295": [0, 0.68889, 0, 0],
"710": [0, 0.825, 0, 0],
"732": [0, 0.9, 0, 0],
"770": [0, 0.825, 0, 0],
"771": [0, 0.9, 0, 0],
"989": [0.08167, 0.58167, 0, 0],
"1008": [0, 0.43056, 0.04028, 0],
"8245": [0, 0.54986, 0, 0],
"8463": [0, 0.68889, 0, 0],
"8487": [0, 0.68889, 0, 0],
"8498": [0, 0.68889, 0, 0],
"8502": [0, 0.68889, 0, 0],
"8503": [0, 0.68889, 0, 0],
"8504": [0, 0.68889, 0, 0],
"8513": [0, 0.68889, 0, 0],
"8592": [-0.03598, 0.46402, 0, 0],
"8594": [-0.03598, 0.46402, 0, 0],
"8602": [-0.13313, 0.36687, 0, 0],
"8603": [-0.13313, 0.36687, 0, 0],
"8606": [0.01354, 0.52239, 0, 0],
"8608": [0.01354, 0.52239, 0, 0],
"8610": [0.01354, 0.52239, 0, 0],
"8611": [0.01354, 0.52239, 0, 0],
"8619": [0, 0.54986, 0, 0],
"8620": [0, 0.54986, 0, 0],
"8621": [-0.13313, 0.37788, 0, 0],
"8622": [-0.13313, 0.36687, 0, 0],
"8624": [0, 0.69224, 0, 0],
"8625": [0, 0.69224, 0, 0],
"8630": [0, 0.43056, 0, 0],
"8631": [0, 0.43056, 0, 0],
"8634": [0.08198, 0.58198, 0, 0],
"8635": [0.08198, 0.58198, 0, 0],
"8638": [0.19444, 0.69224, 0, 0],
"8639": [0.19444, 0.69224, 0, 0],
"8642": [0.19444, 0.69224, 0, 0],
"8643": [0.19444, 0.69224, 0, 0],
"8644": [0.1808, 0.675, 0, 0],
"8646": [0.1808, 0.675, 0, 0],
"8647": [0.1808, 0.675, 0, 0],
"8648": [0.19444, 0.69224, 0, 0],
"8649": [0.1808, 0.675, 0, 0],
"8650": [0.19444, 0.69224, 0, 0],
"8651": [0.01354, 0.52239, 0, 0],
"8652": [0.01354, 0.52239, 0, 0],
"8653": [-0.13313, 0.36687, 0, 0],
"8654": [-0.13313, 0.36687, 0, 0],
"8655": [-0.13313, 0.36687, 0, 0],
"8666": [0.13667, 0.63667, 0, 0],
"8667": [0.13667, 0.63667, 0, 0],
"8669": [-0.13313, 0.37788, 0, 0],
"8672": [-0.064, 0.437, 0, 0],
"8674": [-0.064, 0.437, 0, 0],
"8705": [0, 0.825, 0, 0],
"8708": [0, 0.68889, 0, 0],
"8709": [0.08167, 0.58167, 0, 0],
"8717": [0, 0.43056, 0, 0],
"8722": [-0.03598, 0.46402, 0, 0],
"8724": [0.08198, 0.69224, 0, 0],
"8726": [0.08167, 0.58167, 0, 0],
"8733": [0, 0.69224, 0, 0],
"8736": [0, 0.69224, 0, 0],
"8737": [0, 0.69224, 0, 0],
"8738": [0.03517, 0.52239, 0, 0],
"8739": [0.08167, 0.58167, 0, 0],
"8740": [0.25142, 0.74111, 0, 0],
"8741": [0.08167, 0.58167, 0, 0],
"8742": [0.25142, 0.74111, 0, 0],
"8756": [0, 0.69224, 0, 0],
"8757": [0, 0.69224, 0, 0],
"8764": [-0.13313, 0.36687, 0, 0],
"8765": [-0.13313, 0.37788, 0, 0],
"8769": [-0.13313, 0.36687, 0, 0],
"8770": [-0.03625, 0.46375, 0, 0],
"8774": [0.30274, 0.79383, 0, 0],
"8776": [-0.01688, 0.48312, 0, 0],
"8778": [0.08167, 0.58167, 0, 0],
"8782": [0.06062, 0.54986, 0, 0],
"8783": [0.06062, 0.54986, 0, 0],
"8785": [0.08198, 0.58198, 0, 0],
"8786": [0.08198, 0.58198, 0, 0],
"8787": [0.08198, 0.58198, 0, 0],
"8790": [0, 0.69224, 0, 0],
"8791": [0.22958, 0.72958, 0, 0],
"8796": [0.08198, 0.91667, 0, 0],
"8806": [0.25583, 0.75583, 0, 0],
"8807": [0.25583, 0.75583, 0, 0],
"8808": [0.25142, 0.75726, 0, 0],
"8809": [0.25142, 0.75726, 0, 0],
"8812": [0.25583, 0.75583, 0, 0],
"8814": [0.20576, 0.70576, 0, 0],
"8815": [0.20576, 0.70576, 0, 0],
"8816": [0.30274, 0.79383, 0, 0],
"8817": [0.30274, 0.79383, 0, 0],
"8818": [0.22958, 0.72958, 0, 0],
"8819": [0.22958, 0.72958, 0, 0],
"8822": [0.1808, 0.675, 0, 0],
"8823": [0.1808, 0.675, 0, 0],
"8828": [0.13667, 0.63667, 0, 0],
"8829": [0.13667, 0.63667, 0, 0],
"8830": [0.22958, 0.72958, 0, 0],
"8831": [0.22958, 0.72958, 0, 0],
"8832": [0.20576, 0.70576, 0, 0],
"8833": [0.20576, 0.70576, 0, 0],
"8840": [0.30274, 0.79383, 0, 0],
"8841": [0.30274, 0.79383, 0, 0],
"8842": [0.13597, 0.63597, 0, 0],
"8843": [0.13597, 0.63597, 0, 0],
"8847": [0.03517, 0.54986, 0, 0],
"8848": [0.03517, 0.54986, 0, 0],
"8858": [0.08198, 0.58198, 0, 0],
"8859": [0.08198, 0.58198, 0, 0],
"8861": [0.08198, 0.58198, 0, 0],
"8862": [0, 0.675, 0, 0],
"8863": [0, 0.675, 0, 0],
"8864": [0, 0.675, 0, 0],
"8865": [0, 0.675, 0, 0],
"8872": [0, 0.69224, 0, 0],
"8873": [0, 0.69224, 0, 0],
"8874": [0, 0.69224, 0, 0],
"8876": [0, 0.68889, 0, 0],
"8877": [0, 0.68889, 0, 0],
"8878": [0, 0.68889, 0, 0],
"8879": [0, 0.68889, 0, 0],
"8882": [0.03517, 0.54986, 0, 0],
"8883": [0.03517, 0.54986, 0, 0],
"8884": [0.13667, 0.63667, 0, 0],
"8885": [0.13667, 0.63667, 0, 0],
"8888": [0, 0.54986, 0, 0],
"8890": [0.19444, 0.43056, 0, 0],
"8891": [0.19444, 0.69224, 0, 0],
"8892": [0.19444, 0.69224, 0, 0],
"8901": [0, 0.54986, 0, 0],
"8903": [0.08167, 0.58167, 0, 0],
"8905": [0.08167, 0.58167, 0, 0],
"8906": [0.08167, 0.58167, 0, 0],
"8907": [0, 0.69224, 0, 0],
"8908": [0, 0.69224, 0, 0],
"8909": [-0.03598, 0.46402, 0, 0],
"8910": [0, 0.54986, 0, 0],
"8911": [0, 0.54986, 0, 0],
"8912": [0.03517, 0.54986, 0, 0],
"8913": [0.03517, 0.54986, 0, 0],
"8914": [0, 0.54986, 0, 0],
"8915": [0, 0.54986, 0, 0],
"8916": [0, 0.69224, 0, 0],
"8918": [0.0391, 0.5391, 0, 0],
"8919": [0.0391, 0.5391, 0, 0],
"8920": [0.03517, 0.54986, 0, 0],
"8921": [0.03517, 0.54986, 0, 0],
"8922": [0.38569, 0.88569, 0, 0],
"8923": [0.38569, 0.88569, 0, 0],
"8926": [0.13667, 0.63667, 0, 0],
"8927": [0.13667, 0.63667, 0, 0],
"8928": [0.30274, 0.79383, 0, 0],
"8929": [0.30274, 0.79383, 0, 0],
"8934": [0.23222, 0.74111, 0, 0],
"8935": [0.23222, 0.74111, 0, 0],
"8936": [0.23222, 0.74111, 0, 0],
"8937": [0.23222, 0.74111, 0, 0],
"8938": [0.20576, 0.70576, 0, 0],
"8939": [0.20576, 0.70576, 0, 0],
"8940": [0.30274, 0.79383, 0, 0],
"8941": [0.30274, 0.79383, 0, 0],
"8994": [0.19444, 0.69224, 0, 0],
"8995": [0.19444, 0.69224, 0, 0],
"9416": [0.15559, 0.69224, 0, 0],
"9484": [0, 0.69224, 0, 0],
"9488": [0, 0.69224, 0, 0],
"9492": [0, 0.37788, 0, 0],
"9496": [0, 0.37788, 0, 0],
"9585": [0.19444, 0.68889, 0, 0],
"9586": [0.19444, 0.74111, 0, 0],
"9632": [0, 0.675, 0, 0],
"9633": [0, 0.675, 0, 0],
"9650": [0, 0.54986, 0, 0],
"9651": [0, 0.54986, 0, 0],
"9654": [0.03517, 0.54986, 0, 0],
"9660": [0, 0.54986, 0, 0],
"9661": [0, 0.54986, 0, 0],
"9664": [0.03517, 0.54986, 0, 0],
"9674": [0.11111, 0.69224, 0, 0],
"9733": [0.19444, 0.69224, 0, 0],
"10003": [0, 0.69224, 0, 0],
"10016": [0, 0.69224, 0, 0],
"10731": [0.11111, 0.69224, 0, 0],
"10846": [0.19444, 0.75583, 0, 0],
"10877": [0.13667, 0.63667, 0, 0],
"10878": [0.13667, 0.63667, 0, 0],
"10885": [0.25583, 0.75583, 0, 0],
"10886": [0.25583, 0.75583, 0, 0],
"10887": [0.13597, 0.63597, 0, 0],
"10888": [0.13597, 0.63597, 0, 0],
"10889": [0.26167, 0.75726, 0, 0],
"10890": [0.26167, 0.75726, 0, 0],
"10891": [0.48256, 0.98256, 0, 0],
"10892": [0.48256, 0.98256, 0, 0],
"10901": [0.13667, 0.63667, 0, 0],
"10902": [0.13667, 0.63667, 0, 0],
"10933": [0.25142, 0.75726, 0, 0],
"10934": [0.25142, 0.75726, 0, 0],
"10935": [0.26167, 0.75726, 0, 0],
"10936": [0.26167, 0.75726, 0, 0],
"10937": [0.26167, 0.75726, 0, 0],
"10938": [0.26167, 0.75726, 0, 0],
"10949": [0.25583, 0.75583, 0, 0],
"10950": [0.25583, 0.75583, 0, 0],
"10955": [0.28481, 0.79383, 0, 0],
"10956": [0.28481, 0.79383, 0, 0],
"57350": [0.08167, 0.58167, 0, 0],
"57351": [0.08167, 0.58167, 0, 0],
"57352": [0.08167, 0.58167, 0, 0],
"57353": [0, 0.43056, 0.04028, 0],
"57356": [0.25142, 0.75726, 0, 0],
"57357": [0.25142, 0.75726, 0, 0],
"57358": [0.41951, 0.91951, 0, 0],
"57359": [0.30274, 0.79383, 0, 0],
"57360": [0.30274, 0.79383, 0, 0],
"57361": [0.41951, 0.91951, 0, 0],
"57366": [0.25142, 0.75726, 0, 0],
"57367": [0.25142, 0.75726, 0, 0],
"57368": [0.25142, 0.75726, 0, 0],
"57369": [0.25142, 0.75726, 0, 0],
"57370": [0.13597, 0.63597, 0, 0],
"57371": [0.13597, 0.63597, 0, 0]
},
"Caligraphic-Regular": {
"48": [0, 0.43056, 0, 0],
"49": [0, 0.43056, 0, 0],
"50": [0, 0.43056, 0, 0],
"51": [0.19444, 0.43056, 0, 0],
"52": [0.19444, 0.43056, 0, 0],
"53": [0.19444, 0.43056, 0, 0],
"54": [0, 0.64444, 0, 0],
"55": [0.19444, 0.43056, 0, 0],
"56": [0, 0.64444, 0, 0],
"57": [0.19444, 0.43056, 0, 0],
"65": [0, 0.68333, 0, 0.19445],
"66": [0, 0.68333, 0.03041, 0.13889],
"67": [0, 0.68333, 0.05834, 0.13889],
"68": [0, 0.68333, 0.02778, 0.08334],
"69": [0, 0.68333, 0.08944, 0.11111],
"70": [0, 0.68333, 0.09931, 0.11111],
"71": [0.09722, 0.68333, 0.0593, 0.11111],
"72": [0, 0.68333, 0.00965, 0.11111],
"73": [0, 0.68333, 0.07382, 0],
"74": [0.09722, 0.68333, 0.18472, 0.16667],
"75": [0, 0.68333, 0.01445, 0.05556],
"76": [0, 0.68333, 0, 0.13889],
"77": [0, 0.68333, 0, 0.13889],
"78": [0, 0.68333, 0.14736, 0.08334],
"79": [0, 0.68333, 0.02778, 0.11111],
"80": [0, 0.68333, 0.08222, 0.08334],
"81": [0.09722, 0.68333, 0, 0.11111],
"82": [0, 0.68333, 0, 0.08334],
"83": [0, 0.68333, 0.075, 0.13889],
"84": [0, 0.68333, 0.25417, 0],
"85": [0, 0.68333, 0.09931, 0.08334],
"86": [0, 0.68333, 0.08222, 0],
"87": [0, 0.68333, 0.08222, 0.08334],
"88": [0, 0.68333, 0.14643, 0.13889],
"89": [0.09722, 0.68333, 0.08222, 0.08334],
"90": [0, 0.68333, 0.07944, 0.13889]
},
"Fraktur-Regular": {
"33": [0, 0.69141, 0, 0],
"34": [0, 0.69141, 0, 0],
"38": [0, 0.69141, 0, 0],
"39": [0, 0.69141, 0, 0],
"40": [0.24982, 0.74947, 0, 0],
"41": [0.24982, 0.74947, 0, 0],
"42": [0, 0.62119, 0, 0],
"43": [0.08319, 0.58283, 0, 0],
"44": [0, 0.10803, 0, 0],
"45": [0.08319, 0.58283, 0, 0],
"46": [0, 0.10803, 0, 0],
"47": [0.24982, 0.74947, 0, 0],
"48": [0, 0.47534, 0, 0],
"49": [0, 0.47534, 0, 0],
"50": [0, 0.47534, 0, 0],
"51": [0.18906, 0.47534, 0, 0],
"52": [0.18906, 0.47534, 0, 0],
"53": [0.18906, 0.47534, 0, 0],
"54": [0, 0.69141, 0, 0],
"55": [0.18906, 0.47534, 0, 0],
"56": [0, 0.69141, 0, 0],
"57": [0.18906, 0.47534, 0, 0],
"58": [0, 0.47534, 0, 0],
"59": [0.12604, 0.47534, 0, 0],
"61": [-0.13099, 0.36866, 0, 0],
"63": [0, 0.69141, 0, 0],
"65": [0, 0.69141, 0, 0],
"66": [0, 0.69141, 0, 0],
"67": [0, 0.69141, 0, 0],
"68": [0, 0.69141, 0, 0],
"69": [0, 0.69141, 0, 0],
"70": [0.12604, 0.69141, 0, 0],
"71": [0, 0.69141, 0, 0],
"72": [0.06302, 0.69141, 0, 0],
"73": [0, 0.69141, 0, 0],
"74": [0.12604, 0.69141, 0, 0],
"75": [0, 0.69141, 0, 0],
"76": [0, 0.69141, 0, 0],
"77": [0, 0.69141, 0, 0],
"78": [0, 0.69141, 0, 0],
"79": [0, 0.69141, 0, 0],
"80": [0.18906, 0.69141, 0, 0],
"81": [0.03781, 0.69141, 0, 0],
"82": [0, 0.69141, 0, 0],
"83": [0, 0.69141, 0, 0],
"84": [0, 0.69141, 0, 0],
"85": [0, 0.69141, 0, 0],
"86": [0, 0.69141, 0, 0],
"87": [0, 0.69141, 0, 0],
"88": [0, 0.69141, 0, 0],
"89": [0.18906, 0.69141, 0, 0],
"90": [0.12604, 0.69141, 0, 0],
"91": [0.24982, 0.74947, 0, 0],
"93": [0.24982, 0.74947, 0, 0],
"94": [0, 0.69141, 0, 0],
"97": [0, 0.47534, 0, 0],
"98": [0, 0.69141, 0, 0],
"99": [0, 0.47534, 0, 0],
"100": [0, 0.62119, 0, 0],
"101": [0, 0.47534, 0, 0],
"102": [0.18906, 0.69141, 0, 0],
"103": [0.18906, 0.47534, 0, 0],
"104": [0.18906, 0.69141, 0, 0],
"105": [0, 0.69141, 0, 0],
"106": [0, 0.69141, 0, 0],
"107": [0, 0.69141, 0, 0],
"108": [0, 0.69141, 0, 0],
"109": [0, 0.47534, 0, 0],
"110": [0, 0.47534, 0, 0],
"111": [0, 0.47534, 0, 0],
"112": [0.18906, 0.52396, 0, 0],
"113": [0.18906, 0.47534, 0, 0],
"114": [0, 0.47534, 0, 0],
"115": [0, 0.47534, 0, 0],
"116": [0, 0.62119, 0, 0],
"117": [0, 0.47534, 0, 0],
"118": [0, 0.52396, 0, 0],
"119": [0, 0.52396, 0, 0],
"120": [0.18906, 0.47534, 0, 0],
"121": [0.18906, 0.47534, 0, 0],
"122": [0.18906, 0.47534, 0, 0],
"8216": [0, 0.69141, 0, 0],
"8217": [0, 0.69141, 0, 0],
"58112": [0, 0.62119, 0, 0],
"58113": [0, 0.62119, 0, 0],
"58114": [0.18906, 0.69141, 0, 0],
"58115": [0.18906, 0.69141, 0, 0],
"58116": [0.18906, 0.47534, 0, 0],
"58117": [0, 0.69141, 0, 0],
"58118": [0, 0.62119, 0, 0],
"58119": [0, 0.47534, 0, 0]
},
"Main-Bold": {
"33": [0, 0.69444, 0, 0],
"34": [0, 0.69444, 0, 0],
"35": [0.19444, 0.69444, 0, 0],
"36": [0.05556, 0.75, 0, 0],
"37": [0.05556, 0.75, 0, 0],
"38": [0, 0.69444, 0, 0],
"39": [0, 0.69444, 0, 0],
"40": [0.25, 0.75, 0, 0],
"41": [0.25, 0.75, 0, 0],
"42": [0, 0.75, 0, 0],
"43": [0.13333, 0.63333, 0, 0],
"44": [0.19444, 0.15556, 0, 0],
"45": [0, 0.44444, 0, 0],
"46": [0, 0.15556, 0, 0],
"47": [0.25, 0.75, 0, 0],
"48": [0, 0.64444, 0, 0],
"49": [0, 0.64444, 0, 0],
"50": [0, 0.64444, 0, 0],
"51": [0, 0.64444, 0, 0],
"52": [0, 0.64444, 0, 0],
"53": [0, 0.64444, 0, 0],
"54": [0, 0.64444, 0, 0],
"55": [0, 0.64444, 0, 0],
"56": [0, 0.64444, 0, 0],
"57": [0, 0.64444, 0, 0],
"58": [0, 0.44444, 0, 0],
"59": [0.19444, 0.44444, 0, 0],
"60": [0.08556, 0.58556, 0, 0],
"61": [-0.10889, 0.39111, 0, 0],
"62": [0.08556, 0.58556, 0, 0],
"63": [0, 0.69444, 0, 0],
"64": [0, 0.69444, 0, 0],
"65": [0, 0.68611, 0, 0],
"66": [0, 0.68611, 0, 0],
"67": [0, 0.68611, 0, 0],
"68": [0, 0.68611, 0, 0],
"69": [0, 0.68611, 0, 0],
"70": [0, 0.68611, 0, 0],
"71": [0, 0.68611, 0, 0],
"72": [0, 0.68611, 0, 0],
"73": [0, 0.68611, 0, 0],
"74": [0, 0.68611, 0, 0],
"75": [0, 0.68611, 0, 0],
"76": [0, 0.68611, 0, 0],
"77": [0, 0.68611, 0, 0],
"78": [0, 0.68611, 0, 0],
"79": [0, 0.68611, 0, 0],
"80": [0, 0.68611, 0, 0],
"81": [0.19444, 0.68611, 0, 0],
"82": [0, 0.68611, 0, 0],
"83": [0, 0.68611, 0, 0],
"84": [0, 0.68611, 0, 0],
"85": [0, 0.68611, 0, 0],
"86": [0, 0.68611, 0.01597, 0],
"87": [0, 0.68611, 0.01597, 0],
"88": [0, 0.68611, 0, 0],
"89": [0, 0.68611, 0.02875, 0],
"90": [0, 0.68611, 0, 0],
"91": [0.25, 0.75, 0, 0],
"92": [0.25, 0.75, 0, 0],
"93": [0.25, 0.75, 0, 0],
"94": [0, 0.69444, 0, 0],
"95": [0.31, 0.13444, 0.03194, 0],
"96": [0, 0.69444, 0, 0],
"97": [0, 0.44444, 0, 0],
"98": [0, 0.69444, 0, 0],
"99": [0, 0.44444, 0, 0],
"100": [0, 0.69444, 0, 0],
"101": [0, 0.44444, 0, 0],
"102": [0, 0.69444, 0.10903, 0],
"103": [0.19444, 0.44444, 0.01597, 0],
"104": [0, 0.69444, 0, 0],
"105": [0, 0.69444, 0, 0],
"106": [0.19444, 0.69444, 0, 0],
"107": [0, 0.69444, 0, 0],
"108": [0, 0.69444, 0, 0],
"109": [0, 0.44444, 0, 0],
"110": [0, 0.44444, 0, 0],
"111": [0, 0.44444, 0, 0],
"112": [0.19444, 0.44444, 0, 0],
"113": [0.19444, 0.44444, 0, 0],
"114": [0, 0.44444, 0, 0],
"115": [0, 0.44444, 0, 0],
"116": [0, 0.63492, 0, 0],
"117": [0, 0.44444, 0, 0],
"118": [0, 0.44444, 0.01597, 0],
"119": [0, 0.44444, 0.01597, 0],
"120": [0, 0.44444, 0, 0],
"121": [0.19444, 0.44444, 0.01597, 0],
"122": [0, 0.44444, 0, 0],
"123": [0.25, 0.75, 0, 0],
"124": [0.25, 0.75, 0, 0],
"125": [0.25, 0.75, 0, 0],
"126": [0.35, 0.34444, 0, 0],
"168": [0, 0.69444, 0, 0],
"172": [0, 0.44444, 0, 0],
"175": [0, 0.59611, 0, 0],
"176": [0, 0.69444, 0, 0],
"177": [0.13333, 0.63333, 0, 0],
"180": [0, 0.69444, 0, 0],
"215": [0.13333, 0.63333, 0, 0],
"247": [0.13333, 0.63333, 0, 0],
"305": [0, 0.44444, 0, 0],
"567": [0.19444, 0.44444, 0, 0],
"710": [0, 0.69444, 0, 0],
"711": [0, 0.63194, 0, 0],
"713": [0, 0.59611, 0, 0],
"714": [0, 0.69444, 0, 0],
"715": [0, 0.69444, 0, 0],
"728": [0, 0.69444, 0, 0],
"729": [0, 0.69444, 0, 0],
"730": [0, 0.69444, 0, 0],
"732": [0, 0.69444, 0, 0],
"768": [0, 0.69444, 0, 0],
"769": [0, 0.69444, 0, 0],
"770": [0, 0.69444, 0, 0],
"771": [0, 0.69444, 0, 0],
"772": [0, 0.59611, 0, 0],
"774": [0, 0.69444, 0, 0],
"775": [0, 0.69444, 0, 0],
"776": [0, 0.69444, 0, 0],
"778": [0, 0.69444, 0, 0],
"779": [0, 0.69444, 0, 0],
"780": [0, 0.63194, 0, 0],
"824": [0.19444, 0.69444, 0, 0],
"915": [0, 0.68611, 0, 0],
"916": [0, 0.68611, 0, 0],
"920": [0, 0.68611, 0, 0],
"923": [0, 0.68611, 0, 0],
"926": [0, 0.68611, 0, 0],
"928": [0, 0.68611, 0, 0],
"931": [0, 0.68611, 0, 0],
"933": [0, 0.68611, 0, 0],
"934": [0, 0.68611, 0, 0],
"936": [0, 0.68611, 0, 0],
"937": [0, 0.68611, 0, 0],
"8211": [0, 0.44444, 0.03194, 0],
"8212": [0, 0.44444, 0.03194, 0],
"8216": [0, 0.69444, 0, 0],
"8217": [0, 0.69444, 0, 0],
"8220": [0, 0.69444, 0, 0],
"8221": [0, 0.69444, 0, 0],
"8224": [0.19444, 0.69444, 0, 0],
"8225": [0.19444, 0.69444, 0, 0],
"8242": [0, 0.55556, 0, 0],
"8407": [0, 0.72444, 0.15486, 0],
"8463": [0, 0.69444, 0, 0],
"8465": [0, 0.69444, 0, 0],
"8467": [0, 0.69444, 0, 0],
"8472": [0.19444, 0.44444, 0, 0],
"8476": [0, 0.69444, 0, 0],
"8501": [0, 0.69444, 0, 0],
"8592": [-0.10889, 0.39111, 0, 0],
"8593": [0.19444, 0.69444, 0, 0],
"8594": [-0.10889, 0.39111, 0, 0],
"8595": [0.19444, 0.69444, 0, 0],
"8596": [-0.10889, 0.39111, 0, 0],
"8597": [0.25, 0.75, 0, 0],
"8598": [0.19444, 0.69444, 0, 0],
"8599": [0.19444, 0.69444, 0, 0],
"8600": [0.19444, 0.69444, 0, 0],
"8601": [0.19444, 0.69444, 0, 0],
"8636": [-0.10889, 0.39111, 0, 0],
"8637": [-0.10889, 0.39111, 0, 0],
"8640": [-0.10889, 0.39111, 0, 0],
"8641": [-0.10889, 0.39111, 0, 0],
"8656": [-0.10889, 0.39111, 0, 0],
"8657": [0.19444, 0.69444, 0, 0],
"8658": [-0.10889, 0.39111, 0, 0],
"8659": [0.19444, 0.69444, 0, 0],
"8660": [-0.10889, 0.39111, 0, 0],
"8661": [0.25, 0.75, 0, 0],
"8704": [0, 0.69444, 0, 0],
"8706": [0, 0.69444, 0.06389, 0],
"8707": [0, 0.69444, 0, 0],
"8709": [0.05556, 0.75, 0, 0],
"8711": [0, 0.68611, 0, 0],
"8712": [0.08556, 0.58556, 0, 0],
"8715": [0.08556, 0.58556, 0, 0],
"8722": [0.13333, 0.63333, 0, 0],
"8723": [0.13333, 0.63333, 0, 0],
"8725": [0.25, 0.75, 0, 0],
"8726": [0.25, 0.75, 0, 0],
"8727": [-0.02778, 0.47222, 0, 0],
"8728": [-0.02639, 0.47361, 0, 0],
"8729": [-0.02639, 0.47361, 0, 0],
"8730": [0.18, 0.82, 0, 0],
"8733": [0, 0.44444, 0, 0],
"8734": [0, 0.44444, 0, 0],
"8736": [0, 0.69224, 0, 0],
"8739": [0.25, 0.75, 0, 0],
"8741": [0.25, 0.75, 0, 0],
"8743": [0, 0.55556, 0, 0],
"8744": [0, 0.55556, 0, 0],
"8745": [0, 0.55556, 0, 0],
"8746": [0, 0.55556, 0, 0],
"8747": [0.19444, 0.69444, 0.12778, 0],
"8764": [-0.10889, 0.39111, 0, 0],
"8768": [0.19444, 0.69444, 0, 0],
"8771": [0.00222, 0.50222, 0, 0],
"8776": [0.02444, 0.52444, 0, 0],
"8781": [0.00222, 0.50222, 0, 0],
"8801": [0.00222, 0.50222, 0, 0],
"8804": [0.19667, 0.69667, 0, 0],
"8805": [0.19667, 0.69667, 0, 0],
"8810": [0.08556, 0.58556, 0, 0],
"8811": [0.08556, 0.58556, 0, 0],
"8826": [0.08556, 0.58556, 0, 0],
"8827": [0.08556, 0.58556, 0, 0],
"8834": [0.08556, 0.58556, 0, 0],
"8835": [0.08556, 0.58556, 0, 0],
"8838": [0.19667, 0.69667, 0, 0],
"8839": [0.19667, 0.69667, 0, 0],
"8846": [0, 0.55556, 0, 0],
"8849": [0.19667, 0.69667, 0, 0],
"8850": [0.19667, 0.69667, 0, 0],
"8851": [0, 0.55556, 0, 0],
"8852": [0, 0.55556, 0, 0],
"8853": [0.13333, 0.63333, 0, 0],
"8854": [0.13333, 0.63333, 0, 0],
"8855": [0.13333, 0.63333, 0, 0],
"8856": [0.13333, 0.63333, 0, 0],
"8857": [0.13333, 0.63333, 0, 0],
"8866": [0, 0.69444, 0, 0],
"8867": [0, 0.69444, 0, 0],
"8868": [0, 0.69444, 0, 0],
"8869": [0, 0.69444, 0, 0],
"8900": [-0.02639, 0.47361, 0, 0],
"8901": [-0.02639, 0.47361, 0, 0],
"8902": [-0.02778, 0.47222, 0, 0],
"8968": [0.25, 0.75, 0, 0],
"8969": [0.25, 0.75, 0, 0],
"8970": [0.25, 0.75, 0, 0],
"8971": [0.25, 0.75, 0, 0],
"8994": [-0.13889, 0.36111, 0, 0],
"8995": [-0.13889, 0.36111, 0, 0],
"9651": [0.19444, 0.69444, 0, 0],
"9657": [-0.02778, 0.47222, 0, 0],
"9661": [0.19444, 0.69444, 0, 0],
"9667": [-0.02778, 0.47222, 0, 0],
"9711": [0.19444, 0.69444, 0, 0],
"9824": [0.12963, 0.69444, 0, 0],
"9825": [0.12963, 0.69444, 0, 0],
"9826": [0.12963, 0.69444, 0, 0],
"9827": [0.12963, 0.69444, 0, 0],
"9837": [0, 0.75, 0, 0],
"9838": [0.19444, 0.69444, 0, 0],
"9839": [0.19444, 0.69444, 0, 0],
"10216": [0.25, 0.75, 0, 0],
"10217": [0.25, 0.75, 0, 0],
"10815": [0, 0.68611, 0, 0],
"10927": [0.19667, 0.69667, 0, 0],
"10928": [0.19667, 0.69667, 0, 0]
},
"Main-Italic": {
"33": [0, 0.69444, 0.12417, 0],
"34": [0, 0.69444, 0.06961, 0],
"35": [0.19444, 0.69444, 0.06616, 0],
"37": [0.05556, 0.75, 0.13639, 0],
"38": [0, 0.69444, 0.09694, 0],
"39": [0, 0.69444, 0.12417, 0],
"40": [0.25, 0.75, 0.16194, 0],
"41": [0.25, 0.75, 0.03694, 0],
"42": [0, 0.75, 0.14917, 0],
"43": [0.05667, 0.56167, 0.03694, 0],
"44": [0.19444, 0.10556, 0, 0],
"45": [0, 0.43056, 0.02826, 0],
"46": [0, 0.10556, 0, 0],
"47": [0.25, 0.75, 0.16194, 0],
"48": [0, 0.64444, 0.13556, 0],
"49": [0, 0.64444, 0.13556, 0],
"50": [0, 0.64444, 0.13556, 0],
"51": [0, 0.64444, 0.13556, 0],
"52": [0.19444, 0.64444, 0.13556, 0],
"53": [0, 0.64444, 0.13556, 0],
"54": [0, 0.64444, 0.13556, 0],
"55": [0.19444, 0.64444, 0.13556, 0],
"56": [0, 0.64444, 0.13556, 0],
"57": [0, 0.64444, 0.13556, 0],
"58": [0, 0.43056, 0.0582, 0],
"59": [0.19444, 0.43056, 0.0582, 0],
"61": [-0.13313, 0.36687, 0.06616, 0],
"63": [0, 0.69444, 0.1225, 0],
"64": [0, 0.69444, 0.09597, 0],
"65": [0, 0.68333, 0, 0],
"66": [0, 0.68333, 0.10257, 0],
"67": [0, 0.68333, 0.14528, 0],
"68": [0, 0.68333, 0.09403, 0],
"69": [0, 0.68333, 0.12028, 0],
"70": [0, 0.68333, 0.13305, 0],
"71": [0, 0.68333, 0.08722, 0],
"72": [0, 0.68333, 0.16389, 0],
"73": [0, 0.68333, 0.15806, 0],
"74": [0, 0.68333, 0.14028, 0],
"75": [0, 0.68333, 0.14528, 0],
"76": [0, 0.68333, 0, 0],
"77": [0, 0.68333, 0.16389, 0],
"78": [0, 0.68333, 0.16389, 0],
"79": [0, 0.68333, 0.09403, 0],
"80": [0, 0.68333, 0.10257, 0],
"81": [0.19444, 0.68333, 0.09403, 0],
"82": [0, 0.68333, 0.03868, 0],
"83": [0, 0.68333, 0.11972, 0],
"84": [0, 0.68333, 0.13305, 0],
"85": [0, 0.68333, 0.16389, 0],
"86": [0, 0.68333, 0.18361, 0],
"87": [0, 0.68333, 0.18361, 0],
"88": [0, 0.68333, 0.15806, 0],
"89": [0, 0.68333, 0.19383, 0],
"90": [0, 0.68333, 0.14528, 0],
"91": [0.25, 0.75, 0.1875, 0],
"93": [0.25, 0.75, 0.10528, 0],
"94": [0, 0.69444, 0.06646, 0],
"95": [0.31, 0.12056, 0.09208, 0],
"97": [0, 0.43056, 0.07671, 0],
"98": [0, 0.69444, 0.06312, 0],
"99": [0, 0.43056, 0.05653, 0],
"100": [0, 0.69444, 0.10333, 0],
"101": [0, 0.43056, 0.07514, 0],
"102": [0.19444, 0.69444, 0.21194, 0],
"103": [0.19444, 0.43056, 0.08847, 0],
"104": [0, 0.69444, 0.07671, 0],
"105": [0, 0.65536, 0.1019, 0],
"106": [0.19444, 0.65536, 0.14467, 0],
"107": [0, 0.69444, 0.10764, 0],
"108": [0, 0.69444, 0.10333, 0],
"109": [0, 0.43056, 0.07671, 0],
"110": [0, 0.43056, 0.07671, 0],
"111": [0, 0.43056, 0.06312, 0],
"112": [0.19444, 0.43056, 0.06312, 0],
"113": [0.19444, 0.43056, 0.08847, 0],
"114": [0, 0.43056, 0.10764, 0],
"115": [0, 0.43056, 0.08208, 0],
"116": [0, 0.61508, 0.09486, 0],
"117": [0, 0.43056, 0.07671, 0],
"118": [0, 0.43056, 0.10764, 0],
"119": [0, 0.43056, 0.10764, 0],
"120": [0, 0.43056, 0.12042, 0],
"121": [0.19444, 0.43056, 0.08847, 0],
"122": [0, 0.43056, 0.12292, 0],
"126": [0.35, 0.31786, 0.11585, 0],
"163": [0, 0.69444, 0, 0],
"305": [0, 0.43056, 0, 0.02778],
"567": [0.19444, 0.43056, 0, 0.08334],
"768": [0, 0.69444, 0, 0],
"769": [0, 0.69444, 0.09694, 0],
"770": [0, 0.69444, 0.06646, 0],
"771": [0, 0.66786, 0.11585, 0],
"772": [0, 0.56167, 0.10333, 0],
"774": [0, 0.69444, 0.10806, 0],
"775": [0, 0.66786, 0.11752, 0],
"776": [0, 0.66786, 0.10474, 0],
"778": [0, 0.69444, 0, 0],
"779": [0, 0.69444, 0.1225, 0],
"780": [0, 0.62847, 0.08295, 0],
"915": [0, 0.68333, 0.13305, 0],
"916": [0, 0.68333, 0, 0],
"920": [0, 0.68333, 0.09403, 0],
"923": [0, 0.68333, 0, 0],
"926": [0, 0.68333, 0.15294, 0],
"928": [0, 0.68333, 0.16389, 0],
"931": [0, 0.68333, 0.12028, 0],
"933": [0, 0.68333, 0.11111, 0],
"934": [0, 0.68333, 0.05986, 0],
"936": [0, 0.68333, 0.11111, 0],
"937": [0, 0.68333, 0.10257, 0],
"8211": [0, 0.43056, 0.09208, 0],
"8212": [0, 0.43056, 0.09208, 0],
"8216": [0, 0.69444, 0.12417, 0],
"8217": [0, 0.69444, 0.12417, 0],
"8220": [0, 0.69444, 0.1685, 0],
"8221": [0, 0.69444, 0.06961, 0],
"8463": [0, 0.68889, 0, 0]
},
"Main-Regular": {
"32": [0, 0, 0, 0],
"33": [0, 0.69444, 0, 0],
"34": [0, 0.69444, 0, 0],
"35": [0.19444, 0.69444, 0, 0],
"36": [0.05556, 0.75, 0, 0],
"37": [0.05556, 0.75, 0, 0],
"38": [0, 0.69444, 0, 0],
"39": [0, 0.69444, 0, 0],
"40": [0.25, 0.75, 0, 0],
"41": [0.25, 0.75, 0, 0],
"42": [0, 0.75, 0, 0],
"43": [0.08333, 0.58333, 0, 0],
"44": [0.19444, 0.10556, 0, 0],
"45": [0, 0.43056, 0, 0],
"46": [0, 0.10556, 0, 0],
"47": [0.25, 0.75, 0, 0],
"48": [0, 0.64444, 0, 0],
"49": [0, 0.64444, 0, 0],
"50": [0, 0.64444, 0, 0],
"51": [0, 0.64444, 0, 0],
"52": [0, 0.64444, 0, 0],
"53": [0, 0.64444, 0, 0],
"54": [0, 0.64444, 0, 0],
"55": [0, 0.64444, 0, 0],
"56": [0, 0.64444, 0, 0],
"57": [0, 0.64444, 0, 0],
"58": [0, 0.43056, 0, 0],
"59": [0.19444, 0.43056, 0, 0],
"60": [0.0391, 0.5391, 0, 0],
"61": [-0.13313, 0.36687, 0, 0],
"62": [0.0391, 0.5391, 0, 0],
"63": [0, 0.69444, 0, 0],
"64": [0, 0.69444, 0, 0],
"65": [0, 0.68333, 0, 0],
"66": [0, 0.68333, 0, 0],
"67": [0, 0.68333, 0, 0],
"68": [0, 0.68333, 0, 0],
"69": [0, 0.68333, 0, 0],
"70": [0, 0.68333, 0, 0],
"71": [0, 0.68333, 0, 0],
"72": [0, 0.68333, 0, 0],
"73": [0, 0.68333, 0, 0],
"74": [0, 0.68333, 0, 0],
"75": [0, 0.68333, 0, 0],
"76": [0, 0.68333, 0, 0],
"77": [0, 0.68333, 0, 0],
"78": [0, 0.68333, 0, 0],
"79": [0, 0.68333, 0, 0],
"80": [0, 0.68333, 0, 0],
"81": [0.19444, 0.68333, 0, 0],
"82": [0, 0.68333, 0, 0],
"83": [0, 0.68333, 0, 0],
"84": [0, 0.68333, 0, 0],
"85": [0, 0.68333, 0, 0],
"86": [0, 0.68333, 0.01389, 0],
"87": [0, 0.68333, 0.01389, 0],
"88": [0, 0.68333, 0, 0],
"89": [0, 0.68333, 0.025, 0],
"90": [0, 0.68333, 0, 0],
"91": [0.25, 0.75, 0, 0],
"92": [0.25, 0.75, 0, 0],
"93": [0.25, 0.75, 0, 0],
"94": [0, 0.69444, 0, 0],
"95": [0.31, 0.12056, 0.02778, 0],
"96": [0, 0.69444, 0, 0],
"97": [0, 0.43056, 0, 0],
"98": [0, 0.69444, 0, 0],
"99": [0, 0.43056, 0, 0],
"100": [0, 0.69444, 0, 0],
"101": [0, 0.43056, 0, 0],
"102": [0, 0.69444, 0.07778, 0],
"103": [0.19444, 0.43056, 0.01389, 0],
"104": [0, 0.69444, 0, 0],
"105": [0, 0.66786, 0, 0],
"106": [0.19444, 0.66786, 0, 0],
"107": [0, 0.69444, 0, 0],
"108": [0, 0.69444, 0, 0],
"109": [0, 0.43056, 0, 0],
"110": [0, 0.43056, 0, 0],
"111": [0, 0.43056, 0, 0],
"112": [0.19444, 0.43056, 0, 0],
"113": [0.19444, 0.43056, 0, 0],
"114": [0, 0.43056, 0, 0],
"115": [0, 0.43056, 0, 0],
"116": [0, 0.61508, 0, 0],
"117": [0, 0.43056, 0, 0],
"118": [0, 0.43056, 0.01389, 0],
"119": [0, 0.43056, 0.01389, 0],
"120": [0, 0.43056, 0, 0],
"121": [0.19444, 0.43056, 0.01389, 0],
"122": [0, 0.43056, 0, 0],
"123": [0.25, 0.75, 0, 0],
"124": [0.25, 0.75, 0, 0],
"125": [0.25, 0.75, 0, 0],
"126": [0.35, 0.31786, 0, 0],
"160": [0, 0, 0, 0],
"168": [0, 0.66786, 0, 0],
"172": [0, 0.43056, 0, 0],
"175": [0, 0.56778, 0, 0],
"176": [0, 0.69444, 0, 0],
"177": [0.08333, 0.58333, 0, 0],
"180": [0, 0.69444, 0, 0],
"215": [0.08333, 0.58333, 0, 0],
"247": [0.08333, 0.58333, 0, 0],
"305": [0, 0.43056, 0, 0],
"567": [0.19444, 0.43056, 0, 0],
"710": [0, 0.69444, 0, 0],
"711": [0, 0.62847, 0, 0],
"713": [0, 0.56778, 0, 0],
"714": [0, 0.69444, 0, 0],
"715": [0, 0.69444, 0, 0],
"728": [0, 0.69444, 0, 0],
"729": [0, 0.66786, 0, 0],
"730": [0, 0.69444, 0, 0],
"732": [0, 0.66786, 0, 0],
"768": [0, 0.69444, 0, 0],
"769": [0, 0.69444, 0, 0],
"770": [0, 0.69444, 0, 0],
"771": [0, 0.66786, 0, 0],
"772": [0, 0.56778, 0, 0],
"774": [0, 0.69444, 0, 0],
"775": [0, 0.66786, 0, 0],
"776": [0, 0.66786, 0, 0],
"778": [0, 0.69444, 0, 0],
"779": [0, 0.69444, 0, 0],
"780": [0, 0.62847, 0, 0],
"824": [0.19444, 0.69444, 0, 0],
"915": [0, 0.68333, 0, 0],
"916": [0, 0.68333, 0, 0],
"920": [0, 0.68333, 0, 0],
"923": [0, 0.68333, 0, 0],
"926": [0, 0.68333, 0, 0],
"928": [0, 0.68333, 0, 0],
"931": [0, 0.68333, 0, 0],
"933": [0, 0.68333, 0, 0],
"934": [0, 0.68333, 0, 0],
"936": [0, 0.68333, 0, 0],
"937": [0, 0.68333, 0, 0],
"8211": [0, 0.43056, 0.02778, 0],
"8212": [0, 0.43056, 0.02778, 0],
"8216": [0, 0.69444, 0, 0],
"8217": [0, 0.69444, 0, 0],
"8220": [0, 0.69444, 0, 0],
"8221": [0, 0.69444, 0, 0],
"8224": [0.19444, 0.69444, 0, 0],
"8225": [0.19444, 0.69444, 0, 0],
"8230": [0, 0.12, 0, 0],
"8242": [0, 0.55556, 0, 0],
"8407": [0, 0.71444, 0.15382, 0],
"8463": [0, 0.68889, 0, 0],
"8465": [0, 0.69444, 0, 0],
"8467": [0, 0.69444, 0, 0.11111],
"8472": [0.19444, 0.43056, 0, 0.11111],
"8476": [0, 0.69444, 0, 0],
"8501": [0, 0.69444, 0, 0],
"8592": [-0.13313, 0.36687, 0, 0],
"8593": [0.19444, 0.69444, 0, 0],
"8594": [-0.13313, 0.36687, 0, 0],
"8595": [0.19444, 0.69444, 0, 0],
"8596": [-0.13313, 0.36687, 0, 0],
"8597": [0.25, 0.75, 0, 0],
"8598": [0.19444, 0.69444, 0, 0],
"8599": [0.19444, 0.69444, 0, 0],
"8600": [0.19444, 0.69444, 0, 0],
"8601": [0.19444, 0.69444, 0, 0],
"8614": [0.011, 0.511, 0, 0],
"8617": [0.011, 0.511, 0, 0],
"8618": [0.011, 0.511, 0, 0],
"8636": [-0.13313, 0.36687, 0, 0],
"8637": [-0.13313, 0.36687, 0, 0],
"8640": [-0.13313, 0.36687, 0, 0],
"8641": [-0.13313, 0.36687, 0, 0],
"8652": [0.011, 0.671, 0, 0],
"8656": [-0.13313, 0.36687, 0, 0],
"8657": [0.19444, 0.69444, 0, 0],
"8658": [-0.13313, 0.36687, 0, 0],
"8659": [0.19444, 0.69444, 0, 0],
"8660": [-0.13313, 0.36687, 0, 0],
"8661": [0.25, 0.75, 0, 0],
"8704": [0, 0.69444, 0, 0],
"8706": [0, 0.69444, 0.05556, 0.08334],
"8707": [0, 0.69444, 0, 0],
"8709": [0.05556, 0.75, 0, 0],
"8711": [0, 0.68333, 0, 0],
"8712": [0.0391, 0.5391, 0, 0],
"8715": [0.0391, 0.5391, 0, 0],
"8722": [0.08333, 0.58333, 0, 0],
"8723": [0.08333, 0.58333, 0, 0],
"8725": [0.25, 0.75, 0, 0],
"8726": [0.25, 0.75, 0, 0],
"8727": [-0.03472, 0.46528, 0, 0],
"8728": [-0.05555, 0.44445, 0, 0],
"8729": [-0.05555, 0.44445, 0, 0],
"8730": [0.2, 0.8, 0, 0],
"8733": [0, 0.43056, 0, 0],
"8734": [0, 0.43056, 0, 0],
"8736": [0, 0.69224, 0, 0],
"8739": [0.25, 0.75, 0, 0],
"8741": [0.25, 0.75, 0, 0],
"8743": [0, 0.55556, 0, 0],
"8744": [0, 0.55556, 0, 0],
"8745": [0, 0.55556, 0, 0],
"8746": [0, 0.55556, 0, 0],
"8747": [0.19444, 0.69444, 0.11111, 0],
"8764": [-0.13313, 0.36687, 0, 0],
"8768": [0.19444, 0.69444, 0, 0],
"8771": [-0.03625, 0.46375, 0, 0],
"8773": [-0.022, 0.589, 0, 0],
"8776": [-0.01688, 0.48312, 0, 0],
"8781": [-0.03625, 0.46375, 0, 0],
"8784": [-0.133, 0.67, 0, 0],
"8800": [0.215, 0.716, 0, 0],
"8801": [-0.03625, 0.46375, 0, 0],
"8804": [0.13597, 0.63597, 0, 0],
"8805": [0.13597, 0.63597, 0, 0],
"8810": [0.0391, 0.5391, 0, 0],
"8811": [0.0391, 0.5391, 0, 0],
"8826": [0.0391, 0.5391, 0, 0],
"8827": [0.0391, 0.5391, 0, 0],
"8834": [0.0391, 0.5391, 0, 0],
"8835": [0.0391, 0.5391, 0, 0],
"8838": [0.13597, 0.63597, 0, 0],
"8839": [0.13597, 0.63597, 0, 0],
"8846": [0, 0.55556, 0, 0],
"8849": [0.13597, 0.63597, 0, 0],
"8850": [0.13597, 0.63597, 0, 0],
"8851": [0, 0.55556, 0, 0],
"8852": [0, 0.55556, 0, 0],
"8853": [0.08333, 0.58333, 0, 0],
"8854": [0.08333, 0.58333, 0, 0],
"8855": [0.08333, 0.58333, 0, 0],
"8856": [0.08333, 0.58333, 0, 0],
"8857": [0.08333, 0.58333, 0, 0],
"8866": [0, 0.69444, 0, 0],
"8867": [0, 0.69444, 0, 0],
"8868": [0, 0.69444, 0, 0],
"8869": [0, 0.69444, 0, 0],
"8872": [0.249, 0.75, 0, 0],
"8900": [-0.05555, 0.44445, 0, 0],
"8901": [-0.05555, 0.44445, 0, 0],
"8902": [-0.03472, 0.46528, 0, 0],
"8904": [0.005, 0.505, 0, 0],
"8942": [0.03, 0.9, 0, 0],
"8943": [-0.19, 0.31, 0, 0],
"8945": [-0.1, 0.82, 0, 0],
"8968": [0.25, 0.75, 0, 0],
"8969": [0.25, 0.75, 0, 0],
"8970": [0.25, 0.75, 0, 0],
"8971": [0.25, 0.75, 0, 0],
"8994": [-0.14236, 0.35764, 0, 0],
"8995": [-0.14236, 0.35764, 0, 0],
"9136": [0.244, 0.744, 0, 0],
"9137": [0.244, 0.744, 0, 0],
"9651": [0.19444, 0.69444, 0, 0],
"9657": [-0.03472, 0.46528, 0, 0],
"9661": [0.19444, 0.69444, 0, 0],
"9667": [-0.03472, 0.46528, 0, 0],
"9711": [0.19444, 0.69444, 0, 0],
"9824": [0.12963, 0.69444, 0, 0],
"9825": [0.12963, 0.69444, 0, 0],
"9826": [0.12963, 0.69444, 0, 0],
"9827": [0.12963, 0.69444, 0, 0],
"9837": [0, 0.75, 0, 0],
"9838": [0.19444, 0.69444, 0, 0],
"9839": [0.19444, 0.69444, 0, 0],
"10216": [0.25, 0.75, 0, 0],
"10217": [0.25, 0.75, 0, 0],
"10222": [0.244, 0.744, 0, 0],
"10223": [0.244, 0.744, 0, 0],
"10229": [0.011, 0.511, 0, 0],
"10230": [0.011, 0.511, 0, 0],
"10231": [0.011, 0.511, 0, 0],
"10232": [0.024, 0.525, 0, 0],
"10233": [0.024, 0.525, 0, 0],
"10234": [0.024, 0.525, 0, 0],
"10236": [0.011, 0.511, 0, 0],
"10815": [0, 0.68333, 0, 0],
"10927": [0.13597, 0.63597, 0, 0],
"10928": [0.13597, 0.63597, 0, 0]
},
"Math-BoldItalic": {
"47": [0.19444, 0.69444, 0, 0],
"65": [0, 0.68611, 0, 0],
"66": [0, 0.68611, 0.04835, 0],
"67": [0, 0.68611, 0.06979, 0],
"68": [0, 0.68611, 0.03194, 0],
"69": [0, 0.68611, 0.05451, 0],
"70": [0, 0.68611, 0.15972, 0],
"71": [0, 0.68611, 0, 0],
"72": [0, 0.68611, 0.08229, 0],
"73": [0, 0.68611, 0.07778, 0],
"74": [0, 0.68611, 0.10069, 0],
"75": [0, 0.68611, 0.06979, 0],
"76": [0, 0.68611, 0, 0],
"77": [0, 0.68611, 0.11424, 0],
"78": [0, 0.68611, 0.11424, 0],
"79": [0, 0.68611, 0.03194, 0],
"80": [0, 0.68611, 0.15972, 0],
"81": [0.19444, 0.68611, 0, 0],
"82": [0, 0.68611, 0.00421, 0],
"83": [0, 0.68611, 0.05382, 0],
"84": [0, 0.68611, 0.15972, 0],
"85": [0, 0.68611, 0.11424, 0],
"86": [0, 0.68611, 0.25555, 0],
"87": [0, 0.68611, 0.15972, 0],
"88": [0, 0.68611, 0.07778, 0],
"89": [0, 0.68611, 0.25555, 0],
"90": [0, 0.68611, 0.06979, 0],
"97": [0, 0.44444, 0, 0],
"98": [0, 0.69444, 0, 0],
"99": [0, 0.44444, 0, 0],
"100": [0, 0.69444, 0, 0],
"101": [0, 0.44444, 0, 0],
"102": [0.19444, 0.69444, 0.11042, 0],
"103": [0.19444, 0.44444, 0.03704, 0],
"104": [0, 0.69444, 0, 0],
"105": [0, 0.69326, 0, 0],
"106": [0.19444, 0.69326, 0.0622, 0],
"107": [0, 0.69444, 0.01852, 0],
"108": [0, 0.69444, 0.0088, 0],
"109": [0, 0.44444, 0, 0],
"110": [0, 0.44444, 0, 0],
"111": [0, 0.44444, 0, 0],
"112": [0.19444, 0.44444, 0, 0],
"113": [0.19444, 0.44444, 0.03704, 0],
"114": [0, 0.44444, 0.03194, 0],
"115": [0, 0.44444, 0, 0],
"116": [0, 0.63492, 0, 0],
"117": [0, 0.44444, 0, 0],
"118": [0, 0.44444, 0.03704, 0],
"119": [0, 0.44444, 0.02778, 0],
"120": [0, 0.44444, 0, 0],
"121": [0.19444, 0.44444, 0.03704, 0],
"122": [0, 0.44444, 0.04213, 0],
"915": [0, 0.68611, 0.15972, 0],
"916": [0, 0.68611, 0, 0],
"920": [0, 0.68611, 0.03194, 0],
"923": [0, 0.68611, 0, 0],
"926": [0, 0.68611, 0.07458, 0],
"928": [0, 0.68611, 0.08229, 0],
"931": [0, 0.68611, 0.05451, 0],
"933": [0, 0.68611, 0.15972, 0],
"934": [0, 0.68611, 0, 0],
"936": [0, 0.68611, 0.11653, 0],
"937": [0, 0.68611, 0.04835, 0],
"945": [0, 0.44444, 0, 0],
"946": [0.19444, 0.69444, 0.03403, 0],
"947": [0.19444, 0.44444, 0.06389, 0],
"948": [0, 0.69444, 0.03819, 0],
"949": [0, 0.44444, 0, 0],
"950": [0.19444, 0.69444, 0.06215, 0],
"951": [0.19444, 0.44444, 0.03704, 0],
"952": [0, 0.69444, 0.03194, 0],
"953": [0, 0.44444, 0, 0],
"954": [0, 0.44444, 0, 0],
"955": [0, 0.69444, 0, 0],
"956": [0.19444, 0.44444, 0, 0],
"957": [0, 0.44444, 0.06898, 0],
"958": [0.19444, 0.69444, 0.03021, 0],
"959": [0, 0.44444, 0, 0],
"960": [0, 0.44444, 0.03704, 0],
"961": [0.19444, 0.44444, 0, 0],
"962": [0.09722, 0.44444, 0.07917, 0],
"963": [0, 0.44444, 0.03704, 0],
"964": [0, 0.44444, 0.13472, 0],
"965": [0, 0.44444, 0.03704, 0],
"966": [0.19444, 0.44444, 0, 0],
"967": [0.19444, 0.44444, 0, 0],
"968": [0.19444, 0.69444, 0.03704, 0],
"969": [0, 0.44444, 0.03704, 0],
"977": [0, 0.69444, 0, 0],
"981": [0.19444, 0.69444, 0, 0],
"982": [0, 0.44444, 0.03194, 0],
"1009": [0.19444, 0.44444, 0, 0],
"1013": [0, 0.44444, 0, 0]
},
"Math-Italic": {
"47": [0.19444, 0.69444, 0, 0],
"65": [0, 0.68333, 0, 0.13889],
"66": [0, 0.68333, 0.05017, 0.08334],
"67": [0, 0.68333, 0.07153, 0.08334],
"68": [0, 0.68333, 0.02778, 0.05556],
"69": [0, 0.68333, 0.05764, 0.08334],
"70": [0, 0.68333, 0.13889, 0.08334],
"71": [0, 0.68333, 0, 0.08334],
"72": [0, 0.68333, 0.08125, 0.05556],
"73": [0, 0.68333, 0.07847, 0.11111],
"74": [0, 0.68333, 0.09618, 0.16667],
"75": [0, 0.68333, 0.07153, 0.05556],
"76": [0, 0.68333, 0, 0.02778],
"77": [0, 0.68333, 0.10903, 0.08334],
"78": [0, 0.68333, 0.10903, 0.08334],
"79": [0, 0.68333, 0.02778, 0.08334],
"80": [0, 0.68333, 0.13889, 0.08334],
"81": [0.19444, 0.68333, 0, 0.08334],
"82": [0, 0.68333, 0.00773, 0.08334],
"83": [0, 0.68333, 0.05764, 0.08334],
"84": [0, 0.68333, 0.13889, 0.08334],
"85": [0, 0.68333, 0.10903, 0.02778],
"86": [0, 0.68333, 0.22222, 0],
"87": [0, 0.68333, 0.13889, 0],
"88": [0, 0.68333, 0.07847, 0.08334],
"89": [0, 0.68333, 0.22222, 0],
"90": [0, 0.68333, 0.07153, 0.08334],
"97": [0, 0.43056, 0, 0],
"98": [0, 0.69444, 0, 0],
"99": [0, 0.43056, 0, 0.05556],
"100": [0, 0.69444, 0, 0.16667],
"101": [0, 0.43056, 0, 0.05556],
"102": [0.19444, 0.69444, 0.10764, 0.16667],
"103": [0.19444, 0.43056, 0.03588, 0.02778],
"104": [0, 0.69444, 0, 0],
"105": [0, 0.65952, 0, 0],
"106": [0.19444, 0.65952, 0.05724, 0],
"107": [0, 0.69444, 0.03148, 0],
"108": [0, 0.69444, 0.01968, 0.08334],
"109": [0, 0.43056, 0, 0],
"110": [0, 0.43056, 0, 0],
"111": [0, 0.43056, 0, 0.05556],
"112": [0.19444, 0.43056, 0, 0.08334],
"113": [0.19444, 0.43056, 0.03588, 0.08334],
"114": [0, 0.43056, 0.02778, 0.05556],
"115": [0, 0.43056, 0, 0.05556],
"116": [0, 0.61508, 0, 0.08334],
"117": [0, 0.43056, 0, 0.02778],
"118": [0, 0.43056, 0.03588, 0.02778],
"119": [0, 0.43056, 0.02691, 0.08334],
"120": [0, 0.43056, 0, 0.02778],
"121": [0.19444, 0.43056, 0.03588, 0.05556],
"122": [0, 0.43056, 0.04398, 0.05556],
"915": [0, 0.68333, 0.13889, 0.08334],
"916": [0, 0.68333, 0, 0.16667],
"920": [0, 0.68333, 0.02778, 0.08334],
"923": [0, 0.68333, 0, 0.16667],
"926": [0, 0.68333, 0.07569, 0.08334],
"928": [0, 0.68333, 0.08125, 0.05556],
"931": [0, 0.68333, 0.05764, 0.08334],
"933": [0, 0.68333, 0.13889, 0.05556],
"934": [0, 0.68333, 0, 0.08334],
"936": [0, 0.68333, 0.11, 0.05556],
"937": [0, 0.68333, 0.05017, 0.08334],
"945": [0, 0.43056, 0.0037, 0.02778],
"946": [0.19444, 0.69444, 0.05278, 0.08334],
"947": [0.19444, 0.43056, 0.05556, 0],
"948": [0, 0.69444, 0.03785, 0.05556],
"949": [0, 0.43056, 0, 0.08334],
"950": [0.19444, 0.69444, 0.07378, 0.08334],
"951": [0.19444, 0.43056, 0.03588, 0.05556],
"952": [0, 0.69444, 0.02778, 0.08334],
"953": [0, 0.43056, 0, 0.05556],
"954": [0, 0.43056, 0, 0],
"955": [0, 0.69444, 0, 0],
"956": [0.19444, 0.43056, 0, 0.02778],
"957": [0, 0.43056, 0.06366, 0.02778],
"958": [0.19444, 0.69444, 0.04601, 0.11111],
"959": [0, 0.43056, 0, 0.05556],
"960": [0, 0.43056, 0.03588, 0],
"961": [0.19444, 0.43056, 0, 0.08334],
"962": [0.09722, 0.43056, 0.07986, 0.08334],
"963": [0, 0.43056, 0.03588, 0],
"964": [0, 0.43056, 0.1132, 0.02778],
"965": [0, 0.43056, 0.03588, 0.02778],
"966": [0.19444, 0.43056, 0, 0.08334],
"967": [0.19444, 0.43056, 0, 0.05556],
"968": [0.19444, 0.69444, 0.03588, 0.11111],
"969": [0, 0.43056, 0.03588, 0],
"977": [0, 0.69444, 0, 0.08334],
"981": [0.19444, 0.69444, 0, 0.08334],
"982": [0, 0.43056, 0.02778, 0],
"1009": [0.19444, 0.43056, 0, 0.08334],
"1013": [0, 0.43056, 0, 0.05556]
},
"Math-Regular": {
"65": [0, 0.68333, 0, 0.13889],
"66": [0, 0.68333, 0.05017, 0.08334],
"67": [0, 0.68333, 0.07153, 0.08334],
"68": [0, 0.68333, 0.02778, 0.05556],
"69": [0, 0.68333, 0.05764, 0.08334],
"70": [0, 0.68333, 0.13889, 0.08334],
"71": [0, 0.68333, 0, 0.08334],
"72": [0, 0.68333, 0.08125, 0.05556],
"73": [0, 0.68333, 0.07847, 0.11111],
"74": [0, 0.68333, 0.09618, 0.16667],
"75": [0, 0.68333, 0.07153, 0.05556],
"76": [0, 0.68333, 0, 0.02778],
"77": [0, 0.68333, 0.10903, 0.08334],
"78": [0, 0.68333, 0.10903, 0.08334],
"79": [0, 0.68333, 0.02778, 0.08334],
"80": [0, 0.68333, 0.13889, 0.08334],
"81": [0.19444, 0.68333, 0, 0.08334],
"82": [0, 0.68333, 0.00773, 0.08334],
"83": [0, 0.68333, 0.05764, 0.08334],
"84": [0, 0.68333, 0.13889, 0.08334],
"85": [0, 0.68333, 0.10903, 0.02778],
"86": [0, 0.68333, 0.22222, 0],
"87": [0, 0.68333, 0.13889, 0],
"88": [0, 0.68333, 0.07847, 0.08334],
"89": [0, 0.68333, 0.22222, 0],
"90": [0, 0.68333, 0.07153, 0.08334],
"97": [0, 0.43056, 0, 0],
"98": [0, 0.69444, 0, 0],
"99": [0, 0.43056, 0, 0.05556],
"100": [0, 0.69444, 0, 0.16667],
"101": [0, 0.43056, 0, 0.05556],
"102": [0.19444, 0.69444, 0.10764, 0.16667],
"103": [0.19444, 0.43056, 0.03588, 0.02778],
"104": [0, 0.69444, 0, 0],
"105": [0, 0.65952, 0, 0],
"106": [0.19444, 0.65952, 0.05724, 0],
"107": [0, 0.69444, 0.03148, 0],
"108": [0, 0.69444, 0.01968, 0.08334],
"109": [0, 0.43056, 0, 0],
"110": [0, 0.43056, 0, 0],
"111": [0, 0.43056, 0, 0.05556],
"112": [0.19444, 0.43056, 0, 0.08334],
"113": [0.19444, 0.43056, 0.03588, 0.08334],
"114": [0, 0.43056, 0.02778, 0.05556],
"115": [0, 0.43056, 0, 0.05556],
"116": [0, 0.61508, 0, 0.08334],
"117": [0, 0.43056, 0, 0.02778],
"118": [0, 0.43056, 0.03588, 0.02778],
"119": [0, 0.43056, 0.02691, 0.08334],
"120": [0, 0.43056, 0, 0.02778],
"121": [0.19444, 0.43056, 0.03588, 0.05556],
"122": [0, 0.43056, 0.04398, 0.05556],
"915": [0, 0.68333, 0.13889, 0.08334],
"916": [0, 0.68333, 0, 0.16667],
"920": [0, 0.68333, 0.02778, 0.08334],
"923": [0, 0.68333, 0, 0.16667],
"926": [0, 0.68333, 0.07569, 0.08334],
"928": [0, 0.68333, 0.08125, 0.05556],
"931": [0, 0.68333, 0.05764, 0.08334],
"933": [0, 0.68333, 0.13889, 0.05556],
"934": [0, 0.68333, 0, 0.08334],
"936": [0, 0.68333, 0.11, 0.05556],
"937": [0, 0.68333, 0.05017, 0.08334],
"945": [0, 0.43056, 0.0037, 0.02778],
"946": [0.19444, 0.69444, 0.05278, 0.08334],
"947": [0.19444, 0.43056, 0.05556, 0],
"948": [0, 0.69444, 0.03785, 0.05556],
"949": [0, 0.43056, 0, 0.08334],
"950": [0.19444, 0.69444, 0.07378, 0.08334],
"951": [0.19444, 0.43056, 0.03588, 0.05556],
"952": [0, 0.69444, 0.02778, 0.08334],
"953": [0, 0.43056, 0, 0.05556],
"954": [0, 0.43056, 0, 0],
"955": [0, 0.69444, 0, 0],
"956": [0.19444, 0.43056, 0, 0.02778],
"957": [0, 0.43056, 0.06366, 0.02778],
"958": [0.19444, 0.69444, 0.04601, 0.11111],
"959": [0, 0.43056, 0, 0.05556],
"960": [0, 0.43056, 0.03588, 0],
"961": [0.19444, 0.43056, 0, 0.08334],
"962": [0.09722, 0.43056, 0.07986, 0.08334],
"963": [0, 0.43056, 0.03588, 0],
"964": [0, 0.43056, 0.1132, 0.02778],
"965": [0, 0.43056, 0.03588, 0.02778],
"966": [0.19444, 0.43056, 0, 0.08334],
"967": [0.19444, 0.43056, 0, 0.05556],
"968": [0.19444, 0.69444, 0.03588, 0.11111],
"969": [0, 0.43056, 0.03588, 0],
"977": [0, 0.69444, 0, 0.08334],
"981": [0.19444, 0.69444, 0, 0.08334],
"982": [0, 0.43056, 0.02778, 0],
"1009": [0.19444, 0.43056, 0, 0.08334],
"1013": [0, 0.43056, 0, 0.05556]
},
"SansSerif-Regular": {
"33": [0, 0.69444, 0, 0],
"34": [0, 0.69444, 0, 0],
"35": [0.19444, 0.69444, 0, 0],
"36": [0.05556, 0.75, 0, 0],
"37": [0.05556, 0.75, 0, 0],
"38": [0, 0.69444, 0, 0],
"39": [0, 0.69444, 0, 0],
"40": [0.25, 0.75, 0, 0],
"41": [0.25, 0.75, 0, 0],
"42": [0, 0.75, 0, 0],
"43": [0.08333, 0.58333, 0, 0],
"44": [0.125, 0.08333, 0, 0],
"45": [0, 0.44444, 0, 0],
"46": [0, 0.08333, 0, 0],
"47": [0.25, 0.75, 0, 0],
"48": [0, 0.65556, 0, 0],
"49": [0, 0.65556, 0, 0],
"50": [0, 0.65556, 0, 0],
"51": [0, 0.65556, 0, 0],
"52": [0, 0.65556, 0, 0],
"53": [0, 0.65556, 0, 0],
"54": [0, 0.65556, 0, 0],
"55": [0, 0.65556, 0, 0],
"56": [0, 0.65556, 0, 0],
"57": [0, 0.65556, 0, 0],
"58": [0, 0.44444, 0, 0],
"59": [0.125, 0.44444, 0, 0],
"61": [-0.13, 0.37, 0, 0],
"63": [0, 0.69444, 0, 0],
"64": [0, 0.69444, 0, 0],
"65": [0, 0.69444, 0, 0],
"66": [0, 0.69444, 0, 0],
"67": [0, 0.69444, 0, 0],
"68": [0, 0.69444, 0, 0],
"69": [0, 0.69444, 0, 0],
"70": [0, 0.69444, 0, 0],
"71": [0, 0.69444, 0, 0],
"72": [0, 0.69444, 0, 0],
"73": [0, 0.69444, 0, 0],
"74": [0, 0.69444, 0, 0],
"75": [0, 0.69444, 0, 0],
"76": [0, 0.69444, 0, 0],
"77": [0, 0.69444, 0, 0],
"78": [0, 0.69444, 0, 0],
"79": [0, 0.69444, 0, 0],
"80": [0, 0.69444, 0, 0],
"81": [0.125, 0.69444, 0, 0],
"82": [0, 0.69444, 0, 0],
"83": [0, 0.69444, 0, 0],
"84": [0, 0.69444, 0, 0],
"85": [0, 0.69444, 0, 0],
"86": [0, 0.69444, 0.01389, 0],
"87": [0, 0.69444, 0.01389, 0],
"88": [0, 0.69444, 0, 0],
"89": [0, 0.69444, 0.025, 0],
"90": [0, 0.69444, 0, 0],
"91": [0.25, 0.75, 0, 0],
"93": [0.25, 0.75, 0, 0],
"94": [0, 0.69444, 0, 0],
"95": [0.35, 0.09444, 0.02778, 0],
"97": [0, 0.44444, 0, 0],
"98": [0, 0.69444, 0, 0],
"99": [0, 0.44444, 0, 0],
"100": [0, 0.69444, 0, 0],
"101": [0, 0.44444, 0, 0],
"102": [0, 0.69444, 0.06944, 0],
"103": [0.19444, 0.44444, 0.01389, 0],
"104": [0, 0.69444, 0, 0],
"105": [0, 0.67937, 0, 0],
"106": [0.19444, 0.67937, 0, 0],
"107": [0, 0.69444, 0, 0],
"108": [0, 0.69444, 0, 0],
"109": [0, 0.44444, 0, 0],
"110": [0, 0.44444, 0, 0],
"111": [0, 0.44444, 0, 0],
"112": [0.19444, 0.44444, 0, 0],
"113": [0.19444, 0.44444, 0, 0],
"114": [0, 0.44444, 0.01389, 0],
"115": [0, 0.44444, 0, 0],
"116": [0, 0.57143, 0, 0],
"117": [0, 0.44444, 0, 0],
"118": [0, 0.44444, 0.01389, 0],
"119": [0, 0.44444, 0.01389, 0],
"120": [0, 0.44444, 0, 0],
"121": [0.19444, 0.44444, 0.01389, 0],
"122": [0, 0.44444, 0, 0],
"126": [0.35, 0.32659, 0, 0],
"305": [0, 0.44444, 0, 0],
"567": [0.19444, 0.44444, 0, 0],
"768": [0, 0.69444, 0, 0],
"769": [0, 0.69444, 0, 0],
"770": [0, 0.69444, 0, 0],
"771": [0, 0.67659, 0, 0],
"772": [0, 0.60889, 0, 0],
"774": [0, 0.69444, 0, 0],
"775": [0, 0.67937, 0, 0],
"776": [0, 0.67937, 0, 0],
"778": [0, 0.69444, 0, 0],
"779": [0, 0.69444, 0, 0],
"780": [0, 0.63194, 0, 0],
"915": [0, 0.69444, 0, 0],
"916": [0, 0.69444, 0, 0],
"920": [0, 0.69444, 0, 0],
"923": [0, 0.69444, 0, 0],
"926": [0, 0.69444, 0, 0],
"928": [0, 0.69444, 0, 0],
"931": [0, 0.69444, 0, 0],
"933": [0, 0.69444, 0, 0],
"934": [0, 0.69444, 0, 0],
"936": [0, 0.69444, 0, 0],
"937": [0, 0.69444, 0, 0],
"8211": [0, 0.44444, 0.02778, 0],
"8212": [0, 0.44444, 0.02778, 0],
"8216": [0, 0.69444, 0, 0],
"8217": [0, 0.69444, 0, 0],
"8220": [0, 0.69444, 0, 0],
"8221": [0, 0.69444, 0, 0]
},
"Script-Regular": {
"65": [0, 0.7, 0.22925, 0],
"66": [0, 0.7, 0.04087, 0],
"67": [0, 0.7, 0.1689, 0],
"68": [0, 0.7, 0.09371, 0],
"69": [0, 0.7, 0.18583, 0],
"70": [0, 0.7, 0.13634, 0],
"71": [0, 0.7, 0.17322, 0],
"72": [0, 0.7, 0.29694, 0],
"73": [0, 0.7, 0.19189, 0],
"74": [0.27778, 0.7, 0.19189, 0],
"75": [0, 0.7, 0.31259, 0],
"76": [0, 0.7, 0.19189, 0],
"77": [0, 0.7, 0.15981, 0],
"78": [0, 0.7, 0.3525, 0],
"79": [0, 0.7, 0.08078, 0],
"80": [0, 0.7, 0.08078, 0],
"81": [0, 0.7, 0.03305, 0],
"82": [0, 0.7, 0.06259, 0],
"83": [0, 0.7, 0.19189, 0],
"84": [0, 0.7, 0.29087, 0],
"85": [0, 0.7, 0.25815, 0],
"86": [0, 0.7, 0.27523, 0],
"87": [0, 0.7, 0.27523, 0],
"88": [0, 0.7, 0.26006, 0],
"89": [0, 0.7, 0.2939, 0],
"90": [0, 0.7, 0.24037, 0]
},
"Size1-Regular": {
"40": [0.35001, 0.85, 0, 0],
"41": [0.35001, 0.85, 0, 0],
"47": [0.35001, 0.85, 0, 0],
"91": [0.35001, 0.85, 0, 0],
"92": [0.35001, 0.85, 0, 0],
"93": [0.35001, 0.85, 0, 0],
"123": [0.35001, 0.85, 0, 0],
"125": [0.35001, 0.85, 0, 0],
"710": [0, 0.72222, 0, 0],
"732": [0, 0.72222, 0, 0],
"770": [0, 0.72222, 0, 0],
"771": [0, 0.72222, 0, 0],
"8214": [-0.00099, 0.601, 0, 0],
"8593": [1e-05, 0.6, 0, 0],
"8595": [1e-05, 0.6, 0, 0],
"8657": [1e-05, 0.6, 0, 0],
"8659": [1e-05, 0.6, 0, 0],
"8719": [0.25001, 0.75, 0, 0],
"8720": [0.25001, 0.75, 0, 0],
"8721": [0.25001, 0.75, 0, 0],
"8730": [0.35001, 0.85, 0, 0],
"8739": [-0.00599, 0.606, 0, 0],
"8741": [-0.00599, 0.606, 0, 0],
"8747": [0.30612, 0.805, 0.19445, 0],
"8748": [0.306, 0.805, 0.19445, 0],
"8749": [0.306, 0.805, 0.19445, 0],
"8750": [0.30612, 0.805, 0.19445, 0],
"8896": [0.25001, 0.75, 0, 0],
"8897": [0.25001, 0.75, 0, 0],
"8898": [0.25001, 0.75, 0, 0],
"8899": [0.25001, 0.75, 0, 0],
"8968": [0.35001, 0.85, 0, 0],
"8969": [0.35001, 0.85, 0, 0],
"8970": [0.35001, 0.85, 0, 0],
"8971": [0.35001, 0.85, 0, 0],
"9168": [-0.00099, 0.601, 0, 0],
"10216": [0.35001, 0.85, 0, 0],
"10217": [0.35001, 0.85, 0, 0],
"10752": [0.25001, 0.75, 0, 0],
"10753": [0.25001, 0.75, 0, 0],
"10754": [0.25001, 0.75, 0, 0],
"10756": [0.25001, 0.75, 0, 0],
"10758": [0.25001, 0.75, 0, 0]
},
"Size2-Regular": {
"40": [0.65002, 1.15, 0, 0],
"41": [0.65002, 1.15, 0, 0],
"47": [0.65002, 1.15, 0, 0],
"91": [0.65002, 1.15, 0, 0],
"92": [0.65002, 1.15, 0, 0],
"93": [0.65002, 1.15, 0, 0],
"123": [0.65002, 1.15, 0, 0],
"125": [0.65002, 1.15, 0, 0],
"710": [0, 0.75, 0, 0],
"732": [0, 0.75, 0, 0],
"770": [0, 0.75, 0, 0],
"771": [0, 0.75, 0, 0],
"8719": [0.55001, 1.05, 0, 0],
"8720": [0.55001, 1.05, 0, 0],
"8721": [0.55001, 1.05, 0, 0],
"8730": [0.65002, 1.15, 0, 0],
"8747": [0.86225, 1.36, 0.44445, 0],
"8748": [0.862, 1.36, 0.44445, 0],
"8749": [0.862, 1.36, 0.44445, 0],
"8750": [0.86225, 1.36, 0.44445, 0],
"8896": [0.55001, 1.05, 0, 0],
"8897": [0.55001, 1.05, 0, 0],
"8898": [0.55001, 1.05, 0, 0],
"8899": [0.55001, 1.05, 0, 0],
"8968": [0.65002, 1.15, 0, 0],
"8969": [0.65002, 1.15, 0, 0],
"8970": [0.65002, 1.15, 0, 0],
"8971": [0.65002, 1.15, 0, 0],
"10216": [0.65002, 1.15, 0, 0],
"10217": [0.65002, 1.15, 0, 0],
"10752": [0.55001, 1.05, 0, 0],
"10753": [0.55001, 1.05, 0, 0],
"10754": [0.55001, 1.05, 0, 0],
"10756": [0.55001, 1.05, 0, 0],
"10758": [0.55001, 1.05, 0, 0]
},
"Size3-Regular": {
"40": [0.95003, 1.45, 0, 0],
"41": [0.95003, 1.45, 0, 0],
"47": [0.95003, 1.45, 0, 0],
"91": [0.95003, 1.45, 0, 0],
"92": [0.95003, 1.45, 0, 0],
"93": [0.95003, 1.45, 0, 0],
"123": [0.95003, 1.45, 0, 0],
"125": [0.95003, 1.45, 0, 0],
"710": [0, 0.75, 0, 0],
"732": [0, 0.75, 0, 0],
"770": [0, 0.75, 0, 0],
"771": [0, 0.75, 0, 0],
"8730": [0.95003, 1.45, 0, 0],
"8968": [0.95003, 1.45, 0, 0],
"8969": [0.95003, 1.45, 0, 0],
"8970": [0.95003, 1.45, 0, 0],
"8971": [0.95003, 1.45, 0, 0],
"10216": [0.95003, 1.45, 0, 0],
"10217": [0.95003, 1.45, 0, 0]
},
"Size4-Regular": {
"40": [1.25003, 1.75, 0, 0],
"41": [1.25003, 1.75, 0, 0],
"47": [1.25003, 1.75, 0, 0],
"91": [1.25003, 1.75, 0, 0],
"92": [1.25003, 1.75, 0, 0],
"93": [1.25003, 1.75, 0, 0],
"123": [1.25003, 1.75, 0, 0],
"125": [1.25003, 1.75, 0, 0],
"710": [0, 0.825, 0, 0],
"732": [0, 0.825, 0, 0],
"770": [0, 0.825, 0, 0],
"771": [0, 0.825, 0, 0],
"8730": [1.25003, 1.75, 0, 0],
"8968": [1.25003, 1.75, 0, 0],
"8969": [1.25003, 1.75, 0, 0],
"8970": [1.25003, 1.75, 0, 0],
"8971": [1.25003, 1.75, 0, 0],
"9115": [0.64502, 1.155, 0, 0],
"9116": [1e-05, 0.6, 0, 0],
"9117": [0.64502, 1.155, 0, 0],
"9118": [0.64502, 1.155, 0, 0],
"9119": [1e-05, 0.6, 0, 0],
"9120": [0.64502, 1.155, 0, 0],
"9121": [0.64502, 1.155, 0, 0],
"9122": [-0.00099, 0.601, 0, 0],
"9123": [0.64502, 1.155, 0, 0],
"9124": [0.64502, 1.155, 0, 0],
"9125": [-0.00099, 0.601, 0, 0],
"9126": [0.64502, 1.155, 0, 0],
"9127": [1e-05, 0.9, 0, 0],
"9128": [0.65002, 1.15, 0, 0],
"9129": [0.90001, 0, 0, 0],
"9130": [0, 0.3, 0, 0],
"9131": [1e-05, 0.9, 0, 0],
"9132": [0.65002, 1.15, 0, 0],
"9133": [0.90001, 0, 0, 0],
"9143": [0.88502, 0.915, 0, 0],
"10216": [1.25003, 1.75, 0, 0],
"10217": [1.25003, 1.75, 0, 0],
"57344": [-0.00499, 0.605, 0, 0],
"57345": [-0.00499, 0.605, 0, 0],
"57680": [0, 0.12, 0, 0],
"57681": [0, 0.12, 0, 0],
"57682": [0, 0.12, 0, 0],
"57683": [0, 0.12, 0, 0]
},
"Typewriter-Regular": {
"33": [0, 0.61111, 0, 0],
"34": [0, 0.61111, 0, 0],
"35": [0, 0.61111, 0, 0],
"36": [0.08333, 0.69444, 0, 0],
"37": [0.08333, 0.69444, 0, 0],
"38": [0, 0.61111, 0, 0],
"39": [0, 0.61111, 0, 0],
"40": [0.08333, 0.69444, 0, 0],
"41": [0.08333, 0.69444, 0, 0],
"42": [0, 0.52083, 0, 0],
"43": [-0.08056, 0.53055, 0, 0],
"44": [0.13889, 0.125, 0, 0],
"45": [-0.08056, 0.53055, 0, 0],
"46": [0, 0.125, 0, 0],
"47": [0.08333, 0.69444, 0, 0],
"48": [0, 0.61111, 0, 0],
"49": [0, 0.61111, 0, 0],
"50": [0, 0.61111, 0, 0],
"51": [0, 0.61111, 0, 0],
"52": [0, 0.61111, 0, 0],
"53": [0, 0.61111, 0, 0],
"54": [0, 0.61111, 0, 0],
"55": [0, 0.61111, 0, 0],
"56": [0, 0.61111, 0, 0],
"57": [0, 0.61111, 0, 0],
"58": [0, 0.43056, 0, 0],
"59": [0.13889, 0.43056, 0, 0],
"60": [-0.05556, 0.55556, 0, 0],
"61": [-0.19549, 0.41562, 0, 0],
"62": [-0.05556, 0.55556, 0, 0],
"63": [0, 0.61111, 0, 0],
"64": [0, 0.61111, 0, 0],
"65": [0, 0.61111, 0, 0],
"66": [0, 0.61111, 0, 0],
"67": [0, 0.61111, 0, 0],
"68": [0, 0.61111, 0, 0],
"69": [0, 0.61111, 0, 0],
"70": [0, 0.61111, 0, 0],
"71": [0, 0.61111, 0, 0],
"72": [0, 0.61111, 0, 0],
"73": [0, 0.61111, 0, 0],
"74": [0, 0.61111, 0, 0],
"75": [0, 0.61111, 0, 0],
"76": [0, 0.61111, 0, 0],
"77": [0, 0.61111, 0, 0],
"78": [0, 0.61111, 0, 0],
"79": [0, 0.61111, 0, 0],
"80": [0, 0.61111, 0, 0],
"81": [0.13889, 0.61111, 0, 0],
"82": [0, 0.61111, 0, 0],
"83": [0, 0.61111, 0, 0],
"84": [0, 0.61111, 0, 0],
"85": [0, 0.61111, 0, 0],
"86": [0, 0.61111, 0, 0],
"87": [0, 0.61111, 0, 0],
"88": [0, 0.61111, 0, 0],
"89": [0, 0.61111, 0, 0],
"90": [0, 0.61111, 0, 0],
"91": [0.08333, 0.69444, 0, 0],
"92": [0.08333, 0.69444, 0, 0],
"93": [0.08333, 0.69444, 0, 0],
"94": [0, 0.61111, 0, 0],
"95": [0.09514, 0, 0, 0],
"96": [0, 0.61111, 0, 0],
"97": [0, 0.43056, 0, 0],
"98": [0, 0.61111, 0, 0],
"99": [0, 0.43056, 0, 0],
"100": [0, 0.61111, 0, 0],
"101": [0, 0.43056, 0, 0],
"102": [0, 0.61111, 0, 0],
"103": [0.22222, 0.43056, 0, 0],
"104": [0, 0.61111, 0, 0],
"105": [0, 0.61111, 0, 0],
"106": [0.22222, 0.61111, 0, 0],
"107": [0, 0.61111, 0, 0],
"108": [0, 0.61111, 0, 0],
"109": [0, 0.43056, 0, 0],
"110": [0, 0.43056, 0, 0],
"111": [0, 0.43056, 0, 0],
"112": [0.22222, 0.43056, 0, 0],
"113": [0.22222, 0.43056, 0, 0],
"114": [0, 0.43056, 0, 0],
"115": [0, 0.43056, 0, 0],
"116": [0, 0.55358, 0, 0],
"117": [0, 0.43056, 0, 0],
"118": [0, 0.43056, 0, 0],
"119": [0, 0.43056, 0, 0],
"120": [0, 0.43056, 0, 0],
"121": [0.22222, 0.43056, 0, 0],
"122": [0, 0.43056, 0, 0],
"123": [0.08333, 0.69444, 0, 0],
"124": [0.08333, 0.69444, 0, 0],
"125": [0.08333, 0.69444, 0, 0],
"126": [0, 0.61111, 0, 0],
"127": [0, 0.61111, 0, 0],
"305": [0, 0.43056, 0, 0],
"567": [0.22222, 0.43056, 0, 0],
"768": [0, 0.61111, 0, 0],
"769": [0, 0.61111, 0, 0],
"770": [0, 0.61111, 0, 0],
"771": [0, 0.61111, 0, 0],
"772": [0, 0.56555, 0, 0],
"774": [0, 0.61111, 0, 0],
"776": [0, 0.61111, 0, 0],
"778": [0, 0.61111, 0, 0],
"780": [0, 0.56597, 0, 0],
"915": [0, 0.61111, 0, 0],
"916": [0, 0.61111, 0, 0],
"920": [0, 0.61111, 0, 0],
"923": [0, 0.61111, 0, 0],
"926": [0, 0.61111, 0, 0],
"928": [0, 0.61111, 0, 0],
"931": [0, 0.61111, 0, 0],
"933": [0, 0.61111, 0, 0],
"934": [0, 0.61111, 0, 0],
"936": [0, 0.61111, 0, 0],
"937": [0, 0.61111, 0, 0],
"2018": [0, 0.61111, 0, 0],
"2019": [0, 0.61111, 0, 0],
"8242": [0, 0.61111, 0, 0]
}
};
var cjkRegex = unicodeRegexes.cjkRegex;
/**
* This file contains metrics regarding fonts and individual symbols. The sigma
* and xi variables, as well as the metricMap map contain data extracted from
* TeX, TeX font metrics, and the TTF files. These data are then exposed via the
* `metrics` variable and the getCharacterMetrics function.
*/
// In TeX, there are actually three sets of dimensions, one for each of
// textstyle, scriptstyle, and scriptscriptstyle. These are provided in the
// the arrays below, in that order.
//
// The font metrics are stored in fonts cmsy10, cmsy7, and cmsy5 respsectively.
// This was determined by running the folllowing script:
//
// latex -interaction=nonstopmode \
// '\documentclass{article}\usepackage{amsmath}\begin{document}' \
// '$a$ \expandafter\show\the\textfont2' \
// '\expandafter\show\the\scriptfont2' \
// '\expandafter\show\the\scriptscriptfont2' \
// '\stop'
//
// The metrics themselves were retreived using the following commands:
//
// tftopl cmsy10
// tftopl cmsy7
// tftopl cmsy5
//
// The output of each of these commands is quite lengthy. The only part we
// care about is the FONTDIMEN section. Each value is measured in EMs.
var sigmas$1 = {
slant: [0.250, 0.250, 0.250], // sigma1
space: [0.000, 0.000, 0.000], // sigma2
stretch: [0.000, 0.000, 0.000], // sigma3
shrink: [0.000, 0.000, 0.000], // sigma4
xHeight: [0.431, 0.431, 0.431], // sigma5
quad: [1.000, 1.171, 1.472], // sigma6
extraSpace: [0.000, 0.000, 0.000], // sigma7
num1: [0.677, 0.732, 0.925], // sigma8
num2: [0.394, 0.384, 0.387], // sigma9
num3: [0.444, 0.471, 0.504], // sigma10
denom1: [0.686, 0.752, 1.025], // sigma11
denom2: [0.345, 0.344, 0.532], // sigma12
sup1: [0.413, 0.503, 0.504], // sigma13
sup2: [0.363, 0.431, 0.404], // sigma14
sup3: [0.289, 0.286, 0.294], // sigma15
sub1: [0.150, 0.143, 0.200], // sigma16
sub2: [0.247, 0.286, 0.400], // sigma17
supDrop: [0.386, 0.353, 0.494], // sigma18
subDrop: [0.050, 0.071, 0.100], // sigma19
delim1: [2.390, 1.700, 1.980], // sigma20
delim2: [1.010, 1.157, 1.420], // sigma21
axisHeight: [0.250, 0.250, 0.250] // sigma22
};
var xi8 = 0.04;
var xi9 = 0.111;
var xi10 = 0.166;
var xi11 = 0.2;
var xi12 = 0.6;
var xi13 = 0.1;
// This value determines how large a pt is, for metrics which are defined in
// terms of pts.
// This value is also used in katex.less; if you change it make sure the values
// match.
var ptPerEm = 10.0;
// The space between adjacent `|` columns in an array definition. From
// `\showthe\doublerulesep` in LaTeX.
var doubleRuleSep = 2.0 / ptPerEm;
/**
* This is just a mapping from common names to real metrics
*/
var metrics$1 = {
defaultRuleThickness: xi8,
bigOpSpacing1: xi9,
bigOpSpacing2: xi10,
bigOpSpacing3: xi11,
bigOpSpacing4: xi12,
bigOpSpacing5: xi13,
ptPerEm: ptPerEm,
doubleRuleSep: doubleRuleSep
};
// This map contains a mapping from font name and character code to character
// metrics, including height, depth, italic correction, and skew (kern from the
// character to the corresponding \skewchar)
// This map is generated via `make metrics`. It should not be changed manually.
var metricMap = fontMetricsData;
// These are very rough approximations. We default to Times New Roman which
// should have Latin-1 and Cyrillic characters, but may not depending on the
// operating system. The metrics do not account for extra height from the
// accents. In the case of Cyrillic characters which have both ascenders and
// descenders we prefer approximations with ascenders, primarily to prevent
// the fraction bar or root line from intersecting the glyph.
// TODO(kevinb) allow union of multiple glyph metrics for better accuracy.
var extraCharacterMap = {
// Latin-1
'À': 'A',
'Á': 'A',
'Â': 'A',
'Ã': 'A',
'Ä': 'A',
'Ã…': 'A',
'Æ': 'A',
'Ç': 'C',
'È': 'E',
'É': 'E',
'Ê': 'E',
'Ë': 'E',
'Ì': 'I',
'Í': 'I',
'ÃŽ': 'I',
'Ï': 'I',
'Ð': 'D',
'Ñ': 'N',
'Ã’': 'O',
'Ó': 'O',
'Ô': 'O',
'Õ': 'O',
'Ö': 'O',
'Ø': 'O',
'Ù': 'U',
'Ú': 'U',
'Û': 'U',
'Ü': 'U',
'Ý': 'Y',
'Þ': 'o',
'ß': 'B',
'Ã ': 'a',
'á': 'a',
'â': 'a',
'ã': 'a',
'ä': 'a',
'Ã¥': 'a',
'æ': 'a',
'ç': 'c',
'è': 'e',
'é': 'e',
'ê': 'e',
'ë': 'e',
'ì': 'i',
'í': 'i',
'î': 'i',
'ï': 'i',
'ð': 'd',
'ñ': 'n',
'ò': 'o',
'ó': 'o',
'ô': 'o',
'õ': 'o',
'ö': 'o',
'ø': 'o',
'ù': 'u',
'ú': 'u',
'û': 'u',
'ü': 'u',
'ý': 'y',
'þ': 'o',
'ÿ': 'y',
// Cyrillic
'А': 'A',
'Б': 'B',
'Ð’': 'B',
'Г': 'F',
'Д': 'A',
'Е': 'E',
'Ж': 'K',
'З': '3',
'И': 'N',
'Й': 'N',
'К': 'K',
'Л': 'N',
'М': 'M',
'Н': 'H',
'О': 'O',
'П': 'N',
'Ð ': 'P',
'С': 'C',
'Т': 'T',
'У': 'y',
'Ф': 'O',
'Ð¥': 'X',
'Ц': 'U',
'Ч': 'h',
'Ш': 'W',
'Щ': 'W',
'Ъ': 'B',
'Ы': 'X',
'Ь': 'B',
'Э': '3',
'Ю': 'X',
'Я': 'R',
'а': 'a',
'б': 'b',
'в': 'a',
'г': 'r',
'д': 'y',
'е': 'e',
'ж': 'm',
'з': 'e',
'и': 'n',
'й': 'n',
'к': 'n',
'л': 'n',
'м': 'm',
'н': 'n',
'о': 'o',
'п': 'n',
'Ñ€': 'p',
'с': 'c',
'Ñ‚': 'o',
'у': 'y',
'Ñ„': 'b',
'Ñ…': 'x',
'ц': 'n',
'ч': 'n',
'ш': 'w',
'щ': 'w',
'ÑŠ': 'a',
'Ñ‹': 'm',
'ь': 'a',
'э': 'e',
'ÑŽ': 'm',
'я': 'r'
};
/**
* This function is a convenience function for looking up information in the
* metricMap table. It takes a character as a string, and a style.
*
* Note: the `width` property may be undefined if fontMetricsData.js wasn't
* built using `Make extended_metrics`.
*/
var getCharacterMetrics = function(character, style) {
var ch = character.charCodeAt(0);
if (character[0] in extraCharacterMap) {
ch = extraCharacterMap[character[0]].charCodeAt(0);
} else if (cjkRegex.test(character[0])) {
ch = 'M'.charCodeAt(0);
}
var metrics = metricMap[style][ch];
if (metrics) {
return {
depth: metrics[0],
height: metrics[1],
italic: metrics[2],
skew: metrics[3],
width: metrics[4]
};
}
};
var fontMetrics$1 = {
metrics: metrics$1,
sigmas: sigmas$1,
getCharacterMetrics: getCharacterMetrics
};
/**
* This file contains information and classes for the various kinds of styles
* used in TeX. It provides a generic `Style` class, which holds information
* about a specific style. It then provides instances of all the different kinds
* of styles possible, and provides functions to move between them and get
* information about them.
*/
var sigmas = fontMetrics$1.sigmas;
var metrics = [{}, {}, {}];
var i$1;
for (var key in sigmas) {
if (sigmas.hasOwnProperty(key)) {
for (i$1 = 0; i$1 < 3; i$1++) {
metrics[i$1][key] = sigmas[key][i$1];
}
}
}
for (i$1 = 0; i$1 < 3; i$1++) {
metrics[i$1].emPerEx = sigmas.xHeight[i$1] / sigmas.quad[i$1];
}
/**
* The main style class. Contains a unique id for the style, a size (which is
* the same for cramped and uncramped version of a style), a cramped flag, and a
* size multiplier, which gives the size difference between a style and
* textstyle.
*/
function Style$2(id, size, multiplier, cramped) {
this.id = id;
this.size = size;
this.cramped = cramped;
this.sizeMultiplier = multiplier;
this.metrics = metrics[size > 0 ? size - 1 : 0];
}
/**
* Get the style of a superscript given a base in the current style.
*/
Style$2.prototype.sup = function() {
return styles$1[sup[this.id]];
};
/**
* Get the style of a subscript given a base in the current style.
*/
Style$2.prototype.sub = function() {
return styles$1[sub[this.id]];
};
/**
* Get the style of a fraction numerator given the fraction in the current
* style.
*/
Style$2.prototype.fracNum = function() {
return styles$1[fracNum[this.id]];
};
/**
* Get the style of a fraction denominator given the fraction in the current
* style.
*/
Style$2.prototype.fracDen = function() {
return styles$1[fracDen[this.id]];
};
/**
* Get the cramped version of a style (in particular, cramping a cramped style
* doesn't change the style).
*/
Style$2.prototype.cramp = function() {
return styles$1[cramp[this.id]];
};
/**
* HTML class name, like "displaystyle cramped"
*/
Style$2.prototype.cls = function() {
return sizeNames[this.size] + (this.cramped ? " cramped" : " uncramped");
};
/**
* HTML Reset class name, like "reset-textstyle"
*/
Style$2.prototype.reset = function() {
return resetNames[this.size];
};
/**
* Return if this style is tightly spaced (scriptstyle/scriptscriptstyle)
*/
Style$2.prototype.isTight = function() {
return this.size >= 2;
};
// IDs of the different styles
var D = 0;
var Dc = 1;
var T = 2;
var Tc = 3;
var S = 4;
var Sc = 5;
var SS = 6;
var SSc = 7;
// String names for the different sizes
var sizeNames = [
"displaystyle textstyle",
"textstyle",
"scriptstyle",
"scriptscriptstyle"
];
// Reset names for the different sizes
var resetNames = [
"reset-textstyle",
"reset-textstyle",
"reset-scriptstyle",
"reset-scriptscriptstyle"
];
// Instances of the different styles
var styles$1 = [
new Style$2(D, 0, 1.0, false),
new Style$2(Dc, 0, 1.0, true),
new Style$2(T, 1, 1.0, false),
new Style$2(Tc, 1, 1.0, true),
new Style$2(S, 2, 0.7, false),
new Style$2(Sc, 2, 0.7, true),
new Style$2(SS, 3, 0.5, false),
new Style$2(SSc, 3, 0.5, true)
];
// Lookup tables for switching from one style to another
var sup = [S, Sc, S, Sc, SS, SSc, SS, SSc];
var sub = [Sc, Sc, Sc, Sc, SSc, SSc, SSc, SSc];
var fracNum = [T, Tc, S, Sc, SS, SSc, SS, SSc];
var fracDen = [Tc, Tc, Sc, Sc, SSc, SSc, SSc, SSc];
var cramp = [Dc, Dc, Tc, Tc, Sc, Sc, SSc, SSc];
// We only export some of the styles. Also, we don't export the `Style` class so
// no more styles can be generated.
var Style_1 = {
DISPLAY: styles$1[D],
TEXT: styles$1[T],
SCRIPT: styles$1[S],
SCRIPTSCRIPT: styles$1[SS]
};
/**
* This file contains a list of utility functions which are useful in other
* files.
*/
/**
* Provide an `indexOf` function which works in IE8, but defers to native if
* possible.
*/
var nativeIndexOf = Array.prototype.indexOf;
var indexOf = function(list, elem) {
if (list == null) {
return -1;
}
if (nativeIndexOf && list.indexOf === nativeIndexOf) {
return list.indexOf(elem);
}
var i = 0;
var l = list.length;
for (; i < l; i++) {
if (list[i] === elem) {
return i;
}
}
return -1;
};
/**
* Return whether an element is contained in a list
*/
var contains = function(list, elem) {
return indexOf(list, elem) !== -1;
};
/**
* Provide a default value if a setting is undefined
*/
var deflt = function(setting, defaultIfUndefined) {
return setting === undefined ? defaultIfUndefined : setting;
};
// hyphenate and escape adapted from Facebook's React under Apache 2 license
var uppercase = /([A-Z])/g;
var hyphenate = function(str) {
return str.replace(uppercase, "-$1").toLowerCase();
};
var ESCAPE_LOOKUP = {
"&": "&amp;",
">": "&gt;",
"<": "&lt;",
"\"": "&quot;",
"'": "&#x27;"
};
var ESCAPE_REGEX = /[&><"']/g;
function escaper(match) {
return ESCAPE_LOOKUP[match];
}
/**
* Escapes text to prevent scripting attacks.
*
* @param {*} text Text value to escape.
* @return {string} An escaped string.
*/
function escape$1(text) {
return ("" + text).replace(ESCAPE_REGEX, escaper);
}
/**
* A function to set the text content of a DOM element in all supported
* browsers. Note that we don't define this if there is no document.
*/
var setTextContent;
if (typeof document !== "undefined") {
var testNode = document.createElement("span");
if ("textContent" in testNode) {
setTextContent = function(node, text) {
node.textContent = text;
};
} else {
setTextContent = function(node, text) {
node.innerText = text;
};
}
}
/**
* A function to clear a node.
*/
function clearNode(node) {
setTextContent(node, "");
}
var utils$4 = {
contains: contains,
deflt: deflt,
escape: escape$1,
hyphenate: hyphenate,
indexOf: indexOf,
setTextContent: setTextContent,
clearNode: clearNode
};
/**
* These objects store the data about the DOM nodes we create, as well as some
* extra data. They can then be transformed into real DOM nodes with the
* `toNode` function or HTML markup using `toMarkup`. They are useful for both
* storing extra properties on the nodes, as well as providing a way to easily
* work with the DOM.
*
* Similar functions for working with MathML nodes exist in mathMLTree.js.
*/
var unicodeRegexes$2 = unicodeRegexes;
var utils$3 = utils$4;
/**
* Create an HTML className based on a list of classes. In addition to joining
* with spaces, we also remove null or empty classes.
*/
var createClass = function(classes) {
classes = classes.slice();
for (var i = classes.length - 1; i >= 0; i--) {
if (!classes[i]) {
classes.splice(i, 1);
}
}
return classes.join(" ");
};
/**
* This node represents a span node, with a className, a list of children, and
* an inline style. It also contains information about its height, depth, and
* maxFontSize.
*/
function span(classes, children, options) {
this.classes = classes || [];
this.children = children || [];
this.height = 0;
this.depth = 0;
this.maxFontSize = 0;
this.style = {};
this.attributes = {};
if (options) {
if (options.style.isTight()) {
this.classes.push("mtight");
}
if (options.getColor()) {
this.style.color = options.getColor();
}
}
}
/**
* Sets an arbitrary attribute on the span. Warning: use this wisely. Not all
* browsers support attributes the same, and having too many custom attributes
* is probably bad.
*/
span.prototype.setAttribute = function(attribute, value) {
this.attributes[attribute] = value;
};
span.prototype.tryCombine = function(sibling) {
return false;
};
/**
* Convert the span into an HTML node
*/
span.prototype.toNode = function() {
var this$1 = this;
var span = document.createElement("span");
// Apply the class
span.className = createClass(this.classes);
// Apply inline styles
for (var style in this.style) {
if (Object.prototype.hasOwnProperty.call(this$1.style, style)) {
span.style[style] = this$1.style[style];
}
}
// Apply attributes
for (var attr in this.attributes) {
if (Object.prototype.hasOwnProperty.call(this$1.attributes, attr)) {
span.setAttribute(attr, this$1.attributes[attr]);
}
}
// Append the children, also as HTML nodes
for (var i = 0; i < this.children.length; i++) {
span.appendChild(this$1.children[i].toNode());
}
return span;
};
/**
* Convert the span into an HTML markup string
*/
span.prototype.toMarkup = function() {
var this$1 = this;
var markup = "<span";
// Add the class
if (this.classes.length) {
markup += " class=\"";
markup += utils$3.escape(createClass(this.classes));
markup += "\"";
}
var styles = "";
// Add the styles, after hyphenation
for (var style in this.style) {
if (this$1.style.hasOwnProperty(style)) {
styles += utils$3.hyphenate(style) + ":" + this$1.style[style] + ";";
}
}
if (styles) {
markup += " style=\"" + utils$3.escape(styles) + "\"";
}
// Add the attributes
for (var attr in this.attributes) {
if (Object.prototype.hasOwnProperty.call(this$1.attributes, attr)) {
markup += " " + attr + "=\"";
markup += utils$3.escape(this$1.attributes[attr]);
markup += "\"";
}
}
markup += ">";
// Add the markup of the children, also as markup
for (var i = 0; i < this.children.length; i++) {
markup += this$1.children[i].toMarkup();
}
markup += "</span>";
return markup;
};
/**
* This node represents a document fragment, which contains elements, but when
* placed into the DOM doesn't have any representation itself. Thus, it only
* contains children and doesn't have any HTML properties. It also keeps track
* of a height, depth, and maxFontSize.
*/
function documentFragment(children) {
this.children = children || [];
this.height = 0;
this.depth = 0;
this.maxFontSize = 0;
}
/**
* Convert the fragment into a node
*/
documentFragment.prototype.toNode = function() {
var this$1 = this;
// Create a fragment
var frag = document.createDocumentFragment();
// Append the children
for (var i = 0; i < this.children.length; i++) {
frag.appendChild(this$1.children[i].toNode());
}
return frag;
};
/**
* Convert the fragment into HTML markup
*/
documentFragment.prototype.toMarkup = function() {
var this$1 = this;
var markup = "";
// Simply concatenate the markup for the children together
for (var i = 0; i < this.children.length; i++) {
markup += this$1.children[i].toMarkup();
}
return markup;
};
var iCombinations = {
'î': '\u0131\u0302',
'ï': '\u0131\u0308',
'í': '\u0131\u0301',
// 'Ä«': '\u0131\u0304', // enable when we add Extended Latin
'ì': '\u0131\u0300'
};
/**
* A symbol node contains information about a single symbol. It either renders
* to a single text node, or a span with a single text node in it, depending on
* whether it has CSS classes, styles, or needs italic correction.
*/
function symbolNode(value, height, depth, italic, skew, classes, style) {
this.value = value || "";
this.height = height || 0;
this.depth = depth || 0;
this.italic = italic || 0;
this.skew = skew || 0;
this.classes = classes || [];
this.style = style || {};
this.maxFontSize = 0;
// Mark CJK characters with specific classes so that we can specify which
// fonts to use. This allows us to render these characters with a serif
// font in situations where the browser would either default to a sans serif
// or render a placeholder character.
if (unicodeRegexes$2.cjkRegex.test(value)) {
// I couldn't find any fonts that contained Hangul as well as all of
// the other characters we wanted to test there for it gets its own
// CSS class.
if (unicodeRegexes$2.hangulRegex.test(value)) {
this.classes.push('hangul_fallback');
} else {
this.classes.push('cjk_fallback');
}
}
if (/[îïíì]/.test(this.value)) { // add ī when we add Extended Latin
this.value = iCombinations[this.value];
}
}
symbolNode.prototype.tryCombine = function(sibling) {
var this$1 = this;
if (!sibling
|| !(sibling instanceof symbolNode)
|| this.italic > 0
|| createClass(this.classes) !== createClass(sibling.classes)
|| this.skew !== sibling.skew
|| this.maxFontSize !== sibling.maxFontSize) {
return false;
}
for (var style in this.style) {
if (this$1.style.hasOwnProperty(style)
&& this$1.style[style] !== sibling.style[style]) {
return false;
}
}
for (style in sibling.style) {
if (sibling.style.hasOwnProperty(style)
&& this$1.style[style] !== sibling.style[style]) {
return false;
}
}
this.value += sibling.value;
this.height = Math.max(this.height, sibling.height);
this.depth = Math.max(this.depth, sibling.depth);
this.italic = sibling.italic;
return true;
};
/**
* Creates a text node or span from a symbol node. Note that a span is only
* created if it is needed.
*/
symbolNode.prototype.toNode = function() {
var this$1 = this;
var node = document.createTextNode(this.value);
var span = null;
if (this.italic > 0) {
span = document.createElement("span");
span.style.marginRight = this.italic + "em";
}
if (this.classes.length > 0) {
span = span || document.createElement("span");
span.className = createClass(this.classes);
}
for (var style in this.style) {
if (this$1.style.hasOwnProperty(style)) {
span = span || document.createElement("span");
span.style[style] = this$1.style[style];
}
}
if (span) {
span.appendChild(node);
return span;
} else {
return node;
}
};
/**
* Creates markup for a symbol node.
*/
symbolNode.prototype.toMarkup = function() {
var this$1 = this;
// TODO(alpert): More duplication than I'd like from
// span.prototype.toMarkup and symbolNode.prototype.toNode...
var needsSpan = false;
var markup = "<span";
if (this.classes.length) {
needsSpan = true;
markup += " class=\"";
markup += utils$3.escape(createClass(this.classes));
markup += "\"";
}
var styles = "";
if (this.italic > 0) {
styles += "margin-right:" + this.italic + "em;";
}
for (var style in this.style) {
if (this$1.style.hasOwnProperty(style)) {
styles += utils$3.hyphenate(style) + ":" + this$1.style[style] + ";";
}
}
if (styles) {
needsSpan = true;
markup += " style=\"" + utils$3.escape(styles) + "\"";
}
var escaped = utils$3.escape(this.value);
if (needsSpan) {
markup += ">";
markup += escaped;
markup += "</span>";
return markup;
} else {
return escaped;
}
};
var domTree$2 = {
span: span,
documentFragment: documentFragment,
symbolNode: symbolNode
};
var symbols$1 = createCommonjsModule(function (module) {
/**
* This file holds a list of all no-argument functions and single-character
* symbols (like 'a' or ';').
*
* For each of the symbols, there are three properties they can have:
* - font (required): the font to be used for this symbol. Either "main" (the
normal font), or "ams" (the ams fonts).
* - group (required): the ParseNode group type the symbol should have (i.e.
"textord", "mathord", etc).
See https://github.com/Khan/KaTeX/wiki/Examining-TeX#group-types
* - replace: the character that this symbol or function should be
* replaced with (i.e. "\phi" has a replace value of "\u03d5", the phi
* character in the main font).
*
* The outermost map in the table indicates what mode the symbols should be
* accepted in (e.g. "math" or "text").
*/
module.exports = {
math: {},
text: {}
};
function defineSymbol(mode, font, group, replace, name) {
module.exports[mode][name] = {
font: font,
group: group,
replace: replace
};
}
// Some abbreviations for commonly used strings.
// This helps minify the code, and also spotting typos using jshint.
// modes:
var math = "math";
var text = "text";
// fonts:
var main = "main";
var ams = "ams";
// groups:
var accent = "accent";
var bin = "bin";
var close = "close";
var inner = "inner";
var mathord = "mathord";
var op = "op";
var open = "open";
var punct = "punct";
var rel = "rel";
var spacing = "spacing";
var textord = "textord";
// Now comes the symbol table
// Relation Symbols
defineSymbol(math, main, rel, "\u2261", "\\equiv");
defineSymbol(math, main, rel, "\u227a", "\\prec");
defineSymbol(math, main, rel, "\u227b", "\\succ");
defineSymbol(math, main, rel, "\u223c", "\\sim");
defineSymbol(math, main, rel, "\u22a5", "\\perp");
defineSymbol(math, main, rel, "\u2aaf", "\\preceq");
defineSymbol(math, main, rel, "\u2ab0", "\\succeq");
defineSymbol(math, main, rel, "\u2243", "\\simeq");
defineSymbol(math, main, rel, "\u2223", "\\mid");
defineSymbol(math, main, rel, "\u226a", "\\ll");
defineSymbol(math, main, rel, "\u226b", "\\gg");
defineSymbol(math, main, rel, "\u224d", "\\asymp");
defineSymbol(math, main, rel, "\u2225", "\\parallel");
defineSymbol(math, main, rel, "\u22c8", "\\bowtie");
defineSymbol(math, main, rel, "\u2323", "\\smile");
defineSymbol(math, main, rel, "\u2291", "\\sqsubseteq");
defineSymbol(math, main, rel, "\u2292", "\\sqsupseteq");
defineSymbol(math, main, rel, "\u2250", "\\doteq");
defineSymbol(math, main, rel, "\u2322", "\\frown");
defineSymbol(math, main, rel, "\u220b", "\\ni");
defineSymbol(math, main, rel, "\u221d", "\\propto");
defineSymbol(math, main, rel, "\u22a2", "\\vdash");
defineSymbol(math, main, rel, "\u22a3", "\\dashv");
defineSymbol(math, main, rel, "\u220b", "\\owns");
// Punctuation
defineSymbol(math, main, punct, "\u002e", "\\ldotp");
defineSymbol(math, main, punct, "\u22c5", "\\cdotp");
// Misc Symbols
defineSymbol(math, main, textord, "\u0023", "\\#");
defineSymbol(text, main, textord, "\u0023", "\\#");
defineSymbol(math, main, textord, "\u0026", "\\&");
defineSymbol(text, main, textord, "\u0026", "\\&");
defineSymbol(math, main, textord, "\u2135", "\\aleph");
defineSymbol(math, main, textord, "\u2200", "\\forall");
defineSymbol(math, main, textord, "\u210f", "\\hbar");
defineSymbol(math, main, textord, "\u2203", "\\exists");
defineSymbol(math, main, textord, "\u2207", "\\nabla");
defineSymbol(math, main, textord, "\u266d", "\\flat");
defineSymbol(math, main, textord, "\u2113", "\\ell");
defineSymbol(math, main, textord, "\u266e", "\\natural");
defineSymbol(math, main, textord, "\u2663", "\\clubsuit");
defineSymbol(math, main, textord, "\u2118", "\\wp");
defineSymbol(math, main, textord, "\u266f", "\\sharp");
defineSymbol(math, main, textord, "\u2662", "\\diamondsuit");
defineSymbol(math, main, textord, "\u211c", "\\Re");
defineSymbol(math, main, textord, "\u2661", "\\heartsuit");
defineSymbol(math, main, textord, "\u2111", "\\Im");
defineSymbol(math, main, textord, "\u2660", "\\spadesuit");
// Math and Text
defineSymbol(math, main, textord, "\u2020", "\\dag");
defineSymbol(math, main, textord, "\u2021", "\\ddag");
// Large Delimiters
defineSymbol(math, main, close, "\u23b1", "\\rmoustache");
defineSymbol(math, main, open, "\u23b0", "\\lmoustache");
defineSymbol(math, main, close, "\u27ef", "\\rgroup");
defineSymbol(math, main, open, "\u27ee", "\\lgroup");
// Binary Operators
defineSymbol(math, main, bin, "\u2213", "\\mp");
defineSymbol(math, main, bin, "\u2296", "\\ominus");
defineSymbol(math, main, bin, "\u228e", "\\uplus");
defineSymbol(math, main, bin, "\u2293", "\\sqcap");
defineSymbol(math, main, bin, "\u2217", "\\ast");
defineSymbol(math, main, bin, "\u2294", "\\sqcup");
defineSymbol(math, main, bin, "\u25ef", "\\bigcirc");
defineSymbol(math, main, bin, "\u2219", "\\bullet");
defineSymbol(math, main, bin, "\u2021", "\\ddagger");
defineSymbol(math, main, bin, "\u2240", "\\wr");
defineSymbol(math, main, bin, "\u2a3f", "\\amalg");
// Arrow Symbols
defineSymbol(math, main, rel, "\u27f5", "\\longleftarrow");
defineSymbol(math, main, rel, "\u21d0", "\\Leftarrow");
defineSymbol(math, main, rel, "\u27f8", "\\Longleftarrow");
defineSymbol(math, main, rel, "\u27f6", "\\longrightarrow");
defineSymbol(math, main, rel, "\u21d2", "\\Rightarrow");
defineSymbol(math, main, rel, "\u27f9", "\\Longrightarrow");
defineSymbol(math, main, rel, "\u2194", "\\leftrightarrow");
defineSymbol(math, main, rel, "\u27f7", "\\longleftrightarrow");
defineSymbol(math, main, rel, "\u21d4", "\\Leftrightarrow");
defineSymbol(math, main, rel, "\u27fa", "\\Longleftrightarrow");
defineSymbol(math, main, rel, "\u21a6", "\\mapsto");
defineSymbol(math, main, rel, "\u27fc", "\\longmapsto");
defineSymbol(math, main, rel, "\u2197", "\\nearrow");
defineSymbol(math, main, rel, "\u21a9", "\\hookleftarrow");
defineSymbol(math, main, rel, "\u21aa", "\\hookrightarrow");
defineSymbol(math, main, rel, "\u2198", "\\searrow");
defineSymbol(math, main, rel, "\u21bc", "\\leftharpoonup");
defineSymbol(math, main, rel, "\u21c0", "\\rightharpoonup");
defineSymbol(math, main, rel, "\u2199", "\\swarrow");
defineSymbol(math, main, rel, "\u21bd", "\\leftharpoondown");
defineSymbol(math, main, rel, "\u21c1", "\\rightharpoondown");
defineSymbol(math, main, rel, "\u2196", "\\nwarrow");
defineSymbol(math, main, rel, "\u21cc", "\\rightleftharpoons");
// AMS Negated Binary Relations
defineSymbol(math, ams, rel, "\u226e", "\\nless");
defineSymbol(math, ams, rel, "\ue010", "\\nleqslant");
defineSymbol(math, ams, rel, "\ue011", "\\nleqq");
defineSymbol(math, ams, rel, "\u2a87", "\\lneq");
defineSymbol(math, ams, rel, "\u2268", "\\lneqq");
defineSymbol(math, ams, rel, "\ue00c", "\\lvertneqq");
defineSymbol(math, ams, rel, "\u22e6", "\\lnsim");
defineSymbol(math, ams, rel, "\u2a89", "\\lnapprox");
defineSymbol(math, ams, rel, "\u2280", "\\nprec");
defineSymbol(math, ams, rel, "\u22e0", "\\npreceq");
defineSymbol(math, ams, rel, "\u22e8", "\\precnsim");
defineSymbol(math, ams, rel, "\u2ab9", "\\precnapprox");
defineSymbol(math, ams, rel, "\u2241", "\\nsim");
defineSymbol(math, ams, rel, "\ue006", "\\nshortmid");
defineSymbol(math, ams, rel, "\u2224", "\\nmid");
defineSymbol(math, ams, rel, "\u22ac", "\\nvdash");
defineSymbol(math, ams, rel, "\u22ad", "\\nvDash");
defineSymbol(math, ams, rel, "\u22ea", "\\ntriangleleft");
defineSymbol(math, ams, rel, "\u22ec", "\\ntrianglelefteq");
defineSymbol(math, ams, rel, "\u228a", "\\subsetneq");
defineSymbol(math, ams, rel, "\ue01a", "\\varsubsetneq");
defineSymbol(math, ams, rel, "\u2acb", "\\subsetneqq");
defineSymbol(math, ams, rel, "\ue017", "\\varsubsetneqq");
defineSymbol(math, ams, rel, "\u226f", "\\ngtr");
defineSymbol(math, ams, rel, "\ue00f", "\\ngeqslant");
defineSymbol(math, ams, rel, "\ue00e", "\\ngeqq");
defineSymbol(math, ams, rel, "\u2a88", "\\gneq");
defineSymbol(math, ams, rel, "\u2269", "\\gneqq");
defineSymbol(math, ams, rel, "\ue00d", "\\gvertneqq");
defineSymbol(math, ams, rel, "\u22e7", "\\gnsim");
defineSymbol(math, ams, rel, "\u2a8a", "\\gnapprox");
defineSymbol(math, ams, rel, "\u2281", "\\nsucc");
defineSymbol(math, ams, rel, "\u22e1", "\\nsucceq");
defineSymbol(math, ams, rel, "\u22e9", "\\succnsim");
defineSymbol(math, ams, rel, "\u2aba", "\\succnapprox");
defineSymbol(math, ams, rel, "\u2246", "\\ncong");
defineSymbol(math, ams, rel, "\ue007", "\\nshortparallel");
defineSymbol(math, ams, rel, "\u2226", "\\nparallel");
defineSymbol(math, ams, rel, "\u22af", "\\nVDash");
defineSymbol(math, ams, rel, "\u22eb", "\\ntriangleright");
defineSymbol(math, ams, rel, "\u22ed", "\\ntrianglerighteq");
defineSymbol(math, ams, rel, "\ue018", "\\nsupseteqq");
defineSymbol(math, ams, rel, "\u228b", "\\supsetneq");
defineSymbol(math, ams, rel, "\ue01b", "\\varsupsetneq");
defineSymbol(math, ams, rel, "\u2acc", "\\supsetneqq");
defineSymbol(math, ams, rel, "\ue019", "\\varsupsetneqq");
defineSymbol(math, ams, rel, "\u22ae", "\\nVdash");
defineSymbol(math, ams, rel, "\u2ab5", "\\precneqq");
defineSymbol(math, ams, rel, "\u2ab6", "\\succneqq");
defineSymbol(math, ams, rel, "\ue016", "\\nsubseteqq");
defineSymbol(math, ams, bin, "\u22b4", "\\unlhd");
defineSymbol(math, ams, bin, "\u22b5", "\\unrhd");
// AMS Negated Arrows
defineSymbol(math, ams, rel, "\u219a", "\\nleftarrow");
defineSymbol(math, ams, rel, "\u219b", "\\nrightarrow");
defineSymbol(math, ams, rel, "\u21cd", "\\nLeftarrow");
defineSymbol(math, ams, rel, "\u21cf", "\\nRightarrow");
defineSymbol(math, ams, rel, "\u21ae", "\\nleftrightarrow");
defineSymbol(math, ams, rel, "\u21ce", "\\nLeftrightarrow");
// AMS Misc
defineSymbol(math, ams, rel, "\u25b3", "\\vartriangle");
defineSymbol(math, ams, textord, "\u210f", "\\hslash");
defineSymbol(math, ams, textord, "\u25bd", "\\triangledown");
defineSymbol(math, ams, textord, "\u25ca", "\\lozenge");
defineSymbol(math, ams, textord, "\u24c8", "\\circledS");
defineSymbol(math, ams, textord, "\u00ae", "\\circledR");
defineSymbol(math, ams, textord, "\u2221", "\\measuredangle");
defineSymbol(math, ams, textord, "\u2204", "\\nexists");
defineSymbol(math, ams, textord, "\u2127", "\\mho");
defineSymbol(math, ams, textord, "\u2132", "\\Finv");
defineSymbol(math, ams, textord, "\u2141", "\\Game");
defineSymbol(math, ams, textord, "\u006b", "\\Bbbk");
defineSymbol(math, ams, textord, "\u2035", "\\backprime");
defineSymbol(math, ams, textord, "\u25b2", "\\blacktriangle");
defineSymbol(math, ams, textord, "\u25bc", "\\blacktriangledown");
defineSymbol(math, ams, textord, "\u25a0", "\\blacksquare");
defineSymbol(math, ams, textord, "\u29eb", "\\blacklozenge");
defineSymbol(math, ams, textord, "\u2605", "\\bigstar");
defineSymbol(math, ams, textord, "\u2222", "\\sphericalangle");
defineSymbol(math, ams, textord, "\u2201", "\\complement");
defineSymbol(math, ams, textord, "\u00f0", "\\eth");
defineSymbol(math, ams, textord, "\u2571", "\\diagup");
defineSymbol(math, ams, textord, "\u2572", "\\diagdown");
defineSymbol(math, ams, textord, "\u25a1", "\\square");
defineSymbol(math, ams, textord, "\u25a1", "\\Box");
defineSymbol(math, ams, textord, "\u25ca", "\\Diamond");
defineSymbol(math, ams, textord, "\u00a5", "\\yen");
defineSymbol(math, ams, textord, "\u2713", "\\checkmark");
// AMS Hebrew
defineSymbol(math, ams, textord, "\u2136", "\\beth");
defineSymbol(math, ams, textord, "\u2138", "\\daleth");
defineSymbol(math, ams, textord, "\u2137", "\\gimel");
// AMS Greek
defineSymbol(math, ams, textord, "\u03dd", "\\digamma");
defineSymbol(math, ams, textord, "\u03f0", "\\varkappa");
// AMS Delimiters
defineSymbol(math, ams, open, "\u250c", "\\ulcorner");
defineSymbol(math, ams, close, "\u2510", "\\urcorner");
defineSymbol(math, ams, open, "\u2514", "\\llcorner");
defineSymbol(math, ams, close, "\u2518", "\\lrcorner");
// AMS Binary Relations
defineSymbol(math, ams, rel, "\u2266", "\\leqq");
defineSymbol(math, ams, rel, "\u2a7d", "\\leqslant");
defineSymbol(math, ams, rel, "\u2a95", "\\eqslantless");
defineSymbol(math, ams, rel, "\u2272", "\\lesssim");
defineSymbol(math, ams, rel, "\u2a85", "\\lessapprox");
defineSymbol(math, ams, rel, "\u224a", "\\approxeq");
defineSymbol(math, ams, bin, "\u22d6", "\\lessdot");
defineSymbol(math, ams, rel, "\u22d8", "\\lll");
defineSymbol(math, ams, rel, "\u2276", "\\lessgtr");
defineSymbol(math, ams, rel, "\u22da", "\\lesseqgtr");
defineSymbol(math, ams, rel, "\u2a8b", "\\lesseqqgtr");
defineSymbol(math, ams, rel, "\u2251", "\\doteqdot");
defineSymbol(math, ams, rel, "\u2253", "\\risingdotseq");
defineSymbol(math, ams, rel, "\u2252", "\\fallingdotseq");
defineSymbol(math, ams, rel, "\u223d", "\\backsim");
defineSymbol(math, ams, rel, "\u22cd", "\\backsimeq");
defineSymbol(math, ams, rel, "\u2ac5", "\\subseteqq");
defineSymbol(math, ams, rel, "\u22d0", "\\Subset");
defineSymbol(math, ams, rel, "\u228f", "\\sqsubset");
defineSymbol(math, ams, rel, "\u227c", "\\preccurlyeq");
defineSymbol(math, ams, rel, "\u22de", "\\curlyeqprec");
defineSymbol(math, ams, rel, "\u227e", "\\precsim");
defineSymbol(math, ams, rel, "\u2ab7", "\\precapprox");
defineSymbol(math, ams, rel, "\u22b2", "\\vartriangleleft");
defineSymbol(math, ams, rel, "\u22b4", "\\trianglelefteq");
defineSymbol(math, ams, rel, "\u22a8", "\\vDash");
defineSymbol(math, ams, rel, "\u22aa", "\\Vvdash");
defineSymbol(math, ams, rel, "\u2323", "\\smallsmile");
defineSymbol(math, ams, rel, "\u2322", "\\smallfrown");
defineSymbol(math, ams, rel, "\u224f", "\\bumpeq");
defineSymbol(math, ams, rel, "\u224e", "\\Bumpeq");
defineSymbol(math, ams, rel, "\u2267", "\\geqq");
defineSymbol(math, ams, rel, "\u2a7e", "\\geqslant");
defineSymbol(math, ams, rel, "\u2a96", "\\eqslantgtr");
defineSymbol(math, ams, rel, "\u2273", "\\gtrsim");
defineSymbol(math, ams, rel, "\u2a86", "\\gtrapprox");
defineSymbol(math, ams, bin, "\u22d7", "\\gtrdot");
defineSymbol(math, ams, rel, "\u22d9", "\\ggg");
defineSymbol(math, ams, rel, "\u2277", "\\gtrless");
defineSymbol(math, ams, rel, "\u22db", "\\gtreqless");
defineSymbol(math, ams, rel, "\u2a8c", "\\gtreqqless");
defineSymbol(math, ams, rel, "\u2256", "\\eqcirc");
defineSymbol(math, ams, rel, "\u2257", "\\circeq");
defineSymbol(math, ams, rel, "\u225c", "\\triangleq");
defineSymbol(math, ams, rel, "\u223c", "\\thicksim");
defineSymbol(math, ams, rel, "\u2248", "\\thickapprox");
defineSymbol(math, ams, rel, "\u2ac6", "\\supseteqq");
defineSymbol(math, ams, rel, "\u22d1", "\\Supset");
defineSymbol(math, ams, rel, "\u2290", "\\sqsupset");
defineSymbol(math, ams, rel, "\u227d", "\\succcurlyeq");
defineSymbol(math, ams, rel, "\u22df", "\\curlyeqsucc");
defineSymbol(math, ams, rel, "\u227f", "\\succsim");
defineSymbol(math, ams, rel, "\u2ab8", "\\succapprox");
defineSymbol(math, ams, rel, "\u22b3", "\\vartriangleright");
defineSymbol(math, ams, rel, "\u22b5", "\\trianglerighteq");
defineSymbol(math, ams, rel, "\u22a9", "\\Vdash");
defineSymbol(math, ams, rel, "\u2223", "\\shortmid");
defineSymbol(math, ams, rel, "\u2225", "\\shortparallel");
defineSymbol(math, ams, rel, "\u226c", "\\between");
defineSymbol(math, ams, rel, "\u22d4", "\\pitchfork");
defineSymbol(math, ams, rel, "\u221d", "\\varpropto");
defineSymbol(math, ams, rel, "\u25c0", "\\blacktriangleleft");
defineSymbol(math, ams, rel, "\u2234", "\\therefore");
defineSymbol(math, ams, rel, "\u220d", "\\backepsilon");
defineSymbol(math, ams, rel, "\u25b6", "\\blacktriangleright");
defineSymbol(math, ams, rel, "\u2235", "\\because");
defineSymbol(math, ams, rel, "\u22d8", "\\llless");
defineSymbol(math, ams, rel, "\u22d9", "\\gggtr");
defineSymbol(math, ams, bin, "\u22b2", "\\lhd");
defineSymbol(math, ams, bin, "\u22b3", "\\rhd");
defineSymbol(math, ams, rel, "\u2242", "\\eqsim");
defineSymbol(math, main, rel, "\u22c8", "\\Join");
defineSymbol(math, ams, rel, "\u2251", "\\Doteq");
// AMS Binary Operators
defineSymbol(math, ams, bin, "\u2214", "\\dotplus");
defineSymbol(math, ams, bin, "\u2216", "\\smallsetminus");
defineSymbol(math, ams, bin, "\u22d2", "\\Cap");
defineSymbol(math, ams, bin, "\u22d3", "\\Cup");
defineSymbol(math, ams, bin, "\u2a5e", "\\doublebarwedge");
defineSymbol(math, ams, bin, "\u229f", "\\boxminus");
defineSymbol(math, ams, bin, "\u229e", "\\boxplus");
defineSymbol(math, ams, bin, "\u22c7", "\\divideontimes");
defineSymbol(math, ams, bin, "\u22c9", "\\ltimes");
defineSymbol(math, ams, bin, "\u22ca", "\\rtimes");
defineSymbol(math, ams, bin, "\u22cb", "\\leftthreetimes");
defineSymbol(math, ams, bin, "\u22cc", "\\rightthreetimes");
defineSymbol(math, ams, bin, "\u22cf", "\\curlywedge");
defineSymbol(math, ams, bin, "\u22ce", "\\curlyvee");
defineSymbol(math, ams, bin, "\u229d", "\\circleddash");
defineSymbol(math, ams, bin, "\u229b", "\\circledast");
defineSymbol(math, ams, bin, "\u22c5", "\\centerdot");
defineSymbol(math, ams, bin, "\u22ba", "\\intercal");
defineSymbol(math, ams, bin, "\u22d2", "\\doublecap");
defineSymbol(math, ams, bin, "\u22d3", "\\doublecup");
defineSymbol(math, ams, bin, "\u22a0", "\\boxtimes");
// AMS Arrows
defineSymbol(math, ams, rel, "\u21e2", "\\dashrightarrow");
defineSymbol(math, ams, rel, "\u21e0", "\\dashleftarrow");
defineSymbol(math, ams, rel, "\u21c7", "\\leftleftarrows");
defineSymbol(math, ams, rel, "\u21c6", "\\leftrightarrows");
defineSymbol(math, ams, rel, "\u21da", "\\Lleftarrow");
defineSymbol(math, ams, rel, "\u219e", "\\twoheadleftarrow");
defineSymbol(math, ams, rel, "\u21a2", "\\leftarrowtail");
defineSymbol(math, ams, rel, "\u21ab", "\\looparrowleft");
defineSymbol(math, ams, rel, "\u21cb", "\\leftrightharpoons");
defineSymbol(math, ams, rel, "\u21b6", "\\curvearrowleft");
defineSymbol(math, ams, rel, "\u21ba", "\\circlearrowleft");
defineSymbol(math, ams, rel, "\u21b0", "\\Lsh");
defineSymbol(math, ams, rel, "\u21c8", "\\upuparrows");
defineSymbol(math, ams, rel, "\u21bf", "\\upharpoonleft");
defineSymbol(math, ams, rel, "\u21c3", "\\downharpoonleft");
defineSymbol(math, ams, rel, "\u22b8", "\\multimap");
defineSymbol(math, ams, rel, "\u21ad", "\\leftrightsquigarrow");
defineSymbol(math, ams, rel, "\u21c9", "\\rightrightarrows");
defineSymbol(math, ams, rel, "\u21c4", "\\rightleftarrows");
defineSymbol(math, ams, rel, "\u21a0", "\\twoheadrightarrow");
defineSymbol(math, ams, rel, "\u21a3", "\\rightarrowtail");
defineSymbol(math, ams, rel, "\u21ac", "\\looparrowright");
defineSymbol(math, ams, rel, "\u21b7", "\\curvearrowright");
defineSymbol(math, ams, rel, "\u21bb", "\\circlearrowright");
defineSymbol(math, ams, rel, "\u21b1", "\\Rsh");
defineSymbol(math, ams, rel, "\u21ca", "\\downdownarrows");
defineSymbol(math, ams, rel, "\u21be", "\\upharpoonright");
defineSymbol(math, ams, rel, "\u21c2", "\\downharpoonright");
defineSymbol(math, ams, rel, "\u21dd", "\\rightsquigarrow");
defineSymbol(math, ams, rel, "\u21dd", "\\leadsto");
defineSymbol(math, ams, rel, "\u21db", "\\Rrightarrow");
defineSymbol(math, ams, rel, "\u21be", "\\restriction");
defineSymbol(math, main, textord, "\u2018", "`");
defineSymbol(math, main, textord, "$", "\\$");
defineSymbol(text, main, textord, "$", "\\$");
defineSymbol(math, main, textord, "%", "\\%");
defineSymbol(text, main, textord, "%", "\\%");
defineSymbol(math, main, textord, "_", "\\_");
defineSymbol(text, main, textord, "_", "\\_");
defineSymbol(math, main, textord, "\u2220", "\\angle");
defineSymbol(math, main, textord, "\u221e", "\\infty");
defineSymbol(math, main, textord, "\u2032", "\\prime");
defineSymbol(math, main, textord, "\u25b3", "\\triangle");
defineSymbol(math, main, textord, "\u0393", "\\Gamma");
defineSymbol(math, main, textord, "\u0394", "\\Delta");
defineSymbol(math, main, textord, "\u0398", "\\Theta");
defineSymbol(math, main, textord, "\u039b", "\\Lambda");
defineSymbol(math, main, textord, "\u039e", "\\Xi");
defineSymbol(math, main, textord, "\u03a0", "\\Pi");
defineSymbol(math, main, textord, "\u03a3", "\\Sigma");
defineSymbol(math, main, textord, "\u03a5", "\\Upsilon");
defineSymbol(math, main, textord, "\u03a6", "\\Phi");
defineSymbol(math, main, textord, "\u03a8", "\\Psi");
defineSymbol(math, main, textord, "\u03a9", "\\Omega");
defineSymbol(math, main, textord, "\u00ac", "\\neg");
defineSymbol(math, main, textord, "\u00ac", "\\lnot");
defineSymbol(math, main, textord, "\u22a4", "\\top");
defineSymbol(math, main, textord, "\u22a5", "\\bot");
defineSymbol(math, main, textord, "\u2205", "\\emptyset");
defineSymbol(math, ams, textord, "\u2205", "\\varnothing");
defineSymbol(math, main, mathord, "\u03b1", "\\alpha");
defineSymbol(math, main, mathord, "\u03b2", "\\beta");
defineSymbol(math, main, mathord, "\u03b3", "\\gamma");
defineSymbol(math, main, mathord, "\u03b4", "\\delta");
defineSymbol(math, main, mathord, "\u03f5", "\\epsilon");
defineSymbol(math, main, mathord, "\u03b6", "\\zeta");
defineSymbol(math, main, mathord, "\u03b7", "\\eta");
defineSymbol(math, main, mathord, "\u03b8", "\\theta");
defineSymbol(math, main, mathord, "\u03b9", "\\iota");
defineSymbol(math, main, mathord, "\u03ba", "\\kappa");
defineSymbol(math, main, mathord, "\u03bb", "\\lambda");
defineSymbol(math, main, mathord, "\u03bc", "\\mu");
defineSymbol(math, main, mathord, "\u03bd", "\\nu");
defineSymbol(math, main, mathord, "\u03be", "\\xi");
defineSymbol(math, main, mathord, "o", "\\omicron");
defineSymbol(math, main, mathord, "\u03c0", "\\pi");
defineSymbol(math, main, mathord, "\u03c1", "\\rho");
defineSymbol(math, main, mathord, "\u03c3", "\\sigma");
defineSymbol(math, main, mathord, "\u03c4", "\\tau");
defineSymbol(math, main, mathord, "\u03c5", "\\upsilon");
defineSymbol(math, main, mathord, "\u03d5", "\\phi");
defineSymbol(math, main, mathord, "\u03c7", "\\chi");
defineSymbol(math, main, mathord, "\u03c8", "\\psi");
defineSymbol(math, main, mathord, "\u03c9", "\\omega");
defineSymbol(math, main, mathord, "\u03b5", "\\varepsilon");
defineSymbol(math, main, mathord, "\u03d1", "\\vartheta");
defineSymbol(math, main, mathord, "\u03d6", "\\varpi");
defineSymbol(math, main, mathord, "\u03f1", "\\varrho");
defineSymbol(math, main, mathord, "\u03c2", "\\varsigma");
defineSymbol(math, main, mathord, "\u03c6", "\\varphi");
defineSymbol(math, main, bin, "\u2217", "*");
defineSymbol(math, main, bin, "+", "+");
defineSymbol(math, main, bin, "\u2212", "-");
defineSymbol(math, main, bin, "\u22c5", "\\cdot");
defineSymbol(math, main, bin, "\u2218", "\\circ");
defineSymbol(math, main, bin, "\u00f7", "\\div");
defineSymbol(math, main, bin, "\u00b1", "\\pm");
defineSymbol(math, main, bin, "\u00d7", "\\times");
defineSymbol(math, main, bin, "\u2229", "\\cap");
defineSymbol(math, main, bin, "\u222a", "\\cup");
defineSymbol(math, main, bin, "\u2216", "\\setminus");
defineSymbol(math, main, bin, "\u2227", "\\land");
defineSymbol(math, main, bin, "\u2228", "\\lor");
defineSymbol(math, main, bin, "\u2227", "\\wedge");
defineSymbol(math, main, bin, "\u2228", "\\vee");
defineSymbol(math, main, textord, "\u221a", "\\surd");
defineSymbol(math, main, open, "(", "(");
defineSymbol(math, main, open, "[", "[");
defineSymbol(math, main, open, "\u27e8", "\\langle");
defineSymbol(math, main, open, "\u2223", "\\lvert");
defineSymbol(math, main, open, "\u2225", "\\lVert");
defineSymbol(math, main, close, ")", ")");
defineSymbol(math, main, close, "]", "]");
defineSymbol(math, main, close, "?", "?");
defineSymbol(math, main, close, "!", "!");
defineSymbol(math, main, close, "\u27e9", "\\rangle");
defineSymbol(math, main, close, "\u2223", "\\rvert");
defineSymbol(math, main, close, "\u2225", "\\rVert");
defineSymbol(math, main, rel, "=", "=");
defineSymbol(math, main, rel, "<", "<");
defineSymbol(math, main, rel, ">", ">");
defineSymbol(math, main, rel, ":", ":");
defineSymbol(math, main, rel, "\u2248", "\\approx");
defineSymbol(math, main, rel, "\u2245", "\\cong");
defineSymbol(math, main, rel, "\u2265", "\\ge");
defineSymbol(math, main, rel, "\u2265", "\\geq");
defineSymbol(math, main, rel, "\u2190", "\\gets");
defineSymbol(math, main, rel, ">", "\\gt");
defineSymbol(math, main, rel, "\u2208", "\\in");
defineSymbol(math, main, rel, "\u2209", "\\notin");
defineSymbol(math, main, rel, "\u2282", "\\subset");
defineSymbol(math, main, rel, "\u2283", "\\supset");
defineSymbol(math, main, rel, "\u2286", "\\subseteq");
defineSymbol(math, main, rel, "\u2287", "\\supseteq");
defineSymbol(math, ams, rel, "\u2288", "\\nsubseteq");
defineSymbol(math, ams, rel, "\u2289", "\\nsupseteq");
defineSymbol(math, main, rel, "\u22a8", "\\models");
defineSymbol(math, main, rel, "\u2190", "\\leftarrow");
defineSymbol(math, main, rel, "\u2264", "\\le");
defineSymbol(math, main, rel, "\u2264", "\\leq");
defineSymbol(math, main, rel, "<", "\\lt");
defineSymbol(math, main, rel, "\u2260", "\\ne");
defineSymbol(math, main, rel, "\u2260", "\\neq");
defineSymbol(math, main, rel, "\u2192", "\\rightarrow");
defineSymbol(math, main, rel, "\u2192", "\\to");
defineSymbol(math, ams, rel, "\u2271", "\\ngeq");
defineSymbol(math, ams, rel, "\u2270", "\\nleq");
defineSymbol(math, main, spacing, null, "\\!");
defineSymbol(math, main, spacing, "\u00a0", "\\ ");
defineSymbol(math, main, spacing, "\u00a0", "~");
defineSymbol(math, main, spacing, null, "\\,");
defineSymbol(math, main, spacing, null, "\\:");
defineSymbol(math, main, spacing, null, "\\;");
defineSymbol(math, main, spacing, null, "\\enspace");
defineSymbol(math, main, spacing, null, "\\qquad");
defineSymbol(math, main, spacing, null, "\\quad");
defineSymbol(math, main, spacing, "\u00a0", "\\space");
defineSymbol(math, main, punct, ",", ",");
defineSymbol(math, main, punct, ";", ";");
defineSymbol(math, main, punct, ":", "\\colon");
defineSymbol(math, ams, bin, "\u22bc", "\\barwedge");
defineSymbol(math, ams, bin, "\u22bb", "\\veebar");
defineSymbol(math, main, bin, "\u2299", "\\odot");
defineSymbol(math, main, bin, "\u2295", "\\oplus");
defineSymbol(math, main, bin, "\u2297", "\\otimes");
defineSymbol(math, main, textord, "\u2202", "\\partial");
defineSymbol(math, main, bin, "\u2298", "\\oslash");
defineSymbol(math, ams, bin, "\u229a", "\\circledcirc");
defineSymbol(math, ams, bin, "\u22a1", "\\boxdot");
defineSymbol(math, main, bin, "\u25b3", "\\bigtriangleup");
defineSymbol(math, main, bin, "\u25bd", "\\bigtriangledown");
defineSymbol(math, main, bin, "\u2020", "\\dagger");
defineSymbol(math, main, bin, "\u22c4", "\\diamond");
defineSymbol(math, main, bin, "\u22c6", "\\star");
defineSymbol(math, main, bin, "\u25c3", "\\triangleleft");
defineSymbol(math, main, bin, "\u25b9", "\\triangleright");
defineSymbol(math, main, open, "{", "\\{");
defineSymbol(text, main, textord, "{", "\\{");
defineSymbol(math, main, close, "}", "\\}");
defineSymbol(text, main, textord, "}", "\\}");
defineSymbol(math, main, open, "{", "\\lbrace");
defineSymbol(math, main, close, "}", "\\rbrace");
defineSymbol(math, main, open, "[", "\\lbrack");
defineSymbol(math, main, close, "]", "\\rbrack");
defineSymbol(math, main, open, "\u230a", "\\lfloor");
defineSymbol(math, main, close, "\u230b", "\\rfloor");
defineSymbol(math, main, open, "\u2308", "\\lceil");
defineSymbol(math, main, close, "\u2309", "\\rceil");
defineSymbol(math, main, textord, "\\", "\\backslash");
defineSymbol(math, main, textord, "\u2223", "|");
defineSymbol(math, main, textord, "\u2223", "\\vert");
defineSymbol(math, main, textord, "\u2225", "\\|");
defineSymbol(math, main, textord, "\u2225", "\\Vert");
defineSymbol(math, main, rel, "\u2191", "\\uparrow");
defineSymbol(math, main, rel, "\u21d1", "\\Uparrow");
defineSymbol(math, main, rel, "\u2193", "\\downarrow");
defineSymbol(math, main, rel, "\u21d3", "\\Downarrow");
defineSymbol(math, main, rel, "\u2195", "\\updownarrow");
defineSymbol(math, main, rel, "\u21d5", "\\Updownarrow");
defineSymbol(math, math, op, "\u2210", "\\coprod");
defineSymbol(math, math, op, "\u22c1", "\\bigvee");
defineSymbol(math, math, op, "\u22c0", "\\bigwedge");
defineSymbol(math, math, op, "\u2a04", "\\biguplus");
defineSymbol(math, math, op, "\u22c2", "\\bigcap");
defineSymbol(math, math, op, "\u22c3", "\\bigcup");
defineSymbol(math, math, op, "\u222b", "\\int");
defineSymbol(math, math, op, "\u222b", "\\intop");
defineSymbol(math, math, op, "\u222c", "\\iint");
defineSymbol(math, math, op, "\u222d", "\\iiint");
defineSymbol(math, math, op, "\u220f", "\\prod");
defineSymbol(math, math, op, "\u2211", "\\sum");
defineSymbol(math, math, op, "\u2a02", "\\bigotimes");
defineSymbol(math, math, op, "\u2a01", "\\bigoplus");
defineSymbol(math, math, op, "\u2a00", "\\bigodot");
defineSymbol(math, math, op, "\u222e", "\\oint");
defineSymbol(math, math, op, "\u2a06", "\\bigsqcup");
defineSymbol(math, math, op, "\u222b", "\\smallint");
defineSymbol(text, main, inner, "\u2026", "\\textellipsis");
defineSymbol(math, main, inner, "\u2026", "\\mathellipsis");
defineSymbol(text, main, inner, "\u2026", "\\ldots");
defineSymbol(math, main, inner, "\u2026", "\\ldots");
defineSymbol(math, main, inner, "\u22ef", "\\cdots");
defineSymbol(math, main, inner, "\u22f1", "\\ddots");
defineSymbol(math, main, textord, "\u22ee", "\\vdots");
defineSymbol(math, main, accent, "\u00b4", "\\acute");
defineSymbol(math, main, accent, "\u0060", "\\grave");
defineSymbol(math, main, accent, "\u00a8", "\\ddot");
defineSymbol(math, main, accent, "\u007e", "\\tilde");
defineSymbol(math, main, accent, "\u00af", "\\bar");
defineSymbol(math, main, accent, "\u02d8", "\\breve");
defineSymbol(math, main, accent, "\u02c7", "\\check");
defineSymbol(math, main, accent, "\u005e", "\\hat");
defineSymbol(math, main, accent, "\u20d7", "\\vec");
defineSymbol(math, main, accent, "\u02d9", "\\dot");
defineSymbol(math, main, mathord, "\u0131", "\\imath");
defineSymbol(math, main, mathord, "\u0237", "\\jmath");
defineSymbol(text, main, textord, "\u2013", "--");
defineSymbol(text, main, textord, "\u2014", "---");
defineSymbol(text, main, textord, "\u2018", "`");
defineSymbol(text, main, textord, "\u2019", "'");
defineSymbol(text, main, textord, "\u201c", "``");
defineSymbol(text, main, textord, "\u201d", "''");
defineSymbol(math, main, textord, "\u00b0", "\\degree");
defineSymbol(text, main, textord, "\u00b0", "\\degree");
defineSymbol(math, main, mathord, "\u00a3", "\\pounds");
defineSymbol(math, ams, textord, "\u2720", "\\maltese");
defineSymbol(text, ams, textord, "\u2720", "\\maltese");
defineSymbol(text, main, spacing, "\u00a0", "\\ ");
defineSymbol(text, main, spacing, "\u00a0", " ");
defineSymbol(text, main, spacing, "\u00a0", "~");
// There are lots of symbols which are the same, so we add them in afterwards.
var i;
var ch;
// All of these are textords in math mode
var mathTextSymbols = "0123456789/@.\"";
for (i = 0; i < mathTextSymbols.length; i++) {
ch = mathTextSymbols.charAt(i);
defineSymbol(math, main, textord, ch, ch);
}
// All of these are textords in text mode
var textSymbols = "0123456789!@*()-=+[]\";:?/.,";
for (i = 0; i < textSymbols.length; i++) {
ch = textSymbols.charAt(i);
defineSymbol(text, main, textord, ch, ch);
}
// All of these are textords in text mode, and mathords in math mode
var letters = "abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ";
for (i = 0; i < letters.length; i++) {
ch = letters.charAt(i);
defineSymbol(math, main, mathord, ch, ch);
defineSymbol(text, main, textord, ch, ch);
}
// Latin-1 letters
for (i = 0x00C0; i <= 0x00D6; i++) {
ch = String.fromCharCode(i);
defineSymbol(text, main, textord, ch, ch);
}
for (i = 0x00D8; i <= 0x00F6; i++) {
ch = String.fromCharCode(i);
defineSymbol(text, main, textord, ch, ch);
}
for (i = 0x00F8; i <= 0x00FF; i++) {
ch = String.fromCharCode(i);
defineSymbol(text, main, textord, ch, ch);
}
// Cyrillic
for (i = 0x0410; i <= 0x044F; i++) {
ch = String.fromCharCode(i);
defineSymbol(text, main, textord, ch, ch);
}
// Unicode versions of existing characters
defineSymbol(text, main, textord, "\u2013", "–");
defineSymbol(text, main, textord, "\u2014", "—");
defineSymbol(text, main, textord, "\u2018", "‘");
defineSymbol(text, main, textord, "\u2019", "’");
defineSymbol(text, main, textord, "\u201c", "“");
defineSymbol(text, main, textord, "\u201d", "”");
});
/* eslint no-console:0 */
/**
* This module contains general functions that can be used for building
* different kinds of domTree nodes in a consistent manner.
*/
var domTree$1 = domTree$2;
var fontMetrics$3 = fontMetrics$1;
var symbols = symbols$1;
var utils$2 = utils$4;
var greekCapitals = [
"\\Gamma",
"\\Delta",
"\\Theta",
"\\Lambda",
"\\Xi",
"\\Pi",
"\\Sigma",
"\\Upsilon",
"\\Phi",
"\\Psi",
"\\Omega"
];
// The following have to be loaded from Main-Italic font, using class mainit
var mainitLetters = [
"\u0131", // dotless i, \imath
"\u0237", // dotless j, \jmath
"\u00a3" // \pounds
];
/**
* Makes a symbolNode after translation via the list of symbols in symbols.js.
* Correctly pulls out metrics for the character, and optionally takes a list of
* classes to be attached to the node.
*
* TODO: make argument order closer to makeSpan
* TODO: add a separate argument for math class (e.g. `mop`, `mbin`), which
* should if present come first in `classes`.
*/
var makeSymbol = function(value, fontFamily, mode, options, classes) {
// Replace the value with its replaced value from symbol.js
if (symbols[mode][value] && symbols[mode][value].replace) {
value = symbols[mode][value].replace;
}
var metrics = fontMetrics$3.getCharacterMetrics(value, fontFamily);
var symbolNode;
if (metrics) {
var italic = metrics.italic;
if (mode === "text") {
italic = 0;
}
symbolNode = new domTree$1.symbolNode(
value, metrics.height, metrics.depth, italic, metrics.skew,
classes);
} else {
// TODO(emily): Figure out a good way to only print this in development
typeof console !== "undefined" && console.warn(
"No character metrics for '" + value + "' in style '" +
fontFamily + "'");
symbolNode = new domTree$1.symbolNode(value, 0, 0, 0, 0, classes);
}
if (options) {
if (options.style.isTight()) {
symbolNode.classes.push("mtight");
}
if (options.getColor()) {
symbolNode.style.color = options.getColor();
}
}
return symbolNode;
};
/**
* Makes a symbol in Main-Regular or AMS-Regular.
* Used for rel, bin, open, close, inner, and punct.
*/
var mathsym = function(value, mode, options, classes) {
// Decide what font to render the symbol in by its entry in the symbols
// table.
// Have a special case for when the value = \ because the \ is used as a
// textord in unsupported command errors but cannot be parsed as a regular
// text ordinal and is therefore not present as a symbol in the symbols
// table for text
if (value === "\\" || symbols[mode][value].font === "main") {
return makeSymbol(value, "Main-Regular", mode, options, classes);
} else {
return makeSymbol(
value, "AMS-Regular", mode, options, classes.concat(["amsrm"]));
}
};
/**
* Makes a symbol in the default font for mathords and textords.
*/
var mathDefault = function(value, mode, options, classes, type) {
if (type === "mathord") {
return mathit(value, mode, options, classes);
} else if (type === "textord") {
return makeSymbol(
value, "Main-Regular", mode, options, classes.concat(["mathrm"]));
} else {
throw new Error("unexpected type: " + type + " in mathDefault");
}
};
/**
* Makes a symbol in the italic math font.
*/
var mathit = function(value, mode, options, classes) {
if (/[0-9]/.test(value.charAt(0)) ||
// glyphs for \imath and \jmath do not exist in Math-Italic so we
// need to use Main-Italic instead
utils$2.contains(mainitLetters, value) ||
utils$2.contains(greekCapitals, value)) {
return makeSymbol(
value, "Main-Italic", mode, options, classes.concat(["mainit"]));
} else {
return makeSymbol(
value, "Math-Italic", mode, options, classes.concat(["mathit"]));
}
};
/**
* Makes either a mathord or textord in the correct font and color.
*/
var makeOrd = function(group, options, type) {
var mode = group.mode;
var value = group.value;
if (symbols[mode][value] && symbols[mode][value].replace) {
value = symbols[mode][value].replace;
}
var classes = ["mord"];
var font = options.font;
if (font) {
if (font === "mathit" || utils$2.contains(mainitLetters, value)) {
return mathit(value, mode, options, classes);
} else {
var fontName = fontMap[font].fontName;
if (fontMetrics$3.getCharacterMetrics(value, fontName)) {
return makeSymbol(
value, fontName, mode, options, classes.concat([font]));
} else {
return mathDefault(value, mode, options, classes, type);
}
}
} else {
return mathDefault(value, mode, options, classes, type);
}
};
/**
* Calculate the height, depth, and maxFontSize of an element based on its
* children.
*/
var sizeElementFromChildren = function(elem) {
var height = 0;
var depth = 0;
var maxFontSize = 0;
if (elem.children) {
for (var i = 0; i < elem.children.length; i++) {
if (elem.children[i].height > height) {
height = elem.children[i].height;
}
if (elem.children[i].depth > depth) {
depth = elem.children[i].depth;
}
if (elem.children[i].maxFontSize > maxFontSize) {
maxFontSize = elem.children[i].maxFontSize;
}
}
}
elem.height = height;
elem.depth = depth;
elem.maxFontSize = maxFontSize;
};
/**
* Makes a span with the given list of classes, list of children, and options.
*
* TODO: Ensure that `options` is always provided (currently some call sites
* don't pass it).
* TODO: add a separate argument for math class (e.g. `mop`, `mbin`), which
* should if present come first in `classes`.
*/
var makeSpan$2 = function(classes, children, options) {
var span = new domTree$1.span(classes, children, options);
sizeElementFromChildren(span);
return span;
};
/**
* Prepends the given children to the given span, updating height, depth, and
* maxFontSize.
*/
var prependChildren = function(span, children) {
span.children = children.concat(span.children);
sizeElementFromChildren(span);
};
/**
* Makes a document fragment with the given list of children.
*/
var makeFragment = function(children) {
var fragment = new domTree$1.documentFragment(children);
sizeElementFromChildren(fragment);
return fragment;
};
/**
* Makes an element placed in each of the vlist elements to ensure that each
* element has the same max font size. To do this, we create a zero-width space
* with the correct font size.
*/
var makeFontSizer = function(options, fontSize) {
var fontSizeInner = makeSpan$2([], [new domTree$1.symbolNode("\u200b")]);
fontSizeInner.style.fontSize =
(fontSize / options.style.sizeMultiplier) + "em";
var fontSizer = makeSpan$2(
["fontsize-ensurer", "reset-" + options.size, "size5"],
[fontSizeInner]);
return fontSizer;
};
/**
* Makes a vertical list by stacking elements and kerns on top of each other.
* Allows for many different ways of specifying the positioning method.
*
* Arguments:
* - children: A list of child or kern nodes to be stacked on top of each other
* (i.e. the first element will be at the bottom, and the last at
* the top). Element nodes are specified as
* {type: "elem", elem: node}
* while kern nodes are specified as
* {type: "kern", size: size}
* - positionType: The method by which the vlist should be positioned. Valid
* values are:
* - "individualShift": The children list only contains elem
* nodes, and each node contains an extra
* "shift" value of how much it should be
* shifted (note that shifting is always
* moving downwards). positionData is
* ignored.
* - "top": The positionData specifies the topmost point of
* the vlist (note this is expected to be a height,
* so positive values move up)
* - "bottom": The positionData specifies the bottommost point
* of the vlist (note this is expected to be a
* depth, so positive values move down
* - "shift": The vlist will be positioned such that its
* baseline is positionData away from the baseline
* of the first child. Positive values move
* downwards.
* - "firstBaseline": The vlist will be positioned such that
* its baseline is aligned with the
* baseline of the first child.
* positionData is ignored. (this is
* equivalent to "shift" with
* positionData=0)
* - positionData: Data used in different ways depending on positionType
* - options: An Options object
*
*/
var makeVList = function(children, positionType, positionData, options) {
var depth;
var currPos;
var i;
if (positionType === "individualShift") {
var oldChildren = children;
children = [oldChildren[0]];
// Add in kerns to the list of children to get each element to be
// shifted to the correct specified shift
depth = -oldChildren[0].shift - oldChildren[0].elem.depth;
currPos = depth;
for (i = 1; i < oldChildren.length; i++) {
var diff = -oldChildren[i].shift - currPos -
oldChildren[i].elem.depth;
var size = diff -
(oldChildren[i - 1].elem.height +
oldChildren[i - 1].elem.depth);
currPos = currPos + diff;
children.push({type: "kern", size: size});
children.push(oldChildren[i]);
}
} else if (positionType === "top") {
// We always start at the bottom, so calculate the bottom by adding up
// all the sizes
var bottom = positionData;
for (i = 0; i < children.length; i++) {
if (children[i].type === "kern") {
bottom -= children[i].size;
} else {
bottom -= children[i].elem.height + children[i].elem.depth;
}
}
depth = bottom;
} else if (positionType === "bottom") {
depth = -positionData;
} else if (positionType === "shift") {
depth = -children[0].elem.depth - positionData;
} else if (positionType === "firstBaseline") {
depth = -children[0].elem.depth;
} else {
depth = 0;
}
// Make the fontSizer
var maxFontSize = 0;
for (i = 0; i < children.length; i++) {
if (children[i].type === "elem") {
maxFontSize = Math.max(maxFontSize, children[i].elem.maxFontSize);
}
}
var fontSizer = makeFontSizer(options, maxFontSize);
// Create a new list of actual children at the correct offsets
var realChildren = [];
currPos = depth;
for (i = 0; i < children.length; i++) {
if (children[i].type === "kern") {
currPos += children[i].size;
} else {
var child = children[i].elem;
var shift = -child.depth - currPos;
currPos += child.height + child.depth;
var childWrap = makeSpan$2([], [fontSizer, child]);
childWrap.height -= shift;
childWrap.depth += shift;
childWrap.style.top = shift + "em";
realChildren.push(childWrap);
}
}
// Add in an element at the end with no offset to fix the calculation of
// baselines in some browsers (namely IE, sometimes safari)
var baselineFix = makeSpan$2(
["baseline-fix"], [fontSizer, new domTree$1.symbolNode("\u200b")]);
realChildren.push(baselineFix);
var vlist = makeSpan$2(["vlist"], realChildren);
// Fix the final height and depth, in case there were kerns at the ends
// since the makeSpan calculation won't take that in to account.
vlist.height = Math.max(currPos, vlist.height);
vlist.depth = Math.max(-depth, vlist.depth);
return vlist;
};
// A table of size -> font size for the different sizing functions
var sizingMultiplier = {
size1: 0.5,
size2: 0.7,
size3: 0.8,
size4: 0.9,
size5: 1.0,
size6: 1.2,
size7: 1.44,
size8: 1.73,
size9: 2.07,
size10: 2.49
};
// A map of spacing functions to their attributes, like size and corresponding
// CSS class
var spacingFunctions = {
"\\qquad": {
size: "2em",
className: "qquad"
},
"\\quad": {
size: "1em",
className: "quad"
},
"\\enspace": {
size: "0.5em",
className: "enspace"
},
"\\;": {
size: "0.277778em",
className: "thickspace"
},
"\\:": {
size: "0.22222em",
className: "mediumspace"
},
"\\,": {
size: "0.16667em",
className: "thinspace"
},
"\\!": {
size: "-0.16667em",
className: "negativethinspace"
}
};
/**
* Maps TeX font commands to objects containing:
* - variant: string used for "mathvariant" attribute in buildMathML.js
* - fontName: the "style" parameter to fontMetrics.getCharacterMetrics
*/
// A map between tex font commands an MathML mathvariant attribute values
var fontMap = {
// styles
"mathbf": {
variant: "bold",
fontName: "Main-Bold"
},
"mathrm": {
variant: "normal",
fontName: "Main-Regular"
},
"textit": {
variant: "italic",
fontName: "Main-Italic"
},
// "mathit" is missing because it requires the use of two fonts: Main-Italic
// and Math-Italic. This is handled by a special case in makeOrd which ends
// up calling mathit.
// families
"mathbb": {
variant: "double-struck",
fontName: "AMS-Regular"
},
"mathcal": {
variant: "script",
fontName: "Caligraphic-Regular"
},
"mathfrak": {
variant: "fraktur",
fontName: "Fraktur-Regular"
},
"mathscr": {
variant: "script",
fontName: "Script-Regular"
},
"mathsf": {
variant: "sans-serif",
fontName: "SansSerif-Regular"
},
"mathtt": {
variant: "monospace",
fontName: "Typewriter-Regular"
}
};
var buildCommon$2 = {
fontMap: fontMap,
makeSymbol: makeSymbol,
mathsym: mathsym,
makeSpan: makeSpan$2,
makeFragment: makeFragment,
makeVList: makeVList,
makeOrd: makeOrd,
prependChildren: prependChildren,
sizingMultiplier: sizingMultiplier,
spacingFunctions: spacingFunctions
};
/**
* This file deals with creating delimiters of various sizes. The TeXbook
* discusses these routines on page 441-442, in the "Another subroutine sets box
* x to a specified variable delimiter" paragraph.
*
* There are three main routines here. `makeSmallDelim` makes a delimiter in the
* normal font, but in either text, script, or scriptscript style.
* `makeLargeDelim` makes a delimiter in textstyle, but in one of the Size1,
* Size2, Size3, or Size4 fonts. `makeStackedDelim` makes a delimiter out of
* smaller pieces that are stacked on top of one another.
*
* The functions take a parameter `center`, which determines if the delimiter
* should be centered around the axis.
*
* Then, there are three exposed functions. `sizedDelim` makes a delimiter in
* one of the given sizes. This is used for things like `\bigl`.
* `customSizedDelim` makes a delimiter with a given total height+depth. It is
* called in places like `\sqrt`. `leftRightDelim` makes an appropriate
* delimiter which surrounds an expression of a given height an depth. It is
* used in `\left` and `\right`.
*/
var ParseError$3 = ParseError_1;
var Style$4 = Style_1;
var buildCommon$4 = buildCommon$2;
var fontMetrics$4 = fontMetrics$1;
var symbols$3 = symbols$1;
var utils$6 = utils$4;
var makeSpan$3 = buildCommon$4.makeSpan;
/**
* Get the metrics for a given symbol and font, after transformation (i.e.
* after following replacement from symbols.js)
*/
var getMetrics = function(symbol, font) {
if (symbols$3.math[symbol] && symbols$3.math[symbol].replace) {
return fontMetrics$4.getCharacterMetrics(
symbols$3.math[symbol].replace, font);
} else {
return fontMetrics$4.getCharacterMetrics(
symbol, font);
}
};
/**
* Builds a symbol in the given font size (note size is an integer)
*/
var mathrmSize = function(value, size, mode, options) {
return buildCommon$4.makeSymbol(value, "Size" + size + "-Regular",
mode, options);
};
/**
* Puts a delimiter span in a given style, and adds appropriate height, depth,
* and maxFontSizes.
*/
var styleWrap = function(delim, toStyle, options, classes) {
classes = classes || [];
var span = makeSpan$3(
classes.concat(["style-wrap", options.style.reset(), toStyle.cls()]),
[delim], options);
var multiplier = toStyle.sizeMultiplier / options.style.sizeMultiplier;
span.height *= multiplier;
span.depth *= multiplier;
span.maxFontSize = toStyle.sizeMultiplier;
return span;
};
/**
* Makes a small delimiter. This is a delimiter that comes in the Main-Regular
* font, but is restyled to either be in textstyle, scriptstyle, or
* scriptscriptstyle.
*/
var makeSmallDelim = function(delim, style, center, options, mode, classes) {
var text = buildCommon$4.makeSymbol(delim, "Main-Regular", mode, options);
var span = styleWrap(text, style, options, classes);
if (center) {
var shift =
(1 - options.style.sizeMultiplier / style.sizeMultiplier) *
options.style.metrics.axisHeight;
span.style.top = shift + "em";
span.height -= shift;
span.depth += shift;
}
return span;
};
/**
* Makes a large delimiter. This is a delimiter that comes in the Size1, Size2,
* Size3, or Size4 fonts. It is always rendered in textstyle.
*/
var makeLargeDelim = function(delim, size, center, options, mode, classes) {
var inner = mathrmSize(delim, size, mode, options);
var span = styleWrap(
makeSpan$3(["delimsizing", "size" + size], [inner], options),
Style$4.TEXT, options, classes);
if (center) {
var shift = (1 - options.style.sizeMultiplier) *
options.style.metrics.axisHeight;
span.style.top = shift + "em";
span.height -= shift;
span.depth += shift;
}
return span;
};
/**
* Make an inner span with the given offset and in the given font. This is used
* in `makeStackedDelim` to make the stacking pieces for the delimiter.
*/
var makeInner = function(symbol, font, mode) {
var sizeClass;
// Apply the correct CSS class to choose the right font.
if (font === "Size1-Regular") {
sizeClass = "delim-size1";
} else if (font === "Size4-Regular") {
sizeClass = "delim-size4";
}
var inner = makeSpan$3(
["delimsizinginner", sizeClass],
[makeSpan$3([], [buildCommon$4.makeSymbol(symbol, font, mode)])]);
// Since this will be passed into `makeVList` in the end, wrap the element
// in the appropriate tag that VList uses.
return {type: "elem", elem: inner};
};
/**
* Make a stacked delimiter out of a given delimiter, with the total height at
* least `heightTotal`. This routine is mentioned on page 442 of the TeXbook.
*/
var makeStackedDelim = function(delim, heightTotal, center, options, mode,
classes) {
// There are four parts, the top, an optional middle, a repeated part, and a
// bottom.
var top;
var middle;
var repeat;
var bottom;
top = repeat = bottom = delim;
middle = null;
// Also keep track of what font the delimiters are in
var font = "Size1-Regular";
// We set the parts and font based on the symbol. Note that we use
// '\u23d0' instead of '|' and '\u2016' instead of '\\|' for the
// repeats of the arrows
if (delim === "\\uparrow") {
repeat = bottom = "\u23d0";
} else if (delim === "\\Uparrow") {
repeat = bottom = "\u2016";
} else if (delim === "\\downarrow") {
top = repeat = "\u23d0";
} else if (delim === "\\Downarrow") {
top = repeat = "\u2016";
} else if (delim === "\\updownarrow") {
top = "\\uparrow";
repeat = "\u23d0";
bottom = "\\downarrow";
} else if (delim === "\\Updownarrow") {
top = "\\Uparrow";
repeat = "\u2016";
bottom = "\\Downarrow";
} else if (delim === "[" || delim === "\\lbrack") {
top = "\u23a1";
repeat = "\u23a2";
bottom = "\u23a3";
font = "Size4-Regular";
} else if (delim === "]" || delim === "\\rbrack") {
top = "\u23a4";
repeat = "\u23a5";
bottom = "\u23a6";
font = "Size4-Regular";
} else if (delim === "\\lfloor") {
repeat = top = "\u23a2";
bottom = "\u23a3";
font = "Size4-Regular";
} else if (delim === "\\lceil") {
top = "\u23a1";
repeat = bottom = "\u23a2";
font = "Size4-Regular";
} else if (delim === "\\rfloor") {
repeat = top = "\u23a5";
bottom = "\u23a6";
font = "Size4-Regular";
} else if (delim === "\\rceil") {
top = "\u23a4";
repeat = bottom = "\u23a5";
font = "Size4-Regular";
} else if (delim === "(") {
top = "\u239b";
repeat = "\u239c";
bottom = "\u239d";
font = "Size4-Regular";
} else if (delim === ")") {
top = "\u239e";
repeat = "\u239f";
bottom = "\u23a0";
font = "Size4-Regular";
} else if (delim === "\\{" || delim === "\\lbrace") {
top = "\u23a7";
middle = "\u23a8";
bottom = "\u23a9";
repeat = "\u23aa";
font = "Size4-Regular";
} else if (delim === "\\}" || delim === "\\rbrace") {
top = "\u23ab";
middle = "\u23ac";
bottom = "\u23ad";
repeat = "\u23aa";
font = "Size4-Regular";
} else if (delim === "\\lgroup") {
top = "\u23a7";
bottom = "\u23a9";
repeat = "\u23aa";
font = "Size4-Regular";
} else if (delim === "\\rgroup") {
top = "\u23ab";
bottom = "\u23ad";
repeat = "\u23aa";
font = "Size4-Regular";
} else if (delim === "\\lmoustache") {
top = "\u23a7";
bottom = "\u23ad";
repeat = "\u23aa";
font = "Size4-Regular";
} else if (delim === "\\rmoustache") {
top = "\u23ab";
bottom = "\u23a9";
repeat = "\u23aa";
font = "Size4-Regular";
} else if (delim === "\\surd") {
top = "\ue001";
bottom = "\u23b7";
repeat = "\ue000";
font = "Size4-Regular";
}
// Get the metrics of the four sections
var topMetrics = getMetrics(top, font);
var topHeightTotal = topMetrics.height + topMetrics.depth;
var repeatMetrics = getMetrics(repeat, font);
var repeatHeightTotal = repeatMetrics.height + repeatMetrics.depth;
var bottomMetrics = getMetrics(bottom, font);
var bottomHeightTotal = bottomMetrics.height + bottomMetrics.depth;
var middleHeightTotal = 0;
var middleFactor = 1;
if (middle !== null) {
var middleMetrics = getMetrics(middle, font);
middleHeightTotal = middleMetrics.height + middleMetrics.depth;
middleFactor = 2; // repeat symmetrically above and below middle
}
// Calcuate the minimal height that the delimiter can have.
// It is at least the size of the top, bottom, and optional middle combined.
var minHeight = topHeightTotal + bottomHeightTotal + middleHeightTotal;
// Compute the number of copies of the repeat symbol we will need
var repeatCount = Math.ceil(
(heightTotal - minHeight) / (middleFactor * repeatHeightTotal));
// Compute the total height of the delimiter including all the symbols
var realHeightTotal =
minHeight + repeatCount * middleFactor * repeatHeightTotal;
// The center of the delimiter is placed at the center of the axis. Note
// that in this context, "center" means that the delimiter should be
// centered around the axis in the current style, while normally it is
// centered around the axis in textstyle.
var axisHeight = options.style.metrics.axisHeight;
if (center) {
axisHeight *= options.style.sizeMultiplier;
}
// Calculate the depth
var depth = realHeightTotal / 2 - axisHeight;
// Now, we start building the pieces that will go into the vlist
// Keep a list of the inner pieces
var inners = [];
// Add the bottom symbol
inners.push(makeInner(bottom, font, mode));
var i;
if (middle === null) {
// Add that many symbols
for (i = 0; i < repeatCount; i++) {
inners.push(makeInner(repeat, font, mode));
}
} else {
// When there is a middle bit, we need the middle part and two repeated
// sections
for (i = 0; i < repeatCount; i++) {
inners.push(makeInner(repeat, font, mode));
}
inners.push(makeInner(middle, font, mode));
for (i = 0; i < repeatCount; i++) {
inners.push(makeInner(repeat, font, mode));
}
}
// Add the top symbol
inners.push(makeInner(top, font, mode));
// Finally, build the vlist
var inner = buildCommon$4.makeVList(inners, "bottom", depth, options);
return styleWrap(
makeSpan$3(["delimsizing", "mult"], [inner], options),
Style$4.TEXT, options, classes);
};
// There are three kinds of delimiters, delimiters that stack when they become
// too large
var stackLargeDelimiters = [
"(", ")", "[", "\\lbrack", "]", "\\rbrack",
"\\{", "\\lbrace", "\\}", "\\rbrace",
"\\lfloor", "\\rfloor", "\\lceil", "\\rceil",
"\\surd"
];
// delimiters that always stack
var stackAlwaysDelimiters = [
"\\uparrow", "\\downarrow", "\\updownarrow",
"\\Uparrow", "\\Downarrow", "\\Updownarrow",
"|", "\\|", "\\vert", "\\Vert",
"\\lvert", "\\rvert", "\\lVert", "\\rVert",
"\\lgroup", "\\rgroup", "\\lmoustache", "\\rmoustache"
];
// and delimiters that never stack
var stackNeverDelimiters = [
"<", ">", "\\langle", "\\rangle", "/", "\\backslash", "\\lt", "\\gt"
];
// Metrics of the different sizes. Found by looking at TeX's output of
// $\bigl| // \Bigl| \biggl| \Biggl| \showlists$
// Used to create stacked delimiters of appropriate sizes in makeSizedDelim.
var sizeToMaxHeight = [0, 1.2, 1.8, 2.4, 3.0];
/**
* Used to create a delimiter of a specific size, where `size` is 1, 2, 3, or 4.
*/
var makeSizedDelim = function(delim, size, options, mode, classes) {
// < and > turn into \langle and \rangle in delimiters
if (delim === "<" || delim === "\\lt") {
delim = "\\langle";
} else if (delim === ">" || delim === "\\gt") {
delim = "\\rangle";
}
// Sized delimiters are never centered.
if (utils$6.contains(stackLargeDelimiters, delim) ||
utils$6.contains(stackNeverDelimiters, delim)) {
return makeLargeDelim(delim, size, false, options, mode, classes);
} else if (utils$6.contains(stackAlwaysDelimiters, delim)) {
return makeStackedDelim(
delim, sizeToMaxHeight[size], false, options, mode, classes);
} else {
throw new ParseError$3("Illegal delimiter: '" + delim + "'");
}
};
/**
* There are three different sequences of delimiter sizes that the delimiters
* follow depending on the kind of delimiter. This is used when creating custom
* sized delimiters to decide whether to create a small, large, or stacked
* delimiter.
*
* In real TeX, these sequences aren't explicitly defined, but are instead
* defined inside the font metrics. Since there are only three sequences that
* are possible for the delimiters that TeX defines, it is easier to just encode
* them explicitly here.
*/
// Delimiters that never stack try small delimiters and large delimiters only
var stackNeverDelimiterSequence = [
{type: "small", style: Style$4.SCRIPTSCRIPT},
{type: "small", style: Style$4.SCRIPT},
{type: "small", style: Style$4.TEXT},
{type: "large", size: 1},
{type: "large", size: 2},
{type: "large", size: 3},
{type: "large", size: 4}
];
// Delimiters that always stack try the small delimiters first, then stack
var stackAlwaysDelimiterSequence = [
{type: "small", style: Style$4.SCRIPTSCRIPT},
{type: "small", style: Style$4.SCRIPT},
{type: "small", style: Style$4.TEXT},
{type: "stack"}
];
// Delimiters that stack when large try the small and then large delimiters, and
// stack afterwards
var stackLargeDelimiterSequence = [
{type: "small", style: Style$4.SCRIPTSCRIPT},
{type: "small", style: Style$4.SCRIPT},
{type: "small", style: Style$4.TEXT},
{type: "large", size: 1},
{type: "large", size: 2},
{type: "large", size: 3},
{type: "large", size: 4},
{type: "stack"}
];
/**
* Get the font used in a delimiter based on what kind of delimiter it is.
*/
var delimTypeToFont = function(type) {
if (type.type === "small") {
return "Main-Regular";
} else if (type.type === "large") {
return "Size" + type.size + "-Regular";
} else if (type.type === "stack") {
return "Size4-Regular";
}
};
/**
* Traverse a sequence of types of delimiters to decide what kind of delimiter
* should be used to create a delimiter of the given height+depth.
*/
var traverseSequence = function(delim, height, sequence, options) {
// Here, we choose the index we should start at in the sequences. In smaller
// sizes (which correspond to larger numbers in style.size) we start earlier
// in the sequence. Thus, scriptscript starts at index 3-3=0, script starts
// at index 3-2=1, text starts at 3-1=2, and display starts at min(2,3-0)=2
var start = Math.min(2, 3 - options.style.size);
for (var i = start; i < sequence.length; i++) {
if (sequence[i].type === "stack") {
// This is always the last delimiter, so we just break the loop now.
break;
}
var metrics = getMetrics(delim, delimTypeToFont(sequence[i]));
var heightDepth = metrics.height + metrics.depth;
// Small delimiters are scaled down versions of the same font, so we
// account for the style change size.
if (sequence[i].type === "small") {
heightDepth *= sequence[i].style.sizeMultiplier;
}
// Check if the delimiter at this size works for the given height.
if (heightDepth > height) {
return sequence[i];
}
}
// If we reached the end of the sequence, return the last sequence element.
return sequence[sequence.length - 1];
};
/**
* Make a delimiter of a given height+depth, with optional centering. Here, we
* traverse the sequences, and create a delimiter that the sequence tells us to.
*/
var makeCustomSizedDelim = function(delim, height, center, options, mode,
classes) {
if (delim === "<" || delim === "\\lt") {
delim = "\\langle";
} else if (delim === ">" || delim === "\\gt") {
delim = "\\rangle";
}
// Decide what sequence to use
var sequence;
if (utils$6.contains(stackNeverDelimiters, delim)) {
sequence = stackNeverDelimiterSequence;
} else if (utils$6.contains(stackLargeDelimiters, delim)) {
sequence = stackLargeDelimiterSequence;
} else {
sequence = stackAlwaysDelimiterSequence;
}
// Look through the sequence
var delimType = traverseSequence(delim, height, sequence, options);
// Depending on the sequence element we decided on, call the appropriate
// function.
if (delimType.type === "small") {
return makeSmallDelim(delim, delimType.style, center, options, mode,
classes);
} else if (delimType.type === "large") {
return makeLargeDelim(delim, delimType.size, center, options, mode,
classes);
} else if (delimType.type === "stack") {
return makeStackedDelim(delim, height, center, options, mode, classes);
}
};
/**
* Make a delimiter for use with `\left` and `\right`, given a height and depth
* of an expression that the delimiters surround.
*/
var makeLeftRightDelim = function(delim, height, depth, options, mode,
classes) {
// We always center \left/\right delimiters, so the axis is always shifted
var axisHeight =
options.style.metrics.axisHeight * options.style.sizeMultiplier;
// Taken from TeX source, tex.web, function make_left_right
var delimiterFactor = 901;
var delimiterExtend = 5.0 / fontMetrics$4.metrics.ptPerEm;
var maxDistFromAxis = Math.max(
height - axisHeight, depth + axisHeight);
var totalHeight = Math.max(
// In real TeX, calculations are done using integral values which are
// 65536 per pt, or 655360 per em. So, the division here truncates in
// TeX but doesn't here, producing different results. If we wanted to
// exactly match TeX's calculation, we could do
// Math.floor(655360 * maxDistFromAxis / 500) *
// delimiterFactor / 655360
// (To see the difference, compare
// x^{x^{\left(\rule{0.1em}{0.68em}\right)}}
// in TeX and KaTeX)
maxDistFromAxis / 500 * delimiterFactor,
2 * maxDistFromAxis - delimiterExtend);
// Finally, we defer to `makeCustomSizedDelim` with our calculated total
// height
return makeCustomSizedDelim(delim, totalHeight, true, options, mode,
classes);
};
var delimiter$1 = {
sizedDelim: makeSizedDelim,
customSizedDelim: makeCustomSizedDelim,
leftRightDelim: makeLeftRightDelim
};
/* eslint no-console:0 */
/**
* This file does the main work of building a domTree structure from a parse
* tree. The entry point is the `buildHTML` function, which takes a parse tree.
* Then, the buildExpression, buildGroup, and various groupTypes functions are
* called, to produce a final HTML tree.
*/
var ParseError$2 = ParseError_1;
var Style$1 = Style_1;
var buildCommon$1 = buildCommon$2;
var delimiter = delimiter$1;
var domTree = domTree$2;
var fontMetrics = fontMetrics$1;
var utils$1 = utils$4;
var makeSpan$1 = buildCommon$1.makeSpan;
var isSpace = function(node) {
return node instanceof domTree.span && node.classes[0] === "mspace";
};
// Binary atoms (first class `mbin`) change into ordinary atoms (`mord`)
// depending on their surroundings. See TeXbook pg. 442-446, Rules 5 and 6,
// and the text before Rule 19.
var isBin = function(node) {
return node && node.classes[0] === "mbin";
};
var isBinLeftCanceller = function(node, isRealGroup) {
// TODO: This code assumes that a node's math class is the first element
// of its `classes` array. A later cleanup should ensure this, for
// instance by changing the signature of `makeSpan`.
if (node) {
return utils$1.contains(["mbin", "mopen", "mrel", "mop", "mpunct"],
node.classes[0]);
} else {
return isRealGroup;
}
};
var isBinRightCanceller = function(node, isRealGroup) {
if (node) {
return utils$1.contains(["mrel", "mclose", "mpunct"], node.classes[0]);
} else {
return isRealGroup;
}
};
/**
* Take a list of nodes, build them in order, and return a list of the built
* nodes. documentFragments are flattened into their contents, so the
* returned list contains no fragments. `isRealGroup` is true if `expression`
* is a real group (no atoms will be added on either side), as opposed to
* a partial group (e.g. one created by \color).
*/
var buildExpression = function(expression, options, isRealGroup) {
// Parse expressions into `groups`.
var groups = [];
for (var i = 0; i < expression.length; i++) {
var group = expression[i];
var output = buildGroup(group, options);
if (output instanceof domTree.documentFragment) {
Array.prototype.push.apply(groups, output.children);
} else {
groups.push(output);
}
}
// At this point `groups` consists entirely of `symbolNode`s and `span`s.
// Explicit spaces (e.g., \;, \,) should be ignored with respect to atom
// spacing (e.g., "add thick space between mord and mrel"). Since CSS
// adjacency rules implement atom spacing, spaces should be invisible to
// CSS. So we splice them out of `groups` and into the atoms themselves.
var spaces = null;
for (i = 0; i < groups.length; i++) {
if (isSpace(groups[i])) {
spaces = spaces || [];
spaces.push(groups[i]);
groups.splice(i, 1);
i--;
} else if (spaces) {
if (groups[i] instanceof domTree.symbolNode) {
groups[i] = makeSpan$1([].concat(groups[i].classes), [groups[i]]);
}
buildCommon$1.prependChildren(groups[i], spaces);
spaces = null;
}
}
if (spaces) {
Array.prototype.push.apply(groups, spaces);
}
// Binary operators change to ordinary symbols in some contexts.
for (i = 0; i < groups.length; i++) {
if (isBin(groups[i])
&& (isBinLeftCanceller(groups[i - 1], isRealGroup)
|| isBinRightCanceller(groups[i + 1], isRealGroup))) {
groups[i].classes[0] = "mord";
}
}
return groups;
};
// Return math atom class (mclass) of a domTree.
var getTypeOfDomTree = function(node) {
if (node instanceof domTree.documentFragment) {
if (node.children.length) {
return getTypeOfDomTree(
node.children[node.children.length - 1]);
}
} else {
if (utils$1.contains(["mord", "mop", "mbin", "mrel", "mopen", "mclose",
"mpunct", "minner"], node.classes[0])) {
return node.classes[0];
}
}
return null;
};
/**
* Sometimes, groups perform special rules when they have superscripts or
* subscripts attached to them. This function lets the `supsub` group know that
* its inner element should handle the superscripts and subscripts instead of
* handling them itself.
*/
var shouldHandleSupSub = function(group, options) {
if (!group) {
return false;
} else if (group.type === "op") {
// Operators handle supsubs differently when they have limits
// (e.g. `\displaystyle\sum_2^3`)
return group.value.limits &&
(options.style.size === Style$1.DISPLAY.size ||
group.value.alwaysHandleSupSub);
} else if (group.type === "accent") {
return isCharacterBox(group.value.base);
} else {
return null;
}
};
/**
* Sometimes we want to pull out the innermost element of a group. In most
* cases, this will just be the group itself, but when ordgroups and colors have
* a single element, we want to pull that out.
*/
var getBaseElem = function(group) {
if (!group) {
return false;
} else if (group.type === "ordgroup") {
if (group.value.length === 1) {
return getBaseElem(group.value[0]);
} else {
return group;
}
} else if (group.type === "color") {
if (group.value.value.length === 1) {
return getBaseElem(group.value.value[0]);
} else {
return group;
}
} else if (group.type === "font") {
return getBaseElem(group.value.body);
} else {
return group;
}
};
/**
* TeXbook algorithms often reference "character boxes", which are simply groups
* with a single character in them. To decide if something is a character box,
* we find its innermost group, and see if it is a single character.
*/
var isCharacterBox = function(group) {
var baseElem = getBaseElem(group);
// These are all they types of groups which hold single characters
return baseElem.type === "mathord" ||
baseElem.type === "textord" ||
baseElem.type === "bin" ||
baseElem.type === "rel" ||
baseElem.type === "inner" ||
baseElem.type === "open" ||
baseElem.type === "close" ||
baseElem.type === "punct";
};
var makeNullDelimiter = function(options, classes) {
return makeSpan$1(classes.concat([
"sizing", "reset-" + options.size, "size5",
options.style.reset(), Style$1.TEXT.cls(),
"nulldelimiter"]));
};
/**
* This is a map of group types to the function used to handle that type.
* Simpler types come at the beginning, while complicated types come afterwards.
*/
var groupTypes = {};
groupTypes.mathord = function(group, options) {
return buildCommon$1.makeOrd(group, options, "mathord");
};
groupTypes.textord = function(group, options) {
return buildCommon$1.makeOrd(group, options, "textord");
};
groupTypes.bin = function(group, options) {
return buildCommon$1.mathsym(
group.value, group.mode, options, ["mbin"]);
};
groupTypes.rel = function(group, options) {
return buildCommon$1.mathsym(
group.value, group.mode, options, ["mrel"]);
};
groupTypes.open = function(group, options) {
return buildCommon$1.mathsym(
group.value, group.mode, options, ["mopen"]);
};
groupTypes.close = function(group, options) {
return buildCommon$1.mathsym(
group.value, group.mode, options, ["mclose"]);
};
groupTypes.inner = function(group, options) {
return buildCommon$1.mathsym(
group.value, group.mode, options, ["minner"]);
};
groupTypes.punct = function(group, options) {
return buildCommon$1.mathsym(
group.value, group.mode, options, ["mpunct"]);
};
groupTypes.ordgroup = function(group, options) {
return makeSpan$1(
["mord", options.style.cls()],
buildExpression(group.value, options.reset(), true),
options
);
};
groupTypes.text = function(group, options) {
var newOptions = options.withFont(group.value.style);
var inner = buildExpression(group.value.body, newOptions, true);
for (var i = 0; i < inner.length - 1; i++) {
if (inner[i].tryCombine(inner[i + 1])) {
inner.splice(i + 1, 1);
i--;
}
}
return makeSpan$1(["mord", "text", newOptions.style.cls()],
inner, newOptions);
};
groupTypes.color = function(group, options) {
var elements = buildExpression(
group.value.value,
options.withColor(group.value.color),
false
);
// \color isn't supposed to affect the type of the elements it contains.
// To accomplish this, we wrap the results in a fragment, so the inner
// elements will be able to directly interact with their neighbors. For
// example, `\color{red}{2 +} 3` has the same spacing as `2 + 3`
return new buildCommon$1.makeFragment(elements);
};
groupTypes.supsub = function(group, options) {
// Superscript and subscripts are handled in the TeXbook on page
// 445-446, rules 18(a-f).
// Here is where we defer to the inner group if it should handle
// superscripts and subscripts itself.
if (shouldHandleSupSub(group.value.base, options)) {
return groupTypes[group.value.base.type](group, options);
}
var base = buildGroup(group.value.base, options.reset());
var supmid;
var submid;
var sup;
var sub;
var style = options.style;
var newOptions;
if (group.value.sup) {
newOptions = options.withStyle(style.sup());
sup = buildGroup(group.value.sup, newOptions);
supmid = makeSpan$1([style.reset(), style.sup().cls()],
[sup], newOptions);
}
if (group.value.sub) {
newOptions = options.withStyle(style.sub());
sub = buildGroup(group.value.sub, newOptions);
submid = makeSpan$1([style.reset(), style.sub().cls()],
[sub], newOptions);
}
// Rule 18a
var supShift;
var subShift;
if (isCharacterBox(group.value.base)) {
supShift = 0;
subShift = 0;
} else {
supShift = base.height - style.metrics.supDrop;
subShift = base.depth + style.metrics.subDrop;
}
// Rule 18c
var minSupShift;
if (style === Style$1.DISPLAY) {
minSupShift = style.metrics.sup1;
} else if (style.cramped) {
minSupShift = style.metrics.sup3;
} else {
minSupShift = style.metrics.sup2;
}
// scriptspace is a font-size-independent size, so scale it
// appropriately
var multiplier = Style$1.TEXT.sizeMultiplier *
style.sizeMultiplier;
var scriptspace =
(0.5 / fontMetrics.metrics.ptPerEm) / multiplier + "em";
var supsub;
if (!group.value.sup) {
// Rule 18b
subShift = Math.max(
subShift, style.metrics.sub1,
sub.height - 0.8 * style.metrics.xHeight);
supsub = buildCommon$1.makeVList([
{type: "elem", elem: submid}
], "shift", subShift, options);
supsub.children[0].style.marginRight = scriptspace;
// Subscripts shouldn't be shifted by the base's italic correction.
// Account for that by shifting the subscript back the appropriate
// amount. Note we only do this when the base is a single symbol.
if (base instanceof domTree.symbolNode) {
supsub.children[0].style.marginLeft = -base.italic + "em";
}
} else if (!group.value.sub) {
// Rule 18c, d
supShift = Math.max(supShift, minSupShift,
sup.depth + 0.25 * style.metrics.xHeight);
supsub = buildCommon$1.makeVList([
{type: "elem", elem: supmid}
], "shift", -supShift, options);
supsub.children[0].style.marginRight = scriptspace;
} else {
supShift = Math.max(
supShift, minSupShift, sup.depth + 0.25 * style.metrics.xHeight);
subShift = Math.max(subShift, style.metrics.sub2);
var ruleWidth = fontMetrics.metrics.defaultRuleThickness;
// Rule 18e
if ((supShift - sup.depth) - (sub.height - subShift) <
4 * ruleWidth) {
subShift = 4 * ruleWidth - (supShift - sup.depth) + sub.height;
var psi = 0.8 * style.metrics.xHeight - (supShift - sup.depth);
if (psi > 0) {
supShift += psi;
subShift -= psi;
}
}
supsub = buildCommon$1.makeVList([
{type: "elem", elem: submid, shift: subShift},
{type: "elem", elem: supmid, shift: -supShift}
], "individualShift", null, options);
// See comment above about subscripts not being shifted
if (base instanceof domTree.symbolNode) {
supsub.children[0].style.marginLeft = -base.italic + "em";
}
supsub.children[0].style.marginRight = scriptspace;
supsub.children[1].style.marginRight = scriptspace;
}
// We ensure to wrap the supsub vlist in a span.msupsub to reset text-align
var mclass = getTypeOfDomTree(base) || "mord";
return makeSpan$1([mclass],
[base, makeSpan$1(["msupsub"], [supsub])],
options);
};
groupTypes.genfrac = function(group, options) {
// Fractions are handled in the TeXbook on pages 444-445, rules 15(a-e).
// Figure out what style this fraction should be in based on the
// function used
var style = options.style;
if (group.value.size === "display") {
style = Style$1.DISPLAY;
} else if (group.value.size === "text") {
style = Style$1.TEXT;
}
var nstyle = style.fracNum();
var dstyle = style.fracDen();
var newOptions;
newOptions = options.withStyle(nstyle);
var numer = buildGroup(group.value.numer, newOptions);
var numerreset = makeSpan$1([style.reset(), nstyle.cls()],
[numer], newOptions);
newOptions = options.withStyle(dstyle);
var denom = buildGroup(group.value.denom, newOptions);
var denomreset = makeSpan$1([style.reset(), dstyle.cls()],
[denom], newOptions);
var ruleWidth;
if (group.value.hasBarLine) {
ruleWidth = fontMetrics.metrics.defaultRuleThickness /
options.style.sizeMultiplier;
} else {
ruleWidth = 0;
}
// Rule 15b
var numShift;
var clearance;
var denomShift;
if (style.size === Style$1.DISPLAY.size) {
numShift = style.metrics.num1;
if (ruleWidth > 0) {
clearance = 3 * ruleWidth;
} else {
clearance = 7 * fontMetrics.metrics.defaultRuleThickness;
}
denomShift = style.metrics.denom1;
} else {
if (ruleWidth > 0) {
numShift = style.metrics.num2;
clearance = ruleWidth;
} else {
numShift = style.metrics.num3;
clearance = 3 * fontMetrics.metrics.defaultRuleThickness;
}
denomShift = style.metrics.denom2;
}
var frac;
if (ruleWidth === 0) {
// Rule 15c
var candidateClearance =
(numShift - numer.depth) - (denom.height - denomShift);
if (candidateClearance < clearance) {
numShift += 0.5 * (clearance - candidateClearance);
denomShift += 0.5 * (clearance - candidateClearance);
}
frac = buildCommon$1.makeVList([
{type: "elem", elem: denomreset, shift: denomShift},
{type: "elem", elem: numerreset, shift: -numShift}
], "individualShift", null, options);
} else {
// Rule 15d
var axisHeight = style.metrics.axisHeight;
if ((numShift - numer.depth) - (axisHeight + 0.5 * ruleWidth) <
clearance) {
numShift +=
clearance - ((numShift - numer.depth) -
(axisHeight + 0.5 * ruleWidth));
}
if ((axisHeight - 0.5 * ruleWidth) - (denom.height - denomShift) <
clearance) {
denomShift +=
clearance - ((axisHeight - 0.5 * ruleWidth) -
(denom.height - denomShift));
}
var mid = makeSpan$1(
[options.style.reset(), Style$1.TEXT.cls(), "frac-line"]);
// Manually set the height of the line because its height is
// created in CSS
mid.height = ruleWidth;
var midShift = -(axisHeight - 0.5 * ruleWidth);
frac = buildCommon$1.makeVList([
{type: "elem", elem: denomreset, shift: denomShift},
{type: "elem", elem: mid, shift: midShift},
{type: "elem", elem: numerreset, shift: -numShift}
], "individualShift", null, options);
}
// Since we manually change the style sometimes (with \dfrac or \tfrac),
// account for the possible size change here.
frac.height *= style.sizeMultiplier / options.style.sizeMultiplier;
frac.depth *= style.sizeMultiplier / options.style.sizeMultiplier;
// Rule 15e
var delimSize;
if (style.size === Style$1.DISPLAY.size) {
delimSize = style.metrics.delim1;
} else {
delimSize = style.metrics.delim2;
}
var leftDelim;
var rightDelim;
if (group.value.leftDelim == null) {
leftDelim = makeNullDelimiter(options, ["mopen"]);
} else {
leftDelim = delimiter.customSizedDelim(
group.value.leftDelim, delimSize, true,
options.withStyle(style), group.mode, ["mopen"]);
}
if (group.value.rightDelim == null) {
rightDelim = makeNullDelimiter(options, ["mclose"]);
} else {
rightDelim = delimiter.customSizedDelim(
group.value.rightDelim, delimSize, true,
options.withStyle(style), group.mode, ["mclose"]);
}
return makeSpan$1(
["mord", options.style.reset(), style.cls()],
[leftDelim, makeSpan$1(["mfrac"], [frac]), rightDelim],
options);
};
var calculateSize = function(sizeValue, style) {
var x = sizeValue.number;
if (sizeValue.unit === "ex") {
x *= style.metrics.emPerEx;
} else if (sizeValue.unit === "mu") {
x /= 18;
}
return x;
};
groupTypes.array = function(group, options) {
var r;
var c;
var nr = group.value.body.length;
var nc = 0;
var body = new Array(nr);
var style = options.style;
// Horizontal spacing
var pt = 1 / fontMetrics.metrics.ptPerEm;
var arraycolsep = 5 * pt; // \arraycolsep in article.cls
// Vertical spacing
var baselineskip = 12 * pt; // see size10.clo
// Default \arraystretch from lttab.dtx
// TODO(gagern): may get redefined once we have user-defined macros
var arraystretch = utils$1.deflt(group.value.arraystretch, 1);
var arrayskip = arraystretch * baselineskip;
var arstrutHeight = 0.7 * arrayskip; // \strutbox in ltfsstrc.dtx and
var arstrutDepth = 0.3 * arrayskip; // \@arstrutbox in lttab.dtx
var totalHeight = 0;
for (r = 0; r < group.value.body.length; ++r) {
var inrow = group.value.body[r];
var height = arstrutHeight; // \@array adds an \@arstrut
var depth = arstrutDepth; // to each tow (via the template)
if (nc < inrow.length) {
nc = inrow.length;
}
var outrow = new Array(inrow.length);
for (c = 0; c < inrow.length; ++c) {
var elt = buildGroup(inrow[c], options);
if (depth < elt.depth) {
depth = elt.depth;
}
if (height < elt.height) {
height = elt.height;
}
outrow[c] = elt;
}
var gap = 0;
if (group.value.rowGaps[r]) {
gap = calculateSize(group.value.rowGaps[r].value, style);
if (gap > 0) { // \@argarraycr
gap += arstrutDepth;
if (depth < gap) {
depth = gap; // \@xargarraycr
}
gap = 0;
}
}
outrow.height = height;
outrow.depth = depth;
totalHeight += height;
outrow.pos = totalHeight;
totalHeight += depth + gap; // \@yargarraycr
body[r] = outrow;
}
var offset = totalHeight / 2 + style.metrics.axisHeight;
var colDescriptions = group.value.cols || [];
var cols = [];
var colSep;
var colDescrNum;
for (c = 0, colDescrNum = 0;
// Continue while either there are more columns or more column
// descriptions, so trailing separators don't get lost.
c < nc || colDescrNum < colDescriptions.length;
++c, ++colDescrNum) {
var colDescr = colDescriptions[colDescrNum] || {};
var firstSeparator = true;
while (colDescr.type === "separator") {
// If there is more than one separator in a row, add a space
// between them.
if (!firstSeparator) {
colSep = makeSpan$1(["arraycolsep"], []);
colSep.style.width =
fontMetrics.metrics.doubleRuleSep + "em";
cols.push(colSep);
}
if (colDescr.separator === "|") {
var separator = makeSpan$1(
["vertical-separator"],
[]);
separator.style.height = totalHeight + "em";
separator.style.verticalAlign =
-(totalHeight - offset) + "em";
cols.push(separator);
} else {
throw new ParseError$2(
"Invalid separator type: " + colDescr.separator);
}
colDescrNum++;
colDescr = colDescriptions[colDescrNum] || {};
firstSeparator = false;
}
if (c >= nc) {
continue;
}
var sepwidth;
if (c > 0 || group.value.hskipBeforeAndAfter) {
sepwidth = utils$1.deflt(colDescr.pregap, arraycolsep);
if (sepwidth !== 0) {
colSep = makeSpan$1(["arraycolsep"], []);
colSep.style.width = sepwidth + "em";
cols.push(colSep);
}
}
var col = [];
for (r = 0; r < nr; ++r) {
var row = body[r];
var elem = row[c];
if (!elem) {
continue;
}
var shift = row.pos - offset;
elem.depth = row.depth;
elem.height = row.height;
col.push({type: "elem", elem: elem, shift: shift});
}
col = buildCommon$1.makeVList(col, "individualShift", null, options);
col = makeSpan$1(
["col-align-" + (colDescr.align || "c")],
[col]);
cols.push(col);
if (c < nc - 1 || group.value.hskipBeforeAndAfter) {
sepwidth = utils$1.deflt(colDescr.postgap, arraycolsep);
if (sepwidth !== 0) {
colSep = makeSpan$1(["arraycolsep"], []);
colSep.style.width = sepwidth + "em";
cols.push(colSep);
}
}
}
body = makeSpan$1(["mtable"], cols);
return makeSpan$1(["mord"], [body], options);
};
groupTypes.spacing = function(group, options) {
if (group.value === "\\ " || group.value === "\\space" ||
group.value === " " || group.value === "~") {
// Spaces are generated by adding an actual space. Each of these
// things has an entry in the symbols table, so these will be turned
// into appropriate outputs.
if (group.mode === "text") {
return buildCommon$1.makeOrd(group, options, "textord");
} else {
return makeSpan$1(["mspace"],
[buildCommon$1.mathsym(group.value, group.mode, options)],
options);
}
} else {
// Other kinds of spaces are of arbitrary width. We use CSS to
// generate these.
return makeSpan$1(
["mspace",
buildCommon$1.spacingFunctions[group.value].className],
[], options);
}
};
groupTypes.llap = function(group, options) {
var inner = makeSpan$1(
["inner"], [buildGroup(group.value.body, options.reset())]);
var fix = makeSpan$1(["fix"], []);
return makeSpan$1(
["mord", "llap", options.style.cls()], [inner, fix], options);
};
groupTypes.rlap = function(group, options) {
var inner = makeSpan$1(
["inner"], [buildGroup(group.value.body, options.reset())]);
var fix = makeSpan$1(["fix"], []);
return makeSpan$1(
["mord", "rlap", options.style.cls()], [inner, fix], options);
};
groupTypes.op = function(group, options) {
// Operators are handled in the TeXbook pg. 443-444, rule 13(a).
var supGroup;
var subGroup;
var hasLimits = false;
if (group.type === "supsub") {
// If we have limits, supsub will pass us its group to handle. Pull
// out the superscript and subscript and set the group to the op in
// its base.
supGroup = group.value.sup;
subGroup = group.value.sub;
group = group.value.base;
hasLimits = true;
}
var style = options.style;
// Most operators have a large successor symbol, but these don't.
var noSuccessor = [
"\\smallint"
];
var large = false;
if (style.size === Style$1.DISPLAY.size &&
group.value.symbol &&
!utils$1.contains(noSuccessor, group.value.body)) {
// Most symbol operators get larger in displaystyle (rule 13)
large = true;
}
var base;
var baseShift = 0;
var slant = 0;
if (group.value.symbol) {
// If this is a symbol, create the symbol.
var fontName = large ? "Size2-Regular" : "Size1-Regular";
base = buildCommon$1.makeSymbol(
group.value.body, fontName, "math", options,
["mop", "op-symbol", large ? "large-op" : "small-op"]);
// Shift the symbol so its center lies on the axis (rule 13). It
// appears that our fonts have the centers of the symbols already
// almost on the axis, so these numbers are very small. Note we
// don't actually apply this here, but instead it is used either in
// the vlist creation or separately when there are no limits.
baseShift = (base.height - base.depth) / 2 -
style.metrics.axisHeight * style.sizeMultiplier;
// The slant of the symbol is just its italic correction.
slant = base.italic;
} else if (group.value.value) {
// If this is a list, compose that list.
var inner = buildExpression(group.value.value, options, true);
base = makeSpan$1(["mop"], inner, options);
} else {
// Otherwise, this is a text operator. Build the text from the
// operator's name.
// TODO(emily): Add a space in the middle of some of these
// operators, like \limsup
var output = [];
for (var i = 1; i < group.value.body.length; i++) {
output.push(buildCommon$1.mathsym(group.value.body[i], group.mode));
}
base = makeSpan$1(["mop"], output, options);
}
if (hasLimits) {
// IE 8 clips \int if it is in a display: inline-block. We wrap it
// in a new span so it is an inline, and works.
base = makeSpan$1([], [base]);
var supmid;
var supKern;
var submid;
var subKern;
var newOptions;
// We manually have to handle the superscripts and subscripts. This,
// aside from the kern calculations, is copied from supsub.
if (supGroup) {
newOptions = options.withStyle(style.sup());
var sup = buildGroup(supGroup, newOptions);
supmid = makeSpan$1([style.reset(), style.sup().cls()],
[sup], newOptions);
supKern = Math.max(
fontMetrics.metrics.bigOpSpacing1,
fontMetrics.metrics.bigOpSpacing3 - sup.depth);
}
if (subGroup) {
newOptions = options.withStyle(style.sub());
var sub = buildGroup(subGroup, newOptions);
submid = makeSpan$1([style.reset(), style.sub().cls()],
[sub], newOptions);
subKern = Math.max(
fontMetrics.metrics.bigOpSpacing2,
fontMetrics.metrics.bigOpSpacing4 - sub.height);
}
// Build the final group as a vlist of the possible subscript, base,
// and possible superscript.
var finalGroup;
var top;
var bottom;
if (!supGroup) {
top = base.height - baseShift;
finalGroup = buildCommon$1.makeVList([
{type: "kern", size: fontMetrics.metrics.bigOpSpacing5},
{type: "elem", elem: submid},
{type: "kern", size: subKern},
{type: "elem", elem: base}
], "top", top, options);
// Here, we shift the limits by the slant of the symbol. Note
// that we are supposed to shift the limits by 1/2 of the slant,
// but since we are centering the limits adding a full slant of
// margin will shift by 1/2 that.
finalGroup.children[0].style.marginLeft = -slant + "em";
} else if (!subGroup) {
bottom = base.depth + baseShift;
finalGroup = buildCommon$1.makeVList([
{type: "elem", elem: base},
{type: "kern", size: supKern},
{type: "elem", elem: supmid},
{type: "kern", size: fontMetrics.metrics.bigOpSpacing5}
], "bottom", bottom, options);
// See comment above about slants
finalGroup.children[1].style.marginLeft = slant + "em";
} else if (!supGroup && !subGroup) {
// This case probably shouldn't occur (this would mean the
// supsub was sending us a group with no superscript or
// subscript) but be safe.
return base;
} else {
bottom = fontMetrics.metrics.bigOpSpacing5 +
submid.height + submid.depth +
subKern +
base.depth + baseShift;
finalGroup = buildCommon$1.makeVList([
{type: "kern", size: fontMetrics.metrics.bigOpSpacing5},
{type: "elem", elem: submid},
{type: "kern", size: subKern},
{type: "elem", elem: base},
{type: "kern", size: supKern},
{type: "elem", elem: supmid},
{type: "kern", size: fontMetrics.metrics.bigOpSpacing5}
], "bottom", bottom, options);
// See comment above about slants
finalGroup.children[0].style.marginLeft = -slant + "em";
finalGroup.children[2].style.marginLeft = slant + "em";
}
return makeSpan$1(["mop", "op-limits"], [finalGroup], options);
} else {
if (group.value.symbol) {
base.style.top = baseShift + "em";
}
return base;
}
};
groupTypes.mod = function(group, options) {
var inner = [];
if (group.value.modType === "bmod") {
// “\nonscript\mskip-\medmuskip\mkern5mu”
if (!options.style.isTight()) {
inner.push(makeSpan$1(
["mspace", "negativemediumspace"], [], options));
}
inner.push(makeSpan$1(["mspace", "thickspace"], [], options));
} else if (options.style.size === Style$1.DISPLAY.size) {
inner.push(makeSpan$1(["mspace", "quad"], [], options));
} else if (group.value.modType === "mod") {
inner.push(makeSpan$1(["mspace", "twelvemuspace"], [], options));
} else {
inner.push(makeSpan$1(["mspace", "eightmuspace"], [], options));
}
if (group.value.modType === "pod" || group.value.modType === "pmod") {
inner.push(buildCommon$1.mathsym("(", group.mode));
}
if (group.value.modType !== "pod") {
var modInner = [
buildCommon$1.mathsym("m", group.mode),
buildCommon$1.mathsym("o", group.mode),
buildCommon$1.mathsym("d", group.mode)];
if (group.value.modType === "bmod") {
inner.push(makeSpan$1(["mbin"], modInner, options));
// “\mkern5mu\nonscript\mskip-\medmuskip”
inner.push(makeSpan$1(["mspace", "thickspace"], [], options));
if (!options.style.isTight()) {
inner.push(makeSpan$1(
["mspace", "negativemediumspace"], [], options));
}
} else {
Array.prototype.push.apply(inner, modInner);
inner.push(makeSpan$1(["mspace", "sixmuspace"], [], options));
}
}
if (group.value.value) {
Array.prototype.push.apply(inner,
buildExpression(group.value.value, options, false));
}
if (group.value.modType === "pod" || group.value.modType === "pmod") {
inner.push(buildCommon$1.mathsym(")", group.mode));
}
return buildCommon$1.makeFragment(inner);
};
groupTypes.katex = function(group, options) {
// The KaTeX logo. The offsets for the K and a were chosen to look
// good, but the offsets for the T, E, and X were taken from the
// definition of \TeX in TeX (see TeXbook pg. 356)
var k = makeSpan$1(
["k"], [buildCommon$1.mathsym("K", group.mode)], options);
var a = makeSpan$1(
["a"], [buildCommon$1.mathsym("A", group.mode)], options);
a.height = (a.height + 0.2) * 0.75;
a.depth = (a.height - 0.2) * 0.75;
var t = makeSpan$1(
["t"], [buildCommon$1.mathsym("T", group.mode)], options);
var e = makeSpan$1(
["e"], [buildCommon$1.mathsym("E", group.mode)], options);
e.height = (e.height - 0.2155);
e.depth = (e.depth + 0.2155);
var x = makeSpan$1(
["x"], [buildCommon$1.mathsym("X", group.mode)], options);
return makeSpan$1(
["mord", "katex-logo"], [k, a, t, e, x], options);
};
groupTypes.overline = function(group, options) {
// Overlines are handled in the TeXbook pg 443, Rule 9.
var style = options.style;
// Build the inner group in the cramped style.
var innerGroup = buildGroup(group.value.body,
options.withStyle(style.cramp()));
var ruleWidth = fontMetrics.metrics.defaultRuleThickness /
style.sizeMultiplier;
// Create the line above the body
var line = makeSpan$1(
[style.reset(), Style$1.TEXT.cls(), "overline-line"]);
line.height = ruleWidth;
line.maxFontSize = 1.0;
// Generate the vlist, with the appropriate kerns
var vlist = buildCommon$1.makeVList([
{type: "elem", elem: innerGroup},
{type: "kern", size: 3 * ruleWidth},
{type: "elem", elem: line},
{type: "kern", size: ruleWidth}
], "firstBaseline", null, options);
return makeSpan$1(["mord", "overline"], [vlist], options);
};
groupTypes.underline = function(group, options) {
// Underlines are handled in the TeXbook pg 443, Rule 10.
var style = options.style;
// Build the inner group.
var innerGroup = buildGroup(group.value.body, options);
var ruleWidth = fontMetrics.metrics.defaultRuleThickness /
style.sizeMultiplier;
// Create the line above the body
var line = makeSpan$1([style.reset(), Style$1.TEXT.cls(), "underline-line"]);
line.height = ruleWidth;
line.maxFontSize = 1.0;
// Generate the vlist, with the appropriate kerns
var vlist = buildCommon$1.makeVList([
{type: "kern", size: ruleWidth},
{type: "elem", elem: line},
{type: "kern", size: 3 * ruleWidth},
{type: "elem", elem: innerGroup}
], "top", innerGroup.height, options);
return makeSpan$1(["mord", "underline"], [vlist], options);
};
groupTypes.sqrt = function(group, options) {
// Square roots are handled in the TeXbook pg. 443, Rule 11.
var style = options.style;
// First, we do the same steps as in overline to build the inner group
// and line
var inner = buildGroup(group.value.body, options.withStyle(style.cramp()));
var ruleWidth = fontMetrics.metrics.defaultRuleThickness /
style.sizeMultiplier;
var line = makeSpan$1(
[style.reset(), Style$1.TEXT.cls(), "sqrt-line"], [],
options);
line.height = ruleWidth;
line.maxFontSize = 1.0;
var phi = ruleWidth;
if (style.id < Style$1.TEXT.id) {
phi = style.metrics.xHeight;
}
// Calculate the clearance between the body and line
var lineClearance = ruleWidth + phi / 4;
var innerHeight = (inner.height + inner.depth) * style.sizeMultiplier;
var minDelimiterHeight = innerHeight + lineClearance + ruleWidth;
// Create a \surd delimiter of the required minimum size
var delim = makeSpan$1(["sqrt-sign"], [
delimiter.customSizedDelim("\\surd", minDelimiterHeight,
false, options, group.mode)],
options);
var delimDepth = (delim.height + delim.depth) - ruleWidth;
// Adjust the clearance based on the delimiter size
if (delimDepth > inner.height + inner.depth + lineClearance) {
lineClearance =
(lineClearance + delimDepth - inner.height - inner.depth) / 2;
}
// Shift the delimiter so that its top lines up with the top of the line
var delimShift = -(inner.height + lineClearance + ruleWidth) + delim.height;
delim.style.top = delimShift + "em";
delim.height -= delimShift;
delim.depth += delimShift;
// We add a special case here, because even when `inner` is empty, we
// still get a line. So, we use a simple heuristic to decide if we
// should omit the body entirely. (note this doesn't work for something
// like `\sqrt{\rlap{x}}`, but if someone is doing that they deserve for
// it not to work.
var body;
if (inner.height === 0 && inner.depth === 0) {
body = makeSpan$1();
} else {
body = buildCommon$1.makeVList([
{type: "elem", elem: inner},
{type: "kern", size: lineClearance},
{type: "elem", elem: line},
{type: "kern", size: ruleWidth}
], "firstBaseline", null, options);
}
if (!group.value.index) {
return makeSpan$1(["mord", "sqrt"], [delim, body], options);
} else {
// Handle the optional root index
// The index is always in scriptscript style
var newOptions = options.withStyle(Style$1.SCRIPTSCRIPT);
var root = buildGroup(group.value.index, newOptions);
var rootWrap = makeSpan$1(
[style.reset(), Style$1.SCRIPTSCRIPT.cls()],
[root],
newOptions);
// Figure out the height and depth of the inner part
var innerRootHeight = Math.max(delim.height, body.height);
var innerRootDepth = Math.max(delim.depth, body.depth);
// The amount the index is shifted by. This is taken from the TeX
// source, in the definition of `\r@@t`.
var toShift = 0.6 * (innerRootHeight - innerRootDepth);
// Build a VList with the superscript shifted up correctly
var rootVList = buildCommon$1.makeVList(
[{type: "elem", elem: rootWrap}],
"shift", -toShift, options);
// Add a class surrounding it so we can add on the appropriate
// kerning
var rootVListWrap = makeSpan$1(["root"], [rootVList]);
return makeSpan$1(["mord", "sqrt"],
[rootVListWrap, delim, body], options);
}
};
groupTypes.sizing = function(group, options) {
// Handle sizing operators like \Huge. Real TeX doesn't actually allow
// these functions inside of math expressions, so we do some special
// handling.
var inner = buildExpression(group.value.value,
options.withSize(group.value.size), false);
// Compute the correct maxFontSize.
var style = options.style;
var fontSize = buildCommon$1.sizingMultiplier[group.value.size];
fontSize = fontSize * style.sizeMultiplier;
// Add size-resetting classes to the inner list and set maxFontSize
// manually. Handle nested size changes.
for (var i = 0; i < inner.length; i++) {
var pos = utils$1.indexOf(inner[i].classes, "sizing");
if (pos < 0) {
inner[i].classes.push("sizing", "reset-" + options.size,
group.value.size, style.cls());
inner[i].maxFontSize = fontSize;
} else if (inner[i].classes[pos + 1] === "reset-" + group.value.size) {
// This is a nested size change: e.g., inner[i] is the "b" in
// `\Huge a \small b`. Override the old size (the `reset-` class)
// but not the new size.
inner[i].classes[pos + 1] = "reset-" + options.size;
}
}
return buildCommon$1.makeFragment(inner);
};
groupTypes.styling = function(group, options) {
// Style changes are handled in the TeXbook on pg. 442, Rule 3.
// Figure out what style we're changing to.
var styleMap = {
"display": Style$1.DISPLAY,
"text": Style$1.TEXT,
"script": Style$1.SCRIPT,
"scriptscript": Style$1.SCRIPTSCRIPT
};
var newStyle = styleMap[group.value.style];
var newOptions = options.withStyle(newStyle);
// Build the inner expression in the new style.
var inner = buildExpression(
group.value.value, newOptions, false);
// Add style-resetting classes to the inner list. Handle nested changes.
for (var i = 0; i < inner.length; i++) {
var pos = utils$1.indexOf(inner[i].classes, newStyle.reset());
if (pos < 0) {
inner[i].classes.push(options.style.reset(), newStyle.cls());
} else {
// This is a nested style change, as `\textstyle a\scriptstyle b`.
// Only override the old style (the reset class).
inner[i].classes[pos] = options.style.reset();
}
}
return new buildCommon$1.makeFragment(inner);
};
groupTypes.font = function(group, options) {
var font = group.value.font;
return buildGroup(group.value.body, options.withFont(font));
};
groupTypes.delimsizing = function(group, options) {
var delim = group.value.value;
if (delim === ".") {
// Empty delimiters still count as elements, even though they don't
// show anything.
return makeSpan$1([group.value.mclass]);
}
// Use delimiter.sizedDelim to generate the delimiter.
return delimiter.sizedDelim(
delim, group.value.size, options, group.mode,
[group.value.mclass]);
};
groupTypes.leftright = function(group, options) {
// Build the inner expression
var inner = buildExpression(group.value.body, options.reset(), true);
var innerHeight = 0;
var innerDepth = 0;
var hadMiddle = false;
// Calculate its height and depth
for (var i = 0; i < inner.length; i++) {
if (inner[i].isMiddle) {
hadMiddle = true;
} else {
innerHeight = Math.max(inner[i].height, innerHeight);
innerDepth = Math.max(inner[i].depth, innerDepth);
}
}
var style = options.style;
// The size of delimiters is the same, regardless of what style we are
// in. Thus, to correctly calculate the size of delimiter we need around
// a group, we scale down the inner size based on the size.
innerHeight *= style.sizeMultiplier;
innerDepth *= style.sizeMultiplier;
var leftDelim;
if (group.value.left === ".") {
// Empty delimiters in \left and \right make null delimiter spaces.
leftDelim = makeNullDelimiter(options, ["mopen"]);
} else {
// Otherwise, use leftRightDelim to generate the correct sized
// delimiter.
leftDelim = delimiter.leftRightDelim(
group.value.left, innerHeight, innerDepth, options,
group.mode, ["mopen"]);
}
// Add it to the beginning of the expression
inner.unshift(leftDelim);
// Handle middle delimiters
if (hadMiddle) {
for (i = 1; i < inner.length; i++) {
if (inner[i].isMiddle) {
// Apply the options that were active when \middle was called
inner[i] = delimiter.leftRightDelim(
inner[i].isMiddle.value, innerHeight, innerDepth,
inner[i].isMiddle.options, group.mode, []);
}
}
}
var rightDelim;
// Same for the right delimiter
if (group.value.right === ".") {
rightDelim = makeNullDelimiter(options, ["mclose"]);
} else {
rightDelim = delimiter.leftRightDelim(
group.value.right, innerHeight, innerDepth, options,
group.mode, ["mclose"]);
}
// Add it to the end of the expression.
inner.push(rightDelim);
return makeSpan$1(
["minner", style.cls()], inner, options);
};
groupTypes.middle = function(group, options) {
var middleDelim;
if (group.value.value === ".") {
middleDelim = makeNullDelimiter(options, []);
} else {
middleDelim = delimiter.sizedDelim(
group.value.value, 1, options,
group.mode, []);
middleDelim.isMiddle = {value: group.value.value, options: options};
}
return middleDelim;
};
groupTypes.rule = function(group, options) {
// Make an empty span for the rule
var rule = makeSpan$1(["mord", "rule"], [], options);
var style = options.style;
// Calculate the shift, width, and height of the rule, and account for units
var shift = 0;
if (group.value.shift) {
shift = calculateSize(group.value.shift, style);
}
var width = calculateSize(group.value.width, style);
var height = calculateSize(group.value.height, style);
// The sizes of rules are absolute, so make it larger if we are in a
// smaller style.
shift /= style.sizeMultiplier;
width /= style.sizeMultiplier;
height /= style.sizeMultiplier;
// Style the rule to the right size
rule.style.borderRightWidth = width + "em";
rule.style.borderTopWidth = height + "em";
rule.style.bottom = shift + "em";
// Record the height and width
rule.width = width;
rule.height = height + shift;
rule.depth = -shift;
return rule;
};
groupTypes.kern = function(group, options) {
// Make an empty span for the rule
var rule = makeSpan$1(["mord", "rule"], [], options);
var style = options.style;
var dimension = 0;
if (group.value.dimension) {
dimension = calculateSize(group.value.dimension, style);
}
dimension /= style.sizeMultiplier;
rule.style.marginLeft = dimension + "em";
return rule;
};
groupTypes.accent = function(group, options) {
// Accents are handled in the TeXbook pg. 443, rule 12.
var base = group.value.base;
var style = options.style;
var supsubGroup;
if (group.type === "supsub") {
// If our base is a character box, and we have superscripts and
// subscripts, the supsub will defer to us. In particular, we want
// to attach the superscripts and subscripts to the inner body (so
// that the position of the superscripts and subscripts won't be
// affected by the height of the accent). We accomplish this by
// sticking the base of the accent into the base of the supsub, and
// rendering that, while keeping track of where the accent is.
// The supsub group is the group that was passed in
var supsub = group;
// The real accent group is the base of the supsub group
group = supsub.value.base;
// The character box is the base of the accent group
base = group.value.base;
// Stick the character box into the base of the supsub group
supsub.value.base = base;
// Rerender the supsub group with its new base, and store that
// result.
supsubGroup = buildGroup(
supsub, options.reset());
}
// Build the base group
var body = buildGroup(
base, options.withStyle(style.cramp()));
// Calculate the skew of the accent. This is based on the line "If the
// nucleus is not a single character, let s = 0; otherwise set s to the
// kern amount for the nucleus followed by the \skewchar of its font."
// Note that our skew metrics are just the kern between each character
// and the skewchar.
var skew;
if (isCharacterBox(base)) {
// If the base is a character box, then we want the skew of the
// innermost character. To do that, we find the innermost character:
var baseChar = getBaseElem(base);
// Then, we render its group to get the symbol inside it
var baseGroup = buildGroup(
baseChar, options.withStyle(style.cramp()));
// Finally, we pull the skew off of the symbol.
skew = baseGroup.skew;
// Note that we now throw away baseGroup, because the layers we
// removed with getBaseElem might contain things like \color which
// we can't get rid of.
// TODO(emily): Find a better way to get the skew
} else {
skew = 0;
}
// calculate the amount of space between the body and the accent
var clearance = Math.min(
body.height,
style.metrics.xHeight);
// Build the accent
var accent = buildCommon$1.makeSymbol(
group.value.accent, "Main-Regular", "math", options);
// Remove the italic correction of the accent, because it only serves to
// shift the accent over to a place we don't want.
accent.italic = 0;
// The \vec character that the fonts use is a combining character, and
// thus shows up much too far to the left. To account for this, we add a
// specific class which shifts the accent over to where we want it.
// TODO(emily): Fix this in a better way, like by changing the font
var vecClass = group.value.accent === "\\vec" ? "accent-vec" : null;
var accentBody = makeSpan$1(["accent-body", vecClass], [
makeSpan$1([], [accent])]);
accentBody = buildCommon$1.makeVList([
{type: "elem", elem: body},
{type: "kern", size: -clearance},
{type: "elem", elem: accentBody}
], "firstBaseline", null, options);
// Shift the accent over by the skew. Note we shift by twice the skew
// because we are centering the accent, so by adding 2*skew to the left,
// we shift it to the right by 1*skew.
accentBody.children[1].style.marginLeft = 2 * skew + "em";
var accentWrap = makeSpan$1(["mord", "accent"], [accentBody], options);
if (supsubGroup) {
// Here, we replace the "base" child of the supsub with our newly
// generated accent.
supsubGroup.children[0] = accentWrap;
// Since we don't rerun the height calculation after replacing the
// accent, we manually recalculate height.
supsubGroup.height = Math.max(accentWrap.height, supsubGroup.height);
// Accents should always be ords, even when their innards are not.
supsubGroup.classes[0] = "mord";
return supsubGroup;
} else {
return accentWrap;
}
};
groupTypes.phantom = function(group, options) {
var elements = buildExpression(
group.value.value,
options.withPhantom(),
false
);
// \phantom isn't supposed to affect the elements it contains.
// See "color" for more details.
return new buildCommon$1.makeFragment(elements);
};
groupTypes.mclass = function(group, options) {
var elements = buildExpression(group.value.value, options, true);
return makeSpan$1([group.value.mclass], elements, options);
};
/**
* buildGroup is the function that takes a group and calls the correct groupType
* function for it. It also handles the interaction of size and style changes
* between parents and children.
*/
var buildGroup = function(group, options) {
if (!group) {
return makeSpan$1();
}
if (groupTypes[group.type]) {
// Call the groupTypes function
var groupNode = groupTypes[group.type](group, options);
var multiplier;
// If the style changed between the parent and the current group,
// account for the size difference
if (options.style !== options.parentStyle) {
multiplier = options.style.sizeMultiplier /
options.parentStyle.sizeMultiplier;
groupNode.height *= multiplier;
groupNode.depth *= multiplier;
}
// If the size changed between the parent and the current group, account
// for that size difference.
if (options.size !== options.parentSize) {
multiplier = buildCommon$1.sizingMultiplier[options.size] /
buildCommon$1.sizingMultiplier[options.parentSize];
groupNode.height *= multiplier;
groupNode.depth *= multiplier;
}
return groupNode;
} else {
throw new ParseError$2(
"Got group of unknown type: '" + group.type + "'");
}
};
/**
* Take an entire parse tree, and build it into an appropriate set of HTML
* nodes.
*/
var buildHTML$1 = function(tree, options) {
// buildExpression is destructive, so we need to make a clone
// of the incoming tree so that it isn't accidentally changed
tree = JSON.parse(JSON.stringify(tree));
// Build the expression contained in the tree
var expression = buildExpression(tree, options, true);
var body = makeSpan$1(["base", options.style.cls()], expression, options);
// Add struts, which ensure that the top of the HTML element falls at the
// height of the expression, and the bottom of the HTML element falls at the
// depth of the expression.
var topStrut = makeSpan$1(["strut"]);
var bottomStrut = makeSpan$1(["strut", "bottom"]);
topStrut.style.height = body.height + "em";
bottomStrut.style.height = (body.height + body.depth) + "em";
// We'd like to use `vertical-align: top` but in IE 9 this lowers the
// baseline of the box to the bottom of this strut (instead staying in the
// normal place) so we use an absolute value for vertical-align instead
bottomStrut.style.verticalAlign = -body.depth + "em";
// Wrap the struts and body together
var htmlNode = makeSpan$1(["katex-html"], [topStrut, bottomStrut, body]);
htmlNode.setAttribute("aria-hidden", "true");
return htmlNode;
};
var buildHTML_1 = buildHTML$1;
/**
* These objects store data about MathML nodes. This is the MathML equivalent
* of the types in domTree.js. Since MathML handles its own rendering, and
* since we're mainly using MathML to improve accessibility, we don't manage
* any of the styling state that the plain DOM nodes do.
*
* The `toNode` and `toMarkup` functions work simlarly to how they do in
* domTree.js, creating namespaced DOM nodes and HTML text markup respectively.
*/
var utils$8 = utils$4;
/**
* This node represents a general purpose MathML node of any type. The
* constructor requires the type of node to create (for example, `"mo"` or
* `"mspace"`, corresponding to `<mo>` and `<mspace>` tags).
*/
function MathNode(type, children) {
this.type = type;
this.attributes = {};
this.children = children || [];
}
/**
* Sets an attribute on a MathML node. MathML depends on attributes to convey a
* semantic content, so this is used heavily.
*/
MathNode.prototype.setAttribute = function(name, value) {
this.attributes[name] = value;
};
/**
* Converts the math node into a MathML-namespaced DOM element.
*/
MathNode.prototype.toNode = function() {
var this$1 = this;
var node = document.createElementNS(
"http://www.w3.org/1998/Math/MathML", this.type);
for (var attr in this.attributes) {
if (Object.prototype.hasOwnProperty.call(this$1.attributes, attr)) {
node.setAttribute(attr, this$1.attributes[attr]);
}
}
for (var i = 0; i < this.children.length; i++) {
node.appendChild(this$1.children[i].toNode());
}
return node;
};
/**
* Converts the math node into an HTML markup string.
*/
MathNode.prototype.toMarkup = function() {
var this$1 = this;
var markup = "<" + this.type;
// Add the attributes
for (var attr in this.attributes) {
if (Object.prototype.hasOwnProperty.call(this$1.attributes, attr)) {
markup += " " + attr + "=\"";
markup += utils$8.escape(this$1.attributes[attr]);
markup += "\"";
}
}
markup += ">";
for (var i = 0; i < this.children.length; i++) {
markup += this$1.children[i].toMarkup();
}
markup += "</" + this.type + ">";
return markup;
};
/**
* This node represents a piece of text.
*/
function TextNode(text) {
this.text = text;
}
/**
* Converts the text node into a DOM text node.
*/
TextNode.prototype.toNode = function() {
return document.createTextNode(this.text);
};
/**
* Converts the text node into HTML markup (which is just the text itself).
*/
TextNode.prototype.toMarkup = function() {
return utils$8.escape(this.text);
};
var mathMLTree$1 = {
MathNode: MathNode,
TextNode: TextNode
};
/**
* This file converts a parse tree into a cooresponding MathML tree. The main
* entry point is the `buildMathML` function, which takes a parse tree from the
* parser.
*/
var buildCommon$5 = buildCommon$2;
var fontMetrics$5 = fontMetrics$1;
var mathMLTree = mathMLTree$1;
var ParseError$4 = ParseError_1;
var symbols$4 = symbols$1;
var utils$7 = utils$4;
var makeSpan$4 = buildCommon$5.makeSpan;
var fontMap$1 = buildCommon$5.fontMap;
/**
* Takes a symbol and converts it into a MathML text node after performing
* optional replacement from symbols.js.
*/
var makeText = function(text, mode) {
if (symbols$4[mode][text] && symbols$4[mode][text].replace) {
text = symbols$4[mode][text].replace;
}
return new mathMLTree.TextNode(text);
};
/**
* Returns the math variant as a string or null if none is required.
*/
var getVariant = function(group, options) {
var font = options.font;
if (!font) {
return null;
}
var mode = group.mode;
if (font === "mathit") {
return "italic";
}
var value = group.value;
if (utils$7.contains(["\\imath", "\\jmath"], value)) {
return null;
}
if (symbols$4[mode][value] && symbols$4[mode][value].replace) {
value = symbols$4[mode][value].replace;
}
var fontName = fontMap$1[font].fontName;
if (fontMetrics$5.getCharacterMetrics(value, fontName)) {
return fontMap$1[options.font].variant;
}
return null;
};
/**
* Functions for handling the different types of groups found in the parse
* tree. Each function should take a parse group and return a MathML node.
*/
var groupTypes$1 = {};
groupTypes$1.mathord = function(group, options) {
var node = new mathMLTree.MathNode(
"mi",
[makeText(group.value, group.mode)]);
var variant = getVariant(group, options);
if (variant) {
node.setAttribute("mathvariant", variant);
}
return node;
};
groupTypes$1.textord = function(group, options) {
var text = makeText(group.value, group.mode);
var variant = getVariant(group, options) || "normal";
var node;
if (/[0-9]/.test(group.value)) {
// TODO(kevinb) merge adjacent <mn> nodes
// do it as a post processing step
node = new mathMLTree.MathNode("mn", [text]);
if (options.font) {
node.setAttribute("mathvariant", variant);
}
} else {
node = new mathMLTree.MathNode("mi", [text]);
node.setAttribute("mathvariant", variant);
}
return node;
};
groupTypes$1.bin = function(group) {
var node = new mathMLTree.MathNode(
"mo", [makeText(group.value, group.mode)]);
return node;
};
groupTypes$1.rel = function(group) {
var node = new mathMLTree.MathNode(
"mo", [makeText(group.value, group.mode)]);
return node;
};
groupTypes$1.open = function(group) {
var node = new mathMLTree.MathNode(
"mo", [makeText(group.value, group.mode)]);
return node;
};
groupTypes$1.close = function(group) {
var node = new mathMLTree.MathNode(
"mo", [makeText(group.value, group.mode)]);
return node;
};
groupTypes$1.inner = function(group) {
var node = new mathMLTree.MathNode(
"mo", [makeText(group.value, group.mode)]);
return node;
};
groupTypes$1.punct = function(group) {
var node = new mathMLTree.MathNode(
"mo", [makeText(group.value, group.mode)]);
node.setAttribute("separator", "true");
return node;
};
groupTypes$1.ordgroup = function(group, options) {
var inner = buildExpression$1(group.value, options);
var node = new mathMLTree.MathNode("mrow", inner);
return node;
};
groupTypes$1.text = function(group, options) {
var inner = buildExpression$1(group.value.body, options);
var node = new mathMLTree.MathNode("mtext", inner);
return node;
};
groupTypes$1.color = function(group, options) {
var inner = buildExpression$1(group.value.value, options);
var node = new mathMLTree.MathNode("mstyle", inner);
node.setAttribute("mathcolor", group.value.color);
return node;
};
groupTypes$1.supsub = function(group, options) {
var children = [buildGroup$1(group.value.base, options)];
if (group.value.sub) {
children.push(buildGroup$1(group.value.sub, options));
}
if (group.value.sup) {
children.push(buildGroup$1(group.value.sup, options));
}
var nodeType;
if (!group.value.sub) {
nodeType = "msup";
} else if (!group.value.sup) {
nodeType = "msub";
} else {
nodeType = "msubsup";
}
var node = new mathMLTree.MathNode(nodeType, children);
return node;
};
groupTypes$1.genfrac = function(group, options) {
var node = new mathMLTree.MathNode(
"mfrac",
[buildGroup$1(group.value.numer, options),
buildGroup$1(group.value.denom, options)]);
if (!group.value.hasBarLine) {
node.setAttribute("linethickness", "0px");
}
if (group.value.leftDelim != null || group.value.rightDelim != null) {
var withDelims = [];
if (group.value.leftDelim != null) {
var leftOp = new mathMLTree.MathNode(
"mo", [new mathMLTree.TextNode(group.value.leftDelim)]);
leftOp.setAttribute("fence", "true");
withDelims.push(leftOp);
}
withDelims.push(node);
if (group.value.rightDelim != null) {
var rightOp = new mathMLTree.MathNode(
"mo", [new mathMLTree.TextNode(group.value.rightDelim)]);
rightOp.setAttribute("fence", "true");
withDelims.push(rightOp);
}
var outerNode = new mathMLTree.MathNode("mrow", withDelims);
return outerNode;
}
return node;
};
groupTypes$1.array = function(group, options) {
return new mathMLTree.MathNode(
"mtable", group.value.body.map(function(row) {
return new mathMLTree.MathNode(
"mtr", row.map(function(cell) {
return new mathMLTree.MathNode(
"mtd", [buildGroup$1(cell, options)]);
}));
}));
};
groupTypes$1.sqrt = function(group, options) {
var node;
if (group.value.index) {
node = new mathMLTree.MathNode(
"mroot", [
buildGroup$1(group.value.body, options),
buildGroup$1(group.value.index, options)
]);
} else {
node = new mathMLTree.MathNode(
"msqrt", [buildGroup$1(group.value.body, options)]);
}
return node;
};
groupTypes$1.leftright = function(group, options) {
var inner = buildExpression$1(group.value.body, options);
if (group.value.left !== ".") {
var leftNode = new mathMLTree.MathNode(
"mo", [makeText(group.value.left, group.mode)]);
leftNode.setAttribute("fence", "true");
inner.unshift(leftNode);
}
if (group.value.right !== ".") {
var rightNode = new mathMLTree.MathNode(
"mo", [makeText(group.value.right, group.mode)]);
rightNode.setAttribute("fence", "true");
inner.push(rightNode);
}
var outerNode = new mathMLTree.MathNode("mrow", inner);
return outerNode;
};
groupTypes$1.middle = function(group, options) {
var middleNode = new mathMLTree.MathNode(
"mo", [makeText(group.value.middle, group.mode)]);
middleNode.setAttribute("fence", "true");
return middleNode;
};
groupTypes$1.accent = function(group, options) {
var accentNode = new mathMLTree.MathNode(
"mo", [makeText(group.value.accent, group.mode)]);
var node = new mathMLTree.MathNode(
"mover",
[buildGroup$1(group.value.base, options),
accentNode]);
node.setAttribute("accent", "true");
return node;
};
groupTypes$1.spacing = function(group) {
var node;
if (group.value === "\\ " || group.value === "\\space" ||
group.value === " " || group.value === "~") {
node = new mathMLTree.MathNode(
"mtext", [new mathMLTree.TextNode("\u00a0")]);
} else {
node = new mathMLTree.MathNode("mspace");
node.setAttribute(
"width", buildCommon$5.spacingFunctions[group.value].size);
}
return node;
};
groupTypes$1.op = function(group, options) {
var node;
// TODO(emily): handle big operators using the `largeop` attribute
if (group.value.symbol) {
// This is a symbol. Just add the symbol.
node = new mathMLTree.MathNode(
"mo", [makeText(group.value.body, group.mode)]);
} else if (group.value.value) {
// This is an operator with children. Add them.
node = new mathMLTree.MathNode(
"mo", buildExpression$1(group.value.value, options));
} else {
// This is a text operator. Add all of the characters from the
// operator's name.
// TODO(emily): Add a space in the middle of some of these
// operators, like \limsup.
node = new mathMLTree.MathNode(
"mi", [new mathMLTree.TextNode(group.value.body.slice(1))]);
}
return node;
};
groupTypes$1.mod = function(group, options) {
var inner = [];
if (group.value.modType === "pod" || group.value.modType === "pmod") {
inner.push(new mathMLTree.MathNode(
"mo", [makeText("(", group.mode)]));
}
if (group.value.modType !== "pod") {
inner.push(new mathMLTree.MathNode(
"mo", [makeText("mod", group.mode)]));
}
if (group.value.value) {
var space = new mathMLTree.MathNode("mspace");
space.setAttribute("width", "0.333333em");
inner.push(space);
inner = inner.concat(buildExpression$1(group.value.value, options));
}
if (group.value.modType === "pod" || group.value.modType === "pmod") {
inner.push(new mathMLTree.MathNode(
"mo", [makeText(")", group.mode)]));
}
return new mathMLTree.MathNode("mo", inner);
};
groupTypes$1.katex = function(group) {
var node = new mathMLTree.MathNode(
"mtext", [new mathMLTree.TextNode("KaTeX")]);
return node;
};
groupTypes$1.font = function(group, options) {
var font = group.value.font;
return buildGroup$1(group.value.body, options.withFont(font));
};
groupTypes$1.delimsizing = function(group) {
var children = [];
if (group.value.value !== ".") {
children.push(makeText(group.value.value, group.mode));
}
var node = new mathMLTree.MathNode("mo", children);
if (group.value.mclass === "mopen" ||
group.value.mclass === "mclose") {
// Only some of the delimsizing functions act as fences, and they
// return "mopen" or "mclose" mclass.
node.setAttribute("fence", "true");
} else {
// Explicitly disable fencing if it's not a fence, to override the
// defaults.
node.setAttribute("fence", "false");
}
return node;
};
groupTypes$1.styling = function(group, options) {
var inner = buildExpression$1(group.value.value, options);
var node = new mathMLTree.MathNode("mstyle", inner);
var styleAttributes = {
"display": ["0", "true"],
"text": ["0", "false"],
"script": ["1", "false"],
"scriptscript": ["2", "false"]
};
var attr = styleAttributes[group.value.style];
node.setAttribute("scriptlevel", attr[0]);
node.setAttribute("displaystyle", attr[1]);
return node;
};
groupTypes$1.sizing = function(group, options) {
var inner = buildExpression$1(group.value.value, options);
var node = new mathMLTree.MathNode("mstyle", inner);
// TODO(emily): This doesn't produce the correct size for nested size
// changes, because we don't keep state of what style we're currently
// in, so we can't reset the size to normal before changing it. Now
// that we're passing an options parameter we should be able to fix
// this.
node.setAttribute(
"mathsize", buildCommon$5.sizingMultiplier[group.value.size] + "em");
return node;
};
groupTypes$1.overline = function(group, options) {
var operator = new mathMLTree.MathNode(
"mo", [new mathMLTree.TextNode("\u203e")]);
operator.setAttribute("stretchy", "true");
var node = new mathMLTree.MathNode(
"mover",
[buildGroup$1(group.value.body, options),
operator]);
node.setAttribute("accent", "true");
return node;
};
groupTypes$1.underline = function(group, options) {
var operator = new mathMLTree.MathNode(
"mo", [new mathMLTree.TextNode("\u203e")]);
operator.setAttribute("stretchy", "true");
var node = new mathMLTree.MathNode(
"munder",
[buildGroup$1(group.value.body, options),
operator]);
node.setAttribute("accentunder", "true");
return node;
};
groupTypes$1.rule = function(group) {
// TODO(emily): Figure out if there's an actual way to draw black boxes
// in MathML.
var node = new mathMLTree.MathNode("mrow");
return node;
};
groupTypes$1.kern = function(group) {
// TODO(kevin): Figure out if there's a way to add space in MathML
var node = new mathMLTree.MathNode("mrow");
return node;
};
groupTypes$1.llap = function(group, options) {
var node = new mathMLTree.MathNode(
"mpadded", [buildGroup$1(group.value.body, options)]);
node.setAttribute("lspace", "-1width");
node.setAttribute("width", "0px");
return node;
};
groupTypes$1.rlap = function(group, options) {
var node = new mathMLTree.MathNode(
"mpadded", [buildGroup$1(group.value.body, options)]);
node.setAttribute("width", "0px");
return node;
};
groupTypes$1.phantom = function(group, options) {
var inner = buildExpression$1(group.value.value, options);
return new mathMLTree.MathNode("mphantom", inner);
};
groupTypes$1.mclass = function(group, options) {
var inner = buildExpression$1(group.value.value, options);
return new mathMLTree.MathNode("mstyle", inner);
};
/**
* Takes a list of nodes, builds them, and returns a list of the generated
* MathML nodes. A little simpler than the HTML version because we don't do any
* previous-node handling.
*/
var buildExpression$1 = function(expression, options) {
var groups = [];
for (var i = 0; i < expression.length; i++) {
var group = expression[i];
groups.push(buildGroup$1(group, options));
}
return groups;
};
/**
* Takes a group from the parser and calls the appropriate groupTypes function
* on it to produce a MathML node.
*/
var buildGroup$1 = function(group, options) {
if (!group) {
return new mathMLTree.MathNode("mrow");
}
if (groupTypes$1[group.type]) {
// Call the groupTypes function
return groupTypes$1[group.type](group, options);
} else {
throw new ParseError$4(
"Got group of unknown type: '" + group.type + "'");
}
};
/**
* Takes a full parse tree and settings and builds a MathML representation of
* it. In particular, we put the elements from building the parse tree into a
* <semantics> tag so we can also include that TeX source as an annotation.
*
* Note that we actually return a domTree element with a `<math>` inside it so
* we can do appropriate styling.
*/
var buildMathML$1 = function(tree, texExpression, options) {
var expression = buildExpression$1(tree, options);
// Wrap up the expression in an mrow so it is presented in the semantics
// tag correctly.
var wrapper = new mathMLTree.MathNode("mrow", expression);
// Build a TeX annotation of the source
var annotation = new mathMLTree.MathNode(
"annotation", [new mathMLTree.TextNode(texExpression)]);
annotation.setAttribute("encoding", "application/x-tex");
var semantics = new mathMLTree.MathNode(
"semantics", [wrapper, annotation]);
var math = new mathMLTree.MathNode("math", [semantics]);
// You can't style <math> nodes, so we wrap the node in a span.
return makeSpan$4(["katex-mathml"], [math]);
};
var buildMathML_1 = buildMathML$1;
/**
* This file contains information about the options that the Parser carries
* around with it while parsing. Data is held in an `Options` object, and when
* recursing, a new `Options` object can be created with the `.with*` and
* `.reset` functions.
*/
/**
* This is the main options class. It contains the style, size, color, and font
* of the current parse level. It also contains the style and size of the parent
* parse level, so size changes can be handled efficiently.
*
* Each of the `.with*` and `.reset` functions passes its current style and size
* as the parentStyle and parentSize of the new options class, so parent
* handling is taken care of automatically.
*/
function Options$1(data) {
this.style = data.style;
this.color = data.color;
this.size = data.size;
this.phantom = data.phantom;
this.font = data.font;
if (data.parentStyle === undefined) {
this.parentStyle = data.style;
} else {
this.parentStyle = data.parentStyle;
}
if (data.parentSize === undefined) {
this.parentSize = data.size;
} else {
this.parentSize = data.parentSize;
}
}
/**
* Returns a new options object with the same properties as "this". Properties
* from "extension" will be copied to the new options object.
*/
Options$1.prototype.extend = function(extension) {
var data = {
style: this.style,
size: this.size,
color: this.color,
parentStyle: this.style,
parentSize: this.size,
phantom: this.phantom,
font: this.font
};
for (var key in extension) {
if (extension.hasOwnProperty(key)) {
data[key] = extension[key];
}
}
return new Options$1(data);
};
/**
* Create a new options object with the given style.
*/
Options$1.prototype.withStyle = function(style) {
return this.extend({
style: style
});
};
/**
* Create a new options object with the given size.
*/
Options$1.prototype.withSize = function(size) {
return this.extend({
size: size
});
};
/**
* Create a new options object with the given color.
*/
Options$1.prototype.withColor = function(color) {
return this.extend({
color: color
});
};
/**
* Create a new options object with "phantom" set to true.
*/
Options$1.prototype.withPhantom = function() {
return this.extend({
phantom: true
});
};
/**
* Create a new options objects with the give font.
*/
Options$1.prototype.withFont = function(font) {
return this.extend({
font: font || this.font
});
};
/**
* Create a new options object with the same style, size, and color. This is
* used so that parent style and size changes are handled correctly.
*/
Options$1.prototype.reset = function() {
return this.extend({});
};
/**
* A map of color names to CSS colors.
* TODO(emily): Remove this when we have real macros
*/
var colorMap = {
"katex-blue": "#6495ed",
"katex-orange": "#ffa500",
"katex-pink": "#ff00af",
"katex-red": "#df0030",
"katex-green": "#28ae7b",
"katex-gray": "gray",
"katex-purple": "#9d38bd",
"katex-blueA": "#ccfaff",
"katex-blueB": "#80f6ff",
"katex-blueC": "#63d9ea",
"katex-blueD": "#11accd",
"katex-blueE": "#0c7f99",
"katex-tealA": "#94fff5",
"katex-tealB": "#26edd5",
"katex-tealC": "#01d1c1",
"katex-tealD": "#01a995",
"katex-tealE": "#208170",
"katex-greenA": "#b6ffb0",
"katex-greenB": "#8af281",
"katex-greenC": "#74cf70",
"katex-greenD": "#1fab54",
"katex-greenE": "#0d923f",
"katex-goldA": "#ffd0a9",
"katex-goldB": "#ffbb71",
"katex-goldC": "#ff9c39",
"katex-goldD": "#e07d10",
"katex-goldE": "#a75a05",
"katex-redA": "#fca9a9",
"katex-redB": "#ff8482",
"katex-redC": "#f9685d",
"katex-redD": "#e84d39",
"katex-redE": "#bc2612",
"katex-maroonA": "#ffbde0",
"katex-maroonB": "#ff92c6",
"katex-maroonC": "#ed5fa6",
"katex-maroonD": "#ca337c",
"katex-maroonE": "#9e034e",
"katex-purpleA": "#ddd7ff",
"katex-purpleB": "#c6b9fc",
"katex-purpleC": "#aa87ff",
"katex-purpleD": "#7854ab",
"katex-purpleE": "#543b78",
"katex-mintA": "#f5f9e8",
"katex-mintB": "#edf2df",
"katex-mintC": "#e0e5cc",
"katex-grayA": "#f6f7f7",
"katex-grayB": "#f0f1f2",
"katex-grayC": "#e3e5e6",
"katex-grayD": "#d6d8da",
"katex-grayE": "#babec2",
"katex-grayF": "#888d93",
"katex-grayG": "#626569",
"katex-grayH": "#3b3e40",
"katex-grayI": "#21242c",
"katex-kaBlue": "#314453",
"katex-kaGreen": "#71B307"
};
/**
* Gets the CSS color of the current options object, accounting for the
* `colorMap`.
*/
Options$1.prototype.getColor = function() {
if (this.phantom) {
return "transparent";
} else {
return colorMap[this.color] || this.color;
}
};
var Options_1 = Options$1;
var buildHTML = buildHTML_1;
var buildMathML = buildMathML_1;
var buildCommon = buildCommon$2;
var Options = Options_1;
var Settings$2 = Settings_1;
var Style = Style_1;
var makeSpan = buildCommon.makeSpan;
var buildTree$1 = function(tree, expression, settings) {
settings = settings || new Settings$2({});
var startStyle = Style.TEXT;
if (settings.displayMode) {
startStyle = Style.DISPLAY;
}
// Setup the default options
var options = new Options({
style: startStyle,
size: "size5"
});
// `buildHTML` sometimes messes with the parse tree (like turning bins ->
// ords), so we build the MathML version first.
var mathMLNode = buildMathML(tree, expression, options);
var htmlNode = buildHTML(tree, options);
var katexNode = makeSpan(["katex"], [
mathMLNode, htmlNode
]);
if (settings.displayMode) {
return makeSpan(["katex-display"], [katexNode]);
} else {
return katexNode;
}
};
var buildTree_1 = buildTree$1;
/**
* The resulting parse tree nodes of the parse tree.
*
* It is possible to provide position information, so that a ParseNode can
* fulfil a role similar to a Token in error reporting.
* For details on the corresponding properties see Token constructor.
* Providing such information can lead to better error reporting.
*
* @param {string} type type of node, like e.g. "ordgroup"
* @param {?object} value type-specific representation of the node
* @param {string} mode parse mode in action for this node,
* "math" or "text"
* @param {Token=} firstToken first token of the input for this node,
* will omit position information if unset
* @param {Token=} lastToken last token of the input for this node,
* will default to firstToken if unset
*/
function ParseNode$1(type, value, mode, firstToken, lastToken) {
this.type = type;
this.value = value;
this.mode = mode;
if (firstToken && (!lastToken || lastToken.lexer === firstToken.lexer)) {
this.lexer = firstToken.lexer;
this.start = firstToken.start;
this.end = (lastToken || firstToken).end;
}
}
var parseData$1 = {
ParseNode: ParseNode$1
};
var functions$1 = createCommonjsModule(function (module) {
var utils = utils$4;
var ParseError = ParseError_1;
var parseData = parseData$1;
var ParseNode = parseData.ParseNode;
/* This file contains a list of functions that we parse, identified by
* the calls to defineFunction.
*
* The first argument to defineFunction is a single name or a list of names.
* All functions named in such a list will share a single implementation.
*
* Each declared function can have associated properties, which
* include the following:
*
* - numArgs: The number of arguments the function takes.
* If this is the only property, it can be passed as a number
* instead of an element of a properties object.
* - argTypes: (optional) An array corresponding to each argument of the
* function, giving the type of argument that should be parsed. Its
* length should be equal to `numArgs + numOptionalArgs`. Valid
* types:
* - "size": A size-like thing, such as "1em" or "5ex"
* - "color": An html color, like "#abc" or "blue"
* - "original": The same type as the environment that the
* function being parsed is in (e.g. used for the
* bodies of functions like \color where the first
* argument is special and the second argument is
* parsed normally)
* Other possible types (probably shouldn't be used)
* - "text": Text-like (e.g. \text)
* - "math": Normal math
* If undefined, this will be treated as an appropriate length
* array of "original" strings
* - greediness: (optional) The greediness of the function to use ungrouped
* arguments.
*
* E.g. if you have an expression
* \sqrt \frac 1 2
* since \frac has greediness=2 vs \sqrt's greediness=1, \frac
* will use the two arguments '1' and '2' as its two arguments,
* then that whole function will be used as the argument to
* \sqrt. On the other hand, the expressions
* \frac \frac 1 2 3
* and
* \frac \sqrt 1 2
* will fail because \frac and \frac have equal greediness
* and \sqrt has a lower greediness than \frac respectively. To
* make these parse, we would have to change them to:
* \frac {\frac 1 2} 3
* and
* \frac {\sqrt 1} 2
*
* The default value is `1`
* - allowedInText: (optional) Whether or not the function is allowed inside
* text mode (default false)
* - numOptionalArgs: (optional) The number of optional arguments the function
* should parse. If the optional arguments aren't found,
* `null` will be passed to the handler in their place.
* (default 0)
* - infix: (optional) Must be true if the function is an infix operator.
*
* The last argument is that implementation, the handler for the function(s).
* It is called to handle these functions and their arguments.
* It receives two arguments:
* - context contains information and references provided by the parser
* - args is an array of arguments obtained from TeX input
* The context contains the following properties:
* - funcName: the text (i.e. name) of the function, including \
* - parser: the parser object
* - lexer: the lexer object
* - positions: the positions in the overall string of the function
* and the arguments.
* The latter three should only be used to produce error messages.
*
* The function should return an object with the following keys:
* - type: The type of element that this is. This is then used in
* buildHTML/buildMathML to determine which function
* should be called to build this node into a DOM node
* Any other data can be added to the object, which will be passed
* in to the function in buildHTML/buildMathML as `group.value`.
*/
function defineFunction(names, props, handler) {
if (typeof names === "string") {
names = [names];
}
if (typeof props === "number") {
props = { numArgs: props };
}
// Set default values of functions
var data = {
numArgs: props.numArgs,
argTypes: props.argTypes,
greediness: (props.greediness === undefined) ? 1 : props.greediness,
allowedInText: !!props.allowedInText,
numOptionalArgs: props.numOptionalArgs || 0,
infix: !!props.infix,
handler: handler
};
for (var i = 0; i < names.length; ++i) {
module.exports[names[i]] = data;
}
}
// Since the corresponding buildHTML/buildMathML function expects a
// list of elements, we normalize for different kinds of arguments
var ordargument = function(arg) {
if (arg.type === "ordgroup") {
return arg.value;
} else {
return [arg];
}
};
// A normal square root
defineFunction("\\sqrt", {
numArgs: 1,
numOptionalArgs: 1
}, function(context, args) {
var index = args[0];
var body = args[1];
return {
type: "sqrt",
body: body,
index: index
};
});
// Non-mathy text, possibly in a font
var textFunctionStyles = {
"\\text": undefined, "\\textrm": "mathrm", "\\textsf": "mathsf",
"\\texttt": "mathtt", "\\textnormal": "mathrm", "\\textbf": "mathbf",
"\\textit": "textit"
};
defineFunction([
"\\text", "\\textrm", "\\textsf", "\\texttt", "\\textnormal",
"\\textbf", "\\textit"
], {
numArgs: 1,
argTypes: ["text"],
greediness: 2,
allowedInText: true
}, function(context, args) {
var body = args[0];
return {
type: "text",
body: ordargument(body),
style: textFunctionStyles[context.funcName]
};
});
// A two-argument custom color
defineFunction("\\color", {
numArgs: 2,
allowedInText: true,
greediness: 3,
argTypes: ["color", "original"]
}, function(context, args) {
var color = args[0];
var body = args[1];
return {
type: "color",
color: color.value,
value: ordargument(body)
};
});
// An overline
defineFunction("\\overline", {
numArgs: 1
}, function(context, args) {
var body = args[0];
return {
type: "overline",
body: body
};
});
// An underline
defineFunction("\\underline", {
numArgs: 1
}, function(context, args) {
var body = args[0];
return {
type: "underline",
body: body
};
});
// A box of the width and height
defineFunction("\\rule", {
numArgs: 2,
numOptionalArgs: 1,
argTypes: ["size", "size", "size"]
}, function(context, args) {
var shift = args[0];
var width = args[1];
var height = args[2];
return {
type: "rule",
shift: shift && shift.value,
width: width.value,
height: height.value
};
});
// TODO: In TeX, \mkern only accepts mu-units, and \kern does not accept
// mu-units. In current KaTeX we relax this; both commands accept any unit.
defineFunction(["\\kern", "\\mkern"], {
numArgs: 1,
argTypes: ["size"]
}, function(context, args) {
return {
type: "kern",
dimension: args[0].value
};
});
// A KaTeX logo
defineFunction("\\KaTeX", {
numArgs: 0
}, function(context) {
return {
type: "katex"
};
});
defineFunction("\\phantom", {
numArgs: 1
}, function(context, args) {
var body = args[0];
return {
type: "phantom",
value: ordargument(body)
};
});
// Math class commands except \mathop
defineFunction([
"\\mathord", "\\mathbin", "\\mathrel", "\\mathopen",
"\\mathclose", "\\mathpunct", "\\mathinner"
], {
numArgs: 1
}, function(context, args) {
var body = args[0];
return {
type: "mclass",
mclass: "m" + context.funcName.substr(5),
value: ordargument(body)
};
});
// Build a relation by placing one symbol on top of another
defineFunction("\\stackrel", {
numArgs: 2
}, function(context, args) {
var top = args[0];
var bottom = args[1];
var bottomop = new ParseNode("op", {
type: "op",
limits: true,
alwaysHandleSupSub: true,
symbol: false,
value: ordargument(bottom)
}, bottom.mode);
var supsub = new ParseNode("supsub", {
base: bottomop,
sup: top,
sub: null
}, top.mode);
return {
type: "mclass",
mclass: "mrel",
value: [supsub]
};
});
// \mod-type functions
defineFunction("\\bmod", {
numArgs: 0
}, function(context, args) {
return {
type: "mod",
modType: "bmod",
value: null
};
});
defineFunction(["\\pod", "\\pmod", "\\mod"], {
numArgs: 1
}, function(context, args) {
var body = args[0];
return {
type: "mod",
modType: context.funcName.substr(1),
value: ordargument(body)
};
});
// Extra data needed for the delimiter handler down below
var delimiterSizes = {
"\\bigl" : {mclass: "mopen", size: 1},
"\\Bigl" : {mclass: "mopen", size: 2},
"\\biggl": {mclass: "mopen", size: 3},
"\\Biggl": {mclass: "mopen", size: 4},
"\\bigr" : {mclass: "mclose", size: 1},
"\\Bigr" : {mclass: "mclose", size: 2},
"\\biggr": {mclass: "mclose", size: 3},
"\\Biggr": {mclass: "mclose", size: 4},
"\\bigm" : {mclass: "mrel", size: 1},
"\\Bigm" : {mclass: "mrel", size: 2},
"\\biggm": {mclass: "mrel", size: 3},
"\\Biggm": {mclass: "mrel", size: 4},
"\\big" : {mclass: "mord", size: 1},
"\\Big" : {mclass: "mord", size: 2},
"\\bigg" : {mclass: "mord", size: 3},
"\\Bigg" : {mclass: "mord", size: 4}
};
var delimiters = [
"(", ")", "[", "\\lbrack", "]", "\\rbrack",
"\\{", "\\lbrace", "\\}", "\\rbrace",
"\\lfloor", "\\rfloor", "\\lceil", "\\rceil",
"<", ">", "\\langle", "\\rangle", "\\lt", "\\gt",
"\\lvert", "\\rvert", "\\lVert", "\\rVert",
"\\lgroup", "\\rgroup", "\\lmoustache", "\\rmoustache",
"/", "\\backslash",
"|", "\\vert", "\\|", "\\Vert",
"\\uparrow", "\\Uparrow",
"\\downarrow", "\\Downarrow",
"\\updownarrow", "\\Updownarrow",
"."
];
var fontAliases = {
"\\Bbb": "\\mathbb",
"\\bold": "\\mathbf",
"\\frak": "\\mathfrak"
};
// Single-argument color functions
defineFunction([
"\\blue", "\\orange", "\\pink", "\\red",
"\\green", "\\gray", "\\purple",
"\\blueA", "\\blueB", "\\blueC", "\\blueD", "\\blueE",
"\\tealA", "\\tealB", "\\tealC", "\\tealD", "\\tealE",
"\\greenA", "\\greenB", "\\greenC", "\\greenD", "\\greenE",
"\\goldA", "\\goldB", "\\goldC", "\\goldD", "\\goldE",
"\\redA", "\\redB", "\\redC", "\\redD", "\\redE",
"\\maroonA", "\\maroonB", "\\maroonC", "\\maroonD", "\\maroonE",
"\\purpleA", "\\purpleB", "\\purpleC", "\\purpleD", "\\purpleE",
"\\mintA", "\\mintB", "\\mintC",
"\\grayA", "\\grayB", "\\grayC", "\\grayD", "\\grayE",
"\\grayF", "\\grayG", "\\grayH", "\\grayI",
"\\kaBlue", "\\kaGreen"
], {
numArgs: 1,
allowedInText: true,
greediness: 3
}, function(context, args) {
var body = args[0];
return {
type: "color",
color: "katex-" + context.funcName.slice(1),
value: ordargument(body)
};
});
// There are 2 flags for operators; whether they produce limits in
// displaystyle, and whether they are symbols and should grow in
// displaystyle. These four groups cover the four possible choices.
// No limits, not symbols
defineFunction([
"\\arcsin", "\\arccos", "\\arctan", "\\arg", "\\cos", "\\cosh",
"\\cot", "\\coth", "\\csc", "\\deg", "\\dim", "\\exp", "\\hom",
"\\ker", "\\lg", "\\ln", "\\log", "\\sec", "\\sin", "\\sinh",
"\\tan", "\\tanh"
], {
numArgs: 0
}, function(context) {
return {
type: "op",
limits: false,
symbol: false,
body: context.funcName
};
});
// Limits, not symbols
defineFunction([
"\\det", "\\gcd", "\\inf", "\\lim", "\\liminf", "\\limsup", "\\max",
"\\min", "\\Pr", "\\sup"
], {
numArgs: 0
}, function(context) {
return {
type: "op",
limits: true,
symbol: false,
body: context.funcName
};
});
// No limits, symbols
defineFunction([
"\\int", "\\iint", "\\iiint", "\\oint"
], {
numArgs: 0
}, function(context) {
return {
type: "op",
limits: false,
symbol: true,
body: context.funcName
};
});
// Limits, symbols
defineFunction([
"\\coprod", "\\bigvee", "\\bigwedge", "\\biguplus", "\\bigcap",
"\\bigcup", "\\intop", "\\prod", "\\sum", "\\bigotimes",
"\\bigoplus", "\\bigodot", "\\bigsqcup", "\\smallint"
], {
numArgs: 0
}, function(context) {
return {
type: "op",
limits: true,
symbol: true,
body: context.funcName
};
});
// \mathop class command
defineFunction("\\mathop", {
numArgs: 1
}, function(context, args) {
var body = args[0];
return {
type: "op",
limits: false,
symbol: false,
value: ordargument(body)
};
});
// Fractions
defineFunction([
"\\dfrac", "\\frac", "\\tfrac",
"\\dbinom", "\\binom", "\\tbinom",
"\\\\atopfrac" // can’t be entered directly
], {
numArgs: 2,
greediness: 2
}, function(context, args) {
var numer = args[0];
var denom = args[1];
var hasBarLine;
var leftDelim = null;
var rightDelim = null;
var size = "auto";
switch (context.funcName) {
case "\\dfrac":
case "\\frac":
case "\\tfrac":
hasBarLine = true;
break;
case "\\\\atopfrac":
hasBarLine = false;
break;
case "\\dbinom":
case "\\binom":
case "\\tbinom":
hasBarLine = false;
leftDelim = "(";
rightDelim = ")";
break;
default:
throw new Error("Unrecognized genfrac command");
}
switch (context.funcName) {
case "\\dfrac":
case "\\dbinom":
size = "display";
break;
case "\\tfrac":
case "\\tbinom":
size = "text";
break;
}
return {
type: "genfrac",
numer: numer,
denom: denom,
hasBarLine: hasBarLine,
leftDelim: leftDelim,
rightDelim: rightDelim,
size: size
};
});
// Left and right overlap functions
defineFunction(["\\llap", "\\rlap"], {
numArgs: 1,
allowedInText: true
}, function(context, args) {
var body = args[0];
return {
type: context.funcName.slice(1),
body: body
};
});
// Delimiter functions
var checkDelimiter = function(delim, context) {
if (utils.contains(delimiters, delim.value)) {
return delim;
} else {
throw new ParseError(
"Invalid delimiter: '" + delim.value + "' after '" +
context.funcName + "'", delim);
}
};
defineFunction([
"\\bigl", "\\Bigl", "\\biggl", "\\Biggl",
"\\bigr", "\\Bigr", "\\biggr", "\\Biggr",
"\\bigm", "\\Bigm", "\\biggm", "\\Biggm",
"\\big", "\\Big", "\\bigg", "\\Bigg"
], {
numArgs: 1
}, function(context, args) {
var delim = checkDelimiter(args[0], context);
return {
type: "delimsizing",
size: delimiterSizes[context.funcName].size,
mclass: delimiterSizes[context.funcName].mclass,
value: delim.value
};
});
defineFunction([
"\\left", "\\right"
], {
numArgs: 1
}, function(context, args) {
var delim = checkDelimiter(args[0], context);
// \left and \right are caught somewhere in Parser.js, which is
// why this data doesn't match what is in buildHTML.
return {
type: "leftright",
value: delim.value
};
});
defineFunction("\\middle", {
numArgs: 1
}, function(context, args) {
var delim = checkDelimiter(args[0], context);
if (!context.parser.leftrightDepth) {
throw new ParseError("\\middle without preceding \\left", delim);
}
return {
type: "middle",
value: delim.value
};
});
// Sizing functions (handled in Parser.js explicitly, hence no handler)
defineFunction([
"\\tiny", "\\scriptsize", "\\footnotesize", "\\small",
"\\normalsize", "\\large", "\\Large", "\\LARGE", "\\huge", "\\Huge"
], 0, null);
// Style changing functions (handled in Parser.js explicitly, hence no
// handler)
defineFunction([
"\\displaystyle", "\\textstyle", "\\scriptstyle",
"\\scriptscriptstyle"
], 0, null);
defineFunction([
// styles
"\\mathrm", "\\mathit", "\\mathbf",
// families
"\\mathbb", "\\mathcal", "\\mathfrak", "\\mathscr", "\\mathsf",
"\\mathtt",
// aliases
"\\Bbb", "\\bold", "\\frak"
], {
numArgs: 1,
greediness: 2
}, function(context, args) {
var body = args[0];
var func = context.funcName;
if (func in fontAliases) {
func = fontAliases[func];
}
return {
type: "font",
font: func.slice(1),
body: body
};
});
// Accents
defineFunction([
"\\acute", "\\grave", "\\ddot", "\\tilde", "\\bar", "\\breve",
"\\check", "\\hat", "\\vec", "\\dot" ], {
numArgs: 1
}, function(context, args) {
var base = args[0];
return {
type: "accent",
accent: context.funcName,
base: base
};
});
// Infix generalized fractions
defineFunction(["\\over", "\\choose", "\\atop"], {
numArgs: 0,
infix: true
}, function(context) {
var replaceWith;
switch (context.funcName) {
case "\\over":
replaceWith = "\\frac";
break;
case "\\choose":
replaceWith = "\\binom";
break;
case "\\atop":
replaceWith = "\\\\atopfrac";
break;
default:
throw new Error("Unrecognized infix genfrac command");
}
return {
type: "infix",
replaceWith: replaceWith,
token: context.token
};
});
// Row breaks for aligned data
defineFunction(["\\\\", "\\cr"], {
numArgs: 0,
numOptionalArgs: 1,
argTypes: ["size"]
}, function(context, args) {
var size = args[0];
return {
type: "cr",
size: size
};
});
// Environment delimiters
defineFunction(["\\begin", "\\end"], {
numArgs: 1,
argTypes: ["text"]
}, function(context, args) {
var nameGroup = args[0];
if (nameGroup.type !== "ordgroup") {
throw new ParseError("Invalid environment name", nameGroup);
}
var name = "";
for (var i = 0; i < nameGroup.value.length; ++i) {
name += nameGroup.value[i].value;
}
return {
type: "environment",
name: name,
nameGroup: nameGroup
};
});
});
var environments$1 = createCommonjsModule(function (module) {
/* eslint no-constant-condition:0 */
var parseData = parseData$1;
var ParseError = ParseError_1;
var Style = Style_1;
var ParseNode = parseData.ParseNode;
/**
* Parse the body of the environment, with rows delimited by \\ and
* columns delimited by &, and create a nested list in row-major order
* with one group per cell.
*/
function parseArray(parser, result) {
var row = [];
var body = [row];
var rowGaps = [];
while (true) {
var cell = parser.parseExpression(false, null);
row.push(new ParseNode("ordgroup", cell, parser.mode));
var next = parser.nextToken.text;
if (next === "&") {
parser.consume();
} else if (next === "\\end") {
break;
} else if (next === "\\\\" || next === "\\cr") {
var cr = parser.parseFunction();
rowGaps.push(cr.value.size);
row = [];
body.push(row);
} else {
throw new ParseError("Expected & or \\\\ or \\end",
parser.nextToken);
}
}
result.body = body;
result.rowGaps = rowGaps;
return new ParseNode(result.type, result, parser.mode);
}
/*
* An environment definition is very similar to a function definition:
* it is declared with a name or a list of names, a set of properties
* and a handler containing the actual implementation.
*
* The properties include:
* - numArgs: The number of arguments after the \begin{name} function.
* - argTypes: (optional) Just like for a function
* - allowedInText: (optional) Whether or not the environment is allowed inside
* text mode (default false) (not enforced yet)
* - numOptionalArgs: (optional) Just like for a function
* A bare number instead of that object indicates the numArgs value.
*
* The handler function will receive two arguments
* - context: information and references provided by the parser
* - args: an array of arguments passed to \begin{name}
* The context contains the following properties:
* - envName: the name of the environment, one of the listed names.
* - parser: the parser object
* - lexer: the lexer object
* - positions: the positions associated with these arguments from args.
* The handler must return a ParseResult.
*/
function defineEnvironment(names, props, handler) {
if (typeof names === "string") {
names = [names];
}
if (typeof props === "number") {
props = { numArgs: props };
}
// Set default values of environments
var data = {
numArgs: props.numArgs || 0,
argTypes: props.argTypes,
greediness: 1,
allowedInText: !!props.allowedInText,
numOptionalArgs: props.numOptionalArgs || 0,
handler: handler
};
for (var i = 0; i < names.length; ++i) {
module.exports[names[i]] = data;
}
}
// Arrays are part of LaTeX, defined in lttab.dtx so its documentation
// is part of the source2e.pdf file of LaTeX2e source documentation.
defineEnvironment("array", {
numArgs: 1
}, function(context, args) {
var colalign = args[0];
colalign = colalign.value.map ? colalign.value : [colalign];
var cols = colalign.map(function(node) {
var ca = node.value;
if ("lcr".indexOf(ca) !== -1) {
return {
type: "align",
align: ca
};
} else if (ca === "|") {
return {
type: "separator",
separator: "|"
};
}
throw new ParseError(
"Unknown column alignment: " + node.value,
node);
});
var res = {
type: "array",
cols: cols,
hskipBeforeAndAfter: true // \@preamble in lttab.dtx
};
res = parseArray(context.parser, res);
return res;
});
// The matrix environments of amsmath builds on the array environment
// of LaTeX, which is discussed above.
defineEnvironment([
"matrix",
"pmatrix",
"bmatrix",
"Bmatrix",
"vmatrix",
"Vmatrix"
], {
}, function(context) {
var delimiters = {
"matrix": null,
"pmatrix": ["(", ")"],
"bmatrix": ["[", "]"],
"Bmatrix": ["\\{", "\\}"],
"vmatrix": ["|", "|"],
"Vmatrix": ["\\Vert", "\\Vert"]
}[context.envName];
var res = {
type: "array",
hskipBeforeAndAfter: false // \hskip -\arraycolsep in amsmath
};
res = parseArray(context.parser, res);
if (delimiters) {
res = new ParseNode("leftright", {
body: [res],
left: delimiters[0],
right: delimiters[1]
}, context.mode);
}
return res;
});
// A cases environment (in amsmath.sty) is almost equivalent to
// \def\arraystretch{1.2}%
// \left\{\begin{array}{@{}l@{\quad}l@{}} … \end{array}\right.
defineEnvironment("cases", {
}, function(context) {
var res = {
type: "array",
arraystretch: 1.2,
cols: [{
type: "align",
align: "l",
pregap: 0,
// TODO(kevinb) get the current style.
// For now we use the metrics for TEXT style which is what we were
// doing before. Before attempting to get the current style we
// should look at TeX's behavior especially for \over and matrices.
postgap: Style.TEXT.metrics.quad
}, {
type: "align",
align: "l",
pregap: 0,
postgap: 0
}]
};
res = parseArray(context.parser, res);
res = new ParseNode("leftright", {
body: [res],
left: "\\{",
right: "."
}, context.mode);
return res;
});
// An aligned environment is like the align* environment
// except it operates within math mode.
// Note that we assume \nomallineskiplimit to be zero,
// so that \strut@ is the same as \strut.
defineEnvironment("aligned", {
}, function(context) {
var res = {
type: "array",
cols: []
};
res = parseArray(context.parser, res);
var emptyGroup = new ParseNode("ordgroup", [], context.mode);
var numCols = 0;
res.value.body.forEach(function(row) {
var i;
for (i = 1; i < row.length; i += 2) {
row[i].value.unshift(emptyGroup);
}
if (numCols < row.length) {
numCols = row.length;
}
});
for (var i = 0; i < numCols; ++i) {
var align = "r";
var pregap = 0;
if (i % 2 === 1) {
align = "l";
} else if (i > 0) {
pregap = 2; // one \qquad between columns
}
res.value.cols[i] = {
type: "align",
align: align,
pregap: pregap,
postgap: 0
};
}
return res;
});
});
/** @flow */
function getRelocatable(re) {
// In the future, this could use a WeakMap instead of an expando.
if (!re.__matchAtRelocatable) {
// Disjunctions are the lowest-precedence operator, so we can make any
// pattern match the empty string by appending `|()` to it:
// https://people.mozilla.org/~jorendorff/es6-draft.html#sec-patterns
var source = re.source + "|()";
// We always make the new regex global.
var flags = "g" + (re.ignoreCase ? "i" : "") + (re.multiline ? "m" : "") + (re.unicode ? "u" : "");
re.__matchAtRelocatable = new RegExp(source, flags);
}
return re.__matchAtRelocatable;
}
function matchAt$1(re, str, pos) {
if (re.global || re.sticky) {
throw new Error("matchAt(...): Only non-global regexes are supported");
}
var reloc = getRelocatable(re);
reloc.lastIndex = pos;
var match = reloc.exec(str);
// Last capturing group is our sentinel that indicates whether the regex
// matched at the given location.
if (match[match.length - 1] == null) {
// Original regex matched.
match.length = match.length - 1;
return match;
} else {
return null;
}
}
var matchAt_1 = matchAt$1;
/**
* The Lexer class handles tokenizing the input in various ways. Since our
* parser expects us to be able to backtrack, the lexer allows lexing from any
* given starting point.
*
* Its main exposed function is the `lex` function, which takes a position to
* lex from and a type of token to lex. It defers to the appropriate `_innerLex`
* function.
*
* The various `_innerLex` functions perform the actual lexing of different
* kinds.
*/
var matchAt = matchAt_1;
var ParseError$6 = ParseError_1;
// The main lexer class
function Lexer$1(input) {
this.input = input;
this.pos = 0;
}
/**
* The resulting token returned from `lex`.
*
* It consists of the token text plus some position information.
* The position information is essentially a range in an input string,
* but instead of referencing the bare input string, we refer to the lexer.
* That way it is possible to attach extra metadata to the input string,
* like for example a file name or similar.
*
* The position information (all three parameters) is optional,
* so it is OK to construct synthetic tokens if appropriate.
* Not providing available position information may lead to
* degraded error reporting, though.
*
* @param {string} text the text of this token
* @param {number=} start the start offset, zero-based inclusive
* @param {number=} end the end offset, zero-based exclusive
* @param {Lexer=} lexer the lexer which in turn holds the input string
*/
function Token(text, start, end, lexer) {
this.text = text;
this.start = start;
this.end = end;
this.lexer = lexer;
}
/**
* Given a pair of tokens (this and endToken), compute a “Token” encompassing
* the whole input range enclosed by these two.
*
* @param {Token} endToken last token of the range, inclusive
* @param {string} text the text of the newly constructed token
*/
Token.prototype.range = function(endToken, text) {
if (endToken.lexer !== this.lexer) {
return new Token(text); // sorry, no position information available
}
return new Token(text, this.start, endToken.end, this.lexer);
};
/* The following tokenRegex
* - matches typical whitespace (but not NBSP etc.) using its first group
* - does not match any control character \x00-\x1f except whitespace
* - does not match a bare backslash
* - matches any ASCII character except those just mentioned
* - does not match the BMP private use area \uE000-\uF8FF
* - does not match bare surrogate code units
* - matches any BMP character except for those just described
* - matches any valid Unicode surrogate pair
* - matches a backslash followed by one or more letters
* - matches a backslash followed by any BMP character, including newline
* Just because the Lexer matches something doesn't mean it's valid input:
* If there is no matching function or symbol definition, the Parser will
* still reject the input.
*/
var tokenRegex = new RegExp(
"([ \r\n\t]+)|" + // whitespace
"([!-\\[\\]-\u2027\u202A-\uD7FF\uF900-\uFFFF]" + // single codepoint
"|[\uD800-\uDBFF][\uDC00-\uDFFF]" + // surrogate pair
"|\\\\(?:[a-zA-Z]+|[^\uD800-\uDFFF])" + // function name
")"
);
/**
* This function lexes a single token.
*/
Lexer$1.prototype.lex = function() {
var input = this.input;
var pos = this.pos;
if (pos === input.length) {
return new Token("EOF", pos, pos, this);
}
var match = matchAt(tokenRegex, input, pos);
if (match === null) {
throw new ParseError$6(
"Unexpected character: '" + input[pos] + "'",
new Token(input[pos], pos, pos + 1, this));
}
var text = match[2] || " ";
var start = this.pos;
this.pos += match[0].length;
var end = this.pos;
return new Token(text, start, end, this);
};
var Lexer_1 = Lexer$1;
/**
* This file contains the “gullet” where macros are expanded
* until only non-macro tokens remain.
*/
var Lexer = Lexer_1;
function MacroExpander$1(input, macros) {
this.lexer = new Lexer(input);
this.macros = macros;
this.stack = []; // contains tokens in REVERSE order
this.discardedWhiteSpace = [];
}
/**
* Recursively expand first token, then return first non-expandable token.
*/
MacroExpander$1.prototype.nextToken = function() {
var this$1 = this;
for (;;) {
if (this$1.stack.length === 0) {
this$1.stack.push(this$1.lexer.lex());
}
var topToken = this$1.stack.pop();
var name = topToken.text;
if (!(name.charAt(0) === "\\" && this$1.macros.hasOwnProperty(name))) {
return topToken;
}
var expansion = this$1.macros[name];
if (typeof expansion === "string") {
var bodyLexer = new Lexer(expansion);
expansion = [];
var tok = bodyLexer.lex();
while (tok.text !== "EOF") {
expansion.push(tok);
tok = bodyLexer.lex();
}
expansion.reverse(); // to fit in with stack using push and pop
this$1.macros[name] = expansion;
}
this$1.stack = this$1.stack.concat(expansion);
}
};
MacroExpander$1.prototype.get = function(ignoreSpace) {
var this$1 = this;
this.discardedWhiteSpace = [];
var token = this.nextToken();
if (ignoreSpace) {
while (token.text === " ") {
this$1.discardedWhiteSpace.push(token);
token = this$1.nextToken();
}
}
return token;
};
/**
* Undo the effect of the preceding call to the get method.
* A call to this method MUST be immediately preceded and immediately followed
* by a call to get. Only used during mode switching, i.e. after one token
* was got in the old mode but should get got again in a new mode
* with possibly different whitespace handling.
*/
MacroExpander$1.prototype.unget = function(token) {
var this$1 = this;
this.stack.push(token);
while (this.discardedWhiteSpace.length !== 0) {
this$1.stack.push(this$1.discardedWhiteSpace.pop());
}
};
var MacroExpander_1 = MacroExpander$1;
/* eslint no-constant-condition:0 */
var functions = functions$1;
var environments = environments$1;
var MacroExpander = MacroExpander_1;
var symbols$5 = symbols$1;
var utils$9 = utils$4;
var cjkRegex$2 = unicodeRegexes.cjkRegex;
var parseData = parseData$1;
var ParseError$5 = ParseError_1;
/**
* This file contains the parser used to parse out a TeX expression from the
* input. Since TeX isn't context-free, standard parsers don't work particularly
* well.
*
* The strategy of this parser is as such:
*
* The main functions (the `.parse...` ones) take a position in the current
* parse string to parse tokens from. The lexer (found in Lexer.js, stored at
* this.lexer) also supports pulling out tokens at arbitrary places. When
* individual tokens are needed at a position, the lexer is called to pull out a
* token, which is then used.
*
* The parser has a property called "mode" indicating the mode that
* the parser is currently in. Currently it has to be one of "math" or
* "text", which denotes whether the current environment is a math-y
* one or a text-y one (e.g. inside \text). Currently, this serves to
* limit the functions which can be used in text mode.
*
* The main functions then return an object which contains the useful data that
* was parsed at its given point, and a new position at the end of the parsed
* data. The main functions can call each other and continue the parsing by
* using the returned position as a new starting point.
*
* There are also extra `.handle...` functions, which pull out some reused
* functionality into self-contained functions.
*
* The earlier functions return ParseNodes.
* The later functions (which are called deeper in the parse) sometimes return
* ParseFuncOrArgument, which contain a ParseNode as well as some data about
* whether the parsed object is a function which is missing some arguments, or a
* standalone object which can be used as an argument to another function.
*/
/**
* Main Parser class
*/
function Parser$1(input, settings) {
// Create a new macro expander (gullet) and (indirectly via that) also a
// new lexer (mouth) for this parser (stomach, in the language of TeX)
this.gullet = new MacroExpander(input, settings.macros);
// Store the settings for use in parsing
this.settings = settings;
// Count leftright depth (for \middle errors)
this.leftrightDepth = 0;
}
var ParseNode = parseData.ParseNode;
/**
* An initial function (without its arguments), or an argument to a function.
* The `result` argument should be a ParseNode.
*/
function ParseFuncOrArgument(result, isFunction, token) {
this.result = result;
// Is this a function (i.e. is it something defined in functions.js)?
this.isFunction = isFunction;
this.token = token;
}
/**
* Checks a result to make sure it has the right type, and throws an
* appropriate error otherwise.
*
* @param {boolean=} consume whether to consume the expected token,
* defaults to true
*/
Parser$1.prototype.expect = function(text, consume) {
if (this.nextToken.text !== text) {
throw new ParseError$5(
"Expected '" + text + "', got '" + this.nextToken.text + "'",
this.nextToken
);
}
if (consume !== false) {
this.consume();
}
};
/**
* Considers the current look ahead token as consumed,
* and fetches the one after that as the new look ahead.
*/
Parser$1.prototype.consume = function() {
this.nextToken = this.gullet.get(this.mode === "math");
};
Parser$1.prototype.switchMode = function(newMode) {
this.gullet.unget(this.nextToken);
this.mode = newMode;
this.consume();
};
/**
* Main parsing function, which parses an entire input.
*
* @return {?Array.<ParseNode>}
*/
Parser$1.prototype.parse = function() {
// Try to parse the input
this.mode = "math";
this.consume();
var parse = this.parseInput();
return parse;
};
/**
* Parses an entire input tree.
*/
Parser$1.prototype.parseInput = function() {
// Parse an expression
var expression = this.parseExpression(false);
// If we succeeded, make sure there's an EOF at the end
this.expect("EOF", false);
return expression;
};
var endOfExpression = ["}", "\\end", "\\right", "&", "\\\\", "\\cr"];
/**
* Parses an "expression", which is a list of atoms.
*
* @param {boolean} breakOnInfix Should the parsing stop when we hit infix
* nodes? This happens when functions have higher precendence
* than infix nodes in implicit parses.
*
* @param {?string} breakOnTokenText The text of the token that the expression
* should end with, or `null` if something else should end the
* expression.
*
* @return {ParseNode}
*/
Parser$1.prototype.parseExpression = function(breakOnInfix, breakOnTokenText) {
var this$1 = this;
var body = [];
// Keep adding atoms to the body until we can't parse any more atoms (either
// we reached the end, a }, or a \right)
while (true) {
var lex = this$1.nextToken;
if (endOfExpression.indexOf(lex.text) !== -1) {
break;
}
if (breakOnTokenText && lex.text === breakOnTokenText) {
break;
}
if (breakOnInfix && functions[lex.text] && functions[lex.text].infix) {
break;
}
var atom = this$1.parseAtom();
if (!atom) {
if (!this$1.settings.throwOnError && lex.text[0] === "\\") {
var errorNode = this$1.handleUnsupportedCmd();
body.push(errorNode);
continue;
}
break;
}
body.push(atom);
}
return this.handleInfixNodes(body);
};
/**
* Rewrites infix operators such as \over with corresponding commands such
* as \frac.
*
* There can only be one infix operator per group. If there's more than one
* then the expression is ambiguous. This can be resolved by adding {}.
*
* @returns {Array}
*/
Parser$1.prototype.handleInfixNodes = function(body) {
var overIndex = -1;
var funcName;
for (var i = 0; i < body.length; i++) {
var node = body[i];
if (node.type === "infix") {
if (overIndex !== -1) {
throw new ParseError$5(
"only one infix operator per group",
node.value.token);
}
overIndex = i;
funcName = node.value.replaceWith;
}
}
if (overIndex !== -1) {
var numerNode;
var denomNode;
var numerBody = body.slice(0, overIndex);
var denomBody = body.slice(overIndex + 1);
if (numerBody.length === 1 && numerBody[0].type === "ordgroup") {
numerNode = numerBody[0];
} else {
numerNode = new ParseNode("ordgroup", numerBody, this.mode);
}
if (denomBody.length === 1 && denomBody[0].type === "ordgroup") {
denomNode = denomBody[0];
} else {
denomNode = new ParseNode("ordgroup", denomBody, this.mode);
}
var value = this.callFunction(
funcName, [numerNode, denomNode], null);
return [new ParseNode(value.type, value, this.mode)];
} else {
return body;
}
};
// The greediness of a superscript or subscript
var SUPSUB_GREEDINESS = 1;
/**
* Handle a subscript or superscript with nice errors.
*/
Parser$1.prototype.handleSupSubscript = function(name) {
var symbolToken = this.nextToken;
var symbol = symbolToken.text;
this.consume();
var group = this.parseGroup();
if (!group) {
if (!this.settings.throwOnError && this.nextToken.text[0] === "\\") {
return this.handleUnsupportedCmd();
} else {
throw new ParseError$5(
"Expected group after '" + symbol + "'",
symbolToken
);
}
} else if (group.isFunction) {
// ^ and _ have a greediness, so handle interactions with functions'
// greediness
var funcGreediness = functions[group.result].greediness;
if (funcGreediness > SUPSUB_GREEDINESS) {
return this.parseFunction(group);
} else {
throw new ParseError$5(
"Got function '" + group.result + "' with no arguments " +
"as " + name, symbolToken);
}
} else {
return group.result;
}
};
/**
* Converts the textual input of an unsupported command into a text node
* contained within a color node whose color is determined by errorColor
*/
Parser$1.prototype.handleUnsupportedCmd = function() {
var text = this.nextToken.text;
var textordArray = [];
for (var i = 0; i < text.length; i++) {
textordArray.push(new ParseNode("textord", text[i], "text"));
}
var textNode = new ParseNode(
"text",
{
body: textordArray,
type: "text"
},
this.mode);
var colorNode = new ParseNode(
"color",
{
color: this.settings.errorColor,
value: [textNode],
type: "color"
},
this.mode);
this.consume();
return colorNode;
};
/**
* Parses a group with optional super/subscripts.
*
* @return {?ParseNode}
*/
Parser$1.prototype.parseAtom = function() {
var this$1 = this;
// The body of an atom is an implicit group, so that things like
// \left(x\right)^2 work correctly.
var base = this.parseImplicitGroup();
// In text mode, we don't have superscripts or subscripts
if (this.mode === "text") {
return base;
}
// Note that base may be empty (i.e. null) at this point.
var superscript;
var subscript;
while (true) {
// Lex the first token
var lex = this$1.nextToken;
if (lex.text === "\\limits" || lex.text === "\\nolimits") {
// We got a limit control
if (!base || base.type !== "op") {
throw new ParseError$5(
"Limit controls must follow a math operator",
lex);
} else {
var limits = lex.text === "\\limits";
base.value.limits = limits;
base.value.alwaysHandleSupSub = true;
}
this$1.consume();
} else if (lex.text === "^") {
// We got a superscript start
if (superscript) {
throw new ParseError$5("Double superscript", lex);
}
superscript = this$1.handleSupSubscript("superscript");
} else if (lex.text === "_") {
// We got a subscript start
if (subscript) {
throw new ParseError$5("Double subscript", lex);
}
subscript = this$1.handleSupSubscript("subscript");
} else if (lex.text === "'") {
// We got a prime
var prime = new ParseNode("textord", "\\prime", this$1.mode);
// Many primes can be grouped together, so we handle this here
var primes = [prime];
this$1.consume();
// Keep lexing tokens until we get something that's not a prime
while (this.nextToken.text === "'") {
// For each one, add another prime to the list
primes.push(prime);
this$1.consume();
}
// Put them into an ordgroup as the superscript
superscript = new ParseNode("ordgroup", primes, this$1.mode);
} else {
// If it wasn't ^, _, or ', stop parsing super/subscripts
break;
}
}
if (superscript || subscript) {
// If we got either a superscript or subscript, create a supsub
return new ParseNode("supsub", {
base: base,
sup: superscript,
sub: subscript
}, this.mode);
} else {
// Otherwise return the original body
return base;
}
};
// A list of the size-changing functions, for use in parseImplicitGroup
var sizeFuncs = [
"\\tiny", "\\scriptsize", "\\footnotesize", "\\small", "\\normalsize",
"\\large", "\\Large", "\\LARGE", "\\huge", "\\Huge"
];
// A list of the style-changing functions, for use in parseImplicitGroup
var styleFuncs = [
"\\displaystyle", "\\textstyle", "\\scriptstyle", "\\scriptscriptstyle"
];
/**
* Parses an implicit group, which is a group that starts at the end of a
* specified, and ends right before a higher explicit group ends, or at EOL. It
* is used for functions that appear to affect the current style, like \Large or
* \textrm, where instead of keeping a style we just pretend that there is an
* implicit grouping after it until the end of the group. E.g.
* small text {\Large large text} small text again
* It is also used for \left and \right to get the correct grouping.
*
* @return {?ParseNode}
*/
Parser$1.prototype.parseImplicitGroup = function() {
var start = this.parseSymbol();
if (start == null) {
// If we didn't get anything we handle, fall back to parseFunction
return this.parseFunction();
}
var func = start.result;
var body;
if (func === "\\left") {
// If we see a left:
// Parse the entire left function (including the delimiter)
var left = this.parseFunction(start);
// Parse out the implicit body
++this.leftrightDepth;
body = this.parseExpression(false);
--this.leftrightDepth;
// Check the next token
this.expect("\\right", false);
var right = this.parseFunction();
return new ParseNode("leftright", {
body: body,
left: left.value.value,
right: right.value.value
}, this.mode);
} else if (func === "\\begin") {
// begin...end is similar to left...right
var begin = this.parseFunction(start);
var envName = begin.value.name;
if (!environments.hasOwnProperty(envName)) {
throw new ParseError$5(
"No such environment: " + envName, begin.value.nameGroup);
}
// Build the environment object. Arguments and other information will
// be made available to the begin and end methods using properties.
var env = environments[envName];
var args = this.parseArguments("\\begin{" + envName + "}", env);
var context = {
mode: this.mode,
envName: envName,
parser: this,
positions: args.pop()
};
var result = env.handler(context, args);
this.expect("\\end", false);
var endNameToken = this.nextToken;
var end = this.parseFunction();
if (end.value.name !== envName) {
throw new ParseError$5(
"Mismatch: \\begin{" + envName + "} matched " +
"by \\end{" + end.value.name + "}",
endNameToken);
}
result.position = end.position;
return result;
} else if (utils$9.contains(sizeFuncs, func)) {
// If we see a sizing function, parse out the implict body
body = this.parseExpression(false);
return new ParseNode("sizing", {
// Figure out what size to use based on the list of functions above
size: "size" + (utils$9.indexOf(sizeFuncs, func) + 1),
value: body
}, this.mode);
} else if (utils$9.contains(styleFuncs, func)) {
// If we see a styling function, parse out the implict body
body = this.parseExpression(true);
return new ParseNode("styling", {
// Figure out what style to use by pulling out the style from
// the function name
style: func.slice(1, func.length - 5),
value: body
}, this.mode);
} else {
// Defer to parseFunction if it's not a function we handle
return this.parseFunction(start);
}
};
/**
* Parses an entire function, including its base and all of its arguments.
* The base might either have been parsed already, in which case
* it is provided as an argument, or it's the next group in the input.
*
* @param {ParseFuncOrArgument=} baseGroup optional as described above
* @return {?ParseNode}
*/
Parser$1.prototype.parseFunction = function(baseGroup) {
if (!baseGroup) {
baseGroup = this.parseGroup();
}
if (baseGroup) {
if (baseGroup.isFunction) {
var func = baseGroup.result;
var funcData = functions[func];
if (this.mode === "text" && !funcData.allowedInText) {
throw new ParseError$5(
"Can't use function '" + func + "' in text mode",
baseGroup.token);
}
var args = this.parseArguments(func, funcData);
var token = baseGroup.token;
var result = this.callFunction(func, args, args.pop(), token);
return new ParseNode(result.type, result, this.mode);
} else {
return baseGroup.result;
}
} else {
return null;
}
};
/**
* Call a function handler with a suitable context and arguments.
*/
Parser$1.prototype.callFunction = function(name, args, positions, token) {
var context = {
funcName: name,
parser: this,
positions: positions,
token: token
};
return functions[name].handler(context, args);
};
/**
* Parses the arguments of a function or environment
*
* @param {string} func "\name" or "\begin{name}"
* @param {{numArgs:number,numOptionalArgs:number|undefined}} funcData
* @return the array of arguments, with the list of positions as last element
*/
Parser$1.prototype.parseArguments = function(func, funcData) {
var this$1 = this;
var totalArgs = funcData.numArgs + funcData.numOptionalArgs;
if (totalArgs === 0) {
return [[this.pos]];
}
var baseGreediness = funcData.greediness;
var positions = [this.pos];
var args = [];
for (var i = 0; i < totalArgs; i++) {
var nextToken = this$1.nextToken;
var argType = funcData.argTypes && funcData.argTypes[i];
var arg;
if (i < funcData.numOptionalArgs) {
if (argType) {
arg = this$1.parseGroupOfType(argType, true);
} else {
arg = this$1.parseGroup(true);
}
if (!arg) {
args.push(null);
positions.push(this$1.pos);
continue;
}
} else {
if (argType) {
arg = this$1.parseGroupOfType(argType);
} else {
arg = this$1.parseGroup();
}
if (!arg) {
if (!this$1.settings.throwOnError &&
this$1.nextToken.text[0] === "\\") {
arg = new ParseFuncOrArgument(
this$1.handleUnsupportedCmd(this$1.nextToken.text),
false);
} else {
throw new ParseError$5(
"Expected group after '" + func + "'", nextToken);
}
}
}
var argNode;
if (arg.isFunction) {
var argGreediness =
functions[arg.result].greediness;
if (argGreediness > baseGreediness) {
argNode = this$1.parseFunction(arg);
} else {
throw new ParseError$5(
"Got function '" + arg.result + "' as " +
"argument to '" + func + "'", nextToken);
}
} else {
argNode = arg.result;
}
args.push(argNode);
positions.push(this$1.pos);
}
args.push(positions);
return args;
};
/**
* Parses a group when the mode is changing.
*
* @return {?ParseFuncOrArgument}
*/
Parser$1.prototype.parseGroupOfType = function(innerMode, optional) {
var this$1 = this;
var outerMode = this.mode;
// Handle `original` argTypes
if (innerMode === "original") {
innerMode = outerMode;
}
if (innerMode === "color") {
return this.parseColorGroup(optional);
}
if (innerMode === "size") {
return this.parseSizeGroup(optional);
}
this.switchMode(innerMode);
if (innerMode === "text") {
// text mode is special because it should ignore the whitespace before
// it
while (this.nextToken.text === " ") {
this$1.consume();
}
}
// By the time we get here, innerMode is one of "text" or "math".
// We switch the mode of the parser, recurse, then restore the old mode.
var res = this.parseGroup(optional);
this.switchMode(outerMode);
return res;
};
/**
* Parses a group, essentially returning the string formed by the
* brace-enclosed tokens plus some position information.
*
* @param {string} modeName Used to describe the mode in error messages
* @param {boolean=} optional Whether the group is optional or required
*/
Parser$1.prototype.parseStringGroup = function(modeName, optional) {
var this$1 = this;
if (optional && this.nextToken.text !== "[") {
return null;
}
var outerMode = this.mode;
this.mode = "text";
this.expect(optional ? "[" : "{");
var str = "";
var firstToken = this.nextToken;
var lastToken = firstToken;
while (this.nextToken.text !== (optional ? "]" : "}")) {
if (this$1.nextToken.text === "EOF") {
throw new ParseError$5(
"Unexpected end of input in " + modeName,
firstToken.range(this$1.nextToken, str));
}
lastToken = this$1.nextToken;
str += lastToken.text;
this$1.consume();
}
this.mode = outerMode;
this.expect(optional ? "]" : "}");
return firstToken.range(lastToken, str);
};
/**
* Parses a regex-delimited group: the largest sequence of tokens
* whose concatenated strings match `regex`. Returns the string
* formed by the tokens plus some position information.
*
* @param {RegExp} regex
* @param {string} modeName Used to describe the mode in error messages
*/
Parser$1.prototype.parseRegexGroup = function(regex, modeName) {
var this$1 = this;
var outerMode = this.mode;
this.mode = "text";
var firstToken = this.nextToken;
var lastToken = firstToken;
var str = "";
while (this.nextToken.text !== "EOF"
&& regex.test(str + this.nextToken.text)) {
lastToken = this$1.nextToken;
str += lastToken.text;
this$1.consume();
}
if (str === "") {
throw new ParseError$5(
"Invalid " + modeName + ": '" + firstToken.text + "'",
firstToken);
}
this.mode = outerMode;
return firstToken.range(lastToken, str);
};
/**
* Parses a color description.
*/
Parser$1.prototype.parseColorGroup = function(optional) {
var res = this.parseStringGroup("color", optional);
if (!res) {
return null;
}
var match = (/^(#[a-z0-9]+|[a-z]+)$/i).exec(res.text);
if (!match) {
throw new ParseError$5("Invalid color: '" + res.text + "'", res);
}
return new ParseFuncOrArgument(
new ParseNode("color", match[0], this.mode),
false);
};
/**
* Parses a size specification, consisting of magnitude and unit.
*/
Parser$1.prototype.parseSizeGroup = function(optional) {
var res;
if (!optional && this.nextToken.text !== "{") {
res = this.parseRegexGroup(
/^[-+]? *(?:$|\d+|\d+\.\d*|\.\d*) *[a-z]{0,2}$/, "size");
} else {
res = this.parseStringGroup("size", optional);
}
if (!res) {
return null;
}
var match = (/([-+]?) *(\d+(?:\.\d*)?|\.\d+) *([a-z]{2})/).exec(res.text);
if (!match) {
throw new ParseError$5("Invalid size: '" + res.text + "'", res);
}
var data = {
number: +(match[1] + match[2]), // sign + magnitude, cast to number
unit: match[3]
};
if (data.unit !== "em" && data.unit !== "ex" && data.unit !== "mu") {
throw new ParseError$5("Invalid unit: '" + data.unit + "'", res);
}
return new ParseFuncOrArgument(
new ParseNode("color", data, this.mode),
false);
};
/**
* If the argument is false or absent, this parses an ordinary group,
* which is either a single nucleus (like "x") or an expression
* in braces (like "{x+y}").
* If the argument is true, it parses either a bracket-delimited expression
* (like "[x+y]") or returns null to indicate the absence of a
* bracket-enclosed group.
*
* @param {boolean=} optional Whether the group is optional or required
* @return {?ParseFuncOrArgument}
*/
Parser$1.prototype.parseGroup = function(optional) {
var firstToken = this.nextToken;
// Try to parse an open brace
if (this.nextToken.text === (optional ? "[" : "{")) {
// If we get a brace, parse an expression
this.consume();
var expression = this.parseExpression(false, optional ? "]" : null);
var lastToken = this.nextToken;
// Make sure we get a close brace
this.expect(optional ? "]" : "}");
if (this.mode === "text") {
this.formLigatures(expression);
}
return new ParseFuncOrArgument(
new ParseNode("ordgroup", expression, this.mode,
firstToken, lastToken),
false);
} else {
// Otherwise, just return a nucleus, or nothing for an optional group
return optional ? null : this.parseSymbol();
}
};
/**
* Form ligature-like combinations of characters for text mode.
* This includes inputs like "--", "---", "``" and "''".
* The result will simply replace multiple textord nodes with a single
* character in each value by a single textord node having multiple
* characters in its value. The representation is still ASCII source.
*
* @param {Array.<ParseNode>} group the nodes of this group,
* list will be moified in place
*/
Parser$1.prototype.formLigatures = function(group) {
var i;
var n = group.length - 1;
for (i = 0; i < n; ++i) {
var a = group[i];
var v = a.value;
if (v === "-" && group[i + 1].value === "-") {
if (i + 1 < n && group[i + 2].value === "-") {
group.splice(i, 3, new ParseNode(
"textord", "---", "text", a, group[i + 2]));
n -= 2;
} else {
group.splice(i, 2, new ParseNode(
"textord", "--", "text", a, group[i + 1]));
n -= 1;
}
}
if ((v === "'" || v === "`") && group[i + 1].value === v) {
group.splice(i, 2, new ParseNode(
"textord", v + v, "text", a, group[i + 1]));
n -= 1;
}
}
};
/**
* Parse a single symbol out of the string. Here, we handle both the functions
* we have defined, as well as the single character symbols
*
* @return {?ParseFuncOrArgument}
*/
Parser$1.prototype.parseSymbol = function() {
var nucleus = this.nextToken;
if (functions[nucleus.text]) {
this.consume();
// If there exists a function with this name, we return the function and
// say that it is a function.
return new ParseFuncOrArgument(
nucleus.text,
true, nucleus);
} else if (symbols$5[this.mode][nucleus.text]) {
this.consume();
// Otherwise if this is a no-argument function, find the type it
// corresponds to in the symbols map
return new ParseFuncOrArgument(
new ParseNode(symbols$5[this.mode][nucleus.text].group,
nucleus.text, this.mode, nucleus),
false, nucleus);
} else if (this.mode === "text" && cjkRegex$2.test(nucleus.text)) {
this.consume();
return new ParseFuncOrArgument(
new ParseNode("textord", nucleus.text, this.mode, nucleus),
false, nucleus);
} else {
return null;
}
};
Parser$1.prototype.ParseNode = ParseNode;
var Parser_1 = Parser$1;
/**
* Provides a single function for parsing an expression using a Parser
* TODO(emily): Remove this
*/
var Parser = Parser_1;
/**
* Parses an expression using a Parser, then returns the parsed result.
*/
var parseTree$1 = function(toParse, settings) {
if (!(typeof toParse === 'string' || toParse instanceof String)) {
throw new TypeError('KaTeX can only parse string typed expression');
}
var parser = new Parser(toParse, settings);
return parser.parse();
};
var parseTree_1 = parseTree$1;
/* eslint no-console:0 */
/**
* This is the main entry point for KaTeX. Here, we expose functions for
* rendering expressions either to DOM nodes or to markup strings.
*
* We also expose the ParseError class to check if errors thrown from KaTeX are
* errors in the expression, or errors in javascript handling.
*/
var ParseError = ParseError_1;
var Settings = Settings_1;
var buildTree = buildTree_1;
var parseTree = parseTree_1;
var utils = utils$4;
/**
* Parse and build an expression, and place that expression in the DOM node
* given.
*/
var render$2 = function(expression, baseNode, options) {
utils.clearNode(baseNode);
var settings = new Settings(options);
var tree = parseTree(expression, settings);
var node = buildTree(tree, expression, settings).toNode();
baseNode.appendChild(node);
};
// KaTeX's styles don't work properly in quirks mode. Print out an error, and
// disable rendering.
if (typeof document !== "undefined") {
if (document.compatMode !== "CSS1Compat") {
typeof console !== "undefined" && console.warn(
"Warning: KaTeX doesn't work in quirks mode. Make sure your " +
"website has a suitable doctype.");
render$2 = function() {
throw new ParseError("KaTeX doesn't work in quirks mode.");
};
}
}
/**
* Parse and build an expression, and return the markup for that.
*/
var renderToString = function(expression, options) {
var settings = new Settings(options);
var tree = parseTree(expression, settings);
return buildTree(tree, expression, settings).toMarkup();
};
/**
* Parse an expression and return the parse tree.
*/
var generateParseTree = function(expression, options) {
var settings = new Settings(options);
return parseTree(expression, settings);
};
var katex = {
render: render$2,
renderToString: renderToString,
/**
* NOTE: This method is not currently recommended for public use.
* The internal tree representation is unstable and is very likely
* to change. Use at your own risk.
*/
__parse: generateParseTree,
ParseError: ParseError
};
var html$3 = "\n<style>\ndt-math[block] {\n display: block;\n}\n</style>\n";
var DTMath = function(dom, data) {
var equationElements = [].slice.call(dom.querySelectorAll("dt-math"));
equationElements.forEach(function (el) {
var content = el.textContent;
var displayMode = el.hasAttribute("block") ? true : false;
el.innerHTML = html$3 + katex.renderToString(content, {displayMode: displayMode});
});
};
var marked = createCommonjsModule(function (module, exports) {
/**
* marked - a markdown parser
* Copyright (c) 2011-2014, Christopher Jeffrey. (MIT Licensed)
* https://github.com/chjj/marked
*/
(function() {
/**
* Block-Level Grammar
*/
var block = {
newline: /^\n+/,
code: /^( {4}[^\n]+\n*)+/,
fences: noop,
hr: /^( *[-*_]){3,} *(?:\n+|$)/,
heading: /^ *(#{1,6}) *([^\n]+?) *#* *(?:\n+|$)/,
nptable: noop,
lheading: /^([^\n]+)\n *(=|-){2,} *(?:\n+|$)/,
blockquote: /^( *>[^\n]+(\n(?!def)[^\n]+)*\n*)+/,
list: /^( *)(bull) [\s\S]+?(?:hr|def|\n{2,}(?! )(?!\1bull )\n*|\s*$)/,
html: /^ *(?:comment *(?:\n|\s*$)|closed *(?:\n{2,}|\s*$)|closing *(?:\n{2,}|\s*$))/,
def: /^ *\[([^\]]+)\]: *<?([^\s>]+)>?(?: +["(]([^\n]+)[")])? *(?:\n+|$)/,
table: noop,
paragraph: /^((?:[^\n]+\n?(?!hr|heading|lheading|blockquote|tag|def))+)\n*/,
text: /^[^\n]+/
};
block.bullet = /(?:[*+-]|\d+\.)/;
block.item = /^( *)(bull) [^\n]*(?:\n(?!\1bull )[^\n]*)*/;
block.item = replace(block.item, 'gm')
(/bull/g, block.bullet)
();
block.list = replace(block.list)
(/bull/g, block.bullet)
('hr', '\\n+(?=\\1?(?:[-*_] *){3,}(?:\\n+|$))')
('def', '\\n+(?=' + block.def.source + ')')
();
block.blockquote = replace(block.blockquote)
('def', block.def)
();
block._tag = '(?!(?:'
+ 'a|em|strong|small|s|cite|q|dfn|abbr|data|time|code'
+ '|var|samp|kbd|sub|sup|i|b|u|mark|ruby|rt|rp|bdi|bdo'
+ '|span|br|wbr|ins|del|img)\\b)\\w+(?!:/|[^\\w\\s@]*@)\\b';
block.html = replace(block.html)
('comment', /<!--[\s\S]*?-->/)
('closed', /<(tag)[\s\S]+?<\/\1>/)
('closing', /<tag(?:"[^"]*"|'[^']*'|[^'">])*?>/)
(/tag/g, block._tag)
();
block.paragraph = replace(block.paragraph)
('hr', block.hr)
('heading', block.heading)
('lheading', block.lheading)
('blockquote', block.blockquote)
('tag', '<' + block._tag)
('def', block.def)
();
/**
* Normal Block Grammar
*/
block.normal = merge({}, block);
/**
* GFM Block Grammar
*/
block.gfm = merge({}, block.normal, {
fences: /^ *(`{3,}|~{3,})[ \.]*(\S+)? *\n([\s\S]*?)\s*\1 *(?:\n+|$)/,
paragraph: /^/,
heading: /^ *(#{1,6}) +([^\n]+?) *#* *(?:\n+|$)/
});
block.gfm.paragraph = replace(block.paragraph)
('(?!', '(?!'
+ block.gfm.fences.source.replace('\\1', '\\2') + '|'
+ block.list.source.replace('\\1', '\\3') + '|')
();
/**
* GFM + Tables Block Grammar
*/
block.tables = merge({}, block.gfm, {
nptable: /^ *(\S.*\|.*)\n *([-:]+ *\|[-| :]*)\n((?:.*\|.*(?:\n|$))*)\n*/,
table: /^ *\|(.+)\n *\|( *[-:]+[-| :]*)\n((?: *\|.*(?:\n|$))*)\n*/
});
/**
* Block Lexer
*/
function Lexer(options) {
this.tokens = [];
this.tokens.links = {};
this.options = options || marked.defaults;
this.rules = block.normal;
if (this.options.gfm) {
if (this.options.tables) {
this.rules = block.tables;
} else {
this.rules = block.gfm;
}
}
}
/**
* Expose Block Rules
*/
Lexer.rules = block;
/**
* Static Lex Method
*/
Lexer.lex = function(src, options) {
var lexer = new Lexer(options);
return lexer.lex(src);
};
/**
* Preprocessing
*/
Lexer.prototype.lex = function(src) {
src = src
.replace(/\r\n|\r/g, '\n')
.replace(/\t/g, ' ')
.replace(/\u00a0/g, ' ')
.replace(/\u2424/g, '\n');
return this.token(src, true);
};
/**
* Lexing
*/
Lexer.prototype.token = function(src, top, bq) {
var this$1 = this;
var src = src.replace(/^ +$/gm, '')
, next
, loose
, cap
, bull
, b
, item
, space
, i
, l;
while (src) {
// newline
if (cap = this$1.rules.newline.exec(src)) {
src = src.substring(cap[0].length);
if (cap[0].length > 1) {
this$1.tokens.push({
type: 'space'
});
}
}
// code
if (cap = this$1.rules.code.exec(src)) {
src = src.substring(cap[0].length);
cap = cap[0].replace(/^ {4}/gm, '');
this$1.tokens.push({
type: 'code',
text: !this$1.options.pedantic
? cap.replace(/\n+$/, '')
: cap
});
continue;
}
// fences (gfm)
if (cap = this$1.rules.fences.exec(src)) {
src = src.substring(cap[0].length);
this$1.tokens.push({
type: 'code',
lang: cap[2],
text: cap[3] || ''
});
continue;
}
// heading
if (cap = this$1.rules.heading.exec(src)) {
src = src.substring(cap[0].length);
this$1.tokens.push({
type: 'heading',
depth: cap[1].length,
text: cap[2]
});
continue;
}
// table no leading pipe (gfm)
if (top && (cap = this$1.rules.nptable.exec(src))) {
src = src.substring(cap[0].length);
item = {
type: 'table',
header: cap[1].replace(/^ *| *\| *$/g, '').split(/ *\| */),
align: cap[2].replace(/^ *|\| *$/g, '').split(/ *\| */),
cells: cap[3].replace(/\n$/, '').split('\n')
};
for (i = 0; i < item.align.length; i++) {
if (/^ *-+: *$/.test(item.align[i])) {
item.align[i] = 'right';
} else if (/^ *:-+: *$/.test(item.align[i])) {
item.align[i] = 'center';
} else if (/^ *:-+ *$/.test(item.align[i])) {
item.align[i] = 'left';
} else {
item.align[i] = null;
}
}
for (i = 0; i < item.cells.length; i++) {
item.cells[i] = item.cells[i].split(/ *\| */);
}
this$1.tokens.push(item);
continue;
}
// lheading
if (cap = this$1.rules.lheading.exec(src)) {
src = src.substring(cap[0].length);
this$1.tokens.push({
type: 'heading',
depth: cap[2] === '=' ? 1 : 2,
text: cap[1]
});
continue;
}
// hr
if (cap = this$1.rules.hr.exec(src)) {
src = src.substring(cap[0].length);
this$1.tokens.push({
type: 'hr'
});
continue;
}
// blockquote
if (cap = this$1.rules.blockquote.exec(src)) {
src = src.substring(cap[0].length);
this$1.tokens.push({
type: 'blockquote_start'
});
cap = cap[0].replace(/^ *> ?/gm, '');
// Pass `top` to keep the current
// "toplevel" state. This is exactly
// how markdown.pl works.
this$1.token(cap, top, true);
this$1.tokens.push({
type: 'blockquote_end'
});
continue;
}
// list
if (cap = this$1.rules.list.exec(src)) {
src = src.substring(cap[0].length);
bull = cap[2];
this$1.tokens.push({
type: 'list_start',
ordered: bull.length > 1
});
// Get each top-level item.
cap = cap[0].match(this$1.rules.item);
next = false;
l = cap.length;
i = 0;
for (; i < l; i++) {
item = cap[i];
// Remove the list item's bullet
// so it is seen as the next token.
space = item.length;
item = item.replace(/^ *([*+-]|\d+\.) +/, '');
// Outdent whatever the
// list item contains. Hacky.
if (~item.indexOf('\n ')) {
space -= item.length;
item = !this$1.options.pedantic
? item.replace(new RegExp('^ {1,' + space + '}', 'gm'), '')
: item.replace(/^ {1,4}/gm, '');
}
// Determine whether the next list item belongs here.
// Backpedal if it does not belong in this list.
if (this$1.options.smartLists && i !== l - 1) {
b = block.bullet.exec(cap[i + 1])[0];
if (bull !== b && !(bull.length > 1 && b.length > 1)) {
src = cap.slice(i + 1).join('\n') + src;
i = l - 1;
}
}
// Determine whether item is loose or not.
// Use: /(^|\n)(?! )[^\n]+\n\n(?!\s*$)/
// for discount behavior.
loose = next || /\n\n(?!\s*$)/.test(item);
if (i !== l - 1) {
next = item.charAt(item.length - 1) === '\n';
if (!loose) { loose = next; }
}
this$1.tokens.push({
type: loose
? 'loose_item_start'
: 'list_item_start'
});
// Recurse.
this$1.token(item, false, bq);
this$1.tokens.push({
type: 'list_item_end'
});
}
this$1.tokens.push({
type: 'list_end'
});
continue;
}
// html
if (cap = this$1.rules.html.exec(src)) {
src = src.substring(cap[0].length);
this$1.tokens.push({
type: this$1.options.sanitize
? 'paragraph'
: 'html',
pre: !this$1.options.sanitizer
&& (cap[1] === 'pre' || cap[1] === 'script' || cap[1] === 'style'),
text: cap[0]
});
continue;
}
// def
if ((!bq && top) && (cap = this$1.rules.def.exec(src))) {
src = src.substring(cap[0].length);
this$1.tokens.links[cap[1].toLowerCase()] = {
href: cap[2],
title: cap[3]
};
continue;
}
// table (gfm)
if (top && (cap = this$1.rules.table.exec(src))) {
src = src.substring(cap[0].length);
item = {
type: 'table',
header: cap[1].replace(/^ *| *\| *$/g, '').split(/ *\| */),
align: cap[2].replace(/^ *|\| *$/g, '').split(/ *\| */),
cells: cap[3].replace(/(?: *\| *)?\n$/, '').split('\n')
};
for (i = 0; i < item.align.length; i++) {
if (/^ *-+: *$/.test(item.align[i])) {
item.align[i] = 'right';
} else if (/^ *:-+: *$/.test(item.align[i])) {
item.align[i] = 'center';
} else if (/^ *:-+ *$/.test(item.align[i])) {
item.align[i] = 'left';
} else {
item.align[i] = null;
}
}
for (i = 0; i < item.cells.length; i++) {
item.cells[i] = item.cells[i]
.replace(/^ *\| *| *\| *$/g, '')
.split(/ *\| */);
}
this$1.tokens.push(item);
continue;
}
// top-level paragraph
if (top && (cap = this$1.rules.paragraph.exec(src))) {
src = src.substring(cap[0].length);
this$1.tokens.push({
type: 'paragraph',
text: cap[1].charAt(cap[1].length - 1) === '\n'
? cap[1].slice(0, -1)
: cap[1]
});
continue;
}
// text
if (cap = this$1.rules.text.exec(src)) {
// Top-level should never reach here.
src = src.substring(cap[0].length);
this$1.tokens.push({
type: 'text',
text: cap[0]
});
continue;
}
if (src) {
throw new
Error('Infinite loop on byte: ' + src.charCodeAt(0));
}
}
return this.tokens;
};
/**
* Inline-Level Grammar
*/
var inline = {
escape: /^\\([\\`*{}\[\]()#+\-.!_>])/,
autolink: /^<([^ >]+(@|:\/)[^ >]+)>/,
url: noop,
tag: /^<!--[\s\S]*?-->|^<\/?\w+(?:"[^"]*"|'[^']*'|[^'">])*?>/,
link: /^!?\[(inside)\]\(href\)/,
reflink: /^!?\[(inside)\]\s*\[([^\]]*)\]/,
nolink: /^!?\[((?:\[[^\]]*\]|[^\[\]])*)\]/,
strong: /^__([\s\S]+?)__(?!_)|^\*\*([\s\S]+?)\*\*(?!\*)/,
em: /^\b_((?:[^_]|__)+?)_\b|^\*((?:\*\*|[\s\S])+?)\*(?!\*)/,
code: /^(`+)\s*([\s\S]*?[^`])\s*\1(?!`)/,
br: /^ {2,}\n(?!\s*$)/,
del: noop,
text: /^[\s\S]+?(?=[\\<!\[_*`]| {2,}\n|$)/
};
inline._inside = /(?:\[[^\]]*\]|[^\[\]]|\](?=[^\[]*\]))*/;
inline._href = /\s*<?([\s\S]*?)>?(?:\s+['"]([\s\S]*?)['"])?\s*/;
inline.link = replace(inline.link)
('inside', inline._inside)
('href', inline._href)
();
inline.reflink = replace(inline.reflink)
('inside', inline._inside)
();
/**
* Normal Inline Grammar
*/
inline.normal = merge({}, inline);
/**
* Pedantic Inline Grammar
*/
inline.pedantic = merge({}, inline.normal, {
strong: /^__(?=\S)([\s\S]*?\S)__(?!_)|^\*\*(?=\S)([\s\S]*?\S)\*\*(?!\*)/,
em: /^_(?=\S)([\s\S]*?\S)_(?!_)|^\*(?=\S)([\s\S]*?\S)\*(?!\*)/
});
/**
* GFM Inline Grammar
*/
inline.gfm = merge({}, inline.normal, {
escape: replace(inline.escape)('])', '~|])')(),
url: /^(https?:\/\/[^\s<]+[^<.,:;"')\]\s])/,
del: /^~~(?=\S)([\s\S]*?\S)~~/,
text: replace(inline.text)
(']|', '~]|')
('|', '|https?://|')
()
});
/**
* GFM + Line Breaks Inline Grammar
*/
inline.breaks = merge({}, inline.gfm, {
br: replace(inline.br)('{2,}', '*')(),
text: replace(inline.gfm.text)('{2,}', '*')()
});
/**
* Inline Lexer & Compiler
*/
function InlineLexer(links, options) {
this.options = options || marked.defaults;
this.links = links;
this.rules = inline.normal;
this.renderer = this.options.renderer || new Renderer;
this.renderer.options = this.options;
if (!this.links) {
throw new
Error('Tokens array requires a `links` property.');
}
if (this.options.gfm) {
if (this.options.breaks) {
this.rules = inline.breaks;
} else {
this.rules = inline.gfm;
}
} else if (this.options.pedantic) {
this.rules = inline.pedantic;
}
}
/**
* Expose Inline Rules
*/
InlineLexer.rules = inline;
/**
* Static Lexing/Compiling Method
*/
InlineLexer.output = function(src, links, options) {
var inline = new InlineLexer(links, options);
return inline.output(src);
};
/**
* Lexing/Compiling
*/
InlineLexer.prototype.output = function(src) {
var this$1 = this;
var out = ''
, link
, text
, href
, cap;
while (src) {
// escape
if (cap = this$1.rules.escape.exec(src)) {
src = src.substring(cap[0].length);
out += cap[1];
continue;
}
// autolink
if (cap = this$1.rules.autolink.exec(src)) {
src = src.substring(cap[0].length);
if (cap[2] === '@') {
text = cap[1].charAt(6) === ':'
? this$1.mangle(cap[1].substring(7))
: this$1.mangle(cap[1]);
href = this$1.mangle('mailto:') + text;
} else {
text = escape(cap[1]);
href = text;
}
out += this$1.renderer.link(href, null, text);
continue;
}
// url (gfm)
if (!this$1.inLink && (cap = this$1.rules.url.exec(src))) {
src = src.substring(cap[0].length);
text = escape(cap[1]);
href = text;
out += this$1.renderer.link(href, null, text);
continue;
}
// tag
if (cap = this$1.rules.tag.exec(src)) {
if (!this$1.inLink && /^<a /i.test(cap[0])) {
this$1.inLink = true;
} else if (this$1.inLink && /^<\/a>/i.test(cap[0])) {
this$1.inLink = false;
}
src = src.substring(cap[0].length);
out += this$1.options.sanitize
? this$1.options.sanitizer
? this$1.options.sanitizer(cap[0])
: escape(cap[0])
: cap[0];
continue;
}
// link
if (cap = this$1.rules.link.exec(src)) {
src = src.substring(cap[0].length);
this$1.inLink = true;
out += this$1.outputLink(cap, {
href: cap[2],
title: cap[3]
});
this$1.inLink = false;
continue;
}
// reflink, nolink
if ((cap = this$1.rules.reflink.exec(src))
|| (cap = this$1.rules.nolink.exec(src))) {
src = src.substring(cap[0].length);
link = (cap[2] || cap[1]).replace(/\s+/g, ' ');
link = this$1.links[link.toLowerCase()];
if (!link || !link.href) {
out += cap[0].charAt(0);
src = cap[0].substring(1) + src;
continue;
}
this$1.inLink = true;
out += this$1.outputLink(cap, link);
this$1.inLink = false;
continue;
}
// strong
if (cap = this$1.rules.strong.exec(src)) {
src = src.substring(cap[0].length);
out += this$1.renderer.strong(this$1.output(cap[2] || cap[1]));
continue;
}
// em
if (cap = this$1.rules.em.exec(src)) {
src = src.substring(cap[0].length);
out += this$1.renderer.em(this$1.output(cap[2] || cap[1]));
continue;
}
// code
if (cap = this$1.rules.code.exec(src)) {
src = src.substring(cap[0].length);
out += this$1.renderer.codespan(escape(cap[2], true));
continue;
}
// br
if (cap = this$1.rules.br.exec(src)) {
src = src.substring(cap[0].length);
out += this$1.renderer.br();
continue;
}
// del (gfm)
if (cap = this$1.rules.del.exec(src)) {
src = src.substring(cap[0].length);
out += this$1.renderer.del(this$1.output(cap[1]));
continue;
}
// text
if (cap = this$1.rules.text.exec(src)) {
src = src.substring(cap[0].length);
out += this$1.renderer.text(escape(this$1.smartypants(cap[0])));
continue;
}
if (src) {
throw new
Error('Infinite loop on byte: ' + src.charCodeAt(0));
}
}
return out;
};
/**
* Compile Link
*/
InlineLexer.prototype.outputLink = function(cap, link) {
var href = escape(link.href)
, title = link.title ? escape(link.title) : null;
return cap[0].charAt(0) !== '!'
? this.renderer.link(href, title, this.output(cap[1]))
: this.renderer.image(href, title, escape(cap[1]));
};
/**
* Smartypants Transformations
*/
InlineLexer.prototype.smartypants = function(text) {
if (!this.options.smartypants) { return text; }
return text
// em-dashes
.replace(/---/g, '\u2014')
// en-dashes
.replace(/--/g, '\u2013')
// opening singles
.replace(/(^|[-\u2014/(\[{"\s])'/g, '$1\u2018')
// closing singles & apostrophes
.replace(/'/g, '\u2019')
// opening doubles
.replace(/(^|[-\u2014/(\[{\u2018\s])"/g, '$1\u201c')
// closing doubles
.replace(/"/g, '\u201d')
// ellipses
.replace(/\.{3}/g, '\u2026');
};
/**
* Mangle Links
*/
InlineLexer.prototype.mangle = function(text) {
if (!this.options.mangle) { return text; }
var out = ''
, l = text.length
, i = 0
, ch;
for (; i < l; i++) {
ch = text.charCodeAt(i);
if (Math.random() > 0.5) {
ch = 'x' + ch.toString(16);
}
out += '&#' + ch + ';';
}
return out;
};
/**
* Renderer
*/
function Renderer(options) {
this.options = options || {};
}
Renderer.prototype.code = function(code, lang, escaped) {
if (this.options.highlight) {
var out = this.options.highlight(code, lang);
if (out != null && out !== code) {
escaped = true;
code = out;
}
}
if (!lang) {
return '<pre><code>'
+ (escaped ? code : escape(code, true))
+ '\n</code></pre>';
}
return '<pre><code class="'
+ this.options.langPrefix
+ escape(lang, true)
+ '">'
+ (escaped ? code : escape(code, true))
+ '\n</code></pre>\n';
};
Renderer.prototype.blockquote = function(quote) {
return '<blockquote>\n' + quote + '</blockquote>\n';
};
Renderer.prototype.html = function(html) {
return html;
};
Renderer.prototype.heading = function(text, level, raw) {
return '<h'
+ level
+ ' id="'
+ this.options.headerPrefix
+ raw.toLowerCase().replace(/[^\w]+/g, '-')
+ '">'
+ text
+ '</h'
+ level
+ '>\n';
};
Renderer.prototype.hr = function() {
return this.options.xhtml ? '<hr/>\n' : '<hr>\n';
};
Renderer.prototype.list = function(body, ordered) {
var type = ordered ? 'ol' : 'ul';
return '<' + type + '>\n' + body + '</' + type + '>\n';
};
Renderer.prototype.listitem = function(text) {
return '<li>' + text + '</li>\n';
};
Renderer.prototype.paragraph = function(text) {
return '<p>' + text + '</p>\n';
};
Renderer.prototype.table = function(header, body) {
return '<table>\n'
+ '<thead>\n'
+ header
+ '</thead>\n'
+ '<tbody>\n'
+ body
+ '</tbody>\n'
+ '</table>\n';
};
Renderer.prototype.tablerow = function(content) {
return '<tr>\n' + content + '</tr>\n';
};
Renderer.prototype.tablecell = function(content, flags) {
var type = flags.header ? 'th' : 'td';
var tag = flags.align
? '<' + type + ' style="text-align:' + flags.align + '">'
: '<' + type + '>';
return tag + content + '</' + type + '>\n';
};
// span level renderer
Renderer.prototype.strong = function(text) {
return '<strong>' + text + '</strong>';
};
Renderer.prototype.em = function(text) {
return '<em>' + text + '</em>';
};
Renderer.prototype.codespan = function(text) {
return '<code>' + text + '</code>';
};
Renderer.prototype.br = function() {
return this.options.xhtml ? '<br/>' : '<br>';
};
Renderer.prototype.del = function(text) {
return '<del>' + text + '</del>';
};
Renderer.prototype.link = function(href, title, text) {
if (this.options.sanitize) {
try {
var prot = decodeURIComponent(unescape(href))
.replace(/[^\w:]/g, '')
.toLowerCase();
} catch (e) {
return '';
}
if (prot.indexOf('javascript:') === 0 || prot.indexOf('vbscript:') === 0) {
return '';
}
}
var out = '<a href="' + href + '"';
if (title) {
out += ' title="' + title + '"';
}
out += '>' + text + '</a>';
return out;
};
Renderer.prototype.image = function(href, title, text) {
var out = '<img src="' + href + '" alt="' + text + '"';
if (title) {
out += ' title="' + title + '"';
}
out += this.options.xhtml ? '/>' : '>';
return out;
};
Renderer.prototype.text = function(text) {
return text;
};
/**
* Parsing & Compiling
*/
function Parser(options) {
this.tokens = [];
this.token = null;
this.options = options || marked.defaults;
this.options.renderer = this.options.renderer || new Renderer;
this.renderer = this.options.renderer;
this.renderer.options = this.options;
}
/**
* Static Parse Method
*/
Parser.parse = function(src, options, renderer) {
var parser = new Parser(options, renderer);
return parser.parse(src);
};
/**
* Parse Loop
*/
Parser.prototype.parse = function(src) {
var this$1 = this;
this.inline = new InlineLexer(src.links, this.options, this.renderer);
this.tokens = src.reverse();
var out = '';
while (this.next()) {
out += this$1.tok();
}
return out;
};
/**
* Next Token
*/
Parser.prototype.next = function() {
return this.token = this.tokens.pop();
};
/**
* Preview Next Token
*/
Parser.prototype.peek = function() {
return this.tokens[this.tokens.length - 1] || 0;
};
/**
* Parse Text Tokens
*/
Parser.prototype.parseText = function() {
var this$1 = this;
var body = this.token.text;
while (this.peek().type === 'text') {
body += '\n' + this$1.next().text;
}
return this.inline.output(body);
};
/**
* Parse Current Token
*/
Parser.prototype.tok = function() {
var this$1 = this;
switch (this.token.type) {
case 'space': {
return '';
}
case 'hr': {
return this.renderer.hr();
}
case 'heading': {
return this.renderer.heading(
this.inline.output(this.token.text),
this.token.depth,
this.token.text);
}
case 'code': {
return this.renderer.code(this.token.text,
this.token.lang,
this.token.escaped);
}
case 'table': {
var header = ''
, body = ''
, i
, row
, cell
, flags
, j;
// header
cell = '';
for (i = 0; i < this.token.header.length; i++) {
flags = { header: true, align: this$1.token.align[i] };
cell += this$1.renderer.tablecell(
this$1.inline.output(this$1.token.header[i]),
{ header: true, align: this$1.token.align[i] }
);
}
header += this.renderer.tablerow(cell);
for (i = 0; i < this.token.cells.length; i++) {
row = this$1.token.cells[i];
cell = '';
for (j = 0; j < row.length; j++) {
cell += this$1.renderer.tablecell(
this$1.inline.output(row[j]),
{ header: false, align: this$1.token.align[j] }
);
}
body += this$1.renderer.tablerow(cell);
}
return this.renderer.table(header, body);
}
case 'blockquote_start': {
var body = '';
while (this.next().type !== 'blockquote_end') {
body += this$1.tok();
}
return this.renderer.blockquote(body);
}
case 'list_start': {
var body = ''
, ordered = this.token.ordered;
while (this.next().type !== 'list_end') {
body += this$1.tok();
}
return this.renderer.list(body, ordered);
}
case 'list_item_start': {
var body = '';
while (this.next().type !== 'list_item_end') {
body += this$1.token.type === 'text'
? this$1.parseText()
: this$1.tok();
}
return this.renderer.listitem(body);
}
case 'loose_item_start': {
var body = '';
while (this.next().type !== 'list_item_end') {
body += this$1.tok();
}
return this.renderer.listitem(body);
}
case 'html': {
var html = !this.token.pre && !this.options.pedantic
? this.inline.output(this.token.text)
: this.token.text;
return this.renderer.html(html);
}
case 'paragraph': {
return this.renderer.paragraph(this.inline.output(this.token.text));
}
case 'text': {
return this.renderer.paragraph(this.parseText());
}
}
};
/**
* Helpers
*/
function escape(html, encode) {
return html
.replace(!encode ? /&(?!#?\w+;)/g : /&/g, '&amp;')
.replace(/</g, '&lt;')
.replace(/>/g, '&gt;')
.replace(/"/g, '&quot;')
.replace(/'/g, '&#39;');
}
function unescape(html) {
// explicitly match decimal, hex, and named HTML entities
return html.replace(/&(#(?:\d+)|(?:#x[0-9A-Fa-f]+)|(?:\w+));?/g, function(_, n) {
n = n.toLowerCase();
if (n === 'colon') { return ':'; }
if (n.charAt(0) === '#') {
return n.charAt(1) === 'x'
? String.fromCharCode(parseInt(n.substring(2), 16))
: String.fromCharCode(+n.substring(1));
}
return '';
});
}
function replace(regex, opt) {
regex = regex.source;
opt = opt || '';
return function self(name, val) {
if (!name) { return new RegExp(regex, opt); }
val = val.source || val;
val = val.replace(/(^|[^\[])\^/g, '$1');
regex = regex.replace(name, val);
return self;
};
}
function noop() {}
noop.exec = noop;
function merge(obj) {
var arguments$1 = arguments;
var i = 1
, target
, key;
for (; i < arguments.length; i++) {
target = arguments$1[i];
for (key in target) {
if (Object.prototype.hasOwnProperty.call(target, key)) {
obj[key] = target[key];
}
}
}
return obj;
}
/**
* Marked
*/
function marked(src, opt, callback) {
if (callback || typeof opt === 'function') {
if (!callback) {
callback = opt;
opt = null;
}
opt = merge({}, marked.defaults, opt || {});
var highlight = opt.highlight
, tokens
, pending
, i = 0;
try {
tokens = Lexer.lex(src, opt);
} catch (e) {
return callback(e);
}
pending = tokens.length;
var done = function(err) {
if (err) {
opt.highlight = highlight;
return callback(err);
}
var out;
try {
out = Parser.parse(tokens, opt);
} catch (e) {
err = e;
}
opt.highlight = highlight;
return err
? callback(err)
: callback(null, out);
};
if (!highlight || highlight.length < 3) {
return done();
}
delete opt.highlight;
if (!pending) { return done(); }
for (; i < tokens.length; i++) {
(function(token) {
if (token.type !== 'code') {
return --pending || done();
}
return highlight(token.text, token.lang, function(err, code) {
if (err) { return done(err); }
if (code == null || code === token.text) {
return --pending || done();
}
token.text = code;
token.escaped = true;
--pending || done();
});
})(tokens[i]);
}
return;
}
try {
if (opt) { opt = merge({}, marked.defaults, opt); }
return Parser.parse(Lexer.lex(src, opt), opt);
} catch (e) {
e.message += '\nPlease report this to https://github.com/chjj/marked.';
if ((opt || marked.defaults).silent) {
return '<p>An error occured:</p><pre>'
+ escape(e.message + '', true)
+ '</pre>';
}
throw e;
}
}
/**
* Options
*/
marked.options =
marked.setOptions = function(opt) {
merge(marked.defaults, opt);
return marked;
};
marked.defaults = {
gfm: true,
tables: true,
breaks: false,
pedantic: false,
sanitize: false,
sanitizer: null,
mangle: true,
smartLists: false,
silent: false,
highlight: null,
langPrefix: 'lang-',
smartypants: false,
headerPrefix: '',
renderer: new Renderer,
xhtml: false
};
/**
* Expose
*/
marked.Parser = Parser;
marked.parser = Parser.parse;
marked.Renderer = Renderer;
marked.Lexer = Lexer;
marked.lexer = Lexer.lex;
marked.InlineLexer = InlineLexer;
marked.inlineLexer = InlineLexer.output;
marked.parse = marked;
if ('object' !== 'undefined' && 'object' === 'object') {
module.exports = marked;
} else if (typeof undefined === 'function' && undefined.amd) {
undefined(function() { return marked; });
} else {
this.marked = marked;
}
}).call(function() {
return this || (typeof window !== 'undefined' ? window : commonjsGlobal);
}());
});
marked.setOptions({
gfm: true,
smartypants: true
});
var markdown = function(dom, data) {
var markdownElements = [].slice.call(dom.querySelectorAll('[markdown]'));
markdownElements.forEach(function (el) {
var content = el.innerHTML;
// Set default indents
content = content.replace(/\n/, "");
var tabs = content.match(/\s*/);
content = content.replace(new RegExp("\n" + tabs, "g"), "\n");
content = content.trim();
el.innerHTML = marked(content);
});
};
var prism = createCommonjsModule(function (module) {
/* **********************************************
Begin prism-core.js
********************************************** */
var _self = (typeof window !== 'undefined')
? window // if in browser
: (
(typeof WorkerGlobalScope !== 'undefined' && self instanceof WorkerGlobalScope)
? self // if in worker
: {} // if in node js
);
/**
* Prism: Lightweight, robust, elegant syntax highlighting
* MIT license http://www.opensource.org/licenses/mit-license.php/
* @author Lea Verou http://lea.verou.me
*/
var Prism = (function(){
// Private helper vars
var lang = /\blang(?:uage)?-(\w+)\b/i;
var uniqueId = 0;
var _ = _self.Prism = {
util: {
encode: function (tokens) {
if (tokens instanceof Token) {
return new Token(tokens.type, _.util.encode(tokens.content), tokens.alias);
} else if (_.util.type(tokens) === 'Array') {
return tokens.map(_.util.encode);
} else {
return tokens.replace(/&/g, '&amp;').replace(/</g, '&lt;').replace(/\u00a0/g, ' ');
}
},
type: function (o) {
return Object.prototype.toString.call(o).match(/\[object (\w+)\]/)[1];
},
objId: function (obj) {
if (!obj['__id']) {
Object.defineProperty(obj, '__id', { value: ++uniqueId });
}
return obj['__id'];
},
// Deep clone a language definition (e.g. to extend it)
clone: function (o) {
var type = _.util.type(o);
switch (type) {
case 'Object':
var clone = {};
for (var key in o) {
if (o.hasOwnProperty(key)) {
clone[key] = _.util.clone(o[key]);
}
}
return clone;
case 'Array':
// Check for existence for IE8
return o.map && o.map(function(v) { return _.util.clone(v); });
}
return o;
}
},
languages: {
extend: function (id, redef) {
var lang = _.util.clone(_.languages[id]);
for (var key in redef) {
lang[key] = redef[key];
}
return lang;
},
/**
* Insert a token before another token in a language literal
* As this needs to recreate the object (we cannot actually insert before keys in object literals),
* we cannot just provide an object, we need anobject and a key.
* @param inside The key (or language id) of the parent
* @param before The key to insert before. If not provided, the function appends instead.
* @param insert Object with the key/value pairs to insert
* @param root The object that contains `inside`. If equal to Prism.languages, it can be omitted.
*/
insertBefore: function (inside, before, insert, root) {
root = root || _.languages;
var grammar = root[inside];
if (arguments.length == 2) {
insert = arguments[1];
for (var newToken in insert) {
if (insert.hasOwnProperty(newToken)) {
grammar[newToken] = insert[newToken];
}
}
return grammar;
}
var ret = {};
for (var token in grammar) {
if (grammar.hasOwnProperty(token)) {
if (token == before) {
for (var newToken in insert) {
if (insert.hasOwnProperty(newToken)) {
ret[newToken] = insert[newToken];
}
}
}
ret[token] = grammar[token];
}
}
// Update references in other language definitions
_.languages.DFS(_.languages, function(key, value) {
if (value === root[inside] && key != inside) {
this[key] = ret;
}
});
return root[inside] = ret;
},
// Traverse a language definition with Depth First Search
DFS: function(o, callback, type, visited) {
visited = visited || {};
for (var i in o) {
if (o.hasOwnProperty(i)) {
callback.call(o, i, o[i], type || i);
if (_.util.type(o[i]) === 'Object' && !visited[_.util.objId(o[i])]) {
visited[_.util.objId(o[i])] = true;
_.languages.DFS(o[i], callback, null, visited);
}
else if (_.util.type(o[i]) === 'Array' && !visited[_.util.objId(o[i])]) {
visited[_.util.objId(o[i])] = true;
_.languages.DFS(o[i], callback, i, visited);
}
}
}
}
},
plugins: {},
highlightAll: function(async, callback) {
var env = {
callback: callback,
selector: 'code[class*="language-"], [class*="language-"] code, code[class*="lang-"], [class*="lang-"] code'
};
_.hooks.run("before-highlightall", env);
var elements = env.elements || document.querySelectorAll(env.selector);
for (var i=0, element; element = elements[i++];) {
_.highlightElement(element, async === true, env.callback);
}
},
highlightElement: function(element, async, callback) {
// Find language
var language, grammar, parent = element;
while (parent && !lang.test(parent.className)) {
parent = parent.parentNode;
}
if (parent) {
language = (parent.className.match(lang) || [,''])[1].toLowerCase();
grammar = _.languages[language];
}
// Set language on the element, if not present
element.className = element.className.replace(lang, '').replace(/\s+/g, ' ') + ' language-' + language;
// Set language on the parent, for styling
parent = element.parentNode;
if (/pre/i.test(parent.nodeName)) {
parent.className = parent.className.replace(lang, '').replace(/\s+/g, ' ') + ' language-' + language;
}
var code = element.textContent;
var env = {
element: element,
language: language,
grammar: grammar,
code: code
};
_.hooks.run('before-sanity-check', env);
if (!env.code || !env.grammar) {
if (env.code) {
env.element.textContent = env.code;
}
_.hooks.run('complete', env);
return;
}
_.hooks.run('before-highlight', env);
if (async && _self.Worker) {
var worker = new Worker(_.filename);
worker.onmessage = function(evt) {
env.highlightedCode = evt.data;
_.hooks.run('before-insert', env);
env.element.innerHTML = env.highlightedCode;
callback && callback.call(env.element);
_.hooks.run('after-highlight', env);
_.hooks.run('complete', env);
};
worker.postMessage(JSON.stringify({
language: env.language,
code: env.code,
immediateClose: true
}));
}
else {
env.highlightedCode = _.highlight(env.code, env.grammar, env.language);
_.hooks.run('before-insert', env);
env.element.innerHTML = env.highlightedCode;
callback && callback.call(element);
_.hooks.run('after-highlight', env);
_.hooks.run('complete', env);
}
},
highlight: function (text, grammar, language) {
var tokens = _.tokenize(text, grammar);
return Token.stringify(_.util.encode(tokens), language);
},
tokenize: function(text, grammar, language) {
var Token = _.Token;
var strarr = [text];
var rest = grammar.rest;
if (rest) {
for (var token in rest) {
grammar[token] = rest[token];
}
delete grammar.rest;
}
tokenloop: for (var token in grammar) {
if(!grammar.hasOwnProperty(token) || !grammar[token]) {
continue;
}
var patterns = grammar[token];
patterns = (_.util.type(patterns) === "Array") ? patterns : [patterns];
for (var j = 0; j < patterns.length; ++j) {
var pattern = patterns[j],
inside = pattern.inside,
lookbehind = !!pattern.lookbehind,
greedy = !!pattern.greedy,
lookbehindLength = 0,
alias = pattern.alias;
if (greedy && !pattern.pattern.global) {
// Without the global flag, lastIndex won't work
var flags = pattern.pattern.toString().match(/[imuy]*$/)[0];
pattern.pattern = RegExp(pattern.pattern.source, flags + "g");
}
pattern = pattern.pattern || pattern;
// Don’t cache length as it changes during the loop
for (var i=0, pos = 0; i<strarr.length; pos += strarr[i].length, ++i) {
var str = strarr[i];
if (strarr.length > text.length) {
// Something went terribly wrong, ABORT, ABORT!
break tokenloop;
}
if (str instanceof Token) {
continue;
}
pattern.lastIndex = 0;
var match = pattern.exec(str),
delNum = 1;
// Greedy patterns can override/remove up to two previously matched tokens
if (!match && greedy && i != strarr.length - 1) {
pattern.lastIndex = pos;
match = pattern.exec(text);
if (!match) {
break;
}
var from = match.index + (lookbehind ? match[1].length : 0),
to = match.index + match[0].length,
k = i,
p = pos;
for (var len = strarr.length; k < len && p < to; ++k) {
p += strarr[k].length;
// Move the index i to the element in strarr that is closest to from
if (from >= p) {
++i;
pos = p;
}
}
/*
* If strarr[i] is a Token, then the match starts inside another Token, which is invalid
* If strarr[k - 1] is greedy we are in conflict with another greedy pattern
*/
if (strarr[i] instanceof Token || strarr[k - 1].greedy) {
continue;
}
// Number of tokens to delete and replace with the new match
delNum = k - i;
str = text.slice(pos, p);
match.index -= pos;
}
if (!match) {
continue;
}
if(lookbehind) {
lookbehindLength = match[1].length;
}
var from = match.index + lookbehindLength,
match = match[0].slice(lookbehindLength),
to = from + match.length,
before = str.slice(0, from),
after = str.slice(to);
var args = [i, delNum];
if (before) {
args.push(before);
}
var wrapped = new Token(token, inside? _.tokenize(match, inside) : match, alias, match, greedy);
args.push(wrapped);
if (after) {
args.push(after);
}
Array.prototype.splice.apply(strarr, args);
}
}
}
return strarr;
},
hooks: {
all: {},
add: function (name, callback) {
var hooks = _.hooks.all;
hooks[name] = hooks[name] || [];
hooks[name].push(callback);
},
run: function (name, env) {
var callbacks = _.hooks.all[name];
if (!callbacks || !callbacks.length) {
return;
}
for (var i=0, callback; callback = callbacks[i++];) {
callback(env);
}
}
}
};
var Token = _.Token = function(type, content, alias, matchedStr, greedy) {
this.type = type;
this.content = content;
this.alias = alias;
// Copy of the full string this token was created from
this.length = (matchedStr || "").length|0;
this.greedy = !!greedy;
};
Token.stringify = function(o, language, parent) {
if (typeof o == 'string') {
return o;
}
if (_.util.type(o) === 'Array') {
return o.map(function(element) {
return Token.stringify(element, language, o);
}).join('');
}
var env = {
type: o.type,
content: Token.stringify(o.content, language, parent),
tag: 'span',
classes: ['token', o.type],
attributes: {},
language: language,
parent: parent
};
if (env.type == 'comment') {
env.attributes['spellcheck'] = 'true';
}
if (o.alias) {
var aliases = _.util.type(o.alias) === 'Array' ? o.alias : [o.alias];
Array.prototype.push.apply(env.classes, aliases);
}
_.hooks.run('wrap', env);
var attributes = Object.keys(env.attributes).map(function(name) {
return name + '="' + (env.attributes[name] || '').replace(/"/g, '&quot;') + '"';
}).join(' ');
return '<' + env.tag + ' class="' + env.classes.join(' ') + '"' + (attributes ? ' ' + attributes : '') + '>' + env.content + '</' + env.tag + '>';
};
if (!_self.document) {
if (!_self.addEventListener) {
// in Node.js
return _self.Prism;
}
// In worker
_self.addEventListener('message', function(evt) {
var message = JSON.parse(evt.data),
lang = message.language,
code = message.code,
immediateClose = message.immediateClose;
_self.postMessage(_.highlight(code, _.languages[lang], lang));
if (immediateClose) {
_self.close();
}
}, false);
return _self.Prism;
}
//Get current script and highlight
var script = document.currentScript || [].slice.call(document.getElementsByTagName("script")).pop();
if (script) {
_.filename = script.src;
if (document.addEventListener && !script.hasAttribute('data-manual')) {
if(document.readyState !== "loading") {
if (window.requestAnimationFrame) {
window.requestAnimationFrame(_.highlightAll);
} else {
window.setTimeout(_.highlightAll, 16);
}
}
else {
document.addEventListener('DOMContentLoaded', _.highlightAll);
}
}
}
return _self.Prism;
})();
if ('object' !== 'undefined' && module.exports) {
module.exports = Prism;
}
// hack for components to work correctly in node.js
if (typeof commonjsGlobal !== 'undefined') {
commonjsGlobal.Prism = Prism;
}
/* **********************************************
Begin prism-markup.js
********************************************** */
Prism.languages.markup = {
'comment': /<!--[\w\W]*?-->/,
'prolog': /<\?[\w\W]+?\?>/,
'doctype': /<!DOCTYPE[\w\W]+?>/i,
'cdata': /<!\[CDATA\[[\w\W]*?]]>/i,
'tag': {
pattern: /<\/?(?!\d)[^\s>\/=$<]+(?:\s+[^\s>\/=]+(?:=(?:("|')(?:\\\1|\\?(?!\1)[\w\W])*\1|[^\s'">=]+))?)*\s*\/?>/i,
inside: {
'tag': {
pattern: /^<\/?[^\s>\/]+/i,
inside: {
'punctuation': /^<\/?/,
'namespace': /^[^\s>\/:]+:/
}
},
'attr-value': {
pattern: /=(?:('|")[\w\W]*?(\1)|[^\s>]+)/i,
inside: {
'punctuation': /[=>"']/
}
},
'punctuation': /\/?>/,
'attr-name': {
pattern: /[^\s>\/]+/,
inside: {
'namespace': /^[^\s>\/:]+:/
}
}
}
},
'entity': /&#?[\da-z]{1,8};/i
};
// Plugin to make entity title show the real entity, idea by Roman Komarov
Prism.hooks.add('wrap', function(env) {
if (env.type === 'entity') {
env.attributes['title'] = env.content.replace(/&amp;/, '&');
}
});
Prism.languages.xml = Prism.languages.markup;
Prism.languages.html = Prism.languages.markup;
Prism.languages.mathml = Prism.languages.markup;
Prism.languages.svg = Prism.languages.markup;
/* **********************************************
Begin prism-css.js
********************************************** */
Prism.languages.css = {
'comment': /\/\*[\w\W]*?\*\//,
'atrule': {
pattern: /@[\w-]+?.*?(;|(?=\s*\{))/i,
inside: {
'rule': /@[\w-]+/
// See rest below
}
},
'url': /url\((?:(["'])(\\(?:\r\n|[\w\W])|(?!\1)[^\\\r\n])*\1|.*?)\)/i,
'selector': /[^\{\}\s][^\{\};]*?(?=\s*\{)/,
'string': {
pattern: /("|')(\\(?:\r\n|[\w\W])|(?!\1)[^\\\r\n])*\1/,
greedy: true
},
'property': /(\b|\B)[\w-]+(?=\s*:)/i,
'important': /\B!important\b/i,
'function': /[-a-z0-9]+(?=\()/i,
'punctuation': /[(){};:]/
};
Prism.languages.css['atrule'].inside.rest = Prism.util.clone(Prism.languages.css);
if (Prism.languages.markup) {
Prism.languages.insertBefore('markup', 'tag', {
'style': {
pattern: /(<style[\w\W]*?>)[\w\W]*?(?=<\/style>)/i,
lookbehind: true,
inside: Prism.languages.css,
alias: 'language-css'
}
});
Prism.languages.insertBefore('inside', 'attr-value', {
'style-attr': {
pattern: /\s*style=("|').*?\1/i,
inside: {
'attr-name': {
pattern: /^\s*style/i,
inside: Prism.languages.markup.tag.inside
},
'punctuation': /^\s*=\s*['"]|['"]\s*$/,
'attr-value': {
pattern: /.+/i,
inside: Prism.languages.css
}
},
alias: 'language-css'
}
}, Prism.languages.markup.tag);
}
/* **********************************************
Begin prism-clike.js
********************************************** */
Prism.languages.clike = {
'comment': [
{
pattern: /(^|[^\\])\/\*[\w\W]*?\*\//,
lookbehind: true
},
{
pattern: /(^|[^\\:])\/\/.*/,
lookbehind: true
}
],
'string': {
pattern: /(["'])(\\(?:\r\n|[\s\S])|(?!\1)[^\\\r\n])*\1/,
greedy: true
},
'class-name': {
pattern: /((?:\b(?:class|interface|extends|implements|trait|instanceof|new)\s+)|(?:catch\s+\())[a-z0-9_\.\\]+/i,
lookbehind: true,
inside: {
punctuation: /(\.|\\)/
}
},
'keyword': /\b(if|else|while|do|for|return|in|instanceof|function|new|try|throw|catch|finally|null|break|continue)\b/,
'boolean': /\b(true|false)\b/,
'function': /[a-z0-9_]+(?=\()/i,
'number': /\b-?(?:0x[\da-f]+|\d*\.?\d+(?:e[+-]?\d+)?)\b/i,
'operator': /--?|\+\+?|!=?=?|<=?|>=?|==?=?|&&?|\|\|?|\?|\*|\/|~|\^|%/,
'punctuation': /[{}[\];(),.:]/
};
/* **********************************************
Begin prism-javascript.js
********************************************** */
Prism.languages.javascript = Prism.languages.extend('clike', {
'keyword': /\b(as|async|await|break|case|catch|class|const|continue|debugger|default|delete|do|else|enum|export|extends|finally|for|from|function|get|if|implements|import|in|instanceof|interface|let|new|null|of|package|private|protected|public|return|set|static|super|switch|this|throw|try|typeof|var|void|while|with|yield)\b/,
'number': /\b-?(0x[\dA-Fa-f]+|0b[01]+|0o[0-7]+|\d*\.?\d+([Ee][+-]?\d+)?|NaN|Infinity)\b/,
// Allow for all non-ASCII characters (See http://stackoverflow.com/a/2008444)
'function': /[_$a-zA-Z\xA0-\uFFFF][_$a-zA-Z0-9\xA0-\uFFFF]*(?=\()/i,
'operator': /--?|\+\+?|!=?=?|<=?|>=?|==?=?|&&?|\|\|?|\?|\*\*?|\/|~|\^|%|\.{3}/
});
Prism.languages.insertBefore('javascript', 'keyword', {
'regex': {
pattern: /(^|[^/])\/(?!\/)(\[.+?]|\\.|[^/\\\r\n])+\/[gimyu]{0,5}(?=\s*($|[\r\n,.;})]))/,
lookbehind: true,
greedy: true
}
});
Prism.languages.insertBefore('javascript', 'string', {
'template-string': {
pattern: /`(?:\\\\|\\?[^\\])*?`/,
greedy: true,
inside: {
'interpolation': {
pattern: /\$\{[^}]+\}/,
inside: {
'interpolation-punctuation': {
pattern: /^\$\{|\}$/,
alias: 'punctuation'
},
rest: Prism.languages.javascript
}
},
'string': /[\s\S]+/
}
}
});
if (Prism.languages.markup) {
Prism.languages.insertBefore('markup', 'tag', {
'script': {
pattern: /(<script[\w\W]*?>)[\w\W]*?(?=<\/script>)/i,
lookbehind: true,
inside: Prism.languages.javascript,
alias: 'language-javascript'
}
});
}
Prism.languages.js = Prism.languages.javascript;
/* **********************************************
Begin prism-file-highlight.js
********************************************** */
(function () {
if (typeof self === 'undefined' || !self.Prism || !self.document || !document.querySelector) {
return;
}
self.Prism.fileHighlight = function() {
var Extensions = {
'js': 'javascript',
'py': 'python',
'rb': 'ruby',
'ps1': 'powershell',
'psm1': 'powershell',
'sh': 'bash',
'bat': 'batch',
'h': 'c',
'tex': 'latex'
};
if(Array.prototype.forEach) { // Check to prevent error in IE8
Array.prototype.slice.call(document.querySelectorAll('pre[data-src]')).forEach(function (pre) {
var src = pre.getAttribute('data-src');
var language, parent = pre;
var lang = /\blang(?:uage)?-(?!\*)(\w+)\b/i;
while (parent && !lang.test(parent.className)) {
parent = parent.parentNode;
}
if (parent) {
language = (pre.className.match(lang) || [, ''])[1];
}
if (!language) {
var extension = (src.match(/\.(\w+)$/) || [, ''])[1];
language = Extensions[extension] || extension;
}
var code = document.createElement('code');
code.className = 'language-' + language;
pre.textContent = '';
code.textContent = 'Loading…';
pre.appendChild(code);
var xhr = new XMLHttpRequest();
xhr.open('GET', src, true);
xhr.onreadystatechange = function () {
if (xhr.readyState == 4) {
if (xhr.status < 400 && xhr.responseText) {
code.textContent = xhr.responseText;
Prism.highlightElement(code);
}
else if (xhr.status >= 400) {
code.textContent = '✖ Error ' + xhr.status + ' while fetching file: ' + xhr.statusText;
}
else {
code.textContent = '✖ Error: File does not exist or is empty';
}
}
};
xhr.send(null);
});
}
};
document.addEventListener('DOMContentLoaded', self.Prism.fileHighlight);
})();
});
Prism.languages.python= {
'triple-quoted-string': {
pattern: /"""[\s\S]+?"""|'''[\s\S]+?'''/,
alias: 'string'
},
'comment': {
pattern: /(^|[^\\])#.*/,
lookbehind: true
},
'string': {
pattern: /("|')(?:\\\\|\\?[^\\\r\n])*?\1/,
greedy: true
},
'function' : {
pattern: /((?:^|\s)def[ \t]+)[a-zA-Z_][a-zA-Z0-9_]*(?=\()/g,
lookbehind: true
},
'class-name': {
pattern: /(\bclass\s+)[a-z0-9_]+/i,
lookbehind: true
},
'keyword' : /\b(?:as|assert|async|await|break|class|continue|def|del|elif|else|except|exec|finally|for|from|global|if|import|in|is|lambda|pass|print|raise|return|try|while|with|yield)\b/,
'boolean' : /\b(?:True|False)\b/,
'number' : /\b-?(?:0[bo])?(?:(?:\d|0x[\da-f])[\da-f]*\.?\d*|\.\d+)(?:e[+-]?\d+)?j?\b/i,
'operator' : /[-+%=]=?|!=|\*\*?=?|\/\/?=?|<[<=>]?|>[=>]?|[&|^~]|\b(?:or|and|not)\b/,
'punctuation' : /[{}[\];(),.:]/
};
Prism.languages.clike = {
'comment': [
{
pattern: /(^|[^\\])\/\*[\w\W]*?\*\//,
lookbehind: true
},
{
pattern: /(^|[^\\:])\/\/.*/,
lookbehind: true
}
],
'string': {
pattern: /(["'])(\\(?:\r\n|[\s\S])|(?!\1)[^\\\r\n])*\1/,
greedy: true
},
'class-name': {
pattern: /((?:\b(?:class|interface|extends|implements|trait|instanceof|new)\s+)|(?:catch\s+\())[a-z0-9_\.\\]+/i,
lookbehind: true,
inside: {
punctuation: /(\.|\\)/
}
},
'keyword': /\b(if|else|while|do|for|return|in|instanceof|function|new|try|throw|catch|finally|null|break|continue)\b/,
'boolean': /\b(true|false)\b/,
'function': /[a-z0-9_]+(?=\()/i,
'number': /\b-?(?:0x[\da-f]+|\d*\.?\d+(?:e[+-]?\d+)?)\b/i,
'operator': /--?|\+\+?|!=?=?|<=?|>=?|==?=?|&&?|\|\|?|\?|\*|\/|~|\^|%/,
'punctuation': /[{}[\];(),.:]/
};
Prism.languages.lua = {
'comment': /^#!.+|--(?:\[(=*)\[[\s\S]*?\]\1\]|.*)/m,
// \z may be used to skip the following space
'string': {
pattern: /(["'])(?:(?!\1)[^\\\r\n]|\\z(?:\r\n|\s)|\\(?:\r\n|[\s\S]))*\1|\[(=*)\[[\s\S]*?\]\2\]/,
greedy: true
},
'number': /\b0x[a-f\d]+\.?[a-f\d]*(?:p[+-]?\d+)?\b|\b\d+(?:\.\B|\.?\d*(?:e[+-]?\d+)?\b)|\B\.\d+(?:e[+-]?\d+)?\b/i,
'keyword': /\b(?:and|break|do|else|elseif|end|false|for|function|goto|if|in|local|nil|not|or|repeat|return|then|true|until|while)\b/,
'function': /(?!\d)\w+(?=\s*(?:[({]))/,
'operator': [
/[-+*%^&|#]|\/\/?|<[<=]?|>[>=]?|[=~]=?/,
{
// Match ".." but don't break "..."
pattern: /(^|[^.])\.\.(?!\.)/,
lookbehind: true
}
],
'punctuation': /[\[\](){},;]|\.+|:+/
};
(function(Prism) {
var insideString = {
variable: [
// Arithmetic Environment
{
pattern: /\$?\(\([\w\W]+?\)\)/,
inside: {
// If there is a $ sign at the beginning highlight $(( and )) as variable
variable: [{
pattern: /(^\$\(\([\w\W]+)\)\)/,
lookbehind: true
},
/^\$\(\(/ ],
number: /\b-?(?:0x[\dA-Fa-f]+|\d*\.?\d+(?:[Ee]-?\d+)?)\b/,
// Operators according to https://www.gnu.org/software/bash/manual/bashref.html#Shell-Arithmetic
operator: /--?|-=|\+\+?|\+=|!=?|~|\*\*?|\*=|\/=?|%=?|<<=?|>>=?|<=?|>=?|==?|&&?|&=|\^=?|\|\|?|\|=|\?|:/,
// If there is no $ sign at the beginning highlight (( and )) as punctuation
punctuation: /\(\(?|\)\)?|,|;/
}
},
// Command Substitution
{
pattern: /\$\([^)]+\)|`[^`]+`/,
inside: {
variable: /^\$\(|^`|\)$|`$/
}
},
/\$(?:[a-z0-9_#\?\*!@]+|\{[^}]+\})/i
],
};
Prism.languages.bash = {
'shebang': {
pattern: /^#!\s*\/bin\/bash|^#!\s*\/bin\/sh/,
alias: 'important'
},
'comment': {
pattern: /(^|[^"{\\])#.*/,
lookbehind: true
},
'string': [
//Support for Here-Documents https://en.wikipedia.org/wiki/Here_document
{
pattern: /((?:^|[^<])<<\s*)(?:"|')?(\w+?)(?:"|')?\s*\r?\n(?:[\s\S])*?\r?\n\2/g,
lookbehind: true,
greedy: true,
inside: insideString
},
{
pattern: /(["'])(?:\\\\|\\?[^\\])*?\1/g,
greedy: true,
inside: insideString
}
],
'variable': insideString.variable,
// Originally based on http://ss64.com/bash/
'function': {
pattern: /(^|\s|;|\||&)(?:alias|apropos|apt-get|aptitude|aspell|awk|basename|bash|bc|bg|builtin|bzip2|cal|cat|cd|cfdisk|chgrp|chmod|chown|chroot|chkconfig|cksum|clear|cmp|comm|command|cp|cron|crontab|csplit|cut|date|dc|dd|ddrescue|df|diff|diff3|dig|dir|dircolors|dirname|dirs|dmesg|du|egrep|eject|enable|env|ethtool|eval|exec|expand|expect|export|expr|fdformat|fdisk|fg|fgrep|file|find|fmt|fold|format|free|fsck|ftp|fuser|gawk|getopts|git|grep|groupadd|groupdel|groupmod|groups|gzip|hash|head|help|hg|history|hostname|htop|iconv|id|ifconfig|ifdown|ifup|import|install|jobs|join|kill|killall|less|link|ln|locate|logname|logout|look|lpc|lpr|lprint|lprintd|lprintq|lprm|ls|lsof|make|man|mkdir|mkfifo|mkisofs|mknod|more|most|mount|mtools|mtr|mv|mmv|nano|netstat|nice|nl|nohup|notify-send|npm|nslookup|open|op|passwd|paste|pathchk|ping|pkill|popd|pr|printcap|printenv|printf|ps|pushd|pv|pwd|quota|quotacheck|quotactl|ram|rar|rcp|read|readarray|readonly|reboot|rename|renice|remsync|rev|rm|rmdir|rsync|screen|scp|sdiff|sed|seq|service|sftp|shift|shopt|shutdown|sleep|slocate|sort|source|split|ssh|stat|strace|su|sudo|sum|suspend|sync|tail|tar|tee|test|time|timeout|times|touch|top|traceroute|trap|tr|tsort|tty|type|ulimit|umask|umount|unalias|uname|unexpand|uniq|units|unrar|unshar|uptime|useradd|userdel|usermod|users|uuencode|uudecode|v|vdir|vi|vmstat|wait|watch|wc|wget|whereis|which|who|whoami|write|xargs|xdg-open|yes|zip)(?=$|\s|;|\||&)/,
lookbehind: true
},
'keyword': {
pattern: /(^|\s|;|\||&)(?:let|:|\.|if|then|else|elif|fi|for|break|continue|while|in|case|function|select|do|done|until|echo|exit|return|set|declare)(?=$|\s|;|\||&)/,
lookbehind: true
},
'boolean': {
pattern: /(^|\s|;|\||&)(?:true|false)(?=$|\s|;|\||&)/,
lookbehind: true
},
'operator': /&&?|\|\|?|==?|!=?|<<<?|>>|<=?|>=?|=~/,
'punctuation': /\$?\(\(?|\)\)?|\.\.|[{}[\];]/
};
var inside = insideString.variable[1].inside;
inside['function'] = Prism.languages.bash['function'];
inside.keyword = Prism.languages.bash.keyword;
inside.boolean = Prism.languages.bash.boolean;
inside.operator = Prism.languages.bash.operator;
inside.punctuation = Prism.languages.bash.punctuation;
})(Prism);
Prism.languages.go = Prism.languages.extend('clike', {
'keyword': /\b(break|case|chan|const|continue|default|defer|else|fallthrough|for|func|go(to)?|if|import|interface|map|package|range|return|select|struct|switch|type|var)\b/,
'builtin': /\b(bool|byte|complex(64|128)|error|float(32|64)|rune|string|u?int(8|16|32|64|)|uintptr|append|cap|close|complex|copy|delete|imag|len|make|new|panic|print(ln)?|real|recover)\b/,
'boolean': /\b(_|iota|nil|true|false)\b/,
'operator': /[*\/%^!=]=?|\+[=+]?|-[=-]?|\|[=|]?|&(?:=|&|\^=?)?|>(?:>=?|=)?|<(?:<=?|=|-)?|:=|\.\.\./,
'number': /\b(-?(0x[a-f\d]+|(\d+\.?\d*|\.\d+)(e[-+]?\d+)?)i?)\b/i,
'string': /("|'|`)(\\?.|\r|\n)*?\1/
});
delete Prism.languages.go['class-name'];
Prism.languages.markdown = Prism.languages.extend('markup', {});
Prism.languages.insertBefore('markdown', 'prolog', {
'blockquote': {
// > ...
pattern: /^>(?:[\t ]*>)*/m,
alias: 'punctuation'
},
'code': [
{
// Prefixed by 4 spaces or 1 tab
pattern: /^(?: {4}|\t).+/m,
alias: 'keyword'
},
{
// `code`
// ``code``
pattern: /``.+?``|`[^`\n]+`/,
alias: 'keyword'
}
],
'title': [
{
// title 1
// =======
// title 2
// -------
pattern: /\w+.*(?:\r?\n|\r)(?:==+|--+)/,
alias: 'important',
inside: {
punctuation: /==+$|--+$/
}
},
{
// # title 1
// ###### title 6
pattern: /(^\s*)#+.+/m,
lookbehind: true,
alias: 'important',
inside: {
punctuation: /^#+|#+$/
}
}
],
'hr': {
// ***
// ---
// * * *
// -----------
pattern: /(^\s*)([*-])([\t ]*\2){2,}(?=\s*$)/m,
lookbehind: true,
alias: 'punctuation'
},
'list': {
// * item
// + item
// - item
// 1. item
pattern: /(^\s*)(?:[*+-]|\d+\.)(?=[\t ].)/m,
lookbehind: true,
alias: 'punctuation'
},
'url-reference': {
// [id]: http://example.com "Optional title"
// [id]: http://example.com 'Optional title'
// [id]: http://example.com (Optional title)
// [id]: <http://example.com> "Optional title"
pattern: /!?\[[^\]]+\]:[\t ]+(?:\S+|<(?:\\.|[^>\\])+>)(?:[\t ]+(?:"(?:\\.|[^"\\])*"|'(?:\\.|[^'\\])*'|\((?:\\.|[^)\\])*\)))?/,
inside: {
'variable': {
pattern: /^(!?\[)[^\]]+/,
lookbehind: true
},
'string': /(?:"(?:\\.|[^"\\])*"|'(?:\\.|[^'\\])*'|\((?:\\.|[^)\\])*\))$/,
'punctuation': /^[\[\]!:]|[<>]/
},
alias: 'url'
},
'bold': {
// **strong**
// __strong__
// Allow only one line break
pattern: /(^|[^\\])(\*\*|__)(?:(?:\r?\n|\r)(?!\r?\n|\r)|.)+?\2/,
lookbehind: true,
inside: {
'punctuation': /^\*\*|^__|\*\*$|__$/
}
},
'italic': {
// *em*
// _em_
// Allow only one line break
pattern: /(^|[^\\])([*_])(?:(?:\r?\n|\r)(?!\r?\n|\r)|.)+?\2/,
lookbehind: true,
inside: {
'punctuation': /^[*_]|[*_]$/
}
},
'url': {
// [example](http://example.com "Optional title")
// [example] [id]
pattern: /!?\[[^\]]+\](?:\([^\s)]+(?:[\t ]+"(?:\\.|[^"\\])*")?\)| ?\[[^\]\n]*\])/,
inside: {
'variable': {
pattern: /(!?\[)[^\]]+(?=\]$)/,
lookbehind: true
},
'string': {
pattern: /"(?:\\.|[^"\\])*"(?=\)$)/
}
}
}
});
Prism.languages.markdown['bold'].inside['url'] = Prism.util.clone(Prism.languages.markdown['url']);
Prism.languages.markdown['italic'].inside['url'] = Prism.util.clone(Prism.languages.markdown['url']);
Prism.languages.markdown['bold'].inside['italic'] = Prism.util.clone(Prism.languages.markdown['italic']);
Prism.languages.markdown['italic'].inside['bold'] = Prism.util.clone(Prism.languages.markdown['bold']);
Prism.languages.julia= {
'comment': {
pattern: /(^|[^\\])#.*/,
lookbehind: true
},
'string': /"""[\s\S]+?"""|'''[\s\S]+?'''|("|')(\\?.)*?\1/,
'keyword' : /\b(abstract|baremodule|begin|bitstype|break|catch|ccall|const|continue|do|else|elseif|end|export|finally|for|function|global|if|immutable|import|importall|let|local|macro|module|print|println|quote|return|try|type|typealias|using|while)\b/,
'boolean' : /\b(true|false)\b/,
'number' : /\b-?(0[box])?(?:[\da-f]+\.?\d*|\.\d+)(?:[efp][+-]?\d+)?j?\b/i,
'operator': /\+=?|-=?|\*=?|\/[\/=]?|\\=?|\^=?|%=?|÷=?|!=?=?|&=?|\|[=>]?|\$=?|<(?:<=?|[=:])?|>(?:=|>>?=?)?|==?=?|[~≠≤≥]/,
'punctuation' : /[{}[\];(),.:]/
};
var code$1 = function(dom, data) {
var codeElements = [].slice.call(dom.querySelectorAll("dt-code"));
codeElements.forEach(function (el) {
var content = el.textContent;
el.innerHTML = "";
var language = el.getAttribute("language");
var c = dom.createElement("code");
if (el.getAttribute("block") === "") {
// Let's normalize the tab indents
content = content.replace(/\n/, "");
var tabs = content.match(/\s*/);
content = content.replace(new RegExp("\n" + tabs, "g"), "\n");
content = content.trim();
var p = dom.createElement("pre");
p.appendChild(c);
el.appendChild(p);
} else {
el.appendChild(c);
}
var highlighted = content;
if (prism.languages[language]) {
c.setAttribute("class", "language-" + language);
highlighted = prism.highlight(content, prism.languages[language]);
}
c.innerHTML = highlighted;
});
};
var typeset = function(dom, data) {
var textNodes = dom.createTreeWalker(
dom.body,
dom.defaultView.NodeFilter.SHOW_TEXT
);
while (textNodes.nextNode()) {
var n = textNodes.currentNode,
text = n.nodeValue;
if (text && acceptNode(n)) {
text = quotes(text);
text = punctuation(text);
n.nodeValue = text;
}
}
};
function acceptNode(node) {
var parent = node.parentElement;
var isMath = (parent && parent.getAttribute && parent.getAttribute("class")) ? parent.getAttribute("class").includes("katex") || parent.getAttribute("class").includes("MathJax") : false;
return parent &&
parent.nodeName !== "SCRIPT" &&
parent.nodeName !== "STYLE" &&
parent.nodeName !== "CODE" &&
parent.nodeName !== "PRE" &&
parent.nodeName !== "SPAN" &&
parent.nodeName !== "DT-HEADER" &&
parent.nodeName !== "DT-BYLINE" &&
parent.nodeName !== "DT-MATH" &&
parent.nodeName !== "DT-CODE" &&
parent.nodeName !== "DT-BIBLIOGRAPHY" &&
parent.nodeName !== "DT-FOOTER" &&
parent.nodeType !== 8 && //comment nodes
!isMath;
}
/*!
* typeset - Typesetting for the web
* @version v0.1.6
* @link https://github.com/davidmerfield/Typeset.js
* @author David Merfield
*/
// which has a CC0 license
// http://creativecommons.org/publicdomain/zero/1.0/
function punctuation(text){
// Dashes
text = text.replace(/--/g, '\u2014');
text = text.replace(/ \u2014 /g,"\u2009\u2014\u2009"); //this has thin spaces
// The following are temporary commented out because incompatibility
// with katex
// Elipses
// text = text.replace(/\.\.\./g,'…');
// Nbsp for punc with spaces
// var NBSP = "\u00a0";
// var NBSP_PUNCTUATION_START = /([«¿¡]) /g;
// var NBSP_PUNCTUATION_END = / ([\!\?:;\.,‽»])/g;
// text = text.replace(NBSP_PUNCTUATION_START, '$1' + NBSP);
// text = text.replace(NBSP_PUNCTUATION_END, NBSP + '$1');
return text;
}
function quotes(text) {
text = text
.replace(/(\W|^)"([^\s\!\?:;\.,‽»])/g, '$1\u201c$2') // beginning "
.replace(/(\u201c[^"]*)"([^"]*$|[^\u201c"]*\u201c)/g, '$1\u201d$2') // ending "
.replace(/([^0-9])"/g,'$1\u201d') // remaining " at end of word
.replace(/(\W|^)'(\S)/g, '$1\u2018$2') // beginning '
.replace(/([a-z])'([a-z])/ig, '$1\u2019$2') // conjunction's possession
.replace(/((\u2018[^']*)|[a-z])'([^0-9]|$)/ig, '$1\u2019$3') // ending '
.replace(/(\u2018)([0-9]{2}[^\u2019]*)(\u2018([^0-9]|$)|$|\u2019[a-z])/ig, '\u2019$2$3') // abbrev. years like '93
.replace(/(\B|^)\u2018(?=([^\u2019]*\u2019\b)*([^\u2019\u2018]*\W[\u2019\u2018]\b|[^\u2019\u2018]*$))/ig, '$1\u2019') // backwards apostrophe
.replace(/'''/g, '\u2034') // triple prime
.replace(/("|'')/g, '\u2033') // double prime
.replace(/'/g, '\u2032');
// Allow escaped quotes
text = text.replace(/\\“/, '\"');
text = text.replace(/\\”/, '\"');
text = text.replace(/\\’/, '\'');
text = text.replace(/\\‘/, '\'');
return text;
}
var code$2 = "\n\nfunction nodeFromString(str) {\n var div = document.createElement(\"div\");\n div.innerHTML = str;\n return div.firstChild;\n}\n\nfunction make_hover_css(pos) {\n var pretty = window.innerWidth > 600;\n var padding = pretty? 18 : 12;\n var outer_padding = pretty ? 18 : 0;\n var bbox = document.querySelector(\"body\").getBoundingClientRect();\n var left = pos[0] - bbox.left, top = pos[1] - bbox.top;\n var width = Math.min(window.innerWidth-2*outer_padding, 648);\n left = Math.min(left, window.innerWidth-width-outer_padding);\n width = width - 2*padding;\n return (`position: absolute;\n background-color: #FFF;\n opacity: 0.95;\n max-width: ${width}px;\n top: ${top}px;\n left: ${left}px;\n border: 1px solid rgba(0, 0, 0, 0.25);\n padding: ${padding}px;\n border-radius: ${pretty? 3 : 0}px;\n box-shadow: 0px 2px 10px 2px rgba(0, 0, 0, 0.2);\n z-index: ${1e6};`);\n}\n\n\nfunction DtHoverBox(div_id) {\n this.div = document.querySelector(\"#\"+div_id);\n this.visible = false;\n this.bindDivEvents();\n DtHoverBox.box_map[div_id] = this;\n}\n\nDtHoverBox.box_map = {};\n\nDtHoverBox.get_box = function get_box(div_id) {\n if (div_id in DtHoverBox.box_map) {\n return DtHoverBox.box_map[div_id];\n } else {\n return new DtHoverBox(div_id);\n }\n}\n\nDtHoverBox.prototype.show = function show(pos){\n this.visible = true;\n this.div.setAttribute(\"style\", make_hover_css(pos) );\n for (var box_id in DtHoverBox.box_map) {\n var box = DtHoverBox.box_map[box_id];\n if (box != this) box.hide();\n }\n}\n\nDtHoverBox.prototype.showAtNode = function showAtNode(node){\n var bbox = node.getBoundingClientRect();\n this.show([bbox.right, bbox.bottom]);\n}\n\nDtHoverBox.prototype.hide = function hide(){\n this.visible = false;\n if (this.div) this.div.setAttribute(\"style\", \"display:none\");\n if (this.timeout) clearTimeout(this.timeout);\n}\n\nDtHoverBox.prototype.stopTimeout = function stopTimeout() {\n if (this.timeout) clearTimeout(this.timeout);\n}\n\nDtHoverBox.prototype.extendTimeout = function extendTimeout(T) {\n //console.log(\"extend\", T)\n var this_ = this;\n this.stopTimeout();\n this.timeout = setTimeout(function(){this_.hide();}.bind(this), T);\n}\n\n// Bind events to a link to open this box\nDtHoverBox.prototype.bind = function bind(node) {\n if (typeof node == \"string\"){\n node = document.querySelector(node);\n }\n\n node.addEventListener(\"mouseover\", function(){\n if (!this.visible) this.showAtNode(node);\n this.stopTimeout();\n }.bind(this));\n\n node.addEventListener(\"mouseout\", function(){this.extendTimeout(250);}.bind(this));\n\n node.addEventListener(\"touchstart\", function(e) {\n if (this.visible) {\n this.hide();\n } else {\n this.showAtNode(node);\n }\n // Don't trigger body touchstart event when touching link\n e.stopPropagation();\n }.bind(this));\n}\n\nDtHoverBox.prototype.bindDivEvents = function bindDivEvents(){\n // For mice, same behavior as hovering on links\n this.div.addEventListener(\"mouseover\", function(){\n if (!this.visible) this.showAtNode(node);\n this.stopTimeout();\n }.bind(this));\n this.div.addEventListener(\"mouseout\", function(){this.extendTimeout(250);}.bind(this));\n\n // Don't trigger body touchstart event when touching within box\n this.div.addEventListener(\"touchstart\", function(e){e.stopPropagation();});\n // Close box when touching outside box\n document.body.addEventListener(\"touchstart\", function(){this.hide();}.bind(this));\n}\n\nvar hover_es = document.querySelectorAll(\"span[data-hover-ref]\");\nhover_es = [].slice.apply(hover_es);\nhover_es.forEach(function(e,n){\n var ref_id = e.getAttribute(\"data-hover-ref\");\n DtHoverBox.get_box(ref_id).bind(e);\n})\n";
var hoverBox = function(dom) {
var s = dom.createElement("script");
s.textContent = code$2;
dom.querySelector("body").appendChild(s);
};
//import xml from "xml";
var generateCrossref = function(data) {
var date = data.publishedDate;
var batch_timestamp = Math.floor(Date.now() / 1000);
var batch_id = data.authors.length ? data.authors[0].lastName.toLowerCase().slice(0,20) : "Anonymous";
batch_id += "_" + date.getFullYear();
batch_id += "_" + data.title.split(" ")[0].toLowerCase().slice(0,20) + "_" + batch_timestamp;
// generate XML
var crf_data =
{doi_batch : [
{ _attr: {
version: "4.3.7",
xmlns: "http://www.crossref.org/schema/4.3.7",
"xmlns:xsi": "http://www.w3.org/2001/XMLSchema-instance",
"xsi:schemaLocation": "http://www.crossref.org/schema/4.3.7 http://www.crossref.org/schemas/crossref4.3.7.xsd",
}},
{ head: [
{doi_batch_id: batch_id},
{timestamp: batch_timestamp},
{depositor: [
{depositor_name: data.journal.publisherName},
{email_address: data.journal.publisherEmail} ]},
{registrant: data.journal.publisherName} ]},
{body: [
{journal: [
{journal_metadata: [
{full_title: data.journal.full_title || data.journal.title},
{abbrev_title: data.journal.abbrev_title || data.journal.title || data.journal.full_title},
{issn: data.journal.issn},
{doi_data: [
{doi: data.journal.doi},
{resource: data.journal.url} ]} ]},
{journal_issue: [
{publication_date: [
{month: date.getMonth()+1},
{year: date.getFullYear()} ]},
{journal_volume: [
{volume: data.volume} ]},
{issue: data.issue} ]},
{journal_article: [
{titles: [
{title: data.title} ]},
{ contributors:
data.authors.map(function (author, ind) { return (
{person_name: [
{ _attr: {
contributor_role: "author",
sequence: (ind == 0)? "first" : "additional"
}},
{given_name: author.firstName},
{surname: author.lastName},
{affiliation: author.affiliation}
// TODO: ORCID?
]}
); })
},
{publication_date: [
{month: date.getMonth()+1},
{day: date.getDate()},
{year: date.getFullYear()}
]},
{ publisher_item: [
{item_number: data.doi}
]},
{doi_data: [
{doi: data.doi},
//{timestamp: ""},
{resource: data.url} ]},
{citation_list:
data.citations.map(function (key) { return citation_xml(key, data.bibliography[key]); })
}
]} ]} ]} ]};
return xml(crf_data);
};
function citation_xml(key, ent){
if (ent == undefined) { return {}; }
var info = [];
info.push({_attr: {key: key}});
if ("title" in ent)
{ info.push({article_title: ent.title}); }
if ("author" in ent)
{ info.push({author: ent.author.split(" and ")[0].split(",")[0].trim()}); }
if ("journal" in ent)
{ info.push({journal_title: ent.journal}); }
if ("booktitle" in ent)
{ info.push({volume_title: ent.booktitle}); }
if ("volume" in ent)
{ info.push({volume: ent.volume}); }
if ("issue" in ent)
{ info.push({issue: ent.issue}); }
if ("doi" in ent)
{ info.push({doi: ent.doi}); }
return {citation: info}
}
function xml(obj) {
//console.log(typeof(obj), obj)
if (typeof obj === 'string') { return obj; }
if (typeof obj === 'number') { return ""+obj; }
var keys = Object.keys(obj);
if (keys.length != 1) { console.error("can't interpret ", obj, "as xml"); }
var name = keys[0];
var full_content = obj[name];
var attr = {};
if (Array.isArray(full_content)){
var content = [];
for (var i in full_content) {
var obj = full_content[i];
var obj_name = Object.keys(obj)[0];
if ("_attr" == obj_name) {
attr = obj["_attr"];
} else {
//console.log(Object.keys(obj)[0])
content.push(obj);
}
}
} else {
content = full_content;
}
if (content == undefined){
content = "undefined";
}
var attr_string = "";
for (var k in attr) {
attr_string += " " + k + "=\"" + (attr[k]) + "\"";
}
//console.log(typeof content, Array.isArray(content), content instanceof String, content)
if (Array.isArray(content)){
content = content.map(xml);
content = content.join("\n").split("\n");
content = content.map(function (s) { return " " + s; }).join("\n");
var result = "<" + name + attr_string + ">\n" + content + "\n</" + name + ">";
} else {
content = xml(content);
var result = "<" + name + attr_string + ">" + content + "</" + name + ">";
}
return result;
}
var logo = "<svg viewBox=\"-607 419 64 64\">\n <path d=\"M-573.4,478.9c-8,0-14.6-6.4-14.6-14.5s14.6-25.9,14.6-40.8c0,14.9,14.6,32.8,14.6,40.8S-565.4,478.9-573.4,478.9z\"/>\n</svg>\n";
var html$4 = "\n<style>\ndt-header {\n display: block;\n position: relative;\n height: 60px;\n background-color: hsl(200, 60%, 15%);\n width: 100%;\n box-sizing: border-box;\n z-index: 2;\n color: rgba(0, 0, 0, 0.8);\n border-bottom: 1px solid rgba(0, 0, 0, 0.08);\n box-shadow: 0 1px 6px rgba(0, 0, 0, 0.05);\n}\ndt-header .content {\n height: 70px;\n}\ndt-header a {\n font-size: 16px;\n height: 60px;\n line-height: 60px;\n text-decoration: none;\n color: rgba(255, 255, 255, 0.8);\n padding: 22px 0;\n}\ndt-header a:hover {\n color: rgba(255, 255, 255, 1);\n}\ndt-header svg {\n width: 24px;\n position: relative;\n top: 4px;\n margin-right: 2px;\n}\n@media(min-width: 1080px) {\n dt-header {\n height: 70px;\n }\n dt-header a {\n height: 70px;\n line-height: 70px;\n padding: 28px 0;\n }\n dt-header .logo {\n }\n}\ndt-header svg path {\n fill: none;\n stroke: rgba(255, 255, 255, 0.8);\n stroke-width: 3px;\n}\ndt-header .logo {\n font-size: 17px;\n font-weight: 200;\n}\ndt-header .nav {\n float: right;\n font-weight: 300;\n}\ndt-header .nav a {\n font-size: 12px;\n margin-left: 24px;\n text-transform: uppercase;\n}\n</style>\n\n<div class=\"content l-page\">\n <a href=\"/\" class=\"logo\">\n " + logo + "\n Distill\n </a>\n <div class=\"nav\">\n <a href=\"/about/\">About</a>\n <a href=\"/prize/\">Prize</a>\n <a href=\"/journal/\">Submit</a>\n </div>\n</div>\n";
var header = function(dom, data) {
var el = dom.querySelector("dt-header");
if(el) {
el.innerHTML = html$4;
} else {
var header = dom.createElement("dt-header");
header.innerHTML = html$4;
var b = dom.querySelector("body");
b.insertBefore(header, b.firstChild);
}
};
var html$5 = "\n<style>\ndt-footer {\n display: block;\n color: rgba(255, 255, 255, 0.4);\n font-weight: 300;\n padding: 40px 0;\n border-top: 1px solid rgba(0, 0, 0, 0.1);\n background-color: hsl(200, 60%, 15%);\n text-align: center;\n}\ndt-footer .logo svg {\n width: 24px;\n position: relative;\n top: 4px;\n margin-right: 2px;\n}\ndt-footer .logo svg path {\n fill: none;\n stroke: rgba(255, 255, 255, 0.8);\n stroke-width: 3px;\n}\ndt-footer .logo {\n font-size: 17px;\n font-weight: 200;\n color: rgba(255, 255, 255, 0.8);\n text-decoration: none;\n margin-right: 6px;\n}\ndt-footer .nav {\n margin-top: 12px;\n}\ndt-footer .nav a {\n color: rgba(255, 255, 255, 0.8);\n margin-right: 6px;\n}\n</style>\n\n<div class=\"l-page\">\n <div class=\"description\">\n <a href=\"/\" class=\"logo\">\n " + logo + "\n Distill\n </a>\n is dedicated to clear explanations of machine learning\n </div>\n <div class=\"nav\">\n <a href=\"http://distill.pub/about/\">About</a>\n <a href=\"http://distill.pub/journal/\">Submit</a>\n <a href=\"http://distill.pub/prize/\">Prize</a>\n <a href=\"http://distill.pub/archive/\">Archive</a>\n <a href=\"http://distill.pub/rss.xml\">RSS</a>\n <a href=\"https://github.com/distillpub\">GitHub</a>\n <a href=\"https://twitter.com/distillpub\">Twitter</a>\n &nbsp;&nbsp;&nbsp;&nbsp; ISSN 2476-0757\n </div>\n</div>\n";
var footer = function(dom, data) {
var el = dom.querySelector("dt-footer");
if(el) {
el.innerHTML = html$5;
} else {
var footer = dom.createElement("dt-footer");
footer.innerHTML = html$5;
var b = dom.querySelector("body");
b.appendChild(footer);
}
};
function renderImmediately(dom) {
html(dom);
styles(dom);
}
function renderOnLoad(dom, data) {
frontMatter(dom, data);
bibliography(dom, data);
expandData(dom, data);
meta(dom, data);
byline(dom, data);
appendix(dom, data);
markdown(dom, data);
DTMath(dom, data);
code$1(dom, data);
citation(dom, data);
footnote(dom, data);
typeset(dom, data);
hoverBox(dom, data);
}
// If we are in a browser, render automatically...
var browser = new Function("try { return this === window; }catch(e){ return false; }");
if (browser) {
try {
var data = {};
renderImmediately(window.document);
window.document.addEventListener("DOMContentLoaded", function (event) {
renderOnLoad(window.document, data);
// Add a banner if we're not on localhost.
if (window.location.hostname !== "localhost" && window.location.origin !== "file://") {
banner(window.document, data);
}
generateCrossref(data);
// console.log(data);
});
} catch (error) {
console.error("Window not defined");
}
}
// If we are in node...
function render$1(dom, data) {
renderImmediately(dom);
renderOnLoad(dom, data);
// Remove script tag so it doesn't run again in the client
var s = dom.querySelector('script[src*="distill.pub/template"]');
if (s) { s.parentElement.removeChild(s); }
}
// Distill specific rendering
function distillify(dom, data) {
header(dom, data);
appendixDistill(dom, data);
footer(dom, data);
}
exports.render = render$1;
exports.distillify = distillify;
exports.generateCrossref = generateCrossref;
Object.defineProperty(exports, '__esModule', { value: true });
})));
//# sourceMappingURL=template.v1.js.map
Sign up for free to join this conversation on GitHub. Already have an account? Sign in to comment