Last active
August 29, 2015 14:20
-
-
Save stain/cf2d3f392e822f846bfe to your computer and use it in GitHub Desktop.
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
{ | |
"@context" : { | |
"rest" : { | |
"@id" : "http://www.w3.org/1999/02/22-rdf-syntax-ns#rest", | |
"@type" : "@id" | |
}, | |
"first" : { | |
"@id" : "http://www.w3.org/1999/02/22-rdf-syntax-ns#first", | |
"@type" : "@id" | |
}, | |
"inDataset" : { | |
"@id" : "http://rdfs.org/ns/void#inDataset", | |
"@type" : "@id" | |
}, | |
"exactMatch" : { | |
"@id" : "http://www.w3.org/2004/02/skos/core#exactMatch", | |
"@type" : "@id" | |
}, | |
"hasMolecule" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#hasMolecule", | |
"@type" : "@id", | |
"@container": "@set" | |
}, | |
"hasAssay" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#hasAssay", | |
"@type" : "@id" | |
}, | |
"standardValue" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#standardValue", | |
"@type" : "http://www.w3.org/2001/XMLSchema#decimal" | |
}, | |
"publishedRelation" : "http://rdf.ebi.ac.uk/terms/chembl#publishedRelation", | |
"publishedValue" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#publishedValue", | |
"@type" : "http://www.w3.org/2001/XMLSchema#double" | |
}, | |
"pmid" : { | |
"@id" : "http://purl.org/ontology/bibo/pmid", | |
"@type" : "@id" | |
}, | |
"publishedUnits" : "http://rdf.ebi.ac.uk/terms/chembl#publishedUnits", | |
"standardType" : "http://rdf.ebi.ac.uk/terms/chembl#standardType", | |
"standardRelation" : "http://rdf.ebi.ac.uk/terms/chembl#standardRelation", | |
"publishedType" : "http://rdf.ebi.ac.uk/terms/chembl#publishedType", | |
"hasQUDT" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#hasQUDT", | |
"@type" : "@id" | |
}, | |
"prefLabel" : "http://www.w3.org/2004/02/skos/core#prefLabel", | |
"assayOrganismName" : "http://rdf.ebi.ac.uk/terms/chembl#assayOrganismName", | |
"hasTarget" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#hasTarget", | |
"@type" : "@id" | |
}, | |
"description" : "http://purl.org/dc/terms/description", | |
"pChembl" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#pChembl", | |
"@type" : "http://www.w3.org/2001/XMLSchema#double" | |
}, | |
"activityComment" : "http://rdf.ebi.ac.uk/terms/chembl#activityComment", | |
"molweight" : { | |
"@id" : "http://www.openphacts.org/api#molweight", | |
"@type" : "http://www.w3.org/2001/XMLSchema#double" | |
}, | |
"ro5_violations" : { | |
"@id" : "http://www.openphacts.org/api#ro5_violations", | |
"@type" : "http://www.w3.org/2001/XMLSchema#double" | |
}, | |
"inchikey" : "http://www.openphacts.org/api#inchikey", | |
"inchi" : "http://www.openphacts.org/api#inchi", | |
"smiles" : "http://www.openphacts.org/api#smiles", | |
"title" : "http://purl.org/dc/terms/title", | |
"organismName" : "http://rdf.ebi.ac.uk/terms/chembl#organismName", | |
"hasTargetComponent" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#hasTargetComponent", | |
"@type" : "@id", | |
"@container": "@set" | |
}, | |
"isPartOf" : { | |
"@id" : "http://purl.org/dc/terms/isPartOf", | |
"@type" : "@id" | |
}, | |
"label" : "http://www.w3.org/2000/01/rdf-schema#label", | |
"items" : { | |
"@id" : "http://purl.org/linked-data/api/vocab#items", | |
"@type" : "@id" | |
}, | |
"startIndex" : { | |
"@id" : "http://a9.com/-/spec/opensearch/1.1/startIndex", | |
"@type" : "http://www.w3.org/2001/XMLSchema#integer" | |
}, | |
"modified" : { | |
"@id" : "http://purl.org/dc/terms/modified", | |
"@type" : "http://www.w3.org/2001/XMLSchema#dateTime" | |
}, | |
"extendedMetadataVersion" : { | |
"@id" : "http://purl.org/linked-data/api/vocab#extendedMetadataVersion", | |
"@type" : "@id" | |
}, | |
"itemsPerPage" : { | |
"@id" : "http://a9.com/-/spec/opensearch/1.1/itemsPerPage", | |
"@type" : "http://www.w3.org/2001/XMLSchema#integer" | |
}, | |
"next" : { | |
"@id" : "http://www.w3.org/1999/xhtml/vocab#next", | |
"@type" : "@id" | |
}, | |
"hasPart" : { | |
"@id" : "http://purl.org/dc/terms/hasPart", | |
"@type" : "@id" | |
}, | |
"linkPredicate" : { | |
"@id" : "http://rdfs.org/ns/void#linkPredicate", | |
"@type" : "@id" | |
}, | |
"activeLens" : "http://www.openphacts.org/api/activeLens", | |
"definition" : { | |
"@id" : "http://purl.org/linked-data/api/vocab#definition", | |
"@type" : "@id" | |
}, | |
"void" : "http://rdfs.org/ns/void#", | |
"dct" : "http://purl.org/dc/terms/", | |
"rdf" : "http://www.w3.org/1999/02/22-rdf-syntax-ns#", | |
"opensearch" : "http://a9.com/-/spec/opensearch/1.1/", | |
"skos" : "http://www.w3.org/2004/02/skos/core#", | |
"ns0" : "http://www.openphacts.org/api#", | |
"rdfs" : "http://www.w3.org/2000/01/rdf-schema#", | |
"bibo" : "http://purl.org/ontology/bibo/", | |
"msg0" : "http://www.openphacts.org/api/", | |
"linked-data" : "http://purl.org/linked-data/api/vocab#", | |
"chembl" : "http://rdf.ebi.ac.uk/terms/chembl#", | |
"xhtml" : "http://www.w3.org/1999/xhtml/vocab#" | |
}, | |
"@type": "linked-data:Page" | |
} |
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
{ | |
"@context": { | |
"rest": { | |
"@id": "http://www.w3.org/1999/02/22-rdf-syntax-ns#rest", | |
"@type": "@id" | |
}, | |
"first": { | |
"@id": "http://www.w3.org/1999/02/22-rdf-syntax-ns#first", | |
"@type": "@id" | |
}, | |
"inDataset": { | |
"@id": "http://rdfs.org/ns/void#inDataset", | |
"@type": "@id" | |
}, | |
"exactMatch": { | |
"@id": "http://www.w3.org/2004/02/skos/core#exactMatch", | |
"@type": "@id" | |
}, | |
"hasMolecule": { | |
"@id": "http://rdf.ebi.ac.uk/terms/chembl#hasMolecule", | |
"@type": "@id", | |
"@container": "@set" | |
}, | |
"hasAssay": { | |
"@id": "http://rdf.ebi.ac.uk/terms/chembl#hasAssay", | |
"@type": "@id" | |
}, | |
"standardValue": { | |
"@id": "http://rdf.ebi.ac.uk/terms/chembl#standardValue", | |
"@type": "http://www.w3.org/2001/XMLSchema#decimal" | |
}, | |
"publishedRelation": "http://rdf.ebi.ac.uk/terms/chembl#publishedRelation", | |
"publishedValue": { | |
"@id": "http://rdf.ebi.ac.uk/terms/chembl#publishedValue", | |
"@type": "http://www.w3.org/2001/XMLSchema#double" | |
}, | |
"pmid": { | |
"@id": "http://purl.org/ontology/bibo/pmid", | |
"@type": "@id" | |
}, | |
"publishedUnits": "http://rdf.ebi.ac.uk/terms/chembl#publishedUnits", | |
"standardType": "http://rdf.ebi.ac.uk/terms/chembl#standardType", | |
"standardRelation": "http://rdf.ebi.ac.uk/terms/chembl#standardRelation", | |
"publishedType": "http://rdf.ebi.ac.uk/terms/chembl#publishedType", | |
"hasQUDT": { | |
"@id": "http://rdf.ebi.ac.uk/terms/chembl#hasQUDT", | |
"@type": "@id" | |
}, | |
"prefLabel": "http://www.w3.org/2004/02/skos/core#prefLabel", | |
"assayOrganismName": "http://rdf.ebi.ac.uk/terms/chembl#assayOrganismName", | |
"hasTarget": { | |
"@id": "http://rdf.ebi.ac.uk/terms/chembl#hasTarget", | |
"@type": "@id" | |
}, | |
"description": "http://purl.org/dc/terms/description", | |
"pChembl": { | |
"@id": "http://rdf.ebi.ac.uk/terms/chembl#pChembl", | |
"@type": "http://www.w3.org/2001/XMLSchema#double" | |
}, | |
"activityComment": "http://rdf.ebi.ac.uk/terms/chembl#activityComment", | |
"molweight": { | |
"@id": "http://www.openphacts.org/api#molweight", | |
"@type": "http://www.w3.org/2001/XMLSchema#double" | |
}, | |
"ro5_violations": { | |
"@id": "http://www.openphacts.org/api#ro5_violations", | |
"@type": "http://www.w3.org/2001/XMLSchema#double" | |
}, | |
"inchikey": "http://www.openphacts.org/api#inchikey", | |
"inchi": "http://www.openphacts.org/api#inchi", | |
"smiles": "http://www.openphacts.org/api#smiles", | |
"title": "http://purl.org/dc/terms/title", | |
"organismName": "http://rdf.ebi.ac.uk/terms/chembl#organismName", | |
"hasTargetComponent": { | |
"@id": "http://rdf.ebi.ac.uk/terms/chembl#hasTargetComponent", | |
"@type": "@id", | |
"@container": "@set" | |
}, | |
"isPartOf": { | |
"@id": "http://purl.org/dc/terms/isPartOf", | |
"@type": "@id" | |
}, | |
"label": "http://www.w3.org/2000/01/rdf-schema#label", | |
"items": { | |
"@id": "http://purl.org/linked-data/api/vocab#items", | |
"@type": "@id" | |
}, | |
"startIndex": { | |
"@id": "http://a9.com/-/spec/opensearch/1.1/startIndex", | |
"@type": "http://www.w3.org/2001/XMLSchema#integer" | |
}, | |
"modified": { | |
"@id": "http://purl.org/dc/terms/modified", | |
"@type": "http://www.w3.org/2001/XMLSchema#dateTime" | |
}, | |
"extendedMetadataVersion": { | |
"@id": "http://purl.org/linked-data/api/vocab#extendedMetadataVersion", | |
"@type": "@id" | |
}, | |
"itemsPerPage": { | |
"@id": "http://a9.com/-/spec/opensearch/1.1/itemsPerPage", | |
"@type": "http://www.w3.org/2001/XMLSchema#integer" | |
}, | |
"next": { | |
"@id": "http://www.w3.org/1999/xhtml/vocab#next", | |
"@type": "@id" | |
}, | |
"hasPart": { | |
"@id": "http://purl.org/dc/terms/hasPart", | |
"@type": "@id" | |
}, | |
"linkPredicate": { | |
"@id": "http://rdfs.org/ns/void#linkPredicate", | |
"@type": "@id" | |
}, | |
"activeLens": "http://www.openphacts.org/api/activeLens", | |
"definition": { | |
"@id": "http://purl.org/linked-data/api/vocab#definition", | |
"@type": "@id" | |
}, | |
"void": "http://rdfs.org/ns/void#", | |
"dct": "http://purl.org/dc/terms/", | |
"rdf": "http://www.w3.org/1999/02/22-rdf-syntax-ns#", | |
"opensearch": "http://a9.com/-/spec/opensearch/1.1/", | |
"skos": "http://www.w3.org/2004/02/skos/core#", | |
"ns0": "http://www.openphacts.org/api#", | |
"rdfs": "http://www.w3.org/2000/01/rdf-schema#", | |
"bibo": "http://purl.org/ontology/bibo/", | |
"msg0": "http://www.openphacts.org/api/", | |
"linked-data": "http://purl.org/linked-data/api/vocab#", | |
"chembl": "http://rdf.ebi.ac.uk/terms/chembl#", | |
"xhtml": "http://www.w3.org/1999/xhtml/vocab#" | |
}, | |
"@graph": [ | |
{ | |
"@id": "http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=1", | |
"@type": "linked-data:Page", | |
"opensearch:itemsPerPage": 50, | |
"opensearch:startIndex": 0, | |
"isPartOf": { | |
"@id": "http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50", | |
"@type": "linked-data:List", | |
"hasPart": "http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=1", | |
"definition": "http://ops2.few.vu.nl/api-config", | |
"linkPredicate": "skos:exactMatch", | |
"activeLens": "Default" | |
}, | |
"modified": "2015-04-30T13:59:57", | |
"extendedMetadataVersion": "http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_page=1&_pageSize=50&_metadata=all%2Cviews%2Cformats%2Cexecution%2Cbindings%2Csite", | |
"items": { | |
"@list": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1069030", | |
"pmid": "http://identifiers.org/pubmed/3155552", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"hasMolecule": [ | |
"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1207" | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Kii", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 19, | |
"standardRelation": "=", | |
"standardType": "Kii", | |
"standardValue": "19000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1069031", | |
"pmid": "http://identifiers.org/pubmed/3155552", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1207", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
{ | |
"@id": "http://ops.rsc.org/OPS1752849", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C4H8OS/c5-6-3-1-2-4-6/h1-4H2", | |
"inchikey": "ISXOBTBCNRIIQO-UHFFFAOYSA-N", | |
"ns0:molweight": 104.171, | |
"smiles": "C1CC[S+](C1)[O-]" | |
}, | |
"http://ops.rsc.org/OPS1752849/rdf", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/8f97c172-d98e-4991-9f45-8ccb26c1f2de", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Tetrahydrothiophene 1-oxide" | |
} | |
}, | |
"http://www.conceptwiki.org/concept/index/8f97c172-d98e-4991-9f45-8ccb26c1f2de" | |
] | |
} | |
], | |
"hasQUDT": { | |
"@id": "http://www.openphacts.org/units/Micromolar", | |
"prefLabel": "uM" | |
}, | |
"publishedRelation": "=", | |
"publishedType": "Kii", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 1600, | |
"standardRelation": "=", | |
"standardType": "Kii", | |
"standardValue": "1600", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1074837", | |
"pmid": "http://identifiers.org/pubmed/3155552", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"hasMolecule": [ | |
"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335060" | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Kii", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 0.63, | |
"standardRelation": "=", | |
"standardType": "Kii", | |
"standardValue": "630", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1074838", | |
"pmid": "http://identifiers.org/pubmed/3155552", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335060", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
"http://ops.rsc.org/OPS1749014/rdf", | |
{ | |
"@id": "http://ops.rsc.org/OPS1749014", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C8H16OS/c1-2-3-4-8-5-6-10(9)7-8/h8H,2-7H2,1H3", | |
"inchikey": "QVVQIIIFHZDBDL-UHFFFAOYSA-N", | |
"ns0:molweight": 160.277, | |
"smiles": "CCCCC1CC[S+](C1)[O-]" | |
}, | |
"http://www.conceptwiki.org/concept/index/9fcf0be0-4add-42df-890f-a77c30628e62", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/9fcf0be0-4add-42df-890f-a77c30628e62", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "3-butylthiolane 1-oxide" | |
} | |
} | |
] | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Kii", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 2.3, | |
"standardRelation": "=", | |
"standardType": "Kii", | |
"standardValue": "2300", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1076070", | |
"pmid": "http://identifiers.org/pubmed/3155552", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"hasMolecule": [ | |
"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335234" | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Kii", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 7.5, | |
"standardRelation": "=", | |
"standardType": "Kii", | |
"standardValue": "7500", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1076071", | |
"pmid": "http://identifiers.org/pubmed/3155552", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335234", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
"http://ops.rsc.org/OPS1749599/rdf", | |
{ | |
"@id": "http://ops.rsc.org/OPS1749599", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C5H10OS/c1-5-2-3-7(6)4-5/h5H,2-4H2,1H3", | |
"inchikey": "GFDQTQWMQFSCRF-UHFFFAOYSA-N", | |
"ns0:molweight": 118.197, | |
"smiles": "CC1CC[S+](C1)[O-]" | |
}, | |
{ | |
"@id": "http://www.conceptwiki.org/concept/dfc59974-6a80-4288-8f0a-47fdde9c6e77", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "3-methyltetrahydrothiophene 1-oxide" | |
} | |
}, | |
"http://www.conceptwiki.org/concept/index/dfc59974-6a80-4288-8f0a-47fdde9c6e77" | |
] | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Kii", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 460, | |
"standardRelation": "=", | |
"standardType": "Kii", | |
"standardValue": "460000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1080739", | |
"pmid": "http://identifiers.org/pubmed/3155552", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"hasMolecule": [ | |
"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL334894" | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Kii", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 0.19, | |
"standardRelation": "=", | |
"standardType": "Kii", | |
"standardValue": "190", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1080740", | |
"pmid": "http://identifiers.org/pubmed/3155552", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL334894", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
"http://ops.rsc.org/OPS1749831/rdf", | |
{ | |
"@id": "http://ops.rsc.org/OPS1749831", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C10H20OS/c1-2-3-4-5-6-10-7-8-12(11)9-10/h10H,2-9H2,1H3", | |
"inchikey": "YIMUSBYGQWKFIX-UHFFFAOYSA-N", | |
"ns0:molweight": 188.33, | |
"smiles": "CCCCCCC1CC[S+](C1)[O-]" | |
}, | |
"http://www.conceptwiki.org/concept/index/40a6b53b-c3d2-4784-a432-d085b9460d83", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/40a6b53b-c3d2-4784-a432-d085b9460d83", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "3-hexyltetrahydrothiophene 1-oxide" | |
} | |
} | |
] | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Kii", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 0.35, | |
"standardRelation": "=", | |
"standardType": "Kii", | |
"standardValue": "350", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1085188", | |
"pmid": "http://identifiers.org/pubmed/3155552", | |
"hasAssay": { | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"description": "In vitro inhibitory constant against horse liver alcohol dehydrogenase was determined", | |
"assayOrganismName": "Equus caballus", | |
"hasTarget": "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule": [ | |
"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL131394" | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Kii", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 0.36, | |
"standardRelation": "=", | |
"standardType": "Kii", | |
"standardValue": "360", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1085189", | |
"pmid": "http://identifiers.org/pubmed/3155552", | |
"hasAssay": { | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"description": "In vitro inhibitory constant against monkey liver alcohol dehydrogenase was determined", | |
"assayOrganismName": "Cercopithecidae", | |
"hasTarget": "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL131394", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
{ | |
"@id": "http://ops.rsc.org/OPS1509162", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C10H12OS/c11-12-7-6-10(8-12)9-4-2-1-3-5-9/h1-5,10H,6-8H2", | |
"inchikey": "BJEDAGITLDRWJW-UHFFFAOYSA-N", | |
"ns0:molweight": 180.267, | |
"smiles": "C1C[S+](CC1C2=CC=CC=C2)[O-]" | |
}, | |
"http://ops.rsc.org/OPS1509162/rdf", | |
"http://www.conceptwiki.org/concept/index/bb3fb2b6-47a3-4a1c-9222-137beeb3a09d", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/bb3fb2b6-47a3-4a1c-9222-137beeb3a09d", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "3-phenyltetrahydrothiophene 1-oxide" | |
} | |
} | |
] | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Kii", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 1.5, | |
"standardRelation": "=", | |
"standardType": "Kii", | |
"standardValue": "1500", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_10994231", | |
"pmid": "http://identifiers.org/pubmed/22917519", | |
"activityComment": "Not Active", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL2071959", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2071012", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
"http://ops.rsc.org/OPS33170/rdf", | |
{ | |
"@id": "http://ops.rsc.org/OPS33170", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C11H10N2O2/c1-8-11(15)10(7-14)12-13(8)9-5-3-2-4-6-9/h2-7,15H,1H3", | |
"inchikey": "PQWLFAAZJPOHMG-UHFFFAOYSA-N", | |
"ns0:molweight": 202.209, | |
"ns0:ro5_violations": 0, | |
"smiles": "CC1=C(C(=NN1C2=CC=CC=C2)C=O)O" | |
}, | |
"http://www.conceptwiki.org/concept/index/4c5c31d2-d399-4b64-8bad-56fd927a4703", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/4c5c31d2-d399-4b64-8bad-56fd927a4703", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "4-Hydroxy-5-methyl-1-phenyl-1H-pyrazole-3-carbaldehyde" | |
} | |
} | |
] | |
} | |
], | |
"publishedType": "INH", | |
"standardType": "Inhibition", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_10994232", | |
"pmid": "http://identifiers.org/pubmed/22917519", | |
"activityComment": "Not Active", | |
"hasAssay": { | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL2071959", | |
"description": "Inhibition of FDH using formalin as substrate at 0.01 to 500 uM after 30 mins by fluorimetry", | |
"assayOrganismName": "Homo sapiens", | |
"hasTarget": { | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL4116", | |
"@type": "chembl:SingleProtein", | |
"title": "Alcohol dehydrogenase class III", | |
"hasTargetComponent": [ | |
"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434" | |
], | |
"organismName": "Homo sapiens", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2071013", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
"http://ops.rsc.org/OPS33175/rdf", | |
{ | |
"@id": "http://ops.rsc.org/OPS33175", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C7H8N2O5/c1-13-6(11)3-5(10)4(9-8-3)7(12)14-2/h10H,1-2H3,(H,8,9)", | |
"inchikey": "FBZGCRCSPADZHL-UHFFFAOYSA-N", | |
"ns0:molweight": 200.149, | |
"ns0:ro5_violations": 0, | |
"smiles": "COC(=O)C1=C(C(=NN1)C(=O)OC)O" | |
}, | |
{ | |
"@id": "http://www.conceptwiki.org/concept/fb360819-66f4-4c40-8430-a1aaf257d211", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "1H-pyrazole-3,5-dicarboxylic acid, 4-hydroxy-, dimethyl ester" | |
} | |
}, | |
"http://www.conceptwiki.org/concept/index/fb360819-66f4-4c40-8430-a1aaf257d211" | |
] | |
} | |
], | |
"publishedType": "INH", | |
"standardType": "Inhibition", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1143574", | |
"pmid": "http://identifiers.org/pubmed/8099976", | |
"hasAssay": { | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645403", | |
"description": "Inhibition of horse liver alcohol dehydrogenase enzyme by non-competitive inhibition", | |
"assayOrganismName": "Equus caballus", | |
"hasTarget": "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3144046", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl": 4.7, | |
"publishedRelation": "=", | |
"publishedType": "Ki", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 20, | |
"standardRelation": "=", | |
"standardType": "Ki", | |
"standardValue": "20000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1146157", | |
"pmid": "http://identifiers.org/pubmed/8099976", | |
"hasAssay": { | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645404", | |
"description": "Inhibition of horse liver alcohol dehydrogenase enzyme by Non-competitive inhibition", | |
"assayOrganismName": "Equus caballus", | |
"hasTarget": "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2368671", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl": 8.96, | |
"publishedRelation": "=", | |
"publishedType": "Ki", | |
"publishedUnits": "nM", | |
"chembl:publishedValue": 1.1, | |
"standardRelation": "=", | |
"standardType": "Ki", | |
"standardValue": "1.1", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1232998", | |
"pmid": "http://identifiers.org/pubmed/7021832", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL316966", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
{ | |
"@id": "http://ops.rsc.org/OPS782699", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C10H12N5O6P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(20-10)1-19-22(17,18)21-7/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13)/t4-,6-,7-,10-/m1/s1", | |
"inchikey": "IVOMOUWHDPKRLL-KQYNXXCUSA-N", | |
"ns0:molweight": 329.206, | |
"smiles": "C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C(N=CN=C43)N)O)OP(=O)(O1)O" | |
}, | |
"http://ops.rsc.org/OPS782699/rdf", | |
"http://www.conceptwiki.org/concept/index/9b3a8ddb-ce4a-47a3-b56f-701000ffbf8a", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/9b3a8ddb-ce4a-47a3-b56f-701000ffbf8a", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Adenosine cyclic 3',5'-monophosphate" | |
} | |
} | |
] | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Inhibition constant", | |
"publishedUnits": "mM", | |
"chembl:publishedValue": 0.78, | |
"standardRelation": "=", | |
"standardType": "Ki", | |
"standardValue": "780000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1239563", | |
"pmid": "http://identifiers.org/pubmed/7021832", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161259", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
"http://www.conceptwiki.org/concept/index/725f0c84-8667-4025-beb8-e92c10710482", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/725f0c84-8667-4025-beb8-e92c10710482", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "(2R,3R,4S)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)tetrahydrofuran-3-sulfonic acid" | |
} | |
} | |
] | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Inhibition constant", | |
"publishedUnits": "mM", | |
"chembl:publishedValue": 1.2, | |
"standardRelation": "=", | |
"standardType": "Ki", | |
"standardValue": "1200000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1251220", | |
"pmid": "http://identifiers.org/pubmed/7021832", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161257", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
{ | |
"@id": "http://ops.rsc.org/OPS1323453", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C7H9N5O3S/c8-6-5-7(10-3-9-6)12(4-11-5)1-2-16(13,14)15/h3-4H,1-2H2,(H2,8,9,10)(H,13,14,15)", | |
"inchikey": "QVIVYTFFLSTWLW-UHFFFAOYSA-N", | |
"ns0:molweight": 243.243, | |
"ns0:ro5_violations": 0, | |
"smiles": "C1=NC(=C2C(=N1)N(C=N2)CCS(=O)(=O)O)N" | |
}, | |
"http://ops.rsc.org/OPS1323453/rdf", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/ef06a35d-9b46-4fdc-8005-416e76935588", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "2-(6-aminopurin-9-yl)ethanesulfonic acid" | |
} | |
}, | |
"http://www.conceptwiki.org/concept/index/ef06a35d-9b46-4fdc-8005-416e76935588" | |
] | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Inhibition constant", | |
"publishedUnits": "mM", | |
"chembl:publishedValue": 4.3, | |
"standardRelation": "=", | |
"standardType": "Ki", | |
"standardValue": "4300000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1254796", | |
"pmid": "http://identifiers.org/pubmed/7021832", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL752", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
{ | |
"@id": "http://ops.rsc.org/OPS312171", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1", | |
"inchikey": "UDMBCSSLTHHNCD-KQYNXXCUSA-N", | |
"ns0:molweight": 347.221, | |
"ns0:ro5_violations": 2, | |
"smiles": "C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)N" | |
}, | |
"http://ops.rsc.org/OPS312171/rdf", | |
"http://www.conceptwiki.org/concept/index/a9e18edd-8f4f-4537-b47f-d573120c1381", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/a9e18edd-8f4f-4537-b47f-d573120c1381", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Adenosine monophosphate" | |
} | |
} | |
] | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl": 4.42, | |
"publishedRelation": "=", | |
"publishedType": "Inhibition constant", | |
"publishedUnits": "mM", | |
"chembl:publishedValue": 0.038, | |
"standardRelation": "=", | |
"standardType": "Ki", | |
"standardValue": "38000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1256314", | |
"pmid": "http://identifiers.org/pubmed/7021832", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL608749", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
"http://ops.rsc.org/OPS1337875/rdf", | |
{ | |
"@id": "http://ops.rsc.org/OPS1337875", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C11H16N5O7P/c1-21-24(19,20)22-2-5-7(17)8(18)11(23-5)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H,19,20)(H2,12,13,14)/t5-,7-,8-,11?/m1/s1", | |
"inchikey": "OYQVPLDFZZKUTQ-YNJARDAQSA-N", | |
"ns0:molweight": 361.248, | |
"ns0:ro5_violations": 2, | |
"smiles": "COP(=O)(O)OC[C@@H]1[C@H]([C@H](C(O1)N2C=NC3=C(N=CN=C32)N)O)O" | |
}, | |
{ | |
"@id": "http://www.conceptwiki.org/concept/2fad1725-891b-4d3b-b093-f88ef9293337", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "[(2R,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methyl methyl hydrogen phosphate" | |
} | |
}, | |
"http://www.conceptwiki.org/concept/index/2fad1725-891b-4d3b-b093-f88ef9293337" | |
] | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Inhibition constant", | |
"publishedUnits": "mM", | |
"chembl:publishedValue": 0.44, | |
"standardRelation": "=", | |
"standardType": "Ki", | |
"standardValue": "440000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1256346", | |
"pmid": "http://identifiers.org/pubmed/7021832", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL608163", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
"http://ops.rsc.org/OPS1285429/rdf", | |
{ | |
"@id": "http://ops.rsc.org/OPS1285429", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C10H13N5O6S/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(21-10)1-22(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H,18,19,20)/t4-,6-,7-,10?/m1/s1", | |
"inchikey": "HOZDBGKMRJWBEQ-VTHZCTBJSA-N", | |
"ns0:molweight": 331.305, | |
"ns0:ro5_violations": 2, | |
"smiles": "C1=NC(=C2C(=N1)N(C=N2)C3[C@@H]([C@@H]([C@H](O3)CS(=O)(=O)O)O)O)N" | |
}, | |
{ | |
"@id": "http://www.conceptwiki.org/concept/daee72c5-ca16-4e63-893f-4cc6b8fb78b1", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "5'-Deoxy-5'-sulfoadenosine" | |
} | |
}, | |
"http://www.conceptwiki.org/concept/index/daee72c5-ca16-4e63-893f-4cc6b8fb78b1" | |
] | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Inhibition constant", | |
"publishedUnits": "mM", | |
"chembl:publishedValue": 0.18, | |
"standardRelation": "=", | |
"standardType": "Ki", | |
"standardValue": "180000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1257610", | |
"pmid": "http://identifiers.org/pubmed/7021832", | |
"hasAssay": { | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"description": "Inhibition constant was evaluated against horse liver alcohol dehydrogenase", | |
"assayOrganismName": "Equus caballus", | |
"hasTarget": "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161249", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
"http://ops.rsc.org/OPS1334349/rdf", | |
{ | |
"@id": "http://ops.rsc.org/OPS1334349", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C8H11N5O3S/c9-7-6-8(11-4-10-7)13(5-12-6)2-1-3-17(14,15)16/h4-5H,1-3H2,(H2,9,10,11)(H,14,15,16)", | |
"inchikey": "VLHMGMJBEZFPKZ-UHFFFAOYSA-N", | |
"ns0:molweight": 257.27, | |
"ns0:ro5_violations": 0, | |
"smiles": "C1=NC(=C2C(=N1)N(C=N2)CCCS(=O)(=O)O)N" | |
}, | |
"http://www.conceptwiki.org/concept/index/c599ccbc-a2d7-4080-bf13-616b4491e28c", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/c599ccbc-a2d7-4080-bf13-616b4491e28c", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "3-(6-aminopurin-9-yl)propane-1-sulfonic acid" | |
} | |
} | |
] | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Inhibition constant", | |
"publishedUnits": "mM", | |
"chembl:publishedValue": 4.9, | |
"standardRelation": "=", | |
"standardType": "Ki", | |
"standardValue": "4900000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618787", | |
"pmid": "http://identifiers.org/pubmed/321782", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL121999", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
{ | |
"@id": "http://ops.rsc.org/OPS1508947", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C7H6ClNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10)", | |
"inchikey": "BLNVISNJTIRAHF-UHFFFAOYSA-N", | |
"ns0:molweight": 155.582, | |
"ns0:ro5_violations": 0, | |
"smiles": "C1=CC(=CC=C1C(=O)N)Cl" | |
}, | |
"http://ops.rsc.org/OPS1508947/rdf", | |
"http://www.conceptwiki.org/concept/index/038201a7-1637-489a-9664-63580e24599c", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/038201a7-1637-489a-9664-63580e24599c", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "4-chlorobenzamide" | |
} | |
} | |
] | |
} | |
], | |
"publishedRelation": "=", | |
"publishedType": "log K", | |
"chembl:publishedValue": -1.93, | |
"standardRelation": "=", | |
"standardType": "log K", | |
"standardValue": "-1.93", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618788", | |
"pmid": "http://identifiers.org/pubmed/321782", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3247924", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"publishedRelation": "=", | |
"publishedType": "log K", | |
"chembl:publishedValue": -1.78, | |
"standardRelation": "=", | |
"standardType": "log K", | |
"standardValue": "-1.78", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618789", | |
"pmid": "http://identifiers.org/pubmed/321782", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL449635", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
"http://ops.rsc.org/OPS1078882/rdf", | |
{ | |
"@id": "http://ops.rsc.org/OPS1078882", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C8H9NO2/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H2,9,10)", | |
"inchikey": "GUCPYIYFQVTFSI-UHFFFAOYSA-N", | |
"ns0:molweight": 151.163, | |
"ns0:ro5_violations": 0, | |
"smiles": "COC1=CC=C(C=C1)C(=O)N" | |
}, | |
"http://www.conceptwiki.org/concept/index/0930fb01-3eaa-44b8-bb91-4ba71e40f22c", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/0930fb01-3eaa-44b8-bb91-4ba71e40f22c", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Anisamide" | |
} | |
} | |
] | |
} | |
], | |
"publishedRelation": "=", | |
"publishedType": "log K", | |
"chembl:publishedValue": -2.2, | |
"standardRelation": "=", | |
"standardType": "log K", | |
"standardValue": "-2.2", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618790", | |
"pmid": "http://identifiers.org/pubmed/321782", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL267373", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
{ | |
"@id": "http://ops.rsc.org/OPS1670722", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C7H7NO/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9)", | |
"inchikey": "KXDAEFPNCMNJSK-UHFFFAOYSA-N", | |
"ns0:molweight": 121.137, | |
"ns0:ro5_violations": 0, | |
"smiles": "C1=CC=C(C=C1)C(=O)N" | |
}, | |
"http://ops.rsc.org/OPS1670722/rdf", | |
"http://www.conceptwiki.org/concept/index/fcd38022-f391-460c-b7a7-0a2e3c63324e", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/fcd38022-f391-460c-b7a7-0a2e3c63324e", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "benzamide" | |
} | |
} | |
] | |
} | |
], | |
"publishedRelation": "=", | |
"publishedType": "log K", | |
"chembl:publishedValue": -2.72, | |
"standardRelation": "=", | |
"standardType": "log K", | |
"standardValue": "-2.72", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618791", | |
"pmid": "http://identifiers.org/pubmed/321782", | |
"hasAssay": { | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"description": "Inhibition of alcohol dehydrogenase (unknown origin) assessed as dissociation constant for the complex of enzyme and DPNH", | |
"assayOrganismName": "Homo sapiens", | |
"hasTarget": "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3247925", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"publishedRelation": "=", | |
"publishedType": "log K", | |
"chembl:publishedValue": -1.7, | |
"standardRelation": "=", | |
"standardType": "log K", | |
"standardValue": "-1.7", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14677830", | |
"pmid": "http://identifiers.org/pubmed/1246029", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3282425", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL125596", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
"http://ops.rsc.org/OPS1501345/rdf", | |
{ | |
"@id": "http://ops.rsc.org/OPS1501345", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C7H6FNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10)", | |
"inchikey": "VNDHYTGVCGVETQ-UHFFFAOYSA-N", | |
"ns0:molweight": 139.127, | |
"ns0:ro5_violations": 0, | |
"smiles": "C1=CC(=CC=C1C(=O)N)F" | |
}, | |
"http://www.conceptwiki.org/concept/index/4798759b-c160-48d0-8b89-78865ea6bd09", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/4798759b-c160-48d0-8b89-78865ea6bd09", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "4-fluorobenzamide" | |
} | |
} | |
] | |
} | |
], | |
"publishedRelation": "=", | |
"publishedType": "log(1/K)", | |
"chembl:publishedValue": -2.6, | |
"standardRelation": "=", | |
"standardType": "log(1/K)", | |
"standardValue": "-2.6", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14677832", | |
"pmid": "http://identifiers.org/pubmed/1246029", | |
"hasAssay": { | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3282425", | |
"description": "Binding affinity to alcohol dehydrogenase (unknown origin)", | |
"assayOrganismName": "Homo sapiens", | |
"hasTarget": { | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"@type": "chembl:ProteinFamily", | |
"title": "Alcohol dehydrogenase", | |
"hasTargetComponent": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", | |
"exactMatch": { | |
"@id": "http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Alcohol dehydrogenase 1B (Homo sapiens)" | |
} | |
} | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", | |
"exactMatch": { | |
"@id": "http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Alcohol dehydrogenase 6 (Homo sapiens)" | |
} | |
} | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", | |
"exactMatch": { | |
"@id": "http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Alcohol dehydrogenase 1C (Homo sapiens)" | |
} | |
} | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", | |
"exactMatch": { | |
"@id": "http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)" | |
} | |
} | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", | |
"exactMatch": { | |
"@id": "http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Alcohol dehydrogenase 1A (Homo sapiens)" | |
} | |
} | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", | |
"exactMatch": { | |
"@id": "http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Alcohol dehydrogenase 4 (Homo sapiens)" | |
} | |
} | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch": { | |
"@id": "http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
} | |
} | |
], | |
"organismName": "Homo sapiens", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1483601", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
"http://ops.rsc.org/OPS902805/rdf", | |
{ | |
"@id": "http://ops.rsc.org/OPS902805", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C7H6N2O3/c8-7(10)5-1-3-6(4-2-5)9(11)12/h1-4H,(H2,8,10)", | |
"inchikey": "ZESWUEBPRPGMTP-UHFFFAOYSA-N", | |
"ns0:molweight": 166.134, | |
"ns0:ro5_violations": 0, | |
"smiles": "C1=CC(=CC=C1C(=O)N)[N+](=O)[O-]" | |
}, | |
"http://www.conceptwiki.org/concept/index/d09d5eac-563e-490c-8a44-8c43e4c24574", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/d09d5eac-563e-490c-8a44-8c43e4c24574", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "4-nitrobenzamide" | |
} | |
} | |
] | |
} | |
], | |
"publishedRelation": "=", | |
"publishedType": "log(1/K)", | |
"chembl:publishedValue": -2.6, | |
"standardRelation": "=", | |
"standardType": "log(1/K)", | |
"standardValue": "-2.6", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705973", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": { | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279516", | |
"description": "Reversible inhibition of horse liver alcohol dehydrogenase using ethanol as substrate by stopped-flow method in presence of 1 mM NAD+", | |
"assayOrganismName": "Equus caballus", | |
"hasTarget": "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule": [ | |
"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL15967" | |
], | |
"publishedRelation": "=", | |
"publishedType": "Activity", | |
"publishedUnits": "10'5/M/s", | |
"chembl:publishedValue": 3, | |
"standardRelation": "=", | |
"standardType": "Activity", | |
"standardValue": "3", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705974", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL15967", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
{ | |
"@id": "http://ops.rsc.org/OPS1357172", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C3H4N2/c1-2-4-5-3-1/h1-3H,(H,4,5)", | |
"inchikey": "WTKZEGDFNFYCGP-UHFFFAOYSA-N", | |
"ns0:molweight": 68.0773, | |
"ns0:ro5_violations": 0, | |
"smiles": "C1=CNN=C1" | |
}, | |
"http://ops.rsc.org/OPS1357172/rdf", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/d1cf19d6-6d7a-492b-b7b8-20ca77d57842", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Pyrazole" | |
} | |
}, | |
"http://www.conceptwiki.org/concept/index/d1cf19d6-6d7a-492b-b7b8-20ca77d57842" | |
] | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl": 6.7, | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 0.2, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "200", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705975", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule": [ | |
"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275944" | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 125, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "125000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705976", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule": [ | |
"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275945" | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 150, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "150000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705977", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule": [ | |
"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275947" | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 170, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "170000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705978", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule": [ | |
"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275948" | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 200, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "200000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705979", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule": [ | |
"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275949" | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl": 4.22, | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 60, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "60000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705980", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275950", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl": 4.4, | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 40, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "40000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705981", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275951", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 5100, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "5100000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705982", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1308", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
{ | |
"@id": "http://ops.rsc.org/OPS767517", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C4H6N2/c1-4-2-5-6-3-4/h2-3H,1H3,(H,5,6)", | |
"inchikey": "RIKMMFOAQPJVMX-UHFFFAOYSA-N", | |
"ns0:molweight": 82.1038, | |
"ns0:ro5_violations": 0, | |
"smiles": "CC1=CNN=C1" | |
}, | |
"http://ops.rsc.org/OPS767517/rdf", | |
"http://www.conceptwiki.org/concept/index/8dff382c-73a4-4574-8cd8-7822b14cd678", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/8dff382c-73a4-4574-8cd8-7822b14cd678", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Fomepizole" | |
} | |
} | |
] | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl": 7.89, | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 0.013, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "13", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705983", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276272", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl": 5.44, | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 3.6, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "3600", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705984", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276273", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl": 5.57, | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 2.7, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "2700", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705985", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276274", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl": 6.11, | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 0.77, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "770", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705986", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276275", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl": 6.25, | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 0.56, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "560", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705987", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276276", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"hasQUDT": "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl": 7.7, | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 0.02, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "20", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705988", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"hasAssay": { | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description": "Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName": "Equus caballus", | |
"hasTarget": "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL128679", | |
"inDataset": "http://www.ebi.ac.uk/chembl", | |
"exactMatch": [ | |
{ | |
"@id": "http://ops.rsc.org/OPS1490108", | |
"inDataset": "http://ops.rsc.org", | |
"inchi": "InChI=1S/C4H4N2O2/c7-4(8)3-1-2-5-6-3/h1-2H,(H,5,6)(H,7,8)", | |
"inchikey": "KOPFEFZSAMLEHK-UHFFFAOYSA-N", | |
"ns0:molweight": 112.087, | |
"ns0:ro5_violations": 0, | |
"smiles": "C1=CNN=C1C(=O)O" | |
}, | |
"http://ops.rsc.org/OPS1490108/rdf", | |
{ | |
"@id": "http://www.conceptwiki.org/concept/1068f285-81f3-4a6e-9d14-a1d371c18a1f", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "3-Carboxy-1H-pyrazole" | |
} | |
}, | |
"http://www.conceptwiki.org/concept/index/1068f285-81f3-4a6e-9d14-a1d371c18a1f" | |
] | |
} | |
], | |
"hasQUDT": { | |
"@id": "http://www.openphacts.org/units/Nanomolar", | |
"prefLabel": "nM" | |
}, | |
"publishedRelation": "=", | |
"publishedType": "Kd", | |
"publishedUnits": "uM", | |
"chembl:publishedValue": 6500, | |
"standardRelation": "=", | |
"standardType": "Kd", | |
"standardValue": "6500000", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705989", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"activityComment": "Active", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275944", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"publishedType": "INH", | |
"standardType": "Inhibition", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705990", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"activityComment": "Active", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275945", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"publishedType": "INH", | |
"standardType": "Inhibition", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705991", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"activityComment": "Active", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275946", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"publishedType": "INH", | |
"standardType": "Inhibition", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705992", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"activityComment": "Active", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275947", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"publishedType": "INH", | |
"standardType": "Inhibition", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705993", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"activityComment": "Active", | |
"hasAssay": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275948", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"publishedType": "INH", | |
"standardType": "Inhibition", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705994", | |
"pmid": "http://identifiers.org/pubmed/219196", | |
"activityComment": "Active", | |
"hasAssay": { | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"description": "Competitive inhibition of horse liver alcohol dehydrogenase using ethanol as substrate by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName": "Equus caballus", | |
"hasTarget": { | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"@type": "chembl:ProteinFamily", | |
"title": "Alcohol dehydrogenase", | |
"hasTargetComponent": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch": { | |
"@id": "http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
}, | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch": { | |
"@id": "http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset": "http://www.conceptwiki.org", | |
"prefLabel": { | |
"@language": "en", | |
"@value": "Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
} | |
} | |
], | |
"organismName": "Equus caballus", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule": [ | |
{ | |
"@id": "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275949", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"publishedType": "INH", | |
"standardType": "Inhibition", | |
"inDataset": "http://www.ebi.ac.uk/chembl" | |
} | |
] | |
}, | |
"xhtml:first": { | |
"@id": "http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=1" | |
}, | |
"next": "http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=2", | |
"label": "Target Class Pharmacology: List " | |
} | |
] | |
} |
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
{ | |
"format":"linked-data-api", | |
"version":"1.5", | |
"result":{ | |
"_about":"http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=json&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=1", | |
"itemsPerPage":50, | |
"startIndex":0, | |
"isPartOf":{ | |
"_about":"http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=json&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50", | |
"hasPart":"http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=json&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=1", | |
"definition":"http://ops2.few.vu.nl/api-config", | |
"linkPredicate":"http://www.w3.org/2004/02/skos/core#exactMatch", | |
"activeLens":"Default", | |
"type":"http://purl.org/linked-data/api/vocab#List" | |
}, | |
"modified":"Thursday, 30-Apr-15 10:28:56 UTC", | |
"extendedMetadataVersion":"http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=json&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_page=1&_pageSize=50&_metadata=all%2Cviews%2Cformats%2Cexecution%2Cbindings%2Csite", | |
"items":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1069030", | |
"pmid":"http://identifiers.org/pubmed/3155552", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"description":"In vitro inhibitory constant against horse liver alcohol dehydrogenase was determined", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1207", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
"http://www.conceptwiki.org/concept/index/8f97c172-d98e-4991-9f45-8ccb26c1f2de", | |
{ | |
"_about":"http://www.conceptwiki.org/concept/8f97c172-d98e-4991-9f45-8ccb26c1f2de", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Tetrahydrothiophene 1-oxide", | |
"prefLabel":"Tetrahydrothiophene 1-oxide" | |
}, | |
"http://ops.rsc.org/OPS1752849/rdf", | |
{ | |
"_about":"http://ops.rsc.org/OPS1752849", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C4H8OS/c5-6-3-1-2-4-6/h1-4H2", | |
"inchikey":"ISXOBTBCNRIIQO-UHFFFAOYSA-N", | |
"molweight":104.171, | |
"smiles":"C1CC[S+](C1)[O-]" | |
} | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kii", | |
"publishedUnits":"uM", | |
"publishedValue":19, | |
"activity_relation":"=", | |
"activity_type":"Kii", | |
"activity_value":19000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1069031", | |
"pmid":"http://identifiers.org/pubmed/3155552", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"description":"In vitro inhibitory constant against monkey liver alcohol dehydrogenase was determined", | |
"assayOrganismName":"Cercopithecidae", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1B (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1B (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1C (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1C (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 4 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 4 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 6 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 6 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1A (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1A (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class-3 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
} | |
], | |
"assay_organism":"Homo sapiens", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1207", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
"http://www.conceptwiki.org/concept/index/8f97c172-d98e-4991-9f45-8ccb26c1f2de", | |
{ | |
"_about":"http://www.conceptwiki.org/concept/8f97c172-d98e-4991-9f45-8ccb26c1f2de", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Tetrahydrothiophene 1-oxide", | |
"prefLabel":"Tetrahydrothiophene 1-oxide" | |
}, | |
"http://ops.rsc.org/OPS1752849/rdf", | |
{ | |
"_about":"http://ops.rsc.org/OPS1752849", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C4H8OS/c5-6-3-1-2-4-6/h1-4H2", | |
"inchikey":"ISXOBTBCNRIIQO-UHFFFAOYSA-N", | |
"molweight":104.171, | |
"smiles":"C1CC[S+](C1)[O-]" | |
} | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Micromolar", | |
"prefLabel":"uM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kii", | |
"publishedUnits":"uM", | |
"publishedValue":1600, | |
"activity_relation":"=", | |
"activity_type":"Kii", | |
"activity_value":1600, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1074837", | |
"pmid":"http://identifiers.org/pubmed/3155552", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"description":"In vitro inhibitory constant against horse liver alcohol dehydrogenase was determined", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335060", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/9fcf0be0-4add-42df-890f-a77c30628e62", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"3-butylthiolane 1-oxide", | |
"prefLabel":"3-butylthiolane 1-oxide" | |
}, | |
"http://www.conceptwiki.org/concept/index/9fcf0be0-4add-42df-890f-a77c30628e62", | |
{ | |
"_about":"http://ops.rsc.org/OPS1749014", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C8H16OS/c1-2-3-4-8-5-6-10(9)7-8/h8H,2-7H2,1H3", | |
"inchikey":"QVVQIIIFHZDBDL-UHFFFAOYSA-N", | |
"molweight":160.277, | |
"smiles":"CCCCC1CC[S+](C1)[O-]" | |
}, | |
"http://ops.rsc.org/OPS1749014/rdf" | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kii", | |
"publishedUnits":"uM", | |
"publishedValue":0.63, | |
"activity_relation":"=", | |
"activity_type":"Kii", | |
"activity_value":630, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1074838", | |
"pmid":"http://identifiers.org/pubmed/3155552", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"description":"In vitro inhibitory constant against monkey liver alcohol dehydrogenase was determined", | |
"assayOrganismName":"Cercopithecidae", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1B (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1B (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1C (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1C (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 4 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 4 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 6 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 6 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1A (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1A (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class-3 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
} | |
], | |
"assay_organism":"Homo sapiens", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335060", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/9fcf0be0-4add-42df-890f-a77c30628e62", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"3-butylthiolane 1-oxide", | |
"prefLabel":"3-butylthiolane 1-oxide" | |
}, | |
"http://www.conceptwiki.org/concept/index/9fcf0be0-4add-42df-890f-a77c30628e62", | |
{ | |
"_about":"http://ops.rsc.org/OPS1749014", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C8H16OS/c1-2-3-4-8-5-6-10(9)7-8/h8H,2-7H2,1H3", | |
"inchikey":"QVVQIIIFHZDBDL-UHFFFAOYSA-N", | |
"molweight":160.277, | |
"smiles":"CCCCC1CC[S+](C1)[O-]" | |
}, | |
"http://ops.rsc.org/OPS1749014/rdf" | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kii", | |
"publishedUnits":"uM", | |
"publishedValue":2.3, | |
"activity_relation":"=", | |
"activity_type":"Kii", | |
"activity_value":2300, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1076070", | |
"pmid":"http://identifiers.org/pubmed/3155552", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"description":"In vitro inhibitory constant against horse liver alcohol dehydrogenase was determined", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335234", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
"http://www.conceptwiki.org/concept/index/dfc59974-6a80-4288-8f0a-47fdde9c6e77", | |
{ | |
"_about":"http://www.conceptwiki.org/concept/dfc59974-6a80-4288-8f0a-47fdde9c6e77", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"3-methyltetrahydrothiophene 1-oxide", | |
"prefLabel":"3-methyltetrahydrothiophene 1-oxide" | |
}, | |
{ | |
"_about":"http://ops.rsc.org/OPS1749599", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C5H10OS/c1-5-2-3-7(6)4-5/h5H,2-4H2,1H3", | |
"inchikey":"GFDQTQWMQFSCRF-UHFFFAOYSA-N", | |
"molweight":118.197, | |
"smiles":"CC1CC[S+](C1)[O-]" | |
}, | |
"http://ops.rsc.org/OPS1749599/rdf" | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kii", | |
"publishedUnits":"uM", | |
"publishedValue":7.5, | |
"activity_relation":"=", | |
"activity_type":"Kii", | |
"activity_value":7500, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1076071", | |
"pmid":"http://identifiers.org/pubmed/3155552", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"description":"In vitro inhibitory constant against monkey liver alcohol dehydrogenase was determined", | |
"assayOrganismName":"Cercopithecidae", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1B (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1B (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1C (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1C (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 4 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 4 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 6 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 6 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1A (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1A (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class-3 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
} | |
], | |
"assay_organism":"Homo sapiens", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335234", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
"http://www.conceptwiki.org/concept/index/dfc59974-6a80-4288-8f0a-47fdde9c6e77", | |
{ | |
"_about":"http://www.conceptwiki.org/concept/dfc59974-6a80-4288-8f0a-47fdde9c6e77", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"3-methyltetrahydrothiophene 1-oxide", | |
"prefLabel":"3-methyltetrahydrothiophene 1-oxide" | |
}, | |
{ | |
"_about":"http://ops.rsc.org/OPS1749599", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C5H10OS/c1-5-2-3-7(6)4-5/h5H,2-4H2,1H3", | |
"inchikey":"GFDQTQWMQFSCRF-UHFFFAOYSA-N", | |
"molweight":118.197, | |
"smiles":"CC1CC[S+](C1)[O-]" | |
}, | |
"http://ops.rsc.org/OPS1749599/rdf" | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kii", | |
"publishedUnits":"uM", | |
"publishedValue":460, | |
"activity_relation":"=", | |
"activity_type":"Kii", | |
"activity_value":460000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1080739", | |
"pmid":"http://identifiers.org/pubmed/3155552", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"description":"In vitro inhibitory constant against horse liver alcohol dehydrogenase was determined", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL334894", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/40a6b53b-c3d2-4784-a432-d085b9460d83", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"3-hexyltetrahydrothiophene 1-oxide", | |
"prefLabel":"3-hexyltetrahydrothiophene 1-oxide" | |
}, | |
"http://www.conceptwiki.org/concept/index/40a6b53b-c3d2-4784-a432-d085b9460d83", | |
{ | |
"_about":"http://ops.rsc.org/OPS1749831", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C10H20OS/c1-2-3-4-5-6-10-7-8-12(11)9-10/h10H,2-9H2,1H3", | |
"inchikey":"YIMUSBYGQWKFIX-UHFFFAOYSA-N", | |
"molweight":188.33, | |
"smiles":"CCCCCCC1CC[S+](C1)[O-]" | |
}, | |
"http://ops.rsc.org/OPS1749831/rdf" | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kii", | |
"publishedUnits":"uM", | |
"publishedValue":0.19, | |
"activity_relation":"=", | |
"activity_type":"Kii", | |
"activity_value":190, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1080740", | |
"pmid":"http://identifiers.org/pubmed/3155552", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"description":"In vitro inhibitory constant against monkey liver alcohol dehydrogenase was determined", | |
"assayOrganismName":"Cercopithecidae", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1B (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1B (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1C (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1C (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 4 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 4 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 6 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 6 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1A (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1A (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class-3 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
} | |
], | |
"assay_organism":"Homo sapiens", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL334894", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/40a6b53b-c3d2-4784-a432-d085b9460d83", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"3-hexyltetrahydrothiophene 1-oxide", | |
"prefLabel":"3-hexyltetrahydrothiophene 1-oxide" | |
}, | |
"http://www.conceptwiki.org/concept/index/40a6b53b-c3d2-4784-a432-d085b9460d83", | |
{ | |
"_about":"http://ops.rsc.org/OPS1749831", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C10H20OS/c1-2-3-4-5-6-10-7-8-12(11)9-10/h10H,2-9H2,1H3", | |
"inchikey":"YIMUSBYGQWKFIX-UHFFFAOYSA-N", | |
"molweight":188.33, | |
"smiles":"CCCCCCC1CC[S+](C1)[O-]" | |
}, | |
"http://ops.rsc.org/OPS1749831/rdf" | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kii", | |
"publishedUnits":"uM", | |
"publishedValue":0.35, | |
"activity_relation":"=", | |
"activity_type":"Kii", | |
"activity_value":350, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1085188", | |
"pmid":"http://identifiers.org/pubmed/3155552", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"description":"In vitro inhibitory constant against horse liver alcohol dehydrogenase was determined", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL131394", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/bb3fb2b6-47a3-4a1c-9222-137beeb3a09d", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"3-phenyltetrahydrothiophene 1-oxide", | |
"prefLabel":"3-phenyltetrahydrothiophene 1-oxide" | |
}, | |
"http://www.conceptwiki.org/concept/index/bb3fb2b6-47a3-4a1c-9222-137beeb3a09d", | |
"http://ops.rsc.org/OPS1509162/rdf", | |
{ | |
"_about":"http://ops.rsc.org/OPS1509162", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C10H12OS/c11-12-7-6-10(8-12)9-4-2-1-3-5-9/h1-5,10H,6-8H2", | |
"inchikey":"BJEDAGITLDRWJW-UHFFFAOYSA-N", | |
"molweight":180.267, | |
"smiles":"C1C[S+](CC1C2=CC=CC=C2)[O-]" | |
} | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kii", | |
"publishedUnits":"uM", | |
"publishedValue":0.36, | |
"activity_relation":"=", | |
"activity_type":"Kii", | |
"activity_value":360, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1085189", | |
"pmid":"http://identifiers.org/pubmed/3155552", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"description":"In vitro inhibitory constant against monkey liver alcohol dehydrogenase was determined", | |
"assayOrganismName":"Cercopithecidae", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1B (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1B (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1C (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1C (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 4 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 4 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 6 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 6 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1A (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1A (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class-3 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
} | |
], | |
"assay_organism":"Homo sapiens", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL131394", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/bb3fb2b6-47a3-4a1c-9222-137beeb3a09d", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"3-phenyltetrahydrothiophene 1-oxide", | |
"prefLabel":"3-phenyltetrahydrothiophene 1-oxide" | |
}, | |
"http://www.conceptwiki.org/concept/index/bb3fb2b6-47a3-4a1c-9222-137beeb3a09d", | |
"http://ops.rsc.org/OPS1509162/rdf", | |
{ | |
"_about":"http://ops.rsc.org/OPS1509162", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C10H12OS/c11-12-7-6-10(8-12)9-4-2-1-3-5-9/h1-5,10H,6-8H2", | |
"inchikey":"BJEDAGITLDRWJW-UHFFFAOYSA-N", | |
"molweight":180.267, | |
"smiles":"C1C[S+](CC1C2=CC=CC=C2)[O-]" | |
} | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kii", | |
"publishedUnits":"uM", | |
"publishedValue":1.5, | |
"activity_relation":"=", | |
"activity_type":"Kii", | |
"activity_value":1500, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_10994231", | |
"pmid":"http://identifiers.org/pubmed/22917519", | |
"activityComment":"Not Active", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL2071959", | |
"description":"Inhibition of FDH using formalin as substrate at 0.01 to 500 uM after 30 mins by fluorimetry", | |
"assayOrganismName":"Homo sapiens", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL4116", | |
"title":"Alcohol dehydrogenase class III", | |
"hasTargetComponent":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class-3 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
}, | |
"assay_organism":"Homo sapiens", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#SingleProtein" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2071012", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/4c5c31d2-d399-4b64-8bad-56fd927a4703", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"4-Hydroxy-5-methyl-1-phenyl-1H-pyrazole-3-carbaldehyde", | |
"prefLabel":"4-Hydroxy-5-methyl-1-phenyl-1H-pyrazole-3-carbaldehyde" | |
}, | |
"http://www.conceptwiki.org/concept/index/4c5c31d2-d399-4b64-8bad-56fd927a4703", | |
{ | |
"_about":"http://ops.rsc.org/OPS33170", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C11H10N2O2/c1-8-11(15)10(7-14)12-13(8)9-5-3-2-4-6-9/h2-7,15H,1H3", | |
"inchikey":"PQWLFAAZJPOHMG-UHFFFAOYSA-N", | |
"molweight":202.209, | |
"ro5_violations":0, | |
"smiles":"CC1=C(C(=NN1C2=CC=CC=C2)C=O)O" | |
}, | |
"http://ops.rsc.org/OPS33170/rdf" | |
] | |
}, | |
"publishedType":"INH", | |
"activity_type":"Inhibition", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_10994232", | |
"pmid":"http://identifiers.org/pubmed/22917519", | |
"activityComment":"Not Active", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL2071959", | |
"description":"Inhibition of FDH using formalin as substrate at 0.01 to 500 uM after 30 mins by fluorimetry", | |
"assayOrganismName":"Homo sapiens", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL4116", | |
"title":"Alcohol dehydrogenase class III", | |
"hasTargetComponent":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class-3 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
}, | |
"assay_organism":"Homo sapiens", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#SingleProtein" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2071013", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
"http://www.conceptwiki.org/concept/index/fb360819-66f4-4c40-8430-a1aaf257d211", | |
{ | |
"_about":"http://www.conceptwiki.org/concept/fb360819-66f4-4c40-8430-a1aaf257d211", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"1H-pyrazole-3,5-dicarboxylic acid, 4-hydroxy-, dimethyl ester", | |
"prefLabel":"1H-pyrazole-3,5-dicarboxylic acid, 4-hydroxy-, dimethyl ester" | |
}, | |
{ | |
"_about":"http://ops.rsc.org/OPS33175", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C7H8N2O5/c1-13-6(11)3-5(10)4(9-8-3)7(12)14-2/h10H,1-2H3,(H,8,9)", | |
"inchikey":"FBZGCRCSPADZHL-UHFFFAOYSA-N", | |
"molweight":200.149, | |
"ro5_violations":0, | |
"smiles":"COC(=O)C1=C(C(=NN1)C(=O)OC)O" | |
}, | |
"http://ops.rsc.org/OPS33175/rdf" | |
] | |
}, | |
"publishedType":"INH", | |
"activity_type":"Inhibition", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1143574", | |
"pmid":"http://identifiers.org/pubmed/8099976", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645403", | |
"description":"Inhibition of horse liver alcohol dehydrogenase enzyme by non-competitive inhibition", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3144046", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"pChembl":4.7, | |
"publishedRelation":"=", | |
"publishedType":"Ki", | |
"publishedUnits":"uM", | |
"publishedValue":20, | |
"activity_relation":"=", | |
"activity_type":"Ki", | |
"activity_value":20000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1146157", | |
"pmid":"http://identifiers.org/pubmed/8099976", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645404", | |
"description":"Inhibition of horse liver alcohol dehydrogenase enzyme by Non-competitive inhibition", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2368671", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"pChembl":8.96, | |
"publishedRelation":"=", | |
"publishedType":"Ki", | |
"publishedUnits":"nM", | |
"publishedValue":1.1, | |
"activity_relation":"=", | |
"activity_type":"Ki", | |
"activity_value":1.1, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1232998", | |
"pmid":"http://identifiers.org/pubmed/7021832", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"description":"Inhibition constant was evaluated against horse liver alcohol dehydrogenase", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL316966", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/9b3a8ddb-ce4a-47a3-b56f-701000ffbf8a", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Adenosine cyclic 3',5'-monophosphate", | |
"prefLabel":"Adenosine cyclic 3',5'-monophosphate" | |
}, | |
"http://www.conceptwiki.org/concept/index/9b3a8ddb-ce4a-47a3-b56f-701000ffbf8a", | |
"http://ops.rsc.org/OPS782699/rdf", | |
{ | |
"_about":"http://ops.rsc.org/OPS782699", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C10H12N5O6P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(20-10)1-19-22(17,18)21-7/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13)/t4-,6-,7-,10-/m1/s1", | |
"inchikey":"IVOMOUWHDPKRLL-KQYNXXCUSA-N", | |
"molweight":329.206, | |
"smiles":"C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C(N=CN=C43)N)O)OP(=O)(O1)O" | |
} | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Inhibition constant", | |
"publishedUnits":"mM", | |
"publishedValue":0.78, | |
"activity_relation":"=", | |
"activity_type":"Ki", | |
"activity_value":780000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1239563", | |
"pmid":"http://identifiers.org/pubmed/7021832", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"description":"Inhibition constant was evaluated against horse liver alcohol dehydrogenase", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161259", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/725f0c84-8667-4025-beb8-e92c10710482", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"(2R,3R,4S)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)tetrahydrofuran-3-sulfonic acid", | |
"prefLabel":"(2R,3R,4S)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)tetrahydrofuran-3-sulfonic acid" | |
}, | |
"http://www.conceptwiki.org/concept/index/725f0c84-8667-4025-beb8-e92c10710482" | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Inhibition constant", | |
"publishedUnits":"mM", | |
"publishedValue":1.2, | |
"activity_relation":"=", | |
"activity_type":"Ki", | |
"activity_value":1200000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1251220", | |
"pmid":"http://identifiers.org/pubmed/7021832", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"description":"Inhibition constant was evaluated against horse liver alcohol dehydrogenase", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161257", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
"http://www.conceptwiki.org/concept/index/ef06a35d-9b46-4fdc-8005-416e76935588", | |
{ | |
"_about":"http://www.conceptwiki.org/concept/ef06a35d-9b46-4fdc-8005-416e76935588", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"2-(6-aminopurin-9-yl)ethanesulfonic acid", | |
"prefLabel":"2-(6-aminopurin-9-yl)ethanesulfonic acid" | |
}, | |
"http://ops.rsc.org/OPS1323453/rdf", | |
{ | |
"_about":"http://ops.rsc.org/OPS1323453", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C7H9N5O3S/c8-6-5-7(10-3-9-6)12(4-11-5)1-2-16(13,14)15/h3-4H,1-2H2,(H2,8,9,10)(H,13,14,15)", | |
"inchikey":"QVIVYTFFLSTWLW-UHFFFAOYSA-N", | |
"molweight":243.243, | |
"ro5_violations":0, | |
"smiles":"C1=NC(=C2C(=N1)N(C=N2)CCS(=O)(=O)O)N" | |
} | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Inhibition constant", | |
"publishedUnits":"mM", | |
"publishedValue":4.3, | |
"activity_relation":"=", | |
"activity_type":"Ki", | |
"activity_value":4300000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1254796", | |
"pmid":"http://identifiers.org/pubmed/7021832", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"description":"Inhibition constant was evaluated against horse liver alcohol dehydrogenase", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL752", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/a9e18edd-8f4f-4537-b47f-d573120c1381", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Adenosine monophosphate", | |
"prefLabel":"Adenosine monophosphate" | |
}, | |
"http://www.conceptwiki.org/concept/index/a9e18edd-8f4f-4537-b47f-d573120c1381", | |
"http://ops.rsc.org/OPS312171/rdf", | |
{ | |
"_about":"http://ops.rsc.org/OPS312171", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1", | |
"inchikey":"UDMBCSSLTHHNCD-KQYNXXCUSA-N", | |
"molweight":347.221, | |
"ro5_violations":2, | |
"smiles":"C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)N" | |
} | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"pChembl":4.42, | |
"publishedRelation":"=", | |
"publishedType":"Inhibition constant", | |
"publishedUnits":"mM", | |
"publishedValue":0.038, | |
"activity_relation":"=", | |
"activity_type":"Ki", | |
"activity_value":38000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1256314", | |
"pmid":"http://identifiers.org/pubmed/7021832", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"description":"Inhibition constant was evaluated against horse liver alcohol dehydrogenase", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL608749", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
"http://www.conceptwiki.org/concept/index/2fad1725-891b-4d3b-b093-f88ef9293337", | |
{ | |
"_about":"http://www.conceptwiki.org/concept/2fad1725-891b-4d3b-b093-f88ef9293337", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"[(2R,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methyl methyl hydrogen phosphate", | |
"prefLabel":"[(2R,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methyl methyl hydrogen phosphate" | |
}, | |
{ | |
"_about":"http://ops.rsc.org/OPS1337875", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C11H16N5O7P/c1-21-24(19,20)22-2-5-7(17)8(18)11(23-5)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H,19,20)(H2,12,13,14)/t5-,7-,8-,11?/m1/s1", | |
"inchikey":"OYQVPLDFZZKUTQ-YNJARDAQSA-N", | |
"molweight":361.248, | |
"ro5_violations":2, | |
"smiles":"COP(=O)(O)OC[C@@H]1[C@H]([C@H](C(O1)N2C=NC3=C(N=CN=C32)N)O)O" | |
}, | |
"http://ops.rsc.org/OPS1337875/rdf" | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Inhibition constant", | |
"publishedUnits":"mM", | |
"publishedValue":0.44, | |
"activity_relation":"=", | |
"activity_type":"Ki", | |
"activity_value":440000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1256346", | |
"pmid":"http://identifiers.org/pubmed/7021832", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"description":"Inhibition constant was evaluated against horse liver alcohol dehydrogenase", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL608163", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
"http://www.conceptwiki.org/concept/index/daee72c5-ca16-4e63-893f-4cc6b8fb78b1", | |
{ | |
"_about":"http://www.conceptwiki.org/concept/daee72c5-ca16-4e63-893f-4cc6b8fb78b1", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"5'-Deoxy-5'-sulfoadenosine", | |
"prefLabel":"5'-Deoxy-5'-sulfoadenosine" | |
}, | |
{ | |
"_about":"http://ops.rsc.org/OPS1285429", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C10H13N5O6S/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(21-10)1-22(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H,18,19,20)/t4-,6-,7-,10?/m1/s1", | |
"inchikey":"HOZDBGKMRJWBEQ-VTHZCTBJSA-N", | |
"molweight":331.305, | |
"ro5_violations":2, | |
"smiles":"C1=NC(=C2C(=N1)N(C=N2)C3[C@@H]([C@@H]([C@H](O3)CS(=O)(=O)O)O)O)N" | |
}, | |
"http://ops.rsc.org/OPS1285429/rdf" | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Inhibition constant", | |
"publishedUnits":"mM", | |
"publishedValue":0.18, | |
"activity_relation":"=", | |
"activity_type":"Ki", | |
"activity_value":180000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1257610", | |
"pmid":"http://identifiers.org/pubmed/7021832", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"description":"Inhibition constant was evaluated against horse liver alcohol dehydrogenase", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161249", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/c599ccbc-a2d7-4080-bf13-616b4491e28c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"3-(6-aminopurin-9-yl)propane-1-sulfonic acid", | |
"prefLabel":"3-(6-aminopurin-9-yl)propane-1-sulfonic acid" | |
}, | |
"http://www.conceptwiki.org/concept/index/c599ccbc-a2d7-4080-bf13-616b4491e28c", | |
{ | |
"_about":"http://ops.rsc.org/OPS1334349", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C8H11N5O3S/c9-7-6-8(11-4-10-7)13(5-12-6)2-1-3-17(14,15)16/h4-5H,1-3H2,(H2,9,10,11)(H,14,15,16)", | |
"inchikey":"VLHMGMJBEZFPKZ-UHFFFAOYSA-N", | |
"molweight":257.27, | |
"ro5_violations":0, | |
"smiles":"C1=NC(=C2C(=N1)N(C=N2)CCCS(=O)(=O)O)N" | |
}, | |
"http://ops.rsc.org/OPS1334349/rdf" | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Inhibition constant", | |
"publishedUnits":"mM", | |
"publishedValue":4.9, | |
"activity_relation":"=", | |
"activity_type":"Ki", | |
"activity_value":4900000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618787", | |
"pmid":"http://identifiers.org/pubmed/321782", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"description":"Inhibition of alcohol dehydrogenase (unknown origin) assessed as dissociation constant for the complex of enzyme and DPNH", | |
"assayOrganismName":"Homo sapiens", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1B (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1B (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1C (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1C (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 4 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 4 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 6 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 6 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1A (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1A (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class-3 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
} | |
], | |
"assay_organism":"Homo sapiens", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL121999", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/038201a7-1637-489a-9664-63580e24599c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"4-chlorobenzamide", | |
"prefLabel":"4-chlorobenzamide" | |
}, | |
"http://www.conceptwiki.org/concept/index/038201a7-1637-489a-9664-63580e24599c", | |
"http://ops.rsc.org/OPS1508947/rdf", | |
{ | |
"_about":"http://ops.rsc.org/OPS1508947", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C7H6ClNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10)", | |
"inchikey":"BLNVISNJTIRAHF-UHFFFAOYSA-N", | |
"molweight":155.582, | |
"ro5_violations":0, | |
"smiles":"C1=CC(=CC=C1C(=O)N)Cl" | |
} | |
] | |
}, | |
"publishedRelation":"=", | |
"publishedType":"log K", | |
"publishedValue":-1.93, | |
"activity_relation":"=", | |
"activity_type":"log K", | |
"activity_value":-1.93, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618788", | |
"pmid":"http://identifiers.org/pubmed/321782", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"description":"Inhibition of alcohol dehydrogenase (unknown origin) assessed as dissociation constant for the complex of enzyme and DPNH", | |
"assayOrganismName":"Homo sapiens", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1B (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1B (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1C (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1C (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 4 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 4 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 6 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 6 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1A (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1A (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class-3 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
} | |
], | |
"assay_organism":"Homo sapiens", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3247924", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"log K", | |
"publishedValue":-1.78, | |
"activity_relation":"=", | |
"activity_type":"log K", | |
"activity_value":-1.78, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618789", | |
"pmid":"http://identifiers.org/pubmed/321782", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"description":"Inhibition of alcohol dehydrogenase (unknown origin) assessed as dissociation constant for the complex of enzyme and DPNH", | |
"assayOrganismName":"Homo sapiens", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1B (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1B (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1C (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1C (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 4 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 4 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 6 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 6 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1A (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1A (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class-3 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
} | |
], | |
"assay_organism":"Homo sapiens", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL449635", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/0930fb01-3eaa-44b8-bb91-4ba71e40f22c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Anisamide", | |
"prefLabel":"Anisamide" | |
}, | |
"http://www.conceptwiki.org/concept/index/0930fb01-3eaa-44b8-bb91-4ba71e40f22c", | |
{ | |
"_about":"http://ops.rsc.org/OPS1078882", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C8H9NO2/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H2,9,10)", | |
"inchikey":"GUCPYIYFQVTFSI-UHFFFAOYSA-N", | |
"molweight":151.163, | |
"ro5_violations":0, | |
"smiles":"COC1=CC=C(C=C1)C(=O)N" | |
}, | |
"http://ops.rsc.org/OPS1078882/rdf" | |
] | |
}, | |
"publishedRelation":"=", | |
"publishedType":"log K", | |
"publishedValue":-2.2, | |
"activity_relation":"=", | |
"activity_type":"log K", | |
"activity_value":-2.2, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618790", | |
"pmid":"http://identifiers.org/pubmed/321782", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"description":"Inhibition of alcohol dehydrogenase (unknown origin) assessed as dissociation constant for the complex of enzyme and DPNH", | |
"assayOrganismName":"Homo sapiens", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1B (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1B (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1C (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1C (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 4 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 4 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 6 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 6 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1A (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1A (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class-3 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
} | |
], | |
"assay_organism":"Homo sapiens", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL267373", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/fcd38022-f391-460c-b7a7-0a2e3c63324e", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"benzamide", | |
"prefLabel":"benzamide" | |
}, | |
"http://www.conceptwiki.org/concept/index/fcd38022-f391-460c-b7a7-0a2e3c63324e", | |
"http://ops.rsc.org/OPS1670722/rdf", | |
{ | |
"_about":"http://ops.rsc.org/OPS1670722", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C7H7NO/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9)", | |
"inchikey":"KXDAEFPNCMNJSK-UHFFFAOYSA-N", | |
"molweight":121.137, | |
"ro5_violations":0, | |
"smiles":"C1=CC=C(C=C1)C(=O)N" | |
} | |
] | |
}, | |
"publishedRelation":"=", | |
"publishedType":"log K", | |
"publishedValue":-2.72, | |
"activity_relation":"=", | |
"activity_type":"log K", | |
"activity_value":-2.72, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618791", | |
"pmid":"http://identifiers.org/pubmed/321782", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"description":"Inhibition of alcohol dehydrogenase (unknown origin) assessed as dissociation constant for the complex of enzyme and DPNH", | |
"assayOrganismName":"Homo sapiens", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1B (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1B (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1C (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1C (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 4 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 4 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 6 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 6 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1A (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1A (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class-3 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
} | |
], | |
"assay_organism":"Homo sapiens", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3247925", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"log K", | |
"publishedValue":-1.7, | |
"activity_relation":"=", | |
"activity_type":"log K", | |
"activity_value":-1.7, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14677830", | |
"pmid":"http://identifiers.org/pubmed/1246029", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3282425", | |
"description":"Binding affinity to alcohol dehydrogenase (unknown origin)", | |
"assayOrganismName":"Homo sapiens", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1B (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1B (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1C (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1C (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 4 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 4 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 6 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 6 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1A (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1A (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class-3 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
} | |
], | |
"assay_organism":"Homo sapiens", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL125596", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/4798759b-c160-48d0-8b89-78865ea6bd09", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"4-fluorobenzamide", | |
"prefLabel":"4-fluorobenzamide" | |
}, | |
"http://www.conceptwiki.org/concept/index/4798759b-c160-48d0-8b89-78865ea6bd09", | |
{ | |
"_about":"http://ops.rsc.org/OPS1501345", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C7H6FNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10)", | |
"inchikey":"VNDHYTGVCGVETQ-UHFFFAOYSA-N", | |
"molweight":139.127, | |
"ro5_violations":0, | |
"smiles":"C1=CC(=CC=C1C(=O)N)F" | |
}, | |
"http://ops.rsc.org/OPS1501345/rdf" | |
] | |
}, | |
"publishedRelation":"=", | |
"publishedType":"log(1/K)", | |
"publishedValue":-2.6, | |
"activity_relation":"=", | |
"activity_type":"log(1/K)", | |
"activity_value":-2.6, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14677832", | |
"pmid":"http://identifiers.org/pubmed/1246029", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3282425", | |
"description":"Binding affinity to alcohol dehydrogenase (unknown origin)", | |
"assayOrganismName":"Homo sapiens", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1B (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1B (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1C (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1C (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 4 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 4 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 6 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 6 (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase 1A (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase 1A (Homo sapiens)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase class-3 (Homo sapiens)", | |
"prefLabel":"Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
} | |
], | |
"assay_organism":"Homo sapiens", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1483601", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/d09d5eac-563e-490c-8a44-8c43e4c24574", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"4-nitrobenzamide", | |
"prefLabel":"4-nitrobenzamide" | |
}, | |
"http://www.conceptwiki.org/concept/index/d09d5eac-563e-490c-8a44-8c43e4c24574", | |
{ | |
"_about":"http://ops.rsc.org/OPS902805", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C7H6N2O3/c8-7(10)5-1-3-6(4-2-5)9(11)12/h1-4H,(H2,8,10)", | |
"inchikey":"ZESWUEBPRPGMTP-UHFFFAOYSA-N", | |
"molweight":166.134, | |
"ro5_violations":0, | |
"smiles":"C1=CC(=CC=C1C(=O)N)[N+](=O)[O-]" | |
}, | |
"http://ops.rsc.org/OPS902805/rdf" | |
] | |
}, | |
"publishedRelation":"=", | |
"publishedType":"log(1/K)", | |
"publishedValue":-2.6, | |
"activity_relation":"=", | |
"activity_type":"log(1/K)", | |
"activity_value":-2.6, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705973", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279516", | |
"description":"Reversible inhibition of horse liver alcohol dehydrogenase using ethanol as substrate by stopped-flow method in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL15967", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
"http://www.conceptwiki.org/concept/index/d1cf19d6-6d7a-492b-b7b8-20ca77d57842", | |
{ | |
"_about":"http://www.conceptwiki.org/concept/d1cf19d6-6d7a-492b-b7b8-20ca77d57842", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Pyrazole", | |
"prefLabel":"Pyrazole" | |
}, | |
"http://ops.rsc.org/OPS1357172/rdf", | |
{ | |
"_about":"http://ops.rsc.org/OPS1357172", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C3H4N2/c1-2-4-5-3-1/h1-3H,(H,4,5)", | |
"inchikey":"WTKZEGDFNFYCGP-UHFFFAOYSA-N", | |
"molweight":68.0773, | |
"ro5_violations":0, | |
"smiles":"C1=CNN=C1" | |
} | |
] | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Activity", | |
"publishedUnits":"10'5/M/s", | |
"publishedValue":3, | |
"activity_relation":"=", | |
"activity_type":"Activity", | |
"activity_value":3, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705974", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL15967", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
"http://www.conceptwiki.org/concept/index/d1cf19d6-6d7a-492b-b7b8-20ca77d57842", | |
{ | |
"_about":"http://www.conceptwiki.org/concept/d1cf19d6-6d7a-492b-b7b8-20ca77d57842", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Pyrazole", | |
"prefLabel":"Pyrazole" | |
}, | |
"http://ops.rsc.org/OPS1357172/rdf", | |
{ | |
"_about":"http://ops.rsc.org/OPS1357172", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C3H4N2/c1-2-4-5-3-1/h1-3H,(H,4,5)", | |
"inchikey":"WTKZEGDFNFYCGP-UHFFFAOYSA-N", | |
"molweight":68.0773, | |
"ro5_violations":0, | |
"smiles":"C1=CNN=C1" | |
} | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"pChembl":6.7, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":0.2, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":200, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705975", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275944", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":125, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":125000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705976", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275945", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":150, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":150000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705977", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275947", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":170, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":170000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705978", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275948", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":200, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":200000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705979", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275949", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"pChembl":4.22, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":60, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":60000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705980", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275950", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"pChembl":4.4, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":40, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":40000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705981", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275951", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":5100, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":5100000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705982", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1308", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
{ | |
"_about":"http://www.conceptwiki.org/concept/8dff382c-73a4-4574-8cd8-7822b14cd678", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Fomepizole", | |
"prefLabel":"Fomepizole" | |
}, | |
"http://www.conceptwiki.org/concept/index/8dff382c-73a4-4574-8cd8-7822b14cd678", | |
"http://ops.rsc.org/OPS767517/rdf", | |
{ | |
"_about":"http://ops.rsc.org/OPS767517", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C4H6N2/c1-4-2-5-6-3-4/h2-3H,1H3,(H,5,6)", | |
"inchikey":"RIKMMFOAQPJVMX-UHFFFAOYSA-N", | |
"molweight":82.1038, | |
"ro5_violations":0, | |
"smiles":"CC1=CNN=C1" | |
} | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"pChembl":7.89, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":0.013, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":13, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705983", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276272", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"pChembl":5.44, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":3.6, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":3600, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705984", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276273", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"pChembl":5.57, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":2.7, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":2700, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705985", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276274", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"pChembl":6.11, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":0.77, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":770, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705986", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276275", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"pChembl":6.25, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":0.56, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":560, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705987", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276276", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"pChembl":7.7, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":0.02, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":20, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705988", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description":"Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL128679", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"exactMatch":[ | |
"http://www.conceptwiki.org/concept/index/1068f285-81f3-4a6e-9d14-a1d371c18a1f", | |
{ | |
"_about":"http://www.conceptwiki.org/concept/1068f285-81f3-4a6e-9d14-a1d371c18a1f", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"3-Carboxy-1H-pyrazole", | |
"prefLabel":"3-Carboxy-1H-pyrazole" | |
}, | |
"http://ops.rsc.org/OPS1490108/rdf", | |
{ | |
"_about":"http://ops.rsc.org/OPS1490108", | |
"inDataset":"http://ops.rsc.org", | |
"inchi":"InChI=1S/C4H4N2O2/c7-4(8)3-1-2-5-6-3/h1-2H,(H,5,6)(H,7,8)", | |
"inchikey":"KOPFEFZSAMLEHK-UHFFFAOYSA-N", | |
"molweight":112.087, | |
"ro5_violations":0, | |
"smiles":"C1=CNN=C1C(=O)O" | |
} | |
] | |
}, | |
"activity_unit":{ | |
"_about":"http://www.openphacts.org/units/Nanomolar", | |
"prefLabel":"nM" | |
}, | |
"publishedRelation":"=", | |
"publishedType":"Kd", | |
"publishedUnits":"uM", | |
"publishedValue":6500, | |
"activity_relation":"=", | |
"activity_type":"Kd", | |
"activity_value":6500000, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705989", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"activityComment":"Active", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"description":"Competitive inhibition of horse liver alcohol dehydrogenase using ethanol as substrate by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275944", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"publishedType":"INH", | |
"activity_type":"Inhibition", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705990", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"activityComment":"Active", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"description":"Competitive inhibition of horse liver alcohol dehydrogenase using ethanol as substrate by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275945", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"publishedType":"INH", | |
"activity_type":"Inhibition", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705991", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"activityComment":"Active", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"description":"Competitive inhibition of horse liver alcohol dehydrogenase using ethanol as substrate by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275946", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"publishedType":"INH", | |
"activity_type":"Inhibition", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705992", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"activityComment":"Active", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"description":"Competitive inhibition of horse liver alcohol dehydrogenase using ethanol as substrate by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275947", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"publishedType":"INH", | |
"activity_type":"Inhibition", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705993", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"activityComment":"Active", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"description":"Competitive inhibition of horse liver alcohol dehydrogenase using ethanol as substrate by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275948", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"publishedType":"INH", | |
"activity_type":"Inhibition", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705994", | |
"pmid":"http://identifiers.org/pubmed/219196", | |
"activityComment":"Active", | |
"hasAssay":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"description":"Competitive inhibition of horse liver alcohol dehydrogenase using ethanol as substrate by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName":"Equus caballus", | |
"hasTarget":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"title":"Alcohol dehydrogenase", | |
"hasTargetComponent":[ | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase S chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, | |
{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch":{ | |
"_about":"http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset":"http://www.conceptwiki.org", | |
"prefLabel_en":"Alcohol dehydrogenase E chain (Equus caballus)", | |
"prefLabel":"Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
} | |
], | |
"assay_organism":"Equus caballus", | |
"inDataset":"http://www.ebi.ac.uk/chembl", | |
"type":"http://rdf.ebi.ac.uk/terms/chembl#ProteinFamily" | |
}, | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"hasMolecule":{ | |
"_about":"http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275949", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
}, | |
"publishedType":"INH", | |
"activity_type":"Inhibition", | |
"inDataset":"http://www.ebi.ac.uk/chembl" | |
} | |
], | |
"type":"http://purl.org/linked-data/api/vocab#Page", | |
"first":"http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=json&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=1", | |
"next":"http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=json&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=2", | |
"label":"Target Class Pharmacology: List " | |
} | |
} |
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
{ | |
"@graph" : [ { | |
"@id" : "http://ops.rsc.org/OPS1078882", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C8H9NO2/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H2,9,10)", | |
"inchikey" : "GUCPYIYFQVTFSI-UHFFFAOYSA-N", | |
"ns0:molweight" : 151.163, | |
"ns0:ro5_violations" : 0.0, | |
"smiles" : "COC1=CC=C(C=C1)C(=O)N" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS1285429", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C10H13N5O6S/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(21-10)1-22(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H,18,19,20)/t4-,6-,7-,10?/m1/s1", | |
"inchikey" : "HOZDBGKMRJWBEQ-VTHZCTBJSA-N", | |
"ns0:molweight" : 331.305, | |
"ns0:ro5_violations" : 2.0, | |
"smiles" : "C1=NC(=C2C(=N1)N(C=N2)C3[C@@H]([C@@H]([C@H](O3)CS(=O)(=O)O)O)O)N" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS1323453", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C7H9N5O3S/c8-6-5-7(10-3-9-6)12(4-11-5)1-2-16(13,14)15/h3-4H,1-2H2,(H2,8,9,10)(H,13,14,15)", | |
"inchikey" : "QVIVYTFFLSTWLW-UHFFFAOYSA-N", | |
"ns0:molweight" : 243.243, | |
"ns0:ro5_violations" : 0.0, | |
"smiles" : "C1=NC(=C2C(=N1)N(C=N2)CCS(=O)(=O)O)N" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS1334349", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C8H11N5O3S/c9-7-6-8(11-4-10-7)13(5-12-6)2-1-3-17(14,15)16/h4-5H,1-3H2,(H2,9,10,11)(H,14,15,16)", | |
"inchikey" : "VLHMGMJBEZFPKZ-UHFFFAOYSA-N", | |
"ns0:molweight" : 257.27, | |
"ns0:ro5_violations" : 0.0, | |
"smiles" : "C1=NC(=C2C(=N1)N(C=N2)CCCS(=O)(=O)O)N" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS1337875", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C11H16N5O7P/c1-21-24(19,20)22-2-5-7(17)8(18)11(23-5)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H,19,20)(H2,12,13,14)/t5-,7-,8-,11?/m1/s1", | |
"inchikey" : "OYQVPLDFZZKUTQ-YNJARDAQSA-N", | |
"ns0:molweight" : 361.248, | |
"ns0:ro5_violations" : 2.0, | |
"smiles" : "COP(=O)(O)OC[C@@H]1[C@H]([C@H](C(O1)N2C=NC3=C(N=CN=C32)N)O)O" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS1357172", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C3H4N2/c1-2-4-5-3-1/h1-3H,(H,4,5)", | |
"inchikey" : "WTKZEGDFNFYCGP-UHFFFAOYSA-N", | |
"ns0:molweight" : 68.0773, | |
"ns0:ro5_violations" : 0.0, | |
"smiles" : "C1=CNN=C1" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS1490108", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C4H4N2O2/c7-4(8)3-1-2-5-6-3/h1-2H,(H,5,6)(H,7,8)", | |
"inchikey" : "KOPFEFZSAMLEHK-UHFFFAOYSA-N", | |
"ns0:molweight" : 112.087, | |
"ns0:ro5_violations" : 0.0, | |
"smiles" : "C1=CNN=C1C(=O)O" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS1501345", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C7H6FNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10)", | |
"inchikey" : "VNDHYTGVCGVETQ-UHFFFAOYSA-N", | |
"ns0:molweight" : 139.127, | |
"ns0:ro5_violations" : 0.0, | |
"smiles" : "C1=CC(=CC=C1C(=O)N)F" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS1508947", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C7H6ClNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10)", | |
"inchikey" : "BLNVISNJTIRAHF-UHFFFAOYSA-N", | |
"ns0:molweight" : 155.582, | |
"ns0:ro5_violations" : 0.0, | |
"smiles" : "C1=CC(=CC=C1C(=O)N)Cl" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS1509162", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C10H12OS/c11-12-7-6-10(8-12)9-4-2-1-3-5-9/h1-5,10H,6-8H2", | |
"inchikey" : "BJEDAGITLDRWJW-UHFFFAOYSA-N", | |
"ns0:molweight" : 180.267, | |
"smiles" : "C1C[S+](CC1C2=CC=CC=C2)[O-]" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS1670722", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C7H7NO/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9)", | |
"inchikey" : "KXDAEFPNCMNJSK-UHFFFAOYSA-N", | |
"ns0:molweight" : 121.137, | |
"ns0:ro5_violations" : 0.0, | |
"smiles" : "C1=CC=C(C=C1)C(=O)N" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS1749014", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C8H16OS/c1-2-3-4-8-5-6-10(9)7-8/h8H,2-7H2,1H3", | |
"inchikey" : "QVVQIIIFHZDBDL-UHFFFAOYSA-N", | |
"ns0:molweight" : 160.277, | |
"smiles" : "CCCCC1CC[S+](C1)[O-]" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS1749599", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C5H10OS/c1-5-2-3-7(6)4-5/h5H,2-4H2,1H3", | |
"inchikey" : "GFDQTQWMQFSCRF-UHFFFAOYSA-N", | |
"ns0:molweight" : 118.197, | |
"smiles" : "CC1CC[S+](C1)[O-]" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS1749831", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C10H20OS/c1-2-3-4-5-6-10-7-8-12(11)9-10/h10H,2-9H2,1H3", | |
"inchikey" : "YIMUSBYGQWKFIX-UHFFFAOYSA-N", | |
"ns0:molweight" : 188.33, | |
"smiles" : "CCCCCCC1CC[S+](C1)[O-]" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS1752849", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C4H8OS/c5-6-3-1-2-4-6/h1-4H2", | |
"inchikey" : "ISXOBTBCNRIIQO-UHFFFAOYSA-N", | |
"ns0:molweight" : 104.171, | |
"smiles" : "C1CC[S+](C1)[O-]" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS312171", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1", | |
"inchikey" : "UDMBCSSLTHHNCD-KQYNXXCUSA-N", | |
"ns0:molweight" : 347.221, | |
"ns0:ro5_violations" : 2.0, | |
"smiles" : "C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)N" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS33170", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C11H10N2O2/c1-8-11(15)10(7-14)12-13(8)9-5-3-2-4-6-9/h2-7,15H,1H3", | |
"inchikey" : "PQWLFAAZJPOHMG-UHFFFAOYSA-N", | |
"ns0:molweight" : 202.209, | |
"ns0:ro5_violations" : 0.0, | |
"smiles" : "CC1=C(C(=NN1C2=CC=CC=C2)C=O)O" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS33175", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C7H8N2O5/c1-13-6(11)3-5(10)4(9-8-3)7(12)14-2/h10H,1-2H3,(H,8,9)", | |
"inchikey" : "FBZGCRCSPADZHL-UHFFFAOYSA-N", | |
"ns0:molweight" : 200.149, | |
"ns0:ro5_violations" : 0.0, | |
"smiles" : "COC(=O)C1=C(C(=NN1)C(=O)OC)O" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS767517", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C4H6N2/c1-4-2-5-6-3-4/h2-3H,1H3,(H,5,6)", | |
"inchikey" : "RIKMMFOAQPJVMX-UHFFFAOYSA-N", | |
"ns0:molweight" : 82.1038, | |
"ns0:ro5_violations" : 0.0, | |
"smiles" : "CC1=CNN=C1" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS782699", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C10H12N5O6P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(20-10)1-19-22(17,18)21-7/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13)/t4-,6-,7-,10-/m1/s1", | |
"inchikey" : "IVOMOUWHDPKRLL-KQYNXXCUSA-N", | |
"ns0:molweight" : 329.206, | |
"smiles" : "C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C(N=CN=C43)N)O)OP(=O)(O1)O" | |
}, { | |
"@id" : "http://ops.rsc.org/OPS902805", | |
"inDataset" : "http://ops.rsc.org", | |
"inchi" : "InChI=1S/C7H6N2O3/c8-7(10)5-1-3-6(4-2-5)9(11)12/h1-4H,(H2,8,10)", | |
"inchikey" : "ZESWUEBPRPGMTP-UHFFFAOYSA-N", | |
"ns0:molweight" : 166.134, | |
"ns0:ro5_violations" : 0.0, | |
"smiles" : "C1=CC(=CC=C1C(=O)N)[N+](=O)[O-]" | |
}, { | |
"@id" : "http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50", | |
"@type" : "linked-data:List", | |
"hasPart" : "http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=1", | |
"definition" : "http://ops2.few.vu.nl/api-config", | |
"linkPredicate" : "skos:exactMatch", | |
"activeLens" : "Default" | |
}, { | |
"@id" : "http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=1", | |
"@type" : "linked-data:Page", | |
"opensearch:itemsPerPage" : 50, | |
"opensearch:startIndex" : 0, | |
"isPartOf" : "http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50", | |
"modified" : "2015-04-30T13:59:57", | |
"extendedMetadataVersion" : "http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_page=1&_pageSize=50&_metadata=all%2Cviews%2Cformats%2Cexecution%2Cbindings%2Csite", | |
"items" : { | |
"@list" : [ "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1069030", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1069031", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1074837", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1074838", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1076070", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1076071", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1080739", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1080740", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1085188", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1085189", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_10994231", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_10994232", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1143574", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1146157", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1232998", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1239563", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1251220", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1254796", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1256314", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1256346", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1257610", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618787", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618788", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618789", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618790", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618791", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14677830", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14677832", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705973", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705974", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705975", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705976", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705977", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705978", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705979", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705980", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705981", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705982", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705983", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705984", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705985", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705986", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705987", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705988", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705989", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705990", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705991", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705992", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705993", "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705994" ] | |
}, | |
"xhtml:first" : { | |
"@id" : "http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=1" | |
}, | |
"next" : "http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=2", | |
"label" : "Target Class Pharmacology: List " | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1069030", | |
"pmid" : "http://identifiers.org/pubmed/3155552", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1207", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kii", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 19.0, | |
"standardRelation" : "=", | |
"standardType" : "Kii", | |
"standardValue" : "19000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1069031", | |
"pmid" : "http://identifiers.org/pubmed/3155552", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1207", | |
"hasQUDT" : "http://www.openphacts.org/units/Micromolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kii", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 1600.0, | |
"standardRelation" : "=", | |
"standardType" : "Kii", | |
"standardValue" : "1600", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1074837", | |
"pmid" : "http://identifiers.org/pubmed/3155552", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335060", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kii", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 0.63, | |
"standardRelation" : "=", | |
"standardType" : "Kii", | |
"standardValue" : "630", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1074838", | |
"pmid" : "http://identifiers.org/pubmed/3155552", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335060", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kii", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 2.3, | |
"standardRelation" : "=", | |
"standardType" : "Kii", | |
"standardValue" : "2300", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1076070", | |
"pmid" : "http://identifiers.org/pubmed/3155552", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335234", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kii", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 7.5, | |
"standardRelation" : "=", | |
"standardType" : "Kii", | |
"standardValue" : "7500", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1076071", | |
"pmid" : "http://identifiers.org/pubmed/3155552", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335234", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kii", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 460.0, | |
"standardRelation" : "=", | |
"standardType" : "Kii", | |
"standardValue" : "460000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1080739", | |
"pmid" : "http://identifiers.org/pubmed/3155552", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL334894", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kii", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 0.19, | |
"standardRelation" : "=", | |
"standardType" : "Kii", | |
"standardValue" : "190", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1080740", | |
"pmid" : "http://identifiers.org/pubmed/3155552", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL334894", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kii", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 0.35, | |
"standardRelation" : "=", | |
"standardType" : "Kii", | |
"standardValue" : "350", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1085188", | |
"pmid" : "http://identifiers.org/pubmed/3155552", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL131394", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kii", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 0.36, | |
"standardRelation" : "=", | |
"standardType" : "Kii", | |
"standardValue" : "360", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1085189", | |
"pmid" : "http://identifiers.org/pubmed/3155552", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL131394", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kii", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 1.5, | |
"standardRelation" : "=", | |
"standardType" : "Kii", | |
"standardValue" : "1500", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_10994231", | |
"pmid" : "http://identifiers.org/pubmed/22917519", | |
"activityComment" : "Not Active", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL2071959", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2071012", | |
"publishedType" : "INH", | |
"standardType" : "Inhibition", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_10994232", | |
"pmid" : "http://identifiers.org/pubmed/22917519", | |
"activityComment" : "Not Active", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL2071959", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2071013", | |
"publishedType" : "INH", | |
"standardType" : "Inhibition", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1143574", | |
"pmid" : "http://identifiers.org/pubmed/8099976", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645403", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3144046", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl" : 4.7, | |
"publishedRelation" : "=", | |
"publishedType" : "Ki", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 20.0, | |
"standardRelation" : "=", | |
"standardType" : "Ki", | |
"standardValue" : "20000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1146157", | |
"pmid" : "http://identifiers.org/pubmed/8099976", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645404", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2368671", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl" : 8.96, | |
"publishedRelation" : "=", | |
"publishedType" : "Ki", | |
"publishedUnits" : "nM", | |
"chembl:publishedValue" : 1.1, | |
"standardRelation" : "=", | |
"standardType" : "Ki", | |
"standardValue" : "1.1", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1232998", | |
"pmid" : "http://identifiers.org/pubmed/7021832", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL316966", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Inhibition constant", | |
"publishedUnits" : "mM", | |
"chembl:publishedValue" : 0.78, | |
"standardRelation" : "=", | |
"standardType" : "Ki", | |
"standardValue" : "780000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1239563", | |
"pmid" : "http://identifiers.org/pubmed/7021832", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161259", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Inhibition constant", | |
"publishedUnits" : "mM", | |
"chembl:publishedValue" : 1.2, | |
"standardRelation" : "=", | |
"standardType" : "Ki", | |
"standardValue" : "1200000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1251220", | |
"pmid" : "http://identifiers.org/pubmed/7021832", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161257", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Inhibition constant", | |
"publishedUnits" : "mM", | |
"chembl:publishedValue" : 4.3, | |
"standardRelation" : "=", | |
"standardType" : "Ki", | |
"standardValue" : "4300000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1254796", | |
"pmid" : "http://identifiers.org/pubmed/7021832", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL752", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl" : 4.42, | |
"publishedRelation" : "=", | |
"publishedType" : "Inhibition constant", | |
"publishedUnits" : "mM", | |
"chembl:publishedValue" : 0.038, | |
"standardRelation" : "=", | |
"standardType" : "Ki", | |
"standardValue" : "38000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1256314", | |
"pmid" : "http://identifiers.org/pubmed/7021832", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL608749", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Inhibition constant", | |
"publishedUnits" : "mM", | |
"chembl:publishedValue" : 0.44, | |
"standardRelation" : "=", | |
"standardType" : "Ki", | |
"standardValue" : "440000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1256346", | |
"pmid" : "http://identifiers.org/pubmed/7021832", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL608163", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Inhibition constant", | |
"publishedUnits" : "mM", | |
"chembl:publishedValue" : 0.18, | |
"standardRelation" : "=", | |
"standardType" : "Ki", | |
"standardValue" : "180000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1257610", | |
"pmid" : "http://identifiers.org/pubmed/7021832", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161249", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Inhibition constant", | |
"publishedUnits" : "mM", | |
"chembl:publishedValue" : 4.9, | |
"standardRelation" : "=", | |
"standardType" : "Ki", | |
"standardValue" : "4900000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618787", | |
"pmid" : "http://identifiers.org/pubmed/321782", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL121999", | |
"publishedRelation" : "=", | |
"publishedType" : "log K", | |
"chembl:publishedValue" : -1.93, | |
"standardRelation" : "=", | |
"standardType" : "log K", | |
"standardValue" : "-1.93", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618788", | |
"pmid" : "http://identifiers.org/pubmed/321782", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3247924", | |
"publishedRelation" : "=", | |
"publishedType" : "log K", | |
"chembl:publishedValue" : -1.78, | |
"standardRelation" : "=", | |
"standardType" : "log K", | |
"standardValue" : "-1.78", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618789", | |
"pmid" : "http://identifiers.org/pubmed/321782", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL449635", | |
"publishedRelation" : "=", | |
"publishedType" : "log K", | |
"chembl:publishedValue" : -2.2, | |
"standardRelation" : "=", | |
"standardType" : "log K", | |
"standardValue" : "-2.2", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618790", | |
"pmid" : "http://identifiers.org/pubmed/321782", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL267373", | |
"publishedRelation" : "=", | |
"publishedType" : "log K", | |
"chembl:publishedValue" : -2.72, | |
"standardRelation" : "=", | |
"standardType" : "log K", | |
"standardValue" : "-2.72", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618791", | |
"pmid" : "http://identifiers.org/pubmed/321782", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3247925", | |
"publishedRelation" : "=", | |
"publishedType" : "log K", | |
"chembl:publishedValue" : -1.7, | |
"standardRelation" : "=", | |
"standardType" : "log K", | |
"standardValue" : "-1.7", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14677830", | |
"pmid" : "http://identifiers.org/pubmed/1246029", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3282425", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL125596", | |
"publishedRelation" : "=", | |
"publishedType" : "log(1/K)", | |
"chembl:publishedValue" : -2.6, | |
"standardRelation" : "=", | |
"standardType" : "log(1/K)", | |
"standardValue" : "-2.6", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14677832", | |
"pmid" : "http://identifiers.org/pubmed/1246029", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3282425", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1483601", | |
"publishedRelation" : "=", | |
"publishedType" : "log(1/K)", | |
"chembl:publishedValue" : -2.6, | |
"standardRelation" : "=", | |
"standardType" : "log(1/K)", | |
"standardValue" : "-2.6", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705973", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279516", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL15967", | |
"publishedRelation" : "=", | |
"publishedType" : "Activity", | |
"publishedUnits" : "10'5/M/s", | |
"chembl:publishedValue" : 3.0, | |
"standardRelation" : "=", | |
"standardType" : "Activity", | |
"standardValue" : "3", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705974", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL15967", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl" : 6.7, | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 0.2, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "200", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705975", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275944", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 125.0, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "125000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705976", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275945", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 150.0, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "150000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705977", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275947", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 170.0, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "170000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705978", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275948", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 200.0, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "200000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705979", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275949", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl" : 4.22, | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 60.0, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "60000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705980", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275950", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl" : 4.4, | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 40.0, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "40000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705981", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275951", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 5100.0, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "5100000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705982", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1308", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl" : 7.89, | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 0.013, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "13", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705983", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276272", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl" : 5.44, | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 3.6, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "3600", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705984", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276273", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl" : 5.57, | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 2.7, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "2700", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705985", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276274", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl" : 6.11, | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 0.77, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "770", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705986", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276275", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl" : 6.25, | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 0.56, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "560", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705987", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276276", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"chembl:pChembl" : 7.7, | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 0.02, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "20", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705988", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL128679", | |
"hasQUDT" : "http://www.openphacts.org/units/Nanomolar", | |
"publishedRelation" : "=", | |
"publishedType" : "Kd", | |
"publishedUnits" : "uM", | |
"chembl:publishedValue" : 6500.0, | |
"standardRelation" : "=", | |
"standardType" : "Kd", | |
"standardValue" : "6500000", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705989", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"activityComment" : "Active", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275944", | |
"publishedType" : "INH", | |
"standardType" : "Inhibition", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705990", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"activityComment" : "Active", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275945", | |
"publishedType" : "INH", | |
"standardType" : "Inhibition", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705991", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"activityComment" : "Active", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275946", | |
"publishedType" : "INH", | |
"standardType" : "Inhibition", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705992", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"activityComment" : "Active", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275947", | |
"publishedType" : "INH", | |
"standardType" : "Inhibition", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705993", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"activityComment" : "Active", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275948", | |
"publishedType" : "INH", | |
"standardType" : "Inhibition", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705994", | |
"pmid" : "http://identifiers.org/pubmed/219196", | |
"activityComment" : "Active", | |
"hasAssay" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"hasMolecule" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275949", | |
"publishedType" : "INH", | |
"standardType" : "Inhibition", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL2071959", | |
"description" : "Inhibition of FDH using formalin as substrate at 0.01 to 500 uM after 30 mins by fluorimetry", | |
"assayOrganismName" : "Homo sapiens", | |
"hasTarget" : "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL4116", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323", | |
"description" : "Inhibition of alcohol dehydrogenase (unknown origin) assessed as dissociation constant for the complex of enzyme and DPNH", | |
"assayOrganismName" : "Homo sapiens", | |
"hasTarget" : "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511", | |
"description" : "Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName" : "Equus caballus", | |
"hasTarget" : "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512", | |
"description" : "Competitive inhibition of horse liver alcohol dehydrogenase using ethanol as substrate by spectrophotometric titration in presence of 1 mM NAD+", | |
"assayOrganismName" : "Equus caballus", | |
"hasTarget" : "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279516", | |
"description" : "Reversible inhibition of horse liver alcohol dehydrogenase using ethanol as substrate by stopped-flow method in presence of 1 mM NAD+", | |
"assayOrganismName" : "Equus caballus", | |
"hasTarget" : "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3282425", | |
"description" : "Binding affinity to alcohol dehydrogenase (unknown origin)", | |
"assayOrganismName" : "Homo sapiens", | |
"hasTarget" : "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231", | |
"description" : "In vitro inhibitory constant against monkey liver alcohol dehydrogenase was determined", | |
"assayOrganismName" : "Cercopithecidae", | |
"hasTarget" : "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402", | |
"description" : "Inhibition constant was evaluated against horse liver alcohol dehydrogenase", | |
"assayOrganismName" : "Equus caballus", | |
"hasTarget" : "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645403", | |
"description" : "Inhibition of horse liver alcohol dehydrogenase enzyme by non-competitive inhibition", | |
"assayOrganismName" : "Equus caballus", | |
"hasTarget" : "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645404", | |
"description" : "Inhibition of horse liver alcohol dehydrogenase enzyme by Non-competitive inhibition", | |
"assayOrganismName" : "Equus caballus", | |
"hasTarget" : "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929", | |
"description" : "In vitro inhibitory constant against horse liver alcohol dehydrogenase was determined", | |
"assayOrganismName" : "Equus caballus", | |
"hasTarget" : "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161249", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1334349/rdf", "http://ops.rsc.org/OPS1334349", "http://www.conceptwiki.org/concept/index/c599ccbc-a2d7-4080-bf13-616b4491e28c", "http://www.conceptwiki.org/concept/c599ccbc-a2d7-4080-bf13-616b4491e28c" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161257", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1323453", "http://ops.rsc.org/OPS1323453/rdf", "http://www.conceptwiki.org/concept/ef06a35d-9b46-4fdc-8005-416e76935588", "http://www.conceptwiki.org/concept/index/ef06a35d-9b46-4fdc-8005-416e76935588" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161259", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://www.conceptwiki.org/concept/index/725f0c84-8667-4025-beb8-e92c10710482", "http://www.conceptwiki.org/concept/725f0c84-8667-4025-beb8-e92c10710482" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1207", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1752849", "http://ops.rsc.org/OPS1752849/rdf", "http://www.conceptwiki.org/concept/8f97c172-d98e-4991-9f45-8ccb26c1f2de", "http://www.conceptwiki.org/concept/index/8f97c172-d98e-4991-9f45-8ccb26c1f2de" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL121999", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1508947", "http://ops.rsc.org/OPS1508947/rdf", "http://www.conceptwiki.org/concept/index/038201a7-1637-489a-9664-63580e24599c", "http://www.conceptwiki.org/concept/038201a7-1637-489a-9664-63580e24599c" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL125596", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1501345/rdf", "http://ops.rsc.org/OPS1501345", "http://www.conceptwiki.org/concept/index/4798759b-c160-48d0-8b89-78865ea6bd09", "http://www.conceptwiki.org/concept/4798759b-c160-48d0-8b89-78865ea6bd09" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL128679", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1490108", "http://ops.rsc.org/OPS1490108/rdf", "http://www.conceptwiki.org/concept/1068f285-81f3-4a6e-9d14-a1d371c18a1f", "http://www.conceptwiki.org/concept/index/1068f285-81f3-4a6e-9d14-a1d371c18a1f" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1308", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS767517", "http://ops.rsc.org/OPS767517/rdf", "http://www.conceptwiki.org/concept/index/8dff382c-73a4-4574-8cd8-7822b14cd678", "http://www.conceptwiki.org/concept/8dff382c-73a4-4574-8cd8-7822b14cd678" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL131394", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1509162", "http://ops.rsc.org/OPS1509162/rdf", "http://www.conceptwiki.org/concept/index/bb3fb2b6-47a3-4a1c-9222-137beeb3a09d", "http://www.conceptwiki.org/concept/bb3fb2b6-47a3-4a1c-9222-137beeb3a09d" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1483601", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS902805/rdf", "http://ops.rsc.org/OPS902805", "http://www.conceptwiki.org/concept/index/d09d5eac-563e-490c-8a44-8c43e4c24574", "http://www.conceptwiki.org/concept/d09d5eac-563e-490c-8a44-8c43e4c24574" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL15967", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1357172", "http://ops.rsc.org/OPS1357172/rdf", "http://www.conceptwiki.org/concept/d1cf19d6-6d7a-492b-b7b8-20ca77d57842", "http://www.conceptwiki.org/concept/index/d1cf19d6-6d7a-492b-b7b8-20ca77d57842" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2071012", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS33170/rdf", "http://ops.rsc.org/OPS33170", "http://www.conceptwiki.org/concept/index/4c5c31d2-d399-4b64-8bad-56fd927a4703", "http://www.conceptwiki.org/concept/4c5c31d2-d399-4b64-8bad-56fd927a4703" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2071013", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS33175/rdf", "http://ops.rsc.org/OPS33175", "http://www.conceptwiki.org/concept/fb360819-66f4-4c40-8430-a1aaf257d211", "http://www.conceptwiki.org/concept/index/fb360819-66f4-4c40-8430-a1aaf257d211" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2368671", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL267373", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1670722", "http://ops.rsc.org/OPS1670722/rdf", "http://www.conceptwiki.org/concept/index/fcd38022-f391-460c-b7a7-0a2e3c63324e", "http://www.conceptwiki.org/concept/fcd38022-f391-460c-b7a7-0a2e3c63324e" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3144046", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL316966", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS782699", "http://ops.rsc.org/OPS782699/rdf", "http://www.conceptwiki.org/concept/index/9b3a8ddb-ce4a-47a3-b56f-701000ffbf8a", "http://www.conceptwiki.org/concept/9b3a8ddb-ce4a-47a3-b56f-701000ffbf8a" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3247924", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3247925", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275944", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275945", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275946", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275947", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275948", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275949", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275950", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275951", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276272", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276273", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276274", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276275", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276276", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL334894", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1749831/rdf", "http://ops.rsc.org/OPS1749831", "http://www.conceptwiki.org/concept/index/40a6b53b-c3d2-4784-a432-d085b9460d83", "http://www.conceptwiki.org/concept/40a6b53b-c3d2-4784-a432-d085b9460d83" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335060", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1749014/rdf", "http://ops.rsc.org/OPS1749014", "http://www.conceptwiki.org/concept/index/9fcf0be0-4add-42df-890f-a77c30628e62", "http://www.conceptwiki.org/concept/9fcf0be0-4add-42df-890f-a77c30628e62" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335234", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1749599/rdf", "http://ops.rsc.org/OPS1749599", "http://www.conceptwiki.org/concept/dfc59974-6a80-4288-8f0a-47fdde9c6e77", "http://www.conceptwiki.org/concept/index/dfc59974-6a80-4288-8f0a-47fdde9c6e77" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL449635", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1078882/rdf", "http://ops.rsc.org/OPS1078882", "http://www.conceptwiki.org/concept/index/0930fb01-3eaa-44b8-bb91-4ba71e40f22c", "http://www.conceptwiki.org/concept/0930fb01-3eaa-44b8-bb91-4ba71e40f22c" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL608163", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1285429/rdf", "http://ops.rsc.org/OPS1285429", "http://www.conceptwiki.org/concept/daee72c5-ca16-4e63-893f-4cc6b8fb78b1", "http://www.conceptwiki.org/concept/index/daee72c5-ca16-4e63-893f-4cc6b8fb78b1" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL608749", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS1337875/rdf", "http://ops.rsc.org/OPS1337875", "http://www.conceptwiki.org/concept/2fad1725-891b-4d3b-b093-f88ef9293337", "http://www.conceptwiki.org/concept/index/2fad1725-891b-4d3b-b093-f88ef9293337" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL752", | |
"inDataset" : "http://www.ebi.ac.uk/chembl", | |
"exactMatch" : [ "http://ops.rsc.org/OPS312171", "http://ops.rsc.org/OPS312171/rdf", "http://www.conceptwiki.org/concept/index/a9e18edd-8f4f-4537-b47f-d573120c1381", "http://www.conceptwiki.org/concept/a9e18edd-8f4f-4537-b47f-d573120c1381" ] | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668", | |
"@type" : "chembl:ProteinFamily", | |
"title" : "Alcohol dehydrogenase", | |
"hasTargetComponent" : [ "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434" ], | |
"organismName" : "Homo sapiens", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372", | |
"@type" : "chembl:ProteinFamily", | |
"title" : "Alcohol dehydrogenase", | |
"hasTargetComponent" : [ "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765" ], | |
"organismName" : "Equus caballus", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL4116", | |
"@type" : "chembl:SingleProtein", | |
"title" : "Alcohol dehydrogenase class III", | |
"hasTargetComponent" : "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"organismName" : "Homo sapiens", | |
"inDataset" : "http://www.ebi.ac.uk/chembl" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321", | |
"exactMatch" : "http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605", | |
"exactMatch" : "http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606", | |
"exactMatch" : "http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765", | |
"exactMatch" : "http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185", | |
"exactMatch" : "http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434", | |
"exactMatch" : "http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293", | |
"exactMatch" : "http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081", | |
"exactMatch" : "http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526" | |
}, { | |
"@id" : "http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959", | |
"exactMatch" : "http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38" | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Alcohol dehydrogenase 4 (Homo sapiens)" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/038201a7-1637-489a-9664-63580e24599c", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "4-chlorobenzamide" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/0930fb01-3eaa-44b8-bb91-4ba71e40f22c", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Anisamide" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Alcohol dehydrogenase E chain (Equus caballus)" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/1068f285-81f3-4a6e-9d14-a1d371c18a1f", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "3-Carboxy-1H-pyrazole" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/2fad1725-891b-4d3b-b093-f88ef9293337", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "[(2R,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methyl methyl hydrogen phosphate" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/40a6b53b-c3d2-4784-a432-d085b9460d83", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "3-hexyltetrahydrothiophene 1-oxide" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/4798759b-c160-48d0-8b89-78865ea6bd09", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "4-fluorobenzamide" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/4c5c31d2-d399-4b64-8bad-56fd927a4703", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "4-Hydroxy-5-methyl-1-phenyl-1H-pyrazole-3-carbaldehyde" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Alcohol dehydrogenase 1B (Homo sapiens)" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/725f0c84-8667-4025-beb8-e92c10710482", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "(2R,3R,4S)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)tetrahydrofuran-3-sulfonic acid" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Alcohol dehydrogenase S chain (Equus caballus)" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/8dff382c-73a4-4574-8cd8-7822b14cd678", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Fomepizole" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/8f97c172-d98e-4991-9f45-8ccb26c1f2de", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Tetrahydrothiophene 1-oxide" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/9b3a8ddb-ce4a-47a3-b56f-701000ffbf8a", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Adenosine cyclic 3',5'-monophosphate" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/9fcf0be0-4add-42df-890f-a77c30628e62", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "3-butylthiolane 1-oxide" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/a9e18edd-8f4f-4537-b47f-d573120c1381", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Adenosine monophosphate" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Alcohol dehydrogenase 6 (Homo sapiens)" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Alcohol dehydrogenase 1A (Homo sapiens)" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/bb3fb2b6-47a3-4a1c-9222-137beeb3a09d", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "3-phenyltetrahydrothiophene 1-oxide" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/c599ccbc-a2d7-4080-bf13-616b4491e28c", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "3-(6-aminopurin-9-yl)propane-1-sulfonic acid" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Alcohol dehydrogenase class-3 (Homo sapiens)" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/d09d5eac-563e-490c-8a44-8c43e4c24574", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "4-nitrobenzamide" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/d1cf19d6-6d7a-492b-b7b8-20ca77d57842", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Pyrazole" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/daee72c5-ca16-4e63-893f-4cc6b8fb78b1", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "5'-Deoxy-5'-sulfoadenosine" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/dfc59974-6a80-4288-8f0a-47fdde9c6e77", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "3-methyltetrahydrothiophene 1-oxide" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/ef06a35d-9b46-4fdc-8005-416e76935588", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "2-(6-aminopurin-9-yl)ethanesulfonic acid" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "Alcohol dehydrogenase 1C (Homo sapiens)" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/fb360819-66f4-4c40-8430-a1aaf257d211", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "1H-pyrazole-3,5-dicarboxylic acid, 4-hydroxy-, dimethyl ester" | |
} | |
}, { | |
"@id" : "http://www.conceptwiki.org/concept/fcd38022-f391-460c-b7a7-0a2e3c63324e", | |
"inDataset" : "http://www.conceptwiki.org", | |
"prefLabel" : { | |
"@language" : "en", | |
"@value" : "benzamide" | |
} | |
}, { | |
"@id" : "http://www.openphacts.org/units/Micromolar", | |
"prefLabel" : "uM" | |
}, { | |
"@id" : "http://www.openphacts.org/units/Nanomolar", | |
"prefLabel" : "nM" | |
} ], | |
"@context" : { | |
"rest" : { | |
"@id" : "http://www.w3.org/1999/02/22-rdf-syntax-ns#rest", | |
"@type" : "@id" | |
}, | |
"first" : { | |
"@id" : "http://www.w3.org/1999/02/22-rdf-syntax-ns#first", | |
"@type" : "@id" | |
}, | |
"inDataset" : { | |
"@id" : "http://rdfs.org/ns/void#inDataset", | |
"@type" : "@id" | |
}, | |
"exactMatch" : { | |
"@id" : "http://www.w3.org/2004/02/skos/core#exactMatch", | |
"@type" : "@id" | |
}, | |
"hasMolecule" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#hasMolecule", | |
"@type" : "@id" | |
}, | |
"hasAssay" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#hasAssay", | |
"@type" : "@id" | |
}, | |
"standardValue" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#standardValue", | |
"@type" : "http://www.w3.org/2001/XMLSchema#decimal" | |
}, | |
"publishedRelation" : "http://rdf.ebi.ac.uk/terms/chembl#publishedRelation", | |
"publishedValue" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#publishedValue", | |
"@type" : "http://www.w3.org/2001/XMLSchema#double" | |
}, | |
"pmid" : { | |
"@id" : "http://purl.org/ontology/bibo/pmid", | |
"@type" : "@id" | |
}, | |
"publishedUnits" : "http://rdf.ebi.ac.uk/terms/chembl#publishedUnits", | |
"standardType" : "http://rdf.ebi.ac.uk/terms/chembl#standardType", | |
"standardRelation" : "http://rdf.ebi.ac.uk/terms/chembl#standardRelation", | |
"publishedType" : "http://rdf.ebi.ac.uk/terms/chembl#publishedType", | |
"hasQUDT" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#hasQUDT", | |
"@type" : "@id" | |
}, | |
"prefLabel" : "http://www.w3.org/2004/02/skos/core#prefLabel", | |
"assayOrganismName" : "http://rdf.ebi.ac.uk/terms/chembl#assayOrganismName", | |
"hasTarget" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#hasTarget", | |
"@type" : "@id" | |
}, | |
"description" : "http://purl.org/dc/terms/description", | |
"pChembl" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#pChembl", | |
"@type" : "http://www.w3.org/2001/XMLSchema#double" | |
}, | |
"activityComment" : "http://rdf.ebi.ac.uk/terms/chembl#activityComment", | |
"molweight" : { | |
"@id" : "http://www.openphacts.org/api#molweight", | |
"@type" : "http://www.w3.org/2001/XMLSchema#double" | |
}, | |
"ro5_violations" : { | |
"@id" : "http://www.openphacts.org/api#ro5_violations", | |
"@type" : "http://www.w3.org/2001/XMLSchema#double" | |
}, | |
"inchikey" : "http://www.openphacts.org/api#inchikey", | |
"inchi" : "http://www.openphacts.org/api#inchi", | |
"smiles" : "http://www.openphacts.org/api#smiles", | |
"title" : "http://purl.org/dc/terms/title", | |
"organismName" : "http://rdf.ebi.ac.uk/terms/chembl#organismName", | |
"hasTargetComponent" : { | |
"@id" : "http://rdf.ebi.ac.uk/terms/chembl#hasTargetComponent", | |
"@type" : "@id" | |
}, | |
"isPartOf" : { | |
"@id" : "http://purl.org/dc/terms/isPartOf", | |
"@type" : "@id" | |
}, | |
"label" : "http://www.w3.org/2000/01/rdf-schema#label", | |
"items" : { | |
"@id" : "http://purl.org/linked-data/api/vocab#items", | |
"@type" : "@id" | |
}, | |
"startIndex" : { | |
"@id" : "http://a9.com/-/spec/opensearch/1.1/startIndex", | |
"@type" : "http://www.w3.org/2001/XMLSchema#integer" | |
}, | |
"modified" : { | |
"@id" : "http://purl.org/dc/terms/modified", | |
"@type" : "http://www.w3.org/2001/XMLSchema#dateTime" | |
}, | |
"extendedMetadataVersion" : { | |
"@id" : "http://purl.org/linked-data/api/vocab#extendedMetadataVersion", | |
"@type" : "@id" | |
}, | |
"itemsPerPage" : { | |
"@id" : "http://a9.com/-/spec/opensearch/1.1/itemsPerPage", | |
"@type" : "http://www.w3.org/2001/XMLSchema#integer" | |
}, | |
"next" : { | |
"@id" : "http://www.w3.org/1999/xhtml/vocab#next", | |
"@type" : "@id" | |
}, | |
"hasPart" : { | |
"@id" : "http://purl.org/dc/terms/hasPart", | |
"@type" : "@id" | |
}, | |
"linkPredicate" : { | |
"@id" : "http://rdfs.org/ns/void#linkPredicate", | |
"@type" : "@id" | |
}, | |
"activeLens" : "http://www.openphacts.org/api/activeLens", | |
"definition" : { | |
"@id" : "http://purl.org/linked-data/api/vocab#definition", | |
"@type" : "@id" | |
}, | |
"void" : "http://rdfs.org/ns/void#", | |
"dct" : "http://purl.org/dc/terms/", | |
"rdf" : "http://www.w3.org/1999/02/22-rdf-syntax-ns#", | |
"opensearch" : "http://a9.com/-/spec/opensearch/1.1/", | |
"skos" : "http://www.w3.org/2004/02/skos/core#", | |
"ns0" : "http://www.openphacts.org/api#", | |
"rdfs" : "http://www.w3.org/2000/01/rdf-schema#", | |
"bibo" : "http://purl.org/ontology/bibo/", | |
"msg0" : "http://www.openphacts.org/api/", | |
"linked-data" : "http://purl.org/linked-data/api/vocab#", | |
"chembl" : "http://rdf.ebi.ac.uk/terms/chembl#", | |
"xhtml" : "http://www.w3.org/1999/xhtml/vocab#" | |
} | |
} |
This file contains bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
@prefix rdf: <http://www.w3.org/1999/02/22-rdf-syntax-ns#> . | |
@prefix void: <http://rdfs.org/ns/void#> . | |
@prefix ns0: <http://www.openphacts.org/api#> . | |
@prefix skos: <http://www.w3.org/2004/02/skos/core#> . | |
@prefix chembl: <http://rdf.ebi.ac.uk/terms/chembl#> . | |
@prefix dct: <http://purl.org/dc/terms/> . | |
@prefix bibo: <http://purl.org/ontology/bibo/> . | |
@prefix linked-data: <http://purl.org/linked-data/api/vocab#> . | |
@prefix msg0: <http://www.openphacts.org/api/> . | |
@prefix rdfs: <http://www.w3.org/2000/01/rdf-schema#> . | |
@prefix xhtml: <http://www.w3.org/1999/xhtml/vocab#> . | |
@prefix opensearch: <http://a9.com/-/spec/opensearch/1.1/> . | |
<http://ops.rsc.org/OPS1078882> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "COC1=CC=C(C=C1)C(=O)N" ; | |
ns0:inchi "InChI=1S/C8H9NO2/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H2,9,10)" ; | |
ns0:inchikey "GUCPYIYFQVTFSI-UHFFFAOYSA-N" ; | |
ns0:ro5_violations "0.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "151.163"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://www.conceptwiki.org/concept/0930fb01-3eaa-44b8-bb91-4ba71e40f22c> skos:prefLabel "Anisamide"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/fb360819-66f4-4c40-8430-a1aaf257d211> skos:prefLabel "1H-pyrazole-3,5-dicarboxylic acid, 4-hydroxy-, dimethyl ester"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321> skos:exactMatch <http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46> . | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605> skos:exactMatch <http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a> . | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606> skos:exactMatch <http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b> . | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765> skos:exactMatch <http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2> . | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185> skos:exactMatch <http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff> . | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434> skos:exactMatch <http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c> . | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293> skos:exactMatch <http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2> . | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081> skos:exactMatch <http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526> . | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959> skos:exactMatch <http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38> . | |
<http://www.conceptwiki.org/concept/0245d6d0-ea6d-41ad-bb35-a84609c4fb46> skos:prefLabel "Alcohol dehydrogenase 4 (Homo sapiens)"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/0cf048a1-d0cf-4395-859d-ddcd2fa61f38> skos:prefLabel "Alcohol dehydrogenase E chain (Equus caballus)"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/23f88c06-99ef-4ca4-a46c-e586316a6bff> skos:prefLabel "Alcohol dehydrogenase class 4 mu/sigma chain (Homo sapiens)"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/6eeee05f-8788-4e0e-9944-22949d74c59a> skos:prefLabel "Alcohol dehydrogenase 1B (Homo sapiens)"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/791e2906-31c3-439e-80c0-4141ae08f1d2> skos:prefLabel "Alcohol dehydrogenase S chain (Equus caballus)"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/b22bf414-ad93-4bb6-9a57-3f7c768c2526> skos:prefLabel "Alcohol dehydrogenase 6 (Homo sapiens)"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/b25166ac-56e8-4b60-b2c6-8016e6eba8a2> skos:prefLabel "Alcohol dehydrogenase 1A (Homo sapiens)"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/c67bf65e-e660-42a2-84fa-5074413a355c> skos:prefLabel "Alcohol dehydrogenase class-3 (Homo sapiens)"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/f5bc9e82-6452-47e5-937f-3c4dea0c7f9b> skos:prefLabel "Alcohol dehydrogenase 1C (Homo sapiens)"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/8dff382c-73a4-4574-8cd8-7822b14cd678> skos:prefLabel "Fomepizole"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/9b3a8ddb-ce4a-47a3-b56f-701000ffbf8a> skos:prefLabel "Adenosine cyclic 3',5'-monophosphate"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/a9e18edd-8f4f-4537-b47f-d573120c1381> skos:prefLabel "Adenosine monophosphate"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/d1cf19d6-6d7a-492b-b7b8-20ca77d57842> skos:prefLabel "Pyrazole"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/fcd38022-f391-460c-b7a7-0a2e3c63324e> skos:prefLabel "benzamide"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://ops.rsc.org/OPS1357172> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "C1=CNN=C1" ; | |
ns0:inchi "InChI=1S/C3H4N2/c1-2-4-5-3-1/h1-3H,(H,4,5)" ; | |
ns0:inchikey "WTKZEGDFNFYCGP-UHFFFAOYSA-N" ; | |
ns0:ro5_violations "0.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "68.0773"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://ops.rsc.org/OPS1670722> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "C1=CC=C(C=C1)C(=O)N" ; | |
ns0:inchi "InChI=1S/C7H7NO/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9)" ; | |
ns0:inchikey "KXDAEFPNCMNJSK-UHFFFAOYSA-N" ; | |
ns0:ro5_violations "0.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "121.137"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://ops.rsc.org/OPS312171> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)N" ; | |
ns0:inchi "InChI=1S/C10H14N5O7P/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20)/t4-,6-,7-,10-/m1/s1" ; | |
ns0:inchikey "UDMBCSSLTHHNCD-KQYNXXCUSA-N" ; | |
ns0:ro5_violations "2.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "347.221"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://ops.rsc.org/OPS767517> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "CC1=CNN=C1" ; | |
ns0:inchi "InChI=1S/C4H6N2/c1-4-2-5-6-3-4/h2-3H,1H3,(H,5,6)" ; | |
ns0:inchikey "RIKMMFOAQPJVMX-UHFFFAOYSA-N" ; | |
ns0:ro5_violations "0.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "82.1038"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://ops.rsc.org/OPS782699> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "C1[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C(N=CN=C43)N)O)OP(=O)(O1)O" ; | |
ns0:inchi "InChI=1S/C10H12N5O6P/c11-8-5-9(13-2-12-8)15(3-14-5)10-6(16)7-4(20-10)1-19-22(17,18)21-7/h2-4,6-7,10,16H,1H2,(H,17,18)(H2,11,12,13)/t4-,6-,7-,10-/m1/s1" ; | |
ns0:inchikey "IVOMOUWHDPKRLL-KQYNXXCUSA-N" ; | |
ns0:molweight "329.206"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://www.conceptwiki.org/concept/2fad1725-891b-4d3b-b093-f88ef9293337> skos:prefLabel "[(2R,3S,4R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-tetrahydrofuran-2-yl]methyl methyl hydrogen phosphate"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/c599ccbc-a2d7-4080-bf13-616b4491e28c> skos:prefLabel "3-(6-aminopurin-9-yl)propane-1-sulfonic acid"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/ef06a35d-9b46-4fdc-8005-416e76935588> skos:prefLabel "2-(6-aminopurin-9-yl)ethanesulfonic acid"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://ops.rsc.org/OPS1323453> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "C1=NC(=C2C(=N1)N(C=N2)CCS(=O)(=O)O)N" ; | |
ns0:inchi "InChI=1S/C7H9N5O3S/c8-6-5-7(10-3-9-6)12(4-11-5)1-2-16(13,14)15/h3-4H,1-2H2,(H2,8,9,10)(H,13,14,15)" ; | |
ns0:inchikey "QVIVYTFFLSTWLW-UHFFFAOYSA-N" ; | |
ns0:ro5_violations "0.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "243.243"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://ops.rsc.org/OPS1334349> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "C1=NC(=C2C(=N1)N(C=N2)CCCS(=O)(=O)O)N" ; | |
ns0:inchi "InChI=1S/C8H11N5O3S/c9-7-6-8(11-4-10-7)13(5-12-6)2-1-3-17(14,15)16/h4-5H,1-3H2,(H2,9,10,11)(H,14,15,16)" ; | |
ns0:inchikey "VLHMGMJBEZFPKZ-UHFFFAOYSA-N" ; | |
ns0:ro5_violations "0.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "257.27"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://ops.rsc.org/OPS1337875> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "COP(=O)(O)OC[C@@H]1[C@H]([C@H](C(O1)N2C=NC3=C(N=CN=C32)N)O)O" ; | |
ns0:inchi "InChI=1S/C11H16N5O7P/c1-21-24(19,20)22-2-5-7(17)8(18)11(23-5)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H,19,20)(H2,12,13,14)/t5-,7-,8-,11?/m1/s1" ; | |
ns0:inchikey "OYQVPLDFZZKUTQ-YNJARDAQSA-N" ; | |
ns0:ro5_violations "2.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "361.248"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://www.conceptwiki.org/concept/d09d5eac-563e-490c-8a44-8c43e4c24574> skos:prefLabel "4-nitrobenzamide"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://ops.rsc.org/OPS902805> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "C1=CC(=CC=C1C(=O)N)[N+](=O)[O-]" ; | |
ns0:inchi "InChI=1S/C7H6N2O3/c8-7(10)5-1-3-6(4-2-5)9(11)12/h1-4H,(H2,8,10)" ; | |
ns0:inchikey "ZESWUEBPRPGMTP-UHFFFAOYSA-N" ; | |
ns0:ro5_violations "0.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "166.134"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://www.conceptwiki.org/concept/038201a7-1637-489a-9664-63580e24599c> skos:prefLabel "4-chlorobenzamide"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/1068f285-81f3-4a6e-9d14-a1d371c18a1f> skos:prefLabel "3-Carboxy-1H-pyrazole"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/4798759b-c160-48d0-8b89-78865ea6bd09> skos:prefLabel "4-fluorobenzamide"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/bb3fb2b6-47a3-4a1c-9222-137beeb3a09d> skos:prefLabel "3-phenyltetrahydrothiophene 1-oxide"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://ops.rsc.org/OPS1490108> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "C1=CNN=C1C(=O)O" ; | |
ns0:inchi "InChI=1S/C4H4N2O2/c7-4(8)3-1-2-5-6-3/h1-2H,(H,5,6)(H,7,8)" ; | |
ns0:inchikey "KOPFEFZSAMLEHK-UHFFFAOYSA-N" ; | |
ns0:ro5_violations "0.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "112.087"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://ops.rsc.org/OPS1501345> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "C1=CC(=CC=C1C(=O)N)F" ; | |
ns0:inchi "InChI=1S/C7H6FNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10)" ; | |
ns0:inchikey "VNDHYTGVCGVETQ-UHFFFAOYSA-N" ; | |
ns0:ro5_violations "0.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "139.127"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://ops.rsc.org/OPS1508947> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "C1=CC(=CC=C1C(=O)N)Cl" ; | |
ns0:inchi "InChI=1S/C7H6ClNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10)" ; | |
ns0:inchikey "BLNVISNJTIRAHF-UHFFFAOYSA-N" ; | |
ns0:ro5_violations "0.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "155.582"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://ops.rsc.org/OPS1509162> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "C1C[S+](CC1C2=CC=CC=C2)[O-]" ; | |
ns0:inchi "InChI=1S/C10H12OS/c11-12-7-6-10(8-12)9-4-2-1-3-5-9/h1-5,10H,6-8H2" ; | |
ns0:inchikey "BJEDAGITLDRWJW-UHFFFAOYSA-N" ; | |
ns0:molweight "180.267"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://www.conceptwiki.org/concept/daee72c5-ca16-4e63-893f-4cc6b8fb78b1> skos:prefLabel "5'-Deoxy-5'-sulfoadenosine"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://ops.rsc.org/OPS1285429> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "C1=NC(=C2C(=N1)N(C=N2)C3[C@@H]([C@@H]([C@H](O3)CS(=O)(=O)O)O)O)N" ; | |
ns0:inchi "InChI=1S/C10H13N5O6S/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(21-10)1-22(18,19)20/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H,18,19,20)/t4-,6-,7-,10?/m1/s1" ; | |
ns0:inchikey "HOZDBGKMRJWBEQ-VTHZCTBJSA-N" ; | |
ns0:ro5_violations "2.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "331.305"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://ops.rsc.org/OPS33170> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "CC1=C(C(=NN1C2=CC=CC=C2)C=O)O" ; | |
ns0:inchi "InChI=1S/C11H10N2O2/c1-8-11(15)10(7-14)12-13(8)9-5-3-2-4-6-9/h2-7,15H,1H3" ; | |
ns0:inchikey "PQWLFAAZJPOHMG-UHFFFAOYSA-N" ; | |
ns0:ro5_violations "0.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "202.209"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://ops.rsc.org/OPS33175> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "COC(=O)C1=C(C(=NN1)C(=O)OC)O" ; | |
ns0:inchi "InChI=1S/C7H8N2O5/c1-13-6(11)3-5(10)4(9-8-3)7(12)14-2/h10H,1-2H3,(H,8,9)" ; | |
ns0:inchikey "FBZGCRCSPADZHL-UHFFFAOYSA-N" ; | |
ns0:ro5_violations "0.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
ns0:molweight "200.149"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://www.conceptwiki.org/concept/4c5c31d2-d399-4b64-8bad-56fd927a4703> skos:prefLabel "4-Hydroxy-5-methyl-1-phenyl-1H-pyrazole-3-carbaldehyde"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/40a6b53b-c3d2-4784-a432-d085b9460d83> skos:prefLabel "3-hexyltetrahydrothiophene 1-oxide"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/8f97c172-d98e-4991-9f45-8ccb26c1f2de> skos:prefLabel "Tetrahydrothiophene 1-oxide"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/9fcf0be0-4add-42df-890f-a77c30628e62> skos:prefLabel "3-butylthiolane 1-oxide"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://www.conceptwiki.org/concept/dfc59974-6a80-4288-8f0a-47fdde9c6e77> skos:prefLabel "3-methyltetrahydrothiophene 1-oxide"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://ops.rsc.org/OPS1749014> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "CCCCC1CC[S+](C1)[O-]" ; | |
ns0:inchi "InChI=1S/C8H16OS/c1-2-3-4-8-5-6-10(9)7-8/h8H,2-7H2,1H3" ; | |
ns0:inchikey "QVVQIIIFHZDBDL-UHFFFAOYSA-N" ; | |
ns0:molweight "160.277"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://ops.rsc.org/OPS1749599> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "CC1CC[S+](C1)[O-]" ; | |
ns0:inchi "InChI=1S/C5H10OS/c1-5-2-3-7(6)4-5/h5H,2-4H2,1H3" ; | |
ns0:inchikey "GFDQTQWMQFSCRF-UHFFFAOYSA-N" ; | |
ns0:molweight "118.197"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://ops.rsc.org/OPS1749831> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "CCCCCCC1CC[S+](C1)[O-]" ; | |
ns0:inchi "InChI=1S/C10H20OS/c1-2-3-4-5-6-10-7-8-12(11)9-10/h10H,2-9H2,1H3" ; | |
ns0:inchikey "YIMUSBYGQWKFIX-UHFFFAOYSA-N" ; | |
ns0:molweight "188.33"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://ops.rsc.org/OPS1752849> void:inDataset <http://ops.rsc.org> ; | |
ns0:smiles "C1CC[S+](C1)[O-]" ; | |
ns0:inchi "InChI=1S/C4H8OS/c5-6-3-1-2-4-6/h1-4H2" ; | |
ns0:inchikey "ISXOBTBCNRIIQO-UHFFFAOYSA-N" ; | |
ns0:molweight "104.171"^^<http://www.w3.org/2001/XMLSchema#double> . | |
<http://www.conceptwiki.org/concept/725f0c84-8667-4025-beb8-e92c10710482> skos:prefLabel "(2R,3R,4S)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)tetrahydrofuran-3-sulfonic acid"@en ; | |
void:inDataset <http://www.conceptwiki.org> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL267373> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/fcd38022-f391-460c-b7a7-0a2e3c63324e> , | |
<http://www.conceptwiki.org/concept/index/fcd38022-f391-460c-b7a7-0a2e3c63324e> , | |
<http://ops.rsc.org/OPS1670722/rdf> , | |
<http://ops.rsc.org/OPS1670722> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL608163> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/index/daee72c5-ca16-4e63-893f-4cc6b8fb78b1> , | |
<http://www.conceptwiki.org/concept/daee72c5-ca16-4e63-893f-4cc6b8fb78b1> , | |
<http://ops.rsc.org/OPS1285429> , | |
<http://ops.rsc.org/OPS1285429/rdf> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL608749> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/index/2fad1725-891b-4d3b-b093-f88ef9293337> , | |
<http://www.conceptwiki.org/concept/2fad1725-891b-4d3b-b093-f88ef9293337> , | |
<http://ops.rsc.org/OPS1337875> , | |
<http://ops.rsc.org/OPS1337875/rdf> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276272> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275946> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2071012> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/4c5c31d2-d399-4b64-8bad-56fd927a4703> , | |
<http://www.conceptwiki.org/concept/index/4c5c31d2-d399-4b64-8bad-56fd927a4703> , | |
<http://ops.rsc.org/OPS33170> , | |
<http://ops.rsc.org/OPS33170/rdf> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2071013> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/index/fb360819-66f4-4c40-8430-a1aaf257d211> , | |
<http://www.conceptwiki.org/concept/fb360819-66f4-4c40-8430-a1aaf257d211> , | |
<http://ops.rsc.org/OPS33175> , | |
<http://ops.rsc.org/OPS33175/rdf> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL316966> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/9b3a8ddb-ce4a-47a3-b56f-701000ffbf8a> , | |
<http://www.conceptwiki.org/concept/index/9b3a8ddb-ce4a-47a3-b56f-701000ffbf8a> , | |
<http://ops.rsc.org/OPS782699/rdf> , | |
<http://ops.rsc.org/OPS782699> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL334894> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/40a6b53b-c3d2-4784-a432-d085b9460d83> , | |
<http://www.conceptwiki.org/concept/index/40a6b53b-c3d2-4784-a432-d085b9460d83> , | |
<http://ops.rsc.org/OPS1749831> , | |
<http://ops.rsc.org/OPS1749831/rdf> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335060> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/9fcf0be0-4add-42df-890f-a77c30628e62> , | |
<http://www.conceptwiki.org/concept/index/9fcf0be0-4add-42df-890f-a77c30628e62> , | |
<http://ops.rsc.org/OPS1749014> , | |
<http://ops.rsc.org/OPS1749014/rdf> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335234> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/index/dfc59974-6a80-4288-8f0a-47fdde9c6e77> , | |
<http://www.conceptwiki.org/concept/dfc59974-6a80-4288-8f0a-47fdde9c6e77> , | |
<http://ops.rsc.org/OPS1749599> , | |
<http://ops.rsc.org/OPS1749599/rdf> . | |
<http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668> rdf:type chembl:ProteinFamily ; | |
void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
chembl:hasTargetComponent <http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1605> , | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1606> , | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1321> , | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_3081> , | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2185> , | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_293> , | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434> ; | |
chembl:organismName "Homo sapiens" ; | |
dct:title "Alcohol dehydrogenase" . | |
<http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372> rdf:type chembl:ProteinFamily ; | |
void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
chembl:hasTargetComponent <http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_1765> , | |
<http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_959> ; | |
chembl:organismName "Equus caballus" ; | |
dct:title "Alcohol dehydrogenase" . | |
<http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL4116> rdf:type chembl:SingleProtein ; | |
void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
chembl:hasTargetComponent <http://rdf.ebi.ac.uk/resource/chembl/targetcomponent/CHEMBL_TC_2434> ; | |
chembl:organismName "Homo sapiens" ; | |
dct:title "Alcohol dehydrogenase class III" . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1069030> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/3155552> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kii" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "19.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kii" ; | |
chembl:standardValue "19000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1207> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1207> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/index/8f97c172-d98e-4991-9f45-8ccb26c1f2de> , | |
<http://www.conceptwiki.org/concept/8f97c172-d98e-4991-9f45-8ccb26c1f2de> , | |
<http://ops.rsc.org/OPS1752849/rdf> , | |
<http://ops.rsc.org/OPS1752849> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL121999> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/038201a7-1637-489a-9664-63580e24599c> , | |
<http://www.conceptwiki.org/concept/index/038201a7-1637-489a-9664-63580e24599c> , | |
<http://ops.rsc.org/OPS1508947/rdf> , | |
<http://ops.rsc.org/OPS1508947> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL125596> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/4798759b-c160-48d0-8b89-78865ea6bd09> , | |
<http://www.conceptwiki.org/concept/index/4798759b-c160-48d0-8b89-78865ea6bd09> , | |
<http://ops.rsc.org/OPS1501345> , | |
<http://ops.rsc.org/OPS1501345/rdf> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL128679> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/index/1068f285-81f3-4a6e-9d14-a1d371c18a1f> , | |
<http://www.conceptwiki.org/concept/1068f285-81f3-4a6e-9d14-a1d371c18a1f> , | |
<http://ops.rsc.org/OPS1490108/rdf> , | |
<http://ops.rsc.org/OPS1490108> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1308> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/8dff382c-73a4-4574-8cd8-7822b14cd678> , | |
<http://www.conceptwiki.org/concept/index/8dff382c-73a4-4574-8cd8-7822b14cd678> , | |
<http://ops.rsc.org/OPS767517/rdf> , | |
<http://ops.rsc.org/OPS767517> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL131394> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/bb3fb2b6-47a3-4a1c-9222-137beeb3a09d> , | |
<http://www.conceptwiki.org/concept/index/bb3fb2b6-47a3-4a1c-9222-137beeb3a09d> , | |
<http://ops.rsc.org/OPS1509162/rdf> , | |
<http://ops.rsc.org/OPS1509162> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1483601> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/d09d5eac-563e-490c-8a44-8c43e4c24574> , | |
<http://www.conceptwiki.org/concept/index/d09d5eac-563e-490c-8a44-8c43e4c24574> , | |
<http://ops.rsc.org/OPS902805> , | |
<http://ops.rsc.org/OPS902805/rdf> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL15967> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/index/d1cf19d6-6d7a-492b-b7b8-20ca77d57842> , | |
<http://www.conceptwiki.org/concept/d1cf19d6-6d7a-492b-b7b8-20ca77d57842> , | |
<http://ops.rsc.org/OPS1357172/rdf> , | |
<http://ops.rsc.org/OPS1357172> . | |
<http://www.openphacts.org/units/Micromolar> skos:prefLabel "uM" . | |
<http://www.openphacts.org/units/Nanomolar> skos:prefLabel "nM" . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1080739> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/3155552> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kii" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "0.19"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kii" ; | |
chembl:standardValue "190"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL334894> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276275> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161249> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/c599ccbc-a2d7-4080-bf13-616b4491e28c> , | |
<http://www.conceptwiki.org/concept/index/c599ccbc-a2d7-4080-bf13-616b4491e28c> , | |
<http://ops.rsc.org/OPS1334349> , | |
<http://ops.rsc.org/OPS1334349/rdf> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161257> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/index/ef06a35d-9b46-4fdc-8005-416e76935588> , | |
<http://www.conceptwiki.org/concept/ef06a35d-9b46-4fdc-8005-416e76935588> , | |
<http://ops.rsc.org/OPS1323453/rdf> , | |
<http://ops.rsc.org/OPS1323453> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1069031> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/3155552> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Micromolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kii" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "1600.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kii" ; | |
chembl:standardValue "1600"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1207> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1074838> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/3155552> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kii" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "2.3"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kii" ; | |
chembl:standardValue "2300"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335060> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1076071> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/3155552> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kii" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "460.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kii" ; | |
chembl:standardValue "460000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335234> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1080740> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/3155552> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kii" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "0.35"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kii" ; | |
chembl:standardValue "350"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL334894> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1085189> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/3155552> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kii" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "1.5"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kii" ; | |
chembl:standardValue "1500"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL131394> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1143574> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/8099976> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645403> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:pChembl "4.7"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Ki" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "20.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Ki" ; | |
chembl:standardValue "20000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3144046> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1146157> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/8099976> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645404> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:pChembl "8.96"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Ki" ; | |
chembl:publishedUnits "nM" ; | |
chembl:publishedValue "1.1"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Ki" ; | |
chembl:standardValue "1.1"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2368671> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1232998> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/7021832> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Inhibition constant" ; | |
chembl:publishedUnits "mM" ; | |
chembl:publishedValue "0.78"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Ki" ; | |
chembl:standardValue "780000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL316966> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1239563> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/7021832> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Inhibition constant" ; | |
chembl:publishedUnits "mM" ; | |
chembl:publishedValue "1.2"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Ki" ; | |
chembl:standardValue "1200000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161259> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1251220> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/7021832> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Inhibition constant" ; | |
chembl:publishedUnits "mM" ; | |
chembl:publishedValue "4.3"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Ki" ; | |
chembl:standardValue "4300000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161257> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1254796> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/7021832> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:pChembl "4.42"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Inhibition constant" ; | |
chembl:publishedUnits "mM" ; | |
chembl:publishedValue "0.038"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Ki" ; | |
chembl:standardValue "38000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL752> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1256314> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/7021832> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Inhibition constant" ; | |
chembl:publishedUnits "mM" ; | |
chembl:publishedValue "0.44"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Ki" ; | |
chembl:standardValue "440000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL608749> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1256346> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/7021832> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Inhibition constant" ; | |
chembl:publishedUnits "mM" ; | |
chembl:publishedValue "0.18"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Ki" ; | |
chembl:standardValue "180000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL608163> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1257610> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/7021832> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Inhibition constant" ; | |
chembl:publishedUnits "mM" ; | |
chembl:publishedValue "4.9"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Ki" ; | |
chembl:standardValue "4900000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161249> . | |
<http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645231> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
dct:description "In vitro inhibitory constant against monkey liver alcohol dehydrogenase was determined" ; | |
chembl:hasTarget <http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668> ; | |
chembl:assayOrganismName "Cercopithecidae" . | |
<http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645402> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
dct:description "Inhibition constant was evaluated against horse liver alcohol dehydrogenase" ; | |
chembl:hasTarget <http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372> ; | |
chembl:assayOrganismName "Equus caballus" . | |
<http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645403> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
dct:description "Inhibition of horse liver alcohol dehydrogenase enzyme by non-competitive inhibition" ; | |
chembl:hasTarget <http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372> ; | |
chembl:assayOrganismName "Equus caballus" . | |
<http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL645404> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
dct:description "Inhibition of horse liver alcohol dehydrogenase enzyme by Non-competitive inhibition" ; | |
chembl:hasTarget <http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372> ; | |
chembl:assayOrganismName "Equus caballus" . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL449635> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/0930fb01-3eaa-44b8-bb91-4ba71e40f22c> , | |
<http://www.conceptwiki.org/concept/index/0930fb01-3eaa-44b8-bb91-4ba71e40f22c> , | |
<http://ops.rsc.org/OPS1078882> , | |
<http://ops.rsc.org/OPS1078882/rdf> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL752> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/a9e18edd-8f4f-4537-b47f-d573120c1381> , | |
<http://www.conceptwiki.org/concept/index/a9e18edd-8f4f-4537-b47f-d573120c1381> , | |
<http://ops.rsc.org/OPS312171/rdf> , | |
<http://ops.rsc.org/OPS312171> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3247925> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275948> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275951> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1161259> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
skos:exactMatch <http://www.conceptwiki.org/concept/725f0c84-8667-4025-beb8-e92c10710482> , | |
<http://www.conceptwiki.org/concept/index/725f0c84-8667-4025-beb8-e92c10710482> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275949> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2368671> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275947> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276273> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276276> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1074837> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/3155552> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kii" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "0.63"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kii" ; | |
chembl:standardValue "630"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335060> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1076070> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/3155552> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kii" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "7.5"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kii" ; | |
chembl:standardValue "7500"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL335234> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1085188> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/3155552> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kii" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "0.36"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kii" ; | |
chembl:standardValue "360"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL131394> . | |
<http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL875929> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
dct:description "In vitro inhibitory constant against horse liver alcohol dehydrogenase was determined" ; | |
chembl:hasTarget <http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372> ; | |
chembl:assayOrganismName "Equus caballus" . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275944> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3144046> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3247924> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275945> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275950> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276274> void:inDataset <http://www.ebi.ac.uk/chembl> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14677830> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/1246029> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3282425> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "log(1/K)" ; | |
chembl:publishedValue "-2.6"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "log(1/K)" ; | |
chembl:standardValue "-2.6"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL125596> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14677832> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/1246029> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3282425> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "log(1/K)" ; | |
chembl:publishedValue "-2.6"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "log(1/K)" ; | |
chembl:standardValue "-2.6"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1483601> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705973> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279516> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Activity" ; | |
chembl:publishedUnits "10'5/M/s" ; | |
chembl:publishedValue "3.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Activity" ; | |
chembl:standardValue "3"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL15967> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705974> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:pChembl "6.7"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "0.2"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "200"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL15967> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705975> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "125.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "125000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275944> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705976> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "150.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "150000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275945> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705977> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "170.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "170000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275947> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705978> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "200.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "200000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275948> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705979> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:pChembl "4.22"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "60.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "60000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275949> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705980> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:pChembl "4.4"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "40.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "40000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275950> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705981> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "5100.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "5100000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275951> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705982> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:pChembl "7.89"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "0.013"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "13"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL1308> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705983> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:pChembl "5.44"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "3.6"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "3600"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276272> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705984> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:pChembl "5.57"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "2.7"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "2700"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276273> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705985> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:pChembl "6.11"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "0.77"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "770"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276274> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705986> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:pChembl "6.25"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "0.56"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "560"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276275> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705987> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:pChembl "7.7"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "0.02"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "20"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3276276> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705988> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> ; | |
chembl:hasQUDT <http://www.openphacts.org/units/Nanomolar> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "Kd" ; | |
chembl:publishedUnits "uM" ; | |
chembl:publishedValue "6500.0"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "Kd" ; | |
chembl:standardValue "6500000"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL128679> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705989> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512> ; | |
chembl:activityComment "Active" ; | |
chembl:publishedType "INH" ; | |
chembl:standardType "Inhibition" ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275944> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705990> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512> ; | |
chembl:activityComment "Active" ; | |
chembl:publishedType "INH" ; | |
chembl:standardType "Inhibition" ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275945> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705991> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512> ; | |
chembl:activityComment "Active" ; | |
chembl:publishedType "INH" ; | |
chembl:standardType "Inhibition" ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275946> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705992> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512> ; | |
chembl:activityComment "Active" ; | |
chembl:publishedType "INH" ; | |
chembl:standardType "Inhibition" ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275947> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705993> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512> ; | |
chembl:activityComment "Active" ; | |
chembl:publishedType "INH" ; | |
chembl:standardType "Inhibition" ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275948> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705994> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/219196> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512> ; | |
chembl:activityComment "Active" ; | |
chembl:publishedType "INH" ; | |
chembl:standardType "Inhibition" ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3275949> . | |
<http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279511> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
dct:description "Inhibition of horse liver alcohol dehydrogenase using ethanol as substrate assessed as dissociation constant by spectrophotometric titration in presence of 1 mM NAD+" ; | |
chembl:hasTarget <http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372> ; | |
chembl:assayOrganismName "Equus caballus" . | |
<http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279512> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
dct:description "Competitive inhibition of horse liver alcohol dehydrogenase using ethanol as substrate by spectrophotometric titration in presence of 1 mM NAD+" ; | |
chembl:hasTarget <http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372> ; | |
chembl:assayOrganismName "Equus caballus" . | |
<http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3279516> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
dct:description "Reversible inhibition of horse liver alcohol dehydrogenase using ethanol as substrate by stopped-flow method in presence of 1 mM NAD+" ; | |
chembl:hasTarget <http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2111372> ; | |
chembl:assayOrganismName "Equus caballus" . | |
<http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3282425> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
dct:description "Binding affinity to alcohol dehydrogenase (unknown origin)" ; | |
chembl:hasTarget <http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668> ; | |
chembl:assayOrganismName "Homo sapiens" . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618787> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/321782> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "log K" ; | |
chembl:publishedValue "-1.93"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "log K" ; | |
chembl:standardValue "-1.93"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL121999> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618788> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/321782> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "log K" ; | |
chembl:publishedValue "-1.78"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "log K" ; | |
chembl:standardValue "-1.78"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3247924> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618789> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/321782> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "log K" ; | |
chembl:publishedValue "-2.2"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "log K" ; | |
chembl:standardValue "-2.2"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL449635> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618790> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/321782> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "log K" ; | |
chembl:publishedValue "-2.72"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "log K" ; | |
chembl:standardValue "-2.72"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL267373> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618791> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/321782> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323> ; | |
chembl:publishedRelation "=" ; | |
chembl:publishedType "log K" ; | |
chembl:publishedValue "-1.7"^^<http://www.w3.org/2001/XMLSchema#double> ; | |
chembl:standardRelation "=" ; | |
chembl:standardType "log K" ; | |
chembl:standardValue "-1.7"^^<http://www.w3.org/2001/XMLSchema#decimal> ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL3247925> . | |
<http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL3257323> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
dct:description "Inhibition of alcohol dehydrogenase (unknown origin) assessed as dissociation constant for the complex of enzyme and DPNH" ; | |
chembl:hasTarget <http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL2096668> ; | |
chembl:assayOrganismName "Homo sapiens" . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_10994231> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/22917519> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL2071959> ; | |
chembl:activityComment "Not Active" ; | |
chembl:publishedType "INH" ; | |
chembl:standardType "Inhibition" ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2071012> . | |
<http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_10994232> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
bibo:pmid <http://identifiers.org/pubmed/22917519> ; | |
chembl:hasAssay <http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL2071959> ; | |
chembl:activityComment "Not Active" ; | |
chembl:publishedType "INH" ; | |
chembl:standardType "Inhibition" ; | |
chembl:hasMolecule <http://rdf.ebi.ac.uk/resource/chembl/molecule/CHEMBL2071013> . | |
<http://rdf.ebi.ac.uk/resource/chembl/assay/CHEMBL2071959> void:inDataset <http://www.ebi.ac.uk/chembl> ; | |
dct:description "Inhibition of FDH using formalin as substrate at 0.01 to 500 uM after 30 mins by fluorimetry" ; | |
chembl:hasTarget <http://rdf.ebi.ac.uk/resource/chembl/target/CHEMBL4116> ; | |
chembl:assayOrganismName "Homo sapiens" . | |
<http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50> linked-data:definition <http://ops2.few.vu.nl/api-config> ; | |
msg0:activeLens "Default" ; | |
void:linkPredicate <http://www.w3.org/2004/02/skos/core#exactMatch> ; | |
rdf:type linked-data:List ; | |
dct:hasPart <http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=1> . | |
<http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=1> rdf:type linked-data:Page ; | |
rdfs:label "Target Class Pharmacology: List " ; | |
dct:isPartOf <http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50> ; | |
xhtml:first <http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=1> ; | |
xhtml:next <http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_pageSize=50&_page=2> ; | |
opensearch:itemsPerPage "50"^^<http://www.w3.org/2001/XMLSchema#integer> ; | |
opensearch:startIndex "0"^^<http://www.w3.org/2001/XMLSchema#integer> ; | |
dct:modified "2015-04-30T13:59:57"^^<http://www.w3.org/2001/XMLSchema#dateTime> ; | |
linked-data:items _:itemsList ; | |
linked-data:extendedMetadataVersion <http://ops2.few.vu.nl/target/tree/pharmacology/pages?_format=ttl&app_key=ad4fca9111f258325e3ca50e7217dcbc&app_id=a409dcc9&uri=http%3A%2F%2Fpurl.uniprot.org%2Fenzyme%2F1.1.1.1&_page=1&_pageSize=50&_metadata=all%2Cviews%2Cformats%2Cexecution%2Cbindings%2Csite> . | |
_:itemsList rdf:type rdf:List ; | |
rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1069030> ; | |
rdf:rest _:itemsList1 . | |
_:itemsList1 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1069031> ; | |
rdf:rest _:itemsList2 . | |
_:itemsList2 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1074837> ; | |
rdf:rest _:itemsList3 . | |
_:itemsList3 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1074838> ; | |
rdf:rest _:itemsList4 . | |
_:itemsList4 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1076070> ; | |
rdf:rest _:itemsList5 . | |
_:itemsList5 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1076071> ; | |
rdf:rest _:itemsList6 . | |
_:itemsList6 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1080739> ; | |
rdf:rest _:itemsList7 . | |
_:itemsList7 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1080740> ; | |
rdf:rest _:itemsList8 . | |
_:itemsList8 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1085188> ; | |
rdf:rest _:itemsList9 . | |
_:itemsList9 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1085189> ; | |
rdf:rest _:itemsList10 . | |
_:itemsList10 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_10994231> ; | |
rdf:rest _:itemsList11 . | |
_:itemsList11 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_10994232> ; | |
rdf:rest _:itemsList12 . | |
_:itemsList12 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1143574> ; | |
rdf:rest _:itemsList13 . | |
_:itemsList13 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1146157> ; | |
rdf:rest _:itemsList14 . | |
_:itemsList14 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1232998> ; | |
rdf:rest _:itemsList15 . | |
_:itemsList15 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1239563> ; | |
rdf:rest _:itemsList16 . | |
_:itemsList16 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1251220> ; | |
rdf:rest _:itemsList17 . | |
_:itemsList17 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1254796> ; | |
rdf:rest _:itemsList18 . | |
_:itemsList18 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1256314> ; | |
rdf:rest _:itemsList19 . | |
_:itemsList19 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1256346> ; | |
rdf:rest _:itemsList20 . | |
_:itemsList20 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_1257610> ; | |
rdf:rest _:itemsList21 . | |
_:itemsList21 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618787> ; | |
rdf:rest _:itemsList22 . | |
_:itemsList22 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618788> ; | |
rdf:rest _:itemsList23 . | |
_:itemsList23 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618789> ; | |
rdf:rest _:itemsList24 . | |
_:itemsList24 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618790> ; | |
rdf:rest _:itemsList25 . | |
_:itemsList25 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14618791> ; | |
rdf:rest _:itemsList26 . | |
_:itemsList26 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14677830> ; | |
rdf:rest _:itemsList27 . | |
_:itemsList27 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14677832> ; | |
rdf:rest _:itemsList28 . | |
_:itemsList28 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705973> ; | |
rdf:rest _:itemsList29 . | |
_:itemsList29 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705974> ; | |
rdf:rest _:itemsList30 . | |
_:itemsList30 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705975> ; | |
rdf:rest _:itemsList31 . | |
_:itemsList31 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705976> ; | |
rdf:rest _:itemsList32 . | |
_:itemsList32 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705977> ; | |
rdf:rest _:itemsList33 . | |
_:itemsList33 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705978> ; | |
rdf:rest _:itemsList34 . | |
_:itemsList34 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705979> ; | |
rdf:rest _:itemsList35 . | |
_:itemsList35 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705980> ; | |
rdf:rest _:itemsList36 . | |
_:itemsList36 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705981> ; | |
rdf:rest _:itemsList37 . | |
_:itemsList37 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705982> ; | |
rdf:rest _:itemsList38 . | |
_:itemsList38 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705983> ; | |
rdf:rest _:itemsList39 . | |
_:itemsList39 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705984> ; | |
rdf:rest _:itemsList40 . | |
_:itemsList40 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705985> ; | |
rdf:rest _:itemsList41 . | |
_:itemsList41 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705986> ; | |
rdf:rest _:itemsList42 . | |
_:itemsList42 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705987> ; | |
rdf:rest _:itemsList43 . | |
_:itemsList43 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705988> ; | |
rdf:rest _:itemsList44 . | |
_:itemsList44 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705989> ; | |
rdf:rest _:itemsList45 . | |
_:itemsList45 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705990> ; | |
rdf:rest _:itemsList46 . | |
_:itemsList46 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705991> ; | |
rdf:rest _:itemsList47 . | |
_:itemsList47 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705992> ; | |
rdf:rest _:itemsList48 . | |
_:itemsList48 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705993> ; | |
rdf:rest _:itemsList49 . | |
_:itemsList49 rdf:first <http://rdf.ebi.ac.uk/resource/chembl/activity/CHEMBL_ACT_14705994> ; | |
rdf:rest <http://www.w3.org/1999/02/22-rdf-syntax-ns#nil> . |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment