|
// Unminified unity framework from Unity 2020.3.12f1 |
|
|
|
function unityFramework(Module) { |
|
var Module = typeof Module !== "undefined" ? Module : {}; |
|
var stackTraceReference = "(^|\\n)(\\s+at\\s+|)jsStackTrace(\\s+\\(|@)([^\\n]+):\\d+:\\d+(\\)|)(\\n|$)"; |
|
var stackTraceReferenceMatch = jsStackTrace().match(new RegExp(stackTraceReference)); |
|
if (stackTraceReferenceMatch) Module.stackTraceRegExp = new RegExp(stackTraceReference.replace("([^\\n]+)", stackTraceReferenceMatch[4].replace(/[\\^${}[\]().*+?|]/g, "\\$&")).replace("jsStackTrace", "[^\\n]+")); |
|
var abort = function (what) { |
|
if (ABORT) return; |
|
ABORT = true; |
|
EXITSTATUS = 1; |
|
if (typeof ENVIRONMENT_IS_PTHREAD !== "undefined" && ENVIRONMENT_IS_PTHREAD) console.error("Pthread aborting at " + new Error().stack); |
|
if (what !== undefined) { |
|
out(what); |
|
err(what); |
|
what = JSON.stringify(what); |
|
} else { |
|
what = ""; |
|
} |
|
var message = "abort(" + what + ") at " + stackTrace(); |
|
if (Module.abortHandler && Module.abortHandler(message)) return; |
|
throw message; |
|
}; |
|
if (typeof ENVIRONMENT_IS_PTHREAD === "undefined" || !ENVIRONMENT_IS_PTHREAD) { |
|
Module["preRun"].push(function () { |
|
var unityFileSystemInit = |
|
Module["unityFileSystemInit"] || |
|
function () { |
|
FS.mkdir("/idbfs"); |
|
FS.mount(IDBFS, {}, "/idbfs"); |
|
Module.addRunDependency("JS_FileSystem_Mount"); |
|
FS.syncfs(true, function (err) { |
|
if (err) console.log("IndexedDB is not available. Data will not persist in cache and PlayerPrefs will not be saved."); |
|
Module.removeRunDependency("JS_FileSystem_Mount"); |
|
}); |
|
}; |
|
unityFileSystemInit(); |
|
}); |
|
} |
|
Module["SetFullscreen"] = function (fullscreen) { |
|
if (typeof runtimeInitialized === "undefined" || !runtimeInitialized) { |
|
console.log("Runtime not initialized yet."); |
|
} else if (typeof JSEvents === "undefined") { |
|
console.log("Player not loaded yet."); |
|
} else { |
|
var tmp = JSEvents.canPerformEventHandlerRequests; |
|
JSEvents.canPerformEventHandlerRequests = function () { |
|
return 1; |
|
}; |
|
Module.ccall("SetFullscreen", null, ["number"], [fullscreen]); |
|
JSEvents.canPerformEventHandlerRequests = tmp; |
|
} |
|
}; |
|
var MediaDevices = []; |
|
if (typeof ENVIRONMENT_IS_PTHREAD === "undefined" || !ENVIRONMENT_IS_PTHREAD) { |
|
Module["preRun"].push(function () { |
|
var enumerateMediaDevices = function () { |
|
var getMedia = navigator.getUserMedia || navigator.webkitGetUserMedia || navigator.mozGetUserMedia || navigator.msGetUserMedia; |
|
if (!getMedia) return; |
|
function addDevice(label) { |
|
label = label ? label : "device #" + MediaDevices.length; |
|
var device = { deviceName: label, refCount: 0, video: null }; |
|
MediaDevices.push(device); |
|
} |
|
if (!navigator.mediaDevices || !navigator.mediaDevices.enumerateDevices) { |
|
if (typeof MediaStreamTrack == "undefined" || typeof MediaStreamTrack.getSources == "undefined") { |
|
console.log("Media Devices cannot be enumerated on this browser."); |
|
return; |
|
} |
|
function gotSources(sourceInfos) { |
|
for (var i = 0; i !== sourceInfos.length; ++i) { |
|
var sourceInfo = sourceInfos[i]; |
|
if (sourceInfo.kind === "video") addDevice(sourceInfo.label); |
|
} |
|
} |
|
MediaStreamTrack.getSources(gotSources); |
|
} |
|
navigator.mediaDevices |
|
.enumerateDevices() |
|
.then(function (devices) { |
|
devices.forEach(function (device) { |
|
if (device.kind == "videoinput") addDevice(device.label); |
|
}); |
|
}) |
|
.catch(function (err) { |
|
console.log(err.name + ": " + error.message); |
|
}); |
|
}; |
|
enumerateMediaDevices(); |
|
}); |
|
} |
|
function SendMessage(gameObject, func, param) { |
|
if (param === undefined) Module.ccall("SendMessage", null, ["string", "string"], [gameObject, func]); |
|
else if (typeof param === "string") Module.ccall("SendMessageString", null, ["string", "string", "string"], [gameObject, func, param]); |
|
else if (typeof param === "number") Module.ccall("SendMessageFloat", null, ["string", "string", "number"], [gameObject, func, param]); |
|
else throw "" + param + " is does not have a type which is supported by SendMessage."; |
|
} |
|
Module["SendMessage"] = SendMessage; |
|
var moduleOverrides = {}; |
|
var key; |
|
for (key in Module) { |
|
if (Module.hasOwnProperty(key)) { |
|
moduleOverrides[key] = Module[key]; |
|
} |
|
} |
|
Module["arguments"] = []; |
|
Module["thisProgram"] = "./this.program"; |
|
Module["quit"] = function (status, toThrow) { |
|
throw toThrow; |
|
}; |
|
Module["preRun"] = []; |
|
Module["postRun"] = []; |
|
var ENVIRONMENT_IS_WEB = false; |
|
var ENVIRONMENT_IS_WORKER = false; |
|
var ENVIRONMENT_IS_NODE = false; |
|
var ENVIRONMENT_IS_SHELL = false; |
|
ENVIRONMENT_IS_WEB = typeof window === "object"; |
|
ENVIRONMENT_IS_WORKER = typeof importScripts === "function"; |
|
ENVIRONMENT_IS_NODE = typeof process === "object" && typeof require === "function" && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER; |
|
ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER; |
|
var scriptDirectory = ""; |
|
function locateFile(path) { |
|
if (Module["locateFile"]) { |
|
return Module["locateFile"](path, scriptDirectory); |
|
} else { |
|
return scriptDirectory + path; |
|
} |
|
} |
|
if (ENVIRONMENT_IS_NODE) { |
|
scriptDirectory = __dirname + "/"; |
|
var nodeFS; |
|
var nodePath; |
|
Module["read"] = function shell_read(filename, binary) { |
|
var ret; |
|
if (!nodeFS) nodeFS = require("fs"); |
|
if (!nodePath) nodePath = require("path"); |
|
filename = nodePath["normalize"](filename); |
|
ret = nodeFS["readFileSync"](filename); |
|
return binary ? ret : ret.toString(); |
|
}; |
|
Module["readBinary"] = function readBinary(filename) { |
|
var ret = Module["read"](filename, true); |
|
if (!ret.buffer) { |
|
ret = new Uint8Array(ret); |
|
} |
|
assert(ret.buffer); |
|
return ret; |
|
}; |
|
if (process["argv"].length > 1) { |
|
Module["thisProgram"] = process["argv"][1].replace(/\\/g, "/"); |
|
} |
|
Module["arguments"] = process["argv"].slice(2); |
|
if (typeof module !== "undefined") { |
|
module["exports"] = Module; |
|
} |
|
process["on"]("uncaughtException", function (ex) { |
|
if (!(ex instanceof ExitStatus)) { |
|
throw ex; |
|
} |
|
}); |
|
process["on"]("unhandledRejection", function (reason, p) { |
|
process["exit"](1); |
|
}); |
|
Module["quit"] = function (status) { |
|
process["exit"](status); |
|
}; |
|
Module["inspect"] = function () { |
|
return "[Emscripten Module object]"; |
|
}; |
|
} else if (ENVIRONMENT_IS_SHELL) { |
|
if (typeof read != "undefined") { |
|
Module["read"] = function shell_read(f) { |
|
return read(f); |
|
}; |
|
} |
|
Module["readBinary"] = function readBinary(f) { |
|
var data; |
|
if (typeof readbuffer === "function") { |
|
return new Uint8Array(readbuffer(f)); |
|
} |
|
data = read(f, "binary"); |
|
assert(typeof data === "object"); |
|
return data; |
|
}; |
|
if (typeof scriptArgs != "undefined") { |
|
Module["arguments"] = scriptArgs; |
|
} else if (typeof arguments != "undefined") { |
|
Module["arguments"] = arguments; |
|
} |
|
if (typeof quit === "function") { |
|
Module["quit"] = function (status) { |
|
quit(status); |
|
}; |
|
} |
|
} else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { |
|
if (ENVIRONMENT_IS_WEB) { |
|
if (document.currentScript) { |
|
scriptDirectory = document.currentScript.src; |
|
} |
|
} else { |
|
scriptDirectory = self.location.href; |
|
} |
|
if (scriptDirectory.indexOf("blob:") !== 0) { |
|
scriptDirectory = scriptDirectory.split("/").slice(0, -1).join("/") + "/"; |
|
} else { |
|
scriptDirectory = ""; |
|
} |
|
Module["read"] = function shell_read(url) { |
|
var xhr = new XMLHttpRequest(); |
|
xhr.open("GET", url, false); |
|
xhr.send(null); |
|
return xhr.responseText; |
|
}; |
|
if (ENVIRONMENT_IS_WORKER) { |
|
Module["readBinary"] = function readBinary(url) { |
|
var xhr = new XMLHttpRequest(); |
|
xhr.open("GET", url, false); |
|
xhr.responseType = "arraybuffer"; |
|
xhr.send(null); |
|
return new Uint8Array(xhr.response); |
|
}; |
|
} |
|
Module["readAsync"] = function readAsync(url, onload, onerror) { |
|
var xhr = new XMLHttpRequest(); |
|
xhr.open("GET", url, true); |
|
xhr.responseType = "arraybuffer"; |
|
xhr.onload = function xhr_onload() { |
|
if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { |
|
onload(xhr.response); |
|
return; |
|
} |
|
onerror(); |
|
}; |
|
xhr.onerror = onerror; |
|
xhr.send(null); |
|
}; |
|
Module["setWindowTitle"] = function (title) { |
|
document.title = title; |
|
}; |
|
} else { |
|
} |
|
var out = Module["print"] || (typeof console !== "undefined" ? console.log.bind(console) : typeof print !== "undefined" ? print : null); |
|
var err = Module["printErr"] || (typeof printErr !== "undefined" ? printErr : (typeof console !== "undefined" && console.warn.bind(console)) || out); |
|
for (key in moduleOverrides) { |
|
if (moduleOverrides.hasOwnProperty(key)) { |
|
Module[key] = moduleOverrides[key]; |
|
} |
|
} |
|
moduleOverrides = undefined; |
|
var STACK_ALIGN = 16; |
|
function staticAlloc(size) { |
|
var ret = STATICTOP; |
|
STATICTOP = (STATICTOP + size + 15) & -16; |
|
return ret; |
|
} |
|
function dynamicAlloc(size) { |
|
var ret = HEAP32[DYNAMICTOP_PTR >> 2]; |
|
var end = (ret + size + 15) & -16; |
|
HEAP32[DYNAMICTOP_PTR >> 2] = end; |
|
if (end >= TOTAL_MEMORY) { |
|
var success = enlargeMemory(); |
|
if (!success) { |
|
HEAP32[DYNAMICTOP_PTR >> 2] = ret; |
|
return 0; |
|
} |
|
} |
|
return ret; |
|
} |
|
function alignMemory(size, factor) { |
|
if (!factor) factor = STACK_ALIGN; |
|
var ret = (size = Math.ceil(size / factor) * factor); |
|
return ret; |
|
} |
|
function getNativeTypeSize(type) { |
|
switch (type) { |
|
case "i1": |
|
case "i8": |
|
return 1; |
|
case "i16": |
|
return 2; |
|
case "i32": |
|
return 4; |
|
case "i64": |
|
return 8; |
|
case "float": |
|
return 4; |
|
case "double": |
|
return 8; |
|
default: { |
|
if (type[type.length - 1] === "*") { |
|
return 4; |
|
} else if (type[0] === "i") { |
|
var bits = parseInt(type.substr(1)); |
|
assert(bits % 8 === 0); |
|
return bits / 8; |
|
} else { |
|
return 0; |
|
} |
|
} |
|
} |
|
} |
|
function warnOnce(text) { |
|
if (!warnOnce.shown) warnOnce.shown = {}; |
|
if (!warnOnce.shown[text]) { |
|
warnOnce.shown[text] = 1; |
|
err(text); |
|
} |
|
} |
|
var asm2wasmImports = { |
|
"f64-rem": function (x, y) { |
|
return x % y; |
|
}, |
|
debugger: function () { |
|
debugger; |
|
}, |
|
}; |
|
var jsCallStartIndex = 1; |
|
var functionPointers = new Array(0); |
|
function addFunction(func, sig) { |
|
var base = 0; |
|
for (var i = base; i < base + 0; i++) { |
|
if (!functionPointers[i]) { |
|
functionPointers[i] = func; |
|
return jsCallStartIndex + i; |
|
} |
|
} |
|
throw "Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS."; |
|
} |
|
var funcWrappers = {}; |
|
function getFuncWrapper(func, sig) { |
|
if (!func) return; |
|
assert(sig); |
|
if (!funcWrappers[sig]) { |
|
funcWrappers[sig] = {}; |
|
} |
|
var sigCache = funcWrappers[sig]; |
|
if (!sigCache[func]) { |
|
if (sig.length === 1) { |
|
sigCache[func] = function dynCall_wrapper() { |
|
return dynCall(sig, func); |
|
}; |
|
} else if (sig.length === 2) { |
|
sigCache[func] = function dynCall_wrapper(arg) { |
|
return dynCall(sig, func, [arg]); |
|
}; |
|
} else { |
|
sigCache[func] = function dynCall_wrapper() { |
|
return dynCall(sig, func, Array.prototype.slice.call(arguments)); |
|
}; |
|
} |
|
} |
|
return sigCache[func]; |
|
} |
|
function makeBigInt(low, high, unsigned) { |
|
return unsigned ? +(low >>> 0) + +(high >>> 0) * 4294967296 : +(low >>> 0) + +(high | 0) * 4294967296; |
|
} |
|
function dynCall(sig, ptr, args) { |
|
if (args && args.length) { |
|
return Module["dynCall_" + sig].apply(null, [ptr].concat(args)); |
|
} else { |
|
return Module["dynCall_" + sig].call(null, ptr); |
|
} |
|
} |
|
var GLOBAL_BASE = 1024; |
|
var ABORT = 0; |
|
var EXITSTATUS = 0; |
|
function assert(condition, text) { |
|
if (!condition) { |
|
abort("Assertion failed: " + text); |
|
} |
|
} |
|
function getCFunc(ident) { |
|
var func = Module["_" + ident]; |
|
assert(func, "Cannot call unknown function " + ident + ", make sure it is exported"); |
|
return func; |
|
} |
|
var JSfuncs = { |
|
stackSave: function () { |
|
stackSave(); |
|
}, |
|
stackRestore: function () { |
|
stackRestore(); |
|
}, |
|
arrayToC: function (arr) { |
|
var ret = stackAlloc(arr.length); |
|
writeArrayToMemory(arr, ret); |
|
return ret; |
|
}, |
|
stringToC: function (str) { |
|
var ret = 0; |
|
if (str !== null && str !== undefined && str !== 0) { |
|
var len = (str.length << 2) + 1; |
|
ret = stackAlloc(len); |
|
stringToUTF8(str, ret, len); |
|
} |
|
return ret; |
|
}, |
|
}; |
|
var toC = { string: JSfuncs["stringToC"], array: JSfuncs["arrayToC"] }; |
|
function ccall(ident, returnType, argTypes, args, opts) { |
|
function convertReturnValue(ret) { |
|
if (returnType === "string") return Pointer_stringify(ret); |
|
if (returnType === "boolean") return Boolean(ret); |
|
return ret; |
|
} |
|
var func = getCFunc(ident); |
|
var cArgs = []; |
|
var stack = 0; |
|
if (args) { |
|
for (var i = 0; i < args.length; i++) { |
|
var converter = toC[argTypes[i]]; |
|
if (converter) { |
|
if (stack === 0) stack = stackSave(); |
|
cArgs[i] = converter(args[i]); |
|
} else { |
|
cArgs[i] = args[i]; |
|
} |
|
} |
|
} |
|
var ret = func.apply(null, cArgs); |
|
ret = convertReturnValue(ret); |
|
if (stack !== 0) stackRestore(stack); |
|
return ret; |
|
} |
|
function cwrap(ident, returnType, argTypes, opts) { |
|
argTypes = argTypes || []; |
|
var numericArgs = argTypes.every(function (type) { |
|
return type === "number"; |
|
}); |
|
var numericRet = returnType !== "string"; |
|
if (numericRet && numericArgs && !opts) { |
|
return getCFunc(ident); |
|
} |
|
return function () { |
|
return ccall(ident, returnType, argTypes, arguments, opts); |
|
}; |
|
} |
|
function setValue(ptr, value, type, noSafe) { |
|
type = type || "i8"; |
|
if (type.charAt(type.length - 1) === "*") type = "i32"; |
|
switch (type) { |
|
case "i1": |
|
HEAP8[ptr >> 0] = value; |
|
break; |
|
case "i8": |
|
HEAP8[ptr >> 0] = value; |
|
break; |
|
case "i16": |
|
HEAP16[ptr >> 1] = value; |
|
break; |
|
case "i32": |
|
HEAP32[ptr >> 2] = value; |
|
break; |
|
case "i64": |
|
(tempI64 = [ |
|
value >>> 0, |
|
((tempDouble = value), +Math_abs(tempDouble) >= 1 ? (tempDouble > 0 ? (Math_min(+Math_floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math_ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0) : 0), |
|
]), |
|
(HEAP32[ptr >> 2] = tempI64[0]), |
|
(HEAP32[(ptr + 4) >> 2] = tempI64[1]); |
|
break; |
|
case "float": |
|
HEAPF32[ptr >> 2] = value; |
|
break; |
|
case "double": |
|
HEAPF64[ptr >> 3] = value; |
|
break; |
|
default: |
|
abort("invalid type for setValue: " + type); |
|
} |
|
} |
|
var ALLOC_NORMAL = 0; |
|
var ALLOC_STATIC = 2; |
|
var ALLOC_NONE = 4; |
|
function allocate(slab, types, allocator, ptr) { |
|
var zeroinit, size; |
|
if (typeof slab === "number") { |
|
zeroinit = true; |
|
size = slab; |
|
} else { |
|
zeroinit = false; |
|
size = slab.length; |
|
} |
|
var singleType = typeof types === "string" ? types : null; |
|
var ret; |
|
if (allocator == ALLOC_NONE) { |
|
ret = ptr; |
|
} else { |
|
ret = [typeof _malloc === "function" ? _malloc : staticAlloc, stackAlloc, staticAlloc, dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length)); |
|
} |
|
if (zeroinit) { |
|
var stop; |
|
ptr = ret; |
|
assert((ret & 3) == 0); |
|
stop = ret + (size & ~3); |
|
for (; ptr < stop; ptr += 4) { |
|
HEAP32[ptr >> 2] = 0; |
|
} |
|
stop = ret + size; |
|
while (ptr < stop) { |
|
HEAP8[ptr++ >> 0] = 0; |
|
} |
|
return ret; |
|
} |
|
if (singleType === "i8") { |
|
if (slab.subarray || slab.slice) { |
|
HEAPU8.set(slab, ret); |
|
} else { |
|
HEAPU8.set(new Uint8Array(slab), ret); |
|
} |
|
return ret; |
|
} |
|
var i = 0, |
|
type, |
|
typeSize, |
|
previousType; |
|
while (i < size) { |
|
var curr = slab[i]; |
|
type = singleType || types[i]; |
|
if (type === 0) { |
|
i++; |
|
continue; |
|
} |
|
if (type == "i64") type = "i32"; |
|
setValue(ret + i, curr, type); |
|
if (previousType !== type) { |
|
typeSize = getNativeTypeSize(type); |
|
previousType = type; |
|
} |
|
i += typeSize; |
|
} |
|
return ret; |
|
} |
|
function getMemory(size) { |
|
if (!staticSealed) return staticAlloc(size); |
|
if (!runtimeInitialized) return dynamicAlloc(size); |
|
return _malloc(size); |
|
} |
|
function Pointer_stringify(ptr, length) { |
|
if (length === 0 || !ptr) return ""; |
|
var hasUtf = 0; |
|
var t; |
|
var i = 0; |
|
while (1) { |
|
t = HEAPU8[(ptr + i) >> 0]; |
|
hasUtf |= t; |
|
if (t == 0 && !length) break; |
|
i++; |
|
if (length && i == length) break; |
|
} |
|
if (!length) length = i; |
|
var ret = ""; |
|
if (hasUtf < 128) { |
|
var MAX_CHUNK = 1024; |
|
var curr; |
|
while (length > 0) { |
|
curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK))); |
|
ret = ret ? ret + curr : curr; |
|
ptr += MAX_CHUNK; |
|
length -= MAX_CHUNK; |
|
} |
|
return ret; |
|
} |
|
return UTF8ToString(ptr); |
|
} |
|
var UTF8Decoder = typeof TextDecoder !== "undefined" ? new TextDecoder("utf8") : undefined; |
|
function UTF8ArrayToString(u8Array, idx) { |
|
var endPtr = idx; |
|
while (u8Array[endPtr]) ++endPtr; |
|
if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) { |
|
return UTF8Decoder.decode(u8Array.subarray(idx, endPtr)); |
|
} else { |
|
var u0, u1, u2, u3, u4, u5; |
|
var str = ""; |
|
while (1) { |
|
u0 = u8Array[idx++]; |
|
if (!u0) return str; |
|
if (!(u0 & 128)) { |
|
str += String.fromCharCode(u0); |
|
continue; |
|
} |
|
u1 = u8Array[idx++] & 63; |
|
if ((u0 & 224) == 192) { |
|
str += String.fromCharCode(((u0 & 31) << 6) | u1); |
|
continue; |
|
} |
|
u2 = u8Array[idx++] & 63; |
|
if ((u0 & 240) == 224) { |
|
u0 = ((u0 & 15) << 12) | (u1 << 6) | u2; |
|
} else { |
|
u3 = u8Array[idx++] & 63; |
|
if ((u0 & 248) == 240) { |
|
u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3; |
|
} else { |
|
u4 = u8Array[idx++] & 63; |
|
if ((u0 & 252) == 248) { |
|
u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4; |
|
} else { |
|
u5 = u8Array[idx++] & 63; |
|
u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5; |
|
} |
|
} |
|
} |
|
if (u0 < 65536) { |
|
str += String.fromCharCode(u0); |
|
} else { |
|
var ch = u0 - 65536; |
|
str += String.fromCharCode(55296 | (ch >> 10), 56320 | (ch & 1023)); |
|
} |
|
} |
|
} |
|
} |
|
function UTF8ToString(ptr) { |
|
return UTF8ArrayToString(HEAPU8, ptr); |
|
} |
|
function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) { |
|
if (!(maxBytesToWrite > 0)) return 0; |
|
var startIdx = outIdx; |
|
var endIdx = outIdx + maxBytesToWrite - 1; |
|
for (var i = 0; i < str.length; ++i) { |
|
var u = str.charCodeAt(i); |
|
if (u >= 55296 && u <= 57343) { |
|
var u1 = str.charCodeAt(++i); |
|
u = (65536 + ((u & 1023) << 10)) | (u1 & 1023); |
|
} |
|
if (u <= 127) { |
|
if (outIdx >= endIdx) break; |
|
outU8Array[outIdx++] = u; |
|
} else if (u <= 2047) { |
|
if (outIdx + 1 >= endIdx) break; |
|
outU8Array[outIdx++] = 192 | (u >> 6); |
|
outU8Array[outIdx++] = 128 | (u & 63); |
|
} else if (u <= 65535) { |
|
if (outIdx + 2 >= endIdx) break; |
|
outU8Array[outIdx++] = 224 | (u >> 12); |
|
outU8Array[outIdx++] = 128 | ((u >> 6) & 63); |
|
outU8Array[outIdx++] = 128 | (u & 63); |
|
} else if (u <= 2097151) { |
|
if (outIdx + 3 >= endIdx) break; |
|
outU8Array[outIdx++] = 240 | (u >> 18); |
|
outU8Array[outIdx++] = 128 | ((u >> 12) & 63); |
|
outU8Array[outIdx++] = 128 | ((u >> 6) & 63); |
|
outU8Array[outIdx++] = 128 | (u & 63); |
|
} else if (u <= 67108863) { |
|
if (outIdx + 4 >= endIdx) break; |
|
outU8Array[outIdx++] = 248 | (u >> 24); |
|
outU8Array[outIdx++] = 128 | ((u >> 18) & 63); |
|
outU8Array[outIdx++] = 128 | ((u >> 12) & 63); |
|
outU8Array[outIdx++] = 128 | ((u >> 6) & 63); |
|
outU8Array[outIdx++] = 128 | (u & 63); |
|
} else { |
|
if (outIdx + 5 >= endIdx) break; |
|
outU8Array[outIdx++] = 252 | (u >> 30); |
|
outU8Array[outIdx++] = 128 | ((u >> 24) & 63); |
|
outU8Array[outIdx++] = 128 | ((u >> 18) & 63); |
|
outU8Array[outIdx++] = 128 | ((u >> 12) & 63); |
|
outU8Array[outIdx++] = 128 | ((u >> 6) & 63); |
|
outU8Array[outIdx++] = 128 | (u & 63); |
|
} |
|
} |
|
outU8Array[outIdx] = 0; |
|
return outIdx - startIdx; |
|
} |
|
function stringToUTF8(str, outPtr, maxBytesToWrite) { |
|
return stringToUTF8Array(str, HEAPU8, outPtr, maxBytesToWrite); |
|
} |
|
function lengthBytesUTF8(str) { |
|
var len = 0; |
|
for (var i = 0; i < str.length; ++i) { |
|
var u = str.charCodeAt(i); |
|
if (u >= 55296 && u <= 57343) u = (65536 + ((u & 1023) << 10)) | (str.charCodeAt(++i) & 1023); |
|
if (u <= 127) { |
|
++len; |
|
} else if (u <= 2047) { |
|
len += 2; |
|
} else if (u <= 65535) { |
|
len += 3; |
|
} else if (u <= 2097151) { |
|
len += 4; |
|
} else if (u <= 67108863) { |
|
len += 5; |
|
} else { |
|
len += 6; |
|
} |
|
} |
|
return len; |
|
} |
|
var UTF16Decoder = typeof TextDecoder !== "undefined" ? new TextDecoder("utf-16le") : undefined; |
|
function allocateUTF8(str) { |
|
var size = lengthBytesUTF8(str) + 1; |
|
var ret = _malloc(size); |
|
if (ret) stringToUTF8Array(str, HEAP8, ret, size); |
|
return ret; |
|
} |
|
function allocateUTF8OnStack(str) { |
|
var size = lengthBytesUTF8(str) + 1; |
|
var ret = stackAlloc(size); |
|
stringToUTF8Array(str, HEAP8, ret, size); |
|
return ret; |
|
} |
|
function demangle(func) { |
|
return func; |
|
} |
|
function demangleAll(text) { |
|
var regex = /__Z[\w\d_]+/g; |
|
return text.replace(regex, function (x) { |
|
var y = demangle(x); |
|
return x === y ? x : x + " [" + y + "]"; |
|
}); |
|
} |
|
function jsStackTrace() { |
|
var err = new Error(); |
|
if (!err.stack) { |
|
try { |
|
throw new Error(0); |
|
} catch (e) { |
|
err = e; |
|
} |
|
if (!err.stack) { |
|
return "(no stack trace available)"; |
|
} |
|
} |
|
return err.stack.toString(); |
|
} |
|
function stackTrace() { |
|
var js = jsStackTrace(); |
|
if (Module["extraStackTrace"]) js += "\n" + Module["extraStackTrace"](); |
|
return demangleAll(js); |
|
} |
|
var PAGE_SIZE = 16384; |
|
var WASM_PAGE_SIZE = 65536; |
|
var ASMJS_PAGE_SIZE = 16777216; |
|
var MIN_TOTAL_MEMORY = 16777216; |
|
function alignUp(x, multiple) { |
|
if (x % multiple > 0) { |
|
x += multiple - (x % multiple); |
|
} |
|
return x; |
|
} |
|
var buffer, HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64; |
|
function updateGlobalBuffer(buf) { |
|
Module["buffer"] = buffer = buf; |
|
} |
|
function updateGlobalBufferViews() { |
|
Module["HEAP8"] = HEAP8 = new Int8Array(buffer); |
|
Module["HEAP16"] = HEAP16 = new Int16Array(buffer); |
|
Module["HEAP32"] = HEAP32 = new Int32Array(buffer); |
|
Module["HEAPU8"] = HEAPU8 = new Uint8Array(buffer); |
|
Module["HEAPU16"] = HEAPU16 = new Uint16Array(buffer); |
|
Module["HEAPU32"] = HEAPU32 = new Uint32Array(buffer); |
|
Module["HEAPF32"] = HEAPF32 = new Float32Array(buffer); |
|
Module["HEAPF64"] = HEAPF64 = new Float64Array(buffer); |
|
} |
|
var STATIC_BASE, STATICTOP, staticSealed; |
|
var STACK_BASE, STACKTOP, STACK_MAX; |
|
var DYNAMIC_BASE, DYNAMICTOP_PTR; |
|
STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0; |
|
staticSealed = false; |
|
function abortOnCannotGrowMemory() { |
|
abort( |
|
"Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value " + |
|
TOTAL_MEMORY + |
|
", (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 " |
|
); |
|
} |
|
if (!Module["reallocBuffer"]) |
|
Module["reallocBuffer"] = function (size) { |
|
var ret; |
|
try { |
|
if (ArrayBuffer.transfer) { |
|
ret = ArrayBuffer.transfer(buffer, size); |
|
} else { |
|
var oldHEAP8 = HEAP8; |
|
ret = new ArrayBuffer(size); |
|
var temp = new Int8Array(ret); |
|
temp.set(oldHEAP8); |
|
} |
|
} catch (e) { |
|
return false; |
|
} |
|
var success = _emscripten_replace_memory(ret); |
|
if (!success) return false; |
|
return ret; |
|
}; |
|
function enlargeMemory() { |
|
var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE; |
|
var LIMIT = 2147483648 - PAGE_MULTIPLE; |
|
if (HEAP32[DYNAMICTOP_PTR >> 2] > LIMIT) { |
|
return false; |
|
} |
|
var OLD_TOTAL_MEMORY = TOTAL_MEMORY; |
|
TOTAL_MEMORY = Math.max(TOTAL_MEMORY, MIN_TOTAL_MEMORY); |
|
while (TOTAL_MEMORY < HEAP32[DYNAMICTOP_PTR >> 2]) { |
|
if (TOTAL_MEMORY <= 536870912) { |
|
TOTAL_MEMORY = alignUp(2 * TOTAL_MEMORY, PAGE_MULTIPLE); |
|
} else { |
|
TOTAL_MEMORY = Math.min(alignUp((3 * TOTAL_MEMORY + 2147483648) / 4, PAGE_MULTIPLE), LIMIT); |
|
} |
|
} |
|
var replacement = Module["reallocBuffer"](TOTAL_MEMORY); |
|
if (!replacement || replacement.byteLength != TOTAL_MEMORY) { |
|
TOTAL_MEMORY = OLD_TOTAL_MEMORY; |
|
return false; |
|
} |
|
updateGlobalBuffer(replacement); |
|
updateGlobalBufferViews(); |
|
return true; |
|
} |
|
var byteLength; |
|
try { |
|
byteLength = Function.prototype.call.bind(Object.getOwnPropertyDescriptor(ArrayBuffer.prototype, "byteLength").get); |
|
byteLength(new ArrayBuffer(4)); |
|
} catch (e) { |
|
byteLength = function (buffer) { |
|
return buffer.byteLength; |
|
}; |
|
} |
|
var TOTAL_STACK = Module["TOTAL_STACK"] || 5242880; |
|
var TOTAL_MEMORY = Module["TOTAL_MEMORY"] || 33554432; |
|
if (TOTAL_MEMORY < TOTAL_STACK) err("TOTAL_MEMORY should be larger than TOTAL_STACK, was " + TOTAL_MEMORY + "! (TOTAL_STACK=" + TOTAL_STACK + ")"); |
|
if (Module["buffer"]) { |
|
buffer = Module["buffer"]; |
|
} else { |
|
if (typeof WebAssembly === "object" && typeof WebAssembly.Memory === "function") { |
|
Module["wasmMemory"] = new WebAssembly.Memory({ initial: TOTAL_MEMORY / WASM_PAGE_SIZE }); |
|
buffer = Module["wasmMemory"].buffer; |
|
} else { |
|
buffer = new ArrayBuffer(TOTAL_MEMORY); |
|
} |
|
Module["buffer"] = buffer; |
|
} |
|
updateGlobalBufferViews(); |
|
function getTotalMemory() { |
|
return TOTAL_MEMORY; |
|
} |
|
function callRuntimeCallbacks(callbacks) { |
|
while (callbacks.length > 0) { |
|
var callback = callbacks.shift(); |
|
if (typeof callback == "function") { |
|
callback(); |
|
continue; |
|
} |
|
var func = callback.func; |
|
if (typeof func === "number") { |
|
if (callback.arg === undefined) { |
|
Module["dynCall_v"](func); |
|
} else { |
|
Module["dynCall_vi"](func, callback.arg); |
|
} |
|
} else { |
|
func(callback.arg === undefined ? null : callback.arg); |
|
} |
|
} |
|
} |
|
var __ATPRERUN__ = []; |
|
var __ATINIT__ = []; |
|
var __ATMAIN__ = []; |
|
var __ATEXIT__ = []; |
|
var __ATPOSTRUN__ = []; |
|
var runtimeInitialized = false; |
|
var runtimeExited = false; |
|
function preRun() { |
|
if (Module["preRun"]) { |
|
if (typeof Module["preRun"] == "function") Module["preRun"] = [Module["preRun"]]; |
|
while (Module["preRun"].length) { |
|
addOnPreRun(Module["preRun"].shift()); |
|
} |
|
} |
|
callRuntimeCallbacks(__ATPRERUN__); |
|
} |
|
function ensureInitRuntime() { |
|
if (runtimeInitialized) return; |
|
runtimeInitialized = true; |
|
callRuntimeCallbacks(__ATINIT__); |
|
} |
|
function preMain() { |
|
callRuntimeCallbacks(__ATMAIN__); |
|
} |
|
function exitRuntime() { |
|
callRuntimeCallbacks(__ATEXIT__); |
|
runtimeExited = true; |
|
} |
|
function postRun() { |
|
if (Module["postRun"]) { |
|
if (typeof Module["postRun"] == "function") Module["postRun"] = [Module["postRun"]]; |
|
while (Module["postRun"].length) { |
|
addOnPostRun(Module["postRun"].shift()); |
|
} |
|
} |
|
callRuntimeCallbacks(__ATPOSTRUN__); |
|
} |
|
function addOnPreRun(cb) { |
|
__ATPRERUN__.unshift(cb); |
|
} |
|
function addOnPostRun(cb) { |
|
__ATPOSTRUN__.unshift(cb); |
|
} |
|
function writeArrayToMemory(array, buffer) { |
|
HEAP8.set(array, buffer); |
|
} |
|
function writeAsciiToMemory(str, buffer, dontAddNull) { |
|
for (var i = 0; i < str.length; ++i) { |
|
HEAP8[buffer++ >> 0] = str.charCodeAt(i); |
|
} |
|
if (!dontAddNull) HEAP8[buffer >> 0] = 0; |
|
} |
|
function unSign(value, bits, ignore) { |
|
if (value >= 0) { |
|
return value; |
|
} |
|
return bits <= 32 ? 2 * Math.abs(1 << (bits - 1)) + value : Math.pow(2, bits) + value; |
|
} |
|
function reSign(value, bits, ignore) { |
|
if (value <= 0) { |
|
return value; |
|
} |
|
var half = bits <= 32 ? Math.abs(1 << (bits - 1)) : Math.pow(2, bits - 1); |
|
if (value >= half && (bits <= 32 || value > half)) { |
|
value = -2 * half + value; |
|
} |
|
return value; |
|
} |
|
var Math_abs = Math.abs; |
|
var Math_sqrt = Math.sqrt; |
|
var Math_ceil = Math.ceil; |
|
var Math_floor = Math.floor; |
|
var Math_min = Math.min; |
|
var Math_clz32 = Math.clz32; |
|
var runDependencies = 0; |
|
var runDependencyWatcher = null; |
|
var dependenciesFulfilled = null; |
|
function getUniqueRunDependency(id) { |
|
return id; |
|
} |
|
function addRunDependency(id) { |
|
runDependencies++; |
|
if (Module["monitorRunDependencies"]) { |
|
Module["monitorRunDependencies"](runDependencies); |
|
} |
|
} |
|
function removeRunDependency(id) { |
|
runDependencies--; |
|
if (Module["monitorRunDependencies"]) { |
|
Module["monitorRunDependencies"](runDependencies); |
|
} |
|
if (runDependencies == 0) { |
|
if (runDependencyWatcher !== null) { |
|
clearInterval(runDependencyWatcher); |
|
runDependencyWatcher = null; |
|
} |
|
if (dependenciesFulfilled) { |
|
var callback = dependenciesFulfilled; |
|
dependenciesFulfilled = null; |
|
callback(); |
|
} |
|
} |
|
} |
|
Module["preloadedImages"] = {}; |
|
Module["preloadedAudios"] = {}; |
|
var dataURIPrefix = "data:application/octet-stream;base64,"; |
|
function isDataURI(filename) { |
|
return String.prototype.startsWith ? filename.startsWith(dataURIPrefix) : filename.indexOf(dataURIPrefix) === 0; |
|
} |
|
function integrateWasmJS() { |
|
var wasmTextFile = "build.wast"; |
|
var wasmBinaryFile = "build.wasm"; |
|
var asmjsCodeFile = "build.temp.asm.js"; |
|
if (!isDataURI(wasmTextFile)) { |
|
wasmTextFile = locateFile(wasmTextFile); |
|
} |
|
if (!isDataURI(wasmBinaryFile)) { |
|
wasmBinaryFile = locateFile(wasmBinaryFile); |
|
} |
|
if (!isDataURI(asmjsCodeFile)) { |
|
asmjsCodeFile = locateFile(asmjsCodeFile); |
|
} |
|
var wasmPageSize = 64 * 1024; |
|
var info = { global: null, env: null, asm2wasm: asm2wasmImports, parent: Module }; |
|
var exports = null; |
|
function mergeMemory(newBuffer) { |
|
var oldBuffer = Module["buffer"]; |
|
if (newBuffer.byteLength < oldBuffer.byteLength) { |
|
err("the new buffer in mergeMemory is smaller than the previous one. in native wasm, we should grow memory here"); |
|
} |
|
var oldView = new Int8Array(oldBuffer); |
|
var newView = new Int8Array(newBuffer); |
|
newView.set(oldView); |
|
updateGlobalBuffer(newBuffer); |
|
updateGlobalBufferViews(); |
|
} |
|
function fixImports(imports) { |
|
return imports; |
|
} |
|
function getBinary() { |
|
try { |
|
if (Module["wasmBinary"]) { |
|
return new Uint8Array(Module["wasmBinary"]); |
|
} |
|
if (Module["readBinary"]) { |
|
return Module["readBinary"](wasmBinaryFile); |
|
} else { |
|
throw "both async and sync fetching of the wasm failed"; |
|
} |
|
} catch (err) { |
|
abort(err); |
|
} |
|
} |
|
function getBinaryPromise() { |
|
if (!Module["wasmBinary"] && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && typeof fetch === "function") { |
|
return fetch(wasmBinaryFile, { credentials: "same-origin" }) |
|
.then(function (response) { |
|
if (!response["ok"]) { |
|
throw "failed to load wasm binary file at '" + wasmBinaryFile + "'"; |
|
} |
|
return response["arrayBuffer"](); |
|
}) |
|
.catch(function () { |
|
return getBinary(); |
|
}); |
|
} |
|
return new Promise(function (resolve, reject) { |
|
resolve(getBinary()); |
|
}); |
|
} |
|
function doNativeWasm(global, env, providedBuffer) { |
|
if (typeof WebAssembly !== "object") { |
|
err("no native wasm support detected"); |
|
return false; |
|
} |
|
if (!(Module["wasmMemory"] instanceof WebAssembly.Memory)) { |
|
err("no native wasm Memory in use"); |
|
return false; |
|
} |
|
env["memory"] = Module["wasmMemory"]; |
|
info["global"] = { NaN: NaN, Infinity: Infinity }; |
|
info["global.Math"] = Math; |
|
info["env"] = env; |
|
function receiveInstance(instance, module) { |
|
exports = instance.exports; |
|
if (exports.memory) mergeMemory(exports.memory); |
|
Module["asm"] = exports; |
|
Module["usingWasm"] = true; |
|
removeRunDependency("wasm-instantiate"); |
|
} |
|
addRunDependency("wasm-instantiate"); |
|
if (Module["instantiateWasm"]) { |
|
try { |
|
return Module["instantiateWasm"](info, receiveInstance); |
|
} catch (e) { |
|
err("Module.instantiateWasm callback failed with error: " + e); |
|
return false; |
|
} |
|
} |
|
function receiveInstantiatedSource(output) { |
|
receiveInstance(output["instance"], output["module"]); |
|
} |
|
function instantiateArrayBuffer(receiver) { |
|
getBinaryPromise() |
|
.then(function (binary) { |
|
return WebAssembly.instantiate(binary, info); |
|
}) |
|
.then(receiver) |
|
.catch(function (reason) { |
|
err("failed to asynchronously prepare wasm: " + reason); |
|
abort(reason); |
|
}); |
|
} |
|
if (!Module["wasmBinary"] && typeof WebAssembly.instantiateStreaming === "function" && !isDataURI(wasmBinaryFile) && typeof fetch === "function") { |
|
WebAssembly.instantiateStreaming(fetch(wasmBinaryFile, { credentials: "same-origin" }), info) |
|
.then(receiveInstantiatedSource) |
|
.catch(function (reason) { |
|
err("wasm streaming compile failed: " + reason); |
|
err("falling back to ArrayBuffer instantiation"); |
|
instantiateArrayBuffer(receiveInstantiatedSource); |
|
}); |
|
} else { |
|
instantiateArrayBuffer(receiveInstantiatedSource); |
|
} |
|
return {}; |
|
} |
|
Module["asmPreload"] = Module["asm"]; |
|
var asmjsReallocBuffer = Module["reallocBuffer"]; |
|
var wasmReallocBuffer = function (size) { |
|
var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE; |
|
size = alignUp(size, PAGE_MULTIPLE); |
|
var old = Module["buffer"]; |
|
var oldSize = old.byteLength; |
|
if (Module["usingWasm"]) { |
|
try { |
|
var result = Module["wasmMemory"].grow((size - oldSize) / wasmPageSize); |
|
if (result !== (-1 | 0)) { |
|
return (Module["buffer"] = Module["wasmMemory"].buffer); |
|
} else { |
|
return null; |
|
} |
|
} catch (e) { |
|
return null; |
|
} |
|
} |
|
}; |
|
Module["reallocBuffer"] = function (size) { |
|
if (finalMethod === "asmjs") { |
|
return asmjsReallocBuffer(size); |
|
} else { |
|
return wasmReallocBuffer(size); |
|
} |
|
}; |
|
var finalMethod = ""; |
|
Module["asm"] = function (global, env, providedBuffer) { |
|
env = fixImports(env); |
|
if (!env["table"]) { |
|
var TABLE_SIZE = Module["wasmTableSize"]; |
|
if (TABLE_SIZE === undefined) TABLE_SIZE = 1024; |
|
var MAX_TABLE_SIZE = Module["wasmMaxTableSize"]; |
|
if (typeof WebAssembly === "object" && typeof WebAssembly.Table === "function") { |
|
if (MAX_TABLE_SIZE !== undefined) { |
|
env["table"] = new WebAssembly.Table({ initial: TABLE_SIZE, maximum: MAX_TABLE_SIZE, element: "anyfunc" }); |
|
} else { |
|
env["table"] = new WebAssembly.Table({ initial: TABLE_SIZE, element: "anyfunc" }); |
|
} |
|
} else { |
|
env["table"] = new Array(TABLE_SIZE); |
|
} |
|
Module["wasmTable"] = env["table"]; |
|
} |
|
if (!env["memoryBase"]) { |
|
env["memoryBase"] = Module["STATIC_BASE"]; |
|
} |
|
if (!env["tableBase"]) { |
|
env["tableBase"] = 0; |
|
} |
|
var exports; |
|
exports = doNativeWasm(global, env, providedBuffer); |
|
assert(exports, "no binaryen method succeeded."); |
|
return exports; |
|
}; |
|
} |
|
integrateWasmJS(); |
|
var ASM_CONSTS = [ |
|
function () { |
|
return Module.webglContextAttributes.premultipliedAlpha; |
|
}, |
|
function () { |
|
return Module.webglContextAttributes.preserveDrawingBuffer; |
|
}, |
|
function ($0) { |
|
throw new Error('Internal Unity error: gles::GetProcAddress("' + Pointer_stringify($0) + '") was called but gles::GetProcAddress() is not implemented on Unity WebGL. Please report a bug.'); |
|
}, |
|
function () { |
|
return typeof Module.shouldQuit != "undefined"; |
|
}, |
|
function () { |
|
for (var id in Module.intervals) { |
|
window.clearInterval(id); |
|
} |
|
Module.intervals = {}; |
|
for (var i = 0; i < Module.deinitializers.length; i++) { |
|
Module.deinitializers[i](); |
|
} |
|
Module.deinitializers = []; |
|
if (typeof Module.onQuit == "function") Module.onQuit(); |
|
}, |
|
]; |
|
function _emscripten_asm_const_i(code) { |
|
return ASM_CONSTS[code](); |
|
} |
|
function _emscripten_asm_const_sync_on_main_thread_i(code) { |
|
return ASM_CONSTS[code](); |
|
} |
|
function _emscripten_asm_const_ii(code, a0) { |
|
return ASM_CONSTS[code](a0); |
|
} |
|
STATIC_BASE = GLOBAL_BASE; |
|
STATICTOP = STATIC_BASE + 1860320; |
|
__ATINIT__.push( |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_AccessibilityScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_AIScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___cxx_global_var_init(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_AndroidJNIScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_AnimationScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Animation_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Animation_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Animation_7_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Animation_Constraints_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_AnimationClip_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_AssetBundleScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_AssetBundle_Public_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_AudioScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Video_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Audio_Public_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Audio_Public_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Audio_Public_3_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Audio_Public_ScriptBindings_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Audio_Public_sound_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_ClothScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Cloth_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___cxx_global_var_init_18(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_nvcloth_src_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_nvcloth_src_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_SwInterCollision_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_SwSolverKernel_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_artifacts_WebGL_codegenerator_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_GfxDevice_opengles_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_VirtualFileSystem_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Input_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_GfxDeviceNull_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_External_ProphecySDK_BlitOperations_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_2D_Renderer_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_2D_Sorting_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_2D_SpriteAtlas_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Allocator_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Application_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_BaseClasses_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_BaseClasses_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_BaseClasses_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_BaseClasses_3_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Burst_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Camera_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Camera_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Camera_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Camera_6_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Camera_7_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Camera_8_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Shadows_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Camera_Culling_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_GUITexture_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Camera_RenderLoops_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Camera_RenderLoops_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Containers_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Core_Callbacks_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_File_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Geometry_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___cxx_global_var_init_104(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_4_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_5_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_6_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_8_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_10_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_11_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_Billboard_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_CommandBuffer_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_LOD_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_4_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_Mesh_5_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Graphics_ScriptableRenderLoop_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Interfaces_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Interfaces_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Interfaces_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Jobs_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Jobs_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Jobs_Internal_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Jobs_ScriptBindings_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Math_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Math_Random_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Misc_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Misc_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___cxx_global_var_init_131(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Misc_4_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Misc_5_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_PreloadManager_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Profiler_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Profiler_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Profiler_ExternalGPUProfiler_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Profiler_ScriptBindings_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_SceneManager_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___cxx_global_var_init_7754(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Shaders_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Shaders_3_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Shaders_GpuPrograms_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___cxx_global_var_init_9(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Shaders_ShaderImpl_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___cxx_global_var_init_8911(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Transform_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Transform_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Utilities_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___cxx_global_var_init_9307(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Utilities_5_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Utilities_6_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Utilities_7_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Utilities_9_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_AssetBundleFileSystem_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Modules_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___cxx_global_var_init_18_1180(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___cxx_global_var_init_19(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___cxx_global_var_init_20(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Profiler_Public_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Profiler_Runtime_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Export_Unsafe_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_GfxDevice_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_GfxDevice_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_GfxDevice_3_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_GfxDevice_4_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_GfxDevice_5_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_PluginInterface_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Director_Core_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_ScriptingBackend_Il2Cpp_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Scripting_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Scripting_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Scripting_3_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_TemplateInstantiations_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Scripting_APIUpdating_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Serialize_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Serialize_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_PlatformDependent_WebGL_Source_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_PlatformDependent_WebGL_Source_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Mesh_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_LogAssert_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Shader_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_PlatformDependent_WebGL_External_baselib_builds_Source_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_DirectorScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_DSPGraph_Public_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_GridScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Grid_Public_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___cxx_global_var_init_3785(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_IMGUIScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_IMGUI_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___cxx_global_var_init_23(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_IMGUI_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_InputLegacyScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_InputScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Input_Private_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_ParticleSystemScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_ParticleSystem_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_ShapeModule_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_UVModule_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Physics2DScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Physics2D_Public_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Physics2D_Public_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_PhysicsScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Physics_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Physics_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_PhysicsQuery_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_SubsystemsScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Subsystems_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_TerrainScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Terrain_Public_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Terrain_Public_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___cxx_global_var_init_89(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Terrain_Public_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Terrain_Public_3_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Terrain_VR_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_TextCoreScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_TextCore_Native_FontEngine_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_TextRenderingScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_TextRendering_Public_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_TilemapScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Tilemap_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Tilemap_Public_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_UIElementsNativeScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_External_Yoga_Yoga_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_UIScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_UI_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_UI_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_UI_2_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_umbra_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_UnityAnalyticsScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_UnityAdsSettings_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_UnityWebRequestScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_UnityWebRequest_Public_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_VFXScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_VFX_Public_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_VFX_Public_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_VFX_Public_Systems_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_VisualEffectAsset_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_VideoScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_Video_Public_Base_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_VRScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_VR_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_VR_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_PluginInterfaceVR_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Wind_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_XRScriptingClasses_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_XR_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_XRAudio_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_XRPreInit_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_XR_Public_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_XR_Stats_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_XR_Subsystems_Display_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_1_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_XR_Subsystems_Meshing_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Modules_XR_Tracing_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_XRWindowsLocatableCamera_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_External_il2cpp_builds_external_baselib_Platforms_WebGL_Source_0_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Lump_libil2cpp_os_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Lump_libil2cpp_icalls_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Lump_libil2cpp_vm_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Lump_libil2cpp_metadata_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Lump_libil2cpp_utils_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Lump_libil2cpp_vm_utils_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Lump_libil2cpp_mono_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
__GLOBAL__sub_I_Lump_libil2cpp_gc_cpp(); |
|
}, |
|
}, |
|
{ |
|
func: function () { |
|
___emscripten_environ_constructor(); |
|
}, |
|
} |
|
); |
|
var STATIC_BUMP = 1860320; |
|
Module["STATIC_BASE"] = STATIC_BASE; |
|
Module["STATIC_BUMP"] = STATIC_BUMP; |
|
var tempDoublePtr = STATICTOP; |
|
STATICTOP += 16; |
|
function _JS_Cursor_SetImage(ptr, length) { |
|
var binary = ""; |
|
for (var i = 0; i < length; i++) binary += String.fromCharCode(HEAPU8[ptr + i]); |
|
Module.canvas.style.cursor = "url(data:image/cur;base64," + btoa(binary) + "),default"; |
|
} |
|
function _JS_Cursor_SetShow(show) { |
|
Module.canvas.style.cursor = show ? "default" : "none"; |
|
} |
|
function _JS_Eval_ClearInterval(id) { |
|
window.clearInterval(id); |
|
} |
|
function _JS_Eval_SetInterval(func, arg, millis) { |
|
Module["noExitRuntime"] = true; |
|
function wrapper() { |
|
getFuncWrapper(func, "vi")(arg); |
|
} |
|
return Browser.safeSetInterval(wrapper, millis); |
|
} |
|
var fs = { |
|
numPendingSync: 0, |
|
syncInternal: 1e3, |
|
syncInProgress: false, |
|
sync: function (onlyPendingSync) { |
|
if (onlyPendingSync) { |
|
if (fs.numPendingSync == 0) return; |
|
} else if (fs.syncInProgress) { |
|
fs.numPendingSync++; |
|
return; |
|
} |
|
fs.syncInProgress = true; |
|
FS.syncfs(false, function (err) { |
|
fs.syncInProgress = false; |
|
}); |
|
fs.numPendingSync = 0; |
|
}, |
|
}; |
|
function _JS_FileSystem_Initialize() { |
|
Module.setInterval(function () { |
|
fs.sync(true); |
|
}, fs.syncInternal); |
|
} |
|
function _JS_FileSystem_Sync() { |
|
fs.sync(false); |
|
} |
|
function _JS_Log_Dump(ptr, type) { |
|
var str = Pointer_stringify(ptr); |
|
if (typeof dump == "function") dump(str); |
|
switch (type) { |
|
case 0: |
|
case 1: |
|
case 4: |
|
console.error(str); |
|
return; |
|
case 2: |
|
console.warn(str); |
|
return; |
|
case 3: |
|
case 5: |
|
console.log(str); |
|
return; |
|
default: |
|
console.error("Unknown console message type!"); |
|
console.error(str); |
|
} |
|
} |
|
function _JS_Log_StackTrace(buffer, bufferSize) { |
|
var trace = stackTrace(); |
|
if (buffer) stringToUTF8(trace, buffer, bufferSize); |
|
return lengthBytesUTF8(trace); |
|
} |
|
var WEBAudio = { audioInstances: [], audioContext: {}, audioWebEnabled: 0 }; |
|
function _JS_Sound_Create_Channel(callback, userData) { |
|
if (WEBAudio.audioWebEnabled == 0) return; |
|
var channel = { |
|
gain: WEBAudio.audioContext.createGain(), |
|
panner: WEBAudio.audioContext.createPanner(), |
|
threeD: false, |
|
playBuffer: function (delay, buffer, offset) { |
|
this.source.buffer = buffer; |
|
var chan = this; |
|
this.source.onended = function () { |
|
if (callback) dynCall("vi", callback, [userData]); |
|
chan.setup(); |
|
}; |
|
this.source.start(delay, offset); |
|
}, |
|
setup: function () { |
|
this.source = WEBAudio.audioContext.createBufferSource(); |
|
this.setupPanning(); |
|
}, |
|
setupPanning: function () { |
|
if (this.threeD) { |
|
this.source.disconnect(); |
|
this.source.connect(this.panner); |
|
this.panner.connect(this.gain); |
|
} else { |
|
this.panner.disconnect(); |
|
this.source.connect(this.gain); |
|
} |
|
}, |
|
}; |
|
channel.panner.rolloffFactor = 0; |
|
channel.gain.connect(WEBAudio.audioContext.destination); |
|
channel.setup(); |
|
return WEBAudio.audioInstances.push(channel) - 1; |
|
} |
|
function _JS_Sound_GetLength(bufferInstance) { |
|
if (WEBAudio.audioWebEnabled == 0) return 0; |
|
var sound = WEBAudio.audioInstances[bufferInstance]; |
|
var sampleRateRatio = 44100 / sound.buffer.sampleRate; |
|
return sound.buffer.length * sampleRateRatio; |
|
} |
|
function _JS_Sound_GetLoadState(bufferInstance) { |
|
if (WEBAudio.audioWebEnabled == 0) return 2; |
|
var sound = WEBAudio.audioInstances[bufferInstance]; |
|
if (sound.error) return 2; |
|
if (sound.buffer) return 0; |
|
return 1; |
|
} |
|
function _JS_Sound_Init() { |
|
try { |
|
window.AudioContext = window.AudioContext || window.webkitAudioContext; |
|
WEBAudio.audioContext = new AudioContext(); |
|
var tryToResumeAudioContext = function () { |
|
if (WEBAudio.audioContext.state === "suspended") WEBAudio.audioContext.resume(); |
|
else Module.clearInterval(resumeInterval); |
|
}; |
|
var resumeInterval = Module.setInterval(tryToResumeAudioContext, 400); |
|
WEBAudio.audioWebEnabled = 1; |
|
} catch (e) { |
|
alert("Web Audio API is not supported in this browser"); |
|
} |
|
} |
|
function _JS_Sound_Load(ptr, length) { |
|
if (WEBAudio.audioWebEnabled == 0) return 0; |
|
var sound = { buffer: null, error: false }; |
|
var instance = WEBAudio.audioInstances.push(sound) - 1; |
|
var audioData = HEAPU8.buffer.slice(ptr, ptr + length); |
|
WEBAudio.audioContext.decodeAudioData( |
|
audioData, |
|
function (buffer) { |
|
sound.buffer = buffer; |
|
}, |
|
function () { |
|
sound.error = true; |
|
console.log("Decode error."); |
|
} |
|
); |
|
return instance; |
|
} |
|
function _JS_Sound_Load_PCM(channels, length, sampleRate, ptr) { |
|
if (WEBAudio.audioWebEnabled == 0) return 0; |
|
var sound = { buffer: WEBAudio.audioContext.createBuffer(channels, length, sampleRate), error: false }; |
|
for (var i = 0; i < channels; i++) { |
|
var offs = (ptr >> 2) + length * i; |
|
var buffer = sound.buffer; |
|
var copyToChannel = |
|
buffer["copyToChannel"] || |
|
function (source, channelNumber, startInChannel) { |
|
var clipped = source.subarray(0, Math.min(source.length, this.length - (startInChannel | 0))); |
|
this.getChannelData(channelNumber | 0).set(clipped, startInChannel | 0); |
|
}; |
|
copyToChannel.apply(buffer, [HEAPF32.subarray(offs, offs + length), i, 0]); |
|
} |
|
var instance = WEBAudio.audioInstances.push(sound) - 1; |
|
return instance; |
|
} |
|
function _JS_Sound_Play(bufferInstance, channelInstance, offset, delay) { |
|
_JS_Sound_Stop(channelInstance, 0); |
|
if (WEBAudio.audioWebEnabled == 0) return; |
|
var sound = WEBAudio.audioInstances[bufferInstance]; |
|
var channel = WEBAudio.audioInstances[channelInstance]; |
|
if (sound.buffer) { |
|
try { |
|
channel.playBuffer(WEBAudio.audioContext.currentTime + delay, sound.buffer, offset); |
|
} catch (e) { |
|
console.error("playBuffer error. Exception: " + e); |
|
} |
|
} else console.log("Trying to play sound which is not loaded."); |
|
} |
|
function _JS_Sound_ReleaseInstance(instance) { |
|
WEBAudio.audioInstances[instance] = null; |
|
} |
|
function _JS_Sound_ResumeIfNeeded() { |
|
if (WEBAudio.audioWebEnabled == 0) return; |
|
if (WEBAudio.audioContext.state === "suspended") WEBAudio.audioContext.resume(); |
|
} |
|
function _JS_Sound_Set3D(channelInstance, threeD) { |
|
var channel = WEBAudio.audioInstances[channelInstance]; |
|
if (channel.threeD != threeD) { |
|
channel.threeD = threeD; |
|
channel.setupPanning(); |
|
} |
|
} |
|
function _JS_Sound_SetListenerOrientation(x, y, z, xUp, yUp, zUp) { |
|
if (WEBAudio.audioWebEnabled == 0) return; |
|
if (WEBAudio.audioContext.listener.forwardX) { |
|
WEBAudio.audioContext.listener.forwardX.setValueAtTime(-x, WEBAudio.audioContext.currentTime); |
|
WEBAudio.audioContext.listener.forwardY.setValueAtTime(-y, WEBAudio.audioContext.currentTime); |
|
WEBAudio.audioContext.listener.forwardZ.setValueAtTime(-z, WEBAudio.audioContext.currentTime); |
|
WEBAudio.audioContext.listener.upX.setValueAtTime(xUp, WEBAudio.audioContext.currentTime); |
|
WEBAudio.audioContext.listener.upY.setValueAtTime(yUp, WEBAudio.audioContext.currentTime); |
|
WEBAudio.audioContext.listener.upZ.setValueAtTime(zUp, WEBAudio.audioContext.currentTime); |
|
} else { |
|
WEBAudio.audioContext.listener.setOrientation(-x, -y, -z, xUp, yUp, zUp); |
|
} |
|
} |
|
function _JS_Sound_SetListenerPosition(x, y, z) { |
|
if (WEBAudio.audioWebEnabled == 0) return; |
|
if (WEBAudio.audioContext.listener.positionX) { |
|
WEBAudio.audioContext.listener.positionX.setValueAtTime(x, WEBAudio.audioContext.currentTime); |
|
WEBAudio.audioContext.listener.positionY.setValueAtTime(y, WEBAudio.audioContext.currentTime); |
|
WEBAudio.audioContext.listener.positionZ.setValueAtTime(z, WEBAudio.audioContext.currentTime); |
|
} else { |
|
WEBAudio.audioContext.listener.setPosition(x, y, z); |
|
} |
|
} |
|
function _JS_Sound_SetLoop(channelInstance, loop) { |
|
if (WEBAudio.audioWebEnabled == 0) return; |
|
WEBAudio.audioInstances[channelInstance].source.loop = loop; |
|
} |
|
function _JS_Sound_SetLoopPoints(channelInstance, loopStart, loopEnd) { |
|
if (WEBAudio.audioWebEnabled == 0) return; |
|
var channel = WEBAudio.audioInstances[channelInstance]; |
|
channel.source.loopStart = loopStart; |
|
channel.source.loopEnd = loopEnd; |
|
} |
|
function _JS_Sound_SetPitch(channelInstance, v) { |
|
if (WEBAudio.audioWebEnabled == 0) return; |
|
try { |
|
WEBAudio.audioInstances[channelInstance].source.playbackRate.setValueAtTime(v, WEBAudio.audioContext.currentTime); |
|
} catch (e) { |
|
console.error("Invalid audio pitch " + v + " specified to WebAudio backend!"); |
|
} |
|
} |
|
function _JS_Sound_SetPosition(channelInstance, x, y, z) { |
|
if (WEBAudio.audioWebEnabled == 0) return; |
|
WEBAudio.audioInstances[channelInstance].panner.setPosition(x, y, z); |
|
} |
|
function _JS_Sound_SetVolume(channelInstance, v) { |
|
if (WEBAudio.audioWebEnabled == 0) return; |
|
try { |
|
WEBAudio.audioInstances[channelInstance].gain.gain.setValueAtTime(v, WEBAudio.audioContext.currentTime); |
|
} catch (e) { |
|
console.error("Invalid audio volume " + v + " specified to WebAudio backend!"); |
|
} |
|
} |
|
function _JS_Sound_Stop(channelInstance, delay) { |
|
if (WEBAudio.audioWebEnabled == 0) return; |
|
var channel = WEBAudio.audioInstances[channelInstance]; |
|
if (channel.source.buffer) { |
|
try { |
|
channel.source.stop(WEBAudio.audioContext.currentTime + delay); |
|
} catch (e) { |
|
channel.source.disconnect(); |
|
} |
|
if (delay == 0) { |
|
channel.source.onended = function () {}; |
|
channel.setup(); |
|
} |
|
} |
|
} |
|
function _JS_SystemInfo_GetCanvasClientSize(domElementSelector, outWidth, outHeight) { |
|
var selector = UTF8ToString(domElementSelector); |
|
var canvas = selector == "#canvas" ? Module["canvas"] : document.querySelector(selector); |
|
HEAPF64[outWidth >> 3] = canvas ? canvas.clientWidth : 0; |
|
HEAPF64[outHeight >> 3] = canvas ? canvas.clientHeight : 0; |
|
} |
|
function _JS_SystemInfo_GetDocumentURL(buffer, bufferSize) { |
|
if (buffer) stringToUTF8(document.URL, buffer, bufferSize); |
|
return lengthBytesUTF8(document.URL); |
|
} |
|
function _JS_SystemInfo_GetGPUInfo(buffer, bufferSize) { |
|
var gpuinfo = Module.SystemInfo.gpu; |
|
if (buffer) stringToUTF8(gpuinfo, buffer, bufferSize); |
|
return lengthBytesUTF8(gpuinfo); |
|
} |
|
function _JS_SystemInfo_GetMatchWebGLToCanvasSize() { |
|
return Module.matchWebGLToCanvasSize || Module.matchWebGLToCanvasSize === undefined; |
|
} |
|
function _JS_SystemInfo_GetMemory() { |
|
return TOTAL_MEMORY / (1024 * 1024); |
|
} |
|
function _JS_SystemInfo_GetOS(buffer, bufferSize) { |
|
var browser = Module.SystemInfo.os + " " + Module.SystemInfo.osVersion; |
|
if (buffer) stringToUTF8(browser, buffer, bufferSize); |
|
return lengthBytesUTF8(browser); |
|
} |
|
function _JS_SystemInfo_GetPreferredDevicePixelRatio() { |
|
return Module.devicePixelRatio || window.devicePixelRatio || 1; |
|
} |
|
function _JS_SystemInfo_GetScreenSize(outWidth, outHeight) { |
|
HEAPF64[outWidth >> 3] = Module.SystemInfo.width; |
|
HEAPF64[outHeight >> 3] = Module.SystemInfo.height; |
|
} |
|
function _JS_SystemInfo_HasCursorLock() { |
|
return Module.SystemInfo.hasCursorLock; |
|
} |
|
function _JS_SystemInfo_HasFullscreen() { |
|
return Module.SystemInfo.hasFullscreen; |
|
} |
|
function _JS_SystemInfo_HasWebGL() { |
|
return Module.SystemInfo.hasWebGL; |
|
} |
|
function ___atomic_compare_exchange_8(ptr, expected, desiredl, desiredh, weak, success_memmodel, failure_memmodel) { |
|
var pl = HEAP32[ptr >> 2]; |
|
var ph = HEAP32[(ptr + 4) >> 2]; |
|
var el = HEAP32[expected >> 2]; |
|
var eh = HEAP32[(expected + 4) >> 2]; |
|
if (pl === el && ph === eh) { |
|
HEAP32[ptr >> 2] = desiredl; |
|
HEAP32[(ptr + 4) >> 2] = desiredh; |
|
return 1; |
|
} else { |
|
HEAP32[expected >> 2] = pl; |
|
HEAP32[(expected + 4) >> 2] = ph; |
|
return 0; |
|
} |
|
} |
|
function ___atomic_fetch_add_8(ptr, vall, valh, memmodel) { |
|
var l = HEAP32[ptr >> 2]; |
|
var h = HEAP32[(ptr + 4) >> 2]; |
|
HEAP32[ptr >> 2] = _i64Add(l, h, vall, valh); |
|
HEAP32[(ptr + 4) >> 2] = getTempRet0(); |
|
return (setTempRet0(h), l) | 0; |
|
} |
|
var ENV = {}; |
|
function ___buildEnvironment(environ) { |
|
var MAX_ENV_VALUES = 64; |
|
var TOTAL_ENV_SIZE = 1024; |
|
var poolPtr; |
|
var envPtr; |
|
if (!___buildEnvironment.called) { |
|
___buildEnvironment.called = true; |
|
ENV["USER"] = ENV["LOGNAME"] = "web_user"; |
|
ENV["PATH"] = "/"; |
|
ENV["PWD"] = "/"; |
|
ENV["HOME"] = "/home/web_user"; |
|
ENV["LANG"] = "C.UTF-8"; |
|
ENV["_"] = Module["thisProgram"]; |
|
poolPtr = getMemory(TOTAL_ENV_SIZE); |
|
envPtr = getMemory(MAX_ENV_VALUES * 4); |
|
HEAP32[envPtr >> 2] = poolPtr; |
|
HEAP32[environ >> 2] = envPtr; |
|
} else { |
|
envPtr = HEAP32[environ >> 2]; |
|
poolPtr = HEAP32[envPtr >> 2]; |
|
} |
|
var strings = []; |
|
var totalSize = 0; |
|
for (var key in ENV) { |
|
if (typeof ENV[key] === "string") { |
|
var line = key + "=" + ENV[key]; |
|
strings.push(line); |
|
totalSize += line.length; |
|
} |
|
} |
|
if (totalSize > TOTAL_ENV_SIZE) { |
|
throw new Error("Environment size exceeded TOTAL_ENV_SIZE!"); |
|
} |
|
var ptrSize = 4; |
|
for (var i = 0; i < strings.length; i++) { |
|
var line = strings[i]; |
|
writeAsciiToMemory(line, poolPtr); |
|
HEAP32[(envPtr + i * ptrSize) >> 2] = poolPtr; |
|
poolPtr += line.length + 1; |
|
} |
|
HEAP32[(envPtr + strings.length * ptrSize) >> 2] = 0; |
|
} |
|
function ___cxa_allocate_exception(size) { |
|
return _malloc(size); |
|
} |
|
function __ZSt18uncaught_exceptionv() { |
|
return !!__ZSt18uncaught_exceptionv.uncaught_exception; |
|
} |
|
var EXCEPTIONS = { |
|
last: 0, |
|
caught: [], |
|
infos: {}, |
|
deAdjust: function (adjusted) { |
|
if (!adjusted || EXCEPTIONS.infos[adjusted]) return adjusted; |
|
for (var key in EXCEPTIONS.infos) { |
|
var ptr = +key; |
|
var info = EXCEPTIONS.infos[ptr]; |
|
if (info.adjusted === adjusted) { |
|
return ptr; |
|
} |
|
} |
|
return adjusted; |
|
}, |
|
addRef: function (ptr) { |
|
if (!ptr) return; |
|
var info = EXCEPTIONS.infos[ptr]; |
|
info.refcount++; |
|
}, |
|
decRef: function (ptr) { |
|
if (!ptr) return; |
|
var info = EXCEPTIONS.infos[ptr]; |
|
assert(info.refcount > 0); |
|
info.refcount--; |
|
if (info.refcount === 0 && !info.rethrown) { |
|
if (info.destructor) { |
|
Module["dynCall_vi"](info.destructor, ptr); |
|
} |
|
delete EXCEPTIONS.infos[ptr]; |
|
___cxa_free_exception(ptr); |
|
} |
|
}, |
|
clearRef: function (ptr) { |
|
if (!ptr) return; |
|
var info = EXCEPTIONS.infos[ptr]; |
|
info.refcount = 0; |
|
}, |
|
}; |
|
function ___cxa_begin_catch(ptr) { |
|
var info = EXCEPTIONS.infos[ptr]; |
|
if (info && !info.caught) { |
|
info.caught = true; |
|
__ZSt18uncaught_exceptionv.uncaught_exception--; |
|
} |
|
if (info) info.rethrown = false; |
|
EXCEPTIONS.caught.push(ptr); |
|
EXCEPTIONS.addRef(EXCEPTIONS.deAdjust(ptr)); |
|
return ptr; |
|
} |
|
function ___cxa_free_exception(ptr) { |
|
try { |
|
return _free(ptr); |
|
} catch (e) {} |
|
} |
|
function ___cxa_end_catch() { |
|
Module["setThrew"](0); |
|
var ptr = EXCEPTIONS.caught.pop(); |
|
if (ptr) { |
|
EXCEPTIONS.decRef(EXCEPTIONS.deAdjust(ptr)); |
|
EXCEPTIONS.last = 0; |
|
} |
|
} |
|
function ___cxa_find_matching_catch_2() { |
|
return ___cxa_find_matching_catch.apply(null, arguments); |
|
} |
|
function ___cxa_find_matching_catch_3() { |
|
return ___cxa_find_matching_catch.apply(null, arguments); |
|
} |
|
function ___cxa_find_matching_catch_4() { |
|
return ___cxa_find_matching_catch.apply(null, arguments); |
|
} |
|
function ___cxa_pure_virtual() { |
|
ABORT = true; |
|
throw "Pure virtual function called!"; |
|
} |
|
function ___cxa_rethrow() { |
|
var ptr = EXCEPTIONS.caught.pop(); |
|
ptr = EXCEPTIONS.deAdjust(ptr); |
|
if (!EXCEPTIONS.infos[ptr].rethrown) { |
|
EXCEPTIONS.caught.push(ptr); |
|
EXCEPTIONS.infos[ptr].rethrown = true; |
|
} |
|
EXCEPTIONS.last = ptr; |
|
throw ptr; |
|
} |
|
function ___resumeException(ptr) { |
|
if (!EXCEPTIONS.last) { |
|
EXCEPTIONS.last = ptr; |
|
} |
|
throw ptr; |
|
} |
|
function ___cxa_find_matching_catch() { |
|
var thrown = EXCEPTIONS.last; |
|
if (!thrown) { |
|
return (setTempRet0(0), 0) | 0; |
|
} |
|
var info = EXCEPTIONS.infos[thrown]; |
|
var throwntype = info.type; |
|
if (!throwntype) { |
|
return (setTempRet0(0), thrown) | 0; |
|
} |
|
var typeArray = Array.prototype.slice.call(arguments); |
|
var pointer = Module["___cxa_is_pointer_type"](throwntype); |
|
if (!___cxa_find_matching_catch.buffer) ___cxa_find_matching_catch.buffer = _malloc(4); |
|
HEAP32[___cxa_find_matching_catch.buffer >> 2] = thrown; |
|
thrown = ___cxa_find_matching_catch.buffer; |
|
for (var i = 0; i < typeArray.length; i++) { |
|
if (typeArray[i] && Module["___cxa_can_catch"](typeArray[i], throwntype, thrown)) { |
|
thrown = HEAP32[thrown >> 2]; |
|
info.adjusted = thrown; |
|
return (setTempRet0(typeArray[i]), thrown) | 0; |
|
} |
|
} |
|
thrown = HEAP32[thrown >> 2]; |
|
return (setTempRet0(throwntype), thrown) | 0; |
|
} |
|
function ___cxa_throw(ptr, type, destructor) { |
|
EXCEPTIONS.infos[ptr] = { ptr: ptr, adjusted: ptr, type: type, destructor: destructor, refcount: 0, caught: false, rethrown: false }; |
|
EXCEPTIONS.last = ptr; |
|
if (!("uncaught_exception" in __ZSt18uncaught_exceptionv)) { |
|
__ZSt18uncaught_exceptionv.uncaught_exception = 1; |
|
} else { |
|
__ZSt18uncaught_exceptionv.uncaught_exception++; |
|
} |
|
throw ptr; |
|
} |
|
function ___gxx_personality_v0() {} |
|
function ___lock() {} |
|
var ERRNO_CODES = { |
|
EPERM: 1, |
|
ENOENT: 2, |
|
ESRCH: 3, |
|
EINTR: 4, |
|
EIO: 5, |
|
ENXIO: 6, |
|
E2BIG: 7, |
|
ENOEXEC: 8, |
|
EBADF: 9, |
|
ECHILD: 10, |
|
EAGAIN: 11, |
|
EWOULDBLOCK: 11, |
|
ENOMEM: 12, |
|
EACCES: 13, |
|
EFAULT: 14, |
|
ENOTBLK: 15, |
|
EBUSY: 16, |
|
EEXIST: 17, |
|
EXDEV: 18, |
|
ENODEV: 19, |
|
ENOTDIR: 20, |
|
EISDIR: 21, |
|
EINVAL: 22, |
|
ENFILE: 23, |
|
EMFILE: 24, |
|
ENOTTY: 25, |
|
ETXTBSY: 26, |
|
EFBIG: 27, |
|
ENOSPC: 28, |
|
ESPIPE: 29, |
|
EROFS: 30, |
|
EMLINK: 31, |
|
EPIPE: 32, |
|
EDOM: 33, |
|
ERANGE: 34, |
|
ENOMSG: 42, |
|
EIDRM: 43, |
|
ECHRNG: 44, |
|
EL2NSYNC: 45, |
|
EL3HLT: 46, |
|
EL3RST: 47, |
|
ELNRNG: 48, |
|
EUNATCH: 49, |
|
ENOCSI: 50, |
|
EL2HLT: 51, |
|
EDEADLK: 35, |
|
ENOLCK: 37, |
|
EBADE: 52, |
|
EBADR: 53, |
|
EXFULL: 54, |
|
ENOANO: 55, |
|
EBADRQC: 56, |
|
EBADSLT: 57, |
|
EDEADLOCK: 35, |
|
EBFONT: 59, |
|
ENOSTR: 60, |
|
ENODATA: 61, |
|
ETIME: 62, |
|
ENOSR: 63, |
|
ENONET: 64, |
|
ENOPKG: 65, |
|
EREMOTE: 66, |
|
ENOLINK: 67, |
|
EADV: 68, |
|
ESRMNT: 69, |
|
ECOMM: 70, |
|
EPROTO: 71, |
|
EMULTIHOP: 72, |
|
EDOTDOT: 73, |
|
EBADMSG: 74, |
|
ENOTUNIQ: 76, |
|
EBADFD: 77, |
|
EREMCHG: 78, |
|
ELIBACC: 79, |
|
ELIBBAD: 80, |
|
ELIBSCN: 81, |
|
ELIBMAX: 82, |
|
ELIBEXEC: 83, |
|
ENOSYS: 38, |
|
ENOTEMPTY: 39, |
|
ENAMETOOLONG: 36, |
|
ELOOP: 40, |
|
EOPNOTSUPP: 95, |
|
EPFNOSUPPORT: 96, |
|
ECONNRESET: 104, |
|
ENOBUFS: 105, |
|
EAFNOSUPPORT: 97, |
|
EPROTOTYPE: 91, |
|
ENOTSOCK: 88, |
|
ENOPROTOOPT: 92, |
|
ESHUTDOWN: 108, |
|
ECONNREFUSED: 111, |
|
EADDRINUSE: 98, |
|
ECONNABORTED: 103, |
|
ENETUNREACH: 101, |
|
ENETDOWN: 100, |
|
ETIMEDOUT: 110, |
|
EHOSTDOWN: 112, |
|
EHOSTUNREACH: 113, |
|
EINPROGRESS: 115, |
|
EALREADY: 114, |
|
EDESTADDRREQ: 89, |
|
EMSGSIZE: 90, |
|
EPROTONOSUPPORT: 93, |
|
ESOCKTNOSUPPORT: 94, |
|
EADDRNOTAVAIL: 99, |
|
ENETRESET: 102, |
|
EISCONN: 106, |
|
ENOTCONN: 107, |
|
ETOOMANYREFS: 109, |
|
EUSERS: 87, |
|
EDQUOT: 122, |
|
ESTALE: 116, |
|
ENOTSUP: 95, |
|
ENOMEDIUM: 123, |
|
EILSEQ: 84, |
|
EOVERFLOW: 75, |
|
ECANCELED: 125, |
|
ENOTRECOVERABLE: 131, |
|
EOWNERDEAD: 130, |
|
ESTRPIPE: 86, |
|
}; |
|
function ___setErrNo(value) { |
|
if (Module["___errno_location"]) HEAP32[Module["___errno_location"]() >> 2] = value; |
|
return value; |
|
} |
|
function ___map_file(pathname, size) { |
|
___setErrNo(ERRNO_CODES.EPERM); |
|
return -1; |
|
} |
|
var ERRNO_MESSAGES = { |
|
0: "Success", |
|
1: "Not super-user", |
|
2: "No such file or directory", |
|
3: "No such process", |
|
4: "Interrupted system call", |
|
5: "I/O error", |
|
6: "No such device or address", |
|
7: "Arg list too long", |
|
8: "Exec format error", |
|
9: "Bad file number", |
|
10: "No children", |
|
11: "No more processes", |
|
12: "Not enough core", |
|
13: "Permission denied", |
|
14: "Bad address", |
|
15: "Block device required", |
|
16: "Mount device busy", |
|
17: "File exists", |
|
18: "Cross-device link", |
|
19: "No such device", |
|
20: "Not a directory", |
|
21: "Is a directory", |
|
22: "Invalid argument", |
|
23: "Too many open files in system", |
|
24: "Too many open files", |
|
25: "Not a typewriter", |
|
26: "Text file busy", |
|
27: "File too large", |
|
28: "No space left on device", |
|
29: "Illegal seek", |
|
30: "Read only file system", |
|
31: "Too many links", |
|
32: "Broken pipe", |
|
33: "Math arg out of domain of func", |
|
34: "Math result not representable", |
|
35: "File locking deadlock error", |
|
36: "File or path name too long", |
|
37: "No record locks available", |
|
38: "Function not implemented", |
|
39: "Directory not empty", |
|
40: "Too many symbolic links", |
|
42: "No message of desired type", |
|
43: "Identifier removed", |
|
44: "Channel number out of range", |
|
45: "Level 2 not synchronized", |
|
46: "Level 3 halted", |
|
47: "Level 3 reset", |
|
48: "Link number out of range", |
|
49: "Protocol driver not attached", |
|
50: "No CSI structure available", |
|
51: "Level 2 halted", |
|
52: "Invalid exchange", |
|
53: "Invalid request descriptor", |
|
54: "Exchange full", |
|
55: "No anode", |
|
56: "Invalid request code", |
|
57: "Invalid slot", |
|
59: "Bad font file fmt", |
|
60: "Device not a stream", |
|
61: "No data (for no delay io)", |
|
62: "Timer expired", |
|
63: "Out of streams resources", |
|
64: "Machine is not on the network", |
|
65: "Package not installed", |
|
66: "The object is remote", |
|
67: "The link has been severed", |
|
68: "Advertise error", |
|
69: "Srmount error", |
|
70: "Communication error on send", |
|
71: "Protocol error", |
|
72: "Multihop attempted", |
|
73: "Cross mount point (not really error)", |
|
74: "Trying to read unreadable message", |
|
75: "Value too large for defined data type", |
|
76: "Given log. name not unique", |
|
77: "f.d. invalid for this operation", |
|
78: "Remote address changed", |
|
79: "Can access a needed shared lib", |
|
80: "Accessing a corrupted shared lib", |
|
81: ".lib section in a.out corrupted", |
|
82: "Attempting to link in too many libs", |
|
83: "Attempting to exec a shared library", |
|
84: "Illegal byte sequence", |
|
86: "Streams pipe error", |
|
87: "Too many users", |
|
88: "Socket operation on non-socket", |
|
89: "Destination address required", |
|
90: "Message too long", |
|
91: "Protocol wrong type for socket", |
|
92: "Protocol not available", |
|
93: "Unknown protocol", |
|
94: "Socket type not supported", |
|
95: "Not supported", |
|
96: "Protocol family not supported", |
|
97: "Address family not supported by protocol family", |
|
98: "Address already in use", |
|
99: "Address not available", |
|
100: "Network interface is not configured", |
|
101: "Network is unreachable", |
|
102: "Connection reset by network", |
|
103: "Connection aborted", |
|
104: "Connection reset by peer", |
|
105: "No buffer space available", |
|
106: "Socket is already connected", |
|
107: "Socket is not connected", |
|
108: "Can't send after socket shutdown", |
|
109: "Too many references", |
|
110: "Connection timed out", |
|
111: "Connection refused", |
|
112: "Host is down", |
|
113: "Host is unreachable", |
|
114: "Socket already connected", |
|
115: "Connection already in progress", |
|
116: "Stale file handle", |
|
122: "Quota exceeded", |
|
123: "No medium (in tape drive)", |
|
125: "Operation canceled", |
|
130: "Previous owner died", |
|
131: "State not recoverable", |
|
}; |
|
var PATH = { |
|
splitPath: function (filename) { |
|
var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; |
|
return splitPathRe.exec(filename).slice(1); |
|
}, |
|
normalizeArray: function (parts, allowAboveRoot) { |
|
var up = 0; |
|
for (var i = parts.length - 1; i >= 0; i--) { |
|
var last = parts[i]; |
|
if (last === ".") { |
|
parts.splice(i, 1); |
|
} else if (last === "..") { |
|
parts.splice(i, 1); |
|
up++; |
|
} else if (up) { |
|
parts.splice(i, 1); |
|
up--; |
|
} |
|
} |
|
if (allowAboveRoot) { |
|
for (; up; up--) { |
|
parts.unshift(".."); |
|
} |
|
} |
|
return parts; |
|
}, |
|
normalize: function (path) { |
|
var isAbsolute = path.charAt(0) === "/", |
|
trailingSlash = path.substr(-1) === "/"; |
|
path = PATH.normalizeArray( |
|
path.split("/").filter(function (p) { |
|
return !!p; |
|
}), |
|
!isAbsolute |
|
).join("/"); |
|
if (!path && !isAbsolute) { |
|
path = "."; |
|
} |
|
if (path && trailingSlash) { |
|
path += "/"; |
|
} |
|
return (isAbsolute ? "/" : "") + path; |
|
}, |
|
dirname: function (path) { |
|
var result = PATH.splitPath(path), |
|
root = result[0], |
|
dir = result[1]; |
|
if (!root && !dir) { |
|
return "."; |
|
} |
|
if (dir) { |
|
dir = dir.substr(0, dir.length - 1); |
|
} |
|
return root + dir; |
|
}, |
|
basename: function (path) { |
|
if (path === "/") return "/"; |
|
var lastSlash = path.lastIndexOf("/"); |
|
if (lastSlash === -1) return path; |
|
return path.substr(lastSlash + 1); |
|
}, |
|
extname: function (path) { |
|
return PATH.splitPath(path)[3]; |
|
}, |
|
join: function () { |
|
var paths = Array.prototype.slice.call(arguments, 0); |
|
return PATH.normalize(paths.join("/")); |
|
}, |
|
join2: function (l, r) { |
|
return PATH.normalize(l + "/" + r); |
|
}, |
|
resolve: function () { |
|
var resolvedPath = "", |
|
resolvedAbsolute = false; |
|
for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { |
|
var path = i >= 0 ? arguments[i] : FS.cwd(); |
|
if (typeof path !== "string") { |
|
throw new TypeError("Arguments to path.resolve must be strings"); |
|
} else if (!path) { |
|
return ""; |
|
} |
|
resolvedPath = path + "/" + resolvedPath; |
|
resolvedAbsolute = path.charAt(0) === "/"; |
|
} |
|
resolvedPath = PATH.normalizeArray( |
|
resolvedPath.split("/").filter(function (p) { |
|
return !!p; |
|
}), |
|
!resolvedAbsolute |
|
).join("/"); |
|
return (resolvedAbsolute ? "/" : "") + resolvedPath || "."; |
|
}, |
|
relative: function (from, to) { |
|
from = PATH.resolve(from).substr(1); |
|
to = PATH.resolve(to).substr(1); |
|
function trim(arr) { |
|
var start = 0; |
|
for (; start < arr.length; start++) { |
|
if (arr[start] !== "") break; |
|
} |
|
var end = arr.length - 1; |
|
for (; end >= 0; end--) { |
|
if (arr[end] !== "") break; |
|
} |
|
if (start > end) return []; |
|
return arr.slice(start, end - start + 1); |
|
} |
|
var fromParts = trim(from.split("/")); |
|
var toParts = trim(to.split("/")); |
|
var length = Math.min(fromParts.length, toParts.length); |
|
var samePartsLength = length; |
|
for (var i = 0; i < length; i++) { |
|
if (fromParts[i] !== toParts[i]) { |
|
samePartsLength = i; |
|
break; |
|
} |
|
} |
|
var outputParts = []; |
|
for (var i = samePartsLength; i < fromParts.length; i++) { |
|
outputParts.push(".."); |
|
} |
|
outputParts = outputParts.concat(toParts.slice(samePartsLength)); |
|
return outputParts.join("/"); |
|
}, |
|
}; |
|
var TTY = { |
|
ttys: [], |
|
init: function () {}, |
|
shutdown: function () {}, |
|
register: function (dev, ops) { |
|
TTY.ttys[dev] = { input: [], output: [], ops: ops }; |
|
FS.registerDevice(dev, TTY.stream_ops); |
|
}, |
|
stream_ops: { |
|
open: function (stream) { |
|
var tty = TTY.ttys[stream.node.rdev]; |
|
if (!tty) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
|
} |
|
stream.tty = tty; |
|
stream.seekable = false; |
|
}, |
|
close: function (stream) { |
|
stream.tty.ops.flush(stream.tty); |
|
}, |
|
flush: function (stream) { |
|
stream.tty.ops.flush(stream.tty); |
|
}, |
|
read: function (stream, buffer, offset, length, pos) { |
|
if (!stream.tty || !stream.tty.ops.get_char) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENXIO); |
|
} |
|
var bytesRead = 0; |
|
for (var i = 0; i < length; i++) { |
|
var result; |
|
try { |
|
result = stream.tty.ops.get_char(stream.tty); |
|
} catch (e) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EIO); |
|
} |
|
if (result === undefined && bytesRead === 0) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); |
|
} |
|
if (result === null || result === undefined) break; |
|
bytesRead++; |
|
buffer[offset + i] = result; |
|
} |
|
if (bytesRead) { |
|
stream.node.timestamp = Date.now(); |
|
} |
|
return bytesRead; |
|
}, |
|
write: function (stream, buffer, offset, length, pos) { |
|
if (!stream.tty || !stream.tty.ops.put_char) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENXIO); |
|
} |
|
for (var i = 0; i < length; i++) { |
|
try { |
|
stream.tty.ops.put_char(stream.tty, buffer[offset + i]); |
|
} catch (e) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EIO); |
|
} |
|
} |
|
if (length) { |
|
stream.node.timestamp = Date.now(); |
|
} |
|
return i; |
|
}, |
|
}, |
|
default_tty_ops: { |
|
get_char: function (tty) { |
|
if (!tty.input.length) { |
|
var result = null; |
|
if (ENVIRONMENT_IS_NODE) { |
|
var BUFSIZE = 256; |
|
var buf = new Buffer(BUFSIZE); |
|
var bytesRead = 0; |
|
var isPosixPlatform = process.platform != "win32"; |
|
var fd = process.stdin.fd; |
|
if (isPosixPlatform) { |
|
var usingDevice = false; |
|
try { |
|
fd = fs.openSync("/dev/stdin", "r"); |
|
usingDevice = true; |
|
} catch (e) {} |
|
} |
|
try { |
|
bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null); |
|
} catch (e) { |
|
if (e.toString().indexOf("EOF") != -1) bytesRead = 0; |
|
else throw e; |
|
} |
|
if (usingDevice) { |
|
fs.closeSync(fd); |
|
} |
|
if (bytesRead > 0) { |
|
result = buf.slice(0, bytesRead).toString("utf-8"); |
|
} else { |
|
result = null; |
|
} |
|
} else if (typeof window != "undefined" && typeof window.prompt == "function") { |
|
result = window.prompt("Input: "); |
|
if (result !== null) { |
|
result += "\n"; |
|
} |
|
} else if (typeof readline == "function") { |
|
result = readline(); |
|
if (result !== null) { |
|
result += "\n"; |
|
} |
|
} |
|
if (!result) { |
|
return null; |
|
} |
|
tty.input = intArrayFromString(result, true); |
|
} |
|
return tty.input.shift(); |
|
}, |
|
put_char: function (tty, val) { |
|
if (val === null || val === 10) { |
|
out(UTF8ArrayToString(tty.output, 0)); |
|
tty.output = []; |
|
} else { |
|
if (val != 0) tty.output.push(val); |
|
} |
|
}, |
|
flush: function (tty) { |
|
if (tty.output && tty.output.length > 0) { |
|
out(UTF8ArrayToString(tty.output, 0)); |
|
tty.output = []; |
|
} |
|
}, |
|
}, |
|
default_tty1_ops: { |
|
put_char: function (tty, val) { |
|
if (val === null || val === 10) { |
|
err(UTF8ArrayToString(tty.output, 0)); |
|
tty.output = []; |
|
} else { |
|
if (val != 0) tty.output.push(val); |
|
} |
|
}, |
|
flush: function (tty) { |
|
if (tty.output && tty.output.length > 0) { |
|
err(UTF8ArrayToString(tty.output, 0)); |
|
tty.output = []; |
|
} |
|
}, |
|
}, |
|
}; |
|
var MEMFS = { |
|
ops_table: null, |
|
mount: function (mount) { |
|
return MEMFS.createNode(null, "/", 16384 | 511, 0); |
|
}, |
|
createNode: function (parent, name, mode, dev) { |
|
if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
} |
|
if (!MEMFS.ops_table) { |
|
MEMFS.ops_table = { |
|
dir: { |
|
node: { |
|
getattr: MEMFS.node_ops.getattr, |
|
setattr: MEMFS.node_ops.setattr, |
|
lookup: MEMFS.node_ops.lookup, |
|
mknod: MEMFS.node_ops.mknod, |
|
rename: MEMFS.node_ops.rename, |
|
unlink: MEMFS.node_ops.unlink, |
|
rmdir: MEMFS.node_ops.rmdir, |
|
readdir: MEMFS.node_ops.readdir, |
|
symlink: MEMFS.node_ops.symlink, |
|
}, |
|
stream: { llseek: MEMFS.stream_ops.llseek }, |
|
}, |
|
file: { |
|
node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr }, |
|
stream: { llseek: MEMFS.stream_ops.llseek, read: MEMFS.stream_ops.read, write: MEMFS.stream_ops.write, allocate: MEMFS.stream_ops.allocate, mmap: MEMFS.stream_ops.mmap, msync: MEMFS.stream_ops.msync }, |
|
}, |
|
link: { node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr, readlink: MEMFS.node_ops.readlink }, stream: {} }, |
|
chrdev: { node: { getattr: MEMFS.node_ops.getattr, setattr: MEMFS.node_ops.setattr }, stream: FS.chrdev_stream_ops }, |
|
}; |
|
} |
|
var node = FS.createNode(parent, name, mode, dev); |
|
if (FS.isDir(node.mode)) { |
|
node.node_ops = MEMFS.ops_table.dir.node; |
|
node.stream_ops = MEMFS.ops_table.dir.stream; |
|
node.contents = {}; |
|
} else if (FS.isFile(node.mode)) { |
|
node.node_ops = MEMFS.ops_table.file.node; |
|
node.stream_ops = MEMFS.ops_table.file.stream; |
|
node.usedBytes = 0; |
|
node.contents = null; |
|
} else if (FS.isLink(node.mode)) { |
|
node.node_ops = MEMFS.ops_table.link.node; |
|
node.stream_ops = MEMFS.ops_table.link.stream; |
|
} else if (FS.isChrdev(node.mode)) { |
|
node.node_ops = MEMFS.ops_table.chrdev.node; |
|
node.stream_ops = MEMFS.ops_table.chrdev.stream; |
|
} |
|
node.timestamp = Date.now(); |
|
if (parent) { |
|
parent.contents[name] = node; |
|
} |
|
return node; |
|
}, |
|
getFileDataAsRegularArray: function (node) { |
|
if (node.contents && node.contents.subarray) { |
|
var arr = []; |
|
for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]); |
|
return arr; |
|
} |
|
return node.contents; |
|
}, |
|
getFileDataAsTypedArray: function (node) { |
|
if (!node.contents) return new Uint8Array(); |
|
if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); |
|
return new Uint8Array(node.contents); |
|
}, |
|
expandFileStorage: function (node, newCapacity) { |
|
if (node.contents && node.contents.subarray && newCapacity > node.contents.length) { |
|
node.contents = MEMFS.getFileDataAsRegularArray(node); |
|
node.usedBytes = node.contents.length; |
|
} |
|
if (!node.contents || node.contents.subarray) { |
|
var prevCapacity = node.contents ? node.contents.length : 0; |
|
if (prevCapacity >= newCapacity) return; |
|
var CAPACITY_DOUBLING_MAX = 1024 * 1024; |
|
newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2 : 1.125)) | 0); |
|
if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); |
|
var oldContents = node.contents; |
|
node.contents = new Uint8Array(newCapacity); |
|
if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); |
|
return; |
|
} |
|
if (!node.contents && newCapacity > 0) node.contents = []; |
|
while (node.contents.length < newCapacity) node.contents.push(0); |
|
}, |
|
resizeFileStorage: function (node, newSize) { |
|
if (node.usedBytes == newSize) return; |
|
if (newSize == 0) { |
|
node.contents = null; |
|
node.usedBytes = 0; |
|
return; |
|
} |
|
if (!node.contents || node.contents.subarray) { |
|
var oldContents = node.contents; |
|
node.contents = new Uint8Array(new ArrayBuffer(newSize)); |
|
if (oldContents) { |
|
node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); |
|
} |
|
node.usedBytes = newSize; |
|
return; |
|
} |
|
if (!node.contents) node.contents = []; |
|
if (node.contents.length > newSize) node.contents.length = newSize; |
|
else while (node.contents.length < newSize) node.contents.push(0); |
|
node.usedBytes = newSize; |
|
}, |
|
node_ops: { |
|
getattr: function (node) { |
|
var attr = {}; |
|
attr.dev = FS.isChrdev(node.mode) ? node.id : 1; |
|
attr.ino = node.id; |
|
attr.mode = node.mode; |
|
attr.nlink = 1; |
|
attr.uid = 0; |
|
attr.gid = 0; |
|
attr.rdev = node.rdev; |
|
if (FS.isDir(node.mode)) { |
|
attr.size = 4096; |
|
} else if (FS.isFile(node.mode)) { |
|
attr.size = node.usedBytes; |
|
} else if (FS.isLink(node.mode)) { |
|
attr.size = node.link.length; |
|
} else { |
|
attr.size = 0; |
|
} |
|
attr.atime = new Date(node.timestamp); |
|
attr.mtime = new Date(node.timestamp); |
|
attr.ctime = new Date(node.timestamp); |
|
attr.blksize = 4096; |
|
attr.blocks = Math.ceil(attr.size / attr.blksize); |
|
return attr; |
|
}, |
|
setattr: function (node, attr) { |
|
if (attr.mode !== undefined) { |
|
node.mode = attr.mode; |
|
} |
|
if (attr.timestamp !== undefined) { |
|
node.timestamp = attr.timestamp; |
|
} |
|
if (attr.size !== undefined) { |
|
MEMFS.resizeFileStorage(node, attr.size); |
|
} |
|
}, |
|
lookup: function (parent, name) { |
|
throw FS.genericErrors[ERRNO_CODES.ENOENT]; |
|
}, |
|
mknod: function (parent, name, mode, dev) { |
|
return MEMFS.createNode(parent, name, mode, dev); |
|
}, |
|
rename: function (old_node, new_dir, new_name) { |
|
if (FS.isDir(old_node.mode)) { |
|
var new_node; |
|
try { |
|
new_node = FS.lookupNode(new_dir, new_name); |
|
} catch (e) {} |
|
if (new_node) { |
|
for (var i in new_node.contents) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); |
|
} |
|
} |
|
} |
|
delete old_node.parent.contents[old_node.name]; |
|
old_node.name = new_name; |
|
new_dir.contents[new_name] = old_node; |
|
old_node.parent = new_dir; |
|
}, |
|
unlink: function (parent, name) { |
|
delete parent.contents[name]; |
|
}, |
|
rmdir: function (parent, name) { |
|
var node = FS.lookupNode(parent, name); |
|
for (var i in node.contents) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); |
|
} |
|
delete parent.contents[name]; |
|
}, |
|
readdir: function (node) { |
|
var entries = [".", ".."]; |
|
for (var key in node.contents) { |
|
if (!node.contents.hasOwnProperty(key)) { |
|
continue; |
|
} |
|
entries.push(key); |
|
} |
|
return entries; |
|
}, |
|
symlink: function (parent, newname, oldpath) { |
|
var node = MEMFS.createNode(parent, newname, 511 | 40960, 0); |
|
node.link = oldpath; |
|
return node; |
|
}, |
|
readlink: function (node) { |
|
if (!FS.isLink(node.mode)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
return node.link; |
|
}, |
|
}, |
|
stream_ops: { |
|
read: function (stream, buffer, offset, length, position) { |
|
var contents = stream.node.contents; |
|
if (position >= stream.node.usedBytes) return 0; |
|
var size = Math.min(stream.node.usedBytes - position, length); |
|
assert(size >= 0); |
|
if (size > 8 && contents.subarray) { |
|
buffer.set(contents.subarray(position, position + size), offset); |
|
} else { |
|
for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]; |
|
} |
|
return size; |
|
}, |
|
write: function (stream, buffer, offset, length, position, canOwn) { |
|
if (!length) return 0; |
|
var node = stream.node; |
|
node.timestamp = Date.now(); |
|
if (buffer.subarray && (!node.contents || node.contents.subarray)) { |
|
if (canOwn) { |
|
node.contents = buffer.subarray(offset, offset + length); |
|
node.usedBytes = length; |
|
return length; |
|
} else if (node.usedBytes === 0 && position === 0) { |
|
node.contents = new Uint8Array(buffer.subarray(offset, offset + length)); |
|
node.usedBytes = length; |
|
return length; |
|
} else if (position + length <= node.usedBytes) { |
|
node.contents.set(buffer.subarray(offset, offset + length), position); |
|
return length; |
|
} |
|
} |
|
MEMFS.expandFileStorage(node, position + length); |
|
if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); |
|
else { |
|
for (var i = 0; i < length; i++) { |
|
node.contents[position + i] = buffer[offset + i]; |
|
} |
|
} |
|
node.usedBytes = Math.max(node.usedBytes, position + length); |
|
return length; |
|
}, |
|
llseek: function (stream, offset, whence) { |
|
var position = offset; |
|
if (whence === 1) { |
|
position += stream.position; |
|
} else if (whence === 2) { |
|
if (FS.isFile(stream.node.mode)) { |
|
position += stream.node.usedBytes; |
|
} |
|
} |
|
if (position < 0) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
return position; |
|
}, |
|
allocate: function (stream, offset, length) { |
|
MEMFS.expandFileStorage(stream.node, offset + length); |
|
stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length); |
|
}, |
|
mmap: function (stream, buffer, offset, length, position, prot, flags) { |
|
if (!FS.isFile(stream.node.mode)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
|
} |
|
var ptr; |
|
var allocated; |
|
var contents = stream.node.contents; |
|
if (!(flags & 2) && (contents.buffer === buffer || contents.buffer === buffer.buffer)) { |
|
allocated = false; |
|
ptr = contents.byteOffset; |
|
} else { |
|
if (position > 0 || position + length < stream.node.usedBytes) { |
|
if (contents.subarray) { |
|
contents = contents.subarray(position, position + length); |
|
} else { |
|
contents = Array.prototype.slice.call(contents, position, position + length); |
|
} |
|
} |
|
allocated = true; |
|
var fromHeap = buffer.buffer == HEAP8.buffer; |
|
ptr = _malloc(length); |
|
if (!ptr) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOMEM); |
|
} |
|
(fromHeap ? HEAP8 : buffer).set(contents, ptr); |
|
} |
|
return { ptr: ptr, allocated: allocated }; |
|
}, |
|
msync: function (stream, buffer, offset, length, mmapFlags) { |
|
if (!FS.isFile(stream.node.mode)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
|
} |
|
if (mmapFlags & 2) { |
|
return 0; |
|
} |
|
var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); |
|
return 0; |
|
}, |
|
}, |
|
}; |
|
var IDBFS = { |
|
dbs: {}, |
|
indexedDB: function () { |
|
if (typeof indexedDB !== "undefined") return indexedDB; |
|
var ret = null; |
|
if (typeof window === "object") ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; |
|
assert(ret, "IDBFS used, but indexedDB not supported"); |
|
return ret; |
|
}, |
|
DB_VERSION: 21, |
|
DB_STORE_NAME: "FILE_DATA", |
|
mount: function (mount) { |
|
return MEMFS.mount.apply(null, arguments); |
|
}, |
|
syncfs: function (mount, populate, callback) { |
|
IDBFS.getLocalSet(mount, function (err, local) { |
|
if (err) return callback(err); |
|
IDBFS.getRemoteSet(mount, function (err, remote) { |
|
if (err) return callback(err); |
|
var src = populate ? remote : local; |
|
var dst = populate ? local : remote; |
|
IDBFS.reconcile(src, dst, callback); |
|
}); |
|
}); |
|
}, |
|
getDB: function (name, callback) { |
|
var db = IDBFS.dbs[name]; |
|
if (db) { |
|
return callback(null, db); |
|
} |
|
var req; |
|
try { |
|
req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION); |
|
} catch (e) { |
|
return callback(e); |
|
} |
|
if (!req) { |
|
return callback("Unable to connect to IndexedDB"); |
|
} |
|
req.onupgradeneeded = function (e) { |
|
var db = e.target.result; |
|
var transaction = e.target.transaction; |
|
var fileStore; |
|
if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) { |
|
fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME); |
|
} else { |
|
fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME); |
|
} |
|
if (!fileStore.indexNames.contains("timestamp")) { |
|
fileStore.createIndex("timestamp", "timestamp", { unique: false }); |
|
} |
|
}; |
|
req.onsuccess = function () { |
|
db = req.result; |
|
IDBFS.dbs[name] = db; |
|
callback(null, db); |
|
}; |
|
req.onerror = function (e) { |
|
callback(this.error); |
|
e.preventDefault(); |
|
}; |
|
}, |
|
getLocalSet: function (mount, callback) { |
|
var entries = {}; |
|
function isRealDir(p) { |
|
return p !== "." && p !== ".."; |
|
} |
|
function toAbsolute(root) { |
|
return function (p) { |
|
return PATH.join2(root, p); |
|
}; |
|
} |
|
var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint)); |
|
while (check.length) { |
|
var path = check.pop(); |
|
var stat; |
|
try { |
|
stat = FS.stat(path); |
|
} catch (e) { |
|
return callback(e); |
|
} |
|
if (FS.isDir(stat.mode)) { |
|
check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path))); |
|
} |
|
entries[path] = { timestamp: stat.mtime }; |
|
} |
|
return callback(null, { type: "local", entries: entries }); |
|
}, |
|
getRemoteSet: function (mount, callback) { |
|
var entries = {}; |
|
IDBFS.getDB(mount.mountpoint, function (err, db) { |
|
if (err) return callback(err); |
|
try { |
|
var transaction = db.transaction([IDBFS.DB_STORE_NAME], "readonly"); |
|
transaction.onerror = function (e) { |
|
callback(this.error); |
|
e.preventDefault(); |
|
}; |
|
var store = transaction.objectStore(IDBFS.DB_STORE_NAME); |
|
var index = store.index("timestamp"); |
|
index.openKeyCursor().onsuccess = function (event) { |
|
var cursor = event.target.result; |
|
if (!cursor) { |
|
return callback(null, { type: "remote", db: db, entries: entries }); |
|
} |
|
entries[cursor.primaryKey] = { timestamp: cursor.key }; |
|
cursor.continue(); |
|
}; |
|
} catch (e) { |
|
return callback(e); |
|
} |
|
}); |
|
}, |
|
loadLocalEntry: function (path, callback) { |
|
var stat, node; |
|
try { |
|
var lookup = FS.lookupPath(path); |
|
node = lookup.node; |
|
stat = FS.stat(path); |
|
} catch (e) { |
|
return callback(e); |
|
} |
|
if (FS.isDir(stat.mode)) { |
|
return callback(null, { timestamp: stat.mtime, mode: stat.mode }); |
|
} else if (FS.isFile(stat.mode)) { |
|
node.contents = MEMFS.getFileDataAsTypedArray(node); |
|
return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents }); |
|
} else { |
|
return callback(new Error("node type not supported")); |
|
} |
|
}, |
|
storeLocalEntry: function (path, entry, callback) { |
|
try { |
|
if (FS.isDir(entry.mode)) { |
|
FS.mkdir(path, entry.mode); |
|
} else if (FS.isFile(entry.mode)) { |
|
FS.writeFile(path, entry.contents, { canOwn: true }); |
|
} else { |
|
return callback(new Error("node type not supported")); |
|
} |
|
FS.chmod(path, entry.mode); |
|
FS.utime(path, entry.timestamp, entry.timestamp); |
|
} catch (e) { |
|
return callback(e); |
|
} |
|
callback(null); |
|
}, |
|
removeLocalEntry: function (path, callback) { |
|
try { |
|
var lookup = FS.lookupPath(path); |
|
var stat = FS.stat(path); |
|
if (FS.isDir(stat.mode)) { |
|
FS.rmdir(path); |
|
} else if (FS.isFile(stat.mode)) { |
|
FS.unlink(path); |
|
} |
|
} catch (e) { |
|
return callback(e); |
|
} |
|
callback(null); |
|
}, |
|
loadRemoteEntry: function (store, path, callback) { |
|
var req = store.get(path); |
|
req.onsuccess = function (event) { |
|
callback(null, event.target.result); |
|
}; |
|
req.onerror = function (e) { |
|
callback(this.error); |
|
e.preventDefault(); |
|
}; |
|
}, |
|
storeRemoteEntry: function (store, path, entry, callback) { |
|
var req = store.put(entry, path); |
|
req.onsuccess = function () { |
|
callback(null); |
|
}; |
|
req.onerror = function (e) { |
|
callback(this.error); |
|
e.preventDefault(); |
|
}; |
|
}, |
|
removeRemoteEntry: function (store, path, callback) { |
|
var req = store.delete(path); |
|
req.onsuccess = function () { |
|
callback(null); |
|
}; |
|
req.onerror = function (e) { |
|
callback(this.error); |
|
e.preventDefault(); |
|
}; |
|
}, |
|
reconcile: function (src, dst, callback) { |
|
var total = 0; |
|
var create = []; |
|
Object.keys(src.entries).forEach(function (key) { |
|
var e = src.entries[key]; |
|
var e2 = dst.entries[key]; |
|
if (!e2 || e.timestamp > e2.timestamp) { |
|
create.push(key); |
|
total++; |
|
} |
|
}); |
|
var remove = []; |
|
Object.keys(dst.entries).forEach(function (key) { |
|
var e = dst.entries[key]; |
|
var e2 = src.entries[key]; |
|
if (!e2) { |
|
remove.push(key); |
|
total++; |
|
} |
|
}); |
|
if (!total) { |
|
return callback(null); |
|
} |
|
var completed = 0; |
|
var db = src.type === "remote" ? src.db : dst.db; |
|
var transaction = db.transaction([IDBFS.DB_STORE_NAME], "readwrite"); |
|
var store = transaction.objectStore(IDBFS.DB_STORE_NAME); |
|
function done(err) { |
|
if (err) { |
|
if (!done.errored) { |
|
done.errored = true; |
|
return callback(err); |
|
} |
|
return; |
|
} |
|
if (++completed >= total) { |
|
return callback(null); |
|
} |
|
} |
|
transaction.onerror = function (e) { |
|
done(this.error); |
|
e.preventDefault(); |
|
}; |
|
create.sort().forEach(function (path) { |
|
if (dst.type === "local") { |
|
IDBFS.loadRemoteEntry(store, path, function (err, entry) { |
|
if (err) return done(err); |
|
IDBFS.storeLocalEntry(path, entry, done); |
|
}); |
|
} else { |
|
IDBFS.loadLocalEntry(path, function (err, entry) { |
|
if (err) return done(err); |
|
IDBFS.storeRemoteEntry(store, path, entry, done); |
|
}); |
|
} |
|
}); |
|
remove |
|
.sort() |
|
.reverse() |
|
.forEach(function (path) { |
|
if (dst.type === "local") { |
|
IDBFS.removeLocalEntry(path, done); |
|
} else { |
|
IDBFS.removeRemoteEntry(store, path, done); |
|
} |
|
}); |
|
}, |
|
}; |
|
var NODEFS = { |
|
isWindows: false, |
|
staticInit: function () { |
|
NODEFS.isWindows = !!process.platform.match(/^win/); |
|
var flags = process["binding"]("constants"); |
|
if (flags["fs"]) { |
|
flags = flags["fs"]; |
|
} |
|
NODEFS.flagsForNodeMap = { "1024": flags["O_APPEND"], "64": flags["O_CREAT"], "128": flags["O_EXCL"], "0": flags["O_RDONLY"], "2": flags["O_RDWR"], "4096": flags["O_SYNC"], "512": flags["O_TRUNC"], "1": flags["O_WRONLY"] }; |
|
}, |
|
bufferFrom: function (arrayBuffer) { |
|
return Buffer.alloc ? Buffer.from(arrayBuffer) : new Buffer(arrayBuffer); |
|
}, |
|
mount: function (mount) { |
|
assert(ENVIRONMENT_IS_NODE); |
|
return NODEFS.createNode(null, "/", NODEFS.getMode(mount.opts.root), 0); |
|
}, |
|
createNode: function (parent, name, mode, dev) { |
|
if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
var node = FS.createNode(parent, name, mode); |
|
node.node_ops = NODEFS.node_ops; |
|
node.stream_ops = NODEFS.stream_ops; |
|
return node; |
|
}, |
|
getMode: function (path) { |
|
var stat; |
|
try { |
|
stat = fs.lstatSync(path); |
|
if (NODEFS.isWindows) { |
|
stat.mode = stat.mode | ((stat.mode & 292) >> 2); |
|
} |
|
} catch (e) { |
|
if (!e.code) throw e; |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
return stat.mode; |
|
}, |
|
realPath: function (node) { |
|
var parts = []; |
|
while (node.parent !== node) { |
|
parts.push(node.name); |
|
node = node.parent; |
|
} |
|
parts.push(node.mount.opts.root); |
|
parts.reverse(); |
|
return PATH.join.apply(null, parts); |
|
}, |
|
flagsForNode: function (flags) { |
|
flags &= ~2097152; |
|
flags &= ~2048; |
|
flags &= ~32768; |
|
flags &= ~524288; |
|
var newFlags = 0; |
|
for (var k in NODEFS.flagsForNodeMap) { |
|
if (flags & k) { |
|
newFlags |= NODEFS.flagsForNodeMap[k]; |
|
flags ^= k; |
|
} |
|
} |
|
if (!flags) { |
|
return newFlags; |
|
} else { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
}, |
|
node_ops: { |
|
getattr: function (node) { |
|
var path = NODEFS.realPath(node); |
|
var stat; |
|
try { |
|
stat = fs.lstatSync(path); |
|
} catch (e) { |
|
if (!e.code) throw e; |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
if (NODEFS.isWindows && !stat.blksize) { |
|
stat.blksize = 4096; |
|
} |
|
if (NODEFS.isWindows && !stat.blocks) { |
|
stat.blocks = ((stat.size + stat.blksize - 1) / stat.blksize) | 0; |
|
} |
|
return { |
|
dev: stat.dev, |
|
ino: stat.ino, |
|
mode: stat.mode, |
|
nlink: stat.nlink, |
|
uid: stat.uid, |
|
gid: stat.gid, |
|
rdev: stat.rdev, |
|
size: stat.size, |
|
atime: stat.atime, |
|
mtime: stat.mtime, |
|
ctime: stat.ctime, |
|
blksize: stat.blksize, |
|
blocks: stat.blocks, |
|
}; |
|
}, |
|
setattr: function (node, attr) { |
|
var path = NODEFS.realPath(node); |
|
try { |
|
if (attr.mode !== undefined) { |
|
fs.chmodSync(path, attr.mode); |
|
node.mode = attr.mode; |
|
} |
|
if (attr.timestamp !== undefined) { |
|
var date = new Date(attr.timestamp); |
|
fs.utimesSync(path, date, date); |
|
} |
|
if (attr.size !== undefined) { |
|
fs.truncateSync(path, attr.size); |
|
} |
|
} catch (e) { |
|
if (!e.code) throw e; |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
}, |
|
lookup: function (parent, name) { |
|
var path = PATH.join2(NODEFS.realPath(parent), name); |
|
var mode = NODEFS.getMode(path); |
|
return NODEFS.createNode(parent, name, mode); |
|
}, |
|
mknod: function (parent, name, mode, dev) { |
|
var node = NODEFS.createNode(parent, name, mode, dev); |
|
var path = NODEFS.realPath(node); |
|
try { |
|
if (FS.isDir(node.mode)) { |
|
fs.mkdirSync(path, node.mode); |
|
} else { |
|
fs.writeFileSync(path, "", { mode: node.mode }); |
|
} |
|
} catch (e) { |
|
if (!e.code) throw e; |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
return node; |
|
}, |
|
rename: function (oldNode, newDir, newName) { |
|
var oldPath = NODEFS.realPath(oldNode); |
|
var newPath = PATH.join2(NODEFS.realPath(newDir), newName); |
|
try { |
|
fs.renameSync(oldPath, newPath); |
|
} catch (e) { |
|
if (!e.code) throw e; |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
}, |
|
unlink: function (parent, name) { |
|
var path = PATH.join2(NODEFS.realPath(parent), name); |
|
try { |
|
fs.unlinkSync(path); |
|
} catch (e) { |
|
if (!e.code) throw e; |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
}, |
|
rmdir: function (parent, name) { |
|
var path = PATH.join2(NODEFS.realPath(parent), name); |
|
try { |
|
fs.rmdirSync(path); |
|
} catch (e) { |
|
if (!e.code) throw e; |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
}, |
|
readdir: function (node) { |
|
var path = NODEFS.realPath(node); |
|
try { |
|
return fs.readdirSync(path); |
|
} catch (e) { |
|
if (!e.code) throw e; |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
}, |
|
symlink: function (parent, newName, oldPath) { |
|
var newPath = PATH.join2(NODEFS.realPath(parent), newName); |
|
try { |
|
fs.symlinkSync(oldPath, newPath); |
|
} catch (e) { |
|
if (!e.code) throw e; |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
}, |
|
readlink: function (node) { |
|
var path = NODEFS.realPath(node); |
|
try { |
|
path = fs.readlinkSync(path); |
|
path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path); |
|
return path; |
|
} catch (e) { |
|
if (!e.code) throw e; |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
}, |
|
}, |
|
stream_ops: { |
|
open: function (stream) { |
|
var path = NODEFS.realPath(stream.node); |
|
try { |
|
if (FS.isFile(stream.node.mode)) { |
|
stream.nfd = fs.openSync(path, NODEFS.flagsForNode(stream.flags)); |
|
} |
|
} catch (e) { |
|
if (!e.code) throw e; |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
}, |
|
close: function (stream) { |
|
try { |
|
if (FS.isFile(stream.node.mode) && stream.nfd) { |
|
fs.closeSync(stream.nfd); |
|
} |
|
} catch (e) { |
|
if (!e.code) throw e; |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
}, |
|
read: function (stream, buffer, offset, length, position) { |
|
if (length === 0) return 0; |
|
try { |
|
return fs.readSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position); |
|
} catch (e) { |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
}, |
|
write: function (stream, buffer, offset, length, position) { |
|
try { |
|
return fs.writeSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position); |
|
} catch (e) { |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
}, |
|
llseek: function (stream, offset, whence) { |
|
var position = offset; |
|
if (whence === 1) { |
|
position += stream.position; |
|
} else if (whence === 2) { |
|
if (FS.isFile(stream.node.mode)) { |
|
try { |
|
var stat = fs.fstatSync(stream.nfd); |
|
position += stat.size; |
|
} catch (e) { |
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]); |
|
} |
|
} |
|
} |
|
if (position < 0) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
return position; |
|
}, |
|
}, |
|
}; |
|
var WORKERFS = { |
|
DIR_MODE: 16895, |
|
FILE_MODE: 33279, |
|
reader: null, |
|
mount: function (mount) { |
|
assert(ENVIRONMENT_IS_WORKER); |
|
if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync(); |
|
var root = WORKERFS.createNode(null, "/", WORKERFS.DIR_MODE, 0); |
|
var createdParents = {}; |
|
function ensureParent(path) { |
|
var parts = path.split("/"); |
|
var parent = root; |
|
for (var i = 0; i < parts.length - 1; i++) { |
|
var curr = parts.slice(0, i + 1).join("/"); |
|
if (!createdParents[curr]) { |
|
createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0); |
|
} |
|
parent = createdParents[curr]; |
|
} |
|
return parent; |
|
} |
|
function base(path) { |
|
var parts = path.split("/"); |
|
return parts[parts.length - 1]; |
|
} |
|
Array.prototype.forEach.call(mount.opts["files"] || [], function (file) { |
|
WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate); |
|
}); |
|
(mount.opts["blobs"] || []).forEach(function (obj) { |
|
WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]); |
|
}); |
|
(mount.opts["packages"] || []).forEach(function (pack) { |
|
pack["metadata"].files.forEach(function (file) { |
|
var name = file.filename.substr(1); |
|
WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack["blob"].slice(file.start, file.end)); |
|
}); |
|
}); |
|
return root; |
|
}, |
|
createNode: function (parent, name, mode, dev, contents, mtime) { |
|
var node = FS.createNode(parent, name, mode); |
|
node.mode = mode; |
|
node.node_ops = WORKERFS.node_ops; |
|
node.stream_ops = WORKERFS.stream_ops; |
|
node.timestamp = (mtime || new Date()).getTime(); |
|
assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE); |
|
if (mode === WORKERFS.FILE_MODE) { |
|
node.size = contents.size; |
|
node.contents = contents; |
|
} else { |
|
node.size = 4096; |
|
node.contents = {}; |
|
} |
|
if (parent) { |
|
parent.contents[name] = node; |
|
} |
|
return node; |
|
}, |
|
node_ops: { |
|
getattr: function (node) { |
|
return { |
|
dev: 1, |
|
ino: undefined, |
|
mode: node.mode, |
|
nlink: 1, |
|
uid: 0, |
|
gid: 0, |
|
rdev: undefined, |
|
size: node.size, |
|
atime: new Date(node.timestamp), |
|
mtime: new Date(node.timestamp), |
|
ctime: new Date(node.timestamp), |
|
blksize: 4096, |
|
blocks: Math.ceil(node.size / 4096), |
|
}; |
|
}, |
|
setattr: function (node, attr) { |
|
if (attr.mode !== undefined) { |
|
node.mode = attr.mode; |
|
} |
|
if (attr.timestamp !== undefined) { |
|
node.timestamp = attr.timestamp; |
|
} |
|
}, |
|
lookup: function (parent, name) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
|
}, |
|
mknod: function (parent, name, mode, dev) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
}, |
|
rename: function (oldNode, newDir, newName) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
}, |
|
unlink: function (parent, name) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
}, |
|
rmdir: function (parent, name) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
}, |
|
readdir: function (node) { |
|
var entries = [".", ".."]; |
|
for (var key in node.contents) { |
|
if (!node.contents.hasOwnProperty(key)) { |
|
continue; |
|
} |
|
entries.push(key); |
|
} |
|
return entries; |
|
}, |
|
symlink: function (parent, newName, oldPath) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
}, |
|
readlink: function (node) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
}, |
|
}, |
|
stream_ops: { |
|
read: function (stream, buffer, offset, length, position) { |
|
if (position >= stream.node.size) return 0; |
|
var chunk = stream.node.contents.slice(position, position + length); |
|
var ab = WORKERFS.reader.readAsArrayBuffer(chunk); |
|
buffer.set(new Uint8Array(ab), offset); |
|
return chunk.size; |
|
}, |
|
write: function (stream, buffer, offset, length, position) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EIO); |
|
}, |
|
llseek: function (stream, offset, whence) { |
|
var position = offset; |
|
if (whence === 1) { |
|
position += stream.position; |
|
} else if (whence === 2) { |
|
if (FS.isFile(stream.node.mode)) { |
|
position += stream.node.size; |
|
} |
|
} |
|
if (position < 0) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
return position; |
|
}, |
|
}, |
|
}; |
|
STATICTOP += 16; |
|
STATICTOP += 16; |
|
STATICTOP += 16; |
|
var FS = { |
|
root: null, |
|
mounts: [], |
|
devices: {}, |
|
streams: [], |
|
nextInode: 1, |
|
nameTable: null, |
|
currentPath: "/", |
|
initialized: false, |
|
ignorePermissions: true, |
|
trackingDelegate: {}, |
|
tracking: { openFlags: { READ: 1, WRITE: 2 } }, |
|
ErrnoError: null, |
|
genericErrors: {}, |
|
filesystems: null, |
|
syncFSRequests: 0, |
|
handleFSError: function (e) { |
|
if (!(e instanceof FS.ErrnoError)) throw e + " : " + stackTrace(); |
|
return ___setErrNo(e.errno); |
|
}, |
|
lookupPath: function (path, opts) { |
|
path = PATH.resolve(FS.cwd(), path); |
|
opts = opts || {}; |
|
if (!path) return { path: "", node: null }; |
|
var defaults = { follow_mount: true, recurse_count: 0 }; |
|
for (var key in defaults) { |
|
if (opts[key] === undefined) { |
|
opts[key] = defaults[key]; |
|
} |
|
} |
|
if (opts.recurse_count > 8) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ELOOP); |
|
} |
|
var parts = PATH.normalizeArray( |
|
path.split("/").filter(function (p) { |
|
return !!p; |
|
}), |
|
false |
|
); |
|
var current = FS.root; |
|
var current_path = "/"; |
|
for (var i = 0; i < parts.length; i++) { |
|
var islast = i === parts.length - 1; |
|
if (islast && opts.parent) { |
|
break; |
|
} |
|
current = FS.lookupNode(current, parts[i]); |
|
current_path = PATH.join2(current_path, parts[i]); |
|
if (FS.isMountpoint(current)) { |
|
if (!islast || (islast && opts.follow_mount)) { |
|
current = current.mounted.root; |
|
} |
|
} |
|
if (!islast || opts.follow) { |
|
var count = 0; |
|
while (FS.isLink(current.mode)) { |
|
var link = FS.readlink(current_path); |
|
current_path = PATH.resolve(PATH.dirname(current_path), link); |
|
var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count }); |
|
current = lookup.node; |
|
if (count++ > 40) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ELOOP); |
|
} |
|
} |
|
} |
|
} |
|
return { path: current_path, node: current }; |
|
}, |
|
getPath: function (node) { |
|
var path; |
|
while (true) { |
|
if (FS.isRoot(node)) { |
|
var mount = node.mount.mountpoint; |
|
if (!path) return mount; |
|
return mount[mount.length - 1] !== "/" ? mount + "/" + path : mount + path; |
|
} |
|
path = path ? node.name + "/" + path : node.name; |
|
node = node.parent; |
|
} |
|
}, |
|
hashName: function (parentid, name) { |
|
var hash = 0; |
|
for (var i = 0; i < name.length; i++) { |
|
hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0; |
|
} |
|
return ((parentid + hash) >>> 0) % FS.nameTable.length; |
|
}, |
|
hashAddNode: function (node) { |
|
var hash = FS.hashName(node.parent.id, node.name); |
|
node.name_next = FS.nameTable[hash]; |
|
FS.nameTable[hash] = node; |
|
}, |
|
hashRemoveNode: function (node) { |
|
var hash = FS.hashName(node.parent.id, node.name); |
|
if (FS.nameTable[hash] === node) { |
|
FS.nameTable[hash] = node.name_next; |
|
} else { |
|
var current = FS.nameTable[hash]; |
|
while (current) { |
|
if (current.name_next === node) { |
|
current.name_next = node.name_next; |
|
break; |
|
} |
|
current = current.name_next; |
|
} |
|
} |
|
}, |
|
lookupNode: function (parent, name) { |
|
var err = FS.mayLookup(parent); |
|
if (err) { |
|
throw new FS.ErrnoError(err, parent); |
|
} |
|
var hash = FS.hashName(parent.id, name); |
|
for (var node = FS.nameTable[hash]; node; node = node.name_next) { |
|
var nodeName = node.name; |
|
if (node.parent.id === parent.id && nodeName === name) { |
|
return node; |
|
} |
|
} |
|
return FS.lookup(parent, name); |
|
}, |
|
createNode: function (parent, name, mode, rdev) { |
|
if (!FS.FSNode) { |
|
FS.FSNode = function (parent, name, mode, rdev) { |
|
if (!parent) { |
|
parent = this; |
|
} |
|
this.parent = parent; |
|
this.mount = parent.mount; |
|
this.mounted = null; |
|
this.id = FS.nextInode++; |
|
this.name = name; |
|
this.mode = mode; |
|
this.node_ops = {}; |
|
this.stream_ops = {}; |
|
this.rdev = rdev; |
|
}; |
|
FS.FSNode.prototype = {}; |
|
var readMode = 292 | 73; |
|
var writeMode = 146; |
|
Object.defineProperties(FS.FSNode.prototype, { |
|
read: { |
|
get: function () { |
|
return (this.mode & readMode) === readMode; |
|
}, |
|
set: function (val) { |
|
val ? (this.mode |= readMode) : (this.mode &= ~readMode); |
|
}, |
|
}, |
|
write: { |
|
get: function () { |
|
return (this.mode & writeMode) === writeMode; |
|
}, |
|
set: function (val) { |
|
val ? (this.mode |= writeMode) : (this.mode &= ~writeMode); |
|
}, |
|
}, |
|
isFolder: { |
|
get: function () { |
|
return FS.isDir(this.mode); |
|
}, |
|
}, |
|
isDevice: { |
|
get: function () { |
|
return FS.isChrdev(this.mode); |
|
}, |
|
}, |
|
}); |
|
} |
|
var node = new FS.FSNode(parent, name, mode, rdev); |
|
FS.hashAddNode(node); |
|
return node; |
|
}, |
|
destroyNode: function (node) { |
|
FS.hashRemoveNode(node); |
|
}, |
|
isRoot: function (node) { |
|
return node === node.parent; |
|
}, |
|
isMountpoint: function (node) { |
|
return !!node.mounted; |
|
}, |
|
isFile: function (mode) { |
|
return (mode & 61440) === 32768; |
|
}, |
|
isDir: function (mode) { |
|
return (mode & 61440) === 16384; |
|
}, |
|
isLink: function (mode) { |
|
return (mode & 61440) === 40960; |
|
}, |
|
isChrdev: function (mode) { |
|
return (mode & 61440) === 8192; |
|
}, |
|
isBlkdev: function (mode) { |
|
return (mode & 61440) === 24576; |
|
}, |
|
isFIFO: function (mode) { |
|
return (mode & 61440) === 4096; |
|
}, |
|
isSocket: function (mode) { |
|
return (mode & 49152) === 49152; |
|
}, |
|
flagModes: { r: 0, rs: 1052672, "r+": 2, w: 577, wx: 705, xw: 705, "w+": 578, "wx+": 706, "xw+": 706, a: 1089, ax: 1217, xa: 1217, "a+": 1090, "ax+": 1218, "xa+": 1218 }, |
|
modeStringToFlags: function (str) { |
|
var flags = FS.flagModes[str]; |
|
if (typeof flags === "undefined") { |
|
throw new Error("Unknown file open mode: " + str); |
|
} |
|
return flags; |
|
}, |
|
flagsToPermissionString: function (flag) { |
|
var perms = ["r", "w", "rw"][flag & 3]; |
|
if (flag & 512) { |
|
perms += "w"; |
|
} |
|
return perms; |
|
}, |
|
nodePermissions: function (node, perms) { |
|
if (FS.ignorePermissions) { |
|
return 0; |
|
} |
|
if (perms.indexOf("r") !== -1 && !(node.mode & 292)) { |
|
return ERRNO_CODES.EACCES; |
|
} else if (perms.indexOf("w") !== -1 && !(node.mode & 146)) { |
|
return ERRNO_CODES.EACCES; |
|
} else if (perms.indexOf("x") !== -1 && !(node.mode & 73)) { |
|
return ERRNO_CODES.EACCES; |
|
} |
|
return 0; |
|
}, |
|
mayLookup: function (dir) { |
|
var err = FS.nodePermissions(dir, "x"); |
|
if (err) return err; |
|
if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES; |
|
return 0; |
|
}, |
|
mayCreate: function (dir, name) { |
|
try { |
|
var node = FS.lookupNode(dir, name); |
|
return ERRNO_CODES.EEXIST; |
|
} catch (e) {} |
|
return FS.nodePermissions(dir, "wx"); |
|
}, |
|
mayDelete: function (dir, name, isdir) { |
|
var node; |
|
try { |
|
node = FS.lookupNode(dir, name); |
|
} catch (e) { |
|
return e.errno; |
|
} |
|
var err = FS.nodePermissions(dir, "wx"); |
|
if (err) { |
|
return err; |
|
} |
|
if (isdir) { |
|
if (!FS.isDir(node.mode)) { |
|
return ERRNO_CODES.ENOTDIR; |
|
} |
|
if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { |
|
return ERRNO_CODES.EBUSY; |
|
} |
|
} else { |
|
if (FS.isDir(node.mode)) { |
|
return ERRNO_CODES.EISDIR; |
|
} |
|
} |
|
return 0; |
|
}, |
|
mayOpen: function (node, flags) { |
|
if (!node) { |
|
return ERRNO_CODES.ENOENT; |
|
} |
|
if (FS.isLink(node.mode)) { |
|
return ERRNO_CODES.ELOOP; |
|
} else if (FS.isDir(node.mode)) { |
|
if (FS.flagsToPermissionString(flags) !== "r" || flags & 512) { |
|
return ERRNO_CODES.EISDIR; |
|
} |
|
} |
|
return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); |
|
}, |
|
MAX_OPEN_FDS: 4096, |
|
nextfd: function (fd_start, fd_end) { |
|
fd_start = fd_start || 0; |
|
fd_end = fd_end || FS.MAX_OPEN_FDS; |
|
for (var fd = fd_start; fd <= fd_end; fd++) { |
|
if (!FS.streams[fd]) { |
|
return fd; |
|
} |
|
} |
|
throw new FS.ErrnoError(ERRNO_CODES.EMFILE); |
|
}, |
|
getStream: function (fd) { |
|
return FS.streams[fd]; |
|
}, |
|
createStream: function (stream, fd_start, fd_end) { |
|
if (!FS.FSStream) { |
|
FS.FSStream = function () {}; |
|
FS.FSStream.prototype = {}; |
|
Object.defineProperties(FS.FSStream.prototype, { |
|
object: { |
|
get: function () { |
|
return this.node; |
|
}, |
|
set: function (val) { |
|
this.node = val; |
|
}, |
|
}, |
|
isRead: { |
|
get: function () { |
|
return (this.flags & 2097155) !== 1; |
|
}, |
|
}, |
|
isWrite: { |
|
get: function () { |
|
return (this.flags & 2097155) !== 0; |
|
}, |
|
}, |
|
isAppend: { |
|
get: function () { |
|
return this.flags & 1024; |
|
}, |
|
}, |
|
}); |
|
} |
|
var newStream = new FS.FSStream(); |
|
for (var p in stream) { |
|
newStream[p] = stream[p]; |
|
} |
|
stream = newStream; |
|
var fd = FS.nextfd(fd_start, fd_end); |
|
stream.fd = fd; |
|
FS.streams[fd] = stream; |
|
return stream; |
|
}, |
|
closeStream: function (fd) { |
|
FS.streams[fd] = null; |
|
}, |
|
chrdev_stream_ops: { |
|
open: function (stream) { |
|
var device = FS.getDevice(stream.node.rdev); |
|
stream.stream_ops = device.stream_ops; |
|
if (stream.stream_ops.open) { |
|
stream.stream_ops.open(stream); |
|
} |
|
}, |
|
llseek: function () { |
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); |
|
}, |
|
}, |
|
major: function (dev) { |
|
return dev >> 8; |
|
}, |
|
minor: function (dev) { |
|
return dev & 255; |
|
}, |
|
makedev: function (ma, mi) { |
|
return (ma << 8) | mi; |
|
}, |
|
registerDevice: function (dev, ops) { |
|
FS.devices[dev] = { stream_ops: ops }; |
|
}, |
|
getDevice: function (dev) { |
|
return FS.devices[dev]; |
|
}, |
|
getMounts: function (mount) { |
|
var mounts = []; |
|
var check = [mount]; |
|
while (check.length) { |
|
var m = check.pop(); |
|
mounts.push(m); |
|
check.push.apply(check, m.mounts); |
|
} |
|
return mounts; |
|
}, |
|
syncfs: function (populate, callback) { |
|
if (typeof populate === "function") { |
|
callback = populate; |
|
populate = false; |
|
} |
|
FS.syncFSRequests++; |
|
if (FS.syncFSRequests > 1) { |
|
console.log("warning: " + FS.syncFSRequests + " FS.syncfs operations in flight at once, probably just doing extra work"); |
|
} |
|
var mounts = FS.getMounts(FS.root.mount); |
|
var completed = 0; |
|
function doCallback(err) { |
|
assert(FS.syncFSRequests > 0); |
|
FS.syncFSRequests--; |
|
return callback(err); |
|
} |
|
function done(err) { |
|
if (err) { |
|
if (!done.errored) { |
|
done.errored = true; |
|
return doCallback(err); |
|
} |
|
return; |
|
} |
|
if (++completed >= mounts.length) { |
|
doCallback(null); |
|
} |
|
} |
|
mounts.forEach(function (mount) { |
|
if (!mount.type.syncfs) { |
|
return done(null); |
|
} |
|
mount.type.syncfs(mount, populate, done); |
|
}); |
|
}, |
|
mount: function (type, opts, mountpoint) { |
|
var root = mountpoint === "/"; |
|
var pseudo = !mountpoint; |
|
var node; |
|
if (root && FS.root) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
|
} else if (!root && !pseudo) { |
|
var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); |
|
mountpoint = lookup.path; |
|
node = lookup.node; |
|
if (FS.isMountpoint(node)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
|
} |
|
if (!FS.isDir(node.mode)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); |
|
} |
|
} |
|
var mount = { type: type, opts: opts, mountpoint: mountpoint, mounts: [] }; |
|
var mountRoot = type.mount(mount); |
|
mountRoot.mount = mount; |
|
mount.root = mountRoot; |
|
if (root) { |
|
FS.root = mountRoot; |
|
} else if (node) { |
|
node.mounted = mount; |
|
if (node.mount) { |
|
node.mount.mounts.push(mount); |
|
} |
|
} |
|
return mountRoot; |
|
}, |
|
unmount: function (mountpoint) { |
|
var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); |
|
if (!FS.isMountpoint(lookup.node)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
var node = lookup.node; |
|
var mount = node.mounted; |
|
var mounts = FS.getMounts(mount); |
|
Object.keys(FS.nameTable).forEach(function (hash) { |
|
var current = FS.nameTable[hash]; |
|
while (current) { |
|
var next = current.name_next; |
|
if (mounts.indexOf(current.mount) !== -1) { |
|
FS.destroyNode(current); |
|
} |
|
current = next; |
|
} |
|
}); |
|
node.mounted = null; |
|
var idx = node.mount.mounts.indexOf(mount); |
|
assert(idx !== -1); |
|
node.mount.mounts.splice(idx, 1); |
|
}, |
|
lookup: function (parent, name) { |
|
return parent.node_ops.lookup(parent, name); |
|
}, |
|
mknod: function (path, mode, dev) { |
|
var lookup = FS.lookupPath(path, { parent: true }); |
|
var parent = lookup.node; |
|
var name = PATH.basename(path); |
|
if (!name || name === "." || name === "..") { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
var err = FS.mayCreate(parent, name); |
|
if (err) { |
|
throw new FS.ErrnoError(err); |
|
} |
|
if (!parent.node_ops.mknod) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
} |
|
return parent.node_ops.mknod(parent, name, mode, dev); |
|
}, |
|
create: function (path, mode) { |
|
mode = mode !== undefined ? mode : 438; |
|
mode &= 4095; |
|
mode |= 32768; |
|
return FS.mknod(path, mode, 0); |
|
}, |
|
mkdir: function (path, mode) { |
|
mode = mode !== undefined ? mode : 511; |
|
mode &= 511 | 512; |
|
mode |= 16384; |
|
return FS.mknod(path, mode, 0); |
|
}, |
|
mkdirTree: function (path, mode) { |
|
var dirs = path.split("/"); |
|
var d = ""; |
|
for (var i = 0; i < dirs.length; ++i) { |
|
if (!dirs[i]) continue; |
|
d += "/" + dirs[i]; |
|
try { |
|
FS.mkdir(d, mode); |
|
} catch (e) { |
|
if (e.errno != ERRNO_CODES.EEXIST) throw e; |
|
} |
|
} |
|
}, |
|
mkdev: function (path, mode, dev) { |
|
if (typeof dev === "undefined") { |
|
dev = mode; |
|
mode = 438; |
|
} |
|
mode |= 8192; |
|
return FS.mknod(path, mode, dev); |
|
}, |
|
symlink: function (oldpath, newpath) { |
|
if (!PATH.resolve(oldpath)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
|
} |
|
var lookup = FS.lookupPath(newpath, { parent: true }); |
|
var parent = lookup.node; |
|
if (!parent) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
|
} |
|
var newname = PATH.basename(newpath); |
|
var err = FS.mayCreate(parent, newname); |
|
if (err) { |
|
throw new FS.ErrnoError(err); |
|
} |
|
if (!parent.node_ops.symlink) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
} |
|
return parent.node_ops.symlink(parent, newname, oldpath); |
|
}, |
|
rename: function (old_path, new_path) { |
|
var old_dirname = PATH.dirname(old_path); |
|
var new_dirname = PATH.dirname(new_path); |
|
var old_name = PATH.basename(old_path); |
|
var new_name = PATH.basename(new_path); |
|
var lookup, old_dir, new_dir; |
|
try { |
|
lookup = FS.lookupPath(old_path, { parent: true }); |
|
old_dir = lookup.node; |
|
lookup = FS.lookupPath(new_path, { parent: true }); |
|
new_dir = lookup.node; |
|
} catch (e) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
|
} |
|
if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
|
if (old_dir.mount !== new_dir.mount) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EXDEV); |
|
} |
|
var old_node = FS.lookupNode(old_dir, old_name); |
|
var relative = PATH.relative(old_path, new_dirname); |
|
if (relative.charAt(0) !== ".") { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
relative = PATH.relative(new_path, old_dirname); |
|
if (relative.charAt(0) !== ".") { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); |
|
} |
|
var new_node; |
|
try { |
|
new_node = FS.lookupNode(new_dir, new_name); |
|
} catch (e) {} |
|
if (old_node === new_node) { |
|
return; |
|
} |
|
var isdir = FS.isDir(old_node.mode); |
|
var err = FS.mayDelete(old_dir, old_name, isdir); |
|
if (err) { |
|
throw new FS.ErrnoError(err); |
|
} |
|
err = new_node ? FS.mayDelete(new_dir, new_name, isdir) : FS.mayCreate(new_dir, new_name); |
|
if (err) { |
|
throw new FS.ErrnoError(err); |
|
} |
|
if (!old_dir.node_ops.rename) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
} |
|
if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
|
} |
|
if (new_dir !== old_dir) { |
|
err = FS.nodePermissions(old_dir, "w"); |
|
if (err) { |
|
throw new FS.ErrnoError(err); |
|
} |
|
} |
|
try { |
|
if (FS.trackingDelegate["willMovePath"]) { |
|
FS.trackingDelegate["willMovePath"](old_path, new_path); |
|
} |
|
} catch (e) { |
|
console.log("FS.trackingDelegate['willMovePath']('" + old_path + "', '" + new_path + "') threw an exception: " + e.message); |
|
} |
|
FS.hashRemoveNode(old_node); |
|
try { |
|
old_dir.node_ops.rename(old_node, new_dir, new_name); |
|
} catch (e) { |
|
throw e; |
|
} finally { |
|
FS.hashAddNode(old_node); |
|
} |
|
try { |
|
if (FS.trackingDelegate["onMovePath"]) FS.trackingDelegate["onMovePath"](old_path, new_path); |
|
} catch (e) { |
|
console.log("FS.trackingDelegate['onMovePath']('" + old_path + "', '" + new_path + "') threw an exception: " + e.message); |
|
} |
|
}, |
|
rmdir: function (path) { |
|
var lookup = FS.lookupPath(path, { parent: true }); |
|
var parent = lookup.node; |
|
var name = PATH.basename(path); |
|
var node = FS.lookupNode(parent, name); |
|
var err = FS.mayDelete(parent, name, true); |
|
if (err) { |
|
throw new FS.ErrnoError(err); |
|
} |
|
if (!parent.node_ops.rmdir) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
} |
|
if (FS.isMountpoint(node)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
|
} |
|
try { |
|
if (FS.trackingDelegate["willDeletePath"]) { |
|
FS.trackingDelegate["willDeletePath"](path); |
|
} |
|
} catch (e) { |
|
console.log("FS.trackingDelegate['willDeletePath']('" + path + "') threw an exception: " + e.message); |
|
} |
|
parent.node_ops.rmdir(parent, name); |
|
FS.destroyNode(node); |
|
try { |
|
if (FS.trackingDelegate["onDeletePath"]) FS.trackingDelegate["onDeletePath"](path); |
|
} catch (e) { |
|
console.log("FS.trackingDelegate['onDeletePath']('" + path + "') threw an exception: " + e.message); |
|
} |
|
}, |
|
readdir: function (path) { |
|
var lookup = FS.lookupPath(path, { follow: true }); |
|
var node = lookup.node; |
|
if (!node.node_ops.readdir) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); |
|
} |
|
return node.node_ops.readdir(node); |
|
}, |
|
unlink: function (path) { |
|
var lookup = FS.lookupPath(path, { parent: true }); |
|
var parent = lookup.node; |
|
var name = PATH.basename(path); |
|
var node = FS.lookupNode(parent, name); |
|
var err = FS.mayDelete(parent, name, false); |
|
if (err) { |
|
throw new FS.ErrnoError(err); |
|
} |
|
if (!parent.node_ops.unlink) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
} |
|
if (FS.isMountpoint(node)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY); |
|
} |
|
try { |
|
if (FS.trackingDelegate["willDeletePath"]) { |
|
FS.trackingDelegate["willDeletePath"](path); |
|
} |
|
} catch (e) { |
|
console.log("FS.trackingDelegate['willDeletePath']('" + path + "') threw an exception: " + e.message); |
|
} |
|
parent.node_ops.unlink(parent, name); |
|
FS.destroyNode(node); |
|
try { |
|
if (FS.trackingDelegate["onDeletePath"]) FS.trackingDelegate["onDeletePath"](path); |
|
} catch (e) { |
|
console.log("FS.trackingDelegate['onDeletePath']('" + path + "') threw an exception: " + e.message); |
|
} |
|
}, |
|
readlink: function (path) { |
|
var lookup = FS.lookupPath(path); |
|
var link = lookup.node; |
|
if (!link) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
|
} |
|
if (!link.node_ops.readlink) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)); |
|
}, |
|
stat: function (path, dontFollow) { |
|
var lookup = FS.lookupPath(path, { follow: !dontFollow }); |
|
var node = lookup.node; |
|
if (!node) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
|
} |
|
if (!node.node_ops.getattr) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
} |
|
return node.node_ops.getattr(node); |
|
}, |
|
lstat: function (path) { |
|
return FS.stat(path, true); |
|
}, |
|
chmod: function (path, mode, dontFollow) { |
|
var node; |
|
if (typeof path === "string") { |
|
var lookup = FS.lookupPath(path, { follow: !dontFollow }); |
|
node = lookup.node; |
|
} else { |
|
node = path; |
|
} |
|
if (!node.node_ops.setattr) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
} |
|
node.node_ops.setattr(node, { mode: (mode & 4095) | (node.mode & ~4095), timestamp: Date.now() }); |
|
}, |
|
lchmod: function (path, mode) { |
|
FS.chmod(path, mode, true); |
|
}, |
|
fchmod: function (fd, mode) { |
|
var stream = FS.getStream(fd); |
|
if (!stream) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
} |
|
FS.chmod(stream.node, mode); |
|
}, |
|
chown: function (path, uid, gid, dontFollow) { |
|
var node; |
|
if (typeof path === "string") { |
|
var lookup = FS.lookupPath(path, { follow: !dontFollow }); |
|
node = lookup.node; |
|
} else { |
|
node = path; |
|
} |
|
if (!node.node_ops.setattr) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
} |
|
node.node_ops.setattr(node, { timestamp: Date.now() }); |
|
}, |
|
lchown: function (path, uid, gid) { |
|
FS.chown(path, uid, gid, true); |
|
}, |
|
fchown: function (fd, uid, gid) { |
|
var stream = FS.getStream(fd); |
|
if (!stream) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
} |
|
FS.chown(stream.node, uid, gid); |
|
}, |
|
truncate: function (path, len) { |
|
if (len < 0) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
var node; |
|
if (typeof path === "string") { |
|
var lookup = FS.lookupPath(path, { follow: true }); |
|
node = lookup.node; |
|
} else { |
|
node = path; |
|
} |
|
if (!node.node_ops.setattr) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM); |
|
} |
|
if (FS.isDir(node.mode)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR); |
|
} |
|
if (!FS.isFile(node.mode)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
var err = FS.nodePermissions(node, "w"); |
|
if (err) { |
|
throw new FS.ErrnoError(err); |
|
} |
|
node.node_ops.setattr(node, { size: len, timestamp: Date.now() }); |
|
}, |
|
ftruncate: function (fd, len) { |
|
var stream = FS.getStream(fd); |
|
if (!stream) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
} |
|
if ((stream.flags & 2097155) === 0) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
FS.truncate(stream.node, len); |
|
}, |
|
utime: function (path, atime, mtime) { |
|
var lookup = FS.lookupPath(path, { follow: true }); |
|
var node = lookup.node; |
|
node.node_ops.setattr(node, { timestamp: Math.max(atime, mtime) }); |
|
}, |
|
open: function (path, flags, mode, fd_start, fd_end) { |
|
if (path === "") { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
|
} |
|
flags = typeof flags === "string" ? FS.modeStringToFlags(flags) : flags; |
|
mode = typeof mode === "undefined" ? 438 : mode; |
|
if (flags & 64) { |
|
mode = (mode & 4095) | 32768; |
|
} else { |
|
mode = 0; |
|
} |
|
var node; |
|
if (typeof path === "object") { |
|
node = path; |
|
} else { |
|
path = PATH.normalize(path); |
|
try { |
|
var lookup = FS.lookupPath(path, { follow: !(flags & 131072) }); |
|
node = lookup.node; |
|
} catch (e) {} |
|
} |
|
var created = false; |
|
if (flags & 64) { |
|
if (node) { |
|
if (flags & 128) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EEXIST); |
|
} |
|
} else { |
|
node = FS.mknod(path, mode, 0); |
|
created = true; |
|
} |
|
} |
|
if (!node) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
|
} |
|
if (FS.isChrdev(node.mode)) { |
|
flags &= ~512; |
|
} |
|
if (flags & 65536 && !FS.isDir(node.mode)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); |
|
} |
|
if (!created) { |
|
var err = FS.mayOpen(node, flags); |
|
if (err) { |
|
throw new FS.ErrnoError(err); |
|
} |
|
} |
|
if (flags & 512) { |
|
FS.truncate(node, 0); |
|
} |
|
flags &= ~(128 | 512); |
|
var stream = FS.createStream({ node: node, path: FS.getPath(node), flags: flags, seekable: true, position: 0, stream_ops: node.stream_ops, ungotten: [], error: false }, fd_start, fd_end); |
|
if (stream.stream_ops.open) { |
|
stream.stream_ops.open(stream); |
|
} |
|
if (Module["logReadFiles"] && !(flags & 1)) { |
|
if (!FS.readFiles) FS.readFiles = {}; |
|
if (!(path in FS.readFiles)) { |
|
FS.readFiles[path] = 1; |
|
err("read file: " + path); |
|
} |
|
} |
|
try { |
|
if (FS.trackingDelegate["onOpenFile"]) { |
|
var trackingFlags = 0; |
|
if ((flags & 2097155) !== 1) { |
|
trackingFlags |= FS.tracking.openFlags.READ; |
|
} |
|
if ((flags & 2097155) !== 0) { |
|
trackingFlags |= FS.tracking.openFlags.WRITE; |
|
} |
|
FS.trackingDelegate["onOpenFile"](path, trackingFlags); |
|
} |
|
} catch (e) { |
|
console.log("FS.trackingDelegate['onOpenFile']('" + path + "', flags) threw an exception: " + e.message); |
|
} |
|
return stream; |
|
}, |
|
close: function (stream) { |
|
if (FS.isClosed(stream)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
} |
|
if (stream.getdents) stream.getdents = null; |
|
try { |
|
if (stream.stream_ops.close) { |
|
stream.stream_ops.close(stream); |
|
} |
|
} catch (e) { |
|
throw e; |
|
} finally { |
|
FS.closeStream(stream.fd); |
|
} |
|
stream.fd = null; |
|
}, |
|
isClosed: function (stream) { |
|
return stream.fd === null; |
|
}, |
|
llseek: function (stream, offset, whence) { |
|
if (FS.isClosed(stream)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
} |
|
if (!stream.seekable || !stream.stream_ops.llseek) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); |
|
} |
|
stream.position = stream.stream_ops.llseek(stream, offset, whence); |
|
stream.ungotten = []; |
|
return stream.position; |
|
}, |
|
read: function (stream, buffer, offset, length, position) { |
|
if (length < 0 || position < 0) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
if (FS.isClosed(stream)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
} |
|
if ((stream.flags & 2097155) === 1) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
} |
|
if (FS.isDir(stream.node.mode)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR); |
|
} |
|
if (!stream.stream_ops.read) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
var seeking = typeof position !== "undefined"; |
|
if (!seeking) { |
|
position = stream.position; |
|
} else if (!stream.seekable) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); |
|
} |
|
var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); |
|
if (!seeking) stream.position += bytesRead; |
|
return bytesRead; |
|
}, |
|
write: function (stream, buffer, offset, length, position, canOwn) { |
|
if (length < 0 || position < 0) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
if (FS.isClosed(stream)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
} |
|
if ((stream.flags & 2097155) === 0) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
} |
|
if (FS.isDir(stream.node.mode)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR); |
|
} |
|
if (!stream.stream_ops.write) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
if (stream.flags & 1024) { |
|
FS.llseek(stream, 0, 2); |
|
} |
|
var seeking = typeof position !== "undefined"; |
|
if (!seeking) { |
|
position = stream.position; |
|
} else if (!stream.seekable) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); |
|
} |
|
var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); |
|
if (!seeking) stream.position += bytesWritten; |
|
try { |
|
if (stream.path && FS.trackingDelegate["onWriteToFile"]) FS.trackingDelegate["onWriteToFile"](stream.path); |
|
} catch (e) { |
|
console.log("FS.trackingDelegate['onWriteToFile']('" + path + "') threw an exception: " + e.message); |
|
} |
|
return bytesWritten; |
|
}, |
|
allocate: function (stream, offset, length) { |
|
if (FS.isClosed(stream)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
} |
|
if (offset < 0 || length <= 0) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL); |
|
} |
|
if ((stream.flags & 2097155) === 0) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
} |
|
if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
|
} |
|
if (!stream.stream_ops.allocate) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP); |
|
} |
|
stream.stream_ops.allocate(stream, offset, length); |
|
}, |
|
mmap: function (stream, buffer, offset, length, position, prot, flags) { |
|
if ((stream.flags & 2097155) === 1) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EACCES); |
|
} |
|
if (!stream.stream_ops.mmap) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV); |
|
} |
|
return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags); |
|
}, |
|
msync: function (stream, buffer, offset, length, mmapFlags) { |
|
if (!stream || !stream.stream_ops.msync) { |
|
return 0; |
|
} |
|
return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags); |
|
}, |
|
munmap: function (stream) { |
|
return 0; |
|
}, |
|
ioctl: function (stream, cmd, arg) { |
|
if (!stream.stream_ops.ioctl) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTTY); |
|
} |
|
return stream.stream_ops.ioctl(stream, cmd, arg); |
|
}, |
|
readFile: function (path, opts) { |
|
opts = opts || {}; |
|
opts.flags = opts.flags || "r"; |
|
opts.encoding = opts.encoding || "binary"; |
|
if (opts.encoding !== "utf8" && opts.encoding !== "binary") { |
|
throw new Error('Invalid encoding type "' + opts.encoding + '"'); |
|
} |
|
var ret; |
|
var stream = FS.open(path, opts.flags); |
|
var stat = FS.stat(path); |
|
var length = stat.size; |
|
var buf = new Uint8Array(length); |
|
FS.read(stream, buf, 0, length, 0); |
|
if (opts.encoding === "utf8") { |
|
ret = UTF8ArrayToString(buf, 0); |
|
} else if (opts.encoding === "binary") { |
|
ret = buf; |
|
} |
|
FS.close(stream); |
|
return ret; |
|
}, |
|
writeFile: function (path, data, opts) { |
|
opts = opts || {}; |
|
opts.flags = opts.flags || "w"; |
|
var stream = FS.open(path, opts.flags, opts.mode); |
|
if (typeof data === "string") { |
|
var buf = new Uint8Array(lengthBytesUTF8(data) + 1); |
|
var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); |
|
FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn); |
|
} else if (ArrayBuffer.isView(data)) { |
|
FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn); |
|
} else { |
|
throw new Error("Unsupported data type"); |
|
} |
|
FS.close(stream); |
|
}, |
|
cwd: function () { |
|
return FS.currentPath; |
|
}, |
|
chdir: function (path) { |
|
var lookup = FS.lookupPath(path, { follow: true }); |
|
if (lookup.node === null) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT); |
|
} |
|
if (!FS.isDir(lookup.node.mode)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); |
|
} |
|
var err = FS.nodePermissions(lookup.node, "x"); |
|
if (err) { |
|
throw new FS.ErrnoError(err); |
|
} |
|
FS.currentPath = lookup.path; |
|
}, |
|
createDefaultDirectories: function () { |
|
FS.mkdir("/tmp"); |
|
FS.mkdir("/home"); |
|
FS.mkdir("/home/web_user"); |
|
}, |
|
createDefaultDevices: function () { |
|
FS.mkdir("/dev"); |
|
FS.registerDevice(FS.makedev(1, 3), { |
|
read: function () { |
|
return 0; |
|
}, |
|
write: function (stream, buffer, offset, length, pos) { |
|
return length; |
|
}, |
|
}); |
|
FS.mkdev("/dev/null", FS.makedev(1, 3)); |
|
TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); |
|
TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); |
|
FS.mkdev("/dev/tty", FS.makedev(5, 0)); |
|
FS.mkdev("/dev/tty1", FS.makedev(6, 0)); |
|
var random_device; |
|
if (typeof crypto !== "undefined") { |
|
var randomBuffer = new Uint8Array(1); |
|
random_device = function () { |
|
crypto.getRandomValues(randomBuffer); |
|
return randomBuffer[0]; |
|
}; |
|
} else if (ENVIRONMENT_IS_NODE) { |
|
random_device = function () { |
|
return require("crypto")["randomBytes"](1)[0]; |
|
}; |
|
} else { |
|
random_device = function () { |
|
return (Math.random() * 256) | 0; |
|
}; |
|
} |
|
FS.createDevice("/dev", "random", random_device); |
|
FS.createDevice("/dev", "urandom", random_device); |
|
FS.mkdir("/dev/shm"); |
|
FS.mkdir("/dev/shm/tmp"); |
|
}, |
|
createSpecialDirectories: function () { |
|
FS.mkdir("/proc"); |
|
FS.mkdir("/proc/self"); |
|
FS.mkdir("/proc/self/fd"); |
|
FS.mount( |
|
{ |
|
mount: function () { |
|
var node = FS.createNode("/proc/self", "fd", 16384 | 511, 73); |
|
node.node_ops = { |
|
lookup: function (parent, name) { |
|
var fd = +name; |
|
var stream = FS.getStream(fd); |
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
var ret = { |
|
parent: null, |
|
mount: { mountpoint: "fake" }, |
|
node_ops: { |
|
readlink: function () { |
|
return stream.path; |
|
}, |
|
}, |
|
}; |
|
ret.parent = ret; |
|
return ret; |
|
}, |
|
}; |
|
return node; |
|
}, |
|
}, |
|
{}, |
|
"/proc/self/fd" |
|
); |
|
}, |
|
createStandardStreams: function () { |
|
if (Module["stdin"]) { |
|
FS.createDevice("/dev", "stdin", Module["stdin"]); |
|
} else { |
|
FS.symlink("/dev/tty", "/dev/stdin"); |
|
} |
|
if (Module["stdout"]) { |
|
FS.createDevice("/dev", "stdout", null, Module["stdout"]); |
|
} else { |
|
FS.symlink("/dev/tty", "/dev/stdout"); |
|
} |
|
if (Module["stderr"]) { |
|
FS.createDevice("/dev", "stderr", null, Module["stderr"]); |
|
} else { |
|
FS.symlink("/dev/tty1", "/dev/stderr"); |
|
} |
|
var stdin = FS.open("/dev/stdin", "r"); |
|
assert(stdin.fd === 0, "invalid handle for stdin (" + stdin.fd + ")"); |
|
var stdout = FS.open("/dev/stdout", "w"); |
|
assert(stdout.fd === 1, "invalid handle for stdout (" + stdout.fd + ")"); |
|
var stderr = FS.open("/dev/stderr", "w"); |
|
assert(stderr.fd === 2, "invalid handle for stderr (" + stderr.fd + ")"); |
|
}, |
|
ensureErrnoError: function () { |
|
if (FS.ErrnoError) return; |
|
FS.ErrnoError = function ErrnoError(errno, node) { |
|
this.node = node; |
|
this.setErrno = function (errno) { |
|
this.errno = errno; |
|
for (var key in ERRNO_CODES) { |
|
if (ERRNO_CODES[key] === errno) { |
|
this.code = key; |
|
break; |
|
} |
|
} |
|
}; |
|
this.setErrno(errno); |
|
this.message = ERRNO_MESSAGES[errno]; |
|
if (this.stack) Object.defineProperty(this, "stack", { value: new Error().stack, writable: true }); |
|
}; |
|
FS.ErrnoError.prototype = new Error(); |
|
FS.ErrnoError.prototype.constructor = FS.ErrnoError; |
|
[ERRNO_CODES.ENOENT].forEach(function (code) { |
|
FS.genericErrors[code] = new FS.ErrnoError(code); |
|
FS.genericErrors[code].stack = "<generic error, no stack>"; |
|
}); |
|
}, |
|
staticInit: function () { |
|
FS.ensureErrnoError(); |
|
FS.nameTable = new Array(4096); |
|
FS.mount(MEMFS, {}, "/"); |
|
FS.createDefaultDirectories(); |
|
FS.createDefaultDevices(); |
|
FS.createSpecialDirectories(); |
|
FS.filesystems = { MEMFS: MEMFS, IDBFS: IDBFS, NODEFS: NODEFS, WORKERFS: WORKERFS }; |
|
}, |
|
init: function (input, output, error) { |
|
assert(!FS.init.initialized, "FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)"); |
|
FS.init.initialized = true; |
|
FS.ensureErrnoError(); |
|
Module["stdin"] = input || Module["stdin"]; |
|
Module["stdout"] = output || Module["stdout"]; |
|
Module["stderr"] = error || Module["stderr"]; |
|
FS.createStandardStreams(); |
|
}, |
|
quit: function () { |
|
FS.init.initialized = false; |
|
var fflush = Module["_fflush"]; |
|
if (fflush) fflush(0); |
|
for (var i = 0; i < FS.streams.length; i++) { |
|
var stream = FS.streams[i]; |
|
if (!stream) { |
|
continue; |
|
} |
|
FS.close(stream); |
|
} |
|
}, |
|
getMode: function (canRead, canWrite) { |
|
var mode = 0; |
|
if (canRead) mode |= 292 | 73; |
|
if (canWrite) mode |= 146; |
|
return mode; |
|
}, |
|
joinPath: function (parts, forceRelative) { |
|
var path = PATH.join.apply(null, parts); |
|
if (forceRelative && path[0] == "/") path = path.substr(1); |
|
return path; |
|
}, |
|
absolutePath: function (relative, base) { |
|
return PATH.resolve(base, relative); |
|
}, |
|
standardizePath: function (path) { |
|
return PATH.normalize(path); |
|
}, |
|
findObject: function (path, dontResolveLastLink) { |
|
var ret = FS.analyzePath(path, dontResolveLastLink); |
|
if (ret.exists) { |
|
return ret.object; |
|
} else { |
|
___setErrNo(ret.error); |
|
return null; |
|
} |
|
}, |
|
analyzePath: function (path, dontResolveLastLink) { |
|
try { |
|
var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); |
|
path = lookup.path; |
|
} catch (e) {} |
|
var ret = { isRoot: false, exists: false, error: 0, name: null, path: null, object: null, parentExists: false, parentPath: null, parentObject: null }; |
|
try { |
|
var lookup = FS.lookupPath(path, { parent: true }); |
|
ret.parentExists = true; |
|
ret.parentPath = lookup.path; |
|
ret.parentObject = lookup.node; |
|
ret.name = PATH.basename(path); |
|
lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); |
|
ret.exists = true; |
|
ret.path = lookup.path; |
|
ret.object = lookup.node; |
|
ret.name = lookup.node.name; |
|
ret.isRoot = lookup.path === "/"; |
|
} catch (e) { |
|
ret.error = e.errno; |
|
} |
|
return ret; |
|
}, |
|
createFolder: function (parent, name, canRead, canWrite) { |
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name); |
|
var mode = FS.getMode(canRead, canWrite); |
|
return FS.mkdir(path, mode); |
|
}, |
|
createPath: function (parent, path, canRead, canWrite) { |
|
parent = typeof parent === "string" ? parent : FS.getPath(parent); |
|
var parts = path.split("/").reverse(); |
|
while (parts.length) { |
|
var part = parts.pop(); |
|
if (!part) continue; |
|
var current = PATH.join2(parent, part); |
|
try { |
|
FS.mkdir(current); |
|
} catch (e) {} |
|
parent = current; |
|
} |
|
return current; |
|
}, |
|
createFile: function (parent, name, properties, canRead, canWrite) { |
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name); |
|
var mode = FS.getMode(canRead, canWrite); |
|
return FS.create(path, mode); |
|
}, |
|
createDataFile: function (parent, name, data, canRead, canWrite, canOwn) { |
|
var path = name ? PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name) : parent; |
|
var mode = FS.getMode(canRead, canWrite); |
|
var node = FS.create(path, mode); |
|
if (data) { |
|
if (typeof data === "string") { |
|
var arr = new Array(data.length); |
|
for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); |
|
data = arr; |
|
} |
|
FS.chmod(node, mode | 146); |
|
var stream = FS.open(node, "w"); |
|
FS.write(stream, data, 0, data.length, 0, canOwn); |
|
FS.close(stream); |
|
FS.chmod(node, mode); |
|
} |
|
return node; |
|
}, |
|
createDevice: function (parent, name, input, output) { |
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name); |
|
var mode = FS.getMode(!!input, !!output); |
|
if (!FS.createDevice.major) FS.createDevice.major = 64; |
|
var dev = FS.makedev(FS.createDevice.major++, 0); |
|
FS.registerDevice(dev, { |
|
open: function (stream) { |
|
stream.seekable = false; |
|
}, |
|
close: function (stream) { |
|
if (output && output.buffer && output.buffer.length) { |
|
output(10); |
|
} |
|
}, |
|
read: function (stream, buffer, offset, length, pos) { |
|
var bytesRead = 0; |
|
for (var i = 0; i < length; i++) { |
|
var result; |
|
try { |
|
result = input(); |
|
} catch (e) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EIO); |
|
} |
|
if (result === undefined && bytesRead === 0) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); |
|
} |
|
if (result === null || result === undefined) break; |
|
bytesRead++; |
|
buffer[offset + i] = result; |
|
} |
|
if (bytesRead) { |
|
stream.node.timestamp = Date.now(); |
|
} |
|
return bytesRead; |
|
}, |
|
write: function (stream, buffer, offset, length, pos) { |
|
for (var i = 0; i < length; i++) { |
|
try { |
|
output(buffer[offset + i]); |
|
} catch (e) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EIO); |
|
} |
|
} |
|
if (length) { |
|
stream.node.timestamp = Date.now(); |
|
} |
|
return i; |
|
}, |
|
}); |
|
return FS.mkdev(path, mode, dev); |
|
}, |
|
createLink: function (parent, name, target, canRead, canWrite) { |
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name); |
|
return FS.symlink(target, path); |
|
}, |
|
forceLoadFile: function (obj) { |
|
if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; |
|
var success = true; |
|
if (typeof XMLHttpRequest !== "undefined") { |
|
throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread."); |
|
} else if (Module["read"]) { |
|
try { |
|
obj.contents = intArrayFromString(Module["read"](obj.url), true); |
|
obj.usedBytes = obj.contents.length; |
|
} catch (e) { |
|
success = false; |
|
} |
|
} else { |
|
throw new Error("Cannot load without read() or XMLHttpRequest."); |
|
} |
|
if (!success) ___setErrNo(ERRNO_CODES.EIO); |
|
return success; |
|
}, |
|
createLazyFile: function (parent, name, url, canRead, canWrite) { |
|
function LazyUint8Array() { |
|
this.lengthKnown = false; |
|
this.chunks = []; |
|
} |
|
LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) { |
|
if (idx > this.length - 1 || idx < 0) { |
|
return undefined; |
|
} |
|
var chunkOffset = idx % this.chunkSize; |
|
var chunkNum = (idx / this.chunkSize) | 0; |
|
return this.getter(chunkNum)[chunkOffset]; |
|
}; |
|
LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { |
|
this.getter = getter; |
|
}; |
|
LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { |
|
var xhr = new XMLHttpRequest(); |
|
xhr.open("HEAD", url, false); |
|
xhr.send(null); |
|
if (!((xhr.status >= 200 && xhr.status < 300) || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); |
|
var datalength = Number(xhr.getResponseHeader("Content-length")); |
|
var header; |
|
var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; |
|
var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip"; |
|
var chunkSize = 1024 * 1024; |
|
if (!hasByteServing) chunkSize = datalength; |
|
var doXHR = function (from, to) { |
|
if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); |
|
if (to > datalength - 1) throw new Error("only " + datalength + " bytes available! programmer error!"); |
|
var xhr = new XMLHttpRequest(); |
|
xhr.open("GET", url, false); |
|
if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); |
|
if (typeof Uint8Array != "undefined") xhr.responseType = "arraybuffer"; |
|
if (xhr.overrideMimeType) { |
|
xhr.overrideMimeType("text/plain; charset=x-user-defined"); |
|
} |
|
xhr.send(null); |
|
if (!((xhr.status >= 200 && xhr.status < 300) || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); |
|
if (xhr.response !== undefined) { |
|
return new Uint8Array(xhr.response || []); |
|
} else { |
|
return intArrayFromString(xhr.responseText || "", true); |
|
} |
|
}; |
|
var lazyArray = this; |
|
lazyArray.setDataGetter(function (chunkNum) { |
|
var start = chunkNum * chunkSize; |
|
var end = (chunkNum + 1) * chunkSize - 1; |
|
end = Math.min(end, datalength - 1); |
|
if (typeof lazyArray.chunks[chunkNum] === "undefined") { |
|
lazyArray.chunks[chunkNum] = doXHR(start, end); |
|
} |
|
if (typeof lazyArray.chunks[chunkNum] === "undefined") throw new Error("doXHR failed!"); |
|
return lazyArray.chunks[chunkNum]; |
|
}); |
|
if (usesGzip || !datalength) { |
|
chunkSize = datalength = 1; |
|
datalength = this.getter(0).length; |
|
chunkSize = datalength; |
|
console.log("LazyFiles on gzip forces download of the whole file when length is accessed"); |
|
} |
|
this._length = datalength; |
|
this._chunkSize = chunkSize; |
|
this.lengthKnown = true; |
|
}; |
|
if (typeof XMLHttpRequest !== "undefined") { |
|
if (!ENVIRONMENT_IS_WORKER) throw "Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc"; |
|
var lazyArray = new LazyUint8Array(); |
|
Object.defineProperties(lazyArray, { |
|
length: { |
|
get: function () { |
|
if (!this.lengthKnown) { |
|
this.cacheLength(); |
|
} |
|
return this._length; |
|
}, |
|
}, |
|
chunkSize: { |
|
get: function () { |
|
if (!this.lengthKnown) { |
|
this.cacheLength(); |
|
} |
|
return this._chunkSize; |
|
}, |
|
}, |
|
}); |
|
var properties = { isDevice: false, contents: lazyArray }; |
|
} else { |
|
var properties = { isDevice: false, url: url }; |
|
} |
|
var node = FS.createFile(parent, name, properties, canRead, canWrite); |
|
if (properties.contents) { |
|
node.contents = properties.contents; |
|
} else if (properties.url) { |
|
node.contents = null; |
|
node.url = properties.url; |
|
} |
|
Object.defineProperties(node, { |
|
usedBytes: { |
|
get: function () { |
|
return this.contents.length; |
|
}, |
|
}, |
|
}); |
|
var stream_ops = {}; |
|
var keys = Object.keys(node.stream_ops); |
|
keys.forEach(function (key) { |
|
var fn = node.stream_ops[key]; |
|
stream_ops[key] = function forceLoadLazyFile() { |
|
if (!FS.forceLoadFile(node)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EIO); |
|
} |
|
return fn.apply(null, arguments); |
|
}; |
|
}); |
|
stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) { |
|
if (!FS.forceLoadFile(node)) { |
|
throw new FS.ErrnoError(ERRNO_CODES.EIO); |
|
} |
|
var contents = stream.node.contents; |
|
if (position >= contents.length) return 0; |
|
var size = Math.min(contents.length - position, length); |
|
assert(size >= 0); |
|
if (contents.slice) { |
|
for (var i = 0; i < size; i++) { |
|
buffer[offset + i] = contents[position + i]; |
|
} |
|
} else { |
|
for (var i = 0; i < size; i++) { |
|
buffer[offset + i] = contents.get(position + i); |
|
} |
|
} |
|
return size; |
|
}; |
|
node.stream_ops = stream_ops; |
|
return node; |
|
}, |
|
createPreloadedFile: function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) { |
|
Browser.init(); |
|
var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent; |
|
var dep = getUniqueRunDependency("cp " + fullname); |
|
function processData(byteArray) { |
|
function finish(byteArray) { |
|
if (preFinish) preFinish(); |
|
if (!dontCreateFile) { |
|
FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn); |
|
} |
|
if (onload) onload(); |
|
removeRunDependency(dep); |
|
} |
|
var handled = false; |
|
Module["preloadPlugins"].forEach(function (plugin) { |
|
if (handled) return; |
|
if (plugin["canHandle"](fullname)) { |
|
plugin["handle"](byteArray, fullname, finish, function () { |
|
if (onerror) onerror(); |
|
removeRunDependency(dep); |
|
}); |
|
handled = true; |
|
} |
|
}); |
|
if (!handled) finish(byteArray); |
|
} |
|
addRunDependency(dep); |
|
if (typeof url == "string") { |
|
Browser.asyncLoad( |
|
url, |
|
function (byteArray) { |
|
processData(byteArray); |
|
}, |
|
onerror |
|
); |
|
} else { |
|
processData(url); |
|
} |
|
}, |
|
indexedDB: function () { |
|
return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; |
|
}, |
|
DB_NAME: function () { |
|
return "EM_FS_" + window.location.pathname; |
|
}, |
|
DB_VERSION: 20, |
|
DB_STORE_NAME: "FILE_DATA", |
|
saveFilesToDB: function (paths, onload, onerror) { |
|
onload = onload || function () {}; |
|
onerror = onerror || function () {}; |
|
var indexedDB = FS.indexedDB(); |
|
try { |
|
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); |
|
} catch (e) { |
|
return onerror(e); |
|
} |
|
openRequest.onupgradeneeded = function openRequest_onupgradeneeded() { |
|
console.log("creating db"); |
|
var db = openRequest.result; |
|
db.createObjectStore(FS.DB_STORE_NAME); |
|
}; |
|
openRequest.onsuccess = function openRequest_onsuccess() { |
|
var db = openRequest.result; |
|
var transaction = db.transaction([FS.DB_STORE_NAME], "readwrite"); |
|
var files = transaction.objectStore(FS.DB_STORE_NAME); |
|
var ok = 0, |
|
fail = 0, |
|
total = paths.length; |
|
function finish() { |
|
if (fail == 0) onload(); |
|
else onerror(); |
|
} |
|
paths.forEach(function (path) { |
|
var putRequest = files.put(FS.analyzePath(path).object.contents, path); |
|
putRequest.onsuccess = function putRequest_onsuccess() { |
|
ok++; |
|
if (ok + fail == total) finish(); |
|
}; |
|
putRequest.onerror = function putRequest_onerror() { |
|
fail++; |
|
if (ok + fail == total) finish(); |
|
}; |
|
}); |
|
transaction.onerror = onerror; |
|
}; |
|
openRequest.onerror = onerror; |
|
}, |
|
loadFilesFromDB: function (paths, onload, onerror) { |
|
onload = onload || function () {}; |
|
onerror = onerror || function () {}; |
|
var indexedDB = FS.indexedDB(); |
|
try { |
|
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); |
|
} catch (e) { |
|
return onerror(e); |
|
} |
|
openRequest.onupgradeneeded = onerror; |
|
openRequest.onsuccess = function openRequest_onsuccess() { |
|
var db = openRequest.result; |
|
try { |
|
var transaction = db.transaction([FS.DB_STORE_NAME], "readonly"); |
|
} catch (e) { |
|
onerror(e); |
|
return; |
|
} |
|
var files = transaction.objectStore(FS.DB_STORE_NAME); |
|
var ok = 0, |
|
fail = 0, |
|
total = paths.length; |
|
function finish() { |
|
if (fail == 0) onload(); |
|
else onerror(); |
|
} |
|
paths.forEach(function (path) { |
|
var getRequest = files.get(path); |
|
getRequest.onsuccess = function getRequest_onsuccess() { |
|
if (FS.analyzePath(path).exists) { |
|
FS.unlink(path); |
|
} |
|
FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true); |
|
ok++; |
|
if (ok + fail == total) finish(); |
|
}; |
|
getRequest.onerror = function getRequest_onerror() { |
|
fail++; |
|
if (ok + fail == total) finish(); |
|
}; |
|
}); |
|
transaction.onerror = onerror; |
|
}; |
|
openRequest.onerror = onerror; |
|
}, |
|
}; |
|
var SYSCALLS = { |
|
DEFAULT_POLLMASK: 5, |
|
mappings: {}, |
|
umask: 511, |
|
calculateAt: function (dirfd, path) { |
|
if (path[0] !== "/") { |
|
var dir; |
|
if (dirfd === -100) { |
|
dir = FS.cwd(); |
|
} else { |
|
var dirstream = FS.getStream(dirfd); |
|
if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
dir = dirstream.path; |
|
} |
|
path = PATH.join2(dir, path); |
|
} |
|
return path; |
|
}, |
|
doStat: function (func, path, buf) { |
|
try { |
|
var stat = func(path); |
|
} catch (e) { |
|
if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { |
|
return -ERRNO_CODES.ENOTDIR; |
|
} |
|
throw e; |
|
} |
|
HEAP32[buf >> 2] = stat.dev; |
|
HEAP32[(buf + 4) >> 2] = 0; |
|
HEAP32[(buf + 8) >> 2] = stat.ino; |
|
HEAP32[(buf + 12) >> 2] = stat.mode; |
|
HEAP32[(buf + 16) >> 2] = stat.nlink; |
|
HEAP32[(buf + 20) >> 2] = stat.uid; |
|
HEAP32[(buf + 24) >> 2] = stat.gid; |
|
HEAP32[(buf + 28) >> 2] = stat.rdev; |
|
HEAP32[(buf + 32) >> 2] = 0; |
|
HEAP32[(buf + 36) >> 2] = stat.size; |
|
HEAP32[(buf + 40) >> 2] = 4096; |
|
HEAP32[(buf + 44) >> 2] = stat.blocks; |
|
HEAP32[(buf + 48) >> 2] = (stat.atime.getTime() / 1e3) | 0; |
|
HEAP32[(buf + 52) >> 2] = 0; |
|
HEAP32[(buf + 56) >> 2] = (stat.mtime.getTime() / 1e3) | 0; |
|
HEAP32[(buf + 60) >> 2] = 0; |
|
HEAP32[(buf + 64) >> 2] = (stat.ctime.getTime() / 1e3) | 0; |
|
HEAP32[(buf + 68) >> 2] = 0; |
|
HEAP32[(buf + 72) >> 2] = stat.ino; |
|
return 0; |
|
}, |
|
doMsync: function (addr, stream, len, flags) { |
|
var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len)); |
|
FS.msync(stream, buffer, 0, len, flags); |
|
}, |
|
doMkdir: function (path, mode) { |
|
path = PATH.normalize(path); |
|
if (path[path.length - 1] === "/") path = path.substr(0, path.length - 1); |
|
FS.mkdir(path, mode, 0); |
|
return 0; |
|
}, |
|
doMknod: function (path, mode, dev) { |
|
switch (mode & 61440) { |
|
case 32768: |
|
case 8192: |
|
case 24576: |
|
case 4096: |
|
case 49152: |
|
break; |
|
default: |
|
return -ERRNO_CODES.EINVAL; |
|
} |
|
FS.mknod(path, mode, dev); |
|
return 0; |
|
}, |
|
doReadlink: function (path, buf, bufsize) { |
|
if (bufsize <= 0) return -ERRNO_CODES.EINVAL; |
|
var ret = FS.readlink(path); |
|
var len = Math.min(bufsize, lengthBytesUTF8(ret)); |
|
var endChar = HEAP8[buf + len]; |
|
stringToUTF8(ret, buf, bufsize + 1); |
|
HEAP8[buf + len] = endChar; |
|
return len; |
|
}, |
|
doAccess: function (path, amode) { |
|
if (amode & ~7) { |
|
return -ERRNO_CODES.EINVAL; |
|
} |
|
var node; |
|
var lookup = FS.lookupPath(path, { follow: true }); |
|
node = lookup.node; |
|
var perms = ""; |
|
if (amode & 4) perms += "r"; |
|
if (amode & 2) perms += "w"; |
|
if (amode & 1) perms += "x"; |
|
if (perms && FS.nodePermissions(node, perms)) { |
|
return -ERRNO_CODES.EACCES; |
|
} |
|
return 0; |
|
}, |
|
doDup: function (path, flags, suggestFD) { |
|
var suggest = FS.getStream(suggestFD); |
|
if (suggest) FS.close(suggest); |
|
return FS.open(path, flags, 0, suggestFD, suggestFD).fd; |
|
}, |
|
doReadv: function (stream, iov, iovcnt, offset) { |
|
var ret = 0; |
|
for (var i = 0; i < iovcnt; i++) { |
|
var ptr = HEAP32[(iov + i * 8) >> 2]; |
|
var len = HEAP32[(iov + (i * 8 + 4)) >> 2]; |
|
var curr = FS.read(stream, HEAP8, ptr, len, offset); |
|
if (curr < 0) return -1; |
|
ret += curr; |
|
if (curr < len) break; |
|
} |
|
return ret; |
|
}, |
|
doWritev: function (stream, iov, iovcnt, offset) { |
|
var ret = 0; |
|
for (var i = 0; i < iovcnt; i++) { |
|
var ptr = HEAP32[(iov + i * 8) >> 2]; |
|
var len = HEAP32[(iov + (i * 8 + 4)) >> 2]; |
|
var curr = FS.write(stream, HEAP8, ptr, len, offset); |
|
if (curr < 0) return -1; |
|
ret += curr; |
|
} |
|
return ret; |
|
}, |
|
varargs: 0, |
|
get: function (varargs) { |
|
SYSCALLS.varargs += 4; |
|
var ret = HEAP32[(SYSCALLS.varargs - 4) >> 2]; |
|
return ret; |
|
}, |
|
getStr: function () { |
|
var ret = Pointer_stringify(SYSCALLS.get()); |
|
return ret; |
|
}, |
|
getStreamFromFD: function () { |
|
var stream = FS.getStream(SYSCALLS.get()); |
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
return stream; |
|
}, |
|
getSocketFromFD: function () { |
|
var socket = SOCKFS.getSocket(SYSCALLS.get()); |
|
if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
return socket; |
|
}, |
|
getSocketAddress: function (allowNull) { |
|
var addrp = SYSCALLS.get(), |
|
addrlen = SYSCALLS.get(); |
|
if (allowNull && addrp === 0) return null; |
|
var info = __read_sockaddr(addrp, addrlen); |
|
if (info.errno) throw new FS.ErrnoError(info.errno); |
|
info.addr = DNS.lookup_addr(info.addr) || info.addr; |
|
return info; |
|
}, |
|
get64: function () { |
|
var low = SYSCALLS.get(), |
|
high = SYSCALLS.get(); |
|
if (low >= 0) assert(high === 0); |
|
else assert(high === -1); |
|
return low; |
|
}, |
|
getZero: function () { |
|
assert(SYSCALLS.get() === 0); |
|
}, |
|
}; |
|
function ___syscall10(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var path = SYSCALLS.getStr(); |
|
FS.unlink(path); |
|
return 0; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall122(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var buf = SYSCALLS.get(); |
|
if (!buf) return -ERRNO_CODES.EFAULT; |
|
var layout = { sysname: 0, nodename: 65, domainname: 325, machine: 260, version: 195, release: 130, __size__: 390 }; |
|
function copyString(element, value) { |
|
var offset = layout[element]; |
|
writeAsciiToMemory(value, buf + offset); |
|
} |
|
copyString("sysname", "Emscripten"); |
|
copyString("nodename", "emscripten"); |
|
copyString("release", "1.0"); |
|
copyString("version", "#1"); |
|
copyString("machine", "x86-JS"); |
|
return 0; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall140(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var stream = SYSCALLS.getStreamFromFD(), |
|
offset_high = SYSCALLS.get(), |
|
offset_low = SYSCALLS.get(), |
|
result = SYSCALLS.get(), |
|
whence = SYSCALLS.get(); |
|
var offset = offset_low; |
|
FS.llseek(stream, offset, whence); |
|
HEAP32[result >> 2] = stream.position; |
|
if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; |
|
return 0; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall142(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var nfds = SYSCALLS.get(), |
|
readfds = SYSCALLS.get(), |
|
writefds = SYSCALLS.get(), |
|
exceptfds = SYSCALLS.get(), |
|
timeout = SYSCALLS.get(); |
|
assert(nfds <= 64, "nfds must be less than or equal to 64"); |
|
assert(!exceptfds, "exceptfds not supported"); |
|
var total = 0; |
|
var srcReadLow = readfds ? HEAP32[readfds >> 2] : 0, |
|
srcReadHigh = readfds ? HEAP32[(readfds + 4) >> 2] : 0; |
|
var srcWriteLow = writefds ? HEAP32[writefds >> 2] : 0, |
|
srcWriteHigh = writefds ? HEAP32[(writefds + 4) >> 2] : 0; |
|
var srcExceptLow = exceptfds ? HEAP32[exceptfds >> 2] : 0, |
|
srcExceptHigh = exceptfds ? HEAP32[(exceptfds + 4) >> 2] : 0; |
|
var dstReadLow = 0, |
|
dstReadHigh = 0; |
|
var dstWriteLow = 0, |
|
dstWriteHigh = 0; |
|
var dstExceptLow = 0, |
|
dstExceptHigh = 0; |
|
var allLow = (readfds ? HEAP32[readfds >> 2] : 0) | (writefds ? HEAP32[writefds >> 2] : 0) | (exceptfds ? HEAP32[exceptfds >> 2] : 0); |
|
var allHigh = (readfds ? HEAP32[(readfds + 4) >> 2] : 0) | (writefds ? HEAP32[(writefds + 4) >> 2] : 0) | (exceptfds ? HEAP32[(exceptfds + 4) >> 2] : 0); |
|
function check(fd, low, high, val) { |
|
return fd < 32 ? low & val : high & val; |
|
} |
|
for (var fd = 0; fd < nfds; fd++) { |
|
var mask = 1 << fd % 32; |
|
if (!check(fd, allLow, allHigh, mask)) { |
|
continue; |
|
} |
|
var stream = FS.getStream(fd); |
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); |
|
var flags = SYSCALLS.DEFAULT_POLLMASK; |
|
if (stream.stream_ops.poll) { |
|
flags = stream.stream_ops.poll(stream); |
|
} |
|
if (flags & 1 && check(fd, srcReadLow, srcReadHigh, mask)) { |
|
fd < 32 ? (dstReadLow = dstReadLow | mask) : (dstReadHigh = dstReadHigh | mask); |
|
total++; |
|
} |
|
if (flags & 4 && check(fd, srcWriteLow, srcWriteHigh, mask)) { |
|
fd < 32 ? (dstWriteLow = dstWriteLow | mask) : (dstWriteHigh = dstWriteHigh | mask); |
|
total++; |
|
} |
|
if (flags & 2 && check(fd, srcExceptLow, srcExceptHigh, mask)) { |
|
fd < 32 ? (dstExceptLow = dstExceptLow | mask) : (dstExceptHigh = dstExceptHigh | mask); |
|
total++; |
|
} |
|
} |
|
if (readfds) { |
|
HEAP32[readfds >> 2] = dstReadLow; |
|
HEAP32[(readfds + 4) >> 2] = dstReadHigh; |
|
} |
|
if (writefds) { |
|
HEAP32[writefds >> 2] = dstWriteLow; |
|
HEAP32[(writefds + 4) >> 2] = dstWriteHigh; |
|
} |
|
if (exceptfds) { |
|
HEAP32[exceptfds >> 2] = dstExceptLow; |
|
HEAP32[(exceptfds + 4) >> 2] = dstExceptHigh; |
|
} |
|
return total; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall145(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var stream = SYSCALLS.getStreamFromFD(), |
|
iov = SYSCALLS.get(), |
|
iovcnt = SYSCALLS.get(); |
|
return SYSCALLS.doReadv(stream, iov, iovcnt); |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall146(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var stream = SYSCALLS.getStreamFromFD(), |
|
iov = SYSCALLS.get(), |
|
iovcnt = SYSCALLS.get(); |
|
return SYSCALLS.doWritev(stream, iov, iovcnt); |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall15(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var path = SYSCALLS.getStr(), |
|
mode = SYSCALLS.get(); |
|
FS.chmod(path, mode); |
|
return 0; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall183(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var buf = SYSCALLS.get(), |
|
size = SYSCALLS.get(); |
|
if (size === 0) return -ERRNO_CODES.EINVAL; |
|
var cwd = FS.cwd(); |
|
var cwdLengthInBytes = lengthBytesUTF8(cwd); |
|
if (size < cwdLengthInBytes + 1) return -ERRNO_CODES.ERANGE; |
|
stringToUTF8(cwd, buf, size); |
|
return buf; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall192(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var addr = SYSCALLS.get(), |
|
len = SYSCALLS.get(), |
|
prot = SYSCALLS.get(), |
|
flags = SYSCALLS.get(), |
|
fd = SYSCALLS.get(), |
|
off = SYSCALLS.get(); |
|
off <<= 12; |
|
var ptr; |
|
var allocated = false; |
|
if (fd === -1) { |
|
ptr = _memalign(PAGE_SIZE, len); |
|
if (!ptr) return -ERRNO_CODES.ENOMEM; |
|
_memset(ptr, 0, len); |
|
allocated = true; |
|
} else { |
|
var info = FS.getStream(fd); |
|
if (!info) return -ERRNO_CODES.EBADF; |
|
var res = FS.mmap(info, HEAPU8, addr, len, off, prot, flags); |
|
ptr = res.ptr; |
|
allocated = res.allocated; |
|
} |
|
SYSCALLS.mappings[ptr] = { malloc: ptr, len: len, allocated: allocated, fd: fd, flags: flags }; |
|
return ptr; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall193(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var path = SYSCALLS.getStr(), |
|
zero = SYSCALLS.getZero(), |
|
length = SYSCALLS.get64(); |
|
FS.truncate(path, length); |
|
return 0; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall195(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var path = SYSCALLS.getStr(), |
|
buf = SYSCALLS.get(); |
|
return SYSCALLS.doStat(FS.stat, path, buf); |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall196(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var path = SYSCALLS.getStr(), |
|
buf = SYSCALLS.get(); |
|
return SYSCALLS.doStat(FS.lstat, path, buf); |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall197(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var stream = SYSCALLS.getStreamFromFD(), |
|
buf = SYSCALLS.get(); |
|
return SYSCALLS.doStat(FS.stat, stream.path, buf); |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall202(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
return 0; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall199() { |
|
return ___syscall202.apply(null, arguments); |
|
} |
|
function ___syscall220(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var stream = SYSCALLS.getStreamFromFD(), |
|
dirp = SYSCALLS.get(), |
|
count = SYSCALLS.get(); |
|
if (!stream.getdents) { |
|
stream.getdents = FS.readdir(stream.path); |
|
} |
|
var pos = 0; |
|
while (stream.getdents.length > 0 && pos + 268 <= count) { |
|
var id; |
|
var type; |
|
var name = stream.getdents.pop(); |
|
if (name[0] === ".") { |
|
id = 1; |
|
type = 4; |
|
} else { |
|
var child = FS.lookupNode(stream.node, name); |
|
id = child.id; |
|
type = FS.isChrdev(child.mode) ? 2 : FS.isDir(child.mode) ? 4 : FS.isLink(child.mode) ? 10 : 8; |
|
} |
|
HEAP32[(dirp + pos) >> 2] = id; |
|
HEAP32[(dirp + pos + 4) >> 2] = stream.position; |
|
HEAP16[(dirp + pos + 8) >> 1] = 268; |
|
HEAP8[(dirp + pos + 10) >> 0] = type; |
|
stringToUTF8(name, dirp + pos + 11, 256); |
|
pos += 268; |
|
} |
|
return pos; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall221(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var stream = SYSCALLS.getStreamFromFD(), |
|
cmd = SYSCALLS.get(); |
|
switch (cmd) { |
|
case 0: { |
|
var arg = SYSCALLS.get(); |
|
if (arg < 0) { |
|
return -ERRNO_CODES.EINVAL; |
|
} |
|
var newStream; |
|
newStream = FS.open(stream.path, stream.flags, 0, arg); |
|
return newStream.fd; |
|
} |
|
case 1: |
|
case 2: |
|
return 0; |
|
case 3: |
|
return stream.flags; |
|
case 4: { |
|
var arg = SYSCALLS.get(); |
|
stream.flags |= arg; |
|
return 0; |
|
} |
|
case 12: |
|
case 12: { |
|
var arg = SYSCALLS.get(); |
|
var offset = 0; |
|
HEAP16[(arg + offset) >> 1] = 2; |
|
return 0; |
|
} |
|
case 13: |
|
case 14: |
|
case 13: |
|
case 14: |
|
return 0; |
|
case 16: |
|
case 8: |
|
return -ERRNO_CODES.EINVAL; |
|
case 9: |
|
___setErrNo(ERRNO_CODES.EINVAL); |
|
return -1; |
|
default: { |
|
return -ERRNO_CODES.EINVAL; |
|
} |
|
} |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall268(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var path = SYSCALLS.getStr(), |
|
size = SYSCALLS.get(), |
|
buf = SYSCALLS.get(); |
|
assert(size === 64); |
|
HEAP32[(buf + 4) >> 2] = 4096; |
|
HEAP32[(buf + 40) >> 2] = 4096; |
|
HEAP32[(buf + 8) >> 2] = 1e6; |
|
HEAP32[(buf + 12) >> 2] = 5e5; |
|
HEAP32[(buf + 16) >> 2] = 5e5; |
|
HEAP32[(buf + 20) >> 2] = FS.nextInode; |
|
HEAP32[(buf + 24) >> 2] = 1e6; |
|
HEAP32[(buf + 28) >> 2] = 42; |
|
HEAP32[(buf + 44) >> 2] = 2; |
|
HEAP32[(buf + 36) >> 2] = 255; |
|
return 0; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall3(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var stream = SYSCALLS.getStreamFromFD(), |
|
buf = SYSCALLS.get(), |
|
count = SYSCALLS.get(); |
|
return FS.read(stream, HEAP8, buf, count); |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall33(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var path = SYSCALLS.getStr(), |
|
amode = SYSCALLS.get(); |
|
return SYSCALLS.doAccess(path, amode); |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall38(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var old_path = SYSCALLS.getStr(), |
|
new_path = SYSCALLS.getStr(); |
|
FS.rename(old_path, new_path); |
|
return 0; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall39(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var path = SYSCALLS.getStr(), |
|
mode = SYSCALLS.get(); |
|
return SYSCALLS.doMkdir(path, mode); |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall4(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var stream = SYSCALLS.getStreamFromFD(), |
|
buf = SYSCALLS.get(), |
|
count = SYSCALLS.get(); |
|
return FS.write(stream, HEAP8, buf, count); |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall40(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var path = SYSCALLS.getStr(); |
|
FS.rmdir(path); |
|
return 0; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall5(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var pathname = SYSCALLS.getStr(), |
|
flags = SYSCALLS.get(), |
|
mode = SYSCALLS.get(); |
|
var stream = FS.open(pathname, flags, mode); |
|
return stream.fd; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall54(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var stream = SYSCALLS.getStreamFromFD(), |
|
op = SYSCALLS.get(); |
|
switch (op) { |
|
case 21509: |
|
case 21505: { |
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
|
return 0; |
|
} |
|
case 21510: |
|
case 21511: |
|
case 21512: |
|
case 21506: |
|
case 21507: |
|
case 21508: { |
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
|
return 0; |
|
} |
|
case 21519: { |
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
|
var argp = SYSCALLS.get(); |
|
HEAP32[argp >> 2] = 0; |
|
return 0; |
|
} |
|
case 21520: { |
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
|
return -ERRNO_CODES.EINVAL; |
|
} |
|
case 21531: { |
|
var argp = SYSCALLS.get(); |
|
return FS.ioctl(stream, op, argp); |
|
} |
|
case 21523: { |
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
|
return 0; |
|
} |
|
case 21524: { |
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY; |
|
return 0; |
|
} |
|
default: |
|
abort("bad ioctl syscall " + op); |
|
} |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall6(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var stream = SYSCALLS.getStreamFromFD(); |
|
FS.close(stream); |
|
return 0; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall77(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var who = SYSCALLS.get(), |
|
usage = SYSCALLS.get(); |
|
_memset(usage, 0, 136); |
|
HEAP32[usage >> 2] = 1; |
|
HEAP32[(usage + 4) >> 2] = 2; |
|
HEAP32[(usage + 8) >> 2] = 3; |
|
HEAP32[(usage + 12) >> 2] = 4; |
|
return 0; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall85(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var path = SYSCALLS.getStr(), |
|
buf = SYSCALLS.get(), |
|
bufsize = SYSCALLS.get(); |
|
return SYSCALLS.doReadlink(path, buf, bufsize); |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___syscall91(which, varargs) { |
|
SYSCALLS.varargs = varargs; |
|
try { |
|
var addr = SYSCALLS.get(), |
|
len = SYSCALLS.get(); |
|
var info = SYSCALLS.mappings[addr]; |
|
if (!info) return 0; |
|
if (len === info.len) { |
|
var stream = FS.getStream(info.fd); |
|
SYSCALLS.doMsync(addr, stream, len, info.flags); |
|
FS.munmap(stream); |
|
SYSCALLS.mappings[addr] = null; |
|
if (info.allocated) { |
|
_free(info.malloc); |
|
} |
|
} |
|
return 0; |
|
} catch (e) { |
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e); |
|
return -e.errno; |
|
} |
|
} |
|
function ___unlock() {} |
|
function _abort() { |
|
Module["abort"](); |
|
} |
|
function _atexit(func, arg) { |
|
__ATEXIT__.unshift({ func: func, arg: arg }); |
|
} |
|
function _clock() { |
|
if (_clock.start === undefined) _clock.start = Date.now(); |
|
return ((Date.now() - _clock.start) * (1e6 / 1e3)) | 0; |
|
} |
|
function _emscripten_get_now_res() { |
|
if (ENVIRONMENT_IS_NODE) { |
|
return 1; |
|
} else if (typeof dateNow !== "undefined" || ((ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self["performance"] && self["performance"]["now"])) { |
|
return 1e3; |
|
} else { |
|
return 1e3 * 1e3; |
|
} |
|
} |
|
function _emscripten_get_now() { |
|
abort(); |
|
} |
|
function _emscripten_get_now_is_monotonic() { |
|
return ENVIRONMENT_IS_NODE || typeof dateNow !== "undefined" || ((ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self["performance"] && self["performance"]["now"]); |
|
} |
|
function _clock_getres(clk_id, res) { |
|
var nsec; |
|
if (clk_id === 0) { |
|
nsec = 1e3 * 1e3; |
|
} else if (clk_id === 1 && _emscripten_get_now_is_monotonic()) { |
|
nsec = _emscripten_get_now_res(); |
|
} else { |
|
___setErrNo(ERRNO_CODES.EINVAL); |
|
return -1; |
|
} |
|
HEAP32[res >> 2] = (nsec / 1e9) | 0; |
|
HEAP32[(res + 4) >> 2] = nsec; |
|
return 0; |
|
} |
|
function _clock_gettime(clk_id, tp) { |
|
var now; |
|
if (clk_id === 0) { |
|
now = Date.now(); |
|
} else if (clk_id === 1 && _emscripten_get_now_is_monotonic()) { |
|
now = _emscripten_get_now(); |
|
} else { |
|
___setErrNo(ERRNO_CODES.EINVAL); |
|
return -1; |
|
} |
|
HEAP32[tp >> 2] = (now / 1e3) | 0; |
|
HEAP32[(tp + 4) >> 2] = ((now % 1e3) * 1e3 * 1e3) | 0; |
|
return 0; |
|
} |
|
function _difftime(time1, time0) { |
|
return time1 - time0; |
|
} |
|
var DLFCN = { error: null, errorMsg: null, loadedLibs: {}, loadedLibNames: {} }; |
|
function _dlclose(handle) { |
|
if (!DLFCN.loadedLibs[handle]) { |
|
DLFCN.errorMsg = "Tried to dlclose() unopened handle: " + handle; |
|
return 1; |
|
} else { |
|
var lib_record = DLFCN.loadedLibs[handle]; |
|
if (--lib_record.refcount == 0) { |
|
if (lib_record.module.cleanups) { |
|
lib_record.module.cleanups.forEach(function (cleanup) { |
|
cleanup(); |
|
}); |
|
} |
|
delete DLFCN.loadedLibNames[lib_record.name]; |
|
delete DLFCN.loadedLibs[handle]; |
|
} |
|
return 0; |
|
} |
|
} |
|
function _dlopen(filename, flag) { |
|
abort("To use dlopen, you need to use Emscripten's linking support, see https://github.com/kripken/emscripten/wiki/Linking"); |
|
var searchpaths = []; |
|
if (filename === 0) { |
|
filename = "__self__"; |
|
} else { |
|
var strfilename = Pointer_stringify(filename); |
|
var isValidFile = function (filename) { |
|
var target = FS.findObject(filename); |
|
return target && !target.isFolder && !target.isDevice; |
|
}; |
|
if (isValidFile(strfilename)) { |
|
filename = strfilename; |
|
} else { |
|
if (ENV["LD_LIBRARY_PATH"]) { |
|
searchpaths = ENV["LD_LIBRARY_PATH"].split(":"); |
|
} |
|
for (var ident in searchpaths) { |
|
var searchfile = PATH.join2(searchpaths[ident], strfilename); |
|
if (isValidFile(searchfile)) { |
|
filename = searchfile; |
|
break; |
|
} |
|
} |
|
} |
|
} |
|
if (DLFCN.loadedLibNames[filename]) { |
|
var handle = DLFCN.loadedLibNames[filename]; |
|
DLFCN.loadedLibs[handle].refcount++; |
|
return handle; |
|
} |
|
var lib_module; |
|
if (filename === "__self__") { |
|
var handle = -1; |
|
lib_module = Module; |
|
} else { |
|
if (Module["preloadedWasm"] !== undefined && Module["preloadedWasm"][filename] !== undefined) { |
|
lib_module = Module["preloadedWasm"][filename]; |
|
} else { |
|
var target = FS.findObject(filename); |
|
if (!target || target.isFolder || target.isDevice) { |
|
DLFCN.errorMsg = "Could not find dynamic lib: " + filename; |
|
return 0; |
|
} |
|
FS.forceLoadFile(target); |
|
try { |
|
var lib_data = FS.readFile(filename, { encoding: "binary" }); |
|
if (!(lib_data instanceof Uint8Array)) lib_data = new Uint8Array(lib_data); |
|
lib_module = loadWebAssemblyModule(lib_data); |
|
} catch (e) { |
|
DLFCN.errorMsg = "Could not evaluate dynamic lib: " + filename + "\n" + e; |
|
return 0; |
|
} |
|
} |
|
var handle = 1; |
|
for (var key in DLFCN.loadedLibs) { |
|
if (DLFCN.loadedLibs.hasOwnProperty(key)) handle++; |
|
} |
|
if (flag & 256) { |
|
for (var ident in lib_module) { |
|
if (lib_module.hasOwnProperty(ident)) { |
|
if (ident[0] == "_") { |
|
Module[ident] = lib_module[ident]; |
|
} |
|
} |
|
} |
|
} |
|
} |
|
DLFCN.loadedLibs[handle] = { refcount: 1, name: filename, module: lib_module }; |
|
DLFCN.loadedLibNames[filename] = handle; |
|
return handle; |
|
} |
|
function _dlsym(handle, symbol) { |
|
symbol = Pointer_stringify(symbol); |
|
if (!DLFCN.loadedLibs[handle]) { |
|
DLFCN.errorMsg = "Tried to dlsym() from an unopened handle: " + handle; |
|
return 0; |
|
} else { |
|
var lib = DLFCN.loadedLibs[handle]; |
|
symbol = "_" + symbol; |
|
if (!lib.module.hasOwnProperty(symbol)) { |
|
DLFCN.errorMsg = 'Tried to lookup unknown symbol "' + symbol + '" in dynamic lib: ' + lib.name; |
|
return 0; |
|
} else { |
|
var result = lib.module[symbol]; |
|
if (typeof result === "function") { |
|
return addFunction(result); |
|
} |
|
return result; |
|
} |
|
} |
|
} |
|
function _emscripten_set_main_loop_timing(mode, value) { |
|
Browser.mainLoop.timingMode = mode; |
|
Browser.mainLoop.timingValue = value; |
|
if (!Browser.mainLoop.func) { |
|
return 1; |
|
} |
|
if (mode == 0) { |
|
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() { |
|
var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now()) | 0; |
|
setTimeout(Browser.mainLoop.runner, timeUntilNextTick); |
|
}; |
|
Browser.mainLoop.method = "timeout"; |
|
} else if (mode == 1) { |
|
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() { |
|
Browser.requestAnimationFrame(Browser.mainLoop.runner); |
|
}; |
|
Browser.mainLoop.method = "rAF"; |
|
} else if (mode == 2) { |
|
if (typeof setImmediate === "undefined") { |
|
var setImmediates = []; |
|
var emscriptenMainLoopMessageId = "setimmediate"; |
|
function Browser_setImmediate_messageHandler(event) { |
|
if (event.data === emscriptenMainLoopMessageId || event.data.target === emscriptenMainLoopMessageId) { |
|
event.stopPropagation(); |
|
setImmediates.shift()(); |
|
} |
|
} |
|
addEventListener("message", Browser_setImmediate_messageHandler, true); |
|
setImmediate = function Browser_emulated_setImmediate(func) { |
|
setImmediates.push(func); |
|
if (ENVIRONMENT_IS_WORKER) { |
|
if (Module["setImmediates"] === undefined) Module["setImmediates"] = []; |
|
Module["setImmediates"].push(func); |
|
postMessage({ target: emscriptenMainLoopMessageId }); |
|
} else postMessage(emscriptenMainLoopMessageId, "*"); |
|
}; |
|
} |
|
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() { |
|
setImmediate(Browser.mainLoop.runner); |
|
}; |
|
Browser.mainLoop.method = "immediate"; |
|
} |
|
return 0; |
|
} |
|
function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) { |
|
Module["noExitRuntime"] = true; |
|
assert(!Browser.mainLoop.func, "emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters."); |
|
Browser.mainLoop.func = func; |
|
Browser.mainLoop.arg = arg; |
|
var browserIterationFunc; |
|
if (typeof arg !== "undefined") { |
|
browserIterationFunc = function () { |
|
Module["dynCall_vi"](func, arg); |
|
}; |
|
} else { |
|
browserIterationFunc = function () { |
|
Module["dynCall_v"](func); |
|
}; |
|
} |
|
var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop; |
|
Browser.mainLoop.runner = function Browser_mainLoop_runner() { |
|
if (ABORT) return; |
|
if (Browser.mainLoop.queue.length > 0) { |
|
var start = Date.now(); |
|
var blocker = Browser.mainLoop.queue.shift(); |
|
blocker.func(blocker.arg); |
|
if (Browser.mainLoop.remainingBlockers) { |
|
var remaining = Browser.mainLoop.remainingBlockers; |
|
var next = remaining % 1 == 0 ? remaining - 1 : Math.floor(remaining); |
|
if (blocker.counted) { |
|
Browser.mainLoop.remainingBlockers = next; |
|
} else { |
|
next = next + 0.5; |
|
Browser.mainLoop.remainingBlockers = (8 * remaining + next) / 9; |
|
} |
|
} |
|
console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + " ms"); |
|
Browser.mainLoop.updateStatus(); |
|
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; |
|
setTimeout(Browser.mainLoop.runner, 0); |
|
return; |
|
} |
|
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; |
|
Browser.mainLoop.currentFrameNumber = (Browser.mainLoop.currentFrameNumber + 1) | 0; |
|
if (Browser.mainLoop.timingMode == 1 && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) { |
|
Browser.mainLoop.scheduler(); |
|
return; |
|
} else if (Browser.mainLoop.timingMode == 0) { |
|
Browser.mainLoop.tickStartTime = _emscripten_get_now(); |
|
} |
|
if (Browser.mainLoop.method === "timeout" && Module.ctx) { |
|
err( |
|
"Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!" |
|
); |
|
Browser.mainLoop.method = ""; |
|
} |
|
Browser.mainLoop.runIter(browserIterationFunc); |
|
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; |
|
if (typeof SDL === "object" && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData(); |
|
Browser.mainLoop.scheduler(); |
|
}; |
|
if (!noSetTiming) { |
|
if (fps && fps > 0) _emscripten_set_main_loop_timing(0, 1e3 / fps); |
|
else _emscripten_set_main_loop_timing(1, 1); |
|
Browser.mainLoop.scheduler(); |
|
} |
|
if (simulateInfiniteLoop) { |
|
throw "SimulateInfiniteLoop"; |
|
} |
|
} |
|
var Browser = { |
|
mainLoop: { |
|
scheduler: null, |
|
method: "", |
|
currentlyRunningMainloop: 0, |
|
func: null, |
|
arg: 0, |
|
timingMode: 0, |
|
timingValue: 0, |
|
currentFrameNumber: 0, |
|
queue: [], |
|
pause: function () { |
|
Browser.mainLoop.scheduler = null; |
|
Browser.mainLoop.currentlyRunningMainloop++; |
|
}, |
|
resume: function () { |
|
Browser.mainLoop.currentlyRunningMainloop++; |
|
var timingMode = Browser.mainLoop.timingMode; |
|
var timingValue = Browser.mainLoop.timingValue; |
|
var func = Browser.mainLoop.func; |
|
Browser.mainLoop.func = null; |
|
_emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true); |
|
_emscripten_set_main_loop_timing(timingMode, timingValue); |
|
Browser.mainLoop.scheduler(); |
|
}, |
|
updateStatus: function () { |
|
if (Module["setStatus"]) { |
|
var message = Module["statusMessage"] || "Please wait..."; |
|
var remaining = Browser.mainLoop.remainingBlockers; |
|
var expected = Browser.mainLoop.expectedBlockers; |
|
if (remaining) { |
|
if (remaining < expected) { |
|
Module["setStatus"](message + " (" + (expected - remaining) + "/" + expected + ")"); |
|
} else { |
|
Module["setStatus"](message); |
|
} |
|
} else { |
|
Module["setStatus"](""); |
|
} |
|
} |
|
}, |
|
runIter: function (func) { |
|
if (ABORT) return; |
|
if (Module["preMainLoop"]) { |
|
var preRet = Module["preMainLoop"](); |
|
if (preRet === false) { |
|
return; |
|
} |
|
} |
|
try { |
|
func(); |
|
} catch (e) { |
|
if (e instanceof ExitStatus) { |
|
return; |
|
} else { |
|
if (e && typeof e === "object" && e.stack) err("exception thrown: " + [e, e.stack]); |
|
throw e; |
|
} |
|
} |
|
if (Module["postMainLoop"]) Module["postMainLoop"](); |
|
}, |
|
}, |
|
isFullscreen: false, |
|
pointerLock: false, |
|
moduleContextCreatedCallbacks: [], |
|
workers: [], |
|
init: function () { |
|
if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; |
|
if (Browser.initted) return; |
|
Browser.initted = true; |
|
try { |
|
new Blob(); |
|
Browser.hasBlobConstructor = true; |
|
} catch (e) { |
|
Browser.hasBlobConstructor = false; |
|
console.log("warning: no blob constructor, cannot create blobs with mimetypes"); |
|
} |
|
Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : !Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null; |
|
Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined; |
|
if (!Module.noImageDecoding && typeof Browser.URLObject === "undefined") { |
|
console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available."); |
|
Module.noImageDecoding = true; |
|
} |
|
var imagePlugin = {}; |
|
imagePlugin["canHandle"] = function imagePlugin_canHandle(name) { |
|
return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name); |
|
}; |
|
imagePlugin["handle"] = function imagePlugin_handle(byteArray, name, onload, onerror) { |
|
var b = null; |
|
if (Browser.hasBlobConstructor) { |
|
try { |
|
b = new Blob([byteArray], { type: Browser.getMimetype(name) }); |
|
if (b.size !== byteArray.length) { |
|
b = new Blob([new Uint8Array(byteArray).buffer], { type: Browser.getMimetype(name) }); |
|
} |
|
} catch (e) { |
|
warnOnce("Blob constructor present but fails: " + e + "; falling back to blob builder"); |
|
} |
|
} |
|
if (!b) { |
|
var bb = new Browser.BlobBuilder(); |
|
bb.append(new Uint8Array(byteArray).buffer); |
|
b = bb.getBlob(); |
|
} |
|
var url = Browser.URLObject.createObjectURL(b); |
|
var img = new Image(); |
|
img.onload = function img_onload() { |
|
assert(img.complete, "Image " + name + " could not be decoded"); |
|
var canvas = document.createElement("canvas"); |
|
canvas.width = img.width; |
|
canvas.height = img.height; |
|
var ctx = canvas.getContext("2d"); |
|
ctx.drawImage(img, 0, 0); |
|
Module["preloadedImages"][name] = canvas; |
|
Browser.URLObject.revokeObjectURL(url); |
|
if (onload) onload(byteArray); |
|
}; |
|
img.onerror = function img_onerror(event) { |
|
console.log("Image " + url + " could not be decoded"); |
|
if (onerror) onerror(); |
|
}; |
|
img.src = url; |
|
}; |
|
Module["preloadPlugins"].push(imagePlugin); |
|
var audioPlugin = {}; |
|
audioPlugin["canHandle"] = function audioPlugin_canHandle(name) { |
|
return !Module.noAudioDecoding && name.substr(-4) in { ".ogg": 1, ".wav": 1, ".mp3": 1 }; |
|
}; |
|
audioPlugin["handle"] = function audioPlugin_handle(byteArray, name, onload, onerror) { |
|
var done = false; |
|
function finish(audio) { |
|
if (done) return; |
|
done = true; |
|
Module["preloadedAudios"][name] = audio; |
|
if (onload) onload(byteArray); |
|
} |
|
function fail() { |
|
if (done) return; |
|
done = true; |
|
Module["preloadedAudios"][name] = new Audio(); |
|
if (onerror) onerror(); |
|
} |
|
if (Browser.hasBlobConstructor) { |
|
try { |
|
var b = new Blob([byteArray], { type: Browser.getMimetype(name) }); |
|
} catch (e) { |
|
return fail(); |
|
} |
|
var url = Browser.URLObject.createObjectURL(b); |
|
var audio = new Audio(); |
|
audio.addEventListener( |
|
"canplaythrough", |
|
function () { |
|
finish(audio); |
|
}, |
|
false |
|
); |
|
audio.onerror = function audio_onerror(event) { |
|
if (done) return; |
|
console.log("warning: browser could not fully decode audio " + name + ", trying slower base64 approach"); |
|
function encode64(data) { |
|
var BASE = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; |
|
var PAD = "="; |
|
var ret = ""; |
|
var leftchar = 0; |
|
var leftbits = 0; |
|
for (var i = 0; i < data.length; i++) { |
|
leftchar = (leftchar << 8) | data[i]; |
|
leftbits += 8; |
|
while (leftbits >= 6) { |
|
var curr = (leftchar >> (leftbits - 6)) & 63; |
|
leftbits -= 6; |
|
ret += BASE[curr]; |
|
} |
|
} |
|
if (leftbits == 2) { |
|
ret += BASE[(leftchar & 3) << 4]; |
|
ret += PAD + PAD; |
|
} else if (leftbits == 4) { |
|
ret += BASE[(leftchar & 15) << 2]; |
|
ret += PAD; |
|
} |
|
return ret; |
|
} |
|
audio.src = "data:audio/x-" + name.substr(-3) + ";base64," + encode64(byteArray); |
|
finish(audio); |
|
}; |
|
audio.src = url; |
|
Browser.safeSetTimeout(function () { |
|
finish(audio); |
|
}, 1e4); |
|
} else { |
|
return fail(); |
|
} |
|
}; |
|
Module["preloadPlugins"].push(audioPlugin); |
|
function pointerLockChange() { |
|
Browser.pointerLock = |
|
document["pointerLockElement"] === Module["canvas"] || |
|
document["mozPointerLockElement"] === Module["canvas"] || |
|
document["webkitPointerLockElement"] === Module["canvas"] || |
|
document["msPointerLockElement"] === Module["canvas"]; |
|
} |
|
var canvas = Module["canvas"]; |
|
if (canvas) { |
|
canvas.requestPointerLock = canvas["requestPointerLock"] || canvas["mozRequestPointerLock"] || canvas["webkitRequestPointerLock"] || canvas["msRequestPointerLock"] || function () {}; |
|
canvas.exitPointerLock = document["exitPointerLock"] || document["mozExitPointerLock"] || document["webkitExitPointerLock"] || document["msExitPointerLock"] || function () {}; |
|
canvas.exitPointerLock = canvas.exitPointerLock.bind(document); |
|
document.addEventListener("pointerlockchange", pointerLockChange, false); |
|
document.addEventListener("mozpointerlockchange", pointerLockChange, false); |
|
document.addEventListener("webkitpointerlockchange", pointerLockChange, false); |
|
document.addEventListener("mspointerlockchange", pointerLockChange, false); |
|
if (Module["elementPointerLock"]) { |
|
canvas.addEventListener( |
|
"click", |
|
function (ev) { |
|
if (!Browser.pointerLock && Module["canvas"].requestPointerLock) { |
|
Module["canvas"].requestPointerLock(); |
|
ev.preventDefault(); |
|
} |
|
}, |
|
false |
|
); |
|
} |
|
} |
|
}, |
|
createContext: function (canvas, useWebGL, setInModule, webGLContextAttributes) { |
|
if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; |
|
var ctx; |
|
var contextHandle; |
|
if (useWebGL) { |
|
var contextAttributes = { antialias: false, alpha: false }; |
|
if (webGLContextAttributes) { |
|
for (var attribute in webGLContextAttributes) { |
|
contextAttributes[attribute] = webGLContextAttributes[attribute]; |
|
} |
|
} |
|
contextHandle = GL.createContext(canvas, contextAttributes); |
|
if (contextHandle) { |
|
ctx = GL.getContext(contextHandle).GLctx; |
|
} |
|
} else { |
|
ctx = canvas.getContext("2d"); |
|
} |
|
if (!ctx) return null; |
|
if (setInModule) { |
|
if (!useWebGL) assert(typeof GLctx === "undefined", "cannot set in module if GLctx is used, but we are a non-GL context that would replace it"); |
|
Module.ctx = ctx; |
|
if (useWebGL) GL.makeContextCurrent(contextHandle); |
|
Module.useWebGL = useWebGL; |
|
Browser.moduleContextCreatedCallbacks.forEach(function (callback) { |
|
callback(); |
|
}); |
|
Browser.init(); |
|
} |
|
return ctx; |
|
}, |
|
destroyContext: function (canvas, useWebGL, setInModule) {}, |
|
fullscreenHandlersInstalled: false, |
|
lockPointer: undefined, |
|
resizeCanvas: undefined, |
|
requestFullscreen: function (lockPointer, resizeCanvas, vrDevice) { |
|
Browser.lockPointer = lockPointer; |
|
Browser.resizeCanvas = resizeCanvas; |
|
Browser.vrDevice = vrDevice; |
|
if (typeof Browser.lockPointer === "undefined") Browser.lockPointer = true; |
|
if (typeof Browser.resizeCanvas === "undefined") Browser.resizeCanvas = false; |
|
if (typeof Browser.vrDevice === "undefined") Browser.vrDevice = null; |
|
var canvas = Module["canvas"]; |
|
function fullscreenChange() { |
|
Browser.isFullscreen = false; |
|
var canvasContainer = canvas.parentNode; |
|
if ((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvasContainer) { |
|
canvas.exitFullscreen = document["exitFullscreen"] || document["cancelFullScreen"] || document["mozCancelFullScreen"] || document["msExitFullscreen"] || document["webkitCancelFullScreen"] || function () {}; |
|
canvas.exitFullscreen = canvas.exitFullscreen.bind(document); |
|
if (Browser.lockPointer) canvas.requestPointerLock(); |
|
Browser.isFullscreen = true; |
|
if (Browser.resizeCanvas) { |
|
Browser.setFullscreenCanvasSize(); |
|
} else { |
|
Browser.updateCanvasDimensions(canvas); |
|
} |
|
} else { |
|
canvasContainer.parentNode.insertBefore(canvas, canvasContainer); |
|
canvasContainer.parentNode.removeChild(canvasContainer); |
|
if (Browser.resizeCanvas) { |
|
Browser.setWindowedCanvasSize(); |
|
} else { |
|
Browser.updateCanvasDimensions(canvas); |
|
} |
|
} |
|
if (Module["onFullScreen"]) Module["onFullScreen"](Browser.isFullscreen); |
|
if (Module["onFullscreen"]) Module["onFullscreen"](Browser.isFullscreen); |
|
} |
|
if (!Browser.fullscreenHandlersInstalled) { |
|
Browser.fullscreenHandlersInstalled = true; |
|
document.addEventListener("fullscreenchange", fullscreenChange, false); |
|
document.addEventListener("mozfullscreenchange", fullscreenChange, false); |
|
document.addEventListener("webkitfullscreenchange", fullscreenChange, false); |
|
document.addEventListener("MSFullscreenChange", fullscreenChange, false); |
|
} |
|
var canvasContainer = document.createElement("div"); |
|
canvas.parentNode.insertBefore(canvasContainer, canvas); |
|
canvasContainer.appendChild(canvas); |
|
canvasContainer.requestFullscreen = |
|
canvasContainer["requestFullscreen"] || |
|
canvasContainer["mozRequestFullScreen"] || |
|
canvasContainer["msRequestFullscreen"] || |
|
(canvasContainer["webkitRequestFullscreen"] |
|
? function () { |
|
canvasContainer["webkitRequestFullscreen"](Element["ALLOW_KEYBOARD_INPUT"]); |
|
} |
|
: null) || |
|
(canvasContainer["webkitRequestFullScreen"] |
|
? function () { |
|
canvasContainer["webkitRequestFullScreen"](Element["ALLOW_KEYBOARD_INPUT"]); |
|
} |
|
: null); |
|
if (vrDevice) { |
|
canvasContainer.requestFullscreen({ vrDisplay: vrDevice }); |
|
} else { |
|
canvasContainer.requestFullscreen(); |
|
} |
|
}, |
|
requestFullScreen: function (lockPointer, resizeCanvas, vrDevice) { |
|
err("Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead."); |
|
Browser.requestFullScreen = function (lockPointer, resizeCanvas, vrDevice) { |
|
return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice); |
|
}; |
|
return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice); |
|
}, |
|
nextRAF: 0, |
|
fakeRequestAnimationFrame: function (func) { |
|
var now = Date.now(); |
|
if (Browser.nextRAF === 0) { |
|
Browser.nextRAF = now + 1e3 / 60; |
|
} else { |
|
while (now + 2 >= Browser.nextRAF) { |
|
Browser.nextRAF += 1e3 / 60; |
|
} |
|
} |
|
var delay = Math.max(Browser.nextRAF - now, 0); |
|
setTimeout(func, delay); |
|
}, |
|
requestAnimationFrame: function requestAnimationFrame(func) { |
|
if (typeof window === "undefined") { |
|
Browser.fakeRequestAnimationFrame(func); |
|
} else { |
|
if (!window.requestAnimationFrame) { |
|
window.requestAnimationFrame = |
|
window["requestAnimationFrame"] || |
|
window["mozRequestAnimationFrame"] || |
|
window["webkitRequestAnimationFrame"] || |
|
window["msRequestAnimationFrame"] || |
|
window["oRequestAnimationFrame"] || |
|
Browser.fakeRequestAnimationFrame; |
|
} |
|
window.requestAnimationFrame(func); |
|
} |
|
}, |
|
safeCallback: function (func) { |
|
return function () { |
|
if (!ABORT) return func.apply(null, arguments); |
|
}; |
|
}, |
|
allowAsyncCallbacks: true, |
|
queuedAsyncCallbacks: [], |
|
pauseAsyncCallbacks: function () { |
|
Browser.allowAsyncCallbacks = false; |
|
}, |
|
resumeAsyncCallbacks: function () { |
|
Browser.allowAsyncCallbacks = true; |
|
if (Browser.queuedAsyncCallbacks.length > 0) { |
|
var callbacks = Browser.queuedAsyncCallbacks; |
|
Browser.queuedAsyncCallbacks = []; |
|
callbacks.forEach(function (func) { |
|
func(); |
|
}); |
|
} |
|
}, |
|
safeRequestAnimationFrame: function (func) { |
|
return Browser.requestAnimationFrame(function () { |
|
if (ABORT) return; |
|
if (Browser.allowAsyncCallbacks) { |
|
func(); |
|
} else { |
|
Browser.queuedAsyncCallbacks.push(func); |
|
} |
|
}); |
|
}, |
|
safeSetTimeout: function (func, timeout) { |
|
Module["noExitRuntime"] = true; |
|
return setTimeout(function () { |
|
if (ABORT) return; |
|
if (Browser.allowAsyncCallbacks) { |
|
func(); |
|
} else { |
|
Browser.queuedAsyncCallbacks.push(func); |
|
} |
|
}, timeout); |
|
}, |
|
safeSetInterval: function (func, timeout) { |
|
Module["noExitRuntime"] = true; |
|
return setInterval(function () { |
|
if (ABORT) return; |
|
if (Browser.allowAsyncCallbacks) { |
|
func(); |
|
} |
|
}, timeout); |
|
}, |
|
getMimetype: function (name) { |
|
return { jpg: "image/jpeg", jpeg: "image/jpeg", png: "image/png", bmp: "image/bmp", ogg: "audio/ogg", wav: "audio/wav", mp3: "audio/mpeg" }[name.substr(name.lastIndexOf(".") + 1)]; |
|
}, |
|
getUserMedia: function (func) { |
|
if (!window.getUserMedia) { |
|
window.getUserMedia = navigator["getUserMedia"] || navigator["mozGetUserMedia"]; |
|
} |
|
window.getUserMedia(func); |
|
}, |
|
getMovementX: function (event) { |
|
return event["movementX"] || event["mozMovementX"] || event["webkitMovementX"] || 0; |
|
}, |
|
getMovementY: function (event) { |
|
return event["movementY"] || event["mozMovementY"] || event["webkitMovementY"] || 0; |
|
}, |
|
getMouseWheelDelta: function (event) { |
|
var delta = 0; |
|
switch (event.type) { |
|
case "DOMMouseScroll": |
|
delta = event.detail; |
|
break; |
|
case "mousewheel": |
|
delta = event.wheelDelta; |
|
break; |
|
case "wheel": |
|
delta = event["deltaY"]; |
|
break; |
|
default: |
|
throw "unrecognized mouse wheel event: " + event.type; |
|
} |
|
return delta; |
|
}, |
|
mouseX: 0, |
|
mouseY: 0, |
|
mouseMovementX: 0, |
|
mouseMovementY: 0, |
|
touches: {}, |
|
lastTouches: {}, |
|
calculateMouseEvent: function (event) { |
|
if (Browser.pointerLock) { |
|
if (event.type != "mousemove" && "mozMovementX" in event) { |
|
Browser.mouseMovementX = Browser.mouseMovementY = 0; |
|
} else { |
|
Browser.mouseMovementX = Browser.getMovementX(event); |
|
Browser.mouseMovementY = Browser.getMovementY(event); |
|
} |
|
if (typeof SDL != "undefined") { |
|
Browser.mouseX = SDL.mouseX + Browser.mouseMovementX; |
|
Browser.mouseY = SDL.mouseY + Browser.mouseMovementY; |
|
} else { |
|
Browser.mouseX += Browser.mouseMovementX; |
|
Browser.mouseY += Browser.mouseMovementY; |
|
} |
|
} else { |
|
var rect = Module["canvas"].getBoundingClientRect(); |
|
var cw = Module["canvas"].width; |
|
var ch = Module["canvas"].height; |
|
var scrollX = typeof window.scrollX !== "undefined" ? window.scrollX : window.pageXOffset; |
|
var scrollY = typeof window.scrollY !== "undefined" ? window.scrollY : window.pageYOffset; |
|
if (event.type === "touchstart" || event.type === "touchend" || event.type === "touchmove") { |
|
var touch = event.touch; |
|
if (touch === undefined) { |
|
return; |
|
} |
|
var adjustedX = touch.pageX - (scrollX + rect.left); |
|
var adjustedY = touch.pageY - (scrollY + rect.top); |
|
adjustedX = adjustedX * (cw / rect.width); |
|
adjustedY = adjustedY * (ch / rect.height); |
|
var coords = { x: adjustedX, y: adjustedY }; |
|
if (event.type === "touchstart") { |
|
Browser.lastTouches[touch.identifier] = coords; |
|
Browser.touches[touch.identifier] = coords; |
|
} else if (event.type === "touchend" || event.type === "touchmove") { |
|
var last = Browser.touches[touch.identifier]; |
|
if (!last) last = coords; |
|
Browser.lastTouches[touch.identifier] = last; |
|
Browser.touches[touch.identifier] = coords; |
|
} |
|
return; |
|
} |
|
var x = event.pageX - (scrollX + rect.left); |
|
var y = event.pageY - (scrollY + rect.top); |
|
x = x * (cw / rect.width); |
|
y = y * (ch / rect.height); |
|
Browser.mouseMovementX = x - Browser.mouseX; |
|
Browser.mouseMovementY = y - Browser.mouseY; |
|
Browser.mouseX = x; |
|
Browser.mouseY = y; |
|
} |
|
}, |
|
asyncLoad: function (url, onload, onerror, noRunDep) { |
|
var dep = !noRunDep ? getUniqueRunDependency("al " + url) : ""; |
|
Module["readAsync"]( |
|
url, |
|
function (arrayBuffer) { |
|
assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).'); |
|
onload(new Uint8Array(arrayBuffer)); |
|
if (dep) removeRunDependency(dep); |
|
}, |
|
function (event) { |
|
if (onerror) { |
|
onerror(); |
|
} else { |
|
throw 'Loading data file "' + url + '" failed.'; |
|
} |
|
} |
|
); |
|
if (dep) addRunDependency(dep); |
|
}, |
|
resizeListeners: [], |
|
updateResizeListeners: function () { |
|
var canvas = Module["canvas"]; |
|
Browser.resizeListeners.forEach(function (listener) { |
|
listener(canvas.width, canvas.height); |
|
}); |
|
}, |
|
setCanvasSize: function (width, height, noUpdates) { |
|
var canvas = Module["canvas"]; |
|
Browser.updateCanvasDimensions(canvas, width, height); |
|
if (!noUpdates) Browser.updateResizeListeners(); |
|
}, |
|
windowedWidth: 0, |
|
windowedHeight: 0, |
|
setFullscreenCanvasSize: function () { |
|
if (typeof SDL != "undefined") { |
|
var flags = HEAPU32[SDL.screen >> 2]; |
|
flags = flags | 8388608; |
|
HEAP32[SDL.screen >> 2] = flags; |
|
} |
|
Browser.updateCanvasDimensions(Module["canvas"]); |
|
Browser.updateResizeListeners(); |
|
}, |
|
setWindowedCanvasSize: function () { |
|
if (typeof SDL != "undefined") { |
|
var flags = HEAPU32[SDL.screen >> 2]; |
|
flags = flags & ~8388608; |
|
HEAP32[SDL.screen >> 2] = flags; |
|
} |
|
Browser.updateCanvasDimensions(Module["canvas"]); |
|
Browser.updateResizeListeners(); |
|
}, |
|
updateCanvasDimensions: function (canvas, wNative, hNative) { |
|
if (wNative && hNative) { |
|
canvas.widthNative = wNative; |
|
canvas.heightNative = hNative; |
|
} else { |
|
wNative = canvas.widthNative; |
|
hNative = canvas.heightNative; |
|
} |
|
var w = wNative; |
|
var h = hNative; |
|
if (Module["forcedAspectRatio"] && Module["forcedAspectRatio"] > 0) { |
|
if (w / h < Module["forcedAspectRatio"]) { |
|
w = Math.round(h * Module["forcedAspectRatio"]); |
|
} else { |
|
h = Math.round(w / Module["forcedAspectRatio"]); |
|
} |
|
} |
|
if ( |
|
(document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvas.parentNode && |
|
typeof screen != "undefined" |
|
) { |
|
var factor = Math.min(screen.width / w, screen.height / h); |
|
w = Math.round(w * factor); |
|
h = Math.round(h * factor); |
|
} |
|
if (Browser.resizeCanvas) { |
|
if (canvas.width != w) canvas.width = w; |
|
if (canvas.height != h) canvas.height = h; |
|
if (typeof canvas.style != "undefined") { |
|
canvas.style.removeProperty("width"); |
|
canvas.style.removeProperty("height"); |
|
} |
|
} else { |
|
if (canvas.width != wNative) canvas.width = wNative; |
|
if (canvas.height != hNative) canvas.height = hNative; |
|
if (typeof canvas.style != "undefined") { |
|
if (w != wNative || h != hNative) { |
|
canvas.style.setProperty("width", w + "px", "important"); |
|
canvas.style.setProperty("height", h + "px", "important"); |
|
} else { |
|
canvas.style.removeProperty("width"); |
|
canvas.style.removeProperty("height"); |
|
} |
|
} |
|
} |
|
}, |
|
wgetRequests: {}, |
|
nextWgetRequestHandle: 0, |
|
getNextWgetRequestHandle: function () { |
|
var handle = Browser.nextWgetRequestHandle; |
|
Browser.nextWgetRequestHandle++; |
|
return handle; |
|
}, |
|
}; |
|
function _emscripten_cancel_main_loop() { |
|
Browser.mainLoop.pause(); |
|
Browser.mainLoop.func = null; |
|
} |
|
function _emscripten_set_canvas_element_size_calling_thread(target, width, height) { |
|
var canvas = JSEvents.findCanvasEventTarget(target); |
|
if (!canvas) return -4; |
|
if (canvas.canvasSharedPtr) { |
|
HEAP32[canvas.canvasSharedPtr >> 2] = width; |
|
HEAP32[(canvas.canvasSharedPtr + 4) >> 2] = height; |
|
} |
|
if (canvas.offscreenCanvas || !canvas.controlTransferredOffscreen) { |
|
if (canvas.offscreenCanvas) canvas = canvas.offscreenCanvas; |
|
var autoResizeViewport = false; |
|
if (canvas.GLctxObject && canvas.GLctxObject.GLctx) { |
|
var prevViewport = canvas.GLctxObject.GLctx.getParameter(canvas.GLctxObject.GLctx.VIEWPORT); |
|
autoResizeViewport = prevViewport[0] === 0 && prevViewport[1] === 0 && prevViewport[2] === canvas.width && prevViewport[3] === canvas.height; |
|
} |
|
canvas.width = width; |
|
canvas.height = height; |
|
if (autoResizeViewport) { |
|
canvas.GLctxObject.GLctx.viewport(0, 0, width, height); |
|
} |
|
} else { |
|
return -4; |
|
} |
|
return 0; |
|
} |
|
function _emscripten_set_canvas_element_size_main_thread(target, width, height) { |
|
return _emscripten_set_canvas_element_size_calling_thread(target, width, height); |
|
} |
|
function _emscripten_set_canvas_element_size(target, width, height) { |
|
var canvas = JSEvents.findCanvasEventTarget(target); |
|
if (canvas) return _emscripten_set_canvas_element_size_calling_thread(target, width, height); |
|
else return _emscripten_set_canvas_element_size_main_thread(target, width, height); |
|
} |
|
function emscripten_set_canvas_element_size_js(target, width, height) { |
|
if (typeof target === "string") { |
|
var stackTop = stackSave(); |
|
var targetInt = stackAlloc(target.length + 1); |
|
stringToUTF8(target, targetInt, target.length + 1); |
|
var ret = _emscripten_set_canvas_element_size(targetInt, width, height); |
|
stackRestore(stackTop); |
|
return ret; |
|
} else { |
|
return _emscripten_set_canvas_element_size(target, width, height); |
|
} |
|
} |
|
function _emscripten_get_canvas_element_size_calling_thread(target, width, height) { |
|
var canvas = JSEvents.findCanvasEventTarget(target); |
|
if (!canvas) return -4; |
|
if (canvas.canvasSharedPtr) { |
|
var w = HEAP32[canvas.canvasSharedPtr >> 2]; |
|
var h = HEAP32[(canvas.canvasSharedPtr + 4) >> 2]; |
|
HEAP32[width >> 2] = w; |
|
HEAP32[height >> 2] = h; |
|
} else if (canvas.offscreenCanvas) { |
|
HEAP32[width >> 2] = canvas.offscreenCanvas.width; |
|
HEAP32[height >> 2] = canvas.offscreenCanvas.height; |
|
} else if (!canvas.controlTransferredOffscreen) { |
|
HEAP32[width >> 2] = canvas.width; |
|
HEAP32[height >> 2] = canvas.height; |
|
} else { |
|
return -4; |
|
} |
|
return 0; |
|
} |
|
function _emscripten_get_canvas_element_size_main_thread(target, width, height) { |
|
return _emscripten_get_canvas_element_size_calling_thread(target, width, height); |
|
} |
|
function _emscripten_get_canvas_element_size(target, width, height) { |
|
var canvas = JSEvents.findCanvasEventTarget(target); |
|
if (canvas) return _emscripten_get_canvas_element_size_calling_thread(target, width, height); |
|
else return _emscripten_get_canvas_element_size_main_thread(target, width, height); |
|
} |
|
function emscripten_get_canvas_element_size_js(target) { |
|
var stackTop = stackSave(); |
|
var w = stackAlloc(8); |
|
var h = w + 4; |
|
if (typeof target === "string") { |
|
var targetInt = stackAlloc(target.length + 1); |
|
stringToUTF8(target, targetInt, target.length + 1); |
|
target = targetInt; |
|
} |
|
var ret = _emscripten_get_canvas_element_size(target, w, h); |
|
var size = [HEAP32[w >> 2], HEAP32[h >> 2]]; |
|
stackRestore(stackTop); |
|
return size; |
|
} |
|
var JSEvents = { |
|
keyEvent: 0, |
|
mouseEvent: 0, |
|
wheelEvent: 0, |
|
uiEvent: 0, |
|
focusEvent: 0, |
|
deviceOrientationEvent: 0, |
|
deviceMotionEvent: 0, |
|
fullscreenChangeEvent: 0, |
|
pointerlockChangeEvent: 0, |
|
visibilityChangeEvent: 0, |
|
touchEvent: 0, |
|
lastGamepadState: null, |
|
lastGamepadStateFrame: null, |
|
numGamepadsConnected: 0, |
|
previousFullscreenElement: null, |
|
previousScreenX: null, |
|
previousScreenY: null, |
|
removeEventListenersRegistered: false, |
|
_onGamepadConnected: function () { |
|
++JSEvents.numGamepadsConnected; |
|
}, |
|
_onGamepadDisconnected: function () { |
|
--JSEvents.numGamepadsConnected; |
|
}, |
|
staticInit: function () { |
|
if (typeof window !== "undefined") { |
|
window.addEventListener("gamepadconnected", JSEvents._onGamepadConnected); |
|
window.addEventListener("gamepaddisconnected", JSEvents._onGamepadDisconnected); |
|
var firstState = navigator.getGamepads ? navigator.getGamepads() : navigator.webkitGetGamepads ? navigator.webkitGetGamepads() : null; |
|
if (firstState) { |
|
JSEvents.numGamepadsConnected = firstState.length; |
|
} |
|
} |
|
}, |
|
removeAllEventListeners: function () { |
|
for (var i = JSEvents.eventHandlers.length - 1; i >= 0; --i) { |
|
JSEvents._removeHandler(i); |
|
} |
|
JSEvents.eventHandlers = []; |
|
JSEvents.deferredCalls = []; |
|
window.removeEventListener("gamepadconnected", JSEvents._onGamepadConnected); |
|
window.removeEventListener("gamepaddisconnected", JSEvents._onGamepadDisconnected); |
|
}, |
|
registerRemoveEventListeners: function () { |
|
if (!JSEvents.removeEventListenersRegistered) { |
|
__ATEXIT__.push(JSEvents.removeAllEventListeners); |
|
JSEvents.removeEventListenersRegistered = true; |
|
} |
|
}, |
|
findEventTarget: function (target) { |
|
try { |
|
if (!target) return window; |
|
if (typeof target === "number") target = Pointer_stringify(target); |
|
if (target === "#window") return window; |
|
else if (target === "#document") return document; |
|
else if (target === "#screen") return window.screen; |
|
else if (target === "#canvas") return Module["canvas"]; |
|
return typeof target === "string" ? document.getElementById(target) : target; |
|
} catch (e) { |
|
return null; |
|
} |
|
}, |
|
findCanvasEventTarget: function (target) { |
|
if (typeof target === "number") target = Pointer_stringify(target); |
|
if (!target || target === "#canvas") { |
|
if (typeof GL !== "undefined" && GL.offscreenCanvases["canvas"]) return GL.offscreenCanvases["canvas"]; |
|
return Module["canvas"]; |
|
} |
|
if (typeof GL !== "undefined" && GL.offscreenCanvases[target]) return GL.offscreenCanvases[target]; |
|
return JSEvents.findEventTarget(target); |
|
}, |
|
deferredCalls: [], |
|
deferCall: function (targetFunction, precedence, argsList) { |
|
function arraysHaveEqualContent(arrA, arrB) { |
|
if (arrA.length != arrB.length) return false; |
|
for (var i in arrA) { |
|
if (arrA[i] != arrB[i]) return false; |
|
} |
|
return true; |
|
} |
|
for (var i in JSEvents.deferredCalls) { |
|
var call = JSEvents.deferredCalls[i]; |
|
if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) { |
|
return; |
|
} |
|
} |
|
JSEvents.deferredCalls.push({ targetFunction: targetFunction, precedence: precedence, argsList: argsList }); |
|
JSEvents.deferredCalls.sort(function (x, y) { |
|
return x.precedence < y.precedence; |
|
}); |
|
}, |
|
removeDeferredCalls: function (targetFunction) { |
|
for (var i = 0; i < JSEvents.deferredCalls.length; ++i) { |
|
if (JSEvents.deferredCalls[i].targetFunction == targetFunction) { |
|
JSEvents.deferredCalls.splice(i, 1); |
|
--i; |
|
} |
|
} |
|
}, |
|
canPerformEventHandlerRequests: function () { |
|
return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls; |
|
}, |
|
runDeferredCalls: function () { |
|
if (!JSEvents.canPerformEventHandlerRequests()) { |
|
return; |
|
} |
|
for (var i = 0; i < JSEvents.deferredCalls.length; ++i) { |
|
var call = JSEvents.deferredCalls[i]; |
|
JSEvents.deferredCalls.splice(i, 1); |
|
--i; |
|
call.targetFunction.apply(this, call.argsList); |
|
} |
|
}, |
|
inEventHandler: 0, |
|
currentEventHandler: null, |
|
eventHandlers: [], |
|
isInternetExplorer: function () { |
|
return navigator.userAgent.indexOf("MSIE") !== -1 || navigator.appVersion.indexOf("Trident/") > 0; |
|
}, |
|
removeAllHandlersOnTarget: function (target, eventTypeString) { |
|
for (var i = 0; i < JSEvents.eventHandlers.length; ++i) { |
|
if (JSEvents.eventHandlers[i].target == target && (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) { |
|
JSEvents._removeHandler(i--); |
|
} |
|
} |
|
}, |
|
_removeHandler: function (i) { |
|
var h = JSEvents.eventHandlers[i]; |
|
h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture); |
|
JSEvents.eventHandlers.splice(i, 1); |
|
}, |
|
registerOrRemoveHandler: function (eventHandler) { |
|
var jsEventHandler = function jsEventHandler(event) { |
|
++JSEvents.inEventHandler; |
|
JSEvents.currentEventHandler = eventHandler; |
|
JSEvents.runDeferredCalls(); |
|
eventHandler.handlerFunc(event); |
|
JSEvents.runDeferredCalls(); |
|
--JSEvents.inEventHandler; |
|
}; |
|
if (eventHandler.callbackfunc) { |
|
eventHandler.eventListenerFunc = jsEventHandler; |
|
eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture); |
|
JSEvents.eventHandlers.push(eventHandler); |
|
JSEvents.registerRemoveEventListeners(); |
|
} else { |
|
for (var i = 0; i < JSEvents.eventHandlers.length; ++i) { |
|
if (JSEvents.eventHandlers[i].target == eventHandler.target && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) { |
|
JSEvents._removeHandler(i--); |
|
} |
|
} |
|
} |
|
}, |
|
registerKeyEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!JSEvents.keyEvent) JSEvents.keyEvent = _malloc(164); |
|
var keyEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
var keyEventData = JSEvents.keyEvent; |
|
stringToUTF8(e.key ? e.key : "", keyEventData + 0, 32); |
|
stringToUTF8(e.code ? e.code : "", keyEventData + 32, 32); |
|
HEAP32[(keyEventData + 64) >> 2] = e.location; |
|
HEAP32[(keyEventData + 68) >> 2] = e.ctrlKey; |
|
HEAP32[(keyEventData + 72) >> 2] = e.shiftKey; |
|
HEAP32[(keyEventData + 76) >> 2] = e.altKey; |
|
HEAP32[(keyEventData + 80) >> 2] = e.metaKey; |
|
HEAP32[(keyEventData + 84) >> 2] = e.repeat; |
|
stringToUTF8(e.locale ? e.locale : "", keyEventData + 88, 32); |
|
stringToUTF8(e.char ? e.char : "", keyEventData + 120, 32); |
|
HEAP32[(keyEventData + 152) >> 2] = e.charCode; |
|
HEAP32[(keyEventData + 156) >> 2] = e.keyCode; |
|
HEAP32[(keyEventData + 160) >> 2] = e.which; |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, keyEventData, userData)) e.preventDefault(); |
|
}; |
|
var eventHandler = { |
|
target: JSEvents.findEventTarget(target), |
|
allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, |
|
eventTypeString: eventTypeString, |
|
callbackfunc: callbackfunc, |
|
handlerFunc: keyEventHandlerFunc, |
|
useCapture: useCapture, |
|
}; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
getBoundingClientRectOrZeros: function (target) { |
|
return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 }; |
|
}, |
|
fillMouseEventData: function (eventStruct, e, target) { |
|
HEAPF64[eventStruct >> 3] = JSEvents.tick(); |
|
HEAP32[(eventStruct + 8) >> 2] = e.screenX; |
|
HEAP32[(eventStruct + 12) >> 2] = e.screenY; |
|
HEAP32[(eventStruct + 16) >> 2] = e.clientX; |
|
HEAP32[(eventStruct + 20) >> 2] = e.clientY; |
|
HEAP32[(eventStruct + 24) >> 2] = e.ctrlKey; |
|
HEAP32[(eventStruct + 28) >> 2] = e.shiftKey; |
|
HEAP32[(eventStruct + 32) >> 2] = e.altKey; |
|
HEAP32[(eventStruct + 36) >> 2] = e.metaKey; |
|
HEAP16[(eventStruct + 40) >> 1] = e.button; |
|
HEAP16[(eventStruct + 42) >> 1] = e.buttons; |
|
HEAP32[(eventStruct + 44) >> 2] = e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || e.screenX - JSEvents.previousScreenX; |
|
HEAP32[(eventStruct + 48) >> 2] = e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || e.screenY - JSEvents.previousScreenY; |
|
if (Module["canvas"]) { |
|
var rect = Module["canvas"].getBoundingClientRect(); |
|
HEAP32[(eventStruct + 60) >> 2] = e.clientX - rect.left; |
|
HEAP32[(eventStruct + 64) >> 2] = e.clientY - rect.top; |
|
} else { |
|
HEAP32[(eventStruct + 60) >> 2] = 0; |
|
HEAP32[(eventStruct + 64) >> 2] = 0; |
|
} |
|
if (target) { |
|
var rect = JSEvents.getBoundingClientRectOrZeros(target); |
|
HEAP32[(eventStruct + 52) >> 2] = e.clientX - rect.left; |
|
HEAP32[(eventStruct + 56) >> 2] = e.clientY - rect.top; |
|
} else { |
|
HEAP32[(eventStruct + 52) >> 2] = 0; |
|
HEAP32[(eventStruct + 56) >> 2] = 0; |
|
} |
|
if (e.type !== "wheel" && e.type !== "mousewheel") { |
|
JSEvents.previousScreenX = e.screenX; |
|
JSEvents.previousScreenY = e.screenY; |
|
} |
|
}, |
|
registerMouseEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!JSEvents.mouseEvent) JSEvents.mouseEvent = _malloc(72); |
|
target = JSEvents.findEventTarget(target); |
|
var mouseEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target); |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, JSEvents.mouseEvent, userData)) e.preventDefault(); |
|
}; |
|
var eventHandler = { |
|
target: target, |
|
allowsDeferredCalls: eventTypeString != "mousemove" && eventTypeString != "mouseenter" && eventTypeString != "mouseleave", |
|
eventTypeString: eventTypeString, |
|
callbackfunc: callbackfunc, |
|
handlerFunc: mouseEventHandlerFunc, |
|
useCapture: useCapture, |
|
}; |
|
if (JSEvents.isInternetExplorer() && eventTypeString == "mousedown") eventHandler.allowsDeferredCalls = false; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
registerWheelEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!JSEvents.wheelEvent) JSEvents.wheelEvent = _malloc(104); |
|
target = JSEvents.findEventTarget(target); |
|
var wheelHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
var wheelEvent = JSEvents.wheelEvent; |
|
JSEvents.fillMouseEventData(wheelEvent, e, target); |
|
HEAPF64[(wheelEvent + 72) >> 3] = e["deltaX"]; |
|
HEAPF64[(wheelEvent + 80) >> 3] = e["deltaY"]; |
|
HEAPF64[(wheelEvent + 88) >> 3] = e["deltaZ"]; |
|
HEAP32[(wheelEvent + 96) >> 2] = e["deltaMode"]; |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, wheelEvent, userData)) e.preventDefault(); |
|
}; |
|
var mouseWheelHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target); |
|
HEAPF64[(JSEvents.wheelEvent + 72) >> 3] = e["wheelDeltaX"] || 0; |
|
HEAPF64[(JSEvents.wheelEvent + 80) >> 3] = -(e["wheelDeltaY"] ? e["wheelDeltaY"] : e["wheelDelta"]); |
|
HEAPF64[(JSEvents.wheelEvent + 88) >> 3] = 0; |
|
HEAP32[(JSEvents.wheelEvent + 96) >> 2] = 0; |
|
var shouldCancel = Module["dynCall_iiii"](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData); |
|
if (shouldCancel) { |
|
e.preventDefault(); |
|
} |
|
}; |
|
var eventHandler = { |
|
target: target, |
|
allowsDeferredCalls: true, |
|
eventTypeString: eventTypeString, |
|
callbackfunc: callbackfunc, |
|
handlerFunc: eventTypeString == "wheel" ? wheelHandlerFunc : mouseWheelHandlerFunc, |
|
useCapture: useCapture, |
|
}; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
pageScrollPos: function () { |
|
if (window.pageXOffset > 0 || window.pageYOffset > 0) { |
|
return [window.pageXOffset, window.pageYOffset]; |
|
} |
|
if (typeof document.documentElement.scrollLeft !== "undefined" || typeof document.documentElement.scrollTop !== "undefined") { |
|
return [document.documentElement.scrollLeft, document.documentElement.scrollTop]; |
|
} |
|
return [document.body.scrollLeft | 0, document.body.scrollTop | 0]; |
|
}, |
|
registerUiEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!JSEvents.uiEvent) JSEvents.uiEvent = _malloc(36); |
|
if (eventTypeString == "scroll" && !target) { |
|
target = document; |
|
} else { |
|
target = JSEvents.findEventTarget(target); |
|
} |
|
var uiEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
if (e.target != target) { |
|
return; |
|
} |
|
var scrollPos = JSEvents.pageScrollPos(); |
|
var uiEvent = JSEvents.uiEvent; |
|
HEAP32[uiEvent >> 2] = e.detail; |
|
HEAP32[(uiEvent + 4) >> 2] = document.body.clientWidth; |
|
HEAP32[(uiEvent + 8) >> 2] = document.body.clientHeight; |
|
HEAP32[(uiEvent + 12) >> 2] = window.innerWidth; |
|
HEAP32[(uiEvent + 16) >> 2] = window.innerHeight; |
|
HEAP32[(uiEvent + 20) >> 2] = window.outerWidth; |
|
HEAP32[(uiEvent + 24) >> 2] = window.outerHeight; |
|
HEAP32[(uiEvent + 28) >> 2] = scrollPos[0]; |
|
HEAP32[(uiEvent + 32) >> 2] = scrollPos[1]; |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, uiEvent, userData)) e.preventDefault(); |
|
}; |
|
var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: uiEventHandlerFunc, useCapture: useCapture }; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
getNodeNameForTarget: function (target) { |
|
if (!target) return ""; |
|
if (target == window) return "#window"; |
|
if (target == window.screen) return "#screen"; |
|
return target && target.nodeName ? target.nodeName : ""; |
|
}, |
|
registerFocusEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!JSEvents.focusEvent) JSEvents.focusEvent = _malloc(256); |
|
var focusEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
var nodeName = JSEvents.getNodeNameForTarget(e.target); |
|
var id = e.target.id ? e.target.id : ""; |
|
var focusEvent = JSEvents.focusEvent; |
|
stringToUTF8(nodeName, focusEvent + 0, 128); |
|
stringToUTF8(id, focusEvent + 128, 128); |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, focusEvent, userData)) e.preventDefault(); |
|
}; |
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: focusEventHandlerFunc, useCapture: useCapture }; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
tick: function () { |
|
if (window["performance"] && window["performance"]["now"]) return window["performance"]["now"](); |
|
else return Date.now(); |
|
}, |
|
fillDeviceOrientationEventData: function (eventStruct, e, target) { |
|
HEAPF64[eventStruct >> 3] = JSEvents.tick(); |
|
HEAPF64[(eventStruct + 8) >> 3] = e.alpha; |
|
HEAPF64[(eventStruct + 16) >> 3] = e.beta; |
|
HEAPF64[(eventStruct + 24) >> 3] = e.gamma; |
|
HEAP32[(eventStruct + 32) >> 2] = e.absolute; |
|
}, |
|
registerDeviceOrientationEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!JSEvents.deviceOrientationEvent) JSEvents.deviceOrientationEvent = _malloc(40); |
|
var deviceOrientationEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
JSEvents.fillDeviceOrientationEventData(JSEvents.deviceOrientationEvent, e, target); |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, JSEvents.deviceOrientationEvent, userData)) e.preventDefault(); |
|
}; |
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: deviceOrientationEventHandlerFunc, useCapture: useCapture }; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
fillDeviceMotionEventData: function (eventStruct, e, target) { |
|
HEAPF64[eventStruct >> 3] = JSEvents.tick(); |
|
HEAPF64[(eventStruct + 8) >> 3] = e.acceleration.x; |
|
HEAPF64[(eventStruct + 16) >> 3] = e.acceleration.y; |
|
HEAPF64[(eventStruct + 24) >> 3] = e.acceleration.z; |
|
HEAPF64[(eventStruct + 32) >> 3] = e.accelerationIncludingGravity.x; |
|
HEAPF64[(eventStruct + 40) >> 3] = e.accelerationIncludingGravity.y; |
|
HEAPF64[(eventStruct + 48) >> 3] = e.accelerationIncludingGravity.z; |
|
HEAPF64[(eventStruct + 56) >> 3] = e.rotationRate.alpha; |
|
HEAPF64[(eventStruct + 64) >> 3] = e.rotationRate.beta; |
|
HEAPF64[(eventStruct + 72) >> 3] = e.rotationRate.gamma; |
|
}, |
|
registerDeviceMotionEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!JSEvents.deviceMotionEvent) JSEvents.deviceMotionEvent = _malloc(80); |
|
var deviceMotionEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
JSEvents.fillDeviceMotionEventData(JSEvents.deviceMotionEvent, e, target); |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, JSEvents.deviceMotionEvent, userData)) e.preventDefault(); |
|
}; |
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: deviceMotionEventHandlerFunc, useCapture: useCapture }; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
screenOrientation: function () { |
|
if (!window.screen) return undefined; |
|
return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation; |
|
}, |
|
fillOrientationChangeEventData: function (eventStruct, e) { |
|
var orientations = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"]; |
|
var orientations2 = ["portrait", "portrait", "landscape", "landscape"]; |
|
var orientationString = JSEvents.screenOrientation(); |
|
var orientation = orientations.indexOf(orientationString); |
|
if (orientation == -1) { |
|
orientation = orientations2.indexOf(orientationString); |
|
} |
|
HEAP32[eventStruct >> 2] = 1 << orientation; |
|
HEAP32[(eventStruct + 4) >> 2] = window.orientation; |
|
}, |
|
registerOrientationChangeEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!JSEvents.orientationChangeEvent) JSEvents.orientationChangeEvent = _malloc(8); |
|
if (!target) { |
|
target = window.screen; |
|
} else { |
|
target = JSEvents.findEventTarget(target); |
|
} |
|
var orientationChangeEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
var orientationChangeEvent = JSEvents.orientationChangeEvent; |
|
JSEvents.fillOrientationChangeEventData(orientationChangeEvent, e); |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, orientationChangeEvent, userData)) e.preventDefault(); |
|
}; |
|
if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) { |
|
eventTypeString = "mozorientationchange"; |
|
} |
|
var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: orientationChangeEventHandlerFunc, useCapture: useCapture }; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
fullscreenEnabled: function () { |
|
return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled; |
|
}, |
|
fillFullscreenChangeEventData: function (eventStruct, e) { |
|
var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement; |
|
var isFullscreen = !!fullscreenElement; |
|
HEAP32[eventStruct >> 2] = isFullscreen; |
|
HEAP32[(eventStruct + 4) >> 2] = JSEvents.fullscreenEnabled(); |
|
var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement; |
|
var nodeName = JSEvents.getNodeNameForTarget(reportedElement); |
|
var id = reportedElement && reportedElement.id ? reportedElement.id : ""; |
|
stringToUTF8(nodeName, eventStruct + 8, 128); |
|
stringToUTF8(id, eventStruct + 136, 128); |
|
HEAP32[(eventStruct + 264) >> 2] = reportedElement ? reportedElement.clientWidth : 0; |
|
HEAP32[(eventStruct + 268) >> 2] = reportedElement ? reportedElement.clientHeight : 0; |
|
HEAP32[(eventStruct + 272) >> 2] = screen.width; |
|
HEAP32[(eventStruct + 276) >> 2] = screen.height; |
|
if (isFullscreen) { |
|
JSEvents.previousFullscreenElement = fullscreenElement; |
|
} |
|
}, |
|
registerFullscreenChangeEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!JSEvents.fullscreenChangeEvent) JSEvents.fullscreenChangeEvent = _malloc(280); |
|
if (!target) target = document; |
|
else target = JSEvents.findEventTarget(target); |
|
var fullscreenChangeEventhandlerFunc = function (event) { |
|
var e = event || window.event; |
|
var fullscreenChangeEvent = JSEvents.fullscreenChangeEvent; |
|
JSEvents.fillFullscreenChangeEventData(fullscreenChangeEvent, e); |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, fullscreenChangeEvent, userData)) e.preventDefault(); |
|
}; |
|
var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: fullscreenChangeEventhandlerFunc, useCapture: useCapture }; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
resizeCanvasForFullscreen: function (target, strategy) { |
|
var restoreOldStyle = __registerRestoreOldStyle(target); |
|
var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width; |
|
var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height; |
|
var rect = target.getBoundingClientRect(); |
|
var windowedCssWidth = rect.right - rect.left; |
|
var windowedCssHeight = rect.bottom - rect.top; |
|
var canvasSize = emscripten_get_canvas_element_size_js(target.id); |
|
var windowedRttWidth = canvasSize[0]; |
|
var windowedRttHeight = canvasSize[1]; |
|
if (strategy.scaleMode == 3) { |
|
__setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2); |
|
cssWidth = windowedCssWidth; |
|
cssHeight = windowedCssHeight; |
|
} else if (strategy.scaleMode == 2) { |
|
if (cssWidth * windowedRttHeight < windowedRttWidth * cssHeight) { |
|
var desiredCssHeight = (windowedRttHeight * cssWidth) / windowedRttWidth; |
|
__setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0); |
|
cssHeight = desiredCssHeight; |
|
} else { |
|
var desiredCssWidth = (windowedRttWidth * cssHeight) / windowedRttHeight; |
|
__setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2); |
|
cssWidth = desiredCssWidth; |
|
} |
|
} |
|
if (!target.style.backgroundColor) target.style.backgroundColor = "black"; |
|
if (!document.body.style.backgroundColor) document.body.style.backgroundColor = "black"; |
|
target.style.width = cssWidth + "px"; |
|
target.style.height = cssHeight + "px"; |
|
if (strategy.filteringMode == 1) { |
|
target.style.imageRendering = "optimizeSpeed"; |
|
target.style.imageRendering = "-moz-crisp-edges"; |
|
target.style.imageRendering = "-o-crisp-edges"; |
|
target.style.imageRendering = "-webkit-optimize-contrast"; |
|
target.style.imageRendering = "optimize-contrast"; |
|
target.style.imageRendering = "crisp-edges"; |
|
target.style.imageRendering = "pixelated"; |
|
} |
|
var dpiScale = strategy.canvasResolutionScaleMode == 2 ? window.devicePixelRatio : 1; |
|
if (strategy.canvasResolutionScaleMode != 0) { |
|
var newWidth = (cssWidth * dpiScale) | 0; |
|
var newHeight = (cssHeight * dpiScale) | 0; |
|
if (!target.controlTransferredOffscreen) { |
|
target.width = newWidth; |
|
target.height = newHeight; |
|
} else { |
|
emscripten_set_canvas_element_size_js(target.id, newWidth, newHeight); |
|
} |
|
if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, newWidth, newHeight); |
|
} |
|
return restoreOldStyle; |
|
}, |
|
requestFullscreen: function (target, strategy) { |
|
if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) { |
|
JSEvents.resizeCanvasForFullscreen(target, strategy); |
|
} |
|
if (target.requestFullscreen) { |
|
target.requestFullscreen(); |
|
} else if (target.msRequestFullscreen) { |
|
target.msRequestFullscreen(); |
|
} else if (target.mozRequestFullScreen) { |
|
target.mozRequestFullScreen(); |
|
} else if (target.mozRequestFullscreen) { |
|
target.mozRequestFullscreen(); |
|
} else if (target.webkitRequestFullscreen) { |
|
target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT); |
|
} else { |
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") { |
|
return -1; |
|
} else { |
|
return -3; |
|
} |
|
} |
|
if (strategy.canvasResizedCallback) { |
|
Module["dynCall_iiii"](strategy.canvasResizedCallback, 37, 0, strategy.canvasResizedCallbackUserData); |
|
} |
|
return 0; |
|
}, |
|
fillPointerlockChangeEventData: function (eventStruct, e) { |
|
var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement; |
|
var isPointerlocked = !!pointerLockElement; |
|
HEAP32[eventStruct >> 2] = isPointerlocked; |
|
var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement); |
|
var id = pointerLockElement && pointerLockElement.id ? pointerLockElement.id : ""; |
|
stringToUTF8(nodeName, eventStruct + 4, 128); |
|
stringToUTF8(id, eventStruct + 132, 128); |
|
}, |
|
registerPointerlockChangeEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!JSEvents.pointerlockChangeEvent) JSEvents.pointerlockChangeEvent = _malloc(260); |
|
if (!target) target = document; |
|
else target = JSEvents.findEventTarget(target); |
|
var pointerlockChangeEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
var pointerlockChangeEvent = JSEvents.pointerlockChangeEvent; |
|
JSEvents.fillPointerlockChangeEventData(pointerlockChangeEvent, e); |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, pointerlockChangeEvent, userData)) e.preventDefault(); |
|
}; |
|
var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: pointerlockChangeEventHandlerFunc, useCapture: useCapture }; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
registerPointerlockErrorEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { |
|
if (!target) target = document; |
|
else target = JSEvents.findEventTarget(target); |
|
var pointerlockErrorEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, 0, userData)) e.preventDefault(); |
|
}; |
|
var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: pointerlockErrorEventHandlerFunc, useCapture: useCapture }; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
requestPointerLock: function (target) { |
|
if (target.requestPointerLock) { |
|
target.requestPointerLock(); |
|
} else if (target.mozRequestPointerLock) { |
|
target.mozRequestPointerLock(); |
|
} else if (target.webkitRequestPointerLock) { |
|
target.webkitRequestPointerLock(); |
|
} else if (target.msRequestPointerLock) { |
|
target.msRequestPointerLock(); |
|
} else { |
|
if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) { |
|
return -3; |
|
} else { |
|
return -1; |
|
} |
|
} |
|
return 0; |
|
}, |
|
fillVisibilityChangeEventData: function (eventStruct, e) { |
|
var visibilityStates = ["hidden", "visible", "prerender", "unloaded"]; |
|
var visibilityState = visibilityStates.indexOf(document.visibilityState); |
|
HEAP32[eventStruct >> 2] = document.hidden; |
|
HEAP32[(eventStruct + 4) >> 2] = visibilityState; |
|
}, |
|
registerVisibilityChangeEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!JSEvents.visibilityChangeEvent) JSEvents.visibilityChangeEvent = _malloc(8); |
|
if (!target) target = document; |
|
else target = JSEvents.findEventTarget(target); |
|
var visibilityChangeEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
var visibilityChangeEvent = JSEvents.visibilityChangeEvent; |
|
JSEvents.fillVisibilityChangeEventData(visibilityChangeEvent, e); |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, visibilityChangeEvent, userData)) e.preventDefault(); |
|
}; |
|
var eventHandler = { target: target, allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: visibilityChangeEventHandlerFunc, useCapture: useCapture }; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
registerTouchEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!JSEvents.touchEvent) JSEvents.touchEvent = _malloc(1684); |
|
target = JSEvents.findEventTarget(target); |
|
var touchEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
var touches = {}; |
|
for (var i = 0; i < e.touches.length; ++i) { |
|
var touch = e.touches[i]; |
|
touches[touch.identifier] = touch; |
|
} |
|
for (var i = 0; i < e.changedTouches.length; ++i) { |
|
var touch = e.changedTouches[i]; |
|
touches[touch.identifier] = touch; |
|
touch.changed = true; |
|
} |
|
for (var i = 0; i < e.targetTouches.length; ++i) { |
|
var touch = e.targetTouches[i]; |
|
touches[touch.identifier].onTarget = true; |
|
} |
|
var touchEvent = JSEvents.touchEvent; |
|
var ptr = touchEvent; |
|
HEAP32[(ptr + 4) >> 2] = e.ctrlKey; |
|
HEAP32[(ptr + 8) >> 2] = e.shiftKey; |
|
HEAP32[(ptr + 12) >> 2] = e.altKey; |
|
HEAP32[(ptr + 16) >> 2] = e.metaKey; |
|
ptr += 20; |
|
var canvasRect = Module["canvas"] ? Module["canvas"].getBoundingClientRect() : undefined; |
|
var targetRect = JSEvents.getBoundingClientRectOrZeros(target); |
|
var numTouches = 0; |
|
for (var i in touches) { |
|
var t = touches[i]; |
|
HEAP32[ptr >> 2] = t.identifier; |
|
HEAP32[(ptr + 4) >> 2] = t.screenX; |
|
HEAP32[(ptr + 8) >> 2] = t.screenY; |
|
HEAP32[(ptr + 12) >> 2] = t.clientX; |
|
HEAP32[(ptr + 16) >> 2] = t.clientY; |
|
HEAP32[(ptr + 20) >> 2] = t.pageX; |
|
HEAP32[(ptr + 24) >> 2] = t.pageY; |
|
HEAP32[(ptr + 28) >> 2] = t.changed; |
|
HEAP32[(ptr + 32) >> 2] = t.onTarget; |
|
if (canvasRect) { |
|
HEAP32[(ptr + 44) >> 2] = t.clientX - canvasRect.left; |
|
HEAP32[(ptr + 48) >> 2] = t.clientY - canvasRect.top; |
|
} else { |
|
HEAP32[(ptr + 44) >> 2] = 0; |
|
HEAP32[(ptr + 48) >> 2] = 0; |
|
} |
|
HEAP32[(ptr + 36) >> 2] = t.clientX - targetRect.left; |
|
HEAP32[(ptr + 40) >> 2] = t.clientY - targetRect.top; |
|
ptr += 52; |
|
if (++numTouches >= 32) { |
|
break; |
|
} |
|
} |
|
HEAP32[touchEvent >> 2] = numTouches; |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, touchEvent, userData)) e.preventDefault(); |
|
}; |
|
var eventHandler = { |
|
target: target, |
|
allowsDeferredCalls: eventTypeString == "touchstart" || eventTypeString == "touchend", |
|
eventTypeString: eventTypeString, |
|
callbackfunc: callbackfunc, |
|
handlerFunc: touchEventHandlerFunc, |
|
useCapture: useCapture, |
|
}; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
fillGamepadEventData: function (eventStruct, e) { |
|
HEAPF64[eventStruct >> 3] = e.timestamp; |
|
for (var i = 0; i < e.axes.length; ++i) { |
|
HEAPF64[(eventStruct + i * 8 + 16) >> 3] = e.axes[i]; |
|
} |
|
for (var i = 0; i < e.buttons.length; ++i) { |
|
if (typeof e.buttons[i] === "object") { |
|
HEAPF64[(eventStruct + i * 8 + 528) >> 3] = e.buttons[i].value; |
|
} else { |
|
HEAPF64[(eventStruct + i * 8 + 528) >> 3] = e.buttons[i]; |
|
} |
|
} |
|
for (var i = 0; i < e.buttons.length; ++i) { |
|
if (typeof e.buttons[i] === "object") { |
|
HEAP32[(eventStruct + i * 4 + 1040) >> 2] = e.buttons[i].pressed; |
|
} else { |
|
HEAP32[(eventStruct + i * 4 + 1040) >> 2] = e.buttons[i] == 1; |
|
} |
|
} |
|
HEAP32[(eventStruct + 1296) >> 2] = e.connected; |
|
HEAP32[(eventStruct + 1300) >> 2] = e.index; |
|
HEAP32[(eventStruct + 8) >> 2] = e.axes.length; |
|
HEAP32[(eventStruct + 12) >> 2] = e.buttons.length; |
|
stringToUTF8(e.id, eventStruct + 1304, 64); |
|
stringToUTF8(e.mapping, eventStruct + 1368, 64); |
|
}, |
|
registerGamepadEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!JSEvents.gamepadEvent) JSEvents.gamepadEvent = _malloc(1432); |
|
var gamepadEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
var gamepadEvent = JSEvents.gamepadEvent; |
|
JSEvents.fillGamepadEventData(gamepadEvent, e.gamepad); |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, gamepadEvent, userData)) e.preventDefault(); |
|
}; |
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: true, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: gamepadEventHandlerFunc, useCapture: useCapture }; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
registerBeforeUnloadEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { |
|
var beforeUnloadEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
var confirmationMessage = Module["dynCall_iiii"](callbackfunc, eventTypeId, 0, userData); |
|
if (confirmationMessage) { |
|
confirmationMessage = Pointer_stringify(confirmationMessage); |
|
} |
|
if (confirmationMessage) { |
|
e.preventDefault(); |
|
e.returnValue = confirmationMessage; |
|
return confirmationMessage; |
|
} |
|
}; |
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: beforeUnloadEventHandlerFunc, useCapture: useCapture }; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
battery: function () { |
|
return navigator.battery || navigator.mozBattery || navigator.webkitBattery; |
|
}, |
|
fillBatteryEventData: function (eventStruct, e) { |
|
HEAPF64[eventStruct >> 3] = e.chargingTime; |
|
HEAPF64[(eventStruct + 8) >> 3] = e.dischargingTime; |
|
HEAPF64[(eventStruct + 16) >> 3] = e.level; |
|
HEAP32[(eventStruct + 24) >> 2] = e.charging; |
|
}, |
|
registerBatteryEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!JSEvents.batteryEvent) JSEvents.batteryEvent = _malloc(32); |
|
var batteryEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
var batteryEvent = JSEvents.batteryEvent; |
|
JSEvents.fillBatteryEventData(batteryEvent, JSEvents.battery()); |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, batteryEvent, userData)) e.preventDefault(); |
|
}; |
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: batteryEventHandlerFunc, useCapture: useCapture }; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
registerWebGlEventCallback: function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { |
|
if (!target) target = Module["canvas"]; |
|
var webGlEventHandlerFunc = function (event) { |
|
var e = event || window.event; |
|
if (Module["dynCall_iiii"](callbackfunc, eventTypeId, 0, userData)) e.preventDefault(); |
|
}; |
|
var eventHandler = { target: JSEvents.findEventTarget(target), allowsDeferredCalls: false, eventTypeString: eventTypeString, callbackfunc: callbackfunc, handlerFunc: webGlEventHandlerFunc, useCapture: useCapture }; |
|
JSEvents.registerOrRemoveHandler(eventHandler); |
|
}, |
|
}; |
|
var __currentFullscreenStrategy = {}; |
|
function _emscripten_exit_fullscreen() { |
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") return -1; |
|
JSEvents.removeDeferredCalls(JSEvents.requestFullscreen); |
|
if (document.exitFullscreen) { |
|
document.exitFullscreen(); |
|
} else if (document.msExitFullscreen) { |
|
document.msExitFullscreen(); |
|
} else if (document.mozCancelFullScreen) { |
|
document.mozCancelFullScreen(); |
|
} else if (document.webkitExitFullscreen) { |
|
document.webkitExitFullscreen(); |
|
} else { |
|
return -1; |
|
} |
|
if (__currentFullscreenStrategy.canvasResizedCallback) { |
|
Module["dynCall_iiii"](__currentFullscreenStrategy.canvasResizedCallback, 37, 0, __currentFullscreenStrategy.canvasResizedCallbackUserData); |
|
} |
|
return 0; |
|
} |
|
function _emscripten_exit_pointerlock() { |
|
JSEvents.removeDeferredCalls(JSEvents.requestPointerLock); |
|
if (document.exitPointerLock) { |
|
document.exitPointerLock(); |
|
} else if (document.msExitPointerLock) { |
|
document.msExitPointerLock(); |
|
} else if (document.mozExitPointerLock) { |
|
document.mozExitPointerLock(); |
|
} else if (document.webkitExitPointerLock) { |
|
document.webkitExitPointerLock(); |
|
} else { |
|
return -1; |
|
} |
|
return 0; |
|
} |
|
function _emscripten_get_fullscreen_status(fullscreenStatus) { |
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") return -1; |
|
JSEvents.fillFullscreenChangeEventData(fullscreenStatus); |
|
return 0; |
|
} |
|
function __emscripten_sample_gamepad_data() { |
|
if (!JSEvents.numGamepadsConnected) return; |
|
if (Browser.mainLoop.currentFrameNumber !== JSEvents.lastGamepadStateFrame || !Browser.mainLoop.currentFrameNumber) { |
|
JSEvents.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : navigator.webkitGetGamepads ? navigator.webkitGetGamepads : null; |
|
JSEvents.lastGamepadStateFrame = Browser.mainLoop.currentFrameNumber; |
|
} |
|
} |
|
function _emscripten_get_gamepad_status(index, gamepadState) { |
|
__emscripten_sample_gamepad_data(); |
|
if (!JSEvents.lastGamepadState) return -1; |
|
if (index < 0 || index >= JSEvents.lastGamepadState.length) return -5; |
|
if (!JSEvents.lastGamepadState[index]) return -7; |
|
JSEvents.fillGamepadEventData(gamepadState, JSEvents.lastGamepadState[index]); |
|
return 0; |
|
} |
|
function _emscripten_get_main_loop_timing(mode, value) { |
|
if (mode) HEAP32[mode >> 2] = Browser.mainLoop.timingMode; |
|
if (value) HEAP32[value >> 2] = Browser.mainLoop.timingValue; |
|
} |
|
function _emscripten_get_num_gamepads() { |
|
if (!JSEvents.numGamepadsConnected) return 0; |
|
__emscripten_sample_gamepad_data(); |
|
if (!JSEvents.lastGamepadState) return -1; |
|
return JSEvents.lastGamepadState.length; |
|
} |
|
function _emscripten_has_threading_support() { |
|
return 0; |
|
} |
|
function _emscripten_html5_remove_all_event_listeners() { |
|
JSEvents.removeAllEventListeners(); |
|
} |
|
function _emscripten_is_webgl_context_lost(target) { |
|
if (!Module.ctx) return true; |
|
return Module.ctx.isContextLost(); |
|
} |
|
function __reallyNegative(x) { |
|
return x < 0 || (x === 0 && 1 / x === -Infinity); |
|
} |
|
function __formatString(format, varargs) { |
|
assert((varargs & 3) === 0); |
|
var textIndex = format; |
|
var argIndex = varargs; |
|
function prepVararg(ptr, type) { |
|
if (type === "double" || type === "i64") { |
|
if (ptr & 7) { |
|
assert((ptr & 7) === 4); |
|
ptr += 4; |
|
} |
|
} else { |
|
assert((ptr & 3) === 0); |
|
} |
|
return ptr; |
|
} |
|
function getNextArg(type) { |
|
var ret; |
|
argIndex = prepVararg(argIndex, type); |
|
if (type === "double") { |
|
ret = HEAPF64[argIndex >> 3]; |
|
argIndex += 8; |
|
} else if (type == "i64") { |
|
ret = [HEAP32[argIndex >> 2], HEAP32[(argIndex + 4) >> 2]]; |
|
argIndex += 8; |
|
} else { |
|
assert((argIndex & 3) === 0); |
|
type = "i32"; |
|
ret = HEAP32[argIndex >> 2]; |
|
argIndex += 4; |
|
} |
|
return ret; |
|
} |
|
var ret = []; |
|
var curr, next, currArg; |
|
while (1) { |
|
var startTextIndex = textIndex; |
|
curr = HEAP8[textIndex >> 0]; |
|
if (curr === 0) break; |
|
next = HEAP8[(textIndex + 1) >> 0]; |
|
if (curr == 37) { |
|
var flagAlwaysSigned = false; |
|
var flagLeftAlign = false; |
|
var flagAlternative = false; |
|
var flagZeroPad = false; |
|
var flagPadSign = false; |
|
flagsLoop: while (1) { |
|
switch (next) { |
|
case 43: |
|
flagAlwaysSigned = true; |
|
break; |
|
case 45: |
|
flagLeftAlign = true; |
|
break; |
|
case 35: |
|
flagAlternative = true; |
|
break; |
|
case 48: |
|
if (flagZeroPad) { |
|
break flagsLoop; |
|
} else { |
|
flagZeroPad = true; |
|
break; |
|
} |
|
case 32: |
|
flagPadSign = true; |
|
break; |
|
default: |
|
break flagsLoop; |
|
} |
|
textIndex++; |
|
next = HEAP8[(textIndex + 1) >> 0]; |
|
} |
|
var width = 0; |
|
if (next == 42) { |
|
width = getNextArg("i32"); |
|
textIndex++; |
|
next = HEAP8[(textIndex + 1) >> 0]; |
|
} else { |
|
while (next >= 48 && next <= 57) { |
|
width = width * 10 + (next - 48); |
|
textIndex++; |
|
next = HEAP8[(textIndex + 1) >> 0]; |
|
} |
|
} |
|
var precisionSet = false, |
|
precision = -1; |
|
if (next == 46) { |
|
precision = 0; |
|
precisionSet = true; |
|
textIndex++; |
|
next = HEAP8[(textIndex + 1) >> 0]; |
|
if (next == 42) { |
|
precision = getNextArg("i32"); |
|
textIndex++; |
|
} else { |
|
while (1) { |
|
var precisionChr = HEAP8[(textIndex + 1) >> 0]; |
|
if (precisionChr < 48 || precisionChr > 57) break; |
|
precision = precision * 10 + (precisionChr - 48); |
|
textIndex++; |
|
} |
|
} |
|
next = HEAP8[(textIndex + 1) >> 0]; |
|
} |
|
if (precision < 0) { |
|
precision = 6; |
|
precisionSet = false; |
|
} |
|
var argSize; |
|
switch (String.fromCharCode(next)) { |
|
case "h": |
|
var nextNext = HEAP8[(textIndex + 2) >> 0]; |
|
if (nextNext == 104) { |
|
textIndex++; |
|
argSize = 1; |
|
} else { |
|
argSize = 2; |
|
} |
|
break; |
|
case "l": |
|
var nextNext = HEAP8[(textIndex + 2) >> 0]; |
|
if (nextNext == 108) { |
|
textIndex++; |
|
argSize = 8; |
|
} else { |
|
argSize = 4; |
|
} |
|
break; |
|
case "L": |
|
case "q": |
|
case "j": |
|
argSize = 8; |
|
break; |
|
case "z": |
|
case "t": |
|
case "I": |
|
argSize = 4; |
|
break; |
|
default: |
|
argSize = null; |
|
} |
|
if (argSize) textIndex++; |
|
next = HEAP8[(textIndex + 1) >> 0]; |
|
switch (String.fromCharCode(next)) { |
|
case "d": |
|
case "i": |
|
case "u": |
|
case "o": |
|
case "x": |
|
case "X": |
|
case "p": { |
|
var signed = next == 100 || next == 105; |
|
argSize = argSize || 4; |
|
currArg = getNextArg("i" + argSize * 8); |
|
var origArg = currArg; |
|
var argText; |
|
if (argSize == 8) { |
|
currArg = makeBigInt(currArg[0], currArg[1], next == 117); |
|
} |
|
if (argSize <= 4) { |
|
var limit = Math.pow(256, argSize) - 1; |
|
currArg = (signed ? reSign : unSign)(currArg & limit, argSize * 8); |
|
} |
|
var currAbsArg = Math.abs(currArg); |
|
var prefix = ""; |
|
if (next == 100 || next == 105) { |
|
if (argSize == 8 && typeof i64Math === "object") argText = i64Math.stringify(origArg[0], origArg[1], null); |
|
else argText = reSign(currArg, 8 * argSize, 1).toString(10); |
|
} else if (next == 117) { |
|
if (argSize == 8 && typeof i64Math === "object") argText = i64Math.stringify(origArg[0], origArg[1], true); |
|
else argText = unSign(currArg, 8 * argSize, 1).toString(10); |
|
currArg = Math.abs(currArg); |
|
} else if (next == 111) { |
|
argText = (flagAlternative ? "0" : "") + currAbsArg.toString(8); |
|
} else if (next == 120 || next == 88) { |
|
prefix = flagAlternative && currArg != 0 ? "0x" : ""; |
|
if (argSize == 8 && typeof i64Math === "object") { |
|
if (origArg[1]) { |
|
argText = (origArg[1] >>> 0).toString(16); |
|
var lower = (origArg[0] >>> 0).toString(16); |
|
while (lower.length < 8) lower = "0" + lower; |
|
argText += lower; |
|
} else { |
|
argText = (origArg[0] >>> 0).toString(16); |
|
} |
|
} else if (currArg < 0) { |
|
currArg = -currArg; |
|
argText = (currAbsArg - 1).toString(16); |
|
var buffer = []; |
|
for (var i = 0; i < argText.length; i++) { |
|
buffer.push((15 - parseInt(argText[i], 16)).toString(16)); |
|
} |
|
argText = buffer.join(""); |
|
while (argText.length < argSize * 2) argText = "f" + argText; |
|
} else { |
|
argText = currAbsArg.toString(16); |
|
} |
|
if (next == 88) { |
|
prefix = prefix.toUpperCase(); |
|
argText = argText.toUpperCase(); |
|
} |
|
} else if (next == 112) { |
|
if (currAbsArg === 0) { |
|
argText = "(nil)"; |
|
} else { |
|
prefix = "0x"; |
|
argText = currAbsArg.toString(16); |
|
} |
|
} |
|
if (precisionSet) { |
|
while (argText.length < precision) { |
|
argText = "0" + argText; |
|
} |
|
} |
|
if (currArg >= 0) { |
|
if (flagAlwaysSigned) { |
|
prefix = "+" + prefix; |
|
} else if (flagPadSign) { |
|
prefix = " " + prefix; |
|
} |
|
} |
|
if (argText.charAt(0) == "-") { |
|
prefix = "-" + prefix; |
|
argText = argText.substr(1); |
|
} |
|
while (prefix.length + argText.length < width) { |
|
if (flagLeftAlign) { |
|
argText += " "; |
|
} else { |
|
if (flagZeroPad) { |
|
argText = "0" + argText; |
|
} else { |
|
prefix = " " + prefix; |
|
} |
|
} |
|
} |
|
argText = prefix + argText; |
|
argText.split("").forEach(function (chr) { |
|
ret.push(chr.charCodeAt(0)); |
|
}); |
|
break; |
|
} |
|
case "f": |
|
case "F": |
|
case "e": |
|
case "E": |
|
case "g": |
|
case "G": { |
|
currArg = getNextArg("double"); |
|
var argText; |
|
if (isNaN(currArg)) { |
|
argText = "nan"; |
|
flagZeroPad = false; |
|
} else if (!isFinite(currArg)) { |
|
argText = (currArg < 0 ? "-" : "") + "inf"; |
|
flagZeroPad = false; |
|
} else { |
|
var isGeneral = false; |
|
var effectivePrecision = Math.min(precision, 20); |
|
if (next == 103 || next == 71) { |
|
isGeneral = true; |
|
precision = precision || 1; |
|
var exponent = parseInt(currArg.toExponential(effectivePrecision).split("e")[1], 10); |
|
if (precision > exponent && exponent >= -4) { |
|
next = (next == 103 ? "f" : "F").charCodeAt(0); |
|
precision -= exponent + 1; |
|
} else { |
|
next = (next == 103 ? "e" : "E").charCodeAt(0); |
|
precision--; |
|
} |
|
effectivePrecision = Math.min(precision, 20); |
|
} |
|
if (next == 101 || next == 69) { |
|
argText = currArg.toExponential(effectivePrecision); |
|
if (/[eE][-+]\d$/.test(argText)) { |
|
argText = argText.slice(0, -1) + "0" + argText.slice(-1); |
|
} |
|
} else if (next == 102 || next == 70) { |
|
argText = currArg.toFixed(effectivePrecision); |
|
if (currArg === 0 && __reallyNegative(currArg)) { |
|
argText = "-" + argText; |
|
} |
|
} |
|
var parts = argText.split("e"); |
|
if (isGeneral && !flagAlternative) { |
|
while (parts[0].length > 1 && parts[0].indexOf(".") != -1 && (parts[0].slice(-1) == "0" || parts[0].slice(-1) == ".")) { |
|
parts[0] = parts[0].slice(0, -1); |
|
} |
|
} else { |
|
if (flagAlternative && argText.indexOf(".") == -1) parts[0] += "."; |
|
while (precision > effectivePrecision++) parts[0] += "0"; |
|
} |
|
argText = parts[0] + (parts.length > 1 ? "e" + parts[1] : ""); |
|
if (next == 69) argText = argText.toUpperCase(); |
|
if (currArg >= 0) { |
|
if (flagAlwaysSigned) { |
|
argText = "+" + argText; |
|
} else if (flagPadSign) { |
|
argText = " " + argText; |
|
} |
|
} |
|
} |
|
while (argText.length < width) { |
|
if (flagLeftAlign) { |
|
argText += " "; |
|
} else { |
|
if (flagZeroPad && (argText[0] == "-" || argText[0] == "+")) { |
|
argText = argText[0] + "0" + argText.slice(1); |
|
} else { |
|
argText = (flagZeroPad ? "0" : " ") + argText; |
|
} |
|
} |
|
} |
|
if (next < 97) argText = argText.toUpperCase(); |
|
argText.split("").forEach(function (chr) { |
|
ret.push(chr.charCodeAt(0)); |
|
}); |
|
break; |
|
} |
|
case "s": { |
|
var arg = getNextArg("i8*"); |
|
var argLength = arg ? _strlen(arg) : "(null)".length; |
|
if (precisionSet) argLength = Math.min(argLength, precision); |
|
if (!flagLeftAlign) { |
|
while (argLength < width--) { |
|
ret.push(32); |
|
} |
|
} |
|
if (arg) { |
|
for (var i = 0; i < argLength; i++) { |
|
ret.push(HEAPU8[arg++ >> 0]); |
|
} |
|
} else { |
|
ret = ret.concat(intArrayFromString("(null)".substr(0, argLength), true)); |
|
} |
|
if (flagLeftAlign) { |
|
while (argLength < width--) { |
|
ret.push(32); |
|
} |
|
} |
|
break; |
|
} |
|
case "c": { |
|
if (flagLeftAlign) ret.push(getNextArg("i8")); |
|
while (--width > 0) { |
|
ret.push(32); |
|
} |
|
if (!flagLeftAlign) ret.push(getNextArg("i8")); |
|
break; |
|
} |
|
case "n": { |
|
var ptr = getNextArg("i32*"); |
|
HEAP32[ptr >> 2] = ret.length; |
|
break; |
|
} |
|
case "%": { |
|
ret.push(curr); |
|
break; |
|
} |
|
default: { |
|
for (var i = startTextIndex; i < textIndex + 2; i++) { |
|
ret.push(HEAP8[i >> 0]); |
|
} |
|
} |
|
} |
|
textIndex += 2; |
|
} else { |
|
ret.push(curr); |
|
textIndex += 1; |
|
} |
|
} |
|
return ret; |
|
} |
|
function __emscripten_traverse_stack(args) { |
|
if (!args || !args.callee || !args.callee.name) { |
|
return [null, "", ""]; |
|
} |
|
var funstr = args.callee.toString(); |
|
var funcname = args.callee.name; |
|
var str = "("; |
|
var first = true; |
|
for (var i in args) { |
|
var a = args[i]; |
|
if (!first) { |
|
str += ", "; |
|
} |
|
first = false; |
|
if (typeof a === "number" || typeof a === "string") { |
|
str += a; |
|
} else { |
|
str += "(" + typeof a + ")"; |
|
} |
|
} |
|
str += ")"; |
|
var caller = args.callee.caller; |
|
args = caller ? caller.arguments : []; |
|
if (first) str = ""; |
|
return [args, funcname, str]; |
|
} |
|
function _emscripten_get_callstack_js(flags) { |
|
var callstack = jsStackTrace(); |
|
var iThisFunc = callstack.lastIndexOf("_emscripten_log"); |
|
var iThisFunc2 = callstack.lastIndexOf("_emscripten_get_callstack"); |
|
var iNextLine = callstack.indexOf("\n", Math.max(iThisFunc, iThisFunc2)) + 1; |
|
callstack = callstack.slice(iNextLine); |
|
if (flags & 8 && typeof emscripten_source_map === "undefined") { |
|
warnOnce('Source map information is not available, emscripten_log with EM_LOG_C_STACK will be ignored. Build with "--pre-js $EMSCRIPTEN/src/emscripten-source-map.min.js" linker flag to add source map loading to code.'); |
|
flags ^= 8; |
|
flags |= 16; |
|
} |
|
var stack_args = null; |
|
if (flags & 128) { |
|
stack_args = __emscripten_traverse_stack(arguments); |
|
while (stack_args[1].indexOf("_emscripten_") >= 0) stack_args = __emscripten_traverse_stack(stack_args[0]); |
|
} |
|
var lines = callstack.split("\n"); |
|
callstack = ""; |
|
var newFirefoxRe = new RegExp("\\s*(.*?)@(.*?):([0-9]+):([0-9]+)"); |
|
var firefoxRe = new RegExp("\\s*(.*?)@(.*):(.*)(:(.*))?"); |
|
var chromeRe = new RegExp("\\s*at (.*?) \\((.*):(.*):(.*)\\)"); |
|
for (var l in lines) { |
|
var line = lines[l]; |
|
var jsSymbolName = ""; |
|
var file = ""; |
|
var lineno = 0; |
|
var column = 0; |
|
var parts = chromeRe.exec(line); |
|
if (parts && parts.length == 5) { |
|
jsSymbolName = parts[1]; |
|
file = parts[2]; |
|
lineno = parts[3]; |
|
column = parts[4]; |
|
} else { |
|
parts = newFirefoxRe.exec(line); |
|
if (!parts) parts = firefoxRe.exec(line); |
|
if (parts && parts.length >= 4) { |
|
jsSymbolName = parts[1]; |
|
file = parts[2]; |
|
lineno = parts[3]; |
|
column = parts[4] | 0; |
|
} else { |
|
callstack += line + "\n"; |
|
continue; |
|
} |
|
} |
|
var cSymbolName = flags & 32 ? demangle(jsSymbolName) : jsSymbolName; |
|
if (!cSymbolName) { |
|
cSymbolName = jsSymbolName; |
|
} |
|
var haveSourceMap = false; |
|
if (flags & 8) { |
|
var orig = emscripten_source_map.originalPositionFor({ line: lineno, column: column }); |
|
haveSourceMap = orig && orig.source; |
|
if (haveSourceMap) { |
|
if (flags & 64) { |
|
orig.source = orig.source.substring(orig.source.replace(/\\/g, "/").lastIndexOf("/") + 1); |
|
} |
|
callstack += " at " + cSymbolName + " (" + orig.source + ":" + orig.line + ":" + orig.column + ")\n"; |
|
} |
|
} |
|
if (flags & 16 || !haveSourceMap) { |
|
if (flags & 64) { |
|
file = file.substring(file.replace(/\\/g, "/").lastIndexOf("/") + 1); |
|
} |
|
callstack += (haveSourceMap ? " = " + jsSymbolName : " at " + cSymbolName) + " (" + file + ":" + lineno + ":" + column + ")\n"; |
|
} |
|
if (flags & 128 && stack_args[0]) { |
|
if (stack_args[1] == jsSymbolName && stack_args[2].length > 0) { |
|
callstack = callstack.replace(/\s+$/, ""); |
|
callstack += " with values: " + stack_args[1] + stack_args[2] + "\n"; |
|
} |
|
stack_args = __emscripten_traverse_stack(stack_args[0]); |
|
} |
|
} |
|
callstack = callstack.replace(/\s+$/, ""); |
|
return callstack; |
|
} |
|
function _emscripten_log_js(flags, str) { |
|
if (flags & 24) { |
|
str = str.replace(/\s+$/, ""); |
|
str += (str.length > 0 ? "\n" : "") + _emscripten_get_callstack_js(flags); |
|
} |
|
if (flags & 1) { |
|
if (flags & 4) { |
|
console.error(str); |
|
} else if (flags & 2) { |
|
console.warn(str); |
|
} else { |
|
console.log(str); |
|
} |
|
} else if (flags & 6) { |
|
err(str); |
|
} else { |
|
out(str); |
|
} |
|
} |
|
function _emscripten_log(flags, varargs) { |
|
var format = HEAP32[varargs >> 2]; |
|
varargs += 4; |
|
var str = ""; |
|
if (format) { |
|
var result = __formatString(format, varargs); |
|
for (var i = 0; i < result.length; ++i) { |
|
str += String.fromCharCode(result[i]); |
|
} |
|
} |
|
_emscripten_log_js(flags, str); |
|
} |
|
function _emscripten_num_logical_cores() { |
|
return 1; |
|
} |
|
function __setLetterbox(element, topBottom, leftRight) { |
|
if (JSEvents.isInternetExplorer()) { |
|
element.style.marginLeft = element.style.marginRight = leftRight + "px"; |
|
element.style.marginTop = element.style.marginBottom = topBottom + "px"; |
|
} else { |
|
element.style.paddingLeft = element.style.paddingRight = leftRight + "px"; |
|
element.style.paddingTop = element.style.paddingBottom = topBottom + "px"; |
|
} |
|
} |
|
function __emscripten_do_request_fullscreen(target, strategy) { |
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") return -1; |
|
if (!JSEvents.fullscreenEnabled()) return -3; |
|
if (!target) target = "#canvas"; |
|
target = JSEvents.findEventTarget(target); |
|
if (!target) return -4; |
|
if (!target.requestFullscreen && !target.msRequestFullscreen && !target.mozRequestFullScreen && !target.mozRequestFullscreen && !target.webkitRequestFullscreen) { |
|
return -3; |
|
} |
|
var canPerformRequests = JSEvents.canPerformEventHandlerRequests(); |
|
if (!canPerformRequests) { |
|
if (strategy.deferUntilInEventHandler) { |
|
JSEvents.deferCall(JSEvents.requestFullscreen, 1, [target, strategy]); |
|
return 1; |
|
} else { |
|
return -2; |
|
} |
|
} |
|
return JSEvents.requestFullscreen(target, strategy); |
|
} |
|
function _emscripten_request_fullscreen(target, deferUntilInEventHandler) { |
|
var strategy = {}; |
|
strategy.scaleMode = 0; |
|
strategy.canvasResolutionScaleMode = 0; |
|
strategy.filteringMode = 0; |
|
strategy.deferUntilInEventHandler = deferUntilInEventHandler; |
|
strategy.canvasResizedCallbackTargetThread = 2; |
|
return __emscripten_do_request_fullscreen(target, strategy); |
|
} |
|
function _emscripten_request_pointerlock(target, deferUntilInEventHandler) { |
|
if (!target) target = "#canvas"; |
|
target = JSEvents.findEventTarget(target); |
|
if (!target) return -4; |
|
if (!target.requestPointerLock && !target.mozRequestPointerLock && !target.webkitRequestPointerLock && !target.msRequestPointerLock) { |
|
return -1; |
|
} |
|
var canPerformRequests = JSEvents.canPerformEventHandlerRequests(); |
|
if (!canPerformRequests) { |
|
if (deferUntilInEventHandler) { |
|
JSEvents.deferCall(JSEvents.requestPointerLock, 2, [target]); |
|
return 1; |
|
} else { |
|
return -2; |
|
} |
|
} |
|
return JSEvents.requestPointerLock(target); |
|
} |
|
function _emscripten_set_blur_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerFocusEventCallback(target, userData, useCapture, callbackfunc, 12, "blur", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_dblclick_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 7, "dblclick", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_devicemotion_callback_on_thread(userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerDeviceMotionEventCallback(window, userData, useCapture, callbackfunc, 17, "devicemotion", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_deviceorientation_callback_on_thread(userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerDeviceOrientationEventCallback(window, userData, useCapture, callbackfunc, 16, "deviceorientation", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_focus_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerFocusEventCallback(target, userData, useCapture, callbackfunc, 13, "focus", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_fullscreenchange_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
if (typeof JSEvents.fullscreenEnabled() === "undefined") return -1; |
|
if (!target) target = document; |
|
else { |
|
target = JSEvents.findEventTarget(target); |
|
if (!target) return -4; |
|
} |
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange", targetThread); |
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "mozfullscreenchange", targetThread); |
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange", targetThread); |
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "msfullscreenchange", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_gamepadconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) { |
|
if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1; |
|
JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 26, "gamepadconnected", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_gamepaddisconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) { |
|
if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1; |
|
JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 27, "gamepaddisconnected", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_keydown_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 2, "keydown", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_keypress_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 1, "keypress", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_keyup_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 3, "keyup", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_mousedown_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 5, "mousedown", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_mousemove_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 8, "mousemove", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_mouseup_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 6, "mouseup", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_touchcancel_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_touchend_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_touchmove_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_touchstart_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart", targetThread); |
|
return 0; |
|
} |
|
function _emscripten_set_wheel_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { |
|
target = JSEvents.findEventTarget(target); |
|
if (typeof target.onwheel !== "undefined") { |
|
JSEvents.registerWheelEventCallback(target, userData, useCapture, callbackfunc, 9, "wheel", targetThread); |
|
return 0; |
|
} else if (typeof target.onmousewheel !== "undefined") { |
|
JSEvents.registerWheelEventCallback(target, userData, useCapture, callbackfunc, 9, "mousewheel", targetThread); |
|
return 0; |
|
} else { |
|
return -1; |
|
} |
|
} |
|
var GL = { |
|
counter: 1, |
|
lastError: 0, |
|
buffers: [], |
|
mappedBuffers: {}, |
|
programs: [], |
|
framebuffers: [], |
|
renderbuffers: [], |
|
textures: [], |
|
uniforms: [], |
|
shaders: [], |
|
vaos: [], |
|
contexts: [], |
|
currentContext: null, |
|
offscreenCanvases: {}, |
|
timerQueriesEXT: [], |
|
queries: [], |
|
samplers: [], |
|
transformFeedbacks: [], |
|
syncs: [], |
|
byteSizeByTypeRoot: 5120, |
|
byteSizeByType: [1, 1, 2, 2, 4, 4, 4, 2, 3, 4, 8], |
|
programInfos: {}, |
|
stringCache: {}, |
|
stringiCache: {}, |
|
tempFixedLengthArray: [], |
|
packAlignment: 4, |
|
unpackAlignment: 4, |
|
init: function () { |
|
GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE); |
|
for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) { |
|
GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i + 1); |
|
} |
|
for (var i = 0; i < 32; i++) { |
|
GL.tempFixedLengthArray.push(new Array(i)); |
|
} |
|
}, |
|
recordError: function recordError(errorCode) { |
|
if (!GL.lastError) { |
|
GL.lastError = errorCode; |
|
} |
|
}, |
|
getNewId: function (table) { |
|
var ret = GL.counter++; |
|
for (var i = table.length; i < ret; i++) { |
|
table[i] = null; |
|
} |
|
return ret; |
|
}, |
|
MINI_TEMP_BUFFER_SIZE: 256, |
|
miniTempBuffer: null, |
|
miniTempBufferViews: [0], |
|
getSource: function (shader, count, string, length) { |
|
var source = ""; |
|
for (var i = 0; i < count; ++i) { |
|
var frag; |
|
if (length) { |
|
var len = HEAP32[(length + i * 4) >> 2]; |
|
if (len < 0) { |
|
frag = Pointer_stringify(HEAP32[(string + i * 4) >> 2]); |
|
} else { |
|
frag = Pointer_stringify(HEAP32[(string + i * 4) >> 2], len); |
|
} |
|
} else { |
|
frag = Pointer_stringify(HEAP32[(string + i * 4) >> 2]); |
|
} |
|
source += frag; |
|
} |
|
return source; |
|
}, |
|
createContext: function (canvas, webGLContextAttributes) { |
|
if (typeof webGLContextAttributes["majorVersion"] === "undefined" && typeof webGLContextAttributes["minorVersion"] === "undefined") { |
|
if (typeof WebGL2RenderingContext !== "undefined") webGLContextAttributes["majorVersion"] = 2; |
|
else webGLContextAttributes["majorVersion"] = 1; |
|
webGLContextAttributes["minorVersion"] = 0; |
|
} |
|
var ctx; |
|
var errorInfo = "?"; |
|
function onContextCreationError(event) { |
|
errorInfo = event.statusMessage || errorInfo; |
|
} |
|
webGLContextAttributes["powerPreference"] = "high-performance"; |
|
try { |
|
canvas.addEventListener("webglcontextcreationerror", onContextCreationError, false); |
|
try { |
|
if (webGLContextAttributes["majorVersion"] == 1 && webGLContextAttributes["minorVersion"] == 0) { |
|
ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes); |
|
} else if (webGLContextAttributes["majorVersion"] == 2 && webGLContextAttributes["minorVersion"] == 0) { |
|
ctx = canvas.getContext("webgl2", webGLContextAttributes); |
|
} else { |
|
throw "Unsupported WebGL context version " + majorVersion + "." + minorVersion + "!"; |
|
} |
|
} finally { |
|
canvas.removeEventListener("webglcontextcreationerror", onContextCreationError, false); |
|
} |
|
if (!ctx) throw ":("; |
|
} catch (e) { |
|
out("Could not create canvas: " + [errorInfo, e, JSON.stringify(webGLContextAttributes)]); |
|
return 0; |
|
} |
|
if (!ctx) return 0; |
|
var context = GL.registerContext(ctx, webGLContextAttributes); |
|
return context; |
|
}, |
|
registerContext: function (ctx, webGLContextAttributes) { |
|
var handle = _malloc(8); |
|
HEAP32[handle >> 2] = webGLContextAttributes["explicitSwapControl"]; |
|
var context = { handle: handle, attributes: webGLContextAttributes, version: webGLContextAttributes["majorVersion"], GLctx: ctx }; |
|
function getChromeVersion() { |
|
var raw = navigator.userAgent.match(/Chrom(e|ium)\/([0-9]+)\./); |
|
return raw ? parseInt(raw[2], 10) : false; |
|
} |
|
context.supportsWebGL2EntryPoints = context.version >= 2 && (getChromeVersion() === false || getChromeVersion() >= 58); |
|
if (ctx.canvas) ctx.canvas.GLctxObject = context; |
|
GL.contexts[handle] = context; |
|
if (typeof webGLContextAttributes["enableExtensionsByDefault"] === "undefined" || webGLContextAttributes["enableExtensionsByDefault"]) { |
|
GL.initExtensions(context); |
|
} |
|
if (webGLContextAttributes["renderViaOffscreenBackBuffer"]) { |
|
return 0; |
|
} |
|
return handle; |
|
}, |
|
makeContextCurrent: function (contextHandle) { |
|
if (!contextHandle) { |
|
GLctx = Module.ctx = GL.currentContext = null; |
|
return true; |
|
} |
|
var context = GL.contexts[contextHandle]; |
|
if (!context) { |
|
return false; |
|
} |
|
GLctx = Module.ctx = context.GLctx; |
|
GL.currentContext = context; |
|
return true; |
|
}, |
|
getContext: function (contextHandle) { |
|
return GL.contexts[contextHandle]; |
|
}, |
|
deleteContext: function (contextHandle) { |
|
if (!contextHandle) return; |
|
if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null; |
|
if (typeof JSEvents === "object") JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); |
|
if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; |
|
_free(GL.contexts[contextHandle]); |
|
GL.contexts[contextHandle] = null; |
|
}, |
|
initExtensions: function (context) { |
|
if (!context) context = GL.currentContext; |
|
if (context.initExtensionsDone) return; |
|
context.initExtensionsDone = true; |
|
var GLctx = context.GLctx; |
|
context.maxVertexAttribs = GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS); |
|
if (context.version < 2) { |
|
var instancedArraysExt = GLctx.getExtension("ANGLE_instanced_arrays"); |
|
if (instancedArraysExt) { |
|
GLctx["vertexAttribDivisor"] = function (index, divisor) { |
|
instancedArraysExt["vertexAttribDivisorANGLE"](index, divisor); |
|
}; |
|
GLctx["drawArraysInstanced"] = function (mode, first, count, primcount) { |
|
instancedArraysExt["drawArraysInstancedANGLE"](mode, first, count, primcount); |
|
}; |
|
GLctx["drawElementsInstanced"] = function (mode, count, type, indices, primcount) { |
|
instancedArraysExt["drawElementsInstancedANGLE"](mode, count, type, indices, primcount); |
|
}; |
|
} |
|
var vaoExt = GLctx.getExtension("OES_vertex_array_object"); |
|
if (vaoExt) { |
|
GLctx["createVertexArray"] = function () { |
|
return vaoExt["createVertexArrayOES"](); |
|
}; |
|
GLctx["deleteVertexArray"] = function (vao) { |
|
vaoExt["deleteVertexArrayOES"](vao); |
|
}; |
|
GLctx["bindVertexArray"] = function (vao) { |
|
vaoExt["bindVertexArrayOES"](vao); |
|
}; |
|
GLctx["isVertexArray"] = function (vao) { |
|
return vaoExt["isVertexArrayOES"](vao); |
|
}; |
|
} |
|
var drawBuffersExt = GLctx.getExtension("WEBGL_draw_buffers"); |
|
if (drawBuffersExt) { |
|
GLctx["drawBuffers"] = function (n, bufs) { |
|
drawBuffersExt["drawBuffersWEBGL"](n, bufs); |
|
}; |
|
} |
|
} |
|
GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query"); |
|
var automaticallyEnabledExtensions = [ |
|
"OES_texture_float", |
|
"OES_texture_half_float", |
|
"OES_standard_derivatives", |
|
"OES_vertex_array_object", |
|
"WEBGL_compressed_texture_s3tc", |
|
"WEBGL_depth_texture", |
|
"OES_element_index_uint", |
|
"EXT_texture_filter_anisotropic", |
|
"EXT_frag_depth", |
|
"WEBGL_draw_buffers", |
|
"ANGLE_instanced_arrays", |
|
"OES_texture_float_linear", |
|
"OES_texture_half_float_linear", |
|
"EXT_blend_minmax", |
|
"EXT_shader_texture_lod", |
|
"EXT_texture_norm16", |
|
"WEBGL_compressed_texture_pvrtc", |
|
"EXT_color_buffer_half_float", |
|
"WEBGL_color_buffer_float", |
|
"EXT_sRGB", |
|
"WEBGL_compressed_texture_etc1", |
|
"EXT_disjoint_timer_query", |
|
"WEBGL_compressed_texture_etc", |
|
"WEBGL_compressed_texture_astc", |
|
"EXT_color_buffer_float", |
|
"WEBGL_compressed_texture_s3tc_srgb", |
|
"EXT_disjoint_timer_query_webgl2", |
|
"WEBKIT_WEBGL_compressed_texture_pvrtc", |
|
]; |
|
var exts = GLctx.getSupportedExtensions(); |
|
if (exts && exts.length > 0) { |
|
GLctx.getSupportedExtensions().forEach(function (ext) { |
|
if (automaticallyEnabledExtensions.indexOf(ext) != -1) { |
|
GLctx.getExtension(ext); |
|
} |
|
}); |
|
} |
|
}, |
|
populateUniformTable: function (program) { |
|
var p = GL.programs[program]; |
|
GL.programInfos[program] = { uniforms: {}, maxUniformLength: 0, maxAttributeLength: -1, maxUniformBlockNameLength: -1 }; |
|
var ptable = GL.programInfos[program]; |
|
var utable = ptable.uniforms; |
|
var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS); |
|
for (var i = 0; i < numUniforms; ++i) { |
|
var u = GLctx.getActiveUniform(p, i); |
|
var name = u.name; |
|
ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length + 1); |
|
if (name.indexOf("]", name.length - 1) !== -1) { |
|
var ls = name.lastIndexOf("["); |
|
name = name.slice(0, ls); |
|
} |
|
var loc = GLctx.getUniformLocation(p, name); |
|
if (loc != null) { |
|
var id = GL.getNewId(GL.uniforms); |
|
utable[name] = [u.size, id]; |
|
GL.uniforms[id] = loc; |
|
for (var j = 1; j < u.size; ++j) { |
|
var n = name + "[" + j + "]"; |
|
loc = GLctx.getUniformLocation(p, n); |
|
id = GL.getNewId(GL.uniforms); |
|
GL.uniforms[id] = loc; |
|
} |
|
} |
|
} |
|
}, |
|
}; |
|
function _emscripten_webgl_do_create_context(target, attributes) { |
|
var contextAttributes = {}; |
|
contextAttributes["alpha"] = !!HEAP32[attributes >> 2]; |
|
contextAttributes["depth"] = !!HEAP32[(attributes + 4) >> 2]; |
|
contextAttributes["stencil"] = !!HEAP32[(attributes + 8) >> 2]; |
|
contextAttributes["antialias"] = !!HEAP32[(attributes + 12) >> 2]; |
|
contextAttributes["premultipliedAlpha"] = !!HEAP32[(attributes + 16) >> 2]; |
|
contextAttributes["preserveDrawingBuffer"] = !!HEAP32[(attributes + 20) >> 2]; |
|
contextAttributes["preferLowPowerToHighPerformance"] = !!HEAP32[(attributes + 24) >> 2]; |
|
contextAttributes["failIfMajorPerformanceCaveat"] = !!HEAP32[(attributes + 28) >> 2]; |
|
contextAttributes["majorVersion"] = HEAP32[(attributes + 32) >> 2]; |
|
contextAttributes["minorVersion"] = HEAP32[(attributes + 36) >> 2]; |
|
contextAttributes["explicitSwapControl"] = HEAP32[(attributes + 44) >> 2]; |
|
contextAttributes["proxyContextToMainThread"] = HEAP32[(attributes + 48) >> 2]; |
|
contextAttributes["renderViaOffscreenBackBuffer"] = HEAP32[(attributes + 52) >> 2]; |
|
target = Pointer_stringify(target); |
|
var canvas; |
|
if ((!target || target === "#canvas") && Module["canvas"]) { |
|
canvas = Module["canvas"].id && GL.offscreenCanvases[Module["canvas"].id] ? GL.offscreenCanvases[Module["canvas"].id].offscreenCanvas || JSEvents.findEventTarget(Module["canvas"].id) : Module["canvas"]; |
|
} else { |
|
canvas = GL.offscreenCanvases[target] ? GL.offscreenCanvases[target].offscreenCanvas : JSEvents.findEventTarget(target); |
|
} |
|
if (!canvas) { |
|
return 0; |
|
} |
|
if (contextAttributes["explicitSwapControl"]) { |
|
return 0; |
|
} |
|
var contextHandle = GL.createContext(canvas, contextAttributes); |
|
return contextHandle; |
|
} |
|
function _emscripten_webgl_create_context() { |
|
return _emscripten_webgl_do_create_context.apply(null, arguments); |
|
} |
|
function _emscripten_webgl_destroy_context_calling_thread(contextHandle) { |
|
GL.deleteContext(contextHandle); |
|
} |
|
function _emscripten_webgl_destroy_context() { |
|
return _emscripten_webgl_destroy_context_calling_thread.apply(null, arguments); |
|
} |
|
function _emscripten_webgl_enable_extension_calling_thread(contextHandle, extension) { |
|
var context = GL.getContext(contextHandle); |
|
var extString = Pointer_stringify(extension); |
|
if (extString.indexOf("GL_") == 0) extString = extString.substr(3); |
|
var ext = context.GLctx.getExtension(extString); |
|
return ext ? 1 : 0; |
|
} |
|
function _emscripten_webgl_enable_extension() { |
|
return _emscripten_webgl_enable_extension_calling_thread.apply(null, arguments); |
|
} |
|
function _emscripten_webgl_do_get_current_context() { |
|
return GL.currentContext ? GL.currentContext.handle : 0; |
|
} |
|
function _emscripten_webgl_get_current_context() { |
|
return _emscripten_webgl_do_get_current_context.apply(null, arguments); |
|
} |
|
function _emscripten_webgl_init_context_attributes(attributes) { |
|
HEAP32[attributes >> 2] = 1; |
|
HEAP32[(attributes + 4) >> 2] = 1; |
|
HEAP32[(attributes + 8) >> 2] = 0; |
|
HEAP32[(attributes + 12) >> 2] = 1; |
|
HEAP32[(attributes + 16) >> 2] = 1; |
|
HEAP32[(attributes + 20) >> 2] = 0; |
|
HEAP32[(attributes + 24) >> 2] = 0; |
|
HEAP32[(attributes + 28) >> 2] = 0; |
|
HEAP32[(attributes + 32) >> 2] = 1; |
|
HEAP32[(attributes + 36) >> 2] = 0; |
|
HEAP32[(attributes + 40) >> 2] = 1; |
|
HEAP32[(attributes + 44) >> 2] = 0; |
|
HEAP32[(attributes + 48) >> 2] = 0; |
|
HEAP32[(attributes + 52) >> 2] = 0; |
|
} |
|
function _emscripten_webgl_make_context_current(contextHandle) { |
|
var success = GL.makeContextCurrent(contextHandle); |
|
return success ? 0 : -5; |
|
} |
|
function __exit(status) { |
|
exit(status); |
|
} |
|
function _exit(status) { |
|
__exit(status); |
|
} |
|
function _flock(fd, operation) { |
|
return 0; |
|
} |
|
function _getenv(name) { |
|
if (name === 0) return 0; |
|
name = Pointer_stringify(name); |
|
if (!ENV.hasOwnProperty(name)) return 0; |
|
if (_getenv.ret) _free(_getenv.ret); |
|
_getenv.ret = allocateUTF8(ENV[name]); |
|
return _getenv.ret; |
|
} |
|
function _getpagesize() { |
|
return PAGE_SIZE; |
|
} |
|
function _getpwuid(uid) { |
|
return 0; |
|
} |
|
function _gettimeofday(ptr) { |
|
var now = Date.now(); |
|
HEAP32[ptr >> 2] = (now / 1e3) | 0; |
|
HEAP32[(ptr + 4) >> 2] = ((now % 1e3) * 1e3) | 0; |
|
return 0; |
|
} |
|
function _glActiveTexture(x0) { |
|
GLctx["activeTexture"](x0); |
|
} |
|
function _glAttachShader(program, shader) { |
|
GLctx.attachShader(GL.programs[program], GL.shaders[shader]); |
|
} |
|
function _glBeginQuery(target, id) { |
|
GLctx["beginQuery"](target, id ? GL.queries[id] : null); |
|
} |
|
function _glBeginTransformFeedback(x0) { |
|
GLctx["beginTransformFeedback"](x0); |
|
} |
|
function _glBindAttribLocation(program, index, name) { |
|
name = Pointer_stringify(name); |
|
GLctx.bindAttribLocation(GL.programs[program], index, name); |
|
} |
|
function _glBindBuffer(target, buffer) { |
|
var bufferObj = buffer ? GL.buffers[buffer] : null; |
|
if (target == 35051) { |
|
GLctx.currentPixelPackBufferBinding = buffer; |
|
} else if (target == 35052) { |
|
GLctx.currentPixelUnpackBufferBinding = buffer; |
|
} |
|
GLctx.bindBuffer(target, bufferObj); |
|
} |
|
function _glBindBufferBase(target, index, buffer) { |
|
var bufferObj = buffer ? GL.buffers[buffer] : null; |
|
GLctx["bindBufferBase"](target, index, bufferObj); |
|
} |
|
function _glBindBufferRange(target, index, buffer, offset, ptrsize) { |
|
var bufferObj = buffer ? GL.buffers[buffer] : null; |
|
GLctx["bindBufferRange"](target, index, bufferObj, offset, ptrsize); |
|
} |
|
function _glBindFramebuffer(target, framebuffer) { |
|
GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null); |
|
} |
|
function _glBindRenderbuffer(target, renderbuffer) { |
|
GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null); |
|
} |
|
function _glBindSampler(unit, sampler) { |
|
GLctx["bindSampler"](unit, sampler ? GL.samplers[sampler] : null); |
|
} |
|
function _glBindTexture(target, texture) { |
|
GLctx.bindTexture(target, texture ? GL.textures[texture] : null); |
|
} |
|
function _glBindTransformFeedback(target, id) { |
|
var transformFeedback = id ? GL.transformFeedbacks[id] : null; |
|
if (id && !transformFeedback) { |
|
GL.recordError(1282); |
|
return; |
|
} |
|
GLctx["bindTransformFeedback"](target, transformFeedback); |
|
} |
|
function _glBindVertexArray(vao) { |
|
GLctx["bindVertexArray"](GL.vaos[vao]); |
|
} |
|
function _glBlendEquation(x0) { |
|
GLctx["blendEquation"](x0); |
|
} |
|
function _glBlendEquationSeparate(x0, x1) { |
|
GLctx["blendEquationSeparate"](x0, x1); |
|
} |
|
function _glBlendFuncSeparate(x0, x1, x2, x3) { |
|
GLctx["blendFuncSeparate"](x0, x1, x2, x3); |
|
} |
|
function _glBlitFramebuffer(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) { |
|
GLctx["blitFramebuffer"](x0, x1, x2, x3, x4, x5, x6, x7, x8, x9); |
|
} |
|
function _glBufferData(target, size, data, usage) { |
|
if (!data) { |
|
GLctx.bufferData(target, size, usage); |
|
} else { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.bufferData(target, HEAPU8, usage, data, size); |
|
return; |
|
} |
|
GLctx.bufferData(target, HEAPU8.subarray(data, data + size), usage); |
|
} |
|
} |
|
function _glBufferSubData(target, offset, size, data) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.bufferSubData(target, offset, HEAPU8, data, size); |
|
return; |
|
} |
|
GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data + size)); |
|
} |
|
function _glCheckFramebufferStatus(x0) { |
|
return GLctx["checkFramebufferStatus"](x0); |
|
} |
|
function _glClear(x0) { |
|
GLctx["clear"](x0); |
|
} |
|
function _glClearBufferfi(x0, x1, x2, x3) { |
|
GLctx["clearBufferfi"](x0, x1, x2, x3); |
|
} |
|
function _glClearBufferfv(buffer, drawbuffer, value) { |
|
GLctx["clearBufferfv"](buffer, drawbuffer, HEAPF32, value >> 2); |
|
} |
|
function _glClearBufferuiv(buffer, drawbuffer, value) { |
|
GLctx["clearBufferuiv"](buffer, drawbuffer, HEAPU32, value >> 2); |
|
} |
|
function _glClearColor(x0, x1, x2, x3) { |
|
GLctx["clearColor"](x0, x1, x2, x3); |
|
} |
|
function _glClearDepthf(x0) { |
|
GLctx["clearDepth"](x0); |
|
} |
|
function _glClearStencil(x0) { |
|
GLctx["clearStencil"](x0); |
|
} |
|
function _glClientWaitSync(sync, flags, timeoutLo, timeoutHi) { |
|
timeoutLo = timeoutLo >>> 0; |
|
timeoutHi = timeoutHi >>> 0; |
|
var timeout = timeoutLo == 4294967295 && timeoutHi == 4294967295 ? -1 : makeBigInt(timeoutLo, timeoutHi, true); |
|
return GLctx.clientWaitSync(GL.syncs[sync], flags, timeout); |
|
} |
|
function _glColorMask(red, green, blue, alpha) { |
|
GLctx.colorMask(!!red, !!green, !!blue, !!alpha); |
|
} |
|
function _glCompileShader(shader) { |
|
GLctx.compileShader(GL.shaders[shader]); |
|
} |
|
function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, HEAPU8, data, imageSize); |
|
return; |
|
} |
|
GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray(data, data + imageSize) : null); |
|
} |
|
function _glCompressedTexImage3D(target, level, internalFormat, width, height, depth, border, imageSize, data) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx["compressedTexImage3D"](target, level, internalFormat, width, height, depth, border, HEAPU8, data, imageSize); |
|
} else { |
|
GLctx["compressedTexImage3D"](target, level, internalFormat, width, height, depth, border, data ? HEAPU8.subarray(data, data + imageSize) : null); |
|
} |
|
} |
|
function _glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx["compressedTexSubImage2D"](target, level, xoffset, yoffset, width, height, format, HEAPU8, data, imageSize); |
|
return; |
|
} |
|
GLctx["compressedTexSubImage2D"](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray(data, data + imageSize) : null); |
|
} |
|
function _glCompressedTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, imageSize, data) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx["compressedTexSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, HEAPU8, data, imageSize); |
|
} else { |
|
GLctx["compressedTexSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, data ? HEAPU8.subarray(data, data + imageSize) : null); |
|
} |
|
} |
|
function _glCopyBufferSubData(x0, x1, x2, x3, x4) { |
|
GLctx["copyBufferSubData"](x0, x1, x2, x3, x4); |
|
} |
|
function _glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { |
|
GLctx["copyTexImage2D"](x0, x1, x2, x3, x4, x5, x6, x7); |
|
} |
|
function _glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { |
|
GLctx["copyTexSubImage2D"](x0, x1, x2, x3, x4, x5, x6, x7); |
|
} |
|
function _glCreateProgram() { |
|
var id = GL.getNewId(GL.programs); |
|
var program = GLctx.createProgram(); |
|
program.name = id; |
|
GL.programs[id] = program; |
|
return id; |
|
} |
|
function _glCreateShader(shaderType) { |
|
var id = GL.getNewId(GL.shaders); |
|
GL.shaders[id] = GLctx.createShader(shaderType); |
|
return id; |
|
} |
|
function _glCullFace(x0) { |
|
GLctx["cullFace"](x0); |
|
} |
|
function _glDeleteBuffers(n, buffers) { |
|
for (var i = 0; i < n; i++) { |
|
var id = HEAP32[(buffers + i * 4) >> 2]; |
|
var buffer = GL.buffers[id]; |
|
if (!buffer) continue; |
|
GLctx.deleteBuffer(buffer); |
|
buffer.name = 0; |
|
GL.buffers[id] = null; |
|
if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0; |
|
if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0; |
|
} |
|
} |
|
function _glDeleteFramebuffers(n, framebuffers) { |
|
for (var i = 0; i < n; ++i) { |
|
var id = HEAP32[(framebuffers + i * 4) >> 2]; |
|
var framebuffer = GL.framebuffers[id]; |
|
if (!framebuffer) continue; |
|
GLctx.deleteFramebuffer(framebuffer); |
|
framebuffer.name = 0; |
|
GL.framebuffers[id] = null; |
|
} |
|
} |
|
function _glDeleteProgram(id) { |
|
if (!id) return; |
|
var program = GL.programs[id]; |
|
if (!program) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
GLctx.deleteProgram(program); |
|
program.name = 0; |
|
GL.programs[id] = null; |
|
GL.programInfos[id] = null; |
|
} |
|
function _glDeleteQueries(n, ids) { |
|
for (var i = 0; i < n; i++) { |
|
var id = HEAP32[(ids + i * 4) >> 2]; |
|
var query = GL.queries[id]; |
|
if (!query) continue; |
|
GLctx["deleteQuery"](query); |
|
GL.queries[id] = null; |
|
} |
|
} |
|
function _glDeleteRenderbuffers(n, renderbuffers) { |
|
for (var i = 0; i < n; i++) { |
|
var id = HEAP32[(renderbuffers + i * 4) >> 2]; |
|
var renderbuffer = GL.renderbuffers[id]; |
|
if (!renderbuffer) continue; |
|
GLctx.deleteRenderbuffer(renderbuffer); |
|
renderbuffer.name = 0; |
|
GL.renderbuffers[id] = null; |
|
} |
|
} |
|
function _glDeleteSamplers(n, samplers) { |
|
for (var i = 0; i < n; i++) { |
|
var id = HEAP32[(samplers + i * 4) >> 2]; |
|
var sampler = GL.samplers[id]; |
|
if (!sampler) continue; |
|
GLctx["deleteSampler"](sampler); |
|
sampler.name = 0; |
|
GL.samplers[id] = null; |
|
} |
|
} |
|
function _glDeleteShader(id) { |
|
if (!id) return; |
|
var shader = GL.shaders[id]; |
|
if (!shader) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
GLctx.deleteShader(shader); |
|
GL.shaders[id] = null; |
|
} |
|
function _glDeleteSync(id) { |
|
if (!id) return; |
|
var sync = GL.syncs[id]; |
|
if (!sync) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
GLctx.deleteSync(sync); |
|
sync.name = 0; |
|
GL.syncs[id] = null; |
|
} |
|
function _glDeleteTextures(n, textures) { |
|
for (var i = 0; i < n; i++) { |
|
var id = HEAP32[(textures + i * 4) >> 2]; |
|
var texture = GL.textures[id]; |
|
if (!texture) continue; |
|
GLctx.deleteTexture(texture); |
|
texture.name = 0; |
|
GL.textures[id] = null; |
|
} |
|
} |
|
function _glDeleteTransformFeedbacks(n, ids) { |
|
for (var i = 0; i < n; i++) { |
|
var id = HEAP32[(ids + i * 4) >> 2]; |
|
var transformFeedback = GL.transformFeedbacks[id]; |
|
if (!transformFeedback) continue; |
|
GLctx["deleteTransformFeedback"](transformFeedback); |
|
transformFeedback.name = 0; |
|
GL.transformFeedbacks[id] = null; |
|
} |
|
} |
|
function _glDeleteVertexArrays(n, vaos) { |
|
for (var i = 0; i < n; i++) { |
|
var id = HEAP32[(vaos + i * 4) >> 2]; |
|
GLctx["deleteVertexArray"](GL.vaos[id]); |
|
GL.vaos[id] = null; |
|
} |
|
} |
|
function _glDepthFunc(x0) { |
|
GLctx["depthFunc"](x0); |
|
} |
|
function _glDepthMask(flag) { |
|
GLctx.depthMask(!!flag); |
|
} |
|
function _glDetachShader(program, shader) { |
|
GLctx.detachShader(GL.programs[program], GL.shaders[shader]); |
|
} |
|
function _glDisable(x0) { |
|
GLctx["disable"](x0); |
|
} |
|
function _glDisableVertexAttribArray(index) { |
|
GLctx.disableVertexAttribArray(index); |
|
} |
|
function _glDrawArrays(mode, first, count) { |
|
GLctx.drawArrays(mode, first, count); |
|
} |
|
function _glDrawArraysInstanced(mode, first, count, primcount) { |
|
GLctx["drawArraysInstanced"](mode, first, count, primcount); |
|
} |
|
function _glDrawBuffers(n, bufs) { |
|
var bufArray = GL.tempFixedLengthArray[n]; |
|
for (var i = 0; i < n; i++) { |
|
bufArray[i] = HEAP32[(bufs + i * 4) >> 2]; |
|
} |
|
GLctx["drawBuffers"](bufArray); |
|
} |
|
function _glDrawElements(mode, count, type, indices) { |
|
GLctx.drawElements(mode, count, type, indices); |
|
} |
|
function _glDrawElementsInstanced(mode, count, type, indices, primcount) { |
|
GLctx["drawElementsInstanced"](mode, count, type, indices, primcount); |
|
} |
|
function _glEnable(x0) { |
|
GLctx["enable"](x0); |
|
} |
|
function _glEnableVertexAttribArray(index) { |
|
GLctx.enableVertexAttribArray(index); |
|
} |
|
function _glEndQuery(x0) { |
|
GLctx["endQuery"](x0); |
|
} |
|
function _glEndTransformFeedback() { |
|
GLctx["endTransformFeedback"](); |
|
} |
|
function _glFenceSync(condition, flags) { |
|
var sync = GLctx.fenceSync(condition, flags); |
|
if (sync) { |
|
var id = GL.getNewId(GL.syncs); |
|
sync.name = id; |
|
GL.syncs[id] = sync; |
|
return id; |
|
} else { |
|
return 0; |
|
} |
|
} |
|
function _glFinish() { |
|
GLctx["finish"](); |
|
} |
|
function _glFlush() { |
|
GLctx["flush"](); |
|
} |
|
function emscriptenWebGLGetBufferBinding(target) { |
|
switch (target) { |
|
case 34962: |
|
target = 34964; |
|
break; |
|
case 34963: |
|
target = 34965; |
|
break; |
|
case 35051: |
|
target = 35053; |
|
break; |
|
case 35052: |
|
target = 35055; |
|
break; |
|
case 35982: |
|
target = 35983; |
|
break; |
|
case 36662: |
|
target = 36662; |
|
break; |
|
case 36663: |
|
target = 36663; |
|
break; |
|
case 35345: |
|
target = 35368; |
|
break; |
|
} |
|
var buffer = GLctx.getParameter(target); |
|
if (buffer) return buffer.name | 0; |
|
else return 0; |
|
} |
|
function emscriptenWebGLValidateMapBufferTarget(target) { |
|
switch (target) { |
|
case 34962: |
|
case 34963: |
|
case 36662: |
|
case 36663: |
|
case 35051: |
|
case 35052: |
|
case 35882: |
|
case 35982: |
|
case 35345: |
|
return true; |
|
default: |
|
return false; |
|
} |
|
} |
|
function _glFlushMappedBufferRange(target, offset, length) { |
|
if (!emscriptenWebGLValidateMapBufferTarget(target)) { |
|
GL.recordError(1280); |
|
err("GL_INVALID_ENUM in glFlushMappedBufferRange"); |
|
return; |
|
} |
|
var mapping = GL.mappedBuffers[emscriptenWebGLGetBufferBinding(target)]; |
|
if (!mapping) { |
|
GL.recordError(1282); |
|
Module.printError("buffer was never mapped in glFlushMappedBufferRange"); |
|
return; |
|
} |
|
if (!(mapping.access & 16)) { |
|
GL.recordError(1282); |
|
Module.printError("buffer was not mapped with GL_MAP_FLUSH_EXPLICIT_BIT in glFlushMappedBufferRange"); |
|
return; |
|
} |
|
if (offset < 0 || length < 0 || offset + length > mapping.length) { |
|
GL.recordError(1281); |
|
Module.printError("invalid range in glFlushMappedBufferRange"); |
|
return; |
|
} |
|
GLctx.bufferSubData(target, mapping.offset, HEAPU8.subarray(mapping.mem + offset, mapping.mem + offset + length)); |
|
} |
|
function _glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) { |
|
GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget, GL.renderbuffers[renderbuffer]); |
|
} |
|
function _glFramebufferTexture2D(target, attachment, textarget, texture, level) { |
|
GLctx.framebufferTexture2D(target, attachment, textarget, GL.textures[texture], level); |
|
} |
|
function _glFramebufferTextureLayer(target, attachment, texture, level, layer) { |
|
GLctx.framebufferTextureLayer(target, attachment, GL.textures[texture], level, layer); |
|
} |
|
function _glFrontFace(x0) { |
|
GLctx["frontFace"](x0); |
|
} |
|
function _glGenBuffers(n, buffers) { |
|
for (var i = 0; i < n; i++) { |
|
var buffer = GLctx.createBuffer(); |
|
if (!buffer) { |
|
GL.recordError(1282); |
|
while (i < n) HEAP32[(buffers + i++ * 4) >> 2] = 0; |
|
return; |
|
} |
|
var id = GL.getNewId(GL.buffers); |
|
buffer.name = id; |
|
GL.buffers[id] = buffer; |
|
HEAP32[(buffers + i * 4) >> 2] = id; |
|
} |
|
} |
|
function _glGenFramebuffers(n, ids) { |
|
for (var i = 0; i < n; ++i) { |
|
var framebuffer = GLctx.createFramebuffer(); |
|
if (!framebuffer) { |
|
GL.recordError(1282); |
|
while (i < n) HEAP32[(ids + i++ * 4) >> 2] = 0; |
|
return; |
|
} |
|
var id = GL.getNewId(GL.framebuffers); |
|
framebuffer.name = id; |
|
GL.framebuffers[id] = framebuffer; |
|
HEAP32[(ids + i * 4) >> 2] = id; |
|
} |
|
} |
|
function _glGenQueries(n, ids) { |
|
for (var i = 0; i < n; i++) { |
|
var query = GLctx["createQuery"](); |
|
if (!query) { |
|
GL.recordError(1282); |
|
while (i < n) HEAP32[(ids + i++ * 4) >> 2] = 0; |
|
return; |
|
} |
|
var id = GL.getNewId(GL.queries); |
|
query.name = id; |
|
GL.queries[id] = query; |
|
HEAP32[(ids + i * 4) >> 2] = id; |
|
} |
|
} |
|
function _glGenRenderbuffers(n, renderbuffers) { |
|
for (var i = 0; i < n; i++) { |
|
var renderbuffer = GLctx.createRenderbuffer(); |
|
if (!renderbuffer) { |
|
GL.recordError(1282); |
|
while (i < n) HEAP32[(renderbuffers + i++ * 4) >> 2] = 0; |
|
return; |
|
} |
|
var id = GL.getNewId(GL.renderbuffers); |
|
renderbuffer.name = id; |
|
GL.renderbuffers[id] = renderbuffer; |
|
HEAP32[(renderbuffers + i * 4) >> 2] = id; |
|
} |
|
} |
|
function _glGenSamplers(n, samplers) { |
|
for (var i = 0; i < n; i++) { |
|
var sampler = GLctx["createSampler"](); |
|
if (!sampler) { |
|
GL.recordError(1282); |
|
while (i < n) HEAP32[(samplers + i++ * 4) >> 2] = 0; |
|
return; |
|
} |
|
var id = GL.getNewId(GL.samplers); |
|
sampler.name = id; |
|
GL.samplers[id] = sampler; |
|
HEAP32[(samplers + i * 4) >> 2] = id; |
|
} |
|
} |
|
function _glGenTextures(n, textures) { |
|
for (var i = 0; i < n; i++) { |
|
var texture = GLctx.createTexture(); |
|
if (!texture) { |
|
GL.recordError(1282); |
|
while (i < n) HEAP32[(textures + i++ * 4) >> 2] = 0; |
|
return; |
|
} |
|
var id = GL.getNewId(GL.textures); |
|
texture.name = id; |
|
GL.textures[id] = texture; |
|
HEAP32[(textures + i * 4) >> 2] = id; |
|
} |
|
} |
|
function _glGenTransformFeedbacks(n, ids) { |
|
for (var i = 0; i < n; i++) { |
|
var transformFeedback = GLctx["createTransformFeedback"](); |
|
if (!transformFeedback) { |
|
GL.recordError(1282); |
|
while (i < n) HEAP32[(ids + i++ * 4) >> 2] = 0; |
|
return; |
|
} |
|
var id = GL.getNewId(GL.transformFeedbacks); |
|
transformFeedback.name = id; |
|
GL.transformFeedbacks[id] = transformFeedback; |
|
HEAP32[(ids + i * 4) >> 2] = id; |
|
} |
|
} |
|
function _glGenVertexArrays(n, arrays) { |
|
for (var i = 0; i < n; i++) { |
|
var vao = GLctx["createVertexArray"](); |
|
if (!vao) { |
|
GL.recordError(1282); |
|
while (i < n) HEAP32[(arrays + i++ * 4) >> 2] = 0; |
|
return; |
|
} |
|
var id = GL.getNewId(GL.vaos); |
|
vao.name = id; |
|
GL.vaos[id] = vao; |
|
HEAP32[(arrays + i * 4) >> 2] = id; |
|
} |
|
} |
|
function _glGenerateMipmap(x0) { |
|
GLctx["generateMipmap"](x0); |
|
} |
|
function _glGetActiveAttrib(program, index, bufSize, length, size, type, name) { |
|
program = GL.programs[program]; |
|
var info = GLctx.getActiveAttrib(program, index); |
|
if (!info) return; |
|
if (bufSize > 0 && name) { |
|
var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize); |
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull; |
|
} else { |
|
if (length) HEAP32[length >> 2] = 0; |
|
} |
|
if (size) HEAP32[size >> 2] = info.size; |
|
if (type) HEAP32[type >> 2] = info.type; |
|
} |
|
function _glGetActiveUniform(program, index, bufSize, length, size, type, name) { |
|
program = GL.programs[program]; |
|
var info = GLctx.getActiveUniform(program, index); |
|
if (!info) return; |
|
if (bufSize > 0 && name) { |
|
var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize); |
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull; |
|
} else { |
|
if (length) HEAP32[length >> 2] = 0; |
|
} |
|
if (size) HEAP32[size >> 2] = info.size; |
|
if (type) HEAP32[type >> 2] = info.type; |
|
} |
|
function _glGetActiveUniformBlockName(program, uniformBlockIndex, bufSize, length, uniformBlockName) { |
|
program = GL.programs[program]; |
|
var result = GLctx["getActiveUniformBlockName"](program, uniformBlockIndex); |
|
if (!result) return; |
|
if (uniformBlockName && bufSize > 0) { |
|
var numBytesWrittenExclNull = stringToUTF8(result, uniformBlockName, bufSize); |
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull; |
|
} else { |
|
if (length) HEAP32[length >> 2] = 0; |
|
} |
|
} |
|
function _glGetActiveUniformBlockiv(program, uniformBlockIndex, pname, params) { |
|
if (!params) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
program = GL.programs[program]; |
|
switch (pname) { |
|
case 35393: |
|
var name = GLctx["getActiveUniformBlockName"](program, uniformBlockIndex); |
|
HEAP32[params >> 2] = name.length + 1; |
|
return; |
|
default: |
|
var result = GLctx["getActiveUniformBlockParameter"](program, uniformBlockIndex, pname); |
|
if (!result) return; |
|
if (typeof result == "number") { |
|
HEAP32[params >> 2] = result; |
|
} else { |
|
for (var i = 0; i < result.length; i++) { |
|
HEAP32[(params + i * 4) >> 2] = result[i]; |
|
} |
|
} |
|
} |
|
} |
|
function _glGetActiveUniformsiv(program, uniformCount, uniformIndices, pname, params) { |
|
if (!params) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
if (uniformCount > 0 && uniformIndices == 0) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
program = GL.programs[program]; |
|
var ids = []; |
|
for (var i = 0; i < uniformCount; i++) { |
|
ids.push(HEAP32[(uniformIndices + i * 4) >> 2]); |
|
} |
|
var result = GLctx["getActiveUniforms"](program, ids, pname); |
|
if (!result) return; |
|
var len = result.length; |
|
for (var i = 0; i < len; i++) { |
|
HEAP32[(params + i * 4) >> 2] = result[i]; |
|
} |
|
} |
|
function _glGetAttribLocation(program, name) { |
|
return GLctx.getAttribLocation(GL.programs[program], Pointer_stringify(name)); |
|
} |
|
function _glGetError() { |
|
if (GL.lastError) { |
|
var error = GL.lastError; |
|
GL.lastError = 0; |
|
return error; |
|
} else { |
|
return GLctx.getError(); |
|
} |
|
} |
|
function _glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) { |
|
var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname); |
|
if (result instanceof WebGLRenderbuffer || result instanceof WebGLTexture) { |
|
result = result.name | 0; |
|
} |
|
HEAP32[params >> 2] = result; |
|
} |
|
function emscriptenWebGLGetIndexed(target, index, data, type) { |
|
if (!data) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
var result = GLctx["getIndexedParameter"](target, index); |
|
var ret; |
|
switch (typeof result) { |
|
case "boolean": |
|
ret = result ? 1 : 0; |
|
break; |
|
case "number": |
|
ret = result; |
|
break; |
|
case "object": |
|
if (result === null) { |
|
switch (target) { |
|
case 35983: |
|
case 35368: |
|
ret = 0; |
|
break; |
|
default: { |
|
GL.recordError(1280); |
|
return; |
|
} |
|
} |
|
} else if (result instanceof WebGLBuffer) { |
|
ret = result.name | 0; |
|
} else { |
|
GL.recordError(1280); |
|
return; |
|
} |
|
break; |
|
default: |
|
GL.recordError(1280); |
|
return; |
|
} |
|
switch (type) { |
|
case "Integer64": |
|
(tempI64 = [ |
|
ret >>> 0, |
|
((tempDouble = ret), +Math_abs(tempDouble) >= 1 ? (tempDouble > 0 ? (Math_min(+Math_floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math_ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0) : 0), |
|
]), |
|
(HEAP32[data >> 2] = tempI64[0]), |
|
(HEAP32[(data + 4) >> 2] = tempI64[1]); |
|
break; |
|
case "Integer": |
|
HEAP32[data >> 2] = ret; |
|
break; |
|
case "Float": |
|
HEAPF32[data >> 2] = ret; |
|
break; |
|
case "Boolean": |
|
HEAP8[data >> 0] = ret ? 1 : 0; |
|
break; |
|
default: |
|
throw "internal emscriptenWebGLGetIndexed() error, bad type: " + type; |
|
} |
|
} |
|
function _glGetIntegeri_v(target, index, data) { |
|
emscriptenWebGLGetIndexed(target, index, data, "Integer"); |
|
} |
|
function emscriptenWebGLGet(name_, p, type) { |
|
if (!p) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
var ret = undefined; |
|
switch (name_) { |
|
case 36346: |
|
ret = 1; |
|
break; |
|
case 36344: |
|
if (type !== "Integer" && type !== "Integer64") { |
|
GL.recordError(1280); |
|
} |
|
return; |
|
case 34814: |
|
case 36345: |
|
ret = 0; |
|
break; |
|
case 34466: |
|
var formats = GLctx.getParameter(34467); |
|
ret = formats.length; |
|
break; |
|
case 33309: |
|
if (GLctx.canvas.GLctxObject.version < 2) { |
|
GL.recordError(1282); |
|
return; |
|
} |
|
var exts = GLctx.getSupportedExtensions(); |
|
ret = 2 * exts.length; |
|
break; |
|
case 33307: |
|
case 33308: |
|
if (GLctx.canvas.GLctxObject.version < 2) { |
|
GL.recordError(1280); |
|
return; |
|
} |
|
ret = name_ == 33307 ? 3 : 0; |
|
break; |
|
} |
|
if (ret === undefined) { |
|
var result = GLctx.getParameter(name_); |
|
switch (typeof result) { |
|
case "number": |
|
ret = result; |
|
break; |
|
case "boolean": |
|
ret = result ? 1 : 0; |
|
break; |
|
case "string": |
|
GL.recordError(1280); |
|
return; |
|
case "object": |
|
if (result === null) { |
|
switch (name_) { |
|
case 34964: |
|
case 35725: |
|
case 34965: |
|
case 36006: |
|
case 36007: |
|
case 32873: |
|
case 34229: |
|
case 35097: |
|
case 36389: |
|
case 34068: { |
|
ret = 0; |
|
break; |
|
} |
|
default: { |
|
GL.recordError(1280); |
|
return; |
|
} |
|
} |
|
} else if (result instanceof Float32Array || result instanceof Uint32Array || result instanceof Int32Array || result instanceof Array) { |
|
for (var i = 0; i < result.length; ++i) { |
|
switch (type) { |
|
case "Integer": |
|
HEAP32[(p + i * 4) >> 2] = result[i]; |
|
break; |
|
case "Float": |
|
HEAPF32[(p + i * 4) >> 2] = result[i]; |
|
break; |
|
case "Boolean": |
|
HEAP8[(p + i) >> 0] = result[i] ? 1 : 0; |
|
break; |
|
default: |
|
throw "internal glGet error, bad type: " + type; |
|
} |
|
} |
|
return; |
|
} else if ( |
|
result instanceof WebGLBuffer || |
|
result instanceof WebGLProgram || |
|
result instanceof WebGLFramebuffer || |
|
result instanceof WebGLRenderbuffer || |
|
result instanceof WebGLQuery || |
|
result instanceof WebGLSampler || |
|
result instanceof WebGLSync || |
|
result instanceof WebGLTransformFeedback || |
|
result instanceof WebGLVertexArrayObject || |
|
result instanceof WebGLTexture |
|
) { |
|
ret = result.name | 0; |
|
} else { |
|
GL.recordError(1280); |
|
return; |
|
} |
|
break; |
|
default: |
|
GL.recordError(1280); |
|
return; |
|
} |
|
} |
|
switch (type) { |
|
case "Integer64": |
|
(tempI64 = [ |
|
ret >>> 0, |
|
((tempDouble = ret), +Math_abs(tempDouble) >= 1 ? (tempDouble > 0 ? (Math_min(+Math_floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math_ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0) : 0), |
|
]), |
|
(HEAP32[p >> 2] = tempI64[0]), |
|
(HEAP32[(p + 4) >> 2] = tempI64[1]); |
|
break; |
|
case "Integer": |
|
HEAP32[p >> 2] = ret; |
|
break; |
|
case "Float": |
|
HEAPF32[p >> 2] = ret; |
|
break; |
|
case "Boolean": |
|
HEAP8[p >> 0] = ret ? 1 : 0; |
|
break; |
|
default: |
|
throw "internal glGet error, bad type: " + type; |
|
} |
|
} |
|
function _glGetIntegerv(name_, p) { |
|
emscriptenWebGLGet(name_, p, "Integer"); |
|
} |
|
function _glGetInternalformativ(target, internalformat, pname, bufSize, params) { |
|
if (bufSize < 0) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
var samples = GLctx["getInternalformatParameter"](target, internalformat, 32937); |
|
if (!samples) { |
|
GL.recordError(1280); |
|
return; |
|
} |
|
switch (pname) { |
|
case 32937: |
|
var n = Math.min(bufSize, samples.length); |
|
for (var i = 0; i < n; i++) { |
|
var v = samples[i]; |
|
HEAP32[(params + i * 4) >> 2] = v; |
|
} |
|
break; |
|
case 37760: |
|
if (bufSize > 1) { |
|
var v = samples.length; |
|
HEAP32[params >> 2] = v; |
|
} |
|
break; |
|
default: |
|
GL.recordError(1280); |
|
} |
|
} |
|
function _glGetProgramBinary(program, bufSize, length, binaryFormat, binary) { |
|
GL.recordError(1282); |
|
} |
|
function _glGetProgramInfoLog(program, maxLength, length, infoLog) { |
|
var log = GLctx.getProgramInfoLog(GL.programs[program]); |
|
if (log === null) log = "(unknown error)"; |
|
if (maxLength > 0 && infoLog) { |
|
var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength); |
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull; |
|
} else { |
|
if (length) HEAP32[length >> 2] = 0; |
|
} |
|
} |
|
function _glGetProgramiv(program, pname, p) { |
|
if (!p) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
if (program >= GL.counter) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
var ptable = GL.programInfos[program]; |
|
if (!ptable) { |
|
GL.recordError(1282); |
|
return; |
|
} |
|
if (pname == 35716) { |
|
var log = GLctx.getProgramInfoLog(GL.programs[program]); |
|
if (log === null) log = "(unknown error)"; |
|
HEAP32[p >> 2] = log.length + 1; |
|
} else if (pname == 35719) { |
|
HEAP32[p >> 2] = ptable.maxUniformLength; |
|
} else if (pname == 35722) { |
|
if (ptable.maxAttributeLength == -1) { |
|
program = GL.programs[program]; |
|
var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES); |
|
ptable.maxAttributeLength = 0; |
|
for (var i = 0; i < numAttribs; ++i) { |
|
var activeAttrib = GLctx.getActiveAttrib(program, i); |
|
ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length + 1); |
|
} |
|
} |
|
HEAP32[p >> 2] = ptable.maxAttributeLength; |
|
} else if (pname == 35381) { |
|
if (ptable.maxUniformBlockNameLength == -1) { |
|
program = GL.programs[program]; |
|
var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS); |
|
ptable.maxUniformBlockNameLength = 0; |
|
for (var i = 0; i < numBlocks; ++i) { |
|
var activeBlockName = GLctx.getActiveUniformBlockName(program, i); |
|
ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length + 1); |
|
} |
|
} |
|
HEAP32[p >> 2] = ptable.maxUniformBlockNameLength; |
|
} else { |
|
HEAP32[p >> 2] = GLctx.getProgramParameter(GL.programs[program], pname); |
|
} |
|
} |
|
function _glGetRenderbufferParameteriv(target, pname, params) { |
|
if (!params) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
HEAP32[params >> 2] = GLctx.getRenderbufferParameter(target, pname); |
|
} |
|
function _glGetShaderInfoLog(shader, maxLength, length, infoLog) { |
|
var log = GLctx.getShaderInfoLog(GL.shaders[shader]); |
|
if (log === null) log = "(unknown error)"; |
|
if (maxLength > 0 && infoLog) { |
|
var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength); |
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull; |
|
} else { |
|
if (length) HEAP32[length >> 2] = 0; |
|
} |
|
} |
|
function _glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) { |
|
var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType); |
|
HEAP32[range >> 2] = result.rangeMin; |
|
HEAP32[(range + 4) >> 2] = result.rangeMax; |
|
HEAP32[precision >> 2] = result.precision; |
|
} |
|
function _glGetShaderSource(shader, bufSize, length, source) { |
|
var result = GLctx.getShaderSource(GL.shaders[shader]); |
|
if (!result) return; |
|
if (bufSize > 0 && source) { |
|
var numBytesWrittenExclNull = stringToUTF8(result, source, bufSize); |
|
if (length) HEAP32[length >> 2] = numBytesWrittenExclNull; |
|
} else { |
|
if (length) HEAP32[length >> 2] = 0; |
|
} |
|
} |
|
function _glGetShaderiv(shader, pname, p) { |
|
if (!p) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
if (pname == 35716) { |
|
var log = GLctx.getShaderInfoLog(GL.shaders[shader]); |
|
if (log === null) log = "(unknown error)"; |
|
HEAP32[p >> 2] = log.length + 1; |
|
} else if (pname == 35720) { |
|
var source = GLctx.getShaderSource(GL.shaders[shader]); |
|
var sourceLength = source === null || source.length == 0 ? 0 : source.length + 1; |
|
HEAP32[p >> 2] = sourceLength; |
|
} else { |
|
HEAP32[p >> 2] = GLctx.getShaderParameter(GL.shaders[shader], pname); |
|
} |
|
} |
|
function _glGetString(name_) { |
|
if (GL.stringCache[name_]) return GL.stringCache[name_]; |
|
var ret; |
|
switch (name_) { |
|
case 7936: |
|
case 7937: |
|
case 37445: |
|
case 37446: |
|
ret = allocate(intArrayFromString(GLctx.getParameter(name_)), "i8", ALLOC_NORMAL); |
|
break; |
|
case 7938: |
|
var glVersion = GLctx.getParameter(GLctx.VERSION); |
|
if (GLctx.canvas.GLctxObject.version >= 2) glVersion = "OpenGL ES 3.0 (" + glVersion + ")"; |
|
else { |
|
glVersion = "OpenGL ES 2.0 (" + glVersion + ")"; |
|
} |
|
ret = allocate(intArrayFromString(glVersion), "i8", ALLOC_NORMAL); |
|
break; |
|
case 7939: |
|
var exts = GLctx.getSupportedExtensions(); |
|
var gl_exts = []; |
|
for (var i = 0; i < exts.length; ++i) { |
|
gl_exts.push(exts[i]); |
|
gl_exts.push("GL_" + exts[i]); |
|
} |
|
ret = allocate(intArrayFromString(gl_exts.join(" ")), "i8", ALLOC_NORMAL); |
|
break; |
|
case 35724: |
|
var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION); |
|
var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/; |
|
var ver_num = glslVersion.match(ver_re); |
|
if (ver_num !== null) { |
|
if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + "0"; |
|
glslVersion = "OpenGL ES GLSL ES " + ver_num[1] + " (" + glslVersion + ")"; |
|
} |
|
ret = allocate(intArrayFromString(glslVersion), "i8", ALLOC_NORMAL); |
|
break; |
|
default: |
|
GL.recordError(1280); |
|
return 0; |
|
} |
|
GL.stringCache[name_] = ret; |
|
return ret; |
|
} |
|
function _glGetStringi(name, index) { |
|
if (GLctx.canvas.GLctxObject.version < 2) { |
|
GL.recordError(1282); |
|
return 0; |
|
} |
|
var stringiCache = GL.stringiCache[name]; |
|
if (stringiCache) { |
|
if (index < 0 || index >= stringiCache.length) { |
|
GL.recordError(1281); |
|
return 0; |
|
} |
|
return stringiCache[index]; |
|
} |
|
switch (name) { |
|
case 7939: |
|
var exts = GLctx.getSupportedExtensions(); |
|
var gl_exts = []; |
|
for (var i = 0; i < exts.length; ++i) { |
|
gl_exts.push(allocate(intArrayFromString(exts[i]), "i8", ALLOC_NORMAL)); |
|
gl_exts.push(allocate(intArrayFromString("GL_" + exts[i]), "i8", ALLOC_NORMAL)); |
|
} |
|
stringiCache = GL.stringiCache[name] = gl_exts; |
|
if (index < 0 || index >= stringiCache.length) { |
|
GL.recordError(1281); |
|
return 0; |
|
} |
|
return stringiCache[index]; |
|
default: |
|
GL.recordError(1280); |
|
return 0; |
|
} |
|
} |
|
function _glGetTexParameteriv(target, pname, params) { |
|
if (!params) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
HEAP32[params >> 2] = GLctx.getTexParameter(target, pname); |
|
} |
|
function _glGetUniformBlockIndex(program, uniformBlockName) { |
|
program = GL.programs[program]; |
|
uniformBlockName = Pointer_stringify(uniformBlockName); |
|
return GLctx["getUniformBlockIndex"](program, uniformBlockName); |
|
} |
|
function _glGetUniformIndices(program, uniformCount, uniformNames, uniformIndices) { |
|
if (!uniformIndices) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
if (uniformCount > 0 && (uniformNames == 0 || uniformIndices == 0)) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
program = GL.programs[program]; |
|
var names = []; |
|
for (var i = 0; i < uniformCount; i++) names.push(Pointer_stringify(HEAP32[(uniformNames + i * 4) >> 2])); |
|
var result = GLctx["getUniformIndices"](program, names); |
|
if (!result) return; |
|
var len = result.length; |
|
for (var i = 0; i < len; i++) { |
|
HEAP32[(uniformIndices + i * 4) >> 2] = result[i]; |
|
} |
|
} |
|
function _glGetUniformLocation(program, name) { |
|
name = Pointer_stringify(name); |
|
var arrayOffset = 0; |
|
if (name.indexOf("]", name.length - 1) !== -1) { |
|
var ls = name.lastIndexOf("["); |
|
var arrayIndex = name.slice(ls + 1, -1); |
|
if (arrayIndex.length > 0) { |
|
arrayOffset = parseInt(arrayIndex); |
|
if (arrayOffset < 0) { |
|
return -1; |
|
} |
|
} |
|
name = name.slice(0, ls); |
|
} |
|
var ptable = GL.programInfos[program]; |
|
if (!ptable) { |
|
return -1; |
|
} |
|
var utable = ptable.uniforms; |
|
var uniformInfo = utable[name]; |
|
if (uniformInfo && arrayOffset < uniformInfo[0]) { |
|
return uniformInfo[1] + arrayOffset; |
|
} else { |
|
return -1; |
|
} |
|
} |
|
function emscriptenWebGLGetUniform(program, location, params, type) { |
|
if (!params) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]); |
|
if (typeof data == "number" || typeof data == "boolean") { |
|
switch (type) { |
|
case "Integer": |
|
HEAP32[params >> 2] = data; |
|
break; |
|
case "Float": |
|
HEAPF32[params >> 2] = data; |
|
break; |
|
default: |
|
throw "internal emscriptenWebGLGetUniform() error, bad type: " + type; |
|
} |
|
} else { |
|
for (var i = 0; i < data.length; i++) { |
|
switch (type) { |
|
case "Integer": |
|
HEAP32[(params + i * 4) >> 2] = data[i]; |
|
break; |
|
case "Float": |
|
HEAPF32[(params + i * 4) >> 2] = data[i]; |
|
break; |
|
default: |
|
throw "internal emscriptenWebGLGetUniform() error, bad type: " + type; |
|
} |
|
} |
|
} |
|
} |
|
function _glGetUniformiv(program, location, params) { |
|
emscriptenWebGLGetUniform(program, location, params, "Integer"); |
|
} |
|
function emscriptenWebGLGetVertexAttrib(index, pname, params, type) { |
|
if (!params) { |
|
GL.recordError(1281); |
|
return; |
|
} |
|
var data = GLctx.getVertexAttrib(index, pname); |
|
if (pname == 34975) { |
|
HEAP32[params >> 2] = data["name"]; |
|
} else if (typeof data == "number" || typeof data == "boolean") { |
|
switch (type) { |
|
case "Integer": |
|
HEAP32[params >> 2] = data; |
|
break; |
|
case "Float": |
|
HEAPF32[params >> 2] = data; |
|
break; |
|
case "FloatToInteger": |
|
HEAP32[params >> 2] = Math.fround(data); |
|
break; |
|
default: |
|
throw "internal emscriptenWebGLGetVertexAttrib() error, bad type: " + type; |
|
} |
|
} else { |
|
for (var i = 0; i < data.length; i++) { |
|
switch (type) { |
|
case "Integer": |
|
HEAP32[(params + i * 4) >> 2] = data[i]; |
|
break; |
|
case "Float": |
|
HEAPF32[(params + i * 4) >> 2] = data[i]; |
|
break; |
|
case "FloatToInteger": |
|
HEAP32[(params + i * 4) >> 2] = Math.fround(data[i]); |
|
break; |
|
default: |
|
throw "internal emscriptenWebGLGetVertexAttrib() error, bad type: " + type; |
|
} |
|
} |
|
} |
|
} |
|
function _glGetVertexAttribiv(index, pname, params) { |
|
emscriptenWebGLGetVertexAttrib(index, pname, params, "FloatToInteger"); |
|
} |
|
function _glInvalidateFramebuffer(target, numAttachments, attachments) { |
|
var list = GL.tempFixedLengthArray[numAttachments]; |
|
for (var i = 0; i < numAttachments; i++) { |
|
list[i] = HEAP32[(attachments + i * 4) >> 2]; |
|
} |
|
GLctx["invalidateFramebuffer"](target, list); |
|
} |
|
function _glIsEnabled(x0) { |
|
return GLctx["isEnabled"](x0); |
|
} |
|
function _glIsVertexArray(array) { |
|
var vao = GL.vaos[array]; |
|
if (!vao) return 0; |
|
return GLctx["isVertexArray"](vao); |
|
} |
|
function _glLinkProgram(program) { |
|
GLctx.linkProgram(GL.programs[program]); |
|
GL.programInfos[program] = null; |
|
GL.populateUniformTable(program); |
|
} |
|
function _glMapBufferRange(target, offset, length, access) { |
|
if (access != 26 && access != 10) { |
|
err("glMapBufferRange is only supported when access is MAP_WRITE|INVALIDATE_BUFFER"); |
|
return 0; |
|
} |
|
if (!emscriptenWebGLValidateMapBufferTarget(target)) { |
|
GL.recordError(1280); |
|
err("GL_INVALID_ENUM in glMapBufferRange"); |
|
return 0; |
|
} |
|
var mem = _malloc(length); |
|
if (!mem) return 0; |
|
GL.mappedBuffers[emscriptenWebGLGetBufferBinding(target)] = { offset: offset, length: length, mem: mem, access: access }; |
|
return mem; |
|
} |
|
function _glPixelStorei(pname, param) { |
|
if (pname == 3333) { |
|
GL.packAlignment = param; |
|
} else if (pname == 3317) { |
|
GL.unpackAlignment = param; |
|
} |
|
GLctx.pixelStorei(pname, param); |
|
} |
|
function _glPolygonOffset(x0, x1) { |
|
GLctx["polygonOffset"](x0, x1); |
|
} |
|
function _glProgramBinary(program, binaryFormat, binary, length) { |
|
GL.recordError(1280); |
|
} |
|
function _glProgramParameteri(program, pname, value) { |
|
GL.recordError(1280); |
|
} |
|
function _glReadBuffer(x0) { |
|
GLctx["readBuffer"](x0); |
|
} |
|
function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) { |
|
function roundedToNextMultipleOf(x, y) { |
|
return Math.floor((x + y - 1) / y) * y; |
|
} |
|
var plainRowSize = width * sizePerPixel; |
|
var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment); |
|
return height <= 0 ? 0 : (height - 1) * alignedRowSize + plainRowSize; |
|
} |
|
function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) { |
|
var sizePerPixel; |
|
var numChannels; |
|
switch (format) { |
|
case 6406: |
|
case 6409: |
|
case 6402: |
|
case 6403: |
|
case 36244: |
|
numChannels = 1; |
|
break; |
|
case 6410: |
|
case 33319: |
|
case 33320: |
|
numChannels = 2; |
|
break; |
|
case 6407: |
|
case 35904: |
|
case 36248: |
|
numChannels = 3; |
|
break; |
|
case 6408: |
|
case 35906: |
|
case 36249: |
|
numChannels = 4; |
|
break; |
|
default: |
|
GL.recordError(1280); |
|
return null; |
|
} |
|
switch (type) { |
|
case 5121: |
|
case 5120: |
|
sizePerPixel = numChannels * 1; |
|
break; |
|
case 5123: |
|
case 36193: |
|
case 5131: |
|
case 5122: |
|
sizePerPixel = numChannels * 2; |
|
break; |
|
case 5125: |
|
case 5126: |
|
case 5124: |
|
sizePerPixel = numChannels * 4; |
|
break; |
|
case 34042: |
|
case 35902: |
|
case 33640: |
|
case 35899: |
|
case 34042: |
|
sizePerPixel = 4; |
|
break; |
|
case 33635: |
|
case 32819: |
|
case 32820: |
|
sizePerPixel = 2; |
|
break; |
|
default: |
|
GL.recordError(1280); |
|
return null; |
|
} |
|
var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment); |
|
switch (type) { |
|
case 5120: |
|
return HEAP8.subarray(pixels, pixels + bytes); |
|
case 5121: |
|
return HEAPU8.subarray(pixels, pixels + bytes); |
|
case 5122: |
|
return HEAP16.subarray(pixels >> 1, (pixels + bytes) >> 1); |
|
case 5124: |
|
return HEAP32.subarray(pixels >> 2, (pixels + bytes) >> 2); |
|
case 5126: |
|
return HEAPF32.subarray(pixels >> 2, (pixels + bytes) >> 2); |
|
case 5125: |
|
case 34042: |
|
case 35902: |
|
case 33640: |
|
case 35899: |
|
case 34042: |
|
return HEAPU32.subarray(pixels >> 2, (pixels + bytes) >> 2); |
|
case 5123: |
|
case 33635: |
|
case 32819: |
|
case 32820: |
|
case 36193: |
|
case 5131: |
|
return HEAPU16.subarray(pixels >> 1, (pixels + bytes) >> 1); |
|
default: |
|
GL.recordError(1280); |
|
return null; |
|
} |
|
} |
|
function emscriptenWebGLGetHeapForType(type) { |
|
switch (type) { |
|
case 5120: |
|
return HEAP8; |
|
case 5121: |
|
return HEAPU8; |
|
case 5122: |
|
return HEAP16; |
|
case 5123: |
|
case 33635: |
|
case 32819: |
|
case 32820: |
|
case 36193: |
|
case 5131: |
|
return HEAPU16; |
|
case 5124: |
|
return HEAP32; |
|
case 5125: |
|
case 34042: |
|
case 35902: |
|
case 33640: |
|
case 35899: |
|
case 34042: |
|
return HEAPU32; |
|
case 5126: |
|
return HEAPF32; |
|
default: |
|
return null; |
|
} |
|
} |
|
function emscriptenWebGLGetShiftForType(type) { |
|
switch (type) { |
|
case 5120: |
|
case 5121: |
|
return 0; |
|
case 5122: |
|
case 5123: |
|
case 33635: |
|
case 32819: |
|
case 32820: |
|
case 36193: |
|
case 5131: |
|
return 1; |
|
case 5124: |
|
case 5126: |
|
case 5125: |
|
case 34042: |
|
case 35902: |
|
case 33640: |
|
case 35899: |
|
case 34042: |
|
return 2; |
|
default: |
|
return 0; |
|
} |
|
} |
|
function _glReadPixels(x, y, width, height, format, type, pixels) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
if (GLctx.currentPixelPackBufferBinding) { |
|
GLctx.readPixels(x, y, width, height, format, type, pixels); |
|
} else { |
|
GLctx.readPixels(x, y, width, height, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type)); |
|
} |
|
return; |
|
} |
|
var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format); |
|
if (!pixelData) { |
|
GL.recordError(1280); |
|
return; |
|
} |
|
GLctx.readPixels(x, y, width, height, format, type, pixelData); |
|
} |
|
function _glRenderbufferStorage(x0, x1, x2, x3) { |
|
GLctx["renderbufferStorage"](x0, x1, x2, x3); |
|
} |
|
function _glRenderbufferStorageMultisample(x0, x1, x2, x3, x4) { |
|
GLctx["renderbufferStorageMultisample"](x0, x1, x2, x3, x4); |
|
} |
|
function _glSamplerParameteri(sampler, pname, param) { |
|
GLctx["samplerParameteri"](sampler ? GL.samplers[sampler] : null, pname, param); |
|
} |
|
function _glScissor(x0, x1, x2, x3) { |
|
GLctx["scissor"](x0, x1, x2, x3); |
|
} |
|
function _glShaderSource(shader, count, string, length) { |
|
var source = GL.getSource(shader, count, string, length); |
|
GLctx.shaderSource(GL.shaders[shader], source); |
|
} |
|
function _glStencilFuncSeparate(x0, x1, x2, x3) { |
|
GLctx["stencilFuncSeparate"](x0, x1, x2, x3); |
|
} |
|
function _glStencilMask(x0) { |
|
GLctx["stencilMask"](x0); |
|
} |
|
function _glStencilOpSeparate(x0, x1, x2, x3) { |
|
GLctx["stencilOpSeparate"](x0, x1, x2, x3); |
|
} |
|
function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
if (GLctx.currentPixelUnpackBufferBinding) { |
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels); |
|
} else if (pixels != 0) { |
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type)); |
|
} else { |
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, null); |
|
} |
|
return; |
|
} |
|
var pixelData = null; |
|
if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat); |
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData); |
|
} |
|
function _glTexImage3D(target, level, internalFormat, width, height, depth, border, format, type, pixels) { |
|
if (GLctx.currentPixelUnpackBufferBinding) { |
|
GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, pixels); |
|
} else if (pixels != 0) { |
|
GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type)); |
|
} else { |
|
GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, null); |
|
} |
|
} |
|
function _glTexParameterf(x0, x1, x2) { |
|
GLctx["texParameterf"](x0, x1, x2); |
|
} |
|
function _glTexParameteri(x0, x1, x2) { |
|
GLctx["texParameteri"](x0, x1, x2); |
|
} |
|
function _glTexParameteriv(target, pname, params) { |
|
var param = HEAP32[params >> 2]; |
|
GLctx.texParameteri(target, pname, param); |
|
} |
|
function _glTexStorage2D(x0, x1, x2, x3, x4) { |
|
GLctx["texStorage2D"](x0, x1, x2, x3, x4); |
|
} |
|
function _glTexStorage3D(x0, x1, x2, x3, x4, x5) { |
|
GLctx["texStorage3D"](x0, x1, x2, x3, x4, x5); |
|
} |
|
function _glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
if (GLctx.currentPixelUnpackBufferBinding) { |
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels); |
|
} else if (pixels != 0) { |
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type)); |
|
} else { |
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, null); |
|
} |
|
return; |
|
} |
|
var pixelData = null; |
|
if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0); |
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData); |
|
} |
|
function _glTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels) { |
|
if (GLctx.currentPixelUnpackBufferBinding) { |
|
GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels); |
|
} else if (pixels != 0) { |
|
GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, emscriptenWebGLGetHeapForType(type), pixels >> emscriptenWebGLGetShiftForType(type)); |
|
} else { |
|
GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, null); |
|
} |
|
} |
|
function _glTransformFeedbackVaryings(program, count, varyings, bufferMode) { |
|
program = GL.programs[program]; |
|
var vars = []; |
|
for (var i = 0; i < count; i++) vars.push(Pointer_stringify(HEAP32[(varyings + i * 4) >> 2])); |
|
GLctx["transformFeedbackVaryings"](program, vars, bufferMode); |
|
} |
|
function _glUniform1fv(location, count, value) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.uniform1fv(GL.uniforms[location], HEAPF32, value >> 2, count); |
|
return; |
|
} |
|
var view; |
|
if (count <= GL.MINI_TEMP_BUFFER_SIZE) { |
|
view = GL.miniTempBufferViews[count - 1]; |
|
for (var i = 0; i < count; ++i) { |
|
view[i] = HEAPF32[(value + 4 * i) >> 2]; |
|
} |
|
} else { |
|
view = HEAPF32.subarray(value >> 2, (value + count * 4) >> 2); |
|
} |
|
GLctx.uniform1fv(GL.uniforms[location], view); |
|
} |
|
function _glUniform1i(location, v0) { |
|
GLctx.uniform1i(GL.uniforms[location], v0); |
|
} |
|
function _glUniform1iv(location, count, value) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.uniform1iv(GL.uniforms[location], HEAP32, value >> 2, count); |
|
return; |
|
} |
|
GLctx.uniform1iv(GL.uniforms[location], HEAP32.subarray(value >> 2, (value + count * 4) >> 2)); |
|
} |
|
function _glUniform1uiv(location, count, value) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.uniform1uiv(GL.uniforms[location], HEAPU32, value >> 2, count); |
|
} else { |
|
GLctx.uniform1uiv(GL.uniforms[location], HEAPU32.subarray(value >> 2, (value + count * 4) >> 2)); |
|
} |
|
} |
|
function _glUniform2fv(location, count, value) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.uniform2fv(GL.uniforms[location], HEAPF32, value >> 2, count * 2); |
|
return; |
|
} |
|
var view; |
|
if (2 * count <= GL.MINI_TEMP_BUFFER_SIZE) { |
|
view = GL.miniTempBufferViews[2 * count - 1]; |
|
for (var i = 0; i < 2 * count; i += 2) { |
|
view[i] = HEAPF32[(value + 4 * i) >> 2]; |
|
view[i + 1] = HEAPF32[(value + (4 * i + 4)) >> 2]; |
|
} |
|
} else { |
|
view = HEAPF32.subarray(value >> 2, (value + count * 8) >> 2); |
|
} |
|
GLctx.uniform2fv(GL.uniforms[location], view); |
|
} |
|
function _glUniform2iv(location, count, value) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.uniform2iv(GL.uniforms[location], HEAP32, value >> 2, count * 2); |
|
return; |
|
} |
|
GLctx.uniform2iv(GL.uniforms[location], HEAP32.subarray(value >> 2, (value + count * 8) >> 2)); |
|
} |
|
function _glUniform2uiv(location, count, value) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.uniform2uiv(GL.uniforms[location], HEAPU32, value >> 2, count * 2); |
|
} else { |
|
GLctx.uniform2uiv(GL.uniforms[location], HEAPU32.subarray(value >> 2, (value + count * 8) >> 2)); |
|
} |
|
} |
|
function _glUniform3fv(location, count, value) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.uniform3fv(GL.uniforms[location], HEAPF32, value >> 2, count * 3); |
|
return; |
|
} |
|
var view; |
|
if (3 * count <= GL.MINI_TEMP_BUFFER_SIZE) { |
|
view = GL.miniTempBufferViews[3 * count - 1]; |
|
for (var i = 0; i < 3 * count; i += 3) { |
|
view[i] = HEAPF32[(value + 4 * i) >> 2]; |
|
view[i + 1] = HEAPF32[(value + (4 * i + 4)) >> 2]; |
|
view[i + 2] = HEAPF32[(value + (4 * i + 8)) >> 2]; |
|
} |
|
} else { |
|
view = HEAPF32.subarray(value >> 2, (value + count * 12) >> 2); |
|
} |
|
GLctx.uniform3fv(GL.uniforms[location], view); |
|
} |
|
function _glUniform3iv(location, count, value) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.uniform3iv(GL.uniforms[location], HEAP32, value >> 2, count * 3); |
|
return; |
|
} |
|
GLctx.uniform3iv(GL.uniforms[location], HEAP32.subarray(value >> 2, (value + count * 12) >> 2)); |
|
} |
|
function _glUniform3uiv(location, count, value) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.uniform3uiv(GL.uniforms[location], HEAPU32, value >> 2, count * 3); |
|
} else { |
|
GLctx.uniform3uiv(GL.uniforms[location], HEAPU32.subarray(value >> 2, (value + count * 12) >> 2)); |
|
} |
|
} |
|
function _glUniform4fv(location, count, value) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.uniform4fv(GL.uniforms[location], HEAPF32, value >> 2, count * 4); |
|
return; |
|
} |
|
var view; |
|
if (4 * count <= GL.MINI_TEMP_BUFFER_SIZE) { |
|
view = GL.miniTempBufferViews[4 * count - 1]; |
|
for (var i = 0; i < 4 * count; i += 4) { |
|
view[i] = HEAPF32[(value + 4 * i) >> 2]; |
|
view[i + 1] = HEAPF32[(value + (4 * i + 4)) >> 2]; |
|
view[i + 2] = HEAPF32[(value + (4 * i + 8)) >> 2]; |
|
view[i + 3] = HEAPF32[(value + (4 * i + 12)) >> 2]; |
|
} |
|
} else { |
|
view = HEAPF32.subarray(value >> 2, (value + count * 16) >> 2); |
|
} |
|
GLctx.uniform4fv(GL.uniforms[location], view); |
|
} |
|
function _glUniform4iv(location, count, value) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.uniform4iv(GL.uniforms[location], HEAP32, value >> 2, count * 4); |
|
return; |
|
} |
|
GLctx.uniform4iv(GL.uniforms[location], HEAP32.subarray(value >> 2, (value + count * 16) >> 2)); |
|
} |
|
function _glUniform4uiv(location, count, value) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.uniform4uiv(GL.uniforms[location], HEAPU32, value >> 2, count * 4); |
|
} else { |
|
GLctx.uniform4uiv(GL.uniforms[location], HEAPU32.subarray(value >> 2, (value + count * 16) >> 2)); |
|
} |
|
} |
|
function _glUniformBlockBinding(program, uniformBlockIndex, uniformBlockBinding) { |
|
program = GL.programs[program]; |
|
GLctx["uniformBlockBinding"](program, uniformBlockIndex, uniformBlockBinding); |
|
} |
|
function _glUniformMatrix3fv(location, count, transpose, value) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, HEAPF32, value >> 2, count * 9); |
|
return; |
|
} |
|
var view; |
|
if (9 * count <= GL.MINI_TEMP_BUFFER_SIZE) { |
|
view = GL.miniTempBufferViews[9 * count - 1]; |
|
for (var i = 0; i < 9 * count; i += 9) { |
|
view[i] = HEAPF32[(value + 4 * i) >> 2]; |
|
view[i + 1] = HEAPF32[(value + (4 * i + 4)) >> 2]; |
|
view[i + 2] = HEAPF32[(value + (4 * i + 8)) >> 2]; |
|
view[i + 3] = HEAPF32[(value + (4 * i + 12)) >> 2]; |
|
view[i + 4] = HEAPF32[(value + (4 * i + 16)) >> 2]; |
|
view[i + 5] = HEAPF32[(value + (4 * i + 20)) >> 2]; |
|
view[i + 6] = HEAPF32[(value + (4 * i + 24)) >> 2]; |
|
view[i + 7] = HEAPF32[(value + (4 * i + 28)) >> 2]; |
|
view[i + 8] = HEAPF32[(value + (4 * i + 32)) >> 2]; |
|
} |
|
} else { |
|
view = HEAPF32.subarray(value >> 2, (value + count * 36) >> 2); |
|
} |
|
GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, view); |
|
} |
|
function _glUniformMatrix4fv(location, count, transpose, value) { |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, HEAPF32, value >> 2, count * 16); |
|
return; |
|
} |
|
var view; |
|
if (16 * count <= GL.MINI_TEMP_BUFFER_SIZE) { |
|
view = GL.miniTempBufferViews[16 * count - 1]; |
|
for (var i = 0; i < 16 * count; i += 16) { |
|
view[i] = HEAPF32[(value + 4 * i) >> 2]; |
|
view[i + 1] = HEAPF32[(value + (4 * i + 4)) >> 2]; |
|
view[i + 2] = HEAPF32[(value + (4 * i + 8)) >> 2]; |
|
view[i + 3] = HEAPF32[(value + (4 * i + 12)) >> 2]; |
|
view[i + 4] = HEAPF32[(value + (4 * i + 16)) >> 2]; |
|
view[i + 5] = HEAPF32[(value + (4 * i + 20)) >> 2]; |
|
view[i + 6] = HEAPF32[(value + (4 * i + 24)) >> 2]; |
|
view[i + 7] = HEAPF32[(value + (4 * i + 28)) >> 2]; |
|
view[i + 8] = HEAPF32[(value + (4 * i + 32)) >> 2]; |
|
view[i + 9] = HEAPF32[(value + (4 * i + 36)) >> 2]; |
|
view[i + 10] = HEAPF32[(value + (4 * i + 40)) >> 2]; |
|
view[i + 11] = HEAPF32[(value + (4 * i + 44)) >> 2]; |
|
view[i + 12] = HEAPF32[(value + (4 * i + 48)) >> 2]; |
|
view[i + 13] = HEAPF32[(value + (4 * i + 52)) >> 2]; |
|
view[i + 14] = HEAPF32[(value + (4 * i + 56)) >> 2]; |
|
view[i + 15] = HEAPF32[(value + (4 * i + 60)) >> 2]; |
|
} |
|
} else { |
|
view = HEAPF32.subarray(value >> 2, (value + count * 64) >> 2); |
|
} |
|
GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view); |
|
} |
|
function _glUnmapBuffer(target) { |
|
if (!emscriptenWebGLValidateMapBufferTarget(target)) { |
|
GL.recordError(1280); |
|
err("GL_INVALID_ENUM in glUnmapBuffer"); |
|
return 0; |
|
} |
|
var buffer = emscriptenWebGLGetBufferBinding(target); |
|
var mapping = GL.mappedBuffers[buffer]; |
|
if (!mapping) { |
|
GL.recordError(1282); |
|
Module.printError("buffer was never mapped in glUnmapBuffer"); |
|
return 0; |
|
} |
|
GL.mappedBuffers[buffer] = null; |
|
if (!(mapping.access & 16)) |
|
if (GL.currentContext.supportsWebGL2EntryPoints) { |
|
GLctx.bufferSubData(target, mapping.offset, HEAPU8, mapping.mem, mapping.length); |
|
} else { |
|
GLctx.bufferSubData(target, mapping.offset, HEAPU8.subarray(mapping.mem, mapping.mem + mapping.length)); |
|
} |
|
_free(mapping.mem); |
|
return 1; |
|
} |
|
function _glUseProgram(program) { |
|
GLctx.useProgram(program ? GL.programs[program] : null); |
|
} |
|
function _glValidateProgram(program) { |
|
GLctx.validateProgram(GL.programs[program]); |
|
} |
|
function _glVertexAttrib4f(x0, x1, x2, x3, x4) { |
|
GLctx["vertexAttrib4f"](x0, x1, x2, x3, x4); |
|
} |
|
function _glVertexAttrib4fv(index, v) { |
|
GLctx.vertexAttrib4f(index, HEAPF32[v >> 2], HEAPF32[(v + 4) >> 2], HEAPF32[(v + 8) >> 2], HEAPF32[(v + 12) >> 2]); |
|
} |
|
function _glVertexAttribIPointer(index, size, type, stride, ptr) { |
|
var cb = GL.currentContext.clientBuffers[index]; |
|
if (!GL.currArrayBuffer) { |
|
cb.size = size; |
|
cb.type = type; |
|
cb.normalized = false; |
|
cb.stride = stride; |
|
cb.ptr = ptr; |
|
cb.clientside = true; |
|
return; |
|
} |
|
cb.clientside = false; |
|
GLctx.vertexAttribIPointer(index, size, type, stride, ptr); |
|
} |
|
function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) { |
|
GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr); |
|
} |
|
function _glViewport(x0, x1, x2, x3) { |
|
GLctx["viewport"](x0, x1, x2, x3); |
|
} |
|
var ___tm_current = STATICTOP; |
|
STATICTOP += 48; |
|
var ___tm_timezone = allocate(intArrayFromString("GMT"), "i8", ALLOC_STATIC); |
|
function _gmtime_r(time, tmPtr) { |
|
var date = new Date(HEAP32[time >> 2] * 1e3); |
|
HEAP32[tmPtr >> 2] = date.getUTCSeconds(); |
|
HEAP32[(tmPtr + 4) >> 2] = date.getUTCMinutes(); |
|
HEAP32[(tmPtr + 8) >> 2] = date.getUTCHours(); |
|
HEAP32[(tmPtr + 12) >> 2] = date.getUTCDate(); |
|
HEAP32[(tmPtr + 16) >> 2] = date.getUTCMonth(); |
|
HEAP32[(tmPtr + 20) >> 2] = date.getUTCFullYear() - 1900; |
|
HEAP32[(tmPtr + 24) >> 2] = date.getUTCDay(); |
|
HEAP32[(tmPtr + 36) >> 2] = 0; |
|
HEAP32[(tmPtr + 32) >> 2] = 0; |
|
var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0); |
|
var yday = ((date.getTime() - start) / (1e3 * 60 * 60 * 24)) | 0; |
|
HEAP32[(tmPtr + 28) >> 2] = yday; |
|
HEAP32[(tmPtr + 40) >> 2] = ___tm_timezone; |
|
return tmPtr; |
|
} |
|
function _gmtime(time) { |
|
return _gmtime_r(time, ___tm_current); |
|
} |
|
var _llvm_ceil_f32 = Math_ceil; |
|
var _llvm_ceil_f64 = Math_ceil; |
|
function _llvm_copysign_f64(x, y) { |
|
return y < 0 || (y === 0 && 1 / y < 0) ? -Math_abs(x) : Math_abs(x); |
|
} |
|
function _llvm_cttz_i32(x) { |
|
x = x | 0; |
|
return (x ? (31 - (Math_clz32(x ^ (x - 1)) | 0)) | 0 : 32) | 0; |
|
} |
|
function _llvm_eh_typeid_for(type) { |
|
return type; |
|
} |
|
function _llvm_exp2_f32(x) { |
|
return Math.pow(2, x); |
|
} |
|
var _llvm_fabs_f32 = Math_abs; |
|
var _llvm_fabs_f64 = Math_abs; |
|
var _llvm_floor_f32 = Math_floor; |
|
var _llvm_floor_f64 = Math_floor; |
|
function _llvm_log10_f32(x) { |
|
return Math.log(x) / Math.LN10; |
|
} |
|
function _llvm_log2_f32(x) { |
|
return Math.log(x) / Math.LN2; |
|
} |
|
var _llvm_sqrt_f32 = Math_sqrt; |
|
function _llvm_trap() { |
|
abort("trap!"); |
|
} |
|
function _tzset() { |
|
if (_tzset.called) return; |
|
_tzset.called = true; |
|
HEAP32[__get_timezone() >> 2] = new Date().getTimezoneOffset() * 60; |
|
var currentYear = new Date().getFullYear(); |
|
var winter = new Date(currentYear, 0, 1); |
|
var summer = new Date(currentYear, 6, 1); |
|
HEAP32[__get_daylight() >> 2] = Number(winter.getTimezoneOffset() != summer.getTimezoneOffset()); |
|
function extractZone(date) { |
|
var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/); |
|
return match ? match[1] : "GMT"; |
|
} |
|
var winterName = extractZone(winter); |
|
var summerName = extractZone(summer); |
|
var winterNamePtr = allocate(intArrayFromString(winterName), "i8", ALLOC_NORMAL); |
|
var summerNamePtr = allocate(intArrayFromString(summerName), "i8", ALLOC_NORMAL); |
|
if (summer.getTimezoneOffset() < winter.getTimezoneOffset()) { |
|
HEAP32[__get_tzname() >> 2] = winterNamePtr; |
|
HEAP32[(__get_tzname() + 4) >> 2] = summerNamePtr; |
|
} else { |
|
HEAP32[__get_tzname() >> 2] = summerNamePtr; |
|
HEAP32[(__get_tzname() + 4) >> 2] = winterNamePtr; |
|
} |
|
} |
|
function _localtime_r(time, tmPtr) { |
|
_tzset(); |
|
var date = new Date(HEAP32[time >> 2] * 1e3); |
|
HEAP32[tmPtr >> 2] = date.getSeconds(); |
|
HEAP32[(tmPtr + 4) >> 2] = date.getMinutes(); |
|
HEAP32[(tmPtr + 8) >> 2] = date.getHours(); |
|
HEAP32[(tmPtr + 12) >> 2] = date.getDate(); |
|
HEAP32[(tmPtr + 16) >> 2] = date.getMonth(); |
|
HEAP32[(tmPtr + 20) >> 2] = date.getFullYear() - 1900; |
|
HEAP32[(tmPtr + 24) >> 2] = date.getDay(); |
|
var start = new Date(date.getFullYear(), 0, 1); |
|
var yday = ((date.getTime() - start.getTime()) / (1e3 * 60 * 60 * 24)) | 0; |
|
HEAP32[(tmPtr + 28) >> 2] = yday; |
|
HEAP32[(tmPtr + 36) >> 2] = -(date.getTimezoneOffset() * 60); |
|
var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset(); |
|
var winterOffset = start.getTimezoneOffset(); |
|
var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset)) | 0; |
|
HEAP32[(tmPtr + 32) >> 2] = dst; |
|
var zonePtr = HEAP32[(__get_tzname() + (dst ? 4 : 0)) >> 2]; |
|
HEAP32[(tmPtr + 40) >> 2] = zonePtr; |
|
return tmPtr; |
|
} |
|
function _localtime(time) { |
|
return _localtime_r(time, ___tm_current); |
|
} |
|
function _emscripten_memcpy_big(dest, src, num) { |
|
HEAPU8.set(HEAPU8.subarray(src, src + num), dest); |
|
return dest; |
|
} |
|
function _mktime(tmPtr) { |
|
_tzset(); |
|
var date = new Date(HEAP32[(tmPtr + 20) >> 2] + 1900, HEAP32[(tmPtr + 16) >> 2], HEAP32[(tmPtr + 12) >> 2], HEAP32[(tmPtr + 8) >> 2], HEAP32[(tmPtr + 4) >> 2], HEAP32[tmPtr >> 2], 0); |
|
var dst = HEAP32[(tmPtr + 32) >> 2]; |
|
var guessedOffset = date.getTimezoneOffset(); |
|
var start = new Date(date.getFullYear(), 0, 1); |
|
var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset(); |
|
var winterOffset = start.getTimezoneOffset(); |
|
var dstOffset = Math.min(winterOffset, summerOffset); |
|
if (dst < 0) { |
|
HEAP32[(tmPtr + 32) >> 2] = Number(summerOffset != winterOffset && dstOffset == guessedOffset); |
|
} else if (dst > 0 != (dstOffset == guessedOffset)) { |
|
var nonDstOffset = Math.max(winterOffset, summerOffset); |
|
var trueOffset = dst > 0 ? dstOffset : nonDstOffset; |
|
date.setTime(date.getTime() + (trueOffset - guessedOffset) * 6e4); |
|
} |
|
HEAP32[(tmPtr + 24) >> 2] = date.getDay(); |
|
var yday = ((date.getTime() - start.getTime()) / (1e3 * 60 * 60 * 24)) | 0; |
|
HEAP32[(tmPtr + 28) >> 2] = yday; |
|
return (date.getTime() / 1e3) | 0; |
|
} |
|
function _usleep(useconds) { |
|
var msec = useconds / 1e3; |
|
if ((ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self["performance"] && self["performance"]["now"]) { |
|
var start = self["performance"]["now"](); |
|
while (self["performance"]["now"]() - start < msec) {} |
|
} else { |
|
var start = Date.now(); |
|
while (Date.now() - start < msec) {} |
|
} |
|
return 0; |
|
} |
|
function _nanosleep(rqtp, rmtp) { |
|
var seconds = HEAP32[rqtp >> 2]; |
|
var nanoseconds = HEAP32[(rqtp + 4) >> 2]; |
|
if (rmtp !== 0) { |
|
HEAP32[rmtp >> 2] = 0; |
|
HEAP32[(rmtp + 4) >> 2] = 0; |
|
} |
|
return _usleep(seconds * 1e6 + nanoseconds / 1e3); |
|
} |
|
var PTHREAD_SPECIFIC = {}; |
|
function _pthread_getspecific(key) { |
|
return PTHREAD_SPECIFIC[key] || 0; |
|
} |
|
var PTHREAD_SPECIFIC_NEXT_KEY = 1; |
|
function _pthread_key_create(key, destructor) { |
|
if (key == 0) { |
|
return ERRNO_CODES.EINVAL; |
|
} |
|
HEAP32[key >> 2] = PTHREAD_SPECIFIC_NEXT_KEY; |
|
PTHREAD_SPECIFIC[PTHREAD_SPECIFIC_NEXT_KEY] = 0; |
|
PTHREAD_SPECIFIC_NEXT_KEY++; |
|
return 0; |
|
} |
|
function _pthread_once(ptr, func) { |
|
if (!_pthread_once.seen) _pthread_once.seen = {}; |
|
if (ptr in _pthread_once.seen) return; |
|
Module["dynCall_v"](func); |
|
_pthread_once.seen[ptr] = 1; |
|
} |
|
function _pthread_setspecific(key, value) { |
|
if (!(key in PTHREAD_SPECIFIC)) { |
|
return ERRNO_CODES.EINVAL; |
|
} |
|
PTHREAD_SPECIFIC[key] = value; |
|
return 0; |
|
} |
|
function _setenv(envname, envval, overwrite) { |
|
if (envname === 0) { |
|
___setErrNo(ERRNO_CODES.EINVAL); |
|
return -1; |
|
} |
|
var name = Pointer_stringify(envname); |
|
var val = Pointer_stringify(envval); |
|
if (name === "" || name.indexOf("=") !== -1) { |
|
___setErrNo(ERRNO_CODES.EINVAL); |
|
return -1; |
|
} |
|
if (ENV.hasOwnProperty(name) && !overwrite) return 0; |
|
ENV[name] = val; |
|
___buildEnvironment(__get_environ()); |
|
return 0; |
|
} |
|
function _sigaction(signum, act, oldact) { |
|
return 0; |
|
} |
|
function _sigemptyset(set) { |
|
HEAP32[set >> 2] = 0; |
|
return 0; |
|
} |
|
function __isLeapYear(year) { |
|
return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); |
|
} |
|
function __arraySum(array, index) { |
|
var sum = 0; |
|
for (var i = 0; i <= index; sum += array[i++]); |
|
return sum; |
|
} |
|
var __MONTH_DAYS_LEAP = [31, 29, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; |
|
var __MONTH_DAYS_REGULAR = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; |
|
function __addDays(date, days) { |
|
var newDate = new Date(date.getTime()); |
|
while (days > 0) { |
|
var leap = __isLeapYear(newDate.getFullYear()); |
|
var currentMonth = newDate.getMonth(); |
|
var daysInCurrentMonth = (leap ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR)[currentMonth]; |
|
if (days > daysInCurrentMonth - newDate.getDate()) { |
|
days -= daysInCurrentMonth - newDate.getDate() + 1; |
|
newDate.setDate(1); |
|
if (currentMonth < 11) { |
|
newDate.setMonth(currentMonth + 1); |
|
} else { |
|
newDate.setMonth(0); |
|
newDate.setFullYear(newDate.getFullYear() + 1); |
|
} |
|
} else { |
|
newDate.setDate(newDate.getDate() + days); |
|
return newDate; |
|
} |
|
} |
|
return newDate; |
|
} |
|
function _strftime(s, maxsize, format, tm) { |
|
var tm_zone = HEAP32[(tm + 40) >> 2]; |
|
var date = { |
|
tm_sec: HEAP32[tm >> 2], |
|
tm_min: HEAP32[(tm + 4) >> 2], |
|
tm_hour: HEAP32[(tm + 8) >> 2], |
|
tm_mday: HEAP32[(tm + 12) >> 2], |
|
tm_mon: HEAP32[(tm + 16) >> 2], |
|
tm_year: HEAP32[(tm + 20) >> 2], |
|
tm_wday: HEAP32[(tm + 24) >> 2], |
|
tm_yday: HEAP32[(tm + 28) >> 2], |
|
tm_isdst: HEAP32[(tm + 32) >> 2], |
|
tm_gmtoff: HEAP32[(tm + 36) >> 2], |
|
tm_zone: tm_zone ? Pointer_stringify(tm_zone) : "", |
|
}; |
|
var pattern = Pointer_stringify(format); |
|
var EXPANSION_RULES_1 = { "%c": "%a %b %d %H:%M:%S %Y", "%D": "%m/%d/%y", "%F": "%Y-%m-%d", "%h": "%b", "%r": "%I:%M:%S %p", "%R": "%H:%M", "%T": "%H:%M:%S", "%x": "%m/%d/%y", "%X": "%H:%M:%S" }; |
|
for (var rule in EXPANSION_RULES_1) { |
|
pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_1[rule]); |
|
} |
|
var WEEKDAYS = ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"]; |
|
var MONTHS = ["January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"]; |
|
function leadingSomething(value, digits, character) { |
|
var str = typeof value === "number" ? value.toString() : value || ""; |
|
while (str.length < digits) { |
|
str = character[0] + str; |
|
} |
|
return str; |
|
} |
|
function leadingNulls(value, digits) { |
|
return leadingSomething(value, digits, "0"); |
|
} |
|
function compareByDay(date1, date2) { |
|
function sgn(value) { |
|
return value < 0 ? -1 : value > 0 ? 1 : 0; |
|
} |
|
var compare; |
|
if ((compare = sgn(date1.getFullYear() - date2.getFullYear())) === 0) { |
|
if ((compare = sgn(date1.getMonth() - date2.getMonth())) === 0) { |
|
compare = sgn(date1.getDate() - date2.getDate()); |
|
} |
|
} |
|
return compare; |
|
} |
|
function getFirstWeekStartDate(janFourth) { |
|
switch (janFourth.getDay()) { |
|
case 0: |
|
return new Date(janFourth.getFullYear() - 1, 11, 29); |
|
case 1: |
|
return janFourth; |
|
case 2: |
|
return new Date(janFourth.getFullYear(), 0, 3); |
|
case 3: |
|
return new Date(janFourth.getFullYear(), 0, 2); |
|
case 4: |
|
return new Date(janFourth.getFullYear(), 0, 1); |
|
case 5: |
|
return new Date(janFourth.getFullYear() - 1, 11, 31); |
|
case 6: |
|
return new Date(janFourth.getFullYear() - 1, 11, 30); |
|
} |
|
} |
|
function getWeekBasedYear(date) { |
|
var thisDate = __addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday); |
|
var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4); |
|
var janFourthNextYear = new Date(thisDate.getFullYear() + 1, 0, 4); |
|
var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear); |
|
var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear); |
|
if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) { |
|
if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) { |
|
return thisDate.getFullYear() + 1; |
|
} else { |
|
return thisDate.getFullYear(); |
|
} |
|
} else { |
|
return thisDate.getFullYear() - 1; |
|
} |
|
} |
|
var EXPANSION_RULES_2 = { |
|
"%a": function (date) { |
|
return WEEKDAYS[date.tm_wday].substring(0, 3); |
|
}, |
|
"%A": function (date) { |
|
return WEEKDAYS[date.tm_wday]; |
|
}, |
|
"%b": function (date) { |
|
return MONTHS[date.tm_mon].substring(0, 3); |
|
}, |
|
"%B": function (date) { |
|
return MONTHS[date.tm_mon]; |
|
}, |
|
"%C": function (date) { |
|
var year = date.tm_year + 1900; |
|
return leadingNulls((year / 100) | 0, 2); |
|
}, |
|
"%d": function (date) { |
|
return leadingNulls(date.tm_mday, 2); |
|
}, |
|
"%e": function (date) { |
|
return leadingSomething(date.tm_mday, 2, " "); |
|
}, |
|
"%g": function (date) { |
|
return getWeekBasedYear(date).toString().substring(2); |
|
}, |
|
"%G": function (date) { |
|
return getWeekBasedYear(date); |
|
}, |
|
"%H": function (date) { |
|
return leadingNulls(date.tm_hour, 2); |
|
}, |
|
"%I": function (date) { |
|
var twelveHour = date.tm_hour; |
|
if (twelveHour == 0) twelveHour = 12; |
|
else if (twelveHour > 12) twelveHour -= 12; |
|
return leadingNulls(twelveHour, 2); |
|
}, |
|
"%j": function (date) { |
|
return leadingNulls(date.tm_mday + __arraySum(__isLeapYear(date.tm_year + 1900) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, date.tm_mon - 1), 3); |
|
}, |
|
"%m": function (date) { |
|
return leadingNulls(date.tm_mon + 1, 2); |
|
}, |
|
"%M": function (date) { |
|
return leadingNulls(date.tm_min, 2); |
|
}, |
|
"%n": function () { |
|
return "\n"; |
|
}, |
|
"%p": function (date) { |
|
if (date.tm_hour >= 0 && date.tm_hour < 12) { |
|
return "AM"; |
|
} else { |
|
return "PM"; |
|
} |
|
}, |
|
"%S": function (date) { |
|
return leadingNulls(date.tm_sec, 2); |
|
}, |
|
"%t": function () { |
|
return "\t"; |
|
}, |
|
"%u": function (date) { |
|
var day = new Date(date.tm_year + 1900, date.tm_mon + 1, date.tm_mday, 0, 0, 0, 0); |
|
return day.getDay() || 7; |
|
}, |
|
"%U": function (date) { |
|
var janFirst = new Date(date.tm_year + 1900, 0, 1); |
|
var firstSunday = janFirst.getDay() === 0 ? janFirst : __addDays(janFirst, 7 - janFirst.getDay()); |
|
var endDate = new Date(date.tm_year + 1900, date.tm_mon, date.tm_mday); |
|
if (compareByDay(firstSunday, endDate) < 0) { |
|
var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth() - 1) - 31; |
|
var firstSundayUntilEndJanuary = 31 - firstSunday.getDate(); |
|
var days = firstSundayUntilEndJanuary + februaryFirstUntilEndMonth + endDate.getDate(); |
|
return leadingNulls(Math.ceil(days / 7), 2); |
|
} |
|
return compareByDay(firstSunday, janFirst) === 0 ? "01" : "00"; |
|
}, |
|
"%V": function (date) { |
|
var janFourthThisYear = new Date(date.tm_year + 1900, 0, 4); |
|
var janFourthNextYear = new Date(date.tm_year + 1901, 0, 4); |
|
var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear); |
|
var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear); |
|
var endDate = __addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday); |
|
if (compareByDay(endDate, firstWeekStartThisYear) < 0) { |
|
return "53"; |
|
} |
|
if (compareByDay(firstWeekStartNextYear, endDate) <= 0) { |
|
return "01"; |
|
} |
|
var daysDifference; |
|
if (firstWeekStartThisYear.getFullYear() < date.tm_year + 1900) { |
|
daysDifference = date.tm_yday + 32 - firstWeekStartThisYear.getDate(); |
|
} else { |
|
daysDifference = date.tm_yday + 1 - firstWeekStartThisYear.getDate(); |
|
} |
|
return leadingNulls(Math.ceil(daysDifference / 7), 2); |
|
}, |
|
"%w": function (date) { |
|
var day = new Date(date.tm_year + 1900, date.tm_mon + 1, date.tm_mday, 0, 0, 0, 0); |
|
return day.getDay(); |
|
}, |
|
"%W": function (date) { |
|
var janFirst = new Date(date.tm_year, 0, 1); |
|
var firstMonday = janFirst.getDay() === 1 ? janFirst : __addDays(janFirst, janFirst.getDay() === 0 ? 1 : 7 - janFirst.getDay() + 1); |
|
var endDate = new Date(date.tm_year + 1900, date.tm_mon, date.tm_mday); |
|
if (compareByDay(firstMonday, endDate) < 0) { |
|
var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth() - 1) - 31; |
|
var firstMondayUntilEndJanuary = 31 - firstMonday.getDate(); |
|
var days = firstMondayUntilEndJanuary + februaryFirstUntilEndMonth + endDate.getDate(); |
|
return leadingNulls(Math.ceil(days / 7), 2); |
|
} |
|
return compareByDay(firstMonday, janFirst) === 0 ? "01" : "00"; |
|
}, |
|
"%y": function (date) { |
|
return (date.tm_year + 1900).toString().substring(2); |
|
}, |
|
"%Y": function (date) { |
|
return date.tm_year + 1900; |
|
}, |
|
"%z": function (date) { |
|
var off = date.tm_gmtoff; |
|
var ahead = off >= 0; |
|
off = Math.abs(off) / 60; |
|
off = (off / 60) * 100 + (off % 60); |
|
return (ahead ? "+" : "-") + String("0000" + off).slice(-4); |
|
}, |
|
"%Z": function (date) { |
|
return date.tm_zone; |
|
}, |
|
"%%": function () { |
|
return "%"; |
|
}, |
|
}; |
|
for (var rule in EXPANSION_RULES_2) { |
|
if (pattern.indexOf(rule) >= 0) { |
|
pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_2[rule](date)); |
|
} |
|
} |
|
var bytes = intArrayFromString(pattern, false); |
|
if (bytes.length > maxsize) { |
|
return 0; |
|
} |
|
writeArrayToMemory(bytes, s); |
|
return bytes.length - 1; |
|
} |
|
function _sysconf(name) { |
|
switch (name) { |
|
case 30: |
|
return PAGE_SIZE; |
|
case 85: |
|
var maxHeapSize = 2 * 1024 * 1024 * 1024 - 65536; |
|
return maxHeapSize / PAGE_SIZE; |
|
case 132: |
|
case 133: |
|
case 12: |
|
case 137: |
|
case 138: |
|
case 15: |
|
case 235: |
|
case 16: |
|
case 17: |
|
case 18: |
|
case 19: |
|
case 20: |
|
case 149: |
|
case 13: |
|
case 10: |
|
case 236: |
|
case 153: |
|
case 9: |
|
case 21: |
|
case 22: |
|
case 159: |
|
case 154: |
|
case 14: |
|
case 77: |
|
case 78: |
|
case 139: |
|
case 80: |
|
case 81: |
|
case 82: |
|
case 68: |
|
case 67: |
|
case 164: |
|
case 11: |
|
case 29: |
|
case 47: |
|
case 48: |
|
case 95: |
|
case 52: |
|
case 51: |
|
case 46: |
|
return 200809; |
|
case 79: |
|
return 0; |
|
case 27: |
|
case 246: |
|
case 127: |
|
case 128: |
|
case 23: |
|
case 24: |
|
case 160: |
|
case 161: |
|
case 181: |
|
case 182: |
|
case 242: |
|
case 183: |
|
case 184: |
|
case 243: |
|
case 244: |
|
case 245: |
|
case 165: |
|
case 178: |
|
case 179: |
|
case 49: |
|
case 50: |
|
case 168: |
|
case 169: |
|
case 175: |
|
case 170: |
|
case 171: |
|
case 172: |
|
case 97: |
|
case 76: |
|
case 32: |
|
case 173: |
|
case 35: |
|
return -1; |
|
case 176: |
|
case 177: |
|
case 7: |
|
case 155: |
|
case 8: |
|
case 157: |
|
case 125: |
|
case 126: |
|
case 92: |
|
case 93: |
|
case 129: |
|
case 130: |
|
case 131: |
|
case 94: |
|
case 91: |
|
return 1; |
|
case 74: |
|
case 60: |
|
case 69: |
|
case 70: |
|
case 4: |
|
return 1024; |
|
case 31: |
|
case 42: |
|
case 72: |
|
return 32; |
|
case 87: |
|
case 26: |
|
case 33: |
|
return 2147483647; |
|
case 34: |
|
case 1: |
|
return 47839; |
|
case 38: |
|
case 36: |
|
return 99; |
|
case 43: |
|
case 37: |
|
return 2048; |
|
case 0: |
|
return 2097152; |
|
case 3: |
|
return 65536; |
|
case 28: |
|
return 32768; |
|
case 44: |
|
return 32767; |
|
case 75: |
|
return 16384; |
|
case 39: |
|
return 1e3; |
|
case 89: |
|
return 700; |
|
case 71: |
|
return 256; |
|
case 40: |
|
return 255; |
|
case 2: |
|
return 100; |
|
case 180: |
|
return 64; |
|
case 25: |
|
return 20; |
|
case 5: |
|
return 16; |
|
case 6: |
|
return 6; |
|
case 73: |
|
return 4; |
|
case 84: { |
|
if (typeof navigator === "object") return navigator["hardwareConcurrency"] || 1; |
|
return 1; |
|
} |
|
} |
|
___setErrNo(ERRNO_CODES.EINVAL); |
|
return -1; |
|
} |
|
function _time(ptr) { |
|
var ret = (Date.now() / 1e3) | 0; |
|
if (ptr) { |
|
HEAP32[ptr >> 2] = ret; |
|
} |
|
return ret; |
|
} |
|
function _unsetenv(name) { |
|
if (name === 0) { |
|
___setErrNo(ERRNO_CODES.EINVAL); |
|
return -1; |
|
} |
|
name = Pointer_stringify(name); |
|
if (name === "" || name.indexOf("=") !== -1) { |
|
___setErrNo(ERRNO_CODES.EINVAL); |
|
return -1; |
|
} |
|
if (ENV.hasOwnProperty(name)) { |
|
delete ENV[name]; |
|
___buildEnvironment(__get_environ()); |
|
} |
|
return 0; |
|
} |
|
function _utime(path, times) { |
|
var time; |
|
if (times) { |
|
var offset = 4; |
|
time = HEAP32[(times + offset) >> 2]; |
|
time *= 1e3; |
|
} else { |
|
time = Date.now(); |
|
} |
|
path = Pointer_stringify(path); |
|
try { |
|
FS.utime(path, time, time); |
|
return 0; |
|
} catch (e) { |
|
FS.handleFSError(e); |
|
return -1; |
|
} |
|
} |
|
FS.staticInit(); |
|
__ATINIT__.unshift(function () { |
|
if (!Module["noFSInit"] && !FS.init.initialized) FS.init(); |
|
}); |
|
__ATMAIN__.push(function () { |
|
FS.ignorePermissions = false; |
|
}); |
|
__ATEXIT__.push(function () { |
|
FS.quit(); |
|
}); |
|
Module["FS_createPath"] = FS.createPath; |
|
Module["FS_createDataFile"] = FS.createDataFile; |
|
__ATINIT__.unshift(function () { |
|
TTY.init(); |
|
}); |
|
__ATEXIT__.push(function () { |
|
TTY.shutdown(); |
|
}); |
|
if (ENVIRONMENT_IS_NODE) { |
|
var fs = require("fs"); |
|
var NODEJS_PATH = require("path"); |
|
NODEFS.staticInit(); |
|
} |
|
if (ENVIRONMENT_IS_NODE) { |
|
_emscripten_get_now = function _emscripten_get_now_actual() { |
|
var t = process["hrtime"](); |
|
return t[0] * 1e3 + t[1] / 1e6; |
|
}; |
|
} else if (typeof dateNow !== "undefined") { |
|
_emscripten_get_now = dateNow; |
|
} else if (typeof self === "object" && self["performance"] && typeof self["performance"]["now"] === "function") { |
|
_emscripten_get_now = function () { |
|
return self["performance"]["now"](); |
|
}; |
|
} else if (typeof performance === "object" && typeof performance["now"] === "function") { |
|
_emscripten_get_now = function () { |
|
return performance["now"](); |
|
}; |
|
} else { |
|
_emscripten_get_now = Date.now; |
|
} |
|
Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) { |
|
err("Module.requestFullScreen is deprecated. Please call Module.requestFullscreen instead."); |
|
Module["requestFullScreen"] = Module["requestFullscreen"]; |
|
Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice); |
|
}; |
|
Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas, vrDevice) { |
|
Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice); |
|
}; |
|
Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { |
|
Browser.requestAnimationFrame(func); |
|
}; |
|
Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { |
|
Browser.setCanvasSize(width, height, noUpdates); |
|
}; |
|
Module["pauseMainLoop"] = function Module_pauseMainLoop() { |
|
Browser.mainLoop.pause(); |
|
}; |
|
Module["resumeMainLoop"] = function Module_resumeMainLoop() { |
|
Browser.mainLoop.resume(); |
|
}; |
|
Module["getUserMedia"] = function Module_getUserMedia() { |
|
Browser.getUserMedia(); |
|
}; |
|
Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { |
|
return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes); |
|
}; |
|
JSEvents.staticInit(); |
|
var GLctx; |
|
GL.init(); |
|
DYNAMICTOP_PTR = staticAlloc(4); |
|
STACK_BASE = STACKTOP = alignMemory(STATICTOP); |
|
STACK_MAX = STACK_BASE + TOTAL_STACK; |
|
DYNAMIC_BASE = alignMemory(STACK_MAX); |
|
HEAP32[DYNAMICTOP_PTR >> 2] = DYNAMIC_BASE; |
|
staticSealed = true; |
|
function intArrayFromString(stringy, dontAddNull, length) { |
|
var len = length > 0 ? length : lengthBytesUTF8(stringy) + 1; |
|
var u8array = new Array(len); |
|
var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); |
|
if (dontAddNull) u8array.length = numBytesWritten; |
|
return u8array; |
|
} |
|
Module["wasmTableSize"] = 37583; |
|
Module["wasmMaxTableSize"] = 37583; |
|
function invoke_dddi(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_dddi"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_ddi(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_ddi"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_dfi(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_dfi"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_di(index, a1) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_di"](index, a1); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_diddi(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_diddi"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_didi(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_didi"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_dii(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_dii"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_diii(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_diii"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_diiii(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_diiii"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_dji(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_dji"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_fdi(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_fdi"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_ff(index, a1) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_ff"](index, a1); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_fff(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_fff"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_fffi(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_fffi"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_ffi(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_ffi"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_fi(index, a1) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_fi"](index, a1); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_fif(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_fif"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_fiffi(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_fiffi"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_fifi(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_fifi"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_fii(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_fii"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_fiii(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_fiii"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_fiiii(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_fiiii"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_fji(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_fji"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_i(index) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_i"](index); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_idi(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_idi"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_idiii(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_idiii"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_ifi(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_ifi"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_ifiii(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_ifiii"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_ii(index, a1) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_ii"](index, a1); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iidi(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iidi"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iidii(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iidii"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iif(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iif"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iifi(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iifi"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iifii(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iifii"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iifiii(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iifiii"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iii(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iii"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiif(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiif"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiff(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiff"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiii(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiii"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiifii(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiifii"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiifiii(index, a1, a2, a3, a4, a5, a6, a7) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiifiii"](index, a1, a2, a3, a4, a5, a6, a7); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiii(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiii"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiiii(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiiii"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiiiii(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiiiii"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiiiiii(index, a1, a2, a3, a4, a5, a6, a7) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiiiji(index, a1, a2, a3, a4, a5, a6, a7) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiiiji"](index, a1, a2, a3, a4, a5, a6, a7); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiij(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiij"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiiji(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiiji"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiijii(index, a1, a2, a3, a4, a5, a6, a7) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiijii"](index, a1, a2, a3, a4, a5, a6, a7); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiijiii(index, a1, a2, a3, a4, a5, a6, a7, a8) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiijiii"](index, a1, a2, a3, a4, a5, a6, a7, a8); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiij(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiij"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiiji(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiiji"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiijii(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiijii"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiijiii(index, a1, a2, a3, a4, a5, a6, a7) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiijiii"](index, a1, a2, a3, a4, a5, a6, a7); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iij(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iij"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iiji(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iiji"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iijii(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iijii"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iijiii(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iijiii"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iijji(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iijji"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iijjii(index, a1, a2, a3, a4, a5, a6, a7) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iijjii"](index, a1, a2, a3, a4, a5, a6, a7); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iijjiii(index, a1, a2, a3, a4, a5, a6, a7, a8) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iijjiii"](index, a1, a2, a3, a4, a5, a6, a7, a8); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iijjji(index, a1, a2, a3, a4, a5, a6, a7, a8) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iijjji"](index, a1, a2, a3, a4, a5, a6, a7, a8); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_ij(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_ij"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_iji(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_iji"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_ijiii(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_ijiii"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_ijj(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_ijj"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_ijji(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_ijji"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_j(index) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_j"](index); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jdi(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jdi"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jdii(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jdii"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jfi(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jfi"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_ji(index, a1) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_ji"](index, a1); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jidi(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jidi"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jidii(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jidii"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jii(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jii"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jiii(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jiii"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jiiii(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jiiii"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jiiiii(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jiiiii"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jiiiiii(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jiiiiii"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jiiji(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jiiji"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jiji(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jiji"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jijii(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jijii"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jijiii(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jijiii"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jijj(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jijj"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jijji(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jijji"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_jji(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
return Module["dynCall_jji"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_v(index) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_v"](index); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vd(index, a1) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vd"](index, a1); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vf(index, a1) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vf"](index, a1); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vff(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vff"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vffff(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vffff"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vfi(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vfi"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vi(index, a1) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vi"](index, a1); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vid(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vid"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vidi(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vidi"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vif(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vif"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viff(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viff"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vifff(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vifff"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viffff(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viffff"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viffffi(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viffffi"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vifffi(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vifffi"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viffi(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viffi"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viffii(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viffii"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vifi(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vifi"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vii(index, a1, a2) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vii"](index, a1, a2); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viid(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viid"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viidi(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viidi"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viidii(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viidii"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viif(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viif"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiff(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiff"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viifff(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viifff"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiffi(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiffi"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viifi(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viifi"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viifii(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viifii"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viifiii(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viifiii"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viii(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viii"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiidi(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiidi"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiifi(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiifi"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiii(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiii"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiii(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiii"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiiif(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiiif"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiiifi(index, a1, a2, a3, a4, a5, a6, a7) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiiifi"](index, a1, a2, a3, a4, a5, a6, a7); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiiii(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiiii"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiiiif(index, a1, a2, a3, a4, a5, a6, a7) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiiiif"](index, a1, a2, a3, a4, a5, a6, a7); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiiiii(index, a1, a2, a3, a4, a5, a6, a7) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiiiii"](index, a1, a2, a3, a4, a5, a6, a7); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiiiiifi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiiiiifi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiiiiiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiiiiiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiijiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiijiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiiji(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiiji"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiijji(index, a1, a2, a3, a4, a5, a6, a7, a8) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiijji"](index, a1, a2, a3, a4, a5, a6, a7, a8); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viij(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viij"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viiji(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viiji"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viijii(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viijii"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viijiijiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viijiijiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viijijii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viijijii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viijijiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viijijiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viijj(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viijj"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viijji(index, a1, a2, a3, a4, a5, a6, a7) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viijji"](index, a1, a2, a3, a4, a5, a6, a7); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viijjiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viijjiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viijjji(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viijjji"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vij(index, a1, a2, a3) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vij"](index, a1, a2, a3); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_viji(index, a1, a2, a3, a4) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_viji"](index, a1, a2, a3, a4); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vijii(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vijii"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vijiii(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vijiii"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vijiji(index, a1, a2, a3, a4, a5, a6, a7) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vijiji"](index, a1, a2, a3, a4, a5, a6, a7); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vijijji(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vijijji"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vijji(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vijji"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vijjii(index, a1, a2, a3, a4, a5, a6, a7) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vijjii"](index, a1, a2, a3, a4, a5, a6, a7); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vjiiii(index, a1, a2, a3, a4, a5, a6) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vjiiii"](index, a1, a2, a3, a4, a5, a6); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
function invoke_vjji(index, a1, a2, a3, a4, a5) { |
|
var sp = stackSave(); |
|
try { |
|
Module["dynCall_vjji"](index, a1, a2, a3, a4, a5); |
|
} catch (e) { |
|
stackRestore(sp); |
|
if (typeof e !== "number" && e !== "longjmp") throw e; |
|
Module["setThrew"](1, 0); |
|
} |
|
} |
|
Module.asmGlobalArg = {}; |
|
Module.asmLibraryArg = { |
|
abort: abort, |
|
assert: assert, |
|
enlargeMemory: enlargeMemory, |
|
getTotalMemory: getTotalMemory, |
|
abortOnCannotGrowMemory: abortOnCannotGrowMemory, |
|
invoke_dddi: invoke_dddi, |
|
invoke_ddi: invoke_ddi, |
|
invoke_dfi: invoke_dfi, |
|
invoke_di: invoke_di, |
|
invoke_diddi: invoke_diddi, |
|
invoke_didi: invoke_didi, |
|
invoke_dii: invoke_dii, |
|
invoke_diii: invoke_diii, |
|
invoke_diiii: invoke_diiii, |
|
invoke_dji: invoke_dji, |
|
invoke_fdi: invoke_fdi, |
|
invoke_ff: invoke_ff, |
|
invoke_fff: invoke_fff, |
|
invoke_fffi: invoke_fffi, |
|
invoke_ffi: invoke_ffi, |
|
invoke_fi: invoke_fi, |
|
invoke_fif: invoke_fif, |
|
invoke_fiffi: invoke_fiffi, |
|
invoke_fifi: invoke_fifi, |
|
invoke_fii: invoke_fii, |
|
invoke_fiii: invoke_fiii, |
|
invoke_fiiii: invoke_fiiii, |
|
invoke_fji: invoke_fji, |
|
invoke_i: invoke_i, |
|
invoke_idi: invoke_idi, |
|
invoke_idiii: invoke_idiii, |
|
invoke_ifi: invoke_ifi, |
|
invoke_ifiii: invoke_ifiii, |
|
invoke_ii: invoke_ii, |
|
invoke_iidi: invoke_iidi, |
|
invoke_iidii: invoke_iidii, |
|
invoke_iif: invoke_iif, |
|
invoke_iifi: invoke_iifi, |
|
invoke_iifii: invoke_iifii, |
|
invoke_iifiii: invoke_iifiii, |
|
invoke_iii: invoke_iii, |
|
invoke_iiif: invoke_iiif, |
|
invoke_iiiff: invoke_iiiff, |
|
invoke_iiii: invoke_iiii, |
|
invoke_iiiifii: invoke_iiiifii, |
|
invoke_iiiifiii: invoke_iiiifiii, |
|
invoke_iiiii: invoke_iiiii, |
|
invoke_iiiiii: invoke_iiiiii, |
|
invoke_iiiiiii: invoke_iiiiiii, |
|
invoke_iiiiiiii: invoke_iiiiiiii, |
|
invoke_iiiiiiiii: invoke_iiiiiiiii, |
|
invoke_iiiiiiiiii: invoke_iiiiiiiiii, |
|
invoke_iiiiiiiiiii: invoke_iiiiiiiiiii, |
|
invoke_iiiiiiiiiiii: invoke_iiiiiiiiiiii, |
|
invoke_iiiiiiiiiiiii: invoke_iiiiiiiiiiiii, |
|
invoke_iiiiiiiiiiiiii: invoke_iiiiiiiiiiiiii, |
|
invoke_iiiiiji: invoke_iiiiiji, |
|
invoke_iiiij: invoke_iiiij, |
|
invoke_iiiiji: invoke_iiiiji, |
|
invoke_iiiijii: invoke_iiiijii, |
|
invoke_iiiijiii: invoke_iiiijiii, |
|
invoke_iiij: invoke_iiij, |
|
invoke_iiiji: invoke_iiiji, |
|
invoke_iiijii: invoke_iiijii, |
|
invoke_iiijiii: invoke_iiijiii, |
|
invoke_iij: invoke_iij, |
|
invoke_iiji: invoke_iiji, |
|
invoke_iijii: invoke_iijii, |
|
invoke_iijiii: invoke_iijiii, |
|
invoke_iijji: invoke_iijji, |
|
invoke_iijjii: invoke_iijjii, |
|
invoke_iijjiii: invoke_iijjiii, |
|
invoke_iijjji: invoke_iijjji, |
|
invoke_ij: invoke_ij, |
|
invoke_iji: invoke_iji, |
|
invoke_ijiii: invoke_ijiii, |
|
invoke_ijj: invoke_ijj, |
|
invoke_ijji: invoke_ijji, |
|
invoke_j: invoke_j, |
|
invoke_jdi: invoke_jdi, |
|
invoke_jdii: invoke_jdii, |
|
invoke_jfi: invoke_jfi, |
|
invoke_ji: invoke_ji, |
|
invoke_jidi: invoke_jidi, |
|
invoke_jidii: invoke_jidii, |
|
invoke_jii: invoke_jii, |
|
invoke_jiii: invoke_jiii, |
|
invoke_jiiii: invoke_jiiii, |
|
invoke_jiiiii: invoke_jiiiii, |
|
invoke_jiiiiii: invoke_jiiiiii, |
|
invoke_jiiiiiiiiii: invoke_jiiiiiiiiii, |
|
invoke_jiiji: invoke_jiiji, |
|
invoke_jiji: invoke_jiji, |
|
invoke_jijii: invoke_jijii, |
|
invoke_jijiii: invoke_jijiii, |
|
invoke_jijj: invoke_jijj, |
|
invoke_jijji: invoke_jijji, |
|
invoke_jji: invoke_jji, |
|
invoke_v: invoke_v, |
|
invoke_vd: invoke_vd, |
|
invoke_vf: invoke_vf, |
|
invoke_vff: invoke_vff, |
|
invoke_vffff: invoke_vffff, |
|
invoke_vfi: invoke_vfi, |
|
invoke_vi: invoke_vi, |
|
invoke_vid: invoke_vid, |
|
invoke_vidi: invoke_vidi, |
|
invoke_vif: invoke_vif, |
|
invoke_viff: invoke_viff, |
|
invoke_vifff: invoke_vifff, |
|
invoke_viffff: invoke_viffff, |
|
invoke_viffffi: invoke_viffffi, |
|
invoke_vifffi: invoke_vifffi, |
|
invoke_viffi: invoke_viffi, |
|
invoke_viffii: invoke_viffii, |
|
invoke_vifi: invoke_vifi, |
|
invoke_vii: invoke_vii, |
|
invoke_viid: invoke_viid, |
|
invoke_viidi: invoke_viidi, |
|
invoke_viidii: invoke_viidii, |
|
invoke_viif: invoke_viif, |
|
invoke_viiff: invoke_viiff, |
|
invoke_viifff: invoke_viifff, |
|
invoke_viiffi: invoke_viiffi, |
|
invoke_viifi: invoke_viifi, |
|
invoke_viifii: invoke_viifii, |
|
invoke_viifiii: invoke_viifiii, |
|
invoke_viii: invoke_viii, |
|
invoke_viiidi: invoke_viiidi, |
|
invoke_viiifi: invoke_viiifi, |
|
invoke_viiii: invoke_viiii, |
|
invoke_viiiii: invoke_viiiii, |
|
invoke_viiiiif: invoke_viiiiif, |
|
invoke_viiiiifi: invoke_viiiiifi, |
|
invoke_viiiiii: invoke_viiiiii, |
|
invoke_viiiiiif: invoke_viiiiiif, |
|
invoke_viiiiiii: invoke_viiiiiii, |
|
invoke_viiiiiiifi: invoke_viiiiiiifi, |
|
invoke_viiiiiiii: invoke_viiiiiiii, |
|
invoke_viiiiiiiii: invoke_viiiiiiiii, |
|
invoke_viiiiiiiiii: invoke_viiiiiiiiii, |
|
invoke_viiiiiiiiiii: invoke_viiiiiiiiiii, |
|
invoke_viiiiiiiiiiii: invoke_viiiiiiiiiiii, |
|
invoke_viiiiiiiiiiiiii: invoke_viiiiiiiiiiiiii, |
|
invoke_viiiiiiiiiiiiiii: invoke_viiiiiiiiiiiiiii, |
|
invoke_viiiiiiiiiiiiiiiiii: invoke_viiiiiiiiiiiiiiiiii, |
|
invoke_viiiijiiii: invoke_viiiijiiii, |
|
invoke_viiiji: invoke_viiiji, |
|
invoke_viiijji: invoke_viiijji, |
|
invoke_viij: invoke_viij, |
|
invoke_viiji: invoke_viiji, |
|
invoke_viijii: invoke_viijii, |
|
invoke_viijiijiii: invoke_viijiijiii, |
|
invoke_viijijii: invoke_viijijii, |
|
invoke_viijijiii: invoke_viijijiii, |
|
invoke_viijj: invoke_viijj, |
|
invoke_viijji: invoke_viijji, |
|
invoke_viijjiii: invoke_viijjiii, |
|
invoke_viijjji: invoke_viijjji, |
|
invoke_vij: invoke_vij, |
|
invoke_viji: invoke_viji, |
|
invoke_vijii: invoke_vijii, |
|
invoke_vijiii: invoke_vijiii, |
|
invoke_vijiji: invoke_vijiji, |
|
invoke_vijijji: invoke_vijijji, |
|
invoke_vijji: invoke_vijji, |
|
invoke_vijjii: invoke_vijjii, |
|
invoke_vjiiii: invoke_vjiiii, |
|
invoke_vjji: invoke_vjji, |
|
_JS_Cursor_SetImage: _JS_Cursor_SetImage, |
|
_JS_Cursor_SetShow: _JS_Cursor_SetShow, |
|
_JS_Eval_ClearInterval: _JS_Eval_ClearInterval, |
|
_JS_Eval_SetInterval: _JS_Eval_SetInterval, |
|
_JS_FileSystem_Initialize: _JS_FileSystem_Initialize, |
|
_JS_FileSystem_Sync: _JS_FileSystem_Sync, |
|
_JS_Log_Dump: _JS_Log_Dump, |
|
_JS_Log_StackTrace: _JS_Log_StackTrace, |
|
_JS_Sound_Create_Channel: _JS_Sound_Create_Channel, |
|
_JS_Sound_GetLength: _JS_Sound_GetLength, |
|
_JS_Sound_GetLoadState: _JS_Sound_GetLoadState, |
|
_JS_Sound_Init: _JS_Sound_Init, |
|
_JS_Sound_Load: _JS_Sound_Load, |
|
_JS_Sound_Load_PCM: _JS_Sound_Load_PCM, |
|
_JS_Sound_Play: _JS_Sound_Play, |
|
_JS_Sound_ReleaseInstance: _JS_Sound_ReleaseInstance, |
|
_JS_Sound_ResumeIfNeeded: _JS_Sound_ResumeIfNeeded, |
|
_JS_Sound_Set3D: _JS_Sound_Set3D, |
|
_JS_Sound_SetListenerOrientation: _JS_Sound_SetListenerOrientation, |
|
_JS_Sound_SetListenerPosition: _JS_Sound_SetListenerPosition, |
|
_JS_Sound_SetLoop: _JS_Sound_SetLoop, |
|
_JS_Sound_SetLoopPoints: _JS_Sound_SetLoopPoints, |
|
_JS_Sound_SetPitch: _JS_Sound_SetPitch, |
|
_JS_Sound_SetPosition: _JS_Sound_SetPosition, |
|
_JS_Sound_SetVolume: _JS_Sound_SetVolume, |
|
_JS_Sound_Stop: _JS_Sound_Stop, |
|
_JS_SystemInfo_GetCanvasClientSize: _JS_SystemInfo_GetCanvasClientSize, |
|
_JS_SystemInfo_GetDocumentURL: _JS_SystemInfo_GetDocumentURL, |
|
_JS_SystemInfo_GetGPUInfo: _JS_SystemInfo_GetGPUInfo, |
|
_JS_SystemInfo_GetMatchWebGLToCanvasSize: _JS_SystemInfo_GetMatchWebGLToCanvasSize, |
|
_JS_SystemInfo_GetMemory: _JS_SystemInfo_GetMemory, |
|
_JS_SystemInfo_GetOS: _JS_SystemInfo_GetOS, |
|
_JS_SystemInfo_GetPreferredDevicePixelRatio: _JS_SystemInfo_GetPreferredDevicePixelRatio, |
|
_JS_SystemInfo_GetScreenSize: _JS_SystemInfo_GetScreenSize, |
|
_JS_SystemInfo_HasCursorLock: _JS_SystemInfo_HasCursorLock, |
|
_JS_SystemInfo_HasFullscreen: _JS_SystemInfo_HasFullscreen, |
|
_JS_SystemInfo_HasWebGL: _JS_SystemInfo_HasWebGL, |
|
__ZSt18uncaught_exceptionv: __ZSt18uncaught_exceptionv, |
|
___atomic_compare_exchange_8: ___atomic_compare_exchange_8, |
|
___atomic_fetch_add_8: ___atomic_fetch_add_8, |
|
___buildEnvironment: ___buildEnvironment, |
|
___cxa_allocate_exception: ___cxa_allocate_exception, |
|
___cxa_begin_catch: ___cxa_begin_catch, |
|
___cxa_end_catch: ___cxa_end_catch, |
|
___cxa_find_matching_catch: ___cxa_find_matching_catch, |
|
___cxa_find_matching_catch_2: ___cxa_find_matching_catch_2, |
|
___cxa_find_matching_catch_3: ___cxa_find_matching_catch_3, |
|
___cxa_find_matching_catch_4: ___cxa_find_matching_catch_4, |
|
___cxa_free_exception: ___cxa_free_exception, |
|
___cxa_pure_virtual: ___cxa_pure_virtual, |
|
___cxa_rethrow: ___cxa_rethrow, |
|
___cxa_throw: ___cxa_throw, |
|
___gxx_personality_v0: ___gxx_personality_v0, |
|
___lock: ___lock, |
|
___map_file: ___map_file, |
|
___resumeException: ___resumeException, |
|
___setErrNo: ___setErrNo, |
|
___syscall10: ___syscall10, |
|
___syscall122: ___syscall122, |
|
___syscall140: ___syscall140, |
|
___syscall142: ___syscall142, |
|
___syscall145: ___syscall145, |
|
___syscall146: ___syscall146, |
|
___syscall15: ___syscall15, |
|
___syscall183: ___syscall183, |
|
___syscall192: ___syscall192, |
|
___syscall193: ___syscall193, |
|
___syscall195: ___syscall195, |
|
___syscall196: ___syscall196, |
|
___syscall197: ___syscall197, |
|
___syscall199: ___syscall199, |
|
___syscall202: ___syscall202, |
|
___syscall220: ___syscall220, |
|
___syscall221: ___syscall221, |
|
___syscall268: ___syscall268, |
|
___syscall3: ___syscall3, |
|
___syscall33: ___syscall33, |
|
___syscall38: ___syscall38, |
|
___syscall39: ___syscall39, |
|
___syscall4: ___syscall4, |
|
___syscall40: ___syscall40, |
|
___syscall5: ___syscall5, |
|
___syscall54: ___syscall54, |
|
___syscall6: ___syscall6, |
|
___syscall77: ___syscall77, |
|
___syscall85: ___syscall85, |
|
___syscall91: ___syscall91, |
|
___unlock: ___unlock, |
|
__addDays: __addDays, |
|
__arraySum: __arraySum, |
|
__emscripten_do_request_fullscreen: __emscripten_do_request_fullscreen, |
|
__emscripten_sample_gamepad_data: __emscripten_sample_gamepad_data, |
|
__emscripten_traverse_stack: __emscripten_traverse_stack, |
|
__exit: __exit, |
|
__formatString: __formatString, |
|
__isLeapYear: __isLeapYear, |
|
__reallyNegative: __reallyNegative, |
|
__setLetterbox: __setLetterbox, |
|
_abort: _abort, |
|
_atexit: _atexit, |
|
_clock: _clock, |
|
_clock_getres: _clock_getres, |
|
_clock_gettime: _clock_gettime, |
|
_difftime: _difftime, |
|
_dlclose: _dlclose, |
|
_dlopen: _dlopen, |
|
_dlsym: _dlsym, |
|
_emscripten_asm_const_i: _emscripten_asm_const_i, |
|
_emscripten_asm_const_ii: _emscripten_asm_const_ii, |
|
_emscripten_asm_const_sync_on_main_thread_i: _emscripten_asm_const_sync_on_main_thread_i, |
|
_emscripten_cancel_main_loop: _emscripten_cancel_main_loop, |
|
_emscripten_exit_fullscreen: _emscripten_exit_fullscreen, |
|
_emscripten_exit_pointerlock: _emscripten_exit_pointerlock, |
|
_emscripten_get_callstack_js: _emscripten_get_callstack_js, |
|
_emscripten_get_canvas_element_size: _emscripten_get_canvas_element_size, |
|
_emscripten_get_canvas_element_size_calling_thread: _emscripten_get_canvas_element_size_calling_thread, |
|
_emscripten_get_canvas_element_size_main_thread: _emscripten_get_canvas_element_size_main_thread, |
|
_emscripten_get_fullscreen_status: _emscripten_get_fullscreen_status, |
|
_emscripten_get_gamepad_status: _emscripten_get_gamepad_status, |
|
_emscripten_get_main_loop_timing: _emscripten_get_main_loop_timing, |
|
_emscripten_get_now: _emscripten_get_now, |
|
_emscripten_get_now_is_monotonic: _emscripten_get_now_is_monotonic, |
|
_emscripten_get_now_res: _emscripten_get_now_res, |
|
_emscripten_get_num_gamepads: _emscripten_get_num_gamepads, |
|
_emscripten_has_threading_support: _emscripten_has_threading_support, |
|
_emscripten_html5_remove_all_event_listeners: _emscripten_html5_remove_all_event_listeners, |
|
_emscripten_is_webgl_context_lost: _emscripten_is_webgl_context_lost, |
|
_emscripten_log: _emscripten_log, |
|
_emscripten_log_js: _emscripten_log_js, |
|
_emscripten_memcpy_big: _emscripten_memcpy_big, |
|
_emscripten_num_logical_cores: _emscripten_num_logical_cores, |
|
_emscripten_request_fullscreen: _emscripten_request_fullscreen, |
|
_emscripten_request_pointerlock: _emscripten_request_pointerlock, |
|
_emscripten_set_blur_callback_on_thread: _emscripten_set_blur_callback_on_thread, |
|
_emscripten_set_canvas_element_size: _emscripten_set_canvas_element_size, |
|
_emscripten_set_canvas_element_size_calling_thread: _emscripten_set_canvas_element_size_calling_thread, |
|
_emscripten_set_canvas_element_size_main_thread: _emscripten_set_canvas_element_size_main_thread, |
|
_emscripten_set_dblclick_callback_on_thread: _emscripten_set_dblclick_callback_on_thread, |
|
_emscripten_set_devicemotion_callback_on_thread: _emscripten_set_devicemotion_callback_on_thread, |
|
_emscripten_set_deviceorientation_callback_on_thread: _emscripten_set_deviceorientation_callback_on_thread, |
|
_emscripten_set_focus_callback_on_thread: _emscripten_set_focus_callback_on_thread, |
|
_emscripten_set_fullscreenchange_callback_on_thread: _emscripten_set_fullscreenchange_callback_on_thread, |
|
_emscripten_set_gamepadconnected_callback_on_thread: _emscripten_set_gamepadconnected_callback_on_thread, |
|
_emscripten_set_gamepaddisconnected_callback_on_thread: _emscripten_set_gamepaddisconnected_callback_on_thread, |
|
_emscripten_set_keydown_callback_on_thread: _emscripten_set_keydown_callback_on_thread, |
|
_emscripten_set_keypress_callback_on_thread: _emscripten_set_keypress_callback_on_thread, |
|
_emscripten_set_keyup_callback_on_thread: _emscripten_set_keyup_callback_on_thread, |
|
_emscripten_set_main_loop: _emscripten_set_main_loop, |
|
_emscripten_set_main_loop_timing: _emscripten_set_main_loop_timing, |
|
_emscripten_set_mousedown_callback_on_thread: _emscripten_set_mousedown_callback_on_thread, |
|
_emscripten_set_mousemove_callback_on_thread: _emscripten_set_mousemove_callback_on_thread, |
|
_emscripten_set_mouseup_callback_on_thread: _emscripten_set_mouseup_callback_on_thread, |
|
_emscripten_set_touchcancel_callback_on_thread: _emscripten_set_touchcancel_callback_on_thread, |
|
_emscripten_set_touchend_callback_on_thread: _emscripten_set_touchend_callback_on_thread, |
|
_emscripten_set_touchmove_callback_on_thread: _emscripten_set_touchmove_callback_on_thread, |
|
_emscripten_set_touchstart_callback_on_thread: _emscripten_set_touchstart_callback_on_thread, |
|
_emscripten_set_wheel_callback_on_thread: _emscripten_set_wheel_callback_on_thread, |
|
_emscripten_webgl_create_context: _emscripten_webgl_create_context, |
|
_emscripten_webgl_destroy_context: _emscripten_webgl_destroy_context, |
|
_emscripten_webgl_destroy_context_calling_thread: _emscripten_webgl_destroy_context_calling_thread, |
|
_emscripten_webgl_do_create_context: _emscripten_webgl_do_create_context, |
|
_emscripten_webgl_do_get_current_context: _emscripten_webgl_do_get_current_context, |
|
_emscripten_webgl_enable_extension: _emscripten_webgl_enable_extension, |
|
_emscripten_webgl_enable_extension_calling_thread: _emscripten_webgl_enable_extension_calling_thread, |
|
_emscripten_webgl_get_current_context: _emscripten_webgl_get_current_context, |
|
_emscripten_webgl_init_context_attributes: _emscripten_webgl_init_context_attributes, |
|
_emscripten_webgl_make_context_current: _emscripten_webgl_make_context_current, |
|
_exit: _exit, |
|
_flock: _flock, |
|
_getenv: _getenv, |
|
_getpagesize: _getpagesize, |
|
_getpwuid: _getpwuid, |
|
_gettimeofday: _gettimeofday, |
|
_glActiveTexture: _glActiveTexture, |
|
_glAttachShader: _glAttachShader, |
|
_glBeginQuery: _glBeginQuery, |
|
_glBeginTransformFeedback: _glBeginTransformFeedback, |
|
_glBindAttribLocation: _glBindAttribLocation, |
|
_glBindBuffer: _glBindBuffer, |
|
_glBindBufferBase: _glBindBufferBase, |
|
_glBindBufferRange: _glBindBufferRange, |
|
_glBindFramebuffer: _glBindFramebuffer, |
|
_glBindRenderbuffer: _glBindRenderbuffer, |
|
_glBindSampler: _glBindSampler, |
|
_glBindTexture: _glBindTexture, |
|
_glBindTransformFeedback: _glBindTransformFeedback, |
|
_glBindVertexArray: _glBindVertexArray, |
|
_glBlendEquation: _glBlendEquation, |
|
_glBlendEquationSeparate: _glBlendEquationSeparate, |
|
_glBlendFuncSeparate: _glBlendFuncSeparate, |
|
_glBlitFramebuffer: _glBlitFramebuffer, |
|
_glBufferData: _glBufferData, |
|
_glBufferSubData: _glBufferSubData, |
|
_glCheckFramebufferStatus: _glCheckFramebufferStatus, |
|
_glClear: _glClear, |
|
_glClearBufferfi: _glClearBufferfi, |
|
_glClearBufferfv: _glClearBufferfv, |
|
_glClearBufferuiv: _glClearBufferuiv, |
|
_glClearColor: _glClearColor, |
|
_glClearDepthf: _glClearDepthf, |
|
_glClearStencil: _glClearStencil, |
|
_glClientWaitSync: _glClientWaitSync, |
|
_glColorMask: _glColorMask, |
|
_glCompileShader: _glCompileShader, |
|
_glCompressedTexImage2D: _glCompressedTexImage2D, |
|
_glCompressedTexImage3D: _glCompressedTexImage3D, |
|
_glCompressedTexSubImage2D: _glCompressedTexSubImage2D, |
|
_glCompressedTexSubImage3D: _glCompressedTexSubImage3D, |
|
_glCopyBufferSubData: _glCopyBufferSubData, |
|
_glCopyTexImage2D: _glCopyTexImage2D, |
|
_glCopyTexSubImage2D: _glCopyTexSubImage2D, |
|
_glCreateProgram: _glCreateProgram, |
|
_glCreateShader: _glCreateShader, |
|
_glCullFace: _glCullFace, |
|
_glDeleteBuffers: _glDeleteBuffers, |
|
_glDeleteFramebuffers: _glDeleteFramebuffers, |
|
_glDeleteProgram: _glDeleteProgram, |
|
_glDeleteQueries: _glDeleteQueries, |
|
_glDeleteRenderbuffers: _glDeleteRenderbuffers, |
|
_glDeleteSamplers: _glDeleteSamplers, |
|
_glDeleteShader: _glDeleteShader, |
|
_glDeleteSync: _glDeleteSync, |
|
_glDeleteTextures: _glDeleteTextures, |
|
_glDeleteTransformFeedbacks: _glDeleteTransformFeedbacks, |
|
_glDeleteVertexArrays: _glDeleteVertexArrays, |
|
_glDepthFunc: _glDepthFunc, |
|
_glDepthMask: _glDepthMask, |
|
_glDetachShader: _glDetachShader, |
|
_glDisable: _glDisable, |
|
_glDisableVertexAttribArray: _glDisableVertexAttribArray, |
|
_glDrawArrays: _glDrawArrays, |
|
_glDrawArraysInstanced: _glDrawArraysInstanced, |
|
_glDrawBuffers: _glDrawBuffers, |
|
_glDrawElements: _glDrawElements, |
|
_glDrawElementsInstanced: _glDrawElementsInstanced, |
|
_glEnable: _glEnable, |
|
_glEnableVertexAttribArray: _glEnableVertexAttribArray, |
|
_glEndQuery: _glEndQuery, |
|
_glEndTransformFeedback: _glEndTransformFeedback, |
|
_glFenceSync: _glFenceSync, |
|
_glFinish: _glFinish, |
|
_glFlush: _glFlush, |
|
_glFlushMappedBufferRange: _glFlushMappedBufferRange, |
|
_glFramebufferRenderbuffer: _glFramebufferRenderbuffer, |
|
_glFramebufferTexture2D: _glFramebufferTexture2D, |
|
_glFramebufferTextureLayer: _glFramebufferTextureLayer, |
|
_glFrontFace: _glFrontFace, |
|
_glGenBuffers: _glGenBuffers, |
|
_glGenFramebuffers: _glGenFramebuffers, |
|
_glGenQueries: _glGenQueries, |
|
_glGenRenderbuffers: _glGenRenderbuffers, |
|
_glGenSamplers: _glGenSamplers, |
|
_glGenTextures: _glGenTextures, |
|
_glGenTransformFeedbacks: _glGenTransformFeedbacks, |
|
_glGenVertexArrays: _glGenVertexArrays, |
|
_glGenerateMipmap: _glGenerateMipmap, |
|
_glGetActiveAttrib: _glGetActiveAttrib, |
|
_glGetActiveUniform: _glGetActiveUniform, |
|
_glGetActiveUniformBlockName: _glGetActiveUniformBlockName, |
|
_glGetActiveUniformBlockiv: _glGetActiveUniformBlockiv, |
|
_glGetActiveUniformsiv: _glGetActiveUniformsiv, |
|
_glGetAttribLocation: _glGetAttribLocation, |
|
_glGetError: _glGetError, |
|
_glGetFramebufferAttachmentParameteriv: _glGetFramebufferAttachmentParameteriv, |
|
_glGetIntegeri_v: _glGetIntegeri_v, |
|
_glGetIntegerv: _glGetIntegerv, |
|
_glGetInternalformativ: _glGetInternalformativ, |
|
_glGetProgramBinary: _glGetProgramBinary, |
|
_glGetProgramInfoLog: _glGetProgramInfoLog, |
|
_glGetProgramiv: _glGetProgramiv, |
|
_glGetRenderbufferParameteriv: _glGetRenderbufferParameteriv, |
|
_glGetShaderInfoLog: _glGetShaderInfoLog, |
|
_glGetShaderPrecisionFormat: _glGetShaderPrecisionFormat, |
|
_glGetShaderSource: _glGetShaderSource, |
|
_glGetShaderiv: _glGetShaderiv, |
|
_glGetString: _glGetString, |
|
_glGetStringi: _glGetStringi, |
|
_glGetTexParameteriv: _glGetTexParameteriv, |
|
_glGetUniformBlockIndex: _glGetUniformBlockIndex, |
|
_glGetUniformIndices: _glGetUniformIndices, |
|
_glGetUniformLocation: _glGetUniformLocation, |
|
_glGetUniformiv: _glGetUniformiv, |
|
_glGetVertexAttribiv: _glGetVertexAttribiv, |
|
_glInvalidateFramebuffer: _glInvalidateFramebuffer, |
|
_glIsEnabled: _glIsEnabled, |
|
_glIsVertexArray: _glIsVertexArray, |
|
_glLinkProgram: _glLinkProgram, |
|
_glMapBufferRange: _glMapBufferRange, |
|
_glPixelStorei: _glPixelStorei, |
|
_glPolygonOffset: _glPolygonOffset, |
|
_glProgramBinary: _glProgramBinary, |
|
_glProgramParameteri: _glProgramParameteri, |
|
_glReadBuffer: _glReadBuffer, |
|
_glReadPixels: _glReadPixels, |
|
_glRenderbufferStorage: _glRenderbufferStorage, |
|
_glRenderbufferStorageMultisample: _glRenderbufferStorageMultisample, |
|
_glSamplerParameteri: _glSamplerParameteri, |
|
_glScissor: _glScissor, |
|
_glShaderSource: _glShaderSource, |
|
_glStencilFuncSeparate: _glStencilFuncSeparate, |
|
_glStencilMask: _glStencilMask, |
|
_glStencilOpSeparate: _glStencilOpSeparate, |
|
_glTexImage2D: _glTexImage2D, |
|
_glTexImage3D: _glTexImage3D, |
|
_glTexParameterf: _glTexParameterf, |
|
_glTexParameteri: _glTexParameteri, |
|
_glTexParameteriv: _glTexParameteriv, |
|
_glTexStorage2D: _glTexStorage2D, |
|
_glTexStorage3D: _glTexStorage3D, |
|
_glTexSubImage2D: _glTexSubImage2D, |
|
_glTexSubImage3D: _glTexSubImage3D, |
|
_glTransformFeedbackVaryings: _glTransformFeedbackVaryings, |
|
_glUniform1fv: _glUniform1fv, |
|
_glUniform1i: _glUniform1i, |
|
_glUniform1iv: _glUniform1iv, |
|
_glUniform1uiv: _glUniform1uiv, |
|
_glUniform2fv: _glUniform2fv, |
|
_glUniform2iv: _glUniform2iv, |
|
_glUniform2uiv: _glUniform2uiv, |
|
_glUniform3fv: _glUniform3fv, |
|
_glUniform3iv: _glUniform3iv, |
|
_glUniform3uiv: _glUniform3uiv, |
|
_glUniform4fv: _glUniform4fv, |
|
_glUniform4iv: _glUniform4iv, |
|
_glUniform4uiv: _glUniform4uiv, |
|
_glUniformBlockBinding: _glUniformBlockBinding, |
|
_glUniformMatrix3fv: _glUniformMatrix3fv, |
|
_glUniformMatrix4fv: _glUniformMatrix4fv, |
|
_glUnmapBuffer: _glUnmapBuffer, |
|
_glUseProgram: _glUseProgram, |
|
_glValidateProgram: _glValidateProgram, |
|
_glVertexAttrib4f: _glVertexAttrib4f, |
|
_glVertexAttrib4fv: _glVertexAttrib4fv, |
|
_glVertexAttribIPointer: _glVertexAttribIPointer, |
|
_glVertexAttribPointer: _glVertexAttribPointer, |
|
_glViewport: _glViewport, |
|
_gmtime: _gmtime, |
|
_gmtime_r: _gmtime_r, |
|
_llvm_ceil_f32: _llvm_ceil_f32, |
|
_llvm_ceil_f64: _llvm_ceil_f64, |
|
_llvm_copysign_f64: _llvm_copysign_f64, |
|
_llvm_cttz_i32: _llvm_cttz_i32, |
|
_llvm_eh_typeid_for: _llvm_eh_typeid_for, |
|
_llvm_exp2_f32: _llvm_exp2_f32, |
|
_llvm_fabs_f32: _llvm_fabs_f32, |
|
_llvm_fabs_f64: _llvm_fabs_f64, |
|
_llvm_floor_f32: _llvm_floor_f32, |
|
_llvm_floor_f64: _llvm_floor_f64, |
|
_llvm_log10_f32: _llvm_log10_f32, |
|
_llvm_log2_f32: _llvm_log2_f32, |
|
_llvm_sqrt_f32: _llvm_sqrt_f32, |
|
_llvm_trap: _llvm_trap, |
|
_localtime: _localtime, |
|
_localtime_r: _localtime_r, |
|
_mktime: _mktime, |
|
_nanosleep: _nanosleep, |
|
_pthread_getspecific: _pthread_getspecific, |
|
_pthread_key_create: _pthread_key_create, |
|
_pthread_once: _pthread_once, |
|
_pthread_setspecific: _pthread_setspecific, |
|
_setenv: _setenv, |
|
_sigaction: _sigaction, |
|
_sigemptyset: _sigemptyset, |
|
_strftime: _strftime, |
|
_sysconf: _sysconf, |
|
_time: _time, |
|
_tzset: _tzset, |
|
_unsetenv: _unsetenv, |
|
_usleep: _usleep, |
|
_utime: _utime, |
|
emscriptenWebGLComputeImageSize: emscriptenWebGLComputeImageSize, |
|
emscriptenWebGLGet: emscriptenWebGLGet, |
|
emscriptenWebGLGetBufferBinding: emscriptenWebGLGetBufferBinding, |
|
emscriptenWebGLGetHeapForType: emscriptenWebGLGetHeapForType, |
|
emscriptenWebGLGetIndexed: emscriptenWebGLGetIndexed, |
|
emscriptenWebGLGetShiftForType: emscriptenWebGLGetShiftForType, |
|
emscriptenWebGLGetTexPixelData: emscriptenWebGLGetTexPixelData, |
|
emscriptenWebGLGetUniform: emscriptenWebGLGetUniform, |
|
emscriptenWebGLGetVertexAttrib: emscriptenWebGLGetVertexAttrib, |
|
emscriptenWebGLValidateMapBufferTarget: emscriptenWebGLValidateMapBufferTarget, |
|
emscripten_get_canvas_element_size_js: emscripten_get_canvas_element_size_js, |
|
emscripten_set_canvas_element_size_js: emscripten_set_canvas_element_size_js, |
|
DYNAMICTOP_PTR: DYNAMICTOP_PTR, |
|
tempDoublePtr: tempDoublePtr, |
|
ABORT: ABORT, |
|
STACKTOP: STACKTOP, |
|
STACK_MAX: STACK_MAX, |
|
}; |
|
var asm = Module["asm"](Module.asmGlobalArg, Module.asmLibraryArg, buffer); |
|
Module["asm"] = asm; |
|
var _SendMessage = (Module["_SendMessage"] = function () { |
|
return Module["asm"]["_SendMessage"].apply(null, arguments); |
|
}); |
|
var _SendMessageFloat = (Module["_SendMessageFloat"] = function () { |
|
return Module["asm"]["_SendMessageFloat"].apply(null, arguments); |
|
}); |
|
var _SendMessageString = (Module["_SendMessageString"] = function () { |
|
return Module["asm"]["_SendMessageString"].apply(null, arguments); |
|
}); |
|
var _SetFullscreen = (Module["_SetFullscreen"] = function () { |
|
return Module["asm"]["_SetFullscreen"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_AIScriptingClasses_cpp = (Module["__GLOBAL__sub_I_AIScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_AIScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_AccessibilityScriptingClasses_cpp = (Module["__GLOBAL__sub_I_AccessibilityScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_AccessibilityScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_AndroidJNIScriptingClasses_cpp = (Module["__GLOBAL__sub_I_AndroidJNIScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_AndroidJNIScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_AnimationClip_cpp = (Module["__GLOBAL__sub_I_AnimationClip_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_AnimationClip_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_AnimationScriptingClasses_cpp = (Module["__GLOBAL__sub_I_AnimationScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_AnimationScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_AssetBundleFileSystem_cpp = (Module["__GLOBAL__sub_I_AssetBundleFileSystem_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_AssetBundleFileSystem_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_AssetBundleScriptingClasses_cpp = (Module["__GLOBAL__sub_I_AssetBundleScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_AssetBundleScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_AudioScriptingClasses_cpp = (Module["__GLOBAL__sub_I_AudioScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_AudioScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_ClothScriptingClasses_cpp = (Module["__GLOBAL__sub_I_ClothScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_ClothScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_DirectorScriptingClasses_cpp = (Module["__GLOBAL__sub_I_DirectorScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_DirectorScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_External_ProphecySDK_BlitOperations_1_cpp = (Module["__GLOBAL__sub_I_External_ProphecySDK_BlitOperations_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_External_ProphecySDK_BlitOperations_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_External_Yoga_Yoga_0_cpp = (Module["__GLOBAL__sub_I_External_Yoga_Yoga_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_External_Yoga_Yoga_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_External_il2cpp_builds_external_baselib_Platforms_WebGL_Source_0_cpp = (Module["__GLOBAL__sub_I_External_il2cpp_builds_external_baselib_Platforms_WebGL_Source_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_External_il2cpp_builds_external_baselib_Platforms_WebGL_Source_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_GUITexture_cpp = (Module["__GLOBAL__sub_I_GUITexture_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_GUITexture_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_GfxDeviceNull_cpp = (Module["__GLOBAL__sub_I_GfxDeviceNull_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_GfxDeviceNull_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_GridScriptingClasses_cpp = (Module["__GLOBAL__sub_I_GridScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_GridScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_IMGUIScriptingClasses_cpp = (Module["__GLOBAL__sub_I_IMGUIScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_IMGUIScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_InputLegacyScriptingClasses_cpp = (Module["__GLOBAL__sub_I_InputLegacyScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_InputLegacyScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_InputScriptingClasses_cpp = (Module["__GLOBAL__sub_I_InputScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_InputScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_LogAssert_cpp = (Module["__GLOBAL__sub_I_LogAssert_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_LogAssert_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Lump_libil2cpp_gc_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_gc_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_gc_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Lump_libil2cpp_icalls_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_icalls_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_icalls_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Lump_libil2cpp_metadata_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_metadata_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_metadata_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Lump_libil2cpp_mono_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_mono_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_mono_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Lump_libil2cpp_os_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_os_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_os_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Lump_libil2cpp_utils_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_utils_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_utils_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Lump_libil2cpp_vm_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_vm_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_vm_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Lump_libil2cpp_vm_utils_cpp = (Module["__GLOBAL__sub_I_Lump_libil2cpp_vm_utils_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Lump_libil2cpp_vm_utils_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Mesh_cpp = (Module["__GLOBAL__sub_I_Mesh_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Mesh_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Animation_0_cpp = (Module["__GLOBAL__sub_I_Modules_Animation_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Animation_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Animation_2_cpp = (Module["__GLOBAL__sub_I_Modules_Animation_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Animation_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Animation_7_cpp = (Module["__GLOBAL__sub_I_Modules_Animation_7_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Animation_7_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Animation_Constraints_0_cpp = (Module["__GLOBAL__sub_I_Modules_Animation_Constraints_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Animation_Constraints_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_AssetBundle_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_AssetBundle_Public_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_AssetBundle_Public_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Audio_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_Audio_Public_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Audio_Public_1_cpp = (Module["__GLOBAL__sub_I_Modules_Audio_Public_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Audio_Public_3_cpp = (Module["__GLOBAL__sub_I_Modules_Audio_Public_3_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_3_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Audio_Public_ScriptBindings_1_cpp = (Module["__GLOBAL__sub_I_Modules_Audio_Public_ScriptBindings_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_ScriptBindings_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Audio_Public_sound_0_cpp = (Module["__GLOBAL__sub_I_Modules_Audio_Public_sound_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Audio_Public_sound_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Cloth_0_cpp = (Module["__GLOBAL__sub_I_Modules_Cloth_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Cloth_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_DSPGraph_Public_1_cpp = (Module["__GLOBAL__sub_I_Modules_DSPGraph_Public_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_DSPGraph_Public_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Grid_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_Grid_Public_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Grid_Public_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_IMGUI_0_cpp = (Module["__GLOBAL__sub_I_Modules_IMGUI_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_IMGUI_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_IMGUI_1_cpp = (Module["__GLOBAL__sub_I_Modules_IMGUI_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_IMGUI_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Input_Private_0_cpp = (Module["__GLOBAL__sub_I_Modules_Input_Private_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Input_Private_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_ParticleSystem_0_cpp = (Module["__GLOBAL__sub_I_Modules_ParticleSystem_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_ParticleSystem_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Physics2D_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_Physics2D_Public_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Physics2D_Public_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Physics2D_Public_1_cpp = (Module["__GLOBAL__sub_I_Modules_Physics2D_Public_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Physics2D_Public_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Physics_0_cpp = (Module["__GLOBAL__sub_I_Modules_Physics_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Physics_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Physics_2_cpp = (Module["__GLOBAL__sub_I_Modules_Physics_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Physics_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Profiler_Public_1_cpp = (Module["__GLOBAL__sub_I_Modules_Profiler_Public_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Profiler_Public_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Profiler_Runtime_1_cpp = (Module["__GLOBAL__sub_I_Modules_Profiler_Runtime_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Profiler_Runtime_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Subsystems_0_cpp = (Module["__GLOBAL__sub_I_Modules_Subsystems_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Subsystems_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Terrain_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_Terrain_Public_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_Public_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Terrain_Public_1_cpp = (Module["__GLOBAL__sub_I_Modules_Terrain_Public_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_Public_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Terrain_Public_2_cpp = (Module["__GLOBAL__sub_I_Modules_Terrain_Public_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_Public_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Terrain_Public_3_cpp = (Module["__GLOBAL__sub_I_Modules_Terrain_Public_3_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_Public_3_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Terrain_VR_0_cpp = (Module["__GLOBAL__sub_I_Modules_Terrain_VR_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Terrain_VR_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_TextCore_Native_FontEngine_0_cpp = (Module["__GLOBAL__sub_I_Modules_TextCore_Native_FontEngine_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_TextCore_Native_FontEngine_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_TextRendering_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_TextRendering_Public_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_TextRendering_Public_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Tilemap_0_cpp = (Module["__GLOBAL__sub_I_Modules_Tilemap_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Tilemap_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Tilemap_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_Tilemap_Public_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Tilemap_Public_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_UI_0_cpp = (Module["__GLOBAL__sub_I_Modules_UI_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_UI_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_UI_1_cpp = (Module["__GLOBAL__sub_I_Modules_UI_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_UI_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_UI_2_cpp = (Module["__GLOBAL__sub_I_Modules_UI_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_UI_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_UnityWebRequest_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_UnityWebRequest_Public_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_UnityWebRequest_Public_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_VFX_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_VFX_Public_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VFX_Public_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_VFX_Public_1_cpp = (Module["__GLOBAL__sub_I_Modules_VFX_Public_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VFX_Public_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_VFX_Public_Systems_0_cpp = (Module["__GLOBAL__sub_I_Modules_VFX_Public_Systems_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VFX_Public_Systems_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_VR_0_cpp = (Module["__GLOBAL__sub_I_Modules_VR_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VR_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_VR_1_cpp = (Module["__GLOBAL__sub_I_Modules_VR_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_VR_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_Video_Public_Base_0_cpp = (Module["__GLOBAL__sub_I_Modules_Video_Public_Base_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_Video_Public_Base_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_XR_0_cpp = (Module["__GLOBAL__sub_I_Modules_XR_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_XR_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_XR_Public_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Public_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_XR_Stats_0_cpp = (Module["__GLOBAL__sub_I_Modules_XR_Stats_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Stats_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_XR_Subsystems_Display_0_cpp = (Module["__GLOBAL__sub_I_Modules_XR_Subsystems_Display_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Subsystems_Display_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_0_cpp = (Module["__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_1_cpp = (Module["__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Subsystems_Input_Public_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_XR_Subsystems_Meshing_0_cpp = (Module["__GLOBAL__sub_I_Modules_XR_Subsystems_Meshing_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Subsystems_Meshing_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Modules_XR_Tracing_0_cpp = (Module["__GLOBAL__sub_I_Modules_XR_Tracing_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Modules_XR_Tracing_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_ParticleSystemScriptingClasses_cpp = (Module["__GLOBAL__sub_I_ParticleSystemScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_ParticleSystemScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Physics2DScriptingClasses_cpp = (Module["__GLOBAL__sub_I_Physics2DScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Physics2DScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_PhysicsQuery_cpp = (Module["__GLOBAL__sub_I_PhysicsQuery_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_PhysicsQuery_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_PhysicsScriptingClasses_cpp = (Module["__GLOBAL__sub_I_PhysicsScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_PhysicsScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_PlatformDependent_WebGL_External_baselib_builds_Source_0_cpp = (Module["__GLOBAL__sub_I_PlatformDependent_WebGL_External_baselib_builds_Source_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_PlatformDependent_WebGL_External_baselib_builds_Source_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_PlatformDependent_WebGL_Source_0_cpp = (Module["__GLOBAL__sub_I_PlatformDependent_WebGL_Source_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_PlatformDependent_WebGL_Source_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_PlatformDependent_WebGL_Source_2_cpp = (Module["__GLOBAL__sub_I_PlatformDependent_WebGL_Source_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_PlatformDependent_WebGL_Source_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_PluginInterfaceVR_cpp = (Module["__GLOBAL__sub_I_PluginInterfaceVR_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_PluginInterfaceVR_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_2D_Renderer_0_cpp = (Module["__GLOBAL__sub_I_Runtime_2D_Renderer_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_2D_Renderer_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_2D_Sorting_0_cpp = (Module["__GLOBAL__sub_I_Runtime_2D_Sorting_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_2D_Sorting_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_2D_SpriteAtlas_0_cpp = (Module["__GLOBAL__sub_I_Runtime_2D_SpriteAtlas_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_2D_SpriteAtlas_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Allocator_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Allocator_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Allocator_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Application_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Application_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Application_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_BaseClasses_0_cpp = (Module["__GLOBAL__sub_I_Runtime_BaseClasses_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_BaseClasses_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_BaseClasses_1_cpp = (Module["__GLOBAL__sub_I_Runtime_BaseClasses_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_BaseClasses_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_BaseClasses_2_cpp = (Module["__GLOBAL__sub_I_Runtime_BaseClasses_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_BaseClasses_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_BaseClasses_3_cpp = (Module["__GLOBAL__sub_I_Runtime_BaseClasses_3_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_BaseClasses_3_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Burst_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Burst_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Burst_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Camera_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Camera_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Camera_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Camera_6_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_6_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_6_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Camera_7_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_7_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_7_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Camera_8_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_8_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_8_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Camera_Culling_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_Culling_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_Culling_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Camera_RenderLoops_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_RenderLoops_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_RenderLoops_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Camera_RenderLoops_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Camera_RenderLoops_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Camera_RenderLoops_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Containers_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Containers_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Containers_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Core_Callbacks_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Core_Callbacks_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Core_Callbacks_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Director_Core_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Director_Core_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Director_Core_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Export_Unsafe_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Export_Unsafe_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Export_Unsafe_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_File_0_cpp = (Module["__GLOBAL__sub_I_Runtime_File_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_File_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Geometry_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Geometry_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Geometry_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_GfxDevice_1_cpp = (Module["__GLOBAL__sub_I_Runtime_GfxDevice_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_GfxDevice_2_cpp = (Module["__GLOBAL__sub_I_Runtime_GfxDevice_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_GfxDevice_3_cpp = (Module["__GLOBAL__sub_I_Runtime_GfxDevice_3_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_3_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_GfxDevice_4_cpp = (Module["__GLOBAL__sub_I_Runtime_GfxDevice_4_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_4_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_GfxDevice_5_cpp = (Module["__GLOBAL__sub_I_Runtime_GfxDevice_5_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_5_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_GfxDevice_opengles_0_cpp = (Module["__GLOBAL__sub_I_Runtime_GfxDevice_opengles_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_GfxDevice_opengles_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_10_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_10_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_10_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_11_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_11_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_11_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_4_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_4_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_4_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_5_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_5_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_5_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_6_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_6_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_6_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_8_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_8_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_8_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_Billboard_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_Billboard_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Billboard_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_CommandBuffer_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_CommandBuffer_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_CommandBuffer_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_LOD_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_LOD_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_LOD_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_4_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_4_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_4_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_Mesh_5_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_Mesh_5_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_Mesh_5_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Graphics_ScriptableRenderLoop_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Graphics_ScriptableRenderLoop_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Graphics_ScriptableRenderLoop_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Input_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Input_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Input_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Interfaces_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Interfaces_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Interfaces_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Interfaces_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Interfaces_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Interfaces_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Interfaces_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Interfaces_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Interfaces_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Jobs_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Jobs_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Jobs_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Jobs_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Jobs_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Jobs_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Jobs_Internal_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Jobs_Internal_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Jobs_Internal_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Jobs_ScriptBindings_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Jobs_ScriptBindings_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Jobs_ScriptBindings_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Math_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Math_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Math_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Math_Random_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Math_Random_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Math_Random_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Misc_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Misc_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Misc_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Misc_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Misc_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Misc_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Misc_4_cpp = (Module["__GLOBAL__sub_I_Runtime_Misc_4_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Misc_4_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Misc_5_cpp = (Module["__GLOBAL__sub_I_Runtime_Misc_5_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Misc_5_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Modules_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Modules_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Modules_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Mono_SerializationBackend_DirectMemoryAccess_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_PluginInterface_0_cpp = (Module["__GLOBAL__sub_I_Runtime_PluginInterface_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_PluginInterface_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_PreloadManager_0_cpp = (Module["__GLOBAL__sub_I_Runtime_PreloadManager_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_PreloadManager_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Profiler_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Profiler_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Profiler_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Profiler_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Profiler_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Profiler_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Profiler_ExternalGPUProfiler_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Profiler_ExternalGPUProfiler_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Profiler_ExternalGPUProfiler_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Profiler_ScriptBindings_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Profiler_ScriptBindings_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Profiler_ScriptBindings_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_SceneManager_0_cpp = (Module["__GLOBAL__sub_I_Runtime_SceneManager_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_SceneManager_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_ScriptingBackend_Il2Cpp_0_cpp = (Module["__GLOBAL__sub_I_Runtime_ScriptingBackend_Il2Cpp_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_ScriptingBackend_Il2Cpp_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Scripting_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Scripting_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Scripting_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Scripting_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Scripting_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Scripting_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Scripting_3_cpp = (Module["__GLOBAL__sub_I_Runtime_Scripting_3_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Scripting_3_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Scripting_APIUpdating_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Scripting_APIUpdating_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Scripting_APIUpdating_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Serialize_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Serialize_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Serialize_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Serialize_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Serialize_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Serialize_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Serialize_TransferFunctions_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Shaders_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Shaders_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Shaders_3_cpp = (Module["__GLOBAL__sub_I_Runtime_Shaders_3_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_3_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Shaders_GpuPrograms_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Shaders_GpuPrograms_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_GpuPrograms_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Shaders_ShaderImpl_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Shaders_ShaderImpl_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Shaders_ShaderImpl_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Transform_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Transform_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Transform_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Transform_1_cpp = (Module["__GLOBAL__sub_I_Runtime_Transform_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Transform_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Utilities_2_cpp = (Module["__GLOBAL__sub_I_Runtime_Utilities_2_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_2_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Utilities_5_cpp = (Module["__GLOBAL__sub_I_Runtime_Utilities_5_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_5_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Utilities_6_cpp = (Module["__GLOBAL__sub_I_Runtime_Utilities_6_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_6_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Utilities_7_cpp = (Module["__GLOBAL__sub_I_Runtime_Utilities_7_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_7_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Utilities_9_cpp = (Module["__GLOBAL__sub_I_Runtime_Utilities_9_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Utilities_9_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_Video_0_cpp = (Module["__GLOBAL__sub_I_Runtime_Video_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_Video_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Runtime_VirtualFileSystem_0_cpp = (Module["__GLOBAL__sub_I_Runtime_VirtualFileSystem_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Runtime_VirtualFileSystem_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Shader_cpp = (Module["__GLOBAL__sub_I_Shader_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Shader_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Shadows_cpp = (Module["__GLOBAL__sub_I_Shadows_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Shadows_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_ShapeModule_cpp = (Module["__GLOBAL__sub_I_ShapeModule_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_ShapeModule_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_SubsystemsScriptingClasses_cpp = (Module["__GLOBAL__sub_I_SubsystemsScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_SubsystemsScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_SwInterCollision_cpp = (Module["__GLOBAL__sub_I_SwInterCollision_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_SwInterCollision_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_SwSolverKernel_cpp = (Module["__GLOBAL__sub_I_SwSolverKernel_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_SwSolverKernel_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_TemplateInstantiations_cpp = (Module["__GLOBAL__sub_I_TemplateInstantiations_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_TemplateInstantiations_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_TerrainScriptingClasses_cpp = (Module["__GLOBAL__sub_I_TerrainScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_TerrainScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_TextCoreScriptingClasses_cpp = (Module["__GLOBAL__sub_I_TextCoreScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_TextCoreScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_TextRenderingScriptingClasses_cpp = (Module["__GLOBAL__sub_I_TextRenderingScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_TextRenderingScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_TilemapScriptingClasses_cpp = (Module["__GLOBAL__sub_I_TilemapScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_TilemapScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_UIElementsNativeScriptingClasses_cpp = (Module["__GLOBAL__sub_I_UIElementsNativeScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_UIElementsNativeScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_UIScriptingClasses_cpp = (Module["__GLOBAL__sub_I_UIScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_UIScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_UVModule_cpp = (Module["__GLOBAL__sub_I_UVModule_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_UVModule_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_UnityAdsSettings_cpp = (Module["__GLOBAL__sub_I_UnityAdsSettings_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_UnityAdsSettings_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_UnityAnalyticsScriptingClasses_cpp = (Module["__GLOBAL__sub_I_UnityAnalyticsScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_UnityAnalyticsScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_UnityWebRequestScriptingClasses_cpp = (Module["__GLOBAL__sub_I_UnityWebRequestScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_UnityWebRequestScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_VFXScriptingClasses_cpp = (Module["__GLOBAL__sub_I_VFXScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_VFXScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_VRScriptingClasses_cpp = (Module["__GLOBAL__sub_I_VRScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_VRScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_VideoScriptingClasses_cpp = (Module["__GLOBAL__sub_I_VideoScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_VideoScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_VisualEffectAsset_cpp = (Module["__GLOBAL__sub_I_VisualEffectAsset_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_VisualEffectAsset_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_Wind_cpp = (Module["__GLOBAL__sub_I_Wind_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_Wind_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_XRAudio_cpp = (Module["__GLOBAL__sub_I_XRAudio_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_XRAudio_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_XRPreInit_cpp = (Module["__GLOBAL__sub_I_XRPreInit_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_XRPreInit_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_XRScriptingClasses_cpp = (Module["__GLOBAL__sub_I_XRScriptingClasses_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_XRScriptingClasses_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_XRWindowsLocatableCamera_cpp = (Module["__GLOBAL__sub_I_XRWindowsLocatableCamera_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_XRWindowsLocatableCamera_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_artifacts_WebGL_codegenerator_0_cpp = (Module["__GLOBAL__sub_I_artifacts_WebGL_codegenerator_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_artifacts_WebGL_codegenerator_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_nvcloth_src_0_cpp = (Module["__GLOBAL__sub_I_nvcloth_src_0_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_nvcloth_src_0_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_nvcloth_src_1_cpp = (Module["__GLOBAL__sub_I_nvcloth_src_1_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_nvcloth_src_1_cpp"].apply(null, arguments); |
|
}); |
|
var __GLOBAL__sub_I_umbra_cpp = (Module["__GLOBAL__sub_I_umbra_cpp"] = function () { |
|
return Module["asm"]["__GLOBAL__sub_I_umbra_cpp"].apply(null, arguments); |
|
}); |
|
var ___cxa_can_catch = (Module["___cxa_can_catch"] = function () { |
|
return Module["asm"]["___cxa_can_catch"].apply(null, arguments); |
|
}); |
|
var ___cxa_is_pointer_type = (Module["___cxa_is_pointer_type"] = function () { |
|
return Module["asm"]["___cxa_is_pointer_type"].apply(null, arguments); |
|
}); |
|
var ___cxx_global_var_init = (Module["___cxx_global_var_init"] = function () { |
|
return Module["asm"]["___cxx_global_var_init"].apply(null, arguments); |
|
}); |
|
var ___cxx_global_var_init_104 = (Module["___cxx_global_var_init_104"] = function () { |
|
return Module["asm"]["___cxx_global_var_init_104"].apply(null, arguments); |
|
}); |
|
var ___cxx_global_var_init_131 = (Module["___cxx_global_var_init_131"] = function () { |
|
return Module["asm"]["___cxx_global_var_init_131"].apply(null, arguments); |
|
}); |
|
var ___cxx_global_var_init_18 = (Module["___cxx_global_var_init_18"] = function () { |
|
return Module["asm"]["___cxx_global_var_init_18"].apply(null, arguments); |
|
}); |
|
var ___cxx_global_var_init_18_1180 = (Module["___cxx_global_var_init_18_1180"] = function () { |
|
return Module["asm"]["___cxx_global_var_init_18_1180"].apply(null, arguments); |
|
}); |
|
var ___cxx_global_var_init_19 = (Module["___cxx_global_var_init_19"] = function () { |
|
return Module["asm"]["___cxx_global_var_init_19"].apply(null, arguments); |
|
}); |
|
var ___cxx_global_var_init_20 = (Module["___cxx_global_var_init_20"] = function () { |
|
return Module["asm"]["___cxx_global_var_init_20"].apply(null, arguments); |
|
}); |
|
var ___cxx_global_var_init_23 = (Module["___cxx_global_var_init_23"] = function () { |
|
return Module["asm"]["___cxx_global_var_init_23"].apply(null, arguments); |
|
}); |
|
var ___cxx_global_var_init_3785 = (Module["___cxx_global_var_init_3785"] = function () { |
|
return Module["asm"]["___cxx_global_var_init_3785"].apply(null, arguments); |
|
}); |
|
var ___cxx_global_var_init_7754 = (Module["___cxx_global_var_init_7754"] = function () { |
|
return Module["asm"]["___cxx_global_var_init_7754"].apply(null, arguments); |
|
}); |
|
var ___cxx_global_var_init_89 = (Module["___cxx_global_var_init_89"] = function () { |
|
return Module["asm"]["___cxx_global_var_init_89"].apply(null, arguments); |
|
}); |
|
var ___cxx_global_var_init_8911 = (Module["___cxx_global_var_init_8911"] = function () { |
|
return Module["asm"]["___cxx_global_var_init_8911"].apply(null, arguments); |
|
}); |
|
var ___cxx_global_var_init_9 = (Module["___cxx_global_var_init_9"] = function () { |
|
return Module["asm"]["___cxx_global_var_init_9"].apply(null, arguments); |
|
}); |
|
var ___cxx_global_var_init_9307 = (Module["___cxx_global_var_init_9307"] = function () { |
|
return Module["asm"]["___cxx_global_var_init_9307"].apply(null, arguments); |
|
}); |
|
var ___emscripten_environ_constructor = (Module["___emscripten_environ_constructor"] = function () { |
|
return Module["asm"]["___emscripten_environ_constructor"].apply(null, arguments); |
|
}); |
|
var ___errno_location = (Module["___errno_location"] = function () { |
|
return Module["asm"]["___errno_location"].apply(null, arguments); |
|
}); |
|
var __get_daylight = (Module["__get_daylight"] = function () { |
|
return Module["asm"]["__get_daylight"].apply(null, arguments); |
|
}); |
|
var __get_environ = (Module["__get_environ"] = function () { |
|
return Module["asm"]["__get_environ"].apply(null, arguments); |
|
}); |
|
var __get_timezone = (Module["__get_timezone"] = function () { |
|
return Module["asm"]["__get_timezone"].apply(null, arguments); |
|
}); |
|
var __get_tzname = (Module["__get_tzname"] = function () { |
|
return Module["asm"]["__get_tzname"].apply(null, arguments); |
|
}); |
|
var _emscripten_replace_memory = (Module["_emscripten_replace_memory"] = function () { |
|
return Module["asm"]["_emscripten_replace_memory"].apply(null, arguments); |
|
}); |
|
var _free = (Module["_free"] = function () { |
|
return Module["asm"]["_free"].apply(null, arguments); |
|
}); |
|
var _htonl = (Module["_htonl"] = function () { |
|
return Module["asm"]["_htonl"].apply(null, arguments); |
|
}); |
|
var _htons = (Module["_htons"] = function () { |
|
return Module["asm"]["_htons"].apply(null, arguments); |
|
}); |
|
var _i64Add = (Module["_i64Add"] = function () { |
|
return Module["asm"]["_i64Add"].apply(null, arguments); |
|
}); |
|
var _llvm_bswap_i16 = (Module["_llvm_bswap_i16"] = function () { |
|
return Module["asm"]["_llvm_bswap_i16"].apply(null, arguments); |
|
}); |
|
var _llvm_bswap_i32 = (Module["_llvm_bswap_i32"] = function () { |
|
return Module["asm"]["_llvm_bswap_i32"].apply(null, arguments); |
|
}); |
|
var _llvm_ctlz_i64 = (Module["_llvm_ctlz_i64"] = function () { |
|
return Module["asm"]["_llvm_ctlz_i64"].apply(null, arguments); |
|
}); |
|
var _llvm_ctpop_i32 = (Module["_llvm_ctpop_i32"] = function () { |
|
return Module["asm"]["_llvm_ctpop_i32"].apply(null, arguments); |
|
}); |
|
var _llvm_maxnum_f32 = (Module["_llvm_maxnum_f32"] = function () { |
|
return Module["asm"]["_llvm_maxnum_f32"].apply(null, arguments); |
|
}); |
|
var _llvm_maxnum_f64 = (Module["_llvm_maxnum_f64"] = function () { |
|
return Module["asm"]["_llvm_maxnum_f64"].apply(null, arguments); |
|
}); |
|
var _llvm_minnum_f32 = (Module["_llvm_minnum_f32"] = function () { |
|
return Module["asm"]["_llvm_minnum_f32"].apply(null, arguments); |
|
}); |
|
var _llvm_round_f32 = (Module["_llvm_round_f32"] = function () { |
|
return Module["asm"]["_llvm_round_f32"].apply(null, arguments); |
|
}); |
|
var _main = (Module["_main"] = function () { |
|
return Module["asm"]["_main"].apply(null, arguments); |
|
}); |
|
var _malloc = (Module["_malloc"] = function () { |
|
return Module["asm"]["_malloc"].apply(null, arguments); |
|
}); |
|
var _memalign = (Module["_memalign"] = function () { |
|
return Module["asm"]["_memalign"].apply(null, arguments); |
|
}); |
|
var _memcpy = (Module["_memcpy"] = function () { |
|
return Module["asm"]["_memcpy"].apply(null, arguments); |
|
}); |
|
var _memmove = (Module["_memmove"] = function () { |
|
return Module["asm"]["_memmove"].apply(null, arguments); |
|
}); |
|
var _memset = (Module["_memset"] = function () { |
|
return Module["asm"]["_memset"].apply(null, arguments); |
|
}); |
|
var _ntohs = (Module["_ntohs"] = function () { |
|
return Module["asm"]["_ntohs"].apply(null, arguments); |
|
}); |
|
var _realloc = (Module["_realloc"] = function () { |
|
return Module["asm"]["_realloc"].apply(null, arguments); |
|
}); |
|
var _sbrk = (Module["_sbrk"] = function () { |
|
return Module["asm"]["_sbrk"].apply(null, arguments); |
|
}); |
|
var _strlen = (Module["_strlen"] = function () { |
|
return Module["asm"]["_strlen"].apply(null, arguments); |
|
}); |
|
var establishStackSpace = (Module["establishStackSpace"] = function () { |
|
return Module["asm"]["establishStackSpace"].apply(null, arguments); |
|
}); |
|
var getTempRet0 = (Module["getTempRet0"] = function () { |
|
return Module["asm"]["getTempRet0"].apply(null, arguments); |
|
}); |
|
var runPostSets = (Module["runPostSets"] = function () { |
|
return Module["asm"]["runPostSets"].apply(null, arguments); |
|
}); |
|
var setTempRet0 = (Module["setTempRet0"] = function () { |
|
return Module["asm"]["setTempRet0"].apply(null, arguments); |
|
}); |
|
var setThrew = (Module["setThrew"] = function () { |
|
return Module["asm"]["setThrew"].apply(null, arguments); |
|
}); |
|
var stackAlloc = (Module["stackAlloc"] = function () { |
|
return Module["asm"]["stackAlloc"].apply(null, arguments); |
|
}); |
|
var stackRestore = (Module["stackRestore"] = function () { |
|
return Module["asm"]["stackRestore"].apply(null, arguments); |
|
}); |
|
var stackSave = (Module["stackSave"] = function () { |
|
return Module["asm"]["stackSave"].apply(null, arguments); |
|
}); |
|
var dynCall_dddi = (Module["dynCall_dddi"] = function () { |
|
return Module["asm"]["dynCall_dddi"].apply(null, arguments); |
|
}); |
|
var dynCall_ddi = (Module["dynCall_ddi"] = function () { |
|
return Module["asm"]["dynCall_ddi"].apply(null, arguments); |
|
}); |
|
var dynCall_dfi = (Module["dynCall_dfi"] = function () { |
|
return Module["asm"]["dynCall_dfi"].apply(null, arguments); |
|
}); |
|
var dynCall_di = (Module["dynCall_di"] = function () { |
|
return Module["asm"]["dynCall_di"].apply(null, arguments); |
|
}); |
|
var dynCall_diddi = (Module["dynCall_diddi"] = function () { |
|
return Module["asm"]["dynCall_diddi"].apply(null, arguments); |
|
}); |
|
var dynCall_didi = (Module["dynCall_didi"] = function () { |
|
return Module["asm"]["dynCall_didi"].apply(null, arguments); |
|
}); |
|
var dynCall_dii = (Module["dynCall_dii"] = function () { |
|
return Module["asm"]["dynCall_dii"].apply(null, arguments); |
|
}); |
|
var dynCall_diii = (Module["dynCall_diii"] = function () { |
|
return Module["asm"]["dynCall_diii"].apply(null, arguments); |
|
}); |
|
var dynCall_diiii = (Module["dynCall_diiii"] = function () { |
|
return Module["asm"]["dynCall_diiii"].apply(null, arguments); |
|
}); |
|
var dynCall_dji = (Module["dynCall_dji"] = function () { |
|
return Module["asm"]["dynCall_dji"].apply(null, arguments); |
|
}); |
|
var dynCall_fdi = (Module["dynCall_fdi"] = function () { |
|
return Module["asm"]["dynCall_fdi"].apply(null, arguments); |
|
}); |
|
var dynCall_ff = (Module["dynCall_ff"] = function () { |
|
return Module["asm"]["dynCall_ff"].apply(null, arguments); |
|
}); |
|
var dynCall_fff = (Module["dynCall_fff"] = function () { |
|
return Module["asm"]["dynCall_fff"].apply(null, arguments); |
|
}); |
|
var dynCall_fffi = (Module["dynCall_fffi"] = function () { |
|
return Module["asm"]["dynCall_fffi"].apply(null, arguments); |
|
}); |
|
var dynCall_ffi = (Module["dynCall_ffi"] = function () { |
|
return Module["asm"]["dynCall_ffi"].apply(null, arguments); |
|
}); |
|
var dynCall_fi = (Module["dynCall_fi"] = function () { |
|
return Module["asm"]["dynCall_fi"].apply(null, arguments); |
|
}); |
|
var dynCall_fif = (Module["dynCall_fif"] = function () { |
|
return Module["asm"]["dynCall_fif"].apply(null, arguments); |
|
}); |
|
var dynCall_fiffi = (Module["dynCall_fiffi"] = function () { |
|
return Module["asm"]["dynCall_fiffi"].apply(null, arguments); |
|
}); |
|
var dynCall_fifi = (Module["dynCall_fifi"] = function () { |
|
return Module["asm"]["dynCall_fifi"].apply(null, arguments); |
|
}); |
|
var dynCall_fii = (Module["dynCall_fii"] = function () { |
|
return Module["asm"]["dynCall_fii"].apply(null, arguments); |
|
}); |
|
var dynCall_fiii = (Module["dynCall_fiii"] = function () { |
|
return Module["asm"]["dynCall_fiii"].apply(null, arguments); |
|
}); |
|
var dynCall_fiiii = (Module["dynCall_fiiii"] = function () { |
|
return Module["asm"]["dynCall_fiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_fji = (Module["dynCall_fji"] = function () { |
|
return Module["asm"]["dynCall_fji"].apply(null, arguments); |
|
}); |
|
var dynCall_i = (Module["dynCall_i"] = function () { |
|
return Module["asm"]["dynCall_i"].apply(null, arguments); |
|
}); |
|
var dynCall_idi = (Module["dynCall_idi"] = function () { |
|
return Module["asm"]["dynCall_idi"].apply(null, arguments); |
|
}); |
|
var dynCall_idiii = (Module["dynCall_idiii"] = function () { |
|
return Module["asm"]["dynCall_idiii"].apply(null, arguments); |
|
}); |
|
var dynCall_ifi = (Module["dynCall_ifi"] = function () { |
|
return Module["asm"]["dynCall_ifi"].apply(null, arguments); |
|
}); |
|
var dynCall_ifiii = (Module["dynCall_ifiii"] = function () { |
|
return Module["asm"]["dynCall_ifiii"].apply(null, arguments); |
|
}); |
|
var dynCall_ii = (Module["dynCall_ii"] = function () { |
|
return Module["asm"]["dynCall_ii"].apply(null, arguments); |
|
}); |
|
var dynCall_iidi = (Module["dynCall_iidi"] = function () { |
|
return Module["asm"]["dynCall_iidi"].apply(null, arguments); |
|
}); |
|
var dynCall_iidii = (Module["dynCall_iidii"] = function () { |
|
return Module["asm"]["dynCall_iidii"].apply(null, arguments); |
|
}); |
|
var dynCall_iif = (Module["dynCall_iif"] = function () { |
|
return Module["asm"]["dynCall_iif"].apply(null, arguments); |
|
}); |
|
var dynCall_iifi = (Module["dynCall_iifi"] = function () { |
|
return Module["asm"]["dynCall_iifi"].apply(null, arguments); |
|
}); |
|
var dynCall_iifii = (Module["dynCall_iifii"] = function () { |
|
return Module["asm"]["dynCall_iifii"].apply(null, arguments); |
|
}); |
|
var dynCall_iifiii = (Module["dynCall_iifiii"] = function () { |
|
return Module["asm"]["dynCall_iifiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iii = (Module["dynCall_iii"] = function () { |
|
return Module["asm"]["dynCall_iii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiif = (Module["dynCall_iiif"] = function () { |
|
return Module["asm"]["dynCall_iiif"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiff = (Module["dynCall_iiiff"] = function () { |
|
return Module["asm"]["dynCall_iiiff"].apply(null, arguments); |
|
}); |
|
var dynCall_iiii = (Module["dynCall_iiii"] = function () { |
|
return Module["asm"]["dynCall_iiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiifii = (Module["dynCall_iiiifii"] = function () { |
|
return Module["asm"]["dynCall_iiiifii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiifiii = (Module["dynCall_iiiifiii"] = function () { |
|
return Module["asm"]["dynCall_iiiifiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiii = (Module["dynCall_iiiii"] = function () { |
|
return Module["asm"]["dynCall_iiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiiii = (Module["dynCall_iiiiii"] = function () { |
|
return Module["asm"]["dynCall_iiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiiiii = (Module["dynCall_iiiiiii"] = function () { |
|
return Module["asm"]["dynCall_iiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiiiiii = (Module["dynCall_iiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_iiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiiiiiii = (Module["dynCall_iiiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_iiiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiiiiiiii = (Module["dynCall_iiiiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_iiiiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiiiiiiiii = (Module["dynCall_iiiiiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_iiiiiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiiiiiiiiii = (Module["dynCall_iiiiiiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_iiiiiiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiiiiiiiiiii = (Module["dynCall_iiiiiiiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_iiiiiiiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiiiiiiiiiiii = (Module["dynCall_iiiiiiiiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_iiiiiiiiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiiiji = (Module["dynCall_iiiiiji"] = function () { |
|
return Module["asm"]["dynCall_iiiiiji"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiij = (Module["dynCall_iiiij"] = function () { |
|
return Module["asm"]["dynCall_iiiij"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiiji = (Module["dynCall_iiiiji"] = function () { |
|
return Module["asm"]["dynCall_iiiiji"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiijii = (Module["dynCall_iiiijii"] = function () { |
|
return Module["asm"]["dynCall_iiiijii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiijiii = (Module["dynCall_iiiijiii"] = function () { |
|
return Module["asm"]["dynCall_iiiijiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiij = (Module["dynCall_iiij"] = function () { |
|
return Module["asm"]["dynCall_iiij"].apply(null, arguments); |
|
}); |
|
var dynCall_iiiji = (Module["dynCall_iiiji"] = function () { |
|
return Module["asm"]["dynCall_iiiji"].apply(null, arguments); |
|
}); |
|
var dynCall_iiijii = (Module["dynCall_iiijii"] = function () { |
|
return Module["asm"]["dynCall_iiijii"].apply(null, arguments); |
|
}); |
|
var dynCall_iiijiii = (Module["dynCall_iiijiii"] = function () { |
|
return Module["asm"]["dynCall_iiijiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iij = (Module["dynCall_iij"] = function () { |
|
return Module["asm"]["dynCall_iij"].apply(null, arguments); |
|
}); |
|
var dynCall_iiji = (Module["dynCall_iiji"] = function () { |
|
return Module["asm"]["dynCall_iiji"].apply(null, arguments); |
|
}); |
|
var dynCall_iijii = (Module["dynCall_iijii"] = function () { |
|
return Module["asm"]["dynCall_iijii"].apply(null, arguments); |
|
}); |
|
var dynCall_iijiii = (Module["dynCall_iijiii"] = function () { |
|
return Module["asm"]["dynCall_iijiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iijji = (Module["dynCall_iijji"] = function () { |
|
return Module["asm"]["dynCall_iijji"].apply(null, arguments); |
|
}); |
|
var dynCall_iijjii = (Module["dynCall_iijjii"] = function () { |
|
return Module["asm"]["dynCall_iijjii"].apply(null, arguments); |
|
}); |
|
var dynCall_iijjiii = (Module["dynCall_iijjiii"] = function () { |
|
return Module["asm"]["dynCall_iijjiii"].apply(null, arguments); |
|
}); |
|
var dynCall_iijjji = (Module["dynCall_iijjji"] = function () { |
|
return Module["asm"]["dynCall_iijjji"].apply(null, arguments); |
|
}); |
|
var dynCall_ij = (Module["dynCall_ij"] = function () { |
|
return Module["asm"]["dynCall_ij"].apply(null, arguments); |
|
}); |
|
var dynCall_iji = (Module["dynCall_iji"] = function () { |
|
return Module["asm"]["dynCall_iji"].apply(null, arguments); |
|
}); |
|
var dynCall_ijiii = (Module["dynCall_ijiii"] = function () { |
|
return Module["asm"]["dynCall_ijiii"].apply(null, arguments); |
|
}); |
|
var dynCall_ijj = (Module["dynCall_ijj"] = function () { |
|
return Module["asm"]["dynCall_ijj"].apply(null, arguments); |
|
}); |
|
var dynCall_ijji = (Module["dynCall_ijji"] = function () { |
|
return Module["asm"]["dynCall_ijji"].apply(null, arguments); |
|
}); |
|
var dynCall_j = (Module["dynCall_j"] = function () { |
|
return Module["asm"]["dynCall_j"].apply(null, arguments); |
|
}); |
|
var dynCall_jdi = (Module["dynCall_jdi"] = function () { |
|
return Module["asm"]["dynCall_jdi"].apply(null, arguments); |
|
}); |
|
var dynCall_jdii = (Module["dynCall_jdii"] = function () { |
|
return Module["asm"]["dynCall_jdii"].apply(null, arguments); |
|
}); |
|
var dynCall_jfi = (Module["dynCall_jfi"] = function () { |
|
return Module["asm"]["dynCall_jfi"].apply(null, arguments); |
|
}); |
|
var dynCall_ji = (Module["dynCall_ji"] = function () { |
|
return Module["asm"]["dynCall_ji"].apply(null, arguments); |
|
}); |
|
var dynCall_jidi = (Module["dynCall_jidi"] = function () { |
|
return Module["asm"]["dynCall_jidi"].apply(null, arguments); |
|
}); |
|
var dynCall_jidii = (Module["dynCall_jidii"] = function () { |
|
return Module["asm"]["dynCall_jidii"].apply(null, arguments); |
|
}); |
|
var dynCall_jii = (Module["dynCall_jii"] = function () { |
|
return Module["asm"]["dynCall_jii"].apply(null, arguments); |
|
}); |
|
var dynCall_jiii = (Module["dynCall_jiii"] = function () { |
|
return Module["asm"]["dynCall_jiii"].apply(null, arguments); |
|
}); |
|
var dynCall_jiiii = (Module["dynCall_jiiii"] = function () { |
|
return Module["asm"]["dynCall_jiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_jiiiii = (Module["dynCall_jiiiii"] = function () { |
|
return Module["asm"]["dynCall_jiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_jiiiiii = (Module["dynCall_jiiiiii"] = function () { |
|
return Module["asm"]["dynCall_jiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_jiiiiiiiiii = (Module["dynCall_jiiiiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_jiiiiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_jiiji = (Module["dynCall_jiiji"] = function () { |
|
return Module["asm"]["dynCall_jiiji"].apply(null, arguments); |
|
}); |
|
var dynCall_jiji = (Module["dynCall_jiji"] = function () { |
|
return Module["asm"]["dynCall_jiji"].apply(null, arguments); |
|
}); |
|
var dynCall_jijii = (Module["dynCall_jijii"] = function () { |
|
return Module["asm"]["dynCall_jijii"].apply(null, arguments); |
|
}); |
|
var dynCall_jijiii = (Module["dynCall_jijiii"] = function () { |
|
return Module["asm"]["dynCall_jijiii"].apply(null, arguments); |
|
}); |
|
var dynCall_jijj = (Module["dynCall_jijj"] = function () { |
|
return Module["asm"]["dynCall_jijj"].apply(null, arguments); |
|
}); |
|
var dynCall_jijji = (Module["dynCall_jijji"] = function () { |
|
return Module["asm"]["dynCall_jijji"].apply(null, arguments); |
|
}); |
|
var dynCall_jji = (Module["dynCall_jji"] = function () { |
|
return Module["asm"]["dynCall_jji"].apply(null, arguments); |
|
}); |
|
var dynCall_v = (Module["dynCall_v"] = function () { |
|
return Module["asm"]["dynCall_v"].apply(null, arguments); |
|
}); |
|
var dynCall_vd = (Module["dynCall_vd"] = function () { |
|
return Module["asm"]["dynCall_vd"].apply(null, arguments); |
|
}); |
|
var dynCall_vf = (Module["dynCall_vf"] = function () { |
|
return Module["asm"]["dynCall_vf"].apply(null, arguments); |
|
}); |
|
var dynCall_vff = (Module["dynCall_vff"] = function () { |
|
return Module["asm"]["dynCall_vff"].apply(null, arguments); |
|
}); |
|
var dynCall_vffff = (Module["dynCall_vffff"] = function () { |
|
return Module["asm"]["dynCall_vffff"].apply(null, arguments); |
|
}); |
|
var dynCall_vfi = (Module["dynCall_vfi"] = function () { |
|
return Module["asm"]["dynCall_vfi"].apply(null, arguments); |
|
}); |
|
var dynCall_vi = (Module["dynCall_vi"] = function () { |
|
return Module["asm"]["dynCall_vi"].apply(null, arguments); |
|
}); |
|
var dynCall_vid = (Module["dynCall_vid"] = function () { |
|
return Module["asm"]["dynCall_vid"].apply(null, arguments); |
|
}); |
|
var dynCall_vidi = (Module["dynCall_vidi"] = function () { |
|
return Module["asm"]["dynCall_vidi"].apply(null, arguments); |
|
}); |
|
var dynCall_vif = (Module["dynCall_vif"] = function () { |
|
return Module["asm"]["dynCall_vif"].apply(null, arguments); |
|
}); |
|
var dynCall_viff = (Module["dynCall_viff"] = function () { |
|
return Module["asm"]["dynCall_viff"].apply(null, arguments); |
|
}); |
|
var dynCall_vifff = (Module["dynCall_vifff"] = function () { |
|
return Module["asm"]["dynCall_vifff"].apply(null, arguments); |
|
}); |
|
var dynCall_viffff = (Module["dynCall_viffff"] = function () { |
|
return Module["asm"]["dynCall_viffff"].apply(null, arguments); |
|
}); |
|
var dynCall_viffffi = (Module["dynCall_viffffi"] = function () { |
|
return Module["asm"]["dynCall_viffffi"].apply(null, arguments); |
|
}); |
|
var dynCall_vifffi = (Module["dynCall_vifffi"] = function () { |
|
return Module["asm"]["dynCall_vifffi"].apply(null, arguments); |
|
}); |
|
var dynCall_viffi = (Module["dynCall_viffi"] = function () { |
|
return Module["asm"]["dynCall_viffi"].apply(null, arguments); |
|
}); |
|
var dynCall_viffii = (Module["dynCall_viffii"] = function () { |
|
return Module["asm"]["dynCall_viffii"].apply(null, arguments); |
|
}); |
|
var dynCall_vifi = (Module["dynCall_vifi"] = function () { |
|
return Module["asm"]["dynCall_vifi"].apply(null, arguments); |
|
}); |
|
var dynCall_vii = (Module["dynCall_vii"] = function () { |
|
return Module["asm"]["dynCall_vii"].apply(null, arguments); |
|
}); |
|
var dynCall_viid = (Module["dynCall_viid"] = function () { |
|
return Module["asm"]["dynCall_viid"].apply(null, arguments); |
|
}); |
|
var dynCall_viidi = (Module["dynCall_viidi"] = function () { |
|
return Module["asm"]["dynCall_viidi"].apply(null, arguments); |
|
}); |
|
var dynCall_viidii = (Module["dynCall_viidii"] = function () { |
|
return Module["asm"]["dynCall_viidii"].apply(null, arguments); |
|
}); |
|
var dynCall_viif = (Module["dynCall_viif"] = function () { |
|
return Module["asm"]["dynCall_viif"].apply(null, arguments); |
|
}); |
|
var dynCall_viiff = (Module["dynCall_viiff"] = function () { |
|
return Module["asm"]["dynCall_viiff"].apply(null, arguments); |
|
}); |
|
var dynCall_viifff = (Module["dynCall_viifff"] = function () { |
|
return Module["asm"]["dynCall_viifff"].apply(null, arguments); |
|
}); |
|
var dynCall_viiffi = (Module["dynCall_viiffi"] = function () { |
|
return Module["asm"]["dynCall_viiffi"].apply(null, arguments); |
|
}); |
|
var dynCall_viifi = (Module["dynCall_viifi"] = function () { |
|
return Module["asm"]["dynCall_viifi"].apply(null, arguments); |
|
}); |
|
var dynCall_viifii = (Module["dynCall_viifii"] = function () { |
|
return Module["asm"]["dynCall_viifii"].apply(null, arguments); |
|
}); |
|
var dynCall_viifiii = (Module["dynCall_viifiii"] = function () { |
|
return Module["asm"]["dynCall_viifiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viii = (Module["dynCall_viii"] = function () { |
|
return Module["asm"]["dynCall_viii"].apply(null, arguments); |
|
}); |
|
var dynCall_viiidi = (Module["dynCall_viiidi"] = function () { |
|
return Module["asm"]["dynCall_viiidi"].apply(null, arguments); |
|
}); |
|
var dynCall_viiifi = (Module["dynCall_viiifi"] = function () { |
|
return Module["asm"]["dynCall_viiifi"].apply(null, arguments); |
|
}); |
|
var dynCall_viiii = (Module["dynCall_viiii"] = function () { |
|
return Module["asm"]["dynCall_viiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiii = (Module["dynCall_viiiii"] = function () { |
|
return Module["asm"]["dynCall_viiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiiif = (Module["dynCall_viiiiif"] = function () { |
|
return Module["asm"]["dynCall_viiiiif"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiiifi = (Module["dynCall_viiiiifi"] = function () { |
|
return Module["asm"]["dynCall_viiiiifi"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiiii = (Module["dynCall_viiiiii"] = function () { |
|
return Module["asm"]["dynCall_viiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiiiif = (Module["dynCall_viiiiiif"] = function () { |
|
return Module["asm"]["dynCall_viiiiiif"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiiiii = (Module["dynCall_viiiiiii"] = function () { |
|
return Module["asm"]["dynCall_viiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiiiiifi = (Module["dynCall_viiiiiiifi"] = function () { |
|
return Module["asm"]["dynCall_viiiiiiifi"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiiiiii = (Module["dynCall_viiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_viiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiiiiiii = (Module["dynCall_viiiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_viiiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiiiiiiii = (Module["dynCall_viiiiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_viiiiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiiiiiiiii = (Module["dynCall_viiiiiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_viiiiiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiiiiiiiiii = (Module["dynCall_viiiiiiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_viiiiiiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiiiiiiiiiiii = (Module["dynCall_viiiiiiiiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_viiiiiiiiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiiiiiiiiiiiii = (Module["dynCall_viiiiiiiiiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_viiiiiiiiiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiiiiiiiiiiiiiiii = (Module["dynCall_viiiiiiiiiiiiiiiiii"] = function () { |
|
return Module["asm"]["dynCall_viiiiiiiiiiiiiiiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiijiiii = (Module["dynCall_viiiijiiii"] = function () { |
|
return Module["asm"]["dynCall_viiiijiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viiiji = (Module["dynCall_viiiji"] = function () { |
|
return Module["asm"]["dynCall_viiiji"].apply(null, arguments); |
|
}); |
|
var dynCall_viiijji = (Module["dynCall_viiijji"] = function () { |
|
return Module["asm"]["dynCall_viiijji"].apply(null, arguments); |
|
}); |
|
var dynCall_viij = (Module["dynCall_viij"] = function () { |
|
return Module["asm"]["dynCall_viij"].apply(null, arguments); |
|
}); |
|
var dynCall_viiji = (Module["dynCall_viiji"] = function () { |
|
return Module["asm"]["dynCall_viiji"].apply(null, arguments); |
|
}); |
|
var dynCall_viijii = (Module["dynCall_viijii"] = function () { |
|
return Module["asm"]["dynCall_viijii"].apply(null, arguments); |
|
}); |
|
var dynCall_viijiijiii = (Module["dynCall_viijiijiii"] = function () { |
|
return Module["asm"]["dynCall_viijiijiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viijijii = (Module["dynCall_viijijii"] = function () { |
|
return Module["asm"]["dynCall_viijijii"].apply(null, arguments); |
|
}); |
|
var dynCall_viijijiii = (Module["dynCall_viijijiii"] = function () { |
|
return Module["asm"]["dynCall_viijijiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viijj = (Module["dynCall_viijj"] = function () { |
|
return Module["asm"]["dynCall_viijj"].apply(null, arguments); |
|
}); |
|
var dynCall_viijji = (Module["dynCall_viijji"] = function () { |
|
return Module["asm"]["dynCall_viijji"].apply(null, arguments); |
|
}); |
|
var dynCall_viijjiii = (Module["dynCall_viijjiii"] = function () { |
|
return Module["asm"]["dynCall_viijjiii"].apply(null, arguments); |
|
}); |
|
var dynCall_viijjji = (Module["dynCall_viijjji"] = function () { |
|
return Module["asm"]["dynCall_viijjji"].apply(null, arguments); |
|
}); |
|
var dynCall_vij = (Module["dynCall_vij"] = function () { |
|
return Module["asm"]["dynCall_vij"].apply(null, arguments); |
|
}); |
|
var dynCall_viji = (Module["dynCall_viji"] = function () { |
|
return Module["asm"]["dynCall_viji"].apply(null, arguments); |
|
}); |
|
var dynCall_vijii = (Module["dynCall_vijii"] = function () { |
|
return Module["asm"]["dynCall_vijii"].apply(null, arguments); |
|
}); |
|
var dynCall_vijiii = (Module["dynCall_vijiii"] = function () { |
|
return Module["asm"]["dynCall_vijiii"].apply(null, arguments); |
|
}); |
|
var dynCall_vijiji = (Module["dynCall_vijiji"] = function () { |
|
return Module["asm"]["dynCall_vijiji"].apply(null, arguments); |
|
}); |
|
var dynCall_vijijji = (Module["dynCall_vijijji"] = function () { |
|
return Module["asm"]["dynCall_vijijji"].apply(null, arguments); |
|
}); |
|
var dynCall_vijji = (Module["dynCall_vijji"] = function () { |
|
return Module["asm"]["dynCall_vijji"].apply(null, arguments); |
|
}); |
|
var dynCall_vijjii = (Module["dynCall_vijjii"] = function () { |
|
return Module["asm"]["dynCall_vijjii"].apply(null, arguments); |
|
}); |
|
var dynCall_vjiiii = (Module["dynCall_vjiiii"] = function () { |
|
return Module["asm"]["dynCall_vjiiii"].apply(null, arguments); |
|
}); |
|
var dynCall_vjji = (Module["dynCall_vjji"] = function () { |
|
return Module["asm"]["dynCall_vjji"].apply(null, arguments); |
|
}); |
|
Module["asm"] = asm; |
|
Module["ccall"] = ccall; |
|
Module["cwrap"] = cwrap; |
|
Module["stackTrace"] = stackTrace; |
|
Module["addRunDependency"] = addRunDependency; |
|
Module["removeRunDependency"] = removeRunDependency; |
|
Module["FS_createPath"] = FS.createPath; |
|
Module["FS_createDataFile"] = FS.createDataFile; |
|
function ExitStatus(status) { |
|
this.name = "ExitStatus"; |
|
this.message = "Program terminated with exit(" + status + ")"; |
|
this.status = status; |
|
} |
|
ExitStatus.prototype = new Error(); |
|
ExitStatus.prototype.constructor = ExitStatus; |
|
var initialStackTop; |
|
var calledMain = false; |
|
dependenciesFulfilled = function runCaller() { |
|
if (!Module["calledRun"]) run(); |
|
if (!Module["calledRun"]) dependenciesFulfilled = runCaller; |
|
}; |
|
Module["callMain"] = function callMain(args) { |
|
args = args || []; |
|
ensureInitRuntime(); |
|
var argc = args.length + 1; |
|
var argv = stackAlloc((argc + 1) * 4); |
|
HEAP32[argv >> 2] = allocateUTF8OnStack(Module["thisProgram"]); |
|
for (var i = 1; i < argc; i++) { |
|
HEAP32[(argv >> 2) + i] = allocateUTF8OnStack(args[i - 1]); |
|
} |
|
HEAP32[(argv >> 2) + argc] = 0; |
|
try { |
|
var ret = Module["_main"](argc, argv, 0); |
|
exit(ret, true); |
|
} catch (e) { |
|
if (e instanceof ExitStatus) { |
|
return; |
|
} else if (e == "SimulateInfiniteLoop") { |
|
Module["noExitRuntime"] = true; |
|
return; |
|
} else { |
|
var toLog = e; |
|
if (e && typeof e === "object" && e.stack) { |
|
toLog = [e, e.stack]; |
|
} |
|
err("exception thrown: " + toLog); |
|
Module["quit"](1, e); |
|
} |
|
} finally { |
|
calledMain = true; |
|
} |
|
}; |
|
function run(args) { |
|
args = args || Module["arguments"]; |
|
if (runDependencies > 0) { |
|
return; |
|
} |
|
preRun(); |
|
if (runDependencies > 0) return; |
|
if (Module["calledRun"]) return; |
|
function doRun() { |
|
if (Module["calledRun"]) return; |
|
Module["calledRun"] = true; |
|
if (ABORT) return; |
|
ensureInitRuntime(); |
|
preMain(); |
|
if (Module["onRuntimeInitialized"]) Module["onRuntimeInitialized"](); |
|
if (Module["_main"] && shouldRunNow) Module["callMain"](args); |
|
postRun(); |
|
} |
|
if (Module["setStatus"]) { |
|
Module["setStatus"]("Running..."); |
|
setTimeout(function () { |
|
setTimeout(function () { |
|
Module["setStatus"](""); |
|
}, 1); |
|
doRun(); |
|
}, 1); |
|
} else { |
|
doRun(); |
|
} |
|
} |
|
Module["run"] = run; |
|
function exit(status, implicit) { |
|
if (implicit && Module["noExitRuntime"] && status === 0) { |
|
return; |
|
} |
|
if (Module["noExitRuntime"]) { |
|
} else { |
|
ABORT = true; |
|
EXITSTATUS = status; |
|
STACKTOP = initialStackTop; |
|
exitRuntime(); |
|
if (Module["onExit"]) Module["onExit"](status); |
|
} |
|
Module["quit"](status, new ExitStatus(status)); |
|
} |
|
function abort(what) { |
|
if (Module["onAbort"]) { |
|
Module["onAbort"](what); |
|
} |
|
if (what !== undefined) { |
|
out(what); |
|
err(what); |
|
what = JSON.stringify(what); |
|
} else { |
|
what = ""; |
|
} |
|
ABORT = true; |
|
EXITSTATUS = 1; |
|
throw "abort(" + what + "). Build with -s ASSERTIONS=1 for more info."; |
|
} |
|
Module["abort"] = abort; |
|
if (Module["preInit"]) { |
|
if (typeof Module["preInit"] == "function") Module["preInit"] = [Module["preInit"]]; |
|
while (Module["preInit"].length > 0) { |
|
Module["preInit"].pop()(); |
|
} |
|
} |
|
var shouldRunNow = true; |
|
if (Module["noInitialRun"]) { |
|
shouldRunNow = false; |
|
} |
|
Module["noExitRuntime"] = true; |
|
run(); |
|
} |
Thanks a lot for sharing. Very interesting.