game.js

// The Module object: Our interface to the outside world. We import
// and export values on it, and do the work to get that through
// closure compiler if necessary. There are various ways Module can be used:
// 1. Not defined. We create it here
// 2. A function parameter, function(Module) { ..generated code.. }
// 3. pre-run appended it, var Module = {}; ..generated code..
// 4. External script tag defines var Module.
// We need to do an eval in order to handle the closure compiler
// case, where this code here is minified but Module was defined
// elsewhere (e.g. case 4 above). We also need to check if Module
// already exists (e.g. case 3 above).
// Note that if you want to run closure, and also to use Module
// after the generated code, you will need to define   var Module = {};
// before the code. Then that object will be used in the code, and you
// can continue to use Module afterwards as well.
var Module;
if (!Module) Module = (typeof Module !== 'undefined' ? Module : null) || {};

// Sometimes an existing Module object exists with properties
// meant to overwrite the default module functionality. Here
// we collect those properties and reapply _after_ we configure
// the current environment's defaults to avoid having to be so
// defensive during initialization.
var moduleOverrides = {};
for (var key in Module) {
  if (Module.hasOwnProperty(key)) {
    moduleOverrides[key] = Module[key];
  }
}

// The environment setup code below is customized to use Module.
// *** Environment setup code ***
var ENVIRONMENT_IS_WEB = false;
var ENVIRONMENT_IS_WORKER = false;
var ENVIRONMENT_IS_NODE = false;
var ENVIRONMENT_IS_SHELL = false;

// Three configurations we can be running in:
// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false)
// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false)
// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true)

if (Module['ENVIRONMENT']) {
  if (Module['ENVIRONMENT'] === 'WEB') {
    ENVIRONMENT_IS_WEB = true;
  } else if (Module['ENVIRONMENT'] === 'WORKER') {
    ENVIRONMENT_IS_WORKER = true;
  } else if (Module['ENVIRONMENT'] === 'NODE') {
    ENVIRONMENT_IS_NODE = true;
  } else if (Module['ENVIRONMENT'] === 'SHELL') {
    ENVIRONMENT_IS_SHELL = true;
  } else {
    throw new Error('The provided Module[\'ENVIRONMENT\'] value is not valid. It must be one of: WEB|WORKER|NODE|SHELL.');
  }
} else {
  ENVIRONMENT_IS_WEB = typeof window === 'object';
  ENVIRONMENT_IS_WORKER = typeof importScripts === 'function';
  ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
  ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
}


if (ENVIRONMENT_IS_NODE) {
  // Expose functionality in the same simple way that the shells work
  // Note that we pollute the global namespace here, otherwise we break in node
  if (!Module['print']) Module['print'] = console.log;
  if (!Module['printErr']) Module['printErr'] = console.warn;

  var nodeFS;
  var nodePath;

  Module['read'] = function read(filename, binary) {
    if (!nodeFS) nodeFS = require('fs');
    if (!nodePath) nodePath = require('path');
    filename = nodePath['normalize'](filename);
    var ret = nodeFS['readFileSync'](filename);
    return binary ? ret : ret.toString();
  };

  Module['readBinary'] = function readBinary(filename) {
    var ret = Module['read'](filename, true);
    if (!ret.buffer) {
      ret = new Uint8Array(ret);
    }
    assert(ret.buffer);
    return ret;
  };

  Module['load'] = function load(f) {
    globalEval(read(f));
  };

  if (!Module['thisProgram']) {
    if (process['argv'].length > 1) {
      Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/');
    } else {
      Module['thisProgram'] = 'unknown-program';
    }
  }

  Module['arguments'] = process['argv'].slice(2);

  if (typeof module !== 'undefined') {
    module['exports'] = Module;
  }

  process['on']('uncaughtException', function(ex) {
    // suppress ExitStatus exceptions from showing an error
    if (!(ex instanceof ExitStatus)) {
      throw ex;
    }
  });

  Module['inspect'] = function () { return '[Emscripten Module object]'; };
}
else if (ENVIRONMENT_IS_SHELL) {
  if (!Module['print']) Module['print'] = print;
  if (typeof printErr != 'undefined') Module['printErr'] = printErr; // not present in v8 or older sm

  if (typeof read != 'undefined') {
    Module['read'] = read;
  } else {
    Module['read'] = function read() { throw 'no read() available' };
  }

  Module['readBinary'] = function readBinary(f) {
    if (typeof readbuffer === 'function') {
      return new Uint8Array(readbuffer(f));
    }
    var data = read(f, 'binary');
    assert(typeof data === 'object');
    return data;
  };

  if (typeof scriptArgs != 'undefined') {
    Module['arguments'] = scriptArgs;
  } else if (typeof arguments != 'undefined') {
    Module['arguments'] = arguments;
  }

  if (typeof quit === 'function') {
    Module['quit'] = function(status, toThrow) {
      quit(status);
    }
  }

}
else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
  Module['read'] = function read(url) {
    var xhr = new XMLHttpRequest();
    xhr.open('GET', url, false);
    xhr.send(null);
    return xhr.responseText;
  };

  if (ENVIRONMENT_IS_WORKER) {
    Module['readBinary'] = function read(url) {
      var xhr = new XMLHttpRequest();
      xhr.open('GET', url, false);
      xhr.responseType = 'arraybuffer';
      xhr.send(null);
      return xhr.response;
    };
  }

  Module['readAsync'] = function readAsync(url, onload, onerror) {
    var xhr = new XMLHttpRequest();
    xhr.open('GET', url, true);
    xhr.responseType = 'arraybuffer';
    xhr.onload = function xhr_onload() {
      if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
        onload(xhr.response);
      } else {
        onerror();
      }
    };
    xhr.onerror = onerror;
    xhr.send(null);
  };

  if (typeof arguments != 'undefined') {
    Module['arguments'] = arguments;
  }

  if (typeof console !== 'undefined') {
    if (!Module['print']) Module['print'] = function print(x) {
      console.log(x);
    };
    if (!Module['printErr']) Module['printErr'] = function printErr(x) {
      console.warn(x);
    };
  } else {
    // Probably a worker, and without console.log. We can do very little here...
    var TRY_USE_DUMP = false;
    if (!Module['print']) Module['print'] = (TRY_USE_DUMP && (typeof(dump) !== "undefined") ? (function(x) {
      dump(x);
    }) : (function(x) {
      // self.postMessage(x); // enable this if you want stdout to be sent as messages
    }));
  }

  if (ENVIRONMENT_IS_WORKER) {
    Module['load'] = importScripts;
  }

  if (typeof Module['setWindowTitle'] === 'undefined') {
    Module['setWindowTitle'] = function(title) { document.title = title };
  }
}
else {
  // Unreachable because SHELL is dependant on the others
  throw 'Unknown runtime environment. Where are we?';
}

function globalEval(x) {
  eval.call(null, x);
}
if (!Module['load'] && Module['read']) {
  Module['load'] = function load(f) {
    globalEval(Module['read'](f));
  };
}
if (!Module['print']) {
  Module['print'] = function(){};
}
if (!Module['printErr']) {
  Module['printErr'] = Module['print'];
}
if (!Module['arguments']) {
  Module['arguments'] = [];
}
if (!Module['thisProgram']) {
  Module['thisProgram'] = './this.program';
}
if (!Module['quit']) {
  Module['quit'] = function(status, toThrow) {
    throw toThrow;
  }
}

// *** Environment setup code ***

// Closure helpers
Module.print = Module['print'];
Module.printErr = Module['printErr'];

// Callbacks
Module['preRun'] = [];
Module['postRun'] = [];

// Merge back in the overrides
for (var key in moduleOverrides) {
  if (moduleOverrides.hasOwnProperty(key)) {
    Module[key] = moduleOverrides[key];
  }
}
// Free the object hierarchy contained in the overrides, this lets the GC
// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
moduleOverrides = undefined;



// {{PREAMBLE_ADDITIONS}}

// === Preamble library stuff ===

// Documentation for the public APIs defined in this file must be updated in:
//    site/source/docs/api_reference/preamble.js.rst
// A prebuilt local version of the documentation is available at:
//    site/build/text/docs/api_reference/preamble.js.txt
// You can also build docs locally as HTML or other formats in site/
// An online HTML version (which may be of a different version of Emscripten)
//    is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html

//========================================
// Runtime code shared with compiler
//========================================

var Runtime = {
  setTempRet0: function (value) {
    tempRet0 = value;
    return value;
  },
  getTempRet0: function () {
    return tempRet0;
  },
  stackSave: function () {
    return STACKTOP;
  },
  stackRestore: function (stackTop) {
    STACKTOP = stackTop;
  },
  getNativeTypeSize: function (type) {
    switch (type) {
      case 'i1': case 'i8': return 1;
      case 'i16': return 2;
      case 'i32': return 4;
      case 'i64': return 8;
      case 'float': return 4;
      case 'double': return 8;
      default: {
        if (type[type.length-1] === '*') {
          return Runtime.QUANTUM_SIZE; // A pointer
        } else if (type[0] === 'i') {
          var bits = parseInt(type.substr(1));
          assert(bits % 8 === 0);
          return bits/8;
        } else {
          return 0;
        }
      }
    }
  },
  getNativeFieldSize: function (type) {
    return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE);
  },
  STACK_ALIGN: 16,
  prepVararg: function (ptr, type) {
    if (type === 'double' || type === 'i64') {
      // move so the load is aligned
      if (ptr & 7) {
        assert((ptr & 7) === 4);
        ptr += 4;
      }
    } else {
      assert((ptr & 3) === 0);
    }
    return ptr;
  },
  getAlignSize: function (type, size, vararg) {
    // we align i64s and doubles on 64-bit boundaries, unlike x86
    if (!vararg && (type == 'i64' || type == 'double')) return 8;
    if (!type) return Math.min(size, 8); // align structures internally to 64 bits
    return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE);
  },
  dynCall: function (sig, ptr, args) {
    if (args && args.length) {
      return Module['dynCall_' + sig].apply(null, [ptr].concat(args));
    } else {
      return Module['dynCall_' + sig].call(null, ptr);
    }
  },
  functionPointers: [],
  addFunction: function (func) {
    for (var i = 0; i < Runtime.functionPointers.length; i++) {
      if (!Runtime.functionPointers[i]) {
        Runtime.functionPointers[i] = func;
        return 2*(1 + i);
      }
    }
    throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.';
  },
  removeFunction: function (index) {
    Runtime.functionPointers[(index-2)/2] = null;
  },
  warnOnce: function (text) {
    if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {};
    if (!Runtime.warnOnce.shown[text]) {
      Runtime.warnOnce.shown[text] = 1;
      Module.printErr(text);
    }
  },
  funcWrappers: {},
  getFuncWrapper: function (func, sig) {
    assert(sig);
    if (!Runtime.funcWrappers[sig]) {
      Runtime.funcWrappers[sig] = {};
    }
    var sigCache = Runtime.funcWrappers[sig];
    if (!sigCache[func]) {
      // optimize away arguments usage in common cases
      if (sig.length === 1) {
        sigCache[func] = function dynCall_wrapper() {
          return Runtime.dynCall(sig, func);
        };
      } else if (sig.length === 2) {
        sigCache[func] = function dynCall_wrapper(arg) {
          return Runtime.dynCall(sig, func, [arg]);
        };
      } else {
        // general case
        sigCache[func] = function dynCall_wrapper() {
          return Runtime.dynCall(sig, func, Array.prototype.slice.call(arguments));
        };
      }
    }
    return sigCache[func];
  },
  getCompilerSetting: function (name) {
    throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work';
  },
  stackAlloc: function (size) { var ret = STACKTOP;STACKTOP = (STACKTOP + size)|0;STACKTOP = (((STACKTOP)+15)&-16); return ret; },
  staticAlloc: function (size) { var ret = STATICTOP;STATICTOP = (STATICTOP + size)|0;STATICTOP = (((STATICTOP)+15)&-16); return ret; },
  dynamicAlloc: function (size) { var ret = HEAP32[DYNAMICTOP_PTR>>2];var end = (((ret + size + 15)|0) & -16);HEAP32[DYNAMICTOP_PTR>>2] = end;if (end >= TOTAL_MEMORY) {var success = enlargeMemory();if (!success) {HEAP32[DYNAMICTOP_PTR>>2] = ret;return 0;}}return ret;},
  alignMemory: function (size,quantum) { var ret = size = Math.ceil((size)/(quantum ? quantum : 16))*(quantum ? quantum : 16); return ret; },
  makeBigInt: function (low,high,unsigned) { var ret = (unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0))); return ret; },
  GLOBAL_BASE: 8,
  QUANTUM_SIZE: 4,
  __dummy__: 0
}



Module["Runtime"] = Runtime;



//========================================
// Runtime essentials
//========================================

var ABORT = 0; // whether we are quitting the application. no code should run after this. set in exit() and abort()
var EXITSTATUS = 0;

function assert(condition, text) {
  if (!condition) {
    abort('Assertion failed: ' + text);
  }
}

var globalScope = this;

// Returns the C function with a specified identifier (for C++, you need to do manual name mangling)
function getCFunc(ident) {
  var func = Module['_' + ident]; // closure exported function
  if (!func) {
    try { func = eval('_' + ident); } catch(e) {}
  }
  assert(func, 'Cannot call unknown function ' + ident + ' (perhaps LLVM optimizations or closure removed it?)');
  return func;
}

var cwrap, ccall;
(function(){
  var JSfuncs = {
    // Helpers for cwrap -- it can't refer to Runtime directly because it might
    // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find
    // out what the minified function name is.
    'stackSave': function() {
      Runtime.stackSave()
    },
    'stackRestore': function() {
      Runtime.stackRestore()
    },
    // type conversion from js to c
    'arrayToC' : function(arr) {
      var ret = Runtime.stackAlloc(arr.length);
      writeArrayToMemory(arr, ret);
      return ret;
    },
    'stringToC' : function(str) {
      var ret = 0;
      if (str !== null && str !== undefined && str !== 0) { // null string
        // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
        var len = (str.length << 2) + 1;
        ret = Runtime.stackAlloc(len);
        stringToUTF8(str, ret, len);
      }
      return ret;
    }
  };
  // For fast lookup of conversion functions
  var toC = {'string' : JSfuncs['stringToC'], 'array' : JSfuncs['arrayToC']};

  // C calling interface.
  ccall = function ccallFunc(ident, returnType, argTypes, args, opts) {
    var func = getCFunc(ident);
    var cArgs = [];
    var stack = 0;
    if (args) {
      for (var i = 0; i < args.length; i++) {
        var converter = toC[argTypes[i]];
        if (converter) {
          if (stack === 0) stack = Runtime.stackSave();
          cArgs[i] = converter(args[i]);
        } else {
          cArgs[i] = args[i];
        }
      }
    }
    var ret = func.apply(null, cArgs);
    if (returnType === 'string') ret = Pointer_stringify(ret);
    if (stack !== 0) {
      if (opts && opts.async) {
        EmterpreterAsync.asyncFinalizers.push(function() {
          Runtime.stackRestore(stack);
        });
        return;
      }
      Runtime.stackRestore(stack);
    }
    return ret;
  }

  var sourceRegex = /^function\s*[a-zA-Z$_0-9]*\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/;
  function parseJSFunc(jsfunc) {
    // Match the body and the return value of a javascript function source
    var parsed = jsfunc.toString().match(sourceRegex).slice(1);
    return {arguments : parsed[0], body : parsed[1], returnValue: parsed[2]}
  }

  // sources of useful functions. we create this lazily as it can trigger a source decompression on this entire file
  var JSsource = null;
  function ensureJSsource() {
    if (!JSsource) {
      JSsource = {};
      for (var fun in JSfuncs) {
        if (JSfuncs.hasOwnProperty(fun)) {
          // Elements of toCsource are arrays of three items:
          // the code, and the return value
          JSsource[fun] = parseJSFunc(JSfuncs[fun]);
        }
      }
    }
  }

  cwrap = function cwrap(ident, returnType, argTypes) {
    argTypes = argTypes || [];
    var cfunc = getCFunc(ident);
    // When the function takes numbers and returns a number, we can just return
    // the original function
    var numericArgs = argTypes.every(function(type){ return type === 'number'});
    var numericRet = (returnType !== 'string');
    if ( numericRet && numericArgs) {
      return cfunc;
    }
    // Creation of the arguments list (["$1","$2",...,"$nargs"])
    var argNames = argTypes.map(function(x,i){return '$'+i});
    var funcstr = "(function(" + argNames.join(',') + ") {";
    var nargs = argTypes.length;
    if (!numericArgs) {
      // Generate the code needed to convert the arguments from javascript
      // values to pointers
      ensureJSsource();
      funcstr += 'var stack = ' + JSsource['stackSave'].body + ';';
      for (var i = 0; i < nargs; i++) {
        var arg = argNames[i], type = argTypes[i];
        if (type === 'number') continue;
        var convertCode = JSsource[type + 'ToC']; // [code, return]
        funcstr += 'var ' + convertCode.arguments + ' = ' + arg + ';';
        funcstr += convertCode.body + ';';
        funcstr += arg + '=(' + convertCode.returnValue + ');';
      }
    }

    // When the code is compressed, the name of cfunc is not literally 'cfunc' anymore
    var cfuncname = parseJSFunc(function(){return cfunc}).returnValue;
    // Call the function
    funcstr += 'var ret = ' + cfuncname + '(' + argNames.join(',') + ');';
    if (!numericRet) { // Return type can only by 'string' or 'number'
      // Convert the result to a string
      var strgfy = parseJSFunc(function(){return Pointer_stringify}).returnValue;
      funcstr += 'ret = ' + strgfy + '(ret);';
    }
    if (!numericArgs) {
      // If we had a stack, restore it
      ensureJSsource();
      funcstr += JSsource['stackRestore'].body.replace('()', '(stack)') + ';';
    }
    funcstr += 'return ret})';
    return eval(funcstr);
  };
})();
Module["ccall"] = ccall;
Module["cwrap"] = cwrap;

function setValue(ptr, value, type, noSafe) {
  type = type || 'i8';
  if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
    switch(type) {
      case 'i1': HEAP8[((ptr)>>0)]=value; break;
      case 'i8': HEAP8[((ptr)>>0)]=value; break;
      case 'i16': HEAP16[((ptr)>>1)]=value; break;
      case 'i32': HEAP32[((ptr)>>2)]=value; break;
      case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break;
      case 'float': HEAPF32[((ptr)>>2)]=value; break;
      case 'double': HEAPF64[((ptr)>>3)]=value; break;
      default: abort('invalid type for setValue: ' + type);
    }
}
Module["setValue"] = setValue;


function getValue(ptr, type, noSafe) {
  type = type || 'i8';
  if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
    switch(type) {
      case 'i1': return HEAP8[((ptr)>>0)];
      case 'i8': return HEAP8[((ptr)>>0)];
      case 'i16': return HEAP16[((ptr)>>1)];
      case 'i32': return HEAP32[((ptr)>>2)];
      case 'i64': return HEAP32[((ptr)>>2)];
      case 'float': return HEAPF32[((ptr)>>2)];
      case 'double': return HEAPF64[((ptr)>>3)];
      default: abort('invalid type for setValue: ' + type);
    }
  return null;
}
Module["getValue"] = getValue;

var ALLOC_NORMAL = 0; // Tries to use _malloc()
var ALLOC_STACK = 1; // Lives for the duration of the current function call
var ALLOC_STATIC = 2; // Cannot be freed
var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk
var ALLOC_NONE = 4; // Do not allocate
Module["ALLOC_NORMAL"] = ALLOC_NORMAL;
Module["ALLOC_STACK"] = ALLOC_STACK;
Module["ALLOC_STATIC"] = ALLOC_STATIC;
Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC;
Module["ALLOC_NONE"] = ALLOC_NONE;

// allocate(): This is for internal use. You can use it yourself as well, but the interface
//             is a little tricky (see docs right below). The reason is that it is optimized
//             for multiple syntaxes to save space in generated code. So you should
//             normally not use allocate(), and instead allocate memory using _malloc(),
//             initialize it with setValue(), and so forth.
// @slab: An array of data, or a number. If a number, then the size of the block to allocate,
//        in *bytes* (note that this is sometimes confusing: the next parameter does not
//        affect this!)
// @types: Either an array of types, one for each byte (or 0 if no type at that position),
//         or a single type which is used for the entire block. This only matters if there
//         is initial data - if @slab is a number, then this does not matter at all and is
//         ignored.
// @allocator: How to allocate memory, see ALLOC_*
function allocate(slab, types, allocator, ptr) {
  var zeroinit, size;
  if (typeof slab === 'number') {
    zeroinit = true;
    size = slab;
  } else {
    zeroinit = false;
    size = slab.length;
  }

  var singleType = typeof types === 'string' ? types : null;

  var ret;
  if (allocator == ALLOC_NONE) {
    ret = ptr;
  } else {
    ret = [typeof _malloc === 'function' ? _malloc : Runtime.staticAlloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length));
  }

  if (zeroinit) {
    var ptr = ret, stop;
    assert((ret & 3) == 0);
    stop = ret + (size & ~3);
    for (; ptr < stop; ptr += 4) {
      HEAP32[((ptr)>>2)]=0;
    }
    stop = ret + size;
    while (ptr < stop) {
      HEAP8[((ptr++)>>0)]=0;
    }
    return ret;
  }

  if (singleType === 'i8') {
    if (slab.subarray || slab.slice) {
      HEAPU8.set(slab, ret);
    } else {
      HEAPU8.set(new Uint8Array(slab), ret);
    }
    return ret;
  }

  var i = 0, type, typeSize, previousType;
  while (i < size) {
    var curr = slab[i];

    if (typeof curr === 'function') {
      curr = Runtime.getFunctionIndex(curr);
    }

    type = singleType || types[i];
    if (type === 0) {
      i++;
      continue;
    }

    if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later

    setValue(ret+i, curr, type);

    // no need to look up size unless type changes, so cache it
    if (previousType !== type) {
      typeSize = Runtime.getNativeTypeSize(type);
      previousType = type;
    }
    i += typeSize;
  }

  return ret;
}
Module["allocate"] = allocate;

// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready
function getMemory(size) {
  if (!staticSealed) return Runtime.staticAlloc(size);
  if (!runtimeInitialized) return Runtime.dynamicAlloc(size);
  return _malloc(size);
}
Module["getMemory"] = getMemory;

function Pointer_stringify(ptr, /* optional */ length) {
  if (length === 0 || !ptr) return '';
  // TODO: use TextDecoder
  // Find the length, and check for UTF while doing so
  var hasUtf = 0;
  var t;
  var i = 0;
  while (1) {
    t = HEAPU8[(((ptr)+(i))>>0)];
    hasUtf |= t;
    if (t == 0 && !length) break;
    i++;
    if (length && i == length) break;
  }
  if (!length) length = i;

  var ret = '';

  if (hasUtf < 128) {
    var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack
    var curr;
    while (length > 0) {
      curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
      ret = ret ? ret + curr : curr;
      ptr += MAX_CHUNK;
      length -= MAX_CHUNK;
    }
    return ret;
  }
  return Module['UTF8ToString'](ptr);
}
Module["Pointer_stringify"] = Pointer_stringify;

// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns
// a copy of that string as a Javascript String object.

function AsciiToString(ptr) {
  var str = '';
  while (1) {
    var ch = HEAP8[((ptr++)>>0)];
    if (!ch) return str;
    str += String.fromCharCode(ch);
  }
}
Module["AsciiToString"] = AsciiToString;

// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP.

function stringToAscii(str, outPtr) {
  return writeAsciiToMemory(str, outPtr, false);
}
Module["stringToAscii"] = stringToAscii;

// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns
// a copy of that string as a Javascript String object.

var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined;
function UTF8ArrayToString(u8Array, idx) {
  var endPtr = idx;
  // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
  // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
  while (u8Array[endPtr]) ++endPtr;

  if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) {
    return UTF8Decoder.decode(u8Array.subarray(idx, endPtr));
  } else {
    var u0, u1, u2, u3, u4, u5;

    var str = '';
    while (1) {
      // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
      u0 = u8Array[idx++];
      if (!u0) return str;
      if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
      u1 = u8Array[idx++] & 63;
      if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
      u2 = u8Array[idx++] & 63;
      if ((u0 & 0xF0) == 0xE0) {
        u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
      } else {
        u3 = u8Array[idx++] & 63;
        if ((u0 & 0xF8) == 0xF0) {
          u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3;
        } else {
          u4 = u8Array[idx++] & 63;
          if ((u0 & 0xFC) == 0xF8) {
            u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4;
          } else {
            u5 = u8Array[idx++] & 63;
            u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5;
          }
        }
      }
      if (u0 < 0x10000) {
        str += String.fromCharCode(u0);
      } else {
        var ch = u0 - 0x10000;
        str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
      }
    }
  }
}
Module["UTF8ArrayToString"] = UTF8ArrayToString;

// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns
// a copy of that string as a Javascript String object.

function UTF8ToString(ptr) {
  return UTF8ArrayToString(HEAPU8,ptr);
}
Module["UTF8ToString"] = UTF8ToString;

// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx',
// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP.
// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
// Parameters:
//   str: the Javascript string to copy.
//   outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element.
//   outIdx: The starting offset in the array to begin the copying.
//   maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
//                    terminator, i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else.
//                    maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator.
// Returns the number of bytes written, EXCLUDING the null terminator.

function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
  if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes.
    return 0;

  var startIdx = outIdx;
  var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
  for (var i = 0; i < str.length; ++i) {
    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
    var u = str.charCodeAt(i); // possibly a lead surrogate
    if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
    if (u <= 0x7F) {
      if (outIdx >= endIdx) break;
      outU8Array[outIdx++] = u;
    } else if (u <= 0x7FF) {
      if (outIdx + 1 >= endIdx) break;
      outU8Array[outIdx++] = 0xC0 | (u >> 6);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    } else if (u <= 0xFFFF) {
      if (outIdx + 2 >= endIdx) break;
      outU8Array[outIdx++] = 0xE0 | (u >> 12);
      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    } else if (u <= 0x1FFFFF) {
      if (outIdx + 3 >= endIdx) break;
      outU8Array[outIdx++] = 0xF0 | (u >> 18);
      outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    } else if (u <= 0x3FFFFFF) {
      if (outIdx + 4 >= endIdx) break;
      outU8Array[outIdx++] = 0xF8 | (u >> 24);
      outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    } else {
      if (outIdx + 5 >= endIdx) break;
      outU8Array[outIdx++] = 0xFC | (u >> 30);
      outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
      outU8Array[outIdx++] = 0x80 | (u & 63);
    }
  }
  // Null-terminate the pointer to the buffer.
  outU8Array[outIdx] = 0;
  return outIdx - startIdx;
}
Module["stringToUTF8Array"] = stringToUTF8Array;

// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP.
// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
// Returns the number of bytes written, EXCLUDING the null terminator.

function stringToUTF8(str, outPtr, maxBytesToWrite) {
  return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
}
Module["stringToUTF8"] = stringToUTF8;

// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte.

function lengthBytesUTF8(str) {
  var len = 0;
  for (var i = 0; i < str.length; ++i) {
    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    var u = str.charCodeAt(i); // possibly a lead surrogate
    if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
    if (u <= 0x7F) {
      ++len;
    } else if (u <= 0x7FF) {
      len += 2;
    } else if (u <= 0xFFFF) {
      len += 3;
    } else if (u <= 0x1FFFFF) {
      len += 4;
    } else if (u <= 0x3FFFFFF) {
      len += 5;
    } else {
      len += 6;
    }
  }
  return len;
}
Module["lengthBytesUTF8"] = lengthBytesUTF8;

// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns
// a copy of that string as a Javascript String object.

var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined;
function UTF16ToString(ptr) {
  var endPtr = ptr;
  // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
  // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
  var idx = endPtr >> 1;
  while (HEAP16[idx]) ++idx;
  endPtr = idx << 1;

  if (endPtr - ptr > 32 && UTF16Decoder) {
    return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr));
  } else {
    var i = 0;

    var str = '';
    while (1) {
      var codeUnit = HEAP16[(((ptr)+(i*2))>>1)];
      if (codeUnit == 0) return str;
      ++i;
      // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through.
      str += String.fromCharCode(codeUnit);
    }
  }
}


// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP.
// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write.
// Parameters:
//   str: the Javascript string to copy.
//   outPtr: Byte address in Emscripten HEAP where to write the string to.
//   maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
//                    terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else.
//                    maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator.
// Returns the number of bytes written, EXCLUDING the null terminator.

function stringToUTF16(str, outPtr, maxBytesToWrite) {
  // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
  if (maxBytesToWrite === undefined) {
    maxBytesToWrite = 0x7FFFFFFF;
  }
  if (maxBytesToWrite < 2) return 0;
  maxBytesToWrite -= 2; // Null terminator.
  var startPtr = outPtr;
  var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length;
  for (var i = 0; i < numCharsToWrite; ++i) {
    // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP.
    var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
    HEAP16[((outPtr)>>1)]=codeUnit;
    outPtr += 2;
  }
  // Null-terminate the pointer to the HEAP.
  HEAP16[((outPtr)>>1)]=0;
  return outPtr - startPtr;
}


// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.

function lengthBytesUTF16(str) {
  return str.length*2;
}


function UTF32ToString(ptr) {
  var i = 0;

  var str = '';
  while (1) {
    var utf32 = HEAP32[(((ptr)+(i*4))>>2)];
    if (utf32 == 0)
      return str;
    ++i;
    // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    if (utf32 >= 0x10000) {
      var ch = utf32 - 0x10000;
      str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
    } else {
      str += String.fromCharCode(utf32);
    }
  }
}


// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP.
// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write.
// Parameters:
//   str: the Javascript string to copy.
//   outPtr: Byte address in Emscripten HEAP where to write the string to.
//   maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
//                    terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else.
//                    maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator.
// Returns the number of bytes written, EXCLUDING the null terminator.

function stringToUTF32(str, outPtr, maxBytesToWrite) {
  // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
  if (maxBytesToWrite === undefined) {
    maxBytesToWrite = 0x7FFFFFFF;
  }
  if (maxBytesToWrite < 4) return 0;
  var startPtr = outPtr;
  var endPtr = startPtr + maxBytesToWrite - 4;
  for (var i = 0; i < str.length; ++i) {
    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
    if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) {
      var trailSurrogate = str.charCodeAt(++i);
      codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF);
    }
    HEAP32[((outPtr)>>2)]=codeUnit;
    outPtr += 4;
    if (outPtr + 4 > endPtr) break;
  }
  // Null-terminate the pointer to the HEAP.
  HEAP32[((outPtr)>>2)]=0;
  return outPtr - startPtr;
}


// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.

function lengthBytesUTF32(str) {
  var len = 0;
  for (var i = 0; i < str.length; ++i) {
    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
    // See http://unicode.org/faq/utf_bom.html#utf16-3
    var codeUnit = str.charCodeAt(i);
    if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate.
    len += 4;
  }

  return len;
}


function demangle(func) {
  var __cxa_demangle_func = Module['___cxa_demangle'] || Module['__cxa_demangle'];
  if (__cxa_demangle_func) {
    try {
      var s =
        func.substr(1);
      var len = lengthBytesUTF8(s)+1;
      var buf = _malloc(len);
      stringToUTF8(s, buf, len);
      var status = _malloc(4);
      var ret = __cxa_demangle_func(buf, 0, 0, status);
      if (getValue(status, 'i32') === 0 && ret) {
        return Pointer_stringify(ret);
      }
      // otherwise, libcxxabi failed
    } catch(e) {
      // ignore problems here
    } finally {
      if (buf) _free(buf);
      if (status) _free(status);
      if (ret) _free(ret);
    }
    // failure when using libcxxabi, don't demangle
    return func;
  }
  Runtime.warnOnce('warning: build with  -s DEMANGLE_SUPPORT=1  to link in libcxxabi demangling');
  return func;
}

function demangleAll(text) {
  var regex =
    /__Z[\w\d_]+/g;
  return text.replace(regex,
    function(x) {
      var y = demangle(x);
      return x === y ? x : (x + ' [' + y + ']');
    });
}

function jsStackTrace() {
  var err = new Error();
  if (!err.stack) {
    // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown,
    // so try that as a special-case.
    try {
      throw new Error(0);
    } catch(e) {
      err = e;
    }
    if (!err.stack) {
      return '(no stack trace available)';
    }
  }
  return err.stack.toString();
}

function stackTrace() {
  var js = jsStackTrace();
  if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace']();
  return demangleAll(js);
}
Module["stackTrace"] = stackTrace;

// Memory management

var PAGE_SIZE = 16384;
var WASM_PAGE_SIZE = 65536;
var ASMJS_PAGE_SIZE = 16777216;
var MIN_TOTAL_MEMORY = 16777216;

function alignUp(x, multiple) {
  if (x % multiple > 0) {
    x += multiple - (x % multiple);
  }
  return x;
}

var HEAP;
var buffer;
var HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64;

function updateGlobalBuffer(buf) {
  Module['buffer'] = buffer = buf;
}

function updateGlobalBufferViews() {
  Module['HEAP8'] = HEAP8 = new Int8Array(buffer);
  Module['HEAP16'] = HEAP16 = new Int16Array(buffer);
  Module['HEAP32'] = HEAP32 = new Int32Array(buffer);
  Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer);
  Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer);
  Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer);
  Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer);
  Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer);
}

var STATIC_BASE, STATICTOP, staticSealed; // static area
var STACK_BASE, STACKTOP, STACK_MAX; // stack area
var DYNAMIC_BASE, DYNAMICTOP_PTR; // dynamic area handled by sbrk

  STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0;
  staticSealed = false;



function abortOnCannotGrowMemory() {
  abort('Cannot enlarge memory arrays. Either (1) compile with  -s TOTAL_MEMORY=X  with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with  -s ALLOW_MEMORY_GROWTH=1  which adjusts the size at runtime but prevents some optimizations, (3) set Module.TOTAL_MEMORY to a higher value before the program runs, or if you want malloc to return NULL (0) instead of this abort, compile with  -s ABORTING_MALLOC=0 ');
}


function enlargeMemory() {
  abortOnCannotGrowMemory();
}


var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880;
var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 16777216;
if (TOTAL_MEMORY < TOTAL_STACK) Module.printErr('TOTAL_MEMORY should be larger than TOTAL_STACK, was ' + TOTAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')');

// Initialize the runtime's memory



// Use a provided buffer, if there is one, or else allocate a new one
if (Module['buffer']) {
  buffer = Module['buffer'];
} else {
  // Use a WebAssembly memory where available
  {
    buffer = new ArrayBuffer(TOTAL_MEMORY);
  }
}
updateGlobalBufferViews();


function getTotalMemory() {
  return TOTAL_MEMORY;
}

// Endianness check (note: assumes compiler arch was little-endian)
  HEAP32[0] = 0x63736d65; /* 'emsc' */
HEAP16[1] = 0x6373;
if (HEAPU8[2] !== 0x73 || HEAPU8[3] !== 0x63) throw 'Runtime error: expected the system to be little-endian!';

Module['HEAP'] = HEAP;
Module['buffer'] = buffer;
Module['HEAP8'] = HEAP8;
Module['HEAP16'] = HEAP16;
Module['HEAP32'] = HEAP32;
Module['HEAPU8'] = HEAPU8;
Module['HEAPU16'] = HEAPU16;
Module['HEAPU32'] = HEAPU32;
Module['HEAPF32'] = HEAPF32;
Module['HEAPF64'] = HEAPF64;

function callRuntimeCallbacks(callbacks) {
  while(callbacks.length > 0) {
    var callback = callbacks.shift();
    if (typeof callback == 'function') {
      callback();
      continue;
    }
    var func = callback.func;
    if (typeof func === 'number') {
      if (callback.arg === undefined) {
        Module['dynCall_v'](func);
      } else {
        Module['dynCall_vi'](func, callback.arg);
      }
    } else {
      func(callback.arg === undefined ? null : callback.arg);
    }
  }
}

var __ATPRERUN__  = []; // functions called before the runtime is initialized
var __ATINIT__    = []; // functions called during startup
var __ATMAIN__    = []; // functions called when main() is to be run
var __ATEXIT__    = []; // functions called during shutdown
var __ATPOSTRUN__ = []; // functions called after the runtime has exited

var runtimeInitialized = false;
var runtimeExited = false;


function preRun() {
  // compatibility - merge in anything from Module['preRun'] at this time
  if (Module['preRun']) {
    if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
    while (Module['preRun'].length) {
      addOnPreRun(Module['preRun'].shift());
    }
  }
  callRuntimeCallbacks(__ATPRERUN__);
}

function ensureInitRuntime() {
  if (runtimeInitialized) return;
  runtimeInitialized = true;
  callRuntimeCallbacks(__ATINIT__);
}

function preMain() {
  callRuntimeCallbacks(__ATMAIN__);
}

function exitRuntime() {
  callRuntimeCallbacks(__ATEXIT__);
  runtimeExited = true;
}

function postRun() {
  // compatibility - merge in anything from Module['postRun'] at this time
  if (Module['postRun']) {
    if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
    while (Module['postRun'].length) {
      addOnPostRun(Module['postRun'].shift());
    }
  }
  callRuntimeCallbacks(__ATPOSTRUN__);
}

function addOnPreRun(cb) {
  __ATPRERUN__.unshift(cb);
}
Module["addOnPreRun"] = addOnPreRun;

function addOnInit(cb) {
  __ATINIT__.unshift(cb);
}
Module["addOnInit"] = addOnInit;

function addOnPreMain(cb) {
  __ATMAIN__.unshift(cb);
}
Module["addOnPreMain"] = addOnPreMain;

function addOnExit(cb) {
  __ATEXIT__.unshift(cb);
}
Module["addOnExit"] = addOnExit;

function addOnPostRun(cb) {
  __ATPOSTRUN__.unshift(cb);
}
Module["addOnPostRun"] = addOnPostRun;

// Tools


function intArrayFromString(stringy, dontAddNull, length /* optional */) {
  var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
  var u8array = new Array(len);
  var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
  if (dontAddNull) u8array.length = numBytesWritten;
  return u8array;
}
Module["intArrayFromString"] = intArrayFromString;

function intArrayToString(array) {
  var ret = [];
  for (var i = 0; i < array.length; i++) {
    var chr = array[i];
    if (chr > 0xFF) {
      chr &= 0xFF;
    }
    ret.push(String.fromCharCode(chr));
  }
  return ret.join('');
}
Module["intArrayToString"] = intArrayToString;

// Deprecated: This function should not be called because it is unsafe and does not provide
// a maximum length limit of how many bytes it is allowed to write. Prefer calling the
// function stringToUTF8Array() instead, which takes in a maximum length that can be used
// to be secure from out of bounds writes.
function writeStringToMemory(string, buffer, dontAddNull) {
  Runtime.warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!');

  var lastChar, end;
  if (dontAddNull) {
    // stringToUTF8Array always appends null. If we don't want to do that, remember the
    // character that existed at the location where the null will be placed, and restore
    // that after the write (below).
    end = buffer + lengthBytesUTF8(string);
    lastChar = HEAP8[end];
  }
  stringToUTF8(string, buffer, Infinity);
  if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character.
}
Module["writeStringToMemory"] = writeStringToMemory;

function writeArrayToMemory(array, buffer) {
  HEAP8.set(array, buffer);
}
Module["writeArrayToMemory"] = writeArrayToMemory;

function writeAsciiToMemory(str, buffer, dontAddNull) {
  for (var i = 0; i < str.length; ++i) {
    HEAP8[((buffer++)>>0)]=str.charCodeAt(i);
  }
  // Null-terminate the pointer to the HEAP.
  if (!dontAddNull) HEAP8[((buffer)>>0)]=0;
}
Module["writeAsciiToMemory"] = writeAsciiToMemory;

function unSign(value, bits, ignore) {
  if (value >= 0) {
    return value;
  }
  return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts
                    : Math.pow(2, bits)         + value;
}
function reSign(value, bits, ignore) {
  if (value <= 0) {
    return value;
  }
  var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32
                        : Math.pow(2, bits-1);
  if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that
                                                       // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors
                                                       // TODO: In i64 mode 1, resign the two parts separately and safely
    value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts
  }
  return value;
}


// check for imul support, and also for correctness ( https://bugs.webkit.org/show_bug.cgi?id=126345 )
if (!Math['imul'] || Math['imul'](0xffffffff, 5) !== -5) Math['imul'] = function imul(a, b) {
  var ah  = a >>> 16;
  var al = a & 0xffff;
  var bh  = b >>> 16;
  var bl = b & 0xffff;
  return (al*bl + ((ah*bl + al*bh) << 16))|0;
};
Math.imul = Math['imul'];


if (!Math['clz32']) Math['clz32'] = function(x) {
  x = x >>> 0;
  for (var i = 0; i < 32; i++) {
    if (x & (1 << (31 - i))) return i;
  }
  return 32;
};
Math.clz32 = Math['clz32']

if (!Math['trunc']) Math['trunc'] = function(x) {
  return x < 0 ? Math.ceil(x) : Math.floor(x);
};
Math.trunc = Math['trunc'];

var Math_abs = Math.abs;
var Math_cos = Math.cos;
var Math_sin = Math.sin;
var Math_tan = Math.tan;
var Math_acos = Math.acos;
var Math_asin = Math.asin;
var Math_atan = Math.atan;
var Math_atan2 = Math.atan2;
var Math_exp = Math.exp;
var Math_log = Math.log;
var Math_sqrt = Math.sqrt;
var Math_ceil = Math.ceil;
var Math_floor = Math.floor;
var Math_pow = Math.pow;
var Math_imul = Math.imul;
var Math_fround = Math.fround;
var Math_round = Math.round;
var Math_min = Math.min;
var Math_clz32 = Math.clz32;
var Math_trunc = Math.trunc;

// A counter of dependencies for calling run(). If we need to
// do asynchronous work before running, increment this and
// decrement it. Incrementing must happen in a place like
// PRE_RUN_ADDITIONS (used by emcc to add file preloading).
// Note that you can add dependencies in preRun, even though
// it happens right before run - run will be postponed until
// the dependencies are met.
var runDependencies = 0;
var runDependencyWatcher = null;
var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled

function getUniqueRunDependency(id) {
  return id;
}

function addRunDependency(id) {
  runDependencies++;
  if (Module['monitorRunDependencies']) {
    Module['monitorRunDependencies'](runDependencies);
  }
}
Module["addRunDependency"] = addRunDependency;

function removeRunDependency(id) {
  runDependencies--;
  if (Module['monitorRunDependencies']) {
    Module['monitorRunDependencies'](runDependencies);
  }
  if (runDependencies == 0) {
    if (runDependencyWatcher !== null) {
      clearInterval(runDependencyWatcher);
      runDependencyWatcher = null;
    }
    if (dependenciesFulfilled) {
      var callback = dependenciesFulfilled;
      dependenciesFulfilled = null;
      callback(); // can add another dependenciesFulfilled
    }
  }
}
Module["removeRunDependency"] = removeRunDependency;

Module["preloadedImages"] = {}; // maps url to image data
Module["preloadedAudios"] = {}; // maps url to audio data



var memoryInitializer = null;






// === Body ===

var ASM_CONSTS = [function($0, $1) { { Module.printErr('bad name in getProcAddress: ' + [Pointer_stringify($0), Pointer_stringify($1)]); } }];

function _emscripten_asm_const_iii(code, a0, a1) {
 return ASM_CONSTS[code](a0, a1);
}



STATIC_BASE = 8;

STATICTOP = STATIC_BASE + 32384;
  /* global initializers */  __ATINIT__.push();
  

/* memory initializer */ allocate([98,39,0,0,0,0,0,0,17,0,0,0,0,0,0,0,115,39,0,0,0,0,0,0,17,0,0,0,0,0,0,0,128,191,160,191,128,159,144,191,128,143,0,0,0,0,0,0,23,0,0,0,0,0,0,0,8,0,0,0,0,0,0,0,129,255,255,255,255,255,255,255,52,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,1,252,255,255,255,255,255,255,1,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,88,120,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,2,0,0,0,127,122,0,0,0,4,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,100,1,0,0,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,240,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,241,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,2,19,3,3,3,3,3,3,3,3,3,3,3,3,35,3,3,52,4,4,4,68,241,241,241,241,241,241,241,241,241,241,241,37,115,40,37,100,58,37,100,41,32,82,117,110,116,105,109,101,32,97,115,115,101,114,116,105,111,110,58,32,37,115,10,37,115,40,37,100,58,37,100,41,32,80,97,110,105,99,58,32,37,115,10,37,115,40,37,100,58,37,100,41,32,73,110,100,101,120,32,37,100,32,105,115,32,111,117,116,32,111,102,32,98,111,117,110,100,115,32,114,97,110,103,101,32,48,46,46,37,100,10,37,115,40,37,100,58,37,100,41,32,73,110,118,97,108,105,100,32,115,108,105,99,101,32,105,110,100,105,99,101,115,58,32,91,37,100,46,46,37,100,46,46,37,100,93,10,37,115,40,37,100,58,37,100,41,32,73,110,118,97,108,105,100,32,115,117,98,115,116,114,105,110,103,32,105,110,100,105,99,101,115,58,32,91,37,100,46,46,37,100,93,10,37,115,40,37,100,58,37,100,41,32,73,110,118,97,108,105,100,32,96,117,110,105,111,110,95,99,97,115,116,96,32,102,114,111,109,32,37,84,32,116,111,32,37,84,10,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,95,112,114,101,108,111,97,100,46,111,100,105,110,72,101,108,108,111,32,119,111,114,108,100,44,32,102,114,111,109,32,79,100,105,110,33,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,105,110,116,117,105,110,116,105,117,102,51,50,102,54,52,99,111,109,112,108,101,120,54,52,99,111,109,112,108,101,120,49,50,56,113,117,97,116,101,114,110,105,111,110,49,50,56,113,117,97,116,101,114,110,105,111,110,115,116,114,105,110,103,98,111,111,108,114,97,119,112,116,114,94,112,114,111,99,40,41,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,40,44,32,41,32,45,62,32,40,44,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,58,32,41,91,93,91,46,46,93,91,93,91,118,101,99,116,111,114,32,93,109,97,112,91,115,116,114,117,99,116,32,35,112,97,99,107,101,100,32,35,111,114,100,101,114,101,100,32,35,97,108,105,103,110,32,44,32,58,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,117,110,105,111,110,32,123,44,32,58,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,44,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,44,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,58,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,125,114,97,119,95,117,110,105,111,110,32,123,44,32,58,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,125,101,110,117,109,32,32,123,44,32,125,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,0,0,0,0,224,235,87,254,42,37,33,60,110,105,108,62,116,114,117,101,102,97,108,115,101,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,105,115,95,105,110,116,101,103,101,114,95,110,101,103,97,116,105,118,101,58,32,85,110,107,110,111,119,110,32,105,110,116,101,103,101,114,32,115,105,122,101,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,95,119,114,105,116,101,95,105,110,116,58,32,98,117,102,102,101,114,32,111,118,101,114,114,117,110,46,32,87,105,100,116,104,32,97,110,100,32,112,114,101,99,105,115,105,111,110,32,116,111,111,32,98,105,103,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,95,119,114,105,116,101,95,105,110,116,58,32,117,110,107,110,111,119,110,32,98,97,115,101,44,32,119,104,111,111,112,115,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,85,43,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,48,120,60,110,105,108,62,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,33,37,40,66,65,68,32,69,78,85,77,32,86,65,76,85,69,41,60,110,105,108,62,44,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,32,61,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,44,32,44,32,109,97,112,91,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,44,32,61,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,44,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,44,32,44,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,32,61,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,44,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,32,61,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,40,114,97,119,95,117,110,105,111,110,41,32,64,32,60,110,105,108,62,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,37,33,40,66,65,68,32,87,73,68,84,72,41,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,37,33,40,66,65,68,32,80,82,69,67,73,83,73,79,78,41,37,33,40,78,79,32,86,69,82,66,41,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,37,33,40,66,65,68,32,65,82,71,85,77,69,78,84,32,78,85,77,66,69,82,41,37,33,40,77,73,83,83,73,78,71,32,65,82,71,85,77,69,78,84,41,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,37,33,40,69,88,84,82,65,32,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,44,32,60,110,105,108,62,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,102,109,116,46,111,100,105,110,41,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,117,116,102,56,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,111,115,95,108,105,110,117,120,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,115,116,114,99,111,110,118,58,32,105,110,118,97,108,105,100,32,98,105,116,95,115,105,122,101,78,97,78,45,73,110,102,43,73,110,102,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,115,116,114,99,111,110,118,58,32,101,47,69,32,102,108,111,97,116,32,112,114,105,110,116,105,110,103,32,105,115,32,110,111,116,32,121,101,116,32,115,117,112,112,111,114,116,101,100,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,115,116,114,99,111,110,118,58,32,103,47,71,32,102,108,111,97,116,32,112,114,105,110,116,105,110,103,32,105,115,32,110,111,116,32,121,101,116,32,115,117,112,112,111,114,116,101,100,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,105,115,95,105,110,116,101,103,101,114,95,110,101,103,97,116,105,118,101,58,32,85,110,107,110,111,119,110,32,105,110,116,101,103,101,114,32,115,105,122,101,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,115,116,114,99,111,110,118,58,32,105,108,108,101,103,97,108,32,98,97,115,101,32,112,97,115,115,101,100,32,116,111,32,97,112,112,101,110,100,95,98,105,116,115,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,115,116,114,99,111,110,118,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,47,104,111,109,101,47,122,97,110,103,101,110,116,47,80,114,111,103,114,97,109,109,105,110,103,47,79,100,105,110,79,102,102,105,99,105,97,108,47,99,111,114,101,47,100,101,99,105,109,97,108,46,111,100,105,110,78,97,109,101,100,115,105,122,101,97,108,105,103,110,110,97,109,101,98,97,115,101,84,121,112,101,95,73,110,102,111,115,105,122,101,97,108,105,103,110,78,97,109,101,100,73,110,116,101,103,101,114,70,108,111,97,116,67,111,109,112,108,101,120,81,117,97,116,101,114,110,105,111,110,83,116,114,105,110,103,66,111,111,108,101,97,110,65,110,121,80,111,105,110,116,101,114,80,114,111,99,101,100,117,114,101,65,114,114,97,121,68,121,110,97,109,105,99,95,65,114,114,97,121,83,108,105,99,101,86,101,99,116,111,114,84,117,112,108,101,83,116,114,117,99,116,82,97,119,95,85,110,105,111,110,85,110,105,111,110,69,110,117,109,77,97,112,73,110,116,101,103,101,114,115,105,122,101,97,108,105,103,110,115,105,103,110,101,100,70,108,111,97,116,115,105,122,101,97,108,105,103,110,67,111,109,112,108,101,120,115,105,122,101,97,108,105,103,110,81,117,97,116,101,114,110,105,111,110,115,105,122,101,97,108,105,103,110,83,116,114,105,110,103,115,105,122,101,97,108,105,103,110,66,111,111,108,101,97,110,115,105,122,101,97,108,105,103,110,65,110,121,115,105,122,101,97,108,105,103,110,80,111,105,110,116,101,114,115,105,122,101,97,108,105,103,110,101,108,101,109,80,114,111,99,101,100,117,114,101,115,105,122,101,97,108,105,103,110,112,97,114,97,109,115,114,101,115,117,108,116,115,118,97,114,105,97,100,105,99,99,111,110,118,101,110,116,105,111,110,67,97,108,108,105,110,103,95,67,111,110,118,101,110,116,105,111,110,79,68,73,78,67,83,84,68,70,65,83,84,65,114,114,97,121,115,105,122,101,97,108,105,103,110,101,108,101,109,101,108,101,109,95,115,105,122,101,99,111,117,110,116,68,121,110,97,109,105,99,95,65,114,114,97,121,115,105,122,101,97,108,105,103,110,101,108,101,109,101,108,101,109,95,115,105,122,101,83,108,105,99,101,115,105,122,101,97,108,105,103,110,101,108,101,109,101,108,101,109,95,115,105,122,101,86,101,99,116,111,114,115,105,122,101,97,108,105,103,110,101,108,101,109,101,108,101,109,95,115,105,122,101,99,111,117,110,116,84,117,112,108,101,115,105,122,101,97,108,105,103,110,114,101,99,111,114,100,84,121,112,101,95,73,110,102,111,95,82,101,99,111,114,100,116,121,112,101,115,110,97,109,101,115,111,102,102,115,101,116,115,112,97,99,107,101,100,111,114,100,101,114,101,100,99,117,115,116,111,109,95,97,108,105,103,110,83,116,114,117,99,116,115,105,122,101,97,108,105,103,110,114,101,99,111,114,100,82,97,119,95,85,110,105,111,110,115,105,122,101,97,108,105,103,110,114,101,99,111,114,100,85,110,105,111,110,115,105,122,101,97,108,105,103,110,99,111,109,109,111,110,95,102,105,101,108,100,115,118,97,114,105,97,110,116,95,110,97,109,101,115,118,97,114,105,97,110,116,95,116,121,112,101,115,116,121,112,101,115,110,97,109,101,115,111,102,102,115,101,116,115,69,110,117,109,115,105,122,101,97,108,105,103,110,98,97,115,101,110,97,109,101,115,118,97,108,117,101,115,84,121,112,101,95,73,110,102,111,95,69,110,117,109,95,86,97,108,117,101,102,105,77,97,112,115,105,122,101,97,108,105,103,110,107,101,121,118,97,108,117,101,103,101,110,101,114,97,116,101,100,95,115,116,114,117,99,116,99,111,117,110,116,75,101,121,98,111,97,114,100,69,118,101,110,116,116,121,112,101,116,105,109,101,115,116,97,109,112,119,105,110,100,111,119,95,105,100,115,116,97,116,101,114,101,112,101,97,116,112,97,100,50,112,97,100,51,107,101,121,115,121,109,75,101,121,115,121,109,115,99,97,110,99,111,100,101,115,121,109,109,111,100,117,110,117,115,101,100,77,111,117,115,101,66,117,116,116,111,110,69,118,101,110,116,116,121,112,101,116,105,109,101,115,116,97,109,112,119,105,110,100,111,119,95,105,100,119,104,105,99,104,98,117,116,116,111,110,115,116,97,116,101,99,108,105,99,107,115,112,97,100,49,120,121,77,111,117,115,101,87,104,101,101,108,69,118,101,110,116,116,121,112,101,116,105,109,101,115,116,97,109,112,119,105,110,100,111,119,95,105,100,119,104,105,99,104,120,121,100,105,114,101,99,116,105,111,110,48,49,50,51,52,53,54,55,56,57,97,98,99,100,101,102,120,48,49,50,51,52,53,54,55,56,57,65,66,67,68,69,70,88,69,88,84,0,65,82,66,0,79,69,83,0,65,78,71,76,69,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,0,103,108,85,115,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,85,115,101,80,114,111,103,114,97,109,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,0,103,108,65,116,116,97,99,104], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE);
/* memory initializer */ allocate([79,98,106,101,99,116,0,103,108,65,116,116,97,99,104,83,104,97,100,101,114,0,103,108,68,101,116,97,99,104,79,98,106,101,99,116,0,103,108,68,101,116,97,99,104,83,104,97,100,101,114,0,103,108,80,105,120,101,108,83,116,111,114,101,105,0,103,108,71,101,116,83,116,114,105,110,103,0,103,108,71,101,116,73,110,116,101,103,101,114,118,0,103,108,71,101,116,70,108,111,97,116,118,0,103,108,71,101,116,66,111,111,108,101,97,110,118,0,103,108,71,101,110,84,101,120,116,117,114,101,115,0,103,108,68,101,108,101,116,101,84,101,120,116,117,114,101,115,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,84,101,120,73,109,97,103,101,50,68,0,103,108,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,82,101,97,100,80,105,120,101,108,115,0,103,108,66,105,110,100,84,101,120,116,117,114,101,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,84,101,120,116,117,114,101,0,103,108,71,101,110,66,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,66,117,102,102,101,114,115,0,103,108,71,101,116,66,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,66,117,102,102,101,114,68,97,116,97,0,103,108,66,117,102,102,101,114,83,117,98,68,97,116,97,0,103,108,73,115,66,117,102,102,101,114,0,103,108,71,101,110,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,66,105,110,100,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,82,101,110,100,101,114,98,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,85,110,105,102,111,114,109,102,118,0,103,108,71,101,116,85,110,105,102,111,114,109,105,118,0,103,108,71,101,116,85,110,105,102,111,114,109,76,111,99,97,116,105,111,110,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,102,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,105,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,118,0,103,108,71,101,116,65,99,116,105,118,101,85,110,105,102,111,114,109,0,103,108,85,110,105,102,111,114,109,49,102,0,103,108,85,110,105,102,111,114,109,50,102,0,103,108,85,110,105,102,111,114,109,51,102,0,103,108,85,110,105,102,111,114,109,52,102,0,103,108,85,110,105,102,111,114,109,49,105,0,103,108,85,110,105,102,111,114,109,50,105,0,103,108,85,110,105,102,111,114,109,51,105,0,103,108,85,110,105,102,111,114,109,52,105,0,103,108,85,110,105,102,111,114,109,49,105,118,0,103,108,85,110,105,102,111,114,109,50,105,118,0,103,108,85,110,105,102,111,114,109,51,105,118,0,103,108,85,110,105,102,111,114,109,52,105,118,0,103,108,85,110,105,102,111,114,109,49,102,118,0,103,108,85,110,105,102,111,114,109,50,102,118,0,103,108,85,110,105,102,111,114,109,51,102,118,0,103,108,85,110,105,102,111,114,109,52,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,50,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,51,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,52,102,118,0,103,108,66,105,110,100,66,117,102,102,101,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,118,0,103,108,71,101,116,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,71,101,116,65,99,116,105,118,101,65,116,116,114,105,98,0,103,108,68,101,108,101,116,101,83,104,97,100,101,114,0,103,108,71,101,116,65,116,116,97,99,104,101,100,83,104,97,100,101,114,115,0,103,108,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,71,101,116,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,67,111,109,112,105,108,101,83,104,97,100,101,114,0,103,108,71,101,116,83,104,97,100,101,114,73,110,102,111,76,111,103,0,103,108,71,101,116,83,104,97,100,101,114,105,118,0,103,108,71,101,116,80,114,111,103,114,97,109,105,118,0,103,108,73,115,83,104,97,100,101,114,0,103,108,68,101,108,101,116,101,80,114,111,103,114,97,109,0,103,108,71,101,116,83,104,97,100,101,114,80,114,101,99,105,115,105,111,110,70,111,114,109,97,116,0,103,108,76,105,110,107,80,114,111,103,114,97,109,0,103,108,71,101,116,80,114,111,103,114,97,109,73,110,102,111,76,111,103,0,103,108,86,97,108,105,100,97,116,101,80,114,111,103,114,97,109,0,103,108,73,115,80,114,111,103,114,97,109,0,103,108,66,105,110,100,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,66,105,110,100,70,114,97,109,101,98,117,102,102,101,114,0,103,108,71,101,110,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,70,114,97,109,101,98,117,102,102,101,114,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,70,114,97,109,101,98,117,102,102,101,114,84,101,120,116,117,114,101,50,68,0,103,108,71,101,116,70,114,97,109,101,98,117,102,102,101,114,65,116,116,97,99,104,109,101,110,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,70,114,97,109,101,98,117,102,102,101,114,0,103,108,68,101,108,101,116,101,79,98,106,101,99,116,0,103,108,71,101,116,79,98,106,101,99,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,71,101,116,73,110,102,111,76,111,103,0,103,108,66,105,110,100,80,114,111,103,114,97,109,0,103,108,71,101,116,80,111,105,110,116,101,114,118,0,103,108,68,114,97,119,82,97,110,103,101,69,108,101,109,101,110,116,115,0,103,108,69,110,97,98,108,101,67,108,105,101,110,116,83,116,97,116,101,0,103,108,86,101,114,116,101,120,80,111,105,110,116,101,114,0,103,108,84,101,120,67,111,111,114,100,80,111,105,110,116,101,114,0,103,108,78,111,114,109,97,108,80,111,105,110,116,101,114,0,103,108,67,111,108,111,114,80,111,105,110,116,101,114,0,103,108,67,108,105,101,110,116,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,0,103,108,77,97,116,114,105,120,77,111,100,101,0,103,108,76,111,97,100,73,100,101,110,116,105,116,121,0,103,108,76,111,97,100,77,97,116,114,105,120,102,0,103,108,70,114,117,115,116,117,109,0,103,108,82,111,116,97,116,101,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,0,103,108,69,110,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,105,115,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,114,97,119,65,114,114,97,121,115,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,0,103,108,83,104,97,100,101,114,66,105,110,97,114,121,0,103,108,82,101,108,101,97,115,101,83,104,97,100,101,114,67,111,109,112,105,108,101,114,0,103,108,71,101,116,69,114,114,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,68,105,118,105,115,111,114,0,103,108,68,114,97,119,65,114,114,97,121,115,73,110,115,116,97,110,99,101,100,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,73,110,115,116,97,110,99,101,100,0,103,108,70,105,110,105,115,104,0,103,108,70,108,117,115,104,0,103,108,67,108,101,97,114,68,101,112,116,104,0,103,108,67,108,101,97,114,68,101,112,116,104,102,0,103,108,68,101,112,116,104,70,117,110,99,0,103,108,69,110,97,98,108,101,0,103,108,68,105,115,97,98,108,101,0,103,108,70,114,111,110,116,70,97,99,101,0,103,108,67,117,108,108,70,97,99,101,0,103,108,67,108,101,97,114,0,103,108,76,105,110,101,87,105,100,116,104,0,103,108,67,108,101,97,114,83,116,101,110,99,105,108,0,103,108,68,101,112,116,104,77,97,115,107,0,103,108,83,116,101,110,99,105,108,77,97,115,107,0,103,108,67,104,101,99,107,70,114,97,109,101,98,117,102,102,101,114,83,116,97,116,117,115,0,103,108,71,101,110,101,114,97,116,101,77,105,112,109,97,112,0,103,108,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,0,103,108,73,115,69,110,97,98,108,101,100,0,103,108,66,108,101,110,100,70,117,110,99,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,83,101,112,97,114,97,116,101,0,103,108,68,101,112,116,104,82,97,110,103,101,0,103,108,68,101,112,116,104,82,97,110,103,101,102,0,103,108,83,116,101,110,99,105,108,77,97,115,107,83,101,112,97,114,97,116,101,0,103,108,72,105,110,116,0,103,108,80,111,108,121,103,111,110,79,102,102,115,101,116,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,0,103,108,83,97,109,112,108,101,67,111,118,101,114,97,103,101,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,0,103,108,83,116,101,110,99,105,108,70,117,110,99,0,103,108,83,116,101,110,99,105,108,79,112,0,103,108,86,105,101,119,112,111,114,116,0,103,108,67,108,101,97,114,67,111,108,111,114,0,103,108,83,99,105,115,115,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,0,103,108,67,111,108,111,114,77,97,115,107,0,103,108,82,101,110,100,101,114,98,117,102,102,101,114,83,116,111,114,97,103,101,0,103,108,66,108,101,110,100,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,66,108,101,110,100,67,111,108,111,114,0,103,108,83,116,101,110,99,105,108,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,83,116,101,110,99,105,108,79,112,83,101,112,97,114,97,116,101,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,0,103,108,67,111,112,121,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,112,121,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,68,114,97,119,66,117,102,102,101,114,115,0,123,32,77,111,100,117,108,101,46,112,114,105,110,116,69,114,114,40,39,98,97,100,32,110,97,109,101,32,105,110,32,103,101,116,80,114,111,99,65,100,100,114,101,115,115,58,32,39,32,43,32,91,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,48,41,44,32,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,49,41,93,41,59,32,125,0], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+10240);





/* no memory initializer */
var tempDoublePtr = STATICTOP; STATICTOP += 16;

function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much

  HEAP8[tempDoublePtr] = HEAP8[ptr];

  HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];

  HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];

  HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];

}

function copyTempDouble(ptr) {

  HEAP8[tempDoublePtr] = HEAP8[ptr];

  HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];

  HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];

  HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];

  HEAP8[tempDoublePtr+4] = HEAP8[ptr+4];

  HEAP8[tempDoublePtr+5] = HEAP8[ptr+5];

  HEAP8[tempDoublePtr+6] = HEAP8[ptr+6];

  HEAP8[tempDoublePtr+7] = HEAP8[ptr+7];

}

// {{PRE_LIBRARY}}


  
  var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:[],currentContext:null,offscreenCanvases:{},timerQueriesEXT:[],byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],programInfos:{},stringCache:{},tempFixedLengthArray:[],packAlignment:4,unpackAlignment:4,init:function () {
        GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE);
        for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) {
          GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i+1);
        }
  
        // For functions such as glDrawBuffers, glInvalidateFramebuffer and glInvalidateSubFramebuffer that need to pass a short array to the WebGL API,
        // create a set of short fixed-length arrays to avoid having to generate any garbage when calling those functions.
        for (var i = 0; i < 32; i++) {
          GL.tempFixedLengthArray.push(new Array(i));
        }
      },recordError:function recordError(errorCode) {
        if (!GL.lastError) {
          GL.lastError = errorCode;
        }
      },getNewId:function (table) {
        var ret = GL.counter++;
        for (var i = table.length; i < ret; i++) {
          table[i] = null;
        }
        return ret;
      },MINI_TEMP_BUFFER_SIZE:256,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function (shader, count, string, length) {
        var source = '';
        for (var i = 0; i < count; ++i) {
          var frag;
          if (length) {
            var len = HEAP32[(((length)+(i*4))>>2)];
            if (len < 0) {
              frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
            } else {
              frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)], len);
            }
          } else {
            frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
          }
          source += frag;
        }
        return source;
      },createContext:function (canvas, webGLContextAttributes) {
        if (typeof webGLContextAttributes['majorVersion'] === 'undefined' && typeof webGLContextAttributes['minorVersion'] === 'undefined') {
          webGLContextAttributes['majorVersion'] = 1;
          webGLContextAttributes['minorVersion'] = 0;
        }
        var ctx;
        var errorInfo = '?';
        function onContextCreationError(event) {
          errorInfo = event.statusMessage || errorInfo;
        }
        try {
          canvas.addEventListener('webglcontextcreationerror', onContextCreationError, false);
          try {
            if (webGLContextAttributes['majorVersion'] == 1 && webGLContextAttributes['minorVersion'] == 0) {
              ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes);
            } else if (webGLContextAttributes['majorVersion'] == 2 && webGLContextAttributes['minorVersion'] == 0) {
              ctx = canvas.getContext("webgl2", webGLContextAttributes) || canvas.getContext("experimental-webgl2", webGLContextAttributes);
            } else {
              throw 'Unsupported WebGL context version ' + majorVersion + '.' + minorVersion + '!'
            }
          } finally {
            canvas.removeEventListener('webglcontextcreationerror', onContextCreationError, false);
          }
          if (!ctx) throw ':(';
        } catch (e) {
          Module.print('Could not create canvas: ' + [errorInfo, e, JSON.stringify(webGLContextAttributes)]);
          return 0;
        }
        // possible GL_DEBUG entry point: ctx = wrapDebugGL(ctx);
  
        if (!ctx) return 0;
        return GL.registerContext(ctx, webGLContextAttributes);
      },registerContext:function (ctx, webGLContextAttributes) {
        var handle = GL.getNewId(GL.contexts);
        var context = {
          handle: handle,
          attributes: webGLContextAttributes,
          version: webGLContextAttributes['majorVersion'],
          GLctx: ctx
        };
  
  
        // Store the created context object so that we can access the context given a canvas without having to pass the parameters again.
        if (ctx.canvas) ctx.canvas.GLctxObject = context;
        GL.contexts[handle] = context;
        if (typeof webGLContextAttributes['enableExtensionsByDefault'] === 'undefined' || webGLContextAttributes['enableExtensionsByDefault']) {
          GL.initExtensions(context);
        }
        return handle;
      },makeContextCurrent:function (contextHandle) {
        var context = GL.contexts[contextHandle];
        if (!context) return false;
        GLctx = Module.ctx = context.GLctx; // Active WebGL context object.
        GL.currentContext = context; // Active Emscripten GL layer context object.
        return true;
      },getContext:function (contextHandle) {
        return GL.contexts[contextHandle];
      },deleteContext:function (contextHandle) {
        if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null;
        if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted.
        if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises.
        GL.contexts[contextHandle] = null;
      },initExtensions:function (context) {
        // If this function is called without a specific context object, init the extensions of the currently active context.
        if (!context) context = GL.currentContext;
  
        if (context.initExtensionsDone) return;
        context.initExtensionsDone = true;
  
        var GLctx = context.GLctx;
  
        context.maxVertexAttribs = GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS);
  
        // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist. 
  
        if (context.version < 2) {
          // Extension available from Firefox 26 and Google Chrome 30
          var instancedArraysExt = GLctx.getExtension('ANGLE_instanced_arrays');
          if (instancedArraysExt) {
            GLctx['vertexAttribDivisor'] = function(index, divisor) { instancedArraysExt['vertexAttribDivisorANGLE'](index, divisor); };
            GLctx['drawArraysInstanced'] = function(mode, first, count, primcount) { instancedArraysExt['drawArraysInstancedANGLE'](mode, first, count, primcount); };
            GLctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { instancedArraysExt['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); };
          }
  
          // Extension available from Firefox 25 and WebKit
          var vaoExt = GLctx.getExtension('OES_vertex_array_object');
          if (vaoExt) {
            GLctx['createVertexArray'] = function() { return vaoExt['createVertexArrayOES'](); };
            GLctx['deleteVertexArray'] = function(vao) { vaoExt['deleteVertexArrayOES'](vao); };
            GLctx['bindVertexArray'] = function(vao) { vaoExt['bindVertexArrayOES'](vao); };
            GLctx['isVertexArray'] = function(vao) { return vaoExt['isVertexArrayOES'](vao); };
          }
  
          var drawBuffersExt = GLctx.getExtension('WEBGL_draw_buffers');
          if (drawBuffersExt) {
            GLctx['drawBuffers'] = function(n, bufs) { drawBuffersExt['drawBuffersWEBGL'](n, bufs); };
          }
        }
  
        GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query");
  
        // These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and
        // should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working.
        // As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions
        // here, as long as they don't produce a performance impact for users that might not be using those extensions.
        // E.g. debugging-related extensions should probably be off by default.
        var automaticallyEnabledExtensions = [ "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives",
                                               "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture",
                                               "OES_element_index_uint", "EXT_texture_filter_anisotropic", "ANGLE_instanced_arrays",
                                               "OES_texture_float_linear", "OES_texture_half_float_linear", "WEBGL_compressed_texture_atc",
                                               "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float",
                                               "EXT_frag_depth", "EXT_sRGB", "WEBGL_draw_buffers", "WEBGL_shared_resources",
                                               "EXT_shader_texture_lod", "EXT_color_buffer_float"];
  
        function shouldEnableAutomatically(extension) {
          var ret = false;
          automaticallyEnabledExtensions.forEach(function(include) {
            if (ext.indexOf(include) != -1) {
              ret = true;
            }
          });
          return ret;
        }
  
        var exts = GLctx.getSupportedExtensions();
        if (exts && exts.length > 0) {
          GLctx.getSupportedExtensions().forEach(function(ext) {
            if (automaticallyEnabledExtensions.indexOf(ext) != -1) {
              GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled.
            }
          });
        }
      },populateUniformTable:function (program) {
        var p = GL.programs[program];
        GL.programInfos[program] = {
          uniforms: {},
          maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway.
          maxAttributeLength: -1, // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet.
          maxUniformBlockNameLength: -1 // Lazily computed as well
        };
  
        var ptable = GL.programInfos[program];
        var utable = ptable.uniforms;
        // A program's uniform table maps the string name of an uniform to an integer location of that uniform.
        // The global GL.uniforms map maps integer locations to WebGLUniformLocations.
        var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS);
        for (var i = 0; i < numUniforms; ++i) {
          var u = GLctx.getActiveUniform(p, i);
  
          var name = u.name;
          ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1);
  
          // Strip off any trailing array specifier we might have got, e.g. "[0]".
          if (name.indexOf(']', name.length-1) !== -1) {
            var ls = name.lastIndexOf('[');
            name = name.slice(0, ls);
          }
  
          // Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then 
          // only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i.
          // Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices.
          var loc = GLctx.getUniformLocation(p, name);
          if (loc != null)
          {
            var id = GL.getNewId(GL.uniforms);
            utable[name] = [u.size, id];
            GL.uniforms[id] = loc;
  
            for (var j = 1; j < u.size; ++j) {
              var n = name + '['+j+']';
              loc = GLctx.getUniformLocation(p, n);
              id = GL.getNewId(GL.uniforms);
  
              GL.uniforms[id] = loc;
            }
          }
        }
      }};function _emscripten_glIsRenderbuffer(renderbuffer) {
      var rb = GL.renderbuffers[renderbuffer];
      if (!rb) return 0;
      return GLctx.isRenderbuffer(rb);
    }

  function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) {
      program = GL.programs[program];
      var info = GLctx.getActiveAttrib(program, index);
      if (!info) return; // If an error occurs, nothing will be written to length, size and type and name.
  
      if (bufSize > 0 && name) {
        var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
      } else {
        if (length) HEAP32[((length)>>2)]=0;
      }
  
      if (size) HEAP32[((size)>>2)]=info.size;
      if (type) HEAP32[((type)>>2)]=info.type;
    }

  function _emscripten_glVertexAttrib3fv(index, v) {
  
      GLctx.vertexAttrib3f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2]);
    }

  function _emscripten_glLineWidth(x0) { GLctx['lineWidth'](x0) }

  function _emscripten_glGetString(name_) {
      if (GL.stringCache[name_]) return GL.stringCache[name_];
      var ret; 
      switch(name_) {
        case 0x1F00 /* GL_VENDOR */:
        case 0x1F01 /* GL_RENDERER */:
        case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
        case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
          ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL);
          break;
        case 0x1F02 /* GL_VERSION */:
          var glVersion = GLctx.getParameter(GLctx.VERSION);
          // return GLES version string corresponding to the version of the WebGL context
          {
            glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
          }
          ret = allocate(intArrayFromString(glVersion), 'i8', ALLOC_NORMAL);
          break;
        case 0x1F03 /* GL_EXTENSIONS */:
          var exts = GLctx.getSupportedExtensions();
          var gl_exts = [];
          for (var i = 0; i < exts.length; ++i) {
            gl_exts.push(exts[i]);
            gl_exts.push("GL_" + exts[i]);
          }
          ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
          break;
        case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
          var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
          // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
          var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
          var ver_num = glslVersion.match(ver_re);
          if (ver_num !== null) {
            if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
            glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
          }
          ret = allocate(intArrayFromString(glslVersion), 'i8', ALLOC_NORMAL);
          break;
        default:
          GL.recordError(0x0500/*GL_INVALID_ENUM*/);
          return 0;
      }
      GL.stringCache[name_] = ret;
      return ret;
    }

  function _emscripten_glGetAttribLocation(program, name) {
      program = GL.programs[program];
      name = Pointer_stringify(name);
      return GLctx.getAttribLocation(program, name);
    }

  function _emscripten_glRotatef() {
  Module['printErr']('missing function: emscripten_glRotatef'); abort(-1);
  }

  function _emscripten_glStencilFunc(x0, x1, x2) { GLctx['stencilFunc'](x0, x1, x2) }

  
  function emscriptenWebGLGet(name_, p, type) {
      // Guard against user passing a null pointer.
      // Note that GLES2 spec does not say anything about how passing a null pointer should be treated.
      // Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but
      // better to report an error instead of doing anything random.
      if (!p) {
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      var ret = undefined;
      switch(name_) { // Handle a few trivial GLES values
        case 0x8DFA: // GL_SHADER_COMPILER
          ret = 1;
          break;
        case 0x8DF8: // GL_SHADER_BINARY_FORMATS
          if (type !== 'Integer' && type !== 'Integer64') {
            GL.recordError(0x0500); // GL_INVALID_ENUM
          }
          return; // Do not write anything to the out pointer, since no binary formats are supported.
        case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS
          ret = 0;
          break;
        case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS
          // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length),
          // so implement it ourselves to allow C++ GLES2 code get the length.
          var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/);
          ret = formats.length;
          break;
      }
  
      if (ret === undefined) {
        var result = GLctx.getParameter(name_);
        switch (typeof(result)) {
          case "number":
            ret = result;
            break;
          case "boolean":
            ret = result ? 1 : 0;
            break;
          case "string":
            GL.recordError(0x0500); // GL_INVALID_ENUM
            return;
          case "object":
            if (result === null) {
              // null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise
              // can mean an invalid name_, which we need to report as an error
              switch(name_) {
                case 0x8894: // ARRAY_BUFFER_BINDING
                case 0x8B8D: // CURRENT_PROGRAM
                case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING
                case 0x8CA6: // FRAMEBUFFER_BINDING
                case 0x8CA7: // RENDERBUFFER_BINDING
                case 0x8069: // TEXTURE_BINDING_2D
                case 0x8514: { // TEXTURE_BINDING_CUBE_MAP
                  ret = 0;
                  break;
                }
                default: {
                  GL.recordError(0x0500); // GL_INVALID_ENUM
                  return;
                }
              }
            } else if (result instanceof Float32Array ||
                       result instanceof Uint32Array ||
                       result instanceof Int32Array ||
                       result instanceof Array) {
              for (var i = 0; i < result.length; ++i) {
                switch (type) {
                  case 'Integer': HEAP32[(((p)+(i*4))>>2)]=result[i];   break;
                  case 'Float':   HEAPF32[(((p)+(i*4))>>2)]=result[i]; break;
                  case 'Boolean': HEAP8[(((p)+(i))>>0)]=result[i] ? 1 : 0;    break;
                  default: throw 'internal glGet error, bad type: ' + type;
                }
              }
              return;
            } else if (result instanceof WebGLBuffer ||
                       result instanceof WebGLProgram ||
                       result instanceof WebGLFramebuffer ||
                       result instanceof WebGLRenderbuffer ||
                       result instanceof WebGLTexture) {
              ret = result.name | 0;
            } else {
              GL.recordError(0x0500); // GL_INVALID_ENUM
              return;
            }
            break;
          default:
            GL.recordError(0x0500); // GL_INVALID_ENUM
            return;
        }
      }
  
      switch (type) {
        case 'Integer64': (tempI64 = [ret>>>0,(tempDouble=ret,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((p)>>2)]=tempI64[0],HEAP32[(((p)+(4))>>2)]=tempI64[1]);    break;
        case 'Integer': HEAP32[((p)>>2)]=ret;    break;
        case 'Float':   HEAPF32[((p)>>2)]=ret;  break;
        case 'Boolean': HEAP8[((p)>>0)]=ret ? 1 : 0; break;
        default: throw 'internal glGet error, bad type: ' + type;
      }
    }function _emscripten_glGetIntegerv(name_, p) {
      emscriptenWebGLGet(name_, p, 'Integer');
    }

  function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) {
      var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname);
      HEAP32[((params)>>2)]=result;
    }

  function _emscripten_glVertexPointer(){ throw 'Legacy GL function (glVertexPointer) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }

  function _emscripten_glUniform3iv(location, count, value) {
  
  
      GLctx.uniform3iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*12)>>2));
    }

  function _emscripten_glShaderSource(shader, count, string, length) {
      var source = GL.getSource(shader, count, string, length);
  
  
      GLctx.shaderSource(GL.shaders[shader], source);
    }

  function _emscripten_glIsFramebuffer(framebuffer) {
      var fb = GL.framebuffers[framebuffer];
      if (!fb) return 0;
      return GLctx.isFramebuffer(fb);
    }

  function _emscripten_glClientActiveTexture() {
  Module['printErr']('missing function: emscripten_glClientActiveTexture'); abort(-1);
  }

  function _emscripten_glReleaseShaderCompiler() {
      // NOP (as allowed by GLES 2.0 spec)
    }

  function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) {
      var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
      if (log === null) log = '(unknown error)';
      if (maxLength > 0 && infoLog) {
        var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
      } else {
        if (length) HEAP32[((length)>>2)]=0;
      }
    }

  function _emscripten_glIsTexture(texture) {
      var texture = GL.textures[texture];
      if (!texture) return 0;
      return GLctx.isTexture(texture);
    }

  function _emscripten_glTexParameterf(x0, x1, x2) { GLctx['texParameterf'](x0, x1, x2) }

  function _emscripten_glGetRenderbufferParameteriv(target, pname, params) {
      if (!params) {
        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
        // if params == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      HEAP32[((params)>>2)]=GLctx.getRenderbufferParameter(target, pname);
    }

  function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { GLctx['stencilOpSeparate'](x0, x1, x2, x3) }

  function _emscripten_glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) }

  
  
  function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) {
      function roundedToNextMultipleOf(x, y) {
        return Math.floor((x + y - 1) / y) * y
      }
      var plainRowSize = width * sizePerPixel;
      var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
      return (height <= 0) ? 0 :
               ((height - 1) * alignedRowSize + plainRowSize);
    }function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) {
      var sizePerPixel;
      var numChannels;
      switch(format) {
        case 0x1906 /* GL_ALPHA */:
        case 0x1909 /* GL_LUMINANCE */:
        case 0x1902 /* GL_DEPTH_COMPONENT */:
          numChannels = 1;
          break;
        case 0x190A /* GL_LUMINANCE_ALPHA */:
          numChannels = 2;
          break;
        case 0x1907 /* GL_RGB */:
        case 0x8C40 /* GL_SRGB_EXT */:
          numChannels = 3;
          break;
        case 0x1908 /* GL_RGBA */:
        case 0x8C42 /* GL_SRGB_ALPHA_EXT */:
          numChannels = 4;
          break;
        default:
          GL.recordError(0x0500); // GL_INVALID_ENUM
          return null;
      }
      switch (type) {
        case 0x1401 /* GL_UNSIGNED_BYTE */:
          sizePerPixel = numChannels*1;
          break;
        case 0x1403 /* GL_UNSIGNED_SHORT */:
        case 0x8D61 /* GL_HALF_FLOAT_OES */:
          sizePerPixel = numChannels*2;
          break;
        case 0x1405 /* GL_UNSIGNED_INT */:
        case 0x1406 /* GL_FLOAT */:
          sizePerPixel = numChannels*4;
          break;
        case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */:
          sizePerPixel = 4;
          break;
        case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
        case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
        case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
          sizePerPixel = 2;
          break;
        default:
          GL.recordError(0x0500); // GL_INVALID_ENUM
          return null;
      }
      var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment);
      switch(type) {
        case 0x1401 /* GL_UNSIGNED_BYTE */:
          return HEAPU8.subarray((pixels),(pixels+bytes));
        case 0x1406 /* GL_FLOAT */:
          return HEAPF32.subarray((pixels)>>2,(pixels+bytes)>>2);
        case 0x1405 /* GL_UNSIGNED_INT */:
        case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */:
          return HEAPU32.subarray((pixels)>>2,(pixels+bytes)>>2);
        case 0x1403 /* GL_UNSIGNED_SHORT */:
        case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
        case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
        case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
        case 0x8D61 /* GL_HALF_FLOAT_OES */:
          return HEAPU16.subarray((pixels)>>1,(pixels+bytes)>>1);
        default:
          GL.recordError(0x0500); // GL_INVALID_ENUM
          return null;
      }
    }function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) {
      var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
      if (!pixelData) {
        GL.recordError(0x0500/*GL_INVALID_ENUM*/);
        return;
      }
      GLctx.readPixels(x, y, width, height, format, type, pixelData);
    }

  function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) {
      GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
    }

  function _emscripten_glGetError() {
      // First return any GL error generated by the emscripten library_gl.js interop layer.
      if (GL.lastError) {
        var error = GL.lastError;
        GL.lastError = 0/*GL_NO_ERROR*/;
        return error;
      } else { // If there were none, return the GL error from the browser GL context.
        return GLctx.getError();
      }
    }

  function _emscripten_glUniform4f(location, v0, v1, v2, v3) {
      GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3);
    }

  function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) {
      GLctx.framebufferTexture2D(target, attachment, textarget,
                                      GL.textures[texture], level);
    }

  function _emscripten_glFrustum() {
  Module['printErr']('missing function: emscripten_glFrustum'); abort(-1);
  }

  function _emscripten_glGetTexParameterfv(target, pname, params) {
      if (!params) {
        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
        // if p == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      HEAPF32[((params)>>2)]=GLctx.getTexParameter(target, pname);
    }

  function _emscripten_glUniform4i(location, v0, v1, v2, v3) {
      GLctx.uniform4i(GL.uniforms[location], v0, v1, v2, v3);
    }

  function _emscripten_glIsEnabled(x0) { return GLctx['isEnabled'](x0) }

  function _emscripten_glBindRenderbuffer(target, renderbuffer) {
      GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null);
    }

  function _emscripten_glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) }

  
  function _emscripten_memcpy_big(dest, src, num) {
      HEAPU8.set(HEAPU8.subarray(src, src+num), dest);
      return dest;
    } 
  Module["_memcpy"] = _memcpy;

  function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }

  function _emscripten_glTexParameterfv(target, pname, params) {
      var param = HEAPF32[((params)>>2)];
      GLctx.texParameterf(target, pname, param);
    }

  function _emscripten_glClearDepthf(x0) { GLctx['clearDepth'](x0) }

  function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx['vertexAttrib4f'](x0, x1, x2, x3, x4) }

  
  
   
  Module["_i64Add"] = _i64Add;
  
   
  Module["_i64Subtract"] = _i64Subtract;
  
  var cttz_i8 = allocate([8,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,7,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0], "i8", ALLOC_STATIC); 
  Module["_llvm_cttz_i32"] = _llvm_cttz_i32; 
  Module["___udivmoddi4"] = ___udivmoddi4; 
  Module["___uremdi3"] = ___uremdi3;

  function _emscripten_glLinkProgram(program) {
      GLctx.linkProgram(GL.programs[program]);
      GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
      GL.populateUniformTable(program);
    }

  function _emscripten_glUniform3f(location, v0, v1, v2) {
      GLctx.uniform3f(GL.uniforms[location], v0, v1, v2);
    }

  function _emscripten_glGetObjectParameterivARB() {
  Module['printErr']('missing function: emscripten_glGetObjectParameterivARB'); abort(-1);
  }

  function _emscripten_glClear(x0) { GLctx['clear'](x0) }

  function _emscripten_glUniform3i(location, v0, v1, v2) {
      GLctx.uniform3i(GL.uniforms[location], v0, v1, v2);
    }

  function _emscripten_glStencilOp(x0, x1, x2) { GLctx['stencilOp'](x0, x1, x2) }

  function _emscripten_glBindAttribLocation(program, index, name) {
      name = Pointer_stringify(name);
      GLctx.bindAttribLocation(GL.programs[program], index, name);
    }

  function _emscripten_glBindBuffer(target, buffer) {
      var bufferObj = buffer ? GL.buffers[buffer] : null;
  
  
      GLctx.bindBuffer(target, bufferObj);
    }

  function _emscripten_glEnableVertexAttribArray(index) {
      GLctx.enableVertexAttribArray(index);
    }

   
  Module["_memset"] = _memset;

  
  function emscriptenWebGLGetUniform(program, location, params, type) {
      if (!params) {
        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
        // if params == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]);
      if (typeof data == 'number' || typeof data == 'boolean') {
        switch (type) {
          case 'Integer': HEAP32[((params)>>2)]=data; break;
          case 'Float': HEAPF32[((params)>>2)]=data; break;
          default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
        }
      } else {
        for (var i = 0; i < data.length; i++) {
          switch (type) {
            case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break;
            case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break;
            default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
          }
        }
      }
    }function _emscripten_glGetUniformfv(program, location, params) {
      emscriptenWebGLGetUniform(program, location, params, 'Float');
    }

  function _emscripten_glUniform1i(location, v0) {
      GLctx.uniform1i(GL.uniforms[location], v0);
    }

  function _emscripten_glGetProgramiv(program, pname, p) {
      if (!p) {
        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
        // if p == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
  
      if (program >= GL.counter) {
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
  
      var ptable = GL.programInfos[program];
      if (!ptable) {
        GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
        return;
      }
  
      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
        var log = GLctx.getProgramInfoLog(GL.programs[program]);
        if (log === null) log = '(unknown error)';
        HEAP32[((p)>>2)]=log.length + 1;
      } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
        HEAP32[((p)>>2)]=ptable.maxUniformLength;
      } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
        if (ptable.maxAttributeLength == -1) {
          var program = GL.programs[program];
          var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
          ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
          for (var i = 0; i < numAttribs; ++i) {
            var activeAttrib = GLctx.getActiveAttrib(program, i);
            ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
          }
        }
        HEAP32[((p)>>2)]=ptable.maxAttributeLength;
      } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
        if (ptable.maxUniformBlockNameLength == -1) {
          var program = GL.programs[program];
          var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS);
          ptable.maxUniformBlockNameLength = 0;
          for (var i = 0; i < numBlocks; ++i) {
            var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
            ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1);
          }
        }
        HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength;
      } else {
        HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
      }
    }

  function _emscripten_glGetBufferParameteriv(target, value, data) {
      if (!data) {
        // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense
        // if data == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      HEAP32[((data)>>2)]=GLctx.getBufferParameter(target, value);
    }

  function _emscripten_glDrawRangeElements() {
  Module['printErr']('missing function: emscripten_glDrawRangeElements'); abort(-1);
  }

  function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) {
      var result = GLctx.getAttachedShaders(GL.programs[program]);
      var len = result.length;
      if (len > maxCount) {
        len = maxCount;
      }
      HEAP32[((count)>>2)]=len;
      for (var i = 0; i < len; ++i) {
        var id = GL.shaders.indexOf(result[i]);
        HEAP32[(((shaders)+(i*4))>>2)]=id;
      }
    }

  function _emscripten_glGenRenderbuffers(n, renderbuffers) {
      for (var i = 0; i < n; i++) {
        var renderbuffer = GLctx.createRenderbuffer();
        if (!renderbuffer) {
          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
          while(i < n) HEAP32[(((renderbuffers)+(i++*4))>>2)]=0;
          return;
        }
        var id = GL.getNewId(GL.renderbuffers);
        renderbuffer.name = id;
        GL.renderbuffers[id] = renderbuffer;
        HEAP32[(((renderbuffers)+(i*4))>>2)]=id;
      }
    }

  function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { GLctx['blendFuncSeparate'](x0, x1, x2, x3) }

  function _emscripten_glFrontFace(x0) { GLctx['frontFace'](x0) }

  function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) {
      if (!pointer) {
        // GLES2 specification does not specify how to behave if pointer is a null pointer. Since calling this function does not make sense
        // if pointer == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      HEAP32[((pointer)>>2)]=GLctx.getVertexAttribOffset(index, pname);
    }

  function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { GLctx['vertexAttrib3f'](x0, x1, x2, x3) }

  function _emscripten_glUniform1iv(location, count, value) {
  
  
      GLctx.uniform1iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*4)>>2));
    }

  function _emscripten_glTexCoordPointer() {
  Module['printErr']('missing function: emscripten_glTexCoordPointer'); abort(-1);
  }

  function _emscripten_glEnable(x0) { GLctx['enable'](x0) }

  function _emscripten_glGetInfoLogARB() {
  Module['printErr']('missing function: emscripten_glGetInfoLogARB'); abort(-1);
  }

  function _emscripten_glNormalPointer() {
  Module['printErr']('missing function: emscripten_glNormalPointer'); abort(-1);
  }

  function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { GLctx['renderbufferStorage'](x0, x1, x2, x3) }

  
  function emscriptenWebGLGetVertexAttrib(index, pname, params, type) {
      if (!params) {
        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
        // if params == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      var data = GLctx.getVertexAttrib(index, pname);
      if (pname == 0x889F/*VERTEX_ATTRIB_ARRAY_BUFFER_BINDING*/) {
        HEAP32[((params)>>2)]=data["name"];
      } else if (typeof data == 'number' || typeof data == 'boolean') {
        switch (type) {
          case 'Integer': HEAP32[((params)>>2)]=data; break;
          case 'Float': HEAPF32[((params)>>2)]=data; break;
          case 'FloatToInteger': HEAP32[((params)>>2)]=Math.fround(data); break;
          default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
        }
      } else {
        for (var i = 0; i < data.length; i++) {
          switch (type) {
            case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break;
            case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break;
            case 'FloatToInteger': HEAP32[(((params)+(i))>>2)]=Math.fround(data[i]); break;
            default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
          }
        }
      }
    }function _emscripten_glGetVertexAttribfv(index, pname, params) {
      // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
      // otherwise the results are undefined. (GLES3 spec 6.1.12)
      emscriptenWebGLGetVertexAttrib(index, pname, params, 'Float');
    }

  function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexSubImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }

  function _emscripten_glDepthRange(x0, x1) { GLctx['depthRange'](x0, x1) }

  function _emscripten_glTexParameteriv(target, pname, params) {
      var param = HEAP32[((params)>>2)];
      GLctx.texParameteri(target, pname, param);
    }

  function _emscripten_glDeleteShader(id) {
      if (!id) return;
      var shader = GL.shaders[id];
      if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      GLctx.deleteShader(shader);
      GL.shaders[id] = null;
    }

  function ____js_alert() {
  		alert("An Odin script has crashed!");
  		debugger;
  	}

  function _emscripten_glDrawArraysInstanced(mode, first, count, primcount) {
      GLctx['drawArraysInstanced'](mode, first, count, primcount);
    }

  function _emscripten_glDeleteBuffers(n, buffers) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((buffers)+(i*4))>>2)];
        var buffer = GL.buffers[id];
  
        // From spec: "glDeleteBuffers silently ignores 0's and names that do not
        // correspond to existing buffer objects."
        if (!buffer) continue;
  
        GLctx.deleteBuffer(buffer);
        buffer.name = 0;
        GL.buffers[id] = null;
  
        if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
        if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
      }
    }

  function _emscripten_glIsProgram(program) {
      var program = GL.programs[program];
      if (!program) return 0;
      return GLctx.isProgram(program);
    }

  function _emscripten_glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) }

  function _emscripten_glUniformMatrix2fv(location, count, transpose, value) {
  
  
      var view;
      if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[4*count-1];
        for (var i = 0; i < 4*count; i += 4) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
      }
      GLctx.uniformMatrix2fv(GL.uniforms[location], !!transpose, view);
    }

  
  
  
  var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};
  
  var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can   access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};
  
  function ___setErrNo(value) {
      if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value;
      return value;
    }
  
  var PATH={splitPath:function (filename) {
        var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
        return splitPathRe.exec(filename).slice(1);
      },normalizeArray:function (parts, allowAboveRoot) {
        // if the path tries to go above the root, `up` ends up > 0
        var up = 0;
        for (var i = parts.length - 1; i >= 0; i--) {
          var last = parts[i];
          if (last === '.') {
            parts.splice(i, 1);
          } else if (last === '..') {
            parts.splice(i, 1);
            up++;
          } else if (up) {
            parts.splice(i, 1);
            up--;
          }
        }
        // if the path is allowed to go above the root, restore leading ..s
        if (allowAboveRoot) {
          for (; up--; up) {
            parts.unshift('..');
          }
        }
        return parts;
      },normalize:function (path) {
        var isAbsolute = path.charAt(0) === '/',
            trailingSlash = path.substr(-1) === '/';
        // Normalize the path
        path = PATH.normalizeArray(path.split('/').filter(function(p) {
          return !!p;
        }), !isAbsolute).join('/');
        if (!path && !isAbsolute) {
          path = '.';
        }
        if (path && trailingSlash) {
          path += '/';
        }
        return (isAbsolute ? '/' : '') + path;
      },dirname:function (path) {
        var result = PATH.splitPath(path),
            root = result[0],
            dir = result[1];
        if (!root && !dir) {
          // No dirname whatsoever
          return '.';
        }
        if (dir) {
          // It has a dirname, strip trailing slash
          dir = dir.substr(0, dir.length - 1);
        }
        return root + dir;
      },basename:function (path) {
        // EMSCRIPTEN return '/'' for '/', not an empty string
        if (path === '/') return '/';
        var lastSlash = path.lastIndexOf('/');
        if (lastSlash === -1) return path;
        return path.substr(lastSlash+1);
      },extname:function (path) {
        return PATH.splitPath(path)[3];
      },join:function () {
        var paths = Array.prototype.slice.call(arguments, 0);
        return PATH.normalize(paths.join('/'));
      },join2:function (l, r) {
        return PATH.normalize(l + '/' + r);
      },resolve:function () {
        var resolvedPath = '',
          resolvedAbsolute = false;
        for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
          var path = (i >= 0) ? arguments[i] : FS.cwd();
          // Skip empty and invalid entries
          if (typeof path !== 'string') {
            throw new TypeError('Arguments to path.resolve must be strings');
          } else if (!path) {
            return ''; // an invalid portion invalidates the whole thing
          }
          resolvedPath = path + '/' + resolvedPath;
          resolvedAbsolute = path.charAt(0) === '/';
        }
        // At this point the path should be resolved to a full absolute path, but
        // handle relative paths to be safe (might happen when process.cwd() fails)
        resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) {
          return !!p;
        }), !resolvedAbsolute).join('/');
        return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
      },relative:function (from, to) {
        from = PATH.resolve(from).substr(1);
        to = PATH.resolve(to).substr(1);
        function trim(arr) {
          var start = 0;
          for (; start < arr.length; start++) {
            if (arr[start] !== '') break;
          }
          var end = arr.length - 1;
          for (; end >= 0; end--) {
            if (arr[end] !== '') break;
          }
          if (start > end) return [];
          return arr.slice(start, end - start + 1);
        }
        var fromParts = trim(from.split('/'));
        var toParts = trim(to.split('/'));
        var length = Math.min(fromParts.length, toParts.length);
        var samePartsLength = length;
        for (var i = 0; i < length; i++) {
          if (fromParts[i] !== toParts[i]) {
            samePartsLength = i;
            break;
          }
        }
        var outputParts = [];
        for (var i = samePartsLength; i < fromParts.length; i++) {
          outputParts.push('..');
        }
        outputParts = outputParts.concat(toParts.slice(samePartsLength));
        return outputParts.join('/');
      }};
  
  var TTY={ttys:[],init:function () {
        // https://github.com/kripken/emscripten/pull/1555
        // if (ENVIRONMENT_IS_NODE) {
        //   // currently, FS.init does not distinguish if process.stdin is a file or TTY
        //   // device, it always assumes it's a TTY device. because of this, we're forcing
        //   // process.stdin to UTF8 encoding to at least make stdin reading compatible
        //   // with text files until FS.init can be refactored.
        //   process['stdin']['setEncoding']('utf8');
        // }
      },shutdown:function () {
        // https://github.com/kripken/emscripten/pull/1555
        // if (ENVIRONMENT_IS_NODE) {
        //   // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
        //   // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
        //   // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
        //   // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
        //   // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
        //   process['stdin']['pause']();
        // }
      },register:function (dev, ops) {
        TTY.ttys[dev] = { input: [], output: [], ops: ops };
        FS.registerDevice(dev, TTY.stream_ops);
      },stream_ops:{open:function (stream) {
          var tty = TTY.ttys[stream.node.rdev];
          if (!tty) {
            throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
          }
          stream.tty = tty;
          stream.seekable = false;
        },close:function (stream) {
          // flush any pending line data
          stream.tty.ops.flush(stream.tty);
        },flush:function (stream) {
          stream.tty.ops.flush(stream.tty);
        },read:function (stream, buffer, offset, length, pos /* ignored */) {
          if (!stream.tty || !stream.tty.ops.get_char) {
            throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
          }
          var bytesRead = 0;
          for (var i = 0; i < length; i++) {
            var result;
            try {
              result = stream.tty.ops.get_char(stream.tty);
            } catch (e) {
              throw new FS.ErrnoError(ERRNO_CODES.EIO);
            }
            if (result === undefined && bytesRead === 0) {
              throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
            }
            if (result === null || result === undefined) break;
            bytesRead++;
            buffer[offset+i] = result;
          }
          if (bytesRead) {
            stream.node.timestamp = Date.now();
          }
          return bytesRead;
        },write:function (stream, buffer, offset, length, pos) {
          if (!stream.tty || !stream.tty.ops.put_char) {
            throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
          }
          for (var i = 0; i < length; i++) {
            try {
              stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
            } catch (e) {
              throw new FS.ErrnoError(ERRNO_CODES.EIO);
            }
          }
          if (length) {
            stream.node.timestamp = Date.now();
          }
          return i;
        }},default_tty_ops:{get_char:function (tty) {
          if (!tty.input.length) {
            var result = null;
            if (ENVIRONMENT_IS_NODE) {
              // we will read data by chunks of BUFSIZE
              var BUFSIZE = 256;
              var buf = new Buffer(BUFSIZE);
              var bytesRead = 0;
  
              var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion
  
              var fd = process.stdin.fd;
              if (isPosixPlatform) {
                // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync)
                var usingDevice = false;
                try {
                  fd = fs.openSync('/dev/stdin', 'r');
                  usingDevice = true;
                } catch (e) {}
              }
  
              try {
                bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null);
              } catch(e) {
                // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
                // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
                if (e.toString().indexOf('EOF') != -1) bytesRead = 0;
                else throw e;
              }
  
              if (usingDevice) { fs.closeSync(fd); }
              if (bytesRead > 0) {
                result = buf.slice(0, bytesRead).toString('utf-8');
              } else {
                result = null;
              }
  
            } else if (typeof window != 'undefined' &&
              typeof window.prompt == 'function') {
              // Browser.
              result = window.prompt('Input: ');  // returns null on cancel
              if (result !== null) {
                result += '\n';
              }
            } else if (typeof readline == 'function') {
              // Command line.
              result = readline();
              if (result !== null) {
                result += '\n';
              }
            }
            if (!result) {
              return null;
            }
            tty.input = intArrayFromString(result, true);
          }
          return tty.input.shift();
        },put_char:function (tty, val) {
          if (val === null || val === 10) {
            Module['print'](UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          } else {
            if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
          }
        },flush:function (tty) {
          if (tty.output && tty.output.length > 0) {
            Module['print'](UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          }
        }},default_tty1_ops:{put_char:function (tty, val) {
          if (val === null || val === 10) {
            Module['printErr'](UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          } else {
            if (val != 0) tty.output.push(val);
          }
        },flush:function (tty) {
          if (tty.output && tty.output.length > 0) {
            Module['printErr'](UTF8ArrayToString(tty.output, 0));
            tty.output = [];
          }
        }}};
  
  var MEMFS={ops_table:null,mount:function (mount) {
        return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
      },createNode:function (parent, name, mode, dev) {
        if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
          // no supported
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (!MEMFS.ops_table) {
          MEMFS.ops_table = {
            dir: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr,
                lookup: MEMFS.node_ops.lookup,
                mknod: MEMFS.node_ops.mknod,
                rename: MEMFS.node_ops.rename,
                unlink: MEMFS.node_ops.unlink,
                rmdir: MEMFS.node_ops.rmdir,
                readdir: MEMFS.node_ops.readdir,
                symlink: MEMFS.node_ops.symlink
              },
              stream: {
                llseek: MEMFS.stream_ops.llseek
              }
            },
            file: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr
              },
              stream: {
                llseek: MEMFS.stream_ops.llseek,
                read: MEMFS.stream_ops.read,
                write: MEMFS.stream_ops.write,
                allocate: MEMFS.stream_ops.allocate,
                mmap: MEMFS.stream_ops.mmap,
                msync: MEMFS.stream_ops.msync
              }
            },
            link: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr,
                readlink: MEMFS.node_ops.readlink
              },
              stream: {}
            },
            chrdev: {
              node: {
                getattr: MEMFS.node_ops.getattr,
                setattr: MEMFS.node_ops.setattr
              },
              stream: FS.chrdev_stream_ops
            }
          };
        }
        var node = FS.createNode(parent, name, mode, dev);
        if (FS.isDir(node.mode)) {
          node.node_ops = MEMFS.ops_table.dir.node;
          node.stream_ops = MEMFS.ops_table.dir.stream;
          node.contents = {};
        } else if (FS.isFile(node.mode)) {
          node.node_ops = MEMFS.ops_table.file.node;
          node.stream_ops = MEMFS.ops_table.file.stream;
          node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
          // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
          // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
          // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
          node.contents = null; 
        } else if (FS.isLink(node.mode)) {
          node.node_ops = MEMFS.ops_table.link.node;
          node.stream_ops = MEMFS.ops_table.link.stream;
        } else if (FS.isChrdev(node.mode)) {
          node.node_ops = MEMFS.ops_table.chrdev.node;
          node.stream_ops = MEMFS.ops_table.chrdev.stream;
        }
        node.timestamp = Date.now();
        // add the new node to the parent
        if (parent) {
          parent.contents[name] = node;
        }
        return node;
      },getFileDataAsRegularArray:function (node) {
        if (node.contents && node.contents.subarray) {
          var arr = [];
          for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
          return arr; // Returns a copy of the original data.
        }
        return node.contents; // No-op, the file contents are already in a JS array. Return as-is.
      },getFileDataAsTypedArray:function (node) {
        if (!node.contents) return new Uint8Array;
        if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
        return new Uint8Array(node.contents);
      },expandFileStorage:function (node, newCapacity) {
        // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file
        // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to
        // increase the size.
        if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
          node.contents = MEMFS.getFileDataAsRegularArray(node);
          node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it.
        }
  
        if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well.
          var prevCapacity = node.contents ? node.contents.length : 0;
          if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
          // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
          // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
          // avoid overshooting the allocation cap by a very large margin.
          var CAPACITY_DOUBLING_MAX = 1024 * 1024;
          newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0);
          if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
          var oldContents = node.contents;
          node.contents = new Uint8Array(newCapacity); // Allocate new storage.
          if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
          return;
        }
        // Not using a typed array to back the file storage. Use a standard JS array instead.
        if (!node.contents && newCapacity > 0) node.contents = [];
        while (node.contents.length < newCapacity) node.contents.push(0);
      },resizeFileStorage:function (node, newSize) {
        if (node.usedBytes == newSize) return;
        if (newSize == 0) {
          node.contents = null; // Fully decommit when requesting a resize to zero.
          node.usedBytes = 0;
          return;
        }
        if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store.
          var oldContents = node.contents;
          node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage.
          if (oldContents) {
            node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
          }
          node.usedBytes = newSize;
          return;
        }
        // Backing with a JS array.
        if (!node.contents) node.contents = [];
        if (node.contents.length > newSize) node.contents.length = newSize;
        else while (node.contents.length < newSize) node.contents.push(0);
        node.usedBytes = newSize;
      },node_ops:{getattr:function (node) {
          var attr = {};
          // device numbers reuse inode numbers.
          attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
          attr.ino = node.id;
          attr.mode = node.mode;
          attr.nlink = 1;
          attr.uid = 0;
          attr.gid = 0;
          attr.rdev = node.rdev;
          if (FS.isDir(node.mode)) {
            attr.size = 4096;
          } else if (FS.isFile(node.mode)) {
            attr.size = node.usedBytes;
          } else if (FS.isLink(node.mode)) {
            attr.size = node.link.length;
          } else {
            attr.size = 0;
          }
          attr.atime = new Date(node.timestamp);
          attr.mtime = new Date(node.timestamp);
          attr.ctime = new Date(node.timestamp);
          // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
          //       but this is not required by the standard.
          attr.blksize = 4096;
          attr.blocks = Math.ceil(attr.size / attr.blksize);
          return attr;
        },setattr:function (node, attr) {
          if (attr.mode !== undefined) {
            node.mode = attr.mode;
          }
          if (attr.timestamp !== undefined) {
            node.timestamp = attr.timestamp;
          }
          if (attr.size !== undefined) {
            MEMFS.resizeFileStorage(node, attr.size);
          }
        },lookup:function (parent, name) {
          throw FS.genericErrors[ERRNO_CODES.ENOENT];
        },mknod:function (parent, name, mode, dev) {
          return MEMFS.createNode(parent, name, mode, dev);
        },rename:function (old_node, new_dir, new_name) {
          // if we're overwriting a directory at new_name, make sure it's empty.
          if (FS.isDir(old_node.mode)) {
            var new_node;
            try {
              new_node = FS.lookupNode(new_dir, new_name);
            } catch (e) {
            }
            if (new_node) {
              for (var i in new_node.contents) {
                throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
              }
            }
          }
          // do the internal rewiring
          delete old_node.parent.contents[old_node.name];
          old_node.name = new_name;
          new_dir.contents[new_name] = old_node;
          old_node.parent = new_dir;
        },unlink:function (parent, name) {
          delete parent.contents[name];
        },rmdir:function (parent, name) {
          var node = FS.lookupNode(parent, name);
          for (var i in node.contents) {
            throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
          }
          delete parent.contents[name];
        },readdir:function (node) {
          var entries = ['.', '..']
          for (var key in node.contents) {
            if (!node.contents.hasOwnProperty(key)) {
              continue;
            }
            entries.push(key);
          }
          return entries;
        },symlink:function (parent, newname, oldpath) {
          var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
          node.link = oldpath;
          return node;
        },readlink:function (node) {
          if (!FS.isLink(node.mode)) {
            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
          }
          return node.link;
        }},stream_ops:{read:function (stream, buffer, offset, length, position) {
          var contents = stream.node.contents;
          if (position >= stream.node.usedBytes) return 0;
          var size = Math.min(stream.node.usedBytes - position, length);
          assert(size >= 0);
          if (size > 8 && contents.subarray) { // non-trivial, and typed array
            buffer.set(contents.subarray(position, position + size), offset);
          } else {
            for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
          }
          return size;
        },write:function (stream, buffer, offset, length, position, canOwn) {
          if (!length) return 0;
          var node = stream.node;
          node.timestamp = Date.now();
  
          if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
            if (canOwn) {
              node.contents = buffer.subarray(offset, offset + length);
              node.usedBytes = length;
              return length;
            } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
              node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
              node.usedBytes = length;
              return length;
            } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
              node.contents.set(buffer.subarray(offset, offset + length), position);
              return length;
            }
          }
  
          // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
          MEMFS.expandFileStorage(node, position+length);
          if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available.
          else {
            for (var i = 0; i < length; i++) {
             node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
            }
          }
          node.usedBytes = Math.max(node.usedBytes, position+length);
          return length;
        },llseek:function (stream, offset, whence) {
          var position = offset;
          if (whence === 1) {  // SEEK_CUR.
            position += stream.position;
          } else if (whence === 2) {  // SEEK_END.
            if (FS.isFile(stream.node.mode)) {
              position += stream.node.usedBytes;
            }
          }
          if (position < 0) {
            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
          }
          return position;
        },allocate:function (stream, offset, length) {
          MEMFS.expandFileStorage(stream.node, offset + length);
          stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
        },mmap:function (stream, buffer, offset, length, position, prot, flags) {
          if (!FS.isFile(stream.node.mode)) {
            throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
          }
          var ptr;
          var allocated;
          var contents = stream.node.contents;
          // Only make a new copy when MAP_PRIVATE is specified.
          if ( !(flags & 2) &&
                (contents.buffer === buffer || contents.buffer === buffer.buffer) ) {
            // We can't emulate MAP_SHARED when the file is not backed by the buffer
            // we're mapping to (e.g. the HEAP buffer).
            allocated = false;
            ptr = contents.byteOffset;
          } else {
            // Try to avoid unnecessary slices.
            if (position > 0 || position + length < stream.node.usedBytes) {
              if (contents.subarray) {
                contents = contents.subarray(position, position + length);
              } else {
                contents = Array.prototype.slice.call(contents, position, position + length);
              }
            }
            allocated = true;
            ptr = _malloc(length);
            if (!ptr) {
              throw new FS.ErrnoError(ERRNO_CODES.ENOMEM);
            }
            buffer.set(contents, ptr);
          }
          return { ptr: ptr, allocated: allocated };
        },msync:function (stream, buffer, offset, length, mmapFlags) {
          if (!FS.isFile(stream.node.mode)) {
            throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
          }
          if (mmapFlags & 2) {
            // MAP_PRIVATE calls need not to be synced back to underlying fs
            return 0;
          }
  
          var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
          // should we check if bytesWritten and length are the same?
          return 0;
        }}};
  
  var IDBFS={dbs:{},indexedDB:function () {
        if (typeof indexedDB !== 'undefined') return indexedDB;
        var ret = null;
        if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
        assert(ret, 'IDBFS used, but indexedDB not supported');
        return ret;
      },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) {
        // reuse all of the core MEMFS functionality
        return MEMFS.mount.apply(null, arguments);
      },syncfs:function (mount, populate, callback) {
        IDBFS.getLocalSet(mount, function(err, local) {
          if (err) return callback(err);
  
          IDBFS.getRemoteSet(mount, function(err, remote) {
            if (err) return callback(err);
  
            var src = populate ? remote : local;
            var dst = populate ? local : remote;
  
            IDBFS.reconcile(src, dst, callback);
          });
        });
      },getDB:function (name, callback) {
        // check the cache first
        var db = IDBFS.dbs[name];
        if (db) {
          return callback(null, db);
        }
  
        var req;
        try {
          req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
        } catch (e) {
          return callback(e);
        }
        if (!req) {
          return callback("Unable to connect to IndexedDB");
        }
        req.onupgradeneeded = function(e) {
          var db = e.target.result;
          var transaction = e.target.transaction;
  
          var fileStore;
  
          if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
            fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
          } else {
            fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
          }
  
          if (!fileStore.indexNames.contains('timestamp')) {
            fileStore.createIndex('timestamp', 'timestamp', { unique: false });
          }
        };
        req.onsuccess = function() {
          db = req.result;
  
          // add to the cache
          IDBFS.dbs[name] = db;
          callback(null, db);
        };
        req.onerror = function(e) {
          callback(this.error);
          e.preventDefault();
        };
      },getLocalSet:function (mount, callback) {
        var entries = {};
  
        function isRealDir(p) {
          return p !== '.' && p !== '..';
        };
        function toAbsolute(root) {
          return function(p) {
            return PATH.join2(root, p);
          }
        };
  
        var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
  
        while (check.length) {
          var path = check.pop();
          var stat;
  
          try {
            stat = FS.stat(path);
          } catch (e) {
            return callback(e);
          }
  
          if (FS.isDir(stat.mode)) {
            check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
          }
  
          entries[path] = { timestamp: stat.mtime };
        }
  
        return callback(null, { type: 'local', entries: entries });
      },getRemoteSet:function (mount, callback) {
        var entries = {};
  
        IDBFS.getDB(mount.mountpoint, function(err, db) {
          if (err) return callback(err);
  
          var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly');
          transaction.onerror = function(e) {
            callback(this.error);
            e.preventDefault();
          };
  
          var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
          var index = store.index('timestamp');
  
          index.openKeyCursor().onsuccess = function(event) {
            var cursor = event.target.result;
  
            if (!cursor) {
              return callback(null, { type: 'remote', db: db, entries: entries });
            }
  
            entries[cursor.primaryKey] = { timestamp: cursor.key };
  
            cursor.continue();
          };
        });
      },loadLocalEntry:function (path, callback) {
        var stat, node;
  
        try {
          var lookup = FS.lookupPath(path);
          node = lookup.node;
          stat = FS.stat(path);
        } catch (e) {
          return callback(e);
        }
  
        if (FS.isDir(stat.mode)) {
          return callback(null, { timestamp: stat.mtime, mode: stat.mode });
        } else if (FS.isFile(stat.mode)) {
          // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
          // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
          node.contents = MEMFS.getFileDataAsTypedArray(node);
          return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents });
        } else {
          return callback(new Error('node type not supported'));
        }
      },storeLocalEntry:function (path, entry, callback) {
        try {
          if (FS.isDir(entry.mode)) {
            FS.mkdir(path, entry.mode);
          } else if (FS.isFile(entry.mode)) {
            FS.writeFile(path, entry.contents, { encoding: 'binary', canOwn: true });
          } else {
            return callback(new Error('node type not supported'));
          }
  
          FS.chmod(path, entry.mode);
          FS.utime(path, entry.timestamp, entry.timestamp);
        } catch (e) {
          return callback(e);
        }
  
        callback(null);
      },removeLocalEntry:function (path, callback) {
        try {
          var lookup = FS.lookupPath(path);
          var stat = FS.stat(path);
  
          if (FS.isDir(stat.mode)) {
            FS.rmdir(path);
          } else if (FS.isFile(stat.mode)) {
            FS.unlink(path);
          }
        } catch (e) {
          return callback(e);
        }
  
        callback(null);
      },loadRemoteEntry:function (store, path, callback) {
        var req = store.get(path);
        req.onsuccess = function(event) { callback(null, event.target.result); };
        req.onerror = function(e) {
          callback(this.error);
          e.preventDefault();
        };
      },storeRemoteEntry:function (store, path, entry, callback) {
        var req = store.put(entry, path);
        req.onsuccess = function() { callback(null); };
        req.onerror = function(e) {
          callback(this.error);
          e.preventDefault();
        };
      },removeRemoteEntry:function (store, path, callback) {
        var req = store.delete(path);
        req.onsuccess = function() { callback(null); };
        req.onerror = function(e) {
          callback(this.error);
          e.preventDefault();
        };
      },reconcile:function (src, dst, callback) {
        var total = 0;
  
        var create = [];
        Object.keys(src.entries).forEach(function (key) {
          var e = src.entries[key];
          var e2 = dst.entries[key];
          if (!e2 || e.timestamp > e2.timestamp) {
            create.push(key);
            total++;
          }
        });
  
        var remove = [];
        Object.keys(dst.entries).forEach(function (key) {
          var e = dst.entries[key];
          var e2 = src.entries[key];
          if (!e2) {
            remove.push(key);
            total++;
          }
        });
  
        if (!total) {
          return callback(null);
        }
  
        var errored = false;
        var completed = 0;
        var db = src.type === 'remote' ? src.db : dst.db;
        var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite');
        var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
  
        function done(err) {
          if (err) {
            if (!done.errored) {
              done.errored = true;
              return callback(err);
            }
            return;
          }
          if (++completed >= total) {
            return callback(null);
          }
        };
  
        transaction.onerror = function(e) {
          done(this.error);
          e.preventDefault();
        };
  
        // sort paths in ascending order so directory entries are created
        // before the files inside them
        create.sort().forEach(function (path) {
          if (dst.type === 'local') {
            IDBFS.loadRemoteEntry(store, path, function (err, entry) {
              if (err) return done(err);
              IDBFS.storeLocalEntry(path, entry, done);
            });
          } else {
            IDBFS.loadLocalEntry(path, function (err, entry) {
              if (err) return done(err);
              IDBFS.storeRemoteEntry(store, path, entry, done);
            });
          }
        });
  
        // sort paths in descending order so files are deleted before their
        // parent directories
        remove.sort().reverse().forEach(function(path) {
          if (dst.type === 'local') {
            IDBFS.removeLocalEntry(path, done);
          } else {
            IDBFS.removeRemoteEntry(store, path, done);
          }
        });
      }};
  
  var NODEFS={isWindows:false,staticInit:function () {
        NODEFS.isWindows = !!process.platform.match(/^win/);
      },mount:function (mount) {
        assert(ENVIRONMENT_IS_NODE);
        return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0);
      },createNode:function (parent, name, mode, dev) {
        if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var node = FS.createNode(parent, name, mode);
        node.node_ops = NODEFS.node_ops;
        node.stream_ops = NODEFS.stream_ops;
        return node;
      },getMode:function (path) {
        var stat;
        try {
          stat = fs.lstatSync(path);
          if (NODEFS.isWindows) {
            // On Windows, directories return permission bits 'rw-rw-rw-', even though they have 'rwxrwxrwx', so
            // propagate write bits to execute bits.
            stat.mode = stat.mode | ((stat.mode & 146) >> 1);
          }
        } catch (e) {
          if (!e.code) throw e;
          throw new FS.ErrnoError(ERRNO_CODES[e.code]);
        }
        return stat.mode;
      },realPath:function (node) {
        var parts = [];
        while (node.parent !== node) {
          parts.push(node.name);
          node = node.parent;
        }
        parts.push(node.mount.opts.root);
        parts.reverse();
        return PATH.join.apply(null, parts);
      },flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:function (flags) {
        flags &= ~0x200000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
        flags &= ~0x800 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
        flags &= ~0x8000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
        flags &= ~0x80000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process.
        if (flags in NODEFS.flagsToPermissionStringMap) {
          return NODEFS.flagsToPermissionStringMap[flags];
        } else {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
      },node_ops:{getattr:function (node) {
          var path = NODEFS.realPath(node);
          var stat;
          try {
            stat = fs.lstatSync(path);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
          // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096.
          // See http://support.microsoft.com/kb/140365
          if (NODEFS.isWindows && !stat.blksize) {
            stat.blksize = 4096;
          }
          if (NODEFS.isWindows && !stat.blocks) {
            stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0;
          }
          return {
            dev: stat.dev,
            ino: stat.ino,
            mode: stat.mode,
            nlink: stat.nlink,
            uid: stat.uid,
            gid: stat.gid,
            rdev: stat.rdev,
            size: stat.size,
            atime: stat.atime,
            mtime: stat.mtime,
            ctime: stat.ctime,
            blksize: stat.blksize,
            blocks: stat.blocks
          };
        },setattr:function (node, attr) {
          var path = NODEFS.realPath(node);
          try {
            if (attr.mode !== undefined) {
              fs.chmodSync(path, attr.mode);
              // update the common node structure mode as well
              node.mode = attr.mode;
            }
            if (attr.timestamp !== undefined) {
              var date = new Date(attr.timestamp);
              fs.utimesSync(path, date, date);
            }
            if (attr.size !== undefined) {
              fs.truncateSync(path, attr.size);
            }
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },lookup:function (parent, name) {
          var path = PATH.join2(NODEFS.realPath(parent), name);
          var mode = NODEFS.getMode(path);
          return NODEFS.createNode(parent, name, mode);
        },mknod:function (parent, name, mode, dev) {
          var node = NODEFS.createNode(parent, name, mode, dev);
          // create the backing node for this in the fs root as well
          var path = NODEFS.realPath(node);
          try {
            if (FS.isDir(node.mode)) {
              fs.mkdirSync(path, node.mode);
            } else {
              fs.writeFileSync(path, '', { mode: node.mode });
            }
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
          return node;
        },rename:function (oldNode, newDir, newName) {
          var oldPath = NODEFS.realPath(oldNode);
          var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
          try {
            fs.renameSync(oldPath, newPath);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },unlink:function (parent, name) {
          var path = PATH.join2(NODEFS.realPath(parent), name);
          try {
            fs.unlinkSync(path);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },rmdir:function (parent, name) {
          var path = PATH.join2(NODEFS.realPath(parent), name);
          try {
            fs.rmdirSync(path);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },readdir:function (node) {
          var path = NODEFS.realPath(node);
          try {
            return fs.readdirSync(path);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },symlink:function (parent, newName, oldPath) {
          var newPath = PATH.join2(NODEFS.realPath(parent), newName);
          try {
            fs.symlinkSync(oldPath, newPath);
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },readlink:function (node) {
          var path = NODEFS.realPath(node);
          try {
            path = fs.readlinkSync(path);
            path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
            return path;
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        }},stream_ops:{open:function (stream) {
          var path = NODEFS.realPath(stream.node);
          try {
            if (FS.isFile(stream.node.mode)) {
              stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags));
            }
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },close:function (stream) {
          try {
            if (FS.isFile(stream.node.mode) && stream.nfd) {
              fs.closeSync(stream.nfd);
            }
          } catch (e) {
            if (!e.code) throw e;
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
        },read:function (stream, buffer, offset, length, position) {
          if (length === 0) return 0; // node errors on 0 length reads
          // FIXME this is terrible.
          var nbuffer = new Buffer(length);
          var res;
          try {
            res = fs.readSync(stream.nfd, nbuffer, 0, length, position);
          } catch (e) {
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
          if (res > 0) {
            for (var i = 0; i < res; i++) {
              buffer[offset + i] = nbuffer[i];
            }
          }
          return res;
        },write:function (stream, buffer, offset, length, position) {
          // FIXME this is terrible.
          var nbuffer = new Buffer(buffer.subarray(offset, offset + length));
          var res;
          try {
            res = fs.writeSync(stream.nfd, nbuffer, 0, length, position);
          } catch (e) {
            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
          }
          return res;
        },llseek:function (stream, offset, whence) {
          var position = offset;
          if (whence === 1) {  // SEEK_CUR.
            position += stream.position;
          } else if (whence === 2) {  // SEEK_END.
            if (FS.isFile(stream.node.mode)) {
              try {
                var stat = fs.fstatSync(stream.nfd);
                position += stat.size;
              } catch (e) {
                throw new FS.ErrnoError(ERRNO_CODES[e.code]);
              }
            }
          }
  
          if (position < 0) {
            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
          }
  
          return position;
        }}};
  
  var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) {
        assert(ENVIRONMENT_IS_WORKER);
        if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync();
        var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0);
        var createdParents = {};
        function ensureParent(path) {
          // return the parent node, creating subdirs as necessary
          var parts = path.split('/');
          var parent = root;
          for (var i = 0; i < parts.length-1; i++) {
            var curr = parts.slice(0, i+1).join('/');
            // Issue 4254: Using curr as a node name will prevent the node
            // from being found in FS.nameTable when FS.open is called on
            // a path which holds a child of this node,
            // given that all FS functions assume node names
            // are just their corresponding parts within their given path,
            // rather than incremental aggregates which include their parent's
            // directories.
            if (!createdParents[curr]) {
              createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0);
            }
            parent = createdParents[curr];
          }
          return parent;
        }
        function base(path) {
          var parts = path.split('/');
          return parts[parts.length-1];
        }
        // We also accept FileList here, by using Array.prototype
        Array.prototype.forEach.call(mount.opts["files"] || [], function(file) {
          WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate);
        });
        (mount.opts["blobs"] || []).forEach(function(obj) {
          WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]);
        });
        (mount.opts["packages"] || []).forEach(function(pack) {
          pack['metadata'].files.forEach(function(file) {
            var name = file.filename.substr(1); // remove initial slash
            WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end));
          });
        });
        return root;
      },createNode:function (parent, name, mode, dev, contents, mtime) {
        var node = FS.createNode(parent, name, mode);
        node.mode = mode;
        node.node_ops = WORKERFS.node_ops;
        node.stream_ops = WORKERFS.stream_ops;
        node.timestamp = (mtime || new Date).getTime();
        assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
        if (mode === WORKERFS.FILE_MODE) {
          node.size = contents.size;
          node.contents = contents;
        } else {
          node.size = 4096;
          node.contents = {};
        }
        if (parent) {
          parent.contents[name] = node;
        }
        return node;
      },node_ops:{getattr:function (node) {
          return {
            dev: 1,
            ino: undefined,
            mode: node.mode,
            nlink: 1,
            uid: 0,
            gid: 0,
            rdev: undefined,
            size: node.size,
            atime: new Date(node.timestamp),
            mtime: new Date(node.timestamp),
            ctime: new Date(node.timestamp),
            blksize: 4096,
            blocks: Math.ceil(node.size / 4096),
          };
        },setattr:function (node, attr) {
          if (attr.mode !== undefined) {
            node.mode = attr.mode;
          }
          if (attr.timestamp !== undefined) {
            node.timestamp = attr.timestamp;
          }
        },lookup:function (parent, name) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        },mknod:function (parent, name, mode, dev) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },rename:function (oldNode, newDir, newName) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },unlink:function (parent, name) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },rmdir:function (parent, name) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },readdir:function (node) {
          var entries = ['.', '..'];
          for (var key in node.contents) {
            if (!node.contents.hasOwnProperty(key)) {
              continue;
            }
            entries.push(key);
          }
          return entries;
        },symlink:function (parent, newName, oldPath) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        },readlink:function (node) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }},stream_ops:{read:function (stream, buffer, offset, length, position) {
          if (position >= stream.node.size) return 0;
          var chunk = stream.node.contents.slice(position, position + length);
          var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
          buffer.set(new Uint8Array(ab), offset);
          return chunk.size;
        },write:function (stream, buffer, offset, length, position) {
          throw new FS.ErrnoError(ERRNO_CODES.EIO);
        },llseek:function (stream, offset, whence) {
          var position = offset;
          if (whence === 1) {  // SEEK_CUR.
            position += stream.position;
          } else if (whence === 2) {  // SEEK_END.
            if (FS.isFile(stream.node.mode)) {
              position += stream.node.size;
            }
          }
          if (position < 0) {
            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
          }
          return position;
        }}};
  
  var _stdin=STATICTOP; STATICTOP += 16;;
  
  var _stdout=STATICTOP; STATICTOP += 16;;
  
  var _stderr=STATICTOP; STATICTOP += 16;;var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) {
        if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace();
        return ___setErrNo(e.errno);
      },lookupPath:function (path, opts) {
        path = PATH.resolve(FS.cwd(), path);
        opts = opts || {};
  
        if (!path) return { path: '', node: null };
  
        var defaults = {
          follow_mount: true,
          recurse_count: 0
        };
        for (var key in defaults) {
          if (opts[key] === undefined) {
            opts[key] = defaults[key];
          }
        }
  
        if (opts.recurse_count > 8) {  // max recursive lookup of 8
          throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
        }
  
        // split the path
        var parts = PATH.normalizeArray(path.split('/').filter(function(p) {
          return !!p;
        }), false);
  
        // start at the root
        var current = FS.root;
        var current_path = '/';
  
        for (var i = 0; i < parts.length; i++) {
          var islast = (i === parts.length-1);
          if (islast && opts.parent) {
            // stop resolving
            break;
          }
  
          current = FS.lookupNode(current, parts[i]);
          current_path = PATH.join2(current_path, parts[i]);
  
          // jump to the mount's root node if this is a mountpoint
          if (FS.isMountpoint(current)) {
            if (!islast || (islast && opts.follow_mount)) {
              current = current.mounted.root;
            }
          }
  
          // by default, lookupPath will not follow a symlink if it is the final path component.
          // setting opts.follow = true will override this behavior.
          if (!islast || opts.follow) {
            var count = 0;
            while (FS.isLink(current.mode)) {
              var link = FS.readlink(current_path);
              current_path = PATH.resolve(PATH.dirname(current_path), link);
  
              var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count });
              current = lookup.node;
  
              if (count++ > 40) {  // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
                throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
              }
            }
          }
        }
  
        return { path: current_path, node: current };
      },getPath:function (node) {
        var path;
        while (true) {
          if (FS.isRoot(node)) {
            var mount = node.mount.mountpoint;
            if (!path) return mount;
            return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path;
          }
          path = path ? node.name + '/' + path : node.name;
          node = node.parent;
        }
      },hashName:function (parentid, name) {
        var hash = 0;
  
  
        for (var i = 0; i < name.length; i++) {
          hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
        }
        return ((parentid + hash) >>> 0) % FS.nameTable.length;
      },hashAddNode:function (node) {
        var hash = FS.hashName(node.parent.id, node.name);
        node.name_next = FS.nameTable[hash];
        FS.nameTable[hash] = node;
      },hashRemoveNode:function (node) {
        var hash = FS.hashName(node.parent.id, node.name);
        if (FS.nameTable[hash] === node) {
          FS.nameTable[hash] = node.name_next;
        } else {
          var current = FS.nameTable[hash];
          while (current) {
            if (current.name_next === node) {
              current.name_next = node.name_next;
              break;
            }
            current = current.name_next;
          }
        }
      },lookupNode:function (parent, name) {
        var err = FS.mayLookup(parent);
        if (err) {
          throw new FS.ErrnoError(err, parent);
        }
        var hash = FS.hashName(parent.id, name);
        for (var node = FS.nameTable[hash]; node; node = node.name_next) {
          var nodeName = node.name;
          if (node.parent.id === parent.id && nodeName === name) {
            return node;
          }
        }
        // if we failed to find it in the cache, call into the VFS
        return FS.lookup(parent, name);
      },createNode:function (parent, name, mode, rdev) {
        if (!FS.FSNode) {
          FS.FSNode = function(parent, name, mode, rdev) {
            if (!parent) {
              parent = this;  // root node sets parent to itself
            }
            this.parent = parent;
            this.mount = parent.mount;
            this.mounted = null;
            this.id = FS.nextInode++;
            this.name = name;
            this.mode = mode;
            this.node_ops = {};
            this.stream_ops = {};
            this.rdev = rdev;
          };
  
          FS.FSNode.prototype = {};
  
          // compatibility
          var readMode = 292 | 73;
          var writeMode = 146;
  
          // NOTE we must use Object.defineProperties instead of individual calls to
          // Object.defineProperty in order to make closure compiler happy
          Object.defineProperties(FS.FSNode.prototype, {
            read: {
              get: function() { return (this.mode & readMode) === readMode; },
              set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; }
            },
            write: {
              get: function() { return (this.mode & writeMode) === writeMode; },
              set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; }
            },
            isFolder: {
              get: function() { return FS.isDir(this.mode); }
            },
            isDevice: {
              get: function() { return FS.isChrdev(this.mode); }
            }
          });
        }
  
        var node = new FS.FSNode(parent, name, mode, rdev);
  
        FS.hashAddNode(node);
  
        return node;
      },destroyNode:function (node) {
        FS.hashRemoveNode(node);
      },isRoot:function (node) {
        return node === node.parent;
      },isMountpoint:function (node) {
        return !!node.mounted;
      },isFile:function (mode) {
        return (mode & 61440) === 32768;
      },isDir:function (mode) {
        return (mode & 61440) === 16384;
      },isLink:function (mode) {
        return (mode & 61440) === 40960;
      },isChrdev:function (mode) {
        return (mode & 61440) === 8192;
      },isBlkdev:function (mode) {
        return (mode & 61440) === 24576;
      },isFIFO:function (mode) {
        return (mode & 61440) === 4096;
      },isSocket:function (mode) {
        return (mode & 49152) === 49152;
      },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) {
        var flags = FS.flagModes[str];
        if (typeof flags === 'undefined') {
          throw new Error('Unknown file open mode: ' + str);
        }
        return flags;
      },flagsToPermissionString:function (flag) {
        var perms = ['r', 'w', 'rw'][flag & 3];
        if ((flag & 512)) {
          perms += 'w';
        }
        return perms;
      },nodePermissions:function (node, perms) {
        if (FS.ignorePermissions) {
          return 0;
        }
        // return 0 if any user, group or owner bits are set.
        if (perms.indexOf('r') !== -1 && !(node.mode & 292)) {
          return ERRNO_CODES.EACCES;
        } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) {
          return ERRNO_CODES.EACCES;
        } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) {
          return ERRNO_CODES.EACCES;
        }
        return 0;
      },mayLookup:function (dir) {
        var err = FS.nodePermissions(dir, 'x');
        if (err) return err;
        if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
        return 0;
      },mayCreate:function (dir, name) {
        try {
          var node = FS.lookupNode(dir, name);
          return ERRNO_CODES.EEXIST;
        } catch (e) {
        }
        return FS.nodePermissions(dir, 'wx');
      },mayDelete:function (dir, name, isdir) {
        var node;
        try {
          node = FS.lookupNode(dir, name);
        } catch (e) {
          return e.errno;
        }
        var err = FS.nodePermissions(dir, 'wx');
        if (err) {
          return err;
        }
        if (isdir) {
          if (!FS.isDir(node.mode)) {
            return ERRNO_CODES.ENOTDIR;
          }
          if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
            return ERRNO_CODES.EBUSY;
          }
        } else {
          if (FS.isDir(node.mode)) {
            return ERRNO_CODES.EISDIR;
          }
        }
        return 0;
      },mayOpen:function (node, flags) {
        if (!node) {
          return ERRNO_CODES.ENOENT;
        }
        if (FS.isLink(node.mode)) {
          return ERRNO_CODES.ELOOP;
        } else if (FS.isDir(node.mode)) {
          if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
              (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
            return ERRNO_CODES.EISDIR;
          }
        }
        return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
      },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) {
        fd_start = fd_start || 0;
        fd_end = fd_end || FS.MAX_OPEN_FDS;
        for (var fd = fd_start; fd <= fd_end; fd++) {
          if (!FS.streams[fd]) {
            return fd;
          }
        }
        throw new FS.ErrnoError(ERRNO_CODES.EMFILE);
      },getStream:function (fd) {
        return FS.streams[fd];
      },createStream:function (stream, fd_start, fd_end) {
        if (!FS.FSStream) {
          FS.FSStream = function(){};
          FS.FSStream.prototype = {};
          // compatibility
          Object.defineProperties(FS.FSStream.prototype, {
            object: {
              get: function() { return this.node; },
              set: function(val) { this.node = val; }
            },
            isRead: {
              get: function() { return (this.flags & 2097155) !== 1; }
            },
            isWrite: {
              get: function() { return (this.flags & 2097155) !== 0; }
            },
            isAppend: {
              get: function() { return (this.flags & 1024); }
            }
          });
        }
        // clone it, so we can return an instance of FSStream
        var newStream = new FS.FSStream();
        for (var p in stream) {
          newStream[p] = stream[p];
        }
        stream = newStream;
        var fd = FS.nextfd(fd_start, fd_end);
        stream.fd = fd;
        FS.streams[fd] = stream;
        return stream;
      },closeStream:function (fd) {
        FS.streams[fd] = null;
      },chrdev_stream_ops:{open:function (stream) {
          var device = FS.getDevice(stream.node.rdev);
          // override node's stream ops with the device's
          stream.stream_ops = device.stream_ops;
          // forward the open call
          if (stream.stream_ops.open) {
            stream.stream_ops.open(stream);
          }
        },llseek:function () {
          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
        }},major:function (dev) {
        return ((dev) >> 8);
      },minor:function (dev) {
        return ((dev) & 0xff);
      },makedev:function (ma, mi) {
        return ((ma) << 8 | (mi));
      },registerDevice:function (dev, ops) {
        FS.devices[dev] = { stream_ops: ops };
      },getDevice:function (dev) {
        return FS.devices[dev];
      },getMounts:function (mount) {
        var mounts = [];
        var check = [mount];
  
        while (check.length) {
          var m = check.pop();
  
          mounts.push(m);
  
          check.push.apply(check, m.mounts);
        }
  
        return mounts;
      },syncfs:function (populate, callback) {
        if (typeof(populate) === 'function') {
          callback = populate;
          populate = false;
        }
  
        FS.syncFSRequests++;
  
        if (FS.syncFSRequests > 1) {
          console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work');
        }
  
        var mounts = FS.getMounts(FS.root.mount);
        var completed = 0;
  
        function doCallback(err) {
          assert(FS.syncFSRequests > 0);
          FS.syncFSRequests--;
          return callback(err);
        }
  
        function done(err) {
          if (err) {
            if (!done.errored) {
              done.errored = true;
              return doCallback(err);
            }
            return;
          }
          if (++completed >= mounts.length) {
            doCallback(null);
          }
        };
  
        // sync all mounts
        mounts.forEach(function (mount) {
          if (!mount.type.syncfs) {
            return done(null);
          }
          mount.type.syncfs(mount, populate, done);
        });
      },mount:function (type, opts, mountpoint) {
        var root = mountpoint === '/';
        var pseudo = !mountpoint;
        var node;
  
        if (root && FS.root) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        } else if (!root && !pseudo) {
          var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
  
          mountpoint = lookup.path;  // use the absolute path
          node = lookup.node;
  
          if (FS.isMountpoint(node)) {
            throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
          }
  
          if (!FS.isDir(node.mode)) {
            throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
          }
        }
  
        var mount = {
          type: type,
          opts: opts,
          mountpoint: mountpoint,
          mounts: []
        };
  
        // create a root node for the fs
        var mountRoot = type.mount(mount);
        mountRoot.mount = mount;
        mount.root = mountRoot;
  
        if (root) {
          FS.root = mountRoot;
        } else if (node) {
          // set as a mountpoint
          node.mounted = mount;
  
          // add the new mount to the current mount's children
          if (node.mount) {
            node.mount.mounts.push(mount);
          }
        }
  
        return mountRoot;
      },unmount:function (mountpoint) {
        var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
  
        if (!FS.isMountpoint(lookup.node)) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
  
        // destroy the nodes for this mount, and all its child mounts
        var node = lookup.node;
        var mount = node.mounted;
        var mounts = FS.getMounts(mount);
  
        Object.keys(FS.nameTable).forEach(function (hash) {
          var current = FS.nameTable[hash];
  
          while (current) {
            var next = current.name_next;
  
            if (mounts.indexOf(current.mount) !== -1) {
              FS.destroyNode(current);
            }
  
            current = next;
          }
        });
  
        // no longer a mountpoint
        node.mounted = null;
  
        // remove this mount from the child mounts
        var idx = node.mount.mounts.indexOf(mount);
        assert(idx !== -1);
        node.mount.mounts.splice(idx, 1);
      },lookup:function (parent, name) {
        return parent.node_ops.lookup(parent, name);
      },mknod:function (path, mode, dev) {
        var lookup = FS.lookupPath(path, { parent: true });
        var parent = lookup.node;
        var name = PATH.basename(path);
        if (!name || name === '.' || name === '..') {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var err = FS.mayCreate(parent, name);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        if (!parent.node_ops.mknod) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        return parent.node_ops.mknod(parent, name, mode, dev);
      },create:function (path, mode) {
        mode = mode !== undefined ? mode : 438 /* 0666 */;
        mode &= 4095;
        mode |= 32768;
        return FS.mknod(path, mode, 0);
      },mkdir:function (path, mode) {
        mode = mode !== undefined ? mode : 511 /* 0777 */;
        mode &= 511 | 512;
        mode |= 16384;
        return FS.mknod(path, mode, 0);
      },mkdirTree:function (path, mode) {
        var dirs = path.split('/');
        var d = '';
        for (var i = 0; i < dirs.length; ++i) {
          if (!dirs[i]) continue;
          d += '/' + dirs[i];
          try {
            FS.mkdir(d, mode);
          } catch(e) {
            if (e.errno != ERRNO_CODES.EEXIST) throw e;
          }
        }
      },mkdev:function (path, mode, dev) {
        if (typeof(dev) === 'undefined') {
          dev = mode;
          mode = 438 /* 0666 */;
        }
        mode |= 8192;
        return FS.mknod(path, mode, dev);
      },symlink:function (oldpath, newpath) {
        if (!PATH.resolve(oldpath)) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        var lookup = FS.lookupPath(newpath, { parent: true });
        var parent = lookup.node;
        if (!parent) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        var newname = PATH.basename(newpath);
        var err = FS.mayCreate(parent, newname);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        if (!parent.node_ops.symlink) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        return parent.node_ops.symlink(parent, newname, oldpath);
      },rename:function (old_path, new_path) {
        var old_dirname = PATH.dirname(old_path);
        var new_dirname = PATH.dirname(new_path);
        var old_name = PATH.basename(old_path);
        var new_name = PATH.basename(new_path);
        // parents must exist
        var lookup, old_dir, new_dir;
        try {
          lookup = FS.lookupPath(old_path, { parent: true });
          old_dir = lookup.node;
          lookup = FS.lookupPath(new_path, { parent: true });
          new_dir = lookup.node;
        } catch (e) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        }
        if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        // need to be part of the same mount
        if (old_dir.mount !== new_dir.mount) {
          throw new FS.ErrnoError(ERRNO_CODES.EXDEV);
        }
        // source must exist
        var old_node = FS.lookupNode(old_dir, old_name);
        // old path should not be an ancestor of the new path
        var relative = PATH.relative(old_path, new_dirname);
        if (relative.charAt(0) !== '.') {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        // new path should not be an ancestor of the old path
        relative = PATH.relative(new_path, old_dirname);
        if (relative.charAt(0) !== '.') {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
        }
        // see if the new path already exists
        var new_node;
        try {
          new_node = FS.lookupNode(new_dir, new_name);
        } catch (e) {
          // not fatal
        }
        // early out if nothing needs to change
        if (old_node === new_node) {
          return;
        }
        // we'll need to delete the old entry
        var isdir = FS.isDir(old_node.mode);
        var err = FS.mayDelete(old_dir, old_name, isdir);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        // need delete permissions if we'll be overwriting.
        // need create permissions if new doesn't already exist.
        err = new_node ?
          FS.mayDelete(new_dir, new_name, isdir) :
          FS.mayCreate(new_dir, new_name);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        if (!old_dir.node_ops.rename) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        }
        // if we are going to change the parent, check write permissions
        if (new_dir !== old_dir) {
          err = FS.nodePermissions(old_dir, 'w');
          if (err) {
            throw new FS.ErrnoError(err);
          }
        }
        try {
          if (FS.trackingDelegate['willMovePath']) {
            FS.trackingDelegate['willMovePath'](old_path, new_path);
          }
        } catch(e) {
          console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
        }
        // remove the node from the lookup hash
        FS.hashRemoveNode(old_node);
        // do the underlying fs rename
        try {
          old_dir.node_ops.rename(old_node, new_dir, new_name);
        } catch (e) {
          throw e;
        } finally {
          // add the node back to the hash (in case node_ops.rename
          // changed its name)
          FS.hashAddNode(old_node);
        }
        try {
          if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path);
        } catch(e) {
          console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
        }
      },rmdir:function (path) {
        var lookup = FS.lookupPath(path, { parent: true });
        var parent = lookup.node;
        var name = PATH.basename(path);
        var node = FS.lookupNode(parent, name);
        var err = FS.mayDelete(parent, name, true);
        if (err) {
          throw new FS.ErrnoError(err);
        }
        if (!parent.node_ops.rmdir) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (FS.isMountpoint(node)) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        }
        try {
          if (FS.trackingDelegate['willDeletePath']) {
            FS.trackingDelegate['willDeletePath'](path);
          }
        } catch(e) {
          console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
        }
        parent.node_ops.rmdir(parent, name);
        FS.destroyNode(node);
        try {
          if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
        } catch(e) {
          console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
        }
      },readdir:function (path) {
        var lookup = FS.lookupPath(path, { follow: true });
        var node = lookup.node;
        if (!node.node_ops.readdir) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
        }
        return node.node_ops.readdir(node);
      },unlink:function (path) {
        var lookup = FS.lookupPath(path, { parent: true });
        var parent = lookup.node;
        var name = PATH.basename(path);
        var node = FS.lookupNode(parent, name);
        var err = FS.mayDelete(parent, name, false);
        if (err) {
          // According to POSIX, we should map EISDIR to EPERM, but
          // we instead do what Linux does (and we must, as we use
          // the musl linux libc).
          throw new FS.ErrnoError(err);
        }
        if (!parent.node_ops.unlink) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (FS.isMountpoint(node)) {
          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
        }
        try {
          if (FS.trackingDelegate['willDeletePath']) {
            FS.trackingDelegate['willDeletePath'](path);
          }
        } catch(e) {
          console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
        }
        parent.node_ops.unlink(parent, name);
        FS.destroyNode(node);
        try {
          if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
        } catch(e) {
          console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
        }
      },readlink:function (path) {
        var lookup = FS.lookupPath(path);
        var link = lookup.node;
        if (!link) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        if (!link.node_ops.readlink) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
      },stat:function (path, dontFollow) {
        var lookup = FS.lookupPath(path, { follow: !dontFollow });
        var node = lookup.node;
        if (!node) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        if (!node.node_ops.getattr) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        return node.node_ops.getattr(node);
      },lstat:function (path) {
        return FS.stat(path, true);
      },chmod:function (path, mode, dontFollow) {
        var node;
        if (typeof path === 'string') {
          var lookup = FS.lookupPath(path, { follow: !dontFollow });
          node = lookup.node;
        } else {
          node = path;
        }
        if (!node.node_ops.setattr) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        node.node_ops.setattr(node, {
          mode: (mode & 4095) | (node.mode & ~4095),
          timestamp: Date.now()
        });
      },lchmod:function (path, mode) {
        FS.chmod(path, mode, true);
      },fchmod:function (fd, mode) {
        var stream = FS.getStream(fd);
        if (!stream) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        FS.chmod(stream.node, mode);
      },chown:function (path, uid, gid, dontFollow) {
        var node;
        if (typeof path === 'string') {
          var lookup = FS.lookupPath(path, { follow: !dontFollow });
          node = lookup.node;
        } else {
          node = path;
        }
        if (!node.node_ops.setattr) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        node.node_ops.setattr(node, {
          timestamp: Date.now()
          // we ignore the uid / gid for now
        });
      },lchown:function (path, uid, gid) {
        FS.chown(path, uid, gid, true);
      },fchown:function (fd, uid, gid) {
        var stream = FS.getStream(fd);
        if (!stream) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        FS.chown(stream.node, uid, gid);
      },truncate:function (path, len) {
        if (len < 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var node;
        if (typeof path === 'string') {
          var lookup = FS.lookupPath(path, { follow: true });
          node = lookup.node;
        } else {
          node = path;
        }
        if (!node.node_ops.setattr) {
          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
        }
        if (FS.isDir(node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
        }
        if (!FS.isFile(node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var err = FS.nodePermissions(node, 'w');
        if (err) {
          throw new FS.ErrnoError(err);
        }
        node.node_ops.setattr(node, {
          size: len,
          timestamp: Date.now()
        });
      },ftruncate:function (fd, len) {
        var stream = FS.getStream(fd);
        if (!stream) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        if ((stream.flags & 2097155) === 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        FS.truncate(stream.node, len);
      },utime:function (path, atime, mtime) {
        var lookup = FS.lookupPath(path, { follow: true });
        var node = lookup.node;
        node.node_ops.setattr(node, {
          timestamp: Math.max(atime, mtime)
        });
      },open:function (path, flags, mode, fd_start, fd_end) {
        if (path === "") {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags;
        mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode;
        if ((flags & 64)) {
          mode = (mode & 4095) | 32768;
        } else {
          mode = 0;
        }
        var node;
        if (typeof path === 'object') {
          node = path;
        } else {
          path = PATH.normalize(path);
          try {
            var lookup = FS.lookupPath(path, {
              follow: !(flags & 131072)
            });
            node = lookup.node;
          } catch (e) {
            // ignore
          }
        }
        // perhaps we need to create the node
        var created = false;
        if ((flags & 64)) {
          if (node) {
            // if O_CREAT and O_EXCL are set, error out if the node already exists
            if ((flags & 128)) {
              throw new FS.ErrnoError(ERRNO_CODES.EEXIST);
            }
          } else {
            // node doesn't exist, try to create it
            node = FS.mknod(path, mode, 0);
            created = true;
          }
        }
        if (!node) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        // can't truncate a device
        if (FS.isChrdev(node.mode)) {
          flags &= ~512;
        }
        // if asked only for a directory, then this must be one
        if ((flags & 65536) && !FS.isDir(node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
        }
        // check permissions, if this is not a file we just created now (it is ok to
        // create and write to a file with read-only permissions; it is read-only
        // for later use)
        if (!created) {
          var err = FS.mayOpen(node, flags);
          if (err) {
            throw new FS.ErrnoError(err);
          }
        }
        // do truncation if necessary
        if ((flags & 512)) {
          FS.truncate(node, 0);
        }
        // we've already handled these, don't pass down to the underlying vfs
        flags &= ~(128 | 512);
  
        // register the stream with the filesystem
        var stream = FS.createStream({
          node: node,
          path: FS.getPath(node),  // we want the absolute path to the node
          flags: flags,
          seekable: true,
          position: 0,
          stream_ops: node.stream_ops,
          // used by the file family libc calls (fopen, fwrite, ferror, etc.)
          ungotten: [],
          error: false
        }, fd_start, fd_end);
        // call the new stream's open function
        if (stream.stream_ops.open) {
          stream.stream_ops.open(stream);
        }
        if (Module['logReadFiles'] && !(flags & 1)) {
          if (!FS.readFiles) FS.readFiles = {};
          if (!(path in FS.readFiles)) {
            FS.readFiles[path] = 1;
            Module['printErr']('read file: ' + path);
          }
        }
        try {
          if (FS.trackingDelegate['onOpenFile']) {
            var trackingFlags = 0;
            if ((flags & 2097155) !== 1) {
              trackingFlags |= FS.tracking.openFlags.READ;
            }
            if ((flags & 2097155) !== 0) {
              trackingFlags |= FS.tracking.openFlags.WRITE;
            }
            FS.trackingDelegate['onOpenFile'](path, trackingFlags);
          }
        } catch(e) {
          console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message);
        }
        return stream;
      },close:function (stream) {
        if (stream.getdents) stream.getdents = null; // free readdir state
        try {
          if (stream.stream_ops.close) {
            stream.stream_ops.close(stream);
          }
        } catch (e) {
          throw e;
        } finally {
          FS.closeStream(stream.fd);
        }
      },llseek:function (stream, offset, whence) {
        if (!stream.seekable || !stream.stream_ops.llseek) {
          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
        }
        stream.position = stream.stream_ops.llseek(stream, offset, whence);
        stream.ungotten = [];
        return stream.position;
      },read:function (stream, buffer, offset, length, position) {
        if (length < 0 || position < 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        if ((stream.flags & 2097155) === 1) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        if (FS.isDir(stream.node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
        }
        if (!stream.stream_ops.read) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        var seeking = true;
        if (typeof position === 'undefined') {
          position = stream.position;
          seeking = false;
        } else if (!stream.seekable) {
          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
        }
        var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
        if (!seeking) stream.position += bytesRead;
        return bytesRead;
      },write:function (stream, buffer, offset, length, position, canOwn) {
        if (length < 0 || position < 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        if ((stream.flags & 2097155) === 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        if (FS.isDir(stream.node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
        }
        if (!stream.stream_ops.write) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        if (stream.flags & 1024) {
          // seek to the end before writing in append mode
          FS.llseek(stream, 0, 2);
        }
        var seeking = true;
        if (typeof position === 'undefined') {
          position = stream.position;
          seeking = false;
        } else if (!stream.seekable) {
          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
        }
        var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
        if (!seeking) stream.position += bytesWritten;
        try {
          if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path);
        } catch(e) {
          console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message);
        }
        return bytesWritten;
      },allocate:function (stream, offset, length) {
        if (offset < 0 || length <= 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
        }
        if ((stream.flags & 2097155) === 0) {
          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        }
        if (!FS.isFile(stream.node.mode) && !FS.isDir(node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
        }
        if (!stream.stream_ops.allocate) {
          throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
        }
        stream.stream_ops.allocate(stream, offset, length);
      },mmap:function (stream, buffer, offset, length, position, prot, flags) {
        // TODO if PROT is PROT_WRITE, make sure we have write access
        if ((stream.flags & 2097155) === 1) {
          throw new FS.ErrnoError(ERRNO_CODES.EACCES);
        }
        if (!stream.stream_ops.mmap) {
          throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
        }
        return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags);
      },msync:function (stream, buffer, offset, length, mmapFlags) {
        if (!stream || !stream.stream_ops.msync) {
          return 0;
        }
        return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
      },munmap:function (stream) {
        return 0;
      },ioctl:function (stream, cmd, arg) {
        if (!stream.stream_ops.ioctl) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTTY);
        }
        return stream.stream_ops.ioctl(stream, cmd, arg);
      },readFile:function (path, opts) {
        opts = opts || {};
        opts.flags = opts.flags || 'r';
        opts.encoding = opts.encoding || 'binary';
        if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
          throw new Error('Invalid encoding type "' + opts.encoding + '"');
        }
        var ret;
        var stream = FS.open(path, opts.flags);
        var stat = FS.stat(path);
        var length = stat.size;
        var buf = new Uint8Array(length);
        FS.read(stream, buf, 0, length, 0);
        if (opts.encoding === 'utf8') {
          ret = UTF8ArrayToString(buf, 0);
        } else if (opts.encoding === 'binary') {
          ret = buf;
        }
        FS.close(stream);
        return ret;
      },writeFile:function (path, data, opts) {
        opts = opts || {};
        opts.flags = opts.flags || 'w';
        opts.encoding = opts.encoding || 'utf8';
        if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
          throw new Error('Invalid encoding type "' + opts.encoding + '"');
        }
        var stream = FS.open(path, opts.flags, opts.mode);
        if (opts.encoding === 'utf8') {
          var buf = new Uint8Array(lengthBytesUTF8(data)+1);
          var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
          FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn);
        } else if (opts.encoding === 'binary') {
          FS.write(stream, data, 0, data.length, 0, opts.canOwn);
        }
        FS.close(stream);
      },cwd:function () {
        return FS.currentPath;
      },chdir:function (path) {
        var lookup = FS.lookupPath(path, { follow: true });
        if (lookup.node === null) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
        }
        if (!FS.isDir(lookup.node.mode)) {
          throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
        }
        var err = FS.nodePermissions(lookup.node, 'x');
        if (err) {
          throw new FS.ErrnoError(err);
        }
        FS.currentPath = lookup.path;
      },createDefaultDirectories:function () {
        FS.mkdir('/tmp');
        FS.mkdir('/home');
        FS.mkdir('/home/web_user');
      },createDefaultDevices:function () {
        // create /dev
        FS.mkdir('/dev');
        // setup /dev/null
        FS.registerDevice(FS.makedev(1, 3), {
          read: function() { return 0; },
          write: function(stream, buffer, offset, length, pos) { return length; }
        });
        FS.mkdev('/dev/null', FS.makedev(1, 3));
        // setup /dev/tty and /dev/tty1
        // stderr needs to print output using Module['printErr']
        // so we register a second tty just for it.
        TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
        TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
        FS.mkdev('/dev/tty', FS.makedev(5, 0));
        FS.mkdev('/dev/tty1', FS.makedev(6, 0));
        // setup /dev/[u]random
        var random_device;
        if (typeof crypto !== 'undefined') {
          // for modern web browsers
          var randomBuffer = new Uint8Array(1);
          random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; };
        } else if (ENVIRONMENT_IS_NODE) {
          // for nodejs
          random_device = function() { return require('crypto').randomBytes(1)[0]; };
        } else {
          // default for ES5 platforms
          random_device = function() { return (Math.random()*256)|0; };
        }
        FS.createDevice('/dev', 'random', random_device);
        FS.createDevice('/dev', 'urandom', random_device);
        // we're not going to emulate the actual shm device,
        // just create the tmp dirs that reside in it commonly
        FS.mkdir('/dev/shm');
        FS.mkdir('/dev/shm/tmp');
      },createSpecialDirectories:function () {
        // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname)
        FS.mkdir('/proc');
        FS.mkdir('/proc/self');
        FS.mkdir('/proc/self/fd');
        FS.mount({
          mount: function() {
            var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73);
            node.node_ops = {
              lookup: function(parent, name) {
                var fd = +name;
                var stream = FS.getStream(fd);
                if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
                var ret = {
                  parent: null,
                  mount: { mountpoint: 'fake' },
                  node_ops: { readlink: function() { return stream.path } }
                };
                ret.parent = ret; // make it look like a simple root node
                return ret;
              }
            };
            return node;
          }
        }, {}, '/proc/self/fd');
      },createStandardStreams:function () {
        // TODO deprecate the old functionality of a single
        // input / output callback and that utilizes FS.createDevice
        // and instead require a unique set of stream ops
  
        // by default, we symlink the standard streams to the
        // default tty devices. however, if the standard streams
        // have been overwritten we create a unique device for
        // them instead.
        if (Module['stdin']) {
          FS.createDevice('/dev', 'stdin', Module['stdin']);
        } else {
          FS.symlink('/dev/tty', '/dev/stdin');
        }
        if (Module['stdout']) {
          FS.createDevice('/dev', 'stdout', null, Module['stdout']);
        } else {
          FS.symlink('/dev/tty', '/dev/stdout');
        }
        if (Module['stderr']) {
          FS.createDevice('/dev', 'stderr', null, Module['stderr']);
        } else {
          FS.symlink('/dev/tty1', '/dev/stderr');
        }
  
        // open default streams for the stdin, stdout and stderr devices
        var stdin = FS.open('/dev/stdin', 'r');
        assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')');
  
        var stdout = FS.open('/dev/stdout', 'w');
        assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')');
  
        var stderr = FS.open('/dev/stderr', 'w');
        assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')');
      },ensureErrnoError:function () {
        if (FS.ErrnoError) return;
        FS.ErrnoError = function ErrnoError(errno, node) {
          //Module.printErr(stackTrace()); // useful for debugging
          this.node = node;
          this.setErrno = function(errno) {
            this.errno = errno;
            for (var key in ERRNO_CODES) {
              if (ERRNO_CODES[key] === errno) {
                this.code = key;
                break;
              }
            }
          };
          this.setErrno(errno);
          this.message = ERRNO_MESSAGES[errno];
        };
        FS.ErrnoError.prototype = new Error();
        FS.ErrnoError.prototype.constructor = FS.ErrnoError;
        // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
        [ERRNO_CODES.ENOENT].forEach(function(code) {
          FS.genericErrors[code] = new FS.ErrnoError(code);
          FS.genericErrors[code].stack = '<generic error, no stack>';
        });
      },staticInit:function () {
        FS.ensureErrnoError();
  
        FS.nameTable = new Array(4096);
  
        FS.mount(MEMFS, {}, '/');
  
        FS.createDefaultDirectories();
        FS.createDefaultDevices();
        FS.createSpecialDirectories();
  
        FS.filesystems = {
          'MEMFS': MEMFS,
          'IDBFS': IDBFS,
          'NODEFS': NODEFS,
          'WORKERFS': WORKERFS,
        };
      },init:function (input, output, error) {
        assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
        FS.init.initialized = true;
  
        FS.ensureErrnoError();
  
        // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
        Module['stdin'] = input || Module['stdin'];
        Module['stdout'] = output || Module['stdout'];
        Module['stderr'] = error || Module['stderr'];
  
        FS.createStandardStreams();
      },quit:function () {
        FS.init.initialized = false;
        // force-flush all streams, so we get musl std streams printed out
        var fflush = Module['_fflush'];
        if (fflush) fflush(0);
        // close all of our streams
        for (var i = 0; i < FS.streams.length; i++) {
          var stream = FS.streams[i];
          if (!stream) {
            continue;
          }
          FS.close(stream);
        }
      },getMode:function (canRead, canWrite) {
        var mode = 0;
        if (canRead) mode |= 292 | 73;
        if (canWrite) mode |= 146;
        return mode;
      },joinPath:function (parts, forceRelative) {
        var path = PATH.join.apply(null, parts);
        if (forceRelative && path[0] == '/') path = path.substr(1);
        return path;
      },absolutePath:function (relative, base) {
        return PATH.resolve(base, relative);
      },standardizePath:function (path) {
        return PATH.normalize(path);
      },findObject:function (path, dontResolveLastLink) {
        var ret = FS.analyzePath(path, dontResolveLastLink);
        if (ret.exists) {
          return ret.object;
        } else {
          ___setErrNo(ret.error);
          return null;
        }
      },analyzePath:function (path, dontResolveLastLink) {
        // operate from within the context of the symlink's target
        try {
          var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
          path = lookup.path;
        } catch (e) {
        }
        var ret = {
          isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
          parentExists: false, parentPath: null, parentObject: null
        };
        try {
          var lookup = FS.lookupPath(path, { parent: true });
          ret.parentExists = true;
          ret.parentPath = lookup.path;
          ret.parentObject = lookup.node;
          ret.name = PATH.basename(path);
          lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
          ret.exists = true;
          ret.path = lookup.path;
          ret.object = lookup.node;
          ret.name = lookup.node.name;
          ret.isRoot = lookup.path === '/';
        } catch (e) {
          ret.error = e.errno;
        };
        return ret;
      },createFolder:function (parent, name, canRead, canWrite) {
        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
        var mode = FS.getMode(canRead, canWrite);
        return FS.mkdir(path, mode);
      },createPath:function (parent, path, canRead, canWrite) {
        parent = typeof parent === 'string' ? parent : FS.getPath(parent);
        var parts = path.split('/').reverse();
        while (parts.length) {
          var part = parts.pop();
          if (!part) continue;
          var current = PATH.join2(parent, part);
          try {
            FS.mkdir(current);
          } catch (e) {
            // ignore EEXIST
          }
          parent = current;
        }
        return current;
      },createFile:function (parent, name, properties, canRead, canWrite) {
        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
        var mode = FS.getMode(canRead, canWrite);
        return FS.create(path, mode);
      },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) {
        var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent;
        var mode = FS.getMode(canRead, canWrite);
        var node = FS.create(path, mode);
        if (data) {
          if (typeof data === 'string') {
            var arr = new Array(data.length);
            for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
            data = arr;
          }
          // make sure we can write to the file
          FS.chmod(node, mode | 146);
          var stream = FS.open(node, 'w');
          FS.write(stream, data, 0, data.length, 0, canOwn);
          FS.close(stream);
          FS.chmod(node, mode);
        }
        return node;
      },createDevice:function (parent, name, input, output) {
        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
        var mode = FS.getMode(!!input, !!output);
        if (!FS.createDevice.major) FS.createDevice.major = 64;
        var dev = FS.makedev(FS.createDevice.major++, 0);
        // Create a fake device that a set of stream ops to emulate
        // the old behavior.
        FS.registerDevice(dev, {
          open: function(stream) {
            stream.seekable = false;
          },
          close: function(stream) {
            // flush any pending line data
            if (output && output.buffer && output.buffer.length) {
              output(10);
            }
          },
          read: function(stream, buffer, offset, length, pos /* ignored */) {
            var bytesRead = 0;
            for (var i = 0; i < length; i++) {
              var result;
              try {
                result = input();
              } catch (e) {
                throw new FS.ErrnoError(ERRNO_CODES.EIO);
              }
              if (result === undefined && bytesRead === 0) {
                throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
              }
              if (result === null || result === undefined) break;
              bytesRead++;
              buffer[offset+i] = result;
            }
            if (bytesRead) {
              stream.node.timestamp = Date.now();
            }
            return bytesRead;
          },
          write: function(stream, buffer, offset, length, pos) {
            for (var i = 0; i < length; i++) {
              try {
                output(buffer[offset+i]);
              } catch (e) {
                throw new FS.ErrnoError(ERRNO_CODES.EIO);
              }
            }
            if (length) {
              stream.node.timestamp = Date.now();
            }
            return i;
          }
        });
        return FS.mkdev(path, mode, dev);
      },createLink:function (parent, name, target, canRead, canWrite) {
        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
        return FS.symlink(target, path);
      },forceLoadFile:function (obj) {
        if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
        var success = true;
        if (typeof XMLHttpRequest !== 'undefined') {
          throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
        } else if (Module['read']) {
          // Command-line.
          try {
            // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
            //          read() will try to parse UTF8.
            obj.contents = intArrayFromString(Module['read'](obj.url), true);
            obj.usedBytes = obj.contents.length;
          } catch (e) {
            success = false;
          }
        } else {
          throw new Error('Cannot load without read() or XMLHttpRequest.');
        }
        if (!success) ___setErrNo(ERRNO_CODES.EIO);
        return success;
      },createLazyFile:function (parent, name, url, canRead, canWrite) {
        // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
        function LazyUint8Array() {
          this.lengthKnown = false;
          this.chunks = []; // Loaded chunks. Index is the chunk number
        }
        LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
          if (idx > this.length-1 || idx < 0) {
            return undefined;
          }
          var chunkOffset = idx % this.chunkSize;
          var chunkNum = (idx / this.chunkSize)|0;
          return this.getter(chunkNum)[chunkOffset];
        }
        LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
          this.getter = getter;
        }
        LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
          // Find length
          var xhr = new XMLHttpRequest();
          xhr.open('HEAD', url, false);
          xhr.send(null);
          if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
          var datalength = Number(xhr.getResponseHeader("Content-length"));
          var header;
          var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
          var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
  
          var chunkSize = 1024*1024; // Chunk size in bytes
  
          if (!hasByteServing) chunkSize = datalength;
  
          // Function to get a range from the remote URL.
          var doXHR = (function(from, to) {
            if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
            if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
  
            // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
            var xhr = new XMLHttpRequest();
            xhr.open('GET', url, false);
            if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
  
            // Some hints to the browser that we want binary data.
            if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer';
            if (xhr.overrideMimeType) {
              xhr.overrideMimeType('text/plain; charset=x-user-defined');
            }
  
            xhr.send(null);
            if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
            if (xhr.response !== undefined) {
              return new Uint8Array(xhr.response || []);
            } else {
              return intArrayFromString(xhr.responseText || '', true);
            }
          });
          var lazyArray = this;
          lazyArray.setDataGetter(function(chunkNum) {
            var start = chunkNum * chunkSize;
            var end = (chunkNum+1) * chunkSize - 1; // including this byte
            end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
            if (typeof(lazyArray.chunks[chunkNum]) === "undefined") {
              lazyArray.chunks[chunkNum] = doXHR(start, end);
            }
            if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!");
            return lazyArray.chunks[chunkNum];
          });
  
          if (usesGzip || !datalength) {
            // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
            chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
            datalength = this.getter(0).length;
            chunkSize = datalength;
            console.log("LazyFiles on gzip forces download of the whole file when length is accessed");
          }
  
          this._length = datalength;
          this._chunkSize = chunkSize;
          this.lengthKnown = true;
        }
        if (typeof XMLHttpRequest !== 'undefined') {
          if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
          var lazyArray = new LazyUint8Array();
          Object.defineProperties(lazyArray, {
            length: {
              get: function() {
                if(!this.lengthKnown) {
                  this.cacheLength();
                }
                return this._length;
              }
            },
            chunkSize: {
              get: function() {
                if(!this.lengthKnown) {
                  this.cacheLength();
                }
                return this._chunkSize;
              }
            }
          });
  
          var properties = { isDevice: false, contents: lazyArray };
        } else {
          var properties = { isDevice: false, url: url };
        }
  
        var node = FS.createFile(parent, name, properties, canRead, canWrite);
        // This is a total hack, but I want to get this lazy file code out of the
        // core of MEMFS. If we want to keep this lazy file concept I feel it should
        // be its own thin LAZYFS proxying calls to MEMFS.
        if (properties.contents) {
          node.contents = properties.contents;
        } else if (properties.url) {
          node.contents = null;
          node.url = properties.url;
        }
        // Add a function that defers querying the file size until it is asked the first time.
        Object.defineProperties(node, {
          usedBytes: {
            get: function() { return this.contents.length; }
          }
        });
        // override each stream op with one that tries to force load the lazy file first
        var stream_ops = {};
        var keys = Object.keys(node.stream_ops);
        keys.forEach(function(key) {
          var fn = node.stream_ops[key];
          stream_ops[key] = function forceLoadLazyFile() {
            if (!FS.forceLoadFile(node)) {
              throw new FS.ErrnoError(ERRNO_CODES.EIO);
            }
            return fn.apply(null, arguments);
          };
        });
        // use a custom read function
        stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
          if (!FS.forceLoadFile(node)) {
            throw new FS.ErrnoError(ERRNO_CODES.EIO);
          }
          var contents = stream.node.contents;
          if (position >= contents.length)
            return 0;
          var size = Math.min(contents.length - position, length);
          assert(size >= 0);
          if (contents.slice) { // normal array
            for (var i = 0; i < size; i++) {
              buffer[offset + i] = contents[position + i];
            }
          } else {
            for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
              buffer[offset + i] = contents.get(position + i);
            }
          }
          return size;
        };
        node.stream_ops = stream_ops;
        return node;
      },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
        Browser.init(); // XXX perhaps this method should move onto Browser?
        // TODO we should allow people to just pass in a complete filename instead
        // of parent and name being that we just join them anyways
        var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
        var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname
        function processData(byteArray) {
          function finish(byteArray) {
            if (preFinish) preFinish();
            if (!dontCreateFile) {
              FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
            }
            if (onload) onload();
            removeRunDependency(dep);
          }
          var handled = false;
          Module['preloadPlugins'].forEach(function(plugin) {
            if (handled) return;
            if (plugin['canHandle'](fullname)) {
              plugin['handle'](byteArray, fullname, finish, function() {
                if (onerror) onerror();
                removeRunDependency(dep);
              });
              handled = true;
            }
          });
          if (!handled) finish(byteArray);
        }
        addRunDependency(dep);
        if (typeof url == 'string') {
          Browser.asyncLoad(url, function(byteArray) {
            processData(byteArray);
          }, onerror);
        } else {
          processData(url);
        }
      },indexedDB:function () {
        return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
      },DB_NAME:function () {
        return 'EM_FS_' + window.location.pathname;
      },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) {
        onload = onload || function(){};
        onerror = onerror || function(){};
        var indexedDB = FS.indexedDB();
        try {
          var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
        } catch (e) {
          return onerror(e);
        }
        openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
          console.log('creating db');
          var db = openRequest.result;
          db.createObjectStore(FS.DB_STORE_NAME);
        };
        openRequest.onsuccess = function openRequest_onsuccess() {
          var db = openRequest.result;
          var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite');
          var files = transaction.objectStore(FS.DB_STORE_NAME);
          var ok = 0, fail = 0, total = paths.length;
          function finish() {
            if (fail == 0) onload(); else onerror();
          }
          paths.forEach(function(path) {
            var putRequest = files.put(FS.analyzePath(path).object.contents, path);
            putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() };
            putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() };
          });
          transaction.onerror = onerror;
        };
        openRequest.onerror = onerror;
      },loadFilesFromDB:function (paths, onload, onerror) {
        onload = onload || function(){};
        onerror = onerror || function(){};
        var indexedDB = FS.indexedDB();
        try {
          var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
        } catch (e) {
          return onerror(e);
        }
        openRequest.onupgradeneeded = onerror; // no database to load from
        openRequest.onsuccess = function openRequest_onsuccess() {
          var db = openRequest.result;
          try {
            var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly');
          } catch(e) {
            onerror(e);
            return;
          }
          var files = transaction.objectStore(FS.DB_STORE_NAME);
          var ok = 0, fail = 0, total = paths.length;
          function finish() {
            if (fail == 0) onload(); else onerror();
          }
          paths.forEach(function(path) {
            var getRequest = files.get(path);
            getRequest.onsuccess = function getRequest_onsuccess() {
              if (FS.analyzePath(path).exists) {
                FS.unlink(path);
              }
              FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
              ok++;
              if (ok + fail == total) finish();
            };
            getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() };
          });
          transaction.onerror = onerror;
        };
        openRequest.onerror = onerror;
      }};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) {
        if (path[0] !== '/') {
          // relative path
          var dir;
          if (dirfd === -100) {
            dir = FS.cwd();
          } else {
            var dirstream = FS.getStream(dirfd);
            if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
            dir = dirstream.path;
          }
          path = PATH.join2(dir, path);
        }
        return path;
      },doStat:function (func, path, buf) {
        try {
          var stat = func(path);
        } catch (e) {
          if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
            // an error occurred while trying to look up the path; we should just report ENOTDIR
            return -ERRNO_CODES.ENOTDIR;
          }
          throw e;
        }
        HEAP32[((buf)>>2)]=stat.dev;
        HEAP32[(((buf)+(4))>>2)]=0;
        HEAP32[(((buf)+(8))>>2)]=stat.ino;
        HEAP32[(((buf)+(12))>>2)]=stat.mode;
        HEAP32[(((buf)+(16))>>2)]=stat.nlink;
        HEAP32[(((buf)+(20))>>2)]=stat.uid;
        HEAP32[(((buf)+(24))>>2)]=stat.gid;
        HEAP32[(((buf)+(28))>>2)]=stat.rdev;
        HEAP32[(((buf)+(32))>>2)]=0;
        HEAP32[(((buf)+(36))>>2)]=stat.size;
        HEAP32[(((buf)+(40))>>2)]=4096;
        HEAP32[(((buf)+(44))>>2)]=stat.blocks;
        HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0;
        HEAP32[(((buf)+(52))>>2)]=0;
        HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0;
        HEAP32[(((buf)+(60))>>2)]=0;
        HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0;
        HEAP32[(((buf)+(68))>>2)]=0;
        HEAP32[(((buf)+(72))>>2)]=stat.ino;
        return 0;
      },doMsync:function (addr, stream, len, flags) {
        var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
        FS.msync(stream, buffer, 0, len, flags);
      },doMkdir:function (path, mode) {
        // remove a trailing slash, if one - /a/b/ has basename of '', but
        // we want to create b in the context of this function
        path = PATH.normalize(path);
        if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
        FS.mkdir(path, mode, 0);
        return 0;
      },doMknod:function (path, mode, dev) {
        // we don't want this in the JS API as it uses mknod to create all nodes.
        switch (mode & 61440) {
          case 32768:
          case 8192:
          case 24576:
          case 4096:
          case 49152:
            break;
          default: return -ERRNO_CODES.EINVAL;
        }
        FS.mknod(path, mode, dev);
        return 0;
      },doReadlink:function (path, buf, bufsize) {
        if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
        var ret = FS.readlink(path);
  
        var len = Math.min(bufsize, lengthBytesUTF8(ret));
        var endChar = HEAP8[buf+len];
        stringToUTF8(ret, buf, bufsize+1);
        // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
        // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
        HEAP8[buf+len] = endChar;
  
        return len;
      },doAccess:function (path, amode) {
        if (amode & ~7) {
          // need a valid mode
          return -ERRNO_CODES.EINVAL;
        }
        var node;
        var lookup = FS.lookupPath(path, { follow: true });
        node = lookup.node;
        var perms = '';
        if (amode & 4) perms += 'r';
        if (amode & 2) perms += 'w';
        if (amode & 1) perms += 'x';
        if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
          return -ERRNO_CODES.EACCES;
        }
        return 0;
      },doDup:function (path, flags, suggestFD) {
        var suggest = FS.getStream(suggestFD);
        if (suggest) FS.close(suggest);
        return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
      },doReadv:function (stream, iov, iovcnt, offset) {
        var ret = 0;
        for (var i = 0; i < iovcnt; i++) {
          var ptr = HEAP32[(((iov)+(i*8))>>2)];
          var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
          var curr = FS.read(stream, HEAP8,ptr, len, offset);
          if (curr < 0) return -1;
          ret += curr;
          if (curr < len) break; // nothing more to read
        }
        return ret;
      },doWritev:function (stream, iov, iovcnt, offset) {
        var ret = 0;
        for (var i = 0; i < iovcnt; i++) {
          var ptr = HEAP32[(((iov)+(i*8))>>2)];
          var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
          var curr = FS.write(stream, HEAP8,ptr, len, offset);
          if (curr < 0) return -1;
          ret += curr;
        }
        return ret;
      },varargs:0,get:function (varargs) {
        SYSCALLS.varargs += 4;
        var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
        return ret;
      },getStr:function () {
        var ret = Pointer_stringify(SYSCALLS.get());
        return ret;
      },getStreamFromFD:function () {
        var stream = FS.getStream(SYSCALLS.get());
        if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        return stream;
      },getSocketFromFD:function () {
        var socket = SOCKFS.getSocket(SYSCALLS.get());
        if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
        return socket;
      },getSocketAddress:function (allowNull) {
        var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get();
        if (allowNull && addrp === 0) return null;
        var info = __read_sockaddr(addrp, addrlen);
        if (info.errno) throw new FS.ErrnoError(info.errno);
        info.addr = DNS.lookup_addr(info.addr) || info.addr;
        return info;
      },get64:function () {
        var low = SYSCALLS.get(), high = SYSCALLS.get();
        if (low >= 0) assert(high === 0);
        else assert(high === -1);
        return low;
      },getZero:function () {
        assert(SYSCALLS.get() === 0);
      }};function ___syscall4(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // write
      var stream = SYSCALLS.getStreamFromFD(), buf = SYSCALLS.get(), count = SYSCALLS.get();
      return FS.write(stream, HEAP8,buf, count);
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function _emscripten_glGetShaderiv(shader, pname, p) {
      if (!p) {
        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
        // if p == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
        var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
        if (log === null) log = '(unknown error)';
        HEAP32[((p)>>2)]=log.length + 1;
      } else {
        HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
      }
    }

  function _emscripten_glUniformMatrix3fv(location, count, transpose, value) {
  
  
      var view;
      if (9*count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[9*count-1];
        for (var i = 0; i < 9*count; i += 9) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
          view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
          view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
          view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
          view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
          view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*36)>>2);
      }
      GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, view);
    }

  function _emscripten_glVertexAttrib2f(x0, x1, x2) { GLctx['vertexAttrib2f'](x0, x1, x2) }

  function _emscripten_glUniform4fv(location, count, value) {
  
  
      var view;
      if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[4*count-1];
        for (var i = 0; i < 4*count; i += 4) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
      }
      GLctx.uniform4fv(GL.uniforms[location], view);
    }

  function _emscripten_glGetVertexAttribiv(index, pname, params) {
      // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
      // otherwise the results are undefined. (GLES3 spec 6.1.12)
      emscriptenWebGLGetVertexAttrib(index, pname, params, 'FloatToInteger');
    }

  function _emscripten_glUniformMatrix4fv(location, count, transpose, value) {
  
  
      var view;
      if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[16*count-1];
        for (var i = 0; i < 16*count; i += 16) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
          view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
          view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
          view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
          view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
          view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
          view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)];
          view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)];
          view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)];
          view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)];
          view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)];
          view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)];
          view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
      }
      GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view);
    }

  function _emscripten_glGenFramebuffers(n, ids) {
      for (var i = 0; i < n; ++i) {
        var framebuffer = GLctx.createFramebuffer();
        if (!framebuffer) {
          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
          while(i < n) HEAP32[(((ids)+(i++*4))>>2)]=0;
          return;
        }
        var id = GL.getNewId(GL.framebuffers);
        framebuffer.name = id;
        GL.framebuffers[id] = framebuffer;
        HEAP32[(((ids)+(i*4))>>2)]=id;
      }
    }

  function _emscripten_glEnableClientState() {
  Module['printErr']('missing function: emscripten_glEnableClientState'); abort(-1);
  }

  function _emscripten_glGetPointerv() {
  Module['printErr']('missing function: emscripten_glGetPointerv'); abort(-1);
  }

  function _emscripten_glBlendEquationSeparate(x0, x1) { GLctx['blendEquationSeparate'](x0, x1) }

  function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // writev
      var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
      return SYSCALLS.doWritev(stream, iov, iovcnt);
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function _emscripten_glBindTexture(target, texture) {
      GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
    }

  function _emscripten_glShaderBinary() {
      GL.recordError(0x0500/*GL_INVALID_ENUM*/);
    }

  function _emscripten_glStencilMask(x0) { GLctx['stencilMask'](x0) }

  function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { GLctx['stencilFuncSeparate'](x0, x1, x2, x3) }

  function _emscripten_glGenTextures(n, textures) {
      for (var i = 0; i < n; i++) {
        var texture = GLctx.createTexture();
        if (!texture) {
          GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
          while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
          return;
        }
        var id = GL.getNewId(GL.textures);
        texture.name = id;
        GL.textures[id] = texture;
        HEAP32[(((textures)+(i*4))>>2)]=id;
      }
    }

  function _emscripten_glVertexAttrib2fv(index, v) {
  
      GLctx.vertexAttrib2f(index, HEAPF32[v>>2], HEAPF32[v+4>>2]);
    }


  function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) {
      program = GL.programs[program];
      var info = GLctx.getActiveUniform(program, index);
      if (!info) return; // If an error occurs, nothing will be written to length, size, type and name.
  
      if (bufSize > 0 && name) {
        var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
      } else {
        if (length) HEAP32[((length)>>2)]=0;
      }
  
      if (size) HEAP32[((size)>>2)]=info.size;
      if (type) HEAP32[((type)>>2)]=info.type;
    }

  function _emscripten_glDeleteObjectARB() {
  Module['printErr']('missing function: emscripten_glDeleteObjectARB'); abort(-1);
  }

  function _emscripten_glUniform1f(location, v0) {
      GLctx.uniform1f(GL.uniforms[location], v0);
    }

  function _emscripten_glDisableVertexAttribArray(index) {
      GLctx.disableVertexAttribArray(index);
    }

  function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
      GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
    }

  function _emscripten_glVertexAttrib1f(x0, x1) { GLctx['vertexAttrib1f'](x0, x1) }

  function _emscripten_glFinish() { GLctx['finish']() }

  function _emscripten_glLoadIdentity(){ throw 'Legacy GL function (glLoadIdentity) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }

  function _emscripten_glDepthFunc(x0) { GLctx['depthFunc'](x0) }

  function _emscripten_glDrawArrays(mode, first, count) {
  
      GLctx.drawArrays(mode, first, count);
  
    }

  function _emscripten_glGenBuffers(n, buffers) {
      for (var i = 0; i < n; i++) {
        var buffer = GLctx.createBuffer();
        if (!buffer) {
          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
          while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
          return;
        }
        var id = GL.getNewId(GL.buffers);
        buffer.name = id;
        GL.buffers[id] = buffer;
        HEAP32[(((buffers)+(i*4))>>2)]=id;
      }
    }

  function _emscripten_glClearDepth(x0) { GLctx['clearDepth'](x0) }


  function _emscripten_glUniform4iv(location, count, value) {
  
  
      GLctx.uniform4iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*16)>>2));
    }

  function _emscripten_glBlendColor(x0, x1, x2, x3) { GLctx['blendColor'](x0, x1, x2, x3) }

  function _emscripten_glUniform3fv(location, count, value) {
  
  
      var view;
      if (3*count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[3*count-1];
        for (var i = 0; i < 3*count; i += 3) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*12)>>2);
      }
      GLctx.uniform3fv(GL.uniforms[location], view);
    }

  function _emscripten_glGetUniformLocation(program, name) {
      name = Pointer_stringify(name);
  
      var arrayOffset = 0;
      // If user passed an array accessor "[index]", parse the array index off the accessor.
      if (name.indexOf(']', name.length-1) !== -1) {
        var ls = name.lastIndexOf('[');
        var arrayIndex = name.slice(ls+1, -1);
        if (arrayIndex.length > 0) {
          arrayOffset = parseInt(arrayIndex);
          if (arrayOffset < 0) {
            return -1;
          }
        }
        name = name.slice(0, ls);
      }
  
      var ptable = GL.programInfos[program];
      if (!ptable) {
        return -1;
      }
      var utable = ptable.uniforms;
      var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
      if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
        return uniformInfo[1]+arrayOffset;
      } else {
        return -1;
      }
    }

  function _emscripten_glAttachShader(program, shader) {
      GLctx.attachShader(GL.programs[program],
                              GL.shaders[shader]);
    }

  function _emscripten_glVertexAttrib4fv(index, v) {
  
      GLctx.vertexAttrib4f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2], HEAPF32[v+12>>2]);
    }

  function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // close
      var stream = SYSCALLS.getStreamFromFD();
      FS.close(stream);
      return 0;
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function _emscripten_glScissor(x0, x1, x2, x3) { GLctx['scissor'](x0, x1, x2, x3) }

   
  Module["_bitshift64Lshr"] = _bitshift64Lshr;

   
  Module["___udivdi3"] = ___udivdi3;

  function _emscripten_glColorPointer() {
  Module['printErr']('missing function: emscripten_glColorPointer'); abort(-1);
  }

  function _emscripten_glValidateProgram(program) {
      GLctx.validateProgram(GL.programs[program]);
    }

  function _emscripten_glDrawBuffers(n, bufs) {
  
      var bufArray = GL.tempFixedLengthArray[n];
      for (var i = 0; i < n; i++) {
        bufArray[i] = HEAP32[(((bufs)+(i*4))>>2)];
      }
  
      GLctx['drawBuffers'](bufArray);
    }

  function _emscripten_glClearStencil(x0) { GLctx['clearStencil'](x0) }

  function _emscripten_glBindFramebuffer(target, framebuffer) {
      GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null);
    }

  function _emscripten_glDetachShader(program, shader) {
      GLctx.detachShader(GL.programs[program],
                              GL.shaders[shader]);
    }

  function _emscripten_glBlendEquation(x0) { GLctx['blendEquation'](x0) }

  function _emscripten_glBufferSubData(target, offset, size, data) {
      GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
    }

  function _emscripten_glBufferData(target, size, data, usage) {
      if (!data) {
        GLctx.bufferData(target, size, usage);
      } else {
        GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
      }
    }

   
  Module["_sbrk"] = _sbrk;

   
  Module["_bitshift64Shl"] = _bitshift64Shl;

  function _emscripten_glGetTexParameteriv(target, pname, params) {
      if (!params) {
        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
        // if p == null, issue a GL error to notify user about it. 
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      HEAP32[((params)>>2)]=GLctx.getTexParameter(target, pname);
    }

  function _emscripten_glGetShaderSource(shader, bufSize, length, source) {
      var result = GLctx.getShaderSource(GL.shaders[shader]);
      if (!result) return; // If an error occurs, nothing will be written to length or source.
      if (bufSize > 0 && source) {
        var numBytesWrittenExclNull = stringToUTF8(result, source, bufSize);
        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
      } else {
        if (length) HEAP32[((length)>>2)]=0;
      }
    }

  function _emscripten_glGenerateMipmap(x0) { GLctx['generateMipmap'](x0) }

  function _emscripten_glSampleCoverage(value, invert) {
      GLctx.sampleCoverage(value, !!invert);
    }

  function _emscripten_glCullFace(x0) { GLctx['cullFace'](x0) }

  function _emscripten_glGetFloatv(name_, p) {
      emscriptenWebGLGet(name_, p, 'Float');
    }

  function _emscripten_glUseProgram(program) {
      GLctx.useProgram(program ? GL.programs[program] : null);
    }

  function _emscripten_glHint(x0, x1) { GLctx['hint'](x0, x1) }

  function _emscripten_glVertexAttribDivisor(index, divisor) {
      GLctx['vertexAttribDivisor'](index, divisor);
    }

  function _emscripten_glDrawElementsInstanced(mode, count, type, indices, primcount) {
      GLctx['drawElementsInstanced'](mode, count, type, indices, primcount);
    }

  function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
      GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget,
                                         GL.renderbuffers[renderbuffer]);
    }

  function _emscripten_glDrawElements(mode, count, type, indices) {
  
      GLctx.drawElements(mode, count, type, indices);
  
    }

  function _emscripten_glUniform2fv(location, count, value) {
  
  
      var view;
      if (2*count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[2*count-1];
        for (var i = 0; i < 2*count; i += 2) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*8)>>2);
      }
      GLctx.uniform2fv(GL.uniforms[location], view);
    }

  function _emscripten_glMatrixMode(){ throw 'Legacy GL function (glMatrixMode) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }

  function _abort() {
      Module['abort']();
    }

  function _emscripten_glCreateProgram() {
      var id = GL.getNewId(GL.programs);
      var program = GLctx.createProgram();
      program.name = id;
      GL.programs[id] = program;
      return id;
    }

   
  Module["___divdi3"] = ___divdi3;

  function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
      GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
    }

  function _emscripten_glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) }

  function _emscripten_glDeleteFramebuffers(n, framebuffers) {
      for (var i = 0; i < n; ++i) {
        var id = HEAP32[(((framebuffers)+(i*4))>>2)];
        var framebuffer = GL.framebuffers[id];
        if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
        GLctx.deleteFramebuffer(framebuffer);
        framebuffer.name = 0;
        GL.framebuffers[id] = null;
      }
    }

  function _emscripten_glBindVertexArray(vao) {
      GLctx['bindVertexArray'](GL.vaos[vao]);
    }

  function _emscripten_glIsBuffer(buffer) {
      var b = GL.buffers[buffer];
      if (!b) return 0;
      return GLctx.isBuffer(b);
    }

  function _emscripten_glUniform2iv(location, count, value) {
  
  
      GLctx.uniform2iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*8)>>2));
    }

  function _emscripten_glVertexAttrib1fv(index, v) {
  
      GLctx.vertexAttrib1f(index, HEAPF32[v>>2]);
    }

  function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) {
      var pixelData = null;
      if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0);
      GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData);
    }

  function _emscripten_glPolygonOffset(x0, x1) { GLctx['polygonOffset'](x0, x1) }

  var _emscripten_asm_const_int=true;

  function _emscripten_glUniform2f(location, v0, v1) {
      GLctx.uniform2f(GL.uniforms[location], v0, v1);
    }

  function ___unlock() {}

  function _emscripten_glLoadMatrixf() {
  Module['printErr']('missing function: emscripten_glLoadMatrixf'); abort(-1);
  }

   
  Module["_memmove"] = _memmove;

  function _emscripten_glUniform2i(location, v0, v1) {
      GLctx.uniform2i(GL.uniforms[location], v0, v1);
    }

  function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) {
      var log = GLctx.getProgramInfoLog(GL.programs[program]);
      if (log === null) log = '(unknown error)';
  
      if (maxLength > 0 && infoLog) {
        var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
      } else {
        if (length) HEAP32[((length)>>2)]=0;
      }
    }

  function _emscripten_glDeleteRenderbuffers(n, renderbuffers) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((renderbuffers)+(i*4))>>2)];
        var renderbuffer = GL.renderbuffers[id];
        if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects".
        GLctx.deleteRenderbuffer(renderbuffer);
        renderbuffer.name = 0;
        GL.renderbuffers[id] = null;
      }
    }

  function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
  
      var pixelData = null;
      if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
      GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
    }

  function _emscripten_glGetUniformiv(program, location, params) {
      emscriptenWebGLGetUniform(program, location, params, 'Integer');
    }

  function _emscripten_glActiveTexture(x0) { GLctx['activeTexture'](x0) }

  function _emscripten_glDepthMask(flag) {
      GLctx.depthMask(!!flag);
    }

  function _emscripten_glDepthRangef(x0, x1) { GLctx['depthRange'](x0, x1) }

  function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // ioctl
      var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get();
      switch (op) {
        case 21505: {
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          return 0;
        }
        case 21506: {
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          return 0; // no-op, not actually adjusting terminal settings
        }
        case 21519: {
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          var argp = SYSCALLS.get();
          HEAP32[((argp)>>2)]=0;
          return 0;
        }
        case 21520: {
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          return -ERRNO_CODES.EINVAL; // not supported
        }
        case 21531: {
          var argp = SYSCALLS.get();
          return FS.ioctl(stream, op, argp);
        }
        case 21523: {
          // TODO: in theory we should write to the winsize struct that gets
          // passed in, but for now musl doesn't read anything on it
          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
          return 0;
        }
        default: abort('bad ioctl syscall ' + op);
      }
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function _emscripten_glFlush() { GLctx['flush']() }

  function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx['stencilMaskSeparate'](x0, x1) }

  function _emscripten_glCreateShader(shaderType) {
      var id = GL.getNewId(GL.shaders);
      GL.shaders[id] = GLctx.createShader(shaderType);
      return id;
    }

  function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs;
  try {
   // llseek
      var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get();
      var offset = offset_low;
      assert(offset_high === 0);
      FS.llseek(stream, offset, whence);
      HEAP32[((result)>>2)]=stream.position;
      if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
      return 0;
    } catch (e) {
    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
    return -e.errno;
  }
  }

  function _emscripten_glIsShader(shader) {
      var s = GL.shaders[shader];
      if (!s) return 0;
      return GLctx.isShader(s);
    }

  
   
  Module["___muldsi3"] = ___muldsi3; 
  Module["___muldi3"] = ___muldi3;

  function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) {
      var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType);
      HEAP32[((range)>>2)]=result.rangeMin;
      HEAP32[(((range)+(4))>>2)]=result.rangeMax;
      HEAP32[((precision)>>2)]=result.precision;
    }

  function _emscripten_glUniform1fv(location, count, value) {
  
  
      var view;
      if (count <= GL.MINI_TEMP_BUFFER_SIZE) {
        // avoid allocation when uploading few enough uniforms
        view = GL.miniTempBufferViews[count-1];
        for (var i = 0; i < count; ++i) {
          view[i] = HEAPF32[(((value)+(4*i))>>2)];
        }
      } else {
        view = HEAPF32.subarray((value)>>2,(value+count*4)>>2);
      }
      GLctx.uniform1fv(GL.uniforms[location], view);
    }

  function _emscripten_glColorMask(red, green, blue, alpha) {
      GLctx.colorMask(!!red, !!green, !!blue, !!alpha);
    }

  function _emscripten_glPixelStorei(pname, param) {
      if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
        GL.packAlignment = param;
      } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
        GL.unpackAlignment = param;
      }
      GLctx.pixelStorei(pname, param);
    }

  function _emscripten_glDeleteTextures(n, textures) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((textures)+(i*4))>>2)];
        var texture = GL.textures[id];
        if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
        GLctx.deleteTexture(texture);
        texture.name = 0;
        GL.textures[id] = null;
      }
    }

  function ___lock() {}

  function _emscripten_glBindProgramARB() {
  Module['printErr']('missing function: emscripten_glBindProgramARB'); abort(-1);
  }

  function _emscripten_glDeleteVertexArrays(n, vaos) {
      for (var i = 0; i < n; i++) {
        var id = HEAP32[(((vaos)+(i*4))>>2)];
        GLctx['deleteVertexArray'](GL.vaos[id]);
        GL.vaos[id] = null;
      }
    }

  function _emscripten_glGenVertexArrays(n, arrays) {
  
      for (var i = 0; i < n; i++) {
        var vao = GLctx['createVertexArray']();
        if (!vao) {
          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
          while(i < n) HEAP32[(((arrays)+(i++*4))>>2)]=0;
          return;
        }
        var id = GL.getNewId(GL.vaos);
        vao.name = id;
        GL.vaos[id] = vao;
        HEAP32[(((arrays)+(i*4))>>2)]=id;
      }
    }

  function _emscripten_glCheckFramebufferStatus(x0) { return GLctx['checkFramebufferStatus'](x0) }

  function _emscripten_glDeleteProgram(id) {
      if (!id) return;
      var program = GL.programs[id];
      if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
        return;
      }
      GLctx.deleteProgram(program);
      program.name = 0;
      GL.programs[id] = null;
      GL.programInfos[id] = null;
    }

  function _emscripten_glGetBooleanv(name_, p) {
      emscriptenWebGLGet(name_, p, 'Boolean');
    }

  function _emscripten_glDisable(x0) { GLctx['disable'](x0) }

  function _emscripten_glCompileShader(shader) {
      GLctx.compileShader(GL.shaders[shader]);
    }
var GLctx; GL.init();
FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink;;
__ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });;
if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); };
DYNAMICTOP_PTR = allocate(1, "i32", ALLOC_STATIC);

STACK_BASE = STACKTOP = Runtime.alignMemory(STATICTOP);

STACK_MAX = STACK_BASE + TOTAL_STACK;

DYNAMIC_BASE = Runtime.alignMemory(STACK_MAX);

HEAP32[DYNAMICTOP_PTR>>2] = DYNAMIC_BASE;

staticSealed = true; // seal the static portion of memory



function invoke_viiiii(index,a1,a2,a3,a4,a5) {
  try {
    Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vd(index,a1) {
  try {
    Module["dynCall_vd"](index,a1);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vid(index,a1,a2) {
  try {
    Module["dynCall_vid"](index,a1,a2);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vi(index,a1) {
  try {
    Module["dynCall_vi"](index,a1);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vii(index,a1,a2) {
  try {
    Module["dynCall_vii"](index,a1,a2);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_ii(index,a1) {
  try {
    return Module["dynCall_ii"](index,a1);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viddd(index,a1,a2,a3,a4) {
  try {
    Module["dynCall_viddd"](index,a1,a2,a3,a4);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vidd(index,a1,a2,a3) {
  try {
    Module["dynCall_vidd"](index,a1,a2,a3);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_iiii(index,a1,a2,a3) {
  try {
    return Module["dynCall_iiii"](index,a1,a2,a3);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
  try {
    Module["dynCall_viiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) {
  try {
    Module["dynCall_viiiiii"](index,a1,a2,a3,a4,a5,a6);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viii(index,a1,a2,a3) {
  try {
    Module["dynCall_viii"](index,a1,a2,a3);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vidddd(index,a1,a2,a3,a4,a5) {
  try {
    Module["dynCall_vidddd"](index,a1,a2,a3,a4,a5);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vdi(index,a1,a2) {
  try {
    Module["dynCall_vdi"](index,a1,a2);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
  try {
    Module["dynCall_viiiiiii"](index,a1,a2,a3,a4,a5,a6,a7);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
  try {
    Module["dynCall_viiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_iii(index,a1,a2) {
  try {
    return Module["dynCall_iii"](index,a1,a2);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_i(index) {
  try {
    return Module["dynCall_i"](index);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vdddddd(index,a1,a2,a3,a4,a5,a6) {
  try {
    Module["dynCall_vdddddd"](index,a1,a2,a3,a4,a5,a6);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vdddd(index,a1,a2,a3,a4) {
  try {
    Module["dynCall_vdddd"](index,a1,a2,a3,a4);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_vdd(index,a1,a2) {
  try {
    Module["dynCall_vdd"](index,a1,a2);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_v(index) {
  try {
    Module["dynCall_v"](index);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viid(index,a1,a2,a3) {
  try {
    Module["dynCall_viid"](index,a1,a2,a3);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

function invoke_viiii(index,a1,a2,a3,a4) {
  try {
    Module["dynCall_viiii"](index,a1,a2,a3,a4);
  } catch(e) {
    if (typeof e !== 'number' && e !== 'longjmp') throw e;
    Module["setThrew"](1, 0);
  }
}

Module.asmGlobalArg = { "Math": Math, "Int8Array": Int8Array, "Int16Array": Int16Array, "Int32Array": Int32Array, "Uint8Array": Uint8Array, "Uint16Array": Uint16Array, "Uint32Array": Uint32Array, "Float32Array": Float32Array, "Float64Array": Float64Array, "NaN": NaN, "Infinity": Infinity };

Module.asmLibraryArg = { "abort": abort, "assert": assert, "enlargeMemory": enlargeMemory, "getTotalMemory": getTotalMemory, "abortOnCannotGrowMemory": abortOnCannotGrowMemory, "invoke_viiiii": invoke_viiiii, "invoke_vd": invoke_vd, "invoke_vid": invoke_vid, "invoke_vi": invoke_vi, "invoke_vii": invoke_vii, "invoke_ii": invoke_ii, "invoke_viddd": invoke_viddd, "invoke_vidd": invoke_vidd, "invoke_iiii": invoke_iiii, "invoke_viiiiiiii": invoke_viiiiiiii, "invoke_viiiiii": invoke_viiiiii, "invoke_viii": invoke_viii, "invoke_vidddd": invoke_vidddd, "invoke_vdi": invoke_vdi, "invoke_viiiiiii": invoke_viiiiiii, "invoke_viiiiiiiii": invoke_viiiiiiiii, "invoke_iii": invoke_iii, "invoke_i": invoke_i, "invoke_vdddddd": invoke_vdddddd, "invoke_vdddd": invoke_vdddd, "invoke_vdd": invoke_vdd, "invoke_v": invoke_v, "invoke_viid": invoke_viid, "invoke_viiii": invoke_viiii, "_emscripten_glGetTexParameterfv": _emscripten_glGetTexParameterfv, "_emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers, "_emscripten_glShaderSource": _emscripten_glShaderSource, "_emscripten_glReleaseShaderCompiler": _emscripten_glReleaseShaderCompiler, "_emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate, "_emscripten_glGetShaderPrecisionFormat": _emscripten_glGetShaderPrecisionFormat, "_emscripten_glGetIntegerv": _emscripten_glGetIntegerv, "_emscripten_glCullFace": _emscripten_glCullFace, "_emscripten_glStencilMaskSeparate": _emscripten_glStencilMaskSeparate, "_emscripten_glViewport": _emscripten_glViewport, "_emscripten_glFrontFace": _emscripten_glFrontFace, "_emscripten_glDrawArrays": _emscripten_glDrawArrays, "_emscripten_glUniform3fv": _emscripten_glUniform3fv, "_emscripten_glPolygonOffset": _emscripten_glPolygonOffset, "_emscripten_glUseProgram": _emscripten_glUseProgram, "_emscripten_glBlendColor": _emscripten_glBlendColor, "_emscripten_glDepthFunc": _emscripten_glDepthFunc, "_emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray, "_emscripten_glUniform3iv": _emscripten_glUniform3iv, "_emscripten_memcpy_big": _emscripten_memcpy_big, "____js_alert": ____js_alert, "_emscripten_glVertexPointer": _emscripten_glVertexPointer, "_emscripten_glUniform1f": _emscripten_glUniform1f, "emscriptenWebGLComputeImageSize": emscriptenWebGLComputeImageSize, "_emscripten_glGetBooleanv": _emscripten_glGetBooleanv, "_emscripten_glGetShaderSource": _emscripten_glGetShaderSource, "_emscripten_glUniform1i": _emscripten_glUniform1i, "_emscripten_glGenBuffers": _emscripten_glGenBuffers, "_emscripten_glDeleteObjectARB": _emscripten_glDeleteObjectARB, "_emscripten_glTexImage2D": _emscripten_glTexImage2D, "_emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer, "_emscripten_glIsProgram": _emscripten_glIsProgram, "_emscripten_glBlendEquationSeparate": _emscripten_glBlendEquationSeparate, "_emscripten_glGetString": _emscripten_glGetString, "_emscripten_glIsFramebuffer": _emscripten_glIsFramebuffer, "_emscripten_glIsEnabled": _emscripten_glIsEnabled, "_emscripten_glScissor": _emscripten_glScissor, "_emscripten_glVertexAttrib4fv": _emscripten_glVertexAttrib4fv, "_emscripten_glTexParameteriv": _emscripten_glTexParameteriv, "_emscripten_glBindProgramARB": _emscripten_glBindProgramARB, "_emscripten_glStencilOpSeparate": _emscripten_glStencilOpSeparate, "___syscall140": ___syscall140, "_emscripten_glIsBuffer": _emscripten_glIsBuffer, "___syscall146": ___syscall146, "_emscripten_glGetActiveAttrib": _emscripten_glGetActiveAttrib, "_emscripten_glAttachShader": _emscripten_glAttachShader, "_emscripten_glCompressedTexSubImage2D": _emscripten_glCompressedTexSubImage2D, "_emscripten_glUniform2f": _emscripten_glUniform2f, "_emscripten_glTexParameterfv": _emscripten_glTexParameterfv, "_emscripten_glUniformMatrix2fv": _emscripten_glUniformMatrix2fv, "_emscripten_glTexParameterf": _emscripten_glTexParameterf, "_emscripten_glGetAttachedShaders": _emscripten_glGetAttachedShaders, "_emscripten_glGenTextures": _emscripten_glGenTextures, "_emscripten_glTexParameteri": _emscripten_glTexParameteri, "_emscripten_glClear": _emscripten_glClear, "_emscripten_glBindVertexArray": _emscripten_glBindVertexArray, "_emscripten_glValidateProgram": _emscripten_glValidateProgram, "_emscripten_glVertexAttrib2fv": _emscripten_glVertexAttrib2fv, "_emscripten_glUniform3f": _emscripten_glUniform3f, "_emscripten_glUniform4iv": _emscripten_glUniform4iv, "_emscripten_glGetTexParameteriv": _emscripten_glGetTexParameteriv, "___setErrNo": ___setErrNo, "_emscripten_glBindAttribLocation": _emscripten_glBindAttribLocation, "_emscripten_glClientActiveTexture": _emscripten_glClientActiveTexture, "_emscripten_glVertexAttrib2f": _emscripten_glVertexAttrib2f, "_emscripten_glFlush": _emscripten_glFlush, "_emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus, "_emscripten_glGetError": _emscripten_glGetError, "_emscripten_glClearDepthf": _emscripten_glClearDepthf, "_emscripten_glBufferData": _emscripten_glBufferData, "_emscripten_glUniform3i": _emscripten_glUniform3i, "_emscripten_glDeleteShader": _emscripten_glDeleteShader, "_emscripten_glReadPixels": _emscripten_glReadPixels, "_emscripten_glMatrixMode": _emscripten_glMatrixMode, "_emscripten_glClearStencil": _emscripten_glClearStencil, "_emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation, "emscriptenWebGLGet": emscriptenWebGLGet, "_emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray, "_emscripten_glGetAttribLocation": _emscripten_glGetAttribLocation, "_emscripten_glNormalPointer": _emscripten_glNormalPointer, "_emscripten_glHint": _emscripten_glHint, "_emscripten_glTexCoordPointer": _emscripten_glTexCoordPointer, "_emscripten_glEnable": _emscripten_glEnable, "_emscripten_glClearDepth": _emscripten_glClearDepth, "___lock": ___lock, "emscriptenWebGLGetTexPixelData": emscriptenWebGLGetTexPixelData, "___syscall6": ___syscall6, "___syscall4": ___syscall4, "_emscripten_glVertexAttrib3f": _emscripten_glVertexAttrib3f, "_emscripten_glVertexAttrib1f": _emscripten_glVertexAttrib1f, "_emscripten_glGetFramebufferAttachmentParameteriv": _emscripten_glGetFramebufferAttachmentParameteriv, "_emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer, "_emscripten_glEnableClientState": _emscripten_glEnableClientState, "_emscripten_glUniform4i": _emscripten_glUniform4i, "_emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers, "_emscripten_glGetPointerv": _emscripten_glGetPointerv, "_emscripten_glUniform4f": _emscripten_glUniform4f, "_emscripten_glShaderBinary": _emscripten_glShaderBinary, "_emscripten_glDrawElements": _emscripten_glDrawElements, "_emscripten_glBlendFunc": _emscripten_glBlendFunc, "_emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog, "_emscripten_glStencilMask": _emscripten_glStencilMask, "_emscripten_glUniform1iv": _emscripten_glUniform1iv, "_emscripten_glGetVertexAttribPointerv": _emscripten_glGetVertexAttribPointerv, "_emscripten_glUniform2i": _emscripten_glUniform2i, "emscriptenWebGLGetUniform": emscriptenWebGLGetUniform, "_emscripten_glDeleteVertexArrays": _emscripten_glDeleteVertexArrays, "_emscripten_glGetActiveUniform": _emscripten_glGetActiveUniform, "emscriptenWebGLGetVertexAttrib": emscriptenWebGLGetVertexAttrib, "_emscripten_glUniform2iv": _emscripten_glUniform2iv, "_emscripten_glDisable": _emscripten_glDisable, "_emscripten_glGetBufferParameteriv": _emscripten_glGetBufferParameteriv, "_emscripten_glDeleteProgram": _emscripten_glDeleteProgram, "_emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers, "_emscripten_glDrawElementsInstanced": _emscripten_glDrawElementsInstanced, "_emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f, "_emscripten_glGetVertexAttribiv": _emscripten_glGetVertexAttribiv, "_emscripten_glTexSubImage2D": _emscripten_glTexSubImage2D, "_emscripten_glGetProgramiv": _emscripten_glGetProgramiv, "_emscripten_glPixelStorei": _emscripten_glPixelStorei, "_emscripten_glUniformMatrix3fv": _emscripten_glUniformMatrix3fv, "_emscripten_glDepthRange": _emscripten_glDepthRange, "_emscripten_glGetObjectParameterivARB": _emscripten_glGetObjectParameterivARB, "_emscripten_glFinish": _emscripten_glFinish, "_emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage, "_emscripten_asm_const_iii": _emscripten_asm_const_iii, "_emscripten_glDepthMask": _emscripten_glDepthMask, "_emscripten_glDrawBuffers": _emscripten_glDrawBuffers, "_emscripten_glLineWidth": _emscripten_glLineWidth, "_emscripten_glCopyTexImage2D": _emscripten_glCopyTexImage2D, "_emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D, "_emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer, "_emscripten_glStencilFunc": _emscripten_glStencilFunc, "_abort": _abort, "_emscripten_glGetUniformiv": _emscripten_glGetUniformiv, "_emscripten_glRotatef": _emscripten_glRotatef, "_emscripten_glGetShaderiv": _emscripten_glGetShaderiv, "_emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers, "_emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv, "_emscripten_glLoadIdentity": _emscripten_glLoadIdentity, "_emscripten_glUniform1fv": _emscripten_glUniform1fv, "_emscripten_glIsRenderbuffer": _emscripten_glIsRenderbuffer, "_emscripten_glLoadMatrixf": _emscripten_glLoadMatrixf, "_emscripten_glDrawArraysInstanced": _emscripten_glDrawArraysInstanced, "_emscripten_glCreateShader": _emscripten_glCreateShader, "_emscripten_glStencilFuncSeparate": _emscripten_glStencilFuncSeparate, "_emscripten_glCopyTexSubImage2D": _emscripten_glCopyTexSubImage2D, "_emscripten_glDeleteTextures": _emscripten_glDeleteTextures, "_emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer, "_emscripten_glBufferSubData": _emscripten_glBufferSubData, "_emscripten_glVertexAttribDivisor": _emscripten_glVertexAttribDivisor, "_emscripten_glGetUniformfv": _emscripten_glGetUniformfv, "_emscripten_glGetVertexAttribfv": _emscripten_glGetVertexAttribfv, "_emscripten_glGetRenderbufferParameteriv": _emscripten_glGetRenderbufferParameteriv, "_emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers, "_emscripten_glVertexAttrib3fv": _emscripten_glVertexAttrib3fv, "_emscripten_glGetInfoLogARB": _emscripten_glGetInfoLogARB, "_emscripten_glCompileShader": _emscripten_glCompileShader, "_emscripten_glSampleCoverage": _emscripten_glSampleCoverage, "_emscripten_glFrustum": _emscripten_glFrustum, "_emscripten_glDepthRangef": _emscripten_glDepthRangef, "_emscripten_glStencilOp": _emscripten_glStencilOp, "_emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap, "_emscripten_glColorMask": _emscripten_glColorMask, "_emscripten_glLinkProgram": _emscripten_glLinkProgram, "_emscripten_glBlendEquation": _emscripten_glBlendEquation, "_emscripten_glIsTexture": _emscripten_glIsTexture, "_emscripten_glVertexAttrib1fv": _emscripten_glVertexAttrib1fv, "_emscripten_glBindTexture": _emscripten_glBindTexture, "_emscripten_glActiveTexture": _emscripten_glActiveTexture, "_emscripten_glDrawRangeElements": _emscripten_glDrawRangeElements, "___syscall54": ___syscall54, "___unlock": ___unlock, "_emscripten_glColorPointer": _emscripten_glColorPointer, "_emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog, "_emscripten_glIsShader": _emscripten_glIsShader, "_emscripten_glUniform4fv": _emscripten_glUniform4fv, "_emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D, "_emscripten_glClearColor": _emscripten_glClearColor, "_emscripten_glCreateProgram": _emscripten_glCreateProgram, "_emscripten_glGenVertexArrays": _emscripten_glGenVertexArrays, "_emscripten_glUniform2fv": _emscripten_glUniform2fv, "_emscripten_glBindBuffer": _emscripten_glBindBuffer, "_emscripten_glGetFloatv": _emscripten_glGetFloatv, "_emscripten_glDetachShader": _emscripten_glDetachShader, "DYNAMICTOP_PTR": DYNAMICTOP_PTR, "tempDoublePtr": tempDoublePtr, "ABORT": ABORT, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX, "cttz_i8": cttz_i8 };
// EMSCRIPTEN_START_ASM
var asm = (function(global, env, buffer) {
  'use asm';
  
  
  var HEAP8 = new global.Int8Array(buffer);
  var HEAP16 = new global.Int16Array(buffer);
  var HEAP32 = new global.Int32Array(buffer);
  var HEAPU8 = new global.Uint8Array(buffer);
  var HEAPU16 = new global.Uint16Array(buffer);
  var HEAPU32 = new global.Uint32Array(buffer);
  var HEAPF32 = new global.Float32Array(buffer);
  var HEAPF64 = new global.Float64Array(buffer);


  var DYNAMICTOP_PTR=env.DYNAMICTOP_PTR|0;
  var tempDoublePtr=env.tempDoublePtr|0;
  var ABORT=env.ABORT|0;
  var STACKTOP=env.STACKTOP|0;
  var STACK_MAX=env.STACK_MAX|0;
  var cttz_i8=env.cttz_i8|0;

  var __THREW__ = 0;
  var threwValue = 0;
  var setjmpId = 0;
  var undef = 0;
  var nan = global.NaN, inf = global.Infinity;
  var tempInt = 0, tempBigInt = 0, tempBigIntP = 0, tempBigIntS = 0, tempBigIntR = 0.0, tempBigIntI = 0, tempBigIntD = 0, tempValue = 0, tempDouble = 0.0;
  var tempRet0 = 0;

  var Math_floor=global.Math.floor;
  var Math_abs=global.Math.abs;
  var Math_sqrt=global.Math.sqrt;
  var Math_pow=global.Math.pow;
  var Math_cos=global.Math.cos;
  var Math_sin=global.Math.sin;
  var Math_tan=global.Math.tan;
  var Math_acos=global.Math.acos;
  var Math_asin=global.Math.asin;
  var Math_atan=global.Math.atan;
  var Math_atan2=global.Math.atan2;
  var Math_exp=global.Math.exp;
  var Math_log=global.Math.log;
  var Math_ceil=global.Math.ceil;
  var Math_imul=global.Math.imul;
  var Math_min=global.Math.min;
  var Math_max=global.Math.max;
  var Math_clz32=global.Math.clz32;
  var abort=env.abort;
  var assert=env.assert;
  var enlargeMemory=env.enlargeMemory;
  var getTotalMemory=env.getTotalMemory;
  var abortOnCannotGrowMemory=env.abortOnCannotGrowMemory;
  var invoke_viiiii=env.invoke_viiiii;
  var invoke_vd=env.invoke_vd;
  var invoke_vid=env.invoke_vid;
  var invoke_vi=env.invoke_vi;
  var invoke_vii=env.invoke_vii;
  var invoke_ii=env.invoke_ii;
  var invoke_viddd=env.invoke_viddd;
  var invoke_vidd=env.invoke_vidd;
  var invoke_iiii=env.invoke_iiii;
  var invoke_viiiiiiii=env.invoke_viiiiiiii;
  var invoke_viiiiii=env.invoke_viiiiii;
  var invoke_viii=env.invoke_viii;
  var invoke_vidddd=env.invoke_vidddd;
  var invoke_vdi=env.invoke_vdi;
  var invoke_viiiiiii=env.invoke_viiiiiii;
  var invoke_viiiiiiiii=env.invoke_viiiiiiiii;
  var invoke_iii=env.invoke_iii;
  var invoke_i=env.invoke_i;
  var invoke_vdddddd=env.invoke_vdddddd;
  var invoke_vdddd=env.invoke_vdddd;
  var invoke_vdd=env.invoke_vdd;
  var invoke_v=env.invoke_v;
  var invoke_viid=env.invoke_viid;
  var invoke_viiii=env.invoke_viiii;
  var _emscripten_glGetTexParameterfv=env._emscripten_glGetTexParameterfv;
  var _emscripten_glGenRenderbuffers=env._emscripten_glGenRenderbuffers;
  var _emscripten_glShaderSource=env._emscripten_glShaderSource;
  var _emscripten_glReleaseShaderCompiler=env._emscripten_glReleaseShaderCompiler;
  var _emscripten_glBlendFuncSeparate=env._emscripten_glBlendFuncSeparate;
  var _emscripten_glGetShaderPrecisionFormat=env._emscripten_glGetShaderPrecisionFormat;
  var _emscripten_glGetIntegerv=env._emscripten_glGetIntegerv;
  var _emscripten_glCullFace=env._emscripten_glCullFace;
  var _emscripten_glStencilMaskSeparate=env._emscripten_glStencilMaskSeparate;
  var _emscripten_glViewport=env._emscripten_glViewport;
  var _emscripten_glFrontFace=env._emscripten_glFrontFace;
  var _emscripten_glDrawArrays=env._emscripten_glDrawArrays;
  var _emscripten_glUniform3fv=env._emscripten_glUniform3fv;
  var _emscripten_glPolygonOffset=env._emscripten_glPolygonOffset;
  var _emscripten_glUseProgram=env._emscripten_glUseProgram;
  var _emscripten_glBlendColor=env._emscripten_glBlendColor;
  var _emscripten_glDepthFunc=env._emscripten_glDepthFunc;
  var _emscripten_glDisableVertexAttribArray=env._emscripten_glDisableVertexAttribArray;
  var _emscripten_glUniform3iv=env._emscripten_glUniform3iv;
  var _emscripten_memcpy_big=env._emscripten_memcpy_big;
  var ____js_alert=env.____js_alert;
  var _emscripten_glVertexPointer=env._emscripten_glVertexPointer;
  var _emscripten_glUniform1f=env._emscripten_glUniform1f;
  var emscriptenWebGLComputeImageSize=env.emscriptenWebGLComputeImageSize;
  var _emscripten_glGetBooleanv=env._emscripten_glGetBooleanv;
  var _emscripten_glGetShaderSource=env._emscripten_glGetShaderSource;
  var _emscripten_glUniform1i=env._emscripten_glUniform1i;
  var _emscripten_glGenBuffers=env._emscripten_glGenBuffers;
  var _emscripten_glDeleteObjectARB=env._emscripten_glDeleteObjectARB;
  var _emscripten_glTexImage2D=env._emscripten_glTexImage2D;
  var _emscripten_glVertexAttribPointer=env._emscripten_glVertexAttribPointer;
  var _emscripten_glIsProgram=env._emscripten_glIsProgram;
  var _emscripten_glBlendEquationSeparate=env._emscripten_glBlendEquationSeparate;
  var _emscripten_glGetString=env._emscripten_glGetString;
  var _emscripten_glIsFramebuffer=env._emscripten_glIsFramebuffer;
  var _emscripten_glIsEnabled=env._emscripten_glIsEnabled;
  var _emscripten_glScissor=env._emscripten_glScissor;
  var _emscripten_glVertexAttrib4fv=env._emscripten_glVertexAttrib4fv;
  var _emscripten_glTexParameteriv=env._emscripten_glTexParameteriv;
  var _emscripten_glBindProgramARB=env._emscripten_glBindProgramARB;
  var _emscripten_glStencilOpSeparate=env._emscripten_glStencilOpSeparate;
  var ___syscall140=env.___syscall140;
  var _emscripten_glIsBuffer=env._emscripten_glIsBuffer;
  var ___syscall146=env.___syscall146;
  var _emscripten_glGetActiveAttrib=env._emscripten_glGetActiveAttrib;
  var _emscripten_glAttachShader=env._emscripten_glAttachShader;
  var _emscripten_glCompressedTexSubImage2D=env._emscripten_glCompressedTexSubImage2D;
  var _emscripten_glUniform2f=env._emscripten_glUniform2f;
  var _emscripten_glTexParameterfv=env._emscripten_glTexParameterfv;
  var _emscripten_glUniformMatrix2fv=env._emscripten_glUniformMatrix2fv;
  var _emscripten_glTexParameterf=env._emscripten_glTexParameterf;
  var _emscripten_glGetAttachedShaders=env._emscripten_glGetAttachedShaders;
  var _emscripten_glGenTextures=env._emscripten_glGenTextures;
  var _emscripten_glTexParameteri=env._emscripten_glTexParameteri;
  var _emscripten_glClear=env._emscripten_glClear;
  var _emscripten_glBindVertexArray=env._emscripten_glBindVertexArray;
  var _emscripten_glValidateProgram=env._emscripten_glValidateProgram;
  var _emscripten_glVertexAttrib2fv=env._emscripten_glVertexAttrib2fv;
  var _emscripten_glUniform3f=env._emscripten_glUniform3f;
  var _emscripten_glUniform4iv=env._emscripten_glUniform4iv;
  var _emscripten_glGetTexParameteriv=env._emscripten_glGetTexParameteriv;
  var ___setErrNo=env.___setErrNo;
  var _emscripten_glBindAttribLocation=env._emscripten_glBindAttribLocation;
  var _emscripten_glClientActiveTexture=env._emscripten_glClientActiveTexture;
  var _emscripten_glVertexAttrib2f=env._emscripten_glVertexAttrib2f;
  var _emscripten_glFlush=env._emscripten_glFlush;
  var _emscripten_glCheckFramebufferStatus=env._emscripten_glCheckFramebufferStatus;
  var _emscripten_glGetError=env._emscripten_glGetError;
  var _emscripten_glClearDepthf=env._emscripten_glClearDepthf;
  var _emscripten_glBufferData=env._emscripten_glBufferData;
  var _emscripten_glUniform3i=env._emscripten_glUniform3i;
  var _emscripten_glDeleteShader=env._emscripten_glDeleteShader;
  var _emscripten_glReadPixels=env._emscripten_glReadPixels;
  var _emscripten_glMatrixMode=env._emscripten_glMatrixMode;
  var _emscripten_glClearStencil=env._emscripten_glClearStencil;
  var _emscripten_glGetUniformLocation=env._emscripten_glGetUniformLocation;
  var emscriptenWebGLGet=env.emscriptenWebGLGet;
  var _emscripten_glEnableVertexAttribArray=env._emscripten_glEnableVertexAttribArray;
  var _emscripten_glGetAttribLocation=env._emscripten_glGetAttribLocation;
  var _emscripten_glNormalPointer=env._emscripten_glNormalPointer;
  var _emscripten_glHint=env._emscripten_glHint;
  var _emscripten_glTexCoordPointer=env._emscripten_glTexCoordPointer;
  var _emscripten_glEnable=env._emscripten_glEnable;
  var _emscripten_glClearDepth=env._emscripten_glClearDepth;
  var ___lock=env.___lock;
  var emscriptenWebGLGetTexPixelData=env.emscriptenWebGLGetTexPixelData;
  var ___syscall6=env.___syscall6;
  var ___syscall4=env.___syscall4;
  var _emscripten_glVertexAttrib3f=env._emscripten_glVertexAttrib3f;
  var _emscripten_glVertexAttrib1f=env._emscripten_glVertexAttrib1f;
  var _emscripten_glGetFramebufferAttachmentParameteriv=env._emscripten_glGetFramebufferAttachmentParameteriv;
  var _emscripten_glBindFramebuffer=env._emscripten_glBindFramebuffer;
  var _emscripten_glEnableClientState=env._emscripten_glEnableClientState;
  var _emscripten_glUniform4i=env._emscripten_glUniform4i;
  var _emscripten_glDeleteBuffers=env._emscripten_glDeleteBuffers;
  var _emscripten_glGetPointerv=env._emscripten_glGetPointerv;
  var _emscripten_glUniform4f=env._emscripten_glUniform4f;
  var _emscripten_glShaderBinary=env._emscripten_glShaderBinary;
  var _emscripten_glDrawElements=env._emscripten_glDrawElements;
  var _emscripten_glBlendFunc=env._emscripten_glBlendFunc;
  var _emscripten_glGetShaderInfoLog=env._emscripten_glGetShaderInfoLog;
  var _emscripten_glStencilMask=env._emscripten_glStencilMask;
  var _emscripten_glUniform1iv=env._emscripten_glUniform1iv;
  var _emscripten_glGetVertexAttribPointerv=env._emscripten_glGetVertexAttribPointerv;
  var _emscripten_glUniform2i=env._emscripten_glUniform2i;
  var emscriptenWebGLGetUniform=env.emscriptenWebGLGetUniform;
  var _emscripten_glDeleteVertexArrays=env._emscripten_glDeleteVertexArrays;
  var _emscripten_glGetActiveUniform=env._emscripten_glGetActiveUniform;
  var emscriptenWebGLGetVertexAttrib=env.emscriptenWebGLGetVertexAttrib;
  var _emscripten_glUniform2iv=env._emscripten_glUniform2iv;
  var _emscripten_glDisable=env._emscripten_glDisable;
  var _emscripten_glGetBufferParameteriv=env._emscripten_glGetBufferParameteriv;
  var _emscripten_glDeleteProgram=env._emscripten_glDeleteProgram;
  var _emscripten_glDeleteRenderbuffers=env._emscripten_glDeleteRenderbuffers;
  var _emscripten_glDrawElementsInstanced=env._emscripten_glDrawElementsInstanced;
  var _emscripten_glVertexAttrib4f=env._emscripten_glVertexAttrib4f;
  var _emscripten_glGetVertexAttribiv=env._emscripten_glGetVertexAttribiv;
  var _emscripten_glTexSubImage2D=env._emscripten_glTexSubImage2D;
  var _emscripten_glGetProgramiv=env._emscripten_glGetProgramiv;
  var _emscripten_glPixelStorei=env._emscripten_glPixelStorei;
  var _emscripten_glUniformMatrix3fv=env._emscripten_glUniformMatrix3fv;
  var _emscripten_glDepthRange=env._emscripten_glDepthRange;
  var _emscripten_glGetObjectParameterivARB=env._emscripten_glGetObjectParameterivARB;
  var _emscripten_glFinish=env._emscripten_glFinish;
  var _emscripten_glRenderbufferStorage=env._emscripten_glRenderbufferStorage;
  var _emscripten_asm_const_iii=env._emscripten_asm_const_iii;
  var _emscripten_glDepthMask=env._emscripten_glDepthMask;
  var _emscripten_glDrawBuffers=env._emscripten_glDrawBuffers;
  var _emscripten_glLineWidth=env._emscripten_glLineWidth;
  var _emscripten_glCopyTexImage2D=env._emscripten_glCopyTexImage2D;
  var _emscripten_glFramebufferTexture2D=env._emscripten_glFramebufferTexture2D;
  var _emscripten_glFramebufferRenderbuffer=env._emscripten_glFramebufferRenderbuffer;
  var _emscripten_glStencilFunc=env._emscripten_glStencilFunc;
  var _abort=env._abort;
  var _emscripten_glGetUniformiv=env._emscripten_glGetUniformiv;
  var _emscripten_glRotatef=env._emscripten_glRotatef;
  var _emscripten_glGetShaderiv=env._emscripten_glGetShaderiv;
  var _emscripten_glGenFramebuffers=env._emscripten_glGenFramebuffers;
  var _emscripten_glUniformMatrix4fv=env._emscripten_glUniformMatrix4fv;
  var _emscripten_glLoadIdentity=env._emscripten_glLoadIdentity;
  var _emscripten_glUniform1fv=env._emscripten_glUniform1fv;
  var _emscripten_glIsRenderbuffer=env._emscripten_glIsRenderbuffer;
  var _emscripten_glLoadMatrixf=env._emscripten_glLoadMatrixf;
  var _emscripten_glDrawArraysInstanced=env._emscripten_glDrawArraysInstanced;
  var _emscripten_glCreateShader=env._emscripten_glCreateShader;
  var _emscripten_glStencilFuncSeparate=env._emscripten_glStencilFuncSeparate;
  var _emscripten_glCopyTexSubImage2D=env._emscripten_glCopyTexSubImage2D;
  var _emscripten_glDeleteTextures=env._emscripten_glDeleteTextures;
  var _emscripten_glBindRenderbuffer=env._emscripten_glBindRenderbuffer;
  var _emscripten_glBufferSubData=env._emscripten_glBufferSubData;
  var _emscripten_glVertexAttribDivisor=env._emscripten_glVertexAttribDivisor;
  var _emscripten_glGetUniformfv=env._emscripten_glGetUniformfv;
  var _emscripten_glGetVertexAttribfv=env._emscripten_glGetVertexAttribfv;
  var _emscripten_glGetRenderbufferParameteriv=env._emscripten_glGetRenderbufferParameteriv;
  var _emscripten_glDeleteFramebuffers=env._emscripten_glDeleteFramebuffers;
  var _emscripten_glVertexAttrib3fv=env._emscripten_glVertexAttrib3fv;
  var _emscripten_glGetInfoLogARB=env._emscripten_glGetInfoLogARB;
  var _emscripten_glCompileShader=env._emscripten_glCompileShader;
  var _emscripten_glSampleCoverage=env._emscripten_glSampleCoverage;
  var _emscripten_glFrustum=env._emscripten_glFrustum;
  var _emscripten_glDepthRangef=env._emscripten_glDepthRangef;
  var _emscripten_glStencilOp=env._emscripten_glStencilOp;
  var _emscripten_glGenerateMipmap=env._emscripten_glGenerateMipmap;
  var _emscripten_glColorMask=env._emscripten_glColorMask;
  var _emscripten_glLinkProgram=env._emscripten_glLinkProgram;
  var _emscripten_glBlendEquation=env._emscripten_glBlendEquation;
  var _emscripten_glIsTexture=env._emscripten_glIsTexture;
  var _emscripten_glVertexAttrib1fv=env._emscripten_glVertexAttrib1fv;
  var _emscripten_glBindTexture=env._emscripten_glBindTexture;
  var _emscripten_glActiveTexture=env._emscripten_glActiveTexture;
  var _emscripten_glDrawRangeElements=env._emscripten_glDrawRangeElements;
  var ___syscall54=env.___syscall54;
  var ___unlock=env.___unlock;
  var _emscripten_glColorPointer=env._emscripten_glColorPointer;
  var _emscripten_glGetProgramInfoLog=env._emscripten_glGetProgramInfoLog;
  var _emscripten_glIsShader=env._emscripten_glIsShader;
  var _emscripten_glUniform4fv=env._emscripten_glUniform4fv;
  var _emscripten_glCompressedTexImage2D=env._emscripten_glCompressedTexImage2D;
  var _emscripten_glClearColor=env._emscripten_glClearColor;
  var _emscripten_glCreateProgram=env._emscripten_glCreateProgram;
  var _emscripten_glGenVertexArrays=env._emscripten_glGenVertexArrays;
  var _emscripten_glUniform2fv=env._emscripten_glUniform2fv;
  var _emscripten_glBindBuffer=env._emscripten_glBindBuffer;
  var _emscripten_glGetFloatv=env._emscripten_glGetFloatv;
  var _emscripten_glDetachShader=env._emscripten_glDetachShader;
  var tempFloat = 0.0;

// EMSCRIPTEN_START_FUNCS

function stackAlloc(size) {
  size = size|0;
  var ret = 0;
  ret = STACKTOP;
  STACKTOP = (STACKTOP + size)|0;
  STACKTOP = (STACKTOP + 15)&-16;

  return ret|0;
}
function stackSave() {
  return STACKTOP|0;
}
function stackRestore(top) {
  top = top|0;
  STACKTOP = top;
}
function establishStackSpace(stackBase, stackMax) {
  stackBase = stackBase|0;
  stackMax = stackMax|0;
  STACKTOP = stackBase;
  STACK_MAX = stackMax;
}

function setThrew(threw, value) {
  threw = threw|0;
  value = value|0;
  if ((__THREW__|0) == 0) {
    __THREW__ = threw;
    threwValue = value;
  }
}

function setTempRet0(value) {
  value = value|0;
  tempRet0 = value;
}
function getTempRet0() {
  return tempRet0|0;
}

function __type_info_base($info) {
 $info = $info|0;
 var $$field5$field = 0, $$field5$index18 = 0, $$field8 = 0, $$index1 = 0, $$index11 = 0, $$index12 = 0, $$index12$index21 = 0, $$index13 = 0, $$index15 = 0, $$index16 = 0, $$index16$index22 = 0, $$index17 = 0, $$index4 = 0, $$index7 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0;
 var $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0;
 var $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0;
 var $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0;
 $0 = sp + 48|0;
 $1 = sp + 40|0;
 $2 = sp;
 HEAP32[$0>>2] = 0;
 HEAP32[$0>>2] = $info;
 $3 = HEAP32[$0>>2]|0;
 $4 = ($3|0)==(0|0);
 if ($4) {
  STACKTOP = sp;return (0|0);
 }
 HEAP32[$1>>2] = 0;
 $5 = HEAP32[$0>>2]|0;
 HEAP32[$1>>2] = $5;
 $6 = HEAP32[$1>>2]|0;
 $7 = ((($6)) + 136|0);
 $8 = $7;
 $9 = $8;
 $10 = HEAP32[$9>>2]|0;
 $11 = (($8) + 4)|0;
 $12 = $11;
 $13 = HEAP32[$12>>2]|0;
 $14 = ($10|0)==(1);
 $15 = ($13|0)==(0);
 $16 = $14 & $15;
 if (!($16)) {
  $61 = HEAP32[$1>>2]|0;
  STACKTOP = sp;return ($61|0);
 }
 $17 = $6;
 $18 = $17;
 $19 = HEAP32[$18>>2]|0;
 $20 = (($17) + 4)|0;
 $21 = $20;
 $22 = HEAP32[$21>>2]|0;
 $$index1 = ((($6)) + 8|0);
 $23 = $$index1;
 $24 = $23;
 $25 = HEAP32[$24>>2]|0;
 $26 = (($23) + 4)|0;
 $27 = $26;
 $28 = HEAP32[$27>>2]|0;
 $$index4 = ((($6)) + 16|0);
 $$field5$field = HEAP32[$$index4>>2]|0;
 $$field5$index18 = ((($$index4)) + 8|0);
 $29 = $$field5$index18;
 $30 = $29;
 $31 = HEAP32[$30>>2]|0;
 $32 = (($29) + 4)|0;
 $33 = $32;
 $34 = HEAP32[$33>>2]|0;
 $$index7 = ((($6)) + 32|0);
 $$field8 = HEAP32[$$index7>>2]|0;
 $35 = $2;
 $36 = $35;
 HEAP32[$36>>2] = 0;
 $37 = (($35) + 4)|0;
 $38 = $37;
 HEAP32[$38>>2] = 0;
 $$index11 = ((($2)) + 8|0);
 $39 = $$index11;
 $40 = $39;
 HEAP32[$40>>2] = 0;
 $41 = (($39) + 4)|0;
 $42 = $41;
 HEAP32[$42>>2] = 0;
 $$index12 = ((($2)) + 16|0);
 HEAP32[$$index12>>2] = 0;
 $$index12$index21 = ((($$index12)) + 8|0);
 $43 = $$index12$index21;
 $44 = $43;
 HEAP32[$44>>2] = 0;
 $45 = (($43) + 4)|0;
 $46 = $45;
 HEAP32[$46>>2] = 0;
 $$index13 = ((($2)) + 32|0);
 HEAP32[$$index13>>2] = 0;
 $47 = $2;
 $48 = $47;
 HEAP32[$48>>2] = $19;
 $49 = (($47) + 4)|0;
 $50 = $49;
 HEAP32[$50>>2] = $22;
 $$index15 = ((($2)) + 8|0);
 $51 = $$index15;
 $52 = $51;
 HEAP32[$52>>2] = $25;
 $53 = (($51) + 4)|0;
 $54 = $53;
 HEAP32[$54>>2] = $28;
 $$index16 = ((($2)) + 16|0);
 HEAP32[$$index16>>2] = $$field5$field;
 $$index16$index22 = ((($$index16)) + 8|0);
 $55 = $$index16$index22;
 $56 = $55;
 HEAP32[$56>>2] = $31;
 $57 = (($55) + 4)|0;
 $58 = $57;
 HEAP32[$58>>2] = $34;
 $$index17 = ((($2)) + 32|0);
 HEAP32[$$index17>>2] = $$field8;
 $59 = ((($2)) + 32|0);
 $60 = HEAP32[$59>>2]|0;
 HEAP32[$1>>2] = $60;
 $61 = HEAP32[$1>>2]|0;
 STACKTOP = sp;return ($61|0);
}
function ____assert($file$ptr,$0,$1,$2,$3,$msg$ptr) {
 $file$ptr = $file$ptr|0;
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $msg$ptr = $msg$ptr|0;
 var $$field28 = 0, $$field31 = 0, $$field36 = 0, $$field39 = 0, $$field44 = 0, $$field47 = 0, $$field52 = 0, $$field55 = 0, $$field73 = 0, $$index10 = 0, $$index12 = 0, $$index14 = 0, $$index26 = 0, $$index30 = 0, $$index34 = 0, $$index38 = 0, $$index42 = 0, $$index46 = 0, $$index50 = 0, $$index54 = 0;
 var $$index58 = 0, $$index59 = 0, $$index60$index84 = 0, $$index61 = 0, $$index61$index85 = 0, $$index62 = 0, $$index62$index86 = 0, $$index63 = 0, $$index63$index87 = 0, $$index65 = 0, $$index67 = 0, $$index69 = 0, $$index71 = 0, $$index75 = 0, $$index78 = 0, $$index8 = 0, $$ptr = 0, $$ptr$index81 = 0, $$ptr1 = 0, $$ptr1$index82 = 0;
 var $$ptr1$index83 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
 var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0;
 var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0;
 var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0;
 var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0;
 var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $file$sreg$field = 0, $file$sreg$index2 = 0, $msg$sreg$field = 0, $msg$sreg$index5 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 176|0;
 $$ptr = sp + 160|0;
 $$ptr1 = sp + 136|0;
 $file$sreg$field = HEAP32[$file$ptr>>2]|0;
 $file$sreg$index2 = ((($file$ptr)) + 8|0);
 $4 = $file$sreg$index2;
 $5 = $4;
 $6 = HEAP32[$5>>2]|0;
 $7 = (($4) + 4)|0;
 $8 = $7;
 $9 = HEAP32[$8>>2]|0;
 $msg$sreg$field = HEAP32[$msg$ptr>>2]|0;
 $msg$sreg$index5 = ((($msg$ptr)) + 8|0);
 $10 = $msg$sreg$index5;
 $11 = $10;
 $12 = HEAP32[$11>>2]|0;
 $13 = (($10) + 4)|0;
 $14 = $13;
 $15 = HEAP32[$14>>2]|0;
 $16 = sp + 120|0;
 $17 = sp + 112|0;
 $18 = sp + 104|0;
 $19 = sp + 88|0;
 $20 = sp + 80|0;
 $21 = sp + 72|0;
 $22 = sp + 64|0;
 $23 = sp + 56|0;
 $24 = sp + 32|0;
 $25 = sp;
 HEAP32[$16>>2] = 0;
 $$index8 = ((($16)) + 8|0);
 $26 = $$index8;
 $27 = $26;
 HEAP32[$27>>2] = 0;
 $28 = (($26) + 4)|0;
 $29 = $28;
 HEAP32[$29>>2] = 0;
 HEAP32[$16>>2] = $file$sreg$field;
 $$index10 = ((($16)) + 8|0);
 $30 = $$index10;
 $31 = $30;
 HEAP32[$31>>2] = $6;
 $32 = (($30) + 4)|0;
 $33 = $32;
 HEAP32[$33>>2] = $9;
 $34 = $17;
 $35 = $34;
 HEAP32[$35>>2] = 0;
 $36 = (($34) + 4)|0;
 $37 = $36;
 HEAP32[$37>>2] = 0;
 $38 = $17;
 $39 = $38;
 HEAP32[$39>>2] = $0;
 $40 = (($38) + 4)|0;
 $41 = $40;
 HEAP32[$41>>2] = $1;
 $42 = $18;
 $43 = $42;
 HEAP32[$43>>2] = 0;
 $44 = (($42) + 4)|0;
 $45 = $44;
 HEAP32[$45>>2] = 0;
 $46 = $18;
 $47 = $46;
 HEAP32[$47>>2] = $2;
 $48 = (($46) + 4)|0;
 $49 = $48;
 HEAP32[$49>>2] = $3;
 HEAP32[$19>>2] = 0;
 $$index12 = ((($19)) + 8|0);
 $50 = $$index12;
 $51 = $50;
 HEAP32[$51>>2] = 0;
 $52 = (($50) + 4)|0;
 $53 = $52;
 HEAP32[$53>>2] = 0;
 HEAP32[$19>>2] = $msg$sreg$field;
 $$index14 = ((($19)) + 8|0);
 $54 = $$index14;
 $55 = $54;
 HEAP32[$55>>2] = $12;
 $56 = (($54) + 4)|0;
 $57 = $56;
 HEAP32[$57>>2] = $15;
 $58 = HEAP32[27]|0;
 HEAP32[$20>>2] = 0;
 $$index26 = ((($20)) + 4|0);
 HEAP32[$$index26>>2] = 0;
 $59 = 13504;
 $60 = ((($20)) + 4|0);
 HEAP32[$20>>2] = $59;
 HEAP32[$60>>2] = $16;
 $$field28 = HEAP32[$20>>2]|0;
 $$index30 = ((($20)) + 4|0);
 $$field31 = HEAP32[$$index30>>2]|0;
 HEAP32[$21>>2] = 0;
 $$index34 = ((($21)) + 4|0);
 HEAP32[$$index34>>2] = 0;
 $61 = 13360;
 $62 = ((($21)) + 4|0);
 HEAP32[$21>>2] = $61;
 HEAP32[$62>>2] = $17;
 $$field36 = HEAP32[$21>>2]|0;
 $$index38 = ((($21)) + 4|0);
 $$field39 = HEAP32[$$index38>>2]|0;
 HEAP32[$22>>2] = 0;
 $$index42 = ((($22)) + 4|0);
 HEAP32[$$index42>>2] = 0;
 $63 = 13360;
 $64 = ((($22)) + 4|0);
 HEAP32[$22>>2] = $63;
 HEAP32[$64>>2] = $18;
 $$field44 = HEAP32[$22>>2]|0;
 $$index46 = ((($22)) + 4|0);
 $$field47 = HEAP32[$$index46>>2]|0;
 HEAP32[$23>>2] = 0;
 $$index50 = ((($23)) + 4|0);
 HEAP32[$$index50>>2] = 0;
 $65 = 13504;
 $66 = ((($23)) + 4|0);
 HEAP32[$23>>2] = $65;
 HEAP32[$66>>2] = $19;
 $$field52 = HEAP32[$23>>2]|0;
 $$index54 = ((($23)) + 4|0);
 $$field55 = HEAP32[$$index54>>2]|0;
 HEAP32[$24>>2] = 0;
 $$index58 = ((($24)) + 8|0);
 $67 = $$index58;
 $68 = $67;
 HEAP32[$68>>2] = 0;
 $69 = (($67) + 4)|0;
 $70 = $69;
 HEAP32[$70>>2] = 0;
 $$index59 = ((($24)) + 16|0);
 $71 = $$index59;
 $72 = $71;
 HEAP32[$72>>2] = 0;
 $73 = (($71) + 4)|0;
 $74 = $73;
 HEAP32[$74>>2] = 0;
 HEAP32[$25>>2] = 0;
 $$index60$index84 = ((($25)) + 4|0);
 HEAP32[$$index60$index84>>2] = 0;
 $$index61 = ((($25)) + 8|0);
 HEAP32[$$index61>>2] = 0;
 $$index61$index85 = ((($$index61)) + 4|0);
 HEAP32[$$index61$index85>>2] = 0;
 $$index62 = ((($25)) + 16|0);
 HEAP32[$$index62>>2] = 0;
 $$index62$index86 = ((($$index62)) + 4|0);
 HEAP32[$$index62$index86>>2] = 0;
 $$index63 = ((($25)) + 24|0);
 HEAP32[$$index63>>2] = 0;
 $$index63$index87 = ((($$index63)) + 4|0);
 HEAP32[$$index63$index87>>2] = 0;
 HEAP32[$25>>2] = $$field28;
 $$index65 = ((($25)) + 4|0);
 HEAP32[$$index65>>2] = $$field31;
 $75 = ((($25)) + 8|0);
 HEAP32[$75>>2] = $$field36;
 $$index67 = ((($75)) + 4|0);
 HEAP32[$$index67>>2] = $$field39;
 $76 = ((($25)) + 16|0);
 HEAP32[$76>>2] = $$field44;
 $$index69 = ((($76)) + 4|0);
 HEAP32[$$index69>>2] = $$field47;
 $77 = ((($25)) + 24|0);
 HEAP32[$77>>2] = $$field52;
 $$index71 = ((($77)) + 4|0);
 HEAP32[$$index71>>2] = $$field55;
 HEAP32[$24>>2] = $25;
 $78 = ((($24)) + 8|0);
 $79 = $78;
 $80 = $79;
 HEAP32[$80>>2] = 4;
 $81 = (($79) + 4)|0;
 $82 = $81;
 HEAP32[$82>>2] = 0;
 $83 = ((($24)) + 16|0);
 $84 = $83;
 $85 = $84;
 HEAP32[$85>>2] = 4;
 $86 = (($84) + 4)|0;
 $87 = $86;
 HEAP32[$87>>2] = 0;
 $$field73 = HEAP32[$24>>2]|0;
 $$index75 = ((($24)) + 8|0);
 $88 = $$index75;
 $89 = $88;
 $90 = HEAP32[$89>>2]|0;
 $91 = (($88) + 4)|0;
 $92 = $91;
 $93 = HEAP32[$92>>2]|0;
 $$index78 = ((($24)) + 16|0);
 $94 = $$index78;
 $95 = $94;
 $96 = HEAP32[$95>>2]|0;
 $97 = (($94) + 4)|0;
 $98 = $97;
 $99 = HEAP32[$98>>2]|0;
 HEAP32[$$ptr>>2] = 740;
 $$ptr$index81 = ((($$ptr)) + 8|0);
 $100 = $$ptr$index81;
 $101 = $100;
 HEAP32[$101>>2] = 32;
 $102 = (($100) + 4)|0;
 $103 = $102;
 HEAP32[$103>>2] = 0;
 HEAP32[$$ptr1>>2] = $$field73;
 $$ptr1$index82 = ((($$ptr1)) + 8|0);
 $104 = $$ptr1$index82;
 $105 = $104;
 HEAP32[$105>>2] = $90;
 $106 = (($104) + 4)|0;
 $107 = $106;
 HEAP32[$107>>2] = $93;
 $$ptr1$index83 = ((($$ptr1)) + 16|0);
 $108 = $$ptr1$index83;
 $109 = $108;
 HEAP32[$109>>2] = $96;
 $110 = (($108) + 4)|0;
 $111 = $110;
 HEAP32[$111>>2] = $99;
 (__fmt_4_fprintf($58,$$ptr,$$ptr1)|0);
 $112 = tempRet0;
 ____js_alert();
 STACKTOP = sp;return;
}
function ____panic($file$ptr,$0,$1,$2,$3,$msg$ptr) {
 $file$ptr = $file$ptr|0;
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $msg$ptr = $msg$ptr|0;
 var $$field28 = 0, $$field31 = 0, $$field36 = 0, $$field39 = 0, $$field44 = 0, $$field47 = 0, $$field52 = 0, $$field55 = 0, $$field73 = 0, $$index10 = 0, $$index12 = 0, $$index14 = 0, $$index26 = 0, $$index30 = 0, $$index34 = 0, $$index38 = 0, $$index42 = 0, $$index46 = 0, $$index50 = 0, $$index54 = 0;
 var $$index58 = 0, $$index59 = 0, $$index60$index84 = 0, $$index61 = 0, $$index61$index85 = 0, $$index62 = 0, $$index62$index86 = 0, $$index63 = 0, $$index63$index87 = 0, $$index65 = 0, $$index67 = 0, $$index69 = 0, $$index71 = 0, $$index75 = 0, $$index78 = 0, $$index8 = 0, $$ptr = 0, $$ptr$index81 = 0, $$ptr1 = 0, $$ptr1$index82 = 0;
 var $$ptr1$index83 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
 var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0;
 var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0;
 var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0;
 var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0;
 var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $file$sreg$field = 0, $file$sreg$index2 = 0, $msg$sreg$field = 0, $msg$sreg$index5 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 176|0;
 $$ptr = sp + 160|0;
 $$ptr1 = sp + 136|0;
 $file$sreg$field = HEAP32[$file$ptr>>2]|0;
 $file$sreg$index2 = ((($file$ptr)) + 8|0);
 $4 = $file$sreg$index2;
 $5 = $4;
 $6 = HEAP32[$5>>2]|0;
 $7 = (($4) + 4)|0;
 $8 = $7;
 $9 = HEAP32[$8>>2]|0;
 $msg$sreg$field = HEAP32[$msg$ptr>>2]|0;
 $msg$sreg$index5 = ((($msg$ptr)) + 8|0);
 $10 = $msg$sreg$index5;
 $11 = $10;
 $12 = HEAP32[$11>>2]|0;
 $13 = (($10) + 4)|0;
 $14 = $13;
 $15 = HEAP32[$14>>2]|0;
 $16 = sp + 120|0;
 $17 = sp + 112|0;
 $18 = sp + 104|0;
 $19 = sp + 88|0;
 $20 = sp + 80|0;
 $21 = sp + 72|0;
 $22 = sp + 64|0;
 $23 = sp + 56|0;
 $24 = sp + 32|0;
 $25 = sp;
 HEAP32[$16>>2] = 0;
 $$index8 = ((($16)) + 8|0);
 $26 = $$index8;
 $27 = $26;
 HEAP32[$27>>2] = 0;
 $28 = (($26) + 4)|0;
 $29 = $28;
 HEAP32[$29>>2] = 0;
 HEAP32[$16>>2] = $file$sreg$field;
 $$index10 = ((($16)) + 8|0);
 $30 = $$index10;
 $31 = $30;
 HEAP32[$31>>2] = $6;
 $32 = (($30) + 4)|0;
 $33 = $32;
 HEAP32[$33>>2] = $9;
 $34 = $17;
 $35 = $34;
 HEAP32[$35>>2] = 0;
 $36 = (($34) + 4)|0;
 $37 = $36;
 HEAP32[$37>>2] = 0;
 $38 = $17;
 $39 = $38;
 HEAP32[$39>>2] = $0;
 $40 = (($38) + 4)|0;
 $41 = $40;
 HEAP32[$41>>2] = $1;
 $42 = $18;
 $43 = $42;
 HEAP32[$43>>2] = 0;
 $44 = (($42) + 4)|0;
 $45 = $44;
 HEAP32[$45>>2] = 0;
 $46 = $18;
 $47 = $46;
 HEAP32[$47>>2] = $2;
 $48 = (($46) + 4)|0;
 $49 = $48;
 HEAP32[$49>>2] = $3;
 HEAP32[$19>>2] = 0;
 $$index12 = ((($19)) + 8|0);
 $50 = $$index12;
 $51 = $50;
 HEAP32[$51>>2] = 0;
 $52 = (($50) + 4)|0;
 $53 = $52;
 HEAP32[$53>>2] = 0;
 HEAP32[$19>>2] = $msg$sreg$field;
 $$index14 = ((($19)) + 8|0);
 $54 = $$index14;
 $55 = $54;
 HEAP32[$55>>2] = $12;
 $56 = (($54) + 4)|0;
 $57 = $56;
 HEAP32[$57>>2] = $15;
 $58 = HEAP32[27]|0;
 HEAP32[$20>>2] = 0;
 $$index26 = ((($20)) + 4|0);
 HEAP32[$$index26>>2] = 0;
 $59 = 13504;
 $60 = ((($20)) + 4|0);
 HEAP32[$20>>2] = $59;
 HEAP32[$60>>2] = $16;
 $$field28 = HEAP32[$20>>2]|0;
 $$index30 = ((($20)) + 4|0);
 $$field31 = HEAP32[$$index30>>2]|0;
 HEAP32[$21>>2] = 0;
 $$index34 = ((($21)) + 4|0);
 HEAP32[$$index34>>2] = 0;
 $61 = 13360;
 $62 = ((($21)) + 4|0);
 HEAP32[$21>>2] = $61;
 HEAP32[$62>>2] = $17;
 $$field36 = HEAP32[$21>>2]|0;
 $$index38 = ((($21)) + 4|0);
 $$field39 = HEAP32[$$index38>>2]|0;
 HEAP32[$22>>2] = 0;
 $$index42 = ((($22)) + 4|0);
 HEAP32[$$index42>>2] = 0;
 $63 = 13360;
 $64 = ((($22)) + 4|0);
 HEAP32[$22>>2] = $63;
 HEAP32[$64>>2] = $18;
 $$field44 = HEAP32[$22>>2]|0;
 $$index46 = ((($22)) + 4|0);
 $$field47 = HEAP32[$$index46>>2]|0;
 HEAP32[$23>>2] = 0;
 $$index50 = ((($23)) + 4|0);
 HEAP32[$$index50>>2] = 0;
 $65 = 13504;
 $66 = ((($23)) + 4|0);
 HEAP32[$23>>2] = $65;
 HEAP32[$66>>2] = $19;
 $$field52 = HEAP32[$23>>2]|0;
 $$index54 = ((($23)) + 4|0);
 $$field55 = HEAP32[$$index54>>2]|0;
 HEAP32[$24>>2] = 0;
 $$index58 = ((($24)) + 8|0);
 $67 = $$index58;
 $68 = $67;
 HEAP32[$68>>2] = 0;
 $69 = (($67) + 4)|0;
 $70 = $69;
 HEAP32[$70>>2] = 0;
 $$index59 = ((($24)) + 16|0);
 $71 = $$index59;
 $72 = $71;
 HEAP32[$72>>2] = 0;
 $73 = (($71) + 4)|0;
 $74 = $73;
 HEAP32[$74>>2] = 0;
 HEAP32[$25>>2] = 0;
 $$index60$index84 = ((($25)) + 4|0);
 HEAP32[$$index60$index84>>2] = 0;
 $$index61 = ((($25)) + 8|0);
 HEAP32[$$index61>>2] = 0;
 $$index61$index85 = ((($$index61)) + 4|0);
 HEAP32[$$index61$index85>>2] = 0;
 $$index62 = ((($25)) + 16|0);
 HEAP32[$$index62>>2] = 0;
 $$index62$index86 = ((($$index62)) + 4|0);
 HEAP32[$$index62$index86>>2] = 0;
 $$index63 = ((($25)) + 24|0);
 HEAP32[$$index63>>2] = 0;
 $$index63$index87 = ((($$index63)) + 4|0);
 HEAP32[$$index63$index87>>2] = 0;
 HEAP32[$25>>2] = $$field28;
 $$index65 = ((($25)) + 4|0);
 HEAP32[$$index65>>2] = $$field31;
 $75 = ((($25)) + 8|0);
 HEAP32[$75>>2] = $$field36;
 $$index67 = ((($75)) + 4|0);
 HEAP32[$$index67>>2] = $$field39;
 $76 = ((($25)) + 16|0);
 HEAP32[$76>>2] = $$field44;
 $$index69 = ((($76)) + 4|0);
 HEAP32[$$index69>>2] = $$field47;
 $77 = ((($25)) + 24|0);
 HEAP32[$77>>2] = $$field52;
 $$index71 = ((($77)) + 4|0);
 HEAP32[$$index71>>2] = $$field55;
 HEAP32[$24>>2] = $25;
 $78 = ((($24)) + 8|0);
 $79 = $78;
 $80 = $79;
 HEAP32[$80>>2] = 4;
 $81 = (($79) + 4)|0;
 $82 = $81;
 HEAP32[$82>>2] = 0;
 $83 = ((($24)) + 16|0);
 $84 = $83;
 $85 = $84;
 HEAP32[$85>>2] = 4;
 $86 = (($84) + 4)|0;
 $87 = $86;
 HEAP32[$87>>2] = 0;
 $$field73 = HEAP32[$24>>2]|0;
 $$index75 = ((($24)) + 8|0);
 $88 = $$index75;
 $89 = $88;
 $90 = HEAP32[$89>>2]|0;
 $91 = (($88) + 4)|0;
 $92 = $91;
 $93 = HEAP32[$92>>2]|0;
 $$index78 = ((($24)) + 16|0);
 $94 = $$index78;
 $95 = $94;
 $96 = HEAP32[$95>>2]|0;
 $97 = (($94) + 4)|0;
 $98 = $97;
 $99 = HEAP32[$98>>2]|0;
 HEAP32[$$ptr>>2] = 772;
 $$ptr$index81 = ((($$ptr)) + 8|0);
 $100 = $$ptr$index81;
 $101 = $100;
 HEAP32[$101>>2] = 20;
 $102 = (($100) + 4)|0;
 $103 = $102;
 HEAP32[$103>>2] = 0;
 HEAP32[$$ptr1>>2] = $$field73;
 $$ptr1$index82 = ((($$ptr1)) + 8|0);
 $104 = $$ptr1$index82;
 $105 = $104;
 HEAP32[$105>>2] = $90;
 $106 = (($104) + 4)|0;
 $107 = $106;
 HEAP32[$107>>2] = $93;
 $$ptr1$index83 = ((($$ptr1)) + 16|0);
 $108 = $$ptr1$index83;
 $109 = $108;
 HEAP32[$109>>2] = $96;
 $110 = (($108) + 4)|0;
 $111 = $110;
 HEAP32[$111>>2] = $99;
 (__fmt_4_fprintf($58,$$ptr,$$ptr1)|0);
 $112 = tempRet0;
 ____js_alert();
 STACKTOP = sp;return;
}
function ____bounds_check_error($file$ptr,$0,$1,$2,$3,$4,$5,$6,$7) {
 $file$ptr = $file$ptr|0;
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 $6 = $6|0;
 $7 = $7|0;
 var $$field15 = 0, $$field18 = 0, $$field23 = 0, $$field26 = 0, $$field31 = 0, $$field34 = 0, $$field39 = 0, $$field42 = 0, $$field47 = 0, $$field50 = 0, $$field71 = 0, $$index13 = 0, $$index17 = 0, $$index21 = 0, $$index25 = 0, $$index29 = 0, $$index33 = 0, $$index37 = 0, $$index41 = 0, $$index45 = 0;
 var $$index49 = 0, $$index5 = 0, $$index53 = 0, $$index54 = 0, $$index55$index82 = 0, $$index56 = 0, $$index56$index83 = 0, $$index57 = 0, $$index57$index84 = 0, $$index58 = 0, $$index58$index85 = 0, $$index59 = 0, $$index59$index86 = 0, $$index61 = 0, $$index63 = 0, $$index65 = 0, $$index67 = 0, $$index69 = 0, $$index7 = 0, $$index73 = 0;
 var $$index76 = 0, $$ptr = 0, $$ptr$index79 = 0, $$ptr1 = 0, $$ptr1$index80 = 0, $$ptr1$index81 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
 var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
 var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
 var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0;
 var $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0;
 var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $70 = 0, $71 = 0;
 var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0;
 var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $file$sreg$field = 0, $file$sreg$index2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 192|0;
 $$ptr = sp + 176|0;
 $$ptr1 = sp + 152|0;
 $file$sreg$field = HEAP32[$file$ptr>>2]|0;
 $file$sreg$index2 = ((($file$ptr)) + 8|0);
 $8 = $file$sreg$index2;
 $9 = $8;
 $10 = HEAP32[$9>>2]|0;
 $11 = (($8) + 4)|0;
 $12 = $11;
 $13 = HEAP32[$12>>2]|0;
 $14 = sp + 136|0;
 $15 = sp + 128|0;
 $16 = sp + 120|0;
 $17 = sp + 112|0;
 $18 = sp + 104|0;
 $19 = sp + 96|0;
 $20 = sp + 88|0;
 $21 = sp + 80|0;
 $22 = sp + 72|0;
 $23 = sp + 64|0;
 $24 = sp + 40|0;
 $25 = sp;
 HEAP32[$14>>2] = 0;
 $$index5 = ((($14)) + 8|0);
 $26 = $$index5;
 $27 = $26;
 HEAP32[$27>>2] = 0;
 $28 = (($26) + 4)|0;
 $29 = $28;
 HEAP32[$29>>2] = 0;
 HEAP32[$14>>2] = $file$sreg$field;
 $$index7 = ((($14)) + 8|0);
 $30 = $$index7;
 $31 = $30;
 HEAP32[$31>>2] = $10;
 $32 = (($30) + 4)|0;
 $33 = $32;
 HEAP32[$33>>2] = $13;
 $34 = $15;
 $35 = $34;
 HEAP32[$35>>2] = 0;
 $36 = (($34) + 4)|0;
 $37 = $36;
 HEAP32[$37>>2] = 0;
 $38 = $15;
 $39 = $38;
 HEAP32[$39>>2] = $0;
 $40 = (($38) + 4)|0;
 $41 = $40;
 HEAP32[$41>>2] = $1;
 $42 = $16;
 $43 = $42;
 HEAP32[$43>>2] = 0;
 $44 = (($42) + 4)|0;
 $45 = $44;
 HEAP32[$45>>2] = 0;
 $46 = $16;
 $47 = $46;
 HEAP32[$47>>2] = $2;
 $48 = (($46) + 4)|0;
 $49 = $48;
 HEAP32[$49>>2] = $3;
 $50 = $17;
 $51 = $50;
 HEAP32[$51>>2] = 0;
 $52 = (($50) + 4)|0;
 $53 = $52;
 HEAP32[$53>>2] = 0;
 $54 = $17;
 $55 = $54;
 HEAP32[$55>>2] = $4;
 $56 = (($54) + 4)|0;
 $57 = $56;
 HEAP32[$57>>2] = $5;
 $58 = $18;
 $59 = $58;
 HEAP32[$59>>2] = 0;
 $60 = (($58) + 4)|0;
 $61 = $60;
 HEAP32[$61>>2] = 0;
 $62 = $18;
 $63 = $62;
 HEAP32[$63>>2] = $6;
 $64 = (($62) + 4)|0;
 $65 = $64;
 HEAP32[$65>>2] = $7;
 $66 = $17;
 $67 = $66;
 $68 = HEAP32[$67>>2]|0;
 $69 = (($66) + 4)|0;
 $70 = $69;
 $71 = HEAP32[$70>>2]|0;
 $72 = (0)<($71|0);
 $73 = (0)<=($68>>>0);
 $74 = (0)==($71|0);
 $75 = $74 & $73;
 $76 = $72 | $75;
 if ($76) {
  $77 = $17;
  $78 = $77;
  $79 = HEAP32[$78>>2]|0;
  $80 = (($77) + 4)|0;
  $81 = $80;
  $82 = HEAP32[$81>>2]|0;
  $83 = $18;
  $84 = $83;
  $85 = HEAP32[$84>>2]|0;
  $86 = (($83) + 4)|0;
  $87 = $86;
  $88 = HEAP32[$87>>2]|0;
  $89 = ($82|0)<($88|0);
  $90 = ($79>>>0)<($85>>>0);
  $91 = ($82|0)==($88|0);
  $92 = $91 & $90;
  $93 = $89 | $92;
  if ($93) {
   STACKTOP = sp;return;
  }
 }
 $94 = HEAP32[27]|0;
 HEAP32[$19>>2] = 0;
 $$index13 = ((($19)) + 4|0);
 HEAP32[$$index13>>2] = 0;
 $95 = 13504;
 $96 = ((($19)) + 4|0);
 HEAP32[$19>>2] = $95;
 HEAP32[$96>>2] = $14;
 $$field15 = HEAP32[$19>>2]|0;
 $$index17 = ((($19)) + 4|0);
 $$field18 = HEAP32[$$index17>>2]|0;
 HEAP32[$20>>2] = 0;
 $$index21 = ((($20)) + 4|0);
 HEAP32[$$index21>>2] = 0;
 $97 = 13360;
 $98 = ((($20)) + 4|0);
 HEAP32[$20>>2] = $97;
 HEAP32[$98>>2] = $15;
 $$field23 = HEAP32[$20>>2]|0;
 $$index25 = ((($20)) + 4|0);
 $$field26 = HEAP32[$$index25>>2]|0;
 HEAP32[$21>>2] = 0;
 $$index29 = ((($21)) + 4|0);
 HEAP32[$$index29>>2] = 0;
 $99 = 13360;
 $100 = ((($21)) + 4|0);
 HEAP32[$21>>2] = $99;
 HEAP32[$100>>2] = $16;
 $$field31 = HEAP32[$21>>2]|0;
 $$index33 = ((($21)) + 4|0);
 $$field34 = HEAP32[$$index33>>2]|0;
 HEAP32[$22>>2] = 0;
 $$index37 = ((($22)) + 4|0);
 HEAP32[$$index37>>2] = 0;
 $101 = 13360;
 $102 = ((($22)) + 4|0);
 HEAP32[$22>>2] = $101;
 HEAP32[$102>>2] = $17;
 $$field39 = HEAP32[$22>>2]|0;
 $$index41 = ((($22)) + 4|0);
 $$field42 = HEAP32[$$index41>>2]|0;
 HEAP32[$23>>2] = 0;
 $$index45 = ((($23)) + 4|0);
 HEAP32[$$index45>>2] = 0;
 $103 = 13360;
 $104 = ((($23)) + 4|0);
 HEAP32[$23>>2] = $103;
 HEAP32[$104>>2] = $18;
 $$field47 = HEAP32[$23>>2]|0;
 $$index49 = ((($23)) + 4|0);
 $$field50 = HEAP32[$$index49>>2]|0;
 HEAP32[$24>>2] = 0;
 $$index53 = ((($24)) + 8|0);
 $105 = $$index53;
 $106 = $105;
 HEAP32[$106>>2] = 0;
 $107 = (($105) + 4)|0;
 $108 = $107;
 HEAP32[$108>>2] = 0;
 $$index54 = ((($24)) + 16|0);
 $109 = $$index54;
 $110 = $109;
 HEAP32[$110>>2] = 0;
 $111 = (($109) + 4)|0;
 $112 = $111;
 HEAP32[$112>>2] = 0;
 HEAP32[$25>>2] = 0;
 $$index55$index82 = ((($25)) + 4|0);
 HEAP32[$$index55$index82>>2] = 0;
 $$index56 = ((($25)) + 8|0);
 HEAP32[$$index56>>2] = 0;
 $$index56$index83 = ((($$index56)) + 4|0);
 HEAP32[$$index56$index83>>2] = 0;
 $$index57 = ((($25)) + 16|0);
 HEAP32[$$index57>>2] = 0;
 $$index57$index84 = ((($$index57)) + 4|0);
 HEAP32[$$index57$index84>>2] = 0;
 $$index58 = ((($25)) + 24|0);
 HEAP32[$$index58>>2] = 0;
 $$index58$index85 = ((($$index58)) + 4|0);
 HEAP32[$$index58$index85>>2] = 0;
 $$index59 = ((($25)) + 32|0);
 HEAP32[$$index59>>2] = 0;
 $$index59$index86 = ((($$index59)) + 4|0);
 HEAP32[$$index59$index86>>2] = 0;
 HEAP32[$25>>2] = $$field15;
 $$index61 = ((($25)) + 4|0);
 HEAP32[$$index61>>2] = $$field18;
 $113 = ((($25)) + 8|0);
 HEAP32[$113>>2] = $$field23;
 $$index63 = ((($113)) + 4|0);
 HEAP32[$$index63>>2] = $$field26;
 $114 = ((($25)) + 16|0);
 HEAP32[$114>>2] = $$field31;
 $$index65 = ((($114)) + 4|0);
 HEAP32[$$index65>>2] = $$field34;
 $115 = ((($25)) + 24|0);
 HEAP32[$115>>2] = $$field39;
 $$index67 = ((($115)) + 4|0);
 HEAP32[$$index67>>2] = $$field42;
 $116 = ((($25)) + 32|0);
 HEAP32[$116>>2] = $$field47;
 $$index69 = ((($116)) + 4|0);
 HEAP32[$$index69>>2] = $$field50;
 HEAP32[$24>>2] = $25;
 $117 = ((($24)) + 8|0);
 $118 = $117;
 $119 = $118;
 HEAP32[$119>>2] = 5;
 $120 = (($118) + 4)|0;
 $121 = $120;
 HEAP32[$121>>2] = 0;
 $122 = ((($24)) + 16|0);
 $123 = $122;
 $124 = $123;
 HEAP32[$124>>2] = 5;
 $125 = (($123) + 4)|0;
 $126 = $125;
 HEAP32[$126>>2] = 0;
 $$field71 = HEAP32[$24>>2]|0;
 $$index73 = ((($24)) + 8|0);
 $127 = $$index73;
 $128 = $127;
 $129 = HEAP32[$128>>2]|0;
 $130 = (($127) + 4)|0;
 $131 = $130;
 $132 = HEAP32[$131>>2]|0;
 $$index76 = ((($24)) + 16|0);
 $133 = $$index76;
 $134 = $133;
 $135 = HEAP32[$134>>2]|0;
 $136 = (($133) + 4)|0;
 $137 = $136;
 $138 = HEAP32[$137>>2]|0;
 HEAP32[$$ptr>>2] = 792;
 $$ptr$index79 = ((($$ptr)) + 8|0);
 $139 = $$ptr$index79;
 $140 = $139;
 HEAP32[$140>>2] = 48;
 $141 = (($139) + 4)|0;
 $142 = $141;
 HEAP32[$142>>2] = 0;
 HEAP32[$$ptr1>>2] = $$field71;
 $$ptr1$index80 = ((($$ptr1)) + 8|0);
 $143 = $$ptr1$index80;
 $144 = $143;
 HEAP32[$144>>2] = $129;
 $145 = (($143) + 4)|0;
 $146 = $145;
 HEAP32[$146>>2] = $132;
 $$ptr1$index81 = ((($$ptr1)) + 16|0);
 $147 = $$ptr1$index81;
 $148 = $147;
 HEAP32[$148>>2] = $135;
 $149 = (($147) + 4)|0;
 $150 = $149;
 HEAP32[$150>>2] = $138;
 (__fmt_4_fprintf($94,$$ptr,$$ptr1)|0);
 $151 = tempRet0;
 ____js_alert();
 STACKTOP = sp;return;
}
function ____slice_expr_error($file$ptr,$0,$1,$2,$3,$4,$5,$6,$7,$8,$9) {
 $file$ptr = $file$ptr|0;
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 $6 = $6|0;
 $7 = $7|0;
 $8 = $8|0;
 $9 = $9|0;
 var $$field15 = 0, $$field18 = 0, $$field23 = 0, $$field26 = 0, $$field31 = 0, $$field34 = 0, $$field39 = 0, $$field42 = 0, $$field47 = 0, $$field50 = 0, $$field55 = 0, $$field58 = 0, $$field82 = 0, $$index13 = 0, $$index17 = 0, $$index21 = 0, $$index25 = 0, $$index29 = 0, $$index33 = 0, $$index37 = 0;
 var $$index41 = 0, $$index45 = 0, $$index49 = 0, $$index5 = 0, $$index53 = 0, $$index57 = 0, $$index61 = 0, $$index62 = 0, $$index63$index93 = 0, $$index64 = 0, $$index64$index94 = 0, $$index65 = 0, $$index65$index95 = 0, $$index66 = 0, $$index66$index96 = 0, $$index67 = 0, $$index67$index97 = 0, $$index68 = 0, $$index68$index98 = 0, $$index7 = 0;
 var $$index70 = 0, $$index72 = 0, $$index74 = 0, $$index76 = 0, $$index78 = 0, $$index80 = 0, $$index84 = 0, $$index87 = 0, $$ptr = 0, $$ptr$index90 = 0, $$ptr1 = 0, $$ptr1$index91 = 0, $$ptr1$index92 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0;
 var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0;
 var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0;
 var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0;
 var $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0;
 var $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0;
 var $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0, $52 = 0;
 var $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $70 = 0, $71 = 0, $72 = 0;
 var $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $90 = 0, $91 = 0, $92 = 0;
 var $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $file$sreg$field = 0, $file$sreg$index2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 224|0;
 $$ptr = sp + 200|0;
 $$ptr1 = sp + 176|0;
 $file$sreg$field = HEAP32[$file$ptr>>2]|0;
 $file$sreg$index2 = ((($file$ptr)) + 8|0);
 $10 = $file$sreg$index2;
 $11 = $10;
 $12 = HEAP32[$11>>2]|0;
 $13 = (($10) + 4)|0;
 $14 = $13;
 $15 = HEAP32[$14>>2]|0;
 $16 = sp + 160|0;
 $17 = sp + 152|0;
 $18 = sp + 144|0;
 $19 = sp + 136|0;
 $20 = sp + 128|0;
 $21 = sp + 120|0;
 $22 = sp + 112|0;
 $23 = sp + 104|0;
 $24 = sp + 96|0;
 $25 = sp + 88|0;
 $26 = sp + 80|0;
 $27 = sp + 72|0;
 $28 = sp + 48|0;
 $29 = sp;
 HEAP32[$16>>2] = 0;
 $$index5 = ((($16)) + 8|0);
 $30 = $$index5;
 $31 = $30;
 HEAP32[$31>>2] = 0;
 $32 = (($30) + 4)|0;
 $33 = $32;
 HEAP32[$33>>2] = 0;
 HEAP32[$16>>2] = $file$sreg$field;
 $$index7 = ((($16)) + 8|0);
 $34 = $$index7;
 $35 = $34;
 HEAP32[$35>>2] = $12;
 $36 = (($34) + 4)|0;
 $37 = $36;
 HEAP32[$37>>2] = $15;
 $38 = $17;
 $39 = $38;
 HEAP32[$39>>2] = 0;
 $40 = (($38) + 4)|0;
 $41 = $40;
 HEAP32[$41>>2] = 0;
 $42 = $17;
 $43 = $42;
 HEAP32[$43>>2] = $0;
 $44 = (($42) + 4)|0;
 $45 = $44;
 HEAP32[$45>>2] = $1;
 $46 = $18;
 $47 = $46;
 HEAP32[$47>>2] = 0;
 $48 = (($46) + 4)|0;
 $49 = $48;
 HEAP32[$49>>2] = 0;
 $50 = $18;
 $51 = $50;
 HEAP32[$51>>2] = $2;
 $52 = (($50) + 4)|0;
 $53 = $52;
 HEAP32[$53>>2] = $3;
 $54 = $19;
 $55 = $54;
 HEAP32[$55>>2] = 0;
 $56 = (($54) + 4)|0;
 $57 = $56;
 HEAP32[$57>>2] = 0;
 $58 = $19;
 $59 = $58;
 HEAP32[$59>>2] = $4;
 $60 = (($58) + 4)|0;
 $61 = $60;
 HEAP32[$61>>2] = $5;
 $62 = $20;
 $63 = $62;
 HEAP32[$63>>2] = 0;
 $64 = (($62) + 4)|0;
 $65 = $64;
 HEAP32[$65>>2] = 0;
 $66 = $20;
 $67 = $66;
 HEAP32[$67>>2] = $6;
 $68 = (($66) + 4)|0;
 $69 = $68;
 HEAP32[$69>>2] = $7;
 $70 = $21;
 $71 = $70;
 HEAP32[$71>>2] = 0;
 $72 = (($70) + 4)|0;
 $73 = $72;
 HEAP32[$73>>2] = 0;
 $74 = $21;
 $75 = $74;
 HEAP32[$75>>2] = $8;
 $76 = (($74) + 4)|0;
 $77 = $76;
 HEAP32[$77>>2] = $9;
 $78 = $19;
 $79 = $78;
 $80 = HEAP32[$79>>2]|0;
 $81 = (($78) + 4)|0;
 $82 = $81;
 $83 = HEAP32[$82>>2]|0;
 $84 = (0)<($83|0);
 $85 = (0)<=($80>>>0);
 $86 = (0)==($83|0);
 $87 = $86 & $85;
 $88 = $84 | $87;
 if ($88) {
  $89 = $19;
  $90 = $89;
  $91 = HEAP32[$90>>2]|0;
  $92 = (($89) + 4)|0;
  $93 = $92;
  $94 = HEAP32[$93>>2]|0;
  $95 = $20;
  $96 = $95;
  $97 = HEAP32[$96>>2]|0;
  $98 = (($95) + 4)|0;
  $99 = $98;
  $100 = HEAP32[$99>>2]|0;
  $101 = ($94|0)<($100|0);
  $102 = ($91>>>0)<=($97>>>0);
  $103 = ($94|0)==($100|0);
  $104 = $103 & $102;
  $105 = $101 | $104;
  if ($105) {
   $106 = $20;
   $107 = $106;
   $108 = HEAP32[$107>>2]|0;
   $109 = (($106) + 4)|0;
   $110 = $109;
   $111 = HEAP32[$110>>2]|0;
   $112 = $21;
   $113 = $112;
   $114 = HEAP32[$113>>2]|0;
   $115 = (($112) + 4)|0;
   $116 = $115;
   $117 = HEAP32[$116>>2]|0;
   $118 = ($111|0)<($117|0);
   $119 = ($108>>>0)<=($114>>>0);
   $120 = ($111|0)==($117|0);
   $121 = $120 & $119;
   $122 = $118 | $121;
   if ($122) {
    STACKTOP = sp;return;
   }
  }
 }
 $123 = HEAP32[27]|0;
 HEAP32[$22>>2] = 0;
 $$index13 = ((($22)) + 4|0);
 HEAP32[$$index13>>2] = 0;
 $124 = 13504;
 $125 = ((($22)) + 4|0);
 HEAP32[$22>>2] = $124;
 HEAP32[$125>>2] = $16;
 $$field15 = HEAP32[$22>>2]|0;
 $$index17 = ((($22)) + 4|0);
 $$field18 = HEAP32[$$index17>>2]|0;
 HEAP32[$23>>2] = 0;
 $$index21 = ((($23)) + 4|0);
 HEAP32[$$index21>>2] = 0;
 $126 = 13360;
 $127 = ((($23)) + 4|0);
 HEAP32[$23>>2] = $126;
 HEAP32[$127>>2] = $17;
 $$field23 = HEAP32[$23>>2]|0;
 $$index25 = ((($23)) + 4|0);
 $$field26 = HEAP32[$$index25>>2]|0;
 HEAP32[$24>>2] = 0;
 $$index29 = ((($24)) + 4|0);
 HEAP32[$$index29>>2] = 0;
 $128 = 13360;
 $129 = ((($24)) + 4|0);
 HEAP32[$24>>2] = $128;
 HEAP32[$129>>2] = $18;
 $$field31 = HEAP32[$24>>2]|0;
 $$index33 = ((($24)) + 4|0);
 $$field34 = HEAP32[$$index33>>2]|0;
 HEAP32[$25>>2] = 0;
 $$index37 = ((($25)) + 4|0);
 HEAP32[$$index37>>2] = 0;
 $130 = 13360;
 $131 = ((($25)) + 4|0);
 HEAP32[$25>>2] = $130;
 HEAP32[$131>>2] = $19;
 $$field39 = HEAP32[$25>>2]|0;
 $$index41 = ((($25)) + 4|0);
 $$field42 = HEAP32[$$index41>>2]|0;
 HEAP32[$26>>2] = 0;
 $$index45 = ((($26)) + 4|0);
 HEAP32[$$index45>>2] = 0;
 $132 = 13360;
 $133 = ((($26)) + 4|0);
 HEAP32[$26>>2] = $132;
 HEAP32[$133>>2] = $20;
 $$field47 = HEAP32[$26>>2]|0;
 $$index49 = ((($26)) + 4|0);
 $$field50 = HEAP32[$$index49>>2]|0;
 HEAP32[$27>>2] = 0;
 $$index53 = ((($27)) + 4|0);
 HEAP32[$$index53>>2] = 0;
 $134 = 13360;
 $135 = ((($27)) + 4|0);
 HEAP32[$27>>2] = $134;
 HEAP32[$135>>2] = $21;
 $$field55 = HEAP32[$27>>2]|0;
 $$index57 = ((($27)) + 4|0);
 $$field58 = HEAP32[$$index57>>2]|0;
 HEAP32[$28>>2] = 0;
 $$index61 = ((($28)) + 8|0);
 $136 = $$index61;
 $137 = $136;
 HEAP32[$137>>2] = 0;
 $138 = (($136) + 4)|0;
 $139 = $138;
 HEAP32[$139>>2] = 0;
 $$index62 = ((($28)) + 16|0);
 $140 = $$index62;
 $141 = $140;
 HEAP32[$141>>2] = 0;
 $142 = (($140) + 4)|0;
 $143 = $142;
 HEAP32[$143>>2] = 0;
 HEAP32[$29>>2] = 0;
 $$index63$index93 = ((($29)) + 4|0);
 HEAP32[$$index63$index93>>2] = 0;
 $$index64 = ((($29)) + 8|0);
 HEAP32[$$index64>>2] = 0;
 $$index64$index94 = ((($$index64)) + 4|0);
 HEAP32[$$index64$index94>>2] = 0;
 $$index65 = ((($29)) + 16|0);
 HEAP32[$$index65>>2] = 0;
 $$index65$index95 = ((($$index65)) + 4|0);
 HEAP32[$$index65$index95>>2] = 0;
 $$index66 = ((($29)) + 24|0);
 HEAP32[$$index66>>2] = 0;
 $$index66$index96 = ((($$index66)) + 4|0);
 HEAP32[$$index66$index96>>2] = 0;
 $$index67 = ((($29)) + 32|0);
 HEAP32[$$index67>>2] = 0;
 $$index67$index97 = ((($$index67)) + 4|0);
 HEAP32[$$index67$index97>>2] = 0;
 $$index68 = ((($29)) + 40|0);
 HEAP32[$$index68>>2] = 0;
 $$index68$index98 = ((($$index68)) + 4|0);
 HEAP32[$$index68$index98>>2] = 0;
 HEAP32[$29>>2] = $$field15;
 $$index70 = ((($29)) + 4|0);
 HEAP32[$$index70>>2] = $$field18;
 $144 = ((($29)) + 8|0);
 HEAP32[$144>>2] = $$field23;
 $$index72 = ((($144)) + 4|0);
 HEAP32[$$index72>>2] = $$field26;
 $145 = ((($29)) + 16|0);
 HEAP32[$145>>2] = $$field31;
 $$index74 = ((($145)) + 4|0);
 HEAP32[$$index74>>2] = $$field34;
 $146 = ((($29)) + 24|0);
 HEAP32[$146>>2] = $$field39;
 $$index76 = ((($146)) + 4|0);
 HEAP32[$$index76>>2] = $$field42;
 $147 = ((($29)) + 32|0);
 HEAP32[$147>>2] = $$field47;
 $$index78 = ((($147)) + 4|0);
 HEAP32[$$index78>>2] = $$field50;
 $148 = ((($29)) + 40|0);
 HEAP32[$148>>2] = $$field55;
 $$index80 = ((($148)) + 4|0);
 HEAP32[$$index80>>2] = $$field58;
 HEAP32[$28>>2] = $29;
 $149 = ((($28)) + 8|0);
 $150 = $149;
 $151 = $150;
 HEAP32[$151>>2] = 6;
 $152 = (($150) + 4)|0;
 $153 = $152;
 HEAP32[$153>>2] = 0;
 $154 = ((($28)) + 16|0);
 $155 = $154;
 $156 = $155;
 HEAP32[$156>>2] = 6;
 $157 = (($155) + 4)|0;
 $158 = $157;
 HEAP32[$158>>2] = 0;
 $$field82 = HEAP32[$28>>2]|0;
 $$index84 = ((($28)) + 8|0);
 $159 = $$index84;
 $160 = $159;
 $161 = HEAP32[$160>>2]|0;
 $162 = (($159) + 4)|0;
 $163 = $162;
 $164 = HEAP32[$163>>2]|0;
 $$index87 = ((($28)) + 16|0);
 $165 = $$index87;
 $166 = $165;
 $167 = HEAP32[$166>>2]|0;
 $168 = (($165) + 4)|0;
 $169 = $168;
 $170 = HEAP32[$169>>2]|0;
 HEAP32[$$ptr>>2] = 840;
 $$ptr$index90 = ((($$ptr)) + 8|0);
 $171 = $$ptr$index90;
 $172 = $171;
 HEAP32[$172>>2] = 46;
 $173 = (($171) + 4)|0;
 $174 = $173;
 HEAP32[$174>>2] = 0;
 HEAP32[$$ptr1>>2] = $$field82;
 $$ptr1$index91 = ((($$ptr1)) + 8|0);
 $175 = $$ptr1$index91;
 $176 = $175;
 HEAP32[$176>>2] = $161;
 $177 = (($175) + 4)|0;
 $178 = $177;
 HEAP32[$178>>2] = $164;
 $$ptr1$index92 = ((($$ptr1)) + 16|0);
 $179 = $$ptr1$index92;
 $180 = $179;
 HEAP32[$180>>2] = $167;
 $181 = (($179) + 4)|0;
 $182 = $181;
 HEAP32[$182>>2] = $170;
 (__fmt_4_fprintf($123,$$ptr,$$ptr1)|0);
 $183 = tempRet0;
 ____js_alert();
 STACKTOP = sp;return;
}
function ____substring_expr_error($file$ptr,$0,$1,$2,$3,$4,$5,$6,$7) {
 $file$ptr = $file$ptr|0;
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $4 = $4|0;
 $5 = $5|0;
 $6 = $6|0;
 $7 = $7|0;
 var $$field15 = 0, $$field18 = 0, $$field23 = 0, $$field26 = 0, $$field31 = 0, $$field34 = 0, $$field39 = 0, $$field42 = 0, $$field47 = 0, $$field50 = 0, $$field71 = 0, $$index13 = 0, $$index17 = 0, $$index21 = 0, $$index25 = 0, $$index29 = 0, $$index33 = 0, $$index37 = 0, $$index41 = 0, $$index45 = 0;
 var $$index49 = 0, $$index5 = 0, $$index53 = 0, $$index54 = 0, $$index55$index82 = 0, $$index56 = 0, $$index56$index83 = 0, $$index57 = 0, $$index57$index84 = 0, $$index58 = 0, $$index58$index85 = 0, $$index59 = 0, $$index59$index86 = 0, $$index61 = 0, $$index63 = 0, $$index65 = 0, $$index67 = 0, $$index69 = 0, $$index7 = 0, $$index73 = 0;
 var $$index76 = 0, $$ptr = 0, $$ptr$index79 = 0, $$ptr1 = 0, $$ptr1$index80 = 0, $$ptr1$index81 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
 var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
 var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
 var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0;
 var $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0;
 var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $70 = 0, $71 = 0;
 var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0;
 var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $file$sreg$field = 0, $file$sreg$index2 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 192|0;
 $$ptr = sp + 176|0;
 $$ptr1 = sp + 152|0;
 $file$sreg$field = HEAP32[$file$ptr>>2]|0;
 $file$sreg$index2 = ((($file$ptr)) + 8|0);
 $8 = $file$sreg$index2;
 $9 = $8;
 $10 = HEAP32[$9>>2]|0;
 $11 = (($8) + 4)|0;
 $12 = $11;
 $13 = HEAP32[$12>>2]|0;
 $14 = sp + 136|0;
 $15 = sp + 128|0;
 $16 = sp + 120|0;
 $17 = sp + 112|0;
 $18 = sp + 104|0;
 $19 = sp + 96|0;
 $20 = sp + 88|0;
 $21 = sp + 80|0;
 $22 = sp + 72|0;
 $23 = sp + 64|0;
 $24 = sp + 40|0;
 $25 = sp;
 HEAP32[$14>>2] = 0;
 $$index5 = ((($14)) + 8|0);
 $26 = $$index5;
 $27 = $26;
 HEAP32[$27>>2] = 0;
 $28 = (($26) + 4)|0;
 $29 = $28;
 HEAP32[$29>>2] = 0;
 HEAP32[$14>>2] = $file$sreg$field;
 $$index7 = ((($14)) + 8|0);
 $30 = $$index7;
 $31 = $30;
 HEAP32[$31>>2] = $10;
 $32 = (($30) + 4)|0;
 $33 = $32;
 HEAP32[$33>>2] = $13;
 $34 = $15;
 $35 = $34;
 HEAP32[$35>>2] = 0;
 $36 = (($34) + 4)|0;
 $37 = $36;
 HEAP32[$37>>2] = 0;
 $38 = $15;
 $39 = $38;
 HEAP32[$39>>2] = $0;
 $40 = (($38) + 4)|0;
 $41 = $40;
 HEAP32[$41>>2] = $1;
 $42 = $16;
 $43 = $42;
 HEAP32[$43>>2] = 0;
 $44 = (($42) + 4)|0;
 $45 = $44;
 HEAP32[$45>>2] = 0;
 $46 = $16;
 $47 = $46;
 HEAP32[$47>>2] = $2;
 $48 = (($46) + 4)|0;
 $49 = $48;
 HEAP32[$49>>2] = $3;
 $50 = $17;
 $51 = $50;
 HEAP32[$51>>2] = 0;
 $52 = (($50) + 4)|0;
 $53 = $52;
 HEAP32[$53>>2] = 0;
 $54 = $17;
 $55 = $54;
 HEAP32[$55>>2] = $4;
 $56 = (($54) + 4)|0;
 $57 = $56;
 HEAP32[$57>>2] = $5;
 $58 = $18;
 $59 = $58;
 HEAP32[$59>>2] = 0;
 $60 = (($58) + 4)|0;
 $61 = $60;
 HEAP32[$61>>2] = 0;
 $62 = $18;
 $63 = $62;
 HEAP32[$63>>2] = $6;
 $64 = (($62) + 4)|0;
 $65 = $64;
 HEAP32[$65>>2] = $7;
 $66 = $17;
 $67 = $66;
 $68 = HEAP32[$67>>2]|0;
 $69 = (($66) + 4)|0;
 $70 = $69;
 $71 = HEAP32[$70>>2]|0;
 $72 = (0)<($71|0);
 $73 = (0)<=($68>>>0);
 $74 = (0)==($71|0);
 $75 = $74 & $73;
 $76 = $72 | $75;
 if ($76) {
  $77 = $17;
  $78 = $77;
  $79 = HEAP32[$78>>2]|0;
  $80 = (($77) + 4)|0;
  $81 = $80;
  $82 = HEAP32[$81>>2]|0;
  $83 = $18;
  $84 = $83;
  $85 = HEAP32[$84>>2]|0;
  $86 = (($83) + 4)|0;
  $87 = $86;
  $88 = HEAP32[$87>>2]|0;
  $89 = ($82|0)<($88|0);
  $90 = ($79>>>0)<=($85>>>0);
  $91 = ($82|0)==($88|0);
  $92 = $91 & $90;
  $93 = $89 | $92;
  if ($93) {
   STACKTOP = sp;return;
  }
 }
 $94 = HEAP32[27]|0;
 HEAP32[$19>>2] = 0;
 $$index13 = ((($19)) + 4|0);
 HEAP32[$$index13>>2] = 0;
 $95 = 13504;
 $96 = ((($19)) + 4|0);
 HEAP32[$19>>2] = $95;
 HEAP32[$96>>2] = $14;
 $$field15 = HEAP32[$19>>2]|0;
 $$index17 = ((($19)) + 4|0);
 $$field18 = HEAP32[$$index17>>2]|0;
 HEAP32[$20>>2] = 0;
 $$index21 = ((($20)) + 4|0);
 HEAP32[$$index21>>2] = 0;
 $97 = 13360;
 $98 = ((($20)) + 4|0);
 HEAP32[$20>>2] = $97;
 HEAP32[$98>>2] = $15;
 $$field23 = HEAP32[$20>>2]|0;
 $$index25 = ((($20)) + 4|0);
 $$field26 = HEAP32[$$index25>>2]|0;
 HEAP32[$21>>2] = 0;
 $$index29 = ((($21)) + 4|0);
 HEAP32[$$index29>>2] = 0;
 $99 = 13360;
 $100 = ((($21)) + 4|0);
 HEAP32[$21>>2] = $99;
 HEAP32[$100>>2] = $16;
 $$field31 = HEAP32[$21>>2]|0;
 $$index33 = ((($21)) + 4|0);
 $$field34 = HEAP32[$$index33>>2]|0;
 HEAP32[$22>>2] = 0;
 $$index37 = ((($22)) + 4|0);
 HEAP32[$$index37>>2] = 0;
 $101 = 13360;
 $102 = ((($22)) + 4|0);
 HEAP32[$22>>2] = $101;
 HEAP32[$102>>2] = $17;
 $$field39 = HEAP32[$22>>2]|0;
 $$index41 = ((($22)) + 4|0);
 $$field42 = HEAP32[$$index41>>2]|0;
 HEAP32[$23>>2] = 0;
 $$index45 = ((($23)) + 4|0);
 HEAP32[$$index45>>2] = 0;
 $103 = 13360;
 $104 = ((($23)) + 4|0);
 HEAP32[$23>>2] = $103;
 HEAP32[$104>>2] = $18;
 $$field47 = HEAP32[$23>>2]|0;
 $$index49 = ((($23)) + 4|0);
 $$field50 = HEAP32[$$index49>>2]|0;
 HEAP32[$24>>2] = 0;
 $$index53 = ((($24)) + 8|0);
 $105 = $$index53;
 $106 = $105;
 HEAP32[$106>>2] = 0;
 $107 = (($105) + 4)|0;
 $108 = $107;
 HEAP32[$108>>2] = 0;
 $$index54 = ((($24)) + 16|0);
 $109 = $$index54;
 $110 = $109;
 HEAP32[$110>>2] = 0;
 $111 = (($109) + 4)|0;
 $112 = $111;
 HEAP32[$112>>2] = 0;
 HEAP32[$25>>2] = 0;
 $$index55$index82 = ((($25)) + 4|0);
 HEAP32[$$index55$index82>>2] = 0;
 $$index56 = ((($25)) + 8|0);
 HEAP32[$$index56>>2] = 0;
 $$index56$index83 = ((($$index56)) + 4|0);
 HEAP32[$$index56$index83>>2] = 0;
 $$index57 = ((($25)) + 16|0);
 HEAP32[$$index57>>2] = 0;
 $$index57$index84 = ((($$index57)) + 4|0);
 HEAP32[$$index57$index84>>2] = 0;
 $$index58 = ((($25)) + 24|0);
 HEAP32[$$index58>>2] = 0;
 $$index58$index85 = ((($$index58)) + 4|0);
 HEAP32[$$index58$index85>>2] = 0;
 $$index59 = ((($25)) + 32|0);
 HEAP32[$$index59>>2] = 0;
 $$index59$index86 = ((($$index59)) + 4|0);
 HEAP32[$$index59$index86>>2] = 0;
 HEAP32[$25>>2] = $$field15;
 $$index61 = ((($25)) + 4|0);
 HEAP32[$$index61>>2] = $$field18;
 $113 = ((($25)) + 8|0);
 HEAP32[$113>>2] = $$field23;
 $$index63 = ((($113)) + 4|0);
 HEAP32[$$index63>>2] = $$field26;
 $114 = ((($25)) + 16|0);
 HEAP32[$114>>2] = $$field31;
 $$index65 = ((($114)) + 4|0);
 HEAP32[$$index65>>2] = $$field34;
 $115 = ((($25)) + 24|0);
 HEAP32[$115>>2] = $$field39;
 $$index67 = ((($115)) + 4|0);
 HEAP32[$$index67>>2] = $$field42;
 $116 = ((($25)) + 32|0);
 HEAP32[$116>>2] = $$field47;
 $$index69 = ((($116)) + 4|0);
 HEAP32[$$index69>>2] = $$field50;
 HEAP32[$24>>2] = $25;
 $117 = ((($24)) + 8|0);
 $118 = $117;
 $119 = $118;
 HEAP32[$119>>2] = 5;
 $120 = (($118) + 4)|0;
 $121 = $120;
 HEAP32[$121>>2] = 0;
 $122 = ((($24)) + 16|0);
 $123 = $122;
 $124 = $123;
 HEAP32[$124>>2] = 5;
 $125 = (($123) + 4)|0;
 $126 = $125;
 HEAP32[$126>>2] = 0;
 $$field71 = HEAP32[$24>>2]|0;
 $$index73 = ((($24)) + 8|0);
 $127 = $$index73;
 $128 = $127;
 $129 = HEAP32[$128>>2]|0;
 $130 = (($127) + 4)|0;
 $131 = $130;
 $132 = HEAP32[$131>>2]|0;
 $$index76 = ((($24)) + 16|0);
 $133 = $$index76;
 $134 = $133;
 $135 = HEAP32[$134>>2]|0;
 $136 = (($133) + 4)|0;
 $137 = $136;
 $138 = HEAP32[$137>>2]|0;
 HEAP32[$$ptr>>2] = 886;
 $$ptr$index79 = ((($$ptr)) + 8|0);
 $139 = $$ptr$index79;
 $140 = $139;
 HEAP32[$140>>2] = 46;
 $141 = (($139) + 4)|0;
 $142 = $141;
 HEAP32[$142>>2] = 0;
 HEAP32[$$ptr1>>2] = $$field71;
 $$ptr1$index80 = ((($$ptr1)) + 8|0);
 $143 = $$ptr1$index80;
 $144 = $143;
 HEAP32[$144>>2] = $129;
 $145 = (($143) + 4)|0;
 $146 = $145;
 HEAP32[$146>>2] = $132;
 $$ptr1$index81 = ((($$ptr1)) + 16|0);
 $147 = $$ptr1$index81;
 $148 = $147;
 HEAP32[$148>>2] = $135;
 $149 = (($147) + 4)|0;
 $150 = $149;
 HEAP32[$150>>2] = $138;
 (__fmt_4_fprintf($94,$$ptr,$$ptr1)|0);
 $151 = tempRet0;
 ____js_alert();
 STACKTOP = sp;return;
}
function ____union_cast_check($ok,$file$ptr,$0,$1,$2,$3,$from,$to) {
 $ok = $ok|0;
 $file$ptr = $file$ptr|0;
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $from = $from|0;
 $to = $to|0;
 var $$expand_i1_val = 0, $$field15 = 0, $$field18 = 0, $$field23 = 0, $$field26 = 0, $$field31 = 0, $$field34 = 0, $$field39 = 0, $$field42 = 0, $$field47 = 0, $$field50 = 0, $$field71 = 0, $$index13 = 0, $$index17 = 0, $$index21 = 0, $$index25 = 0, $$index29 = 0, $$index33 = 0, $$index37 = 0, $$index41 = 0;
 var $$index45 = 0, $$index49 = 0, $$index5 = 0, $$index53 = 0, $$index54 = 0, $$index55$index82 = 0, $$index56 = 0, $$index56$index83 = 0, $$index57 = 0, $$index57$index84 = 0, $$index58 = 0, $$index58$index85 = 0, $$index59 = 0, $$index59$index86 = 0, $$index61 = 0, $$index63 = 0, $$index65 = 0, $$index67 = 0, $$index69 = 0, $$index7 = 0;
 var $$index73 = 0, $$index76 = 0, $$pre_trunc = 0, $$ptr = 0, $$ptr$index79 = 0, $$ptr1 = 0, $$ptr1$index80 = 0, $$ptr1$index81 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
 var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0;
 var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0;
 var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0;
 var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0;
 var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $file$sreg$field = 0, $file$sreg$index2 = 0, $ok$expand_i1_val = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 208|0;
 $$ptr = sp + 176|0;
 $$ptr1 = sp + 152|0;
 $file$sreg$field = HEAP32[$file$ptr>>2]|0;
 $file$sreg$index2 = ((($file$ptr)) + 8|0);
 $4 = $file$sreg$index2;
 $5 = $4;
 $6 = HEAP32[$5>>2]|0;
 $7 = (($4) + 4)|0;
 $8 = $7;
 $9 = HEAP32[$8>>2]|0;
 $10 = sp + 192|0;
 $11 = sp + 136|0;
 $12 = sp + 128|0;
 $13 = sp + 120|0;
 $14 = sp + 112|0;
 $15 = sp + 104|0;
 $16 = sp + 96|0;
 $17 = sp + 88|0;
 $18 = sp + 80|0;
 $19 = sp + 72|0;
 $20 = sp + 64|0;
 $21 = sp + 40|0;
 $22 = sp;
 $$expand_i1_val = 0;
 HEAP8[$10>>0] = $$expand_i1_val;
 $ok$expand_i1_val = $ok&1;
 HEAP8[$10>>0] = $ok$expand_i1_val;
 HEAP32[$11>>2] = 0;
 $$index5 = ((($11)) + 8|0);
 $23 = $$index5;
 $24 = $23;
 HEAP32[$24>>2] = 0;
 $25 = (($23) + 4)|0;
 $26 = $25;
 HEAP32[$26>>2] = 0;
 HEAP32[$11>>2] = $file$sreg$field;
 $$index7 = ((($11)) + 8|0);
 $27 = $$index7;
 $28 = $27;
 HEAP32[$28>>2] = $6;
 $29 = (($27) + 4)|0;
 $30 = $29;
 HEAP32[$30>>2] = $9;
 $31 = $12;
 $32 = $31;
 HEAP32[$32>>2] = 0;
 $33 = (($31) + 4)|0;
 $34 = $33;
 HEAP32[$34>>2] = 0;
 $35 = $12;
 $36 = $35;
 HEAP32[$36>>2] = $0;
 $37 = (($35) + 4)|0;
 $38 = $37;
 HEAP32[$38>>2] = $1;
 $39 = $13;
 $40 = $39;
 HEAP32[$40>>2] = 0;
 $41 = (($39) + 4)|0;
 $42 = $41;
 HEAP32[$42>>2] = 0;
 $43 = $13;
 $44 = $43;
 HEAP32[$44>>2] = $2;
 $45 = (($43) + 4)|0;
 $46 = $45;
 HEAP32[$46>>2] = $3;
 HEAP32[$14>>2] = 0;
 HEAP32[$14>>2] = $from;
 HEAP32[$15>>2] = 0;
 HEAP32[$15>>2] = $to;
 $$pre_trunc = HEAP8[$10>>0]|0;
 $47 = $$pre_trunc&1;
 if ($47) {
  STACKTOP = sp;return;
 }
 $48 = HEAP32[27]|0;
 HEAP32[$16>>2] = 0;
 $$index13 = ((($16)) + 4|0);
 HEAP32[$$index13>>2] = 0;
 $49 = 13504;
 $50 = ((($16)) + 4|0);
 HEAP32[$16>>2] = $49;
 HEAP32[$50>>2] = $11;
 $$field15 = HEAP32[$16>>2]|0;
 $$index17 = ((($16)) + 4|0);
 $$field18 = HEAP32[$$index17>>2]|0;
 HEAP32[$17>>2] = 0;
 $$index21 = ((($17)) + 4|0);
 HEAP32[$$index21>>2] = 0;
 $51 = 13360;
 $52 = ((($17)) + 4|0);
 HEAP32[$17>>2] = $51;
 HEAP32[$52>>2] = $12;
 $$field23 = HEAP32[$17>>2]|0;
 $$index25 = ((($17)) + 4|0);
 $$field26 = HEAP32[$$index25>>2]|0;
 HEAP32[$18>>2] = 0;
 $$index29 = ((($18)) + 4|0);
 HEAP32[$$index29>>2] = 0;
 $53 = 13360;
 $54 = ((($18)) + 4|0);
 HEAP32[$18>>2] = $53;
 HEAP32[$54>>2] = $13;
 $$field31 = HEAP32[$18>>2]|0;
 $$index33 = ((($18)) + 4|0);
 $$field34 = HEAP32[$$index33>>2]|0;
 HEAP32[$19>>2] = 0;
 $$index37 = ((($19)) + 4|0);
 HEAP32[$$index37>>2] = 0;
 $55 = 13936;
 $56 = ((($19)) + 4|0);
 HEAP32[$19>>2] = $55;
 HEAP32[$56>>2] = $14;
 $$field39 = HEAP32[$19>>2]|0;
 $$index41 = ((($19)) + 4|0);
 $$field42 = HEAP32[$$index41>>2]|0;
 HEAP32[$20>>2] = 0;
 $$index45 = ((($20)) + 4|0);
 HEAP32[$$index45>>2] = 0;
 $57 = 13936;
 $58 = ((($20)) + 4|0);
 HEAP32[$20>>2] = $57;
 HEAP32[$58>>2] = $15;
 $$field47 = HEAP32[$20>>2]|0;
 $$index49 = ((($20)) + 4|0);
 $$field50 = HEAP32[$$index49>>2]|0;
 HEAP32[$21>>2] = 0;
 $$index53 = ((($21)) + 8|0);
 $59 = $$index53;
 $60 = $59;
 HEAP32[$60>>2] = 0;
 $61 = (($59) + 4)|0;
 $62 = $61;
 HEAP32[$62>>2] = 0;
 $$index54 = ((($21)) + 16|0);
 $63 = $$index54;
 $64 = $63;
 HEAP32[$64>>2] = 0;
 $65 = (($63) + 4)|0;
 $66 = $65;
 HEAP32[$66>>2] = 0;
 HEAP32[$22>>2] = 0;
 $$index55$index82 = ((($22)) + 4|0);
 HEAP32[$$index55$index82>>2] = 0;
 $$index56 = ((($22)) + 8|0);
 HEAP32[$$index56>>2] = 0;
 $$index56$index83 = ((($$index56)) + 4|0);
 HEAP32[$$index56$index83>>2] = 0;
 $$index57 = ((($22)) + 16|0);
 HEAP32[$$index57>>2] = 0;
 $$index57$index84 = ((($$index57)) + 4|0);
 HEAP32[$$index57$index84>>2] = 0;
 $$index58 = ((($22)) + 24|0);
 HEAP32[$$index58>>2] = 0;
 $$index58$index85 = ((($$index58)) + 4|0);
 HEAP32[$$index58$index85>>2] = 0;
 $$index59 = ((($22)) + 32|0);
 HEAP32[$$index59>>2] = 0;
 $$index59$index86 = ((($$index59)) + 4|0);
 HEAP32[$$index59$index86>>2] = 0;
 HEAP32[$22>>2] = $$field15;
 $$index61 = ((($22)) + 4|0);
 HEAP32[$$index61>>2] = $$field18;
 $67 = ((($22)) + 8|0);
 HEAP32[$67>>2] = $$field23;
 $$index63 = ((($67)) + 4|0);
 HEAP32[$$index63>>2] = $$field26;
 $68 = ((($22)) + 16|0);
 HEAP32[$68>>2] = $$field31;
 $$index65 = ((($68)) + 4|0);
 HEAP32[$$index65>>2] = $$field34;
 $69 = ((($22)) + 24|0);
 HEAP32[$69>>2] = $$field39;
 $$index67 = ((($69)) + 4|0);
 HEAP32[$$index67>>2] = $$field42;
 $70 = ((($22)) + 32|0);
 HEAP32[$70>>2] = $$field47;
 $$index69 = ((($70)) + 4|0);
 HEAP32[$$index69>>2] = $$field50;
 HEAP32[$21>>2] = $22;
 $71 = ((($21)) + 8|0);
 $72 = $71;
 $73 = $72;
 HEAP32[$73>>2] = 5;
 $74 = (($72) + 4)|0;
 $75 = $74;
 HEAP32[$75>>2] = 0;
 $76 = ((($21)) + 16|0);
 $77 = $76;
 $78 = $77;
 HEAP32[$78>>2] = 5;
 $79 = (($77) + 4)|0;
 $80 = $79;
 HEAP32[$80>>2] = 0;
 $$field71 = HEAP32[$21>>2]|0;
 $$index73 = ((($21)) + 8|0);
 $81 = $$index73;
 $82 = $81;
 $83 = HEAP32[$82>>2]|0;
 $84 = (($81) + 4)|0;
 $85 = $84;
 $86 = HEAP32[$85>>2]|0;
 $$index76 = ((($21)) + 16|0);
 $87 = $$index76;
 $88 = $87;
 $89 = HEAP32[$88>>2]|0;
 $90 = (($87) + 4)|0;
 $91 = $90;
 $92 = HEAP32[$91>>2]|0;
 HEAP32[$$ptr>>2] = 932;
 $$ptr$index79 = ((($$ptr)) + 8|0);
 $93 = $$ptr$index79;
 $94 = $93;
 HEAP32[$94>>2] = 45;
 $95 = (($93) + 4)|0;
 $96 = $95;
 HEAP32[$96>>2] = 0;
 HEAP32[$$ptr1>>2] = $$field71;
 $$ptr1$index80 = ((($$ptr1)) + 8|0);
 $97 = $$ptr1$index80;
 $98 = $97;
 HEAP32[$98>>2] = $83;
 $99 = (($97) + 4)|0;
 $100 = $99;
 HEAP32[$100>>2] = $86;
 $$ptr1$index81 = ((($$ptr1)) + 16|0);
 $101 = $$ptr1$index81;
 $102 = $101;
 HEAP32[$102>>2] = $89;
 $103 = (($101) + 4)|0;
 $104 = $103;
 HEAP32[$104>>2] = $92;
 (__fmt_4_fprintf($48,$$ptr,$$ptr1)|0);
 $105 = tempRet0;
 ____js_alert();
 STACKTOP = sp;return;
}
function ____mem_copy($dst,$src,$0,$1) {
 $dst = $dst|0;
 $src = $src|0;
 $0 = $0|0;
 $1 = $1|0;
 var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
 var label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0;
 $2 = sp + 16|0;
 $3 = sp + 8|0;
 $4 = sp;
 HEAP32[$2>>2] = 0;
 HEAP32[$2>>2] = $dst;
 HEAP32[$3>>2] = 0;
 HEAP32[$3>>2] = $src;
 $5 = $4;
 $6 = $5;
 HEAP32[$6>>2] = 0;
 $7 = (($5) + 4)|0;
 $8 = $7;
 HEAP32[$8>>2] = 0;
 $9 = $4;
 $10 = $9;
 HEAP32[$10>>2] = $0;
 $11 = (($9) + 4)|0;
 $12 = $11;
 HEAP32[$12>>2] = $1;
 $13 = HEAP32[$2>>2]|0;
 $14 = HEAP32[$3>>2]|0;
 $15 = $4;
 $16 = $15;
 $17 = HEAP32[$16>>2]|0;
 $18 = (($15) + 4)|0;
 $19 = $18;
 $20 = HEAP32[$19>>2]|0;
 _memmove(($13|0),($14|0),($17|0))|0;
 $21 = HEAP32[$2>>2]|0;
 STACKTOP = sp;return ($21|0);
}
function ____slice_append($slice_,$0,$1,$2,$3,$items,$4,$5) {
 $slice_ = $slice_|0;
 $0 = $0|0;
 $1 = $1|0;
 $2 = $2|0;
 $3 = $3|0;
 $items = $items|0;
 $4 = $4|0;
 $5 = $5|0;
 var $$expand_i1_val = 0, $$expand_i1_val5 = 0, $$ptr = 0, $$ptr$index3 = 0, $$ptr2 = 0, $$ptr2$index4 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
 var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
 var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
 var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0;
 var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
 var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
 var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0;
 var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0;
 var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond = 0, label = 0;
 var sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 96|0;
 $$ptr = sp + 72|0;
 $$ptr2 = sp + 56|0;
 $6 = sp + 48|0;
 $7 = sp + 40|0;
 $8 = sp + 32|0;
 $9 = sp + 24|0;
 $10 = sp + 16|0;
 $11 = sp + 8|0;
 $12 = sp;
 HEAP32[$6>>2] = 0;
 HEAP32[$6>>2] = $slice_;
 $13 = $7;
 $14 = $13;
 HEAP32[$14>>2] = 0;
 $15 = (($13) + 4)|0;
 $16 = $15;
 HEAP32[$16>>2] = 0;
 $17 = $7;
 $18 = $17;
 HEAP32[$18>>2] = $0;
 $19 = (($17) + 4)|0;
 $20 = $19;
 HEAP32[$20>>2] = $1;
 $21 = $8;
 $22 = $21;
 HEAP32[$22>>2] = 0;
 $23 = (($21) + 4)|0;
 $24 = $23;
 HEAP32[$24>>2] = 0;
 $25 = $8;
 $26 = $25;
 HEAP32[$26>>2] = $2;
 $27 = (($25) + 4)|0;
 $28 = $27;
 HEAP32[$28>>2] = $3;
 HEAP32[$9>>2] = 0;
 HEAP32[$9>>2] = $items;
 $29 = $10;
 $30 = $29;
 HEAP32[$30>>2] = 0;
 $31 = (($29) + 4)|0;
 $32 = $31;
 HEAP32[$32>>2] = 0;
 $33 = $10;
 $34 = $33;
 HEAP32[$34>>2] = $4;
 $35 = (($33) + 4)|0;
 $36 = $35;
 HEAP32[$36>>2] = $5;
 HEAP32[$11>>2] = 0;
 $37 = HEAP32[$6>>2]|0;
 HEAP32[$11>>2] = $37;
 $38 = $10;
 $39 = $38;
 $40 = HEAP32[$39>>2]|0;
 $41 = (($38) + 4)|0;
 $42 = $41;
 $43 = HEAP32[$42>>2]|0;
 $44 = ($43|0)<(0);
 $45 = ($40>>>0)<=(0);
 $46 = ($43|0)==(0);
 $47 = $46 & $45;
 $48 = $44 | $47;
 $49 = HEAP32[$9>>2]|0;
 $50 = ($49|0)==(0|0);
 $or$cond = $48 | $50;
 $51 = HEAP32[$11>>2]|0;
 if ($or$cond) {
  $52 = ((($51)) + 8|0);
  $53 = $52;
  $54 = $53;
  $55 = HEAP32[$54>>2]|0;
  $56 = (($53) + 4)|0;
  $57 = $56;
  $58 = HEAP32[$57>>2]|0;
  tempRet0 = ($58);
  STACKTOP = sp;return ($55|0);
 }
 $59 = ((($51)) + 16|0);
 $60 = $59;
 $61 = $60;
 $62 = HEAP32[$61>>2]|0;
 $63 = (($60) + 4)|0;
 $64 = $63;
 $65 = HEAP32[$64>>2]|0;
 $66 = HEAP32[$11>>2]|0;
 $67 = ((($66)) + 8|0);
 $68 = $67;
 $69 = $68;
 $70 = HEAP32[$69>>2]|0;
 $71 = (($68) + 4)|0;
 $72 = $71;
 $73 = HEAP32[$72>>2]|0;
 $74 = (_i64Subtract(($62|0),($65|0),($70|0),($73|0))|0);
 $75 = tempRet0;
 $76 = $10;
 $77 = $76;
 $78 = HEAP32[$77>>2]|0;
 $79 = (($76) + 4)|0;
 $80 = $79;
 $81 = HEAP32[$80>>2]|0;
 $82 = ($75|0)<($81|0);
 $83 = ($74>>>0)<($78>>>0);
 $84 = ($75|0)==($81|0);
 $85 = $84 & $83;
 $86 = $82 | $85;
 $87 = $86 ? $74 : $78;
 $88 = $86 ? $75 : $81;
 $89 = $10;
 $90 = $89;
 HEAP32[$90>>2] = $87;
 $91 = (($89) + 4)|0;
 $92 = $91;
 HEAP32[$92>>2] = $88;
 $93 = $10;
 $94 = $93;
 $95 = HEAP32[$94>>2]|0;
 $96 = (($93) + 4)|0;
 $97 = $96;
 $98 = HEAP32[$97>>2]|0;
 $99 = ($98|0)>(0);
 $100 = ($95>>>0)>(0);
 $101 = ($98|0)==(0);
 $102 = $101 & $100;
 $103 = $99 | $102;
 if (!($103)) {
  $170 = HEAP32[$11>>2]|0;
  $171 = ((($170)) + 8|0);
  $172 = $171;
  $173 = $172;
  $174 = HEAP32[$173>>2]|0;
  $175 = (($172) + 4)|0;
  $176 = $175;
  $177 = HEAP32[$176>>2]|0;
  tempRet0 = ($177);
  STACKTOP = sp;return ($174|0);
 }
 HEAP32[$12>>2] = 0;
 $104 = HEAP32[$11>>2]|0;
 $105 = HEAP32[$104>>2]|0;
 HEAP32[$12>>2] = $105;
 $106 = HEAP32[$12>>2]|0;
 $107 = ($106|0)!=(0|0);
 $$expand_i1_val = $107&1;
 $$expand_i1_val5 = 0;
 $108 = ($$expand_i1_val<<24>>24)==($$expand_i1_val5<<24>>24);
 if ($108) {
  HEAP32[$$ptr>>2] = 977;
  $$ptr$index3 = ((($$ptr)) + 8|0);
  $109 = $$ptr$index3;
  $110 = $109;
  HEAP32[$110>>2] = 57;
  $111 = (($109) + 4)|0;
  $112 = $111;
  HEAP32[$112>>2] = 0;
  HEAP32[$$ptr2>>2] = 31340;
  $$ptr2$index4 = ((($$ptr2)) + 8|0);
  $113 = $$ptr2$index4;
  $114 = $113;
  HEAP32[$114>>2] = 11;
  $115 = (($113) + 4)|0;
  $116 = $115;
  HEAP32[$116>>2] = 0;
  ____assert($$ptr,535,0,10,0,$$ptr2);
 }
 $117 = HEAP32[$12>>2]|0;
 $118 = $7;
 $119 = $118;
 $120 = HEAP32[$119>>2]|0;
 $121 = (($118) + 4)|0;
 $122 = $121;
 $123 = HEAP32[$122>>2]|0;
 $124 = HEAP32[$11>>2]|0;
 $125 = ((($124)) + 8|0);
 $126 = $125;
 $127 = $126;
 $128 = HEAP32[$127>>2]|0;
 $129 = (($126) + 4)|0;
 $130 = $129;
 $131 = HEAP32[$130>>2]|0;
 $132 = (___muldi3(($120|0),($123|0),($128|0),($131|0))|0);
 $133 = tempRet0;
 $134 = (($117) + ($132)|0);
 $135 = HEAP32[$9>>2]|0;
 $136 = $7;
 $137 = $136;
 $138 = HEAP32[$137>>2]|0;
 $139 = (($136) + 4)|0;
 $140 = $139;
 $141 = HEAP32[$140>>2]|0;
 $142 = $10;
 $143 = $142;
 $144 = HEAP32[$143>>2]|0;
 $145 = (($142) + 4)|0;
 $146 = $145;
 $147 = HEAP32[$146>>2]|0;
 $148 = (___muldi3(($138|0),($141|0),($144|0),($147|0))|0);
 $149 = tempRet0;
 (____mem_copy($134,$135,$148,$149)|0);
 $150 = HEAP32[$11>>2]|0;
 $151 = ((($150)) + 8|0);
 $152 = $10;
 $153 = $152;
 $154 = HEAP32[$153>>2]|0;
 $155 = (($152) + 4)|0;
 $156 = $155;
 $157 = HEAP32[$156>>2]|0;
 $158 = $151;
 $159 = $158;
 $160 = HEAP32[$159>>2]|0;
 $161 = (($158) + 4)|0;
 $162 = $161;
 $163 = HEAP32[$162>>2]|0;
 $164 = (_i64Add(($160|0),($163|0),($154|0),($157|0))|0);
 $165 = tempRet0;
 $166 = $151;
 $167 = $166;
 HEAP32[$167>>2] = $164;
 $168 = (($166) + 4)|0;
 $169 = $168;
 HEAP32[$169>>2] = $165;
 $170 = HEAP32[$11>>2]|0;
 $171 = ((($170)) + 8|0);
 $172 = $171;
 $173 = $172;
 $174 = HEAP32[$173>>2]|0;
 $175 = (($172) + 4)|0;
 $176 = $175;
 $177 = HEAP32[$176>>2]|0;
 tempRet0 = ($177);
 STACKTOP = sp;return ($174|0);
}
function _main() {
 var $$field11 = 0, $$field14 = 0, $$field23 = 0, $$index1 = 0, $$index13 = 0, $$index17 = 0, $$index18 = 0, $$index19$index33 = 0, $$index21 = 0, $$index25 = 0, $$index28 = 0, $$index3 = 0, $$index9 = 0, $$ptr = 0, $$ptr$index31 = 0, $$ptr$index32 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0;
 var $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
 var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
 var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 80|0;
 $$ptr = sp + 56|0;
 $0 = sp + 40|0;
 $1 = sp + 32|0;
 $2 = sp + 8|0;
 $3 = sp;
 _____startup_runtime();
 HEAP32[$0>>2] = 0;
 $$index1 = ((($0)) + 8|0);
 $4 = $$index1;
 $5 = $4;
 HEAP32[$5>>2] = 0;
 $6 = (($4) + 4)|0;
 $7 = $6;
 HEAP32[$7>>2] = 0;
 HEAP32[$0>>2] = 1034;
 $$index3 = ((($0)) + 8|0);
 $8 = $$index3;
 $9 = $8;
 HEAP32[$9>>2] = 23;
 $10 = (($8) + 4)|0;
 $11 = $10;
 HEAP32[$11>>2] = 0;
 HEAP32[$1>>2] = 0;
 $$index9 = ((($1)) + 4|0);
 HEAP32[$$index9>>2] = 0;
 $12 = 13504;
 $13 = ((($1)) + 4|0);
 HEAP32[$1>>2] = $12;
 HEAP32[$13>>2] = $0;
 $$field11 = HEAP32[$1>>2]|0;
 $$index13 = ((($1)) + 4|0);
 $$field14 = HEAP32[$$index13>>2]|0;
 HEAP32[$2>>2] = 0;
 $$index17 = ((($2)) + 8|0);
 $14 = $$index17;
 $15 = $14;
 HEAP32[$15>>2] = 0;
 $16 = (($14) + 4)|0;
 $17 = $16;
 HEAP32[$17>>2] = 0;
 $$index18 = ((($2)) + 16|0);
 $18 = $$index18;
 $19 = $18;
 HEAP32[$19>>2] = 0;
 $20 = (($18) + 4)|0;
 $21 = $20;
 HEAP32[$21>>2] = 0;
 HEAP32[$3>>2] = 0;
 $$index19$index33 = ((($3)) + 4|0);
 HEAP32[$$index19$index33>>2] = 0;
 HEAP32[$3>>2] = $$field11;
 $$index21 = ((($3)) + 4|0);
 HEAP32[$$index21>>2] = $$field14;
 HEAP32[$2>>2] = $3;
 $22 = ((($2)) + 8|0);
 $23 = $22;
 $24 = $23;
 HEAP32[$24>>2] = 1;
 $25 = (($23) + 4)|0;
 $26 = $25;
 HEAP32[$26>>2] = 0;
 $27 = ((($2)) + 16|0);
 $28 = $27;
 $29 = $28;
 HEAP32[$29>>2] = 1;
 $30 = (($28) + 4)|0;
 $31 = $30;
 HEAP32[$31>>2] = 0;
 $$field23 = HEAP32[$2>>2]|0;
 $$index25 = ((($2)) + 8|0);
 $32 = $$index25;
 $33 = $32;
 $34 = HEAP32[$33>>2]|0;
 $35 = (($32) + 4)|0;
 $36 = $35;
 $37 = HEAP32[$36>>2]|0;
 $$index28 = ((($2)) + 16|0);
 $38 = $$index28;
 $39 = $38;
 $40 = HEAP32[$39>>2]|0;
 $41 = (($38) + 4)|0;
 $42 = $41;
 $43 = HEAP32[$42>>2]|0;
 HEAP32[$$ptr>>2] = $$field23;
 $$ptr$index31 = ((($$ptr)) + 8|0);
 $44 = $$ptr$index31;
 $45 = $44;
 HEAP32[$45>>2] = $34;
 $46 = (($44) + 4)|0;
 $47 = $46;
 HEAP32[$47>>2] = $37;
 $$ptr$index32 = ((($$ptr)) + 16|0);
 $48 = $$ptr$index32;
 $49 = $48;
 HEAP32[$49>>2] = $40;
 $50 = (($48) + 4)|0;
 $51 = $50;
 HEAP32[$51>>2] = $43;
 (__fmt_4_println($$ptr)|0);
 $52 = tempRet0;
 STACKTOP = sp;return;
}
function __fmt_4_write_string($buf,$s$ptr) {
 $buf = $buf|0;
 $s$ptr = $s$ptr|0;
 var $$field = 0, $$field15 = 0, $$index12 = 0, $$index13 = 0, $$index17 = 0, $$index4 = 0, $$index6 = 0, $$index8 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
 var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
 var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $6 = 0;
 var $7 = 0, $8 = 0, $9 = 0, $s$sreg$field = 0, $s$sreg$index1 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 64|0;
 $s$sreg$field = HEAP32[$s$ptr>>2]|0;
 $s$sreg$index1 = ((($s$ptr)) + 8|0);
 $0 = $s$sreg$index1;
 $1 = $0;
 $2 = HEAP32[$1>>2]|0;
 $3 = (($0) + 4)|0;
 $4 = $3;
 $5 = HEAP32[$4>>2]|0;
 $6 = sp + 48|0;
 $7 = sp + 32|0;
 $8 = sp + 24|0;
 $9 = sp;
 HEAP32[$6>>2] = 0;
 HEAP32[$6>>2] = $buf;
 HEAP32[$7>>2] = 0;
 $$index4 = ((($7)) + 8|0);
 $10 = $$index4;
 $11 = $10;
 HEAP32[$11>>2] = 0;
 $12 = (($10) + 4)|0;
 $13 = $12;
 HEAP32[$13>>2] = 0;
 HEAP32[$7>>2] = $s$sreg$field;
 $$index6 = ((($7)) + 8|0);
 $14 = $$index6;
 $15 = $14;
 HEAP32[$15>>2] = $2;
 $16 = (($14) + 4)|0;
 $17 = $16;
 HEAP32[$17>>2] = $5;
 $18 = HEAP32[$6>>2]|0;
 $$field = HEAP32[$7>>2]|0;
 $$index8 = ((($7)) + 8|0);
 $19 = $$index8;
 $20 = $19;
 $21 = HEAP32[$20>>2]|0;
 $22 = (($19) + 4)|0;
 $23 = $22;
 $24 = HEAP32[$23>>2]|0;
 HEAP32[$8>>2] = 0;
 HEAP32[$8>>2] = $$field;
 $25 = (_i64Subtract(($21|0),($24|0),0,0)|0);
 $26 = tempRet0;
 $27 = (_i64Subtract(($21|0),($24|0),0,0)|0);
 $28 = tempRet0;
 $29 = HEAP32[$8>>2]|0;
 HEAP32[$9>>2] = 0;
 $$index12 = ((($9)) + 8|0);
 $30 = $$index12;
 $31 = $30;
 HEAP32[$31>>2] = 0;
 $32 = (($30) + 4)|0;
 $33 = $32;
 HEAP32[$33>>2] = 0;
 $$index13 = ((($9)) + 16|0);
 $34 = $$index13;
 $35 = $34;
 HEAP32[$35>>2] = 0;
 $36 = (($34) + 4)|0;
 $37 = $36;
 HEAP32[$37>>2] = 0;
 HEAP32[$9>>2] = $29;
 $38 = ((($9)) + 8|0);
 $39 = $38;
 $40 = $39;
 HEAP32[$40>>2] = $25;
 $41 = (($39) + 4)|0;
 $42 = $41;
 HEAP32[$42>>2] = $26;
 $43 = ((($9)) + 16|0);
 $44 = $43;
 $45 = $44;
 HEAP32[$45>>2] = $27;
 $46 = (($44) + 4)|0;
 $47 = $46;
 HEAP32[$47>>2] = $28;
 $$field15 = HEAP32[$9>>2]|0;
 $$index17 = ((($9)) + 8|0);
 $48 = $$index17;
 $49 = $48;
 $50 = HEAP32[$49>>2]|0;
 $51 = (($48) + 4)|0;
 $52 = $51;
 $53 = HEAP32[$52>>2]|0;
 (____slice_append($18,1,0,1,0,$$field15,$50,$53)|0);
 $54 = tempRet0;
 STACKTOP = sp;return;
}
function __fmt_4_write_byte($buf,$b) {
 $buf = $buf|0;
 $b = $b|0;
 var $$field = 0, $$index1 = 0, $$index2 = 0, $$index5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
 var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 32|0;
 $0 = sp + 24|0;
 $1 = sp + 29|0;
 $2 = sp;
 $3 = sp + 28|0;
 HEAP32[$0>>2] = 0;
 HEAP32[$0>>2] = $buf;
 HEAP8[$1>>0] = 0;
 HEAP8[$1>>0] = $b;
 $4 = HEAP32[$0>>2]|0;
 $5 = HEAP8[$1>>0]|0;
 HEAP32[$2>>2] = 0;
 $$index1 = ((($2)) + 8|0);
 $6 = $$index1;
 $7 = $6;
 HEAP32[$7>>2] = 0;
 $8 = (($6) + 4)|0;
 $9 = $8;
 HEAP32[$9>>2] = 0;
 $$index2 = ((($2)) + 16|0);
 $10 = $$index2;
 $11 = $10;
 HEAP32[$11>>2] = 0;
 $12 = (($10) + 4)|0;
 $13 = $12;
 HEAP32[$13>>2] = 0;
 HEAP8[$3>>0] = 0;
 HEAP8[$3>>0] = $5;
 HEAP32[$2>>2] = $3;
 $14 = ((($2)) + 8|0);
 $15 = $14;
 $16 = $15;
 HEAP32[$16>>2] = 1;
 $17 = (($15) + 4)|0;
 $18 = $17;
 HEAP32[$18>>2] = 0;
 $19 = ((($2)) + 16|0);
 $20 = $19;
 $21 = $20;
 HEAP32[$21>>2] = 1;
 $22 = (($20) + 4)|0;
 $23 = $22;
 HEAP32[$23>>2] = 0;
 $$field = HEAP32[$2>>2]|0;
 $$index5 = ((($2)) + 8|0);
 $24 = $$index5;
 $25 = $24;
 $26 = HEAP32[$25>>2]|0;
 $27 = (($24) + 4)|0;
 $28 = $27;
 $29 = HEAP32[$28>>2]|0;
 (____slice_append($4,1,0,1,0,$$field,$26,$29)|0);
 $30 = tempRet0;
 STACKTOP = sp;return;
}
function __fmt_4_write_rune($buf,$r) {
 $buf = $buf|0;
 $r = $r|0;
 var $$field26 = 0, $$index1 = 0, $$index10 = 0, $$index10$index52 = 0, $$index10$index53 = 0, $$index10$index54 = 0, $$index2 = 0, $$index23 = 0, $$index24 = 0, $$index28 = 0, $$index3 = 0, $$index7$index43 = 0, $$index7$index44 = 0, $$index7$index45 = 0, $$index8 = 0, $$index8$index46 = 0, $$index8$index47 = 0, $$index8$index48 = 0, $$index9 = 0, $$index9$index49 = 0;
 var $$index9$index50 = 0, $$index9$index51 = 0, $$ptr = 0, $$ptr$index21 = 0, $$sreg$field$field = 0, $$sreg$field$field35 = 0, $$sreg$field$field38 = 0, $$sreg$field$field41 = 0, $$sreg$field$index34 = 0, $$sreg$field$index37 = 0, $$sreg$field$index40 = 0, $$sreg$index4 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
 var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
 var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
 var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 80|0;
 $$ptr = sp + 56|0;
 $0 = sp;
 $1 = sp + 48|0;
 $2 = sp + 72|0;
 $3 = sp + 76|0;
 $4 = sp + 40|0;
 $5 = sp + 16|0;
 HEAP32[$1>>2] = 0;
 HEAP32[$1>>2] = $buf;
 HEAP32[$2>>2] = 0;
 HEAP32[$2>>2] = $r;
 $6 = HEAP32[$2>>2]|0;
 $7 = ($6|0)<(128);
 if ($7) {
  $8 = HEAP32[$1>>2]|0;
  $9 = HEAP32[$2>>2]|0;
  $10 = $9&255;
  __fmt_4_write_byte($8,$10);
  STACKTOP = sp;return;
 } else {
  HEAP8[$3>>0] = 0;
  $$index1 = ((($3)) + 1|0);
  HEAP8[$$index1>>0] = 0;
  $$index2 = ((($3)) + 2|0);
  HEAP8[$$index2>>0] = 0;
  $$index3 = ((($3)) + 3|0);
  HEAP8[$$index3>>0] = 0;
  $11 = $4;
  $12 = $11;
  HEAP32[$12>>2] = 0;
  $13 = (($11) + 4)|0;
  $14 = $13;
  HEAP32[$14>>2] = 0;
  $15 = HEAP32[$2>>2]|0;
  __utf8_5_encode_rune($0,$15);
  $$sreg$field$field = HEAP8[$0>>0]|0;
  $$sreg$field$index34 = ((($0)) + 1|0);
  $$sreg$field$field35 = HEAP8[$$sreg$field$index34>>0]|0;
  $$sreg$field$index37 = ((($0)) + 2|0);
  $$sreg$field$field38 = HEAP8[$$sreg$field$index37>>0]|0;
  $$sreg$field$index40 = ((($0)) + 3|0);
  $$sreg$field$field41 = HEAP8[$$sreg$field$index40>>0]|0;
  $$sreg$index4 = ((($0)) + 8|0);
  $16 = $$sreg$index4;
  $17 = $16;
  $18 = HEAP32[$17>>2]|0;
  $19 = (($16) + 4)|0;
  $20 = $19;
  $21 = HEAP32[$20>>2]|0;
  HEAP8[$3>>0] = $$sreg$field$field;
  $$index7$index43 = ((($3)) + 1|0);
  HEAP8[$$index7$index43>>0] = $$sreg$field$field35;
  $$index7$index44 = ((($3)) + 2|0);
  HEAP8[$$index7$index44>>0] = $$sreg$field$field38;
  $$index7$index45 = ((($3)) + 3|0);
  HEAP8[$$index7$index45>>0] = $$sreg$field$field41;
  $$index8 = ((($3)) + 1|0);
  HEAP8[$$index8>>0] = $$sreg$field$field;
  $$index8$index46 = ((($$index8)) + 1|0);
  HEAP8[$$index8$index46>>0] = $$sreg$field$field35;
  $$index8$index47 = ((($$index8)) + 2|0);
  HEAP8[$$index8$index47>>0] = $$sreg$field$field38;
  $$index8$index48 = ((($$index8)) + 3|0);
  HEAP8[$$index8$index48>>0] = $$sreg$field$field41;
  $$index9 = ((($3)) + 2|0);
  HEAP8[$$index9>>0] = $$sreg$field$field;
  $$index9$index49 = ((($$index9)) + 1|0);
  HEAP8[$$index9$index49>>0] = $$sreg$field$field35;
  $$index9$index50 = ((($$index9)) + 2|0);
  HEAP8[$$index9$index50>>0] = $$sreg$field$field38;
  $$index9$index51 = ((($$index9)) + 3|0);
  HEAP8[$$index9$index51>>0] = $$sreg$field$field41;
  $$index10 = ((($3)) + 3|0);
  HEAP8[$$index10>>0] = $$sreg$field$field;
  $$index10$index52 = ((($$index10)) + 1|0);
  HEAP8[$$index10$index52>>0] = $$sreg$field$field35;
  $$index10$index53 = ((($$index10)) + 2|0);
  HEAP8[$$index10$index53>>0] = $$sreg$field$field38;
  $$index10$index54 = ((($$index10)) + 3|0);
  HEAP8[$$index10$index54>>0] = $$sreg$field$field41;
  $22 = $4;
  $23 = $22;
  HEAP32[$23>>2] = $18;
  $24 = (($22) + 4)|0;
  $25 = $24;
  HEAP32[$25>>2] = $21;
  $26 = HEAP32[$1>>2]|0;
  $27 = $4;
  $28 = $27;
  $29 = HEAP32[$28>>2]|0;
  $30 = (($27) + 4)|0;
  $31 = $30;
  $32 = HEAP32[$31>>2]|0;
  HEAP32[$$ptr>>2] = 1057;
  $$ptr$index21 = ((($$ptr)) + 8|0);
  $33 = $$ptr$index21;
  $34 = $33;
  HEAP32[$34>>2] = 52;
  $35 = (($33) + 4)|0;
  $36 = $35;
  HEAP32[$36>>2] = 0;
  ____slice_expr_error($$ptr,24,0,17,0,0,0,$29,$32,4,0);
  $37 = (_i64Subtract(($29|0),($32|0),0,0)|0);
  $38 = tempRet0;
  $39 = (_i64Subtract(4,0,0,0)|0);
  $40 = tempRet0;
  HEAP32[$5>>2] = 0;
  $$index23 = ((($5)) + 8|0);
  $41 = $$index23;
  $42 = $41;
  HEAP32[$42>>2] = 0;
  $43 = (($41) + 4)|0;
  $44 = $43;
  HEAP32[$44>>2] = 0;
  $$index24 = ((($5)) + 16|0);
  $45 = $$index24;
  $46 = $45;
  HEAP32[$46>>2] = 0;
  $47 = (($45) + 4)|0;
  $48 = $47;
  HEAP32[$48>>2] = 0;
  HEAP32[$5>>2] = $3;
  $49 = ((($5)) + 8|0);
  $50 = $49;
  $51 = $50;
  HEAP32[$51>>2] = $37;
  $52 = (($50) + 4)|0;
  $53 = $52;
  HEAP32[$53>>2] = $38;
  $54 = ((($5)) + 16|0);
  $55 = $54;
  $56 = $55;
  HEAP32[$56>>2] = $39;
  $57 = (($55) + 4)|0;
  $58 = $57;
  HEAP32[$58>>2] = $40;
  $$field26 = HEAP32[$5>>2]|0;
  $$index28 = ((($5)) + 8|0);
  $59 = $$index28;
  $60 = $59;
  $61 = HEAP32[$60>>2]|0;
  $62 = (($59) + 4)|0;
  $63 = $62;
  $64 = HEAP32[$63>>2]|0;
  (____slice_append($26,1,0,1,0,$$field26,$61,$64)|0);
  $65 = tempRet0;
  STACKTOP = sp;return;
 }
}
function __fmt_4_fprintln($fd,$args$ptr) {
 $fd = $fd|0;
 $args$ptr = $args$ptr|0;
 var $$field16405 = 0, $$field16417 = 0, $$field16437 = 0, $$field16450 = 0, $$index10 = 0, $$index100 = 0, $$index1000 = 0, $$index1001 = 0, $$index1002 = 0, $$index1003 = 0, $$index1004 = 0, $$index1005 = 0, $$index1006 = 0, $$index1007 = 0, $$index1008 = 0, $$index1009 = 0, $$index101 = 0, $$index1010 = 0, $$index1011 = 0, $$index1012 = 0;
 var $$index1013 = 0, $$index1014 = 0, $$index1015 = 0, $$index1016 = 0, $$index1017 = 0, $$index1018 = 0, $$index1019 = 0, $$index102 = 0, $$index1020 = 0, $$index1021 = 0, $$index1022 = 0, $$index1023 = 0, $$index1024 = 0, $$index1025 = 0, $$index1026 = 0, $$index1027 = 0, $$index1028 = 0, $$index1029 = 0, $$index103 = 0, $$index1030 = 0;
 var $$index1031 = 0, $$index1032 = 0, $$index1033 = 0, $$index1034 = 0, $$index1035 = 0, $$index1036 = 0, $$index1037 = 0, $$index1038 = 0, $$index1039 = 0, $$index104 = 0, $$index1040 = 0, $$index1041 = 0, $$index1042 = 0, $$index1043 = 0, $$index1044 = 0, $$index1045 = 0, $$index1046 = 0, $$index1047 = 0, $$index1048 = 0, $$index1049 = 0;
 var $$index105 = 0, $$index1050 = 0, $$index1051 = 0, $$index1052 = 0, $$index1053 = 0, $$index1054 = 0, $$index1055 = 0, $$index1056 = 0, $$index1057 = 0, $$index1058 = 0, $$index1059 = 0, $$index106 = 0, $$index1060 = 0, $$index1061 = 0, $$index1062 = 0, $$index1063 = 0, $$index1064 = 0, $$index1065 = 0, $$index1066 = 0, $$index1067 = 0;
 var $$index1068 = 0, $$index1069 = 0, $$index107 = 0, $$index1070 = 0, $$index1071 = 0, $$index1072 = 0, $$index1073 = 0, $$index1074 = 0, $$index1075 = 0, $$index1076 = 0, $$index1077 = 0, $$index1078 = 0, $$index1079 = 0, $$index108 = 0, $$index1080 = 0, $$index1081 = 0, $$index1082 = 0, $$index1083 = 0, $$index1084 = 0, $$index1085 = 0;
 var $$index1086 = 0, $$index1087 = 0, $$index1088 = 0, $$index1089 = 0, $$index109 = 0, $$index1090 = 0, $$index1091 = 0, $$index1092 = 0, $$index1093 = 0, $$index1094 = 0, $$index1095 = 0, $$index1096 = 0, $$index1097 = 0, $$index1098 = 0, $$index1099 = 0, $$index11 = 0, $$index110 = 0, $$index1100 = 0, $$index1101 = 0, $$index1102 = 0;
 var $$index1103 = 0, $$index1104 = 0, $$index1105 = 0, $$index1106 = 0, $$index1107 = 0, $$index1108 = 0, $$index1109 = 0, $$index111 = 0, $$index1110 = 0, $$index1111 = 0, $$index1112 = 0, $$index1113 = 0, $$index1114 = 0, $$index1115 = 0, $$index1116 = 0, $$index1117 = 0, $$index1118 = 0, $$index1119 = 0, $$index112 = 0, $$index1120 = 0;
 var $$index1121 = 0, $$index1122 = 0, $$index1123 = 0, $$index1124 = 0, $$index1125 = 0, $$index1126 = 0, $$index1127 = 0, $$index1128 = 0, $$index1129 = 0, $$index113 = 0, $$index1130 = 0, $$index1131 = 0, $$index1132 = 0, $$index1133 = 0, $$index1134 = 0, $$index1135 = 0, $$index1136 = 0, $$index1137 = 0, $$index1138 = 0, $$index1139 = 0;
 var $$index114 = 0, $$index1140 = 0, $$index1141 = 0, $$index1142 = 0, $$index1143 = 0, $$index1144 = 0, $$index1145 = 0, $$index1146 = 0, $$index1147 = 0, $$index1148 = 0, $$index1149 = 0, $$index115 = 0, $$index1150 = 0, $$index1151 = 0, $$index1152 = 0, $$index1153 = 0, $$index1154 = 0, $$index1155 = 0, $$index1156 = 0, $$index1157 = 0;
 var $$index1158 = 0, $$index1159 = 0, $$index116 = 0, $$index1160 = 0, $$index1161 = 0, $$index1162 = 0, $$index1163 = 0, $$index1164 = 0, $$index1165 = 0, $$index1166 = 0, $$index1167 = 0, $$index1168 = 0, $$index1169 = 0, $$index117 = 0, $$index1170 = 0, $$index1171 = 0, $$index1172 = 0, $$index1173 = 0, $$index1174 = 0, $$index1175 = 0;
 var $$index1176 = 0, $$index1177 = 0, $$index1178 = 0, $$index1179 = 0, $$index118 = 0, $$index1180 = 0, $$index1181 = 0, $$index1182 = 0, $$index1183 = 0, $$index1184 = 0, $$index1185 = 0, $$index1186 = 0, $$index1187 = 0, $$index1188 = 0, $$index1189 = 0, $$index119 = 0, $$index1190 = 0, $$index1191 = 0, $$index1192 = 0, $$index1193 = 0;
 var $$index1194 = 0, $$index1195 = 0, $$index1196 = 0, $$index1197 = 0, $$index1198 = 0, $$index1199 = 0, $$index120 = 0, $$index1200 = 0, $$index1201 = 0, $$index1202 = 0, $$index1203 = 0, $$index1204 = 0, $$index1205 = 0, $$index1206 = 0, $$index1207 = 0, $$index1208 = 0, $$index1209 = 0, $$index121 = 0, $$index1210 = 0, $$index1211 = 0;
 var $$index1212 = 0, $$index1213 = 0, $$index1214 = 0, $$index1215 = 0, $$index1216 = 0, $$index1217 = 0, $$index1218 = 0, $$index1219 = 0, $$index122 = 0, $$index1220 = 0, $$index1221 = 0, $$index1222 = 0, $$index1223 = 0, $$index1224 = 0, $$index1225 = 0, $$index1226 = 0, $$index1227 = 0, $$index1228 = 0, $$index1229 = 0, $$index123 = 0;
 var $$index1230 = 0, $$index1231 = 0, $$index1232 = 0, $$index1233 = 0, $$index1234 = 0, $$index1235 = 0, $$index1236 = 0, $$index1237 = 0, $$index1238 = 0, $$index1239 = 0, $$index124 = 0, $$index1240 = 0, $$index1241 = 0, $$index1242 = 0, $$index1243 = 0, $$index1244 = 0, $$index1245 = 0, $$index1246 = 0, $$index1247 = 0, $$index1248 = 0;
 var $$index1249 = 0, $$index125 = 0, $$index1250 = 0, $$index1251 = 0, $$index1252 = 0, $$index1253 = 0, $$index1254 = 0, $$index1255 = 0, $$index1256 = 0, $$index1257 = 0, $$index1258 = 0, $$index1259 = 0, $$index126 = 0, $$index1260 = 0, $$index1261 = 0, $$index1262 = 0, $$index1263 = 0, $$index1264 = 0, $$index1265 = 0, $$index1266 = 0;
 var $$index1267 = 0, $$index1268 = 0, $$index1269 = 0, $$index127 = 0, $$index1270 = 0, $$index1271 = 0, $$index1272 = 0, $$index1273 = 0, $$index1274 = 0, $$index1275 = 0, $$index1276 = 0, $$index1277 = 0, $$index1278 = 0, $$index1279 = 0, $$index128 = 0, $$index1280 = 0, $$index1281 = 0, $$index1282 = 0, $$index1283 = 0, $$index1284 = 0;
 var $$index1285 = 0, $$index1286 = 0, $$index1287 = 0, $$index1288 = 0, $$index1289 = 0, $$index129 = 0, $$index1290 = 0, $$index1291 = 0, $$index1292 = 0, $$index1293 = 0, $$index1294 = 0, $$index1295 = 0, $$index1296 = 0, $$index1297 = 0, $$index1298 = 0, $$index1299 = 0, $$index13 = 0, $$index130 = 0, $$index1300 = 0, $$index1301 = 0;
 var $$index1302 = 0, $$index1303 = 0, $$index1304 = 0, $$index1305 = 0, $$index1306 = 0, $$index1307 = 0, $$index1308 = 0, $$index1309 = 0, $$index131 = 0, $$index1310 = 0, $$index1311 = 0, $$index1312 = 0, $$index1313 = 0, $$index1314 = 0, $$index1315 = 0, $$index1316 = 0, $$index1317 = 0, $$index1318 = 0, $$index1319 = 0, $$index132 = 0;
 var $$index1320 = 0, $$index1321 = 0, $$index1322 = 0, $$index1323 = 0, $$index1324 = 0, $$index1325 = 0, $$index1326 = 0, $$index1327 = 0, $$index1328 = 0, $$index1329 = 0, $$index133 = 0, $$index1330 = 0, $$index1331 = 0, $$index1332 = 0, $$index1333 = 0, $$index1334 = 0, $$index1335 = 0, $$index1336 = 0, $$index1337 = 0, $$index1338 = 0;
 var $$index1339 = 0, $$index134 = 0, $$index1340 = 0, $$index1341 = 0, $$index1342 = 0, $$index1343 = 0, $$index1344 = 0, $$index1345 = 0, $$index1346 = 0, $$index1347 = 0, $$index1348 = 0, $$index1349 = 0, $$index135 = 0, $$index1350 = 0, $$index1351 = 0, $$index1352 = 0, $$index1353 = 0, $$index1354 = 0, $$index1355 = 0, $$index1356 = 0;
 var $$index1357 = 0, $$index1358 = 0, $$index1359 = 0, $$index136 = 0, $$index1360 = 0, $$index1361 = 0, $$index1362 = 0, $$index1363 = 0, $$index1364 = 0, $$index1365 = 0, $$index1366 = 0, $$index1367 = 0, $$index1368 = 0, $$index1369 = 0, $$index137 = 0, $$index1370 = 0, $$index1371 = 0, $$index1372 = 0, $$index1373 = 0, $$index1374 = 0;
 var $$index1375 = 0, $$index1376 = 0, $$index1377 = 0, $$index1378 = 0, $$index1379 = 0, $$index138 = 0, $$index1380 = 0, $$index1381 = 0, $$index1382 = 0, $$index1383 = 0, $$index1384 = 0, $$index1385 = 0, $$index1386 = 0, $$index1387 = 0, $$index1388 = 0, $$index1389 = 0, $$index139 = 0, $$index1390 = 0, $$index1391 = 0, $$index1392 = 0;
 var $$index1393 = 0, $$index1394 = 0, $$index1395 = 0, $$index1396 = 0, $$index1397 = 0, $$index1398 = 0, $$index1399 = 0, $$index14 = 0, $$index140 = 0, $$index1400 = 0, $$index1401 = 0, $$index1402 = 0, $$index1403 = 0, $$index1404 = 0, $$index1405 = 0, $$index1406 = 0, $$index1407 = 0, $$index1408 = 0, $$index1409 = 0, $$index141 = 0;
 var $$index1410 = 0, $$index1411 = 0, $$index1412 = 0, $$index1413 = 0, $$index1414 = 0, $$index1415 = 0, $$index1416 = 0, $$index1417 = 0, $$index1418 = 0, $$index1419 = 0, $$index142 = 0, $$index1420 = 0, $$index1421 = 0, $$index1422 = 0, $$index1423 = 0, $$index1424 = 0, $$index1425 = 0, $$index1426 = 0, $$index1427 = 0, $$index1428 = 0;
 var $$index1429 = 0, $$index143 = 0, $$index1430 = 0, $$index1431 = 0, $$index1432 = 0, $$index1433 = 0, $$index1434 = 0, $$index1435 = 0, $$index1436 = 0, $$index1437 = 0, $$index1438 = 0, $$index1439 = 0, $$index144 = 0, $$index1440 = 0, $$index1441 = 0, $$index1442 = 0, $$index1443 = 0, $$index1444 = 0, $$index1445 = 0, $$index1446 = 0;
 var $$index1447 = 0, $$index1448 = 0, $$index1449 = 0, $$index145 = 0, $$index1450 = 0, $$index1451 = 0, $$index1452 = 0, $$index1453 = 0, $$index1454 = 0, $$index1455 = 0, $$index1456 = 0, $$index1457 = 0, $$index1458 = 0, $$index1459 = 0, $$index146 = 0, $$index1460 = 0, $$index1461 = 0, $$index1462 = 0, $$index1463 = 0, $$index1464 = 0;
 var $$index1465 = 0, $$index1466 = 0, $$index1467 = 0, $$index1468 = 0, $$index1469 = 0, $$index147 = 0, $$index1470 = 0, $$index1471 = 0, $$index1472 = 0, $$index1473 = 0, $$index1474 = 0, $$index1475 = 0, $$index1476 = 0, $$index1477 = 0, $$index1478 = 0, $$index1479 = 0, $$index148 = 0, $$index1480 = 0, $$index1481 = 0, $$index1482 = 0;
 var $$index1483 = 0, $$index1484 = 0, $$index1485 = 0, $$index1486 = 0, $$index1487 = 0, $$index1488 = 0, $$index1489 = 0, $$index149 = 0, $$index1490 = 0, $$index1491 = 0, $$index1492 = 0, $$index1493 = 0, $$index1494 = 0, $$index1495 = 0, $$index1496 = 0, $$index1497 = 0, $$index1498 = 0, $$index1499 = 0, $$index150 = 0, $$index1500 = 0;
 var $$index1501 = 0, $$index1502 = 0, $$index1503 = 0, $$index1504 = 0, $$index1505 = 0, $$index1506 = 0, $$index1507 = 0, $$index1508 = 0, $$index1509 = 0, $$index151 = 0, $$index1510 = 0, $$index1511 = 0, $$index1512 = 0, $$index1513 = 0, $$index1514 = 0, $$index1515 = 0, $$index1516 = 0, $$index1517 = 0, $$index1518 = 0, $$index1519 = 0;
 var $$index152 = 0, $$index1520 = 0, $$index1521 = 0, $$index1522 = 0, $$index1523 = 0, $$index1524 = 0, $$index1525 = 0, $$index1526 = 0, $$index1527 = 0, $$index1528 = 0, $$index1529 = 0, $$index153 = 0, $$index1530 = 0, $$index1531 = 0, $$index1532 = 0, $$index1533 = 0, $$index1534 = 0, $$index1535 = 0, $$index1536 = 0, $$index1537 = 0;
 var $$index1538 = 0, $$index1539 = 0, $$index154 = 0, $$index1540 = 0, $$index1541 = 0, $$index1542 = 0, $$index1543 = 0, $$index1544 = 0, $$index1545 = 0, $$index1546 = 0, $$index1547 = 0, $$index1548 = 0, $$index1549 = 0, $$index155 = 0, $$index1550 = 0, $$index1551 = 0, $$index1552 = 0, $$index1553 = 0, $$index1554 = 0, $$index1555 = 0;
 var $$index1556 = 0, $$index1557 = 0, $$index1558 = 0, $$index1559 = 0, $$index156 = 0, $$index1560 = 0, $$index1561 = 0, $$index1562 = 0, $$index1563 = 0, $$index1564 = 0, $$index1565 = 0, $$index1566 = 0, $$index1567 = 0, $$index1568 = 0, $$index1569 = 0, $$index157 = 0, $$index1570 = 0, $$index1571 = 0, $$index1572 = 0, $$index1573 = 0;
 var $$index1574 = 0, $$index1575 = 0, $$index1576 = 0, $$index1577 = 0, $$index1578 = 0, $$index1579 = 0, $$index158 = 0, $$index1580 = 0, $$index1581 = 0, $$index1582 = 0, $$index1583 = 0, $$index1584 = 0, $$index1585 = 0, $$index1586 = 0, $$index1587 = 0, $$index1588 = 0, $$index1589 = 0, $$index159 = 0, $$index1590 = 0, $$index1591 = 0;
 var $$index1592 = 0, $$index1593 = 0, $$index1594 = 0, $$index1595 = 0, $$index1596 = 0, $$index1597 = 0, $$index1598 = 0, $$index1599 = 0, $$index16 = 0, $$index160 = 0, $$index1600 = 0, $$index1601 = 0, $$index1602 = 0, $$index1603 = 0, $$index1604 = 0, $$index1605 = 0, $$index1606 = 0, $$index1607 = 0, $$index1608 = 0, $$index1609 = 0;
 var $$index161 = 0, $$index1610 = 0, $$index1611 = 0, $$index1612 = 0, $$index1613 = 0, $$index1614 = 0, $$index1615 = 0, $$index1616 = 0, $$index1617 = 0, $$index1618 = 0, $$index1619 = 0, $$index162 = 0, $$index1620 = 0, $$index1621 = 0, $$index1622 = 0, $$index1623 = 0, $$index1624 = 0, $$index1625 = 0, $$index1626 = 0, $$index1627 = 0;
 var $$index1628 = 0, $$index1629 = 0, $$index163 = 0, $$index1630 = 0, $$index1631 = 0, $$index1632 = 0, $$index1633 = 0, $$index1634 = 0, $$index1635 = 0, $$index1636 = 0, $$index1637 = 0, $$index1638 = 0, $$index1639 = 0, $$index164 = 0, $$index1640 = 0, $$index16402 = 0, $$index16403 = 0, $$index16407 = 0, $$index1641 = 0, $$index16410 = 0;
 var $$index16414 = 0, $$index16415 = 0, $$index16419 = 0, $$index1642 = 0, $$index16422 = 0, $$index1643 = 0, $$index16430 = 0, $$index1644 = 0, $$index16442 = 0, $$index16447 = 0, $$index16448 = 0, $$index1645 = 0, $$index16452 = 0, $$index16455 = 0, $$index1646 = 0, $$index16466 = 0, $$index1647 = 0, $$index1648 = 0, $$index1649 = 0, $$index165 = 0;
 var $$index1650 = 0, $$index1651 = 0, $$index1652 = 0, $$index1653 = 0, $$index1654 = 0, $$index1655 = 0, $$index1656 = 0, $$index1657 = 0, $$index1658 = 0, $$index1659 = 0, $$index166 = 0, $$index1660 = 0, $$index1661 = 0, $$index1662 = 0, $$index1663 = 0, $$index1664 = 0, $$index1665 = 0, $$index1666 = 0, $$index1667 = 0, $$index1668 = 0;
 var $$index1669 = 0, $$index167 = 0, $$index1670 = 0, $$index1671 = 0, $$index1672 = 0, $$index1673 = 0, $$index1674 = 0, $$index1675 = 0, $$index1676 = 0, $$index1677 = 0, $$index1678 = 0, $$index1679 = 0, $$index168 = 0, $$index1680 = 0, $$index1681 = 0, $$index1682 = 0, $$index1683 = 0, $$index1684 = 0, $$index1685 = 0, $$index1686 = 0;
 var $$index1687 = 0, $$index1688 = 0, $$index1689 = 0, $$index169 = 0, $$index1690 = 0, $$index1691 = 0, $$index1692 = 0, $$index1693 = 0, $$index1694 = 0, $$index1695 = 0, $$index1696 = 0, $$index1697 = 0, $$index1698 = 0, $$index1699 = 0, $$index17 = 0, $$index170 = 0, $$index1700 = 0, $$index1701 = 0, $$index1702 = 0, $$index1703 = 0;
 var $$index1704 = 0, $$index1705 = 0, $$index1706 = 0, $$index1707 = 0, $$index1708 = 0, $$index1709 = 0, $$index171 = 0, $$index1710 = 0, $$index1711 = 0, $$index1712 = 0, $$index1713 = 0, $$index1714 = 0, $$index1715 = 0, $$index1716 = 0, $$index1717 = 0, $$index1718 = 0, $$index1719 = 0, $$index172 = 0, $$index1720 = 0, $$index1721 = 0;
 var $$index1722 = 0, $$index1723 = 0, $$index1724 = 0, $$index1725 = 0, $$index1726 = 0, $$index1727 = 0, $$index1728 = 0, $$index1729 = 0, $$index173 = 0, $$index1730 = 0, $$index1731 = 0, $$index1732 = 0, $$index1733 = 0, $$index1734 = 0, $$index1735 = 0, $$index1736 = 0, $$index1737 = 0, $$index1738 = 0, $$index1739 = 0, $$index174 = 0;
 var $$index1740 = 0, $$index1741 = 0, $$index1742 = 0, $$index1743 = 0, $$index1744 = 0, $$index1745 = 0, $$index1746 = 0, $$index1747 = 0, $$index1748 = 0, $$index1749 = 0, $$index175 = 0, $$index1750 = 0, $$index1751 = 0, $$index1752 = 0, $$index1753 = 0, $$index1754 = 0, $$index1755 = 0, $$index1756 = 0, $$index1757 = 0, $$index1758 = 0;
 var $$index1759 = 0, $$index176 = 0, $$index1760 = 0, $$index1761 = 0, $$index1762 = 0, $$index1763 = 0, $$index1764 = 0, $$index1765 = 0, $$index1766 = 0, $$index1767 = 0, $$index1768 = 0, $$index1769 = 0, $$index177 = 0, $$index1770 = 0, $$index1771 = 0, $$index1772 = 0, $$index1773 = 0, $$index1774 = 0, $$index1775 = 0, $$index1776 = 0;
 var $$index1777 = 0, $$index1778 = 0, $$index1779 = 0, $$index178 = 0, $$index1780 = 0, $$index1781 = 0, $$index1782 = 0, $$index1783 = 0, $$index1784 = 0, $$index1785 = 0, $$index1786 = 0, $$index1787 = 0, $$index1788 = 0, $$index1789 = 0, $$index179 = 0, $$index1790 = 0, $$index1791 = 0, $$index1792 = 0, $$index1793 = 0, $$index1794 = 0;
 var $$index1795 = 0, $$index1796 = 0, $$index1797 = 0, $$index1798 = 0, $$index1799 = 0, $$index18 = 0, $$index180 = 0, $$index1800 = 0, $$index1801 = 0, $$index1802 = 0, $$index1803 = 0, $$index1804 = 0, $$index1805 = 0, $$index1806 = 0, $$index1807 = 0, $$index1808 = 0, $$index1809 = 0, $$index181 = 0, $$index1810 = 0, $$index1811 = 0;
 var $$index1812 = 0, $$index1813 = 0, $$index1814 = 0, $$index1815 = 0, $$index1816 = 0, $$index1817 = 0, $$index1818 = 0, $$index1819 = 0, $$index182 = 0, $$index1820 = 0, $$index1821 = 0, $$index1822 = 0, $$index1823 = 0, $$index1824 = 0, $$index1825 = 0, $$index1826 = 0, $$index1827 = 0, $$index1828 = 0, $$index1829 = 0, $$index183 = 0;
 var $$index1830 = 0, $$index1831 = 0, $$index1832 = 0, $$index1833 = 0, $$index1834 = 0, $$index1835 = 0, $$index1836 = 0, $$index1837 = 0, $$index1838 = 0, $$index1839 = 0, $$index184 = 0, $$index1840 = 0, $$index1841 = 0, $$index1842 = 0, $$index1843 = 0, $$index1844 = 0, $$index1845 = 0, $$index1846 = 0, $$index1847 = 0, $$index1848 = 0;
 var $$index1849 = 0, $$index185 = 0, $$index1850 = 0, $$index1851 = 0, $$index1852 = 0, $$index1853 = 0, $$index1854 = 0, $$index1855 = 0, $$index1856 = 0, $$index1857 = 0, $$index1858 = 0, $$index1859 = 0, $$index186 = 0, $$index1860 = 0, $$index1861 = 0, $$index1862 = 0, $$index1863 = 0, $$index1864 = 0, $$index1865 = 0, $$index1866 = 0;
 var $$index1867 = 0, $$index1868 = 0, $$index1869 = 0, $$index187 = 0, $$index1870 = 0, $$index1871 = 0, $$index1872 = 0, $$index1873 = 0, $$index1874 = 0, $$index1875 = 0, $$index1876 = 0, $$index1877 = 0, $$index1878 = 0, $$index1879 = 0, $$index188 = 0, $$index1880 = 0, $$index1881 = 0, $$index1882 = 0, $$index1883 = 0, $$index1884 = 0;
 var $$index1885 = 0, $$index1886 = 0, $$index1887 = 0, $$index1888 = 0, $$index1889 = 0, $$index189 = 0, $$index1890 = 0, $$index1891 = 0, $$index1892 = 0, $$index1893 = 0, $$index1894 = 0, $$index1895 = 0, $$index1896 = 0, $$index1897 = 0, $$index1898 = 0, $$index1899 = 0, $$index19 = 0, $$index190 = 0, $$index1900 = 0, $$index1901 = 0;
 var $$index1902 = 0, $$index1903 = 0, $$index1904 = 0, $$index1905 = 0, $$index1906 = 0, $$index1907 = 0, $$index1908 = 0, $$index1909 = 0, $$index191 = 0, $$index1910 = 0, $$index1911 = 0, $$index1912 = 0, $$index1913 = 0, $$index1914 = 0, $$index1915 = 0, $$index1916 = 0, $$index1917 = 0, $$index1918 = 0, $$index1919 = 0, $$index192 = 0;
 var $$index1920 = 0, $$index1921 = 0, $$index1922 = 0, $$index1923 = 0, $$index1924 = 0, $$index1925 = 0, $$index1926 = 0, $$index1927 = 0, $$index1928 = 0, $$index1929 = 0, $$index193 = 0, $$index1930 = 0, $$index1931 = 0, $$index1932 = 0, $$index1933 = 0, $$index1934 = 0, $$index1935 = 0, $$index1936 = 0, $$index1937 = 0, $$index1938 = 0;
 var $$index1939 = 0, $$index194 = 0, $$index1940 = 0, $$index1941 = 0, $$index1942 = 0, $$index1943 = 0, $$index1944 = 0, $$index1945 = 0, $$index1946 = 0, $$index1947 = 0, $$index1948 = 0, $$index1949 = 0, $$index195 = 0, $$index1950 = 0, $$index1951 = 0, $$index1952 = 0, $$index1953 = 0, $$index1954 = 0, $$index1955 = 0, $$index1956 = 0;
 var $$index1957 = 0, $$index1958 = 0, $$index1959 = 0, $$index196 = 0, $$index1960 = 0, $$index1961 = 0, $$index1962 = 0, $$index1963 = 0, $$index1964 = 0, $$index1965 = 0, $$index1966 = 0, $$index1967 = 0, $$index1968 = 0, $$index1969 = 0, $$index197 = 0, $$index1970 = 0, $$index1971 = 0, $$index1972 = 0, $$index1973 = 0, $$index1974 = 0;
 var $$index1975 = 0, $$index1976 = 0, $$index1977 = 0, $$index1978 = 0, $$index1979 = 0, $$index198 = 0, $$index1980 = 0, $$index1981 = 0, $$index1982 = 0, $$index1983 = 0, $$index1984 = 0, $$index1985 = 0, $$index1986 = 0, $$index1987 = 0, $$index1988 = 0, $$index1989 = 0, $$index199 = 0, $$index1990 = 0, $$index1991 = 0, $$index1992 = 0;
 var $$index1993 = 0, $$index1994 = 0, $$index1995 = 0, $$index1996 = 0, $$index1997 = 0, $$index1998 = 0, $$index1999 = 0, $$index20 = 0, $$index200 = 0, $$index2000 = 0, $$index2001 = 0, $$index2002 = 0, $$index2003 = 0, $$index2004 = 0, $$index2005 = 0, $$index2006 = 0, $$index2007 = 0, $$index2008 = 0, $$index2009 = 0, $$index201 = 0;
 var $$index2010 = 0, $$index2011 = 0, $$index2012 = 0, $$index2013 = 0, $$index2014 = 0, $$index2015 = 0, $$index2016 = 0, $$index2017 = 0, $$index2018 = 0, $$index2019 = 0, $$index202 = 0, $$index2020 = 0, $$index2021 = 0, $$index2022 = 0, $$index2023 = 0, $$index2024 = 0, $$index2025 = 0, $$index2026 = 0, $$index2027 = 0, $$index2028 = 0;
 var $$index2029 = 0, $$index203 = 0, $$index2030 = 0, $$index2031 = 0, $$index2032 = 0, $$index2033 = 0, $$index2034 = 0, $$index2035 = 0, $$index2036 = 0, $$index2037 = 0, $$index2038 = 0, $$index2039 = 0, $$index204 = 0, $$index2040 = 0, $$index2041 = 0, $$index2042 = 0, $$index2043 = 0, $$index2044 = 0, $$index2045 = 0, $$index2046 = 0;
 var $$index2047 = 0, $$index2048 = 0, $$index2049 = 0, $$index205 = 0, $$index2050 = 0, $$index2051 = 0, $$index2052 = 0, $$index2053 = 0, $$index2054 = 0, $$index2055 = 0, $$index2056 = 0, $$index2057 = 0, $$index2058 = 0, $$index2059 = 0, $$index206 = 0, $$index2060 = 0, $$index2061 = 0, $$index2062 = 0, $$index2063 = 0, $$index2064 = 0;
 var $$index2065 = 0, $$index2066 = 0, $$index2067 = 0, $$index2068 = 0, $$index2069 = 0, $$index207 = 0, $$index2070 = 0, $$index2071 = 0, $$index2072 = 0, $$index2073 = 0, $$index2074 = 0, $$index2075 = 0, $$index2076 = 0, $$index2077 = 0, $$index2078 = 0, $$index2079 = 0, $$index208 = 0, $$index2080 = 0, $$index2081 = 0, $$index2082 = 0;
 var $$index2083 = 0, $$index2084 = 0, $$index2085 = 0, $$index2086 = 0, $$index2087 = 0, $$index2088 = 0, $$index2089 = 0, $$index209 = 0, $$index2090 = 0, $$index2091 = 0, $$index2092 = 0, $$index2093 = 0, $$index2094 = 0, $$index2095 = 0, $$index2096 = 0, $$index2097 = 0, $$index2098 = 0, $$index2099 = 0, $$index21 = 0, $$index210 = 0;
 var $$index2100 = 0, $$index2101 = 0, $$index2102 = 0, $$index2103 = 0, $$index2104 = 0, $$index2105 = 0, $$index2106 = 0, $$index2107 = 0, $$index2108 = 0, $$index2109 = 0, $$index211 = 0, $$index2110 = 0, $$index2111 = 0, $$index2112 = 0, $$index2113 = 0, $$index2114 = 0, $$index2115 = 0, $$index2116 = 0, $$index2117 = 0, $$index2118 = 0;
 var $$index2119 = 0, $$index212 = 0, $$index2120 = 0, $$index2121 = 0, $$index2122 = 0, $$index2123 = 0, $$index2124 = 0, $$index2125 = 0, $$index2126 = 0, $$index2127 = 0, $$index2128 = 0, $$index2129 = 0, $$index213 = 0, $$index2130 = 0, $$index2131 = 0, $$index2132 = 0, $$index2133 = 0, $$index2134 = 0, $$index2135 = 0, $$index2136 = 0;
 var $$index2137 = 0, $$index2138 = 0, $$index2139 = 0, $$index214 = 0, $$index2140 = 0, $$index2141 = 0, $$index2142 = 0, $$index2143 = 0, $$index2144 = 0, $$index2145 = 0, $$index2146 = 0, $$index2147 = 0, $$index2148 = 0, $$index2149 = 0, $$index215 = 0, $$index2150 = 0, $$index2151 = 0, $$index2152 = 0, $$index2153 = 0, $$index2154 = 0;
 var $$index2155 = 0, $$index2156 = 0, $$index2157 = 0, $$index2158 = 0, $$index2159 = 0, $$index216 = 0, $$index2160 = 0, $$index2161 = 0, $$index2162 = 0, $$index2163 = 0, $$index2164 = 0, $$index2165 = 0, $$index2166 = 0, $$index2167 = 0, $$index2168 = 0, $$index2169 = 0, $$index217 = 0, $$index2170 = 0, $$index2171 = 0, $$index2172 = 0;
 var $$index2173 = 0, $$index2174 = 0, $$index2175 = 0, $$index2176 = 0, $$index2177 = 0, $$index2178 = 0, $$index2179 = 0, $$index218 = 0, $$index2180 = 0, $$index2181 = 0, $$index2182 = 0, $$index2183 = 0, $$index2184 = 0, $$index2185 = 0, $$index2186 = 0, $$index2187 = 0, $$index2188 = 0, $$index2189 = 0, $$index219 = 0, $$index2190 = 0;
 var $$index2191 = 0, $$index2192 = 0, $$index2193 = 0, $$index2194 = 0, $$index2195 = 0, $$index2196 = 0, $$index2197 = 0, $$index2198 = 0, $$index2199 = 0, $$index22 = 0, $$index220 = 0, $$index2200 = 0, $$index2201 = 0, $$index2202 = 0, $$index2203 = 0, $$index2204 = 0, $$index2205 = 0, $$index2206 = 0, $$index2207 = 0, $$index2208 = 0;
 var $$index2209 = 0, $$index221 = 0, $$index2210 = 0, $$index2211 = 0, $$index2212 = 0, $$index2213 = 0, $$index2214 = 0, $$index2215 = 0, $$index2216 = 0, $$index2217 = 0, $$index2218 = 0, $$index2219 = 0, $$index222 = 0, $$index2220 = 0, $$index2221 = 0, $$index2222 = 0, $$index2223 = 0, $$index2224 = 0, $$index2225 = 0, $$index2226 = 0;
 var $$index2227 = 0, $$index2228 = 0, $$index2229 = 0, $$index223 = 0, $$index2230 = 0, $$index2231 = 0, $$index2232 = 0, $$index2233 = 0, $$index2234 = 0, $$index2235 = 0, $$index2236 = 0, $$index2237 = 0, $$index2238 = 0, $$index2239 = 0, $$index224 = 0, $$index2240 = 0, $$index2241 = 0, $$index2242 = 0, $$index2243 = 0, $$index2244 = 0;
 var $$index2245 = 0, $$index2246 = 0, $$index2247 = 0, $$index2248 = 0, $$index2249 = 0, $$index225 = 0, $$index2250 = 0, $$index2251 = 0, $$index2252 = 0, $$index2253 = 0, $$index2254 = 0, $$index2255 = 0, $$index2256 = 0, $$index2257 = 0, $$index2258 = 0, $$index2259 = 0, $$index226 = 0, $$index2260 = 0, $$index2261 = 0, $$index2262 = 0;
 var $$index2263 = 0, $$index2264 = 0, $$index2265 = 0, $$index2266 = 0, $$index2267 = 0, $$index2268 = 0, $$index2269 = 0, $$index227 = 0, $$index2270 = 0, $$index2271 = 0, $$index2272 = 0, $$index2273 = 0, $$index2274 = 0, $$index2275 = 0, $$index2276 = 0, $$index2277 = 0, $$index2278 = 0, $$index2279 = 0, $$index228 = 0, $$index2280 = 0;
 var $$index2281 = 0, $$index2282 = 0, $$index2283 = 0, $$index2284 = 0, $$index2285 = 0, $$index2286 = 0, $$index2287 = 0, $$index2288 = 0, $$index2289 = 0, $$index229 = 0, $$index2290 = 0, $$index2291 = 0, $$index2292 = 0, $$index2293 = 0, $$index2294 = 0, $$index2295 = 0, $$index2296 = 0, $$index2297 = 0, $$index2298 = 0, $$index2299 = 0;
 var $$index23 = 0, $$index230 = 0, $$index2300 = 0, $$index2301 = 0, $$index2302 = 0, $$index2303 = 0, $$index2304 = 0, $$index2305 = 0, $$index2306 = 0, $$index2307 = 0, $$index2308 = 0, $$index2309 = 0, $$index231 = 0, $$index2310 = 0, $$index2311 = 0, $$index2312 = 0, $$index2313 = 0, $$index2314 = 0, $$index2315 = 0, $$index2316 = 0;
 var $$index2317 = 0, $$index2318 = 0, $$index2319 = 0, $$index232 = 0, $$index2320 = 0, $$index2321 = 0, $$index2322 = 0, $$index2323 = 0, $$index2324 = 0, $$index2325 = 0, $$index2326 = 0, $$index2327 = 0, $$index2328 = 0, $$index2329 = 0, $$index233 = 0, $$index2330 = 0, $$index2331 = 0, $$index2332 = 0, $$index2333 = 0, $$index2334 = 0;
 var $$index2335 = 0, $$index2336 = 0, $$index2337 = 0, $$index2338 = 0, $$index2339 = 0, $$index234 = 0, $$index2340 = 0, $$index2341 = 0, $$index2342 = 0, $$index2343 = 0, $$index2344 = 0, $$index2345 = 0, $$index2346 = 0, $$index2347 = 0, $$index2348 = 0, $$index2349 = 0, $$index235 = 0, $$index2350 = 0, $$index2351 = 0, $$index2352 = 0;
 var $$index2353 = 0, $$index2354 = 0, $$index2355 = 0, $$index2356 = 0, $$index2357 = 0, $$index2358 = 0, $$index2359 = 0, $$index236 = 0, $$index2360 = 0, $$index2361 = 0, $$index2362 = 0, $$index2363 = 0, $$index2364 = 0, $$index2365 = 0, $$index2366 = 0, $$index2367 = 0, $$index2368 = 0, $$index2369 = 0, $$index237 = 0, $$index2370 = 0;
 var $$index2371 = 0, $$index2372 = 0, $$index2373 = 0, $$index2374 = 0, $$index2375 = 0, $$index2376 = 0, $$index2377 = 0, $$index2378 = 0, $$index2379 = 0, $$index238 = 0, $$index2380 = 0, $$index2381 = 0, $$index2382 = 0, $$index2383 = 0, $$index2384 = 0, $$index2385 = 0, $$index2386 = 0, $$index2387 = 0, $$index2388 = 0, $$index2389 = 0;
 var $$index239 = 0, $$index2390 = 0, $$index2391 = 0, $$index2392 = 0, $$index2393 = 0, $$index2394 = 0, $$index2395 = 0, $$index2396 = 0, $$index2397 = 0, $$index2398 = 0, $$index2399 = 0, $$index24 = 0, $$index240 = 0, $$index2400 = 0, $$index2401 = 0, $$index2402 = 0, $$index2403 = 0, $$index2404 = 0, $$index2405 = 0, $$index2406 = 0;
 var $$index2407 = 0, $$index2408 = 0, $$index2409 = 0, $$index241 = 0, $$index2410 = 0, $$index2411 = 0, $$index2412 = 0, $$index2413 = 0, $$index2414 = 0, $$index2415 = 0, $$index2416 = 0, $$index2417 = 0, $$index2418 = 0, $$index2419 = 0, $$index242 = 0, $$index2420 = 0, $$index2421 = 0, $$index2422 = 0, $$index2423 = 0, $$index2424 = 0;
 var $$index2425 = 0, $$index2426 = 0, $$index2427 = 0, $$index2428 = 0, $$index2429 = 0, $$index243 = 0, $$index2430 = 0, $$index2431 = 0, $$index2432 = 0, $$index2433 = 0, $$index2434 = 0, $$index2435 = 0, $$index2436 = 0, $$index2437 = 0, $$index2438 = 0, $$index2439 = 0, $$index244 = 0, $$index2440 = 0, $$index2441 = 0, $$index2442 = 0;
 var $$index2443 = 0, $$index2444 = 0, $$index2445 = 0, $$index2446 = 0, $$index2447 = 0, $$index2448 = 0, $$index2449 = 0, $$index245 = 0, $$index2450 = 0, $$index2451 = 0, $$index2452 = 0, $$index2453 = 0, $$index2454 = 0, $$index2455 = 0, $$index2456 = 0, $$index2457 = 0, $$index2458 = 0, $$index2459 = 0, $$index246 = 0, $$index2460 = 0;
 var $$index2461 = 0, $$index2462 = 0, $$index2463 = 0, $$index2464 = 0, $$index2465 = 0, $$index2466 = 0, $$index2467 = 0, $$index2468 = 0, $$index2469 = 0, $$index247 = 0, $$index2470 = 0, $$index2471 = 0, $$index2472 = 0, $$index2473 = 0, $$index2474 = 0, $$index2475 = 0, $$index2476 = 0, $$index2477 = 0, $$index2478 = 0, $$index2479 = 0;
 var $$index248 = 0, $$index2480 = 0, $$index2481 = 0, $$index2482 = 0, $$index2483 = 0, $$index2484 = 0, $$index2485 = 0, $$index2486 = 0, $$index2487 = 0, $$index2488 = 0, $$index2489 = 0, $$index249 = 0, $$index2490 = 0, $$index2491 = 0, $$index2492 = 0, $$index2493 = 0, $$index2494 = 0, $$index2495 = 0, $$index2496 = 0, $$index2497 = 0;
 var $$index2498 = 0, $$index2499 = 0, $$index25 = 0, $$index250 = 0, $$index2500 = 0, $$index2501 = 0, $$index2502 = 0, $$index2503 = 0, $$index2504 = 0, $$index2505 = 0, $$index2506 = 0, $$index2507 = 0, $$index2508 = 0, $$index2509 = 0, $$index251 = 0, $$index2510 = 0, $$index2511 = 0, $$index2512 = 0, $$index2513 = 0, $$index2514 = 0;
 var $$index2515 = 0, $$index2516 = 0, $$index2517 = 0, $$index2518 = 0, $$index2519 = 0, $$index252 = 0, $$index2520 = 0, $$index2521 = 0, $$index2522 = 0, $$index2523 = 0, $$index2524 = 0, $$index2525 = 0, $$index2526 = 0, $$index2527 = 0, $$index2528 = 0, $$index2529 = 0, $$index253 = 0, $$index2530 = 0, $$index2531 = 0, $$index2532 = 0;
 var $$index2533 = 0, $$index2534 = 0, $$index2535 = 0, $$index2536 = 0, $$index2537 = 0, $$index2538 = 0, $$index2539 = 0, $$index254 = 0, $$index2540 = 0, $$index2541 = 0, $$index2542 = 0, $$index2543 = 0, $$index2544 = 0, $$index2545 = 0, $$index2546 = 0, $$index2547 = 0, $$index2548 = 0, $$index2549 = 0, $$index255 = 0, $$index2550 = 0;
 var $$index2551 = 0, $$index2552 = 0, $$index2553 = 0, $$index2554 = 0, $$index2555 = 0, $$index2556 = 0, $$index2557 = 0, $$index2558 = 0, $$index2559 = 0, $$index256 = 0, $$index2560 = 0, $$index2561 = 0, $$index2562 = 0, $$index2563 = 0, $$index2564 = 0, $$index2565 = 0, $$index2566 = 0, $$index2567 = 0, $$index2568 = 0, $$index2569 = 0;
 var $$index257 = 0, $$index2570 = 0, $$index2571 = 0, $$index2572 = 0, $$index2573 = 0, $$index2574 = 0, $$index2575 = 0, $$index2576 = 0, $$index2577 = 0, $$index2578 = 0, $$index2579 = 0, $$index258 = 0, $$index2580 = 0, $$index2581 = 0, $$index2582 = 0, $$index2583 = 0, $$index2584 = 0, $$index2585 = 0, $$index2586 = 0, $$index2587 = 0;
 var $$index2588 = 0, $$index2589 = 0, $$index259 = 0, $$index2590 = 0, $$index2591 = 0, $$index2592 = 0, $$index2593 = 0, $$index2594 = 0, $$index2595 = 0, $$index2596 = 0, $$index2597 = 0, $$index2598 = 0, $$index2599 = 0, $$index26 = 0, $$index260 = 0, $$index2600 = 0, $$index2601 = 0, $$index2602 = 0, $$index2603 = 0, $$index2604 = 0;
 var $$index2605 = 0, $$index2606 = 0, $$index2607 = 0, $$index2608 = 0, $$index2609 = 0, $$index261 = 0, $$index2610 = 0, $$index2611 = 0, $$index2612 = 0, $$index2613 = 0, $$index2614 = 0, $$index2615 = 0, $$index2616 = 0, $$index2617 = 0, $$index2618 = 0, $$index2619 = 0, $$index262 = 0, $$index2620 = 0, $$index2621 = 0, $$index2622 = 0;
 var $$index2623 = 0, $$index2624 = 0, $$index2625 = 0, $$index2626 = 0, $$index2627 = 0, $$index2628 = 0, $$index2629 = 0, $$index263 = 0, $$index2630 = 0, $$index2631 = 0, $$index2632 = 0, $$index2633 = 0, $$index2634 = 0, $$index2635 = 0, $$index2636 = 0, $$index2637 = 0, $$index2638 = 0, $$index2639 = 0, $$index264 = 0, $$index2640 = 0;
 var $$index2641 = 0, $$index2642 = 0, $$index2643 = 0, $$index2644 = 0, $$index2645 = 0, $$index2646 = 0, $$index2647 = 0, $$index2648 = 0, $$index2649 = 0, $$index265 = 0, $$index2650 = 0, $$index2651 = 0, $$index2652 = 0, $$index2653 = 0, $$index2654 = 0, $$index2655 = 0, $$index2656 = 0, $$index2657 = 0, $$index2658 = 0, $$index2659 = 0;
 var $$index266 = 0, $$index2660 = 0, $$index2661 = 0, $$index2662 = 0, $$index2663 = 0, $$index2664 = 0, $$index2665 = 0, $$index2666 = 0, $$index2667 = 0, $$index2668 = 0, $$index2669 = 0, $$index267 = 0, $$index2670 = 0, $$index2671 = 0, $$index2672 = 0, $$index2673 = 0, $$index2674 = 0, $$index2675 = 0, $$index2676 = 0, $$index2677 = 0;
 var $$index2678 = 0, $$index2679 = 0, $$index268 = 0, $$index2680 = 0, $$index2681 = 0, $$index2682 = 0, $$index2683 = 0, $$index2684 = 0, $$index2685 = 0, $$index2686 = 0, $$index2687 = 0, $$index2688 = 0, $$index2689 = 0, $$index269 = 0, $$index2690 = 0, $$index2691 = 0, $$index2692 = 0, $$index2693 = 0, $$index2694 = 0, $$index2695 = 0;
 var $$index2696 = 0, $$index2697 = 0, $$index2698 = 0, $$index2699 = 0, $$index27 = 0, $$index270 = 0, $$index2700 = 0, $$index2701 = 0, $$index2702 = 0, $$index2703 = 0, $$index2704 = 0, $$index2705 = 0, $$index2706 = 0, $$index2707 = 0, $$index2708 = 0, $$index2709 = 0, $$index271 = 0, $$index2710 = 0, $$index2711 = 0, $$index2712 = 0;
 var $$index2713 = 0, $$index2714 = 0, $$index2715 = 0, $$index2716 = 0, $$index2717 = 0, $$index2718 = 0, $$index2719 = 0, $$index272 = 0, $$index2720 = 0, $$index2721 = 0, $$index2722 = 0, $$index2723 = 0, $$index2724 = 0, $$index2725 = 0, $$index2726 = 0, $$index2727 = 0, $$index2728 = 0, $$index2729 = 0, $$index273 = 0, $$index2730 = 0;
 var $$index2731 = 0, $$index2732 = 0, $$index2733 = 0, $$index2734 = 0, $$index2735 = 0, $$index2736 = 0, $$index2737 = 0, $$index2738 = 0, $$index2739 = 0, $$index274 = 0, $$index2740 = 0, $$index2741 = 0, $$index2742 = 0, $$index2743 = 0, $$index2744 = 0, $$index2745 = 0, $$index2746 = 0, $$index2747 = 0, $$index2748 = 0, $$index2749 = 0;
 var $$index275 = 0, $$index2750 = 0, $$index2751 = 0, $$index2752 = 0, $$index2753 = 0, $$index2754 = 0, $$index2755 = 0, $$index2756 = 0, $$index2757 = 0, $$index2758 = 0, $$index2759 = 0, $$index276 = 0, $$index2760 = 0, $$index2761 = 0, $$index2762 = 0, $$index2763 = 0, $$index2764 = 0, $$index2765 = 0, $$index2766 = 0, $$index2767 = 0;
 var $$index2768 = 0, $$index2769 = 0, $$index277 = 0, $$index2770 = 0, $$index2771 = 0, $$index2772 = 0, $$index2773 = 0, $$index2774 = 0, $$index2775 = 0, $$index2776 = 0, $$index2777 = 0, $$index2778 = 0, $$index2779 = 0, $$index278 = 0, $$index2780 = 0, $$index2781 = 0, $$index2782 = 0, $$index2783 = 0, $$index2784 = 0, $$index2785 = 0;
 var $$index2786 = 0, $$index2787 = 0, $$index2788 = 0, $$index2789 = 0, $$index279 = 0, $$index2790 = 0, $$index2791 = 0, $$index2792 = 0, $$index2793 = 0, $$index2794 = 0, $$index2795 = 0, $$index2796 = 0, $$index2797 = 0, $$index2798 = 0, $$index2799 = 0, $$index28 = 0, $$index280 = 0, $$index2800 = 0, $$index2801 = 0, $$index2802 = 0;
 var $$index2803 = 0, $$index2804 = 0, $$index2805 = 0, $$index2806 = 0, $$index2807 = 0, $$index2808 = 0, $$index2809 = 0, $$index281 = 0, $$index2810 = 0, $$index2811 = 0, $$index2812 = 0, $$index2813 = 0, $$index2814 = 0, $$index2815 = 0, $$index2816 = 0, $$index2817 = 0, $$index2818 = 0, $$index2819 = 0, $$index282 = 0, $$index2820 = 0;
 var $$index2821 = 0, $$index2822 = 0, $$index2823 = 0, $$index2824 = 0, $$index2825 = 0, $$index2826 = 0, $$index2827 = 0, $$index2828 = 0, $$index2829 = 0, $$index283 = 0, $$index2830 = 0, $$index2831 = 0, $$index2832 = 0, $$index2833 = 0, $$index2834 = 0, $$index2835 = 0, $$index2836 = 0, $$index2837 = 0, $$index2838 = 0, $$index2839 = 0;
 var $$index284 = 0, $$index2840 = 0, $$index2841 = 0, $$index2842 = 0, $$index2843 = 0, $$index2844 = 0, $$index2845 = 0, $$index2846 = 0, $$index2847 = 0, $$index2848 = 0, $$index2849 = 0, $$index285 = 0, $$index2850 = 0, $$index2851 = 0, $$index2852 = 0, $$index2853 = 0, $$index2854 = 0, $$index2855 = 0, $$index2856 = 0, $$index2857 = 0;
 var $$index2858 = 0, $$index2859 = 0, $$index286 = 0, $$index2860 = 0, $$index2861 = 0, $$index2862 = 0, $$index2863 = 0, $$index2864 = 0, $$index2865 = 0, $$index2866 = 0, $$index2867 = 0, $$index2868 = 0, $$index2869 = 0, $$index287 = 0, $$index2870 = 0, $$index2871 = 0, $$index2872 = 0, $$index2873 = 0, $$index2874 = 0, $$index2875 = 0;
 var $$index2876 = 0, $$index2877 = 0, $$index2878 = 0, $$index2879 = 0, $$index288 = 0, $$index2880 = 0, $$index2881 = 0, $$index2882 = 0, $$index2883 = 0, $$index2884 = 0, $$index2885 = 0, $$index2886 = 0, $$index2887 = 0, $$index2888 = 0, $$index2889 = 0, $$index289 = 0, $$index2890 = 0, $$index2891 = 0, $$index2892 = 0, $$index2893 = 0;
 var $$index2894 = 0, $$index2895 = 0, $$index2896 = 0, $$index2897 = 0, $$index2898 = 0, $$index2899 = 0, $$index29 = 0, $$index290 = 0, $$index2900 = 0, $$index2901 = 0, $$index2902 = 0, $$index2903 = 0, $$index2904 = 0, $$index2905 = 0, $$index2906 = 0, $$index2907 = 0, $$index2908 = 0, $$index2909 = 0, $$index291 = 0, $$index2910 = 0;
 var $$index2911 = 0, $$index2912 = 0, $$index2913 = 0, $$index2914 = 0, $$index2915 = 0, $$index2916 = 0, $$index2917 = 0, $$index2918 = 0, $$index2919 = 0, $$index292 = 0, $$index2920 = 0, $$index2921 = 0, $$index2922 = 0, $$index2923 = 0, $$index2924 = 0, $$index2925 = 0, $$index2926 = 0, $$index2927 = 0, $$index2928 = 0, $$index2929 = 0;
 var $$index293 = 0, $$index2930 = 0, $$index2931 = 0, $$index2932 = 0, $$index2933 = 0, $$index2934 = 0, $$index2935 = 0, $$index2936 = 0, $$index2937 = 0, $$index2938 = 0, $$index2939 = 0, $$index294 = 0, $$index2940 = 0, $$index2941 = 0, $$index2942 = 0, $$index2943 = 0, $$index2944 = 0, $$index2945 = 0, $$index2946 = 0, $$index2947 = 0;
 var $$index2948 = 0, $$index2949 = 0, $$index295 = 0, $$index2950 = 0, $$index2951 = 0, $$index2952 = 0, $$index2953 = 0, $$index2954 = 0, $$index2955 = 0, $$index2956 = 0, $$index2957 = 0, $$index2958 = 0, $$index2959 = 0, $$index296 = 0, $$index2960 = 0, $$index2961 = 0, $$index2962 = 0, $$index2963 = 0, $$index2964 = 0, $$index2965 = 0;
 var $$index2966 = 0, $$index2967 = 0, $$index2968 = 0, $$index2969 = 0, $$index297 = 0, $$index2970 = 0, $$index2971 = 0, $$index2972 = 0, $$index2973 = 0, $$index2974 = 0, $$index2975 = 0, $$index2976 = 0, $$index2977 = 0, $$index2978 = 0, $$index2979 = 0, $$index298 = 0, $$index2980 = 0, $$index2981 = 0, $$index2982 = 0, $$index2983 = 0;
 var $$index2984 = 0, $$index2985 = 0, $$index2986 = 0, $$index2987 = 0, $$index2988 = 0, $$index2989 = 0, $$index299 = 0, $$index2990 = 0, $$index2991 = 0, $$index2992 = 0, $$index2993 = 0, $$index2994 = 0, $$index2995 = 0, $$index2996 = 0, $$index2997 = 0, $$index2998 = 0, $$index2999 = 0, $$index30 = 0, $$index300 = 0, $$index3000 = 0;
 var $$index3001 = 0, $$index3002 = 0, $$index3003 = 0, $$index3004 = 0, $$index3005 = 0, $$index3006 = 0, $$index3007 = 0, $$index3008 = 0, $$index3009 = 0, $$index301 = 0, $$index3010 = 0, $$index3011 = 0, $$index3012 = 0, $$index3013 = 0, $$index3014 = 0, $$index3015 = 0, $$index3016 = 0, $$index3017 = 0, $$index3018 = 0, $$index3019 = 0;
 var $$index302 = 0, $$index3020 = 0, $$index3021 = 0, $$index3022 = 0, $$index3023 = 0, $$index3024 = 0, $$index3025 = 0, $$index3026 = 0, $$index3027 = 0, $$index3028 = 0, $$index3029 = 0, $$index303 = 0, $$index3030 = 0, $$index3031 = 0, $$index3032 = 0, $$index3033 = 0, $$index3034 = 0, $$index3035 = 0, $$index3036 = 0, $$index3037 = 0;
 var $$index3038 = 0, $$index3039 = 0, $$index304 = 0, $$index3040 = 0, $$index3041 = 0, $$index3042 = 0, $$index3043 = 0, $$index3044 = 0, $$index3045 = 0, $$index3046 = 0, $$index3047 = 0, $$index3048 = 0, $$index3049 = 0, $$index305 = 0, $$index3050 = 0, $$index3051 = 0, $$index3052 = 0, $$index3053 = 0, $$index3054 = 0, $$index3055 = 0;
 var $$index3056 = 0, $$index3057 = 0, $$index3058 = 0, $$index3059 = 0, $$index306 = 0, $$index3060 = 0, $$index3061 = 0, $$index3062 = 0, $$index3063 = 0, $$index3064 = 0, $$index3065 = 0, $$index3066 = 0, $$index3067 = 0, $$index3068 = 0, $$index3069 = 0, $$index307 = 0, $$index3070 = 0, $$index3071 = 0, $$index3072 = 0, $$index3073 = 0;
 var $$index3074 = 0, $$index3075 = 0, $$index3076 = 0, $$index3077 = 0, $$index3078 = 0, $$index3079 = 0, $$index308 = 0, $$index3080 = 0, $$index3081 = 0, $$index3082 = 0, $$index3083 = 0, $$index3084 = 0, $$index3085 = 0, $$index3086 = 0, $$index3087 = 0, $$index3088 = 0, $$index3089 = 0, $$index309 = 0, $$index3090 = 0, $$index3091 = 0;
 var $$index3092 = 0, $$index3093 = 0, $$index3094 = 0, $$index3095 = 0, $$index3096 = 0, $$index3097 = 0, $$index3098 = 0, $$index3099 = 0, $$index31 = 0, $$index310 = 0, $$index3100 = 0, $$index3101 = 0, $$index3102 = 0, $$index3103 = 0, $$index3104 = 0, $$index3105 = 0, $$index3106 = 0, $$index3107 = 0, $$index3108 = 0, $$index3109 = 0;
 var $$index311 = 0, $$index3110 = 0, $$index3111 = 0, $$index3112 = 0, $$index3113 = 0, $$index3114 = 0, $$index3115 = 0, $$index3116 = 0, $$index3117 = 0, $$index3118 = 0, $$index3119 = 0, $$index312 = 0, $$index3120 = 0, $$index3121 = 0, $$index3122 = 0, $$index3123 = 0, $$index3124 = 0, $$index3125 = 0, $$index3126 = 0, $$index3127 = 0;
 var $$index3128 = 0, $$index3129 = 0, $$index313 = 0, $$index3130 = 0, $$index3131 = 0, $$index3132 = 0, $$index3133 = 0, $$index3134 = 0, $$index3135 = 0, $$index3136 = 0, $$index3137 = 0, $$index3138 = 0, $$index3139 = 0, $$index314 = 0, $$index3140 = 0, $$index3141 = 0, $$index3142 = 0, $$index3143 = 0, $$index3144 = 0, $$index3145 = 0;
 var $$index3146 = 0, $$index3147 = 0, $$index3148 = 0, $$index3149 = 0, $$index315 = 0, $$index3150 = 0, $$index3151 = 0, $$index3152 = 0, $$index3153 = 0, $$index3154 = 0, $$index3155 = 0, $$index3156 = 0, $$index3157 = 0, $$index3158 = 0, $$index3159 = 0, $$index316 = 0, $$index3160 = 0, $$index3161 = 0, $$index3162 = 0, $$index3163 = 0;
 var $$index3164 = 0, $$index3165 = 0, $$index3166 = 0, $$index3167 = 0, $$index3168 = 0, $$index3169 = 0, $$index317 = 0, $$index3170 = 0, $$index3171 = 0, $$index3172 = 0, $$index3173 = 0, $$index3174 = 0, $$index3175 = 0, $$index3176 = 0, $$index3177 = 0, $$index3178 = 0, $$index3179 = 0, $$index318 = 0, $$index3180 = 0, $$index3181 = 0;
 var $$index3182 = 0, $$index3183 = 0, $$index3184 = 0, $$index3185 = 0, $$index3186 = 0, $$index3187 = 0, $$index3188 = 0, $$index3189 = 0, $$index319 = 0, $$index3190 = 0, $$index3191 = 0, $$index3192 = 0, $$index3193 = 0, $$index3194 = 0, $$index3195 = 0, $$index3196 = 0, $$index3197 = 0, $$index3198 = 0, $$index3199 = 0, $$index32 = 0;
 var $$index320 = 0, $$index3200 = 0, $$index3201 = 0, $$index3202 = 0, $$index3203 = 0, $$index3204 = 0, $$index3205 = 0, $$index3206 = 0, $$index3207 = 0, $$index3208 = 0, $$index3209 = 0, $$index321 = 0, $$index3210 = 0, $$index3211 = 0, $$index3212 = 0, $$index3213 = 0, $$index3214 = 0, $$index3215 = 0, $$index3216 = 0, $$index3217 = 0;
 var $$index3218 = 0, $$index3219 = 0, $$index322 = 0, $$index3220 = 0, $$index3221 = 0, $$index3222 = 0, $$index3223 = 0, $$index3224 = 0, $$index3225 = 0, $$index3226 = 0, $$index3227 = 0, $$index3228 = 0, $$index3229 = 0, $$index323 = 0, $$index3230 = 0, $$index3231 = 0, $$index3232 = 0, $$index3233 = 0, $$index3234 = 0, $$index3235 = 0;
 var $$index3236 = 0, $$index3237 = 0, $$index3238 = 0, $$index3239 = 0, $$index324 = 0, $$index3240 = 0, $$index3241 = 0, $$index3242 = 0, $$index3243 = 0, $$index3244 = 0, $$index3245 = 0, $$index3246 = 0, $$index3247 = 0, $$index3248 = 0, $$index3249 = 0, $$index325 = 0, $$index3250 = 0, $$index3251 = 0, $$index3252 = 0, $$index3253 = 0;
 var $$index3254 = 0, $$index3255 = 0, $$index3256 = 0, $$index3257 = 0, $$index3258 = 0, $$index3259 = 0, $$index326 = 0, $$index3260 = 0, $$index3261 = 0, $$index3262 = 0, $$index3263 = 0, $$index3264 = 0, $$index3265 = 0, $$index3266 = 0, $$index3267 = 0, $$index3268 = 0, $$index3269 = 0, $$index327 = 0, $$index3270 = 0, $$index3271 = 0;
 var $$index3272 = 0, $$index3273 = 0, $$index3274 = 0, $$index3275 = 0, $$index3276 = 0, $$index3277 = 0, $$index3278 = 0, $$index3279 = 0, $$index328 = 0, $$index3280 = 0, $$index3281 = 0, $$index3282 = 0, $$index3283 = 0, $$index3284 = 0, $$index3285 = 0, $$index3286 = 0, $$index3287 = 0, $$index3288 = 0, $$index3289 = 0, $$index329 = 0;
 var $$index3290 = 0, $$index3291 = 0, $$index3292 = 0, $$index3293 = 0, $$index3294 = 0, $$index3295 = 0, $$index3296 = 0, $$index3297 = 0, $$index3298 = 0, $$index3299 = 0, $$index33 = 0, $$index330 = 0, $$index3300 = 0, $$index3301 = 0, $$index3302 = 0, $$index3303 = 0, $$index3304 = 0, $$index3305 = 0, $$index3306 = 0, $$index3307 = 0;
 var $$index3308 = 0, $$index3309 = 0, $$index331 = 0, $$index3310 = 0, $$index3311 = 0, $$index3312 = 0, $$index3313 = 0, $$index3314 = 0, $$index3315 = 0, $$index3316 = 0, $$index3317 = 0, $$index3318 = 0, $$index3319 = 0, $$index332 = 0, $$index3320 = 0, $$index3321 = 0, $$index3322 = 0, $$index3323 = 0, $$index3324 = 0, $$index3325 = 0;
 var $$index3326 = 0, $$index3327 = 0, $$index3328 = 0, $$index3329 = 0, $$index333 = 0, $$index3330 = 0, $$index3331 = 0, $$index3332 = 0, $$index3333 = 0, $$index3334 = 0, $$index3335 = 0, $$index3336 = 0, $$index3337 = 0, $$index3338 = 0, $$index3339 = 0, $$index334 = 0, $$index3340 = 0, $$index3341 = 0, $$index3342 = 0, $$index3343 = 0;
 var $$index3344 = 0, $$index3345 = 0, $$index3346 = 0, $$index3347 = 0, $$index3348 = 0, $$index3349 = 0, $$index335 = 0, $$index3350 = 0, $$index3351 = 0, $$index3352 = 0, $$index3353 = 0, $$index3354 = 0, $$index3355 = 0, $$index3356 = 0, $$index3357 = 0, $$index3358 = 0, $$index3359 = 0, $$index336 = 0, $$index3360 = 0, $$index3361 = 0;
 var $$index3362 = 0, $$index3363 = 0, $$index3364 = 0, $$index3365 = 0, $$index3366 = 0, $$index3367 = 0, $$index3368 = 0, $$index3369 = 0, $$index337 = 0, $$index3370 = 0, $$index3371 = 0, $$index3372 = 0, $$index3373 = 0, $$index3374 = 0, $$index3375 = 0, $$index3376 = 0, $$index3377 = 0, $$index3378 = 0, $$index3379 = 0, $$index338 = 0;
 var $$index3380 = 0, $$index3381 = 0, $$index3382 = 0, $$index3383 = 0, $$index3384 = 0, $$index3385 = 0, $$index3386 = 0, $$index3387 = 0, $$index3388 = 0, $$index3389 = 0, $$index339 = 0, $$index3390 = 0, $$index3391 = 0, $$index3392 = 0, $$index3393 = 0, $$index3394 = 0, $$index3395 = 0, $$index3396 = 0, $$index3397 = 0, $$index3398 = 0;
 var $$index3399 = 0, $$index34 = 0, $$index340 = 0, $$index3400 = 0, $$index3401 = 0, $$index3402 = 0, $$index3403 = 0, $$index3404 = 0, $$index3405 = 0, $$index3406 = 0, $$index3407 = 0, $$index3408 = 0, $$index3409 = 0, $$index341 = 0, $$index3410 = 0, $$index3411 = 0, $$index3412 = 0, $$index3413 = 0, $$index3414 = 0, $$index3415 = 0;
 var $$index3416 = 0, $$index3417 = 0, $$index3418 = 0, $$index3419 = 0, $$index342 = 0, $$index3420 = 0, $$index3421 = 0, $$index3422 = 0, $$index3423 = 0, $$index3424 = 0, $$index3425 = 0, $$index3426 = 0, $$index3427 = 0, $$index3428 = 0, $$index3429 = 0, $$index343 = 0, $$index3430 = 0, $$index3431 = 0, $$index3432 = 0, $$index3433 = 0;
 var $$index3434 = 0, $$index3435 = 0, $$index3436 = 0, $$index3437 = 0, $$index3438 = 0, $$index3439 = 0, $$index344 = 0, $$index3440 = 0, $$index3441 = 0, $$index3442 = 0, $$index3443 = 0, $$index3444 = 0, $$index3445 = 0, $$index3446 = 0, $$index3447 = 0, $$index3448 = 0, $$index3449 = 0, $$index345 = 0, $$index3450 = 0, $$index3451 = 0;
 var $$index3452 = 0, $$index3453 = 0, $$index3454 = 0, $$index3455 = 0, $$index3456 = 0, $$index3457 = 0, $$index3458 = 0, $$index3459 = 0, $$index346 = 0, $$index3460 = 0, $$index3461 = 0, $$index3462 = 0, $$index3463 = 0, $$index3464 = 0, $$index3465 = 0, $$index3466 = 0, $$index3467 = 0, $$index3468 = 0, $$index3469 = 0, $$index347 = 0;
 var $$index3470 = 0, $$index3471 = 0, $$index3472 = 0, $$index3473 = 0, $$index3474 = 0, $$index3475 = 0, $$index3476 = 0, $$index3477 = 0, $$index3478 = 0, $$index3479 = 0, $$index348 = 0, $$index3480 = 0, $$index3481 = 0, $$index3482 = 0, $$index3483 = 0, $$index3484 = 0, $$index3485 = 0, $$index3486 = 0, $$index3487 = 0, $$index3488 = 0;
 var $$index3489 = 0, $$index349 = 0, $$index3490 = 0, $$index3491 = 0, $$index3492 = 0, $$index3493 = 0, $$index3494 = 0, $$index3495 = 0, $$index3496 = 0, $$index3497 = 0, $$index3498 = 0, $$index3499 = 0, $$index35 = 0, $$index350 = 0, $$index3500 = 0, $$index3501 = 0, $$index3502 = 0, $$index3503 = 0, $$index3504 = 0, $$index3505 = 0;
 var $$index3506 = 0, $$index3507 = 0, $$index3508 = 0, $$index3509 = 0, $$index351 = 0, $$index3510 = 0, $$index3511 = 0, $$index3512 = 0, $$index3513 = 0, $$index3514 = 0, $$index3515 = 0, $$index3516 = 0, $$index3517 = 0, $$index3518 = 0, $$index3519 = 0, $$index352 = 0, $$index3520 = 0, $$index3521 = 0, $$index3522 = 0, $$index3523 = 0;
 var $$index3524 = 0, $$index3525 = 0, $$index3526 = 0, $$index3527 = 0, $$index3528 = 0, $$index3529 = 0, $$index353 = 0, $$index3530 = 0, $$index3531 = 0, $$index3532 = 0, $$index3533 = 0, $$index3534 = 0, $$index3535 = 0, $$index3536 = 0, $$index3537 = 0, $$index3538 = 0, $$index3539 = 0, $$index354 = 0, $$index3540 = 0, $$index3541 = 0;
 var $$index3542 = 0, $$index3543 = 0, $$index3544 = 0, $$index3545 = 0, $$index3546 = 0, $$index3547 = 0, $$index3548 = 0, $$index3549 = 0, $$index355 = 0, $$index3550 = 0, $$index3551 = 0, $$index3552 = 0, $$index3553 = 0, $$index3554 = 0, $$index3555 = 0, $$index3556 = 0, $$index3557 = 0, $$index3558 = 0, $$index3559 = 0, $$index356 = 0;
 var $$index3560 = 0, $$index3561 = 0, $$index3562 = 0, $$index3563 = 0, $$index3564 = 0, $$index3565 = 0, $$index3566 = 0, $$index3567 = 0, $$index3568 = 0, $$index3569 = 0, $$index357 = 0, $$index3570 = 0, $$index3571 = 0, $$index3572 = 0, $$index3573 = 0, $$index3574 = 0, $$index3575 = 0, $$index3576 = 0, $$index3577 = 0, $$index3578 = 0;
 var $$index3579 = 0, $$index358 = 0, $$index3580 = 0, $$index3581 = 0, $$index3582 = 0, $$index3583 = 0, $$index3584 = 0, $$index3585 = 0, $$index3586 = 0, $$index3587 = 0, $$index3588 = 0, $$index3589 = 0, $$index359 = 0, $$index3590 = 0, $$index3591 = 0, $$index3592 = 0, $$index3593 = 0, $$index3594 = 0, $$index3595 = 0, $$index3596 = 0;
 var $$index3597 = 0, $$index3598 = 0, $$index3599 = 0, $$index36 = 0, $$index360 = 0, $$index3600 = 0, $$index3601 = 0, $$index3602 = 0, $$index3603 = 0, $$index3604 = 0, $$index3605 = 0, $$index3606 = 0, $$index3607 = 0, $$index3608 = 0, $$index3609 = 0, $$index361 = 0, $$index3610 = 0, $$index3611 = 0, $$index3612 = 0, $$index3613 = 0;
 var $$index3614 = 0, $$index3615 = 0, $$index3616 = 0, $$index3617 = 0, $$index3618 = 0, $$index3619 = 0, $$index362 = 0, $$index3620 = 0, $$index3621 = 0, $$index3622 = 0, $$index3623 = 0, $$index3624 = 0, $$index3625 = 0, $$index3626 = 0, $$index3627 = 0, $$index3628 = 0, $$index3629 = 0, $$index363 = 0, $$index3630 = 0, $$index3631 = 0;
 var $$index3632 = 0, $$index3633 = 0, $$index3634 = 0, $$index3635 = 0, $$index3636 = 0, $$index3637 = 0, $$index3638 = 0, $$index3639 = 0, $$index364 = 0, $$index3640 = 0, $$index3641 = 0, $$index3642 = 0, $$index3643 = 0, $$index3644 = 0, $$index3645 = 0, $$index3646 = 0, $$index3647 = 0, $$index3648 = 0, $$index3649 = 0, $$index365 = 0;
 var $$index3650 = 0, $$index3651 = 0, $$index3652 = 0, $$index3653 = 0, $$index3654 = 0, $$index3655 = 0, $$index3656 = 0, $$index3657 = 0, $$index3658 = 0, $$index3659 = 0, $$index366 = 0, $$index3660 = 0, $$index3661 = 0, $$index3662 = 0, $$index3663 = 0, $$index3664 = 0, $$index3665 = 0, $$index3666 = 0, $$index3667 = 0, $$index3668 = 0;
 var $$index3669 = 0, $$index367 = 0, $$index3670 = 0, $$index3671 = 0, $$index3672 = 0, $$index3673 = 0, $$index3674 = 0, $$index3675 = 0, $$index3676 = 0, $$index3677 = 0, $$index3678 = 0, $$index3679 = 0, $$index368 = 0, $$index3680 = 0, $$index3681 = 0, $$index3682 = 0, $$index3683 = 0, $$index3684 = 0, $$index3685 = 0, $$index3686 = 0;
 var $$index3687 = 0, $$index3688 = 0, $$index3689 = 0, $$index369 = 0, $$index3690 = 0, $$index3691 = 0, $$index3692 = 0, $$index3693 = 0, $$index3694 = 0, $$index3695 = 0, $$index3696 = 0, $$index3697 = 0, $$index3698 = 0, $$index3699 = 0, $$index37 = 0, $$index370 = 0, $$index3700 = 0, $$index3701 = 0, $$index3702 = 0, $$index3703 = 0;
 var $$index3704 = 0, $$index3705 = 0, $$index3706 = 0, $$index3707 = 0, $$index3708 = 0, $$index3709 = 0, $$index371 = 0, $$index3710 = 0, $$index3711 = 0, $$index3712 = 0, $$index3713 = 0, $$index3714 = 0, $$index3715 = 0, $$index3716 = 0, $$index3717 = 0, $$index3718 = 0, $$index3719 = 0, $$index372 = 0, $$index3720 = 0, $$index3721 = 0;
 var $$index3722 = 0, $$index3723 = 0, $$index3724 = 0, $$index3725 = 0, $$index3726 = 0, $$index3727 = 0, $$index3728 = 0, $$index3729 = 0, $$index373 = 0, $$index3730 = 0, $$index3731 = 0, $$index3732 = 0, $$index3733 = 0, $$index3734 = 0, $$index3735 = 0, $$index3736 = 0, $$index3737 = 0, $$index3738 = 0, $$index3739 = 0, $$index374 = 0;
 var $$index3740 = 0, $$index3741 = 0, $$index3742 = 0, $$index3743 = 0, $$index3744 = 0, $$index3745 = 0, $$index3746 = 0, $$index3747 = 0, $$index3748 = 0, $$index3749 = 0, $$index375 = 0, $$index3750 = 0, $$index3751 = 0, $$index3752 = 0, $$index3753 = 0, $$index3754 = 0, $$index3755 = 0, $$index3756 = 0, $$index3757 = 0, $$index3758 = 0;
 var $$index3759 = 0, $$index376 = 0, $$index3760 = 0, $$index3761 = 0, $$index3762 = 0, $$index3763 = 0, $$index3764 = 0, $$index3765 = 0, $$index3766 = 0, $$index3767 = 0, $$index3768 = 0, $$index3769 = 0, $$index377 = 0, $$index3770 = 0, $$index3771 = 0, $$index3772 = 0, $$index3773 = 0, $$index3774 = 0, $$index3775 = 0, $$index3776 = 0;
 var $$index3777 = 0, $$index3778 = 0, $$index3779 = 0, $$index378 = 0, $$index3780 = 0, $$index3781 = 0, $$index3782 = 0, $$index3783 = 0, $$index3784 = 0, $$index3785 = 0, $$index3786 = 0, $$index3787 = 0, $$index3788 = 0, $$index3789 = 0, $$index379 = 0, $$index3790 = 0, $$index3791 = 0, $$index3792 = 0, $$index3793 = 0, $$index3794 = 0;
 var $$index3795 = 0, $$index3796 = 0, $$index3797 = 0, $$index3798 = 0, $$index3799 = 0, $$index38 = 0, $$index380 = 0, $$index3800 = 0, $$index3801 = 0, $$index3802 = 0, $$index3803 = 0, $$index3804 = 0, $$index3805 = 0, $$index3806 = 0, $$index3807 = 0, $$index3808 = 0, $$index3809 = 0, $$index381 = 0, $$index3810 = 0, $$index3811 = 0;
 var $$index3812 = 0, $$index3813 = 0, $$index3814 = 0, $$index3815 = 0, $$index3816 = 0, $$index3817 = 0, $$index3818 = 0, $$index3819 = 0, $$index382 = 0, $$index3820 = 0, $$index3821 = 0, $$index3822 = 0, $$index3823 = 0, $$index3824 = 0, $$index3825 = 0, $$index3826 = 0, $$index3827 = 0, $$index3828 = 0, $$index3829 = 0, $$index383 = 0;
 var $$index3830 = 0, $$index3831 = 0, $$index3832 = 0, $$index3833 = 0, $$index3834 = 0, $$index3835 = 0, $$index3836 = 0, $$index3837 = 0, $$index3838 = 0, $$index3839 = 0, $$index384 = 0, $$index3840 = 0, $$index3841 = 0, $$index3842 = 0, $$index3843 = 0, $$index3844 = 0, $$index3845 = 0, $$index3846 = 0, $$index3847 = 0, $$index3848 = 0;
 var $$index3849 = 0, $$index385 = 0, $$index3850 = 0, $$index3851 = 0, $$index3852 = 0, $$index3853 = 0, $$index3854 = 0, $$index3855 = 0, $$index3856 = 0, $$index3857 = 0, $$index3858 = 0, $$index3859 = 0, $$index386 = 0, $$index3860 = 0, $$index3861 = 0, $$index3862 = 0, $$index3863 = 0, $$index3864 = 0, $$index3865 = 0, $$index3866 = 0;
 var $$index3867 = 0, $$index3868 = 0, $$index3869 = 0, $$index387 = 0, $$index3870 = 0, $$index3871 = 0, $$index3872 = 0, $$index3873 = 0, $$index3874 = 0, $$index3875 = 0, $$index3876 = 0, $$index3877 = 0, $$index3878 = 0, $$index3879 = 0, $$index388 = 0, $$index3880 = 0, $$index3881 = 0, $$index3882 = 0, $$index3883 = 0, $$index3884 = 0;
 var $$index3885 = 0, $$index3886 = 0, $$index3887 = 0, $$index3888 = 0, $$index3889 = 0, $$index389 = 0, $$index3890 = 0, $$index3891 = 0, $$index3892 = 0, $$index3893 = 0, $$index3894 = 0, $$index3895 = 0, $$index3896 = 0, $$index3897 = 0, $$index3898 = 0, $$index3899 = 0, $$index39 = 0, $$index390 = 0, $$index3900 = 0, $$index3901 = 0;
 var $$index3902 = 0, $$index3903 = 0, $$index3904 = 0, $$index3905 = 0, $$index3906 = 0, $$index3907 = 0, $$index3908 = 0, $$index3909 = 0, $$index391 = 0, $$index3910 = 0, $$index3911 = 0, $$index3912 = 0, $$index3913 = 0, $$index3914 = 0, $$index3915 = 0, $$index3916 = 0, $$index3917 = 0, $$index3918 = 0, $$index3919 = 0, $$index392 = 0;
 var $$index3920 = 0, $$index3921 = 0, $$index3922 = 0, $$index3923 = 0, $$index3924 = 0, $$index3925 = 0, $$index3926 = 0, $$index3927 = 0, $$index3928 = 0, $$index3929 = 0, $$index393 = 0, $$index3930 = 0, $$index3931 = 0, $$index3932 = 0, $$index3933 = 0, $$index3934 = 0, $$index3935 = 0, $$index3936 = 0, $$index3937 = 0, $$index3938 = 0;
 var $$index3939 = 0, $$index394 = 0, $$index3940 = 0, $$index3941 = 0, $$index3942 = 0, $$index3943 = 0, $$index3944 = 0, $$index3945 = 0, $$index3946 = 0, $$index3947 = 0, $$index3948 = 0, $$index3949 = 0, $$index395 = 0, $$index3950 = 0, $$index3951 = 0, $$index3952 = 0, $$index3953 = 0, $$index3954 = 0, $$index3955 = 0, $$index3956 = 0;
 var $$index3957 = 0, $$index3958 = 0, $$index3959 = 0, $$index396 = 0, $$index3960 = 0, $$index3961 = 0, $$index3962 = 0, $$index3963 = 0, $$index3964 = 0, $$index3965 = 0, $$index3966 = 0, $$index3967 = 0, $$index3968 = 0, $$index3969 = 0, $$index397 = 0, $$index3970 = 0, $$index3971 = 0, $$index3972 = 0, $$index3973 = 0, $$index3974 = 0;
 var $$index3975 = 0, $$index3976 = 0, $$index3977 = 0, $$index3978 = 0, $$index3979 = 0, $$index398 = 0, $$index3980 = 0, $$index3981 = 0, $$index3982 = 0, $$index3983 = 0, $$index3984 = 0, $$index3985 = 0, $$index3986 = 0, $$index3987 = 0, $$index3988 = 0, $$index3989 = 0, $$index399 = 0, $$index3990 = 0, $$index3991 = 0, $$index3992 = 0;
 var $$index3993 = 0, $$index3994 = 0, $$index3995 = 0, $$index3996 = 0, $$index3997 = 0, $$index3998 = 0, $$index3999 = 0, $$index40 = 0, $$index400 = 0, $$index4000 = 0, $$index4001 = 0, $$index4002 = 0, $$index4003 = 0, $$index4004 = 0, $$index4005 = 0, $$index4006 = 0, $$index4007 = 0, $$index4008 = 0, $$index4009 = 0, $$index401 = 0;
 var $$index4010 = 0, $$index4011 = 0, $$index4012 = 0, $$index4013 = 0, $$index4014 = 0, $$index4015 = 0, $$index4016 = 0, $$index4017 = 0, $$index4018 = 0, $$index4019 = 0, $$index402 = 0, $$index4020 = 0, $$index4021 = 0, $$index4022 = 0, $$index4023 = 0, $$index4024 = 0, $$index4025 = 0, $$index4026 = 0, $$index4027 = 0, $$index4028 = 0;
 var $$index4029 = 0, $$index403 = 0, $$index4030 = 0, $$index4031 = 0, $$index4032 = 0, $$index4033 = 0, $$index4034 = 0, $$index4035 = 0, $$index4036 = 0, $$index4037 = 0, $$index4038 = 0, $$index4039 = 0, $$index404 = 0, $$index4040 = 0, $$index4041 = 0, $$index4042 = 0, $$index4043 = 0, $$index4044 = 0, $$index4045 = 0, $$index4046 = 0;
 var $$index4047 = 0, $$index4048 = 0, $$index4049 = 0, $$index405 = 0, $$index4050 = 0, $$index4051 = 0, $$index4052 = 0, $$index4053 = 0, $$index4054 = 0, $$index4055 = 0, $$index4056 = 0, $$index4057 = 0, $$index4058 = 0, $$index4059 = 0, $$index406 = 0, $$index4060 = 0, $$index4061 = 0, $$index4062 = 0, $$index4063 = 0, $$index4064 = 0;
 var $$index4065 = 0, $$index4066 = 0, $$index4067 = 0, $$index4068 = 0, $$index4069 = 0, $$index407 = 0, $$index4070 = 0, $$index4071 = 0, $$index4072 = 0, $$index4073 = 0, $$index4074 = 0, $$index4075 = 0, $$index4076 = 0, $$index4077 = 0, $$index4078 = 0, $$index4079 = 0, $$index408 = 0, $$index4080 = 0, $$index4081 = 0, $$index4082 = 0;
 var $$index4083 = 0, $$index4084 = 0, $$index4085 = 0, $$index4086 = 0, $$index4087 = 0, $$index4088 = 0, $$index4089 = 0, $$index409 = 0, $$index4090 = 0, $$index4091 = 0, $$index4092 = 0, $$index4093 = 0, $$index4094 = 0, $$index4095 = 0, $$index4096 = 0, $$index4097 = 0, $$index4098 = 0, $$index4099 = 0, $$index41 = 0, $$index410 = 0;
 var $$index4100 = 0, $$index4101 = 0, $$index4102 = 0, $$index4103 = 0, $$index4104 = 0, $$index4105 = 0, $$index4106 = 0, $$index4107 = 0, $$index4108 = 0, $$index4109 = 0, $$index411 = 0, $$index4110 = 0, $$index4112 = 0, $$index4113 = 0, $$index412 = 0, $$index413 = 0, $$index414 = 0, $$index415 = 0, $$index416 = 0, $$index417 = 0;
 var $$index418 = 0, $$index419 = 0, $$index42 = 0, $$index420 = 0, $$index421 = 0, $$index422 = 0, $$index423 = 0, $$index424 = 0, $$index425 = 0, $$index426 = 0, $$index427 = 0, $$index428 = 0, $$index429 = 0, $$index43 = 0, $$index430 = 0, $$index431 = 0, $$index432 = 0, $$index433 = 0, $$index434 = 0, $$index435 = 0;
 var $$index436 = 0, $$index437 = 0, $$index438 = 0, $$index439 = 0, $$index44 = 0, $$index440 = 0, $$index441 = 0, $$index442 = 0, $$index443 = 0, $$index444 = 0, $$index445 = 0, $$index446 = 0, $$index447 = 0, $$index448 = 0, $$index449 = 0, $$index45 = 0, $$index450 = 0, $$index451 = 0, $$index452 = 0, $$index453 = 0;
 var $$index454 = 0, $$index455 = 0, $$index456 = 0, $$index457 = 0, $$index458 = 0, $$index459 = 0, $$index46 = 0, $$index460 = 0, $$index461 = 0, $$index462 = 0, $$index463 = 0, $$index464 = 0, $$index465 = 0, $$index466 = 0, $$index467 = 0, $$index468 = 0, $$index469 = 0, $$index47 = 0, $$index470 = 0, $$index471 = 0;
 var $$index472 = 0, $$index473 = 0, $$index474 = 0, $$index475 = 0, $$index476 = 0, $$index477 = 0, $$index478 = 0, $$index479 = 0, $$index48 = 0, $$index480 = 0, $$index481 = 0, $$index482 = 0, $$index483 = 0, $$index484 = 0, $$index485 = 0, $$index486 = 0, $$index487 = 0, $$index488 = 0, $$index489 = 0, $$index49 = 0;
 var $$index490 = 0, $$index491 = 0, $$index492 = 0, $$index493 = 0, $$index494 = 0, $$index495 = 0, $$index496 = 0, $$index497 = 0, $$index498 = 0, $$index499 = 0, $$index50 = 0, $$index500 = 0, $$index501 = 0, $$index502 = 0, $$index503 = 0, $$index504 = 0, $$index505 = 0, $$index506 = 0, $$index507 = 0, $$index508 = 0;
 var $$index509 = 0, $$index51 = 0, $$index510 = 0, $$index511 = 0, $$index512 = 0, $$index513 = 0, $$index514 = 0, $$index515 = 0, $$index516 = 0, $$index517 = 0, $$index518 = 0, $$index519 = 0, $$index52 = 0, $$index520 = 0, $$index521 = 0, $$index522 = 0, $$index523 = 0, $$index524 = 0, $$index525 = 0, $$index526 = 0;
 var $$index527 = 0, $$index528 = 0, $$index529 = 0, $$index53 = 0, $$index530 = 0, $$index531 = 0, $$index532 = 0, $$index533 = 0, $$index534 = 0, $$index535 = 0, $$index536 = 0, $$index537 = 0, $$index538 = 0, $$index539 = 0, $$index54 = 0, $$index540 = 0, $$index541 = 0, $$index542 = 0, $$index543 = 0, $$index544 = 0;
 var $$index545 = 0, $$index546 = 0, $$index547 = 0, $$index548 = 0, $$index549 = 0, $$index55 = 0, $$index550 = 0, $$index551 = 0, $$index552 = 0, $$index553 = 0, $$index554 = 0, $$index555 = 0, $$index556 = 0, $$index557 = 0, $$index558 = 0, $$index559 = 0, $$index56 = 0, $$index560 = 0, $$index561 = 0, $$index562 = 0;
 var $$index563 = 0, $$index564 = 0, $$index565 = 0, $$index566 = 0, $$index567 = 0, $$index568 = 0, $$index569 = 0, $$index57 = 0, $$index570 = 0, $$index571 = 0, $$index572 = 0, $$index573 = 0, $$index574 = 0, $$index575 = 0, $$index576 = 0, $$index577 = 0, $$index578 = 0, $$index579 = 0, $$index58 = 0, $$index580 = 0;
 var $$index581 = 0, $$index582 = 0, $$index583 = 0, $$index584 = 0, $$index585 = 0, $$index586 = 0, $$index587 = 0, $$index588 = 0, $$index589 = 0, $$index59 = 0, $$index590 = 0, $$index591 = 0, $$index592 = 0, $$index593 = 0, $$index594 = 0, $$index595 = 0, $$index596 = 0, $$index597 = 0, $$index598 = 0, $$index599 = 0;
 var $$index60 = 0, $$index600 = 0, $$index601 = 0, $$index602 = 0, $$index603 = 0, $$index604 = 0, $$index605 = 0, $$index606 = 0, $$index607 = 0, $$index608 = 0, $$index609 = 0, $$index61 = 0, $$index610 = 0, $$index611 = 0, $$index612 = 0, $$index613 = 0, $$index614 = 0, $$index615 = 0, $$index616 = 0, $$index617 = 0;
 var $$index618 = 0, $$index619 = 0, $$index62 = 0, $$index620 = 0, $$index621 = 0, $$index622 = 0, $$index623 = 0, $$index624 = 0, $$index625 = 0, $$index626 = 0, $$index627 = 0, $$index628 = 0, $$index629 = 0, $$index63 = 0, $$index630 = 0, $$index631 = 0, $$index632 = 0, $$index633 = 0, $$index634 = 0, $$index635 = 0;
 var $$index636 = 0, $$index637 = 0, $$index638 = 0, $$index639 = 0, $$index64 = 0, $$index640 = 0, $$index641 = 0, $$index642 = 0, $$index643 = 0, $$index644 = 0, $$index645 = 0, $$index646 = 0, $$index647 = 0, $$index648 = 0, $$index649 = 0, $$index65 = 0, $$index650 = 0, $$index651 = 0, $$index652 = 0, $$index653 = 0;
 var $$index654 = 0, $$index655 = 0, $$index656 = 0, $$index657 = 0, $$index658 = 0, $$index659 = 0, $$index66 = 0, $$index660 = 0, $$index661 = 0, $$index662 = 0, $$index663 = 0, $$index664 = 0, $$index665 = 0, $$index666 = 0, $$index667 = 0, $$index668 = 0, $$index669 = 0, $$index67 = 0, $$index670 = 0, $$index671 = 0;
 var $$index672 = 0, $$index673 = 0, $$index674 = 0, $$index675 = 0, $$index676 = 0, $$index677 = 0, $$index678 = 0, $$index679 = 0, $$index68 = 0, $$index680 = 0, $$index681 = 0, $$index682 = 0, $$index683 = 0, $$index684 = 0, $$index685 = 0, $$index686 = 0, $$index687 = 0, $$index688 = 0, $$index689 = 0, $$index69 = 0;
 var $$index690 = 0, $$index691 = 0, $$index692 = 0, $$index693 = 0, $$index694 = 0, $$index695 = 0, $$index696 = 0, $$index697 = 0, $$index698 = 0, $$index699 = 0, $$index70 = 0, $$index700 = 0, $$index701 = 0, $$index702 = 0, $$index703 = 0, $$index704 = 0, $$index705 = 0, $$index706 = 0, $$index707 = 0, $$index708 = 0;
 var $$index709 = 0, $$index71 = 0, $$index710 = 0, $$index711 = 0, $$index712 = 0, $$index713 = 0, $$index714 = 0, $$index715 = 0, $$index716 = 0, $$index717 = 0, $$index718 = 0, $$index719 = 0, $$index72 = 0, $$index720 = 0, $$index721 = 0, $$index722 = 0, $$index723 = 0, $$index724 = 0, $$index725 = 0, $$index726 = 0;
 var $$index727 = 0, $$index728 = 0, $$index729 = 0, $$index73 = 0, $$index730 = 0, $$index731 = 0, $$index732 = 0, $$index733 = 0, $$index734 = 0, $$index735 = 0, $$index736 = 0, $$index737 = 0, $$index738 = 0, $$index739 = 0, $$index74 = 0, $$index740 = 0, $$index741 = 0, $$index742 = 0, $$index743 = 0, $$index744 = 0;
 var $$index745 = 0, $$index746 = 0, $$index747 = 0, $$index748 = 0, $$index749 = 0, $$index75 = 0, $$index750 = 0, $$index751 = 0, $$index752 = 0, $$index753 = 0, $$index754 = 0, $$index755 = 0, $$index756 = 0, $$index757 = 0, $$index758 = 0, $$index759 = 0, $$index76 = 0, $$index760 = 0, $$index761 = 0, $$index762 = 0;
 var $$index763 = 0, $$index764 = 0, $$index765 = 0, $$index766 = 0, $$index767 = 0, $$index768 = 0, $$index769 = 0, $$index77 = 0, $$index770 = 0, $$index771 = 0, $$index772 = 0, $$index773 = 0, $$index774 = 0, $$index775 = 0, $$index776 = 0, $$index777 = 0, $$index778 = 0, $$index779 = 0, $$index78 = 0, $$index780 = 0;
 var $$index781 = 0, $$index782 = 0, $$index783 = 0, $$index784 = 0, $$index785 = 0, $$index786 = 0, $$index787 = 0, $$index788 = 0, $$index789 = 0, $$index79 = 0, $$index790 = 0, $$index791 = 0, $$index792 = 0, $$index793 = 0, $$index794 = 0, $$index795 = 0, $$index796 = 0, $$index797 = 0, $$index798 = 0, $$index799 = 0;
 var $$index80 = 0, $$index800 = 0, $$index801 = 0, $$index802 = 0, $$index803 = 0, $$index804 = 0, $$index805 = 0, $$index806 = 0, $$index807 = 0, $$index808 = 0, $$index809 = 0, $$index81 = 0, $$index810 = 0, $$index811 = 0, $$index812 = 0, $$index813 = 0, $$index814 = 0, $$index815 = 0, $$index816 = 0, $$index817 = 0;
 var $$index818 = 0, $$index819 = 0, $$index82 = 0, $$index820 = 0, $$index821 = 0, $$index822 = 0, $$index823 = 0, $$index824 = 0, $$index825 = 0, $$index826 = 0, $$index827 = 0, $$index828 = 0, $$index829 = 0, $$index83 = 0, $$index830 = 0, $$index831 = 0, $$index832 = 0, $$index833 = 0, $$index834 = 0, $$index835 = 0;
 var $$index836 = 0, $$index837 = 0, $$index838 = 0, $$index839 = 0, $$index84 = 0, $$index840 = 0, $$index841 = 0, $$index842 = 0, $$index843 = 0, $$index844 = 0, $$index845 = 0, $$index846 = 0, $$index847 = 0, $$index848 = 0, $$index849 = 0, $$index85 = 0, $$index850 = 0, $$index851 = 0, $$index852 = 0, $$index853 = 0;
 var $$index854 = 0, $$index855 = 0, $$index856 = 0, $$index857 = 0, $$index858 = 0, $$index859 = 0, $$index86 = 0, $$index860 = 0, $$index861 = 0, $$index862 = 0, $$index863 = 0, $$index864 = 0, $$index865 = 0, $$index866 = 0, $$index867 = 0, $$index868 = 0, $$index869 = 0, $$index87 = 0, $$index870 = 0, $$index871 = 0;
 var $$index872 = 0, $$index873 = 0, $$index874 = 0, $$index875 = 0, $$index876 = 0, $$index877 = 0, $$index878 = 0, $$index879 = 0, $$index88 = 0, $$index880 = 0, $$index881 = 0, $$index882 = 0, $$index883 = 0, $$index884 = 0, $$index885 = 0, $$index886 = 0, $$index887 = 0, $$index888 = 0, $$index889 = 0, $$index89 = 0;
 var $$index890 = 0, $$index891 = 0, $$index892 = 0, $$index893 = 0, $$index894 = 0, $$index895 = 0, $$index896 = 0, $$index897 = 0, $$index898 = 0, $$index899 = 0, $$index90 = 0, $$index900 = 0, $$index901 = 0, $$index902 = 0, $$index903 = 0, $$index904 = 0, $$index905 = 0, $$index906 = 0, $$index907 = 0, $$index908 = 0;
 var $$index909 = 0, $$index91 = 0, $$index910 = 0, $$index911 = 0, $$index912 = 0, $$index913 = 0, $$index914 = 0, $$index915 = 0, $$index916 = 0, $$index917 = 0, $$index918 = 0, $$index919 = 0, $$index92 = 0, $$index920 = 0, $$index921 = 0, $$index922 = 0, $$index923 = 0, $$index924 = 0, $$index925 = 0, $$index926 = 0;
 var $$index927 = 0, $$index928 = 0, $$index929 = 0, $$index93 = 0, $$index930 = 0, $$index931 = 0, $$index932 = 0, $$index933 = 0, $$index934 = 0, $$index935 = 0, $$index936 = 0, $$index937 = 0, $$index938 = 0, $$index939 = 0, $$index94 = 0, $$index940 = 0, $$index941 = 0, $$index942 = 0, $$index943 = 0, $$index944 = 0;
 var $$index945 = 0, $$index946 = 0, $$index947 = 0, $$index948 = 0, $$index949 = 0, $$index95 = 0, $$index950 = 0, $$index951 = 0, $$index952 = 0, $$index953 = 0, $$index954 = 0, $$index955 = 0, $$index956 = 0, $$index957 = 0, $$index958 = 0, $$index959 = 0, $$index96 = 0, $$index960 = 0, $$index961 = 0, $$index962 = 0;
 var $$index963 = 0, $$index964 = 0, $$index965 = 0, $$index966 = 0, $$index967 = 0, $$index968 = 0, $$index969 = 0, $$index97 = 0, $$index970 = 0, $$index971 = 0, $$index972 = 0, $$index973 = 0, $$index974 = 0, $$index975 = 0, $$index976 = 0, $$index977 = 0, $$index978 = 0, $$index979 = 0, $$index98 = 0, $$index980 = 0;
 var $$index981 = 0, $$index982 = 0, $$index983 = 0, $$index984 = 0, $$index985 = 0, $$index986 = 0, $$index987 = 0, $$index988 = 0, $$index989 = 0, $$index99 = 0, $$index990 = 0, $$index991 = 0, $$index992 = 0, $$index993 = 0, $$index994 = 0, $$index995 = 0, $$index996 = 0, $$index997 = 0, $$index998 = 0, $$index999 = 0;
 var $$ptr = 0, $$ptr$index16400 = 0, $$ptr1 = 0, $$ptr1$index16425 = 0, $$ptr1$index16426 = 0, $$ptr2 = 0, $$ptr2$index16445 = 0, $$ptr3 = 0, $$ptr3$index16458 = 0, $$ptr3$index16459 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0;
 var $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0;
 var $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0;
 var $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0;
 var $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
 var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
 var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0;
 var $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0;
 var $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0;
 var $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $args$sreg$field = 0, $args$sreg$index4 = 0, $args$sreg$index7 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 4304|0;
 $0 = sp;
 $$ptr3 = sp + 168|0;
 $$ptr2 = sp + 152|0;
 $$ptr1 = sp + 128|0;
 $$ptr = sp + 112|0;
 $args$sreg$field = HEAP32[$args$ptr>>2]|0;
 $args$sreg$index4 = ((($args$ptr)) + 8|0);
 $1 = $args$sreg$index4;
 $2 = $1;
 $3 = HEAP32[$2>>2]|0;
 $4 = (($1) + 4)|0;
 $5 = $4;
 $6 = HEAP32[$5>>2]|0;
 $args$sreg$index7 = ((($args$ptr)) + 16|0);
 $7 = $args$sreg$index7;
 $8 = $7;
 $9 = HEAP32[$8>>2]|0;
 $10 = (($7) + 4)|0;
 $11 = $10;
 $12 = HEAP32[$11>>2]|0;
 $13 = sp + 192|0;
 $14 = sp + 88|0;
 $15 = sp + 200|0;
 $16 = sp + 64|0;
 $17 = sp + 40|0;
 $18 = sp + 16|0;
 HEAP32[$13>>2] = 0;
 HEAP32[$13>>2] = $fd;
 HEAP32[$14>>2] = 0;
 $$index10 = ((($14)) + 8|0);
 $19 = $$index10;
 $20 = $19;
 HEAP32[$20>>2] = 0;
 $21 = (($19) + 4)|0;
 $22 = $21;
 HEAP32[$22>>2] = 0;
 $$index11 = ((($14)) + 16|0);
 $23 = $$index11;
 $24 = $23;
 HEAP32[$24>>2] = 0;
 $25 = (($23) + 4)|0;
 $26 = $25;
 HEAP32[$26>>2] = 0;
 HEAP32[$14>>2] = $args$sreg$field;
 $$index13 = ((($14)) + 8|0);
 $27 = $$index13;
 $28 = $27;
 HEAP32[$28>>2] = $3;
 $29 = (($27) + 4)|0;
 $30 = $29;
 HEAP32[$30>>2] = $6;
 $$index14 = ((($14)) + 16|0);
 $31 = $$index14;
 $32 = $31;
 HEAP32[$32>>2] = $9;
 $33 = (($31) + 4)|0;
 $34 = $33;
 HEAP32[$34>>2] = $12;
 HEAP8[$15>>0] = 0;
 $$index16 = ((($15)) + 1|0);
 HEAP8[$$index16>>0] = 0;
 $$index17 = ((($15)) + 2|0);
 HEAP8[$$index17>>0] = 0;
 $$index18 = ((($15)) + 3|0);
 HEAP8[$$index18>>0] = 0;
 $$index19 = ((($15)) + 4|0);
 HEAP8[$$index19>>0] = 0;
 $$index20 = ((($15)) + 5|0);
 HEAP8[$$index20>>0] = 0;
 $$index21 = ((($15)) + 6|0);
 HEAP8[$$index21>>0] = 0;
 $$index22 = ((($15)) + 7|0);
 HEAP8[$$index22>>0] = 0;
 $$index23 = ((($15)) + 8|0);
 HEAP8[$$index23>>0] = 0;
 $$index24 = ((($15)) + 9|0);
 HEAP8[$$index24>>0] = 0;
 $$index25 = ((($15)) + 10|0);
 HEAP8[$$index25>>0] = 0;
 $$index26 = ((($15)) + 11|0);
 HEAP8[$$index26>>0] = 0;
 $$index27 = ((($15)) + 12|0);
 HEAP8[$$index27>>0] = 0;
 $$index28 = ((($15)) + 13|0);
 HEAP8[$$index28>>0] = 0;
 $$index29 = ((($15)) + 14|0);
 HEAP8[$$index29>>0] = 0;
 $$index30 = ((($15)) + 15|0);
 HEAP8[$$index30>>0] = 0;
 $$index31 = ((($15)) + 16|0);
 HEAP8[$$index31>>0] = 0;
 $$index32 = ((($15)) + 17|0);
 HEAP8[$$index32>>0] = 0;
 $$index33 = ((($15)) + 18|0);
 HEAP8[$$index33>>0] = 0;
 $$index34 = ((($15)) + 19|0);
 HEAP8[$$index34>>0] = 0;
 $$index35 = ((($15)) + 20|0);
 HEAP8[$$index35>>0] = 0;
 $$index36 = ((($15)) + 21|0);
 HEAP8[$$index36>>0] = 0;
 $$index37 = ((($15)) + 22|0);
 HEAP8[$$index37>>0] = 0;
 $$index38 = ((($15)) + 23|0);
 HEAP8[$$index38>>0] = 0;
 $$index39 = ((($15)) + 24|0);
 HEAP8[$$index39>>0] = 0;
 $$index40 = ((($15)) + 25|0);
 HEAP8[$$index40>>0] = 0;
 $$index41 = ((($15)) + 26|0);
 HEAP8[$$index41>>0] = 0;
 $$index42 = ((($15)) + 27|0);
 HEAP8[$$index42>>0] = 0;
 $$index43 = ((($15)) + 28|0);
 HEAP8[$$index43>>0] = 0;
 $$index44 = ((($15)) + 29|0);
 HEAP8[$$index44>>0] = 0;
 $$index45 = ((($15)) + 30|0);
 HEAP8[$$index45>>0] = 0;
 $$index46 = ((($15)) + 31|0);
 HEAP8[$$index46>>0] = 0;
 $$index47 = ((($15)) + 32|0);
 HEAP8[$$index47>>0] = 0;
 $$index48 = ((($15)) + 33|0);
 HEAP8[$$index48>>0] = 0;
 $$index49 = ((($15)) + 34|0);
 HEAP8[$$index49>>0] = 0;
 $$index50 = ((($15)) + 35|0);
 HEAP8[$$index50>>0] = 0;
 $$index51 = ((($15)) + 36|0);
 HEAP8[$$index51>>0] = 0;
 $$index52 = ((($15)) + 37|0);
 HEAP8[$$index52>>0] = 0;
 $$index53 = ((($15)) + 38|0);
 HEAP8[$$index53>>0] = 0;
 $$index54 = ((($15)) + 39|0);
 HEAP8[$$index54>>0] = 0;
 $$index55 = ((($15)) + 40|0);
 HEAP8[$$index55>>0] = 0;
 $$index56 = ((($15)) + 41|0);
 HEAP8[$$index56>>0] = 0;
 $$index57 = ((($15)) + 42|0);
 HEAP8[$$index57>>0] = 0;
 $$index58 = ((($15)) + 43|0);
 HEAP8[$$index58>>0] = 0;
 $$index59 = ((($15)) + 44|0);
 HEAP8[$$index59>>0] = 0;
 $$index60 = ((($15)) + 45|0);
 HEAP8[$$index60>>0] = 0;
 $$index61 = ((($15)) + 46|0);
 HEAP8[$$index61>>0] = 0;
 $$index62 = ((($15)) + 47|0);
 HEAP8[$$index62>>0] = 0;
 $$index63 = ((($15)) + 48|0);
 HEAP8[$$index63>>0] = 0;
 $$index64 = ((($15)) + 49|0);
 HEAP8[$$index64>>0] = 0;
 $$index65 = ((($15)) + 50|0);
 HEAP8[$$index65>>0] = 0;
 $$index66 = ((($15)) + 51|0);
 HEAP8[$$index66>>0] = 0;
 $$index67 = ((($15)) + 52|0);
 HEAP8[$$index67>>0] = 0;
 $$index68 = ((($15)) + 53|0);
 HEAP8[$$index68>>0] = 0;
 $$index69 = ((($15)) + 54|0);
 HEAP8[$$index69>>0] = 0;
 $$index70 = ((($15)) + 55|0);
 HEAP8[$$index70>>0] = 0;
 $$index71 = ((($15)) + 56|0);
 HEAP8[$$index71>>0] = 0;
 $$index72 = ((($15)) + 57|0);
 HEAP8[$$index72>>0] = 0;
 $$index73 = ((($15)) + 58|0);
 HEAP8[$$index73>>0] = 0;
 $$index74 = ((($15)) + 59|0);
 HEAP8[$$index74>>0] = 0;
 $$index75 = ((($15)) + 60|0);
 HEAP8[$$index75>>0] = 0;
 $$index76 = ((($15)) + 61|0);
 HEAP8[$$index76>>0] = 0;
 $$index77 = ((($15)) + 62|0);
 HEAP8[$$index77>>0] = 0;
 $$index78 = ((($15)) + 63|0);
 HEAP8[$$index78>>0] = 0;
 $$index79 = ((($15)) + 64|0);
 HEAP8[$$index79>>0] = 0;
 $$index80 = ((($15)) + 65|0);
 HEAP8[$$index80>>0] = 0;
 $$index81 = ((($15)) + 66|0);
 HEAP8[$$index81>>0] = 0;
 $$index82 = ((($15)) + 67|0);
 HEAP8[$$index82>>0] = 0;
 $$index83 = ((($15)) + 68|0);
 HEAP8[$$index83>>0] = 0;
 $$index84 = ((($15)) + 69|0);
 HEAP8[$$index84>>0] = 0;
 $$index85 = ((($15)) + 70|0);
 HEAP8[$$index85>>0] = 0;
 $$index86 = ((($15)) + 71|0);
 HEAP8[$$index86>>0] = 0;
 $$index87 = ((($15)) + 72|0);
 HEAP8[$$index87>>0] = 0;
 $$index88 = ((($15)) + 73|0);
 HEAP8[$$index88>>0] = 0;
 $$index89 = ((($15)) + 74|0);
 HEAP8[$$index89>>0] = 0;
 $$index90 = ((($15)) + 75|0);
 HEAP8[$$index90>>0] = 0;
 $$index91 = ((($15)) + 76|0);
 HEAP8[$$index91>>0] = 0;
 $$index92 = ((($15)) + 77|0);
 HEAP8[$$index92>>0] = 0;
 $$index93 = ((($15)) + 78|0);
 HEAP8[$$index93>>0] = 0;
 $$index94 = ((($15)) + 79|0);
 HEAP8[$$index94>>0] = 0;
 $$index95 = ((($15)) + 80|0);
 HEAP8[$$index95>>0] = 0;
 $$index96 = ((($15)) + 81|0);
 HEAP8[$$index96>>0] = 0;
 $$index97 = ((($15)) + 82|0);
 HEAP8[$$index97>>0] = 0;
 $$index98 = ((($15)) + 83|0);
 HEAP8[$$index98>>0] = 0;
 $$index99 = ((($15)) + 84|0);
 HEAP8[$$index99>>0] = 0;
 $$index100 = ((($15)) + 85|0);
 HEAP8[$$index100>>0] = 0;
 $$index101 = ((($15)) + 86|0);
 HEAP8[$$index101>>0] = 0;
 $$index102 = ((($15)) + 87|0);
 HEAP8[$$index102>>0] = 0;
 $$index103 = ((($15)) + 88|0);
 HEAP8[$$index103>>0] = 0;
 $$index104 = ((($15)) + 89|0);
 HEAP8[$$index104>>0] = 0;
 $$index105 = ((($15)) + 90|0);
 HEAP8[$$index105>>0] = 0;
 $$index106 = ((($15)) + 91|0);
 HEAP8[$$index106>>0] = 0;
 $$index107 = ((($15)) + 92|0);
 HEAP8[$$index107>>0] = 0;
 $$index108 = ((($15)) + 93|0);
 HEAP8[$$index108>>0] = 0;
 $$index109 = ((($15)) + 94|0);
 HEAP8[$$index109>>0] = 0;
 $$index110 = ((($15)) + 95|0);
 HEAP8[$$index110>>0] = 0;
 $$index111 = ((($15)) + 96|0);
 HEAP8[$$index111>>0] = 0;
 $$index112 = ((($15)) + 97|0);
 HEAP8[$$index112>>0] = 0;
 $$index113 = ((($15)) + 98|0);
 HEAP8[$$index113>>0] = 0;
 $$index114 = ((($15)) + 99|0);
 HEAP8[$$index114>>0] = 0;
 $$index115 = ((($15)) + 100|0);
 HEAP8[$$index115>>0] = 0;
 $$index116 = ((($15)) + 101|0);
 HEAP8[$$index116>>0] = 0;
 $$index117 = ((($15)) + 102|0);
 HEAP8[$$index117>>0] = 0;
 $$index118 = ((($15)) + 103|0);
 HEAP8[$$index118>>0] = 0;
 $$index119 = ((($15)) + 104|0);
 HEAP8[$$index119>>0] = 0;
 $$index120 = ((($15)) + 105|0);
 HEAP8[$$index120>>0] = 0;
 $$index121 = ((($15)) + 106|0);
 HEAP8[$$index121>>0] = 0;
 $$index122 = ((($15)) + 107|0);
 HEAP8[$$index122>>0] = 0;
 $$index123 = ((($15)) + 108|0);
 HEAP8[$$index123>>0] = 0;
 $$index124 = ((($15)) + 109|0);
 HEAP8[$$index124>>0] = 0;
 $$index125 = ((($15)) + 110|0);
 HEAP8[$$index125>>0] = 0;
 $$index126 = ((($15)) + 111|0);
 HEAP8[$$index126>>0] = 0;
 $$index127 = ((($15)) + 112|0);
 HEAP8[$$index127>>0] = 0;
 $$index128 = ((($15)) + 113|0);
 HEAP8[$$index128>>0] = 0;
 $$index129 = ((($15)) + 114|0);
 HEAP8[$$index129>>0] = 0;
 $$index130 = ((($15)) + 115|0);
 HEAP8[$$index130>>0] = 0;
 $$index131 = ((($15)) + 116|0);
 HEAP8[$$index131>>0] = 0;
 $$index132 = ((($15)) + 117|0);
 HEAP8[$$index132>>0] = 0;
 $$index133 = ((($15)) + 118|0);
 HEAP8[$$index133>>0] = 0;
 $$index134 = ((($15)) + 119|0);
 HEAP8[$$index134>>0] = 0;
 $$index135 = ((($15)) + 120|0);
 HEAP8[$$index135>>0] = 0;
 $$index136 = ((($15)) + 121|0);
 HEAP8[$$index136>>0] = 0;
 $$index137 = ((($15)) + 122|0);
 HEAP8[$$index137>>0] = 0;
 $$index138 = ((($15)) + 123|0);
 HEAP8[$$index138>>0] = 0;
 $$index139 = ((($15)) + 124|0);
 HEAP8[$$index139>>0] = 0;
 $$index140 = ((($15)) + 125|0);
 HEAP8[$$index140>>0] = 0;
 $$index141 = ((($15)) + 126|0);
 HEAP8[$$index141>>0] = 0;
 $$index142 = ((($15)) + 127|0);
 HEAP8[$$index142>>0] = 0;
 $$index143 = ((($15)) + 128|0);
 HEAP8[$$index143>>0] = 0;
 $$index144 = ((($15)) + 129|0);
 HEAP8[$$index144>>0] = 0;
 $$index145 = ((($15)) + 130|0);
 HEAP8[$$index145>>0] = 0;
 $$index146 = ((($15)) + 131|0);
 HEAP8[$$index146>>0] = 0;
 $$index147 = ((($15)) + 132|0);
 HEAP8[$$index147>>0] = 0;
 $$index148 = ((($15)) + 133|0);
 HEAP8[$$index148>>0] = 0;
 $$index149 = ((($15)) + 134|0);
 HEAP8[$$index149>>0] = 0;
 $$index150 = ((($15)) + 135|0);
 HEAP8[$$index150>>0] = 0;
 $$index151 = ((($15)) + 136|0);
 HEAP8[$$index151>>0] = 0;
 $$index152 = ((($15)) + 137|0);
 HEAP8[$$index152>>0] = 0;
 $$index153 = ((($15)) + 138|0);
 HEAP8[$$index153>>0] = 0;
 $$index154 = ((($15)) + 139|0);
 HEAP8[$$index154>>0] = 0;
 $$index155 = ((($15)) + 140|0);
 HEAP8[$$index155>>0] = 0;
 $$index156 = ((($15)) + 141|0);
 HEAP8[$$index156>>0] = 0;
 $$index157 = ((($15)) + 142|0);
 HEAP8[$$index157>>0] = 0;
 $$index158 = ((($15)) + 143|0);
 HEAP8[$$index158>>0] = 0;
 $$index159 = ((($15)) + 144|0);
 HEAP8[$$index159>>0] = 0;
 $$index160 = ((($15)) + 145|0);
 HEAP8[$$index160>>0] = 0;
 $$index161 = ((($15)) + 146|0);
 HEAP8[$$index161>>0] = 0;
 $$index162 = ((($15)) + 147|0);
 HEAP8[$$index162>>0] = 0;
 $$index163 = ((($15)) + 148|0);
 HEAP8[$$index163>>0] = 0;
 $$index164 = ((($15)) + 149|0);
 HEAP8[$$index164>>0] = 0;
 $$index165 = ((($15)) + 150|0);
 HEAP8[$$index165>>0] = 0;
 $$index166 = ((($15)) + 151|0);
 HEAP8[$$index166>>0] = 0;
 $$index167 = ((($15)) + 152|0);
 HEAP8[$$index167>>0] = 0;
 $$index168 = ((($15)) + 153|0);
 HEAP8[$$index168>>0] = 0;
 $$index169 = ((($15)) + 154|0);
 HEAP8[$$index169>>0] = 0;
 $$index170 = ((($15)) + 155|0);
 HEAP8[$$index170>>0] = 0;
 $$index171 = ((($15)) + 156|0);
 HEAP8[$$index171>>0] = 0;
 $$index172 = ((($15)) + 157|0);
 HEAP8[$$index172>>0] = 0;
 $$index173 = ((($15)) + 158|0);
 HEAP8[$$index173>>0] = 0;
 $$index174 = ((($15)) + 159|0);
 HEAP8[$$index174>>0] = 0;
 $$index175 = ((($15)) + 160|0);
 HEAP8[$$index175>>0] = 0;
 $$index176 = ((($15)) + 161|0);
 HEAP8[$$index176>>0] = 0;
 $$index177 = ((($15)) + 162|0);
 HEAP8[$$index177>>0] = 0;
 $$index178 = ((($15)) + 163|0);
 HEAP8[$$index178>>0] = 0;
 $$index179 = ((($15)) + 164|0);
 HEAP8[$$index179>>0] = 0;
 $$index180 = ((($15)) + 165|0);
 HEAP8[$$index180>>0] = 0;
 $$index181 = ((($15)) + 166|0);
 HEAP8[$$index181>>0] = 0;
 $$index182 = ((($15)) + 167|0);
 HEAP8[$$index182>>0] = 0;
 $$index183 = ((($15)) + 168|0);
 HEAP8[$$index183>>0] = 0;
 $$index184 = ((($15)) + 169|0);
 HEAP8[$$index184>>0] = 0;
 $$index185 = ((($15)) + 170|0);
 HEAP8[$$index185>>0] = 0;
 $$index186 = ((($15)) + 171|0);
 HEAP8[$$index186>>0] = 0;
 $$index187 = ((($15)) + 172|0);
 HEAP8[$$index187>>0] = 0;
 $$index188 = ((($15)) + 173|0);
 HEAP8[$$index188>>0] = 0;
 $$index189 = ((($15)) + 174|0);
 HEAP8[$$index189>>0] = 0;
 $$index190 = ((($15)) + 175|0);
 HEAP8[$$index190>>0] = 0;
 $$index191 = ((($15)) + 176|0);
 HEAP8[$$index191>>0] = 0;
 $$index192 = ((($15)) + 177|0);
 HEAP8[$$index192>>0] = 0;
 $$index193 = ((($15)) + 178|0);
 HEAP8[$$index193>>0] = 0;
 $$index194 = ((($15)) + 179|0);
 HEAP8[$$index194>>0] = 0;
 $$index195 = ((($15)) + 180|0);
 HEAP8[$$index195>>0] = 0;
 $$index196 = ((($15)) + 181|0);
 HEAP8[$$index196>>0] = 0;
 $$index197 = ((($15)) + 182|0);
 HEAP8[$$index197>>0] = 0;
 $$index198 = ((($15)) + 183|0);
 HEAP8[$$index198>>0] = 0;
 $$index199 = ((($15)) + 184|0);
 HEAP8[$$index199>>0] = 0;
 $$index200 = ((($15)) + 185|0);
 HEAP8[$$index200>>0] = 0;
 $$index201 = ((($15)) + 186|0);
 HEAP8[$$index201>>0] = 0;
 $$index202 = ((($15)) + 187|0);
 HEAP8[$$index202>>0] = 0;
 $$index203 = ((($15)) + 188|0);
 HEAP8[$$index203>>0] = 0;
 $$index204 = ((($15)) + 189|0);
 HEAP8[$$index204>>0] = 0;
 $$index205 = ((($15)) + 190|0);
 HEAP8[$$index205>>0] = 0;
 $$index206 = ((($15)) + 191|0);
 HEAP8[$$index206>>0] = 0;
 $$index207 = ((($15)) + 192|0);
 HEAP8[$$index207>>0] = 0;
 $$index208 = ((($15)) + 193|0);
 HEAP8[$$index208>>0] = 0;
 $$index209 = ((($15)) + 194|0);
 HEAP8[$$index209>>0] = 0;
 $$index210 = ((($15)) + 195|0);
 HEAP8[$$index210>>0] = 0;
 $$index211 = ((($15)) + 196|0);
 HEAP8[$$index211>>0] = 0;
 $$index212 = ((($15)) + 197|0);
 HEAP8[$$index212>>0] = 0;
 $$index213 = ((($15)) + 198|0);
 HEAP8[$$index213>>0] = 0;
 $$index214 = ((($15)) + 199|0);
 HEAP8[$$index214>>0] = 0;
 $$index215 = ((($15)) + 200|0);
 HEAP8[$$index215>>0] = 0;
 $$index216 = ((($15)) + 201|0);
 HEAP8[$$index216>>0] = 0;
 $$index217 = ((($15)) + 202|0);
 HEAP8[$$index217>>0] = 0;
 $$index218 = ((($15)) + 203|0);
 HEAP8[$$index218>>0] = 0;
 $$index219 = ((($15)) + 204|0);
 HEAP8[$$index219>>0] = 0;
 $$index220 = ((($15)) + 205|0);
 HEAP8[$$index220>>0] = 0;
 $$index221 = ((($15)) + 206|0);
 HEAP8[$$index221>>0] = 0;
 $$index222 = ((($15)) + 207|0);
 HEAP8[$$index222>>0] = 0;
 $$index223 = ((($15)) + 208|0);
 HEAP8[$$index223>>0] = 0;
 $$index224 = ((($15)) + 209|0);
 HEAP8[$$index224>>0] = 0;
 $$index225 = ((($15)) + 210|0);
 HEAP8[$$index225>>0] = 0;
 $$index226 = ((($15)) + 211|0);
 HEAP8[$$index226>>0] = 0;
 $$index227 = ((($15)) + 212|0);
 HEAP8[$$index227>>0] = 0;
 $$index228 = ((($15)) + 213|0);
 HEAP8[$$index228>>0] = 0;
 $$index229 = ((($15)) + 214|0);
 HEAP8[$$index229>>0] = 0;
 $$index230 = ((($15)) + 215|0);
 HEAP8[$$index230>>0] = 0;
 $$index231 = ((($15)) + 216|0);
 HEAP8[$$index231>>0] = 0;
 $$index232 = ((($15)) + 217|0);
 HEAP8[$$index232>>0] = 0;
 $$index233 = ((($15)) + 218|0);
 HEAP8[$$index233>>0] = 0;
 $$index234 = ((($15)) + 219|0);
 HEAP8[$$index234>>0] = 0;
 $$index235 = ((($15)) + 220|0);
 HEAP8[$$index235>>0] = 0;
 $$index236 = ((($15)) + 221|0);
 HEAP8[$$index236>>0] = 0;
 $$index237 = ((($15)) + 222|0);
 HEAP8[$$index237>>0] = 0;
 $$index238 = ((($15)) + 223|0);
 HEAP8[$$index238>>0] = 0;
 $$index239 = ((($15)) + 224|0);
 HEAP8[$$index239>>0] = 0;
 $$index240 = ((($15)) + 225|0);
 HEAP8[$$index240>>0] = 0;
 $$index241 = ((($15)) + 226|0);
 HEAP8[$$index241>>0] = 0;
 $$index242 = ((($15)) + 227|0);
 HEAP8[$$index242>>0] = 0;
 $$index243 = ((($15)) + 228|0);
 HEAP8[$$index243>>0] = 0;
 $$index244 = ((($15)) + 229|0);
 HEAP8[$$index244>>0] = 0;
 $$index245 = ((($15)) + 230|0);
 HEAP8[$$index245>>0] = 0;
 $$index246 = ((($15)) + 231|0);
 HEAP8[$$index246>>0] = 0;
 $$index247 = ((($15)) + 232|0);
 HEAP8[$$index247>>0] = 0;
 $$index248 = ((($15)) + 233|0);
 HEAP8[$$index248>>0] = 0;
 $$index249 = ((($15)) + 234|0);
 HEAP8[$$index249>>0] = 0;
 $$index250 = ((($15)) + 235|0);
 HEAP8[$$index250>>0] = 0;
 $$index251 = ((($15)) + 236|0);
 HEAP8[$$index251>>0] = 0;
 $$index252 = ((($15)) + 237|0);
 HEAP8[$$index252>>0] = 0;
 $$index253 = ((($15)) + 238|0);
 HEAP8[$$index253>>0] = 0;
 $$index254 = ((($15)) + 239|0);
 HEAP8[$$index254>>0] = 0;
 $$index255 = ((($15)) + 240|0);
 HEAP8[$$index255>>0] = 0;
 $$index256 = ((($15)) + 241|0);
 HEAP8[$$index256>>0] = 0;
 $$index257 = ((($15)) + 242|0);
 HEAP8[$$index257>>0] = 0;
 $$index258 = ((($15)) + 243|0);
 HEAP8[$$index258>>0] = 0;
 $$index259 = ((($15)) + 244|0);
 HEAP8[$$index259>>0] = 0;
 $$index260 = ((($15)) + 245|0);
 HEAP8[$$index260>>0] = 0;
 $$index261 = ((($15)) + 246|0);
 HEAP8[$$index261>>0] = 0;
 $$index262 = ((($15)) + 247|0);
 HEAP8[$$index262>>0] = 0;
 $$index263 = ((($15)) + 248|0);
 HEAP8[$$index263>>0] = 0;
 $$index264 = ((($15)) + 249|0);
 HEAP8[$$index264>>0] = 0;
 $$index265 = ((($15)) + 250|0);
 HEAP8[$$index265>>0] = 0;
 $$index266 = ((($15)) + 251|0);
 HEAP8[$$index266>>0] = 0;
 $$index267 = ((($15)) + 252|0);
 HEAP8[$$index267>>0] = 0;
 $$index268 = ((($15)) + 253|0);
 HEAP8[$$index268>>0] = 0;
 $$index269 = ((($15)) + 254|0);
 HEAP8[$$index269>>0] = 0;
 $$index270 = ((($15)) + 255|0);
 HEAP8[$$index270>>0] = 0;
 $$index271 = ((($15)) + 256|0);
 HEAP8[$$index271>>0] = 0;
 $$index272 = ((($15)) + 257|0);
 HEAP8[$$index272>>0] = 0;
 $$index273 = ((($15)) + 258|0);
 HEAP8[$$index273>>0] = 0;
 $$index274 = ((($15)) + 259|0);
 HEAP8[$$index274>>0] = 0;
 $$index275 = ((($15)) + 260|0);
 HEAP8[$$index275>>0] = 0;
 $$index276 = ((($15)) + 261|0);
 HEAP8[$$index276>>0] = 0;
 $$index277 = ((($15)) + 262|0);
 HEAP8[$$index277>>0] = 0;
 $$index278 = ((($15)) + 263|0);
 HEAP8[$$index278>>0] = 0;
 $$index279 = ((($15)) + 264|0);
 HEAP8[$$index279>>0] = 0;
 $$index280 = ((($15)) + 265|0);
 HEAP8[$$index280>>0] = 0;
 $$index281 = ((($15)) + 266|0);
 HEAP8[$$index281>>0] = 0;
 $$index282 = ((($15)) + 267|0);
 HEAP8[$$index282>>0] = 0;
 $$index283 = ((($15)) + 268|0);
 HEAP8[$$index283>>0] = 0;
 $$index284 = ((($15)) + 269|0);
 HEAP8[$$index284>>0] = 0;
 $$index285 = ((($15)) + 270|0);
 HEAP8[$$index285>>0] = 0;
 $$index286 = ((($15)) + 271|0);
 HEAP8[$$index286>>0] = 0;
 $$index287 = ((($15)) + 272|0);
 HEAP8[$$index287>>0] = 0;
 $$index288 = ((($15)) + 273|0);
 HEAP8[$$index288>>0] = 0;
 $$index289 = ((($15)) + 274|0);
 HEAP8[$$index289>>0] = 0;
 $$index290 = ((($15)) + 275|0);
 HEAP8[$$index290>>0] = 0;
 $$index291 = ((($15)) + 276|0);
 HEAP8[$$index291>>0] = 0;
 $$index292 = ((($15)) + 277|0);
 HEAP8[$$index292>>0] = 0;
 $$index293 = ((($15)) + 278|0);
 HEAP8[$$index293>>0] = 0;
 $$index294 = ((($15)) + 279|0);
 HEAP8[$$index294>>0] = 0;
 $$index295 = ((($15)) + 280|0);
 HEAP8[$$index295>>0] = 0;
 $$index296 = ((($15)) + 281|0);
 HEAP8[$$index296>>0] = 0;
 $$index297 = ((($15)) + 282|0);
 HEAP8[$$index297>>0] = 0;
 $$index298 = ((($15)) + 283|0);
 HEAP8[$$index298>>0] = 0;
 $$index299 = ((($15)) + 284|0);
 HEAP8[$$index299>>0] = 0;
 $$index300 = ((($15)) + 285|0);
 HEAP8[$$index300>>0] = 0;
 $$index301 = ((($15)) + 286|0);
 HEAP8[$$index301>>0] = 0;
 $$index302 = ((($15)) + 287|0);
 HEAP8[$$index302>>0] = 0;
 $$index303 = ((($15)) + 288|0);
 HEAP8[$$index303>>0] = 0;
 $$index304 = ((($15)) + 289|0);
 HEAP8[$$index304>>0] = 0;
 $$index305 = ((($15)) + 290|0);
 HEAP8[$$index305>>0] = 0;
 $$index306 = ((($15)) + 291|0);
 HEAP8[$$index306>>0] = 0;
 $$index307 = ((($15)) + 292|0);
 HEAP8[$$index307>>0] = 0;
 $$index308 = ((($15)) + 293|0);
 HEAP8[$$index308>>0] = 0;
 $$index309 = ((($15)) + 294|0);
 HEAP8[$$index309>>0] = 0;
 $$index310 = ((($15)) + 295|0);
 HEAP8[$$index310>>0] = 0;
 $$index311 = ((($15)) + 296|0);
 HEAP8[$$index311>>0] = 0;
 $$index312 = ((($15)) + 297|0);
 HEAP8[$$index312>>0] = 0;
 $$index313 = ((($15)) + 298|0);
 HEAP8[$$index313>>0] = 0;
 $$index314 = ((($15)) + 299|0);
 HEAP8[$$index314>>0] = 0;
 $$index315 = ((($15)) + 300|0);
 HEAP8[$$index315>>0] = 0;
 $$index316 = ((($15)) + 301|0);
 HEAP8[$$index316>>0] = 0;
 $$index317 = ((($15)) + 302|0);
 HEAP8[$$index317>>0] = 0;
 $$index318 = ((($15)) + 303|0);
 HEAP8[$$index318>>0] = 0;
 $$index319 = ((($15)) + 304|0);
 HEAP8[$$index319>>0] = 0;
 $$index320 = ((($15)) + 305|0);
 HEAP8[$$index320>>0] = 0;
 $$index321 = ((($15)) + 306|0);
 HEAP8[$$index321>>0] = 0;
 $$index322 = ((($15)) + 307|0);
 HEAP8[$$index322>>0] = 0;
 $$index323 = ((($15)) + 308|0);
 HEAP8[$$index323>>0] = 0;
 $$index324 = ((($15)) + 309|0);
 HEAP8[$$index324>>0] = 0;
 $$index325 = ((($15)) + 310|0);
 HEAP8[$$index325>>0] = 0;
 $$index326 = ((($15)) + 311|0);
 HEAP8[$$index326>>0] = 0;
 $$index327 = ((($15)) + 312|0);
 HEAP8[$$index327>>0] = 0;
 $$index328 = ((($15)) + 313|0);
 HEAP8[$$index328>>0] = 0;
 $$index329 = ((($15)) + 314|0);
 HEAP8[$$index329>>0] = 0;
 $$index330 = ((($15)) + 315|0);
 HEAP8[$$index330>>0] = 0;
 $$index331 = ((($15)) + 316|0);
 HEAP8[$$index331>>0] = 0;
 $$index332 = ((($15)) + 317|0);
 HEAP8[$$index332>>0] = 0;
 $$index333 = ((($15)) + 318|0);
 HEAP8[$$index333>>0] = 0;
 $$index334 = ((($15)) + 319|0);
 HEAP8[$$index334>>0] = 0;
 $$index335 = ((($15)) + 320|0);
 HEAP8[$$index335>>0] = 0;
 $$index336 = ((($15)) + 321|0);
 HEAP8[$$index336>>0] = 0;
 $$index337 = ((($15)) + 322|0);
 HEAP8[$$index337>>0] = 0;
 $$index338 = ((($15)) + 323|0);
 HEAP8[$$index338>>0] = 0;
 $$index339 = ((($15)) + 324|0);
 HEAP8[$$index339>>0] = 0;
 $$index340 = ((($15)) + 325|0);
 HEAP8[$$index340>>0] = 0;
 $$index341 = ((($15)) + 326|0);
 HEAP8[$$index341>>0] = 0;
 $$index342 = ((($15)) + 327|0);
 HEAP8[$$index342>>0] = 0;
 $$index343 = ((($15)) + 328|0);
 HEAP8[$$index343>>0] = 0;
 $$index344 = ((($15)) + 329|0);
 HEAP8[$$index344>>0] = 0;
 $$index345 = ((($15)) + 330|0);
 HEAP8[$$index345>>0] = 0;
 $$index346 = ((($15)) + 331|0);
 HEAP8[$$index346>>0] = 0;
 $$index347 = ((($15)) + 332|0);
 HEAP8[$$index347>>0] = 0;
 $$index348 = ((($15)) + 333|0);
 HEAP8[$$index348>>0] = 0;
 $$index349 = ((($15)) + 334|0);
 HEAP8[$$index349>>0] = 0;
 $$index350 = ((($15)) + 335|0);
 HEAP8[$$index350>>0] = 0;
 $$index351 = ((($15)) + 336|0);
 HEAP8[$$index351>>0] = 0;
 $$index352 = ((($15)) + 337|0);
 HEAP8[$$index352>>0] = 0;
 $$index353 = ((($15)) + 338|0);
 HEAP8[$$index353>>0] = 0;
 $$index354 = ((($15)) + 339|0);
 HEAP8[$$index354>>0] = 0;
 $$index355 = ((($15)) + 340|0);
 HEAP8[$$index355>>0] = 0;
 $$index356 = ((($15)) + 341|0);
 HEAP8[$$index356>>0] = 0;
 $$index357 = ((($15)) + 342|0);
 HEAP8[$$index357>>0] = 0;
 $$index358 = ((($15)) + 343|0);
 HEAP8[$$index358>>0] = 0;
 $$index359 = ((($15)) + 344|0);
 HEAP8[$$index359>>0] = 0;
 $$index360 = ((($15)) + 345|0);
 HEAP8[$$index360>>0] = 0;
 $$index361 = ((($15)) + 346|0);
 HEAP8[$$index361>>0] = 0;
 $$index362 = ((($15)) + 347|0);
 HEAP8[$$index362>>0] = 0;
 $$index363 = ((($15)) + 348|0);
 HEAP8[$$index363>>0] = 0;
 $$index364 = ((($15)) + 349|0);
 HEAP8[$$index364>>0] = 0;
 $$index365 = ((($15)) + 350|0);
 HEAP8[$$index365>>0] = 0;
 $$index366 = ((($15)) + 351|0);
 HEAP8[$$index366>>0] = 0;
 $$index367 = ((($15)) + 352|0);
 HEAP8[$$index367>>0] = 0;
 $$index368 = ((($15)) + 353|0);
 HEAP8[$$index368>>0] = 0;
 $$index369 = ((($15)) + 354|0);
 HEAP8[$$index369>>0] = 0;
 $$index370 = ((($15)) + 355|0);
 HEAP8[$$index370>>0] = 0;
 $$index371 = ((($15)) + 356|0);
 HEAP8[$$index371>>0] = 0;
 $$index372 = ((($15)) + 357|0);
 HEAP8[$$index372>>0] = 0;
 $$index373 = ((($15)) + 358|0);
 HEAP8[$$index373>>0] = 0;
 $$index374 = ((($15)) + 359|0);
 HEAP8[$$index374>>0] = 0;
 $$index375 = ((($15)) + 360|0);
 HEAP8[$$index375>>0] = 0;
 $$index376 = ((($15)) + 361|0);
 HEAP8[$$index376>>0] = 0;
 $$index377 = ((($15)) + 362|0);
 HEAP8[$$index377>>0] = 0;
 $$index378 = ((($15)) + 363|0);
 HEAP8[$$index378>>0] = 0;
 $$index379 = ((($15)) + 364|0);
 HEAP8[$$index379>>0] = 0;
 $$index380 = ((($15)) + 365|0);
 HEAP8[$$index380>>0] = 0;
 $$index381 = ((($15)) + 366|0);
 HEAP8[$$index381>>0] = 0;
 $$index382 = ((($15)) + 367|0);
 HEAP8[$$index382>>0] = 0;
 $$index383 = ((($15)) + 368|0);
 HEAP8[$$index383>>0] = 0;
 $$index384 = ((($15)) + 369|0);
 HEAP8[$$index384>>0] = 0;
 $$index385 = ((($15)) + 370|0);
 HEAP8[$$index385>>0] = 0;
 $$index386 = ((($15)) + 371|0);
 HEAP8[$$index386>>0] = 0;
 $$index387 = ((($15)) + 372|0);
 HEAP8[$$index387>>0] = 0;
 $$index388 = ((($15)) + 373|0);
 HEAP8[$$index388>>0] = 0;
 $$index389 = ((($15)) + 374|0);
 HEAP8[$$index389>>0] = 0;
 $$index390 = ((($15)) + 375|0);
 HEAP8[$$index390>>0] = 0;
 $$index391 = ((($15)) + 376|0);
 HEAP8[$$index391>>0] = 0;
 $$index392 = ((($15)) + 377|0);
 HEAP8[$$index392>>0] = 0;
 $$index393 = ((($15)) + 378|0);
 HEAP8[$$index393>>0] = 0;
 $$index394 = ((($15)) + 379|0);
 HEAP8[$$index394>>0] = 0;
 $$index395 = ((($15)) + 380|0);
 HEAP8[$$index395>>0] = 0;
 $$index396 = ((($15)) + 381|0);
 HEAP8[$$index396>>0] = 0;
 $$index397 = ((($15)) + 382|0);
 HEAP8[$$index397>>0] = 0;
 $$index398 = ((($15)) + 383|0);
 HEAP8[$$index398>>0] = 0;
 $$index399 = ((($15)) + 384|0);
 HEAP8[$$index399>>0] = 0;
 $$index400 = ((($15)) + 385|0);
 HEAP8[$$index400>>0] = 0;
 $$index401 = ((($15)) + 386|0);
 HEAP8[$$index401>>0] = 0;
 $$index402 = ((($15)) + 387|0);
 HEAP8[$$index402>>0] = 0;
 $$index403 = ((($15)) + 388|0);
 HEAP8[$$index403>>0] = 0;
 $$index404 = ((($15)) + 389|0);
 HEAP8[$$index404>>0] = 0;
 $$index405 = ((($15)) + 390|0);
 HEAP8[$$index405>>0] = 0;
 $$index406 = ((($15)) + 391|0);
 HEAP8[$$index406>>0] = 0;
 $$index407 = ((($15)) + 392|0);
 HEAP8[$$index407>>0] = 0;
 $$index408 = ((($15)) + 393|0);
 HEAP8[$$index408>>0] = 0;
 $$index409 = ((($15)) + 394|0);
 HEAP8[$$index409>>0] = 0;
 $$index410 = ((($15)) + 395|0);
 HEAP8[$$index410>>0] = 0;
 $$index411 = ((($15)) + 396|0);
 HEAP8[$$index411>>0] = 0;
 $$index412 = ((($15)) + 397|0);
 HEAP8[$$index412>>0] = 0;
 $$index413 = ((($15)) + 398|0);
 HEAP8[$$index413>>0] = 0;
 $$index414 = ((($15)) + 399|0);
 HEAP8[$$index414>>0] = 0;
 $$index415 = ((($15)) + 400|0);
 HEAP8[$$index415>>0] = 0;
 $$index416 = ((($15)) + 401|0);
 HEAP8[$$index416>>0] = 0;
 $$index417 = ((($15)) + 402|0);
 HEAP8[$$index417>>0] = 0;
 $$index418 = ((($15)) + 403|0);
 HEAP8[$$index418>>0] = 0;
 $$index419 = ((($15)) + 404|0);
 HEAP8[$$index419>>0] = 0;
 $$index420 = ((($15)) + 405|0);
 HEAP8[$$index420>>0] = 0;
 $$index421 = ((($15)) + 406|0);
 HEAP8[$$index421>>0] = 0;
 $$index422 = ((($15)) + 407|0);
 HEAP8[$$index422>>0] = 0;
 $$index423 = ((($15)) + 408|0);
 HEAP8[$$index423>>0] = 0;
 $$index424 = ((($15)) + 409|0);
 HEAP8[$$index424>>0] = 0;
 $$index425 = ((($15)) + 410|0);
 HEAP8[$$index425>>0] = 0;
 $$index426 = ((($15)) + 411|0);
 HEAP8[$$index426>>0] = 0;
 $$index427 = ((($15)) + 412|0);
 HEAP8[$$index427>>0] = 0;
 $$index428 = ((($15)) + 413|0);
 HEAP8[$$index428>>0] = 0;
 $$index429 = ((($15)) + 414|0);
 HEAP8[$$index429>>0] = 0;
 $$index430 = ((($15)) + 415|0);
 HEAP8[$$index430>>0] = 0;
 $$index431 = ((($15)) + 416|0);
 HEAP8[$$index431>>0] = 0;
 $$index432 = ((($15)) + 417|0);
 HEAP8[$$index432>>0] = 0;
 $$index433 = ((($15)) + 418|0);
 HEAP8[$$index433>>0] = 0;
 $$index434 = ((($15)) + 419|0);
 HEAP8[$$index434>>0] = 0;
 $$index435 = ((($15)) + 420|0);
 HEAP8[$$index435>>0] = 0;
 $$index436 = ((($15)) + 421|0);
 HEAP8[$$index436>>0] = 0;
 $$index437 = ((($15)) + 422|0);
 HEAP8[$$index437>>0] = 0;
 $$index438 = ((($15)) + 423|0);
 HEAP8[$$index438>>0] = 0;
 $$index439 = ((($15)) + 424|0);
 HEAP8[$$index439>>0] = 0;
 $$index440 = ((($15)) + 425|0);
 HEAP8[$$index440>>0] = 0;
 $$index441 = ((($15)) + 426|0);
 HEAP8[$$index441>>0] = 0;
 $$index442 = ((($15)) + 427|0);
 HEAP8[$$index442>>0] = 0;
 $$index443 = ((($15)) + 428|0);
 HEAP8[$$index443>>0] = 0;
 $$index444 = ((($15)) + 429|0);
 HEAP8[$$index444>>0] = 0;
 $$index445 = ((($15)) + 430|0);
 HEAP8[$$index445>>0] = 0;
 $$index446 = ((($15)) + 431|0);
 HEAP8[$$index446>>0] = 0;
 $$index447 = ((($15)) + 432|0);
 HEAP8[$$index447>>0] = 0;
 $$index448 = ((($15)) + 433|0);
 HEAP8[$$index448>>0] = 0;
 $$index449 = ((($15)) + 434|0);
 HEAP8[$$index449>>0] = 0;
 $$index450 = ((($15)) + 435|0);
 HEAP8[$$index450>>0] = 0;
 $$index451 = ((($15)) + 436|0);
 HEAP8[$$index451>>0] = 0;
 $$index452 = ((($15)) + 437|0);
 HEAP8[$$index452>>0] = 0;
 $$index453 = ((($15)) + 438|0);
 HEAP8[$$index453>>0] = 0;
 $$index454 = ((($15)) + 439|0);
 HEAP8[$$index454>>0] = 0;
 $$index455 = ((($15)) + 440|0);
 HEAP8[$$index455>>0] = 0;
 $$index456 = ((($15)) + 441|0);
 HEAP8[$$index456>>0] = 0;
 $$index457 = ((($15)) + 442|0);
 HEAP8[$$index457>>0] = 0;
 $$index458 = ((($15)) + 443|0);
 HEAP8[$$index458>>0] = 0;
 $$index459 = ((($15)) + 444|0);
 HEAP8[$$index459>>0] = 0;
 $$index460 = ((($15)) + 445|0);
 HEAP8[$$index460>>0] = 0;
 $$index461 = ((($15)) + 446|0);
 HEAP8[$$index461>>0] = 0;
 $$index462 = ((($15)) + 447|0);
 HEAP8[$$index462>>0] = 0;
 $$index463 = ((($15)) + 448|0);
 HEAP8[$$index463>>0] = 0;
 $$index464 = ((($15)) + 449|0);
 HEAP8[$$index464>>0] = 0;
 $$index465 = ((($15)) + 450|0);
 HEAP8[$$index465>>0] = 0;
 $$index466 = ((($15)) + 451|0);
 HEAP8[$$index466>>0] = 0;
 $$index467 = ((($15)) + 452|0);
 HEAP8[$$index467>>0] = 0;
 $$index468 = ((($15)) + 453|0);
 HEAP8[$$index468>>0] = 0;
 $$index469 = ((($15)) + 454|0);
 HEAP8[$$index469>>0] = 0;
 $$index470 = ((($15)) + 455|0);
 HEAP8[$$index470>>0] = 0;
 $$index471 = ((($15)) + 456|0);
 HEAP8[$$index471>>0] = 0;
 $$index472 = ((($15)) + 457|0);
 HEAP8[$$index472>>0] = 0;
 $$index473 = ((($15)) + 458|0);
 HEAP8[$$index473>>0] = 0;
 $$index474 = ((($15)) + 459|0);
 HEAP8[$$index474>>0] = 0;
 $$index475 = ((($15)) + 460|0);
 HEAP8[$$index475>>0] = 0;
 $$index476 = ((($15)) + 461|0);
 HEAP8[$$index476>>0] = 0;
 $$index477 = ((($15)) + 462|0);
 HEAP8[$$index477>>0] = 0;
 $$index478 = ((($15)) + 463|0);
 HEAP8[$$index478>>0] = 0;
 $$index479 = ((($15)) + 464|0);
 HEAP8[$$index479>>0] = 0;
 $$index480 = ((($15)) + 465|0);
 HEAP8[$$index480>>0] = 0;
 $$index481 = ((($15)) + 466|0);
 HEAP8[$$index481>>0] = 0;
 $$index482 = ((($15)) + 467|0);
 HEAP8[$$index482>>0] = 0;
 $$index483 = ((($15)) + 468|0);
 HEAP8[$$index483>>0] = 0;
 $$index484 = ((($15)) + 469|0);
 HEAP8[$$index484>>0] = 0;
 $$index485 = ((($15)) + 470|0);
 HEAP8[$$index485>>0] = 0;
 $$index486 = ((($15)) + 471|0);
 HEAP8[$$index486>>0] = 0;
 $$index487 = ((($15)) + 472|0);
 HEAP8[$$index487>>0] = 0;
 $$index488 = ((($15)) + 473|0);
 HEAP8[$$index488>>0] = 0;
 $$index489 = ((($15)) + 474|0);
 HEAP8[$$index489>>0] = 0;
 $$index490 = ((($15)) + 475|0);
 HEAP8[$$index490>>0] = 0;
 $$index491 = ((($15)) + 476|0);
 HEAP8[$$index491>>0] = 0;
 $$index492 = ((($15)) + 477|0);
 HEAP8[$$index492>>0] = 0;
 $$index493 = ((($15)) + 478|0);
 HEAP8[$$index493>>0] = 0;
 $$index494 = ((($15)) + 479|0);
 HEAP8[$$index494>>0] = 0;
 $$index495 = ((($15)) + 480|0);
 HEAP8[$$index495>>0] = 0;
 $$index496 = ((($15)) + 481|0);
 HEAP8[$$index496>>0] = 0;
 $$index497 = ((($15)) + 482|0);
 HEAP8[$$index497>>0] = 0;
 $$index498 = ((($15)) + 483|0);
 HEAP8[$$index498>>0] = 0;
 $$index499 = ((($15)) + 484|0);
 HEAP8[$$index499>>0] = 0;
 $$index500 = ((($15)) + 485|0);
 HEAP8[$$index500>>0] = 0;
 $$index501 = ((($15)) + 486|0);
 HEAP8[$$index501>>0] = 0;
 $$index502 = ((($15)) + 487|0);
 HEAP8[$$index502>>0] = 0;
 $$index503 = ((($15)) + 488|0);
 HEAP8[$$index503>>0] = 0;
 $$index504 = ((($15)) + 489|0);
 HEAP8[$$index504>>0] = 0;
 $$index505 = ((($15)) + 490|0);
 HEAP8[$$index505>>0] = 0;
 $$index506 = ((($15)) + 491|0);
 HEAP8[$$index506>>0] = 0;
 $$index507 = ((($15)) + 492|0);
 HEAP8[$$index507>>0] = 0;
 $$index508 = ((($15)) + 493|0);
 HEAP8[$$index508>>0] = 0;
 $$index509 = ((($15)) + 494|0);
 HEAP8[$$index509>>0] = 0;
 $$index510 = ((($15)) + 495|0);
 HEAP8[$$index510>>0] = 0;
 $$index511 = ((($15)) + 496|0);
 HEAP8[$$index511>>0] = 0;
 $$index512 = ((($15)) + 497|0);
 HEAP8[$$index512>>0] = 0;
 $$index513 = ((($15)) + 498|0);
 HEAP8[$$index513>>0] = 0;
 $$index514 = ((($15)) + 499|0);
 HEAP8[$$index514>>0] = 0;
 $$index515 = ((($15)) + 500|0);
 HEAP8[$$index515>>0] = 0;
 $$index516 = ((($15)) + 501|0);
 HEAP8[$$index516>>0] = 0;
 $$index517 = ((($15)) + 502|0);
 HEAP8[$$index517>>0] = 0;
 $$index518 = ((($15)) + 503|0);
 HEAP8[$$index518>>0] = 0;
 $$index519 = ((($15)) + 504|0);
 HEAP8[$$index519>>0] = 0;
 $$index520 = ((($15)) + 505|0);
 HEAP8[$$index520>>0] = 0;
 $$index521 = ((($15)) + 506|0);
 HEAP8[$$index521>>0] = 0;
 $$index522 = ((($15)) + 507|0);
 HEAP8[$$index522>>0] = 0;
 $$index523 = ((($15)) + 508|0);
 HEAP8[$$index523>>0] = 0;
 $$index524 = ((($15)) + 509|0);
 HEAP8[$$index524>>0] = 0;
 $$index525 = ((($15)) + 510|0);
 HEAP8[$$index525>>0] = 0;
 $$index526 = ((($15)) + 511|0);
 HEAP8[$$index526>>0] = 0;
 $$index527 = ((($15)) + 512|0);
 HEAP8[$$index527>>0] = 0;
 $$index528 = ((($15)) + 513|0);
 HEAP8[$$index528>>0] = 0;
 $$index529 = ((($15)) + 514|0);
 HEAP8[$$index529>>0] = 0;
 $$index530 = ((($15)) + 515|0);
 HEAP8[$$index530>>0] = 0;
 $$index531 = ((($15)) + 516|0);
 HEAP8[$$index531>>0] = 0;
 $$index532 = ((($15)) + 517|0);
 HEAP8[$$index532>>0] = 0;
 $$index533 = ((($15)) + 518|0);
 HEAP8[$$index533>>0] = 0;
 $$index534 = ((($15)) + 519|0);
 HEAP8[$$index534>>0] = 0;
 $$index535 = ((($15)) + 520|0);
 HEAP8[$$index535>>0] = 0;
 $$index536 = ((($15)) + 521|0);
 HEAP8[$$index536>>0] = 0;
 $$index537 = ((($15)) + 522|0);
 HEAP8[$$index537>>0] = 0;
 $$index538 = ((($15)) + 523|0);
 HEAP8[$$index538>>0] = 0;
 $$index539 = ((($15)) + 524|0);
 HEAP8[$$index539>>0] = 0;
 $$index540 = ((($15)) + 525|0);
 HEAP8[$$index540>>0] = 0;
 $$index541 = ((($15)) + 526|0);
 HEAP8[$$index541>>0] = 0;
 $$index542 = ((($15)) + 527|0);
 HEAP8[$$index542>>0] = 0;
 $$index543 = ((($15)) + 528|0);
 HEAP8[$$index543>>0] = 0;
 $$index544 = ((($15)) + 529|0);
 HEAP8[$$index544>>0] = 0;
 $$index545 = ((($15)) + 530|0);
 HEAP8[$$index545>>0] = 0;
 $$index546 = ((($15)) + 531|0);
 HEAP8[$$index546>>0] = 0;
 $$index547 = ((($15)) + 532|0);
 HEAP8[$$index547>>0] = 0;
 $$index548 = ((($15)) + 533|0);
 HEAP8[$$index548>>0] = 0;
 $$index549 = ((($15)) + 534|0);
 HEAP8[$$index549>>0] = 0;
 $$index550 = ((($15)) + 535|0);
 HEAP8[$$index550>>0] = 0;
 $$index551 = ((($15)) + 536|0);
 HEAP8[$$index551>>0] = 0;
 $$index552 = ((($15)) + 537|0);
 HEAP8[$$index552>>0] = 0;
 $$index553 = ((($15)) + 538|0);
 HEAP8[$$index553>>0] = 0;
 $$index554 = ((($15)) + 539|0);
 HEAP8[$$index554>>0] = 0;
 $$index555 = ((($15)) + 540|0);
 HEAP8[$$index555>>0] = 0;
 $$index556 = ((($15)) + 541|0);
 HEAP8[$$index556>>0] = 0;
 $$index557 = ((($15)) + 542|0);
 HEAP8[$$index557>>0] = 0;
 $$index558 = ((($15)) + 543|0);
 HEAP8[$$index558>>0] = 0;
 $$index559 = ((($15)) + 544|0);
 HEAP8[$$index559>>0] = 0;
 $$index560 = ((($15)) + 545|0);
 HEAP8[$$index560>>0] = 0;
 $$index561 = ((($15)) + 546|0);
 HEAP8[$$index561>>0] = 0;
 $$index562 = ((($15)) + 547|0);
 HEAP8[$$index562>>0] = 0;
 $$index563 = ((($15)) + 548|0);
 HEAP8[$$index563>>0] = 0;
 $$index564 = ((($15)) + 549|0);
 HEAP8[$$index564>>0] = 0;
 $$index565 = ((($15)) + 550|0);
 HEAP8[$$index565>>0] = 0;
 $$index566 = ((($15)) + 551|0);
 HEAP8[$$index566>>0] = 0;
 $$index567 = ((($15)) + 552|0);
 HEAP8[$$index567>>0] = 0;
 $$index568 = ((($15)) + 553|0);
 HEAP8[$$index568>>0] = 0;
 $$index569 = ((($15)) + 554|0);
 HEAP8[$$index569>>0] = 0;
 $$index570 = ((($15)) + 555|0);
 HEAP8[$$index570>>0] = 0;
 $$index571 = ((($15)) + 556|0);
 HEAP8[$$index571>>0] = 0;
 $$index572 = ((($15)) + 557|0);
 HEAP8[$$index572>>0] = 0;
 $$index573 = ((($15)) + 558|0);
 HEAP8[$$index573>>0] = 0;
 $$index574 = ((($15)) + 559|0);
 HEAP8[$$index574>>0] = 0;
 $$index575 = ((($15)) + 560|0);
 HEAP8[$$index575>>0] = 0;
 $$index576 = ((($15)) + 561|0);
 HEAP8[$$index576>>0] = 0;
 $$index577 = ((($15)) + 562|0);
 HEAP8[$$index577>>0] = 0;
 $$index578 = ((($15)) + 563|0);
 HEAP8[$$index578>>0] = 0;
 $$index579 = ((($15)) + 564|0);
 HEAP8[$$index579>>0] = 0;
 $$index580 = ((($15)) + 565|0);
 HEAP8[$$index580>>0] = 0;
 $$index581 = ((($15)) + 566|0);
 HEAP8[$$index581>>0] = 0;
 $$index582 = ((($15)) + 567|0);
 HEAP8[$$index582>>0] = 0;
 $$index583 = ((($15)) + 568|0);
 HEAP8[$$index583>>0] = 0;
 $$index584 = ((($15)) + 569|0);
 HEAP8[$$index584>>0] = 0;
 $$index585 = ((($15)) + 570|0);
 HEAP8[$$index585>>0] = 0;
 $$index586 = ((($15)) + 571|0);
 HEAP8[$$index586>>0] = 0;
 $$index587 = ((($15)) + 572|0);
 HEAP8[$$index587>>0] = 0;
 $$index588 = ((($15)) + 573|0);
 HEAP8[$$index588>>0] = 0;
 $$index589 = ((($15)) + 574|0);
 HEAP8[$$index589>>0] = 0;
 $$index590 = ((($15)) + 575|0);
 HEAP8[$$index590>>0] = 0;
 $$index591 = ((($15)) + 576|0);
 HEAP8[$$index591>>0] = 0;
 $$index592 = ((($15)) + 577|0);
 HEAP8[$$index592>>0] = 0;
 $$index593 = ((($15)) + 578|0);
 HEAP8[$$index593>>0] = 0;
 $$index594 = ((($15)) + 579|0);
 HEAP8[$$index594>>0] = 0;
 $$index595 = ((($15)) + 580|0);
 HEAP8[$$index595>>0] = 0;
 $$index596 = ((($15)) + 581|0);
 HEAP8[$$index596>>0] = 0;
 $$index597 = ((($15)) + 582|0);
 HEAP8[$$index597>>0] = 0;
 $$index598 = ((($15)) + 583|0);
 HEAP8[$$index598>>0] = 0;
 $$index599 = ((($15)) + 584|0);
 HEAP8[$$index599>>0] = 0;
 $$index600 = ((($15)) + 585|0);
 HEAP8[$$index600>>0] = 0;
 $$index601 = ((($15)) + 586|0);
 HEAP8[$$index601>>0] = 0;
 $$index602 = ((($15)) + 587|0);
 HEAP8[$$index602>>0] = 0;
 $$index603 = ((($15)) + 588|0);
 HEAP8[$$index603>>0] = 0;
 $$index604 = ((($15)) + 589|0);
 HEAP8[$$index604>>0] = 0;
 $$index605 = ((($15)) + 590|0);
 HEAP8[$$index605>>0] = 0;
 $$index606 = ((($15)) + 591|0);
 HEAP8[$$index606>>0] = 0;
 $$index607 = ((($15)) + 592|0);
 HEAP8[$$index607>>0] = 0;
 $$index608 = ((($15)) + 593|0);
 HEAP8[$$index608>>0] = 0;
 $$index609 = ((($15)) + 594|0);
 HEAP8[$$index609>>0] = 0;
 $$index610 = ((($15)) + 595|0);
 HEAP8[$$index610>>0] = 0;
 $$index611 = ((($15)) + 596|0);
 HEAP8[$$index611>>0] = 0;
 $$index612 = ((($15)) + 597|0);
 HEAP8[$$index612>>0] = 0;
 $$index613 = ((($15)) + 598|0);
 HEAP8[$$index613>>0] = 0;
 $$index614 = ((($15)) + 599|0);
 HEAP8[$$index614>>0] = 0;
 $$index615 = ((($15)) + 600|0);
 HEAP8[$$index615>>0] = 0;
 $$index616 = ((($15)) + 601|0);
 HEAP8[$$index616>>0] = 0;
 $$index617 = ((($15)) + 602|0);
 HEAP8[$$index617>>0] = 0;
 $$index618 = ((($15)) + 603|0);
 HEAP8[$$index618>>0] = 0;
 $$index619 = ((($15)) + 604|0);
 HEAP8[$$index619>>0] = 0;
 $$index620 = ((($15)) + 605|0);
 HEAP8[$$index620>>0] = 0;
 $$index621 = ((($15)) + 606|0);
 HEAP8[$$index621>>0] = 0;
 $$index622 = ((($15)) + 607|0);
 HEAP8[$$index622>>0] = 0;
 $$index623 = ((($15)) + 608|0);
 HEAP8[$$index623>>0] = 0;
 $$index624 = ((($15)) + 609|0);
 HEAP8[$$index624>>0] = 0;
 $$index625 = ((($15)) + 610|0);
 HEAP8[$$index625>>0] = 0;
 $$index626 = ((($15)) + 611|0);
 HEAP8[$$index626>>0] = 0;
 $$index627 = ((($15)) + 612|0);
 HEAP8[$$index627>>0] = 0;
 $$index628 = ((($15)) + 613|0);
 HEAP8[$$index628>>0] = 0;
 $$index629 = ((($15)) + 614|0);
 HEAP8[$$index629>>0] = 0;
 $$index630 = ((($15)) + 615|0);
 HEAP8[$$index630>>0] = 0;
 $$index631 = ((($15)) + 616|0);
 HEAP8[$$index631>>0] = 0;
 $$index632 = ((($15)) + 617|0);
 HEAP8[$$index632>>0] = 0;
 $$index633 = ((($15)) + 618|0);
 HEAP8[$$index633>>0] = 0;
 $$index634 = ((($15)) + 619|0);
 HEAP8[$$index634>>0] = 0;
 $$index635 = ((($15)) + 620|0);
 HEAP8[$$index635>>0] = 0;
 $$index636 = ((($15)) + 621|0);
 HEAP8[$$index636>>0] = 0;
 $$index637 = ((($15)) + 622|0);
 HEAP8[$$index637>>0] = 0;
 $$index638 = ((($15)) + 623|0);
 HEAP8[$$index638>>0] = 0;
 $$index639 = ((($15)) + 624|0);
 HEAP8[$$index639>>0] = 0;
 $$index640 = ((($15)) + 625|0);
 HEAP8[$$index640>>0] = 0;
 $$index641 = ((($15)) + 626|0);
 HEAP8[$$index641>>0] = 0;
 $$index642 = ((($15)) + 627|0);
 HEAP8[$$index642>>0] = 0;
 $$index643 = ((($15)) + 628|0);
 HEAP8[$$index643>>0] = 0;
 $$index644 = ((($15)) + 629|0);
 HEAP8[$$index644>>0] = 0;
 $$index645 = ((($15)) + 630|0);
 HEAP8[$$index645>>0] = 0;
 $$index646 = ((($15)) + 631|0);
 HEAP8[$$index646>>0] = 0;
 $$index647 = ((($15)) + 632|0);
 HEAP8[$$index647>>0] = 0;
 $$index648 = ((($15)) + 633|0);
 HEAP8[$$index648>>0] = 0;
 $$index649 = ((($15)) + 634|0);
 HEAP8[$$index649>>0] = 0;
 $$index650 = ((($15)) + 635|0);
 HEAP8[$$index650>>0] = 0;
 $$index651 = ((($15)) + 636|0);
 HEAP8[$$index651>>0] = 0;
 $$index652 = ((($15)) + 637|0);
 HEAP8[$$index652>>0] = 0;
 $$index653 = ((($15)) + 638|0);
 HEAP8[$$index653>>0] = 0;
 $$index654 = ((($15)) + 639|0);
 HEAP8[$$index654>>0] = 0;
 $$index655 = ((($15)) + 640|0);
 HEAP8[$$index655>>0] = 0;
 $$index656 = ((($15)) + 641|0);
 HEAP8[$$index656>>0] = 0;
 $$index657 = ((($15)) + 642|0);
 HEAP8[$$index657>>0] = 0;
 $$index658 = ((($15)) + 643|0);
 HEAP8[$$index658>>0] = 0;
 $$index659 = ((($15)) + 644|0);
 HEAP8[$$index659>>0] = 0;
 $$index660 = ((($15)) + 645|0);
 HEAP8[$$index660>>0] = 0;
 $$index661 = ((($15)) + 646|0);
 HEAP8[$$index661>>0] = 0;
 $$index662 = ((($15)) + 647|0);
 HEAP8[$$index662>>0] = 0;
 $$index663 = ((($15)) + 648|0);
 HEAP8[$$index663>>0] = 0;
 $$index664 = ((($15)) + 649|0);
 HEAP8[$$index664>>0] = 0;
 $$index665 = ((($15)) + 650|0);
 HEAP8[$$index665>>0] = 0;
 $$index666 = ((($15)) + 651|0);
 HEAP8[$$index666>>0] = 0;
 $$index667 = ((($15)) + 652|0);
 HEAP8[$$index667>>0] = 0;
 $$index668 = ((($15)) + 653|0);
 HEAP8[$$index668>>0] = 0;
 $$index669 = ((($15)) + 654|0);
 HEAP8[$$index669>>0] = 0;
 $$index670 = ((($15)) + 655|0);
 HEAP8[$$index670>>0] = 0;
 $$index671 = ((($15)) + 656|0);
 HEAP8[$$index671>>0] = 0;
 $$index672 = ((($15)) + 657|0);
 HEAP8[$$index672>>0] = 0;
 $$index673 = ((($15)) + 658|0);
 HEAP8[$$index673>>0] = 0;
 $$index674 = ((($15)) + 659|0);
 HEAP8[$$index674>>0] = 0;
 $$index675 = ((($15)) + 660|0);
 HEAP8[$$index675>>0] = 0;
 $$index676 = ((($15)) + 661|0);
 HEAP8[$$index676>>0] = 0;
 $$index677 = ((($15)) + 662|0);
 HEAP8[$$index677>>0] = 0;
 $$index678 = ((($15)) + 663|0);
 HEAP8[$$index678>>0] = 0;
 $$index679 = ((($15)) + 664|0);
 HEAP8[$$index679>>0] = 0;
 $$index680 = ((($15)) + 665|0);
 HEAP8[$$index680>>0] = 0;
 $$index681 = ((($15)) + 666|0);
 HEAP8[$$index681>>0] = 0;
 $$index682 = ((($15)) + 667|0);
 HEAP8[$$index682>>0] = 0;
 $$index683 = ((($15)) + 668|0);
 HEAP8[$$index683>>0] = 0;
 $$index684 = ((($15)) + 669|0);
 HEAP8[$$index684>>0] = 0;
 $$index685 = ((($15)) + 670|0);
 HEAP8[$$index685>>0] = 0;
 $$index686 = ((($15)) + 671|0);
 HEAP8[$$index686>>0] = 0;
 $$index687 = ((($15)) + 672|0);
 HEAP8[$$index687>>0] = 0;
 $$index688 = ((($15)) + 673|0);
 HEAP8[$$index688>>0] = 0;
 $$index689 = ((($15)) + 674|0);
 HEAP8[$$index689>>0] = 0;
 $$index690 = ((($15)) + 675|0);
 HEAP8[$$index690>>0] = 0;
 $$index691 = ((($15)) + 676|0);
 HEAP8[$$index691>>0] = 0;
 $$index692 = ((($15)) + 677|0);
 HEAP8[$$index692>>0] = 0;
 $$index693 = ((($15)) + 678|0);
 HEAP8[$$index693>>0] = 0;
 $$index694 = ((($15)) + 679|0);
 HEAP8[$$index694>>0] = 0;
 $$index695 = ((($15)) + 680|0);
 HEAP8[$$index695>>0] = 0;
 $$index696 = ((($15)) + 681|0);
 HEAP8[$$index696>>0] = 0;
 $$index697 = ((($15)) + 682|0);
 HEAP8[$$index697>>0] = 0;
 $$index698 = ((($15)) + 683|0);
 HEAP8[$$index698>>0] = 0;
 $$index699 = ((($15)) + 684|0);
 HEAP8[$$index699>>0] = 0;
 $$index700 = ((($15)) + 685|0);
 HEAP8[$$index700>>0] = 0;
 $$index701 = ((($15)) + 686|0);
 HEAP8[$$index701>>0] = 0;
 $$index702 = ((($15)) + 687|0);
 HEAP8[$$index702>>0] = 0;
 $$index703 = ((($15)) + 688|0);
 HEAP8[$$index703>>0] = 0;
 $$index704 = ((($15)) + 689|0);
 HEAP8[$$index704>>0] = 0;
 $$index705 = ((($15)) + 690|0);
 HEAP8[$$index705>>0] = 0;
 $$index706 = ((($15)) + 691|0);
 HEAP8[$$index706>>0] = 0;
 $$index707 = ((($15)) + 692|0);
 HEAP8[$$index707>>0] = 0;
 $$index708 = ((($15)) + 693|0);
 HEAP8[$$index708>>0] = 0;
 $$index709 = ((($15)) + 694|0);
 HEAP8[$$index709>>0] = 0;
 $$index710 = ((($15)) + 695|0);
 HEAP8[$$index710>>0] = 0;
 $$index711 = ((($15)) + 696|0);
 HEAP8[$$index711>>0] = 0;
 $$index712 = ((($15)) + 697|0);
 HEAP8[$$index712>>0] = 0;
 $$index713 = ((($15)) + 698|0);
 HEAP8[$$index713>>0] = 0;
 $$index714 = ((($15)) + 699|0);
 HEAP8[$$index714>>0] = 0;
 $$index715 = ((($15)) + 700|0);
 HEAP8[$$index715>>0] = 0;
 $$index716 = ((($15)) + 701|0);
 HEAP8[$$index716>>0] = 0;
 $$index717 = ((($15)) + 702|0);
 HEAP8[$$index717>>0] = 0;
 $$index718 = ((($15)) + 703|0);
 HEAP8[$$index718>>0] = 0;
 $$index719 = ((($15)) + 704|0);
 HEAP8[$$index719>>0] = 0;
 $$index720 = ((($15)) + 705|0);
 HEAP8[$$index720>>0] = 0;
 $$index721 = ((($15)) + 706|0);
 HEAP8[$$index721>>0] = 0;
 $$index722 = ((($15)) + 707|0);
 HEAP8[$$index722>>0] = 0;
 $$index723 = ((($15)) + 708|0);
 HEAP8[$$index723>>0] = 0;
 $$index724 = ((($15)) + 709|0);
 HEAP8[$$index724>>0] = 0;
 $$index725 = ((($15)) + 710|0);
 HEAP8[$$index725>>0] = 0;
 $$index726 = ((($15)) + 711|0);
 HEAP8[$$index726>>0] = 0;
 $$index727 = ((($15)) + 712|0);
 HEAP8[$$index727>>0] = 0;
 $$index728 = ((($15)) + 713|0);
 HEAP8[$$index728>>0] = 0;
 $$index729 = ((($15)) + 714|0);
 HEAP8[$$index729>>0] = 0;
 $$index730 = ((($15)) + 715|0);
 HEAP8[$$index730>>0] = 0;
 $$index731 = ((($15)) + 716|0);
 HEAP8[$$index731>>0] = 0;
 $$index732 = ((($15)) + 717|0);
 HEAP8[$$index732>>0] = 0;
 $$index733 = ((($15)) + 718|0);
 HEAP8[$$index733>>0] = 0;
 $$index734 = ((($15)) + 719|0);
 HEAP8[$$index734>>0] = 0;
 $$index735 = ((($15)) + 720|0);
 HEAP8[$$index735>>0] = 0;
 $$index736 = ((($15)) + 721|0);
 HEAP8[$$index736>>0] = 0;
 $$index737 = ((($15)) + 722|0);
 HEAP8[$$index737>>0] = 0;
 $$index738 = ((($15)) + 723|0);
 HEAP8[$$index738>>0] = 0;
 $$index739 = ((($15)) + 724|0);
 HEAP8[$$index739>>0] = 0;
 $$index740 = ((($15)) + 725|0);
 HEAP8[$$index740>>0] = 0;
 $$index741 = ((($15)) + 726|0);
 HEAP8[$$index741>>0] = 0;
 $$index742 = ((($15)) + 727|0);
 HEAP8[$$index742>>0] = 0;
 $$index743 = ((($15)) + 728|0);
 HEAP8[$$index743>>0] = 0;
 $$index744 = ((($15)) + 729|0);
 HEAP8[$$index744>>0] = 0;
 $$index745 = ((($15)) + 730|0);
 HEAP8[$$index745>>0] = 0;
 $$index746 = ((($15)) + 731|0);
 HEAP8[$$index746>>0] = 0;
 $$index747 = ((($15)) + 732|0);
 HEAP8[$$index747>>0] = 0;
 $$index748 = ((($15)) + 733|0);
 HEAP8[$$index748>>0] = 0;
 $$index749 = ((($15)) + 734|0);
 HEAP8[$$index749>>0] = 0;
 $$index750 = ((($15)) + 735|0);
 HEAP8[$$index750>>0] = 0;
 $$index751 = ((($15)) + 736|0);
 HEAP8[$$index751>>0] = 0;
 $$index752 = ((($15)) + 737|0);
 HEAP8[$$index752>>0] = 0;
 $$index753 = ((($15)) + 738|0);
 HEAP8[$$index753>>0] = 0;
 $$index754 = ((($15)) + 739|0);
 HEAP8[$$index754>>0] = 0;
 $$index755 = ((($15)) + 740|0);
 HEAP8[$$index755>>0] = 0;
 $$index756 = ((($15)) + 741|0);
 HEAP8[$$index756>>0] = 0;
 $$index757 = ((($15)) + 742|0);
 HEAP8[$$index757>>0] = 0;
 $$index758 = ((($15)) + 743|0);
 HEAP8[$$index758>>0] = 0;
 $$index759 = ((($15)) + 744|0);
 HEAP8[$$index759>>0] = 0;
 $$index760 = ((($15)) + 745|0);
 HEAP8[$$index760>>0] = 0;
 $$index761 = ((($15)) + 746|0);
 HEAP8[$$index761>>0] = 0;
 $$index762 = ((($15)) + 747|0);
 HEAP8[$$index762>>0] = 0;
 $$index763 = ((($15)) + 748|0);
 HEAP8[$$index763>>0] = 0;
 $$index764 = ((($15)) + 749|0);
 HEAP8[$$index764>>0] = 0;
 $$index765 = ((($15)) + 750|0);
 HEAP8[$$index765>>0] = 0;
 $$index766 = ((($15)) + 751|0);
 HEAP8[$$index766>>0] = 0;
 $$index767 = ((($15)) + 752|0);
 HEAP8[$$index767>>0] = 0;
 $$index768 = ((($15)) + 753|0);
 HEAP8[$$index768>>0] = 0;
 $$index769 = ((($15)) + 754|0);
 HEAP8[$$index769>>0] = 0;
 $$index770 = ((($15)) + 755|0);
 HEAP8[$$index770>>0] = 0;
 $$index771 = ((($15)) + 756|0);
 HEAP8[$$index771>>0] = 0;
 $$index772 = ((($15)) + 757|0);
 HEAP8[$$index772>>0] = 0;
 $$index773 = ((($15)) + 758|0);
 HEAP8[$$index773>>0] = 0;
 $$index774 = ((($15)) + 759|0);
 HEAP8[$$index774>>0] = 0;
 $$index775 = ((($15)) + 760|0);
 HEAP8[$$index775>>0] = 0;
 $$index776 = ((($15)) + 761|0);
 HEAP8[$$index776>>0] = 0;
 $$index777 = ((($15)) + 762|0);
 HEAP8[$$index777>>0] = 0;
 $$index778 = ((($15)) + 763|0);
 HEAP8[$$index778>>0] = 0;
 $$index779 = ((($15)) + 764|0);
 HEAP8[$$index779>>0] = 0;
 $$index780 = ((($15)) + 765|0);
 HEAP8[$$index780>>0] = 0;
 $$index781 = ((($15)) + 766|0);
 HEAP8[$$index781>>0] = 0;
 $$index782 = ((($15)) + 767|0);
 HEAP8[$$index782>>0] = 0;
 $$index783 = ((($15)) + 768|0);
 HEAP8[$$index783>>0] = 0;
 $$index784 = ((($15)) + 769|0);
 HEAP8[$$index784>>0] = 0;
 $$index785 = ((($15)) + 770|0);
 HEAP8[$$index785>>0] = 0;
 $$index786 = ((($15)) + 771|0);
 HEAP8[$$index786>>0] = 0;
 $$index787 = ((($15)) + 772|0);
 HEAP8[$$index787>>0] = 0;
 $$index788 = ((($15)) + 773|0);
 HEAP8[$$index788>>0] = 0;
 $$index789 = ((($15)) + 774|0);
 HEAP8[$$index789>>0] = 0;
 $$index790 = ((($15)) + 775|0);
 HEAP8[$$index790>>0] = 0;
 $$index791 = ((($15)) + 776|0);
 HEAP8[$$index791>>0] = 0;
 $$index792 = ((($15)) + 777|0);
 HEAP8[$$index792>>0] = 0;
 $$index793 = ((($15)) + 778|0);
 HEAP8[$$index793>>0] = 0;
 $$index794 = ((($15)) + 779|0);
 HEAP8[$$index794>>0] = 0;
 $$index795 = ((($15)) + 780|0);
 HEAP8[$$index795>>0] = 0;
 $$index796 = ((($15)) + 781|0);
 HEAP8[$$index796>>0] = 0;
 $$index797 = ((($15)) + 782|0);
 HEAP8[$$index797>>0] = 0;
 $$index798 = ((($15)) + 783|0);
 HEAP8[$$index798>>0] = 0;
 $$index799 = ((($15)) + 784|0);
 HEAP8[$$index799>>0] = 0;
 $$index800 = ((($15)) + 785|0);
 HEAP8[$$index800>>0] = 0;
 $$index801 = ((($15)) + 786|0);
 HEAP8[$$index801>>0] = 0;
 $$index802 = ((($15)) + 787|0);
 HEAP8[$$index802>>0] = 0;
 $$index803 = ((($15)) + 788|0);
 HEAP8[$$index803>>0] = 0;
 $$index804 = ((($15)) + 789|0);
 HEAP8[$$index804>>0] = 0;
 $$index805 = ((($15)) + 790|0);
 HEAP8[$$index805>>0] = 0;
 $$index806 = ((($15)) + 791|0);
 HEAP8[$$index806>>0] = 0;
 $$index807 = ((($15)) + 792|0);
 HEAP8[$$index807>>0] = 0;
 $$index808 = ((($15)) + 793|0);
 HEAP8[$$index808>>0] = 0;
 $$index809 = ((($15)) + 794|0);
 HEAP8[$$index809>>0] = 0;
 $$index810 = ((($15)) + 795|0);
 HEAP8[$$index810>>0] = 0;
 $$index811 = ((($15)) + 796|0);
 HEAP8[$$index811>>0] = 0;
 $$index812 = ((($15)) + 797|0);
 HEAP8[$$index812>>0] = 0;
 $$index813 = ((($15)) + 798|0);
 HEAP8[$$index813>>0] = 0;
 $$index814 = ((($15)) + 799|0);
 HEAP8[$$index814>>0] = 0;
 $$index815 = ((($15)) + 800|0);
 HEAP8[$$index815>>0] = 0;
 $$index816 = ((($15)) + 801|0);
 HEAP8[$$index816>>0] = 0;
 $$index817 = ((($15)) + 802|0);
 HEAP8[$$index817>>0] = 0;
 $$index818 = ((($15)) + 803|0);
 HEAP8[$$index818>>0] = 0;
 $$index819 = ((($15)) + 804|0);
 HEAP8[$$index819>>0] = 0;
 $$index820 = ((($15)) + 805|0);
 HEAP8[$$index820>>0] = 0;
 $$index821 = ((($15)) + 806|0);
 HEAP8[$$index821>>0] = 0;
 $$index822 = ((($15)) + 807|0);
 HEAP8[$$index822>>0] = 0;
 $$index823 = ((($15)) + 808|0);
 HEAP8[$$index823>>0] = 0;
 $$index824 = ((($15)) + 809|0);
 HEAP8[$$index824>>0] = 0;
 $$index825 = ((($15)) + 810|0);
 HEAP8[$$index825>>0] = 0;
 $$index826 = ((($15)) + 811|0);
 HEAP8[$$index826>>0] = 0;
 $$index827 = ((($15)) + 812|0);
 HEAP8[$$index827>>0] = 0;
 $$index828 = ((($15)) + 813|0);
 HEAP8[$$index828>>0] = 0;
 $$index829 = ((($15)) + 814|0);
 HEAP8[$$index829>>0] = 0;
 $$index830 = ((($15)) + 815|0);
 HEAP8[$$index830>>0] = 0;
 $$index831 = ((($15)) + 816|0);
 HEAP8[$$index831>>0] = 0;
 $$index832 = ((($15)) + 817|0);
 HEAP8[$$index832>>0] = 0;
 $$index833 = ((($15)) + 818|0);
 HEAP8[$$index833>>0] = 0;
 $$index834 = ((($15)) + 819|0);
 HEAP8[$$index834>>0] = 0;
 $$index835 = ((($15)) + 820|0);
 HEAP8[$$index835>>0] = 0;
 $$index836 = ((($15)) + 821|0);
 HEAP8[$$index836>>0] = 0;
 $$index837 = ((($15)) + 822|0);
 HEAP8[$$index837>>0] = 0;
 $$index838 = ((($15)) + 823|0);
 HEAP8[$$index838>>0] = 0;
 $$index839 = ((($15)) + 824|0);
 HEAP8[$$index839>>0] = 0;
 $$index840 = ((($15)) + 825|0);
 HEAP8[$$index840>>0] = 0;
 $$index841 = ((($15)) + 826|0);
 HEAP8[$$index841>>0] = 0;
 $$index842 = ((($15)) + 827|0);
 HEAP8[$$index842>>0] = 0;
 $$index843 = ((($15)) + 828|0);
 HEAP8[$$index843>>0] = 0;
 $$index844 = ((($15)) + 829|0);
 HEAP8[$$index844>>0] = 0;
 $$index845 = ((($15)) + 830|0);
 HEAP8[$$index845>>0] = 0;
 $$index846 = ((($15)) + 831|0);
 HEAP8[$$index846>>0] = 0;
 $$index847 = ((($15)) + 832|0);
 HEAP8[$$index847>>0] = 0;
 $$index848 = ((($15)) + 833|0);
 HEAP8[$$index848>>0] = 0;
 $$index849 = ((($15)) + 834|0);
 HEAP8[$$index849>>0] = 0;
 $$index850 = ((($15)) + 835|0);
 HEAP8[$$index850>>0] = 0;
 $$index851 = ((($15)) + 836|0);
 HEAP8[$$index851>>0] = 0;
 $$index852 = ((($15)) + 837|0);
 HEAP8[$$index852>>0] = 0;
 $$index853 = ((($15)) + 838|0);
 HEAP8[$$index853>>0] = 0;
 $$index854 = ((($15)) + 839|0);
 HEAP8[$$index854>>0] = 0;
 $$index855 = ((($15)) + 840|0);
 HEAP8[$$index855>>0] = 0;
 $$index856 = ((($15)) + 841|0);
 HEAP8[$$index856>>0] = 0;
 $$index857 = ((($15)) + 842|0);
 HEAP8[$$index857>>0] = 0;
 $$index858 = ((($15)) + 843|0);
 HEAP8[$$index858>>0] = 0;
 $$index859 = ((($15)) + 844|0);
 HEAP8[$$index859>>0] = 0;
 $$index860 = ((($15)) + 845|0);
 HEAP8[$$index860>>0] = 0;
 $$index861 = ((($15)) + 846|0);
 HEAP8[$$index861>>0] = 0;
 $$index862 = ((($15)) + 847|0);
 HEAP8[$$index862>>0] = 0;
 $$index863 = ((($15)) + 848|0);
 HEAP8[$$index863>>0] = 0;
 $$index864 = ((($15)) + 849|0);
 HEAP8[$$index864>>0] = 0;
 $$index865 = ((($15)) + 850|0);
 HEAP8[$$index865>>0] = 0;
 $$index866 = ((($15)) + 851|0);
 HEAP8[$$index866>>0] = 0;
 $$index867 = ((($15)) + 852|0);
 HEAP8[$$index867>>0] = 0;
 $$index868 = ((($15)) + 853|0);
 HEAP8[$$index868>>0] = 0;
 $$index869 = ((($15)) + 854|0);
 HEAP8[$$index869>>0] = 0;
 $$index870 = ((($15)) + 855|0);
 HEAP8[$$index870>>0] = 0;
 $$index871 = ((($15)) + 856|0);
 HEAP8[$$index871>>0] = 0;
 $$index872 = ((($15)) + 857|0);
 HEAP8[$$index872>>0] = 0;
 $$index873 = ((($15)) + 858|0);
 HEAP8[$$index873>>0] = 0;
 $$index874 = ((($15)) + 859|0);
 HEAP8[$$index874>>0] = 0;
 $$index875 = ((($15)) + 860|0);
 HEAP8[$$index875>>0] = 0;
 $$index876 = ((($15)) + 861|0);
 HEAP8[$$index876>>0] = 0;
 $$index877 = ((($15)) + 862|0);
 HEAP8[$$index877>>0] = 0;
 $$index878 = ((($15)) + 863|0);
 HEAP8[$$index878>>0] = 0;
 $$index879 = ((($15)) + 864|0);
 HEAP8[$$index879>>0] = 0;
 $$index880 = ((($15)) + 865|0);
 HEAP8[$$index880>>0] = 0;
 $$index881 = ((($15)) + 866|0);
 HEAP8[$$index881>>0] = 0;
 $$index882 = ((($15)) + 867|0);
 HEAP8[$$index882>>0] = 0;
 $$index883 = ((($15)) + 868|0);
 HEAP8[$$index883>>0] = 0;
 $$index884 = ((($15)) + 869|0);
 HEAP8[$$index884>>0] = 0;
 $$index885 = ((($15)) + 870|0);
 HEAP8[$$index885>>0] = 0;
 $$index886 = ((($15)) + 871|0);
 HEAP8[$$index886>>0] = 0;
 $$index887 = ((($15)) + 872|0);
 HEAP8[$$index887>>0] = 0;
 $$index888 = ((($15)) + 873|0);
 HEAP8[$$index888>>0] = 0;
 $$index889 = ((($15)) + 874|0);
 HEAP8[$$index889>>0] = 0;
 $$index890 = ((($15)) + 875|0);
 HEAP8[$$index890>>0] = 0;
 $$index891 = ((($15)) + 876|0);
 HEAP8[$$index891>>0] = 0;
 $$index892 = ((($15)) + 877|0);
 HEAP8[$$index892>>0] = 0;
 $$index893 = ((($15)) + 878|0);
 HEAP8[$$index893>>0] = 0;
 $$index894 = ((($15)) + 879|0);
 HEAP8[$$index894>>0] = 0;
 $$index895 = ((($15)) + 880|0);
 HEAP8[$$index895>>0] = 0;
 $$index896 = ((($15)) + 881|0);
 HEAP8[$$index896>>0] = 0;
 $$index897 = ((($15)) + 882|0);
 HEAP8[$$index897>>0] = 0;
 $$index898 = ((($15)) + 883|0);
 HEAP8[$$index898>>0] = 0;
 $$index899 = ((($15)) + 884|0);
 HEAP8[$$index899>>0] = 0;
 $$index900 = ((($15)) + 885|0);
 HEAP8[$$index900>>0] = 0;
 $$index901 = ((($15)) + 886|0);
 HEAP8[$$index901>>0] = 0;
 $$index902 = ((($15)) + 887|0);
 HEAP8[$$index902>>0] = 0;
 $$index903 = ((($15)) + 888|0);
 HEAP8[$$index903>>0] = 0;
 $$index904 = ((($15)) + 889|0);
 HEAP8[$$index904>>0] = 0;
 $$index905 = ((($15)) + 890|0);
 HEAP8[$$index905>>0] = 0;
 $$index906 = ((($15)) + 891|0);
 HEAP8[$$index906>>0] = 0;
 $$index907 = ((($15)) + 892|0);
 HEAP8[$$index907>>0] = 0;
 $$index908 = ((($15)) + 893|0);
 HEAP8[$$index908>>0] = 0;
 $$index909 = ((($15)) + 894|0);
 HEAP8[$$index909>>0] = 0;
 $$index910 = ((($15)) + 895|0);
 HEAP8[$$index910>>0] = 0;
 $$index911 = ((($15)) + 896|0);
 HEAP8[$$index911>>0] = 0;
 $$index912 = ((($15)) + 897|0);
 HEAP8[$$index912>>0] = 0;
 $$index913 = ((($15)) + 898|0);
 HEAP8[$$index913>>0] = 0;
 $$index914 = ((($15)) + 899|0);
 HEAP8[$$index914>>0] = 0;
 $$index915 = ((($15)) + 900|0);
 HEAP8[$$index915>>0] = 0;
 $$index916 = ((($15)) + 901|0);
 HEAP8[$$index916>>0] = 0;
 $$index917 = ((($15)) + 902|0);
 HEAP8[$$index917>>0] = 0;
 $$index918 = ((($15)) + 903|0);
 HEAP8[$$index918>>0] = 0;
 $$index919 = ((($15)) + 904|0);
 HEAP8[$$index919>>0] = 0;
 $$index920 = ((($15)) + 905|0);
 HEAP8[$$index920>>0] = 0;
 $$index921 = ((($15)) + 906|0);
 HEAP8[$$index921>>0] = 0;
 $$index922 = ((($15)) + 907|0);
 HEAP8[$$index922>>0] = 0;
 $$index923 = ((($15)) + 908|0);
 HEAP8[$$index923>>0] = 0;
 $$index924 = ((($15)) + 909|0);
 HEAP8[$$index924>>0] = 0;
 $$index925 = ((($15)) + 910|0);
 HEAP8[$$index925>>0] = 0;
 $$index926 = ((($15)) + 911|0);
 HEAP8[$$index926>>0] = 0;
 $$index927 = ((($15)) + 912|0);
 HEAP8[$$index927>>0] = 0;
 $$index928 = ((($15)) + 913|0);
 HEAP8[$$index928>>0] = 0;
 $$index929 = ((($15)) + 914|0);
 HEAP8[$$index929>>0] = 0;
 $$index930 = ((($15)) + 915|0);
 HEAP8[$$index930>>0] = 0;
 $$index931 = ((($15)) + 916|0);
 HEAP8[$$index931>>0] = 0;
 $$index932 = ((($15)) + 917|0);
 HEAP8[$$index932>>0] = 0;
 $$index933 = ((($15)) + 918|0);
 HEAP8[$$index933>>0] = 0;
 $$index934 = ((($15)) + 919|0);
 HEAP8[$$index934>>0] = 0;
 $$index935 = ((($15)) + 920|0);
 HEAP8[$$index935>>0] = 0;
 $$index936 = ((($15)) + 921|0);
 HEAP8[$$index936>>0] = 0;
 $$index937 = ((($15)) + 922|0);
 HEAP8[$$index937>>0] = 0;
 $$index938 = ((($15)) + 923|0);
 HEAP8[$$index938>>0] = 0;
 $$index939 = ((($15)) + 924|0);
 HEAP8[$$index939>>0] = 0;
 $$index940 = ((($15)) + 925|0);
 HEAP8[$$index940>>0] = 0;
 $$index941 = ((($15)) + 926|0);
 HEAP8[$$index941>>0] = 0;
 $$index942 = ((($15)) + 927|0);
 HEAP8[$$index942>>0] = 0;
 $$index943 = ((($15)) + 928|0);
 HEAP8[$$index943>>0] = 0;
 $$index944 = ((($15)) + 929|0);
 HEAP8[$$index944>>0] = 0;
 $$index945 = ((($15)) + 930|0);
 HEAP8[$$index945>>0] = 0;
 $$index946 = ((($15)) + 931|0);
 HEAP8[$$index946>>0] = 0;
 $$index947 = ((($15)) + 932|0);
 HEAP8[$$index947>>0] = 0;
 $$index948 = ((($15)) + 933|0);
 HEAP8[$$index948>>0] = 0;
 $$index949 = ((($15)) + 934|0);
 HEAP8[$$index949>>0] = 0;
 $$index950 = ((($15)) + 935|0);
 HEAP8[$$index950>>0] = 0;
 $$index951 = ((($15)) + 936|0);
 HEAP8[$$index951>>0] = 0;
 $$index952 = ((($15)) + 937|0);
 HEAP8[$$index952>>0] = 0;
 $$index953 = ((($15)) + 938|0);
 HEAP8[$$index953>>0] = 0;
 $$index954 = ((($15)) + 939|0);
 HEAP8[$$index954>>0] = 0;
 $$index955 = ((($15)) + 940|0);
 HEAP8[$$index955>>0] = 0;
 $$index956 = ((($15)) + 941|0);
 HEAP8[$$index956>>0] = 0;
 $$index957 = ((($15)) + 942|0);
 HEAP8[$$index957>>0] = 0;
 $$index958 = ((($15)) + 943|0);
 HEAP8[$$index958>>0] = 0;
 $$index959 = ((($15)) + 944|0);
 HEAP8[$$index959>>0] = 0;
 $$index960 = ((($15)) + 945|0);
 HEAP8[$$index960>>0] = 0;
 $$index961 = ((($15)) + 946|0);
 HEAP8[$$index961>>0] = 0;
 $$index962 = ((($15)) + 947|0);
 HEAP8[$$index962>>0] = 0;
 $$index963 = ((($15)) + 948|0);
 HEAP8[$$index963>>0] = 0;
 $$index964 = ((($15)) + 949|0);
 HEAP8[$$index964>>0] = 0;
 $$index965 = ((($15)) + 950|0);
 HEAP8[$$index965>>0] = 0;
 $$index966 = ((($15)) + 951|0);
 HEAP8[$$index966>>0] = 0;
 $$index967 = ((($15)) + 952|0);
 HEAP8[$$index967>>0] = 0;
 $$index968 = ((($15)) + 953|0);
 HEAP8[$$index968>>0] = 0;
 $$index969 = ((($15)) + 954|0);
 HEAP8[$$index969>>0] = 0;
 $$index970 = ((($15)) + 955|0);
 HEAP8[$$index970>>0] = 0;
 $$index971 = ((($15)) + 956|0);
 HEAP8[$$index971>>0] = 0;
 $$index972 = ((($15)) + 957|0);
 HEAP8[$$index972>>0] = 0;
 $$index973 = ((($15)) + 958|0);
 HEAP8[$$index973>>0] = 0;
 $$index974 = ((($15)) + 959|0);
 HEAP8[$$index974>>0] = 0;
 $$index975 = ((($15)) + 960|0);
 HEAP8[$$index975>>0] = 0;
 $$index976 = ((($15)) + 961|0);
 HEAP8[$$index976>>0] = 0;
 $$index977 = ((($15)) + 962|0);
 HEAP8[$$index977>>0] = 0;
 $$index978 = ((($15)) + 963|0);
 HEAP8[$$index978>>0] = 0;
 $$index979 = ((($15)) + 964|0);
 HEAP8[$$index979>>0] = 0;
 $$index980 = ((($15)) + 965|0);
 HEAP8[$$index980>>0] = 0;
 $$index981 = ((($15)) + 966|0);
 HEAP8[$$index981>>0] = 0;
 $$index982 = ((($15)) + 967|0);
 HEAP8[$$index982>>0] = 0;
 $$index983 = ((($15)) + 968|0);
 HEAP8[$$index983>>0] = 0;
 $$index984 = ((($15)) + 969|0);
 HEAP8[$$index984>>0] = 0;
 $$index985 = ((($15)) + 970|0);
 HEAP8[$$index985>>0] = 0;
 $$index986 = ((($15)) + 971|0);
 HEAP8[$$index986>>0] = 0;
 $$index987 = ((($15)) + 972|0);
 HEAP8[$$index987>>0] = 0;
 $$index988 = ((($15)) + 973|0);
 HEAP8[$$index988>>0] = 0;
 $$index989 = ((($15)) + 974|0);
 HEAP8[$$index989>>0] = 0;
 $$index990 = ((($15)) + 975|0);
 HEAP8[$$index990>>0] = 0;
 $$index991 = ((($15)) + 976|0);
 HEAP8[$$index991>>0] = 0;
 $$index992 = ((($15)) + 977|0);
 HEAP8[$$index992>>0] = 0;
 $$index993 = ((($15)) + 978|0);
 HEAP8[$$index993>>0] = 0;
 $$index994 = ((($15)) + 979|0);
 HEAP8[$$index994>>0] = 0;
 $$index995 = ((($15)) + 980|0);
 HEAP8[$$index995>>0] = 0;
 $$index996 = ((($15)) + 981|0);
 HEAP8[$$index996>>0] = 0;
 $$index997 = ((($15)) + 982|0);
 HEAP8[$$index997>>0] = 0;
 $$index998 = ((($15)) + 983|0);
 HEAP8[$$index998>>0] = 0;
 $$index999 = ((($15)) + 984|0);
 HEAP8[$$index999>>0] = 0;
 $$index1000 = ((($15)) + 985|0);
 HEAP8[$$index1000>>0] = 0;
 $$index1001 = ((($15)) + 986|0);
 HEAP8[$$index1001>>0] = 0;
 $$index1002 = ((($15)) + 987|0);
 HEAP8[$$index1002>>0] = 0;
 $$index1003 = ((($15)) + 988|0);
 HEAP8[$$index1003>>0] = 0;
 $$index1004 = ((($15)) + 989|0);
 HEAP8[$$index1004>>0] = 0;
 $$index1005 = ((($15)) + 990|0);
 HEAP8[$$index1005>>0] = 0;
 $$index1006 = ((($15)) + 991|0);
 HEAP8[$$index1006>>0] = 0;
 $$index1007 = ((($15)) + 992|0);
 HEAP8[$$index1007>>0] = 0;
 $$index1008 = ((($15)) + 993|0);
 HEAP8[$$index1008>>0] = 0;
 $$index1009 = ((($15)) + 994|0);
 HEAP8[$$index1009>>0] = 0;
 $$index1010 = ((($15)) + 995|0);
 HEAP8[$$index1010>>0] = 0;
 $$index1011 = ((($15)) + 996|0);
 HEAP8[$$index1011>>0] = 0;
 $$index1012 = ((($15)) + 997|0);
 HEAP8[$$index1012>>0] = 0;
 $$index1013 = ((($15)) + 998|0);
 HEAP8[$$index1013>>0] = 0;
 $$index1014 = ((($15)) + 999|0);
 HEAP8[$$index1014>>0] = 0;
 $$index1015 = ((($15)) + 1000|0);
 HEAP8[$$index1015>>0] = 0;
 $$index1016 = ((($15)) + 1001|0);
 HEAP8[$$index1016>>0] = 0;
 $$index1017 = ((($15)) + 1002|0);
 HEAP8[$$index1017>>0] = 0;
 $$index1018 = ((($15)) + 1003|0);
 HEAP8[$$index1018>>0] = 0;
 $$index1019 = ((($15)) + 1004|0);
 HEAP8[$$index1019>>0] = 0;
 $$index1020 = ((($15)) + 1005|0);
 HEAP8[$$index1020>>0] = 0;
 $$index1021 = ((($15)) + 1006|0);
 HEAP8[$$index1021>>0] = 0;
 $$index1022 = ((($15)) + 1007|0);
 HEAP8[$$index1022>>0] = 0;
 $$index1023 = ((($15)) + 1008|0);
 HEAP8[$$index1023>>0] = 0;
 $$index1024 = ((($15)) + 1009|0);
 HEAP8[$$index1024>>0] = 0;
 $$index1025 = ((($15)) + 1010|0);
 HEAP8[$$index1025>>0] = 0;
 $$index1026 = ((($15)) + 1011|0);
 HEAP8[$$index1026>>0] = 0;
 $$index1027 = ((($15)) + 1012|0);
 HEAP8[$$index1027>>0] = 0;
 $$index1028 = ((($15)) + 1013|0);
 HEAP8[$$index1028>>0] = 0;
 $$index1029 = ((($15)) + 1014|0);
 HEAP8[$$index1029>>0] = 0;
 $$index1030 = ((($15)) + 1015|0);
 HEAP8[$$index1030>>0] = 0;
 $$index1031 = ((($15)) + 1016|0);
 HEAP8[$$index1031>>0] = 0;
 $$index1032 = ((($15)) + 1017|0);
 HEAP8[$$index1032>>0] = 0;
 $$index1033 = ((($15)) + 1018|0);
 HEAP8[$$index1033>>0] = 0;
 $$index1034 = ((($15)) + 1019|0);
 HEAP8[$$index1034>>0] = 0;
 $$index1035 = ((($15)) + 1020|0);
 HEAP8[$$index1035>>0] = 0;
 $$index1036 = ((($15)) + 1021|0);
 HEAP8[$$index1036>>0] = 0;
 $$index1037 = ((($15)) + 1022|0);
 HEAP8[$$index1037>>0] = 0;
 $$index1038 = ((($15)) + 1023|0);
 HEAP8[$$index1038>>0] = 0;
 $$index1039 = ((($15)) + 1024|0);
 HEAP8[$$index1039>>0] = 0;
 $$index1040 = ((($15)) + 1025|0);
 HEAP8[$$index1040>>0] = 0;
 $$index1041 = ((($15)) + 1026|0);
 HEAP8[$$index1041>>0] = 0;
 $$index1042 = ((($15)) + 1027|0);
 HEAP8[$$index1042>>0] = 0;
 $$index1043 = ((($15)) + 1028|0);
 HEAP8[$$index1043>>0] = 0;
 $$index1044 = ((($15)) + 1029|0);
 HEAP8[$$index1044>>0] = 0;
 $$index1045 = ((($15)) + 1030|0);
 HEAP8[$$index1045>>0] = 0;
 $$index1046 = ((($15)) + 1031|0);
 HEAP8[$$index1046>>0] = 0;
 $$index1047 = ((($15)) + 1032|0);
 HEAP8[$$index1047>>0] = 0;
 $$index1048 = ((($15)) + 1033|0);
 HEAP8[$$index1048>>0] = 0;
 $$index1049 = ((($15)) + 1034|0);
 HEAP8[$$index1049>>0] = 0;
 $$index1050 = ((($15)) + 1035|0);
 HEAP8[$$index1050>>0] = 0;
 $$index1051 = ((($15)) + 1036|0);
 HEAP8[$$index1051>>0] = 0;
 $$index1052 = ((($15)) + 1037|0);
 HEAP8[$$index1052>>0] = 0;
 $$index1053 = ((($15)) + 1038|0);
 HEAP8[$$index1053>>0] = 0;
 $$index1054 = ((($15)) + 1039|0);
 HEAP8[$$index1054>>0] = 0;
 $$index1055 = ((($15)) + 1040|0);
 HEAP8[$$index1055>>0] = 0;
 $$index1056 = ((($15)) + 1041|0);
 HEAP8[$$index1056>>0] = 0;
 $$index1057 = ((($15)) + 1042|0);
 HEAP8[$$index1057>>0] = 0;
 $$index1058 = ((($15)) + 1043|0);
 HEAP8[$$index1058>>0] = 0;
 $$index1059 = ((($15)) + 1044|0);
 HEAP8[$$index1059>>0] = 0;
 $$index1060 = ((($15)) + 1045|0);
 HEAP8[$$index1060>>0] = 0;
 $$index1061 = ((($15)) + 1046|0);
 HEAP8[$$index1061>>0] = 0;
 $$index1062 = ((($15)) + 1047|0);
 HEAP8[$$index1062>>0] = 0;
 $$index1063 = ((($15)) + 1048|0);
 HEAP8[$$index1063>>0] = 0;
 $$index1064 = ((($15)) + 1049|0);
 HEAP8[$$index1064>>0] = 0;
 $$index1065 = ((($15)) + 1050|0);
 HEAP8[$$index1065>>0] = 0;
 $$index1066 = ((($15)) + 1051|0);
 HEAP8[$$index1066>>0] = 0;
 $$index1067 = ((($15)) + 1052|0);
 HEAP8[$$index1067>>0] = 0;
 $$index1068 = ((($15)) + 1053|0);
 HEAP8[$$index1068>>0] = 0;
 $$index1069 = ((($15)) + 1054|0);
 HEAP8[$$index1069>>0] = 0;
 $$index1070 = ((($15)) + 1055|0);
 HEAP8[$$index1070>>0] = 0;
 $$index1071 = ((($15)) + 1056|0);
 HEAP8[$$index1071>>0] = 0;
 $$index1072 = ((($15)) + 1057|0);
 HEAP8[$$index1072>>0] = 0;
 $$index1073 = ((($15)) + 1058|0);
 HEAP8[$$index1073>>0] = 0;
 $$index1074 = ((($15)) + 1059|0);
 HEAP8[$$index1074>>0] = 0;
 $$index1075 = ((($15)) + 1060|0);
 HEAP8[$$index1075>>0] = 0;
 $$index1076 = ((($15)) + 1061|0);
 HEAP8[$$index1076>>0] = 0;
 $$index1077 = ((($15)) + 1062|0);
 HEAP8[$$index1077>>0] = 0;
 $$index1078 = ((($15)) + 1063|0);
 HEAP8[$$index1078>>0] = 0;
 $$index1079 = ((($15)) + 1064|0);
 HEAP8[$$index1079>>0] = 0;
 $$index1080 = ((($15)) + 1065|0);
 HEAP8[$$index1080>>0] = 0;
 $$index1081 = ((($15)) + 1066|0);
 HEAP8[$$index1081>>0] = 0;
 $$index1082 = ((($15)) + 1067|0);
 HEAP8[$$index1082>>0] = 0;
 $$index1083 = ((($15)) + 1068|0);
 HEAP8[$$index1083>>0] = 0;
 $$index1084 = ((($15)) + 1069|0);
 HEAP8[$$index1084>>0] = 0;
 $$index1085 = ((($15)) + 1070|0);
 HEAP8[$$index1085>>0] = 0;
 $$index1086 = ((($15)) + 1071|0);
 HEAP8[$$index1086>>0] = 0;
 $$index1087 = ((($15)) + 1072|0);
 HEAP8[$$index1087>>0] = 0;
 $$index1088 = ((($15)) + 1073|0);
 HEAP8[$$index1088>>0] = 0;
 $$index1089 = ((($15)) + 1074|0);
 HEAP8[$$index1089>>0] = 0;
 $$index1090 = ((($15)) + 1075|0);
 HEAP8[$$index1090>>0] = 0;
 $$index1091 = ((($15)) + 1076|0);
 HEAP8[$$index1091>>0] = 0;
 $$index1092 = ((($15)) + 1077|0);
 HEAP8[$$index1092>>0] = 0;
 $$index1093 = ((($15)) + 1078|0);
 HEAP8[$$index1093>>0] = 0;
 $$index1094 = ((($15)) + 1079|0);
 HEAP8[$$index1094>>0] = 0;
 $$index1095 = ((($15)) + 1080|0);
 HEAP8[$$index1095>>0] = 0;
 $$index1096 = ((($15)) + 1081|0);
 HEAP8[$$index1096>>0] = 0;
 $$index1097 = ((($15)) + 1082|0);
 HEAP8[$$index1097>>0] = 0;
 $$index1098 = ((($15)) + 1083|0);
 HEAP8[$$index1098>>0] = 0;
 $$index1099 = ((($15)) + 1084|0);
 HEAP8[$$index1099>>0] = 0;
 $$index1100 = ((($15)) + 1085|0);
 HEAP8[$$index1100>>0] = 0;
 $$index1101 = ((($15)) + 1086|0);
 HEAP8[$$index1101>>0] = 0;
 $$index1102 = ((($15)) + 1087|0);
 HEAP8[$$index1102>>0] = 0;
 $$index1103 = ((($15)) + 1088|0);
 HEAP8[$$index1103>>0] = 0;
 $$index1104 = ((($15)) + 1089|0);
 HEAP8[$$index1104>>0] = 0;
 $$index1105 = ((($15)) + 1090|0);
 HEAP8[$$index1105>>0] = 0;
 $$index1106 = ((($15)) + 1091|0);
 HEAP8[$$index1106>>0] = 0;
 $$index1107 = ((($15)) + 1092|0);
 HEAP8[$$index1107>>0] = 0;
 $$index1108 = ((($15)) + 1093|0);
 HEAP8[$$index1108>>0] = 0;
 $$index1109 = ((($15)) + 1094|0);
 HEAP8[$$index1109>>0] = 0;
 $$index1110 = ((($15)) + 1095|0);
 HEAP8[$$index1110>>0] = 0;
 $$index1111 = ((($15)) + 1096|0);
 HEAP8[$$index1111>>0] = 0;
 $$index1112 = ((($15)) + 1097|0);
 HEAP8[$$index1112>>0] = 0;
 $$index1113 = ((($15)) + 1098|0);
 HEAP8[$$index1113>>0] = 0;
 $$index1114 = ((($15)) + 1099|0);
 HEAP8[$$index1114>>0] = 0;
 $$index1115 = ((($15)) + 1100|0);
 HEAP8[$$index1115>>0] = 0;
 $$index1116 = ((($15)) + 1101|0);
 HEAP8[$$index1116>>0] = 0;
 $$index1117 = ((($15)) + 1102|0);
 HEAP8[$$index1117>>0] = 0;
 $$index1118 = ((($15)) + 1103|0);
 HEAP8[$$index1118>>0] = 0;
 $$index1119 = ((($15)) + 1104|0);
 HEAP8[$$index1119>>0] = 0;
 $$index1120 = ((($15)) + 1105|0);
 HEAP8[$$index1120>>0] = 0;
 $$index1121 = ((($15)) + 1106|0);
 HEAP8[$$index1121>>0] = 0;
 $$index1122 = ((($15)) + 1107|0);
 HEAP8[$$index1122>>0] = 0;
 $$index1123 = ((($15)) + 1108|0);
 HEAP8[$$index1123>>0] = 0;
 $$index1124 = ((($15)) + 1109|0);
 HEAP8[$$index1124>>0] = 0;
 $$index1125 = ((($15)) + 1110|0);
 HEAP8[$$index1125>>0] = 0;
 $$index1126 = ((($15)) + 1111|0);
 HEAP8[$$index1126>>0] = 0;
 $$index1127 = ((($15)) + 1112|0);
 HEAP8[$$index1127>>0] = 0;
 $$index1128 = ((($15)) + 1113|0);
 HEAP8[$$index1128>>0] = 0;
 $$index1129 = ((($15)) + 1114|0);
 HEAP8[$$index1129>>0] = 0;
 $$index1130 = ((($15)) + 1115|0);
 HEAP8[$$index1130>>0] = 0;
 $$index1131 = ((($15)) + 1116|0);
 HEAP8[$$index1131>>0] = 0;
 $$index1132 = ((($15)) + 1117|0);
 HEAP8[$$index1132>>0] = 0;
 $$index1133 = ((($15)) + 1118|0);
 HEAP8[$$index1133>>0] = 0;
 $$index1134 = ((($15)) + 1119|0);
 HEAP8[$$index1134>>0] = 0;
 $$index1135 = ((($15)) + 1120|0);
 HEAP8[$$index1135>>0] = 0;
 $$index1136 = ((($15)) + 1121|0);
 HEAP8[$$index1136>>0] = 0;
 $$index1137 = ((($15)) + 1122|0);
 HEAP8[$$index1137>>0] = 0;
 $$index1138 = ((($15)) + 1123|0);
 HEAP8[$$index1138>>0] = 0;
 $$index1139 = ((($15)) + 1124|0);
 HEAP8[$$index1139>>0] = 0;
 $$index1140 = ((($15)) + 1125|0);
 HEAP8[$$index1140>>0] = 0;
 $$index1141 = ((($15)) + 1126|0);
 HEAP8[$$index1141>>0] = 0;
 $$index1142 = ((($15)) + 1127|0);
 HEAP8[$$index1142>>0] = 0;
 $$index1143 = ((($15)) + 1128|0);
 HEAP8[$$index1143>>0] = 0;
 $$index1144 = ((($15)) + 1129|0);
 HEAP8[$$index1144>>0] = 0;
 $$index1145 = ((($15)) + 1130|0);
 HEAP8[$$index1145>>0] = 0;
 $$index1146 = ((($15)) + 1131|0);
 HEAP8[$$index1146>>0] = 0;
 $$index1147 = ((($15)) + 1132|0);
 HEAP8[$$index1147>>0] = 0;
 $$index1148 = ((($15)) + 1133|0);
 HEAP8[$$index1148>>0] = 0;
 $$index1149 = ((($15)) + 1134|0);
 HEAP8[$$index1149>>0] = 0;
 $$index1150 = ((($15)) + 1135|0);
 HEAP8[$$index1150>>0] = 0;
 $$index1151 = ((($15)) + 1136|0);
 HEAP8[$$index1151>>0] = 0;
 $$index1152 = ((($15)) + 1137|0);
 HEAP8[$$index1152>>0] = 0;
 $$index1153 = ((($15)) + 1138|0);
 HEAP8[$$index1153>>0] = 0;
 $$index1154 = ((($15)) + 1139|0);
 HEAP8[$$index1154>>0] = 0;
 $$index1155 = ((($15)) + 1140|0);
 HEAP8[$$index1155>>0] = 0;
 $$index1156 = ((($15)) + 1141|0);
 HEAP8[$$index1156>>0] = 0;
 $$index1157 = ((($15)) + 1142|0);
 HEAP8[$$index1157>>0] = 0;
 $$index1158 = ((($15)) + 1143|0);
 HEAP8[$$index1158>>0] = 0;
 $$index1159 = ((($15)) + 1144|0);
 HEAP8[$$index1159>>0] = 0;
 $$index1160 = ((($15)) + 1145|0);
 HEAP8[$$index1160>>0] = 0;
 $$index1161 = ((($15)) + 1146|0);
 HEAP8[$$index1161>>0] = 0;
 $$index1162 = ((($15)) + 1147|0);
 HEAP8[$$index1162>>0] = 0;
 $$index1163 = ((($15)) + 1148|0);
 HEAP8[$$index1163>>0] = 0;
 $$index1164 = ((($15)) + 1149|0);
 HEAP8[$$index1164>>0] = 0;
 $$index1165 = ((($15)) + 1150|0);
 HEAP8[$$index1165>>0] = 0;
 $$index1166 = ((($15)) + 1151|0);
 HEAP8[$$index1166>>0] = 0;
 $$index1167 = ((($15)) + 1152|0);
 HEAP8[$$index1167>>0] = 0;
 $$index1168 = ((($15)) + 1153|0);
 HEAP8[$$index1168>>0] = 0;
 $$index1169 = ((($15)) + 1154|0);
 HEAP8[$$index1169>>0] = 0;
 $$index1170 = ((($15)) + 1155|0);
 HEAP8[$$index1170>>0] = 0;
 $$index1171 = ((($15)) + 1156|0);
 HEAP8[$$index1171>>0] = 0;
 $$index1172 = ((($15)) + 1157|0);
 HEAP8[$$index1172>>0] = 0;
 $$index1173 = ((($15)) + 1158|0);
 HEAP8[$$index1173>>0] = 0;
 $$index1174 = ((($15)) + 1159|0);
 HEAP8[$$index1174>>0] = 0;
 $$index1175 = ((($15)) + 1160|0);
 HEAP8[$$index1175>>0] = 0;
 $$index1176 = ((($15)) + 1161|0);
 HEAP8[$$index1176>>0] = 0;
 $$index1177 = ((($15)) + 1162|0);
 HEAP8[$$index1177>>0] = 0;
 $$index1178 = ((($15)) + 1163|0);
 HEAP8[$$index1178>>0] = 0;
 $$index1179 = ((($15)) + 1164|0);
 HEAP8[$$index1179>>0] = 0;
 $$index1180 = ((($15)) + 1165|0);
 HEAP8[$$index1180>>0] = 0;
 $$index1181 = ((($15)) + 1166|0);
 HEAP8[$$index1181>>0] = 0;
 $$index1182 = ((($15)) + 1167|0);
 HEAP8[$$index1182>>0] = 0;
 $$index1183 = ((($15)) + 1168|0);
 HEAP8[$$index1183>>0] = 0;
 $$index1184 = ((($15)) + 1169|0);
 HEAP8[$$index1184>>0] = 0;
 $$index1185 = ((($15)) + 1170|0);
 HEAP8[$$index1185>>0] = 0;
 $$index1186 = ((($15)) + 1171|0);
 HEAP8[$$index1186>>0] = 0;
 $$index1187 = ((($15)) + 1172|0);
 HEAP8[$$index1187>>0] = 0;
 $$index1188 = ((($15)) + 1173|0);
 HEAP8[$$index1188>>0] = 0;
 $$index1189 = ((($15)) + 1174|0);
 HEAP8[$$index1189>>0] = 0;
 $$index1190 = ((($15)) + 1175|0);
 HEAP8[$$index1190>>0] = 0;
 $$index1191 = ((($15)) + 1176|0);
 HEAP8[$$index1191>>0] = 0;
 $$index1192 = ((($15)) + 1177|0);
 HEAP8[$$index1192>>0] = 0;
 $$index1193 = ((($15)) + 1178|0);
 HEAP8[$$index1193>>0] = 0;
 $$index1194 = ((($15)) + 1179|0);
 HEAP8[$$index1194>>0] = 0;
 $$index1195 = ((($15)) + 1180|0);
 HEAP8[$$index1195>>0] = 0;
 $$index1196 = ((($15)) + 1181|0);
 HEAP8[$$index1196>>0] = 0;
 $$index1197 = ((($15)) + 1182|0);
 HEAP8[$$index1197>>0] = 0;
 $$index1198 = ((($15)) + 1183|0);
 HEAP8[$$index1198>>0] = 0;
 $$index1199 = ((($15)) + 1184|0);
 HEAP8[$$index1199>>0] = 0;
 $$index1200 = ((($15)) + 1185|0);
 HEAP8[$$index1200>>0] = 0;
 $$index1201 = ((($15)) + 1186|0);
 HEAP8[$$index1201>>0] = 0;
 $$index1202 = ((($15)) + 1187|0);
 HEAP8[$$index1202>>0] = 0;
 $$index1203 = ((($15)) + 1188|0);
 HEAP8[$$index1203>>0] = 0;
 $$index1204 = ((($15)) + 1189|0);
 HEAP8[$$index1204>>0] = 0;
 $$index1205 = ((($15)) + 1190|0);
 HEAP8[$$index1205>>0] = 0;
 $$index1206 = ((($15)) + 1191|0);
 HEAP8[$$index1206>>0] = 0;
 $$index1207 = ((($15)) + 1192|0);
 HEAP8[$$index1207>>0] = 0;
 $$index1208 = ((($15)) + 1193|0);
 HEAP8[$$index1208>>0] = 0;
 $$index1209 = ((($15)) + 1194|0);
 HEAP8[$$index1209>>0] = 0;
 $$index1210 = ((($15)) + 1195|0);
 HEAP8[$$index1210>>0] = 0;
 $$index1211 = ((($15)) + 1196|0);
 HEAP8[$$index1211>>0] = 0;
 $$index1212 = ((($15)) + 1197|0);
 HEAP8[$$index1212>>0] = 0;
 $$index1213 = ((($15)) + 1198|0);
 HEAP8[$$index1213>>0] = 0;
 $$index1214 = ((($15)) + 1199|0);
 HEAP8[$$index1214>>0] = 0;
 $$index1215 = ((($15)) + 1200|0);
 HEAP8[$$index1215>>0] = 0;
 $$index1216 = ((($15)) + 1201|0);
 HEAP8[$$index1216>>0] = 0;
 $$index1217 = ((($15)) + 1202|0);
 HEAP8[$$index1217>>0] = 0;
 $$index1218 = ((($15)) + 1203|0);
 HEAP8[$$index1218>>0] = 0;
 $$index1219 = ((($15)) + 1204|0);
 HEAP8[$$index1219>>0] = 0;
 $$index1220 = ((($15)) + 1205|0);
 HEAP8[$$index1220>>0] = 0;
 $$index1221 = ((($15)) + 1206|0);
 HEAP8[$$index1221>>0] = 0;
 $$index1222 = ((($15)) + 1207|0);
 HEAP8[$$index1222>>0] = 0;
 $$index1223 = ((($15)) + 1208|0);
 HEAP8[$$index1223>>0] = 0;
 $$index1224 = ((($15)) + 1209|0);
 HEAP8[$$index1224>>0] = 0;
 $$index1225 = ((($15)) + 1210|0);
 HEAP8[$$index1225>>0] = 0;
 $$index1226 = ((($15)) + 1211|0);
 HEAP8[$$index1226>>0] = 0;
 $$index1227 = ((($15)) + 1212|0);
 HEAP8[$$index1227>>0] = 0;
 $$index1228 = ((($15)) + 1213|0);
 HEAP8[$$index1228>>0] = 0;
 $$index1229 = ((($15)) + 1214|0);
 HEAP8[$$index1229>>0] = 0;
 $$index1230 = ((($15)) + 1215|0);
 HEAP8[$$index1230>>0] = 0;
 $$index1231 = ((($15)) + 1216|0);
 HEAP8[$$index1231>>0] = 0;
 $$index1232 = ((($15)) + 1217|0);
 HEAP8[$$index1232>>0] = 0;
 $$index1233 = ((($15)) + 1218|0);
 HEAP8[$$index1233>>0] = 0;
 $$index1234 = ((($15)) + 1219|0);
 HEAP8[$$index1234>>0] = 0;
 $$index1235 = ((($15)) + 1220|0);
 HEAP8[$$index1235>>0] = 0;
 $$index1236 = ((($15)) + 1221|0);
 HEAP8[$$index1236>>0] = 0;
 $$index1237 = ((($15)) + 1222|0);
 HEAP8[$$index1237>>0] = 0;
 $$index1238 = ((($15)) + 1223|0);
 HEAP8[$$index1238>>0] = 0;
 $$index1239 = ((($15)) + 1224|0);
 HEAP8[$$index1239>>0] = 0;
 $$index1240 = ((($15)) + 1225|0);
 HEAP8[$$index1240>>0] = 0;
 $$index1241 = ((($15)) + 1226|0);
 HEAP8[$$index1241>>0] = 0;
 $$index1242 = ((($15)) + 1227|0);
 HEAP8[$$index1242>>0] = 0;
 $$index1243 = ((($15)) + 1228|0);
 HEAP8[$$index1243>>0] = 0;
 $$index1244 = ((($15)) + 1229|0);
 HEAP8[$$index1244>>0] = 0;
 $$index1245 = ((($15)) + 1230|0);
 HEAP8[$$index1245>>0] = 0;
 $$index1246 = ((($15)) + 1231|0);
 HEAP8[$$index1246>>0] = 0;
 $$index1247 = ((($15)) + 1232|0);
 HEAP8[$$index1247>>0] = 0;
 $$index1248 = ((($15)) + 1233|0);
 HEAP8[$$index1248>>0] = 0;
 $$index1249 = ((($15)) + 1234|0);
 HEAP8[$$index1249>>0] = 0;
 $$index1250 = ((($15)) + 1235|0);
 HEAP8[$$index1250>>0] = 0;
 $$index1251 = ((($15)) + 1236|0);
 HEAP8[$$index1251>>0] = 0;
 $$index1252 = ((($15)) + 1237|0);
 HEAP8[$$index1252>>0] = 0;
 $$index1253 = ((($15)) + 1238|0);
 HEAP8[$$index1253>>0] = 0;
 $$index1254 = ((($15)) + 1239|0);
 HEAP8[$$index1254>>0] = 0;
 $$index1255 = ((($15)) + 1240|0);
 HEAP8[$$index1255>>0] = 0;
 $$index1256 = ((($15)) + 1241|0);
 HEAP8[$$index1256>>0] = 0;
 $$index1257 = ((($15)) + 1242|0);
 HEAP8[$$index1257>>0] = 0;
 $$index1258 = ((($15)) + 1243|0);
 HEAP8[$$index1258>>0] = 0;
 $$index1259 = ((($15)) + 1244|0);
 HEAP8[$$index1259>>0] = 0;
 $$index1260 = ((($15)) + 1245|0);
 HEAP8[$$index1260>>0] = 0;
 $$index1261 = ((($15)) + 1246|0);
 HEAP8[$$index1261>>0] = 0;
 $$index1262 = ((($15)) + 1247|0);
 HEAP8[$$index1262>>0] = 0;
 $$index1263 = ((($15)) + 1248|0);
 HEAP8[$$index1263>>0] = 0;
 $$index1264 = ((($15)) + 1249|0);
 HEAP8[$$index1264>>0] = 0;
 $$index1265 = ((($15)) + 1250|0);
 HEAP8[$$index1265>>0] = 0;
 $$index1266 = ((($15)) + 1251|0);
 HEAP8[$$index1266>>0] = 0;
 $$index1267 = ((($15)) + 1252|0);
 HEAP8[$$index1267>>0] = 0;
 $$index1268 = ((($15)) + 1253|0);
 HEAP8[$$index1268>>0] = 0;
 $$index1269 = ((($15)) + 1254|0);
 HEAP8[$$index1269>>0] = 0;
 $$index1270 = ((($15)) + 1255|0);
 HEAP8[$$index1270>>0] = 0;
 $$index1271 = ((($15)) + 1256|0);
 HEAP8[$$index1271>>0] = 0;
 $$index1272 = ((($15)) + 1257|0);
 HEAP8[$$index1272>>0] = 0;
 $$index1273 = ((($15)) + 1258|0);
 HEAP8[$$index1273>>0] = 0;
 $$index1274 = ((($15)) + 1259|0);
 HEAP8[$$index1274>>0] = 0;
 $$index1275 = ((($15)) + 1260|0);
 HEAP8[$$index1275>>0] = 0;
 $$index1276 = ((($15)) + 1261|0);
 HEAP8[$$index1276>>0] = 0;
 $$index1277 = ((($15)) + 1262|0);
 HEAP8[$$index1277>>0] = 0;
 $$index1278 = ((($15)) + 1263|0);
 HEAP8[$$index1278>>0] = 0;
 $$index1279 = ((($15)) + 1264|0);
 HEAP8[$$index1279>>0] = 0;
 $$index1280 = ((($15)) + 1265|0);
 HEAP8[$$index1280>>0] = 0;
 $$index1281 = ((($15)) + 1266|0);
 HEAP8[$$index1281>>0] = 0;
 $$index1282 = ((($15)) + 1267|0);
 HEAP8[$$index1282>>0] = 0;
 $$index1283 = ((($15)) + 1268|0);
 HEAP8[$$index1283>>0] = 0;
 $$index1284 = ((($15)) + 1269|0);
 HEAP8[$$index1284>>0] = 0;
 $$index1285 = ((($15)) + 1270|0);
 HEAP8[$$index1285>>0] = 0;
 $$index1286 = ((($15)) + 1271|0);
 HEAP8[$$index1286>>0] = 0;
 $$index1287 = ((($15)) + 1272|0);
 HEAP8[$$index1287>>0] = 0;
 $$index1288 = ((($15)) + 1273|0);
 HEAP8[$$index1288>>0] = 0;
 $$index1289 = ((($15)) + 1274|0);
 HEAP8[$$index1289>>0] = 0;
 $$index1290 = ((($15)) + 1275|0);
 HEAP8[$$index1290>>0] = 0;
 $$index1291 = ((($15)) + 1276|0);
 HEAP8[$$index1291>>0] = 0;
 $$index1292 = ((($15)) + 1277|0);
 HEAP8[$$index1292>>0] = 0;
 $$index1293 = ((($15)) + 1278|0);
 HEAP8[$$index1293>>0] = 0;
 $$index1294 = ((($15)) + 1279|0);
 HEAP8[$$index1294>>0] = 0;
 $$index1295 = ((($15)) + 1280|0);
 HEAP8[$$index1295>>0] = 0;
 $$index1296 = ((($15)) + 1281|0);
 HEAP8[$$index1296>>0] = 0;
 $$index1297 = ((($15)) + 1282|0);
 HEAP8[$$index1297>>0] = 0;
 $$index1298 = ((($15)) + 1283|0);
 HEAP8[$$index1298>>0] = 0;
 $$index1299 = ((($15)) + 1284|0);
 HEAP8[$$index1299>>0] = 0;
 $$index1300 = ((($15)) + 1285|0);
 HEAP8[$$index1300>>0] = 0;
 $$index1301 = ((($15)) + 1286|0);
 HEAP8[$$index1301>>0] = 0;
 $$index1302 = ((($15)) + 1287|0);
 HEAP8[$$index1302>>0] = 0;
 $$index1303 = ((($15)) + 1288|0);
 HEAP8[$$index1303>>0] = 0;
 $$index1304 = ((($15)) + 1289|0);
 HEAP8[$$index1304>>0] = 0;
 $$index1305 = ((($15)) + 1290|0);
 HEAP8[$$index1305>>0] = 0;
 $$index1306 = ((($15)) + 1291|0);
 HEAP8[$$index1306>>0] = 0;
 $$index1307 = ((($15)) + 1292|0);
 HEAP8[$$index1307>>0] = 0;
 $$index1308 = ((($15)) + 1293|0);
 HEAP8[$$index1308>>0] = 0;
 $$index1309 = ((($15)) + 1294|0);
 HEAP8[$$index1309>>0] = 0;
 $$index1310 = ((($15)) + 1295|0);
 HEAP8[$$index1310>>0] = 0;
 $$index1311 = ((($15)) + 1296|0);
 HEAP8[$$index1311>>0] = 0;
 $$index1312 = ((($15)) + 1297|0);
 HEAP8[$$index1312>>0] = 0;
 $$index1313 = ((($15)) + 1298|0);
 HEAP8[$$index1313>>0] = 0;
 $$index1314 = ((($15)) + 1299|0);
 HEAP8[$$index1314>>0] = 0;
 $$index1315 = ((($15)) + 1300|0);
 HEAP8[$$index1315>>0] = 0;
 $$index1316 = ((($15)) + 1301|0);
 HEAP8[$$index1316>>0] = 0;
 $$index1317 = ((($15)) + 1302|0);
 HEAP8[$$index1317>>0] = 0;
 $$index1318 = ((($15)) + 1303|0);
 HEAP8[$$index1318>>0] = 0;
 $$index1319 = ((($15)) + 1304|0);
 HEAP8[$$index1319>>0] = 0;
 $$index1320 = ((($15)) + 1305|0);
 HEAP8[$$index1320>>0] = 0;
 $$index1321 = ((($15)) + 1306|0);
 HEAP8[$$index1321>>0] = 0;
 $$index1322 = ((($15)) + 1307|0);
 HEAP8[$$index1322>>0] = 0;
 $$index1323 = ((($15)) + 1308|0);
 HEAP8[$$index1323>>0] = 0;
 $$index1324 = ((($15)) + 1309|0);
 HEAP8[$$index1324>>0] = 0;
 $$index1325 = ((($15)) + 1310|0);
 HEAP8[$$index1325>>0] = 0;
 $$index1326 = ((($15)) + 1311|0);
 HEAP8[$$index1326>>0] = 0;
 $$index1327 = ((($15)) + 1312|0);
 HEAP8[$$index1327>>0] = 0;
 $$index1328 = ((($15)) + 1313|0);
 HEAP8[$$index1328>>0] = 0;
 $$index1329 = ((($15)) + 1314|0);
 HEAP8[$$index1329>>0] = 0;
 $$index1330 = ((($15)) + 1315|0);
 HEAP8[$$index1330>>0] = 0;
 $$index1331 = ((($15)) + 1316|0);
 HEAP8[$$index1331>>0] = 0;
 $$index1332 = ((($15)) + 1317|0);
 HEAP8[$$index1332>>0] = 0;
 $$index1333 = ((($15)) + 1318|0);
 HEAP8[$$index1333>>0] = 0;
 $$index1334 = ((($15)) + 1319|0);
 HEAP8[$$index1334>>0] = 0;
 $$index1335 = ((($15)) + 1320|0);
 HEAP8[$$index1335>>0] = 0;
 $$index1336 = ((($15)) + 1321|0);
 HEAP8[$$index1336>>0] = 0;
 $$index1337 = ((($15)) + 1322|0);
 HEAP8[$$index1337>>0] = 0;
 $$index1338 = ((($15)) + 1323|0);
 HEAP8[$$index1338>>0] = 0;
 $$index1339 = ((($15)) + 1324|0);
 HEAP8[$$index1339>>0] = 0;
 $$index1340 = ((($15)) + 1325|0);
 HEAP8[$$index1340>>0] = 0;
 $$index1341 = ((($15)) + 1326|0);
 HEAP8[$$index1341>>0] = 0;
 $$index1342 = ((($15)) + 1327|0);
 HEAP8[$$index1342>>0] = 0;
 $$index1343 = ((($15)) + 1328|0);
 HEAP8[$$index1343>>0] = 0;
 $$index1344 = ((($15)) + 1329|0);
 HEAP8[$$index1344>>0] = 0;
 $$index1345 = ((($15)) + 1330|0);
 HEAP8[$$index1345>>0] = 0;
 $$index1346 = ((($15)) + 1331|0);
 HEAP8[$$index1346>>0] = 0;
 $$index1347 = ((($15)) + 1332|0);
 HEAP8[$$index1347>>0] = 0;
 $$index1348 = ((($15)) + 1333|0);
 HEAP8[$$index1348>>0] = 0;
 $$index1349 = ((($15)) + 1334|0);
 HEAP8[$$index1349>>0] = 0;
 $$index1350 = ((($15)) + 1335|0);
 HEAP8[$$index1350>>0] = 0;
 $$index1351 = ((($15)) + 1336|0);
 HEAP8[$$index1351>>0] = 0;
 $$index1352 = ((($15)) + 1337|0);
 HEAP8[$$index1352>>0] = 0;
 $$index1353 = ((($15)) + 1338|0);
 HEAP8[$$index1353>>0] = 0;
 $$index1354 = ((($15)) + 1339|0);
 HEAP8[$$index1354>>0] = 0;
 $$index1355 = ((($15)) + 1340|0);
 HEAP8[$$index1355>>0] = 0;
 $$index1356 = ((($15)) + 1341|0);
 HEAP8[$$index1356>>0] = 0;
 $$index1357 = ((($15)) + 1342|0);
 HEAP8[$$index1357>>0] = 0;
 $$index1358 = ((($15)) + 1343|0);
 HEAP8[$$index1358>>0] = 0;
 $$index1359 = ((($15)) + 1344|0);
 HEAP8[$$index1359>>0] = 0;
 $$index1360 = ((($15)) + 1345|0);
 HEAP8[$$index1360>>0] = 0;
 $$index1361 = ((($15)) + 1346|0);
 HEAP8[$$index1361>>0] = 0;
 $$index1362 = ((($15)) + 1347|0);
 HEAP8[$$index1362>>0] = 0;
 $$index1363 = ((($15)) + 1348|0);
 HEAP8[$$index1363>>0] = 0;
 $$index1364 = ((($15)) + 1349|0);
 HEAP8[$$index1364>>0] = 0;
 $$index1365 = ((($15)) + 1350|0);
 HEAP8[$$index1365>>0] = 0;
 $$index1366 = ((($15)) + 1351|0);
 HEAP8[$$index1366>>0] = 0;
 $$index1367 = ((($15)) + 1352|0);
 HEAP8[$$index1367>>0] = 0;
 $$index1368 = ((($15)) + 1353|0);
 HEAP8[$$index1368>>0] = 0;
 $$index1369 = ((($15)) + 1354|0);
 HEAP8[$$index1369>>0] = 0;
 $$index1370 = ((($15)) + 1355|0);
 HEAP8[$$index1370>>0] = 0;
 $$index1371 = ((($15)) + 1356|0);
 HEAP8[$$index1371>>0] = 0;
 $$index1372 = ((($15)) + 1357|0);
 HEAP8[$$index1372>>0] = 0;
 $$index1373 = ((($15)) + 1358|0);
 HEAP8[$$index1373>>0] = 0;
 $$index1374 = ((($15)) + 1359|0);
 HEAP8[$$index1374>>0] = 0;
 $$index1375 = ((($15)) + 1360|0);
 HEAP8[$$index1375>>0] = 0;
 $$index1376 = ((($15)) + 1361|0);
 HEAP8[$$index1376>>0] = 0;
 $$index1377 = ((($15)) + 1362|0);
 HEAP8[$$index1377>>0] = 0;
 $$index1378 = ((($15)) + 1363|0);
 HEAP8[$$index1378>>0] = 0;
 $$index1379 = ((($15)) + 1364|0);
 HEAP8[$$index1379>>0] = 0;
 $$index1380 = ((($15)) + 1365|0);
 HEAP8[$$index1380>>0] = 0;
 $$index1381 = ((($15)) + 1366|0);
 HEAP8[$$index1381>>0] = 0;
 $$index1382 = ((($15)) + 1367|0);
 HEAP8[$$index1382>>0] = 0;
 $$index1383 = ((($15)) + 1368|0);
 HEAP8[$$index1383>>0] = 0;
 $$index1384 = ((($15)) + 1369|0);
 HEAP8[$$index1384>>0] = 0;
 $$index1385 = ((($15)) + 1370|0);
 HEAP8[$$index1385>>0] = 0;
 $$index1386 = ((($15)) + 1371|0);
 HEAP8[$$index1386>>0] = 0;
 $$index1387 = ((($15)) + 1372|0);
 HEAP8[$$index1387>>0] = 0;
 $$index1388 = ((($15)) + 1373|0);
 HEAP8[$$index1388>>0] = 0;
 $$index1389 = ((($15)) + 1374|0);
 HEAP8[$$index1389>>0] = 0;
 $$index1390 = ((($15)) + 1375|0);
 HEAP8[$$index1390>>0] = 0;
 $$index1391 = ((($15)) + 1376|0);
 HEAP8[$$index1391>>0] = 0;
 $$index1392 = ((($15)) + 1377|0);
 HEAP8[$$index1392>>0] = 0;
 $$index1393 = ((($15)) + 1378|0);
 HEAP8[$$index1393>>0] = 0;
 $$index1394 = ((($15)) + 1379|0);
 HEAP8[$$index1394>>0] = 0;
 $$index1395 = ((($15)) + 1380|0);
 HEAP8[$$index1395>>0] = 0;
 $$index1396 = ((($15)) + 1381|0);
 HEAP8[$$index1396>>0] = 0;
 $$index1397 = ((($15)) + 1382|0);
 HEAP8[$$index1397>>0] = 0;
 $$index1398 = ((($15)) + 1383|0);
 HEAP8[$$index1398>>0] = 0;
 $$index1399 = ((($15)) + 1384|0);
 HEAP8[$$index1399>>0] = 0;
 $$index1400 = ((($15)) + 1385|0);
 HEAP8[$$index1400>>0] = 0;
 $$index1401 = ((($15)) + 1386|0);
 HEAP8[$$index1401>>0] = 0;
 $$index1402 = ((($15)) + 1387|0);
 HEAP8[$$index1402>>0] = 0;
 $$index1403 = ((($15)) + 1388|0);
 HEAP8[$$index1403>>0] = 0;
 $$index1404 = ((($15)) + 1389|0);
 HEAP8[$$index1404>>0] = 0;
 $$index1405 = ((($15)) + 1390|0);
 HEAP8[$$index1405>>0] = 0;
 $$index1406 = ((($15)) + 1391|0);
 HEAP8[$$index1406>>0] = 0;
 $$index1407 = ((($15)) + 1392|0);
 HEAP8[$$index1407>>0] = 0;
 $$index1408 = ((($15)) + 1393|0);
 HEAP8[$$index1408>>0] = 0;
 $$index1409 = ((($15)) + 1394|0);
 HEAP8[$$index1409>>0] = 0;
 $$index1410 = ((($15)) + 1395|0);
 HEAP8[$$index1410>>0] = 0;
 $$index1411 = ((($15)) + 1396|0);
 HEAP8[$$index1411>>0] = 0;
 $$index1412 = ((($15)) + 1397|0);
 HEAP8[$$index1412>>0] = 0;
 $$index1413 = ((($15)) + 1398|0);
 HEAP8[$$index1413>>0] = 0;
 $$index1414 = ((($15)) + 1399|0);
 HEAP8[$$index1414>>0] = 0;
 $$index1415 = ((($15)) + 1400|0);
 HEAP8[$$index1415>>0] = 0;
 $$index1416 = ((($15)) + 1401|0);
 HEAP8[$$index1416>>0] = 0;
 $$index1417 = ((($15)) + 1402|0);
 HEAP8[$$index1417>>0] = 0;
 $$index1418 = ((($15)) + 1403|0);
 HEAP8[$$index1418>>0] = 0;
 $$index1419 = ((($15)) + 1404|0);
 HEAP8[$$index1419>>0] = 0;
 $$index1420 = ((($15)) + 1405|0);
 HEAP8[$$index1420>>0] = 0;
 $$index1421 = ((($15)) + 1406|0);
 HEAP8[$$index1421>>0] = 0;
 $$index1422 = ((($15)) + 1407|0);
 HEAP8[$$index1422>>0] = 0;
 $$index1423 = ((($15)) + 1408|0);
 HEAP8[$$index1423>>0] = 0;
 $$index1424 = ((($15)) + 1409|0);
 HEAP8[$$index1424>>0] = 0;
 $$index1425 = ((($15)) + 1410|0);
 HEAP8[$$index1425>>0] = 0;
 $$index1426 = ((($15)) + 1411|0);
 HEAP8[$$index1426>>0] = 0;
 $$index1427 = ((($15)) + 1412|0);
 HEAP8[$$index1427>>0] = 0;
 $$index1428 = ((($15)) + 1413|0);
 HEAP8[$$index1428>>0] = 0;
 $$index1429 = ((($15)) + 1414|0);
 HEAP8[$$index1429>>0] = 0;
 $$index1430 = ((($15)) + 1415|0);
 HEAP8[$$index1430>>0] = 0;
 $$index1431 = ((($15)) + 1416|0);
 HEAP8[$$index1431>>0] = 0;
 $$index1432 = ((($15)) + 1417|0);
 HEAP8[$$index1432>>0] = 0;
 $$index1433 = ((($15)) + 1418|0);
 HEAP8[$$index1433>>0] = 0;
 $$index1434 = ((($15)) + 1419|0);
 HEAP8[$$index1434>>0] = 0;
 $$index1435 = ((($15)) + 1420|0);
 HEAP8[$$index1435>>0] = 0;
 $$index1436 = ((($15)) + 1421|0);
 HEAP8[$$index1436>>0] = 0;
 $$index1437 = ((($15)) + 1422|0);
 HEAP8[$$index1437>>0] = 0;
 $$index1438 = ((($15)) + 1423|0);
 HEAP8[$$index1438>>0] = 0;
 $$index1439 = ((($15)) + 1424|0);
 HEAP8[$$index1439>>0] = 0;
 $$index1440 = ((($15)) + 1425|0);
 HEAP8[$$index1440>>0] = 0;
 $$index1441 = ((($15)) + 1426|0);
 HEAP8[$$index1441>>0] = 0;
 $$index1442 = ((($15)) + 1427|0);
 HEAP8[$$index1442>>0] = 0;
 $$index1443 = ((($15)) + 1428|0);
 HEAP8[$$index1443>>0] = 0;
 $$index1444 = ((($15)) + 1429|0);
 HEAP8[$$index1444>>0] = 0;
 $$index1445 = ((($15)) + 1430|0);
 HEAP8[$$index1445>>0] = 0;
 $$index1446 = ((($15)) + 1431|0);
 HEAP8[$$index1446>>0] = 0;
 $$index1447 = ((($15)) + 1432|0);
 HEAP8[$$index1447>>0] = 0;
 $$index1448 = ((($15)) + 1433|0);
 HEAP8[$$index1448>>0] = 0;
 $$index1449 = ((($15)) + 1434|0);
 HEAP8[$$index1449>>0] = 0;
 $$index1450 = ((($15)) + 1435|0);
 HEAP8[$$index1450>>0] = 0;
 $$index1451 = ((($15)) + 1436|0);
 HEAP8[$$index1451>>0] = 0;
 $$index1452 = ((($15)) + 1437|0);
 HEAP8[$$index1452>>0] = 0;
 $$index1453 = ((($15)) + 1438|0);
 HEAP8[$$index1453>>0] = 0;
 $$index1454 = ((($15)) + 1439|0);
 HEAP8[$$index1454>>0] = 0;
 $$index1455 = ((($15)) + 1440|0);
 HEAP8[$$index1455>>0] = 0;
 $$index1456 = ((($15)) + 1441|0);
 HEAP8[$$index1456>>0] = 0;
 $$index1457 = ((($15)) + 1442|0);
 HEAP8[$$index1457>>0] = 0;
 $$index1458 = ((($15)) + 1443|0);
 HEAP8[$$index1458>>0] = 0;
 $$index1459 = ((($15)) + 1444|0);
 HEAP8[$$index1459>>0] = 0;
 $$index1460 = ((($15)) + 1445|0);
 HEAP8[$$index1460>>0] = 0;
 $$index1461 = ((($15)) + 1446|0);
 HEAP8[$$index1461>>0] = 0;
 $$index1462 = ((($15)) + 1447|0);
 HEAP8[$$index1462>>0] = 0;
 $$index1463 = ((($15)) + 1448|0);
 HEAP8[$$index1463>>0] = 0;
 $$index1464 = ((($15)) + 1449|0);
 HEAP8[$$index1464>>0] = 0;
 $$index1465 = ((($15)) + 1450|0);
 HEAP8[$$index1465>>0] = 0;
 $$index1466 = ((($15)) + 1451|0);
 HEAP8[$$index1466>>0] = 0;
 $$index1467 = ((($15)) + 1452|0);
 HEAP8[$$index1467>>0] = 0;
 $$index1468 = ((($15)) + 1453|0);
 HEAP8[$$index1468>>0] = 0;
 $$index1469 = ((($15)) + 1454|0);
 HEAP8[$$index1469>>0] = 0;
 $$index1470 = ((($15)) + 1455|0);
 HEAP8[$$index1470>>0] = 0;
 $$index1471 = ((($15)) + 1456|0);
 HEAP8[$$index1471>>0] = 0;
 $$index1472 = ((($15)) + 1457|0);
 HEAP8[$$index1472>>0] = 0;
 $$index1473 = ((($15)) + 1458|0);
 HEAP8[$$index1473>>0] = 0;
 $$index1474 = ((($15)) + 1459|0);
 HEAP8[$$index1474>>0] = 0;
 $$index1475 = ((($15)) + 1460|0);
 HEAP8[$$index1475>>0] = 0;
 $$index1476 = ((($15)) + 1461|0);
 HEAP8[$$index1476>>0] = 0;
 $$index1477 = ((($15)) + 1462|0);
 HEAP8[$$index1477>>0] = 0;
 $$index1478 = ((($15)) + 1463|0);
 HEAP8[$$index1478>>0] = 0;
 $$index1479 = ((($15)) + 1464|0);
 HEAP8[$$index1479>>0] = 0;
 $$index1480 = ((($15)) + 1465|0);
 HEAP8[$$index1480>>0] = 0;
 $$index1481 = ((($15)) + 1466|0);
 HEAP8[$$index1481>>0] = 0;
 $$index1482 = ((($15)) + 1467|0);
 HEAP8[$$index1482>>0] = 0;
 $$index1483 = ((($15)) + 1468|0);
 HEAP8[$$index1483>>0] = 0;
 $$index1484 = ((($15)) + 1469|0);
 HEAP8[$$index1484>>0] = 0;
 $$index1485 = ((($15)) + 1470|0);
 HEAP8[$$index1485>>0] = 0;
 $$index1486 = ((($15)) + 1471|0);
 HEAP8[$$index1486>>0] = 0;
 $$index1487 = ((($15)) + 1472|0);
 HEAP8[$$index1487>>0] = 0;
 $$index1488 = ((($15)) + 1473|0);
 HEAP8[$$index1488>>0] = 0;
 $$index1489 = ((($15)) + 1474|0);
 HEAP8[$$index1489>>0] = 0;
 $$index1490 = ((($15)) + 1475|0);
 HEAP8[$$index1490>>0] = 0;
 $$index1491 = ((($15)) + 1476|0);
 HEAP8[$$index1491>>0] = 0;
 $$index1492 = ((($15)) + 1477|0);
 HEAP8[$$index1492>>0] = 0;
 $$index1493 = ((($15)) + 1478|0);
 HEAP8[$$index1493>>0] = 0;
 $$index1494 = ((($15)) + 1479|0);
 HEAP8[$$index1494>>0] = 0;
 $$index1495 = ((($15)) + 1480|0);
 HEAP8[$$index1495>>0] = 0;
 $$index1496 = ((($15)) + 1481|0);
 HEAP8[$$index1496>>0] = 0;
 $$index1497 = ((($15)) + 1482|0);
 HEAP8[$$index1497>>0] = 0;
 $$index1498 = ((($15)) + 1483|0);
 HEAP8[$$index1498>>0] = 0;
 $$index1499 = ((($15)) + 1484|0);
 HEAP8[$$index1499>>0] = 0;
 $$index1500 = ((($15)) + 1485|0);
 HEAP8[$$index1500>>0] = 0;
 $$index1501 = ((($15)) + 1486|0);
 HEAP8[$$index1501>>0] = 0;
 $$index1502 = ((($15)) + 1487|0);
 HEAP8[$$index1502>>0] = 0;
 $$index1503 = ((($15)) + 1488|0);
 HEAP8[$$index1503>>0] = 0;
 $$index1504 = ((($15)) + 1489|0);
 HEAP8[$$index1504>>0] = 0;
 $$index1505 = ((($15)) + 1490|0);
 HEAP8[$$index1505>>0] = 0;
 $$index1506 = ((($15)) + 1491|0);
 HEAP8[$$index1506>>0] = 0;
 $$index1507 = ((($15)) + 1492|0);
 HEAP8[$$index1507>>0] = 0;
 $$index1508 = ((($15)) + 1493|0);
 HEAP8[$$index1508>>0] = 0;
 $$index1509 = ((($15)) + 1494|0);
 HEAP8[$$index1509>>0] = 0;
 $$index1510 = ((($15)) + 1495|0);
 HEAP8[$$index1510>>0] = 0;
 $$index1511 = ((($15)) + 1496|0);
 HEAP8[$$index1511>>0] = 0;
 $$index1512 = ((($15)) + 1497|0);
 HEAP8[$$index1512>>0] = 0;
 $$index1513 = ((($15)) + 1498|0);
 HEAP8[$$index1513>>0] = 0;
 $$index1514 = ((($15)) + 1499|0);
 HEAP8[$$index1514>>0] = 0;
 $$index1515 = ((($15)) + 1500|0);
 HEAP8[$$index1515>>0] = 0;
 $$index1516 = ((($15)) + 1501|0);
 HEAP8[$$index1516>>0] = 0;
 $$index1517 = ((($15)) + 1502|0);
 HEAP8[$$index1517>>0] = 0;
 $$index1518 = ((($15)) + 1503|0);
 HEAP8[$$index1518>>0] = 0;
 $$index1519 = ((($15)) + 1504|0);
 HEAP8[$$index1519>>0] = 0;
 $$index1520 = ((($15)) + 1505|0);
 HEAP8[$$index1520>>0] = 0;
 $$index1521 = ((($15)) + 1506|0);
 HEAP8[$$index1521>>0] = 0;
 $$index1522 = ((($15)) + 1507|0);
 HEAP8[$$index1522>>0] = 0;
 $$index1523 = ((($15)) + 1508|0);
 HEAP8[$$index1523>>0] = 0;
 $$index1524 = ((($15)) + 1509|0);
 HEAP8[$$index1524>>0] = 0;
 $$index1525 = ((($15)) + 1510|0);
 HEAP8[$$index1525>>0] = 0;
 $$index1526 = ((($15)) + 1511|0);
 HEAP8[$$index1526>>0] = 0;
 $$index1527 = ((($15)) + 1512|0);
 HEAP8[$$index1527>>0] = 0;
 $$index1528 = ((($15)) + 1513|0);
 HEAP8[$$index1528>>0] = 0;
 $$index1529 = ((($15)) + 1514|0);
 HEAP8[$$index1529>>0] = 0;
 $$index1530 = ((($15)) + 1515|0);
 HEAP8[$$index1530>>0] = 0;
 $$index1531 = ((($15)) + 1516|0);
 HEAP8[$$index1531>>0] = 0;
 $$index1532 = ((($15)) + 1517|0);
 HEAP8[$$index1532>>0] = 0;
 $$index1533 = ((($15)) + 1518|0);
 HEAP8[$$index1533>>0] = 0;
 $$index1534 = ((($15)) + 1519|0);
 HEAP8[$$index1534>>0] = 0;
 $$index1535 = ((($15)) + 1520|0);
 HEAP8[$$index1535>>0] = 0;
 $$index1536 = ((($15)) + 1521|0);
 HEAP8[$$index1536>>0] = 0;
 $$index1537 = ((($15)) + 1522|0);
 HEAP8[$$index1537>>0] = 0;
 $$index1538 = ((($15)) + 1523|0);
 HEAP8[$$index1538>>0] = 0;
 $$index1539 = ((($15)) + 1524|0);
 HEAP8[$$index1539>>0] = 0;
 $$index1540 = ((($15)) + 1525|0);
 HEAP8[$$index1540>>0] = 0;
 $$index1541 = ((($15)) + 1526|0);
 HEAP8[$$index1541>>0] = 0;
 $$index1542 = ((($15)) + 1527|0);
 HEAP8[$$index1542>>0] = 0;
 $$index1543 = ((($15)) + 1528|0);
 HEAP8[$$index1543>>0] = 0;
 $$index1544 = ((($15)) + 1529|0);
 HEAP8[$$index1544>>0] = 0;
 $$index1545 = ((($15)) + 1530|0);
 HEAP8[$$index1545>>0] = 0;
 $$index1546 = ((($15)) + 1531|0);
 HEAP8[$$index1546>>0] = 0;
 $$index1547 = ((($15)) + 1532|0);
 HEAP8[$$index1547>>0] = 0;
 $$index1548 = ((($15)) + 1533|0);
 HEAP8[$$index1548>>0] = 0;
 $$index1549 = ((($15)) + 1534|0);
 HEAP8[$$index1549>>0] = 0;
 $$index1550 = ((($15)) + 1535|0);
 HEAP8[$$index1550>>0] = 0;
 $$index1551 = ((($15)) + 1536|0);
 HEAP8[$$index1551>>0] = 0;
 $$index1552 = ((($15)) + 1537|0);
 HEAP8[$$index1552>>0] = 0;
 $$index1553 = ((($15)) + 1538|0);
 HEAP8[$$index1553>>0] = 0;
 $$index1554 = ((($15)) + 1539|0);
 HEAP8[$$index1554>>0] = 0;
 $$index1555 = ((($15)) + 1540|0);
 HEAP8[$$index1555>>0] = 0;
 $$index1556 = ((($15)) + 1541|0);
 HEAP8[$$index1556>>0] = 0;
 $$index1557 = ((($15)) + 1542|0);
 HEAP8[$$index1557>>0] = 0;
 $$index1558 = ((($15)) + 1543|0);
 HEAP8[$$index1558>>0] = 0;
 $$index1559 = ((($15)) + 1544|0);
 HEAP8[$$index1559>>0] = 0;
 $$index1560 = ((($15)) + 1545|0);
 HEAP8[$$index1560>>0] = 0;
 $$index1561 = ((($15)) + 1546|0);
 HEAP8[$$index1561>>0] = 0;
 $$index1562 = ((($15)) + 1547|0);
 HEAP8[$$index1562>>0] = 0;
 $$index1563 = ((($15)) + 1548|0);
 HEAP8[$$index1563>>0] = 0;
 $$index1564 = ((($15)) + 1549|0);
 HEAP8[$$index1564>>0] = 0;
 $$index1565 = ((($15)) + 1550|0);
 HEAP8[$$index1565>>0] = 0;
 $$index1566 = ((($15)) + 1551|0);
 HEAP8[$$index1566>>0] = 0;
 $$index1567 = ((($15)) + 1552|0);
 HEAP8[$$index1567>>0] = 0;
 $$index1568 = ((($15)) + 1553|0);
 HEAP8[$$index1568>>0] = 0;
 $$index1569 = ((($15)) + 1554|0);
 HEAP8[$$index1569>>0] = 0;
 $$index1570 = ((($15)) + 1555|0);
 HEAP8[$$index1570>>0] = 0;
 $$index1571 = ((($15)) + 1556|0);
 HEAP8[$$index1571>>0] = 0;
 $$index1572 = ((($15)) + 1557|0);
 HEAP8[$$index1572>>0] = 0;
 $$index1573 = ((($15)) + 1558|0);
 HEAP8[$$index1573>>0] = 0;
 $$index1574 = ((($15)) + 1559|0);
 HEAP8[$$index1574>>0] = 0;
 $$index1575 = ((($15)) + 1560|0);
 HEAP8[$$index1575>>0] = 0;
 $$index1576 = ((($15)) + 1561|0);
 HEAP8[$$index1576>>0] = 0;
 $$index1577 = ((($15)) + 1562|0);
 HEAP8[$$index1577>>0] = 0;
 $$index1578 = ((($15)) + 1563|0);
 HEAP8[$$index1578>>0] = 0;
 $$index1579 = ((($15)) + 1564|0);
 HEAP8[$$index1579>>0] = 0;
 $$index1580 = ((($15)) + 1565|0);
 HEAP8[$$index1580>>0] = 0;
 $$index1581 = ((($15)) + 1566|0);
 HEAP8[$$index1581>>0] = 0;
 $$index1582 = ((($15)) + 1567|0);
 HEAP8[$$index1582>>0] = 0;
 $$index1583 = ((($15)) + 1568|0);
 HEAP8[$$index1583>>0] = 0;
 $$index1584 = ((($15)) + 1569|0);
 HEAP8[$$index1584>>0] = 0;
 $$index1585 = ((($15)) + 1570|0);
 HEAP8[$$index1585>>0] = 0;
 $$index1586 = ((($15)) + 1571|0);
 HEAP8[$$index1586>>0] = 0;
 $$index1587 = ((($15)) + 1572|0);
 HEAP8[$$index1587>>0] = 0;
 $$index1588 = ((($15)) + 1573|0);
 HEAP8[$$index1588>>0] = 0;
 $$index1589 = ((($15)) + 1574|0);
 HEAP8[$$index1589>>0] = 0;
 $$index1590 = ((($15)) + 1575|0);
 HEAP8[$$index1590>>0] = 0;
 $$index1591 = ((($15)) + 1576|0);
 HEAP8[$$index1591>>0] = 0;
 $$index1592 = ((($15)) + 1577|0);
 HEAP8[$$index1592>>0] = 0;
 $$index1593 = ((($15)) + 1578|0);
 HEAP8[$$index1593>>0] = 0;
 $$index1594 = ((($15)) + 1579|0);
 HEAP8[$$index1594>>0] = 0;
 $$index1595 = ((($15)) + 1580|0);
 HEAP8[$$index1595>>0] = 0;
 $$index1596 = ((($15)) + 1581|0);
 HEAP8[$$index1596>>0] = 0;
 $$index1597 = ((($15)) + 1582|0);
 HEAP8[$$index1597>>0] = 0;
 $$index1598 = ((($15)) + 1583|0);
 HEAP8[$$index1598>>0] = 0;
 $$index1599 = ((($15)) + 1584|0);
 HEAP8[$$index1599>>0] = 0;
 $$index1600 = ((($15)) + 1585|0);
 HEAP8[$$index1600>>0] = 0;
 $$index1601 = ((($15)) + 1586|0);
 HEAP8[$$index1601>>0] = 0;
 $$index1602 = ((($15)) + 1587|0);
 HEAP8[$$index1602>>0] = 0;
 $$index1603 = ((($15)) + 1588|0);
 HEAP8[$$index1603>>0] = 0;
 $$index1604 = ((($15)) + 1589|0);
 HEAP8[$$index1604>>0] = 0;
 $$index1605 = ((($15)) + 1590|0);
 HEAP8[$$index1605>>0] = 0;
 $$index1606 = ((($15)) + 1591|0);
 HEAP8[$$index1606>>0] = 0;
 $$index1607 = ((($15)) + 1592|0);
 HEAP8[$$index1607>>0] = 0;
 $$index1608 = ((($15)) + 1593|0);
 HEAP8[$$index1608>>0] = 0;
 $$index1609 = ((($15)) + 1594|0);
 HEAP8[$$index1609>>0] = 0;
 $$index1610 = ((($15)) + 1595|0);
 HEAP8[$$index1610>>0] = 0;
 $$index1611 = ((($15)) + 1596|0);
 HEAP8[$$index1611>>0] = 0;
 $$index1612 = ((($15)) + 1597|0);
 HEAP8[$$index1612>>0] = 0;
 $$index1613 = ((($15)) + 1598|0);
 HEAP8[$$index1613>>0] = 0;
 $$index1614 = ((($15)) + 1599|0);
 HEAP8[$$index1614>>0] = 0;
 $$index1615 = ((($15)) + 1600|0);
 HEAP8[$$index1615>>0] = 0;
 $$index1616 = ((($15)) + 1601|0);
 HEAP8[$$index1616>>0] = 0;
 $$index1617 = ((($15)) + 1602|0);
 HEAP8[$$index1617>>0] = 0;
 $$index1618 = ((($15)) + 1603|0);
 HEAP8[$$index1618>>0] = 0;
 $$index1619 = ((($15)) + 1604|0);
 HEAP8[$$index1619>>0] = 0;
 $$index1620 = ((($15)) + 1605|0);
 HEAP8[$$index1620>>0] = 0;
 $$index1621 = ((($15)) + 1606|0);
 HEAP8[$$index1621>>0] = 0;
 $$index1622 = ((($15)) + 1607|0);
 HEAP8[$$index1622>>0] = 0;
 $$index1623 = ((($15)) + 1608|0);
 HEAP8[$$index1623>>0] = 0;
 $$index1624 = ((($15)) + 1609|0);
 HEAP8[$$index1624>>0] = 0;
 $$index1625 = ((($15)) + 1610|0);
 HEAP8[$$index1625>>0] = 0;
 $$index1626 = ((($15)) + 1611|0);
 HEAP8[$$index1626>>0] = 0;
 $$index1627 = ((($15)) + 1612|0);
 HEAP8[$$index1627>>0] = 0;
 $$index1628 = ((($15)) + 1613|0);
 HEAP8[$$index1628>>0] = 0;
 $$index1629 = ((($15)) + 1614|0);
 HEAP8[$$index1629>>0] = 0;
 $$index1630 = ((($15)) + 1615|0);
 HEAP8[$$index1630>>0] = 0;
 $$index1631 = ((($15)) + 1616|0);
 HEAP8[$$index1631>>0] = 0;
 $$index1632 = ((($15)) + 1617|0);
 HEAP8[$$index1632>>0] = 0;
 $$index1633 = ((($15)) + 1618|0);
 HEAP8[$$index1633>>0] = 0;
 $$index1634 = ((($15)) + 1619|0);
 HEAP8[$$index1634>>0] = 0;
 $$index1635 = ((($15)) + 1620|0);
 HEAP8[$$index1635>>0] = 0;
 $$index1636 = ((($15)) + 1621|0);
 HEAP8[$$index1636>>0] = 0;
 $$index1637 = ((($15)) + 1622|0);
 HEAP8[$$index1637>>0] = 0;
 $$index1638 = ((($15)) + 1623|0);
 HEAP8[$$index1638>>0] = 0;
 $$index1639 = ((($15)) + 1624|0);
 HEAP8[$$index1639>>0] = 0;
 $$index1640 = ((($15)) + 1625|0);
 HEAP8[$$index1640>>0] = 0;
 $$index1641 = ((($15)) + 1626|0);
 HEAP8[$$index1641>>0] = 0;
 $$index1642 = ((($15)) + 1627|0);
 HEAP8[$$index1642>>0] = 0;
 $$index1643 = ((($15)) + 1628|0);
 HEAP8[$$index1643>>0] = 0;
 $$index1644 = ((($15)) + 1629|0);
 HEAP8[$$index1644>>0] = 0;
 $$index1645 = ((($15)) + 1630|0);
 HEAP8[$$index1645>>0] = 0;
 $$index1646 = ((($15)) + 1631|0);
 HEAP8[$$index1646>>0] = 0;
 $$index1647 = ((($15)) + 1632|0);
 HEAP8[$$index1647>>0] = 0;
 $$index1648 = ((($15)) + 1633|0);
 HEAP8[$$index1648>>0] = 0;
 $$index1649 = ((($15)) + 1634|0);
 HEAP8[$$index1649>>0] = 0;
 $$index1650 = ((($15)) + 1635|0);
 HEAP8[$$index1650>>0] = 0;
 $$index1651 = ((($15)) + 1636|0);
 HEAP8[$$index1651>>0] = 0;
 $$index1652 = ((($15)) + 1637|0);
 HEAP8[$$index1652>>0] = 0;
 $$index1653 = ((($15)) + 1638|0);
 HEAP8[$$index1653>>0] = 0;
 $$index1654 = ((($15)) + 1639|0);
 HEAP8[$$index1654>>0] = 0;
 $$index1655 = ((($15)) + 1640|0);
 HEAP8[$$index1655>>0] = 0;
 $$index1656 = ((($15)) + 1641|0);
 HEAP8[$$index1656>>0] = 0;
 $$index1657 = ((($15)) + 1642|0);
 HEAP8[$$index1657>>0] = 0;
 $$index1658 = ((($15)) + 1643|0);
 HEAP8[$$index1658>>0] = 0;
 $$index1659 = ((($15)) + 1644|0);
 HEAP8[$$index1659>>0] = 0;
 $$index1660 = ((($15)) + 1645|0);
 HEAP8[$$index1660>>0] = 0;
 $$index1661 = ((($15)) + 1646|0);
 HEAP8[$$index1661>>0] = 0;
 $$index1662 = ((($15)) + 1647|0);
 HEAP8[$$index1662>>0] = 0;
 $$index1663 = ((($15)) + 1648|0);
 HEAP8[$$index1663>>0] = 0;
 $$index1664 = ((($15)) + 1649|0);
 HEAP8[$$index1664>>0] = 0;
 $$index1665 = ((($15)) + 1650|0);
 HEAP8[$$index1665>>0] = 0;
 $$index1666 = ((($15)) + 1651|0);
 HEAP8[$$index1666>>0] = 0;
 $$index1667 = ((($15)) + 1652|0);
 HEAP8[$$index1667>>0] = 0;
 $$index1668 = ((($15)) + 1653|0);
 HEAP8[$$index1668>>0] = 0;
 $$index1669 = ((($15)) + 1654|0);
 HEAP8[$$index1669>>0] = 0;
 $$index1670 = ((($15)) + 1655|0);
 HEAP8[$$index1670>>0] = 0;
 $$index1671 = ((($15)) + 1656|0);
 HEAP8[$$index1671>>0] = 0;
 $$index1672 = ((($15)) + 1657|0);
 HEAP8[$$index1672>>0] = 0;
 $$index1673 = ((($15)) + 1658|0);
 HEAP8[$$index1673>>0] = 0;
 $$index1674 = ((($15)) + 1659|0);
 HEAP8[$$index1674>>0] = 0;
 $$index1675 = ((($15)) + 1660|0);
 HEAP8[$$index1675>>0] = 0;
 $$index1676 = ((($15)) + 1661|0);
 HEAP8[$$index1676>>0] = 0;
 $$index1677 = ((($15)) + 1662|0);
 HEAP8[$$index1677>>0] = 0;
 $$index1678 = ((($15)) + 1663|0);
 HEAP8[$$index1678>>0] = 0;
 $$index1679 = ((($15)) + 1664|0);
 HEAP8[$$index1679>>0] = 0;
 $$index1680 = ((($15)) + 1665|0);
 HEAP8[$$index1680>>0] = 0;
 $$index1681 = ((($15)) + 1666|0);
 HEAP8[$$index1681>>0] = 0;
 $$index1682 = ((($15)) + 1667|0);
 HEAP8[$$index1682>>0] = 0;
 $$index1683 = ((($15)) + 1668|0);
 HEAP8[$$index1683>>0] = 0;
 $$index1684 = ((($15)) + 1669|0);
 HEAP8[$$index1684>>0] = 0;
 $$index1685 = ((($15)) + 1670|0);
 HEAP8[$$index1685>>0] = 0;
 $$index1686 = ((($15)) + 1671|0);
 HEAP8[$$index1686>>0] = 0;
 $$index1687 = ((($15)) + 1672|0);
 HEAP8[$$index1687>>0] = 0;
 $$index1688 = ((($15)) + 1673|0);
 HEAP8[$$index1688>>0] = 0;
 $$index1689 = ((($15)) + 1674|0);
 HEAP8[$$index1689>>0] = 0;
 $$index1690 = ((($15)) + 1675|0);
 HEAP8[$$index1690>>0] = 0;
 $$index1691 = ((($15)) + 1676|0);
 HEAP8[$$index1691>>0] = 0;
 $$index1692 = ((($15)) + 1677|0);
 HEAP8[$$index1692>>0] = 0;
 $$index1693 = ((($15)) + 1678|0);
 HEAP8[$$index1693>>0] = 0;
 $$index1694 = ((($15)) + 1679|0);
 HEAP8[$$index1694>>0] = 0;
 $$index1695 = ((($15)) + 1680|0);
 HEAP8[$$index1695>>0] = 0;
 $$index1696 = ((($15)) + 1681|0);
 HEAP8[$$index1696>>0] = 0;
 $$index1697 = ((($15)) + 1682|0);
 HEAP8[$$index1697>>0] = 0;
 $$index1698 = ((($15)) + 1683|0);
 HEAP8[$$index1698>>0] = 0;
 $$index1699 = ((($15)) + 1684|0);
 HEAP8[$$index1699>>0] = 0;
 $$index1700 = ((($15)) + 1685|0);
 HEAP8[$$index1700>>0] = 0;
 $$index1701 = ((($15)) + 1686|0);
 HEAP8[$$index1701>>0] = 0;
 $$index1702 = ((($15)) + 1687|0);
 HEAP8[$$index1702>>0] = 0;
 $$index1703 = ((($15)) + 1688|0);
 HEAP8[$$index1703>>0] = 0;
 $$index1704 = ((($15)) + 1689|0);
 HEAP8[$$index1704>>0] = 0;
 $$index1705 = ((($15)) + 1690|0);
 HEAP8[$$index1705>>0] = 0;
 $$index1706 = ((($15)) + 1691|0);
 HEAP8[$$index1706>>0] = 0;
 $$index1707 = ((($15)) + 1692|0);
 HEAP8[$$index1707>>0] = 0;
 $$index1708 = ((($15)) + 1693|0);
 HEAP8[$$index1708>>0] = 0;
 $$index1709 = ((($15)) + 1694|0);
 HEAP8[$$index1709>>0] = 0;
 $$index1710 = ((($15)) + 1695|0);
 HEAP8[$$index1710>>0] = 0;
 $$index1711 = ((($15)) + 1696|0);
 HEAP8[$$index1711>>0] = 0;
 $$index1712 = ((($15)) + 1697|0);
 HEAP8[$$index1712>>0] = 0;
 $$index1713 = ((($15)) + 1698|0);
 HEAP8[$$index1713>>0] = 0;
 $$index1714 = ((($15)) + 1699|0);
 HEAP8[$$index1714>>0] = 0;
 $$index1715 = ((($15)) + 1700|0);
 HEAP8[$$index1715>>0] = 0;
 $$index1716 = ((($15)) + 1701|0);
 HEAP8[$$index1716>>0] = 0;
 $$index1717 = ((($15)) + 1702|0);
 HEAP8[$$index1717>>0] = 0;
 $$index1718 = ((($15)) + 1703|0);
 HEAP8[$$index1718>>0] = 0;
 $$index1719 = ((($15)) + 1704|0);
 HEAP8[$$index1719>>0] = 0;
 $$index1720 = ((($15)) + 1705|0);
 HEAP8[$$index1720>>0] = 0;
 $$index1721 = ((($15)) + 1706|0);
 HEAP8[$$index1721>>0] = 0;
 $$index1722 = ((($15)) + 1707|0);
 HEAP8[$$index1722>>0] = 0;
 $$index1723 = ((($15)) + 1708|0);
 HEAP8[$$index1723>>0] = 0;
 $$index1724 = ((($15)) + 1709|0);
 HEAP8[$$index1724>>0] = 0;
 $$index1725 = ((($15)) + 1710|0);
 HEAP8[$$index1725>>0] = 0;
 $$index1726 = ((($15)) + 1711|0);
 HEAP8[$$index1726>>0] = 0;
 $$index1727 = ((($15)) + 1712|0);
 HEAP8[$$index1727>>0] = 0;
 $$index1728 = ((($15)) + 1713|0);
 HEAP8[$$index1728>>0] = 0;
 $$index1729 = ((($15)) + 1714|0);
 HEAP8[$$index1729>>0] = 0;
 $$index1730 = ((($15)) + 1715|0);
 HEAP8[$$index1730>>0] = 0;
 $$index1731 = ((($15)) + 1716|0);
 HEAP8[$$index1731>>0] = 0;
 $$index1732 = ((($15)) + 1717|0);
 HEAP8[$$index1732>>0] = 0;
 $$index1733 = ((($15)) + 1718|0);
 HEAP8[$$index1733>>0] = 0;
 $$index1734 = ((($15)) + 1719|0);
 HEAP8[$$index1734>>0] = 0;
 $$index1735 = ((($15)) + 1720|0);
 HEAP8[$$index1735>>0] = 0;
 $$index1736 = ((($15)) + 1721|0);
 HEAP8[$$index1736>>0] = 0;
 $$index1737 = ((($15)) + 1722|0);
 HEAP8[$$index1737>>0] = 0;
 $$index1738 = ((($15)) + 1723|0);
 HEAP8[$$index1738>>0] = 0;
 $$index1739 = ((($15)) + 1724|0);
 HEAP8[$$index1739>>0] = 0;
 $$index1740 = ((($15)) + 1725|0);
 HEAP8[$$index1740>>0] = 0;
 $$index1741 = ((($15)) + 1726|0);
 HEAP8[$$index1741>>0] = 0;
 $$index1742 = ((($15)) + 1727|0);
 HEAP8[$$index1742>>0] = 0;
 $$index1743 = ((($15)) + 1728|0);
 HEAP8[$$index1743>>0] = 0;
 $$index1744 = ((($15)) + 1729|0);
 HEAP8[$$index1744>>0] = 0;
 $$index1745 = ((($15)) + 1730|0);
 HEAP8[$$index1745>>0] = 0;
 $$index1746 = ((($15)) + 1731|0);
 HEAP8[$$index1746>>0] = 0;
 $$index1747 = ((($15)) + 1732|0);
 HEAP8[$$index1747>>0] = 0;
 $$index1748 = ((($15)) + 1733|0);
 HEAP8[$$index1748>>0] = 0;
 $$index1749 = ((($15)) + 1734|0);
 HEAP8[$$index1749>>0] = 0;
 $$index1750 = ((($15)) + 1735|0);
 HEAP8[$$index1750>>0] = 0;
 $$index1751 = ((($15)) + 1736|0);
 HEAP8[$$index1751>>0] = 0;
 $$index1752 = ((($15)) + 1737|0);
 HEAP8[$$index1752>>0] = 0;
 $$index1753 = ((($15)) + 1738|0);
 HEAP8[$$index1753>>0] = 0;
 $$index1754 = ((($15)) + 1739|0);
 HEAP8[$$index1754>>0] = 0;
 $$index1755 = ((($15)) + 1740|0);
 HEAP8[$$index1755>>0] = 0;
 $$index1756 = ((($15)) + 1741|0);
 HEAP8[$$index1756>>0] = 0;
 $$index1757 = ((($15)) + 1742|0);
 HEAP8[$$index1757>>0] = 0;
 $$index1758 = ((($15)) + 1743|0);
 HEAP8[$$index1758>>0] = 0;
 $$index1759 = ((($15)) + 1744|0);
 HEAP8[$$index1759>>0] = 0;
 $$index1760 = ((($15)) + 1745|0);
 HEAP8[$$index1760>>0] = 0;
 $$index1761 = ((($15)) + 1746|0);
 HEAP8[$$index1761>>0] = 0;
 $$index1762 = ((($15)) + 1747|0);
 HEAP8[$$index1762>>0] = 0;
 $$index1763 = ((($15)) + 1748|0);
 HEAP8[$$index1763>>0] = 0;
 $$index1764 = ((($15)) + 1749|0);
 HEAP8[$$index1764>>0] = 0;
 $$index1765 = ((($15)) + 1750|0);
 HEAP8[$$index1765>>0] = 0;
 $$index1766 = ((($15)) + 1751|0);
 HEAP8[$$index1766>>0] = 0;
 $$index1767 = ((($15)) + 1752|0);
 HEAP8[$$index1767>>0] = 0;
 $$index1768 = ((($15)) + 1753|0);
 HEAP8[$$index1768>>0] = 0;
 $$index1769 = ((($15)) + 1754|0);
 HEAP8[$$index1769>>0] = 0;
 $$index1770 = ((($15)) + 1755|0);
 HEAP8[$$index1770>>0] = 0;
 $$index1771 = ((($15)) + 1756|0);
 HEAP8[$$index1771>>0] = 0;
 $$index1772 = ((($15)) + 1757|0);
 HEAP8[$$index1772>>0] = 0;
 $$index1773 = ((($15)) + 1758|0);
 HEAP8[$$index1773>>0] = 0;
 $$index1774 = ((($15)) + 1759|0);
 HEAP8[$$index1774>>0] = 0;
 $$index1775 = ((($15)) + 1760|0);
 HEAP8[$$index1775>>0] = 0;
 $$index1776 = ((($15)) + 1761|0);
 HEAP8[$$index1776>>0] = 0;
 $$index1777 = ((($15)) + 1762|0);
 HEAP8[$$index1777>>0] = 0;
 $$index1778 = ((($15)) + 1763|0);
 HEAP8[$$index1778>>0] = 0;
 $$index1779 = ((($15)) + 1764|0);
 HEAP8[$$index1779>>0] = 0;
 $$index1780 = ((($15)) + 1765|0);
 HEAP8[$$index1780>>0] = 0;
 $$index1781 = ((($15)) + 1766|0);
 HEAP8[$$index1781>>0] = 0;
 $$index1782 = ((($15)) + 1767|0);
 HEAP8[$$index1782>>0] = 0;
 $$index1783 = ((($15)) + 1768|0);
 HEAP8[$$index1783>>0] = 0;
 $$index1784 = ((($15)) + 1769|0);
 HEAP8[$$index1784>>0] = 0;
 $$index1785 = ((($15)) + 1770|0);
 HEAP8[$$index1785>>0] = 0;
 $$index1786 = ((($15)) + 1771|0);
 HEAP8[$$index1786>>0] = 0;
 $$index1787 = ((($15)) + 1772|0);
 HEAP8[$$index1787>>0] = 0;
 $$index1788 = ((($15)) + 1773|0);
 HEAP8[$$index1788>>0] = 0;
 $$index1789 = ((($15)) + 1774|0);
 HEAP8[$$index1789>>0] = 0;
 $$index1790 = ((($15)) + 1775|0);
 HEAP8[$$index1790>>0] = 0;
 $$index1791 = ((($15)) + 1776|0);
 HEAP8[$$index1791>>0] = 0;
 $$index1792 = ((($15)) + 1777|0);
 HEAP8[$$index1792>>0] = 0;
 $$index1793 = ((($15)) + 1778|0);
 HEAP8[$$index1793>>0] = 0;
 $$index1794 = ((($15)) + 1779|0);
 HEAP8[$$index1794>>0] = 0;
 $$index1795 = ((($15)) + 1780|0);
 HEAP8[$$index1795>>0] = 0;
 $$index1796 = ((($15)) + 1781|0);
 HEAP8[$$index1796>>0] = 0;
 $$index1797 = ((($15)) + 1782|0);
 HEAP8[$$index1797>>0] = 0;
 $$index1798 = ((($15)) + 1783|0);
 HEAP8[$$index1798>>0] = 0;
 $$index1799 = ((($15)) + 1784|0);
 HEAP8[$$index1799>>0] = 0;
 $$index1800 = ((($15)) + 1785|0);
 HEAP8[$$index1800>>0] = 0;
 $$index1801 = ((($15)) + 1786|0);
 HEAP8[$$index1801>>0] = 0;
 $$index1802 = ((($15)) + 1787|0);
 HEAP8[$$index1802>>0] = 0;
 $$index1803 = ((($15)) + 1788|0);
 HEAP8[$$index1803>>0] = 0;
 $$index1804 = ((($15)) + 1789|0);
 HEAP8[$$index1804>>0] = 0;
 $$index1805 = ((($15)) + 1790|0);
 HEAP8[$$index1805>>0] = 0;
 $$index1806 = ((($15)) + 1791|0);
 HEAP8[$$index1806>>0] = 0;
 $$index1807 = ((($15)) + 1792|0);
 HEAP8[$$index1807>>0] = 0;
 $$index1808 = ((($15)) + 1793|0);
 HEAP8[$$index1808>>0] = 0;
 $$index1809 = ((($15)) + 1794|0);
 HEAP8[$$index1809>>0] = 0;
 $$index1810 = ((($15)) + 1795|0);
 HEAP8[$$index1810>>0] = 0;
 $$index1811 = ((($15)) + 1796|0);
 HEAP8[$$index1811>>0] = 0;
 $$index1812 = ((($15)) + 1797|0);
 HEAP8[$$index1812>>0] = 0;
 $$index1813 = ((($15)) + 1798|0);
 HEAP8[$$index1813>>0] = 0;
 $$index1814 = ((($15)) + 1799|0);
 HEAP8[$$index1814>>0] = 0;
 $$index1815 = ((($15)) + 1800|0);
 HEAP8[$$index1815>>0] = 0;
 $$index1816 = ((($15)) + 1801|0);
 HEAP8[$$index1816>>0] = 0;
 $$index1817 = ((($15)) + 1802|0);
 HEAP8[$$index1817>>0] = 0;
 $$index1818 = ((($15)) + 1803|0);
 HEAP8[$$index1818>>0] = 0;
 $$index1819 = ((($15)) + 1804|0);
 HEAP8[$$index1819>>0] = 0;
 $$index1820 = ((($15)) + 1805|0);
 HEAP8[$$index1820>>0] = 0;
 $$index1821 = ((($15)) + 1806|0);
 HEAP8[$$index1821>>0] = 0;
 $$index1822 = ((($15)) + 1807|0);
 HEAP8[$$index1822>>0] = 0;
 $$index1823 = ((($15)) + 1808|0);
 HEAP8[$$index1823>>0] = 0;
 $$index1824 = ((($15)) + 1809|0);
 HEAP8[$$index1824>>0] = 0;
 $$index1825 = ((($15)) + 1810|0);
 HEAP8[$$index1825>>0] = 0;
 $$index1826 = ((($15)) + 1811|0);
 HEAP8[$$index1826>>0] = 0;
 $$index1827 = ((($15)) + 1812|0);
 HEAP8[$$index1827>>0] = 0;
 $$index1828 = ((($15)) + 1813|0);
 HEAP8[$$index1828>>0] = 0;
 $$index1829 = ((($15)) + 1814|0);
 HEAP8[$$index1829>>0] = 0;
 $$index1830 = ((($15)) + 1815|0);
 HEAP8[$$index1830>>0] = 0;
 $$index1831 = ((($15)) + 1816|0);
 HEAP8[$$index1831>>0] = 0;
 $$index1832 = ((($15)) + 1817|0);
 HEAP8[$$index1832>>0] = 0;
 $$index1833 = ((($15)) + 1818|0);
 HEAP8[$$index1833>>0] = 0;
 $$index1834 = ((($15)) + 1819|0);
 HEAP8[$$index1834>>0] = 0;
 $$index1835 = ((($15)) + 1820|0);
 HEAP8[$$index1835>>0] = 0;
 $$index1836 = ((($15)) + 1821|0);
 HEAP8[$$index1836>>0] = 0;
 $$index1837 = ((($15)) + 1822|0);
 HEAP8[$$index1837>>0] = 0;
 $$index1838 = ((($15)) + 1823|0);
 HEAP8[$$index1838>>0] = 0;
 $$index1839 = ((($15)) + 1824|0);
 HEAP8[$$index1839>>0] = 0;
 $$index1840 = ((($15)) + 1825|0);
 HEAP8[$$index1840>>0] = 0;
 $$index1841 = ((($15)) + 1826|0);
 HEAP8[$$index1841>>0] = 0;
 $$index1842 = ((($15)) + 1827|0);
 HEAP8[$$index1842>>0] = 0;
 $$index1843 = ((($15)) + 1828|0);
 HEAP8[$$index1843>>0] = 0;
 $$index1844 = ((($15)) + 1829|0);
 HEAP8[$$index1844>>0] = 0;
 $$index1845 = ((($15)) + 1830|0);
 HEAP8[$$index1845>>0] = 0;
 $$index1846 = ((($15)) + 1831|0);
 HEAP8[$$index1846>>0] = 0;
 $$index1847 = ((($15)) + 1832|0);
 HEAP8[$$index1847>>0] = 0;
 $$index1848 = ((($15)) + 1833|0);
 HEAP8[$$index1848>>0] = 0;
 $$index1849 = ((($15)) + 1834|0);
 HEAP8[$$index1849>>0] = 0;
 $$index1850 = ((($15)) + 1835|0);
 HEAP8[$$index1850>>0] = 0;
 $$index1851 = ((($15)) + 1836|0);
 HEAP8[$$index1851>>0] = 0;
 $$index1852 = ((($15)) + 1837|0);
 HEAP8[$$index1852>>0] = 0;
 $$index1853 = ((($15)) + 1838|0);
 HEAP8[$$index1853>>0] = 0;
 $$index1854 = ((($15)) + 1839|0);
 HEAP8[$$index1854>>0] = 0;
 $$index1855 = ((($15)) + 1840|0);
 HEAP8[$$index1855>>0] = 0;
 $$index1856 = ((($15)) + 1841|0);
 HEAP8[$$index1856>>0] = 0;
 $$index1857 = ((($15)) + 1842|0);
 HEAP8[$$index1857>>0] = 0;
 $$index1858 = ((($15)) + 1843|0);
 HEAP8[$$index1858>>0] = 0;
 $$index1859 = ((($15)) + 1844|0);
 HEAP8[$$index1859>>0] = 0;
 $$index1860 = ((($15)) + 1845|0);
 HEAP8[$$index1860>>0] = 0;
 $$index1861 = ((($15)) + 1846|0);
 HEAP8[$$index1861>>0] = 0;
 $$index1862 = ((($15)) + 1847|0);
 HEAP8[$$index1862>>0] = 0;
 $$index1863 = ((($15)) + 1848|0);
 HEAP8[$$index1863>>0] = 0;
 $$index1864 = ((($15)) + 1849|0);
 HEAP8[$$index1864>>0] = 0;
 $$index1865 = ((($15)) + 1850|0);
 HEAP8[$$index1865>>0] = 0;
 $$index1866 = ((($15)) + 1851|0);
 HEAP8[$$index1866>>0] = 0;
 $$index1867 = ((($15)) + 1852|0);
 HEAP8[$$index1867>>0] = 0;
 $$index1868 = ((($15)) + 1853|0);
 HEAP8[$$index1868>>0] = 0;
 $$index1869 = ((($15)) + 1854|0);
 HEAP8[$$index1869>>0] = 0;
 $$index1870 = ((($15)) + 1855|0);
 HEAP8[$$index1870>>0] = 0;
 $$index1871 = ((($15)) + 1856|0);
 HEAP8[$$index1871>>0] = 0;
 $$index1872 = ((($15)) + 1857|0);
 HEAP8[$$index1872>>0] = 0;
 $$index1873 = ((($15)) + 1858|0);
 HEAP8[$$index1873>>0] = 0;
 $$index1874 = ((($15)) + 1859|0);
 HEAP8[$$index1874>>0] = 0;
 $$index1875 = ((($15)) + 1860|0);
 HEAP8[$$index1875>>0] = 0;
 $$index1876 = ((($15)) + 1861|0);
 HEAP8[$$index1876>>0] = 0;
 $$index1877 = ((($15)) + 1862|0);
 HEAP8[$$index1877>>0] = 0;
 $$index1878 = ((($15)) + 1863|0);
 HEAP8[$$index1878>>0] = 0;
 $$index1879 = ((($15)) + 1864|0);
 HEAP8[$$index1879>>0] = 0;
 $$index1880 = ((($15)) + 1865|0);
 HEAP8[$$index1880>>0] = 0;
 $$index1881 = ((($15)) + 1866|0);
 HEAP8[$$index1881>>0] = 0;
 $$index1882 = ((($15)) + 1867|0);
 HEAP8[$$index1882>>0] = 0;
 $$index1883 = ((($15)) + 1868|0);
 HEAP8[$$index1883>>0] = 0;
 $$index1884 = ((($15)) + 1869|0);
 HEAP8[$$index1884>>0] = 0;
 $$index1885 = ((($15)) + 1870|0);
 HEAP8[$$index1885>>0] = 0;
 $$index1886 = ((($15)) + 1871|0);
 HEAP8[$$index1886>>0] = 0;
 $$index1887 = ((($15)) + 1872|0);
 HEAP8[$$index1887>>0] = 0;
 $$index1888 = ((($15)) + 1873|0);
 HEAP8[$$index1888>>0] = 0;
 $$index1889 = ((($15)) + 1874|0);
 HEAP8[$$index1889>>0] = 0;
 $$index1890 = ((($15)) + 1875|0);
 HEAP8[$$index1890>>0] = 0;
 $$index1891 = ((($15)) + 1876|0);
 HEAP8[$$index1891>>0] = 0;
 $$index1892 = ((($15)) + 1877|0);
 HEAP8[$$index1892>>0] = 0;
 $$index1893 = ((($15)) + 1878|0);
 HEAP8[$$index1893>>0] = 0;
 $$index1894 = ((($15)) + 1879|0);
 HEAP8[$$index1894>>0] = 0;
 $$index1895 = ((($15)) + 1880|0);
 HEAP8[$$index1895>>0] = 0;
 $$index1896 = ((($15)) + 1881|0);
 HEAP8[$$index1896>>0] = 0;
 $$index1897 = ((($15)) + 1882|0);
 HEAP8[$$index1897>>0] = 0;
 $$index1898 = ((($15)) + 1883|0);
 HEAP8[$$index1898>>0] = 0;
 $$index1899 = ((($15)) + 1884|0);
 HEAP8[$$index1899>>0] = 0;
 $$index1900 = ((($15)) + 1885|0);
 HEAP8[$$index1900>>0] = 0;
 $$index1901 = ((($15)) + 1886|0);
 HEAP8[$$index1901>>0] = 0;
 $$index1902 = ((($15)) + 1887|0);
 HEAP8[$$index1902>>0] = 0;
 $$index1903 = ((($15)) + 1888|0);
 HEAP8[$$index1903>>0] = 0;
 $$index1904 = ((($15)) + 1889|0);
 HEAP8[$$index1904>>0] = 0;
 $$index1905 = ((($15)) + 1890|0);
 HEAP8[$$index1905>>0] = 0;
 $$index1906 = ((($15)) + 1891|0);
 HEAP8[$$index1906>>0] = 0;
 $$index1907 = ((($15)) + 1892|0);
 HEAP8[$$index1907>>0] = 0;
 $$index1908 = ((($15)) + 1893|0);
 HEAP8[$$index1908>>0] = 0;
 $$index1909 = ((($15)) + 1894|0);
 HEAP8[$$index1909>>0] = 0;
 $$index1910 = ((($15)) + 1895|0);
 HEAP8[$$index1910>>0] = 0;
 $$index1911 = ((($15)) + 1896|0);
 HEAP8[$$index1911>>0] = 0;
 $$index1912 = ((($15)) + 1897|0);
 HEAP8[$$index1912>>0] = 0;
 $$index1913 = ((($15)) + 1898|0);
 HEAP8[$$index1913>>0] = 0;
 $$index1914 = ((($15)) + 1899|0);
 HEAP8[$$index1914>>0] = 0;
 $$index1915 = ((($15)) + 1900|0);
 HEAP8[$$index1915>>0] = 0;
 $$index1916 = ((($15)) + 1901|0);
 HEAP8[$$index1916>>0] = 0;
 $$index1917 = ((($15)) + 1902|0);
 HEAP8[$$index1917>>0] = 0;
 $$index1918 = ((($15)) + 1903|0);
 HEAP8[$$index1918>>0] = 0;
 $$index1919 = ((($15)) + 1904|0);
 HEAP8[$$index1919>>0] = 0;
 $$index1920 = ((($15)) + 1905|0);
 HEAP8[$$index1920>>0] = 0;
 $$index1921 = ((($15)) + 1906|0);
 HEAP8[$$index1921>>0] = 0;
 $$index1922 = ((($15)) + 1907|0);
 HEAP8[$$index1922>>0] = 0;
 $$index1923 = ((($15)) + 1908|0);
 HEAP8[$$index1923>>0] = 0;
 $$index1924 = ((($15)) + 1909|0);
 HEAP8[$$index1924>>0] = 0;
 $$index1925 = ((($15)) + 1910|0);
 HEAP8[$$index1925>>0] = 0;
 $$index1926 = ((($15)) + 1911|0);
 HEAP8[$$index1926>>0] = 0;
 $$index1927 = ((($15)) + 1912|0);
 HEAP8[$$index1927>>0] = 0;
 $$index1928 = ((($15)) + 1913|0);
 HEAP8[$$index1928>>0] = 0;
 $$index1929 = ((($15)) + 1914|0);
 HEAP8[$$index1929>>0] = 0;
 $$index1930 = ((($15)) + 1915|0);
 HEAP8[$$index1930>>0] = 0;
 $$index1931 = ((($15)) + 1916|0);
 HEAP8[$$index1931>>0] = 0;
 $$index1932 = ((($15)) + 1917|0);
 HEAP8[$$index1932>>0] = 0;
 $$index1933 = ((($15)) + 1918|0);
 HEAP8[$$index1933>>0] = 0;
 $$index1934 = ((($15)) + 1919|0);
 HEAP8[$$index1934>>0] = 0;
 $$index1935 = ((($15)) + 1920|0);
 HEAP8[$$index1935>>0] = 0;
 $$index1936 = ((($15)) + 1921|0);
 HEAP8[$$index1936>>0] = 0;
 $$index1937 = ((($15)) + 1922|0);
 HEAP8[$$index1937>>0] = 0;
 $$index1938 = ((($15)) + 1923|0);
 HEAP8[$$index1938>>0] = 0;
 $$index1939 = ((($15)) + 1924|0);
 HEAP8[$$index1939>>0] = 0;
 $$index1940 = ((($15)) + 1925|0);
 HEAP8[$$index1940>>0] = 0;
 $$index1941 = ((($15)) + 1926|0);
 HEAP8[$$index1941>>0] = 0;
 $$index1942 = ((($15)) + 1927|0);
 HEAP8[$$index1942>>0] = 0;
 $$index1943 = ((($15)) + 1928|0);
 HEAP8[$$index1943>>0] = 0;
 $$index1944 = ((($15)) + 1929|0);
 HEAP8[$$index1944>>0] = 0;
 $$index1945 = ((($15)) + 1930|0);
 HEAP8[$$index1945>>0] = 0;
 $$index1946 = ((($15)) + 1931|0);
 HEAP8[$$index1946>>0] = 0;
 $$index1947 = ((($15)) + 1932|0);
 HEAP8[$$index1947>>0] = 0;
 $$index1948 = ((($15)) + 1933|0);
 HEAP8[$$index1948>>0] = 0;
 $$index1949 = ((($15)) + 1934|0);
 HEAP8[$$index1949>>0] = 0;
 $$index1950 = ((($15)) + 1935|0);
 HEAP8[$$index1950>>0] = 0;
 $$index1951 = ((($15)) + 1936|0);
 HEAP8[$$index1951>>0] = 0;
 $$index1952 = ((($15)) + 1937|0);
 HEAP8[$$index1952>>0] = 0;
 $$index1953 = ((($15)) + 1938|0);
 HEAP8[$$index1953>>0] = 0;
 $$index1954 = ((($15)) + 1939|0);
 HEAP8[$$index1954>>0] = 0;
 $$index1955 = ((($15)) + 1940|0);
 HEAP8[$$index1955>>0] = 0;
 $$index1956 = ((($15)) + 1941|0);
 HEAP8[$$index1956>>0] = 0;
 $$index1957 = ((($15)) + 1942|0);
 HEAP8[$$index1957>>0] = 0;
 $$index1958 = ((($15)) + 1943|0);
 HEAP8[$$index1958>>0] = 0;
 $$index1959 = ((($15)) + 1944|0);
 HEAP8[$$index1959>>0] = 0;
 $$index1960 = ((($15)) + 1945|0);
 HEAP8[$$index1960>>0] = 0;
 $$index1961 = ((($15)) + 1946|0);
 HEAP8[$$index1961>>0] = 0;
 $$index1962 = ((($15)) + 1947|0);
 HEAP8[$$index1962>>0] = 0;
 $$index1963 = ((($15)) + 1948|0);
 HEAP8[$$index1963>>0] = 0;
 $$index1964 = ((($15)) + 1949|0);
 HEAP8[$$index1964>>0] = 0;
 $$index1965 = ((($15)) + 1950|0);
 HEAP8[$$index1965>>0] = 0;
 $$index1966 = ((($15)) + 1951|0);
 HEAP8[$$index1966>>0] = 0;
 $$index1967 = ((($15)) + 1952|0);
 HEAP8[$$index1967>>0] = 0;
 $$index1968 = ((($15)) + 1953|0);
 HEAP8[$$index1968>>0] = 0;
 $$index1969 = ((($15)) + 1954|0);
 HEAP8[$$index1969>>0] = 0;
 $$index1970 = ((($15)) + 1955|0);
 HEAP8[$$index1970>>0] = 0;
 $$index1971 = ((($15)) + 1956|0);
 HEAP8[$$index1971>>0] = 0;
 $$index1972 = ((($15)) + 1957|0);
 HEAP8[$$index1972>>0] = 0;
 $$index1973 = ((($15)) + 1958|0);
 HEAP8[$$index1973>>0] = 0;
 $$index1974 = ((($15)) + 1959|0);
 HEAP8[$$index1974>>0] = 0;
 $$index1975 = ((($15)) + 1960|0);
 HEAP8[$$index1975>>0] = 0;
 $$index1976 = ((($15)) + 1961|0);
 HEAP8[$$index1976>>0] = 0;
 $$index1977 = ((($15)) + 1962|0);
 HEAP8[$$index1977>>0] = 0;
 $$index1978 = ((($15)) + 1963|0);
 HEAP8[$$index1978>>0] = 0;
 $$index1979 = ((($15)) + 1964|0);
 HEAP8[$$index1979>>0] = 0;
 $$index1980 = ((($15)) + 1965|0);
 HEAP8[$$index1980>>0] = 0;
 $$index1981 = ((($15)) + 1966|0);
 HEAP8[$$index1981>>0] = 0;
 $$index1982 = ((($15)) + 1967|0);
 HEAP8[$$index1982>>0] = 0;
 $$index1983 = ((($15)) + 1968|0);
 HEAP8[$$index1983>>0] = 0;
 $$index1984 = ((($15)) + 1969|0);
 HEAP8[$$index1984>>0] = 0;
 $$index1985 = ((($15)) + 1970|0);
 HEAP8[$$index1985>>0] = 0;
 $$index1986 = ((($15)) + 1971|0);
 HEAP8[$$index1986>>0] = 0;
 $$index1987 = ((($15)) + 1972|0);
 HEAP8[$$index1987>>0] = 0;
 $$index1988 = ((($15)) + 1973|0);
 HEAP8[$$index1988>>0] = 0;
 $$index1989 = ((($15)) + 1974|0);
 HEAP8[$$index1989>>0] = 0;
 $$index1990 = ((($15)) + 1975|0);
 HEAP8[$$index1990>>0] = 0;
 $$index1991 = ((($15)) + 1976|0);
 HEAP8[$$index1991>>0] = 0;
 $$index1992 = ((($15)) + 1977|0);
 HEAP8[$$index1992>>0] = 0;
 $$index1993 = ((($15)) + 1978|0);
 HEAP8[$$index1993>>0] = 0;
 $$index1994 = ((($15)) + 1979|0);
 HEAP8[$$index1994>>0] = 0;
 $$index1995 = ((($15)) + 1980|0);
 HEAP8[$$index1995>>0] = 0;
 $$index1996 = ((($15)) + 1981|0);
 HEAP8[$$index1996>>0] = 0;
 $$index1997 = ((($15)) + 1982|0);
 HEAP8[$$index1997>>0] = 0;
 $$index1998 = ((($15)) + 1983|0);
 HEAP8[$$index1998>>0] = 0;
 $$index1999 = ((($15)) + 1984|0);
 HEAP8[$$index1999>>0] = 0;
 $$index2000 = ((($15)) + 1985|0);
 HEAP8[$$index2000>>0] = 0;
 $$index2001 = ((($15)) + 1986|0);
 HEAP8[$$index2001>>0] = 0;
 $$index2002 = ((($15)) + 1987|0);
 HEAP8[$$index2002>>0] = 0;
 $$index2003 = ((($15)) + 1988|0);
 HEAP8[$$index2003>>0] = 0;
 $$index2004 = ((($15)) + 1989|0);
 HEAP8[$$index2004>>0] = 0;
 $$index2005 = ((($15)) + 1990|0);
 HEAP8[$$index2005>>0] = 0;
 $$index2006 = ((($15)) + 1991|0);
 HEAP8[$$index2006>>0] = 0;
 $$index2007 = ((($15)) + 1992|0);
 HEAP8[$$index2007>>0] = 0;
 $$index2008 = ((($15)) + 1993|0);
 HEAP8[$$index2008>>0] = 0;
 $$index2009 = ((($15)) + 1994|0);
 HEAP8[$$index2009>>0] = 0;
 $$index2010 = ((($15)) + 1995|0);
 HEAP8[$$index2010>>0] = 0;
 $$index2011 = ((($15)) + 1996|0);
 HEAP8[$$index2011>>0] = 0;
 $$index2012 = ((($15)) + 1997|0);
 HEAP8[$$index2012>>0] = 0;
 $$index2013 = ((($15)) + 1998|0);
 HEAP8[$$index2013>>0] = 0;
 $$index2014 = ((($15)) + 1999|0);
 HEAP8[$$index2014>>0] = 0;
 $$index2015 = ((($15)) + 2000|0);
 HEAP8[$$index2015>>0] = 0;
 $$index2016 = ((($15)) + 2001|0);
 HEAP8[$$index2016>>0] = 0;
 $$index2017 = ((($15)) + 2002|0);
 HEAP8[$$index2017>>0] = 0;
 $$index2018 = ((($15)) + 2003|0);
 HEAP8[$$index2018>>0] = 0;
 $$index2019 = ((($15)) + 2004|0);
 HEAP8[$$index2019>>0] = 0;
 $$index2020 = ((($15)) + 2005|0);
 HEAP8[$$index2020>>0] = 0;
 $$index2021 = ((($15)) + 2006|0);
 HEAP8[$$index2021>>0] = 0;
 $$index2022 = ((($15)) + 2007|0);
 HEAP8[$$index2022>>0] = 0;
 $$index2023 = ((($15)) + 2008|0);
 HEAP8[$$index2023>>0] = 0;
 $$index2024 = ((($15)) + 2009|0);
 HEAP8[$$index2024>>0] = 0;
 $$index2025 = ((($15)) + 2010|0);
 HEAP8[$$index2025>>0] = 0;
 $$index2026 = ((($15)) + 2011|0);
 HEAP8[$$index2026>>0] = 0;
 $$index2027 = ((($15)) + 2012|0);
 HEAP8[$$index2027>>0] = 0;
 $$index2028 = ((($15)) + 2013|0);
 HEAP8[$$index2028>>0] = 0;
 $$index2029 = ((($15)) + 2014|0);
 HEAP8[$$index2029>>0] = 0;
 $$index2030 = ((($15)) + 2015|0);
 HEAP8[$$index2030>>0] = 0;
 $$index2031 = ((($15)) + 2016|0);
 HEAP8[$$index2031>>0] = 0;
 $$index2032 = ((($15)) + 2017|0);
 HEAP8[$$index2032>>0] = 0;
 $$index2033 = ((($15)) + 2018|0);
 HEAP8[$$index2033>>0] = 0;
 $$index2034 = ((($15)) + 2019|0);
 HEAP8[$$index2034>>0] = 0;
 $$index2035 = ((($15)) + 2020|0);
 HEAP8[$$index2035>>0] = 0;
 $$index2036 = ((($15)) + 2021|0);
 HEAP8[$$index2036>>0] = 0;
 $$index2037 = ((($15)) + 2022|0);
 HEAP8[$$index2037>>0] = 0;
 $$index2038 = ((($15)) + 2023|0);
 HEAP8[$$index2038>>0] = 0;
 $$index2039 = ((($15)) + 2024|0);
 HEAP8[$$index2039>>0] = 0;
 $$index2040 = ((($15)) + 2025|0);
 HEAP8[$$index2040>>0] = 0;
 $$index2041 = ((($15)) + 2026|0);
 HEAP8[$$index2041>>0] = 0;
 $$index2042 = ((($15)) + 2027|0);
 HEAP8[$$index2042>>0] = 0;
 $$index2043 = ((($15)) + 2028|0);
 HEAP8[$$index2043>>0] = 0;
 $$index2044 = ((($15)) + 2029|0);
 HEAP8[$$index2044>>0] = 0;
 $$index2045 = ((($15)) + 2030|0);
 HEAP8[$$index2045>>0] = 0;
 $$index2046 = ((($15)) + 2031|0);
 HEAP8[$$index2046>>0] = 0;
 $$index2047 = ((($15)) + 2032|0);
 HEAP8[$$index2047>>0] = 0;
 $$index2048 = ((($15)) + 2033|0);
 HEAP8[$$index2048>>0] = 0;
 $$index2049 = ((($15)) + 2034|0);
 HEAP8[$$index2049>>0] = 0;
 $$index2050 = ((($15)) + 2035|0);
 HEAP8[$$index2050>>0] = 0;
 $$index2051 = ((($15)) + 2036|0);
 HEAP8[$$index2051>>0] = 0;
 $$index2052 = ((($15)) + 2037|0);
 HEAP8[$$index2052>>0] = 0;
 $$index2053 = ((($15)) + 2038|0);
 HEAP8[$$index2053>>0] = 0;
 $$index2054 = ((($15)) + 2039|0);
 HEAP8[$$index2054>>0] = 0;
 $$index2055 = ((($15)) + 2040|0);
 HEAP8[$$index2055>>0] = 0;
 $$index2056 = ((($15)) + 2041|0);
 HEAP8[$$index2056>>0] = 0;
 $$index2057 = ((($15)) + 2042|0);
 HEAP8[$$index2057>>0] = 0;
 $$index2058 = ((($15)) + 2043|0);
 HEAP8[$$index2058>>0] = 0;
 $$index2059 = ((($15)) + 2044|0);
 HEAP8[$$index2059>>0] = 0;
 $$index2060 = ((($15)) + 2045|0);
 HEAP8[$$index2060>>0] = 0;
 $$index2061 = ((($15)) + 2046|0);
 HEAP8[$$index2061>>0] = 0;
 $$index2062 = ((($15)) + 2047|0);
 HEAP8[$$index2062>>0] = 0;
 $$index2063 = ((($15)) + 2048|0);
 HEAP8[$$index2063>>0] = 0;
 $$index2064 = ((($15)) + 2049|0);
 HEAP8[$$index2064>>0] = 0;
 $$index2065 = ((($15)) + 2050|0);
 HEAP8[$$index2065>>0] = 0;
 $$index2066 = ((($15)) + 2051|0);
 HEAP8[$$index2066>>0] = 0;
 $$index2067 = ((($15)) + 2052|0);
 HEAP8[$$index2067>>0] = 0;
 $$index2068 = ((($15)) + 2053|0);
 HEAP8[$$index2068>>0] = 0;
 $$index2069 = ((($15)) + 2054|0);
 HEAP8[$$index2069>>0] = 0;
 $$index2070 = ((($15)) + 2055|0);
 HEAP8[$$index2070>>0] = 0;
 $$index2071 = ((($15)) + 2056|0);
 HEAP8[$$index2071>>0] = 0;
 $$index2072 = ((($15)) + 2057|0);
 HEAP8[$$index2072>>0] = 0;
 $$index2073 = ((($15)) + 2058|0);
 HEAP8[$$index2073>>0] = 0;
 $$index2074 = ((($15)) + 2059|0);
 HEAP8[$$index2074>>0] = 0;
 $$index2075 = ((($15)) + 2060|0);
 HEAP8[$$index2075>>0] = 0;
 $$index2076 = ((($15)) + 2061|0);
 HEAP8[$$index2076>>0] = 0;
 $$index2077 = ((($15)) + 2062|0);
 HEAP8[$$index2077>>0] = 0;
 $$index2078 = ((($15)) + 2063|0);
 HEAP8[$$index2078>>0] = 0;
 $$index2079 = ((($15)) + 2064|0);
 HEAP8[$$index2079>>0] = 0;
 $$index2080 = ((($15)) + 2065|0);
 HEAP8[$$index2080>>0] = 0;
 $$index2081 = ((($15)) + 2066|0);
 HEAP8[$$index2081>>0] = 0;
 $$index2082 = ((($15)) + 2067|0);
 HEAP8[$$index2082>>0] = 0;
 $$index2083 = ((($15)) + 2068|0);
 HEAP8[$$index2083>>0] = 0;
 $$index2084 = ((($15)) + 2069|0);
 HEAP8[$$index2084>>0] = 0;
 $$index2085 = ((($15)) + 2070|0);
 HEAP8[$$index2085>>0] = 0;
 $$index2086 = ((($15)) + 2071|0);
 HEAP8[$$index2086>>0] = 0;
 $$index2087 = ((($15)) + 2072|0);
 HEAP8[$$index2087>>0] = 0;
 $$index2088 = ((($15)) + 2073|0);
 HEAP8[$$index2088>>0] = 0;
 $$index2089 = ((($15)) + 2074|0);
 HEAP8[$$index2089>>0] = 0;
 $$index2090 = ((($15)) + 2075|0);
 HEAP8[$$index2090>>0] = 0;
 $$index2091 = ((($15)) + 2076|0);
 HEAP8[$$index2091>>0] = 0;
 $$index2092 = ((($15)) + 2077|0);
 HEAP8[$$index2092>>0] = 0;
 $$index2093 = ((($15)) + 2078|0);
 HEAP8[$$index2093>>0] = 0;
 $$index2094 = ((($15)) + 2079|0);
 HEAP8[$$index2094>>0] = 0;
 $$index2095 = ((($15)) + 2080|0);
 HEAP8[$$index2095>>0] = 0;
 $$index2096 = ((($15)) + 2081|0);
 HEAP8[$$index2096>>0] = 0;
 $$index2097 = ((($15)) + 2082|0);
 HEAP8[$$index2097>>0] = 0;
 $$index2098 = ((($15)) + 2083|0);
 HEAP8[$$index2098>>0] = 0;
 $$index2099 = ((($15)) + 2084|0);
 HEAP8[$$index2099>>0] = 0;
 $$index2100 = ((($15)) + 2085|0);
 HEAP8[$$index2100>>0] = 0;
 $$index2101 = ((($15)) + 2086|0);
 HEAP8[$$index2101>>0] = 0;
 $$index2102 = ((($15)) + 2087|0);
 HEAP8[$$index2102>>0] = 0;
 $$index2103 = ((($15)) + 2088|0);
 HEAP8[$$index2103>>0] = 0;
 $$index2104 = ((($15)) + 2089|0);
 HEAP8[$$index2104>>0] = 0;
 $$index2105 = ((($15)) + 2090|0);
 HEAP8[$$index2105>>0] = 0;
 $$index2106 = ((($15)) + 2091|0);
 HEAP8[$$index2106>>0] = 0;
 $$index2107 = ((($15)) + 2092|0);
 HEAP8[$$index2107>>0] = 0;
 $$index2108 = ((($15)) + 2093|0);
 HEAP8[$$index2108>>0] = 0;
 $$index2109 = ((($15)) + 2094|0);
 HEAP8[$$index2109>>0] = 0;
 $$index2110 = ((($15)) + 2095|0);
 HEAP8[$$index2110>>0] = 0;
 $$index2111 = ((($15)) + 2096|0);
 HEAP8[$$index2111>>0] = 0;
 $$index2112 = ((($15)) + 2097|0);
 HEAP8[$$index2112>>0] = 0;
 $$index2113 = ((($15)) + 2098|0);
 HEAP8[$$index2113>>0] = 0;
 $$index2114 = ((($15)) + 2099|0);
 HEAP8[$$index2114>>0] = 0;
 $$index2115 = ((($15)) + 2100|0);
 HEAP8[$$index2115>>0] = 0;
 $$index2116 = ((($15)) + 2101|0);
 HEAP8[$$index2116>>0] = 0;
 $$index2117 = ((($15)) + 2102|0);
 HEAP8[$$index2117>>0] = 0;
 $$index2118 = ((($15)) + 2103|0);
 HEAP8[$$index2118>>0] = 0;
 $$index2119 = ((($15)) + 2104|0);
 HEAP8[$$index2119>>0] = 0;
 $$index2120 = ((($15)) + 2105|0);
 HEAP8[$$index2120>>0] = 0;
 $$index2121 = ((($15)) + 2106|0);
 HEAP8[$$index2121>>0] = 0;
 $$index2122 = ((($15)) + 2107|0);
 HEAP8[$$index2122>>0] = 0;
 $$index2123 = ((($15)) + 2108|0);
 HEAP8[$$index2123>>0] = 0;
 $$index2124 = ((($15)) + 2109|0);
 HEAP8[$$index2124>>0] = 0;
 $$index2125 = ((($15)) + 2110|0);
 HEAP8[$$index2125>>0] = 0;
 $$index2126 = ((($15)) + 2111|0);
 HEAP8[$$index2126>>0] = 0;
 $$index2127 = ((($15)) + 2112|0);
 HEAP8[$$index2127>>0] = 0;
 $$index2128 = ((($15)) + 2113|0);
 HEAP8[$$index2128>>0] = 0;
 $$index2129 = ((($15)) + 2114|0);
 HEAP8[$$index2129>>0] = 0;
 $$index2130 = ((($15)) + 2115|0);
 HEAP8[$$index2130>>0] = 0;
 $$index2131 = ((($15)) + 2116|0);
 HEAP8[$$index2131>>0] = 0;
 $$index2132 = ((($15)) + 2117|0);
 HEAP8[$$index2132>>0] = 0;
 $$index2133 = ((($15)) + 2118|0);
 HEAP8[$$index2133>>0] = 0;
 $$index2134 = ((($15)) + 2119|0);
 HEAP8[$$index2134>>0] = 0;
 $$index2135 = ((($15)) + 2120|0);
 HEAP8[$$index2135>>0] = 0;
 $$index2136 = ((($15)) + 2121|0);
 HEAP8[$$index2136>>0] = 0;
 $$index2137 = ((($15)) + 2122|0);
 HEAP8[$$index2137>>0] = 0;
 $$index2138 = ((($15)) + 2123|0);
 HEAP8[$$index2138>>0] = 0;
 $$index2139 = ((($15)) + 2124|0);
 HEAP8[$$index2139>>0] = 0;
 $$index2140 = ((($15)) + 2125|0);
 HEAP8[$$index2140>>0] = 0;
 $$index2141 = ((($15)) + 2126|0);
 HEAP8[$$index2141>>0] = 0;
 $$index2142 = ((($15)) + 2127|0);
 HEAP8[$$index2142>>0] = 0;
 $$index2143 = ((($15)) + 2128|0);
 HEAP8[$$index2143>>0] = 0;
 $$index2144 = ((($15)) + 2129|0);
 HEAP8[$$index2144>>0] = 0;
 $$index2145 = ((($15)) + 2130|0);
 HEAP8[$$index2145>>0] = 0;
 $$index2146 = ((($15)) + 2131|0);
 HEAP8[$$index2146>>0] = 0;
 $$index2147 = ((($15)) + 2132|0);
 HEAP8[$$index2147>>0] = 0;
 $$index2148 = ((($15)) + 2133|0);
 HEAP8[$$index2148>>0] = 0;
 $$index2149 = ((($15)) + 2134|0);
 HEAP8[$$index2149>>0] = 0;
 $$index2150 = ((($15)) + 2135|0);
 HEAP8[$$index2150>>0] = 0;
 $$index2151 = ((($15)) + 2136|0);
 HEAP8[$$index2151>>0] = 0;
 $$index2152 = ((($15)) + 2137|0);
 HEAP8[$$index2152>>0] = 0;
 $$index2153 = ((($15)) + 2138|0);
 HEAP8[$$index2153>>0] = 0;
 $$index2154 = ((($15)) + 2139|0);
 HEAP8[$$index2154>>0] = 0;
 $$index2155 = ((($15)) + 2140|0);
 HEAP8[$$index2155>>0] = 0;
 $$index2156 = ((($15)) + 2141|0);
 HEAP8[$$index2156>>0] = 0;
 $$index2157 = ((($15)) + 2142|0);
 HEAP8[$$index2157>>0] = 0;
 $$index2158 = ((($15)) + 2143|0);
 HEAP8[$$index2158>>0] = 0;
 $$index2159 = ((($15)) + 2144|0);
 HEAP8[$$index2159>>0] = 0;
 $$index2160 = ((($15)) + 2145|0);
 HEAP8[$$index2160>>0] = 0;
 $$index2161 = ((($15)) + 2146|0);
 HEAP8[$$index2161>>0] = 0;
 $$index2162 = ((($15)) + 2147|0);
 HEAP8[$$index2162>>0] = 0;
 $$index2163 = ((($15)) + 2148|0);
 HEAP8[$$index2163>>0] = 0;
 $$index2164 = ((($15)) + 2149|0);
 HEAP8[$$index2164>>0] = 0;
 $$index2165 = ((($15)) + 2150|0);
 HEAP8[$$index2165>>0] = 0;
 $$index2166 = ((($15)) + 2151|0);
 HEAP8[$$index2166>>0] = 0;
 $$index2167 = ((($15)) + 2152|0);
 HEAP8[$$index2167>>0] = 0;
 $$index2168 = ((($15)) + 2153|0);
 HEAP8[$$index2168>>0] = 0;
 $$index2169 = ((($15)) + 2154|0);
 HEAP8[$$index2169>>0] = 0;
 $$index2170 = ((($15)) + 2155|0);
 HEAP8[$$index2170>>0] = 0;
 $$index2171 = ((($15)) + 2156|0);
 HEAP8[$$index2171>>0] = 0;
 $$index2172 = ((($15)) + 2157|0);
 HEAP8[$$index2172>>0] = 0;
 $$index2173 = ((($15)) + 2158|0);
 HEAP8[$$index2173>>0] = 0;
 $$index2174 = ((($15)) + 2159|0);
 HEAP8[$$index2174>>0] = 0;
 $$index2175 = ((($15)) + 2160|0);
 HEAP8[$$index2175>>0] = 0;
 $$index2176 = ((($15)) + 2161|0);
 HEAP8[$$index2176>>0] = 0;
 $$index2177 = ((($15)) + 2162|0);
 HEAP8[$$index2177>>0] = 0;
 $$index2178 = ((($15)) + 2163|0);
 HEAP8[$$index2178>>0] = 0;
 $$index2179 = ((($15)) + 2164|0);
 HEAP8[$$index2179>>0] = 0;
 $$index2180 = ((($15)) + 2165|0);
 HEAP8[$$index2180>>0] = 0;
 $$index2181 = ((($15)) + 2166|0);
 HEAP8[$$index2181>>0] = 0;
 $$index2182 = ((($15)) + 2167|0);
 HEAP8[$$index2182>>0] = 0;
 $$index2183 = ((($15)) + 2168|0);
 HEAP8[$$index2183>>0] = 0;
 $$index2184 = ((($15)) + 2169|0);
 HEAP8[$$index2184>>0] = 0;
 $$index2185 = ((($15)) + 2170|0);
 HEAP8[$$index2185>>0] = 0;
 $$index2186 = ((($15)) + 2171|0);
 HEAP8[$$index2186>>0] = 0;
 $$index2187 = ((($15)) + 2172|0);
 HEAP8[$$index2187>>0] = 0;
 $$index2188 = ((($15)) + 2173|0);
 HEAP8[$$index2188>>0] = 0;
 $$index2189 = ((($15)) + 2174|0);
 HEAP8[$$index2189>>0] = 0;
 $$index2190 = ((($15)) + 2175|0);
 HEAP8[$$index2190>>0] = 0;
 $$index2191 = ((($15)) + 2176|0);
 HEAP8[$$index2191>>0] = 0;
 $$index2192 = ((($15)) + 2177|0);
 HEAP8[$$index2192>>0] = 0;
 $$index2193 = ((($15)) + 2178|0);
 HEAP8[$$index2193>>0] = 0;
 $$index2194 = ((($15)) + 2179|0);
 HEAP8[$$index2194>>0] = 0;
 $$index2195 = ((($15)) + 2180|0);
 HEAP8[$$index2195>>0] = 0;
 $$index2196 = ((($15)) + 2181|0);
 HEAP8[$$index2196>>0] = 0;
 $$index2197 = ((($15)) + 2182|0);
 HEAP8[$$index2197>>0] = 0;
 $$index2198 = ((($15)) + 2183|0);
 HEAP8[$$index2198>>0] = 0;
 $$index2199 = ((($15)) + 2184|0);
 HEAP8[$$index2199>>0] = 0;
 $$index2200 = ((($15)) + 2185|0);
 HEAP8[$$index2200>>0] = 0;
 $$index2201 = ((($15)) + 2186|0);
 HEAP8[$$index2201>>0] = 0;
 $$index2202 = ((($15)) + 2187|0);
 HEAP8[$$index2202>>0] = 0;
 $$index2203 = ((($15)) + 2188|0);
 HEAP8[$$index2203>>0] = 0;
 $$index2204 = ((($15)) + 2189|0);
 HEAP8[$$index2204>>0] = 0;
 $$index2205 = ((($15)) + 2190|0);
 HEAP8[$$index2205>>0] = 0;
 $$index2206 = ((($15)) + 2191|0);
 HEAP8[$$index2206>>0] = 0;
 $$index2207 = ((($15)) + 2192|0);
 HEAP8[$$index2207>>0] = 0;
 $$index2208 = ((($15)) + 2193|0);
 HEAP8[$$index2208>>0] = 0;
 $$index2209 = ((($15)) + 2194|0);
 HEAP8[$$index2209>>0] = 0;
 $$index2210 = ((($15)) + 2195|0);
 HEAP8[$$index2210>>0] = 0;
 $$index2211 = ((($15)) + 2196|0);
 HEAP8[$$index2211>>0] = 0;
 $$index2212 = ((($15)) + 2197|0);
 HEAP8[$$index2212>>0] = 0;
 $$index2213 = ((($15)) + 2198|0);
 HEAP8[$$index2213>>0] = 0;
 $$index2214 = ((($15)) + 2199|0);
 HEAP8[$$index2214>>0] = 0;
 $$index2215 = ((($15)) + 2200|0);
 HEAP8[$$index2215>>0] = 0;
 $$index2216 = ((($15)) + 2201|0);
 HEAP8[$$index2216>>0] = 0;
 $$index2217 = ((($15)) + 2202|0);
 HEAP8[$$index2217>>0] = 0;
 $$index2218 = ((($15)) + 2203|0);
 HEAP8[$$index2218>>0] = 0;
 $$index2219 = ((($15)) + 2204|0);
 HEAP8[$$index2219>>0] = 0;
 $$index2220 = ((($15)) + 2205|0);
 HEAP8[$$index2220>>0] = 0;
 $$index2221 = ((($15)) + 2206|0);
 HEAP8[$$index2221>>0] = 0;
 $$index2222 = ((($15)) + 2207|0);
 HEAP8[$$index2222>>0] = 0;
 $$index2223 = ((($15)) + 2208|0);
 HEAP8[$$index2223>>0] = 0;
 $$index2224 = ((($15)) + 2209|0);
 HEAP8[$$index2224>>0] = 0;
 $$index2225 = ((($15)) + 2210|0);
 HEAP8[$$index2225>>0] = 0;
 $$index2226 = ((($15)) + 2211|0);
 HEAP8[$$index2226>>0] = 0;
 $$index2227 = ((($15)) + 2212|0);
 HEAP8[$$index2227>>0] = 0;
 $$index2228 = ((($15)) + 2213|0);
 HEAP8[$$index2228>>0] = 0;
 $$index2229 = ((($15)) + 2214|0);
 HEAP8[$$index2229>>0] = 0;
 $$index2230 = ((($15)) + 2215|0);
 HEAP8[$$index2230>>0] = 0;
 $$index2231 = ((($15)) + 2216|0);
 HEAP8[$$index2231>>0] = 0;
 $$index2232 = ((($15)) + 2217|0);
 HEAP8[$$index2232>>0] = 0;
 $$index2233 = ((($15)) + 2218|0);
 HEAP8[$$index2233>>0] = 0;
 $$index2234 = ((($15)) + 2219|0);
 HEAP8[$$index2234>>0] = 0;
 $$index2235 = ((($15)) + 2220|0);
 HEAP8[$$index2235>>0] = 0;
 $$index2236 = ((($15)) + 2221|0);
 HEAP8[$$index2236>>0] = 0;
 $$index2237 = ((($15)) + 2222|0);
 HEAP8[$$index2237>>0] = 0;
 $$index2238 = ((($15)) + 2223|0);
 HEAP8[$$index2238>>0] = 0;
 $$index2239 = ((($15)) + 2224|0);
 HEAP8[$$index2239>>0] = 0;
 $$index2240 = ((($15)) + 2225|0);
 HEAP8[$$index2240>>0] = 0;
 $$index2241 = ((($15)) + 2226|0);
 HEAP8[$$index2241>>0] = 0;
 $$index2242 = ((($15)) + 2227|0);
 HEAP8[$$index2242>>0] = 0;
 $$index2243 = ((($15)) + 2228|0);
 HEAP8[$$index2243>>0] = 0;
 $$index2244 = ((($15)) + 2229|0);
 HEAP8[$$index2244>>0] = 0;
 $$index2245 = ((($15)) + 2230|0);
 HEAP8[$$index2245>>0] = 0;
 $$index2246 = ((($15)) + 2231|0);
 HEAP8[$$index2246>>0] = 0;
 $$index2247 = ((($15)) + 2232|0);
 HEAP8[$$index2247>>0] = 0;
 $$index2248 = ((($15)) + 2233|0);
 HEAP8[$$index2248>>0] = 0;
 $$index2249 = ((($15)) + 2234|0);
 HEAP8[$$index2249>>0] = 0;
 $$index2250 = ((($15)) + 2235|0);
 HEAP8[$$index2250>>0] = 0;
 $$index2251 = ((($15)) + 2236|0);
 HEAP8[$$index2251>>0] = 0;
 $$index2252 = ((($15)) + 2237|0);
 HEAP8[$$index2252>>0] = 0;
 $$index2253 = ((($15)) + 2238|0);
 HEAP8[$$index2253>>0] = 0;
 $$index2254 = ((($15)) + 2239|0);
 HEAP8[$$index2254>>0] = 0;
 $$index2255 = ((($15)) + 2240|0);
 HEAP8[$$index2255>>0] = 0;
 $$index2256 = ((($15)) + 2241|0);
 HEAP8[$$index2256>>0] = 0;
 $$index2257 = ((($15)) + 2242|0);
 HEAP8[$$index2257>>0] = 0;
 $$index2258 = ((($15)) + 2243|0);
 HEAP8[$$index2258>>0] = 0;
 $$index2259 = ((($15)) + 2244|0);
 HEAP8[$$index2259>>0] = 0;
 $$index2260 = ((($15)) + 2245|0);
 HEAP8[$$index2260>>0] = 0;
 $$index2261 = ((($15)) + 2246|0);
 HEAP8[$$index2261>>0] = 0;
 $$index2262 = ((($15)) + 2247|0);
 HEAP8[$$index2262>>0] = 0;
 $$index2263 = ((($15)) + 2248|0);
 HEAP8[$$index2263>>0] = 0;
 $$index2264 = ((($15)) + 2249|0);
 HEAP8[$$index2264>>0] = 0;
 $$index2265 = ((($15)) + 2250|0);
 HEAP8[$$index2265>>0] = 0;
 $$index2266 = ((($15)) + 2251|0);
 HEAP8[$$index2266>>0] = 0;
 $$index2267 = ((($15)) + 2252|0);
 HEAP8[$$index2267>>0] = 0;
 $$index2268 = ((($15)) + 2253|0);
 HEAP8[$$index2268>>0] = 0;
 $$index2269 = ((($15)) + 2254|0);
 HEAP8[$$index2269>>0] = 0;
 $$index2270 = ((($15)) + 2255|0);
 HEAP8[$$index2270>>0] = 0;
 $$index2271 = ((($15)) + 2256|0);
 HEAP8[$$index2271>>0] = 0;
 $$index2272 = ((($15)) + 2257|0);
 HEAP8[$$index2272>>0] = 0;
 $$index2273 = ((($15)) + 2258|0);
 HEAP8[$$index2273>>0] = 0;
 $$index2274 = ((($15)) + 2259|0);
 HEAP8[$$index2274>>0] = 0;
 $$index2275 = ((($15)) + 2260|0);
 HEAP8[$$index2275>>0] = 0;
 $$index2276 = ((($15)) + 2261|0);
 HEAP8[$$index2276>>0] = 0;
 $$index2277 = ((($15)) + 2262|0);
 HEAP8[$$index2277>>0] = 0;
 $$index2278 = ((($15)) + 2263|0);
 HEAP8[$$index2278>>0] = 0;
 $$index2279 = ((($15)) + 2264|0);
 HEAP8[$$index2279>>0] = 0;
 $$index2280 = ((($15)) + 2265|0);
 HEAP8[$$index2280>>0] = 0;
 $$index2281 = ((($15)) + 2266|0);
 HEAP8[$$index2281>>0] = 0;
 $$index2282 = ((($15)) + 2267|0);
 HEAP8[$$index2282>>0] = 0;
 $$index2283 = ((($15)) + 2268|0);
 HEAP8[$$index2283>>0] = 0;
 $$index2284 = ((($15)) + 2269|0);
 HEAP8[$$index2284>>0] = 0;
 $$index2285 = ((($15)) + 2270|0);
 HEAP8[$$index2285>>0] = 0;
 $$index2286 = ((($15)) + 2271|0);
 HEAP8[$$index2286>>0] = 0;
 $$index2287 = ((($15)) + 2272|0);
 HEAP8[$$index2287>>0] = 0;
 $$index2288 = ((($15)) + 2273|0);
 HEAP8[$$index2288>>0] = 0;
 $$index2289 = ((($15)) + 2274|0);
 HEAP8[$$index2289>>0] = 0;
 $$index2290 = ((($15)) + 2275|0);
 HEAP8[$$index2290>>0] = 0;
 $$index2291 = ((($15)) + 2276|0);
 HEAP8[$$index2291>>0] = 0;
 $$index2292 = ((($15)) + 2277|0);
 HEAP8[$$index2292>>0] = 0;
 $$index2293 = ((($15)) + 2278|0);
 HEAP8[$$index2293>>0] = 0;
 $$index2294 = ((($15)) + 2279|0);
 HEAP8[$$index2294>>0] = 0;
 $$index2295 = ((($15)) + 2280|0);
 HEAP8[$$index2295>>0] = 0;
 $$index2296 = ((($15)) + 2281|0);
 HEAP8[$$index2296>>0] = 0;
 $$index2297 = ((($15)) + 2282|0);
 HEAP8[$$index2297>>0] = 0;
 $$index2298 = ((($15)) + 2283|0);
 HEAP8[$$index2298>>0] = 0;
 $$index2299 = ((($15)) + 2284|0);
 HEAP8[$$index2299>>0] = 0;
 $$index2300 = ((($15)) + 2285|0);
 HEAP8[$$index2300>>0] = 0;
 $$index2301 = ((($15)) + 2286|0);
 HEAP8[$$index2301>>0] = 0;
 $$index2302 = ((($15)) + 2287|0);
 HEAP8[$$index2302>>0] = 0;
 $$index2303 = ((($15)) + 2288|0);
 HEAP8[$$index2303>>0] = 0;
 $$index2304 = ((($15)) + 2289|0);
 HEAP8[$$index2304>>0] = 0;
 $$index2305 = ((($15)) + 2290|0);
 HEAP8[$$index2305>>0] = 0;
 $$index2306 = ((($15)) + 2291|0);
 HEAP8[$$index2306>>0] = 0;
 $$index2307 = ((($15)) + 2292|0);
 HEAP8[$$index2307>>0] = 0;
 $$index2308 = ((($15)) + 2293|0);
 HEAP8[$$index2308>>0] = 0;
 $$index2309 = ((($15)) + 2294|0);
 HEAP8[$$index2309>>0] = 0;
 $$index2310 = ((($15)) + 2295|0);
 HEAP8[$$index2310>>0] = 0;
 $$index2311 = ((($15)) + 2296|0);
 HEAP8[$$index2311>>0] = 0;
 $$index2312 = ((($15)) + 2297|0);
 HEAP8[$$index2312>>0] = 0;
 $$index2313 = ((($15)) + 2298|0);
 HEAP8[$$index2313>>0] = 0;
 $$index2314 = ((($15)) + 2299|0);
 HEAP8[$$index2314>>0] = 0;
 $$index2315 = ((($15)) + 2300|0);
 HEAP8[$$index2315>>0] = 0;
 $$index2316 = ((($15)) + 2301|0);
 HEAP8[$$index2316>>0] = 0;
 $$index2317 = ((($15)) + 2302|0);
 HEAP8[$$index2317>>0] = 0;
 $$index2318 = ((($15)) + 2303|0);
 HEAP8[$$index2318>>0] = 0;
 $$index2319 = ((($15)) + 2304|0);
 HEAP8[$$index2319>>0] = 0;
 $$index2320 = ((($15)) + 2305|0);
 HEAP8[$$index2320>>0] = 0;
 $$index2321 = ((($15)) + 2306|0);
 HEAP8[$$index2321>>0] = 0;
 $$index2322 = ((($15)) + 2307|0);
 HEAP8[$$index2322>>0] = 0;
 $$index2323 = ((($15)) + 2308|0);
 HEAP8[$$index2323>>0] = 0;
 $$index2324 = ((($15)) + 2309|0);
 HEAP8[$$index2324>>0] = 0;
 $$index2325 = ((($15)) + 2310|0);
 HEAP8[$$index2325>>0] = 0;
 $$index2326 = ((($15)) + 2311|0);
 HEAP8[$$index2326>>0] = 0;
 $$index2327 = ((($15)) + 2312|0);
 HEAP8[$$index2327>>0] = 0;
 $$index2328 = ((($15)) + 2313|0);
 HEAP8[$$index2328>>0] = 0;
 $$index2329 = ((($15)) + 2314|0);
 HEAP8[$$index2329>>0] = 0;
 $$index2330 = ((($15)) + 2315|0);
 HEAP8[$$index2330>>0] = 0;
 $$index2331 = ((($15)) + 2316|0);
 HEAP8[$$index2331>>0] = 0;
 $$index2332 = ((($15)) + 2317|0);
 HEAP8[$$index2332>>0] = 0;
 $$index2333 = ((($15)) + 2318|0);
 HEAP8[$$index2333>>0] = 0;
 $$index2334 = ((($15)) + 2319|0);
 HEAP8[$$index2334>>0] = 0;
 $$index2335 = ((($15)) + 2320|0);
 HEAP8[$$index2335>>0] = 0;
 $$index2336 = ((($15)) + 2321|0);
 HEAP8[$$index2336>>0] = 0;
 $$index2337 = ((($15)) + 2322|0);
 HEAP8[$$index2337>>0] = 0;
 $$index2338 = ((($15)) + 2323|0);
 HEAP8[$$index2338>>0] = 0;
 $$index2339 = ((($15)) + 2324|0);
 HEAP8[$$index2339>>0] = 0;
 $$index2340 = ((($15)) + 2325|0);
 HEAP8[$$index2340>>0] = 0;
 $$index2341 = ((($15)) + 2326|0);
 HEAP8[$$index2341>>0] = 0;
 $$index2342 = ((($15)) + 2327|0);
 HEAP8[$$index2342>>0] = 0;
 $$index2343 = ((($15)) + 2328|0);
 HEAP8[$$index2343>>0] = 0;
 $$index2344 = ((($15)) + 2329|0);
 HEAP8[$$index2344>>0] = 0;
 $$index2345 = ((($15)) + 2330|0);
 HEAP8[$$index2345>>0] = 0;
 $$index2346 = ((($15)) + 2331|0);
 HEAP8[$$index2346>>0] = 0;
 $$index2347 = ((($15)) + 2332|0);
 HEAP8[$$index2347>>0] = 0;
 $$index2348 = ((($15)) + 2333|0);
 HEAP8[$$index2348>>0] = 0;
 $$index2349 = ((($15)) + 2334|0);
 HEAP8[$$index2349>>0] = 0;
 $$index2350 = ((($15)) + 2335|0);
 HEAP8[$$index2350>>0] = 0;
 $$index2351 = ((($15)) + 2336|0);
 HEAP8[$$index2351>>0] = 0;
 $$index2352 = ((($15)) + 2337|0);
 HEAP8[$$index2352>>0] = 0;
 $$index2353 = ((($15)) + 2338|0);
 HEAP8[$$index2353>>0] = 0;
 $$index2354 = ((($15)) + 2339|0);
 HEAP8[$$index2354>>0] = 0;
 $$index2355 = ((($15)) + 2340|0);
 HEAP8[$$index2355>>0] = 0;
 $$index2356 = ((($15)) + 2341|0);
 HEAP8[$$index2356>>0] = 0;
 $$index2357 = ((($15)) + 2342|0);
 HEAP8[$$index2357>>0] = 0;
 $$index2358 = ((($15)) + 2343|0);
 HEAP8[$$index2358>>0] = 0;
 $$index2359 = ((($15)) + 2344|0);
 HEAP8[$$index2359>>0] = 0;
 $$index2360 = ((($15)) + 2345|0);
 HEAP8[$$index2360>>0] = 0;
 $$index2361 = ((($15)) + 2346|0);
 HEAP8[$$index2361>>0] = 0;
 $$index2362 = ((($15)) + 2347|0);
 HEAP8[$$index2362>>0] = 0;
 $$index2363 = ((($15)) + 2348|0);
 HEAP8[$$index2363>>0] = 0;
 $$index2364 = ((($15)) + 2349|0);
 HEAP8[$$index2364>>0] = 0;
 $$index2365 = ((($15)) + 2350|0);
 HEAP8[$$index2365>>0] = 0;
 $$index2366 = ((($15)) + 2351|0);
 HEAP8[$$index2366>>0] = 0;
 $$index2367 = ((($15)) + 2352|0);
 HEAP8[$$index2367>>0] = 0;
 $$index2368 = ((($15)) + 2353|0);
 HEAP8[$$index2368>>0] = 0;
 $$index2369 = ((($15)) + 2354|0);
 HEAP8[$$index2369>>0] = 0;
 $$index2370 = ((($15)) + 2355|0);
 HEAP8[$$index2370>>0] = 0;
 $$index2371 = ((($15)) + 2356|0);
 HEAP8[$$index2371>>0] = 0;
 $$index2372 = ((($15)) + 2357|0);
 HEAP8[$$index2372>>0] = 0;
 $$index2373 = ((($15)) + 2358|0);
 HEAP8[$$index2373>>0] = 0;
 $$index2374 = ((($15)) + 2359|0);
 HEAP8[$$index2374>>0] = 0;
 $$index2375 = ((($15)) + 2360|0);
 HEAP8[$$index2375>>0] = 0;
 $$index2376 = ((($15)) + 2361|0);
 HEAP8[$$index2376>>0] = 0;
 $$index2377 = ((($15)) + 2362|0);
 HEAP8[$$index2377>>0] = 0;
 $$index2378 = ((($15)) + 2363|0);
 HEAP8[$$index2378>>0] = 0;
 $$index2379 = ((($15)) + 2364|0);
 HEAP8[$$index2379>>0] = 0;
 $$index2380 = ((($15)) + 2365|0);
 HEAP8[$$index2380>>0] = 0;
 $$index2381 = ((($15)) + 2366|0);
 HEAP8[$$index2381>>0] = 0;
 $$index2382 = ((($15)) + 2367|0);
 HEAP8[$$index2382>>0] = 0;
 $$index2383 = ((($15)) + 2368|0);
 HEAP8[$$index2383>>0] = 0;
 $$index2384 = ((($15)) + 2369|0);
 HEAP8[$$index2384>>0] = 0;
 $$index2385 = ((($15)) + 2370|0);
 HEAP8[$$index2385>>0] = 0;
 $$index2386 = ((($15)) + 2371|0);
 HEAP8[$$index2386>>0] = 0;
 $$index2387 = ((($15)) + 2372|0);
 HEAP8[$$index2387>>0] = 0;
 $$index2388 = ((($15)) + 2373|0);
 HEAP8[$$index2388>>0] = 0;
 $$index2389 = ((($15)) + 2374|0);
 HEAP8[$$index2389>>0] = 0;
 $$index2390 = ((($15)) + 2375|0);
 HEAP8[$$index2390>>0] = 0;
 $$index2391 = ((($15)) + 2376|0);
 HEAP8[$$index2391>>0] = 0;
 $$index2392 = ((($15)) + 2377|0);
 HEAP8[$$index2392>>0] = 0;
 $$index2393 = ((($15)) + 2378|0);
 HEAP8[$$index2393>>0] = 0;
 $$index2394 = ((($15)) + 2379|0);
 HEAP8[$$index2394>>0] = 0;
 $$index2395 = ((($15)) + 2380|0);
 HEAP8[$$index2395>>0] = 0;
 $$index2396 = ((($15)) + 2381|0);
 HEAP8[$$index2396>>0] = 0;
 $$index2397 = ((($15)) + 2382|0);
 HEAP8[$$index2397>>0] = 0;
 $$index2398 = ((($15)) + 2383|0);
 HEAP8[$$index2398>>0] = 0;
 $$index2399 = ((($15)) + 2384|0);
 HEAP8[$$index2399>>0] = 0;
 $$index2400 = ((($15)) + 2385|0);
 HEAP8[$$index2400>>0] = 0;
 $$index2401 = ((($15)) + 2386|0);
 HEAP8[$$index2401>>0] = 0;
 $$index2402 = ((($15)) + 2387|0);
 HEAP8[$$index2402>>0] = 0;
 $$index2403 = ((($15)) + 2388|0);
 HEAP8[$$index2403>>0] = 0;
 $$index2404 = ((($15)) + 2389|0);
 HEAP8[$$index2404>>0] = 0;
 $$index2405 = ((($15)) + 2390|0);
 HEAP8[$$index2405>>0] = 0;
 $$index2406 = ((($15)) + 2391|0);
 HEAP8[$$index2406>>0] = 0;
 $$index2407 = ((($15)) + 2392|0);
 HEAP8[$$index2407>>0] = 0;
 $$index2408 = ((($15)) + 2393|0);
 HEAP8[$$index2408>>0] = 0;
 $$index2409 = ((($15)) + 2394|0);
 HEAP8[$$index2409>>0] = 0;
 $$index2410 = ((($15)) + 2395|0);
 HEAP8[$$index2410>>0] = 0;
 $$index2411 = ((($15)) + 2396|0);
 HEAP8[$$index2411>>0] = 0;
 $$index2412 = ((($15)) + 2397|0);
 HEAP8[$$index2412>>0] = 0;
 $$index2413 = ((($15)) + 2398|0);
 HEAP8[$$index2413>>0] = 0;
 $$index2414 = ((($15)) + 2399|0);
 HEAP8[$$index2414>>0] = 0;
 $$index2415 = ((($15)) + 2400|0);
 HEAP8[$$index2415>>0] = 0;
 $$index2416 = ((($15)) + 2401|0);
 HEAP8[$$index2416>>0] = 0;
 $$index2417 = ((($15)) + 2402|0);
 HEAP8[$$index2417>>0] = 0;
 $$index2418 = ((($15)) + 2403|0);
 HEAP8[$$index2418>>0] = 0;
 $$index2419 = ((($15)) + 2404|0);
 HEAP8[$$index2419>>0] = 0;
 $$index2420 = ((($15)) + 2405|0);
 HEAP8[$$index2420>>0] = 0;
 $$index2421 = ((($15)) + 2406|0);
 HEAP8[$$index2421>>0] = 0;
 $$index2422 = ((($15)) + 2407|0);
 HEAP8[$$index2422>>0] = 0;
 $$index2423 = ((($15)) + 2408|0);
 HEAP8[$$index2423>>0] = 0;
 $$index2424 = ((($15)) + 2409|0);
 HEAP8[$$index2424>>0] = 0;
 $$index2425 = ((($15)) + 2410|0);
 HEAP8[$$index2425>>0] = 0;
 $$index2426 = ((($15)) + 2411|0);
 HEAP8[$$index2426>>0] = 0;
 $$index2427 = ((($15)) + 2412|0);
 HEAP8[$$index2427>>0] = 0;
 $$index2428 = ((($15)) + 2413|0);
 HEAP8[$$index2428>>0] = 0;
 $$index2429 = ((($15)) + 2414|0);
 HEAP8[$$index2429>>0] = 0;
 $$index2430 = ((($15)) + 2415|0);
 HEAP8[$$index2430>>0] = 0;
 $$index2431 = ((($15)) + 2416|0);
 HEAP8[$$index2431>>0] = 0;
 $$index2432 = ((($15)) + 2417|0);
 HEAP8[$$index2432>>0] = 0;
 $$index2433 = ((($15)) + 2418|0);
 HEAP8[$$index2433>>0] = 0;
 $$index2434 = ((($15)) + 2419|0);
 HEAP8[$$index2434>>0] = 0;
 $$index2435 = ((($15)) + 2420|0);
 HEAP8[$$index2435>>0] = 0;
 $$index2436 = ((($15)) + 2421|0);
 HEAP8[$$index2436>>0] = 0;
 $$index2437 = ((($15)) + 2422|0);
 HEAP8[$$index2437>>0] = 0;
 $$index2438 = ((($15)) + 2423|0);
 HEAP8[$$index2438>>0] = 0;
 $$index2439 = ((($15)) + 2424|0);
 HEAP8[$$index2439>>0] = 0;
 $$index2440 = ((($15)) + 2425|0);
 HEAP8[$$index2440>>0] = 0;
 $$index2441 = ((($15)) + 2426|0);
 HEAP8[$$index2441>>0] = 0;
 $$index2442 = ((($15)) + 2427|0);
 HEAP8[$$index2442>>0] = 0;
 $$index2443 = ((($15)) + 2428|0);
 HEAP8[$$index2443>>0] = 0;
 $$index2444 = ((($15)) + 2429|0);
 HEAP8[$$index2444>>0] = 0;
 $$index2445 = ((($15)) + 2430|0);
 HEAP8[$$index2445>>0] = 0;
 $$index2446 = ((($15)) + 2431|0);
 HEAP8[$$index2446>>0] = 0;
 $$index2447 = ((($15)) + 2432|0);
 HEAP8[$$index2447>>0] = 0;
 $$index2448 = ((($15)) + 2433|0);
 HEAP8[$$index2448>>0] = 0;
 $$index2449 = ((($15)) + 2434|0);
 HEAP8[$$index2449>>0] = 0;
 $$index2450 = ((($15)) + 2435|0);
 HEAP8[$$index2450>>0] = 0;
 $$index2451 = ((($15)) + 2436|0);
 HEAP8[$$index2451>>0] = 0;
 $$index2452 = ((($15)) + 2437|0);
 HEAP8[$$index2452>>0] = 0;
 $$index2453 = ((($15)) + 2438|0);
 HEAP8[$$index2453>>0] = 0;
 $$index2454 = ((($15)) + 2439|0);
 HEAP8[$$index2454>>0] = 0;
 $$index2455 = ((($15)) + 2440|0);
 HEAP8[$$index2455>>0] = 0;
 $$index2456 = ((($15)) + 2441|0);
 HEAP8[$$index2456>>0] = 0;
 $$index2457 = ((($15)) + 2442|0);
 HEAP8[$$index2457>>0] = 0;
 $$index2458 = ((($15)) + 2443|0);
 HEAP8[$$index2458>>0] = 0;
 $$index2459 = ((($15)) + 2444|0);
 HEAP8[$$index2459>>0] = 0;
 $$index2460 = ((($15)) + 2445|0);
 HEAP8[$$index2460>>0] = 0;
 $$index2461 = ((($15)) + 2446|0);
 HEAP8[$$index2461>>0] = 0;
 $$index2462 = ((($15)) + 2447|0);
 HEAP8[$$index2462>>0] = 0;
 $$index2463 = ((($15)) + 2448|0);
 HEAP8[$$index2463>>0] = 0;
 $$index2464 = ((($15)) + 2449|0);
 HEAP8[$$index2464>>0] = 0;
 $$index2465 = ((($15)) + 2450|0);
 HEAP8[$$index2465>>0] = 0;
 $$index2466 = ((($15)) + 2451|0);
 HEAP8[$$index2466>>0] = 0;
 $$index2467 = ((($15)) + 2452|0);
 HEAP8[$$index2467>>0] = 0;
 $$index2468 = ((($15)) + 2453|0);
 HEAP8[$$index2468>>0] = 0;
 $$index2469 = ((($15)) + 2454|0);
 HEAP8[$$index2469>>0] = 0;
 $$index2470 = ((($15)) + 2455|0);
 HEAP8[$$index2470>>0] = 0;
 $$index2471 = ((($15)) + 2456|0);
 HEAP8[$$index2471>>0] = 0;
 $$index2472 = ((($15)) + 2457|0);
 HEAP8[$$index2472>>0] = 0;
 $$index2473 = ((($15)) + 2458|0);
 HEAP8[$$index2473>>0] = 0;
 $$index2474 = ((($15)) + 2459|0);
 HEAP8[$$index2474>>0] = 0;
 $$index2475 = ((($15)) + 2460|0);
 HEAP8[$$index2475>>0] = 0;
 $$index2476 = ((($15)) + 2461|0);
 HEAP8[$$index2476>>0] = 0;
 $$index2477 = ((($15)) + 2462|0);
 HEAP8[$$index2477>>0] = 0;
 $$index2478 = ((($15)) + 2463|0);
 HEAP8[$$index2478>>0] = 0;
 $$index2479 = ((($15)) + 2464|0);
 HEAP8[$$index2479>>0] = 0;
 $$index2480 = ((($15)) + 2465|0);
 HEAP8[$$index2480>>0] = 0;
 $$index2481 = ((($15)) + 2466|0);
 HEAP8[$$index2481>>0] = 0;
 $$index2482 = ((($15)) + 2467|0);
 HEAP8[$$index2482>>0] = 0;
 $$index2483 = ((($15)) + 2468|0);
 HEAP8[$$index2483>>0] = 0;
 $$index2484 = ((($15)) + 2469|0);
 HEAP8[$$index2484>>0] = 0;
 $$index2485 = ((($15)) + 2470|0);
 HEAP8[$$index2485>>0] = 0;
 $$index2486 = ((($15)) + 2471|0);
 HEAP8[$$index2486>>0] = 0;
 $$index2487 = ((($15)) + 2472|0);
 HEAP8[$$index2487>>0] = 0;
 $$index2488 = ((($15)) + 2473|0);
 HEAP8[$$index2488>>0] = 0;
 $$index2489 = ((($15)) + 2474|0);
 HEAP8[$$index2489>>0] = 0;
 $$index2490 = ((($15)) + 2475|0);
 HEAP8[$$index2490>>0] = 0;
 $$index2491 = ((($15)) + 2476|0);
 HEAP8[$$index2491>>0] = 0;
 $$index2492 = ((($15)) + 2477|0);
 HEAP8[$$index2492>>0] = 0;
 $$index2493 = ((($15)) + 2478|0);
 HEAP8[$$index2493>>0] = 0;
 $$index2494 = ((($15)) + 2479|0);
 HEAP8[$$index2494>>0] = 0;
 $$index2495 = ((($15)) + 2480|0);
 HEAP8[$$index2495>>0] = 0;
 $$index2496 = ((($15)) + 2481|0);
 HEAP8[$$index2496>>0] = 0;
 $$index2497 = ((($15)) + 2482|0);
 HEAP8[$$index2497>>0] = 0;
 $$index2498 = ((($15)) + 2483|0);
 HEAP8[$$index2498>>0] = 0;
 $$index2499 = ((($15)) + 2484|0);
 HEAP8[$$index2499>>0] = 0;
 $$index2500 = ((($15)) + 2485|0);
 HEAP8[$$index2500>>0] = 0;
 $$index2501 = ((($15)) + 2486|0);
 HEAP8[$$index2501>>0] = 0;
 $$index2502 = ((($15)) + 2487|0);
 HEAP8[$$index2502>>0] = 0;
 $$index2503 = ((($15)) + 2488|0);
 HEAP8[$$index2503>>0] = 0;
 $$index2504 = ((($15)) + 2489|0);
 HEAP8[$$index2504>>0] = 0;
 $$index2505 = ((($15)) + 2490|0);
 HEAP8[$$index2505>>0] = 0;
 $$index2506 = ((($15)) + 2491|0);
 HEAP8[$$index2506>>0] = 0;
 $$index2507 = ((($15)) + 2492|0);
 HEAP8[$$index2507>>0] = 0;
 $$index2508 = ((($15)) + 2493|0);
 HEAP8[$$index2508>>0] = 0;
 $$index2509 = ((($15)) + 2494|0);
 HEAP8[$$index2509>>0] = 0;
 $$index2510 = ((($15)) + 2495|0);
 HEAP8[$$index2510>>0] = 0;
 $$index2511 = ((($15)) + 2496|0);
 HEAP8[$$index2511>>0] = 0;
 $$index2512 = ((($15)) + 2497|0);
 HEAP8[$$index2512>>0] = 0;
 $$index2513 = ((($15)) + 2498|0);
 HEAP8[$$index2513>>0] = 0;
 $$index2514 = ((($15)) + 2499|0);
 HEAP8[$$index2514>>0] = 0;
 $$index2515 = ((($15)) + 2500|0);
 HEAP8[$$index2515>>0] = 0;
 $$index2516 = ((($15)) + 2501|0);
 HEAP8[$$index2516>>0] = 0;
 $$index2517 = ((($15)) + 2502|0);
 HEAP8[$$index2517>>0] = 0;
 $$index2518 = ((($15)) + 2503|0);
 HEAP8[$$index2518>>0] = 0;
 $$index2519 = ((($15)) + 2504|0);
 HEAP8[$$index2519>>0] = 0;
 $$index2520 = ((($15)) + 2505|0);
 HEAP8[$$index2520>>0] = 0;
 $$index2521 = ((($15)) + 2506|0);
 HEAP8[$$index2521>>0] = 0;
 $$index2522 = ((($15)) + 2507|0);
 HEAP8[$$index2522>>0] = 0;
 $$index2523 = ((($15)) + 2508|0);
 HEAP8[$$index2523>>0] = 0;
 $$index2524 = ((($15)) + 2509|0);
 HEAP8[$$index2524>>0] = 0;
 $$index2525 = ((($15)) + 2510|0);
 HEAP8[$$index2525>>0] = 0;
 $$index2526 = ((($15)) + 2511|0);
 HEAP8[$$index2526>>0] = 0;
 $$index2527 = ((($15)) + 2512|0);
 HEAP8[$$index2527>>0] = 0;
 $$index2528 = ((($15)) + 2513|0);
 HEAP8[$$index2528>>0] = 0;
 $$index2529 = ((($15)) + 2514|0);
 HEAP8[$$index2529>>0] = 0;
 $$index2530 = ((($15)) + 2515|0);
 HEAP8[$$index2530>>0] = 0;
 $$index2531 = ((($15)) + 2516|0);
 HEAP8[$$index2531>>0] = 0;
 $$index2532 = ((($15)) + 2517|0);
 HEAP8[$$index2532>>0] = 0;
 $$index2533 = ((($15)) + 2518|0);
 HEAP8[$$index2533>>0] = 0;
 $$index2534 = ((($15)) + 2519|0);
 HEAP8[$$index2534>>0] = 0;
 $$index2535 = ((($15)) + 2520|0);
 HEAP8[$$index2535>>0] = 0;
 $$index2536 = ((($15)) + 2521|0);
 HEAP8[$$index2536>>0] = 0;
 $$index2537 = ((($15)) + 2522|0);
 HEAP8[$$index2537>>0] = 0;
 $$index2538 = ((($15)) + 2523|0);
 HEAP8[$$index2538>>0] = 0;
 $$index2539 = ((($15)) + 2524|0);
 HEAP8[$$index2539>>0] = 0;
 $$index2540 = ((($15)) + 2525|0);
 HEAP8[$$index2540>>0] = 0;
 $$index2541 = ((($15)) + 2526|0);
 HEAP8[$$index2541>>0] = 0;
 $$index2542 = ((($15)) + 2527|0);
 HEAP8[$$index2542>>0] = 0;
 $$index2543 = ((($15)) + 2528|0);
 HEAP8[$$index2543>>0] = 0;
 $$index2544 = ((($15)) + 2529|0);
 HEAP8[$$index2544>>0] = 0;
 $$index2545 = ((($15)) + 2530|0);
 HEAP8[$$index2545>>0] = 0;
 $$index2546 = ((($15)) + 2531|0);
 HEAP8[$$index2546>>0] = 0;
 $$index2547 = ((($15)) + 2532|0);
 HEAP8[$$index2547>>0] = 0;
 $$index2548 = ((($15)) + 2533|0);
 HEAP8[$$index2548>>0] = 0;
 $$index2549 = ((($15)) + 2534|0);
 HEAP8[$$index2549>>0] = 0;
 $$index2550 = ((($15)) + 2535|0);
 HEAP8[$$index2550>>0] = 0;
 $$index2551 = ((($15)) + 2536|0);
 HEAP8[$$index2551>>0] = 0;
 $$index2552 = ((($15)) + 2537|0);
 HEAP8[$$index2552>>0] = 0;
 $$index2553 = ((($15)) + 2538|0);
 HEAP8[$$index2553>>0] = 0;
 $$index2554 = ((($15)) + 2539|0);
 HEAP8[$$index2554>>0] = 0;
 $$index2555 = ((($15)) + 2540|0);
 HEAP8[$$index2555>>0] = 0;
 $$index2556 = ((($15)) + 2541|0);
 HEAP8[$$index2556>>0] = 0;
 $$index2557 = ((($15)) + 2542|0);
 HEAP8[$$index2557>>0] = 0;
 $$index2558 = ((($15)) + 2543|0);
 HEAP8[$$index2558>>0] = 0;
 $$index2559 = ((($15)) + 2544|0);
 HEAP8[$$index2559>>0] = 0;
 $$index2560 = ((($15)) + 2545|0);
 HEAP8[$$index2560>>0] = 0;
 $$index2561 = ((($15)) + 2546|0);
 HEAP8[$$index2561>>0] = 0;
 $$index2562 = ((($15)) + 2547|0);
 HEAP8[$$index2562>>0] = 0;
 $$index2563 = ((($15)) + 2548|0);
 HEAP8[$$index2563>>0] = 0;
 $$index2564 = ((($15)) + 2549|0);
 HEAP8[$$index2564>>0] = 0;
 $$index2565 = ((($15)) + 2550|0);
 HEAP8[$$index2565>>0] = 0;
 $$index2566 = ((($15)) + 2551|0);
 HEAP8[$$index2566>>0] = 0;
 $$index2567 = ((($15)) + 2552|0);
 HEAP8[$$index2567>>0] = 0;
 $$index2568 = ((($15)) + 2553|0);
 HEAP8[$$index2568>>0] = 0;
 $$index2569 = ((($15)) + 2554|0);
 HEAP8[$$index2569>>0] = 0;
 $$index2570 = ((($15)) + 2555|0);
 HEAP8[$$index2570>>0] = 0;
 $$index2571 = ((($15)) + 2556|0);
 HEAP8[$$index2571>>0] = 0;
 $$index2572 = ((($15)) + 2557|0);
 HEAP8[$$index2572>>0] = 0;
 $$index2573 = ((($15)) + 2558|0);
 HEAP8[$$index2573>>0] = 0;
 $$index2574 = ((($15)) + 2559|0);
 HEAP8[$$index2574>>0] = 0;
 $$index2575 = ((($15)) + 2560|0);
 HEAP8[$$index2575>>0] = 0;
 $$index2576 = ((($15)) + 2561|0);
 HEAP8[$$index2576>>0] = 0;
 $$index2577 = ((($15)) + 2562|0);
 HEAP8[$$index2577>>0] = 0;
 $$index2578 = ((($15)) + 2563|0);
 HEAP8[$$index2578>>0] = 0;
 $$index2579 = ((($15)) + 2564|0);
 HEAP8[$$index2579>>0] = 0;
 $$index2580 = ((($15)) + 2565|0);
 HEAP8[$$index2580>>0] = 0;
 $$index2581 = ((($15)) + 2566|0);
 HEAP8[$$index2581>>0] = 0;
 $$index2582 = ((($15)) + 2567|0);
 HEAP8[$$index2582>>0] = 0;
 $$index2583 = ((($15)) + 2568|0);
 HEAP8[$$index2583>>0] = 0;
 $$index2584 = ((($15)) + 2569|0);
 HEAP8[$$index2584>>0] = 0;
 $$index2585 = ((($15)) + 2570|0);
 HEAP8[$$index2585>>0] = 0;
 $$index2586 = ((($15)) + 2571|0);
 HEAP8[$$index2586>>0] = 0;
 $$index2587 = ((($15)) + 2572|0);
 HEAP8[$$index2587>>0] = 0;
 $$index2588 = ((($15)) + 2573|0);
 HEAP8[$$index2588>>0] = 0;
 $$index2589 = ((($15)) + 2574|0);
 HEAP8[$$index2589>>0] = 0;
 $$index2590 = ((($15)) + 2575|0);
 HEAP8[$$index2590>>0] = 0;
 $$index2591 = ((($15)) + 2576|0);
 HEAP8[$$index2591>>0] = 0;
 $$index2592 = ((($15)) + 2577|0);
 HEAP8[$$index2592>>0] = 0;
 $$index2593 = ((($15)) + 2578|0);
 HEAP8[$$index2593>>0] = 0;
 $$index2594 = ((($15)) + 2579|0);
 HEAP8[$$index2594>>0] = 0;
 $$index2595 = ((($15)) + 2580|0);
 HEAP8[$$index2595>>0] = 0;
 $$index2596 = ((($15)) + 2581|0);
 HEAP8[$$index2596>>0] = 0;
 $$index2597 = ((($15)) + 2582|0);
 HEAP8[$$index2597>>0] = 0;
 $$index2598 = ((($15)) + 2583|0);
 HEAP8[$$index2598>>0] = 0;
 $$index2599 = ((($15)) + 2584|0);
 HEAP8[$$index2599>>0] = 0;
 $$index2600 = ((($15)) + 2585|0);
 HEAP8[$$index2600>>0] = 0;
 $$index2601 = ((($15)) + 2586|0);
 HEAP8[$$index2601>>0] = 0;
 $$index2602 = ((($15)) + 2587|0);
 HEAP8[$$index2602>>0] = 0;
 $$index2603 = ((($15)) + 2588|0);
 HEAP8[$$index2603>>0] = 0;
 $$index2604 = ((($15)) + 2589|0);
 HEAP8[$$index2604>>0] = 0;
 $$index2605 = ((($15)) + 2590|0);
 HEAP8[$$index2605>>0] = 0;
 $$index2606 = ((($15)) + 2591|0);
 HEAP8[$$index2606>>0] = 0;
 $$index2607 = ((($15)) + 2592|0);
 HEAP8[$$index2607>>0] = 0;
 $$index2608 = ((($15)) + 2593|0);
 HEAP8[$$index2608>>0] = 0;
 $$index2609 = ((($15)) + 2594|0);
 HEAP8[$$index2609>>0] = 0;
 $$index2610 = ((($15)) + 2595|0);
 HEAP8[$$index2610>>0] = 0;
 $$index2611 = ((($15)) + 2596|0);
 HEAP8[$$index2611>>0] = 0;
 $$index2612 = ((($15)) + 2597|0);
 HEAP8[$$index2612>>0] = 0;
 $$index2613 = ((($15)) + 2598|0);
 HEAP8[$$index2613>>0] = 0;
 $$index2614 = ((($15)) + 2599|0);
 HEAP8[$$index2614>>0] = 0;
 $$index2615 = ((($15)) + 2600|0);
 HEAP8[$$index2615>>0] = 0;
 $$index2616 = ((($15)) + 2601|0);
 HEAP8[$$index2616>>0] = 0;
 $$index2617 = ((($15)) + 2602|0);
 HEAP8[$$index2617>>0] = 0;
 $$index2618 = ((($15)) + 2603|0);
 HEAP8[$$index2618>>0] = 0;
 $$index2619 = ((($15)) + 2604|0);
 HEAP8[$$index2619>>0] = 0;
 $$index2620 = ((($15)) + 2605|0);
 HEAP8[$$index2620>>0] = 0;
 $$index2621 = ((($15)) + 2606|0);
 HEAP8[$$index2621>>0] = 0;
 $$index2622 = ((($15)) + 2607|0);
 HEAP8[$$index2622>>0] = 0;
 $$index2623 = ((($15)) + 2608|0);
 HEAP8[$$index2623>>0] = 0;
 $$index2624 = ((($15)) + 2609|0);
 HEAP8[$$index2624>>0] = 0;
 $$index2625 = ((($15)) + 2610|0);
 HEAP8[$$index2625>>0] = 0;
 $$index2626 = ((($15)) + 2611|0);
 HEAP8[$$index2626>>0] = 0;
 $$index2627 = ((($15)) + 2612|0);
 HEAP8[$$index2627>>0] = 0;
 $$index2628 = ((($15)) + 2613|0);
 HEAP8[$$index2628>>0] = 0;
 $$index2629 = ((($15)) + 2614|0);
 HEAP8[$$index2629>>0] = 0;
 $$index2630 = ((($15)) + 2615|0);
 HEAP8[$$index2630>>0] = 0;
 $$index2631 = ((($15)) + 2616|0);
 HEAP8[$$index2631>>0] = 0;
 $$index2632 = ((($15)) + 2617|0);
 HEAP8[$$index2632>>0] = 0;
 $$index2633 = ((($15)) + 2618|0);
 HEAP8[$$index2633>>0] = 0;
 $$index2634 = ((($15)) + 2619|0);
 HEAP8[$$index2634>>0] = 0;
 $$index2635 = ((($15)) + 2620|0);
 HEAP8[$$index2635>>0] = 0;
 $$index2636 = ((($15)) + 2621|0);
 HEAP8[$$index2636>>0] = 0;
 $$index2637 = ((($15)) + 2622|0);
 HEAP8[$$index2637>>0] = 0;
 $$index2638 = ((($15)) + 2623|0);
 HEAP8[$$index2638>>0] = 0;
 $$index2639 = ((($15)) + 2624|0);
 HEAP8[$$index2639>>0] = 0;
 $$index2640 = ((($15)) + 2625|0);
 HEAP8[$$index2640>>0] = 0;
 $$index2641 = ((($15)) + 2626|0);
 HEAP8[$$index2641>>0] = 0;
 $$index2642 = ((($15)) + 2627|0);
 HEAP8[$$index2642>>0] = 0;
 $$index2643 = ((($15)) + 2628|0);
 HEAP8[$$index2643>>0] = 0;
 $$index2644 = ((($15)) + 2629|0);
 HEAP8[$$index2644>>0] = 0;
 $$index2645 = ((($15)) + 2630|0);
 HEAP8[$$index2645>>0] = 0;
 $$index2646 = ((($15)) + 2631|0);
 HEAP8[$$index2646>>0] = 0;
 $$index2647 = ((($15)) + 2632|0);
 HEAP8[$$index2647>>0] = 0;
 $$index2648 = ((($15)) + 2633|0);
 HEAP8[$$index2648>>0] = 0;
 $$index2649 = ((($15)) + 2634|0);
 HEAP8[$$index2649>>0] = 0;
 $$index2650 = ((($15)) + 2635|0);
 HEAP8[$$index2650>>0] = 0;
 $$index2651 = ((($15)) + 2636|0);
 HEAP8[$$index2651>>0] = 0;
 $$index2652 = ((($15)) + 2637|0);
 HEAP8[$$index2652>>0] = 0;
 $$index2653 = ((($15)) + 2638|0);
 HEAP8[$$index2653>>0] = 0;
 $$index2654 = ((($15)) + 2639|0);
 HEAP8[$$index2654>>0] = 0;
 $$index2655 = ((($15)) + 2640|0);
 HEAP8[$$index2655>>0] = 0;
 $$index2656 = ((($15)) + 2641|0);
 HEAP8[$$index2656>>0] = 0;
 $$index2657 = ((($15)) + 2642|0);
 HEAP8[$$index2657>>0] = 0;
 $$index2658 = ((($15)) + 2643|0);
 HEAP8[$$index2658>>0] = 0;
 $$index2659 = ((($15)) + 2644|0);
 HEAP8[$$index2659>>0] = 0;
 $$index2660 = ((($15)) + 2645|0);
 HEAP8[$$index2660>>0] = 0;
 $$index2661 = ((($15)) + 2646|0);
 HEAP8[$$index2661>>0] = 0;
 $$index2662 = ((($15)) + 2647|0);
 HEAP8[$$index2662>>0] = 0;
 $$index2663 = ((($15)) + 2648|0);
 HEAP8[$$index2663>>0] = 0;
 $$index2664 = ((($15)) + 2649|0);
 HEAP8[$$index2664>>0] = 0;
 $$index2665 = ((($15)) + 2650|0);
 HEAP8[$$index2665>>0] = 0;
 $$index2666 = ((($15)) + 2651|0);
 HEAP8[$$index2666>>0] = 0;
 $$index2667 = ((($15)) + 2652|0);
 HEAP8[$$index2667>>0] = 0;
 $$index2668 = ((($15)) + 2653|0);
 HEAP8[$$index2668>>0] = 0;
 $$index2669 = ((($15)) + 2654|0);
 HEAP8[$$index2669>>0] = 0;
 $$index2670 = ((($15)) + 2655|0);
 HEAP8[$$index2670>>0] = 0;
 $$index2671 = ((($15)) + 2656|0);
 HEAP8[$$index2671>>0] = 0;
 $$index2672 = ((($15)) + 2657|0);
 HEAP8[$$index2672>>0] = 0;
 $$index2673 = ((($15)) + 2658|0);
 HEAP8[$$index2673>>0] = 0;
 $$index2674 = ((($15)) + 2659|0);
 HEAP8[$$index2674>>0] = 0;
 $$index2675 = ((($15)) + 2660|0);
 HEAP8[$$index2675>>0] = 0;
 $$index2676 = ((($15)) + 2661|0);
 HEAP8[$$index2676>>0] = 0;
 $$index2677 = ((($15)) + 2662|0);
 HEAP8[$$index2677>>0] = 0;
 $$index2678 = ((($15)) + 2663|0);
 HEAP8[$$index2678>>0] = 0;
 $$index2679 = ((($15)) + 2664|0);
 HEAP8[$$index2679>>0] = 0;
 $$index2680 = ((($15)) + 2665|0);
 HEAP8[$$index2680>>0] = 0;
 $$index2681 = ((($15)) + 2666|0);
 HEAP8[$$index2681>>0] = 0;
 $$index2682 = ((($15)) + 2667|0);
 HEAP8[$$index2682>>0] = 0;
 $$index2683 = ((($15)) + 2668|0);
 HEAP8[$$index2683>>0] = 0;
 $$index2684 = ((($15)) + 2669|0);
 HEAP8[$$index2684>>0] = 0;
 $$index2685 = ((($15)) + 2670|0);
 HEAP8[$$index2685>>0] = 0;
 $$index2686 = ((($15)) + 2671|0);
 HEAP8[$$index2686>>0] = 0;
 $$index2687 = ((($15)) + 2672|0);
 HEAP8[$$index2687>>0] = 0;
 $$index2688 = ((($15)) + 2673|0);
 HEAP8[$$index2688>>0] = 0;
 $$index2689 = ((($15)) + 2674|0);
 HEAP8[$$index2689>>0] = 0;
 $$index2690 = ((($15)) + 2675|0);
 HEAP8[$$index2690>>0] = 0;
 $$index2691 = ((($15)) + 2676|0);
 HEAP8[$$index2691>>0] = 0;
 $$index2692 = ((($15)) + 2677|0);
 HEAP8[$$index2692>>0] = 0;
 $$index2693 = ((($15)) + 2678|0);
 HEAP8[$$index2693>>0] = 0;
 $$index2694 = ((($15)) + 2679|0);
 HEAP8[$$index2694>>0] = 0;
 $$index2695 = ((($15)) + 2680|0);
 HEAP8[$$index2695>>0] = 0;
 $$index2696 = ((($15)) + 2681|0);
 HEAP8[$$index2696>>0] = 0;
 $$index2697 = ((($15)) + 2682|0);
 HEAP8[$$index2697>>0] = 0;
 $$index2698 = ((($15)) + 2683|0);
 HEAP8[$$index2698>>0] = 0;
 $$index2699 = ((($15)) + 2684|0);
 HEAP8[$$index2699>>0] = 0;
 $$index2700 = ((($15)) + 2685|0);
 HEAP8[$$index2700>>0] = 0;
 $$index2701 = ((($15)) + 2686|0);
 HEAP8[$$index2701>>0] = 0;
 $$index2702 = ((($15)) + 2687|0);
 HEAP8[$$index2702>>0] = 0;
 $$index2703 = ((($15)) + 2688|0);
 HEAP8[$$index2703>>0] = 0;
 $$index2704 = ((($15)) + 2689|0);
 HEAP8[$$index2704>>0] = 0;
 $$index2705 = ((($15)) + 2690|0);
 HEAP8[$$index2705>>0] = 0;
 $$index2706 = ((($15)) + 2691|0);
 HEAP8[$$index2706>>0] = 0;
 $$index2707 = ((($15)) + 2692|0);
 HEAP8[$$index2707>>0] = 0;
 $$index2708 = ((($15)) + 2693|0);
 HEAP8[$$index2708>>0] = 0;
 $$index2709 = ((($15)) + 2694|0);
 HEAP8[$$index2709>>0] = 0;
 $$index2710 = ((($15)) + 2695|0);
 HEAP8[$$index2710>>0] = 0;
 $$index2711 = ((($15)) + 2696|0);
 HEAP8[$$index2711>>0] = 0;
 $$index2712 = ((($15)) + 2697|0);
 HEAP8[$$index2712>>0] = 0;
 $$index2713 = ((($15)) + 2698|0);
 HEAP8[$$index2713>>0] = 0;
 $$index2714 = ((($15)) + 2699|0);
 HEAP8[$$index2714>>0] = 0;
 $$index2715 = ((($15)) + 2700|0);
 HEAP8[$$index2715>>0] = 0;
 $$index2716 = ((($15)) + 2701|0);
 HEAP8[$$index2716>>0] = 0;
 $$index2717 = ((($15)) + 2702|0);
 HEAP8[$$index2717>>0] = 0;
 $$index2718 = ((($15)) + 2703|0);
 HEAP8[$$index2718>>0] = 0;
 $$index2719 = ((($15)) + 2704|0);
 HEAP8[$$index2719>>0] = 0;
 $$index2720 = ((($15)) + 2705|0);
 HEAP8[$$index2720>>0] = 0;
 $$index2721 = ((($15)) + 2706|0);
 HEAP8[$$index2721>>0] = 0;
 $$index2722 = ((($15)) + 2707|0);
 HEAP8[$$index2722>>0] = 0;
 $$index2723 = ((($15)) + 2708|0);
 HEAP8[$$index2723>>0] = 0;
 $$index2724 = ((($15)) + 2709|0);
 HEAP8[$$index2724>>0] = 0;
 $$index2725 = ((($15)) + 2710|0);
 HEAP8[$$index2725>>0] = 0;
 $$index2726 = ((($15)) + 2711|0);
 HEAP8[$$index2726>>0] = 0;
 $$index2727 = ((($15)) + 2712|0);
 HEAP8[$$index2727>>0] = 0;
 $$index2728 = ((($15)) + 2713|0);
 HEAP8[$$index2728>>0] = 0;
 $$index2729 = ((($15)) + 2714|0);
 HEAP8[$$index2729>>0] = 0;
 $$index2730 = ((($15)) + 2715|0);
 HEAP8[$$index2730>>0] = 0;
 $$index2731 = ((($15)) + 2716|0);
 HEAP8[$$index2731>>0] = 0;
 $$index2732 = ((($15)) + 2717|0);
 HEAP8[$$index2732>>0] = 0;
 $$index2733 = ((($15)) + 2718|0);
 HEAP8[$$index2733>>0] = 0;
 $$index2734 = ((($15)) + 2719|0);
 HEAP8[$$index2734>>0] = 0;
 $$index2735 = ((($15)) + 2720|0);
 HEAP8[$$index2735>>0] = 0;
 $$index2736 = ((($15)) + 2721|0);
 HEAP8[$$index2736>>0] = 0;
 $$index2737 = ((($15)) + 2722|0);
 HEAP8[$$index2737>>0] = 0;
 $$index2738 = ((($15)) + 2723|0);
 HEAP8[$$index2738>>0] = 0;
 $$index2739 = ((($15)) + 2724|0);
 HEAP8[$$index2739>>0] = 0;
 $$index2740 = ((($15)) + 2725|0);
 HEAP8[$$index2740>>0] = 0;
 $$index2741 = ((($15)) + 2726|0);
 HEAP8[$$index2741>>0] = 0;
 $$index2742 = ((($15)) + 2727|0);
 HEAP8[$$index2742>>0] = 0;
 $$index2743 = ((($15)) + 2728|0);
 HEAP8[$$index2743>>0] = 0;
 $$index2744 = ((($15)) + 2729|0);
 HEAP8[$$index2744>>0] = 0;
 $$index2745 = ((($15)) + 2730|0);
 HEAP8[$$index2745>>0] = 0;
 $$index2746 = ((($15)) + 2731|0);
 HEAP8[$$index2746>>0] = 0;
 $$index2747 = ((($15)) + 2732|0);
 HEAP8[$$index2747>>0] = 0;
 $$index2748 = ((($15)) + 2733|0);
 HEAP8[$$index2748>>0] = 0;
 $$index2749 = ((($15)) + 2734|0);
 HEAP8[$$index2749>>0] = 0;
 $$index2750 = ((($15)) + 2735|0);
 HEAP8[$$index2750>>0] = 0;
 $$index2751 = ((($15)) + 2736|0);
 HEAP8[$$index2751>>0] = 0;
 $$index2752 = ((($15)) + 2737|0);
 HEAP8[$$index2752>>0] = 0;
 $$index2753 = ((($15)) + 2738|0);
 HEAP8[$$index2753>>0] = 0;
 $$index2754 = ((($15)) + 2739|0);
 HEAP8[$$index2754>>0] = 0;
 $$index2755 = ((($15)) + 2740|0);
 HEAP8[$$index2755>>0] = 0;
 $$index2756 = ((($15)) + 2741|0);
 HEAP8[$$index2756>>0] = 0;
 $$index2757 = ((($15)) + 2742|0);
 HEAP8[$$index2757>>0] = 0;
 $$index2758 = ((($15)) + 2743|0);
 HEAP8[$$index2758>>0] = 0;
 $$index2759 = ((($15)) + 2744|0);
 HEAP8[$$index2759>>0] = 0;
 $$index2760 = ((($15)) + 2745|0);
 HEAP8[$$index2760>>0] = 0;
 $$index2761 = ((($15)) + 2746|0);
 HEAP8[$$index2761>>0] = 0;
 $$index2762 = ((($15)) + 2747|0);
 HEAP8[$$index2762>>0] = 0;
 $$index2763 = ((($15)) + 2748|0);
 HEAP8[$$index2763>>0] = 0;
 $$index2764 = ((($15)) + 2749|0);
 HEAP8[$$index2764>>0] = 0;
 $$index2765 = ((($15)) + 2750|0);
 HEAP8[$$index2765>>0] = 0;
 $$index2766 = ((($15)) + 2751|0);
 HEAP8[$$index2766>>0] = 0;
 $$index2767 = ((($15)) + 2752|0);
 HEAP8[$$index2767>>0] = 0;
 $$index2768 = ((($15)) + 2753|0);
 HEAP8[$$index2768>>0] = 0;
 $$index2769 = ((($15)) + 2754|0);
 HEAP8[$$index2769>>0] = 0;
 $$index2770 = ((($15)) + 2755|0);
 HEAP8[$$index2770>>0] = 0;
 $$index2771 = ((($15)) + 2756|0);
 HEAP8[$$index2771>>0] = 0;
 $$index2772 = ((($15)) + 2757|0);
 HEAP8[$$index2772>>0] = 0;
 $$index2773 = ((($15)) + 2758|0);
 HEAP8[$$index2773>>0] = 0;
 $$index2774 = ((($15)) + 2759|0);
 HEAP8[$$index2774>>0] = 0;
 $$index2775 = ((($15)) + 2760|0);
 HEAP8[$$index2775>>0] = 0;
 $$index2776 = ((($15)) + 2761|0);
 HEAP8[$$index2776>>0] = 0;
 $$index2777 = ((($15)) + 2762|0);
 HEAP8[$$index2777>>0] = 0;
 $$index2778 = ((($15)) + 2763|0);
 HEAP8[$$index2778>>0] = 0;
 $$index2779 = ((($15)) + 2764|0);
 HEAP8[$$index2779>>0] = 0;
 $$index2780 = ((($15)) + 2765|0);
 HEAP8[$$index2780>>0] = 0;
 $$index2781 = ((($15)) + 2766|0);
 HEAP8[$$index2781>>0] = 0;
 $$index2782 = ((($15)) + 2767|0);
 HEAP8[$$index2782>>0] = 0;
 $$index2783 = ((($15)) + 2768|0);
 HEAP8[$$index2783>>0] = 0;
 $$index2784 = ((($15)) + 2769|0);
 HEAP8[$$index2784>>0] = 0;
 $$index2785 = ((($15)) + 2770|0);
 HEAP8[$$index2785>>0] = 0;
 $$index2786 = ((($15)) + 2771|0);
 HEAP8[$$index2786>>0] = 0;
 $$index2787 = ((($15)) + 2772|0);
 HEAP8[$$index2787>>0] = 0;
 $$index2788 = ((($15)) + 2773|0);
 HEAP8[$$index2788>>0] = 0;
 $$index2789 = ((($15)) + 2774|0);
 HEAP8[$$index2789>>0] = 0;
 $$index2790 = ((($15)) + 2775|0);
 HEAP8[$$index2790>>0] = 0;
 $$index2791 = ((($15)) + 2776|0);
 HEAP8[$$index2791>>0] = 0;
 $$index2792 = ((($15)) + 2777|0);
 HEAP8[$$index2792>>0] = 0;
 $$index2793 = ((($15)) + 2778|0);
 HEAP8[$$index2793>>0] = 0;
 $$index2794 = ((($15)) + 2779|0);
 HEAP8[$$index2794>>0] = 0;
 $$index2795 = ((($15)) + 2780|0);
 HEAP8[$$index2795>>0] = 0;
 $$index2796 = ((($15)) + 2781|0);
 HEAP8[$$index2796>>0] = 0;
 $$index2797 = ((($15)) + 2782|0);
 HEAP8[$$index2797>>0] = 0;
 $$index2798 = ((($15)) + 2783|0);
 HEAP8[$$index2798>>0] = 0;
 $$index2799 = ((($15)) + 2784|0);
 HEAP8[$$index2799>>0] = 0;
 $$index2800 = ((($15)) + 2785|0);
 HEAP8[$$index2800>>0] = 0;
 $$index2801 = ((($15)) + 2786|0);
 HEAP8[$$index2801>>0] = 0;
 $$index2802 = ((($15)) + 2787|0);
 HEAP8[$$index2802>>0] = 0;
 $$index2803 = ((($15)) + 2788|0);
 HEAP8[$$index2803>>0] = 0;
 $$index2804 = ((($15)) + 2789|0);
 HEAP8[$$index2804>>0] = 0;
 $$index2805 = ((($15)) + 2790|0);
 HEAP8[$$index2805>>0] = 0;
 $$index2806 = ((($15)) + 2791|0);
 HEAP8[$$index2806>>0] = 0;
 $$index2807 = ((($15)) + 2792|0);
 HEAP8[$$index2807>>0] = 0;
 $$index2808 = ((($15)) + 2793|0);
 HEAP8[$$index2808>>0] = 0;
 $$index2809 = ((($15)) + 2794|0);
 HEAP8[$$index2809>>0] = 0;
 $$index2810 = ((($15)) + 2795|0);
 HEAP8[$$index2810>>0] = 0;
 $$index2811 = ((($15)) + 2796|0);
 HEAP8[$$index2811>>0] = 0;
 $$index2812 = ((($15)) + 2797|0);
 HEAP8[$$index2812>>0] = 0;
 $$index2813 = ((($15)) + 2798|0);
 HEAP8[$$index2813>>0] = 0;
 $$index2814 = ((($15)) + 2799|0);
 HEAP8[$$index2814>>0] = 0;
 $$index2815 = ((($15)) + 2800|0);
 HEAP8[$$index2815>>0] = 0;
 $$index2816 = ((($15)) + 2801|0);
 HEAP8[$$index2816>>0] = 0;
 $$index2817 = ((($15)) + 2802|0);
 HEAP8[$$index2817>>0] = 0;
 $$index2818 = ((($15)) + 2803|0);
 HEAP8[$$index2818>>0] = 0;
 $$index2819 = ((($15)) + 2804|0);
 HEAP8[$$index2819>>0] = 0;
 $$index2820 = ((($15)) + 2805|0);
 HEAP8[$$index2820>>0] = 0;
 $$index2821 = ((($15)) + 2806|0);
 HEAP8[$$index2821>>0] = 0;
 $$index2822 = ((($15)) + 2807|0);
 HEAP8[$$index2822>>0] = 0;
 $$index2823 = ((($15)) + 2808|0);
 HEAP8[$$index2823>>0] = 0;
 $$index2824 = ((($15)) + 2809|0);
 HEAP8[$$index2824>>0] = 0;
 $$index2825 = ((($15)) + 2810|0);
 HEAP8[$$index2825>>0] = 0;
 $$index2826 = ((($15)) + 2811|0);
 HEAP8[$$index2826>>0] = 0;
 $$index2827 = ((($15)) + 2812|0);
 HEAP8[$$index2827>>0] = 0;
 $$index2828 = ((($15)) + 2813|0);
 HEAP8[$$index2828>>0] = 0;
 $$index2829 = ((($15)) + 2814|0);
 HEAP8[$$index2829>>0] = 0;
 $$index2830 = ((($15)) + 2815|0);
 HEAP8[$$index2830>>0] = 0;
 $$index2831 = ((($15)) + 2816|0);
 HEAP8[$$index2831>>0] = 0;
 $$index2832 = ((($15)) + 2817|0);
 HEAP8[$$index2832>>0] = 0;
 $$index2833 = ((($15)) + 2818|0);
 HEAP8[$$index2833>>0] = 0;
 $$index2834 = ((($15)) + 2819|0);
 HEAP8[$$index2834>>0] = 0;
 $$index2835 = ((($15)) + 2820|0);
 HEAP8[$$index2835>>0] = 0;
 $$index2836 = ((($15)) + 2821|0);
 HEAP8[$$index2836>>0] = 0;
 $$index2837 = ((($15)) + 2822|0);
 HEAP8[$$index2837>>0] = 0;
 $$index2838 = ((($15)) + 2823|0);
 HEAP8[$$index2838>>0] = 0;
 $$index2839 = ((($15)) + 2824|0);
 HEAP8[$$index2839>>0] = 0;
 $$index2840 = ((($15)) + 2825|0);
 HEAP8[$$index2840>>0] = 0;
 $$index2841 = ((($15)) + 2826|0);
 HEAP8[$$index2841>>0] = 0;
 $$index2842 = ((($15)) + 2827|0);
 HEAP8[$$index2842>>0] = 0;
 $$index2843 = ((($15)) + 2828|0);
 HEAP8[$$index2843>>0] = 0;
 $$index2844 = ((($15)) + 2829|0);
 HEAP8[$$index2844>>0] = 0;
 $$index2845 = ((($15)) + 2830|0);
 HEAP8[$$index2845>>0] = 0;
 $$index2846 = ((($15)) + 2831|0);
 HEAP8[$$index2846>>0] = 0;
 $$index2847 = ((($15)) + 2832|0);
 HEAP8[$$index2847>>0] = 0;
 $$index2848 = ((($15)) + 2833|0);
 HEAP8[$$index2848>>0] = 0;
 $$index2849 = ((($15)) + 2834|0);
 HEAP8[$$index2849>>0] = 0;
 $$index2850 = ((($15)) + 2835|0);
 HEAP8[$$index2850>>0] = 0;
 $$index2851 = ((($15)) + 2836|0);
 HEAP8[$$index2851>>0] = 0;
 $$index2852 = ((($15)) + 2837|0);
 HEAP8[$$index2852>>0] = 0;
 $$index2853 = ((($15)) + 2838|0);
 HEAP8[$$index2853>>0] = 0;
 $$index2854 = ((($15)) + 2839|0);
 HEAP8[$$index2854>>0] = 0;
 $$index2855 = ((($15)) + 2840|0);
 HEAP8[$$index2855>>0] = 0;
 $$index2856 = ((($15)) + 2841|0);
 HEAP8[$$index2856>>0] = 0;
 $$index2857 = ((($15)) + 2842|0);
 HEAP8[$$index2857>>0] = 0;
 $$index2858 = ((($15)) + 2843|0);
 HEAP8[$$index2858>>0] = 0;
 $$index2859 = ((($15)) + 2844|0);
 HEAP8[$$index2859>>0] = 0;
 $$index2860 = ((($15)) + 2845|0);
 HEAP8[$$index2860>>0] = 0;
 $$index2861 = ((($15)) + 2846|0);
 HEAP8[$$index2861>>0] = 0;
 $$index2862 = ((($15)) + 2847|0);
 HEAP8[$$index2862>>0] = 0;
 $$index2863 = ((($15)) + 2848|0);
 HEAP8[$$index2863>>0] = 0;
 $$index2864 = ((($15)) + 2849|0);
 HEAP8[$$index2864>>0] = 0;
 $$index2865 = ((($15)) + 2850|0);
 HEAP8[$$index2865>>0] = 0;
 $$index2866 = ((($15)) + 2851|0);
 HEAP8[$$index2866>>0] = 0;
 $$index2867 = ((($15)) + 2852|0);
 HEAP8[$$index2867>>0] = 0;
 $$index2868 = ((($15)) + 2853|0);
 HEAP8[$$index2868>>0] = 0;
 $$index2869 = ((($15)) + 2854|0);
 HEAP8[$$index2869>>0] = 0;
 $$index2870 = ((($15)) + 2855|0);
 HEAP8[$$index2870>>0] = 0;
 $$index2871 = ((($15)) + 2856|0);
 HEAP8[$$index2871>>0] = 0;
 $$index2872 = ((($15)) + 2857|0);
 HEAP8[$$index2872>>0] = 0;
 $$index2873 = ((($15)) + 2858|0);
 HEAP8[$$index2873>>0] = 0;
 $$index2874 = ((($15)) + 2859|0);
 HEAP8[$$index2874>>0] = 0;
 $$index2875 = ((($15)) + 2860|0);
 HEAP8[$$index2875>>0] = 0;
 $$index2876 = ((($15)) + 2861|0);
 HEAP8[$$index2876>>0] = 0;
 $$index2877 = ((($15)) + 2862|0);
 HEAP8[$$index2877>>0] = 0;
 $$index2878 = ((($15)) + 2863|0);
 HEAP8[$$index2878>>0] = 0;
 $$index2879 = ((($15)) + 2864|0);
 HEAP8[$$index2879>>0] = 0;
 $$index2880 = ((($15)) + 2865|0);
 HEAP8[$$index2880>>0] = 0;
 $$index2881 = ((($15)) + 2866|0);
 HEAP8[$$index2881>>0] = 0;
 $$index2882 = ((($15)) + 2867|0);
 HEAP8[$$index2882>>0] = 0;
 $$index2883 = ((($15)) + 2868|0);
 HEAP8[$$index2883>>0] = 0;
 $$index2884 = ((($15)) + 2869|0);
 HEAP8[$$index2884>>0] = 0;
 $$index2885 = ((($15)) + 2870|0);
 HEAP8[$$index2885>>0] = 0;
 $$index2886 = ((($15)) + 2871|0);
 HEAP8[$$index2886>>0] = 0;
 $$index2887 = ((($15)) + 2872|0);
 HEAP8[$$index2887>>0] = 0;
 $$index2888 = ((($15)) + 2873|0);
 HEAP8[$$index2888>>0] = 0;
 $$index2889 = ((($15)) + 2874|0);
 HEAP8[$$index2889>>0] = 0;
 $$index2890 = ((($15)) + 2875|0);
 HEAP8[$$index2890>>0] = 0;
 $$index2891 = ((($15)) + 2876|0);
 HEAP8[$$index2891>>0] = 0;
 $$index2892 = ((($15)) + 2877|0);
 HEAP8[$$index2892>>0] = 0;
 $$index2893 = ((($15)) + 2878|0);
 HEAP8[$$index2893>>0] = 0;
 $$index2894 = ((($15)) + 2879|0);
 HEAP8[$$index2894>>0] = 0;
 $$index2895 = ((($15)) + 2880|0);
 HEAP8[$$index2895>>0] = 0;
 $$index2896 = ((($15)) + 2881|0);
 HEAP8[$$index2896>>0] = 0;
 $$index2897 = ((($15)) + 2882|0);
 HEAP8[$$index2897>>0] = 0;
 $$index2898 = ((($15)) + 2883|0);
 HEAP8[$$index2898>>0] = 0;
 $$index2899 = ((($15)) + 2884|0);
 HEAP8[$$index2899>>0] = 0;
 $$index2900 = ((($15)) + 2885|0);
 HEAP8[$$index2900>>0] = 0;
 $$index2901 = ((($15)) + 2886|0);
 HEAP8[$$index2901>>0] = 0;
 $$index2902 = ((($15)) + 2887|0);
 HEAP8[$$index2902>>0] = 0;
 $$index2903 = ((($15)) + 2888|0);
 HEAP8[$$index2903>>0] = 0;
 $$index2904 = ((($15)) + 2889|0);
 HEAP8[$$index2904>>0] = 0;
 $$index2905 = ((($15)) + 2890|0);
 HEAP8[$$index2905>>0] = 0;
 $$index2906 = ((($15)) + 2891|0);
 HEAP8[$$index2906>>0] = 0;
 $$index2907 = ((($15)) + 2892|0);
 HEAP8[$$index2907>>0] = 0;
 $$index2908 = ((($15)) + 2893|0);
 HEAP8[$$index2908>>0] = 0;
 $$index2909 = ((($15)) + 2894|0);
 HEAP8[$$index2909>>0] = 0;
 $$index2910 = ((($15)) + 2895|0);
 HEAP8[$$index2910>>0] = 0;
 $$index2911 = ((($15)) + 2896|0);
 HEAP8[$$index2911>>0] = 0;
 $$index2912 = ((($15)) + 2897|0);
 HEAP8[$$index2912>>0] = 0;
 $$index2913 = ((($15)) + 2898|0);
 HEAP8[$$index2913>>0] = 0;
 $$index2914 = ((($15)) + 2899|0);
 HEAP8[$$index2914>>0] = 0;
 $$index2915 = ((($15)) + 2900|0);
 HEAP8[$$index2915>>0] = 0;
 $$index2916 = ((($15)) + 2901|0);
 HEAP8[$$index2916>>0] = 0;
 $$index2917 = ((($15)) + 2902|0);
 HEAP8[$$index2917>>0] = 0;
 $$index2918 = ((($15)) + 2903|0);
 HEAP8[$$index2918>>0] = 0;
 $$index2919 = ((($15)) + 2904|0);
 HEAP8[$$index2919>>0] = 0;
 $$index2920 = ((($15)) + 2905|0);
 HEAP8[$$index2920>>0] = 0;
 $$index2921 = ((($15)) + 2906|0);
 HEAP8[$$index2921>>0] = 0;
 $$index2922 = ((($15)) + 2907|0);
 HEAP8[$$index2922>>0] = 0;
 $$index2923 = ((($15)) + 2908|0);
 HEAP8[$$index2923>>0] = 0;
 $$index2924 = ((($15)) + 2909|0);
 HEAP8[$$index2924>>0] = 0;
 $$index2925 = ((($15)) + 2910|0);
 HEAP8[$$index2925>>0] = 0;
 $$index2926 = ((($15)) + 2911|0);
 HEAP8[$$index2926>>0] = 0;
 $$index2927 = ((($15)) + 2912|0);
 HEAP8[$$index2927>>0] = 0;
 $$index2928 = ((($15)) + 2913|0);
 HEAP8[$$index2928>>0] = 0;
 $$index2929 = ((($15)) + 2914|0);
 HEAP8[$$index2929>>0] = 0;
 $$index2930 = ((($15)) + 2915|0);
 HEAP8[$$index2930>>0] = 0;
 $$index2931 = ((($15)) + 2916|0);
 HEAP8[$$index2931>>0] = 0;
 $$index2932 = ((($15)) + 2917|0);
 HEAP8[$$index2932>>0] = 0;
 $$index2933 = ((($15)) + 2918|0);
 HEAP8[$$index2933>>0] = 0;
 $$index2934 = ((($15)) + 2919|0);
 HEAP8[$$index2934>>0] = 0;
 $$index2935 = ((($15)) + 2920|0);
 HEAP8[$$index2935>>0] = 0;
 $$index2936 = ((($15)) + 2921|0);
 HEAP8[$$index2936>>0] = 0;
 $$index2937 = ((($15)) + 2922|0);
 HEAP8[$$index2937>>0] = 0;
 $$index2938 = ((($15)) + 2923|0);
 HEAP8[$$index2938>>0] = 0;
 $$index2939 = ((($15)) + 2924|0);
 HEAP8[$$index2939>>0] = 0;
 $$index2940 = ((($15)) + 2925|0);
 HEAP8[$$index2940>>0] = 0;
 $$index2941 = ((($15)) + 2926|0);
 HEAP8[$$index2941>>0] = 0;
 $$index2942 = ((($15)) + 2927|0);
 HEAP8[$$index2942>>0] = 0;
 $$index2943 = ((($15)) + 2928|0);
 HEAP8[$$index2943>>0] = 0;
 $$index2944 = ((($15)) + 2929|0);
 HEAP8[$$index2944>>0] = 0;
 $$index2945 = ((($15)) + 2930|0);
 HEAP8[$$index2945>>0] = 0;
 $$index2946 = ((($15)) + 2931|0);
 HEAP8[$$index2946>>0] = 0;
 $$index2947 = ((($15)) + 2932|0);
 HEAP8[$$index2947>>0] = 0;
 $$index2948 = ((($15)) + 2933|0);
 HEAP8[$$index2948>>0] = 0;
 $$index2949 = ((($15)) + 2934|0);
 HEAP8[$$index2949>>0] = 0;
 $$index2950 = ((($15)) + 2935|0);
 HEAP8[$$index2950>>0] = 0;
 $$index2951 = ((($15)) + 2936|0);
 HEAP8[$$index2951>>0] = 0;
 $$index2952 = ((($15)) + 2937|0);
 HEAP8[$$index2952>>0] = 0;
 $$index2953 = ((($15)) + 2938|0);
 HEAP8[$$index2953>>0] = 0;
 $$index2954 = ((($15)) + 2939|0);
 HEAP8[$$index2954>>0] = 0;
 $$index2955 = ((($15)) + 2940|0);
 HEAP8[$$index2955>>0] = 0;
 $$index2956 = ((($15)) + 2941|0);
 HEAP8[$$index2956>>0] = 0;
 $$index2957 = ((($15)) + 2942|0);
 HEAP8[$$index2957>>0] = 0;
 $$index2958 = ((($15)) + 2943|0);
 HEAP8[$$index2958>>0] = 0;
 $$index2959 = ((($15)) + 2944|0);
 HEAP8[$$index2959>>0] = 0;
 $$index2960 = ((($15)) + 2945|0);
 HEAP8[$$index2960>>0] = 0;
 $$index2961 = ((($15)) + 2946|0);
 HEAP8[$$index2961>>0] = 0;
 $$index2962 = ((($15)) + 2947|0);
 HEAP8[$$index2962>>0] = 0;
 $$index2963 = ((($15)) + 2948|0);
 HEAP8[$$index2963>>0] = 0;
 $$index2964 = ((($15)) + 2949|0);
 HEAP8[$$index2964>>0] = 0;
 $$index2965 = ((($15)) + 2950|0);
 HEAP8[$$index2965>>0] = 0;
 $$index2966 = ((($15)) + 2951|0);
 HEAP8[$$index2966>>0] = 0;
 $$index2967 = ((($15)) + 2952|0);
 HEAP8[$$index2967>>0] = 0;
 $$index2968 = ((($15)) + 2953|0);
 HEAP8[$$index2968>>0] = 0;
 $$index2969 = ((($15)) + 2954|0);
 HEAP8[$$index2969>>0] = 0;
 $$index2970 = ((($15)) + 2955|0);
 HEAP8[$$index2970>>0] = 0;
 $$index2971 = ((($15)) + 2956|0);
 HEAP8[$$index2971>>0] = 0;
 $$index2972 = ((($15)) + 2957|0);
 HEAP8[$$index2972>>0] = 0;
 $$index2973 = ((($15)) + 2958|0);
 HEAP8[$$index2973>>0] = 0;
 $$index2974 = ((($15)) + 2959|0);
 HEAP8[$$index2974>>0] = 0;
 $$index2975 = ((($15)) + 2960|0);
 HEAP8[$$index2975>>0] = 0;
 $$index2976 = ((($15)) + 2961|0);
 HEAP8[$$index2976>>0] = 0;
 $$index2977 = ((($15)) + 2962|0);
 HEAP8[$$index2977>>0] = 0;
 $$index2978 = ((($15)) + 2963|0);
 HEAP8[$$index2978>>0] = 0;
 $$index2979 = ((($15)) + 2964|0);
 HEAP8[$$index2979>>0] = 0;
 $$index2980 = ((($15)) + 2965|0);
 HEAP8[$$index2980>>0] = 0;
 $$index2981 = ((($15)) + 2966|0);
 HEAP8[$$index2981>>0] = 0;
 $$index2982 = ((($15)) + 2967|0);
 HEAP8[$$index2982>>0] = 0;
 $$index2983 = ((($15)) + 2968|0);
 HEAP8[$$index2983>>0] = 0;
 $$index2984 = ((($15)) + 2969|0);
 HEAP8[$$index2984>>0] = 0;
 $$index2985 = ((($15)) + 2970|0);
 HEAP8[$$index2985>>0] = 0;
 $$index2986 = ((($15)) + 2971|0);
 HEAP8[$$index2986>>0] = 0;
 $$index2987 = ((($15)) + 2972|0);
 HEAP8[$$index2987>>0] = 0;
 $$index2988 = ((($15)) + 2973|0);
 HEAP8[$$index2988>>0] = 0;
 $$index2989 = ((($15)) + 2974|0);
 HEAP8[$$index2989>>0] = 0;
 $$index2990 = ((($15)) + 2975|0);
 HEAP8[$$index2990>>0] = 0;
 $$index2991 = ((($15)) + 2976|0);
 HEAP8[$$index2991>>0] = 0;
 $$index2992 = ((($15)) + 2977|0);
 HEAP8[$$index2992>>0] = 0;
 $$index2993 = ((($15)) + 2978|0);
 HEAP8[$$index2993>>0] = 0;
 $$index2994 = ((($15)) + 2979|0);
 HEAP8[$$index2994>>0] = 0;
 $$index2995 = ((($15)) + 2980|0);
 HEAP8[$$index2995>>0] = 0;
 $$index2996 = ((($15)) + 2981|0);
 HEAP8[$$index2996>>0] = 0;
 $$index2997 = ((($15)) + 2982|0);
 HEAP8[$$index2997>>0] = 0;
 $$index2998 = ((($15)) + 2983|0);
 HEAP8[$$index2998>>0] = 0;
 $$index2999 = ((($15)) + 2984|0);
 HEAP8[$$index2999>>0] = 0;
 $$index3000 = ((($15)) + 2985|0);
 HEAP8[$$index3000>>0] = 0;
 $$index3001 = ((($15)) + 2986|0);
 HEAP8[$$index3001>>0] = 0;
 $$index3002 = ((($15)) + 2987|0);
 HEAP8[$$index3002>>0] = 0;
 $$index3003 = ((($15)) + 2988|0);
 HEAP8[$$index3003>>0] = 0;
 $$index3004 = ((($15)) + 2989|0);
 HEAP8[$$index3004>>0] = 0;
 $$index3005 = ((($15)) + 2990|0);
 HEAP8[$$index3005>>0] = 0;
 $$index3006 = ((($15)) + 2991|0);
 HEAP8[$$index3006>>0] = 0;
 $$index3007 = ((($15)) + 2992|0);
 HEAP8[$$index3007>>0] = 0;
 $$index3008 = ((($15)) + 2993|0);
 HEAP8[$$index3008>>0] = 0;
 $$index3009 = ((($15)) + 2994|0);
 HEAP8[$$index3009>>0] = 0;
 $$index3010 = ((($15)) + 2995|0);
 HEAP8[$$index3010>>0] = 0;
 $$index3011 = ((($15)) + 2996|0);
 HEAP8[$$index3011>>0] = 0;
 $$index3012 = ((($15)) + 2997|0);
 HEAP8[$$index3012>>0] = 0;
 $$index3013 = ((($15)) + 2998|0);
 HEAP8[$$index3013>>0] = 0;
 $$index3014 = ((($15)) + 2999|0);
 HEAP8[$$index3014>>0] = 0;
 $$index3015 = ((($15)) + 3000|0);
 HEAP8[$$index3015>>0] = 0;
 $$index3016 = ((($15)) + 3001|0);
 HEAP8[$$index3016>>0] = 0;
 $$index3017 = ((($15)) + 3002|0);
 HEAP8[$$index3017>>0] = 0;
 $$index3018 = ((($15)) + 3003|0);
 HEAP8[$$index3018>>0] = 0;
 $$index3019 = ((($15)) + 3004|0);
 HEAP8[$$index3019>>0] = 0;
 $$index3020 = ((($15)) + 3005|0);
 HEAP8[$$index3020>>0] = 0;
 $$index3021 = ((($15)) + 3006|0);
 HEAP8[$$index3021>>0] = 0;
 $$index3022 = ((($15)) + 3007|0);
 HEAP8[$$index3022>>0] = 0;
 $$index3023 = ((($15)) + 3008|0);
 HEAP8[$$index3023>>0] = 0;
 $$index3024 = ((($15)) + 3009|0);
 HEAP8[$$index3024>>0] = 0;
 $$index3025 = ((($15)) + 3010|0);
 HEAP8[$$index3025>>0] = 0;
 $$index3026 = ((($15)) + 3011|0);
 HEAP8[$$index3026>>0] = 0;
 $$index3027 = ((($15)) + 3012|0);
 HEAP8[$$index3027>>0] = 0;
 $$index3028 = ((($15)) + 3013|0);
 HEAP8[$$index3028>>0] = 0;
 $$index3029 = ((($15)) + 3014|0);
 HEAP8[$$index3029>>0] = 0;
 $$index3030 = ((($15)) + 3015|0);
 HEAP8[$$index3030>>0] = 0;
 $$index3031 = ((($15)) + 3016|0);
 HEAP8[$$index3031>>0] = 0;
 $$index3032 = ((($15)) + 3017|0);
 HEAP8[$$index3032>>0] = 0;
 $$index3033 = ((($15)) + 3018|0);
 HEAP8[$$index3033>>0] = 0;
 $$index3034 = ((($15)) + 3019|0);
 HEAP8[$$index3034>>0] = 0;
 $$index3035 = ((($15)) + 3020|0);
 HEAP8[$$index3035>>0] = 0;
 $$index3036 = ((($15)) + 3021|0);
 HEAP8[$$index3036>>0] = 0;
 $$index3037 = ((($15)) + 3022|0);
 HEAP8[$$index3037>>0] = 0;
 $$index3038 = ((($15)) + 3023|0);
 HEAP8[$$index3038>>0] = 0;
 $$index3039 = ((($15)) + 3024|0);
 HEAP8[$$index3039>>0] = 0;
 $$index3040 = ((($15)) + 3025|0);
 HEAP8[$$index3040>>0] = 0;
 $$index3041 = ((($15)) + 3026|0);
 HEAP8[$$index3041>>0] = 0;
 $$index3042 = ((($15)) + 3027|0);
 HEAP8[$$index3042>>0] = 0;
 $$index3043 = ((($15)) + 3028|0);
 HEAP8[$$index3043>>0] = 0;
 $$index3044 = ((($15)) + 3029|0);
 HEAP8[$$index3044>>0] = 0;
 $$index3045 = ((($15)) + 3030|0);
 HEAP8[$$index3045>>0] = 0;
 $$index3046 = ((($15)) + 3031|0);
 HEAP8[$$index3046>>0] = 0;
 $$index3047 = ((($15)) + 3032|0);
 HEAP8[$$index3047>>0] = 0;
 $$index3048 = ((($15)) + 3033|0);
 HEAP8[$$index3048>>0] = 0;
 $$index3049 = ((($15)) + 3034|0);
 HEAP8[$$index3049>>0] = 0;
 $$index3050 = ((($15)) + 3035|0);
 HEAP8[$$index3050>>0] = 0;
 $$index3051 = ((($15)) + 3036|0);
 HEAP8[$$index3051>>0] = 0;
 $$index3052 = ((($15)) + 3037|0);
 HEAP8[$$index3052>>0] = 0;
 $$index3053 = ((($15)) + 3038|0);
 HEAP8[$$index3053>>0] = 0;
 $$index3054 = ((($15)) + 3039|0);
 HEAP8[$$index3054>>0] = 0;
 $$index3055 = ((($15)) + 3040|0);
 HEAP8[$$index3055>>0] = 0;
 $$index3056 = ((($15)) + 3041|0);
 HEAP8[$$index3056>>0] = 0;
 $$index3057 = ((($15)) + 3042|0);
 HEAP8[$$index3057>>0] = 0;
 $$index3058 = ((($15)) + 3043|0);
 HEAP8[$$index3058>>0] = 0;
 $$index3059 = ((($15)) + 3044|0);
 HEAP8[$$index3059>>0] = 0;
 $$index3060 = ((($15)) + 3045|0);
 HEAP8[$$index3060>>0] = 0;
 $$index3061 = ((($15)) + 3046|0);
 HEAP8[$$index3061>>0] = 0;
 $$index3062 = ((($15)) + 3047|0);
 HEAP8[$$index3062>>0] = 0;
 $$index3063 = ((($15)) + 3048|0);
 HEAP8[$$index3063>>0] = 0;
 $$index3064 = ((($15)) + 3049|0);
 HEAP8[$$index3064>>0] = 0;
 $$index3065 = ((($15)) + 3050|0);
 HEAP8[$$index3065>>0] = 0;
 $$index3066 = ((($15)) + 3051|0);
 HEAP8[$$index3066>>0] = 0;
 $$index3067 = ((($15)) + 3052|0);
 HEAP8[$$index3067>>0] = 0;
 $$index3068 = ((($15)) + 3053|0);
 HEAP8[$$index3068>>0] = 0;
 $$index3069 = ((($15)) + 3054|0);
 HEAP8[$$index3069>>0] = 0;
 $$index3070 = ((($15)) + 3055|0);
 HEAP8[$$index3070>>0] = 0;
 $$index3071 = ((($15)) + 3056|0);
 HEAP8[$$index3071>>0] = 0;
 $$index3072 = ((($15)) + 3057|0);
 HEAP8[$$index3072>>0] = 0;
 $$index3073 = ((($15)) + 3058|0);
 HEAP8[$$index3073>>0] = 0;
 $$index3074 = ((($15)) + 3059|0);
 HEAP8[$$index3074>>0] = 0;
 $$index3075 = ((($15)) + 3060|0);
 HEAP8[$$index3075>>0] = 0;
 $$index3076 = ((($15)) + 3061|0);
 HEAP8[$$index3076>>0] = 0;
 $$index3077 = ((($15)) + 3062|0);
 HEAP8[$$index3077>>0] = 0;
 $$index3078 = ((($15)) + 3063|0);
 HEAP8[$$index3078>>0] = 0;
 $$index3079 = ((($15)) + 3064|0);
 HEAP8[$$index3079>>0] = 0;
 $$index3080 = ((($15)) + 3065|0);
 HEAP8[$$index3080>>0] = 0;
 $$index3081 = ((($15)) + 3066|0);
 HEAP8[$$index3081>>0] = 0;
 $$index3082 = ((($15)) + 3067|0);
 HEAP8[$$index3082>>0] = 0;
 $$index3083 = ((($15)) + 3068|0);
 HEAP8[$$index3083>>0] = 0;
 $$index3084 = ((($15)) + 3069|0);
 HEAP8[$$index3084>>0] = 0;
 $$index3085 = ((($15)) + 3070|0);
 HEAP8[$$index3085>>0] = 0;
 $$index3086 = ((($15)) + 3071|0);
 HEAP8[$$index3086>>0] = 0;
 $$index3087 = ((($15)) + 3072|0);
 HEAP8[$$index3087>>0] = 0;
 $$index3088 = ((($15)) + 3073|0);
 HEAP8[$$index3088>>0] = 0;
 $$index3089 = ((($15)) + 3074|0);
 HEAP8[$$index3089>>0] = 0;
 $$index3090 = ((($15)) + 3075|0);
 HEAP8[$$index3090>>0] = 0;
 $$index3091 = ((($15)) + 3076|0);
 HEAP8[$$index3091>>0] = 0;
 $$index3092 = ((($15)) + 3077|0);
 HEAP8[$$index3092>>0] = 0;
 $$index3093 = ((($15)) + 3078|0);
 HEAP8[$$index3093>>0] = 0;
 $$index3094 = ((($15)) + 3079|0);
 HEAP8[$$index3094>>0] = 0;
 $$index3095 = ((($15)) + 3080|0);
 HEAP8[$$index3095>>0] = 0;
 $$index3096 = ((($15)) + 3081|0);
 HEAP8[$$index3096>>0] = 0;
 $$index3097 = ((($15)) + 3082|0);
 HEAP8[$$index3097>>0] = 0;
 $$index3098 = ((($15)) + 3083|0);
 HEAP8[$$index3098>>0] = 0;
 $$index3099 = ((($15)) + 3084|0);
 HEAP8[$$index3099>>0] = 0;
 $$index3100 = ((($15)) + 3085|0);
 HEAP8[$$index3100>>0] = 0;
 $$index3101 = ((($15)) + 3086|0);
 HEAP8[$$index3101>>0] = 0;
 $$index3102 = ((($15)) + 3087|0);
 HEAP8[$$index3102>>0] = 0;
 $$index3103 = ((($15)) + 3088|0);
 HEAP8[$$index3103>>0] = 0;
 $$index3104 = ((($15)) + 3089|0);
 HEAP8[$$index3104>>0] = 0;
 $$index3105 = ((($15)) + 3090|0);
 HEAP8[$$index3105>>0] = 0;
 $$index3106 = ((($15)) + 3091|0);
 HEAP8[$$index3106>>0] = 0;
 $$index3107 = ((($15)) + 3092|0);
 HEAP8[$$index3107>>0] = 0;
 $$index3108 = ((($15)) + 3093|0);
 HEAP8[$$index3108>>0] = 0;
 $$index3109 = ((($15)) + 3094|0);
 HEAP8[$$index3109>>0] = 0;
 $$index3110 = ((($15)) + 3095|0);
 HEAP8[$$index3110>>0] = 0;
 $$index3111 = ((($15)) + 3096|0);
 HEAP8[$$index3111>>0] = 0;
 $$index3112 = ((($15)) + 3097|0);
 HEAP8[$$index3112>>0] = 0;
 $$index3113 = ((($15)) + 3098|0);
 HEAP8[$$index3113>>0] = 0;
 $$index3114 = ((($15)) + 3099|0);
 HEAP8[$$index3114>>0] = 0;
 $$index3115 = ((($15)) + 3100|0);
 HEAP8[$$index3115>>0] = 0;
 $$index3116 = ((($15)) + 3101|0);
 HEAP8[$$index3116>>0] = 0;
 $$index3117 = ((($15)) + 3102|0);
 HEAP8[$$index3117>>0] = 0;
 $$index3118 = ((($15)) + 3103|0);
 HEAP8[$$index3118>>0] = 0;
 $$index3119 = ((($15)) + 3104|0);
 HEAP8[$$index3119>>0] = 0;
 $$index3120 = ((($15)) + 3105|0);
 HEAP8[$$index3120>>0] = 0;
 $$index3121 = ((($15)) + 3106|0);
 HEAP8[$$index3121>>0] = 0;
 $$index3122 = ((($15)) + 3107|0);
 HEAP8[$$index3122>>0] = 0;
 $$index3123 = ((($15)) + 3108|0);
 HEAP8[$$index3123>>0] = 0;
 $$index3124 = ((($15)) + 3109|0);
 HEAP8[$$index3124>>0] = 0;
 $$index3125 = ((($15)) + 3110|0);
 HEAP8[$$index3125>>0] = 0;
 $$index3126 = ((($15)) + 3111|0);
 HEAP8[$$index3126>>0] = 0;
 $$index3127 = ((($15)) + 3112|0);
 HEAP8[$$index3127>>0] = 0;
 $$index3128 = ((($15)) + 3113|0);
 HEAP8[$$index3128>>0] = 0;
 $$index3129 = ((($15)) + 3114|0);
 HEAP8[$$index3129>>0] = 0;
 $$index3130 = ((($15)) + 3115|0);
 HEAP8[$$index3130>>0] = 0;
 $$index3131 = ((($15)) + 3116|0);
 HEAP8[$$index3131>>0] = 0;
 $$index3132 = ((($15)) + 3117|0);
 HEAP8[$$index3132>>0] = 0;
 $$index3133 = ((($15)) + 3118|0);
 HEAP8[$$index3133>>0] = 0;
 $$index3134 = ((($15)) + 3119|0);
 HEAP8[$$index3134>>0] = 0;
 $$index3135 = ((($15)) + 3120|0);
 HEAP8[$$index3135>>0] = 0;
 $$index3136 = ((($15)) + 3121|0);
 HEAP8[$$index3136>>0] = 0;
 $$index3137 = ((($15)) + 3122|0);
 HEAP8[$$index3137>>0] = 0;
 $$index3138 = ((($15)) + 3123|0);
 HEAP8[$$index3138>>0] = 0;
 $$index3139 = ((($15)) + 3124|0);
 HEAP8[$$index3139>>0] = 0;
 $$index3140 = ((($15)) + 3125|0);
 HEAP8[$$index3140>>0] = 0;
 $$index3141 = ((($15)) + 3126|0);
 HEAP8[$$index3141>>0] = 0;
 $$index3142 = ((($15)) + 3127|0);
 HEAP8[$$index3142>>0] = 0;
 $$index3143 = ((($15)) + 3128|0);
 HEAP8[$$index3143>>0] = 0;
 $$index3144 = ((($15)) + 3129|0);
 HEAP8[$$index3144>>0] = 0;
 $$index3145 = ((($15)) + 3130|0);
 HEAP8[$$index3145>>0] = 0;
 $$index3146 = ((($15)) + 3131|0);
 HEAP8[$$index3146>>0] = 0;
 $$index3147 = ((($15)) + 3132|0);
 HEAP8[$$index3147>>0] = 0;
 $$index3148 = ((($15)) + 3133|0);
 HEAP8[$$index3148>>0] = 0;
 $$index3149 = ((($15)) + 3134|0);
 HEAP8[$$index3149>>0] = 0;
 $$index3150 = ((($15)) + 3135|0);
 HEAP8[$$index3150>>0] = 0;
 $$index3151 = ((($15)) + 3136|0);
 HEAP8[$$index3151>>0] = 0;
 $$index3152 = ((($15)) + 3137|0);
 HEAP8[$$index3152>>0] = 0;
 $$index3153 = ((($15)) + 3138|0);
 HEAP8[$$index3153>>0] = 0;
 $$index3154 = ((($15)) + 3139|0);
 HEAP8[$$index3154>>0] = 0;
 $$index3155 = ((($15)) + 3140|0);
 HEAP8[$$index3155>>0] = 0;
 $$index3156 = ((($15)) + 3141|0);
 HEAP8[$$index3156>>0] = 0;
 $$index3157 = ((($15)) + 3142|0);
 HEAP8[$$index3157>>0] = 0;
 $$index3158 = ((($15)) + 3143|0);
 HEAP8[$$index3158>>0] = 0;
 $$index3159 = ((($15)) + 3144|0);
 HEAP8[$$index3159>>0] = 0;
 $$index3160 = ((($15)) + 3145|0);
 HEAP8[$$index3160>>0] = 0;
 $$index3161 = ((($15)) + 3146|0);
 HEAP8[$$index3161>>0] = 0;
 $$index3162 = ((($15)) + 3147|0);
 HEAP8[$$index3162>>0] = 0;
 $$index3163 = ((($15)) + 3148|0);
 HEAP8[$$index3163>>0] = 0;
 $$index3164 = ((($15)) + 3149|0);
 HEAP8[$$index3164>>0] = 0;
 $$index3165 = ((($15)) + 3150|0);
 HEAP8[$$index3165>>0] = 0;
 $$index3166 = ((($15)) + 3151|0);
 HEAP8[$$index3166>>0] = 0;
 $$index3167 = ((($15)) + 3152|0);
 HEAP8[$$index3167>>0] = 0;
 $$index3168 = ((($15)) + 3153|0);
 HEAP8[$$index3168>>0] = 0;
 $$index3169 = ((($15)) + 3154|0);
 HEAP8[$$index3169>>0] = 0;
 $$index3170 = ((($15)) + 3155|0);
 HEAP8[$$index3170>>0] = 0;
 $$index3171 = ((($15)) + 3156|0);
 HEAP8[$$index3171>>0] = 0;
 $$index3172 = ((($15)) + 3157|0);
 HEAP8[$$index3172>>0] = 0;
 $$index3173 = ((($15)) + 3158|0);
 HEAP8[$$index3173>>0] = 0;
 $$index3174 = ((($15)) + 3159|0);
 HEAP8[$$index3174>>0] = 0;
 $$index3175 = ((($15)) + 3160|0);
 HEAP8[$$index3175>>0] = 0;
 $$index3176 = ((($15)) + 3161|0);
 HEAP8[$$index3176>>0] = 0;
 $$index3177 = ((($15)) + 3162|0);
 HEAP8[$$index3177>>0] = 0;
 $$index3178 = ((($15)) + 3163|0);
 HEAP8[$$index3178>>0] = 0;
 $$index3179 = ((($15)) + 3164|0);
 HEAP8[$$index3179>>0] = 0;
 $$index3180 = ((($15)) + 3165|0);
 HEAP8[$$index3180>>0] = 0;
 $$index3181 = ((($15)) + 3166|0);
 HEAP8[$$index3181>>0] = 0;
 $$index3182 = ((($15)) + 3167|0);
 HEAP8[$$index3182>>0] = 0;
 $$index3183 = ((($15)) + 3168|0);
 HEAP8[$$index3183>>0] = 0;
 $$index3184 = ((($15)) + 3169|0);
 HEAP8[$$index3184>>0] = 0;
 $$index3185 = ((($15)) + 3170|0);
 HEAP8[$$index3185>>0] = 0;
 $$index3186 = ((($15)) + 3171|0);
 HEAP8[$$index3186>>0] = 0;
 $$index3187 = ((($15)) + 3172|0);
 HEAP8[$$index3187>>0] = 0;
 $$index3188 = ((($15)) + 3173|0);
 HEAP8[$$index3188>>0] = 0;
 $$index3189 = ((($15)) + 3174|0);
 HEAP8[$$index3189>>0] = 0;
 $$index3190 = ((($15)) + 3175|0);
 HEAP8[$$index3190>>0] = 0;
 $$index3191 = ((($15)) + 3176|0);
 HEAP8[$$index3191>>0] = 0;
 $$index3192 = ((($15)) + 3177|0);
 HEAP8[$$index3192>>0] = 0;
 $$index3193 = ((($15)) + 3178|0);
 HEAP8[$$index3193>>0] = 0;
 $$index3194 = ((($15)) + 3179|0);
 HEAP8[$$index3194>>0] = 0;
 $$index3195 = ((($15)) + 3180|0);
 HEAP8[$$index3195>>0] = 0;
 $$index3196 = ((($15)) + 3181|0);
 HEAP8[$$index3196>>0] = 0;
 $$index3197 = ((($15)) + 3182|0);
 HEAP8[$$index3197>>0] = 0;
 $$index3198 = ((($15)) + 3183|0);
 HEAP8[$$index3198>>0] = 0;
 $$index3199 = ((($15)) + 3184|0);
 HEAP8[$$index3199>>0] = 0;
 $$index3200 = ((($15)) + 3185|0);
 HEAP8[$$index3200>>0] = 0;
 $$index3201 = ((($15)) + 3186|0);
 HEAP8[$$index3201>>0] = 0;
 $$index3202 = ((($15)) + 3187|0);
 HEAP8[$$index3202>>0] = 0;
 $$index3203 = ((($15)) + 3188|0);
 HEAP8[$$index3203>>0] = 0;
 $$index3204 = ((($15)) + 3189|0);
 HEAP8[$$index3204>>0] = 0;
 $$index3205 = ((($15)) + 3190|0);
 HEAP8[$$index3205>>0] = 0;
 $$index3206 = ((($15)) + 3191|0);
 HEAP8[$$index3206>>0] = 0;
 $$index3207 = ((($15)) + 3192|0);
 HEAP8[$$index3207>>0] = 0;
 $$index3208 = ((($15)) + 3193|0);
 HEAP8[$$index3208>>0] = 0;
 $$index3209 = ((($15)) + 3194|0);
 HEAP8[$$index3209>>0] = 0;
 $$index3210 = ((($15)) + 3195|0);
 HEAP8[$$index3210>>0] = 0;
 $$index3211 = ((($15)) + 3196|0);
 HEAP8[$$index3211>>0] = 0;
 $$index3212 = ((($15)) + 3197|0);
 HEAP8[$$index3212>>0] = 0;
 $$index3213 = ((($15)) + 3198|0);
 HEAP8[$$index3213>>0] = 0;
 $$index3214 = ((($15)) + 3199|0);
 HEAP8[$$index3214>>0] = 0;
 $$index3215 = ((($15)) + 3200|0);
 HEAP8[$$index3215>>0] = 0;
 $$index3216 = ((($15)) + 3201|0);
 HEAP8[$$index3216>>0] = 0;
 $$index3217 = ((($15)) + 3202|0);
 HEAP8[$$index3217>>0] = 0;
 $$index3218 = ((($15)) + 3203|0);
 HEAP8[$$index3218>>0] = 0;
 $$index3219 = ((($15)) + 3204|0);
 HEAP8[$$index3219>>0] = 0;
 $$index3220 = ((($15)) + 3205|0);
 HEAP8[$$index3220>>0] = 0;
 $$index3221 = ((($15)) + 3206|0);
 HEAP8[$$index3221>>0] = 0;
 $$index3222 = ((($15)) + 3207|0);
 HEAP8[$$index3222>>0] = 0;
 $$index3223 = ((($15)) + 3208|0);
 HEAP8[$$index3223>>0] = 0;
 $$index3224 = ((($15)) + 3209|0);
 HEAP8[$$index3224>>0] = 0;
 $$index3225 = ((($15)) + 3210|0);
 HEAP8[$$index3225>>0] = 0;
 $$index3226 = ((($15)) + 3211|0);
 HEAP8[$$index3226>>0] = 0;
 $$index3227 = ((($15)) + 3212|0);
 HEAP8[$$index3227>>0] = 0;
 $$index3228 = ((($15)) + 3213|0);
 HEAP8[$$index3228>>0] = 0;
 $$index3229 = ((($15)) + 3214|0);
 HEAP8[$$index3229>>0] = 0;
 $$index3230 = ((($15)) + 3215|0);
 HEAP8[$$index3230>>0] = 0;
 $$index3231 = ((($15)) + 3216|0);
 HEAP8[$$index3231>>0] = 0;
 $$index3232 = ((($15)) + 3217|0);
 HEAP8[$$index3232>>0] = 0;
 $$index3233 = ((($15)) + 3218|0);
 HEAP8[$$index3233>>0] = 0;
 $$index3234 = ((($15)) + 3219|0);
 HEAP8[$$index3234>>0] = 0;
 $$index3235 = ((($15)) + 3220|0);
 HEAP8[$$index3235>>0] = 0;
 $$index3236 = ((($15)) + 3221|0);
 HEAP8[$$index3236>>0] = 0;
 $$index3237 = ((($15)) + 3222|0);
 HEAP8[$$index3237>>0] = 0;
 $$index3238 = ((($15)) + 3223|0);
 HEAP8[$$index3238>>0] = 0;
 $$index3239 = ((($15)) + 3224|0);
 HEAP8[$$index3239>>0] = 0;
 $$index3240 = ((($15)) + 3225|0);
 HEAP8[$$index3240>>0] = 0;
 $$index3241 = ((($15)) + 3226|0);
 HEAP8[$$index3241>>0] = 0;
 $$index3242 = ((($15)) + 3227|0);
 HEAP8[$$index3242>>0] = 0;
 $$index3243 = ((($15)) + 3228|0);
 HEAP8[$$index3243>>0] = 0;
 $$index3244 = ((($15)) + 3229|0);
 HEAP8[$$index3244>>0] = 0;
 $$index3245 = ((($15)) + 3230|0);
 HEAP8[$$index3245>>0] = 0;
 $$index3246 = ((($15)) + 3231|0);
 HEAP8[$$index3246>>0] = 0;
 $$index3247 = ((($15)) + 3232|0);
 HEAP8[$$index3247>>0] = 0;
 $$index3248 = ((($15)) + 3233|0);
 HEAP8[$$index3248>>0] = 0;
 $$index3249 = ((($15)) + 3234|0);
 HEAP8[$$index3249>>0] = 0;
 $$index3250 = ((($15)) + 3235|0);
 HEAP8[$$index3250>>0] = 0;
 $$index3251 = ((($15)) + 3236|0);
 HEAP8[$$index3251>>0] = 0;
 $$index3252 = ((($15)) + 3237|0);
 HEAP8[$$index3252>>0] = 0;
 $$index3253 = ((($15)) + 3238|0);
 HEAP8[$$index3253>>0] = 0;
 $$index3254 = ((($15)) + 3239|0);
 HEAP8[$$index3254>>0] = 0;
 $$index3255 = ((($15)) + 3240|0);
 HEAP8[$$index3255>>0] = 0;
 $$index3256 = ((($15)) + 3241|0);
 HEAP8[$$index3256>>0] = 0;
 $$index3257 = ((($15)) + 3242|0);
 HEAP8[$$index3257>>0] = 0;
 $$index3258 = ((($15)) + 3243|0);
 HEAP8[$$index3258>>0] = 0;
 $$index3259 = ((($15)) + 3244|0);
 HEAP8[$$index3259>>0] = 0;
 $$index3260 = ((($15)) + 3245|0);
 HEAP8[$$index3260>>0] = 0;
 $$index3261 = ((($15)) + 3246|0);
 HEAP8[$$index3261>>0] = 0;
 $$index3262 = ((($15)) + 3247|0);
 HEAP8[$$index3262>>0] = 0;
 $$index3263 = ((($15)) + 3248|0);
 HEAP8[$$index3263>>0] = 0;
 $$index3264 = ((($15)) + 3249|0);
 HEAP8[$$index3264>>0] = 0;
 $$index3265 = ((($15)) + 3250|0);
 HEAP8[$$index3265>>0] = 0;
 $$index3266 = ((($15)) + 3251|0);
 HEAP8[$$index3266>>0] = 0;
 $$index3267 = ((($15)) + 3252|0);
 HEAP8[$$index3267>>0] = 0;
 $$index3268 = ((($15)) + 3253|0);
 HEAP8[$$index3268>>0] = 0;
 $$index3269 = ((($15)) + 3254|0);
 HEAP8[$$index3269>>0] = 0;
 $$index3270 = ((($15)) + 3255|0);
 HEAP8[$$index3270>>0] = 0;
 $$index3271 = ((($15)) + 3256|0);
 HEAP8[$$index3271>>0] = 0;
 $$index3272 = ((($15)) + 3257|0);
 HEAP8[$$index3272>>0] = 0;
 $$index3273 = ((($15)) + 3258|0);
 HEAP8[$$index3273>>0] = 0;
 $$index3274 = ((($15)) + 3259|0);
 HEAP8[$$index3274>>0] = 0;
 $$index3275 = ((($15)) + 3260|0);
 HEAP8[$$index3275>>0] = 0;
 $$index3276 = ((($15)) + 3261|0);
 HEAP8[$$index3276>>0] = 0;
 $$index3277 = ((($15)) + 3262|0);
 HEAP8[$$index3277>>0] = 0;
 $$index3278 = ((($15)) + 3263|0);
 HEAP8[$$index3278>>0] = 0;
 $$index3279 = ((($15)) + 3264|0);
 HEAP8[$$index3279>>0] = 0;
 $$index3280 = ((($15)) + 3265|0);
 HEAP8[$$index3280>>0] = 0;
 $$index3281 = ((($15)) + 3266|0);
 HEAP8[$$index3281>>0] = 0;
 $$index3282 = ((($15)) + 3267|0);
 HEAP8[$$index3282>>0] = 0;
 $$index3283 = ((($15)) + 3268|0);
 HEAP8[$$index3283>>0] = 0;
 $$index3284 = ((($15)) + 3269|0);
 HEAP8[$$index3284>>0] = 0;
 $$index3285 = ((($15)) + 3270|0);
 HEAP8[$$index3285>>0] = 0;
 $$index3286 = ((($15)) + 3271|0);
 HEAP8[$$index3286>>0] = 0;
 $$index3287 = ((($15)) + 3272|0);
 HEAP8[$$index3287>>0] = 0;
 $$index3288 = ((($15)) + 3273|0);
 HEAP8[$$index3288>>0] = 0;
 $$index3289 = ((($15)) + 3274|0);
 HEAP8[$$index3289>>0] = 0;
 $$index3290 = ((($15)) + 3275|0);
 HEAP8[$$index3290>>0] = 0;
 $$index3291 = ((($15)) + 3276|0);
 HEAP8[$$index3291>>0] = 0;
 $$index3292 = ((($15)) + 3277|0);
 HEAP8[$$index3292>>0] = 0;
 $$index3293 = ((($15)) + 3278|0);
 HEAP8[$$index3293>>0] = 0;
 $$index3294 = ((($15)) + 3279|0);
 HEAP8[$$index3294>>0] = 0;
 $$index3295 = ((($15)) + 3280|0);
 HEAP8[$$index3295>>0] = 0;
 $$index3296 = ((($15)) + 3281|0);
 HEAP8[$$index3296>>0] = 0;
 $$index3297 = ((($15)) + 3282|0);
 HEAP8[$$index3297>>0] = 0;
 $$index3298 = ((($15)) + 3283|0);
 HEAP8[$$index3298>>0] = 0;
 $$index3299 = ((($15)) + 3284|0);
 HEAP8[$$index3299>>0] = 0;
 $$index3300 = ((($15)) + 3285|0);
 HEAP8[$$index3300>>0] = 0;
 $$index3301 = ((($15)) + 3286|0);
 HEAP8[$$index3301>>0] = 0;
 $$index3302 = ((($15)) + 3287|0);
 HEAP8[$$index3302>>0] = 0;
 $$index3303 = ((($15)) + 3288|0);
 HEAP8[$$index3303>>0] = 0;
 $$index3304 = ((($15)) + 3289|0);
 HEAP8[$$index3304>>0] = 0;
 $$index3305 = ((($15)) + 3290|0);
 HEAP8[$$index3305>>0] = 0;
 $$index3306 = ((($15)) + 3291|0);
 HEAP8[$$index3306>>0] = 0;
 $$index3307 = ((($15)) + 3292|0);
 HEAP8[$$index3307>>0] = 0;
 $$index3308 = ((($15)) + 3293|0);
 HEAP8[$$index3308>>0] = 0;
 $$index3309 = ((($15)) + 3294|0);
 HEAP8[$$index3309>>0] = 0;
 $$index3310 = ((($15)) + 3295|0);
 HEAP8[$$index3310>>0] = 0;
 $$index3311 = ((($15)) + 3296|0);
 HEAP8[$$index3311>>0] = 0;
 $$index3312 = ((($15)) + 3297|0);
 HEAP8[$$index3312>>0] = 0;
 $$index3313 = ((($15)) + 3298|0);
 HEAP8[$$index3313>>0] = 0;
 $$index3314 = ((($15)) + 3299|0);
 HEAP8[$$index3314>>0] = 0;
 $$index3315 = ((($15)) + 3300|0);
 HEAP8[$$index3315>>0] = 0;
 $$index3316 = ((($15)) + 3301|0);
 HEAP8[$$index3316>>0] = 0;
 $$index3317 = ((($15)) + 3302|0);
 HEAP8[$$index3317>>0] = 0;
 $$index3318 = ((($15)) + 3303|0);
 HEAP8[$$index3318>>0] = 0;
 $$index3319 = ((($15)) + 3304|0);
 HEAP8[$$index3319>>0] = 0;
 $$index3320 = ((($15)) + 3305|0);
 HEAP8[$$index3320>>0] = 0;
 $$index3321 = ((($15)) + 3306|0);
 HEAP8[$$index3321>>0] = 0;
 $$index3322 = ((($15)) + 3307|0);
 HEAP8[$$index3322>>0] = 0;
 $$index3323 = ((($15)) + 3308|0);
 HEAP8[$$index3323>>0] = 0;
 $$index3324 = ((($15)) + 3309|0);
 HEAP8[$$index3324>>0] = 0;
 $$index3325 = ((($15)) + 3310|0);
 HEAP8[$$index3325>>0] = 0;
 $$index3326 = ((($15)) + 3311|0);
 HEAP8[$$index3326>>0] = 0;
 $$index3327 = ((($15)) + 3312|0);
 HEAP8[$$index3327>>0] = 0;
 $$index3328 = ((($15)) + 3313|0);
 HEAP8[$$index3328>>0] = 0;
 $$index3329 = ((($15)) + 3314|0);
 HEAP8[$$index3329>>0] = 0;
 $$index3330 = ((($15)) + 3315|0);
 HEAP8[$$index3330>>0] = 0;
 $$index3331 = ((($15)) + 3316|0);
 HEAP8[$$index3331>>0] = 0;
 $$index3332 = ((($15)) + 3317|0);
 HEAP8[$$index3332>>0] = 0;
 $$index3333 = ((($15)) + 3318|0);
 HEAP8[$$index3333>>0] = 0;
 $$index3334 = ((($15)) + 3319|0);
 HEAP8[$$index3334>>0] = 0;
 $$index3335 = ((($15)) + 3320|0);
 HEAP8[$$index3335>>0] = 0;
 $$index3336 = ((($15)) + 3321|0);
 HEAP8[$$index3336>>0] = 0;
 $$index3337 = ((($15)) + 3322|0);
 HEAP8[$$index3337>>0] = 0;
 $$index3338 = ((($15)) + 3323|0);
 HEAP8[$$index3338>>0] = 0;
 $$index3339 = ((($15)) + 3324|0);
 HEAP8[$$index3339>>0] = 0;
 $$index3340 = ((($15)) + 3325|0);
 HEAP8[$$index3340>>0] = 0;
 $$index3341 = ((($15)) + 3326|0);
 HEAP8[$$index3341>>0] = 0;
 $$index3342 = ((($15)) + 3327|0);
 HEAP8[$$index3342>>0] = 0;
 $$index3343 = ((($15)) + 3328|0);
 HEAP8[$$index3343>>0] = 0;
 $$index3344 = ((($15)) + 3329|0);
 HEAP8[$$index3344>>0] = 0;
 $$index3345 = ((($15)) + 3330|0);
 HEAP8[$$index3345>>0] = 0;
 $$index3346 = ((($15)) + 3331|0);
 HEAP8[$$index3346>>0] = 0;
 $$index3347 = ((($15)) + 3332|0);
 HEAP8[$$index3347>>0] = 0;
 $$index3348 = ((($15)) + 3333|0);
 HEAP8[$$index3348>>0] = 0;
 $$index3349 = ((($15)) + 3334|0);
 HEAP8[$$index3349>>0] = 0;
 $$index3350 = ((($15)) + 3335|0);
 HEAP8[$$index3350>>0] = 0;
 $$index3351 = ((($15)) + 3336|0);
 HEAP8[$$index3351>>0] = 0;
 $$index3352 = ((($15)) + 3337|0);
 HEAP8[$$index3352>>0] = 0;
 $$index3353 = ((($15)) + 3338|0);
 HEAP8[$$index3353>>0] = 0;
 $$index3354 = ((($15)) + 3339|0);
 HEAP8[$$index3354>>0] = 0;
 $$index3355 = ((($15)) + 3340|0);
 HEAP8[$$index3355>>0] = 0;
 $$index3356 = ((($15)) + 3341|0);
 HEAP8[$$index3356>>0] = 0;
 $$index3357 = ((($15)) + 3342|0);
 HEAP8[$$index3357>>0] = 0;
 $$index3358 = ((($15)) + 3343|0);
 HEAP8[$$index3358>>0] = 0;
 $$index3359 = ((($15)) + 3344|0);
 HEAP8[$$index3359>>0] = 0;
 $$index3360 = ((($15)) + 3345|0);
 HEAP8[$$index3360>>0] = 0;
 $$index3361 = ((($15)) + 3346|0);
 HEAP8[$$index3361>>0] = 0;
 $$index3362 = ((($15)) + 3347|0);
 HEAP8[$$index3362>>0] = 0;
 $$index3363 = ((($15)) + 3348|0);
 HEAP8[$$index3363>>0] = 0;
 $$index3364 = ((($15)) + 3349|0);
 HEAP8[$$index3364>>0] = 0;
 $$index3365 = ((($15)) + 3350|0);
 HEAP8[$$index3365>>0] = 0;
 $$index3366 = ((($15)) + 3351|0);
 HEAP8[$$index3366>>0] = 0;
 $$index3367 = ((($15)) + 3352|0);
 HEAP8[$$index3367>>0] = 0;
 $$index3368 = ((($15)) + 3353|0);
 HEAP8[$$index3368>>0] = 0;
 $$index3369 = ((($15)) + 3354|0);
 HEAP8[$$index3369>>0] = 0;
 $$index3370 = ((($15)) + 3355|0);
 HEAP8[$$index3370>>0] = 0;
 $$index3371 = ((($15)) + 3356|0);
 HEAP8[$$index3371>>0] = 0;
 $$index3372 = ((($15)) + 3357|0);
 HEAP8[$$index3372>>0] = 0;
 $$index3373 = ((($15)) + 3358|0);
 HEAP8[$$index3373>>0] = 0;
 $$index3374 = ((($15)) + 3359|0);
 HEAP8[$$index3374>>0] = 0;
 $$index3375 = ((($15)) + 3360|0);
 HEAP8[$$index3375>>0] = 0;
 $$index3376 = ((($15)) + 3361|0);
 HEAP8[$$index3376>>0] = 0;
 $$index3377 = ((($15)) + 3362|0);
 HEAP8[$$index3377>>0] = 0;
 $$index3378 = ((($15)) + 3363|0);
 HEAP8[$$index3378>>0] = 0;
 $$index3379 = ((($15)) + 3364|0);
 HEAP8[$$index3379>>0] = 0;
 $$index3380 = ((($15)) + 3365|0);
 HEAP8[$$index3380>>0] = 0;
 $$index3381 = ((($15)) + 3366|0);
 HEAP8[$$index3381>>0] = 0;
 $$index3382 = ((($15)) + 3367|0);
 HEAP8[$$index3382>>0] = 0;
 $$index3383 = ((($15)) + 3368|0);
 HEAP8[$$index3383>>0] = 0;
 $$index3384 = ((($15)) + 3369|0);
 HEAP8[$$index3384>>0] = 0;
 $$index3385 = ((($15)) + 3370|0);
 HEAP8[$$index3385>>0] = 0;
 $$index3386 = ((($15)) + 3371|0);
 HEAP8[$$index3386>>0] = 0;
 $$index3387 = ((($15)) + 3372|0);
 HEAP8[$$index3387>>0] = 0;
 $$index3388 = ((($15)) + 3373|0);
 HEAP8[$$index3388>>0] = 0;
 $$index3389 = ((($15)) + 3374|0);
 HEAP8[$$index3389>>0] = 0;
 $$index3390 = ((($15)) + 3375|0);
 HEAP8[$$index3390>>0] = 0;
 $$index3391 = ((($15)) + 3376|0);
 HEAP8[$$index3391>>0] = 0;
 $$index3392 = ((($15)) + 3377|0);
 HEAP8[$$index3392>>0] = 0;
 $$index3393 = ((($15)) + 3378|0);
 HEAP8[$$index3393>>0] = 0;
 $$index3394 = ((($15)) + 3379|0);
 HEAP8[$$index3394>>0] = 0;
 $$index3395 = ((($15)) + 3380|0);
 HEAP8[$$index3395>>0] = 0;
 $$index3396 = ((($15)) + 3381|0);
 HEAP8[$$index3396>>0] = 0;
 $$index3397 = ((($15)) + 3382|0);
 HEAP8[$$index3397>>0] = 0;
 $$index3398 = ((($15)) + 3383|0);
 HEAP8[$$index3398>>0] = 0;
 $$index3399 = ((($15)) + 3384|0);
 HEAP8[$$index3399>>0] = 0;
 $$index3400 = ((($15)) + 3385|0);
 HEAP8[$$index3400>>0] = 0;
 $$index3401 = ((($15)) + 3386|0);
 HEAP8[$$index3401>>0] = 0;
 $$index3402 = ((($15)) + 3387|0);
 HEAP8[$$index3402>>0] = 0;
 $$index3403 = ((($15)) + 3388|0);
 HEAP8[$$index3403>>0] = 0;
 $$index3404 = ((($15)) + 3389|0);
 HEAP8[$$index3404>>0] = 0;
 $$index3405 = ((($15)) + 3390|0);
 HEAP8[$$index3405>>0] = 0;
 $$index3406 = ((($15)) + 3391|0);
 HEAP8[$$index3406>>0] = 0;
 $$index3407 = ((($15)) + 3392|0);
 HEAP8[$$index3407>>0] = 0;
 $$index3408 = ((($15)) + 3393|0);
 HEAP8[$$index3408>>0] = 0;
 $$index3409 = ((($15)) + 3394|0);
 HEAP8[$$index3409>>0] = 0;
 $$index3410 = ((($15)) + 3395|0);
 HEAP8[$$index3410>>0] = 0;
 $$index3411 = ((($15)) + 3396|0);
 HEAP8[$$index3411>>0] = 0;
 $$index3412 = ((($15)) + 3397|0);
 HEAP8[$$index3412>>0] = 0;
 $$index3413 = ((($15)) + 3398|0);
 HEAP8[$$index3413>>0] = 0;
 $$index3414 = ((($15)) + 3399|0);
 HEAP8[$$index3414>>0] = 0;
 $$index3415 = ((($15)) + 3400|0);
 HEAP8[$$index3415>>0] = 0;
 $$index3416 = ((($15)) + 3401|0);
 HEAP8[$$index3416>>0] = 0;
 $$index3417 = ((($15)) + 3402|0);
 HEAP8[$$index3417>>0] = 0;
 $$index3418 = ((($15)) + 3403|0);
 HEAP8[$$index3418>>0] = 0;
 $$index3419 = ((($15)) + 3404|0);
 HEAP8[$$index3419>>0] = 0;
 $$index3420 = ((($15)) + 3405|0);
 HEAP8[$$index3420>>0] = 0;
 $$index3421 = ((($15)) + 3406|0);
 HEAP8[$$index3421>>0] = 0;
 $$index3422 = ((($15)) + 3407|0);
 HEAP8[$$index3422>>0] = 0;
 $$index3423 = ((($15)) + 3408|0);
 HEAP8[$$index3423>>0] = 0;
 $$index3424 = ((($15)) + 3409|0);
 HEAP8[$$index3424>>0] = 0;
 $$index3425 = ((($15)) + 3410|0);
 HEAP8[$$index3425>>0] = 0;
 $$index3426 = ((($15)) + 3411|0);
 HEAP8[$$index3426>>0] = 0;
 $$index3427 = ((($15)) + 3412|0);
 HEAP8[$$index3427>>0] = 0;
 $$index3428 = ((($15)) + 3413|0);
 HEAP8[$$index3428>>0] = 0;
 $$index3429 = ((($15)) + 3414|0);
 HEAP8[$$index3429>>0] = 0;
 $$index3430 = ((($15)) + 3415|0);
 HEAP8[$$index3430>>0] = 0;
 $$index3431 = ((($15)) + 3416|0);
 HEAP8[$$index3431>>0] = 0;
 $$index3432 = ((($15)) + 3417|0);
 HEAP8[$$index3432>>0] = 0;
 $$index3433 = ((($15)) + 3418|0);
 HEAP8[$$index3433>>0] = 0;
 $$index3434 = ((($15)) + 3419|0);
 HEAP8[$$index3434>>0] = 0;
 $$index3435 = ((($15)) + 3420|0);
 HEAP8[$$index3435>>0] = 0;
 $$index3436 = ((($15)) + 3421|0);
 HEAP8[$$index3436>>0] = 0;
 $$index3437 = ((($15)) + 3422|0);
 HEAP8[$$index3437>>0] = 0;
 $$index3438 = ((($15)) + 3423|0);
 HEAP8[$$index3438>>0] = 0;
 $$index3439 = ((($15)) + 3424|0);
 HEAP8[$$index3439>>0] = 0;
 $$index3440 = ((($15)) + 3425|0);
 HEAP8[$$index3440>>0] = 0;
 $$index3441 = ((($15)) + 3426|0);
 HEAP8[$$index3441>>0] = 0;
 $$index3442 = ((($15)) + 3427|0);
 HEAP8[$$index3442>>0] = 0;
 $$index3443 = ((($15)) + 3428|0);
 HEAP8[$$index3443>>0] = 0;
 $$index3444 = ((($15)) + 3429|0);
 HEAP8[$$index3444>>0] = 0;
 $$index3445 = ((($15)) + 3430|0);
 HEAP8[$$index3445>>0] = 0;
 $$index3446 = ((($15)) + 3431|0);
 HEAP8[$$index3446>>0] = 0;
 $$index3447 = ((($15)) + 3432|0);
 HEAP8[$$index3447>>0] = 0;
 $$index3448 = ((($15)) + 3433|0);
 HEAP8[$$index3448>>0] = 0;
 $$index3449 = ((($15)) + 3434|0);
 HEAP8[$$index3449>>0] = 0;
 $$index3450 = ((($15)) + 3435|0);
 HEAP8[$$index3450>>0] = 0;
 $$index3451 = ((($15)) + 3436|0);
 HEAP8[$$index3451>>0] = 0;
 $$index3452 = ((($15)) + 3437|0);
 HEAP8[$$index3452>>0] = 0;
 $$index3453 = ((($15)) + 3438|0);
 HEAP8[$$index3453>>0] = 0;
 $$index3454 = ((($15)) + 3439|0);
 HEAP8[$$index3454>>0] = 0;
 $$index3455 = ((($15)) + 3440|0);
 HEAP8[$$index3455>>0] = 0;
 $$index3456 = ((($15)) + 3441|0);
 HEAP8[$$index3456>>0] = 0;
 $$index3457 = ((($15)) + 3442|0);
 HEAP8[$$index3457>>0] = 0;
 $$index3458 = ((($15)) + 3443|0);
 HEAP8[$$index3458>>0] = 0;
 $$index3459 = ((($15)) + 3444|0);
 HEAP8[$$index3459>>0] = 0;
 $$index3460 = ((($15)) + 3445|0);
 HEAP8[$$index3460>>0] = 0;
 $$index3461 = ((($15)) + 3446|0);
 HEAP8[$$index3461>>0] = 0;
 $$index3462 = ((($15)) + 3447|0);
 HEAP8[$$index3462>>0] = 0;
 $$index3463 = ((($15)) + 3448|0);
 HEAP8[$$index3463>>0] = 0;
 $$index3464 = ((($15)) + 3449|0);
 HEAP8[$$index3464>>0] = 0;
 $$index3465 = ((($15)) + 3450|0);
 HEAP8[$$index3465>>0] = 0;
 $$index3466 = ((($15)) + 3451|0);
 HEAP8[$$index3466>>0] = 0;
 $$index3467 = ((($15)) + 3452|0);
 HEAP8[$$index3467>>0] = 0;
 $$index3468 = ((($15)) + 3453|0);
 HEAP8[$$index3468>>0] = 0;
 $$index3469 = ((($15)) + 3454|0);
 HEAP8[$$index3469>>0] = 0;
 $$index3470 = ((($15)) + 3455|0);
 HEAP8[$$index3470>>0] = 0;
 $$index3471 = ((($15)) + 3456|0);
 HEAP8[$$index3471>>0] = 0;
 $$index3472 = ((($15)) + 3457|0);
 HEAP8[$$index3472>>0] = 0;
 $$index3473 = ((($15)) + 3458|0);
 HEAP8[$$index3473>>0] = 0;
 $$index3474 = ((($15)) + 3459|0);
 HEAP8[$$index3474>>0] = 0;
 $$index3475 = ((($15)) + 3460|0);
 HEAP8[$$index3475>>0] = 0;
 $$index3476 = ((($15)) + 3461|0);
 HEAP8[$$index3476>>0] = 0;
 $$index3477 = ((($15)) + 3462|0);
 HEAP8[$$index3477>>0] = 0;
 $$index3478 = ((($15)) + 3463|0);
 HEAP8[$$index3478>>0] = 0;
 $$index3479 = ((($15)) + 3464|0);
 HEAP8[$$index3479>>0] = 0;
 $$index3480 = ((($15)) + 3465|0);
 HEAP8[$$index3480>>0] = 0;
 $$index3481 = ((($15)) + 3466|0);
 HEAP8[$$index3481>>0] = 0;
 $$index3482 = ((($15)) + 3467|0);
 HEAP8[$$index3482>>0] = 0;
 $$index3483 = ((($15)) + 3468|0);
 HEAP8[$$index3483>>0] = 0;
 $$index3484 = ((($15)) + 3469|0);
 HEAP8[$$index3484>>0] = 0;
 $$index3485 = ((($15)) + 3470|0);
 HEAP8[$$index3485>>0] = 0;
 $$index3486 = ((($15)) + 3471|0);
 HEAP8[$$index3486>>0] = 0;
 $$index3487 = ((($15)) + 3472|0);
 HEAP8[$$index3487>>0] = 0;
 $$index3488 = ((($15)) + 3473|0);
 HEAP8[$$index3488>>0] = 0;
 $$index3489 = ((($15)) + 3474|0);
 HEAP8[$$index3489>>0] = 0;
 $$index3490 = ((($15)) + 3475|0);
 HEAP8[$$index3490>>0] = 0;
 $$index3491 = ((($15)) + 3476|0);
 HEAP8[$$index3491>>0] = 0;
 $$index3492 = ((($15)) + 3477|0);
 HEAP8[$$index3492>>0] = 0;
 $$index3493 = ((($15)) + 3478|0);
 HEAP8[$$index3493>>0] = 0;
 $$index3494 = ((($15)) + 3479|0);
 HEAP8[$$index3494>>0] = 0;
 $$index3495 = ((($15)) + 3480|0);
 HEAP8[$$index3495>>0] = 0;
 $$index3496 = ((($15)) + 3481|0);
 HEAP8[$$index3496>>0] = 0;
 $$index3497 = ((($15)) + 3482|0);
 HEAP8[$$index3497>>0] = 0;
 $$index3498 = ((($15)) + 3483|0);
 HEAP8[$$index3498>>0] = 0;
 $$index3499 = ((($15)) + 3484|0);
 HEAP8[$$index3499>>0] = 0;
 $$index3500 = ((($15)) + 3485|0);
 HEAP8[$$index3500>>0] = 0;
 $$index3501 = ((($15)) + 3486|0);
 HEAP8[$$index3501>>0] = 0;
 $$index3502 = ((($15)) + 3487|0);
 HEAP8[$$index3502>>0] = 0;
 $$index3503 = ((($15)) + 3488|0);
 HEAP8[$$index3503>>0] = 0;
 $$index3504 = ((($15)) + 3489|0);
 HEAP8[$$index3504>>0] = 0;
 $$index3505 = ((($15)) + 3490|0);
 HEAP8[$$index3505>>0] = 0;
 $$index3506 = ((($15)) + 3491|0);
 HEAP8[$$index3506>>0] = 0;
 $$index3507 = ((($15)) + 3492|0);
 HEAP8[$$index3507>>0] = 0;
 $$index3508 = ((($15)) + 3493|0);
 HEAP8[$$index3508>>0] = 0;
 $$index3509 = ((($15)) + 3494|0);
 HEAP8[$$index3509>>0] = 0;
 $$index3510 = ((($15)) + 3495|0);
 HEAP8[$$index3510>>0] = 0;
 $$index3511 = ((($15)) + 3496|0);
 HEAP8[$$index3511>>0] = 0;
 $$index3512 = ((($15)) + 3497|0);
 HEAP8[$$index3512>>0] = 0;
 $$index3513 = ((($15)) + 3498|0);
 HEAP8[$$index3513>>0] = 0;
 $$index3514 = ((($15)) + 3499|0);
 HEAP8[$$index3514>>0] = 0;
 $$index3515 = ((($15)) + 3500|0);
 HEAP8[$$index3515>>0] = 0;
 $$index3516 = ((($15)) + 3501|0);
 HEAP8[$$index3516>>0] = 0;
 $$index3517 = ((($15)) + 3502|0);
 HEAP8[$$index3517>>0] = 0;
 $$index3518 = ((($15)) + 3503|0);
 HEAP8[$$index3518>>0] = 0;
 $$index3519 = ((($15)) + 3504|0);
 HEAP8[$$index3519>>0] = 0;
 $$index3520 = ((($15)) + 3505|0);
 HEAP8[$$index3520>>0] = 0;
 $$index3521 = ((($15)) + 3506|0);
 HEAP8[$$index3521>>0] = 0;
 $$index3522 = ((($15)) + 3507|0);
 HEAP8[$$index3522>>0] = 0;
 $$index3523 = ((($15)) + 3508|0);
 HEAP8[$$index3523>>0] = 0;
 $$index3524 = ((($15)) + 3509|0);
 HEAP8[$$index3524>>0] = 0;
 $$index3525 = ((($15)) + 3510|0);
 HEAP8[$$index3525>>0] = 0;
 $$index3526 = ((($15)) + 3511|0);
 HEAP8[$$index3526>>0] = 0;
 $$index3527 = ((($15)) + 3512|0);
 HEAP8[$$index3527>>0] = 0;
 $$index3528 = ((($15)) + 3513|0);
 HEAP8[$$index3528>>0] = 0;
 $$index3529 = ((($15)) + 3514|0);
 HEAP8[$$index3529>>0] = 0;
 $$index3530 = ((($15)) + 3515|0);
 HEAP8[$$index3530>>0] = 0;
 $$index3531 = ((($15)) + 3516|0);
 HEAP8[$$index3531>>0] = 0;
 $$index3532 = ((($15)) + 3517|0);
 HEAP8[$$index3532>>0] = 0;
 $$index3533 = ((($15)) + 3518|0);
 HEAP8[$$index3533>>0] = 0;
 $$index3534 = ((($15)) + 3519|0);
 HEAP8[$$index3534>>0] = 0;
 $$index3535 = ((($15)) + 3520|0);
 HEAP8[$$index3535>>0] = 0;
 $$index3536 = ((($15)) + 3521|0);
 HEAP8[$$index3536>>0] = 0;
 $$index3537 = ((($15)) + 3522|0);
 HEAP8[$$index3537>>0] = 0;
 $$index3538 = ((($15)) + 3523|0);
 HEAP8[$$index3538>>0] = 0;
 $$index3539 = ((($15)) + 3524|0);
 HEAP8[$$index3539>>0] = 0;
 $$index3540 = ((($15)) + 3525|0);
 HEAP8[$$index3540>>0] = 0;
 $$index3541 = ((($15)) + 3526|0);
 HEAP8[$$index3541>>0] = 0;
 $$index3542 = ((($15)) + 3527|0);
 HEAP8[$$index3542>>0] = 0;
 $$index3543 = ((($15)) + 3528|0);
 HEAP8[$$index3543>>0] = 0;
 $$index3544 = ((($15)) + 3529|0);
 HEAP8[$$index3544>>0] = 0;
 $$index3545 = ((($15)) + 3530|0);
 HEAP8[$$index3545>>0] = 0;
 $$index3546 = ((($15)) + 3531|0);
 HEAP8[$$index3546>>0] = 0;
 $$index3547 = ((($15)) + 3532|0);
 HEAP8[$$index3547>>0] = 0;
 $$index3548 = ((($15)) + 3533|0);
 HEAP8[$$index3548>>0] = 0;
 $$index3549 = ((($15)) + 3534|0);
 HEAP8[$$index3549>>0] = 0;
 $$index3550 = ((($15)) + 3535|0);
 HEAP8[$$index3550>>0] = 0;
 $$index3551 = ((($15)) + 3536|0);
 HEAP8[$$index3551>>0] = 0;
 $$index3552 = ((($15)) + 3537|0);
 HEAP8[$$index3552>>0] = 0;
 $$index3553 = ((($15)) + 3538|0);
 HEAP8[$$index3553>>0] = 0;
 $$index3554 = ((($15)) + 3539|0);
 HEAP8[$$index3554>>0] = 0;
 $$index3555 = ((($15)) + 3540|0);
 HEAP8[$$index3555>>0] = 0;
 $$index3556 = ((($15)) + 3541|0);
 HEAP8[$$index3556>>0] = 0;
 $$index3557 = ((($15)) + 3542|0);
 HEAP8[$$index3557>>0] = 0;
 $$index3558 = ((($15)) + 3543|0);
 HEAP8[$$index3558>>0] = 0;
 $$index3559 = ((($15)) + 3544|0);
 HEAP8[$$index3559>>0] = 0;
 $$index3560 = ((($15)) + 3545|0);
 HEAP8[$$index3560>>0] = 0;
 $$index3561 = ((($15)) + 3546|0);
 HEAP8[$$index3561>>0] = 0;
 $$index3562 = ((($15)) + 3547|0);
 HEAP8[$$index3562>>0] = 0;
 $$index3563 = ((($15)) + 3548|0);
 HEAP8[$$index3563>>0] = 0;
 $$index3564 = ((($15)) + 3549|0);
 HEAP8[$$index3564>>0] = 0;
 $$index3565 = ((($15)) + 3550|0);
 HEAP8[$$index3565>>0] = 0;
 $$index3566 = ((($15)) + 3551|0);
 HEAP8[$$index3566>>0] = 0;
 $$index3567 = ((($15)) + 3552|0);
 HEAP8[$$index3567>>0] = 0;
 $$index3568 = ((($15)) + 3553|0);
 HEAP8[$$index3568>>0] = 0;
 $$index3569 = ((($15)) + 3554|0);
 HEAP8[$$index3569>>0] = 0;
 $$index3570 = ((($15)) + 3555|0);
 HEAP8[$$index3570>>0] = 0;
 $$index3571 = ((($15)) + 3556|0);
 HEAP8[$$index3571>>0] = 0;
 $$index3572 = ((($15)) + 3557|0);
 HEAP8[$$index3572>>0] = 0;
 $$index3573 = ((($15)) + 3558|0);
 HEAP8[$$index3573>>0] = 0;
 $$index3574 = ((($15)) + 3559|0);
 HEAP8[$$index3574>>0] = 0;
 $$index3575 = ((($15)) + 3560|0);
 HEAP8[$$index3575>>0] = 0;
 $$index3576 = ((($15)) + 3561|0);
 HEAP8[$$index3576>>0] = 0;
 $$index3577 = ((($15)) + 3562|0);
 HEAP8[$$index3577>>0] = 0;
 $$index3578 = ((($15)) + 3563|0);
 HEAP8[$$index3578>>0] = 0;
 $$index3579 = ((($15)) + 3564|0);
 HEAP8[$$index3579>>0] = 0;
 $$index3580 = ((($15)) + 3565|0);
 HEAP8[$$index3580>>0] = 0;
 $$index3581 = ((($15)) + 3566|0);
 HEAP8[$$index3581>>0] = 0;
 $$index3582 = ((($15)) + 3567|0);
 HEAP8[$$index3582>>0] = 0;
 $$index3583 = ((($15)) + 3568|0);
 HEAP8[$$index3583>>0] = 0;
 $$index3584 = ((($15)) + 3569|0);
 HEAP8[$$index3584>>0] = 0;
 $$index3585 = ((($15)) + 3570|0);
 HEAP8[$$index3585>>0] = 0;
 $$index3586 = ((($15)) + 3571|0);
 HEAP8[$$index3586>>0] = 0;
 $$index3587 = ((($15)) + 3572|0);
 HEAP8[$$index3587>>0] = 0;
 $$index3588 = ((($15)) + 3573|0);
 HEAP8[$$index3588>>0] = 0;
 $$index3589 = ((($15)) + 3574|0);
 HEAP8[$$index3589>>0] = 0;
 $$index3590 = ((($15)) + 3575|0);
 HEAP8[$$index3590>>0] = 0;
 $$index3591 = ((($15)) + 3576|0);
 HEAP8[$$index3591>>0] = 0;
 $$index3592 = ((($15)) + 3577|0);
 HEAP8[$$index3592>>0] = 0;
 $$index3593 = ((($15)) + 3578|0);
 HEAP8[$$index3593>>0] = 0;
 $$index3594 = ((($15)) + 3579|0);
 HEAP8[$$index3594>>0] = 0;
 $$index3595 = ((($15)) + 3580|0);
 HEAP8[$$index3595>>0] = 0;
 $$index3596 = ((($15)) + 3581|0);
 HEAP8[$$index3596>>0] = 0;
 $$index3597 = ((($15)) + 3582|0);
 HEAP8[$$index3597>>0] = 0;
 $$index3598 = ((($15)) + 3583|0);
 HEAP8[$$index3598>>0] = 0;
 $$index3599 = ((($15)) + 3584|0);
 HEAP8[$$index3599>>0] = 0;
 $$index3600 = ((($15)) + 3585|0);
 HEAP8[$$index3600>>0] = 0;
 $$index3601 = ((($15)) + 3586|0);
 HEAP8[$$index3601>>0] = 0;
 $$index3602 = ((($15)) + 3587|0);
 HEAP8[$$index3602>>0] = 0;
 $$index3603 = ((($15)) + 3588|0);
 HEAP8[$$index3603>>0] = 0;
 $$index3604 = ((($15)) + 3589|0);
 HEAP8[$$index3604>>0] = 0;
 $$index3605 = ((($15)) + 3590|0);
 HEAP8[$$index3605>>0] = 0;
 $$index3606 = ((($15)) + 3591|0);
 HEAP8[$$index3606>>0] = 0;
 $$index3607 = ((($15)) + 3592|0);
 HEAP8[$$index3607>>0] = 0;
 $$index3608 = ((($15)) + 3593|0);
 HEAP8[$$index3608>>0] = 0;
 $$index3609 = ((($15)) + 3594|0);
 HEAP8[$$index3609>>0] = 0;
 $$index3610 = ((($15)) + 3595|0);
 HEAP8[$$index3610>>0] = 0;
 $$index3611 = ((($15)) + 3596|0);
 HEAP8[$$index3611>>0] = 0;
 $$index3612 = ((($15)) + 3597|0);
 HEAP8[$$index3612>>0] = 0;
 $$index3613 = ((($15)) + 3598|0);
 HEAP8[$$index3613>>0] = 0;
 $$index3614 = ((($15)) + 3599|0);
 HEAP8[$$index3614>>0] = 0;
 $$index3615 = ((($15)) + 3600|0);
 HEAP8[$$index3615>>0] = 0;
 $$index3616 = ((($15)) + 3601|0);
 HEAP8[$$index3616>>0] = 0;
 $$index3617 = ((($15)) + 3602|0);
 HEAP8[$$index3617>>0] = 0;
 $$index3618 = ((($15)) + 3603|0);
 HEAP8[$$index3618>>0] = 0;
 $$index3619 = ((($15)) + 3604|0);
 HEAP8[$$index3619>>0] = 0;
 $$index3620 = ((($15)) + 3605|0);
 HEAP8[$$index3620>>0] = 0;
 $$index3621 = ((($15)) + 3606|0);
 HEAP8[$$index3621>>0] = 0;
 $$index3622 = ((($15)) + 3607|0);
 HEAP8[$$index3622>>0] = 0;
 $$index3623 = ((($15)) + 3608|0);
 HEAP8[$$index3623>>0] = 0;
 $$index3624 = ((($15)) + 3609|0);
 HEAP8[$$index3624>>0] = 0;
 $$index3625 = ((($15)) + 3610|0);
 HEAP8[$$index3625>>0] = 0;
 $$index3626 = ((($15)) + 3611|0);
 HEAP8[$$index3626>>0] = 0;
 $$index3627 = ((($15)) + 3612|0);
 HEAP8[$$index3627>>0] = 0;
 $$index3628 = ((($15)) + 3613|0);
 HEAP8[$$index3628>>0] = 0;
 $$index3629 = ((($15)) + 3614|0);
 HEAP8[$$index3629>>0] = 0;
 $$index3630 = ((($15)) + 3615|0);
 HEAP8[$$index3630>>0] = 0;
 $$index3631 = ((($15)) + 3616|0);
 HEAP8[$$index3631>>0] = 0;
 $$index3632 = ((($15)) + 3617|0);
 HEAP8[$$index3632>>0] = 0;
 $$index3633 = ((($15)) + 3618|0);
 HEAP8[$$index3633>>0] = 0;
 $$index3634 = ((($15)) + 3619|0);
 HEAP8[$$index3634>>0] = 0;
 $$index3635 = ((($15)) + 3620|0);
 HEAP8[$$index3635>>0] = 0;
 $$index3636 = ((($15)) + 3621|0);
 HEAP8[$$index3636>>0] = 0;
 $$index3637 = ((($15)) + 3622|0);
 HEAP8[$$index3637>>0] = 0;
 $$index3638 = ((($15)) + 3623|0);
 HEAP8[$$index3638>>0] = 0;
 $$index3639 = ((($15)) + 3624|0);
 HEAP8[$$index3639>>0] = 0;
 $$index3640 = ((($15)) + 3625|0);
 HEAP8[$$index3640>>0] = 0;
 $$index3641 = ((($15)) + 3626|0);
 HEAP8[$$index3641>>0] = 0;
 $$index3642 = ((($15)) + 3627|0);
 HEAP8[$$index3642>>0] = 0;
 $$index3643 = ((($15)) + 3628|0);
 HEAP8[$$index3643>>0] = 0;
 $$index3644 = ((($15)) + 3629|0);
 HEAP8[$$index3644>>0] = 0;
 $$index3645 = ((($15)) + 3630|0);
 HEAP8[$$index3645>>0] = 0;
 $$index3646 = ((($15)) + 3631|0);
 HEAP8[$$index3646>>0] = 0;
 $$index3647 = ((($15)) + 3632|0);
 HEAP8[$$index3647>>0] = 0;
 $$index3648 = ((($15)) + 3633|0);
 HEAP8[$$index3648>>0] = 0;
 $$index3649 = ((($15)) + 3634|0);
 HEAP8[$$index3649>>0] = 0;
 $$index3650 = ((($15)) + 3635|0);
 HEAP8[$$index3650>>0] = 0;
 $$index3651 = ((($15)) + 3636|0);
 HEAP8[$$index3651>>0] = 0;
 $$index3652 = ((($15)) + 3637|0);
 HEAP8[$$index3652>>0] = 0;
 $$index3653 = ((($15)) + 3638|0);
 HEAP8[$$index3653>>0] = 0;
 $$index3654 = ((($15)) + 3639|0);
 HEAP8[$$index3654>>0] = 0;
 $$index3655 = ((($15)) + 3640|0);
 HEAP8[$$index3655>>0] = 0;
 $$index3656 = ((($15)) + 3641|0);
 HEAP8[$$index3656>>0] = 0;
 $$index3657 = ((($15)) + 3642|0);
 HEAP8[$$index3657>>0] = 0;
 $$index3658 = ((($15)) + 3643|0);
 HEAP8[$$index3658>>0] = 0;
 $$index3659 = ((($15)) + 3644|0);
 HEAP8[$$index3659>>0] = 0;
 $$index3660 = ((($15)) + 3645|0);
 HEAP8[$$index3660>>0] = 0;
 $$index3661 = ((($15)) + 3646|0);
 HEAP8[$$index3661>>0] = 0;
 $$index3662 = ((($15)) + 3647|0);
 HEAP8[$$index3662>>0] = 0;
 $$index3663 = ((($15)) + 3648|0);
 HEAP8[$$index3663>>0] = 0;
 $$index3664 = ((($15)) + 3649|0);
 HEAP8[$$index3664>>0] = 0;
 $$index3665 = ((($15)) + 3650|0);
 HEAP8[$$index3665>>0] = 0;
 $$index3666 = ((($15)) + 3651|0);
 HEAP8[$$index3666>>0] = 0;
 $$index3667 = ((($15)) + 3652|0);
 HEAP8[$$index3667>>0] = 0;
 $$index3668 = ((($15)) + 3653|0);
 HEAP8[$$index3668>>0] = 0;
 $$index3669 = ((($15)) + 3654|0);
 HEAP8[$$index3669>>0] = 0;
 $$index3670 = ((($15)) + 3655|0);
 HEAP8[$$index3670>>0] = 0;
 $$index3671 = ((($15)) + 3656|0);
 HEAP8[$$index3671>>0] = 0;
 $$index3672 = ((($15)) + 3657|0);
 HEAP8[$$index3672>>0] = 0;
 $$index3673 = ((($15)) + 3658|0);
 HEAP8[$$index3673>>0] = 0;
 $$index3674 = ((($15)) + 3659|0);
 HEAP8[$$index3674>>0] = 0;
 $$index3675 = ((($15)) + 3660|0);
 HEAP8[$$index3675>>0] = 0;
 $$index3676 = ((($15)) + 3661|0);
 HEAP8[$$index3676>>0] = 0;
 $$index3677 = ((($15)) + 3662|0);
 HEAP8[$$index3677>>0] = 0;
 $$index3678 = ((($15)) + 3663|0);
 HEAP8[$$index3678>>0] = 0;
 $$index3679 = ((($15)) + 3664|0);
 HEAP8[$$index3679>>0] = 0;
 $$index3680 = ((($15)) + 3665|0);
 HEAP8[$$index3680>>0] = 0;
 $$index3681 = ((($15)) + 3666|0);
 HEAP8[$$index3681>>0] = 0;
 $$index3682 = ((($15)) + 3667|0);
 HEAP8[$$index3682>>0] = 0;
 $$index3683 = ((($15)) + 3668|0);
 HEAP8[$$index3683>>0] = 0;
 $$index3684 = ((($15)) + 3669|0);
 HEAP8[$$index3684>>0] = 0;
 $$index3685 = ((($15)) + 3670|0);
 HEAP8[$$index3685>>0] = 0;
 $$index3686 = ((($15)) + 3671|0);
 HEAP8[$$index3686>>0] = 0;
 $$index3687 = ((($15)) + 3672|0);
 HEAP8[$$index3687>>0] = 0;
 $$index3688 = ((($15)) + 3673|0);
 HEAP8[$$index3688>>0] = 0;
 $$index3689 = ((($15)) + 3674|0);
 HEAP8[$$index3689>>0] = 0;
 $$index3690 = ((($15)) + 3675|0);
 HEAP8[$$index3690>>0] = 0;
 $$index3691 = ((($15)) + 3676|0);
 HEAP8[$$index3691>>0] = 0;
 $$index3692 = ((($15)) + 3677|0);
 HEAP8[$$index3692>>0] = 0;
 $$index3693 = ((($15)) + 3678|0);
 HEAP8[$$index3693>>0] = 0;
 $$index3694 = ((($15)) + 3679|0);
 HEAP8[$$index3694>>0] = 0;
 $$index3695 = ((($15)) + 3680|0);
 HEAP8[$$index3695>>0] = 0;
 $$index3696 = ((($15)) + 3681|0);
 HEAP8[$$index3696>>0] = 0;
 $$index3697 = ((($15)) + 3682|0);
 HEAP8[$$index3697>>0] = 0;
 $$index3698 = ((($15)) + 3683|0);
 HEAP8[$$index3698>>0] = 0;
 $$index3699 = ((($15)) + 3684|0);
 HEAP8[$$index3699>>0] = 0;
 $$index3700 = ((($15)) + 3685|0);
 HEAP8[$$index3700>>0] = 0;
 $$index3701 = ((($15)) + 3686|0);
 HEAP8[$$index3701>>0] = 0;
 $$index3702 = ((($15)) + 3687|0);
 HEAP8[$$index3702>>0] = 0;
 $$index3703 = ((($15)) + 3688|0);
 HEAP8[$$index3703>>0] = 0;
 $$index3704 = ((($15)) + 3689|0);
 HEAP8[$$index3704>>0] = 0;
 $$index3705 = ((($15)) + 3690|0);
 HEAP8[$$index3705>>0] = 0;
 $$index3706 = ((($15)) + 3691|0);
 HEAP8[$$index3706>>0] = 0;
 $$index3707 = ((($15)) + 3692|0);
 HEAP8[$$index3707>>0] = 0;
 $$index3708 = ((($15)) + 3693|0);
 HEAP8[$$index3708>>0] = 0;
 $$index3709 = ((($15)) + 3694|0);
 HEAP8[$$index3709>>0] = 0;
 $$index3710 = ((($15)) + 3695|0);
 HEAP8[$$index3710>>0] = 0;
 $$index3711 = ((($15)) + 3696|0);
 HEAP8[$$index3711>>0] = 0;
 $$index3712 = ((($15)) + 3697|0);
 HEAP8[$$index3712>>0] = 0;
 $$index3713 = ((($15)) + 3698|0);
 HEAP8[$$index3713>>0] = 0;
 $$index3714 = ((($15)) + 3699|0);
 HEAP8[$$index3714>>0] = 0;
 $$index3715 = ((($15)) + 3700|0);
 HEAP8[$$index3715>>0] = 0;
 $$index3716 = ((($15)) + 3701|0);
 HEAP8[$$index3716>>0] = 0;
 $$index3717 = ((($15)) + 3702|0);
 HEAP8[$$index3717>>0] = 0;
 $$index3718 = ((($15)) + 3703|0);
 HEAP8[$$index3718>>0] = 0;
 $$index3719 = ((($15)) + 3704|0);
 HEAP8[$$index3719>>0] = 0;
 $$index3720 = ((($15)) + 3705|0);
 HEAP8[$$index3720>>0] = 0;
 $$index3721 = ((($15)) + 3706|0);
 HEAP8[$$index3721>>0] = 0;
 $$index3722 = ((($15)) + 3707|0);
 HEAP8[$$index3722>>0] = 0;
 $$index3723 = ((($15)) + 3708|0);
 HEAP8[$$index3723>>0] = 0;
 $$index3724 = ((($15)) + 3709|0);
 HEAP8[$$index3724>>0] = 0;
 $$index3725 = ((($15)) + 3710|0);
 HEAP8[$$index3725>>0] = 0;
 $$index3726 = ((($15)) + 3711|0);
 HEAP8[$$index3726>>0] = 0;
 $$index3727 = ((($15)) + 3712|0);
 HEAP8[$$index3727>>0] = 0;
 $$index3728 = ((($15)) + 3713|0);
 HEAP8[$$index3728>>0] = 0;
 $$index3729 = ((($15)) + 3714|0);
 HEAP8[$$index3729>>0] = 0;
 $$index3730 = ((($15)) + 3715|0);
 HEAP8[$$index3730>>0] = 0;
 $$index3731 = ((($15)) + 3716|0);
 HEAP8[$$index3731>>0] = 0;
 $$index3732 = ((($15)) + 3717|0);
 HEAP8[$$index3732>>0] = 0;
 $$index3733 = ((($15)) + 3718|0);
 HEAP8[$$index3733>>0] = 0;
 $$index3734 = ((($15)) + 3719|0);
 HEAP8[$$index3734>>0] = 0;
 $$index3735 = ((($15)) + 3720|0);
 HEAP8[$$index3735>>0] = 0;
 $$index3736 = ((($15)) + 3721|0);
 HEAP8[$$index3736>>0] = 0;
 $$index3737 = ((($15)) + 3722|0);
 HEAP8[$$index3737>>0] = 0;
 $$index3738 = ((($15)) + 3723|0);
 HEAP8[$$index3738>>0] = 0;
 $$index3739 = ((($15)) + 3724|0);
 HEAP8[$$index3739>>0] = 0;
 $$index3740 = ((($15)) + 3725|0);
 HEAP8[$$index3740>>0] = 0;
 $$index3741 = ((($15)) + 3726|0);
 HEAP8[$$index3741>>0] = 0;
 $$index3742 = ((($15)) + 3727|0);
 HEAP8[$$index3742>>0] = 0;
 $$index3743 = ((($15)) + 3728|0);
 HEAP8[$$index3743>>0] = 0;
 $$index3744 = ((($15)) + 3729|0);
 HEAP8[$$index3744>>0] = 0;
 $$index3745 = ((($15)) + 3730|0);
 HEAP8[$$index3745>>0] = 0;
 $$index3746 = ((($15)) + 3731|0);
 HEAP8[$$index3746>>0] = 0;
 $$index3747 = ((($15)) + 3732|0);
 HEAP8[$$index3747>>0] = 0;
 $$index3748 = ((($15)) + 3733|0);
 HEAP8[$$index3748>>0] = 0;
 $$index3749 = ((($15)) + 3734|0);
 HEAP8[$$index3749>>0] = 0;
 $$index3750 = ((($15)) + 3735|0);
 HEAP8[$$index3750>>0] = 0;
 $$index3751 = ((($15)) + 3736|0);
 HEAP8[$$index3751>>0] = 0;
 $$index3752 = ((($15)) + 3737|0);
 HEAP8[$$index3752>>0] = 0;
 $$index3753 = ((($15)) + 3738|0);
 HEAP8[$$index3753>>0] = 0;
 $$index3754 = ((($15)) + 3739|0);
 HEAP8[$$index3754>>0] = 0;
 $$index3755 = ((($15)) + 3740|0);
 HEAP8[$$index3755>>0] = 0;
 $$index3756 = ((($15)) + 3741|0);
 HEAP8[$$index3756>>0] = 0;
 $$index3757 = ((($15)) + 3742|0);
 HEAP8[$$index3757>>0] = 0;
 $$index3758 = ((($15)) + 3743|0);
 HEAP8[$$index3758>>0] = 0;
 $$index3759 = ((($15)) + 3744|0);
 HEAP8[$$index3759>>0] = 0;
 $$index3760 = ((($15)) + 3745|0);
 HEAP8[$$index3760>>0] = 0;
 $$index3761 = ((($15)) + 3746|0);
 HEAP8[$$index3761>>0] = 0;
 $$index3762 = ((($15)) + 3747|0);
 HEAP8[$$index3762>>0] = 0;
 $$index3763 = ((($15)) + 3748|0);
 HEAP8[$$index3763>>0] = 0;
 $$index3764 = ((($15)) + 3749|0);
 HEAP8[$$index3764>>0] = 0;
 $$index3765 = ((($15)) + 3750|0);
 HEAP8[$$index3765>>0] = 0;
 $$index3766 = ((($15)) + 3751|0);
 HEAP8[$$index3766>>0] = 0;
 $$index3767 = ((($15)) + 3752|0);
 HEAP8[$$index3767>>0] = 0;
 $$index3768 = ((($15)) + 3753|0);
 HEAP8[$$index3768>>0] = 0;
 $$index3769 = ((($15)) + 3754|0);
 HEAP8[$$index3769>>0] = 0;
 $$index3770 = ((($15)) + 3755|0);
 HEAP8[$$index3770>>0] = 0;
 $$index3771 = ((($15)) + 3756|0);
 HEAP8[$$index3771>>0] = 0;
 $$index3772 = ((($15)) + 3757|0);
 HEAP8[$$index3772>>0] = 0;
 $$index3773 = ((($15)) + 3758|0);
 HEAP8[$$index3773>>0] = 0;
 $$index3774 = ((($15)) + 3759|0);
 HEAP8[$$index3774>>0] = 0;
 $$index3775 = ((($15)) + 3760|0);
 HEAP8[$$index3775>>0] = 0;
 $$index3776 = ((($15)) + 3761|0);
 HEAP8[$$index3776>>0] = 0;
 $$index3777 = ((($15)) + 3762|0);
 HEAP8[$$index3777>>0] = 0;
 $$index3778 = ((($15)) + 3763|0);
 HEAP8[$$index3778>>0] = 0;
 $$index3779 = ((($15)) + 3764|0);
 HEAP8[$$index3779>>0] = 0;
 $$index3780 = ((($15)) + 3765|0);
 HEAP8[$$index3780>>0] = 0;
 $$index3781 = ((($15)) + 3766|0);
 HEAP8[$$index3781>>0] = 0;
 $$index3782 = ((($15)) + 3767|0);
 HEAP8[$$index3782>>0] = 0;
 $$index3783 = ((($15)) + 3768|0);
 HEAP8[$$index3783>>0] = 0;
 $$index3784 = ((($15)) + 3769|0);
 HEAP8[$$index3784>>0] = 0;
 $$index3785 = ((($15)) + 3770|0);
 HEAP8[$$index3785>>0] = 0;
 $$index3786 = ((($15)) + 3771|0);
 HEAP8[$$index3786>>0] = 0;
 $$index3787 = ((($15)) + 3772|0);
 HEAP8[$$index3787>>0] = 0;
 $$index3788 = ((($15)) + 3773|0);
 HEAP8[$$index3788>>0] = 0;
 $$index3789 = ((($15)) + 3774|0);
 HEAP8[$$index3789>>0] = 0;
 $$index3790 = ((($15)) + 3775|0);
 HEAP8[$$index3790>>0] = 0;
 $$index3791 = ((($15)) + 3776|0);
 HEAP8[$$index3791>>0] = 0;
 $$index3792 = ((($15)) + 3777|0);
 HEAP8[$$index3792>>0] = 0;
 $$index3793 = ((($15)) + 3778|0);
 HEAP8[$$index3793>>0] = 0;
 $$index3794 = ((($15)) + 3779|0);
 HEAP8[$$index3794>>0] = 0;
 $$index3795 = ((($15)) + 3780|0);
 HEAP8[$$index3795>>0] = 0;
 $$index3796 = ((($15)) + 3781|0);
 HEAP8[$$index3796>>0] = 0;
 $$index3797 = ((($15)) + 3782|0);
 HEAP8[$$index3797>>0] = 0;
 $$index3798 = ((($15)) + 3783|0);
 HEAP8[$$index3798>>0] = 0;
 $$index3799 = ((($15)) + 3784|0);
 HEAP8[$$index3799>>0] = 0;
 $$index3800 = ((($15)) + 3785|0);
 HEAP8[$$index3800>>0] = 0;
 $$index3801 = ((($15)) + 3786|0);
 HEAP8[$$index3801>>0] = 0;
 $$index3802 = ((($15)) + 3787|0);
 HEAP8[$$index3802>>0] = 0;
 $$index3803 = ((($15)) + 3788|0);
 HEAP8[$$index3803>>0] = 0;
 $$index3804 = ((($15)) + 3789|0);
 HEAP8[$$index3804>>0] = 0;
 $$index3805 = ((($15)) + 3790|0);
 HEAP8[$$index3805>>0] = 0;
 $$index3806 = ((($15)) + 3791|0);
 HEAP8[$$index3806>>0] = 0;
 $$index3807 = ((($15)) + 3792|0);
 HEAP8[$$index3807>>0] = 0;
 $$index3808 = ((($15)) + 3793|0);
 HEAP8[$$index3808>>0] = 0;
 $$index3809 = ((($15)) + 3794|0);
 HEAP8[$$index3809>>0] = 0;
 $$index3810 = ((($15)) + 3795|0);
 HEAP8[$$index3810>>0] = 0;
 $$index3811 = ((($15)) + 3796|0);
 HEAP8[$$index3811>>0] = 0;
 $$index3812 = ((($15)) + 3797|0);
 HEAP8[$$index3812>>0] = 0;
 $$index3813 = ((($15)) + 3798|0);
 HEAP8[$$index3813>>0] = 0;
 $$index3814 = ((($15)) + 3799|0);
 HEAP8[$$index3814>>0] = 0;
 $$index3815 = ((($15)) + 3800|0);
 HEAP8[$$index3815>>0] = 0;
 $$index3816 = ((($15)) + 3801|0);
 HEAP8[$$index3816>>0] = 0;
 $$index3817 = ((($15)) + 3802|0);
 HEAP8[$$index3817>>0] = 0;
 $$index3818 = ((($15)) + 3803|0);
 HEAP8[$$index3818>>0] = 0;
 $$index3819 = ((($15)) + 3804|0);
 HEAP8[$$index3819>>0] = 0;
 $$index3820 = ((($15)) + 3805|0);
 HEAP8[$$index3820>>0] = 0;
 $$index3821 = ((($15)) + 3806|0);
 HEAP8[$$index3821>>0] = 0;
 $$index3822 = ((($15)) + 3807|0);
 HEAP8[$$index3822>>0] = 0;
 $$index3823 = ((($15)) + 3808|0);
 HEAP8[$$index3823>>0] = 0;
 $$index3824 = ((($15)) + 3809|0);
 HEAP8[$$index3824>>0] = 0;
 $$index3825 = ((($15)) + 3810|0);
 HEAP8[$$index3825>>0] = 0;
 $$index3826 = ((($15)) + 3811|0);
 HEAP8[$$index3826>>0] = 0;
 $$index3827 = ((($15)) + 3812|0);
 HEAP8[$$index3827>>0] = 0;
 $$index3828 = ((($15)) + 3813|0);
 HEAP8[$$index3828>>0] = 0;
 $$index3829 = ((($15)) + 3814|0);
 HEAP8[$$index3829>>0] = 0;
 $$index3830 = ((($15)) + 3815|0);
 HEAP8[$$index3830>>0] = 0;
 $$index3831 = ((($15)) + 3816|0);
 HEAP8[$$index3831>>0] = 0;
 $$index3832 = ((($15)) + 3817|0);
 HEAP8[$$index3832>>0] = 0;
 $$index3833 = ((($15)) + 3818|0);
 HEAP8[$$index3833>>0] = 0;
 $$index3834 = ((($15)) + 3819|0);
 HEAP8[$$index3834>>0] = 0;
 $$index3835 = ((($15)) + 3820|0);
 HEAP8[$$index3835>>0] = 0;
 $$index3836 = ((($15)) + 3821|0);
 HEAP8[$$index3836>>0] = 0;
 $$index3837 = ((($15)) + 3822|0);
 HEAP8[$$index3837>>0] = 0;
 $$index3838 = ((($15)) + 3823|0);
 HEAP8[$$index3838>>0] = 0;
 $$index3839 = ((($15)) + 3824|0);
 HEAP8[$$index3839>>0] = 0;
 $$index3840 = ((($15)) + 3825|0);
 HEAP8[$$index3840>>0] = 0;
 $$index3841 = ((($15)) + 3826|0);
 HEAP8[$$index3841>>0] = 0;
 $$index3842 = ((($15)) + 3827|0);
 HEAP8[$$index3842>>0] = 0;
 $$index3843 = ((($15)) + 3828|0);
 HEAP8[$$index3843>>0] = 0;
 $$index3844 = ((($15)) + 3829|0);
 HEAP8[$$index3844>>0] = 0;
 $$index3845 = ((($15)) + 3830|0);
 HEAP8[$$index3845>>0] = 0;
 $$index3846 = ((($15)) + 3831|0);
 HEAP8[$$index3846>>0] = 0;
 $$index3847 = ((($15)) + 3832|0);
 HEAP8[$$index3847>>0] = 0;
 $$index3848 = ((($15)) + 3833|0);
 HEAP8[$$index3848>>0] = 0;
 $$index3849 = ((($15)) + 3834|0);
 HEAP8[$$index3849>>0] = 0;
 $$index3850 = ((($15)) + 3835|0);
 HEAP8[$$index3850>>0] = 0;
 $$index3851 = ((($15)) + 3836|0);
 HEAP8[$$index3851>>0] = 0;
 $$index3852 = ((($15)) + 3837|0);
 HEAP8[$$index3852>>0] = 0;
 $$index3853 = ((($15)) + 3838|0);
 HEAP8[$$index3853>>0] = 0;
 $$index3854 = ((($15)) + 3839|0);
 HEAP8[$$index3854>>0] = 0;
 $$index3855 = ((($15)) + 3840|0);
 HEAP8[$$index3855>>0] = 0;
 $$index3856 = ((($15)) + 3841|0);
 HEAP8[$$index3856>>0] = 0;
 $$index3857 = ((($15)) + 3842|0);
 HEAP8[$$index3857>>0] = 0;
 $$index3858 = ((($15)) + 3843|0);
 HEAP8[$$index3858>>0] = 0;
 $$index3859 = ((($15)) + 3844|0);
 HEAP8[$$index3859>>0] = 0;
 $$index3860 = ((($15)) + 3845|0);
 HEAP8[$$index3860>>0] = 0;
 $$index3861 = ((($15)) + 3846|0);
 HEAP8[$$index3861>>0] = 0;
 $$index3862 = ((($15)) + 3847|0);
 HEAP8[$$index3862>>0] = 0;
 $$index3863 = ((($15)) + 3848|0);
 HEAP8[$$index3863>>0] = 0;
 $$index3864 = ((($15)) + 3849|0);
 HEAP8[$$index3864>>0] = 0;
 $$index3865 = ((($15)) + 3850|0);
 HEAP8[$$index3865>>0] = 0;
 $$index3866 = ((($15)) + 3851|0);
 HEAP8[$$index3866>>0] = 0;
 $$index3867 = ((($15)) + 3852|0);
 HEAP8[$$index3867>>0] = 0;
 $$index3868 = ((($15)) + 3853|0);
 HEAP8[$$index3868>>0] = 0;
 $$index3869 = ((($15)) + 3854|0);
 HEAP8[$$index3869>>0] = 0;
 $$index3870 = ((($15)) + 3855|0);
 HEAP8[$$index3870>>0] = 0;
 $$index3871 = ((($15)) + 3856|0);
 HEAP8[$$index3871>>0] = 0;
 $$index3872 = ((($15)) + 3857|0);
 HEAP8[$$index3872>>0] = 0;
 $$index3873 = ((($15)) + 3858|0);
 HEAP8[$$index3873>>0] = 0;
 $$index3874 = ((($15)) + 3859|0);
 HEAP8[$$index3874>>0] = 0;
 $$index3875 = ((($15)) + 3860|0);
 HEAP8[$$index3875>>0] = 0;
 $$index3876 = ((($15)) + 3861|0);
 HEAP8[$$index3876>>0] = 0;
 $$index3877 = ((($15)) + 3862|0);
 HEAP8[$$index3877>>0] = 0;
 $$index3878 = ((($15)) + 3863|0);
 HEAP8[$$index3878>>0] = 0;
 $$index3879 = ((($15)) + 3864|0);
 HEAP8[$$index3879>>0] = 0;
 $$index3880 = ((($15)) + 3865|0);
 HEAP8[$$index3880>>0] = 0;
 $$index3881 = ((($15)) + 3866|0);
 HEAP8[$$index3881>>0] = 0;
 $$index3882 = ((($15)) + 3867|0);
 HEAP8[$$index3882>>0] = 0;
 $$index3883 = ((($15)) + 3868|0);
 HEAP8[$$index3883>>0] = 0;
 $$index3884 = ((($15)) + 3869|0);
 HEAP8[$$index3884>>0] = 0;
 $$index3885 = ((($15)) + 3870|0);
 HEAP8[$$index3885>>0] = 0;
 $$index3886 = ((($15)) + 3871|0);
 HEAP8[$$index3886>>0] = 0;
 $$index3887 = ((($15)) + 3872|0);
 HEAP8[$$index3887>>0] = 0;
 $$index3888 = ((($15)) + 3873|0);
 HEAP8[$$index3888>>0] = 0;
 $$index3889 = ((($15)) + 3874|0);
 HEAP8[$$index3889>>0] = 0;
 $$index3890 = ((($15)) + 3875|0);
 HEAP8[$$index3890>>0] = 0;
 $$index3891 = ((($15)) + 3876|0);
 HEAP8[$$index3891>>0] = 0;
 $$index3892 = ((($15)) + 3877|0);
 HEAP8[$$index3892>>0] = 0;
 $$index3893 = ((($15)) + 3878|0);
 HEAP8[$$index3893>>0] = 0;
 $$index3894 = ((($15)) + 3879|0);
 HEAP8[$$index3894>>0] = 0;
 $$index3895 = ((($15)) + 3880|0);
 HEAP8[$$index3895>>0] = 0;
 $$index3896 = ((($15)) + 3881|0);
 HEAP8[$$index3896>>0] = 0;
 $$index3897 = ((($15)) + 3882|0);
 HEAP8[$$index3897>>0] = 0;
 $$index3898 = ((($15)) + 3883|0);
 HEAP8[$$index3898>>0] = 0;
 $$index3899 = ((($15)) + 3884|0);
 HEAP8[$$index3899>>0] = 0;
 $$index3900 = ((($15)) + 3885|0);
 HEAP8[$$index3900>>0] = 0;
 $$index3901 = ((($15)) + 3886|0);
 HEAP8[$$index3901>>0] = 0;
 $$index3902 = ((($15)) + 3887|0);
 HEAP8[$$index3902>>0] = 0;
 $$index3903 = ((($15)) + 3888|0);
 HEAP8[$$index3903>>0] = 0;
 $$index3904 = ((($15)) + 3889|0);
 HEAP8[$$index3904>>0] = 0;
 $$index3905 = ((($15)) + 3890|0);
 HEAP8[$$index3905>>0] = 0;
 $$index3906 = ((($15)) + 3891|0);
 HEAP8[$$index3906>>0] = 0;
 $$index3907 = ((($15)) + 3892|0);
 HEAP8[$$index3907>>0] = 0;
 $$index3908 = ((($15)) + 3893|0);
 HEAP8[$$index3908>>0] = 0;
 $$index3909 = ((($15)) + 3894|0);
 HEAP8[$$index3909>>0] = 0;
 $$index3910 = ((($15)) + 3895|0);
 HEAP8[$$index3910>>0] = 0;
 $$index3911 = ((($15)) + 3896|0);
 HEAP8[$$index3911>>0] = 0;
 $$index3912 = ((($15)) + 3897|0);
 HEAP8[$$index3912>>0] = 0;
 $$index3913 = ((($15)) + 3898|0);
 HEAP8[$$index3913>>0] = 0;
 $$index3914 = ((($15)) + 3899|0);
 HEAP8[$$index3914>>0] = 0;
 $$index3915 = ((($15)) + 3900|0);
 HEAP8[$$index3915>>0] = 0;
 $$index3916 = ((($15)) + 3901|0);
 HEAP8[$$index3916>>0] = 0;
 $$index3917 = ((($15)) + 3902|0);
 HEAP8[$$index3917>>0] = 0;
 $$index3918 = ((($15)) + 3903|0);
 HEAP8[$$index3918>>0] = 0;
 $$index3919 = ((($15)) + 3904|0);
 HEAP8[$$index3919>>0] = 0;
 $$index3920 = ((($15)) + 3905|0);
 HEAP8[$$index3920>>0] = 0;
 $$index3921 = ((($15)) + 3906|0);
 HEAP8[$$index3921>>0] = 0;
 $$index3922 = ((($15)) + 3907|0);
 HEAP8[$$index3922>>0] = 0;
 $$index3923 = ((($15)) + 3908|0);
 HEAP8[$$index3923>>0] = 0;
 $$index3924 = ((($15)) + 3909|0);
 HEAP8[$$index3924>>0] = 0;
 $$index3925 = ((($15)) + 3910|0);
 HEAP8[$$index3925>>0] = 0;
 $$index3926 = ((($15)) + 3911|0);
 HEAP8[$$index3926>>0] = 0;
 $$index3927 = ((($15)) + 3912|0);
 HEAP8[$$index3927>>0] = 0;
 $$index3928 = ((($15)) + 3913|0);
 HEAP8[$$index3928>>0] = 0;
 $$index3929 = ((($15)) + 3914|0);
 HEAP8[$$index3929>>0] = 0;
 $$index3930 = ((($15)) + 3915|0);
 HEAP8[$$index3930>>0] = 0;
 $$index3931 = ((($15)) + 3916|0);
 HEAP8[$$index3931>>0] = 0;
 $$index3932 = ((($15)) + 3917|0);
 HEAP8[$$index3932>>0] = 0;
 $$index3933 = ((($15)) + 3918|0);
 HEAP8[$$index3933>>0] = 0;
 $$index3934 = ((($15)) + 3919|0);
 HEAP8[$$index3934>>0] = 0;
 $$index3935 = ((($15)) + 3920|0);
 HEAP8[$$index3935>>0] = 0;
 $$index3936 = ((($15)) + 3921|0);
 HEAP8[$$index3936>>0] = 0;
 $$index3937 = ((($15)) + 3922|0);
 HEAP8[$$index3937>>0] = 0;
 $$index3938 = ((($15)) + 3923|0);
 HEAP8[$$index3938>>0] = 0;
 $$index3939 = ((($15)) + 3924|0);
 HEAP8[$$index3939>>0] = 0;
 $$index3940 = ((($15)) + 3925|0);
 HEAP8[$$index3940>>0] = 0;
 $$index3941 = ((($15)) + 3926|0);
 HEAP8[$$index3941>>0] = 0;
 $$index3942 = ((($15)) + 3927|0);
 HEAP8[$$index3942>>0] = 0;
 $$index3943 = ((($15)) + 3928|0);
 HEAP8[$$index3943>>0] = 0;
 $$index3944 = ((($15)) + 3929|0);
 HEAP8[$$index3944>>0] = 0;
 $$index3945 = ((($15)) + 3930|0);
 HEAP8[$$index3945>>0] = 0;
 $$index3946 = ((($15)) + 3931|0);
 HEAP8[$$index3946>>0] = 0;
 $$index3947 = ((($15)) + 3932|0);
 HEAP8[$$index3947>>0] = 0;
 $$index3948 = ((($15)) + 3933|0);
 HEAP8[$$index3948>>0] = 0;
 $$index3949 = ((($15)) + 3934|0);
 HEAP8[$$index3949>>0] = 0;
 $$index3950 = ((($15)) + 3935|0);
 HEAP8[$$index3950>>0] = 0;
 $$index3951 = ((($15)) + 3936|0);
 HEAP8[$$index3951>>0] = 0;
 $$index3952 = ((($15)) + 3937|0);
 HEAP8[$$index3952>>0] = 0;
 $$index3953 = ((($15)) + 3938|0);
 HEAP8[$$index3953>>0] = 0;
 $$index3954 = ((($15)) + 3939|0);
 HEAP8[$$index3954>>0] = 0;
 $$index3955 = ((($15)) + 3940|0);
 HEAP8[$$index3955>>0] = 0;
 $$index3956 = ((($15)) + 3941|0);
 HEAP8[$$index3956>>0] = 0;
 $$index3957 = ((($15)) + 3942|0);
 HEAP8[$$index3957>>0] = 0;
 $$index3958 = ((($15)) + 3943|0);
 HEAP8[$$index3958>>0] = 0;
 $$index3959 = ((($15)) + 3944|0);
 HEAP8[$$index3959>>0] = 0;
 $$index3960 = ((($15)) + 3945|0);
 HEAP8[$$index3960>>0] = 0;
 $$index3961 = ((($15)) + 3946|0);
 HEAP8[$$index3961>>0] = 0;
 $$index3962 = ((($15)) + 3947|0);
 HEAP8[$$index3962>>0] = 0;
 $$index3963 = ((($15)) + 3948|0);
 HEAP8[$$index3963>>0] = 0;
 $$index3964 = ((($15)) + 3949|0);
 HEAP8[$$index3964>>0] = 0;
 $$index3965 = ((($15)) + 3950|0);
 HEAP8[$$index3965>>0] = 0;
 $$index3966 = ((($15)) + 3951|0);
 HEAP8[$$index3966>>0] = 0;
 $$index3967 = ((($15)) + 3952|0);
 HEAP8[$$index3967>>0] = 0;
 $$index3968 = ((($15)) + 3953|0);
 HEAP8[$$index3968>>0] = 0;
 $$index3969 = ((($15)) + 3954|0);
 HEAP8[$$index3969>>0] = 0;
 $$index3970 = ((($15)) + 3955|0);
 HEAP8[$$index3970>>0] = 0;
 $$index3971 = ((($15)) + 3956|0);
 HEAP8[$$index3971>>0] = 0;
 $$index3972 = ((($15)) + 3957|0);
 HEAP8[$$index3972>>0] = 0;
 $$index3973 = ((($15)) + 3958|0);
 HEAP8[$$index3973>>0] = 0;
 $$index3974 = ((($15)) + 3959|0);
 HEAP8[$$index3974>>0] = 0;
 $$index3975 = ((($15)) + 3960|0);
 HEAP8[$$index3975>>0] = 0;
 $$index3976 = ((($15)) + 3961|0);
 HEAP8[$$index3976>>0] = 0;
 $$index3977 = ((($15)) + 3962|0);
 HEAP8[$$index3977>>0] = 0;
 $$index3978 = ((($15)) + 3963|0);
 HEAP8[$$index3978>>0] = 0;
 $$index3979 = ((($15)) + 3964|0);
 HEAP8[$$index3979>>0] = 0;
 $$index3980 = ((($15)) + 3965|0);
 HEAP8[$$index3980>>0] = 0;
 $$index3981 = ((($15)) + 3966|0);
 HEAP8[$$index3981>>0] = 0;
 $$index3982 = ((($15)) + 3967|0);
 HEAP8[$$index3982>>0] = 0;
 $$index3983 = ((($15)) + 3968|0);
 HEAP8[$$index3983>>0] = 0;
 $$index3984 = ((($15)) + 3969|0);
 HEAP8[$$index3984>>0] = 0;
 $$index3985 = ((($15)) + 3970|0);
 HEAP8[$$index3985>>0] = 0;
 $$index3986 = ((($15)) + 3971|0);
 HEAP8[$$index3986>>0] = 0;
 $$index3987 = ((($15)) + 3972|0);
 HEAP8[$$index3987>>0] = 0;
 $$index3988 = ((($15)) + 3973|0);
 HEAP8[$$index3988>>0] = 0;
 $$index3989 = ((($15)) + 3974|0);
 HEAP8[$$index3989>>0] = 0;
 $$index3990 = ((($15)) + 3975|0);
 HEAP8[$$index3990>>0] = 0;
 $$index3991 = ((($15)) + 3976|0);
 HEAP8[$$index3991>>0] = 0;
 $$index3992 = ((($15)) + 3977|0);
 HEAP8[$$index3992>>0] = 0;
 $$index3993 = ((($15)) + 3978|0);
 HEAP8[$$index3993>>0] = 0;
 $$index3994 = ((($15)) + 3979|0);
 HEAP8[$$index3994>>0] = 0;
 $$index3995 = ((($15)) + 3980|0);
 HEAP8[$$index3995>>0] = 0;
 $$index3996 = ((($15)) + 3981|0);
 HEAP8[$$index3996>>0] = 0;
 $$index3997 = ((($15)) + 3982|0);
 HEAP8[$$index3997>>0] = 0;
 $$index3998 = ((($15)) + 3983|0);
 HEAP8[$$index3998>>0] = 0;
 $$index3999 = ((($15)) + 3984|0);
 HEAP8[$$index3999>>0] = 0;
 $$index4000 = ((($15)) + 3985|0);
 HEAP8[$$index4000>>0] = 0;
 $$index4001 = ((($15)) + 3986|0);
 HEAP8[$$index4001>>0] = 0;
 $$index4002 = ((($15)) + 3987|0);
 HEAP8[$$index4002>>0] = 0;
 $$index4003 = ((($15)) + 3988|0);
 HEAP8[$$index4003>>0] = 0;
 $$index4004 = ((($15)) + 3989|0);
 HEAP8[$$index4004>>0] = 0;
 $$index4005 = ((($15)) + 3990|0);
 HEAP8[$$index4005>>0] = 0;
 $$index4006 = ((($15)) + 3991|0);
 HEAP8[$$index4006>>0] = 0;
 $$index4007 = ((($15)) + 3992|0);
 HEAP8[$$index4007>>0] = 0;
 $$index4008 = ((($15)) + 3993|0);
 HEAP8[$$index4008>>0] = 0;
 $$index4009 = ((($15)) + 3994|0);
 HEAP8[$$index4009>>0] = 0;
 $$index4010 = ((($15)) + 3995|0);
 HEAP8[$$index4010>>0] = 0;
 $$index4011 = ((($15)) + 3996|0);
 HEAP8[$$index4011>>0] = 0;
 $$index4012 = ((($15)) + 3997|0);
 HEAP8[$$index4012>>0] = 0;
 $$index4013 = ((($15)) + 3998|0);
 HEAP8[$$index4013>>0] = 0;
 $$index4014 = ((($15)) + 3999|0);
 HEAP8[$$index4014>>0] = 0;
 $$index4015 = ((($15)) + 4000|0);
 HEAP8[$$index4015>>0] = 0;
 $$index4016 = ((($15)) + 4001|0);
 HEAP8[$$index4016>>0] = 0;
 $$index4017 = ((($15)) + 4002|0);
 HEAP8[$$index4017>>0] = 0;
 $$index4018 = ((($15)) + 4003|0);
 HEAP8[$$index4018>>0] = 0;
 $$index4019 = ((($15)) + 4004|0);
 HEAP8[$$index4019>>0] = 0;
 $$index4020 = ((($15)) + 4005|0);
 HEAP8[$$index4020>>0] = 0;
 $$index4021 = ((($15)) + 4006|0);
 HEAP8[$$index4021>>0] = 0;
 $$index4022 = ((($15)) + 4007|0);
 HEAP8[$$index4022>>0] = 0;
 $$index4023 = ((($15)) + 4008|0);
 HEAP8[$$index4023>>0] = 0;
 $$index4024 = ((($15)) + 4009|0);
 HEAP8[$$index4024>>0] = 0;
 $$index4025 = ((($15)) + 4010|0);
 HEAP8[$$index4025>>0] = 0;
 $$index4026 = ((($15)) + 4011|0);
 HEAP8[$$index4026>>0] = 0;
 $$index4027 = ((($15)) + 4012|0);
 HEAP8[$$index4027>>0] = 0;
 $$index4028 = ((($15)) + 4013|0);
 HEAP8[$$index4028>>0] = 0;
 $$index4029 = ((($15)) + 4014|0);
 HEAP8[$$index4029>>0] = 0;
 $$index4030 = ((($15)) + 4015|0);
 HEAP8[$$index4030>>0] = 0;
 $$index4031 = ((($15)) + 4016|0);
 HEAP8[$$index4031>>0] = 0;
 $$index4032 = ((($15)) + 4017|0);
 HEAP8[$$index4032>>0] = 0;
 $$index4033 = ((($15)) + 4018|0);
 HEAP8[$$index4033>>0] = 0;
 $$index4034 = ((($15)) + 4019|0);
 HEAP8[$$index4034>>0] = 0;
 $$index4035 = ((($15)) + 4020|0);
 HEAP8[$$index4035>>0] = 0;
 $$index4036 = ((($15)) + 4021|0);
 HEAP8[$$index4036>>0] = 0;
 $$index4037 = ((($15)) + 4022|0);
 HEAP8[$$index4037>>0] = 0;
 $$index4038 = ((($15)) + 4023|0);
 HEAP8[$$index4038>>0] = 0;
 $$index4039 = ((($15)) + 4024|0);
 HEAP8[$$index4039>>0] = 0;
 $$index4040 = ((($15)) + 4025|0);
 HEAP8[$$index4040>>0] = 0;
 $$index4041 = ((($15)) + 4026|0);
 HEAP8[$$index4041>>0] = 0;
 $$index4042 = ((($15)) + 4027|0);
 HEAP8[$$index4042>>0] = 0;
 $$index4043 = ((($15)) + 4028|0);
 HEAP8[$$index4043>>0] = 0;
 $$index4044 = ((($15)) + 4029|0);
 HEAP8[$$index4044>>0] = 0;
 $$index4045 = ((($15)) + 4030|0);
 HEAP8[$$index4045>>0] = 0;
 $$index4046 = ((($15)) + 4031|0);
 HEAP8[$$index4046>>0] = 0;
 $$index4047 = ((($15)) + 4032|0);
 HEAP8[$$index4047>>0] = 0;
 $$index4048 = ((($15)) + 4033|0);
 HEAP8[$$index4048>>0] = 0;
 $$index4049 = ((($15)) + 4034|0);
 HEAP8[$$index4049>>0] = 0;
 $$index4050 = ((($15)) + 4035|0);
 HEAP8[$$index4050>>0] = 0;
 $$index4051 = ((($15)) + 4036|0);
 HEAP8[$$index4051>>0] = 0;
 $$index4052 = ((($15)) + 4037|0);
 HEAP8[$$index4052>>0] = 0;
 $$index4053 = ((($15)) + 4038|0);
 HEAP8[$$index4053>>0] = 0;
 $$index4054 = ((($15)) + 4039|0);
 HEAP8[$$index4054>>0] = 0;
 $$index4055 = ((($15)) + 4040|0);
 HEAP8[$$index4055>>0] = 0;
 $$index4056 = ((($15)) + 4041|0);
 HEAP8[$$index4056>>0] = 0;
 $$index4057 = ((($15)) + 4042|0);
 HEAP8[$$index4057>>0] = 0;
 $$index4058 = ((($15)) + 4043|0);
 HEAP8[$$index4058>>0] = 0;
 $$index4059 = ((($15)) + 4044|0);
 HEAP8[$$index4059>>0] = 0;
 $$index4060 = ((($15)) + 4045|0);
 HEAP8[$$index4060>>0] = 0;
 $$index4061 = ((($15)) + 4046|0);
 HEAP8[$$index4061>>0] = 0;
 $$index4062 = ((($15)) + 4047|0);
 HEAP8[$$index4062>>0] = 0;
 $$index4063 = ((($15)) + 4048|0);
 HEAP8[$$index4063>>0] = 0;
 $$index4064 = ((($15)) + 4049|0);
 HEAP8[$$index4064>>0] = 0;
 $$index4065 = ((($15)) + 4050|0);
 HEAP8[$$index4065>>0] = 0;
 $$index4066 = ((($15)) + 4051|0);
 HEAP8[$$index4066>>0] = 0;
 $$index4067 = ((($15)) + 4052|0);
 HEAP8[$$index4067>>0] = 0;
 $$index4068 = ((($15)) + 4053|0);
 HEAP8[$$index4068>>0] = 0;
 $$index4069 = ((($15)) + 4054|0);
 HEAP8[$$index4069>>0] = 0;
 $$index4070 = ((($15)) + 4055|0);
 HEAP8[$$index4070>>0] = 0;
 $$index4071 = ((($15)) + 4056|0);
 HEAP8[$$index4071>>0] = 0;
 $$index4072 = ((($15)) + 4057|0);
 HEAP8[$$index4072>>0] = 0;
 $$index4073 = ((($15)) + 4058|0);
 HEAP8[$$index4073>>0] = 0;
 $$index4074 = ((($15)) + 4059|0);
 HEAP8[$$index4074>>0] = 0;
 $$index4075 = ((($15)) + 4060|0);
 HEAP8[$$index4075>>0] = 0;
 $$index4076 = ((($15)) + 4061|0);
 HEAP8[$$index4076>>0] = 0;
 $$index4077 = ((($15)) + 4062|0);
 HEAP8[$$index4077>>0] = 0;
 $$index4078 = ((($15)) + 4063|0);
 HEAP8[$$index4078>>0] = 0;
 $$index4079 = ((($15)) + 4064|0);
 HEAP8[$$index4079>>0] = 0;
 $$index4080 = ((($15)) + 4065|0);
 HEAP8[$$index4080>>0] = 0;
 $$index4081 = ((($15)) + 4066|0);
 HEAP8[$$index4081>>0] = 0;
 $$index4082 = ((($15)) + 4067|0);
 HEAP8[$$index4082>>0] = 0;
 $$index4083 = ((($15)) + 4068|0);
 HEAP8[$$index4083>>0] = 0;
 $$index4084 = ((($15)) + 4069|0);
 HEAP8[$$index4084>>0] = 0;
 $$index4085 = ((($15)) + 4070|0);
 HEAP8[$$index4085>>0] = 0;
 $$index4086 = ((($15)) + 4071|0);
 HEAP8[$$index4086>>0] = 0;
 $$index4087 = ((($15)) + 4072|0);
 HEAP8[$$index4087>>0] = 0;
 $$index4088 = ((($15)) + 4073|0);
 HEAP8[$$index4088>>0] = 0;
 $$index4089 = ((($15)) + 4074|0);
 HEAP8[$$index4089>>0] = 0;
 $$index4090 = ((($15)) + 4075|0);
 HEAP8[$$index4090>>0] = 0;
 $$index4091 = ((($15)) + 4076|0);
 HEAP8[$$index4091>>0] = 0;
 $$index4092 = ((($15)) + 4077|0);
 HEAP8[$$index4092>>0] = 0;
 $$index4093 = ((($15)) + 4078|0);
 HEAP8[$$index4093>>0] = 0;
 $$index4094 = ((($15)) + 4079|0);
 HEAP8[$$index4094>>0] = 0;
 $$index4095 = ((($15)) + 4080|0);
 HEAP8[$$index4095>>0] = 0;
 $$index4096 = ((($15)) + 4081|0);
 HEAP8[$$index4096>>0] = 0;
 $$index4097 = ((($15)) + 4082|0);
 HEAP8[$$index4097>>0] = 0;
 $$index4098 = ((($15)) + 4083|0);
 HEAP8[$$index4098>>0] = 0;
 $$index4099 = ((($15)) + 4084|0);
 HEAP8[$$index4099>>0] = 0;
 $$index4100 = ((($15)) + 4085|0);
 HEAP8[$$index4100>>0] = 0;
 $$index4101 = ((($15)) + 4086|0);
 HEAP8[$$index4101>>0] = 0;
 $$index4102 = ((($15)) + 4087|0);
 HEAP8[$$index4102>>0] = 0;
 $$index4103 = ((($15)) + 4088|0);
 HEAP8[$$index4103>>0] = 0;
 $$index4104 = ((($15)) + 4089|0);
 HEAP8[$$index4104>>0] = 0;
 $$index4105 = ((($15)) + 4090|0);
 HEAP8[$$index4105>>0] = 0;
 $$index4106 = ((($15)) + 4091|0);
 HEAP8[$$index4106>>0] = 0;
 $$index4107 = ((($15)) + 4092|0);
 HEAP8[$$index4107>>0] = 0;
 $$index4108 = ((($15)) + 4093|0);
 HEAP8[$$index4108>>0] = 0;
 $$index4109 = ((($15)) + 4094|0);
 HEAP8[$$index4109>>0] = 0;
 $$index4110 = ((($15)) + 4095|0);
 HEAP8[$$index4110>>0] = 0;
 HEAP32[$16>>2] = 0;
 $$index4112 = ((($16)) + 8|0);
 $35 = $$index4112;
 $36 = $35;
 HEAP32[$36>>2] = 0;
 $37 = (($35) + 4)|0;
 $38 = $37;
 HEAP32[$38>>2] = 0;
 $$index4113 = ((($16)) + 16|0);
 $39 = $$index4113;
 $40 = $39;
 HEAP32[$40>>2] = 0;
 $41 = (($39) + 4)|0;
 $42 = $41;
 HEAP32[$42>>2] = 0;
 HEAP32[$$ptr>>2] = 1109;
 $$ptr$index16400 = ((($$ptr)) + 8|0);
 $43 = $$ptr$index16400;
 $44 = $43;
 HEAP32[$44>>2] = 52;
 $45 = (($43) + 4)|0;
 $46 = $45;
 HEAP32[$46>>2] = 0;
 ____slice_expr_error($$ptr,58,0,13,0,0,0,0,0,4096,0);
 $47 = (_i64Subtract(0,0,0,0)|0);
 $48 = tempRet0;
 $49 = (_i64Subtract(4096,0,0,0)|0);
 $50 = tempRet0;
 HEAP32[$17>>2] = 0;
 $$index16402 = ((($17)) + 8|0);
 $51 = $$index16402;
 $52 = $51;
 HEAP32[$52>>2] = 0;
 $53 = (($51) + 4)|0;
 $54 = $53;
 HEAP32[$54>>2] = 0;
 $$index16403 = ((($17)) + 16|0);
 $55 = $$index16403;
 $56 = $55;
 HEAP32[$56>>2] = 0;
 $57 = (($55) + 4)|0;
 $58 = $57;
 HEAP32[$58>>2] = 0;
 HEAP32[$17>>2] = $15;
 $59 = ((($17)) + 8|0);
 $60 = $59;
 $61 = $60;
 HEAP32[$61>>2] = $47;
 $62 = (($60) + 4)|0;
 $63 = $62;
 HEAP32[$63>>2] = $48;
 $64 = ((($17)) + 16|0);
 $65 = $64;
 $66 = $65;
 HEAP32[$66>>2] = $49;
 $67 = (($65) + 4)|0;
 $68 = $67;
 HEAP32[$68>>2] = $50;
 $$field16405 = HEAP32[$17>>2]|0;
 $$index16407 = ((($17)) + 8|0);
 $69 = $$index16407;
 $70 = $69;
 $71 = HEAP32[$70>>2]|0;
 $72 = (($69) + 4)|0;
 $73 = $72;
 $74 = HEAP32[$73>>2]|0;
 $$index16410 = ((($17)) + 16|0);
 $75 = $$index16410;
 $76 = $75;
 $77 = HEAP32[$76>>2]|0;
 $78 = (($75) + 4)|0;
 $79 = $78;
 $80 = HEAP32[$79>>2]|0;
 HEAP32[$16>>2] = $$field16405;
 $$index16414 = ((($16)) + 8|0);
 $81 = $$index16414;
 $82 = $81;
 HEAP32[$82>>2] = $71;
 $83 = (($81) + 4)|0;
 $84 = $83;
 HEAP32[$84>>2] = $74;
 $$index16415 = ((($16)) + 16|0);
 $85 = $$index16415;
 $86 = $85;
 HEAP32[$86>>2] = $77;
 $87 = (($85) + 4)|0;
 $88 = $87;
 HEAP32[$88>>2] = $80;
 $$field16417 = HEAP32[$14>>2]|0;
 $$index16419 = ((($14)) + 8|0);
 $89 = $$index16419;
 $90 = $89;
 $91 = HEAP32[$90>>2]|0;
 $92 = (($89) + 4)|0;
 $93 = $92;
 $94 = HEAP32[$93>>2]|0;
 $$index16422 = ((($14)) + 16|0);
 $95 = $$index16422;
 $96 = $95;
 $97 = HEAP32[$96>>2]|0;
 $98 = (($95) + 4)|0;
 $99 = $98;
 $100 = HEAP32[$99>>2]|0;
 HEAP32[$$ptr1>>2] = $$field16417;
 $$ptr1$index16425 = ((($$ptr1)) + 8|0);
 $101 = $$ptr1$index16425;
 $102 = $101;
 HEAP32[$102>>2] = $91;
 $103 = (($101) + 4)|0;
 $104 = $103;
 HEAP32[$104>>2] = $94;
 $$ptr1$index16426 = ((($$ptr1)) + 16|0);
 $105 = $$ptr1$index16426;
 $106 = $105;
 HEAP32[$106>>2] = $97;
 $107 = (($105) + 4)|0;
 $108 = $107;
 HEAP32[$108>>2] = $100;
 (__fmt_4_bprintln($16,$$ptr1)|0);
 $109 = tempRet0;
 $110 = HEAP32[$13>>2]|0;
 $$index16430 = ((($16)) + 8|0);
 $111 = $$index16430;
 $112 = $111;
 $113 = HEAP32[$112>>2]|0;
 $114 = (($111) + 4)|0;
 $115 = $114;
 $116 = HEAP32[$115>>2]|0;
 $$field16437 = HEAP32[$16>>2]|0;
 $$index16442 = ((($16)) + 16|0);
 $117 = $$index16442;
 $118 = $117;
 $119 = HEAP32[$118>>2]|0;
 $120 = (($117) + 4)|0;
 $121 = $120;
 $122 = HEAP32[$121>>2]|0;
 HEAP32[$$ptr2>>2] = 1161;
 $$ptr2$index16445 = ((($$ptr2)) + 8|0);
 $123 = $$ptr2$index16445;
 $124 = $123;
 HEAP32[$124>>2] = 52;
 $125 = (($123) + 4)|0;
 $126 = $125;
 HEAP32[$126>>2] = 0;
 ____slice_expr_error($$ptr2,60,0,18,0,0,0,$113,$116,$119,$122);
 $127 = (_i64Subtract(($113|0),($116|0),0,0)|0);
 $128 = tempRet0;
 $129 = (_i64Subtract(($119|0),($122|0),0,0)|0);
 $130 = tempRet0;
 HEAP32[$18>>2] = 0;
 $$index16447 = ((($18)) + 8|0);
 $131 = $$index16447;
 $132 = $131;
 HEAP32[$132>>2] = 0;
 $133 = (($131) + 4)|0;
 $134 = $133;
 HEAP32[$134>>2] = 0;
 $$index16448 = ((($18)) + 16|0);
 $135 = $$index16448;
 $136 = $135;
 HEAP32[$136>>2] = 0;
 $137 = (($135) + 4)|0;
 $138 = $137;
 HEAP32[$138>>2] = 0;
 HEAP32[$18>>2] = $$field16437;
 $139 = ((($18)) + 8|0);
 $140 = $139;
 $141 = $140;
 HEAP32[$141>>2] = $127;
 $142 = (($140) + 4)|0;
 $143 = $142;
 HEAP32[$143>>2] = $128;
 $144 = ((($18)) + 16|0);
 $145 = $144;
 $146 = $145;
 HEAP32[$146>>2] = $129;
 $147 = (($145) + 4)|0;
 $148 = $147;
 HEAP32[$148>>2] = $130;
 $$field16450 = HEAP32[$18>>2]|0;
 $$index16452 = ((($18)) + 8|0);
 $149 = $$index16452;
 $150 = $149;
 $151 = HEAP32[$150>>2]|0;
 $152 = (($149) + 4)|0;
 $153 = $152;
 $154 = HEAP32[$153>>2]|0;
 $$index16455 = ((($18)) + 16|0);
 $155 = $$index16455;
 $156 = $155;
 $157 = HEAP32[$156>>2]|0;
 $158 = (($155) + 4)|0;
 $159 = $158;
 $160 = HEAP32[$159>>2]|0;
 HEAP32[$$ptr3>>2] = $$field16450;
 $$ptr3$index16458 = ((($$ptr3)) + 8|0);
 $161 = $$ptr3$index16458;
 $162 = $161;
 HEAP32[$162>>2] = $151;
 $163 = (($161) + 4)|0;
 $164 = $163;
 HEAP32[$164>>2] = $154;
 $$ptr3$index16459 = ((($$ptr3)) + 16|0);
 $165 = $$ptr3$index16459;
 $166 = $165;
 HEAP32[$166>>2] = $157;
 $167 = (($165) + 4)|0;
 $168 = $167;
 HEAP32[$168>>2] = $160;
 __os_linux_10_write($0,$110,$$ptr3);
 $$index16466 = ((($16)) + 8|0);
 $169 = $$index16466;
 $170 = $169;
 $171 = HEAP32[$170>>2]|0;
 $172 = (($169) + 4)|0;
 $173 = $172;
 $174 = HEAP32[$173>>2]|0;
 tempRet0 = ($174);
 STACKTOP = sp;return ($171|0);
}
function __fmt_4_fprintf($fd,$fmt$ptr,$args$ptr) {
 $fd = $fd|0;
 $fmt$ptr = $fmt$ptr|0;
 $args$ptr = $args$ptr|0;
 var $$field16413 = 0, $$field16425 = 0, $$field16431 = 0, $$field16452 = 0, $$field16465 = 0, $$index100 = 0, $$index1000 = 0, $$index1001 = 0, $$index1002 = 0, $$index1003 = 0, $$index1004 = 0, $$index1005 = 0, $$index1006 = 0, $$index1007 = 0, $$index1008 = 0, $$index1009 = 0, $$index101 = 0, $$index1010 = 0, $$index1011 = 0, $$index1012 = 0;
 var $$index1013 = 0, $$index1014 = 0, $$index1015 = 0, $$index1016 = 0, $$index1017 = 0, $$index1018 = 0, $$index1019 = 0, $$index102 = 0, $$index1020 = 0, $$index1021 = 0, $$index1022 = 0, $$index1023 = 0, $$index1024 = 0, $$index1025 = 0, $$index1026 = 0, $$index1027 = 0, $$index1028 = 0, $$index1029 = 0, $$index103 = 0, $$index1030 = 0;
 var $$index1031 = 0, $$index1032 = 0, $$index1033 = 0, $$index1034 = 0, $$index1035 = 0, $$index1036 = 0, $$index1037 = 0, $$index1038 = 0, $$index1039 = 0, $$index104 = 0, $$index1040 = 0, $$index1041 = 0, $$index1042 = 0, $$index1043 = 0, $$index1044 = 0, $$index1045 = 0, $$index1046 = 0, $$index1047 = 0, $$index1048 = 0, $$index1049 = 0;
 var $$index105 = 0, $$index1050 = 0, $$index1051 = 0, $$index1052 = 0, $$index1053 = 0, $$index1054 = 0, $$index1055 = 0, $$index1056 = 0, $$index1057 = 0, $$index1058 = 0, $$index1059 = 0, $$index106 = 0, $$index1060 = 0, $$index1061 = 0, $$index1062 = 0, $$index1063 = 0, $$index1064 = 0, $$index1065 = 0, $$index1066 = 0, $$index1067 = 0;
 var $$index1068 = 0, $$index1069 = 0, $$index107 = 0, $$index1070 = 0, $$index1071 = 0, $$index1072 = 0, $$index1073 = 0, $$index1074 = 0, $$index1075 = 0, $$index1076 = 0, $$index1077 = 0, $$index1078 = 0, $$index1079 = 0, $$index108 = 0, $$index1080 = 0, $$index1081 = 0, $$index1082 = 0, $$index1083 = 0, $$index1084 = 0, $$index1085 = 0;
 var $$index1086 = 0, $$index1087 = 0, $$index1088 = 0, $$index1089 = 0, $$index109 = 0, $$index1090 = 0, $$index1091 = 0, $$index1092 = 0, $$index1093 = 0, $$index1094 = 0, $$index1095 = 0, $$index1096 = 0, $$index1097 = 0, $$index1098 = 0, $$index1099 = 0, $$index110 = 0, $$index1100 = 0, $$index1101 = 0, $$index1102 = 0, $$index1103 = 0;
 var $$index1104 = 0, $$index1105 = 0, $$index1106 = 0, $$index1107 = 0, $$index1108 = 0, $$index1109 = 0, $$index111 = 0, $$index1110 = 0, $$index1111 = 0, $$index1112 = 0, $$index1113 = 0, $$index1114 = 0, $$index1115 = 0, $$index1116 = 0, $$index1117 = 0, $$index1118 = 0, $$index1119 = 0, $$index112 = 0, $$index1120 = 0, $$index1121 = 0;
 var $$index1122 = 0, $$index1123 = 0, $$index1124 = 0, $$index1125 = 0, $$index1126 = 0, $$index1127 = 0, $$index1128 = 0, $$index1129 = 0, $$index113 = 0, $$index1130 = 0, $$index1131 = 0, $$index1132 = 0, $$index1133 = 0, $$index1134 = 0, $$index1135 = 0, $$index1136 = 0, $$index1137 = 0, $$index1138 = 0, $$index1139 = 0, $$index114 = 0;
 var $$index1140 = 0, $$index1141 = 0, $$index1142 = 0, $$index1143 = 0, $$index1144 = 0, $$index1145 = 0, $$index1146 = 0, $$index1147 = 0, $$index1148 = 0, $$index1149 = 0, $$index115 = 0, $$index1150 = 0, $$index1151 = 0, $$index1152 = 0, $$index1153 = 0, $$index1154 = 0, $$index1155 = 0, $$index1156 = 0, $$index1157 = 0, $$index1158 = 0;
 var $$index1159 = 0, $$index116 = 0, $$index1160 = 0, $$index1161 = 0, $$index1162 = 0, $$index1163 = 0, $$index1164 = 0, $$index1165 = 0, $$index1166 = 0, $$index1167 = 0, $$index1168 = 0, $$index1169 = 0, $$index117 = 0, $$index1170 = 0, $$index1171 = 0, $$index1172 = 0, $$index1173 = 0, $$index1174 = 0, $$index1175 = 0, $$index1176 = 0;
 var $$index1177 = 0, $$index1178 = 0, $$index1179 = 0, $$index118 = 0, $$index1180 = 0, $$index1181 = 0, $$index1182 = 0, $$index1183 = 0, $$index1184 = 0, $$index1185 = 0, $$index1186 = 0, $$index1187 = 0, $$index1188 = 0, $$index1189 = 0, $$index119 = 0, $$index1190 = 0, $$index1191 = 0, $$index1192 = 0, $$index1193 = 0, $$index1194 = 0;
 var $$index1195 = 0, $$index1196 = 0, $$index1197 = 0, $$index1198 = 0, $$index1199 = 0, $$index120 = 0, $$index1200 = 0, $$index1201 = 0, $$index1202 = 0, $$index1203 = 0, $$index1204 = 0, $$index1205 = 0, $$index1206 = 0, $$index1207 = 0, $$index1208 = 0, $$index1209 = 0, $$index121 = 0, $$index1210 = 0, $$index1211 = 0, $$index1212 = 0;
 var $$index1213 = 0, $$index1214 = 0, $$index1215 = 0, $$index1216 = 0, $$index1217 = 0, $$index1218 = 0, $$index1219 = 0, $$index122 = 0, $$index1220 = 0, $$index1221 = 0, $$index1222 = 0, $$index1223 = 0, $$index1224 = 0, $$index1225 = 0, $$index1226 = 0, $$index1227 = 0, $$index1228 = 0, $$index1229 = 0, $$index123 = 0, $$index1230 = 0;
 var $$index1231 = 0, $$index1232 = 0, $$index1233 = 0, $$index1234 = 0, $$index1235 = 0, $$index1236 = 0, $$index1237 = 0, $$index1238 = 0, $$index1239 = 0, $$index124 = 0, $$index1240 = 0, $$index1241 = 0, $$index1242 = 0, $$index1243 = 0, $$index1244 = 0, $$index1245 = 0, $$index1246 = 0, $$index1247 = 0, $$index1248 = 0, $$index1249 = 0;
 var $$index125 = 0, $$index1250 = 0, $$index1251 = 0, $$index1252 = 0, $$index1253 = 0, $$index1254 = 0, $$index1255 = 0, $$index1256 = 0, $$index1257 = 0, $$index1258 = 0, $$index1259 = 0, $$index126 = 0, $$index1260 = 0, $$index1261 = 0, $$index1262 = 0, $$index1263 = 0, $$index1264 = 0, $$index1265 = 0, $$index1266 = 0, $$index1267 = 0;
 var $$index1268 = 0, $$index1269 = 0, $$index127 = 0, $$index1270 = 0, $$index1271 = 0, $$index1272 = 0, $$index1273 = 0, $$index1274 = 0, $$index1275 = 0, $$index1276 = 0, $$index1277 = 0, $$index1278 = 0, $$index1279 = 0, $$index128 = 0, $$index1280 = 0, $$index1281 = 0, $$index1282 = 0, $$index1283 = 0, $$index1284 = 0, $$index1285 = 0;
 var $$index1286 = 0, $$index1287 = 0, $$index1288 = 0, $$index1289 = 0, $$index129 = 0, $$index1290 = 0, $$index1291 = 0, $$index1292 = 0, $$index1293 = 0, $$index1294 = 0, $$index1295 = 0, $$index1296 = 0, $$index1297 = 0, $$index1298 = 0, $$index1299 = 0, $$index130 = 0, $$index1300 = 0, $$index1301 = 0, $$index1302 = 0, $$index1303 = 0;
 var $$index1304 = 0, $$index1305 = 0, $$index1306 = 0, $$index1307 = 0, $$index1308 = 0, $$index1309 = 0, $$index131 = 0, $$index1310 = 0, $$index1311 = 0, $$index1312 = 0, $$index1313 = 0, $$index1314 = 0, $$index1315 = 0, $$index1316 = 0, $$index1317 = 0, $$index1318 = 0, $$index1319 = 0, $$index132 = 0, $$index1320 = 0, $$index1321 = 0;
 var $$index1322 = 0, $$index1323 = 0, $$index1324 = 0, $$index1325 = 0, $$index1326 = 0, $$index1327 = 0, $$index1328 = 0, $$index1329 = 0, $$index133 = 0, $$index1330 = 0, $$index1331 = 0, $$index1332 = 0, $$index1333 = 0, $$index1334 = 0, $$index1335 = 0, $$index1336 = 0, $$index1337 = 0, $$index1338 = 0, $$index1339 = 0, $$index134 = 0;
 var $$index1340 = 0, $$index1341 = 0, $$index1342 = 0, $$index1343 = 0, $$index1344 = 0, $$index1345 = 0, $$index1346 = 0, $$index1347 = 0, $$index1348 = 0, $$index1349 = 0, $$index135 = 0, $$index1350 = 0, $$index1351 = 0, $$index1352 = 0, $$index1353 = 0, $$index1354 = 0, $$index1355 = 0, $$index1356 = 0, $$index1357 = 0, $$index1358 = 0;
 var $$index1359 = 0, $$index136 = 0, $$index1360 = 0, $$index1361 = 0, $$index1362 = 0, $$index1363 = 0, $$index1364 = 0, $$index1365 = 0, $$index1366 = 0, $$index1367 = 0, $$index1368 = 0, $$index1369 = 0, $$index137 = 0, $$index1370 = 0, $$index1371 = 0, $$index1372 = 0, $$index1373 = 0, $$index1374 = 0, $$index1375 = 0, $$index1376 = 0;
 var $$index1377 = 0, $$index1378 = 0, $$index1379 = 0, $$index138 = 0, $$index1380 = 0, $$index1381 = 0, $$index1382 = 0, $$index1383 = 0, $$index1384 = 0, $$index1385 = 0, $$index1386 = 0, $$index1387 = 0, $$index1388 = 0, $$index1389 = 0, $$index139 = 0, $$index1390 = 0, $$index1391 = 0, $$index1392 = 0, $$index1393 = 0, $$index1394 = 0;
 var $$index1395 = 0, $$index1396 = 0, $$index1397 = 0, $$index1398 = 0, $$index1399 = 0, $$index14 = 0, $$index140 = 0, $$index1400 = 0, $$index1401 = 0, $$index1402 = 0, $$index1403 = 0, $$index1404 = 0, $$index1405 = 0, $$index1406 = 0, $$index1407 = 0, $$index1408 = 0, $$index1409 = 0, $$index141 = 0, $$index1410 = 0, $$index1411 = 0;
 var $$index1412 = 0, $$index1413 = 0, $$index1414 = 0, $$index1415 = 0, $$index1416 = 0, $$index1417 = 0, $$index1418 = 0, $$index1419 = 0, $$index142 = 0, $$index1420 = 0, $$index1421 = 0, $$index1422 = 0, $$index1423 = 0, $$index1424 = 0, $$index1425 = 0, $$index1426 = 0, $$index1427 = 0, $$index1428 = 0, $$index1429 = 0, $$index143 = 0;
 var $$index1430 = 0, $$index1431 = 0, $$index1432 = 0, $$index1433 = 0, $$index1434 = 0, $$index1435 = 0, $$index1436 = 0, $$index1437 = 0, $$index1438 = 0, $$index1439 = 0, $$index144 = 0, $$index1440 = 0, $$index1441 = 0, $$index1442 = 0, $$index1443 = 0, $$index1444 = 0, $$index1445 = 0, $$index1446 = 0, $$index1447 = 0, $$index1448 = 0;
 var $$index1449 = 0, $$index145 = 0, $$index1450 = 0, $$index1451 = 0, $$index1452 = 0, $$index1453 = 0, $$index1454 = 0, $$index1455 = 0, $$index1456 = 0, $$index1457 = 0, $$index1458 = 0, $$index1459 = 0, $$index146 = 0, $$index1460 = 0, $$index1461 = 0, $$index1462 = 0, $$index1463 = 0, $$index1464 = 0, $$index1465 = 0, $$index1466 = 0;
 var $$index1467 = 0, $$index1468 = 0, $$index1469 = 0, $$index147 = 0, $$index1470 = 0, $$index1471 = 0, $$index1472 = 0, $$index1473 = 0, $$index1474 = 0, $$index1475 = 0, $$index1476 = 0, $$index1477 = 0, $$index1478 = 0, $$index1479 = 0, $$index148 = 0, $$index1480 = 0, $$index1481 = 0, $$index1482 = 0, $$index1483 = 0, $$index1484 = 0;
 var $$index1485 = 0, $$index1486 = 0, $$index1487 = 0, $$index1488 = 0, $$index1489 = 0, $$index149 = 0, $$index1490 = 0, $$index1491 = 0, $$index1492 = 0, $$index1493 = 0, $$index1494 = 0, $$index1495 = 0, $$index1496 = 0, $$index1497 = 0, $$index1498 = 0, $$index1499 = 0, $$index150 = 0, $$index1500 = 0, $$index1501 = 0, $$index1502 = 0;
 var $$index1503 = 0, $$index1504 = 0, $$index1505 = 0, $$index1506 = 0, $$index1507 = 0, $$index1508 = 0, $$index1509 = 0, $$index151 = 0, $$index1510 = 0, $$index1511 = 0, $$index1512 = 0, $$index1513 = 0, $$index1514 = 0, $$index1515 = 0, $$index1516 = 0, $$index1517 = 0, $$index1518 = 0, $$index1519 = 0, $$index152 = 0, $$index1520 = 0;
 var $$index1521 = 0, $$index1522 = 0, $$index1523 = 0, $$index1524 = 0, $$index1525 = 0, $$index1526 = 0, $$index1527 = 0, $$index1528 = 0, $$index1529 = 0, $$index153 = 0, $$index1530 = 0, $$index1531 = 0, $$index1532 = 0, $$index1533 = 0, $$index1534 = 0, $$index1535 = 0, $$index1536 = 0, $$index1537 = 0, $$index1538 = 0, $$index1539 = 0;
 var $$index154 = 0, $$index1540 = 0, $$index1541 = 0, $$index1542 = 0, $$index1543 = 0, $$index1544 = 0, $$index1545 = 0, $$index1546 = 0, $$index1547 = 0, $$index1548 = 0, $$index1549 = 0, $$index155 = 0, $$index1550 = 0, $$index1551 = 0, $$index1552 = 0, $$index1553 = 0, $$index1554 = 0, $$index1555 = 0, $$index1556 = 0, $$index1557 = 0;
 var $$index1558 = 0, $$index1559 = 0, $$index156 = 0, $$index1560 = 0, $$index1561 = 0, $$index1562 = 0, $$index1563 = 0, $$index1564 = 0, $$index1565 = 0, $$index1566 = 0, $$index1567 = 0, $$index1568 = 0, $$index1569 = 0, $$index157 = 0, $$index1570 = 0, $$index1571 = 0, $$index1572 = 0, $$index1573 = 0, $$index1574 = 0, $$index1575 = 0;
 var $$index1576 = 0, $$index1577 = 0, $$index1578 = 0, $$index1579 = 0, $$index158 = 0, $$index1580 = 0, $$index1581 = 0, $$index1582 = 0, $$index1583 = 0, $$index1584 = 0, $$index1585 = 0, $$index1586 = 0, $$index1587 = 0, $$index1588 = 0, $$index1589 = 0, $$index159 = 0, $$index1590 = 0, $$index1591 = 0, $$index1592 = 0, $$index1593 = 0;
 var $$index1594 = 0, $$index1595 = 0, $$index1596 = 0, $$index1597 = 0, $$index1598 = 0, $$index1599 = 0, $$index16 = 0, $$index160 = 0, $$index1600 = 0, $$index1601 = 0, $$index1602 = 0, $$index1603 = 0, $$index1604 = 0, $$index1605 = 0, $$index1606 = 0, $$index1607 = 0, $$index1608 = 0, $$index1609 = 0, $$index161 = 0, $$index1610 = 0;
 var $$index1611 = 0, $$index1612 = 0, $$index1613 = 0, $$index1614 = 0, $$index1615 = 0, $$index1616 = 0, $$index1617 = 0, $$index1618 = 0, $$index1619 = 0, $$index162 = 0, $$index1620 = 0, $$index1621 = 0, $$index1622 = 0, $$index1623 = 0, $$index1624 = 0, $$index1625 = 0, $$index1626 = 0, $$index1627 = 0, $$index1628 = 0, $$index1629 = 0;
 var $$index163 = 0, $$index1630 = 0, $$index1631 = 0, $$index1632 = 0, $$index1633 = 0, $$index1634 = 0, $$index1635 = 0, $$index1636 = 0, $$index1637 = 0, $$index1638 = 0, $$index1639 = 0, $$index164 = 0, $$index1640 = 0, $$index1641 = 0, $$index16410 = 0, $$index16411 = 0, $$index16415 = 0, $$index16418 = 0, $$index1642 = 0, $$index16422 = 0;
 var $$index16423 = 0, $$index16427 = 0, $$index1643 = 0, $$index16433 = 0, $$index16436 = 0, $$index1644 = 0, $$index16445 = 0, $$index1645 = 0, $$index16457 = 0, $$index1646 = 0, $$index16462 = 0, $$index16463 = 0, $$index16467 = 0, $$index1647 = 0, $$index16470 = 0, $$index1648 = 0, $$index16481 = 0, $$index1649 = 0, $$index165 = 0, $$index1650 = 0;
 var $$index1651 = 0, $$index1652 = 0, $$index1653 = 0, $$index1654 = 0, $$index1655 = 0, $$index1656 = 0, $$index1657 = 0, $$index1658 = 0, $$index1659 = 0, $$index166 = 0, $$index1660 = 0, $$index1661 = 0, $$index1662 = 0, $$index1663 = 0, $$index1664 = 0, $$index1665 = 0, $$index1666 = 0, $$index1667 = 0, $$index1668 = 0, $$index1669 = 0;
 var $$index167 = 0, $$index1670 = 0, $$index1671 = 0, $$index1672 = 0, $$index1673 = 0, $$index1674 = 0, $$index1675 = 0, $$index1676 = 0, $$index1677 = 0, $$index1678 = 0, $$index1679 = 0, $$index168 = 0, $$index1680 = 0, $$index1681 = 0, $$index1682 = 0, $$index1683 = 0, $$index1684 = 0, $$index1685 = 0, $$index1686 = 0, $$index1687 = 0;
 var $$index1688 = 0, $$index1689 = 0, $$index169 = 0, $$index1690 = 0, $$index1691 = 0, $$index1692 = 0, $$index1693 = 0, $$index1694 = 0, $$index1695 = 0, $$index1696 = 0, $$index1697 = 0, $$index1698 = 0, $$index1699 = 0, $$index170 = 0, $$index1700 = 0, $$index1701 = 0, $$index1702 = 0, $$index1703 = 0, $$index1704 = 0, $$index1705 = 0;
 var $$index1706 = 0, $$index1707 = 0, $$index1708 = 0, $$index1709 = 0, $$index171 = 0, $$index1710 = 0, $$index1711 = 0, $$index1712 = 0, $$index1713 = 0, $$index1714 = 0, $$index1715 = 0, $$index1716 = 0, $$index1717 = 0, $$index1718 = 0, $$index1719 = 0, $$index172 = 0, $$index1720 = 0, $$index1721 = 0, $$index1722 = 0, $$index1723 = 0;
 var $$index1724 = 0, $$index1725 = 0, $$index1726 = 0, $$index1727 = 0, $$index1728 = 0, $$index1729 = 0, $$index173 = 0, $$index1730 = 0, $$index1731 = 0, $$index1732 = 0, $$index1733 = 0, $$index1734 = 0, $$index1735 = 0, $$index1736 = 0, $$index1737 = 0, $$index1738 = 0, $$index1739 = 0, $$index174 = 0, $$index1740 = 0, $$index1741 = 0;
 var $$index1742 = 0, $$index1743 = 0, $$index1744 = 0, $$index1745 = 0, $$index1746 = 0, $$index1747 = 0, $$index1748 = 0, $$index1749 = 0, $$index175 = 0, $$index1750 = 0, $$index1751 = 0, $$index1752 = 0, $$index1753 = 0, $$index1754 = 0, $$index1755 = 0, $$index1756 = 0, $$index1757 = 0, $$index1758 = 0, $$index1759 = 0, $$index176 = 0;
 var $$index1760 = 0, $$index1761 = 0, $$index1762 = 0, $$index1763 = 0, $$index1764 = 0, $$index1765 = 0, $$index1766 = 0, $$index1767 = 0, $$index1768 = 0, $$index1769 = 0, $$index177 = 0, $$index1770 = 0, $$index1771 = 0, $$index1772 = 0, $$index1773 = 0, $$index1774 = 0, $$index1775 = 0, $$index1776 = 0, $$index1777 = 0, $$index1778 = 0;
 var $$index1779 = 0, $$index178 = 0, $$index1780 = 0, $$index1781 = 0, $$index1782 = 0, $$index1783 = 0, $$index1784 = 0, $$index1785 = 0, $$index1786 = 0, $$index1787 = 0, $$index1788 = 0, $$index1789 = 0, $$index179 = 0, $$index1790 = 0, $$index1791 = 0, $$index1792 = 0, $$index1793 = 0, $$index1794 = 0, $$index1795 = 0, $$index1796 = 0;
 var $$index1797 = 0, $$index1798 = 0, $$index1799 = 0, $$index18 = 0, $$index180 = 0, $$index1800 = 0, $$index1801 = 0, $$index1802 = 0, $$index1803 = 0, $$index1804 = 0, $$index1805 = 0, $$index1806 = 0, $$index1807 = 0, $$index1808 = 0, $$index1809 = 0, $$index181 = 0, $$index1810 = 0, $$index1811 = 0, $$index1812 = 0, $$index1813 = 0;
 var $$index1814 = 0, $$index1815 = 0, $$index1816 = 0, $$index1817 = 0, $$index1818 = 0, $$index1819 = 0, $$index182 = 0, $$index1820 = 0, $$index1821 = 0, $$index1822 = 0, $$index1823 = 0, $$index1824 = 0, $$index1825 = 0, $$index1826 = 0, $$index1827 = 0, $$index1828 = 0, $$index1829 = 0, $$index183 = 0, $$index1830 = 0, $$index1831 = 0;
 var $$index1832 = 0, $$index1833 = 0, $$index1834 = 0, $$index1835 = 0, $$index1836 = 0, $$index1837 = 0, $$index1838 = 0, $$index1839 = 0, $$index184 = 0, $$index1840 = 0, $$index1841 = 0, $$index1842 = 0, $$index1843 = 0, $$index1844 = 0, $$index1845 = 0, $$index1846 = 0, $$index1847 = 0, $$index1848 = 0, $$index1849 = 0, $$index185 = 0;
 var $$index1850 = 0, $$index1851 = 0, $$index1852 = 0, $$index1853 = 0, $$index1854 = 0, $$index1855 = 0, $$index1856 = 0, $$index1857 = 0, $$index1858 = 0, $$index1859 = 0, $$index186 = 0, $$index1860 = 0, $$index1861 = 0, $$index1862 = 0, $$index1863 = 0, $$index1864 = 0, $$index1865 = 0, $$index1866 = 0, $$index1867 = 0, $$index1868 = 0;
 var $$index1869 = 0, $$index187 = 0, $$index1870 = 0, $$index1871 = 0, $$index1872 = 0, $$index1873 = 0, $$index1874 = 0, $$index1875 = 0, $$index1876 = 0, $$index1877 = 0, $$index1878 = 0, $$index1879 = 0, $$index188 = 0, $$index1880 = 0, $$index1881 = 0, $$index1882 = 0, $$index1883 = 0, $$index1884 = 0, $$index1885 = 0, $$index1886 = 0;
 var $$index1887 = 0, $$index1888 = 0, $$index1889 = 0, $$index189 = 0, $$index1890 = 0, $$index1891 = 0, $$index1892 = 0, $$index1893 = 0, $$index1894 = 0, $$index1895 = 0, $$index1896 = 0, $$index1897 = 0, $$index1898 = 0, $$index1899 = 0, $$index19 = 0, $$index190 = 0, $$index1900 = 0, $$index1901 = 0, $$index1902 = 0, $$index1903 = 0;
 var $$index1904 = 0, $$index1905 = 0, $$index1906 = 0, $$index1907 = 0, $$index1908 = 0, $$index1909 = 0, $$index191 = 0, $$index1910 = 0, $$index1911 = 0, $$index1912 = 0, $$index1913 = 0, $$index1914 = 0, $$index1915 = 0, $$index1916 = 0, $$index1917 = 0, $$index1918 = 0, $$index1919 = 0, $$index192 = 0, $$index1920 = 0, $$index1921 = 0;
 var $$index1922 = 0, $$index1923 = 0, $$index1924 = 0, $$index1925 = 0, $$index1926 = 0, $$index1927 = 0, $$index1928 = 0, $$index1929 = 0, $$index193 = 0, $$index1930 = 0, $$index1931 = 0, $$index1932 = 0, $$index1933 = 0, $$index1934 = 0, $$index1935 = 0, $$index1936 = 0, $$index1937 = 0, $$index1938 = 0, $$index1939 = 0, $$index194 = 0;
 var $$index1940 = 0, $$index1941 = 0, $$index1942 = 0, $$index1943 = 0, $$index1944 = 0, $$index1945 = 0, $$index1946 = 0, $$index1947 = 0, $$index1948 = 0, $$index1949 = 0, $$index195 = 0, $$index1950 = 0, $$index1951 = 0, $$index1952 = 0, $$index1953 = 0, $$index1954 = 0, $$index1955 = 0, $$index1956 = 0, $$index1957 = 0, $$index1958 = 0;
 var $$index1959 = 0, $$index196 = 0, $$index1960 = 0, $$index1961 = 0, $$index1962 = 0, $$index1963 = 0, $$index1964 = 0, $$index1965 = 0, $$index1966 = 0, $$index1967 = 0, $$index1968 = 0, $$index1969 = 0, $$index197 = 0, $$index1970 = 0, $$index1971 = 0, $$index1972 = 0, $$index1973 = 0, $$index1974 = 0, $$index1975 = 0, $$index1976 = 0;
 var $$index1977 = 0, $$index1978 = 0, $$index1979 = 0, $$index198 = 0, $$index1980 = 0, $$index1981 = 0, $$index1982 = 0, $$index1983 = 0, $$index1984 = 0, $$index1985 = 0, $$index1986 = 0, $$index1987 = 0, $$index1988 = 0, $$index1989 = 0, $$index199 = 0, $$index1990 = 0, $$index1991 = 0, $$index1992 = 0, $$index1993 = 0, $$index1994 = 0;
 var $$index1995 = 0, $$index1996 = 0, $$index1997 = 0, $$index1998 = 0, $$index1999 = 0, $$index200 = 0, $$index2000 = 0, $$index2001 = 0, $$index2002 = 0, $$index2003 = 0, $$index2004 = 0, $$index2005 = 0, $$index2006 = 0, $$index2007 = 0, $$index2008 = 0, $$index2009 = 0, $$index201 = 0, $$index2010 = 0, $$index2011 = 0, $$index2012 = 0;
 var $$index2013 = 0, $$index2014 = 0, $$index2015 = 0, $$index2016 = 0, $$index2017 = 0, $$index2018 = 0, $$index2019 = 0, $$index202 = 0, $$index2020 = 0, $$index2021 = 0, $$index2022 = 0, $$index2023 = 0, $$index2024 = 0, $$index2025 = 0, $$index2026 = 0, $$index2027 = 0, $$index2028 = 0, $$index2029 = 0, $$index203 = 0, $$index2030 = 0;
 var $$index2031 = 0, $$index2032 = 0, $$index2033 = 0, $$index2034 = 0, $$index2035 = 0, $$index2036 = 0, $$index2037 = 0, $$index2038 = 0, $$index2039 = 0, $$index204 = 0, $$index2040 = 0, $$index2041 = 0, $$index2042 = 0, $$index2043 = 0, $$index2044 = 0, $$index2045 = 0, $$index2046 = 0, $$index2047 = 0, $$index2048 = 0, $$index2049 = 0;
 var $$index205 = 0, $$index2050 = 0, $$index2051 = 0, $$index2052 = 0, $$index2053 = 0, $$index2054 = 0, $$index2055 = 0, $$index2056 = 0, $$index2057 = 0, $$index2058 = 0, $$index2059 = 0, $$index206 = 0, $$index2060 = 0, $$index2061 = 0, $$index2062 = 0, $$index2063 = 0, $$index2064 = 0, $$index2065 = 0, $$index2066 = 0, $$index2067 = 0;
 var $$index2068 = 0, $$index2069 = 0, $$index207 = 0, $$index2070 = 0, $$index2071 = 0, $$index2072 = 0, $$index2073 = 0, $$index2074 = 0, $$index2075 = 0, $$index2076 = 0, $$index2077 = 0, $$index2078 = 0, $$index2079 = 0, $$index208 = 0, $$index2080 = 0, $$index2081 = 0, $$index2082 = 0, $$index2083 = 0, $$index2084 = 0, $$index2085 = 0;
 var $$index2086 = 0, $$index2087 = 0, $$index2088 = 0, $$index2089 = 0, $$index209 = 0, $$index2090 = 0, $$index2091 = 0, $$index2092 = 0, $$index2093 = 0, $$index2094 = 0, $$index2095 = 0, $$index2096 = 0, $$index2097 = 0, $$index2098 = 0, $$index2099 = 0, $$index21 = 0, $$index210 = 0, $$index2100 = 0, $$index2101 = 0, $$index2102 = 0;
 var $$index2103 = 0, $$index2104 = 0, $$index2105 = 0, $$index2106 = 0, $$index2107 = 0, $$index2108 = 0, $$index2109 = 0, $$index211 = 0, $$index2110 = 0, $$index2111 = 0, $$index2112 = 0, $$index2113 = 0, $$index2114 = 0, $$index2115 = 0, $$index2116 = 0, $$index2117 = 0, $$index2118 = 0, $$index2119 = 0, $$index212 = 0, $$index2120 = 0;
 var $$index2121 = 0, $$index2122 = 0, $$index2123 = 0, $$index2124 = 0, $$index2125 = 0, $$index2126 = 0, $$index2127 = 0, $$index2128 = 0, $$index2129 = 0, $$index213 = 0, $$index2130 = 0, $$index2131 = 0, $$index2132 = 0, $$index2133 = 0, $$index2134 = 0, $$index2135 = 0, $$index2136 = 0, $$index2137 = 0, $$index2138 = 0, $$index2139 = 0;
 var $$index214 = 0, $$index2140 = 0, $$index2141 = 0, $$index2142 = 0, $$index2143 = 0, $$index2144 = 0, $$index2145 = 0, $$index2146 = 0, $$index2147 = 0, $$index2148 = 0, $$index2149 = 0, $$index215 = 0, $$index2150 = 0, $$index2151 = 0, $$index2152 = 0, $$index2153 = 0, $$index2154 = 0, $$index2155 = 0, $$index2156 = 0, $$index2157 = 0;
 var $$index2158 = 0, $$index2159 = 0, $$index216 = 0, $$index2160 = 0, $$index2161 = 0, $$index2162 = 0, $$index2163 = 0, $$index2164 = 0, $$index2165 = 0, $$index2166 = 0, $$index2167 = 0, $$index2168 = 0, $$index2169 = 0, $$index217 = 0, $$index2170 = 0, $$index2171 = 0, $$index2172 = 0, $$index2173 = 0, $$index2174 = 0, $$index2175 = 0;
 var $$index2176 = 0, $$index2177 = 0, $$index2178 = 0, $$index2179 = 0, $$index218 = 0, $$index2180 = 0, $$index2181 = 0, $$index2182 = 0, $$index2183 = 0, $$index2184 = 0, $$index2185 = 0, $$index2186 = 0, $$index2187 = 0, $$index2188 = 0, $$index2189 = 0, $$index219 = 0, $$index2190 = 0, $$index2191 = 0, $$index2192 = 0, $$index2193 = 0;
 var $$index2194 = 0, $$index2195 = 0, $$index2196 = 0, $$index2197 = 0, $$index2198 = 0, $$index2199 = 0, $$index22 = 0, $$index220 = 0, $$index2200 = 0, $$index2201 = 0, $$index2202 = 0, $$index2203 = 0, $$index2204 = 0, $$index2205 = 0, $$index2206 = 0, $$index2207 = 0, $$index2208 = 0, $$index2209 = 0, $$index221 = 0, $$index2210 = 0;
 var $$index2211 = 0, $$index2212 = 0, $$index2213 = 0, $$index2214 = 0, $$index2215 = 0, $$index2216 = 0, $$index2217 = 0, $$index2218 = 0, $$index2219 = 0, $$index222 = 0, $$index2220 = 0, $$index2221 = 0, $$index2222 = 0, $$index2223 = 0, $$index2224 = 0, $$index2225 = 0, $$index2226 = 0, $$index2227 = 0, $$index2228 = 0, $$index2229 = 0;
 var $$index223 = 0, $$index2230 = 0, $$index2231 = 0, $$index2232 = 0, $$index2233 = 0, $$index2234 = 0, $$index2235 = 0, $$index2236 = 0, $$index2237 = 0, $$index2238 = 0, $$index2239 = 0, $$index224 = 0, $$index2240 = 0, $$index2241 = 0, $$index2242 = 0, $$index2243 = 0, $$index2244 = 0, $$index2245 = 0, $$index2246 = 0, $$index2247 = 0;
 var $$index2248 = 0, $$index2249 = 0, $$index225 = 0, $$index2250 = 0, $$index2251 = 0, $$index2252 = 0, $$index2253 = 0, $$index2254 = 0, $$index2255 = 0, $$index2256 = 0, $$index2257 = 0, $$index2258 = 0, $$index2259 = 0, $$index226 = 0, $$index2260 = 0, $$index2261 = 0, $$index2262 = 0, $$index2263 = 0, $$index2264 = 0, $$index2265 = 0;
 var $$index2266 = 0, $$index2267 = 0, $$index2268 = 0, $$index2269 = 0, $$index227 = 0, $$index2270 = 0, $$index2271 = 0, $$index2272 = 0, $$index2273 = 0, $$index2274 = 0, $$index2275 = 0, $$index2276 = 0, $$index2277 = 0, $$index2278 = 0, $$index2279 = 0, $$index228 = 0, $$index2280 = 0, $$index2281 = 0, $$index2282 = 0, $$index2283 = 0;
 var $$index2284 = 0, $$index2285 = 0, $$index2286 = 0, $$index2287 = 0, $$index2288 = 0, $$index2289 = 0, $$index229 = 0, $$index2290 = 0, $$index2291 = 0, $$index2292 = 0, $$index2293 = 0, $$index2294 = 0, $$index2295 = 0, $$index2296 = 0, $$index2297 = 0, $$index2298 = 0, $$index2299 = 0, $$index230 = 0, $$index2300 = 0, $$index2301 = 0;
 var $$index2302 = 0, $$index2303 = 0, $$index2304 = 0, $$index2305 = 0, $$index2306 = 0, $$index2307 = 0, $$index2308 = 0, $$index2309 = 0, $$index231 = 0, $$index2310 = 0, $$index2311 = 0, $$index2312 = 0, $$index2313 = 0, $$index2314 = 0, $$index2315 = 0, $$index2316 = 0, $$index2317 = 0, $$index2318 = 0, $$index2319 = 0, $$index232 = 0;
 var $$index2320 = 0, $$index2321 = 0, $$index2322 = 0, $$index2323 = 0, $$index2324 = 0, $$index2325 = 0, $$index2326 = 0, $$index2327 = 0, $$index2328 = 0, $$index2329 = 0, $$index233 = 0, $$index2330 = 0, $$index2331 = 0, $$index2332 = 0, $$index2333 = 0, $$index2334 = 0, $$index2335 = 0, $$index2336 = 0, $$index2337 = 0, $$index2338 = 0;
 var $$index2339 = 0, $$index234 = 0, $$index2340 = 0, $$index2341 = 0, $$index2342 = 0, $$index2343 = 0, $$index2344 = 0, $$index2345 = 0, $$index2346 = 0, $$index2347 = 0, $$index2348 = 0, $$index2349 = 0, $$index235 = 0, $$index2350 = 0, $$index2351 = 0, $$index2352 = 0, $$index2353 = 0, $$index2354 = 0, $$index2355 = 0, $$index2356 = 0;
 var $$index2357 = 0, $$index2358 = 0, $$index2359 = 0, $$index236 = 0, $$index2360 = 0, $$index2361 = 0, $$index2362 = 0, $$index2363 = 0, $$index2364 = 0, $$index2365 = 0, $$index2366 = 0, $$index2367 = 0, $$index2368 = 0, $$index2369 = 0, $$index237 = 0, $$index2370 = 0, $$index2371 = 0, $$index2372 = 0, $$index2373 = 0, $$index2374 = 0;
 var $$index2375 = 0, $$index2376 = 0, $$index2377 = 0, $$index2378 = 0, $$index2379 = 0, $$index238 = 0, $$index2380 = 0, $$index2381 = 0, $$index2382 = 0, $$index2383 = 0, $$index2384 = 0, $$index2385 = 0, $$index2386 = 0, $$index2387 = 0, $$index2388 = 0, $$index2389 = 0, $$index239 = 0, $$index2390 = 0, $$index2391 = 0, $$index2392 = 0;
 var $$index2393 = 0, $$index2394 = 0, $$index2395 = 0, $$index2396 = 0, $$index2397 = 0, $$index2398 = 0, $$index2399 = 0, $$index24 = 0, $$index240 = 0, $$index2400 = 0, $$index2401 = 0, $$index2402 = 0, $$index2403 = 0, $$index2404 = 0, $$index2405 = 0, $$index2406 = 0, $$index2407 = 0, $$index2408 = 0, $$index2409 = 0, $$index241 = 0;
 var $$index2410 = 0, $$index2411 = 0, $$index2412 = 0, $$index2413 = 0, $$index2414 = 0, $$index2415 = 0, $$index2416 = 0, $$index2417 = 0, $$index2418 = 0, $$index2419 = 0, $$index242 = 0, $$index2420 = 0, $$index2421 = 0, $$index2422 = 0, $$index2423 = 0, $$index2424 = 0, $$index2425 = 0, $$index2426 = 0, $$index2427 = 0, $$index2428 = 0;
 var $$index2429 = 0, $$index243 = 0, $$index2430 = 0, $$index2431 = 0, $$index2432 = 0, $$index2433 = 0, $$index2434 = 0, $$index2435 = 0, $$index2436 = 0, $$index2437 = 0, $$index2438 = 0, $$index2439 = 0, $$index244 = 0, $$index2440 = 0, $$index2441 = 0, $$index2442 = 0, $$index2443 = 0, $$index2444 = 0, $$index2445 = 0, $$index2446 = 0;
 var $$index2447 = 0, $$index2448 = 0, $$index2449 = 0, $$index245 = 0, $$index2450 = 0, $$index2451 = 0, $$index2452 = 0, $$index2453 = 0, $$index2454 = 0, $$index2455 = 0, $$index2456 = 0, $$index2457 = 0, $$index2458 = 0, $$index2459 = 0, $$index246 = 0, $$index2460 = 0, $$index2461 = 0, $$index2462 = 0, $$index2463 = 0, $$index2464 = 0;
 var $$index2465 = 0, $$index2466 = 0, $$index2467 = 0, $$index2468 = 0, $$index2469 = 0, $$index247 = 0, $$index2470 = 0, $$index2471 = 0, $$index2472 = 0, $$index2473 = 0, $$index2474 = 0, $$index2475 = 0, $$index2476 = 0, $$index2477 = 0, $$index2478 = 0, $$index2479 = 0, $$index248 = 0, $$index2480 = 0, $$index2481 = 0, $$index2482 = 0;
 var $$index2483 = 0, $$index2484 = 0, $$index2485 = 0, $$index2486 = 0, $$index2487 = 0, $$index2488 = 0, $$index2489 = 0, $$index249 = 0, $$index2490 = 0, $$index2491 = 0, $$index2492 = 0, $$index2493 = 0, $$index2494 = 0, $$index2495 = 0, $$index2496 = 0, $$index2497 = 0, $$index2498 = 0, $$index2499 = 0, $$index25 = 0, $$index250 = 0;
 var $$index2500 = 0, $$index2501 = 0, $$index2502 = 0, $$index2503 = 0, $$index2504 = 0, $$index2505 = 0, $$index2506 = 0, $$index2507 = 0, $$index2508 = 0, $$index2509 = 0, $$index251 = 0, $$index2510 = 0, $$index2511 = 0, $$index2512 = 0, $$index2513 = 0, $$index2514 = 0, $$index2515 = 0, $$index2516 = 0, $$index2517 = 0, $$index2518 = 0;
 var $$index2519 = 0, $$index252 = 0, $$index2520 = 0, $$index2521 = 0, $$index2522 = 0, $$index2523 = 0, $$index2524 = 0, $$index2525 = 0, $$index2526 = 0, $$index2527 = 0, $$index2528 = 0, $$index2529 = 0, $$index253 = 0, $$index2530 = 0, $$index2531 = 0, $$index2532 = 0, $$index2533 = 0, $$index2534 = 0, $$index2535 = 0, $$index2536 = 0;
 var $$index2537 = 0, $$index2538 = 0, $$index2539 = 0, $$index254 = 0, $$index2540 = 0, $$index2541 = 0, $$index2542 = 0, $$index2543 = 0, $$index2544 = 0, $$index2545 = 0, $$index2546 = 0, $$index2547 = 0, $$index2548 = 0, $$index2549 = 0, $$index255 = 0, $$index2550 = 0, $$index2551 = 0, $$index2552 = 0, $$index2553 = 0, $$index2554 = 0;
 var $$index2555 = 0, $$index2556 = 0, $$index2557 = 0, $$index2558 = 0, $$index2559 = 0, $$index256 = 0, $$index2560 = 0, $$index2561 = 0, $$index2562 = 0, $$index2563 = 0, $$index2564 = 0, $$index2565 = 0, $$index2566 = 0, $$index2567 = 0, $$index2568 = 0, $$index2569 = 0, $$index257 = 0, $$index2570 = 0, $$index2571 = 0, $$index2572 = 0;
 var $$index2573 = 0, $$index2574 = 0, $$index2575 = 0, $$index2576 = 0, $$index2577 = 0, $$index2578 = 0, $$index2579 = 0, $$index258 = 0, $$index2580 = 0, $$index2581 = 0, $$index2582 = 0, $$index2583 = 0, $$index2584 = 0, $$index2585 = 0, $$index2586 = 0, $$index2587 = 0, $$index2588 = 0, $$index2589 = 0, $$index259 = 0, $$index2590 = 0;
 var $$index2591 = 0, $$index2592 = 0, $$index2593 = 0, $$index2594 = 0, $$index2595 = 0, $$index2596 = 0, $$index2597 = 0, $$index2598 = 0, $$index2599 = 0, $$index26 = 0, $$index260 = 0, $$index2600 = 0, $$index2601 = 0, $$index2602 = 0, $$index2603 = 0, $$index2604 = 0, $$index2605 = 0, $$index2606 = 0, $$index2607 = 0, $$index2608 = 0;
 var $$index2609 = 0, $$index261 = 0, $$index2610 = 0, $$index2611 = 0, $$index2612 = 0, $$index2613 = 0, $$index2614 = 0, $$index2615 = 0, $$index2616 = 0, $$index2617 = 0, $$index2618 = 0, $$index2619 = 0, $$index262 = 0, $$index2620 = 0, $$index2621 = 0, $$index2622 = 0, $$index2623 = 0, $$index2624 = 0, $$index2625 = 0, $$index2626 = 0;
 var $$index2627 = 0, $$index2628 = 0, $$index2629 = 0, $$index263 = 0, $$index2630 = 0, $$index2631 = 0, $$index2632 = 0, $$index2633 = 0, $$index2634 = 0, $$index2635 = 0, $$index2636 = 0, $$index2637 = 0, $$index2638 = 0, $$index2639 = 0, $$index264 = 0, $$index2640 = 0, $$index2641 = 0, $$index2642 = 0, $$index2643 = 0, $$index2644 = 0;
 var $$index2645 = 0, $$index2646 = 0, $$index2647 = 0, $$index2648 = 0, $$index2649 = 0, $$index265 = 0, $$index2650 = 0, $$index2651 = 0, $$index2652 = 0, $$index2653 = 0, $$index2654 = 0, $$index2655 = 0, $$index2656 = 0, $$index2657 = 0, $$index2658 = 0, $$index2659 = 0, $$index266 = 0, $$index2660 = 0, $$index2661 = 0, $$index2662 = 0;
 var $$index2663 = 0, $$index2664 = 0, $$index2665 = 0, $$index2666 = 0, $$index2667 = 0, $$index2668 = 0, $$index2669 = 0, $$index267 = 0, $$index2670 = 0, $$index2671 = 0, $$index2672 = 0, $$index2673 = 0, $$index2674 = 0, $$index2675 = 0, $$index2676 = 0, $$index2677 = 0, $$index2678 = 0, $$index2679 = 0, $$index268 = 0, $$index2680 = 0;
 var $$index2681 = 0, $$index2682 = 0, $$index2683 = 0, $$index2684 = 0, $$index2685 = 0, $$index2686 = 0, $$index2687 = 0, $$index2688 = 0, $$index2689 = 0, $$index269 = 0, $$index2690 = 0, $$index2691 = 0, $$index2692 = 0, $$index2693 = 0, $$index2694 = 0, $$index2695 = 0, $$index2696 = 0, $$index2697 = 0, $$index2698 = 0, $$index2699 = 0;
 var $$index27 = 0, $$index270 = 0, $$index2700 = 0, $$index2701 = 0, $$index2702 = 0, $$index2703 = 0, $$index2704 = 0, $$index2705 = 0, $$index2706 = 0, $$index2707 = 0, $$index2708 = 0, $$index2709 = 0, $$index271 = 0, $$index2710 = 0, $$index2711 = 0, $$index2712 = 0, $$index2713 = 0, $$index2714 = 0, $$index2715 = 0, $$index2716 = 0;
 var $$index2717 = 0, $$index2718 = 0, $$index2719 = 0, $$index272 = 0, $$index2720 = 0, $$index2721 = 0, $$index2722 = 0, $$index2723 = 0, $$index2724 = 0, $$index2725 = 0, $$index2726 = 0, $$index2727 = 0, $$index2728 = 0, $$index2729 = 0, $$index273 = 0, $$index2730 = 0, $$index2731 = 0, $$index2732 = 0, $$index2733 = 0, $$index2734 = 0;
 var $$index2735 = 0, $$index2736 = 0, $$index2737 = 0, $$index2738 = 0, $$index2739 = 0, $$index274 = 0, $$index2740 = 0, $$index2741 = 0, $$index2742 = 0, $$index2743 = 0, $$index2744 = 0, $$index2745 = 0, $$index2746 = 0, $$index2747 = 0, $$index2748 = 0, $$index2749 = 0, $$index275 = 0, $$index2750 = 0, $$index2751 = 0, $$index2752 = 0;
 var $$index2753 = 0, $$index2754 = 0, $$index2755 = 0, $$index2756 = 0, $$index2757 = 0, $$index2758 = 0, $$index2759 = 0, $$index276 = 0, $$index2760 = 0, $$index2761 = 0, $$index2762 = 0, $$index2763 = 0, $$index2764 = 0, $$index2765 = 0, $$index2766 = 0, $$index2767 = 0, $$index2768 = 0, $$index2769 = 0, $$index277 = 0, $$index2770 = 0;
 var $$index2771 = 0, $$index2772 = 0, $$index2773 = 0, $$index2774 = 0, $$index2775 = 0, $$index2776 = 0, $$index2777 = 0, $$index2778 = 0, $$index2779 = 0, $$index278 = 0, $$index2780 = 0, $$index2781 = 0, $$index2782 = 0, $$index2783 = 0, $$index2784 = 0, $$index2785 = 0, $$index2786 = 0, $$index2787 = 0, $$index2788 = 0, $$index2789 = 0;
 var $$index279 = 0, $$index2790 = 0, $$index2791 = 0, $$index2792 = 0, $$index2793 = 0, $$index2794 = 0, $$index2795 = 0, $$index2796 = 0, $$index2797 = 0, $$index2798 = 0, $$index2799 = 0, $$index28 = 0, $$index280 = 0, $$index2800 = 0, $$index2801 = 0, $$index2802 = 0, $$index2803 = 0, $$index2804 = 0, $$index2805 = 0, $$index2806 = 0;
 var $$index2807 = 0, $$index2808 = 0, $$index2809 = 0, $$index281 = 0, $$index2810 = 0, $$index2811 = 0, $$index2812 = 0, $$index2813 = 0, $$index2814 = 0, $$index2815 = 0, $$index2816 = 0, $$index2817 = 0, $$index2818 = 0, $$index2819 = 0, $$index282 = 0, $$index2820 = 0, $$index2821 = 0, $$index2822 = 0, $$index2823 = 0, $$index2824 = 0;
 var $$index2825 = 0, $$index2826 = 0, $$index2827 = 0, $$index2828 = 0, $$index2829 = 0, $$index283 = 0, $$index2830 = 0, $$index2831 = 0, $$index2832 = 0, $$index2833 = 0, $$index2834 = 0, $$index2835 = 0, $$index2836 = 0, $$index2837 = 0, $$index2838 = 0, $$index2839 = 0, $$index284 = 0, $$index2840 = 0, $$index2841 = 0, $$index2842 = 0;
 var $$index2843 = 0, $$index2844 = 0, $$index2845 = 0, $$index2846 = 0, $$index2847 = 0, $$index2848 = 0, $$index2849 = 0, $$index285 = 0, $$index2850 = 0, $$index2851 = 0, $$index2852 = 0, $$index2853 = 0, $$index2854 = 0, $$index2855 = 0, $$index2856 = 0, $$index2857 = 0, $$index2858 = 0, $$index2859 = 0, $$index286 = 0, $$index2860 = 0;
 var $$index2861 = 0, $$index2862 = 0, $$index2863 = 0, $$index2864 = 0, $$index2865 = 0, $$index2866 = 0, $$index2867 = 0, $$index2868 = 0, $$index2869 = 0, $$index287 = 0, $$index2870 = 0, $$index2871 = 0, $$index2872 = 0, $$index2873 = 0, $$index2874 = 0, $$index2875 = 0, $$index2876 = 0, $$index2877 = 0, $$index2878 = 0, $$index2879 = 0;
 var $$index288 = 0, $$index2880 = 0, $$index2881 = 0, $$index2882 = 0, $$index2883 = 0, $$index2884 = 0, $$index2885 = 0, $$index2886 = 0, $$index2887 = 0, $$index2888 = 0, $$index2889 = 0, $$index289 = 0, $$index2890 = 0, $$index2891 = 0, $$index2892 = 0, $$index2893 = 0, $$index2894 = 0, $$index2895 = 0, $$index2896 = 0, $$index2897 = 0;
 var $$index2898 = 0, $$index2899 = 0, $$index29 = 0, $$index290 = 0, $$index2900 = 0, $$index2901 = 0, $$index2902 = 0, $$index2903 = 0, $$index2904 = 0, $$index2905 = 0, $$index2906 = 0, $$index2907 = 0, $$index2908 = 0, $$index2909 = 0, $$index291 = 0, $$index2910 = 0, $$index2911 = 0, $$index2912 = 0, $$index2913 = 0, $$index2914 = 0;
 var $$index2915 = 0, $$index2916 = 0, $$index2917 = 0, $$index2918 = 0, $$index2919 = 0, $$index292 = 0, $$index2920 = 0, $$index2921 = 0, $$index2922 = 0, $$index2923 = 0, $$index2924 = 0, $$index2925 = 0, $$index2926 = 0, $$index2927 = 0, $$index2928 = 0, $$index2929 = 0, $$index293 = 0, $$index2930 = 0, $$index2931 = 0, $$index2932 = 0;
 var $$index2933 = 0, $$index2934 = 0, $$index2935 = 0, $$index2936 = 0, $$index2937 = 0, $$index2938 = 0, $$index2939 = 0, $$index294 = 0, $$index2940 = 0, $$index2941 = 0, $$index2942 = 0, $$index2943 = 0, $$index2944 = 0, $$index2945 = 0, $$index2946 = 0, $$index2947 = 0, $$index2948 = 0, $$index2949 = 0, $$index295 = 0, $$index2950 = 0;
 var $$index2951 = 0, $$index2952 = 0, $$index2953 = 0, $$index2954 = 0, $$index2955 = 0, $$index2956 = 0, $$index2957 = 0, $$index2958 = 0, $$index2959 = 0, $$index296 = 0, $$index2960 = 0, $$index2961 = 0, $$index2962 = 0, $$index2963 = 0, $$index2964 = 0, $$index2965 = 0, $$index2966 = 0, $$index2967 = 0, $$index2968 = 0, $$index2969 = 0;
 var $$index297 = 0, $$index2970 = 0, $$index2971 = 0, $$index2972 = 0, $$index2973 = 0, $$index2974 = 0, $$index2975 = 0, $$index2976 = 0, $$index2977 = 0, $$index2978 = 0, $$index2979 = 0, $$index298 = 0, $$index2980 = 0, $$index2981 = 0, $$index2982 = 0, $$index2983 = 0, $$index2984 = 0, $$index2985 = 0, $$index2986 = 0, $$index2987 = 0;
 var $$index2988 = 0, $$index2989 = 0, $$index299 = 0, $$index2990 = 0, $$index2991 = 0, $$index2992 = 0, $$index2993 = 0, $$index2994 = 0, $$index2995 = 0, $$index2996 = 0, $$index2997 = 0, $$index2998 = 0, $$index2999 = 0, $$index30 = 0, $$index300 = 0, $$index3000 = 0, $$index3001 = 0, $$index3002 = 0, $$index3003 = 0, $$index3004 = 0;
 var $$index3005 = 0, $$index3006 = 0, $$index3007 = 0, $$index3008 = 0, $$index3009 = 0, $$index301 = 0, $$index3010 = 0, $$index3011 = 0, $$index3012 = 0, $$index3013 = 0, $$index3014 = 0, $$index3015 = 0, $$index3016 = 0, $$index3017 = 0, $$index3018 = 0, $$index3019 = 0, $$index302 = 0, $$index3020 = 0, $$index3021 = 0, $$index3022 = 0;
 var $$index3023 = 0, $$index3024 = 0, $$index3025 = 0, $$index3026 = 0, $$index3027 = 0, $$index3028 = 0, $$index3029 = 0, $$index303 = 0, $$index3030 = 0, $$index3031 = 0, $$index3032 = 0, $$index3033 = 0, $$index3034 = 0, $$index3035 = 0, $$index3036 = 0, $$index3037 = 0, $$index3038 = 0, $$index3039 = 0, $$index304 = 0, $$index3040 = 0;
 var $$index3041 = 0, $$index3042 = 0, $$index3043 = 0, $$index3044 = 0, $$index3045 = 0, $$index3046 = 0, $$index3047 = 0, $$index3048 = 0, $$index3049 = 0, $$index305 = 0, $$index3050 = 0, $$index3051 = 0, $$index3052 = 0, $$index3053 = 0, $$index3054 = 0, $$index3055 = 0, $$index3056 = 0, $$index3057 = 0, $$index3058 = 0, $$index3059 = 0;
 var $$index306 = 0, $$index3060 = 0, $$index3061 = 0, $$index3062 = 0, $$index3063 = 0, $$index3064 = 0, $$index3065 = 0, $$index3066 = 0, $$index3067 = 0, $$index3068 = 0, $$index3069 = 0, $$index307 = 0, $$index3070 = 0, $$index3071 = 0, $$index3072 = 0, $$index3073 = 0, $$index3074 = 0, $$index3075 = 0, $$index3076 = 0, $$index3077 = 0;
 var $$index3078 = 0, $$index3079 = 0, $$index308 = 0, $$index3080 = 0, $$index3081 = 0, $$index3082 = 0, $$index3083 = 0, $$index3084 = 0, $$index3085 = 0, $$index3086 = 0, $$index3087 = 0, $$index3088 = 0, $$index3089 = 0, $$index309 = 0, $$index3090 = 0, $$index3091 = 0, $$index3092 = 0, $$index3093 = 0, $$index3094 = 0, $$index3095 = 0;
 var $$index3096 = 0, $$index3097 = 0, $$index3098 = 0, $$index3099 = 0, $$index31 = 0, $$index310 = 0, $$index3100 = 0, $$index3101 = 0, $$index3102 = 0, $$index3103 = 0, $$index3104 = 0, $$index3105 = 0, $$index3106 = 0, $$index3107 = 0, $$index3108 = 0, $$index3109 = 0, $$index311 = 0, $$index3110 = 0, $$index3111 = 0, $$index3112 = 0;
 var $$index3113 = 0, $$index3114 = 0, $$index3115 = 0, $$index3116 = 0, $$index3117 = 0, $$index3118 = 0, $$index3119 = 0, $$index312 = 0, $$index3120 = 0, $$index3121 = 0, $$index3122 = 0, $$index3123 = 0, $$index3124 = 0, $$index3125 = 0, $$index3126 = 0, $$index3127 = 0, $$index3128 = 0, $$index3129 = 0, $$index313 = 0, $$index3130 = 0;
 var $$index3131 = 0, $$index3132 = 0, $$index3133 = 0, $$index3134 = 0, $$index3135 = 0, $$index3136 = 0, $$index3137 = 0, $$index3138 = 0, $$index3139 = 0, $$index314 = 0, $$index3140 = 0, $$index3141 = 0, $$index3142 = 0, $$index3143 = 0, $$index3144 = 0, $$index3145 = 0, $$index3146 = 0, $$index3147 = 0, $$index3148 = 0, $$index3149 = 0;
 var $$index315 = 0, $$index3150 = 0, $$index3151 = 0, $$index3152 = 0, $$index3153 = 0, $$index3154 = 0, $$index3155 = 0, $$index3156 = 0, $$index3157 = 0, $$index3158 = 0, $$index3159 = 0, $$index316 = 0, $$index3160 = 0, $$index3161 = 0, $$index3162 = 0, $$index3163 = 0, $$index3164 = 0, $$index3165 = 0, $$index3166 = 0, $$index3167 = 0;
 var $$index3168 = 0, $$index3169 = 0, $$index317 = 0, $$index3170 = 0, $$index3171 = 0, $$index3172 = 0, $$index3173 = 0, $$index3174 = 0, $$index3175 = 0, $$index3176 = 0, $$index3177 = 0, $$index3178 = 0, $$index3179 = 0, $$index318 = 0, $$index3180 = 0, $$index3181 = 0, $$index3182 = 0, $$index3183 = 0, $$index3184 = 0, $$index3185 = 0;
 var $$index3186 = 0, $$index3187 = 0, $$index3188 = 0, $$index3189 = 0, $$index319 = 0, $$index3190 = 0, $$index3191 = 0, $$index3192 = 0, $$index3193 = 0, $$index3194 = 0, $$index3195 = 0, $$index3196 = 0, $$index3197 = 0, $$index3198 = 0, $$index3199 = 0, $$index32 = 0, $$index320 = 0, $$index3200 = 0, $$index3201 = 0, $$index3202 = 0;
 var $$index3203 = 0, $$index3204 = 0, $$index3205 = 0, $$index3206 = 0, $$index3207 = 0, $$index3208 = 0, $$index3209 = 0, $$index321 = 0, $$index3210 = 0, $$index3211 = 0, $$index3212 = 0, $$index3213 = 0, $$index3214 = 0, $$index3215 = 0, $$index3216 = 0, $$index3217 = 0, $$index3218 = 0, $$index3219 = 0, $$index322 = 0, $$index3220 = 0;
 var $$index3221 = 0, $$index3222 = 0, $$index3223 = 0, $$index3224 = 0, $$index3225 = 0, $$index3226 = 0, $$index3227 = 0, $$index3228 = 0, $$index3229 = 0, $$index323 = 0, $$index3230 = 0, $$index3231 = 0, $$index3232 = 0, $$index3233 = 0, $$index3234 = 0, $$index3235 = 0, $$index3236 = 0, $$index3237 = 0, $$index3238 = 0, $$index3239 = 0;
 var $$index324 = 0, $$index3240 = 0, $$index3241 = 0, $$index3242 = 0, $$index3243 = 0, $$index3244 = 0, $$index3245 = 0, $$index3246 = 0, $$index3247 = 0, $$index3248 = 0, $$index3249 = 0, $$index325 = 0, $$index3250 = 0, $$index3251 = 0, $$index3252 = 0, $$index3253 = 0, $$index3254 = 0, $$index3255 = 0, $$index3256 = 0, $$index3257 = 0;
 var $$index3258 = 0, $$index3259 = 0, $$index326 = 0, $$index3260 = 0, $$index3261 = 0, $$index3262 = 0, $$index3263 = 0, $$index3264 = 0, $$index3265 = 0, $$index3266 = 0, $$index3267 = 0, $$index3268 = 0, $$index3269 = 0, $$index327 = 0, $$index3270 = 0, $$index3271 = 0, $$index3272 = 0, $$index3273 = 0, $$index3274 = 0, $$index3275 = 0;
 var $$index3276 = 0, $$index3277 = 0, $$index3278 = 0, $$index3279 = 0, $$index328 = 0, $$index3280 = 0, $$index3281 = 0, $$index3282 = 0, $$index3283 = 0, $$index3284 = 0, $$index3285 = 0, $$index3286 = 0, $$index3287 = 0, $$index3288 = 0, $$index3289 = 0, $$index329 = 0, $$index3290 = 0, $$index3291 = 0, $$index3292 = 0, $$index3293 = 0;
 var $$index3294 = 0, $$index3295 = 0, $$index3296 = 0, $$index3297 = 0, $$index3298 = 0, $$index3299 = 0, $$index33 = 0, $$index330 = 0, $$index3300 = 0, $$index3301 = 0, $$index3302 = 0, $$index3303 = 0, $$index3304 = 0, $$index3305 = 0, $$index3306 = 0, $$index3307 = 0, $$index3308 = 0, $$index3309 = 0, $$index331 = 0, $$index3310 = 0;
 var $$index3311 = 0, $$index3312 = 0, $$index3313 = 0, $$index3314 = 0, $$index3315 = 0, $$index3316 = 0, $$index3317 = 0, $$index3318 = 0, $$index3319 = 0, $$index332 = 0, $$index3320 = 0, $$index3321 = 0, $$index3322 = 0, $$index3323 = 0, $$index3324 = 0, $$index3325 = 0, $$index3326 = 0, $$index3327 = 0, $$index3328 = 0, $$index3329 = 0;
 var $$index333 = 0, $$index3330 = 0, $$index3331 = 0, $$index3332 = 0, $$index3333 = 0, $$index3334 = 0, $$index3335 = 0, $$index3336 = 0, $$index3337 = 0, $$index3338 = 0, $$index3339 = 0, $$index334 = 0, $$index3340 = 0, $$index3341 = 0, $$index3342 = 0, $$index3343 = 0, $$index3344 = 0, $$index3345 = 0, $$index3346 = 0, $$index3347 = 0;
 var $$index3348 = 0, $$index3349 = 0, $$index335 = 0, $$index3350 = 0, $$index3351 = 0, $$index3352 = 0, $$index3353 = 0, $$index3354 = 0, $$index3355 = 0, $$index3356 = 0, $$index3357 = 0, $$index3358 = 0, $$index3359 = 0, $$index336 = 0, $$index3360 = 0, $$index3361 = 0, $$index3362 = 0, $$index3363 = 0, $$index3364 = 0, $$index3365 = 0;
 var $$index3366 = 0, $$index3367 = 0, $$index3368 = 0, $$index3369 = 0, $$index337 = 0, $$index3370 = 0, $$index3371 = 0, $$index3372 = 0, $$index3373 = 0, $$index3374 = 0, $$index3375 = 0, $$index3376 = 0, $$index3377 = 0, $$index3378 = 0, $$index3379 = 0, $$index338 = 0, $$index3380 = 0, $$index3381 = 0, $$index3382 = 0, $$index3383 = 0;
 var $$index3384 = 0, $$index3385 = 0, $$index3386 = 0, $$index3387 = 0, $$index3388 = 0, $$index3389 = 0, $$index339 = 0, $$index3390 = 0, $$index3391 = 0, $$index3392 = 0, $$index3393 = 0, $$index3394 = 0, $$index3395 = 0, $$index3396 = 0, $$index3397 = 0, $$index3398 = 0, $$index3399 = 0, $$index34 = 0, $$index340 = 0, $$index3400 = 0;
 var $$index3401 = 0, $$index3402 = 0, $$index3403 = 0, $$index3404 = 0, $$index3405 = 0, $$index3406 = 0, $$index3407 = 0, $$index3408 = 0, $$index3409 = 0, $$index341 = 0, $$index3410 = 0, $$index3411 = 0, $$index3412 = 0, $$index3413 = 0, $$index3414 = 0, $$index3415 = 0, $$index3416 = 0, $$index3417 = 0, $$index3418 = 0, $$index3419 = 0;
 var $$index342 = 0, $$index3420 = 0, $$index3421 = 0, $$index3422 = 0, $$index3423 = 0, $$index3424 = 0, $$index3425 = 0, $$index3426 = 0, $$index3427 = 0, $$index3428 = 0, $$index3429 = 0, $$index343 = 0, $$index3430 = 0, $$index3431 = 0, $$index3432 = 0, $$index3433 = 0, $$index3434 = 0, $$index3435 = 0, $$index3436 = 0, $$index3437 = 0;
 var $$index3438 = 0, $$index3439 = 0, $$index344 = 0, $$index3440 = 0, $$index3441 = 0, $$index3442 = 0, $$index3443 = 0, $$index3444 = 0, $$index3445 = 0, $$index3446 = 0, $$index3447 = 0, $$index3448 = 0, $$index3449 = 0, $$index345 = 0, $$index3450 = 0, $$index3451 = 0, $$index3452 = 0, $$index3453 = 0, $$index3454 = 0, $$index3455 = 0;
 var $$index3456 = 0, $$index3457 = 0, $$index3458 = 0, $$index3459 = 0, $$index346 = 0, $$index3460 = 0, $$index3461 = 0, $$index3462 = 0, $$index3463 = 0, $$index3464 = 0, $$index3465 = 0, $$index3466 = 0, $$index3467 = 0, $$index3468 = 0, $$index3469 = 0, $$index347 = 0, $$index3470 = 0, $$index3471 = 0, $$index3472 = 0, $$index3473 = 0;
 var $$index3474 = 0, $$index3475 = 0, $$index3476 = 0, $$index3477 = 0, $$index3478 = 0, $$index3479 = 0, $$index348 = 0, $$index3480 = 0, $$index3481 = 0, $$index3482 = 0, $$index3483 = 0, $$index3484 = 0, $$index3485 = 0, $$index3486 = 0, $$index3487 = 0, $$index3488 = 0, $$index3489 = 0, $$index349 = 0, $$index3490 = 0, $$index3491 = 0;
 var $$index3492 = 0, $$index3493 = 0, $$index3494 = 0, $$index3495 = 0, $$index3496 = 0, $$index3497 = 0, $$index3498 = 0, $$index3499 = 0, $$index35 = 0, $$index350 = 0, $$index3500 = 0, $$index3501 = 0, $$index3502 = 0, $$index3503 = 0, $$index3504 = 0, $$index3505 = 0, $$index3506 = 0, $$index3507 = 0, $$index3508 = 0, $$index3509 = 0;
 var $$index351 = 0, $$index3510 = 0, $$index3511 = 0, $$index3512 = 0, $$index3513 = 0, $$index3514 = 0, $$index3515 = 0, $$index3516 = 0, $$index3517 = 0, $$index3518 = 0, $$index3519 = 0, $$index352 = 0, $$index3520 = 0, $$index3521 = 0, $$index3522 = 0, $$index3523 = 0, $$index3524 = 0, $$index3525 = 0, $$index3526 = 0, $$index3527 = 0;
 var $$index3528 = 0, $$index3529 = 0, $$index353 = 0, $$index3530 = 0, $$index3531 = 0, $$index3532 = 0, $$index3533 = 0, $$index3534 = 0, $$index3535 = 0, $$index3536 = 0, $$index3537 = 0, $$index3538 = 0, $$index3539 = 0, $$index354 = 0, $$index3540 = 0, $$index3541 = 0, $$index3542 = 0, $$index3543 = 0, $$index3544 = 0, $$index3545 = 0;
 var $$index3546 = 0, $$index3547 = 0, $$index3548 = 0, $$index3549 = 0, $$index355 = 0, $$index3550 = 0, $$index3551 = 0, $$index3552 = 0, $$index3553 = 0, $$index3554 = 0, $$index3555 = 0, $$index3556 = 0, $$index3557 = 0, $$index3558 = 0, $$index3559 = 0, $$index356 = 0, $$index3560 = 0, $$index3561 = 0, $$index3562 = 0, $$index3563 = 0;
 var $$index3564 = 0, $$index3565 = 0, $$index3566 = 0, $$index3567 = 0, $$index3568 = 0, $$index3569 = 0, $$index357 = 0, $$index3570 = 0, $$index3571 = 0, $$index3572 = 0, $$index3573 = 0, $$index3574 = 0, $$index3575 = 0, $$index3576 = 0, $$index3577 = 0, $$index3578 = 0, $$index3579 = 0, $$index358 = 0, $$index3580 = 0, $$index3581 = 0;
 var $$index3582 = 0, $$index3583 = 0, $$index3584 = 0, $$index3585 = 0, $$index3586 = 0, $$index3587 = 0, $$index3588 = 0, $$index3589 = 0, $$index359 = 0, $$index3590 = 0, $$index3591 = 0, $$index3592 = 0, $$index3593 = 0, $$index3594 = 0, $$index3595 = 0, $$index3596 = 0, $$index3597 = 0, $$index3598 = 0, $$index3599 = 0, $$index36 = 0;
 var $$index360 = 0, $$index3600 = 0, $$index3601 = 0, $$index3602 = 0, $$index3603 = 0, $$index3604 = 0, $$index3605 = 0, $$index3606 = 0, $$index3607 = 0, $$index3608 = 0, $$index3609 = 0, $$index361 = 0, $$index3610 = 0, $$index3611 = 0, $$index3612 = 0, $$index3613 = 0, $$index3614 = 0, $$index3615 = 0, $$index3616 = 0, $$index3617 = 0;
 var $$index3618 = 0, $$index3619 = 0, $$index362 = 0, $$index3620 = 0, $$index3621 = 0, $$index3622 = 0, $$index3623 = 0, $$index3624 = 0, $$index3625 = 0, $$index3626 = 0, $$index3627 = 0, $$index3628 = 0, $$index3629 = 0, $$index363 = 0, $$index3630 = 0, $$index3631 = 0, $$index3632 = 0, $$index3633 = 0, $$index3634 = 0, $$index3635 = 0;
 var $$index3636 = 0, $$index3637 = 0, $$index3638 = 0, $$index3639 = 0, $$index364 = 0, $$index3640 = 0, $$index3641 = 0, $$index3642 = 0, $$index3643 = 0, $$index3644 = 0, $$index3645 = 0, $$index3646 = 0, $$index3647 = 0, $$index3648 = 0, $$index3649 = 0, $$index365 = 0, $$index3650 = 0, $$index3651 = 0, $$index3652 = 0, $$index3653 = 0;
 var $$index3654 = 0, $$index3655 = 0, $$index3656 = 0, $$index3657 = 0, $$index3658 = 0, $$index3659 = 0, $$index366 = 0, $$index3660 = 0, $$index3661 = 0, $$index3662 = 0, $$index3663 = 0, $$index3664 = 0, $$index3665 = 0, $$index3666 = 0, $$index3667 = 0, $$index3668 = 0, $$index3669 = 0, $$index367 = 0, $$index3670 = 0, $$index3671 = 0;
 var $$index3672 = 0, $$index3673 = 0, $$index3674 = 0, $$index3675 = 0, $$index3676 = 0, $$index3677 = 0, $$index3678 = 0, $$index3679 = 0, $$index368 = 0, $$index3680 = 0, $$index3681 = 0, $$index3682 = 0, $$index3683 = 0, $$index3684 = 0, $$index3685 = 0, $$index3686 = 0, $$index3687 = 0, $$index3688 = 0, $$index3689 = 0, $$index369 = 0;
 var $$index3690 = 0, $$index3691 = 0, $$index3692 = 0, $$index3693 = 0, $$index3694 = 0, $$index3695 = 0, $$index3696 = 0, $$index3697 = 0, $$index3698 = 0, $$index3699 = 0, $$index37 = 0, $$index370 = 0, $$index3700 = 0, $$index3701 = 0, $$index3702 = 0, $$index3703 = 0, $$index3704 = 0, $$index3705 = 0, $$index3706 = 0, $$index3707 = 0;
 var $$index3708 = 0, $$index3709 = 0, $$index371 = 0, $$index3710 = 0, $$index3711 = 0, $$index3712 = 0, $$index3713 = 0, $$index3714 = 0, $$index3715 = 0, $$index3716 = 0, $$index3717 = 0, $$index3718 = 0, $$index3719 = 0, $$index372 = 0, $$index3720 = 0, $$index3721 = 0, $$index3722 = 0, $$index3723 = 0, $$index3724 = 0, $$index3725 = 0;
 var $$index3726 = 0, $$index3727 = 0, $$index3728 = 0, $$index3729 = 0, $$index373 = 0, $$index3730 = 0, $$index3731 = 0, $$index3732 = 0, $$index3733 = 0, $$index3734 = 0, $$index3735 = 0, $$index3736 = 0, $$index3737 = 0, $$index3738 = 0, $$index3739 = 0, $$index374 = 0, $$index3740 = 0, $$index3741 = 0, $$index3742 = 0, $$index3743 = 0;
 var $$index3744 = 0, $$index3745 = 0, $$index3746 = 0, $$index3747 = 0, $$index3748 = 0, $$index3749 = 0, $$index375 = 0, $$index3750 = 0, $$index3751 = 0, $$index3752 = 0, $$index3753 = 0, $$index3754 = 0, $$index3755 = 0, $$index3756 = 0, $$index3757 = 0, $$index3758 = 0, $$index3759 = 0, $$index376 = 0, $$index3760 = 0, $$index3761 = 0;
 var $$index3762 = 0, $$index3763 = 0, $$index3764 = 0, $$index3765 = 0, $$index3766 = 0, $$index3767 = 0, $$index3768 = 0, $$index3769 = 0, $$index377 = 0, $$index3770 = 0, $$index3771 = 0, $$index3772 = 0, $$index3773 = 0, $$index3774 = 0, $$index3775 = 0, $$index3776 = 0, $$index3777 = 0, $$index3778 = 0, $$index3779 = 0, $$index378 = 0;
 var $$index3780 = 0, $$index3781 = 0, $$index3782 = 0, $$index3783 = 0, $$index3784 = 0, $$index3785 = 0, $$index3786 = 0, $$index3787 = 0, $$index3788 = 0, $$index3789 = 0, $$index379 = 0, $$index3790 = 0, $$index3791 = 0, $$index3792 = 0, $$index3793 = 0, $$index3794 = 0, $$index3795 = 0, $$index3796 = 0, $$index3797 = 0, $$index3798 = 0;
 var $$index3799 = 0, $$index38 = 0, $$index380 = 0, $$index3800 = 0, $$index3801 = 0, $$index3802 = 0, $$index3803 = 0, $$index3804 = 0, $$index3805 = 0, $$index3806 = 0, $$index3807 = 0, $$index3808 = 0, $$index3809 = 0, $$index381 = 0, $$index3810 = 0, $$index3811 = 0, $$index3812 = 0, $$index3813 = 0, $$index3814 = 0, $$index3815 = 0;
 var $$index3816 = 0, $$index3817 = 0, $$index3818 = 0, $$index3819 = 0, $$index382 = 0, $$index3820 = 0, $$index3821 = 0, $$index3822 = 0, $$index3823 = 0, $$index3824 = 0, $$index3825 = 0, $$index3826 = 0, $$index3827 = 0, $$index3828 = 0, $$index3829 = 0, $$index383 = 0, $$index3830 = 0, $$index3831 = 0, $$index3832 = 0, $$index3833 = 0;
 var $$index3834 = 0, $$index3835 = 0, $$index3836 = 0, $$index3837 = 0, $$index3838 = 0, $$index3839 = 0, $$index384 = 0, $$index3840 = 0, $$index3841 = 0, $$index3842 = 0, $$index3843 = 0, $$index3844 = 0, $$index3845 = 0, $$index3846 = 0, $$index3847 = 0, $$index3848 = 0, $$index3849 = 0, $$index385 = 0, $$index3850 = 0, $$index3851 = 0;
 var $$index3852 = 0, $$index3853 = 0, $$index3854 = 0, $$index3855 = 0, $$index3856 = 0, $$index3857 = 0, $$index3858 = 0, $$index3859 = 0, $$index386 = 0, $$index3860 = 0, $$index3861 = 0, $$index3862 = 0, $$index3863 = 0, $$index3864 = 0, $$index3865 = 0, $$index3866 = 0, $$index3867 = 0, $$index3868 = 0, $$index3869 = 0, $$index387 = 0;
 var $$index3870 = 0, $$index3871 = 0, $$index3872 = 0, $$index3873 = 0, $$index3874 = 0, $$index3875 = 0, $$index3876 = 0, $$index3877 = 0, $$index3878 = 0, $$index3879 = 0, $$index388 = 0, $$index3880 = 0, $$index3881 = 0, $$index3882 = 0, $$index3883 = 0, $$index3884 = 0, $$index3885 = 0, $$index3886 = 0, $$index3887 = 0, $$index3888 = 0;
 var $$index3889 = 0, $$index389 = 0, $$index3890 = 0, $$index3891 = 0, $$index3892 = 0, $$index3893 = 0, $$index3894 = 0, $$index3895 = 0, $$index3896 = 0, $$index3897 = 0, $$index3898 = 0, $$index3899 = 0, $$index39 = 0, $$index390 = 0, $$index3900 = 0, $$index3901 = 0, $$index3902 = 0, $$index3903 = 0, $$index3904 = 0, $$index3905 = 0;
 var $$index3906 = 0, $$index3907 = 0, $$index3908 = 0, $$index3909 = 0, $$index391 = 0, $$index3910 = 0, $$index3911 = 0, $$index3912 = 0, $$index3913 = 0, $$index3914 = 0, $$index3915 = 0, $$index3916 = 0, $$index3917 = 0, $$index3918 = 0, $$index3919 = 0, $$index392 = 0, $$index3920 = 0, $$index3921 = 0, $$index3922 = 0, $$index3923 = 0;
 var $$index3924 = 0, $$index3925 = 0, $$index3926 = 0, $$index3927 = 0, $$index3928 = 0, $$index3929 = 0, $$index393 = 0, $$index3930 = 0, $$index3931 = 0, $$index3932 = 0, $$index3933 = 0, $$index3934 = 0, $$index3935 = 0, $$index3936 = 0, $$index3937 = 0, $$index3938 = 0, $$index3939 = 0, $$index394 = 0, $$index3940 = 0, $$index3941 = 0;
 var $$index3942 = 0, $$index3943 = 0, $$index3944 = 0, $$index3945 = 0, $$index3946 = 0, $$index3947 = 0, $$index3948 = 0, $$index3949 = 0, $$index395 = 0, $$index3950 = 0, $$index3951 = 0, $$index3952 = 0, $$index3953 = 0, $$index3954 = 0, $$index3955 = 0, $$index3956 = 0, $$index3957 = 0, $$index3958 = 0, $$index3959 = 0, $$index396 = 0;
 var $$index3960 = 0, $$index3961 = 0, $$index3962 = 0, $$index3963 = 0, $$index3964 = 0, $$index3965 = 0, $$index3966 = 0, $$index3967 = 0, $$index3968 = 0, $$index3969 = 0, $$index397 = 0, $$index3970 = 0, $$index3971 = 0, $$index3972 = 0, $$index3973 = 0, $$index3974 = 0, $$index3975 = 0, $$index3976 = 0, $$index3977 = 0, $$index3978 = 0;
 var $$index3979 = 0, $$index398 = 0, $$index3980 = 0, $$index3981 = 0, $$index3982 = 0, $$index3983 = 0, $$index3984 = 0, $$index3985 = 0, $$index3986 = 0, $$index3987 = 0, $$index3988 = 0, $$index3989 = 0, $$index399 = 0, $$index3990 = 0, $$index3991 = 0, $$index3992 = 0, $$index3993 = 0, $$index3994 = 0, $$index3995 = 0, $$index3996 = 0;
 var $$index3997 = 0, $$index3998 = 0, $$index3999 = 0, $$index40 = 0, $$index400 = 0, $$index4000 = 0, $$index4001 = 0, $$index4002 = 0, $$index4003 = 0, $$index4004 = 0, $$index4005 = 0, $$index4006 = 0, $$index4007 = 0, $$index4008 = 0, $$index4009 = 0, $$index401 = 0, $$index4010 = 0, $$index4011 = 0, $$index4012 = 0, $$index4013 = 0;
 var $$index4014 = 0, $$index4015 = 0, $$index4016 = 0, $$index4017 = 0, $$index4018 = 0, $$index4019 = 0, $$index402 = 0, $$index4020 = 0, $$index4021 = 0, $$index4022 = 0, $$index4023 = 0, $$index4024 = 0, $$index4025 = 0, $$index4026 = 0, $$index4027 = 0, $$index4028 = 0, $$index4029 = 0, $$index403 = 0, $$index4030 = 0, $$index4031 = 0;
 var $$index4032 = 0, $$index4033 = 0, $$index4034 = 0, $$index4035 = 0, $$index4036 = 0, $$index4037 = 0, $$index4038 = 0, $$index4039 = 0, $$index404 = 0, $$index4040 = 0, $$index4041 = 0, $$index4042 = 0, $$index4043 = 0, $$index4044 = 0, $$index4045 = 0, $$index4046 = 0, $$index4047 = 0, $$index4048 = 0, $$index4049 = 0, $$index405 = 0;
 var $$index4050 = 0, $$index4051 = 0, $$index4052 = 0, $$index4053 = 0, $$index4054 = 0, $$index4055 = 0, $$index4056 = 0, $$index4057 = 0, $$index4058 = 0, $$index4059 = 0, $$index406 = 0, $$index4060 = 0, $$index4061 = 0, $$index4062 = 0, $$index4063 = 0, $$index4064 = 0, $$index4065 = 0, $$index4066 = 0, $$index4067 = 0, $$index4068 = 0;
 var $$index4069 = 0, $$index407 = 0, $$index4070 = 0, $$index4071 = 0, $$index4072 = 0, $$index4073 = 0, $$index4074 = 0, $$index4075 = 0, $$index4076 = 0, $$index4077 = 0, $$index4078 = 0, $$index4079 = 0, $$index408 = 0, $$index4080 = 0, $$index4081 = 0, $$index4082 = 0, $$index4083 = 0, $$index4084 = 0, $$index4085 = 0, $$index4086 = 0;
 var $$index4087 = 0, $$index4088 = 0, $$index4089 = 0, $$index409 = 0, $$index4090 = 0, $$index4091 = 0, $$index4092 = 0, $$index4093 = 0, $$index4094 = 0, $$index4095 = 0, $$index4096 = 0, $$index4097 = 0, $$index4098 = 0, $$index4099 = 0, $$index41 = 0, $$index410 = 0, $$index4100 = 0, $$index4101 = 0, $$index4102 = 0, $$index4103 = 0;
 var $$index4104 = 0, $$index4105 = 0, $$index4106 = 0, $$index4107 = 0, $$index4108 = 0, $$index4109 = 0, $$index411 = 0, $$index4110 = 0, $$index4111 = 0, $$index4112 = 0, $$index4113 = 0, $$index4114 = 0, $$index4115 = 0, $$index4116 = 0, $$index4117 = 0, $$index4118 = 0, $$index412 = 0, $$index4120 = 0, $$index4121 = 0, $$index413 = 0;
 var $$index414 = 0, $$index415 = 0, $$index416 = 0, $$index417 = 0, $$index418 = 0, $$index419 = 0, $$index42 = 0, $$index420 = 0, $$index421 = 0, $$index422 = 0, $$index423 = 0, $$index424 = 0, $$index425 = 0, $$index426 = 0, $$index427 = 0, $$index428 = 0, $$index429 = 0, $$index43 = 0, $$index430 = 0, $$index431 = 0;
 var $$index432 = 0, $$index433 = 0, $$index434 = 0, $$index435 = 0, $$index436 = 0, $$index437 = 0, $$index438 = 0, $$index439 = 0, $$index44 = 0, $$index440 = 0, $$index441 = 0, $$index442 = 0, $$index443 = 0, $$index444 = 0, $$index445 = 0, $$index446 = 0, $$index447 = 0, $$index448 = 0, $$index449 = 0, $$index45 = 0;
 var $$index450 = 0, $$index451 = 0, $$index452 = 0, $$index453 = 0, $$index454 = 0, $$index455 = 0, $$index456 = 0, $$index457 = 0, $$index458 = 0, $$index459 = 0, $$index46 = 0, $$index460 = 0, $$index461 = 0, $$index462 = 0, $$index463 = 0, $$index464 = 0, $$index465 = 0, $$index466 = 0, $$index467 = 0, $$index468 = 0;
 var $$index469 = 0, $$index47 = 0, $$index470 = 0, $$index471 = 0, $$index472 = 0, $$index473 = 0, $$index474 = 0, $$index475 = 0, $$index476 = 0, $$index477 = 0, $$index478 = 0, $$index479 = 0, $$index48 = 0, $$index480 = 0, $$index481 = 0, $$index482 = 0, $$index483 = 0, $$index484 = 0, $$index485 = 0, $$index486 = 0;
 var $$index487 = 0, $$index488 = 0, $$index489 = 0, $$index49 = 0, $$index490 = 0, $$index491 = 0, $$index492 = 0, $$index493 = 0, $$index494 = 0, $$index495 = 0, $$index496 = 0, $$index497 = 0, $$index498 = 0, $$index499 = 0, $$index50 = 0, $$index500 = 0, $$index501 = 0, $$index502 = 0, $$index503 = 0, $$index504 = 0;
 var $$index505 = 0, $$index506 = 0, $$index507 = 0, $$index508 = 0, $$index509 = 0, $$index51 = 0, $$index510 = 0, $$index511 = 0, $$index512 = 0, $$index513 = 0, $$index514 = 0, $$index515 = 0, $$index516 = 0, $$index517 = 0, $$index518 = 0, $$index519 = 0, $$index52 = 0, $$index520 = 0, $$index521 = 0, $$index522 = 0;
 var $$index523 = 0, $$index524 = 0, $$index525 = 0, $$index526 = 0, $$index527 = 0, $$index528 = 0, $$index529 = 0, $$index53 = 0, $$index530 = 0, $$index531 = 0, $$index532 = 0, $$index533 = 0, $$index534 = 0, $$index535 = 0, $$index536 = 0, $$index537 = 0, $$index538 = 0, $$index539 = 0, $$index54 = 0, $$index540 = 0;
 var $$index541 = 0, $$index542 = 0, $$index543 = 0, $$index544 = 0, $$index545 = 0, $$index546 = 0, $$index547 = 0, $$index548 = 0, $$index549 = 0, $$index55 = 0, $$index550 = 0, $$index551 = 0, $$index552 = 0, $$index553 = 0, $$index554 = 0, $$index555 = 0, $$index556 = 0, $$index557 = 0, $$index558 = 0, $$index559 = 0;
 var $$index56 = 0, $$index560 = 0, $$index561 = 0, $$index562 = 0, $$index563 = 0, $$index564 = 0, $$index565 = 0, $$index566 = 0, $$index567 = 0, $$index568 = 0, $$index569 = 0, $$index57 = 0, $$index570 = 0, $$index571 = 0, $$index572 = 0, $$index573 = 0, $$index574 = 0, $$index575 = 0, $$index576 = 0, $$index577 = 0;
 var $$index578 = 0, $$index579 = 0, $$index58 = 0, $$index580 = 0, $$index581 = 0, $$index582 = 0, $$index583 = 0, $$index584 = 0, $$index585 = 0, $$index586 = 0, $$index587 = 0, $$index588 = 0, $$index589 = 0, $$index59 = 0, $$index590 = 0, $$index591 = 0, $$index592 = 0, $$index593 = 0, $$index594 = 0, $$index595 = 0;
 var $$index596 = 0, $$index597 = 0, $$index598 = 0, $$index599 = 0, $$index60 = 0, $$index600 = 0, $$index601 = 0, $$index602 = 0, $$index603 = 0, $$index604 = 0, $$index605 = 0, $$index606 = 0, $$index607 = 0, $$index608 = 0, $$index609 = 0, $$index61 = 0, $$index610 = 0, $$index611 = 0, $$index612 = 0, $$index613 = 0;
 var $$index614 = 0, $$index615 = 0, $$index616 = 0, $$index617 = 0, $$index618 = 0, $$index619 = 0, $$index62 = 0, $$index620 = 0, $$index621 = 0, $$index622 = 0, $$index623 = 0, $$index624 = 0, $$index625 = 0, $$index626 = 0, $$index627 = 0, $$index628 = 0, $$index629 = 0, $$index63 = 0, $$index630 = 0, $$index631 = 0;
 var $$index632 = 0, $$index633 = 0, $$index634 = 0, $$index635 = 0, $$index636 = 0, $$index637 = 0, $$index638 = 0, $$index639 = 0, $$index64 = 0, $$index640 = 0, $$index641 = 0, $$index642 = 0, $$index643 = 0, $$index644 = 0, $$index645 = 0, $$index646 = 0, $$index647 = 0, $$index648 = 0, $$index649 = 0, $$index65 = 0;
 var $$index650 = 0, $$index651 = 0, $$index652 = 0, $$index653 = 0, $$index654 = 0, $$index655 = 0, $$index656 = 0, $$index657 = 0, $$index658 = 0, $$index659 = 0, $$index66 = 0, $$index660 = 0, $$index661 = 0, $$index662 = 0, $$index663 = 0, $$index664 = 0, $$index665 = 0, $$index666 = 0, $$index667 = 0, $$index668 = 0;
 var $$index669 = 0, $$index67 = 0, $$index670 = 0, $$index671 = 0, $$index672 = 0, $$index673 = 0, $$index674 = 0, $$index675 = 0, $$index676 = 0, $$index677 = 0, $$index678 = 0, $$index679 = 0, $$index68 = 0, $$index680 = 0, $$index681 = 0, $$index682 = 0, $$index683 = 0, $$index684 = 0, $$index685 = 0, $$index686 = 0;
 var $$index687 = 0, $$index688 = 0, $$index689 = 0, $$index69 = 0, $$index690 = 0, $$index691 = 0, $$index692 = 0, $$index693 = 0, $$index694 = 0, $$index695 = 0, $$index696 = 0, $$index697 = 0, $$index698 = 0, $$index699 = 0, $$index70 = 0, $$index700 = 0, $$index701 = 0, $$index702 = 0, $$index703 = 0, $$index704 = 0;
 var $$index705 = 0, $$index706 = 0, $$index707 = 0, $$index708 = 0, $$index709 = 0, $$index71 = 0, $$index710 = 0, $$index711 = 0, $$index712 = 0, $$index713 = 0, $$index714 = 0, $$index715 = 0, $$index716 = 0, $$index717 = 0, $$index718 = 0, $$index719 = 0, $$index72 = 0, $$index720 = 0, $$index721 = 0, $$index722 = 0;
 var $$index723 = 0, $$index724 = 0, $$index725 = 0, $$index726 = 0, $$index727 = 0, $$index728 = 0, $$index729 = 0, $$index73 = 0, $$index730 = 0, $$index731 = 0, $$index732 = 0, $$index733 = 0, $$index734 = 0, $$index735 = 0, $$index736 = 0, $$index737 = 0, $$index738 = 0, $$index739 = 0, $$index74 = 0, $$index740 = 0;
 var $$index741 = 0, $$index742 = 0, $$index743 = 0, $$index744 = 0, $$index745 = 0, $$index746 = 0, $$index747 = 0, $$index748 = 0, $$index749 = 0, $$index75 = 0, $$index750 = 0, $$index751 = 0, $$index752 = 0, $$index753 = 0, $$index754 = 0, $$index755 = 0, $$index756 = 0, $$index757 = 0, $$index758 = 0, $$index759 = 0;
 var $$index76 = 0, $$index760 = 0, $$index761 = 0, $$index762 = 0, $$index763 = 0, $$index764 = 0, $$index765 = 0, $$index766 = 0, $$index767 = 0, $$index768 = 0, $$index769 = 0, $$index77 = 0, $$index770 = 0, $$index771 = 0, $$index772 = 0, $$index773 = 0, $$index774 = 0, $$index775 = 0, $$index776 = 0, $$index777 = 0;
 var $$index778 = 0, $$index779 = 0, $$index78 = 0, $$index780 = 0, $$index781 = 0, $$index782 = 0, $$index783 = 0, $$index784 = 0, $$index785 = 0, $$index786 = 0, $$index787 = 0, $$index788 = 0, $$index789 = 0, $$index79 = 0, $$index790 = 0, $$index791 = 0, $$index792 = 0, $$index793 = 0, $$index794 = 0, $$index795 = 0;
 var $$index796 = 0, $$index797 = 0, $$index798 = 0, $$index799 = 0, $$index80 = 0, $$index800 = 0, $$index801 = 0, $$index802 = 0, $$index803 = 0, $$index804 = 0, $$index805 = 0, $$index806 = 0, $$index807 = 0, $$index808 = 0, $$index809 = 0, $$index81 = 0, $$index810 = 0, $$index811 = 0, $$index812 = 0, $$index813 = 0;
 var $$index814 = 0, $$index815 = 0, $$index816 = 0, $$index817 = 0, $$index818 = 0, $$index819 = 0, $$index82 = 0, $$index820 = 0, $$index821 = 0, $$index822 = 0, $$index823 = 0, $$index824 = 0, $$index825 = 0, $$index826 = 0, $$index827 = 0, $$index828 = 0, $$index829 = 0, $$index83 = 0, $$index830 = 0, $$index831 = 0;
 var $$index832 = 0, $$index833 = 0, $$index834 = 0, $$index835 = 0, $$index836 = 0, $$index837 = 0, $$index838 = 0, $$index839 = 0, $$index84 = 0, $$index840 = 0, $$index841 = 0, $$index842 = 0, $$index843 = 0, $$index844 = 0, $$index845 = 0, $$index846 = 0, $$index847 = 0, $$index848 = 0, $$index849 = 0, $$index85 = 0;
 var $$index850 = 0, $$index851 = 0, $$index852 = 0, $$index853 = 0, $$index854 = 0, $$index855 = 0, $$index856 = 0, $$index857 = 0, $$index858 = 0, $$index859 = 0, $$index86 = 0, $$index860 = 0, $$index861 = 0, $$index862 = 0, $$index863 = 0, $$index864 = 0, $$index865 = 0, $$index866 = 0, $$index867 = 0, $$index868 = 0;
 var $$index869 = 0, $$index87 = 0, $$index870 = 0, $$index871 = 0, $$index872 = 0, $$index873 = 0, $$index874 = 0, $$index875 = 0, $$index876 = 0, $$index877 = 0, $$index878 = 0, $$index879 = 0, $$index88 = 0, $$index880 = 0, $$index881 = 0, $$index882 = 0, $$index883 = 0, $$index884 = 0, $$index885 = 0, $$index886 = 0;
 var $$index887 = 0, $$index888 = 0, $$index889 = 0, $$index89 = 0, $$index890 = 0, $$index891 = 0, $$index892 = 0, $$index893 = 0, $$index894 = 0, $$index895 = 0, $$index896 = 0, $$index897 = 0, $$index898 = 0, $$index899 = 0, $$index90 = 0, $$index900 = 0, $$index901 = 0, $$index902 = 0, $$index903 = 0, $$index904 = 0;
 var $$index905 = 0, $$index906 = 0, $$index907 = 0, $$index908 = 0, $$index909 = 0, $$index91 = 0, $$index910 = 0, $$index911 = 0, $$index912 = 0, $$index913 = 0, $$index914 = 0, $$index915 = 0, $$index916 = 0, $$index917 = 0, $$index918 = 0, $$index919 = 0, $$index92 = 0, $$index920 = 0, $$index921 = 0, $$index922 = 0;
 var $$index923 = 0, $$index924 = 0, $$index925 = 0, $$index926 = 0, $$index927 = 0, $$index928 = 0, $$index929 = 0, $$index93 = 0, $$index930 = 0, $$index931 = 0, $$index932 = 0, $$index933 = 0, $$index934 = 0, $$index935 = 0, $$index936 = 0, $$index937 = 0, $$index938 = 0, $$index939 = 0, $$index94 = 0, $$index940 = 0;
 var $$index941 = 0, $$index942 = 0, $$index943 = 0, $$index944 = 0, $$index945 = 0, $$index946 = 0, $$index947 = 0, $$index948 = 0, $$index949 = 0, $$index95 = 0, $$index950 = 0, $$index951 = 0, $$index952 = 0, $$index953 = 0, $$index954 = 0, $$index955 = 0, $$index956 = 0, $$index957 = 0, $$index958 = 0, $$index959 = 0;
 var $$index96 = 0, $$index960 = 0, $$index961 = 0, $$index962 = 0, $$index963 = 0, $$index964 = 0, $$index965 = 0, $$index966 = 0, $$index967 = 0, $$index968 = 0, $$index969 = 0, $$index97 = 0, $$index970 = 0, $$index971 = 0, $$index972 = 0, $$index973 = 0, $$index974 = 0, $$index975 = 0, $$index976 = 0, $$index977 = 0;
 var $$index978 = 0, $$index979 = 0, $$index98 = 0, $$index980 = 0, $$index981 = 0, $$index982 = 0, $$index983 = 0, $$index984 = 0, $$index985 = 0, $$index986 = 0, $$index987 = 0, $$index988 = 0, $$index989 = 0, $$index99 = 0, $$index990 = 0, $$index991 = 0, $$index992 = 0, $$index993 = 0, $$index994 = 0, $$index995 = 0;
 var $$index996 = 0, $$index997 = 0, $$index998 = 0, $$index999 = 0, $$ptr = 0, $$ptr$index16408 = 0, $$ptr1 = 0, $$ptr1$index16439 = 0, $$ptr2 = 0, $$ptr2$index16440 = 0, $$ptr2$index16441 = 0, $$ptr3 = 0, $$ptr3$index16460 = 0, $$ptr4 = 0, $$ptr4$index16473 = 0, $$ptr4$index16474 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0;
 var $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0;
 var $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0;
 var $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0;
 var $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0;
 var $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0;
 var $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
 var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
 var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
 var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
 var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $args$sreg$field = 0, $args$sreg$index11 = 0, $args$sreg$index8 = 0, $fmt$sreg$field = 0;
 var $fmt$sreg$index5 = 0, label = 0, sp = 0;
 sp = STACKTOP;
 STACKTOP = STACKTOP + 4336|0;
 $0 = sp;
 $$ptr4 = sp + 200|0;
 $$ptr3 = sp + 184|0;
 $$ptr1 = sp + 168|0;
 $$ptr2 = sp + 144|0;
 $$ptr = sp + 128|0;
 $fmt$sreg$field = HEAP32[$fmt$ptr>>2]|0;
 $fmt$sreg$index5 = ((($fmt$ptr)) + 8|0);
 $1 = $fmt$sreg$index5;
 $2 = $1;
 $3 = HEAP32[$2>>2]|0;
 $4 = (($1) + 4)|0;
 $5 = $4;
 $6 = HEAP32[$5>>2]|0;
 $args$sreg$field = HEAP32[$args$ptr>>2]|0;
 $args$sreg$index8 = ((($args$ptr)) + 8|0);
 $7 = $args$sreg$index8;
 $8 = $7;
 $9 = HEAP32[$8>>2]|0;
 $10 = (($7) + 4)|0;
 $11 = $10;
 $12 = HEAP32[$11>>2]|0;
 $args$sreg$index11 = ((($args$ptr)) + 16|0);
 $13 = $args$sreg$index11;
 $14 = $13;
 $15 = HEAP32[$14>>2]|0;
 $16 = (($13) + 4)|0;
 $17 = $16;
 $18 = HEAP32[$17>>2]|0;
 $19 = sp + 224|0;
 $20 = sp + 112|0;
 $21 = sp + 88|0;
 $22 = sp + 232|0;
 $23 = sp + 64|0;
 $24 = sp + 40|0;
 $25 = sp + 16|0;
 HEAP32[$19>>2] = 0;
 HEAP32[$19>>2] = $fd;
 HEAP32[$20>>2] = 0;
 $$index14 = ((($20)) + 8|0);
 $26 = $$index14;
 $27 = $26;
 HEAP32[$27>>2] = 0;
 $28 = (($26) + 4)|0;
 $29 = $28;
 HEAP32[$29>>2] = 0;
 HEAP32[$20>>2] = $fmt$sreg$field;
 $$index16 = ((($20)) + 8|0);
 $30 = $$index16;
 $31 = $30;
 HEAP32[$31>>2] = $3;
 $32 = (($30) + 4)|0;
 $33 = $32;
 HEAP32[$33>>2] = $6;
 HEAP32[$21>>2] = 0;
 $$index18 = ((($21)) + 8|0);
 $34 = $$index18;
 $35 = $34;
 HEAP32[$35>>2] = 0;
 $36 = (($34) + 4)|0;
 $37 = $36;
 HEAP32[$37>>2] = 0;
 $$index19 = ((($21)) + 16|0);
 $38 = $$index19;
 $39 = $38;
 HEAP32[$39>>2] = 0;
 $40 = (($38) + 4)|0;
 $41 = $40;
 HEAP32[$41>>2] = 0;
 HEAP32[$21>>2] = $args$sreg$field;
 $$index21 = ((($21)) + 8|0);
 $42 = $$index21;
 $43 = $42;
 HEAP32[$43>>2] = $9;
 $44 = (($42) + 4)|0;
 $45 = $44;
 HEAP32[$45>>2] = $12;
 $$index22 = ((($21)) + 16|0);
 $46 = $$index22;
 $47 = $46;
 HEAP32[$47>>2] = $15;
 $48 = (($46) + 4)|0;
 $49 = $48;
 HEAP32[$49>>2] = $18;
 HEAP8[$22>>0] = 0;
 $$index24 = ((($22)) + 1|0);
 HEAP8[$$index24>>0] = 0;
 $$index25 = ((($22)) + 2|0);
 HEAP8[$$index25>>0] = 0;
 $$index26 = ((($22)) + 3|0);
 HEAP8[$$index26>>0] = 0;
 $$index27 = ((($22)) + 4|0);
 HEAP8[$$index27>>0] = 0;
 $$index28 = ((($22)) + 5|0);
 HEAP8[$$index28>>0] = 0;
 $$index29 = ((($22)) + 6|0);
 HEAP8[$$index29>>0] = 0;
 $$index30 = ((($22)) + 7|0);
 HEAP8[$$index30>>0] = 0;
 $$index31 = ((($22)) + 8|0);
 HEAP8[$$index31>>0] = 0;
 $$index32 = ((($22)) + 9|0);
 HEAP8[$$index32>>0] = 0;
 $$index33 = ((($22)) + 10|0);
 HEAP8[$$index33>>0] = 0;
 $$index34 = ((($22)) + 11|0);
 HEAP8[$$index34>>0] = 0;
 $$index35 = ((($22)) + 12|0);
 HEAP8[$$index35>>0] = 0;
 $$index36 = ((($22)) + 13|0);
 HEAP8[$$index36>>0] = 0;
 $$index37 = ((($22)) + 14|0);
 HEAP8[$$index37>>0] = 0;
 $$index38 = ((($22)) + 15|0);
 HEAP8[$$index38>>0] = 0;
 $$index39 = ((($22)) + 16|0);
 HEAP8[$$index39>>0] = 0;
 $$index40 = ((($22)) + 17|0);
 HEAP8[$$index40>>0] = 0;
 $$index41 = ((($22)) + 18|0);
 HEAP8[$$index41>>0] = 0;
 $$index42 = ((($22)) + 19|0);
 HEAP8[$$index42>>0] = 0;
 $$index43 = ((($22)) + 20|0);
 HEAP8[$$index43>>0] = 0;
 $$index44 = ((($22)) + 21|0);
 HEAP8[$$index44>>0] = 0;
 $$index45 = ((($22)) + 22|0);
 HEAP8[$$index45>>0] = 0;
 $$index46 = ((($22)) + 23|0);
 HEAP8[$$index46>>0] = 0;
 $$index47 = ((($22)) + 24|0);
 HEAP8[$$index47>>0] = 0;
 $$index48 = ((($22)) + 25|0);
 HEAP8[$$index48>>0] = 0;
 $$index49 = ((($22)) + 26|0);
 HEAP8[$$index49>>0] = 0;
 $$index50 = ((($22)) + 27|0);
 HEAP8[$$index50>>0] = 0;
 $$index51 = ((($22)) + 28|0);
 HEAP8[$$index51>>0] = 0;
 $$index52 = ((($22)) + 29|0);
 HEAP8[$$index52>>0] = 0;
 $$index53 = ((($22)) + 30|0);
 HEAP8[$$index53>>0] = 0;
 $$index54 = ((($22)) + 31|0);
 HEAP8[$$index54>>0] = 0;
 $$index55 = ((($22)) + 32|0);
 HEAP8[$$index55>>0] = 0;
 $$index56 = ((($22)) + 33|0);
 HEAP8[$$index56>>0] = 0;
 $$index57 = ((($22)) + 34|0);
 HEAP8[$$index57>>0] = 0;
 $$index58 = ((($22)) + 35|0);
 HEAP8[$$index58>>0] = 0;
 $$index59 = ((($22)) + 36|0);
 HEAP8[$$index59>>0] = 0;
 $$index60 = ((($22)) + 37|0);
 HEAP8[$$index60>>0] = 0;
 $$index61 = ((($22)) + 38|0);
 HEAP8[$$index61>>0] = 0;
 $$index62 = ((($22)) + 39|0);
 HEAP8[$$index62>>0] = 0;
 $$index63 = ((($22)) + 40|0);
 HEAP8[$$index63>>0] = 0;
 $$index64 = ((($22)) + 41|0);
 HEAP8[$$index64>>0] = 0;
 $$index65 = ((($22)) + 42|0);
 HEAP8[$$index65>>0] = 0;
 $$index66 = ((($22)) + 43|0);
 HEAP8[$$index66>>0] = 0;
 $$index67 = ((($22)) + 44|0);
 HEAP8[$$index67>>0] = 0;
 $$index68 = ((($22)) + 45|0);
 HEAP8[$$index68>>0] = 0;
 $$index69 = ((($22)) + 46|0);
 HEAP8[$$index69>>0] = 0;
 $$index70 = ((($22)) + 47|0);
 HEAP8[$$index70>>0] = 0;
 $$index71 = ((($22)) + 48|0);
 HEAP8[$$index71>>0] = 0;
 $$index72 = ((($22)) + 49|0);
 HEAP8[$$index72>>0] = 0;
 $$index73 = ((($22)) + 50|0);
 HEAP8[$$index73>>0] = 0;
 $$index74 = ((($22)) + 51|0);
 HEAP8[$$index74>>0] = 0;
 $$index75 = ((($22)) + 52|0);
 HEAP8[$$index75>>0] = 0;
 $$index76 = ((($22)) + 53|0);
 HEAP8[$$index76>>0] = 0;
 $$index77 = ((($22)) + 54|0);
 HEAP8[$$index77>>0] = 0;
 $$index78 = ((($22)) + 55|0);
 HEAP8[$$index78>>0] = 0;
 $$index79 = ((($22)) + 56|0);
 HEAP8[$$index79>>0] = 0;
 $$index80 = ((($22)) + 57|0);
 HEAP8[$$index80>>0] = 0;
 $$index81 = ((($22)) + 58|0);
 HEAP8[$$index81>>0] = 0;
 $$index82 = ((($22)) + 59|0);
 HEAP8[$$index82>>0] = 0;
 $$index83 = ((($22)) + 60|0);
 HEAP8[$$index83>>0] = 0;
 $$index84 = ((($22)) + 61|0);
 HEAP8[$$index84>>0] = 0;
 $$index85 = ((($22)) + 62|0);
 HEAP8[$$index85>>0] = 0;
 $$index86 = ((($22)) + 63|0);
 HEAP8[$$index86>>0] = 0;
 $$index87 = ((($22)) + 64|0);
 HEAP8[$$index87>>0] = 0;
 $$index88 = ((($22)) + 65|0);
 HEAP8[$$index88>>0] = 0;
 $$index89 = ((($22)) + 66|0);
 HEAP8[$$index89>>0] = 0;
 $$index90 = ((($22)) + 67|0);
 HEAP8[$$index90>>0] = 0;
 $$index91 = ((($22)) + 68|0);
 HEAP8[$$index91>>0] = 0;
 $$index92 = ((($22)) + 69|0);
 HEAP8[$$index92>>0] = 0;
 $$index93 = ((($22)) + 70|0);
 HEAP8[$$index93>>0] = 0;
 $$index94 = ((($22)) + 71|0);
 HEAP8[$$index94>>0] = 0;
 $$index95 = ((($22)) + 72|0);
 HEAP8[$$index95>>0] = 0;
 $$index96 = ((($22)) + 73|0);
 HEAP8[$$index96>>0] = 0;
 $$index97 = ((($22)) + 74|0);
 HEAP8[$$index97>>0] = 0;
 $$index98 = ((($22)) + 75|0);
 HEAP8[$$index98>>0] = 0;
 $$index99 = ((($22)) + 76|0);
 HEAP8[$$index99>>0] = 0;
 $$index100 = ((($22)) + 77|0);
 HEAP8[$$index100>>0] = 0;
 $$index101 = ((($22)) + 78|0);
 HEAP8[$$index101>>0] = 0;
 $$index102 = ((($22)) + 79|0);
 HEAP8[$$index102>>0] = 0;
 $$index103 = ((($22)) + 80|0);
 HEAP8[$$index103>>0] = 0;
 $$index104 = ((($22)) + 81|0);
 HEAP8[$$index104>>0] = 0;
 $$index105 = ((($22)) + 82|0);
 HEAP8[$$index105>>0] = 0;
 $$index106 = ((($22)) + 83|0);
 HEAP8[$$index106>>0] = 0;
 $$index107 = ((($22)) + 84|0);
 HEAP8[$$index107>>0] = 0;
 $$index108 = ((($22)) + 85|0);
 HEAP8[$$index108>>0] = 0;
 $$index109 = ((($22)) + 86|0);
 HEAP8[$$index109>>0] = 0;
 $$index110 = ((($22)) + 87|0);
 HEAP8[$$index110>>0] = 0;
 $$index111 = ((($22)) + 88|0);
 HEAP8[$$index111>>0] = 0;
 $$index112 = ((($22)) + 89|0);
 HEAP8[$$index112>>0] = 0;
 $$index113 = ((($22)) + 90|0);
 HEAP8[$$index113>>0] = 0;
 $$index114 = ((($22)) + 91|0);
 HEAP8[$$index114>>0] = 0;
 $$index115 = ((($22)) + 92|0);
 HEAP8[$$index115>>0] = 0;
 $$index116 = ((($22)) + 93|0);
 HEAP8[$$index116>>0] = 0;
 $$index117 = ((($22)) + 94|0);
 HEAP8[$$index117>>0] = 0;
 $$index118 = ((($22)) + 95|0);
 HEAP8[$$index118>>0] = 0;
 $$index119 = ((($22)) + 96|0);
 HEAP8[$$index119>>0] = 0;
 $$index120 = ((($22)) + 97|0);
 HEAP8[$$index120>>0] = 0;
 $$index121 = ((($22)) + 98|0);
 HEAP8[$$index121>>0] = 0;
 $$index122 = ((($22)) + 99|0);
 HEAP8[$$index122>>0] = 0;
 $$index123 = ((($22)) + 100|0);
 HEAP8[$$index123>>0] = 0;
 $$index124 = ((($22)) + 101|0);
 HEAP8[$$index124>>0] = 0;
 $$index125 = ((($22)) + 102|0);
 HEAP8[$$index125>>0] = 0;
 $$index126 = ((($22)) + 103|0);
 HEAP8[$$index126>>0] = 0;
 $$index127 = ((($22)) + 104|0);
 HEAP8[$$index127>>0] = 0;
 $$index128 = ((($22)) + 105|0);
 HEAP8[$$index128>>0] = 0;
 $$index129 = ((($22)) + 106|0);
 HEAP8[$$index129>>0] = 0;
 $$index130 = ((($22)) + 107|0);
 HEAP8[$$index130>>0] = 0;
 $$index131 = ((($22)) + 108|0);
 HEAP8[$$index131>>0] = 0;
 $$index132 = ((($22)) + 109|0);
 HEAP8[$$index132>>0] = 0;
 $$index133 = ((($22)) + 110|0);
 HEAP8[$$index133>>0] = 0;
 $$index134 = ((($22)) + 111|0);
 HEAP8[$$index134>>0] = 0;
 $$index135 = ((($22)) + 112|0);
 HEAP8[$$index135>>0] = 0;
 $$index136 = ((($22)) + 113|0);
 HEAP8[$$index136>>0] = 0;
 $$index137 = ((($22)) + 114|0);
 HEAP8[$$index137>>0] = 0;
 $$index138 = ((($22)) + 115|0);
 HEAP8[$$index138>>0] = 0;
 $$index139 = ((($22)) + 116|0);
 HEAP8[$$index139>>0] = 0;
 $$index140 = ((($22)) + 117|0);
 HEAP8[$$index140>>0] = 0;
 $$index141 = ((($22)) + 118|0);
 HEAP8[$$index141>>0] = 0;
 $$index142 = ((($22)) + 119|0);
 HEAP8[$$index142>>0] = 0;
 $$index143 = ((($22)) + 120|0);
 HEAP8[$$index143>>0] = 0;
 $$index144 = ((($22)) + 121|0);
 HEAP8[$$index144>>0] = 0;
 $$index145 = ((($22)) + 122|0);
 HEAP8[$$index145>>0] = 0;
 $$index146 = ((($22)) + 123|0);
 HEAP8[$$index146>>0] = 0;
 $$index147 = ((($22)) + 124|0);
 HEAP8[$$index147>>0] = 0;
 $$index148 = ((($22)) + 125|0);
 HEAP8[$$index148>>0] = 0;
 $$index149 = ((($22)) + 126|0);
 HEAP8[$$index149>>0] = 0;
 $$index150 = ((($22)) + 127|0);
 HEAP8[$$index150>>0] = 0;
 $$index151 = ((($22)) + 128|0);
 HEAP8[$$index151>>0] = 0;
 $$index152 = ((($22)) + 129|0);
 HEAP8[$$index152>>0] = 0;
 $$index153 = ((($22)) + 130|0);
 HEAP8[$$index153>>0] = 0;
 $$index154 = ((($22)) + 131|0);
 HEAP8[$$index154>>0] = 0;
 $$index155 = ((($22)) + 132|0);
 HEAP8[$$index155>>0] = 0;
 $$index156 = ((($22)) + 133|0);
 HEAP8[$$index156>>0] = 0;
 $$index157 = ((($22)) + 134|0);
 HEAP8[$$index157>>0] = 0;
 $$index158 = ((($22)) + 135|0);
 HEAP8[$$index158>>0] = 0;
 $$index159 = ((($22)) + 136|0);
 HEAP8[$$index159>>0] = 0;
 $$index160 = ((($22)) + 137|0);
 HEAP8[$$index160>>0] = 0;
 $$index161 = ((($22)) + 138|0);
 HEAP8[$$index161>>0] = 0;
 $$index162 = ((($22)) + 139|0);
 HEAP8[$$index162>>0] = 0;
 $$index163 = ((($22)) + 140|0);
 HEAP8[$$index163>>0] = 0;
 $$index164 = ((($22)) + 141|0);
 HEAP8[$$index164>>0] = 0;
 $$index165 = ((($22)) + 142|0);
 HEAP8[$$index165>>0] = 0;
 $$index166 = ((($22)) + 143|0);
 HEAP8[$$index166>>0] = 0;
 $$index167 = ((($22)) + 144|0);
 HEAP8[$$index167>>0] = 0;
 $$index168 = ((($22)) + 145|0);
 HEAP8[$$index168>>0] = 0;
 $$index169 = ((($22)) + 146|0);
 HEAP8[$$index169>>0] = 0;
 $$index170 = ((($22)) + 147|0);
 HEAP8[$$index170>>0] = 0;
 $$index171 = ((($22)) + 148|0);
 HEAP8[$$index171>>0] = 0;
 $$index172 = ((($22)) + 149|0);
 HEAP8[$$index172>>0] = 0;
 $$index173 = ((($22)) + 150|0);
 HEAP8[$$index173>>0] = 0;
 $$index174 = ((($22)) + 151|0);
 HEAP8[$$index174>>0] = 0;
 $$index175 = ((($22)) + 152|0);
 HEAP8[$$index175>>0] = 0;
 $$index176 = ((($22)) + 153|0);
 HEAP8[$$index176>>0] = 0;
 $$index177 = ((($22)) + 154|0);
 HEAP8[$$index177>>0] = 0;
 $$index178 = ((($22)) + 155|0);
 HEAP8[$$index178>>0] = 0;
 $$index179 = ((($22)) + 156|0);
 HEAP8[$$index179>>0] = 0;
 $$index180 = ((($22)) + 157|0);
 HEAP8[$$index180>>0] = 0;
 $$index181 = ((($22)) + 158|0);
 HEAP8[$$index181>>0] = 0;
 $$index182 = ((($22)) + 159|0);
 HEAP8[$$index182>>0] = 0;
 $$index183 = ((($22)) + 160|0);
 HEAP8[$$index183>>0] = 0;
 $$index184 = ((($22)) + 161|0);
 HEAP8[$$index184>>0] = 0;
 $$index185 = ((($22)) + 162|0);
 HEAP8[$$index185>>0] = 0;
 $$index186 = ((($22)) + 163|0);
 HEAP8[$$index186>>0] = 0;
 $$index187 = ((($22)) + 164|0);
 HEAP8[$$index187>>0] = 0;
 $$index188 = ((($22)) + 165|0);
 HEAP8[$$index188>>0] = 0;
 $$index189 = ((($22)) + 166|0);
 HEAP8[$$index189>>0] = 0;
 $$index190 = ((($22)) + 167|0);
 HEAP8[$$index190>>0] = 0;
 $$index191 = ((($22)) + 168|0);
 HEAP8[$$index191>>0] = 0;
 $$index192 = ((($22)) + 169|0);
 HEAP8[$$index192>>0] = 0;
 $$index193 = ((($22)) + 170|0);
 HEAP8[$$index193>>0] = 0;
 $$index194 = ((($22)) + 171|0);
 HEAP8[$$index194>>0] = 0;
 $$index195 = ((($22)) + 172|0);
 HEAP8[$$index195>>0] = 0;
 $$index196 = ((($22)) + 173|0);
 HEAP8[$$index196>>0] = 0;
 $$index197 = ((($22)) + 174|0);
 HEAP8[$$index197>>0] = 0;
 $$index198 = ((($22)) + 175|0);
 HEAP8[$$index198>>0] = 0;
 $$index199 = ((($22)) + 176|0);
 HEAP8[$$index199>>0] = 0;
 $$index200 = ((($22)) + 177|0);
 HEAP8[$$index200>>0] = 0;
 $$index201 = ((($22)) + 178|0);
 HEAP8[$$index201>>0] = 0;
 $$index202 = ((($22)) + 179|0);
 HEAP8[$$index202>>0] = 0;
 $$index203 = ((($22)) + 180|0);
 HEAP8[$$index203>>0] = 0;
 $$index204 = ((($22)) + 181|0);
 HEAP8[$$index204>>0] = 0;
 $$index205 = ((($22)) + 182|0);
 HEAP8[$$index205>>0] = 0;
 $$index206 = ((($22)) + 183|0);
 HEAP8[$$index206>>0] = 0;
 $$index207 = ((($22)) + 184|0);
 HEAP8[$$index207>>0] = 0;
 $$index208 = ((($22)) + 185|0);
 HEAP8[$$index208>>0] = 0;
 $$index209 = ((($22)) + 186|0);
 HEAP8[$$index209>>0] = 0;
 $$index210 = ((($22)) + 187|0);
 HEAP8[$$index210>>0] = 0;
 $$index211 = ((($22)) + 188|0);
 HEAP8[$$index211>>0] = 0;
 $$index212 = ((($22)) + 189|0);
 HEAP8[$$index212>>0] = 0;
 $$index213 = ((($22)) + 190|0);
 HEAP8[$$index213>>0] = 0;
 $$index214 = ((($22)) + 191|0);
 HEAP8[$$index214>>0] = 0;
 $$index215 = ((($22)) + 192|0);
 HEAP8[$$index215>>0] = 0;
 $$index216 = ((($22)) + 193|0);
 HEAP8[$$index216>>0] = 0;
 $$index217 = ((($22)) + 194|0);
 HEAP8[$$index217>>0] = 0;
 $$index218 = ((($22)) + 195|0);
 HEAP8[$$index218>>0] = 0;
 $$index219 = ((($22)) + 196|0);
 HEAP8[$$index219>>0] = 0;
 $$index220 = ((($22)) + 197|0);
 HEAP8[$$index220>>0] = 0;
 $$index221 = ((($22)) + 198|0);
 HEAP8[$$index221>>0] = 0;
 $$index222 = ((($22)) + 199|0);
 HEAP8[$$index222>>0] = 0;
 $$index223 = ((($22)) + 200|0);
 HEAP8[$$index223>>0] = 0;
 $$index224 = ((($22)) + 201|0);
 HEAP8[$$index224>>0] = 0;
 $$index225 = ((($22)) + 202|0);
 HEAP8[$$index225>>0] = 0;
 $$index226 = ((($22)) + 203|0);
 HEAP8[$$index226>>0] = 0;
 $$index227 = ((($22)) + 204|0);
 HEAP8[$$index227>>0] = 0;
 $$index228 = ((($22)) + 205|0);
 HEAP8[$$index228>>0] = 0;
 $$index229 = ((($22)) + 206|0);
 HEAP8[$$index229>>0] = 0;
 $$index230 = ((($22)) + 207|0);
 HEAP8[$$index230>>0] = 0;
 $$index231 = ((($22)) + 208|0);
 HEAP8[$$index231>>0] = 0;
 $$index232 = ((($22)) + 209|0);
 HEAP8[$$index232>>0] = 0;
 $$index233 = ((($22)) + 210|0);
 HEAP8[$$index233>>0] = 0;
 $$index234 = ((($22)) + 211|0);
 HEAP8[$$index234>>0] = 0;
 $$index235 = ((($22)) + 212|0);
 HEAP8[$$index235>>0] = 0;
 $$index236 = ((($22)) + 213|0);
 HEAP8[$$index236>>0] = 0;
 $$index237 = ((($22)) + 214|0);
 HEAP8[$$index237>>0] = 0;
 $$index238 = ((($22)) + 215|0);
 HEAP8[$$index238>>0] = 0;
 $$index239 = ((($22)) + 216|0);
 HEAP8[$$index239>>0] = 0;
 $$index240 = ((($22)) + 217|0);
 HEAP8[$$index240>>0] = 0;
 $$index241 = ((($22)) + 218|0);
 HEAP8[$$index241>>0] = 0;
 $$index242 = ((($22)) + 219|0);
 HEAP8[$$index242>>0] = 0;
 $$index243 = ((($22)) + 220|0);
 HEAP8[$$index243>>0] = 0;
 $$index244 = ((($22)) + 221|0);
 HEAP8[$$index244>>0] = 0;
 $$index245 = ((($22)) + 222|0);
 HEAP8[$$index245>>0] = 0;
 $$index246 = ((($22)) + 223|0);
 HEAP8[$$index246>>0] = 0;
 $$index247 = ((($22)) + 224|0);
 HEAP8[$$index247>>0] = 0;
 $$index248 = ((($22)) + 225|0);
 HEAP8[$$index248>>0] = 0;
 $$index249 = ((($22)) + 226|0);
 HEAP8[$$index249>>0] = 0;
 $$index250 = ((($22)) + 227|0);
 HEAP8[$$index250>>0] = 0;
 $$index251 = ((($22)) + 228|0);
 HEAP8[$$index251>>0] = 0;
 $$index252 = ((($22)) + 229|0);
 HEAP8[$$index252>>0] = 0;
 $$index253 = ((($22)) + 230|0);
 HEAP8[$$index253>>0] = 0;
 $$index254 = ((($22)) + 231|0);
 HEAP8[$$index254>>0] = 0;
 $$index255 = ((($22)) + 232|0);
 HEAP8[$$index255>>0] = 0;
 $$index256 = ((($22)) + 233|0);
 HEAP8[$$index256>>0] = 0;
 $$index257 = ((($22)) + 234|0);
 HEAP8[$$index257>>0] = 0;
 $$index258 = ((($22)) + 235|0);
 HEAP8[$$index258>>0] = 0;
 $$index259 = ((($22)) + 236|0);
 HEAP8[$$index259>>0] = 0;
 $$index260 = ((($22)) + 237|0);
 HEAP8[$$index260>>0] = 0;
 $$index261 = ((($22)) + 238|0);
 HEAP8[$$index261>>0] = 0;
 $$index262 = ((($22)) + 239|0);
 HEAP8[$$index262>>0] = 0;
 $$index263 = ((($22)) + 240|0);
 HEAP8[$$index263>>0] = 0;
 $$index264 = ((($22)) + 241|0);
 HEAP8[$$index264>>0] = 0;
 $$index265 = ((($22)) + 242|0);
 HEAP8[$$index265>>0] = 0;
 $$index266 = ((($22)) + 243|0);
 HEAP8[$$index266>>0] = 0;
 $$index267 = ((($22)) + 244|0);
 HEAP8[$$index267>>0] = 0;
 $$index268 = ((($22)) + 245|0);
 HEAP8[$$index268>>0] = 0;
 $$index269 = ((($22)) + 246|0);
 HEAP8[$$index269>>0] = 0;
 $$index270 = ((($22)) + 247|0);
 HEAP8[$$index270>>0] = 0;
 $$index271 = ((($22)) + 248|0);
 HEAP8[$$index271>>0] = 0;
 $$index272 = ((($22)) + 249|0);
 HEAP8[$$index272>>0] = 0;
 $$index273 = ((($22)) + 250|0);
 HEAP8[$$index273>>0] = 0;
 $$index274 = ((($22)) + 251|0);
 HEAP8[$$index274>>0] = 0;
 $$index275 = ((($22)) + 252|0);
 HEAP8[$$index275>>0] = 0;
 $$index276 = ((($22)) + 253|0);
 HEAP8[$$index276>>0] = 0;
 $$index277 = ((($22)) + 254|0);
 HEAP8[$$index277>>0] = 0;
 $$index278 = ((($22)) + 255|0);
 HEAP8[$$index278>>0] = 0;
 $$index279 = ((($22)) + 256|0);
 HEAP8[$$index279>>0] = 0;
 $$index280 = ((($22)) + 257|0);
 HEAP8[$$index280>>0] = 0;
 $$index281 = ((($22)) + 258|0);
 HEAP8[$$index281>>0] = 0;
 $$index282 = ((($22)) + 259|0);
 HEAP8[$$index282>>0] = 0;
 $$index283 = ((($22)) + 260|0);
 HEAP8[$$index283>>0] = 0;
 $$index284 = ((($22)) + 261|0);
 HEAP8[$$index284>>0] = 0;
 $$index285 = ((($22)) + 262|0);
 HEAP8[$$index285>>0] = 0;
 $$index286 = ((($22)) + 263|0);
 HEAP8[$$index286>>0] = 0;
 $$index287 = ((($22)) + 264|0);
 HEAP8[$$index287>>0] = 0;
 $$index288 = ((($22)) + 265|0);
 HEAP8[$$index288>>0] = 0;
 $$index289 = ((($22)) + 266|0);
 HEAP8[$$index289>>0] = 0;
 $$index290 = ((($22)) + 267|0);
 HEAP8[$$index290>>0] = 0;
 $$index291 = ((($22)) + 268|0);
 HEAP8[$$index291>>0] = 0;
 $$index292 = ((($22)) + 269|0);
 HEAP8[$$index292>>0] = 0;
 $$index293 = ((($22)) + 270|0);
 HEAP8[$$index293>>0] = 0;
 $$index294 = ((($22)) + 271|0);
 HEAP8[$$index294>>0] = 0;
 $$index295 = ((($22)) + 272|0);
 HEAP8[$$index295>>0] = 0;
 $$index296 = ((($22)) + 273|0);
 HEAP8[$$index296>>0] = 0;
 $$index297 = ((($22)) + 274|0);
 HEAP8[$$index297>>0] = 0;
 $$index298 = ((($22)) + 275|0);
 HEAP8[$$index298>>0] = 0;
 $$index299 = ((($22)) + 276|0);
 HEAP8[$$index299>>0] = 0;
 $$index300 = ((($22)) + 277|0);
 HEAP8[$$index300>>0] = 0;
 $$index301 = ((($22)) + 278|0);
 HEAP8[$$index301>>0] = 0;
 $$index302 = ((($22)) + 279|0);
 HEAP8[$$index302>>0] = 0;
 $$index303 = ((($22)) + 280|0);
 HEAP8[$$index303>>0] = 0;
 $$index304 = ((($22)) + 281|0);
 HEAP8[$$index304>>0] = 0;
 $$index305 = ((($22)) + 282|0);
 HEAP8[$$index305>>0] = 0;
 $$index306 = ((($22)) + 283|0);
 HEAP8[$$index306>>0] = 0;
 $$index307 = ((($22)) + 284|0);
 HEAP8[$$index307>>0] = 0;
 $$index308 = ((($22)) + 285|0);
 HEAP8[$$index308>>0] = 0;
 $$index309 = ((($22)) + 286|0);
 HEAP8[$$index309>>0] = 0;
 $$index310 = ((($22)) + 287|0);
 HEAP8[$$index310>>0] = 0;
 $$index311 = ((($22)) + 288|0);
 HEAP8[$$index311>>0] = 0;
 $$index312 = ((($22)) + 289|0);
 HEAP8[$$index312>>0] = 0;
 $$index313 = ((($22)) + 290|0);
 HEAP8[$$index313>>0] = 0;
 $$index314 = ((($22)) + 291|0);
 HEAP8[$$index314>>0] = 0;
 $$index315 = ((($22)) + 292|0);
 HEAP8[$$index315>>0] = 0;
 $$index316 = ((($22)) + 293|0);
 HEAP8[$$index316>>0] = 0;
 $$index317 = ((($22)) + 294|0);
 HEAP8[$$index317>>0] = 0;
 $$index318 = ((($22)) + 295|0);
 HEAP8[$$index318>>0] = 0;
 $$index319 = ((($22)) + 296|0);
 HEAP8[$$index319>>0] = 0;
 $$index320 = ((($22)) + 297|0);
 HEAP8[$$index320>>0] = 0;
 $$index321 = ((($22)) + 298|0);
 HEAP8[$$index321>>0] = 0;
 $$index322 = ((($22)) + 299|0);
 HEAP8[$$index322>>0] = 0;
 $$index323 = ((($22)) + 300|0);
 HEAP8[$$index323>>0] = 0;
 $$index324 = ((($22)) + 301|0);
 HEAP8[$$index324>>0] = 0;
 $$index325 = ((($22)) + 302|0);
 HEAP8[$$index325>>0] = 0;
 $$index326 = ((($22)) + 303|0);
 HEAP8[$$index326>>0] = 0;
 $$index327 = ((($22)) + 304|0);
 HEAP8[$$index327>>0] = 0;
 $$index328 = ((($22)) + 305|0);
 HEAP8[$$index328>>0] = 0;
 $$index329 = ((($22)) + 306|0);
 HEAP8[$$index329>>0] = 0;
 $$index330 = ((($22)) + 307|0);
 HEAP8[$$index330>>0] = 0;
 $$index331 = ((($22)) + 308|0);
 HEAP8[$$index331>>0] = 0;
 $$index332 = ((($22)) + 309|0);
 HEAP8[$$index332>>0] = 0;
 $$index333 = ((($22)) + 310|0);
 HEAP8[$$index333>>0] = 0;
 $$index334 = ((($22)) + 311|0);
 HEAP8[$$index334>>0] = 0;
 $$index335 = ((($22)) + 312|0);
 HEAP8[$$index335>>0] = 0;
 $$index336 = ((($22)) + 313|0);
 HEAP8[$$index336>>0] = 0;
 $$index337 = ((($22)) + 314|0);
 HEAP8[$$index337>>0] = 0;
 $$index338 = ((($22)) + 315|0);
 HEAP8[$$index338>>0] = 0;
 $$index339 = ((($22)) + 316|0);
 HEAP8[$$index339>>0] = 0;
 $$index340 = ((($22)) + 317|0);
 HEAP8[$$index340>>0] = 0;
 $$index341 = ((($22)) + 318|0);
 HEAP8[$$index341>>0] = 0;
 $$index342 = ((($22)) + 319|0);
 HEAP8[$$index342>>0] = 0;
 $$index343 = ((($22)) + 320|0);
 HEAP8[$$index343>>0] = 0;
 $$index344 = ((($22)) + 321|0);
 HEAP8[$$index344>>0] = 0;
 $$index345 = ((($22)) + 322|0);
 HEAP8[$$index345>>0] = 0;
 $$index346 = ((($22)) + 323|0);
 HEAP8[$$index346>>0] = 0;
 $$index347 = ((($22)) + 324|0);
 HEAP8[$$index347>>0] = 0;
 $$index348 = ((($22)) + 325|0);
 HEAP8[$$index348>>0] = 0;
 $$index349 = ((($22)) + 326|0);
 HEAP8[$$index349>>0] = 0;
 $$index350 = ((($22)) + 327|0);
 HEAP8[$$index350>>0] = 0;
 $$index351 = ((($22)) + 328|0);
 HEAP8[$$index351>>0] = 0;
 $$index352 = ((($22)) + 329|0);
 HEAP8[$$index352>>0] = 0;
 $$index353 = ((($22)) + 330|0);
 HEAP8[$$index353>>0] = 0;
 $$index354 = ((($22)) + 331|0);
 HEAP8[$$index354>>0] = 0;
 $$index355 = ((($22)) + 332|0);
 HEAP8[$$index355>>0] = 0;
 $$index356 = ((($22)) + 333|0);
 HEAP8[$$index356>>0] = 0;
 $$index357 = ((($22)) + 334|0);
 HEAP8[$$index357>>0] = 0;
 $$index358 = ((($22)) + 335|0);
 HEAP8[$$index358>>0] = 0;
 $$index359 = ((($22)) + 336|0);
 HEAP8[$$index359>>0] = 0;
 $$index360 = ((($22)) + 337|0);
 HEAP8[$$index360>>0] = 0;
 $$index361 = ((($22)) + 338|0);
 HEAP8[$$index361>>0] = 0;
 $$index362 = ((($22)) + 339|0);
 HEAP8[$$index362>>0] = 0;
 $$index363 = ((($22)) + 340|0);
 HEAP8[$$index363>>0] = 0;
 $$index364 = ((($22)) + 341|0);
 HEAP8[$$index364>>0] = 0;
 $$index365 = ((($22)) + 342|0);
 HEAP8[$$index365>>0] = 0;
 $$index366 = ((($22)) + 343|0);
 HEAP8[$$index366>>0] = 0;
 $$index367 = ((($22)) + 344|0);
 HEAP8[$$index367>>0] = 0;
 $$index368 = ((($22)) + 345|0);
 HEAP8[$$index368>>0] = 0;
 $$index369 = ((($22)) + 346|0);
 HEAP8[$$index369>>0] = 0;
 $$index370 = ((($22)) + 347|0);
 HEAP8[$$index370>>0] = 0;
 $$index371 = ((($22)) + 348|0);
 HEAP8[$$index371>>0] = 0;
 $$index372 = ((($22)) + 349|0);
 HEAP8[$$index372>>0] = 0;
 $$index373 = ((($22)) + 350|0);
 HEAP8[$$index373>>0] = 0;
 $$index374 = ((($22)) + 351|0);
 HEAP8[$$index374>>0] = 0;
 $$index375 = ((($22)) + 352|0);
 HEAP8[$$index375>>0] = 0;
 $$index376 = ((($22)) + 353|0);
 HEAP8[$$index376>>0] = 0;
 $$index377 = ((($22)) + 354|0);
 HEAP8[$$index377>>0] = 0;
 $$index378 = ((($22)) + 355|0);
 HEAP8[$$index378>>0] = 0;
 $$index379 = ((($22)) + 356|0);
 HEAP8[$$index379>>0] = 0;
 $$index380 = ((($22)) + 357|0);
 HEAP8[$$index380>>0] = 0;
 $$index381 = ((($22)) + 358|0);
 HEAP8[$$index381>>0] = 0;
 $$index382 = ((($22)) + 359|0);
 HEAP8[$$index382>>0] = 0;
 $$index383 = ((($22)) + 360|0);
 HEAP8[$$index383>>0] = 0;
 $$index384 = ((($22)) + 361|0);
 HEAP8[$$index384>>0] = 0;
 $$index385 = ((($22)) + 362|0);
 HEAP8[$$index385>>0] = 0;
 $$index386 = ((($22)) + 363|0);
 HEAP8[$$index386>>0] = 0;
 $$index387 = ((($22)) + 364|0);
 HEAP8[$$index387>>0] = 0;
 $$index388 = ((($22)) + 365|0);
 HEAP8[$$index388>>0] = 0;
 $$index389 = ((($22)) + 366|0);
 HEAP8[$$index389>>0] = 0;
 $$index390 = ((($22)) + 367|0);
 HEAP8[$$index390>>0] = 0;
 $$index391 = ((($22)) + 368|0);
 HEAP8[$$index391>>0] = 0;
 $$index392 = ((($22)) + 369|0);
 HEAP8[$$index392>>0] = 0;
 $$index393 = ((($22)) + 370|0);
 HEAP8[$$index393>>0] = 0;
 $$index394 = ((($22)) + 371|0);
 HEAP8[$$index394>>0] = 0;
 $$index395 = ((($22)) + 372|0);
 HEAP8[$$index395>>0] = 0;
 $$index396 = ((($22)) + 373|0);
 HEAP8[$$index396>>0] = 0;
 $$index397 = ((($22)) + 374|0);
 HEAP8[$$index397>>0] = 0;
 $$index398 = ((($22)) + 375|0);
 HEAP8[$$index398>>0] = 0;
 $$index399 = ((($22)) + 376|0);
 HEAP8[$$index399>>0] = 0;
 $$index400 = ((($22)) + 377|0);
 HEAP8[$$index400>>0] = 0;
 $$index401 = ((($22)) + 378|0);
 HEAP8[$$index401>>0] = 0;
 $$index402 = ((($22)) + 379|0);
 HEAP8[$$index402>>0] = 0;
 $$index403 = ((($22)) + 380|0);
 HEAP8[$$index403>>0] = 0;
 $$index404 = ((($22)) + 381|0);
 HEAP8[$$index404>>0] = 0;
 $$index405 = ((($22)) + 382|0);
 HEAP8[$$index405>>0] = 0;
 $$index406 = ((($22)) + 383|0);
 HEAP8[$$index406>>0] = 0;
 $$index407 = ((($22)) + 384|0);
 HEAP8[$$index407>>0] = 0;
 $$index408 = ((($22)) + 385|0);
 HEAP8[$$index408>>0] = 0;
 $$index409 = ((($22)) + 386|0);
 HEAP8[$$index409>>0] = 0;
 $$index410 = ((($22)) + 387|0);
 HEAP8[$$index410>>0] = 0;
 $$index411 = ((($22)) + 388|0);
 HEAP8[$$index411>>0] = 0;
 $$index412 = ((($22)) + 389|0);
 HEAP8[$$index412>>0] = 0;
 $$index413 = ((($22)) + 390|0);
 HEAP8[$$index413>>0] = 0;
 $$index414 = ((($22)) + 391|0);
 HEAP8[$$index414>>0] = 0;
 $$index415 = ((($22)) + 392|0);
 HEAP8[$$index415>>0] = 0;
 $$index416 = ((($22)) + 393|0);
 HEAP8[$$index416>>0] = 0;
 $$index417 = ((($22)) + 394|0);
 HEAP8[$$index417>>0] = 0;
 $$index418 = ((($22)) + 395|0);
 HEAP8[$$index418>>0] = 0;
 $$index419 = ((($22)) + 396|0);
 HEAP8[$$index419>>0] = 0;
 $$index420 = ((($22)) + 397|0);
 HEAP8[$$index420>>0] = 0;
 $$index421 = ((($22)) + 398|0);
 HEAP8[$$index421>>0] = 0;
 $$index422 = ((($22)) + 399|0);
 HEAP8[$$index422>>0] = 0;
 $$index423 = ((($22)) + 400|0);
 HEAP8[$$index423>>0] = 0;
 $$index424 = ((($22)) + 401|0);
 HEAP8[$$index424>>0] = 0;
 $$index425 = ((($22)) + 402|0);
 HEAP8[$$index425>>0] = 0;
 $$index426 = ((($22)) + 403|0);
 HEAP8[$$index426>>0] = 0;
 $$index427 = ((($22)) + 404|0);
 HEAP8[$$index427>>0] = 0;
 $$index428 = ((($22)) + 405|0);
 HEAP8[$$index428>>0] = 0;
 $$index429 = ((($22)) + 406|0);
 HEAP8[$$index429>>0] = 0;
 $$index430 = ((($22)) + 407|0);
 HEAP8[$$index430>>0] = 0;
 $$index431 = ((($22)) + 408|0);
 HEAP8[$$index431>>0] = 0;
 $$index432 = ((($22)) + 409|0);
 HEAP8[$$index432>>0] = 0;
 $$index433 = ((($22)) + 410|0);
 HEAP8[$$index433>>0] = 0;
 $$index434 = ((($22)) + 411|0);
 HEAP8[$$index434>>0] = 0;
 $$index435 = ((($22)) + 412|0);
 HEAP8[$$index435>>0] = 0;
 $$index436 = ((($22)) + 413|0);
 HEAP8[$$index436>>0] = 0;
 $$index437 = ((($22)) + 414|0);
 HEAP8[$$index437>>0] = 0;
 $$index438 = ((($22)) + 415|0);
 HEAP8[$$index438>>0] = 0;
 $$index439 = ((($22)) + 416|0);
 HEAP8[$$index439>>0] = 0;
 $$index440 = ((($22)) + 417|0);
 HEAP8[$$index440>>0] = 0;
 $$index441 = ((($22)) + 418|0);
 HEAP8[$$index441>>0] = 0;
 $$index442 = ((($22)) + 419|0);
 HEAP8[$$index442>>0] = 0;
 $$index443 = ((($22)) + 420|0);
 HEAP8[$$index443>>0] = 0;
 $$index444 = ((($22)) + 421|0);
 HEAP8[$$index444>>0] = 0;
 $$index445 = ((($22)) + 422|0);
 HEAP8[$$index445>>0] = 0;
 $$index446 = ((($22)) + 423|0);
 HEAP8[$$index446>>0] = 0;
 $$index447 = ((($22)) + 424|0);
 HEAP8[$$index447>>0] = 0;
 $$index448 = ((($22)) + 425|0);
 HEAP8[$$index448>>0] = 0;
 $$index449 = ((($22)) + 426|0);
 HEAP8[$$index449>>0] = 0;
 $$index450 = ((($22)) + 427|0);
 HEAP8[$$index450>>0] = 0;
 $$index451 = ((($22)) + 428|0);
 HEAP8[$$index451>>0] = 0;
 $$index452 = ((($22)) + 429|0);
 HEAP8[$$index452>>0] = 0;
 $$index453 = ((($22)) + 430|0);
 HEAP8[$$index453>>0] = 0;
 $$index454 = ((($22)) + 431|0);
 HEAP8[$$index454>>0] = 0;
 $$index455 = ((($22)) + 432|0);
 HEAP8[$$index455>>0] = 0;
 $$index456 = ((($22)) + 433|0);
 HEAP8[$$index456>>0] = 0;
 $$index457 = ((($22)) + 434|0);
 HEAP8[$$index457>>0] = 0;
 $$index458 = ((($22)) + 435|0);
 HEAP8[$$index458>>0] = 0;
 $$index459 = ((($22)) + 436|0);
 HEAP8[$$index459>>0] = 0;
 $$index460 = ((($22)) + 437|0);
 HEAP8[$$index460>>0] = 0;
 $$index461 = ((($22)) + 438|0);
 HEAP8[$$index461>>0] = 0;
 $$index462 = ((($22)) + 439|0);
 HEAP8[$$index462>>0] = 0;
 $$index463 = ((($22)) + 440|0);
 HEAP8[$$index463>>0] = 0;
 $$index464 = ((($22)) + 441|0);
 HEAP8[$$index464>>0] = 0;
 $$index465 = ((($22)) + 442|0);
 HEAP8[$$index465>>0] = 0;
 $$index466 = ((($22)) + 443|0);
 HEAP8[$$index466>>0] = 0;
 $$index467 = ((($22)) + 444|0);
 HEAP8[$$index467>>0] = 0;
 $$index468 = ((($22)) + 445|0);
 HEAP8[$$index468>>0] = 0;
 $$index469 = ((($22)) + 446|0);
 HEAP8[$$index469>>0] = 0;
 $$index470 = ((($22)) + 447|0);
 HEAP8[$$index470>>0] = 0;
 $$index471 = ((($22)) + 448|0);
 HEAP8[$$index471>>0] = 0;
 $$index472 = ((($22)) + 449|0);
 HEAP8[$$index472>>0] = 0;
 $$index473 = ((($22)) + 450|0);
 HEAP8[$$index473>>0] = 0;
 $$index474 = ((($22)) + 451|0);
 HEAP8[$$index474>>0] = 0;
 $$index475 = ((($22)) + 452|0);
 HEAP8[$$index475>>0] = 0;
 $$index476 = ((($22)) + 453|0);
 HEAP8[$$index476>>0] = 0;
 $$index477 = ((($22)) + 454|0);
 HEAP8[$$index477>>0] = 0;
 $$index478 = ((($22)) + 455|0);
 HEAP8[$$index478>>0] = 0;
 $$index479 = ((($22)) + 456|0);
 HEAP8[$$index479>>0] = 0;
 $$index480 = ((($22)) + 457|0);
 HEAP8[$$index480>>0] = 0;
 $$index481 = ((($22)) + 458|0);
 HEAP8[$$index481>>0] = 0;
 $$index482 = ((($22)) + 459|0);
 HEAP8[$$index482>>0] = 0;
 $$index483 = ((($22)) + 460|0);
 HEAP8[$$index483>>0] = 0;
 $$index484 = ((($22)) + 461|0);
 HEAP8[$$index484>>0] = 0;
 $$index485 = ((($22)) + 462|0);
 HEAP8[$$index485>>0] = 0;
 $$index486 = ((($22)) + 463|0);
 HEAP8[$$index486>>0] = 0;
 $$index487 = ((($22)) + 464|0);
 HEAP8[$$index487>>0] = 0;
 $$index488 = ((($22)) + 465|0);
 HEAP8[$$index488>>0] = 0;
 $$index489 = ((($22)) + 466|0);
 HEAP8[$$index489>>0] = 0;
 $$index490 = ((($22)) + 467|0);
 HEAP8[$$index490>>0] = 0;
 $$index491 = ((($22)) + 468|0);
 HEAP8[$$index491>>0] = 0;
 $$index492 = ((($22)) + 469|0);
 HEAP8[$$index492>>0] = 0;
 $$index493 = ((($22)) + 470|0);
 HEAP8[$$index493>>0] = 0;
 $$index494 = ((($22)) + 471|0);
 HEAP8[$$index494>>0] = 0;
 $$index495 = ((($22)) + 472|0);
 HEAP8[$$index495>>0] = 0;
 $$index496 = ((($22)) + 473|0);
 HEAP8[$$index496>>0] = 0;
 $$index497 = ((($22)) + 474|0);
 HEAP8[$$index497>>0] = 0;
 $$index498 = ((($22)) + 475|0);
 HEAP8[$$index498>>0] = 0;
 $$index499 = ((($22)) + 476|0);
 HEAP8[$$index499>>0] = 0;
 $$index500 = ((($22)) + 477|0);
 HEAP8[$$index500>>0] = 0;
 $$index501 = ((($22)) + 478|0);
 HEAP8[$$index501>>0] = 0;
 $$index502 = ((($22)) + 479|0);
 HEAP8[$$index502>>0] = 0;
 $$index503 = ((($22)) + 480|0);
 HEAP8[$$index503>>0] = 0;
 $$index504 = ((($22)) + 481|0);
 HEAP8[$$index504>>0] = 0;
 $$index505 = ((($22)) + 482|0);
 HEAP8[$$index505>>0] = 0;
 $$index506 = ((($22)) + 483|0);
 HEAP8[$$index506>>0] = 0;
 $$index507 = ((($22)) + 484|0);
 HEAP8[$$index507>>0] = 0;
 $$index508 = ((($22)) + 485|0);
 HEAP8[$$index508>>0] = 0;
 $$index509 = ((($22)) + 486|0);
 HEAP8[$$index509>>0] = 0;
 $$index510 = ((($22)) + 487|0);
 HEAP8[$$index510>>0] = 0;
 $$index511 = ((($22)) + 488|0);
 HEAP8[$$index511>>0] = 0;
 $$index512 = ((($22)) + 489|0);
 HEAP8[$$index512>>0] = 0;
 $$index513 = ((($22)) + 490|0);
 HEAP8[$$index513>>0] = 0;
 $$index514 = ((($22)) + 491|0);
 HEAP8[$$index514>>0] = 0;
 $$index515 = ((($22)) + 492|0);
 HEAP8[$$index515>>0] = 0;
 $$index516 = ((($22)) + 493|0);
 HEAP8[$$index516>>0] = 0;
 $$index517 = ((($22)) + 494|0);
 HEAP8[$$index517>>0] = 0;
 $$index518 = ((($22)) + 495|0);
 HEAP8[$$index518>>0] = 0;
 $$index519 = ((($22)) + 496|0);
 HEAP8[$$index519>>0] = 0;
 $$index520 = ((($22)) + 497|0);
 HEAP8[$$index520>>0] = 0;
 $$index521 = ((($22)) + 498|0);
 HEAP8[$$index521>>0] = 0;
 $$index522 = ((($22)) + 499|0);
 HEAP8[$$index522>>0] = 0;
 $$index523 = ((($22)) + 500|0);
 HEAP8[$$index523>>0] = 0;
 $$index524 = ((($22)) + 501|0);
 HEAP8[$$index524>>0] = 0;
 $$index525 = ((($22)) + 502|0);
 HEAP8[$$index525>>0] = 0;
 $$index526 = ((($22)) + 503|0);
 HEAP8[$$index526>>0] = 0;
 $$index527 = ((($22)) + 504|0);
 HEAP8[$$index527>>0] = 0;
 $$index528 = ((($22)) + 505|0);
 HEAP8[$$index528>>0] = 0;
 $$index529 = ((($22)) + 506|0);
 HEAP8[$$index529>>0] = 0;
 $$index530 = ((($22)) + 507|0);
 HEAP8[$$index530>>0] = 0;
 $$index531 = ((($22)) + 508|0);
 HEAP8[$$index531>>0] = 0;
 $$index532 = ((($22)) + 509|0);
 HEAP8[$$index532>>0] = 0;
 $$index533 = ((($22)) + 510|0);
 HEAP8[$$index533>>0] = 0;
 $$index534 = ((($22)) + 511|0);
 HEAP8[$$index534>>0] = 0;
 $$index535 = ((($22)) + 512|0);
 HEAP8[$$index535>>0] = 0;
 $$index536 = ((($22)) + 513|0);
 HEAP8[$$index536>>0] = 0;
 $$index537 = ((($22)) + 514|0);
 HEAP8[$$index537>>0] = 0;
 $$index538 = ((($22)) + 515|0);
 HEAP8[$$index538>>0] = 0;
 $$index539 = ((($22)) + 516|0);
 HEAP8[$$index539>>0] = 0;
 $$index540 = ((($22)) + 517|0);
 HEAP8[$$index540>>0] = 0;
 $$index541 = ((($22)) + 518|0);
 HEAP8[$$index541>>0] = 0;
 $$index542 = ((($22)) + 519|0);
 HEAP8[$$index542>>0] = 0;
 $$index543 = ((($22)) + 520|0);
 HEAP8[$$index543>>0] = 0;
 $$index544 = ((($22)) + 521|0);
 HEAP8[$$index544>>0] = 0;
 $$index545 = ((($22)) + 522|0);
 HEAP8[$$index545>>0] = 0;
 $$index546 = ((($22)) + 523|0);
 HEAP8[$$index546>>0] = 0;
 $$index547 = ((($22)) + 524|0);
 HEAP8[$$index547>>0] = 0;
 $$index548 = ((($22)) + 525|0);
 HEAP8[$$index548>>0] = 0;
 $$index549 = ((($22)) + 526|0);
 HEAP8[$$index549>>0] = 0;
 $$index550 = ((($22)) + 527|0);
 HEAP8[$$index550>>0] = 0;
 $$index551 = ((($22)) + 528|0);
 HEAP8[$$index551>>0] = 0;
 $$index552 = ((($22)) + 529|0);
 HEAP8[$$index552>>0] = 0;
 $$index553 = ((($22)) + 530|0);
 HEAP8[$$index553>>0] = 0;
 $$index554 = ((($22)) + 531|0);
 HEAP8[$$index554>>0] = 0;
 $$index555 = ((($22)) + 532|0);
 HEAP8[$$index555>>0] = 0;
 $$index556 = ((($22)) + 533|0);
 HEAP8[$$index556>>0] = 0;
 $$index557 = ((($22)) + 534|0);
 HEAP8[$$index557>>0] = 0;
 $$index558 = ((($22)) + 535|0);
 HEAP8[$$index558>>0] = 0;
 $$index559 = ((($22)) + 536|0);
 HEAP8[$$index559>>0] = 0;
 $$index560 = ((($22)) + 537|0);
 HEAP8[$$index560>>0] = 0;
 $$index561 = ((($22)) + 538|0);
 HEAP8[$$index561>>0] = 0;
 $$index562 = ((($22)) + 539|0);
 HEAP8[$$index562>>0] = 0;
 $$index563 = ((($22)) + 540|0);
 HEAP8[$$index563>>0] = 0;
 $$index564 = ((($22)) + 541|0);
 HEAP8[$$index564>>0] = 0;
 $$index565 = ((($22)) + 542|0);
 HEAP8[$$index565>>0] = 0;
 $$index566 = ((($22)) + 543|0);
 HEAP8[$$index566>>0] = 0;
 $$index567 = ((($22)) + 544|0);
 HEAP8[$$index567>>0] = 0;
 $$index568 = ((($22)) + 545|0);
 HEAP8[$$index568>>0] = 0;
 $$index569 = ((($22)) + 546|0);
 HEAP8[$$index569>>0] = 0;
 $$index570 = ((($22)) + 547|0);
 HEAP8[$$index570>>0] = 0;
 $$index571 = ((($22)) + 548|0);
 HEAP8[$$index571>>0] = 0;
 $$index572 = ((($22)) + 549|0);
 HEAP8[$$index572>>0] = 0;
 $$index573 = ((($22)) + 550|0);
 HEAP8[$$index573>>0] = 0;
 $$index574 = ((($22)) + 551|0);
 HEAP8[$$index574>>0] = 0;
 $$index575 = ((($22)) + 552|0);
 HEAP8[$$index575>>0] = 0;
 $$index576 = ((($22)) + 553|0);
 HEAP8[$$index576>>0] = 0;
 $$index577 = ((($22)) + 554|0);
 HEAP8[$$index577>>0] = 0;
 $$index578 = ((($22)) + 555|0);
 HEAP8[$$index578>>0] = 0;
 $$index579 = ((($22)) + 556|0);
 HEAP8[$$index579>>0] = 0;
 $$index580 = ((($22)) + 557|0);
 HEAP8[$$index580>>0] = 0;
 $$index581 = ((($22)) + 558|0);
 HEAP8[$$index581>>0] = 0;
 $$index582 = ((($22)) + 559|0);
 HEAP8[$$index582>>0] = 0;
 $$index583 = ((($22)) + 560|0);
 HEAP8[$$index583>>0] = 0;
 $$index584 = ((($22)) + 561|0);
 HEAP8[$$index584>>0] = 0;
 $$index585 = ((($22)) + 562|0);
 HEAP8[$$index585>>0] = 0;
 $$index586 = ((($22)) + 563|0);
 HEAP8[$$index586>>0] = 0;
 $$index587 = ((($22)) + 564|0);
 HEAP8[$$index587>>0] = 0;
 $$index588 = ((($22)) + 565|0);
 HEAP8[$$index588>>0] = 0;
 $$index589 = ((($22)) + 566|0);
 HEAP8[$$index589>>0] = 0;
 $$index590 = ((($22)) + 567|0);
 HEAP8[$$index590>>0] = 0;
 $$index591 = ((($22)) + 568|0);
 HEAP8[$$index591>>0] = 0;
 $$index592 = ((($22)) + 569|0);
 HEAP8[$$index592>>0] = 0;
 $$index593 = ((($22)) + 570|0);
 HEAP8[$$index593>>0] = 0;
 $$index594 = ((($22)) + 571|0);
 HEAP8[$$index594>>0] = 0;
 $$index595 = ((($22)) + 572|0);
 HEAP8[$$index595>>0] = 0;
 $$index596 = ((($22)) + 573|0);
 HEAP8[$$index596>>0] = 0;
 $$index597 = ((($22)) + 574|0);
 HEAP8[$$index597>>0] = 0;
 $$index598 = ((($22)) + 575|0);
 HEAP8[$$index598>>0] = 0;
 $$index599 = ((($22)) + 576|0);
 HEAP8[$$index599>>0] = 0;
 $$index600 = ((($22)) + 577|0);
 HEAP8[$$index600>>0] = 0;
 $$index601 = ((($22)) + 578|0);
 HEAP8[$$index601>>0] = 0;
 $$index602 = ((($22)) + 579|0);
 HEAP8[$$index602>>0] = 0;
 $$index603 = ((($22)) + 580|0);
 HEAP8[$$index603>>0] = 0;
 $$index604 = ((($22)) + 581|0);
 HEAP8[$$index604>>0] = 0;
 $$index605 = ((($22)) + 582|0);
 HEAP8[$$index605>>0] = 0;
 $$index606 = ((($22)) + 583|0);
 HEAP8[$$index606>>0] = 0;
 $$index607 = ((($22)) + 584|0);
 HEAP8[$$index607>>0] = 0;
 $$index608 = ((($22)) + 585|0);
 HEAP8[$$index608>>0] = 0;
 $$index609 = ((($22)) + 586|0);
 HEAP8[$$index609>>0] = 0;
 $$index610 = ((($22)) + 587|0);
 HEAP8[$$index610>>0] = 0;
 $$index611 = ((($22)) + 588|0);
 HEAP8[$$index611>>0] = 0;
 $$index612 = ((($22)) + 589|0);
 HEAP8[$$index612>>0] = 0;
 $$index613 = ((($22)) + 590|0);
 HEAP8[$$index613>>0] = 0;
 $$index614 = ((($22)) + 591|0);
 HEAP8[$$index614>>0] = 0;
 $$index615 = ((($22)) + 592|0);
 HEAP8[$$index615>>0] = 0;
 $$index616 = ((($22)) + 593|0);
 HEAP8[$$index616>>0] = 0;
 $$index617 = ((($22)) + 594|0);
 HEAP8[$$index617>>0] = 0;
 $$index618 = ((($22)) + 595|0);
 HEAP8[$$index618>>0] = 0;
 $$index619 = ((($22)) + 596|0);
 HEAP8[$$index619>>0] = 0;
 $$index620 = ((($22)) + 597|0);
 HEAP8[$$index620>>0] = 0;
 $$index621 = ((($22)) + 598|0);
 HEAP8[$$index621>>0] = 0;
 $$index622 = ((($22)) + 599|0);
 HEAP8[$$index622>>0] = 0;
 $$index623 = ((($22)) + 600|0);
 HEAP8[$$index623>>0] = 0;
 $$index624 = ((($22)) + 601|0);
 HEAP8[$$index624>>0] = 0;
 $$index625 = ((($22)) + 602|0);
 HEAP8[$$index625>>0] = 0;
 $$index626 = ((($22)) + 603|0);
 HEAP8[$$index626>>0] = 0;
 $$index627 = ((($22)) + 604|0);
 HEAP8[$$index627>>0] = 0;
 $$index628 = ((($22)) + 605|0);
 HEAP8[$$index628>>0] = 0;
 $$index629 = ((($22)) + 606|0);
 HEAP8[$$index629>>0] = 0;
 $$index630 = ((($22)) + 607|0);
 HEAP8[$$index630>>0] = 0;
 $$index631 = ((($22)) + 608|0);
 HEAP8[$$index631>>0] = 0;
 $$index632 = ((($22)) + 609|0);
 HEAP8[$$index632>>0] = 0;
 $$index633 = ((($22)) + 610|0);
 HEAP8[$$index633>>0] = 0;
 $$index634 = ((($22)) + 611|0);
 HEAP8[$$index634>>0] = 0;
 $$index635 = ((($22)) + 612|0);
 HEAP8[$$index635>>0] = 0;
 $$index636 = ((($22)) + 613|0);
 HEAP8[$$index636>>0] = 0;
 $$index637 = ((($22)) + 614|0);
 HEAP8[$$index637>>0] = 0;
 $$index638 = ((($22)) + 615|0);
 HEAP8[$$index638>>0] = 0;
 $$index639 = ((($22)) + 616|0);
 HEAP8[$$index639>>0] = 0;
 $$index640 = ((($22)) + 617|0);
 HEAP8[$$index640>>0] = 0;
 $$index641 = ((($22)) + 618|0);
 HEAP8[$$index641>>0] = 0;
 $$index642 = ((($22)) + 619|0);
 HEAP8[$$index642>>0] = 0;
 $$index643 = ((($22)) + 620|0);
 HEAP8[$$index643>>0] = 0;
 $$index644 = ((($22)) + 621|0);
 HEAP8[$$index644>>0] = 0;
 $$index645 = ((($22)) + 622|0);
 HEAP8[$$index645>>0] = 0;
 $$index646 = ((($22)) + 623|0);
 HEAP8[$$index646>>0] = 0;
 $$index647 = ((($22)) + 624|0);
 HEAP8[$$index647>>0] = 0;
 $$index648 = ((($22)) + 625|0);
 HEAP8[$$index648>>0] = 0;
 $$index649 = ((($22)) + 626|0);
 HEAP8[$$index649>>0] = 0;
 $$index650 = ((($22)) + 627|0);
 HEAP8[$$index650>>0] = 0;
 $$index651 = ((($22)) + 628|0);
 HEAP8[$$index651>>0] = 0;
 $$index652 = ((($22)) + 629|0);
 HEAP8[$$index652>>0] = 0;
 $$index653 = ((($22)) + 630|0);
 HEAP8[$$index653>>0] = 0;
 $$index654 = ((($22)) + 631|0);
 HEAP8[$$index654>>0] = 0;
 $$index655 = ((($22)) + 632|0);
 HEAP8[$$index655>>0] = 0;
 $$index656 = ((($22)) + 633|0);
 HEAP8[$$index656>>0] = 0;
 $$index657 = ((($22)) + 634|0);
 HEAP8[$$index657>>0] = 0;
 $$index658 = ((($22)) + 635|0);
 HEAP8[$$index658>>0] = 0;
 $$index659 = ((($22)) + 636|0);
 HEAP8[$$index659>>0] = 0;
 $$index660 = ((($22)) + 637|0);
 HEAP8[$$index660>>0] = 0;
 $$index661 = ((($22)) + 638|0);
 HEAP8[$$index661>>0] = 0;
 $$index662 = ((($22)) + 639|0);
 HEAP8[$$index662>>0] = 0;
 $$index663 = ((($22)) + 640|0);
 HEAP8[$$index663>>0] = 0;
 $$index664 = ((($22)) + 641|0);
 HEAP8[$$index664>>0] = 0;
 $$index665 = ((($22)) + 642|0);
 HEAP8[$$index665>>0] = 0;
 $$index666 = ((($22)) + 643|0);
 HEAP8[$$index666>>0] = 0;
 $$index667 = ((($22)) + 644|0);
 HEAP8[$$index667>>0] = 0;
 $$index668 = ((($22)) + 645|0);
 HEAP8[$$index668>>0] = 0;
 $$index669 = ((($22)) + 646|0);
 HEAP8[$$index669>>0] = 0;
 $$index670 = ((($22)) + 647|0);
 HEAP8[$$index670>>0] = 0;
 $$index671 = ((($22)) + 648|0);
 HEAP8[$$index671>>0] = 0;
 $$index672 = ((($22)) + 649|0);
 HEAP8[$$index672>>0] = 0;
 $$index673 = ((($22)) + 650|0);
 HEAP8[$$index673>>0] = 0;
 $$index674 = ((($22)) + 651|0);
 HEAP8[$$index674>>0] = 0;
 $$index675 = ((($22)) + 652|0);
 HEAP8[$$index675>>0] = 0;
 $$index676 = ((($22)) + 653|0);
 HEAP8[$$index676>>0] = 0;
 $$index677 = ((($22)) + 654|0);
 HEAP8[$$index677>>0] = 0;
 $$index678 = ((($22)) + 655|0);
 HEAP8[$$index678>>0] = 0;
 $$index679 = ((($22)) + 656|0);
 HEAP8[$$index679>>0] = 0;
 $$index680 = ((($22)) + 657|0);
 HEAP8[$$index680>>0] = 0;
 $$index681 = ((($22)) + 658|0);
 HEAP8[$$index681>>0] = 0;
 $$index682 = ((($22)) + 659|0);
 HEAP8[$$index682>>0] = 0;
 $$index683 = ((($22)) + 660|0);
 HEAP8[$$index683>>0] = 0;
 $$index684 = ((($22)) + 661|0);
 HEAP8[$$index684>>0] = 0;
 $$index685 = ((($22)) + 662|0);
 HEAP8[$$index685>>0] = 0;
 $$index686 = ((($22)) + 663|0);
 HEAP8[$$index686>>0] = 0;
 $$index687 = ((($22)) + 664|0);
 HEAP8[$$index687>>0] = 0;
 $$index688 = ((($22)) + 665|0);
 HEAP8[$$index688>>0] = 0;
 $$index689 = ((($22)) + 666|0);
 HEAP8[$$index689>>0] = 0;
 $$index690 = ((($22)) + 667|0);
 HEAP8[$$index690>>0] = 0;
 $$index691 = ((($22)) + 668|0);
 HEAP8[$$index691>>0] = 0;
 $$index692 = ((($22)) + 669|0);
 HEAP8[$$index692>>0] = 0;
 $$index693 = ((($22)) + 670|0);
 HEAP8[$$index693>>0] = 0;
 $$index694 = ((($22)) + 671|0);
 HEAP8[$$index694>>0] = 0;
 $$index695 = ((($22)) + 672|0);
 HEAP8[$$index695>>0] = 0;
 $$index696 = ((($22)) + 673|0);
 HEAP8[$$index696>>0] = 0;
 $$index697 = ((($22)) + 674|0);
 HEAP8[$$index697>>0] = 0;
 $$index698 = ((($22)) + 675|0);
 HEAP8[$$index698>>0] = 0;
 $$index699 = ((($22)) + 676|0);
 HEAP8[$$index699>>0] = 0;
 $$index700 = ((($22)) + 677|0);
 HEAP8[$$index700>>0] = 0;
 $$index701 = ((($22)) + 678|0);
 HEAP8[$$index701>>0] = 0;
 $$index702 = ((($22)) + 679|0);
 HEAP8[$$index702>>0] = 0;
 $$index703 = ((($22)) + 680|0);
 HEAP8[$$index703>>0] = 0;
 $$index704 = ((($22)) + 681|0);
 HEAP8[$$index704>>0] = 0;
 $$index705 = ((($22)) + 682|0);
 HEAP8[$$index705>>0] = 0;
 $$index706 = ((($22)) + 683|0);
 HEAP8[$$index706>>0] = 0;
 $$index707 = ((($22)) + 684|0);
 HEAP8[$$index707>>0] = 0;
 $$index708 = ((($22)) + 685|0);
 HEAP8[$$index708>>0] = 0;
 $$index709 = ((($22)) + 686|0);
 HEAP8[$$index709>>0] = 0;
 $$index710 = ((($22)) + 687|0);
 HEAP8[$$index710>>0] = 0;
 $$index711 = ((($22)) + 688|0);
 HEAP8[$$index711>>0] = 0;
 $$index712 = ((($22)) + 689|0);
 HEAP8[$$index712>>0] = 0;
 $$index713 = ((($22)) + 690|0);
 HEAP8[$$index713>>0] = 0;
 $$index714 = ((($22)) + 691|0);
 HEAP8[$$index714>>0] = 0;
 $$index715 = ((($22)) + 692|0);
 HEAP8[$$index715>>0] = 0;
 $$index716 = ((($22)) + 693|0);
 HEAP8[$$index716>>0] = 0;
 $$index717 = ((($22)) + 694|0);
 HEAP8[$$index717>>0] = 0;
 $$index718 = ((($22)) + 695|0);
 HEAP8[$$index718>>0] = 0;
 $$index719 = ((($22)) + 696|0);
 HEAP8[$$index719>>0] = 0;
 $$index720 = ((($22)) + 697|0);
 HEAP8[$$index720>>0] = 0;
 $$index721 = ((($22)) + 698|0);
 HEAP8[$$index721>>0] = 0;
 $$index722 = ((($22)) + 699|0);
 HEAP8[$$index722>>0] = 0;
 $$index723 = ((($22)) + 700|0);
 HEAP8[$$index723>>0] = 0;
 $$index724 = ((($22)) + 701|0);
 HEAP8[$$index724>>0] = 0;
 $$index725 = ((($22)) + 702|0);
 HEAP8[$$index725>>0] = 0;
 $$index726 = ((($22)) + 703|0);
 HEAP8[$$index726>>0] = 0;
 $$index727 = ((($22)) + 704|0);
 HEAP8[$$index727>>0] = 0;
 $$index728 = ((($22)) + 705|0);
 HEAP8[$$index728>>0] = 0;
 $$index729 = ((($22)) + 706|0);
 HEAP8[$$index729>>0] = 0;
 $$index730 = ((($22)) + 707|0);
 HEAP8[$$index730>>0] = 0;
 $$index731 = ((($22)) + 708|0);
 HEAP8[$$index731>>0] = 0;
 $$index732 = ((($22)) + 709|0);
 HEAP8[$$index732>>0] = 0;
 $$index733 = ((($22)) + 710|0);
 HEAP8[$$index733>>0] = 0;
 $$index734 = ((($22)) + 711|0);
 HEAP8[$$index734>>0] = 0;
 $$index735 = ((($22)) + 712|0);
 HEAP8[$$index735>>0] = 0;
 $$index736 = ((($22)) + 713|0);
 HEAP8[$$index736>>0] = 0;
 $$index737 = ((($22)) + 714|0);
 HEAP8[$$index737>>0] = 0;
 $$index738 = ((($22)) + 715|0);
 HEAP8[$$index738>>0] = 0;
 $$index739 = ((($22)) + 716|0);
 HEAP8[$$index739>>0] = 0;
 $$index740 = ((($22)) + 717|0);
 HEAP8[$$index740>>0] = 0;
 $$index741 = ((($22)) + 718|0);
 HEAP8[$$index741>>0] = 0;
 $$index742 = ((($22)) + 719|0);
 HEAP8[$$index742>>0] = 0;
 $$index743 = ((($22)) + 720|0);
 HEAP8[$$index743>>0] = 0;
 $$index744 = ((($22)) + 721|0);
 HEAP8[$$index744>>0] = 0;
 $$index745 = ((($22)) + 722|0);
 HEAP8[$$index745>>0] = 0;
 $$index746 = ((($22)) + 723|0);
 HEAP8[$$index746>>0] = 0;
 $$index747 = ((($22)) + 724|0);
 HEAP8[$$index747>>0] = 0;
 $$index748 = ((($22)) + 725|0);
 HEAP8[$$index748>>0] = 0;
 $$index749 = ((($22)) + 726|0);
 HEAP8[$$index749>>0] = 0;
 $$index750 = ((($22)) + 727|0);
 HEAP8[$$index750>>0] = 0;
 $$index751 = ((($22)) + 728|0);
 HEAP8[$$index751>>0] = 0;
 $$index752 = ((($22)) + 729|0);
 HEAP8[$$index752>>0] = 0;
 $$index753 = ((($22)) + 730|0);
 HEAP8[$$index753>>0] = 0;
 $$index754 = ((($22)) + 731|0);
 HEAP8[$$index754>>0] = 0;
 $$index755 = ((($22)) + 732|0);
 HEAP8[$$index755>>0] = 0;
 $$index756 = ((($22)) + 733|0);
 HEAP8[$$index756>>0] = 0;
 $$index757 = ((($22)) + 734|0);
 HEAP8[$$index757>>0] = 0;
 $$index758 = ((($22)) + 735|0);
 HEAP8[$$index758>>0] = 0;
 $$index759 = ((($22)) + 736|0);
 HEAP8[$$index759>>0] = 0;
 $$index760 = ((($22)) + 737|0);
 HEAP8[$$index760>>0] = 0;
 $$index761 = ((($22)) + 738|0);
 HEAP8[$$index761>>0] = 0;
 $$index762 = ((($22)) + 739|0);
 HEAP8[$$index762>>0] = 0;
 $$index763 = ((($22)) + 740|0);
 HEAP8[$$index763>>0] = 0;
 $$index764 = ((($22)) + 741|0);
 HEAP8[$$index764>>0] = 0;
 $$index765 = ((($22)) + 742|0);
 HEAP8[$$index765>>0] = 0;
 $$index766 = ((($22)) + 743|0);
 HEAP8[$$index766>>0] = 0;
 $$index767 = ((($22)) + 744|0);
 HEAP8[$$index767>>0] = 0;
 $$index768 = ((($22)) + 745|0);
 HEAP8[$$index768>>0] = 0;
 $$index769 = ((($22)) + 746|0);
 HEAP8[$$index769>>0] = 0;
 $$index770 = ((($22)) + 747|0);
 HEAP8[$$index770>>0] = 0;
 $$index771 = ((($22)) + 748|0);
 HEAP8[$$index771>>0] = 0;
 $$index772 = ((($22)) + 749|0);
 HEAP8[$$index772>>0] = 0;
 $$index773 = ((($22)) + 750|0);
 HEAP8[$$index773>>0] = 0;
 $$index774 = ((($22)) + 751|0);
 HEAP8[$$index774>>0] = 0;
 $$index775 = ((($22)) + 752|0);
 HEAP8[$$index775>>0] = 0;
 $$index776 = ((($22)) + 753|0);
 HEAP8[$$index776>>0] = 0;
 $$index777 = ((($22)) + 754|0);
 HEAP8[$$index777>>0] = 0;
 $$index778 = ((($22)) + 755|0);
 HEAP8[$$index778>>0] = 0;
 $$index779 = ((($22)) + 756|0);
 HEAP8[$$index779>>0] = 0;
 $$index780 = ((($22)) + 757|0);
 HEAP8[$$index780>>0] = 0;
 $$index781 = ((($22)) + 758|0);
 HEAP8[$$index781>>0] = 0;
 $$index782 = ((($22)) + 759|0);
 HEAP8[$$index782>>0] = 0;
 $$index783 = ((($22)) + 760|0);
 HEAP8[$$index783>>0] = 0;
 $$index784 = ((($22)) + 761|0);
 HEAP8[$$index784>>0] = 0;
 $$index785 = ((($22)) + 762|0);
 HEAP8[$$index785>>0] = 0;
 $$index786 = ((($22)) + 763|0);
 HEAP8[$$index786>>0] = 0;
 $$index787 = ((($22)) + 764|0);
 HEAP8[$$index787>>0] = 0;
 $$index788 = ((($22)) + 765|0);
 HEAP8[$$index788>>0] = 0;
 $$index789 = ((($22)) + 766|0);
 HEAP8[$$index789>>0] = 0;
 $$index790 = ((($22)) + 767|0);
 HEAP8[$$index790>>0] = 0;
 $$index791 = ((($22)) + 768|0);
 HEAP8[$$index791>>0] = 0;
 $$index792 = ((($22)) + 769|0);
 HEAP8[$$index792>>0] = 0;
 $$index793 = ((($22)) + 770|0);
 HEAP8[$$index793>>0] = 0;
 $$index794 = ((($22)) + 771|0);
 HEAP8[$$index794>>0] = 0;
 $$index795 = ((($22)) + 772|0);
 HEAP8[$$index795>>0] = 0;
 $$index796 = ((($22)) + 773|0);
 HEAP8[$$index796>>0] = 0;
 $$index797 = ((($22)) + 774|0);
 HEAP8[$$index797>>0] = 0;
 $$index798 = ((($22)) + 775|0);
 HEAP8[$$index798>>0] = 0;
 $$index799 = ((($22)) + 776|0);
 HEAP8[$$index799>>0] = 0;
 $$index800 = ((($22)) + 777|0);
 HEAP8[$$index800>>0] = 0;
 $$index801 = ((($22)) + 778|0);
 HEAP8[$$index801>>0] = 0;
 $$index802 = ((($22)) + 779|0);
 HEAP8[$$index802>>0] = 0;
 $$index803 = ((($22)) + 780|0);
 HEAP8[$$index803>>0] = 0;
 $$index804 = ((($22)) + 781|0);
 HEAP8[$$index804>>0] = 0;
 $$index805 = ((($22)) + 782|0);
 HEAP8[$$index805>>0] = 0;
 $$index806 = ((($22)) + 783|0);
 HEAP8[$$index806>>0] = 0;
 $$index807 = ((($22)) + 784|0);
 HEAP8[$$index807>>0] = 0;
 $$index808 = ((($22)) + 785|0);
 HEAP8[$$index808>>0] = 0;
 $$index809 = ((($22)) + 786|0);
 HEAP8[$$index809>>0] = 0;
 $$index810 = ((($22)) + 787|0);
 HEAP8[$$index810>>0] = 0;
 $$index811 = ((($22)) + 788|0);
 HEAP8[$$index811>>0] = 0;
 $$index812 = ((($22)) + 789|0);
 HEAP8[$$index812>>0] = 0;
 $$index813 = ((($22)) + 790|0);
 HEAP8[$$index813>>0] = 0;
 $$index814 = ((($22)) + 791|0);
 HEAP8[$$index814>>0] = 0;
 $$index815 = ((($22)) + 792|0);
 HEAP8[$$index815>>0] = 0;
 $$index816 = ((($22)) + 793|0);
 HEAP8[$$index816>>0] = 0;
 $$index817 = ((($22)) + 794|0);
 HEAP8[$$index817>>0] = 0;
 $$index818 = ((($22)) + 795|0);
 HEAP8[$$index818>>0] = 0;
 $$index819 = ((($22)) + 796|0);
 HEAP8[$$index819>>0] = 0;
 $$index820 = ((($22)) + 797|0);
 HEAP8[$$index820>>0] = 0;
 $$index821 = ((($22)) + 798|0);
 HEAP8[$$index821>>0] = 0;
 $$index822 = ((($22)) + 799|0);
 HEAP8[$$index822>>0] = 0;
 $$index823 = ((($22)) + 800|0);
 HEAP8[$$index823>>0] = 0;
 $$index824 = ((($22)) + 801|0);
 HEAP8[$$index824>>0] = 0;
 $$index825 = ((($22)) + 802|0);
 HEAP8[$$index825>>0] = 0;
 $$index826 = ((($22)) + 803|0);
 HEAP8[$$index826>>0] = 0;
 $$index827 = ((($22)) + 804|0);
 HEAP8[$$index827>>0] = 0;
 $$index828 = ((($22)) + 805|0);
 HEAP8[$$index828>>0] = 0;
 $$index829 = ((($22)) + 806|0);
 HEAP8[$$index829>>0] = 0;
 $$index830 = ((($22)) + 807|0);
 HEAP8[$$index830>>0] = 0;
 $$index831 = ((($22)) + 808|0);
 HEAP8[$$index831>>0] = 0;
 $$index832 = ((($22)) + 809|0);
 HEAP8[$$index832>>0] = 0;
 $$index833 = ((($22)) + 810|0);
 HEAP8[$$index833>>0] = 0;
 $$index834 = ((($22)) + 811|0);
 HEAP8[$$index834>>0] = 0;
 $$index835 = ((($22)) + 812|0);
 HEAP8[$$index835>>0] = 0;
 $$index836 = ((($22)) + 813|0);
 HEAP8[$$index836>>0] = 0;
 $$index837 = ((($22)) + 814|0);
 HEAP8[$$index837>>0] = 0;
 $$index838 = ((($22)) + 815|0);
 HEAP8[$$index838>>0] = 0;
 $$index839 = ((($22)) + 816|0);
 HEAP8[$$index839>>0] = 0;
 $$index840 = ((($22)) + 817|0);
 HEAP8[$$index840>>0] = 0;
 $$index841 = ((($22)) + 818|0);
 HEAP8[$$index841>>0] = 0;
 $$index842 = ((($22)) + 819|0);
 HEAP8[$$index842>>0] = 0;
 $$index843 = ((($22)) + 820|0);
 HEAP8[$$index843>>0] = 0;
 $$index844 = ((($22)) + 821|0);
 HEAP8[$$index844>>0] = 0;
 $$index845 = ((($22)) + 822|0);
 HEAP8[$$index845>>0] = 0;
 $$index846 = ((($22)) + 823|0);
 HEAP8[$$index846>>0] = 0;
 $$index847 = ((($22)) + 824|0);
 HEAP8[$$index847>>0] = 0;
 $$index848 = ((($22)) + 825|0);
 HEAP8[$$index848>>0] = 0;
 $$index849 = ((($22)) + 826|0);
 HEAP8[$$index849>>0] = 0;
 $$index850 = ((($22)) + 827|0);
 HEAP8[$$index850>>0] = 0;
 $$index851 = ((($22)) + 828|0);
 HEAP8[$$index851>>0] = 0;
 $$index852 = ((($22)) + 829|0);
 HEAP8[$$index852>>0] = 0;
 $$index853 = ((($22)) + 830|0);
 HEAP8[$$index853>>0] = 0;
 $$index854 = ((($22)) + 831|0);
 HEAP8[$$index854>>0] = 0;
 $$index855 = ((($22)) + 832|0);
 HEAP8[$$index855>>0] = 0;
 $$index856 = ((($22)) + 833|0);
 HEAP8[$$index856>>0] = 0;
 $$index857 = ((($22)) + 834|0);
 HEAP8[$$index857>>0] = 0;
 $$index858 = ((($22)) + 835|0);
 HEAP8[$$index858>>0] = 0;
 $$index859 = ((($22)) + 836|0);
 HEAP8[$$index859>>0] = 0;
 $$index860 = ((($22)) + 837|0);
 HEAP8[$$index860>>0] = 0;
 $$index861 = ((($22)) + 838|0);
 HEAP8[$$index861>>0] = 0;
 $$index862 = ((($22)) + 839|0);
 HEAP8[$$index862>>0] = 0;
 $$index863 = ((($22)) + 840|0);
 HEAP8[$$index863>>0] = 0;
 $$index864 = ((($22)) + 841|0);
 HEAP8[$$index864>>0] = 0;
 $$index865 = ((($22)) + 842|0);
 HEAP8[$$index865>>0] = 0;
 $$index866 = ((($22)) + 843|0);
 HEAP8[$$index866>>0] = 0;
 $$index867 = ((($22)) + 844|0);
 HEAP8[$$index867>>0] = 0;
 $$index868 = ((($22)) + 845|0);
 HEAP8[$$index868>>0] = 0;
 $$index869 = ((($22)) + 846|0);
 HEAP8[$$index869>>0] = 0;
 $$index870 = ((($22)) + 847|0);
 HEAP8[$$index870>>0] = 0;
 $$index871 = ((($22)) + 848|0);
 HEAP8[$$index871>>0] = 0;
 $$index872 = ((($22)) + 849|0);
 HEAP8[$$index872>>0] = 0;
 $$index873 = ((($22)) + 850|0);
 HEAP8[$$index873>>0] = 0;
 $$index874 = ((($22)) + 851|0);
 HEAP8[$$index874>>0] = 0;
 $$index875 = ((($22)) + 852|0);
 HEAP8[$$index875>>0] = 0;
 $$index876 = ((($22)) + 853|0);
 HEAP8[$$index876>>0] = 0;
 $$index877 = ((($22)) + 854|0);
 HEAP8[$$index877>>0] = 0;
 $$index878 = ((($22)) + 855|0);
 HEAP8[$$index878>>0] = 0;
 $$index879 = ((($22)) + 856|0);
 HEAP8[$$index879>>0] = 0;
 $$index880 = ((($22)) + 857|0);
 HEAP8[$$index880>>0] = 0;
 $$index881 = ((($22)) + 858|0);
 HEAP8[$$index881>>0] = 0;
 $$index882 = ((($22)) + 859|0);
 HEAP8[$$index882>>0] = 0;
 $$index883 = ((($22)) + 860|0);
 HEAP8[$$index883>>0] = 0;
 $$index884 = ((($22)) + 861|0);
 HEAP8[$$index884>>0] = 0;
 $$index885 = ((($22)) + 862|0);
 HEAP8[$$index885>>0] = 0;
 $$index886 = ((($22)) + 863|0);
 HEAP8[$$index886>>0] = 0;
 $$index887 = ((($22)) + 864|0);
 HEAP8[$$index887>>0] = 0;
 $$index888 = ((($22)) + 865|0);
 HEAP8[$$index888>>0] = 0;
 $$index889 = ((($22)) + 866|0);
 HEAP8[$$index889>>0] = 0;
 $$index890 = ((($22)) + 867|0);
 HEAP8[$$index890>>0] = 0;
 $$index891 = ((($22)) + 868|0);
 HEAP8[$$index891>>0] = 0;
 $$index892 = ((($22)) + 869|0);
 HEAP8[$$index892>>0] = 0;
 $$index893 = ((($22)) + 870|0);
 HEAP8[$$index893>>0] = 0;
 $$index894 = ((($22)) + 871|0);
 HEAP8[$$index894>>0] = 0;
 $$index895 = ((($22)) + 872|0);
 HEAP8[$$index895>>0] = 0;
 $$index896 = ((($22)) + 873|0);
 HEAP8[$$index896>>0] = 0;
 $$index897 = ((($22)) + 874|0);
 HEAP8[$$index897>>0] = 0;
 $$index898 = ((($22)) + 875|0);
 HEAP8[$$index898>>0] = 0;
 $$index899 = ((($22)) + 876|0);
 HEAP8[$$index899>>0] = 0;
 $$index900 = ((($22)) + 877|0);
 HEAP8[$$index900>>0] = 0;
 $$index901 = ((($22)) + 878|0);
 HEAP8[$$index901>>0] = 0;
 $$index902 = ((($22)) + 879|0);
 HEAP8[$$index902>>0] = 0;
 $$index903 = ((($22)) + 880|0);
 HEAP8[$$index903>>0] = 0;
 $$index904 = ((($22)) + 881|0);
 HEAP8[$$index904>>0] = 0;
 $$index905 = ((($22)) + 882|0);
 HEAP8[$$index905>>0] = 0;
 $$index906 = ((($22)) + 883|0);
 HEAP8[$$index906>>0] = 0;
 $$index907 = ((($22)) + 884|0);
 HEAP8[$$index907>>0] = 0;
 $$index908 = ((($22)) + 885|0);
 HEAP8[$$index908>>0] = 0;
 $$index909 = ((($22)) + 886|0);
 HEAP8[$$index909>>0] = 0;
 $$index910 = ((($22)) + 887|0);
 HEAP8[$$index910>>0] = 0;
 $$index911 = ((($22)) + 888|0);
 HEAP8[$$index911>>0] = 0;
 $$index912 = ((($22)) + 889|0);
 HEAP8[$$index912>>0] = 0;
 $$index913 = ((($22)) + 890|0);
 HEAP8[$$index913>>0] = 0;
 $$index914 = ((($22)) + 891|0);
 HEAP8[$$index914>>0] = 0;
 $$index915 = ((($22)) + 892|0);
 HEAP8[$$index915>>0] = 0;
 $$index916 = ((($22)) + 893|0);
 HEAP8[$$index916>>0] = 0;
 $$index917 = ((($22)) + 894|0);
 HEAP8[$$index917>>0] = 0;
 $$index918 = ((($22)) + 895|0);
 HEAP8[$$index918>>0] = 0;
 $$index919 = ((($22)) + 896|0);
 HEAP8[$$index919>>0] = 0;
 $$index920 = ((($22)) + 897|0);
 HEAP8[$$index920>>0] = 0;
 $$index921 = ((($22)) + 898|0);
 HEAP8[$$index921>>0] = 0;
 $$index922 = ((($22)) + 899|0);
 HEAP8[$$index922>>0] = 0;
 $$index923 = ((($22)) + 900|0);
 HEAP8[$$index923>>0] = 0;
 $$index924 = ((($22)) + 901|0);
 HEAP8[$$index924>>0] = 0;
 $$index925 = ((($22)) + 902|0);
 HEAP8[$$index925>>0] = 0;
 $$index926 = ((($22)) + 903|0);
 HEAP8[$$index926>>0] = 0;
 $$index927 = ((($22)) + 904|0);
 HEAP8[$$index927>>0] = 0;
 $$index928 = ((($22)) + 905|0);
 HEAP8[$$index928>>0] = 0;
 $$index929 = ((($22)) + 906|0);
 HEAP8[$$index929>>0] = 0;
 $$index930 = ((($22)) + 907|0);
 HEAP8[$$index930>>0] = 0;
 $$index931 = ((($22)) + 908|0);
 HEAP8[$$index931>>0] = 0;
 $$index932 = ((($22)) + 909|0);
 HEAP8[$$index932>>0] = 0;
 $$index933 = ((($22)) + 910|0);
 HEAP8[$$index933>>0] = 0;
 $$index934 = ((($22)) + 911|0);
 HEAP8[$$index934>>0] = 0;
 $$index935 = ((($22)) + 912|0);
 HEAP8[$$index935>>0] = 0;
 $$index936 = ((($22)) + 913|0);
 HEAP8[$$index936>>0] = 0;
 $$index937 = ((($22)) + 914|0);
 HEAP8[$$index937>>0] = 0;
 $$index938 = ((($22)) + 915|0);
 HEAP8[$$index938>>0] = 0;
 $$index939 = ((($22)) + 916|0);
 HEAP8[$$index939>>0] = 0;
 $$index940 = ((($22)) + 917|0);
 HEAP8[$$index940>>0] = 0;
 $$index941 = ((($22)) + 918|0);
 HEAP8[$$index941>>0] = 0;
 $$index942 = ((($22)) + 919|0);
 HEAP8[$$index942>>0] = 0;
 $$index943 = ((($22)) + 920|0);
 HEAP8[$$index943>>0] = 0;
 $$index944 = ((($22)) + 921|0);
 HEAP8[$$index944>>0] = 0;
 $$index945 = ((($22)) + 922|0);
 HEAP8[$$index945>>0] = 0;
 $$index946 = ((($22)) + 923|0);
 HEAP8[$$index946>>0] = 0;
 $$index947 = ((($22)) + 924|0);
 HEAP8[$$index947>>0] = 0;
 $$index948 = ((($22)) + 925|0);
 HEAP8[$$index948>>0] = 0;
 $$index949 = ((($22)) + 926|0);
 HEAP8[$$index949>>0] = 0;
 $$index950 = ((($22)) + 927|0);
 HEAP8[$$index950>>0] = 0;
 $$index951 = ((($22)) + 928|0);
 HEAP8[$$index951>>0] = 0;
 $$index952 = ((($22)) + 929|0);
 HEAP8[$$index952>>0] = 0;
 $$index953 = ((($22)) + 930|0);
 HEAP8[$$index953>>0] = 0;
 $$index954 = ((($22)) + 931|0);
 HEAP8[$$index954>>0] = 0;
 $$index955 = ((($22)) + 932|0);
 HEAP8[$$index955>>0] = 0;
 $$index956 = ((($22)) + 933|0);
 HEAP8[$$index956>>0] = 0;
 $$index957 = ((($22)) + 934|0);
 HEAP8[$$index957>>0] = 0;
 $$index958 = ((($22)) + 935|0);
 HEAP8[$$index958>>0] = 0;
 $$index959 = ((($22)) + 936|0);
 HEAP8[$$index959>>0] = 0;
 $$index960 = ((($22)) + 937|0);
 HEAP8[$$index960>>0] = 0;
 $$index961 = ((($22)) + 938|0);
 HEAP8[$$index961>>0] = 0;
 $$index962 = ((($22)) + 939|0);
 HEAP8[$$index962>>0] = 0;
 $$index963 = ((($22)) + 940|0);
 HEAP8[$$index963>>0] = 0;
 $$index964 = ((($22)) + 941|0);
 HEAP8[$$index964>>0] = 0;
 $$index965 = ((($22)) + 942|0);
 HEAP8[$$index965>>0] = 0;
 $$index966 = ((($22)) + 943|0);
 HEAP8[$$index966>>0] = 0;
 $$index967 = ((($22)) + 944|0);
 HEAP8[$$index967>>0] = 0;
 $$index968 = ((($22)) + 945|0);
 HEAP8[$$index968>>0] = 0;
 $$index969 = ((($22)) + 946|0);
 HEAP8[$$index969>>0] = 0;
 $$index970 = ((($22)) + 947|0);
 HEAP8[$$index970>>0] = 0;
 $$index971 = ((($22)) + 948|0);
 HEAP8[$$index971>>0] = 0;
 $$index972 = ((($22)) + 949|0);
 HEAP8[$$index972>>0] = 0;
 $$index973 = ((($22)) + 950|0);
 HEAP8[$$index973>>0] = 0;
 $$index974 = ((($22)) + 951|0);
 HEAP8[$$index974>>0] = 0;
 $$index975 = ((($22)) + 952|0);
 HEAP8[$$index975>>0] = 0;
 $$index976 = ((($22)) + 953|0);
 HEAP8[$$index976>>0] = 0;
 $$index977 = ((($22)) + 954|0);
 HEAP8[$$index977>>0] = 0;
 $$index978 = ((($22)) + 955|0);
 HEAP8[$$index978>>0] = 0;
 $$index979 = ((($22)) + 956|0);
 HEAP8[$$index979>>0] = 0;
 $$index980 = ((($22)) + 957|0);
 HEAP8[$$index980>>0] = 0;
 $$index981 = ((($22)) + 958|0);
 HEAP8[$$index981>>0] = 0;
 $$index982 = ((($22)) + 959|0);
 HEAP8[$$index982>>0] = 0;
 $$index983 = ((($22)) + 960|0);
 HEAP8[$$index983>>0] = 0;
 $$index984 = ((($22)) + 961|0);
 HEAP8[$$index984>>0] = 0;
 $$index985 = ((($22)) + 962|0);
 HEAP8[$$index985>>0] = 0;
 $$index986 = ((($22)) + 963|0);
 HEAP8[$$index986>>0] = 0;
 $$index987 = ((($22)) + 964|0);
 HEAP8[$$index987>>0] = 0;
 $$index988 = ((($22)) + 965|0);
 HEAP8[$$index988>>0] = 0;
 $$index989 = ((($22)) + 966|0);
 HEAP8[$$index989>>0] = 0;
 $$index990 = ((($22)) + 967|0);
 HEAP8[$$index990>>0] = 0;
 $$index991 = ((($22)) + 968|0);
 HEAP8[$$index991>>0] = 0;
 $$index992 = ((($22)) + 969|0);
 HEAP8[$$index992>>0] = 0;
 $$index993 = ((($22)) + 970|0);
 HEAP8[$$index993>>0] = 0;
 $$index994 = ((($22)) + 971|0);
 HEAP8[$$index994>>0] = 0;
 $$index995 = ((($22)) + 972|0);
 HEAP8[$$index995>>0] = 0;
 $$index996 = ((($22)) + 973|0);
 HEAP8[$$index996>>0] = 0;
 $$index997 = ((($22)) + 974|0);
 HEAP8[$$index997>>0] = 0;
 $$index998 = ((($22)) + 975|0);
 HEAP8[$$index998>>0] = 0;
 $$index999 = ((($22)) + 976|0);
 HEAP8[$$index999>>0] = 0;
 $$index1000 = ((($22)) + 977|0);
 HEAP8[$$index1000>>0] = 0;
 $$index1001 = ((($22)) + 978|0);
 HEAP8[$$index1001>>0] = 0;
 $$index1002 = ((($22)) + 979|0);
 HEAP8[$$index1002>>0] = 0;
 $$index1003 = ((($22)) + 980|0);
 HEAP8[$$index1003>>0] = 0;
 $$index1004 = ((($22)) + 981|0);
 HEAP8[$$index1004>>0] = 0;
 $$index1005 = ((($22)) + 982|0);
 HEAP8[$$index1005>>0] = 0;
 $$index1006 = ((($22)) + 983|0);
 HEAP8[$$index1006>>0] = 0;
 $$index1007 = ((($22)) + 984|0);
 HEAP8[$$index1007>>0] = 0;
 $$index1008 = ((($22)) + 985|0);
 HEAP8[$$index1008>>0] = 0;
 $$index1009 = ((($22)) + 986|0);
 HEAP8[$$index1009>>0] = 0;
 $$index1010 = ((($22)) + 987|0);
 HEAP8[$$index1010>>0] = 0;
 $$index1011 = ((($22)) + 988|0);
 HEAP8[$$index1011>>0] = 0;
 $$index1012 = ((($22)) + 989|0);
 HEAP8[$$index1012>>0] = 0;
 $$index1013 = ((($22)) + 990|0);
 HEAP8[$$index1013>>0] = 0;
 $$index1014 = ((($22)) + 991|0);
 HEAP8[$$index1014>>0] = 0;
 $$index1015 = ((($22)) + 992|0);
 HEAP8[$$index1015>>0] = 0;
 $$index1016 = ((($22)) + 993|0);
 HEAP8[$$index1016>>0] = 0;
 $$index1017 = ((($22)) + 994|0);
 HEAP8[$$index1017>>0] = 0;
 $$index1018 = ((($22)) + 995|0);
 HEAP8[$$index1018>>0] = 0;
 $$index1019 = ((($22)) + 996|0);
 HEAP8[$$index1019>>0] = 0;
 $$index1020 = ((($22)) + 997|0);
 HEAP8[$$index1020>>0] = 0;
 $$index1021 = ((($22)) + 998|0);
 HEAP8[$$index1021>>0] = 0;
 $$index1022 = ((($22)) + 999|0);
 HEAP8[$$index1022>>0] = 0;
 $$index1023 = ((($22)) + 1000|0);
 HEAP8[$$index1023>>0] = 0;
 $$index1024 = ((($22)) + 1001|0);
 HEAP8[$$index1024>>0] = 0;
 $$index1025 = ((($22)) + 1002|0);
 HEAP8[$$index1025>>0] = 0;
 $$index1026 = ((($22)) + 1003|0);
 HEAP8[$$index1026>>0] = 0;
 $$index1027 = ((($22)) + 1004|0);
 HEAP8[$$index1027>>0] = 0;
 $$index1028 = ((($22)) + 1005|0);
 HEAP8[$$index1028>>0] = 0;
 $$index1029 = ((($22)) + 1006|0);
 HEAP8[$$index1029>>0] = 0;
 $$index1030 = ((($22)) + 1007|0);
 HEAP8[$$index1030>>0] = 0;
 $$index1031 = ((($22)) + 1008|0);
 HEAP8[$$index1031>>0] = 0;
 $$index1032 = ((($22)) + 1009|0);
 HEAP8[$$index1032>>0] = 0;
 $$index1033 = ((($22)) + 1010|0);
 HEAP8[$$index1033>>0] = 0;
 $$index1034 = ((($22)) + 1011|0);
 HEAP8[$$index1034>>0] = 0;
 $$index1035 = ((($22)) + 1012|0);
 HEAP8[$$index1035>>0] = 0;
 $$index1036 = ((($22)) + 1013|0);
 HEAP8[$$index1036>>0] = 0;
 $$index1037 = ((($22)) + 1014|0);
 HEAP8[$$index1037>>0] = 0;
 $$index1038 = ((($22)) + 1015|0);
 HEAP8[$$index1038>>0] = 0;
 $$index1039 = ((($22)) + 1016|0);
 HEAP8[$$index1039>>0] = 0;
 $$index1040 = ((($22)) + 1017|0);
 HEAP8[$$index1040>>0] = 0;
 $$index1041 = ((($22)) + 1018|0);
 HEAP8[$$index1041>>0] = 0;
 $$index1042 = ((($22)) + 1019|0);
 HEAP8[$$index1042>>0] = 0;
 $$index1043 = ((($22)) + 1020|0);
 HEAP8[$$index1043>>0] = 0;
 $$index1044 = ((($22)) + 1021|0);
 HEAP8[$$index1044>>0] = 0;
 $$index1045 = ((($22)) + 1022|0);
 HEAP8[$$index1045>>0] = 0;
 $$index1046 = ((($22)) + 1023|0);
 HEAP8[$$index1046>>0] = 0;
 $$index1047 = ((($22)) + 1024|0);
 HEAP8[$$index1047>>0] = 0;
 $$index1048 = ((($22)) + 1025|0);
 HEAP8[$$index1048>>0] = 0;
 $$index1049 = ((($22)) + 1026|0);
 HEAP8[$$index1049>>0] = 0;
 $$index1050 = ((($22)) + 1027|0);
 HEAP8[$$index1050>>0] = 0;
 $$index1051 = ((($22)) + 1028|0);
 HEAP8[$$index1051>>0] = 0;
 $$index1052 = ((($22)) + 1029|0);
 HEAP8[$$index1052>>0] = 0;
 $$index1053 = ((($22)) + 1030|0);
 HEAP8[$$index1053>>0] = 0;
 $$index1054 = ((($22)) + 1031|0);
 HEAP8[$$index1054>>0] = 0;
 $$index1055 = ((($22)) + 1032|0);
 HEAP8[$$index1055>>0] = 0;
 $$index1056 = ((($22)) + 1033|0);
 HEAP8[$$index1056>>0] = 0;
 $$index1057 = ((($22)) + 1034|0);
 HEAP8[$$index1057>>0] = 0;
 $$index1058 = ((($22)) + 1035|0);
 HEAP8[$$index1058>>0] = 0;
 $$index1059 = ((($22)) + 1036|0);
 HEAP8[$$index1059>>0] = 0;
 $$index1060 = ((($22)) + 1037|0);
 HEAP8[$$index1060>>0] = 0;
 $$index1061 = ((($22)) + 1038|0);
 HEAP8[$$index1061>>0] = 0;
 $$index1062 = ((($22)) + 1039|0);
 HEAP8[$$index1062>>0] = 0;
 $$index1063 = ((($22)) + 1040|0);
 HEAP8[$$index1063>>0] = 0;
 $$index1064 = ((($22)) + 1041|0);
 HEAP8[$$index1064>>0] = 0;
 $$index1065 = ((($22)) + 1042|0);
 HEAP8[$$index1065>>0] = 0;
 $$index1066 = ((($22)) + 1043|0);
 HEAP8[$$index1066>>0] = 0;
 $$index1067 = ((($22)) + 1044|0);
 HEAP8[$$index1067>>0] = 0;
 $$index1068 = ((($22)) + 1045|0);
 HEAP8[$$index1068>>0] = 0;
 $$index1069 = ((($22)) + 1046|0);
 HEAP8[$$index1069>>0] = 0;
 $$index1070 = ((($22)) + 1047|0);
 HEAP8[$$index1070>>0] = 0;
 $$index1071 = ((($22)) + 1048|0);
 HEAP8[$$index1071>>0] = 0;
 $$index1072 = ((($22)) + 1049|0);
 HEAP8[$$index1072>>0] = 0;
 $$index1073 = ((($22)) + 1050|0);
 HEAP8[$$index1073>>0] = 0;
 $$index1074 = ((($22)) + 1051|0);
 HEAP8[$$index1074>>0] = 0;
 $$index1075 = ((($22)) + 1052|0);
 HEAP8[$$index1075>>0] = 0;
 $$index1076 = ((($22)) + 1053|0);
 HEAP8[$$index1076>>0] = 0;
 $$index1077 = ((($22)) + 1054|0);
 HEAP8[$$index1077>>0] = 0;
 $$index1078 = ((($22)) + 1055|0);
 HEAP8[$$index1078>>0] = 0;
 $$index1079 = ((($22)) + 1056|0);
 HEAP8[$$index1079>>0] = 0;
 $$index1080 = ((($22)) + 1057|0);
 HEAP8[$$index1080>>0] = 0;
 $$index1081 = ((($22)) + 1058|0);
 HEAP8[$$index1081>>0] = 0;
 $$index1082 = ((($22)) + 1059|0);
 HEAP8[$$index1082>>0] = 0;
 $$index1083 = ((($22)) + 1060|0);
 HEAP8[$$index1083>>0] = 0;
 $$index1084 = ((($22)) + 1061|0);
 HEAP8[$$index1084>>0] = 0;
 $$index1085 = ((($22)) + 1062|0);
 HEAP8[$$index1085>>0] = 0;
 $$index1086 = ((($22)) + 1063|0);
 HEAP8[$$index1086>>0] = 0;
 $$index1087 = ((($22)) + 1064|0);
 HEAP8[$$index1087>>0] = 0;
 $$index1088 = ((($22)) + 1065|0);
 HEAP8[$$index1088>>0] = 0;
 $$index1089 = ((($22)) + 1066|0);
 HEAP8[$$index1089>>0] = 0;
 $$index1090 = ((($22)) + 1067|0);
 HEAP8[$$index1090>>0] = 0;
 $$index1091 = ((($22)) + 1068|0);
 HEAP8[$$index1091>>0] = 0;
 $$index1092 = ((($22)) + 1069|0);
 HEAP8[$$index1092>>0] = 0;
 $$index1093 = ((($22)) + 1070|0);
 HEAP8[$$index1093>>0] = 0;
 $$index1094 = ((($22)) + 1071|0);
 HEAP8[$$index1094>>0] = 0;
 $$index1095 = ((($22)) + 1072|0);
 HEAP8[$$index1095>>0] = 0;
 $$index1096 = ((($22)) + 1073|0);
 HEAP8[$$index1096>>0] = 0;
 $$index1097 = ((($22)) + 1074|0);
 HEAP8[$$index1097>>0] = 0;
 $$index1098 = ((($22)) + 1075|0);
 HEAP8[$$index1098>>0] = 0;
 $$index1099 = ((($22)) + 1076|0);
 HEAP8[$$index1099>>0] = 0;
 $$index1100 = ((($22)) + 1077|0);
 HEAP8[$$index1100>>0] = 0;
 $$index1101 = ((($22)) + 1078|0);
 HEAP8[$$index1101>>0] = 0;
 $$index1102 = ((($22)) + 1079|0);
 HEAP8[$$index1102>>0] = 0;
 $$index1103 = ((($22)) + 1080|0);
 HEAP8[$$index1103>>0] = 0;
 $$index1104 = ((($22)) + 1081|0);
 HEAP8[$$index1104>>0] = 0;
 $$index1105 = ((($22)) + 1082|0);
 HEAP8[$$index1105>>0] = 0;
 $$index1106 = ((($22)) + 1083|0);
 HEAP8[$$index1106>>0] = 0;
 $$index1107 = ((($22)) + 1084|0);
 HEAP8[$$index1107>>0] = 0;
 $$index1108 = ((($22)) + 1085|0);
 HEAP8[$$index1108>>0] = 0;
 $$index1109 = ((($22)) + 1086|0);
 HEAP8[$$index1109>>0] = 0;
 $$index1110 = ((($22)) + 1087|0);
 HEAP8[$$index1110>>0] = 0;
 $$index1111 = ((($22)) + 1088|0);
 HEAP8[$$index1111>>0] = 0;
 $$index1112 = ((($22)) + 1089|0);
 HEAP8[$$index1112>>0] = 0;
 $$index1113 = ((($22)) + 1090|0);
 HEAP8[$$index1113>>0] = 0;
 $$index1114 = ((($22)) + 1091|0);
 HEAP8[$$index1114>>0] = 0;
 $$index1115 = ((($22)) + 1092|0);
 HEAP8[$$index1115>>0] = 0;
 $$index1116 = ((($22)) + 1093|0);
 HEAP8[$$index1116>>0] = 0;
 $$index1117 = ((($22)) + 1094|0);
 HEAP8[$$index1117>>0] = 0;
 $$index1118 = ((($22)) + 1095|0);
 HEAP8[$$index1118>>0] = 0;
 $$index1119 = ((($22)) + 1096|0);
 HEAP8[$$index1119>>0] = 0;
 $$index1120 = ((($22)) + 1097|0);
 HEAP8[$$index1120>>0] = 0;
 $$index1121 = ((($22)) + 1098|0);
 HEAP8[$$index1121>>0] = 0;
 $$index1122 = ((($22)) + 1099|0);
 HEAP8[$$index1122>>0] = 0;
 $$index1123 = ((($22)) + 1100|0);
 HEAP8[$$index1123>>0] = 0;
 $$index1124 = ((($22)) + 1101|0);
 HEAP8[$$index1124>>0] = 0;
 $$index1125 = ((($22)) + 1102|0);
 HEAP8[$$index1125>>0] = 0;
 $$index1126 = ((($22)) + 1103|0);
 HEAP8[$$index1126>>0] = 0;
 $$index1127 = ((($22)) + 1104|0);
 HEAP8[$$index1127>>0] = 0;
 $$index1128 = ((($22)) + 1105|0);
 HEAP8[$$index1128>>0] = 0;
 $$index1129 = ((($22)) + 1106|0);
 HEAP8[$$index1129>>0] = 0;
 $$index1130 = ((($22)) + 1107|0);
 HEAP8[$$index1130>>0] = 0;
 $$index1131 = ((($22)) + 1108|0);
 HEAP8[$$index1131>>0] = 0;
 $$index1132 = ((($22)) + 1109|0);
 HEAP8[$$index1132>>0] = 0;
 $$index1133 = ((($22)) + 1110|0);
 HEAP8[$$index1133>>0] = 0;
 $$index1134 = ((($22)) + 1111|0);
 HEAP8[$$index1134>>0] = 0;
 $$index1135 = ((($22)) + 1112|0);
 HEAP8[$$index1135>>0] = 0;
 $$index1136 = ((($22)) + 1113|0);
 HEAP8[$$index1136>>0] = 0;
 $$index1137 = ((($22)) + 1114|0);
 HEAP8[$$index1137>>0] = 0;
 $$index1138 = ((($22)) + 1115|0);
 HEAP8[$$index1138>>0] = 0;
 $$index1139 = ((($22)) + 1116|0);
 HEAP8[$$index1139>>0] = 0;
 $$index1140 = ((($22)) + 1117|0);
 HEAP8[$$index1140>>0] = 0;
 $$index1141 = ((($22)) + 1118|0);
 HEAP8[$$index1141>>0] = 0;
 $$index1142 = ((($22)) + 1119|0);
 HEAP8[$$index1142>>0] = 0;
 $$index1143 = ((($22)) + 1120|0);
 HEAP8[$$index1143>>0] = 0;
 $$index1144 = ((($22)) + 1121|0);
 HEAP8[$$index1144>>0] = 0;
 $$index1145 = ((($22)) + 1122|0);
 HEAP8[$$index1145>>0] = 0;
 $$index1146 = ((($22)) + 1123|0);
 HEAP8[$$index1146>>0] = 0;
 $$index1147 = ((($22)) + 1124|0);
 HEAP8[$$index1147>>0] = 0;
 $$index1148 = ((($22)) + 1125|0);
 HEAP8[$$index1148>>0] = 0;
 $$index1149 = ((($22)) + 1126|0);
 HEAP8[$$index1149>>0] = 0;
 $$index1150 = ((($22)) + 1127|0);
 HEAP8[$$index1150>>0] = 0;
 $$index1151 = ((($22)) + 1128|0);
 HEAP8[$$index1151>>0] = 0;
 $$index1152 = ((($22)) + 1129|0);
 HEAP8[$$index1152>>0] = 0;
 $$index1153 = ((($22)) + 1130|0);
 HEAP8[$$index1153>>0] = 0;
 $$index1154 = ((($22)) + 1131|0);
 HEAP8[$$index1154>>0] = 0;
 $$index1155 = ((($22)) + 1132|0);
 HEAP8[$$index1155>>0] = 0;
 $$index1156 = ((($22)) + 1133|0);
 HEAP8[$$index1156>>0] = 0;
 $$index1157 = ((($22)) + 1134|0);
 HEAP8[$$index1157>>0] = 0;
 $$index1158 = ((($22)) + 1135|0);
 HEAP8[$$index1158>>0] = 0;
 $$index1159 = ((($22)) + 1136|0);
 HEAP8[$$index1159>>0] = 0;
 $$index1160 = ((($22)) + 1137|0);
 HEAP8[$$index1160>>0] = 0;
 $$index1161 = ((($22)) + 1138|0);
 HEAP8[$$index1161>>0] = 0;
 $$index1162 = ((($22)) + 1139|0);
 HEAP8[$$index1162>>0] = 0;
 $$index1163 = ((($22)) + 1140|0);
 HEAP8[$$index1163>>0] = 0;
 $$index1164 = ((($22)) + 1141|0);
 HEAP8[$$index1164>>0] = 0;
 $$index1165 = ((($22)) + 1142|0);
 HEAP8[$$index1165>>0] = 0;
 $$index1166 = ((($22)) + 1143|0);
 HEAP8[$$index1166>>0] = 0;
 $$index1167 = ((($22)) + 1144|0);
 HEAP8[$$index1167>>0] = 0;
 $$index1168 = ((($22)) + 1145|0);
 HEAP8[$$index1168>>0] = 0;
 $$index1169 = ((($22)) + 1146|0);
 HEAP8[$$index1169>>0] = 0;
 $$index1170 = ((($22)) + 1147|0);
 HEAP8[$$index1170>>0] = 0;
 $$index1171 = ((($22)) + 1148|0);
 HEAP8[$$index1171>>0] = 0;
 $$index1172 = ((($22)) + 1149|0);
 HEAP8[$$index1172>>0] = 0;
 $$index1173 = ((($22)) + 1150|0);
 HEAP8[$$index1173>>0] = 0;
 $$index1174 = ((($22)) + 1151|0);
 HEAP8[$$index1174>>0] = 0;
 $$index1175 = ((($22)) + 1152|0);
 HEAP8[$$index1175>>0] = 0;
 $$index1176 = ((($22)) + 1153|0);
 HEAP8[$$index1176>>0] = 0;
 $$index1177 = ((($22)) + 1154|0);
 HEAP8[$$index1177>>0] = 0;
 $$index1178 = ((($22)) + 1155|0);
 HEAP8[$$index1178>>0] = 0;
 $$index1179 = ((($22)) + 1156|0);
 HEAP8[$$index1179>>0] = 0;
 $$index1180 = ((($22)) + 1157|0);
 HEAP8[$$index1180>>0] = 0;
 $$index1181 = ((($22)) + 1158|0);
 HEAP8[$$index1181>>0] = 0;
 $$index1182 = ((($22)) + 1159|0);
 HEAP8[$$index1182>>0] = 0;
 $$index1183 = ((($22)) + 1160|0);
 HEAP8[$$index1183>>0] = 0;
 $$index1184 = ((($22)) + 1161|0);
 HEAP8[$$index1184>>0] = 0;
 $$index1185 = ((($22)) + 1162|0);
 HEAP8[$$index1185>>0] = 0;
 $$index1186 = ((($22)) + 1163|0);
 HEAP8[$$index1186>>0] = 0;
 $$index1187 = ((($22)) + 1164|0);
 HEAP8[$$index1187>>0] = 0;
 $$index1188 = ((($22)) + 1165|0);
 HEAP8[$$index1188>>0] = 0;
 $$index1189 = ((($22)) + 1166|0);
 HEAP8[$$index1189>>0] = 0;
 $$index1190 = ((($22)) + 1167|0);
 HEAP8[$$index1190>>0] = 0;
 $$index1191 = ((($22)) + 1168|0);
 HEAP8[$$index1191>>0] = 0;
 $$index1192 = ((($22)) + 1169|0);
 HEAP8[$$index1192>>0] = 0;
 $$index1193 = ((($22)) + 1170|0);
 HEAP8[$$index1193>>0] = 0;
 $$index1194 = ((($22)) + 1171|0);
 HEAP8[$$index1194>>0] = 0;
 $$index1195 = ((($22)) + 1172|0);
 HEAP8[$$index1195>>0] = 0;
 $$index1196 = ((($22)) + 1173|0);
 HEAP8[$$index1196>>0] = 0;
 $$index1197 = ((($22)) + 1174|0);
 HEAP8[$$index1197>>0] = 0;
 $$index1198 = ((($22)) + 1175|0);
 HEAP8[$$index1198>>0] = 0;
 $$index1199 = ((($22)) + 1176|0);
 HEAP8[$$index1199>>0] = 0;
 $$index1200 = ((($22)) + 1177|0);
 HEAP8[$$index1200>>0] = 0;
 $$index1201 = ((($22)) + 1178|0);
 HEAP8[$$index1201>>0] = 0;
 $$index1202 = ((($22)) + 1179|0);
 HEAP8[$$index1202>>0] = 0;
 $$index1203 = ((($22)) + 1180|0);
 HEAP8[$$index1203>>0] = 0;
 $$index1204 = ((($22)) + 1181|0);
 HEAP8[$$index1204>>0] = 0;
 $$index1205 = ((($22)) + 1182|0);
 HEAP8[$$index1205>>0] = 0;
 $$index1206 = ((($22)) + 1183|0);
 HEAP8[$$index1206>>0] = 0;
 $$index1207 = ((($22)) + 1184|0);
 HEAP8[$$index1207>>0] = 0;
 $$index1208 = ((($22)) + 1185|0);
 HEAP8[$$index1208>>0] = 0;
 $$index1209 = ((($22)) + 1186|0);
 HEAP8[$$index1209>>0] = 0;
 $$index1210 = ((($22)) + 1187|0);
 HEAP8[$$index1210>>0] = 0;
 $$index1211 = ((($22)) + 1188|0);
 HEAP8[$$index1211>>0] = 0;
 $$index1212 = ((($22)) + 1189|0);
 HEAP8[$$index1212>>0] = 0;
 $$index1213 = ((($22)) + 1190|0);
 HEAP8[$$index1213>>0] = 0;
 $$index1214 = ((($22)) + 1191|0);
 HEAP8[$$index1214>>0] = 0;
 $$index1215 = ((($22)) + 1192|0);
 HEAP8[$$index1215>>0] = 0;
 $$index1216 = ((($22)) + 1193|0);
 HEAP8[$$index1216>>0] = 0;
 $$index1217 = ((($22)) + 1194|0);
 HEAP8[$$index1217>>0] = 0;
 $$index1218 = ((($22)) + 1195|0);
 HEAP8[$$index1218>>0] = 0;
 $$index1219 = ((($22)) + 1196|0);
 HEAP8[$$index1219>>0] = 0;
 $$index1220 = ((($22)) + 1197|0);
 HEAP8[$$index1220>>0] = 0;
 $$index1221 = ((($22)) + 1198|0);
 HEAP8[$$index1221>>0] = 0;
 $$index1222 = ((($22)) + 1199|0);
 HEAP8[$$index1222>>0] = 0;
 $$index1223 = ((($22)) + 1200|0);
 HEAP8[$$index1223>>0] = 0;
 $$index1224 = ((($22)) + 1201|0);
 HEAP8[$$index1224>>0] = 0;
 $$index1225 = ((($22)) + 1202|0);
 HEAP8[$$index1225>>0] = 0;
 $$index1226 = ((($22)) + 1203|0);
 HEAP8[$$index1226>>0] = 0;
 $$index1227 = ((($22)) + 1204|0);
 HEAP8[$$index1227>>0] = 0;
 $$index1228 = ((($22)) + 1205|0);
 HEAP8[$$index1228>>0] = 0;
 $$index1229 = ((($22)) + 1206|0);
 HEAP8[$$index1229>>0] = 0;
 $$index1230 = ((($22)) + 1207|0);
 HEAP8[$$index1230>>0] = 0;
 $$index1231 = ((($22)) + 1208|0);
 HEAP8[$$index1231>>0] = 0;
 $$index1232 = ((($22)) + 1209|0);
 HEAP8[$$index1232>>0] = 0;
 $$index1233 = ((($22)) + 1210|0);
 HEAP8[$$index1233>>0] = 0;
 $$index1234 = ((($22)) + 1211|0);
 HEAP8[$$index1234>>0] = 0;
 $$index1235 = ((($22)) + 1212|0);
 HEAP8[$$index1235>>0] = 0;
 $$index1236 = ((($22)) + 1213|0);
 HEAP8[$$index1236>>0] = 0;
 $$index1237 = ((($22)) + 1214|0);
 HEAP8[$$index1237>>0] = 0;
 $$index1238 = ((($22)) + 1215|0);
 HEAP8[$$index1238>>0] = 0;
 $$index1239 = ((($22)) + 1216|0);
 HEAP8[$$index1239>>0] = 0;
 $$index1240 = ((($22)) + 1217|0);
 HEAP8[$$index1240>>0] = 0;
 $$index1241 = ((($22)) + 1218|0);
 HEAP8[$$index1241>>0] = 0;
 $$index1242 = ((($22)) + 1219|0);
 HEAP8[$$index1242>>0] = 0;
 $$index1243 = ((($22)) + 1220|0);
 HEAP8[$$index1243>>0] = 0;
 $$index1244 = ((($22)) + 1221|0);
 HEAP8[$$index1244>>0] = 0;
 $$index1245 = ((($22)) + 1222|0);
 HEAP8[$$index1245>>0] = 0;
 $$index1246 = ((($22)) + 1223|0);
 HEAP8[$$index1246>>0] = 0;
 $$index1247 = ((($22)) + 1224|0);
 HEAP8[$$index1247>>0] = 0;
 $$index1248 = ((($22)) + 1225|0);
 HEAP8[$$index1248>>0] = 0;
 $$index1249 = ((($22)) + 1226|0);
 HEAP8[$$index1249>>0] = 0;
 $$index1250 = ((($22)) + 1227|0);
 HEAP8[$$index1250>>0] = 0;
 $$index1251 = ((($22)) + 1228|0);
 HEAP8[$$index1251>>0] = 0;
 $$index1252 = ((($22)) + 1229|0);
 HEAP8[$$index1252>>0] = 0;
 $$index1253 = ((($22)) + 1230|0);
 HEAP8[$$index1253>>0] = 0;
 $$index1254 = ((($22)) + 1231|0);
 HEAP8[$$index1254>>0] = 0;
 $$index1255 = ((($22)) + 1232|0);
 HEAP8[$$index1255>>0] = 0;
 $$index1256 = ((($22)) + 1233|0);
 HEAP8[$$index1256>>0] = 0;
 $$index1257 = ((($22)) + 1234|0);
 HEAP8[$$index1257>>0] = 0;
 $$index1258 = ((($22)) + 1235|0);
 HEAP8[$$index1258>>0] = 0;
 $$index1259 = ((($22)) + 1236|0);
 HEAP8[$$index1259>>0] = 0;
 $$index1260 = ((($22)) + 1237|0);
 HEAP8[$$index1260>>0] = 0;
 $$index1261 = ((($22)) + 1238|0);
 HEAP8[$$index1261>>0] = 0;
 $$index1262 = ((($22)) + 1239|0);
 HEAP8[$$index1262>>0] = 0;
 $$index1263 = ((($22)) + 1240|0);
 HEAP8[$$index1263>>0] = 0;
 $$index1264 = ((($22)) + 1241|0);
 HEAP8[$$index1264>>0] = 0;
 $$index1265 = ((($22)) + 1242|0);
 HEAP8[$$index1265>>0] = 0;
 $$index1266 = ((($22)) + 1243|0);
 HEAP8[$$index1266>>0] = 0;
 $$index1267 = ((($22)) + 1244|0);
 HEAP8[$$index1267>>0] = 0;
 $$index1268 = ((($22)) + 1245|0);
 HEAP8[$$index1268>>0] = 0;
 $$index1269 = ((($22)) + 1246|0);
 HEAP8[$$index1269>>0] = 0;
 $$index1270 = ((($22)) + 1247|0);
 HEAP8[$$index1270>>0] = 0;
 $$index1271 = ((($22)) + 1248|0);
 HEAP8[$$index1271>>0] = 0;
 $$index1272 = ((($22)) + 1249|0);
 HEAP8[$$index1272>>0] = 0;
 $$index1273 = ((($22)) + 1250|0);
 HEAP8[$$index1273>>0] = 0;
 $$index1274 = ((($22)) + 1251|0);
 HEAP8[$$index1274>>0] = 0;
 $$index1275 = ((($22)) + 1252|0);
 HEAP8[$$index1275>>0] = 0;
 $$index1276 = ((($22)) + 1253|0);
 HEAP8[$$index1276>>0] = 0;
 $$index1277 = ((($22)) + 1254|0);
 HEAP8[$$index1277>>0] = 0;
 $$index1278 = ((($22)) + 1255|0);
 HEAP8[$$index1278>>0] = 0;
 $$index1279 = ((($22)) + 1256|0);
 HEAP8[$$index1279>>0] = 0;
 $$index1280 = ((($22)) + 1257|0);
 HEAP8[$$index1280>>0] = 0;
 $$index1281 = ((($22)) + 1258|0);
 HEAP8[$$index1281>>0] = 0;
 $$index1282 = ((($22)) + 1259|0);
 HEAP8[$$index1282>>0] = 0;
 $$index1283 = ((($22)) + 1260|0);
 HEAP8[$$index1283>>0] = 0;
 $$index1284 = ((($22)) + 1261|0);
 HEAP8[$$index1284>>0] = 0;
 $$index1285 = ((($22)) + 1262|0);
 HEAP8[$$index1285>>0] = 0;
 $$index1286 = ((($22)) + 1263|0);
 HEAP8[$$index1286>>0] = 0;
 $$index1287 = ((($22)) + 1264|0);
 HEAP8[$$index1287>>0] = 0;
 $$index1288 = ((($22)) + 1265|0);
 HEAP8[$$index1288>>0] = 0;
 $$index1289 = ((($22)) + 1266|0);
 HEAP8[$$index1289>>0] = 0;
 $$index1290 = ((($22)) + 1267|0);
 HEAP8[$$index1290>>0] = 0;
 $$index1291 = ((($22)) + 1268|0);
 HEAP8[$$index1291>>0] = 0;
 $$index1292 = ((($22)) + 1269|0);
 HEAP8[$$index1292>>0] = 0;
 $$index1293 = ((($22)) + 1270|0);
 HEAP8[$$index1293>>0] = 0;
 $$index1294 = ((($22)) + 1271|0);
 HEAP8[$$index1294>>0] = 0;
 $$index1295 = ((($22)) + 1272|0);
 HEAP8[$$index1295>>0] = 0;
 $$index1296 = ((($22)) + 1273|0);
 HEAP8[$$index1296>>0] = 0;
 $$index1297 = ((($22)) + 1274|0);
 HEAP8[$$index1297>>0] = 0;
 $$index1298 = ((($22)) + 1275|0);
 HEAP8[$$index1298>>0] = 0;
 $$index1299 = ((($22)) + 1276|0);
 HEAP8[$$index1299>>0] = 0;
 $$index1300 = ((($22)) + 1277|0);
 HEAP8[$$index1300>>0] = 0;
 $$index1301 = ((($22)) + 1278|0);
 HEAP8[$$index1301>>0] = 0;
 $$index1302 = ((($22)) + 1279|0);
 HEAP8[$$index1302>>0] = 0;
 $$index1303 = ((($22)) + 1280|0);
 HEAP8[$$index1303>>0] = 0;
 $$index1304 = ((($22)) + 1281|0);
 HEAP8[$$index1304>>0] = 0;
 $$index1305 = ((($22)) + 1282|0);
 HEAP8[$$index1305>>0] = 0;
 $$index1306 = ((($22)) + 1283|0);
 HEAP8[$$index1306>>0] = 0;
 $$index1307 = ((($22)) + 1284|0);
 HEAP8[$$index1307>>0] = 0;
 $$index1308 = ((($22)) + 1285|0);
 HEAP8[$$index1308>>0] = 0;
 $$index1309 = ((($22)) + 1286|0);
 HEAP8[$$index1309>>0] = 0;
 $$index1310 = ((($22)) + 1287|0);
 HEAP8[$$index1310>>0] = 0;
 $$index1311 = ((($22)) + 1288|0);
 HEAP8[$$index1311>>0] = 0;
 $$index1312 = ((($22)) + 1289|0);
 HEAP8[$$index1312>>0] = 0;
 $$index1313 = ((($22)) + 1290|0);
 HEAP8[$$index1313>>0] = 0;
 $$index1314 = ((($22)) + 1291|0);
 HEAP8[$$index1314>>0] = 0;
 $$index1315 = ((($22)) + 1292|0);
 HEAP8[$$index1315>>0] = 0;
 $$index1316 = ((($22)) + 1293|0);
 HEAP8[$$index1316>>0] = 0;
 $$index1317 = ((($22)) + 1294|0);
 HEAP8[$$index1317>>0] = 0;
 $$index1318 = ((($22)) + 1295|0);
 HEAP8[$$index1318>>0] = 0;
 $$index1319 = ((($22)) + 1296|0);
 HEAP8[$$index1319>>0] = 0;
 $$index1320 = ((($22)) + 1297|0);
 HEAP8[$$index1320>>0] = 0;
 $$index1321 = ((($22)) + 1298|0);
 HEAP8[$$index1321>>0] = 0;
 $$index1322 = ((($22)) + 1299|0);
 HEAP8[$$index1322>>0] = 0;
 $$index1323 = ((($22)) + 1300|0);
 HEAP8[$$index1323>>0] = 0;
 $$index1324 = ((($22)) + 1301|0);
 HEAP8[$$index1324>>0] = 0;
 $$index1325 = ((($22)) + 1302|0);
 HEAP8[$$index1325>>0] = 0;
 $$index1326 = ((($22)) + 1303|0);
 HEAP8[$$index1326>>0] = 0;
 $$index1327 = ((($22)) + 1304|0);
 HEAP8[$$index1327>>0] = 0;
 $$index1328 = ((($22)) + 1305|0);
 HEAP8[$$index1328>>0] = 0;
 $$index1329 = ((($22)) + 1306|0);
 HEAP8[$$index1329>>0] = 0;
 $$index1330 = ((($22)) + 1307|0);
 HEAP8[$$index1330>>0] = 0;
 $$index1331 = ((($22)) + 1308|0);
 HEAP8[$$index1331>>0] = 0;
 $$index1332 = ((($22)) + 1309|0);
 HEAP8[$$index1332>>0] = 0;
 $$index1333 = ((($22)) + 1310|0);
 HEAP8[$$index1333>>0] = 0;
 $$index1334 = ((($22)) + 1311|0);
 HEAP8[$$index1334>>0] = 0;
 $$index1335 = ((($22)) + 1312|0);
 HEAP8[$$index1335>>0] = 0;
 $$index1336 = ((($22)) + 1313|0);
 HEAP8[$$index1336>>0] = 0;
 $$index1337 = ((($22)) + 1314|0);
 HEAP8[$$index1337>>0] = 0;
 $$index1338 = ((($22)) + 1315|0);
 HEAP8[$$index1338>>0] = 0;
 $$index1339 = ((($22)) + 1316|0);
 HEAP8[$$index1339>>0] = 0;
 $$index1340 = ((($22)) + 1317|0);
 HEAP8[$$index1340>>0] = 0;
 $$index1341 = ((($22)) + 1318|0);
 HEAP8[$$index1341>>0] = 0;
 $$index1342 = ((($22)) + 1319|0);
 HEAP8[$$index1342>>0] = 0;
 $$index1343 = ((($22)) + 1320|0);
 HEAP8[$$index1343>>0] = 0;
 $$index1344 = ((($22)) + 1321|0);
 HEAP8[$$index1344>>0] = 0;
 $$index1345 = ((($22)) + 1322|0);
 HEAP8[$$index1345>>0] = 0;
 $$index1346 = ((($22)) + 1323|0);
 HEAP8[$$index1346>>0] = 0;
 $$index1347 = ((($22)) + 1324|0);
 HEAP8[$$index1347>>0] = 0;
 $$index1348 = ((($22)) + 1325|0);
 HEAP8[$$index1348>>0] = 0;
 $$index1349 = ((($22)) + 1326|0);
 HEAP8[$$index1349>>0] = 0;
 $$index1350 = ((($22)) + 1327|0);
 HEAP8[$$index1350>>0] = 0;
 $$index1351 = ((($22)) + 1328|0);
 HEAP8[$$index1351>>0] = 0;
 $$index1352 = ((($22)) + 1329|0);
 HEAP8[$$index1352>>0] = 0;
 $$index1353 = ((($22)) + 1330|0);
 HEAP8[$$index1353>>0] = 0;
 $$index1354 = ((($22)) + 1331|0);
 HEAP8[$$index1354>>0] = 0;
 $$index1355 = ((($22)) + 1332|0);
 HEAP8[$$index1355>>0] = 0;
 $$index1356 = ((($22)) + 1333|0);
 HEAP8[$$index1356>>0] = 0;
 $$index1357 = ((($22)) + 1334|0);
 HEAP8[$$index1357>>0] = 0;
 $$index1358 = ((($22)) + 1335|0);
 HEAP8[$$index1358>>0] = 0;
 $$index1359 = ((($22)) + 1336|0);
 HEAP8[$$index1359>>0] = 0;
 $$index1360 = ((($22)) + 1337|0);
 HEAP8[$$index1360>>0] = 0;
 $$index1361 = ((($22)) + 1338|0);
 HEAP8[$$index1361>>0] = 0;
 $$index1362 = ((($22)) + 1339|0);
 HEAP8[$$index1362>>0] = 0;
 $$index1363 = ((($22)) + 1340|0);
 HEAP8[$$index1363>>0] = 0;
 $$index1364 = ((($22)) + 1341|0);
 HEAP8[$$index1364>>0] = 0;
 $$index1365 = ((($22)) + 1342|0);
 HEAP8[$$index1365>>0] = 0;
 $$index1366 = ((($22)) + 1343|0);
 HEAP8[$$index1366>>0] = 0;
 $$index1367 = ((($22)) + 1344|0);
 HEAP8[$$index1367>>0] = 0;
 $$index1368 = ((($22)) + 1345|0);
 HEAP8[$$index1368>>0] = 0;
 $$index1369 = ((($22)) + 1346|0);
 HEAP8[$$index1369>>0] = 0;
 $$index1370 = ((($22)) + 1347|0);
 HEAP8[$$index1370>>0] = 0;
 $$index1371 = ((($22)) + 1348|0);
 HEAP8[$$index1371>>0] = 0;
 $$index1372 = ((($22)) + 1349|0);
 HEAP8[$$index1372>>0] = 0;
 $$index1373 = ((($22)) + 1350|0);
 HEAP8[$$index1373>>0] = 0;
 $$index1374 = ((($22)) + 1351|0);
 HEAP8[$$index1374>>0] = 0;
 $$index1375 = ((($22)) + 1352|0);
 HEAP8[$$index1375>>0] = 0;
 $$index1376 = ((($22)) + 1353|0);
 HEAP8[$$index1376>>0] = 0;
 $$index1377 = ((($22)) + 1354|0);
 HEAP8[$$index1377>>0] = 0;
 $$index1378 = ((($22)) + 1355|0);
 HEAP8[$$index1378>>0] = 0;
 $$index1379 = ((($22)) + 1356|0);
 HEAP8[$$index1379>>0] = 0;
 $$index1380 = ((($22)) + 1357|0);
 HEAP8[$$index1380>>0] = 0;
 $$index1381 = ((($22)) + 1358|0);
 HEAP8[$$index1381>>0] = 0;
 $$index1382 = ((($22)) + 1359|0);
 HEAP8[$$index1382>>0] = 0;
 $$index1383 = ((($22)) + 1360|0);
 HEAP8[$$index1383>>0] = 0;
 $$index1384 = ((($22)) + 1361|0);
 HEAP8[$$index1384>>0] = 0;
 $$index1385 = ((($22)) + 1362|0);
 HEAP8[$$index1385>>0] = 0;
 $$index1386 = ((($22)) + 1363|0);
 HEAP8[$$index1386>>0] = 0;
 $$index1387 = ((($22)) + 1364|0);
 HEAP8[$$index1387>>0] = 0;
 $$index1388 = ((($22)) + 1365|0);
 HEAP8[$$index1388>>0] = 0;
 $$index1389 = ((($22)) + 1366|0);
 HEAP8[$$index1389>>0] = 0;
 $$index1390 = ((($22)) + 1367|0);
 HEAP8[$$index1390>>0] = 0;
 $$index1391 = ((($22)) + 1368|0);
 HEAP8[$$index1391>>0] = 0;
 $$index1392 = ((($22)) + 1369|0);
 HEAP8[$$index1392>>0] = 0;
 $$index1393 = ((($22)) + 1370|0);
 HEAP8[$$index1393>>0] = 0;
 $$index1394 = ((($22)) + 1371|0);
 HEAP8[$$index1394>>0] = 0;
 $$index1395 = ((($22)) + 1372|0);
 HEAP8[$$index1395>>0] = 0;
 $$index1396 = ((($22)) + 1373|0);
 HEAP8[$$index1396>>0] = 0;
 $$index1397 = ((($22)) + 1374|0);
 HEAP8[$$index1397>>0] = 0;
 $$index1398 = ((($22)) + 1375|0);
 HEAP8[$$index1398>>0] = 0;
 $$index1399 = ((($22)) + 1376|0);
 HEAP8[$$index1399>>0] = 0;
 $$index1400 = ((($22)) + 1377|0);
 HEAP8[$$index1400>>0] = 0;
 $$index1401 = ((($22)) + 1378|0);
 HEAP8[$$index1401>>0] = 0;
 $$index1402 = ((($22)) + 1379|0);
 HEAP8[$$index1402>>0] = 0;
 $$index1403 = ((($22)) + 1380|0);
 HEAP8[$$index1403>>0] = 0;
 $$index1404 = ((($22)) + 1381|0);
 HEAP8[$$index1404>>0] = 0;
 $$index1405 = ((($22)) + 1382|0);
 HEAP8[$$index1405>>0] = 0;
 $$index1406 = ((($22)) + 1383|0);
 HEAP8[$$index1406>>0] = 0;
 $$index1407 = ((($22)) + 1384|0);
 HEAP8[$$index1407>>0] = 0;
 $$index1408 = ((($22)) + 1385|0);
 HEAP8[$$index1408>>0] = 0;
 $$index1409 = ((($22)) + 1386|0);
 HEAP8[$$index1409>>0] = 0;
 $$index1410 = ((($22)) + 1387|0);
 HEAP8[$$index1410>>0] = 0;
 $$index1411 = ((($22)) + 1388|0);
 HEAP8[$$index1411>>0] = 0;
 $$index1412 = ((($22)) + 1389|0);
 HEAP8[$$index1412>>0] = 0;
 $$index1413 = ((($22)) + 1390|0);
 HEAP8[$$index1413>>0] = 0;
 $$index1414 = ((($22)) + 1391|0);
 HEAP8[$$index1414>>0] = 0;
 $$index1415 = ((($22)) + 1392|0);
 HEAP8[$$index1415>>0] = 0;
 $$index1416 = ((($22)) + 1393|0);
 HEAP8[$$index1416>>0] = 0;
 $$index1417 = ((($22)) + 1394|0);
 HEAP8[$$index1417>>0] = 0;
 $$index1418 = ((($22)) + 1395|0);
 HEAP8[$$index1418>>0] = 0;
 $$index1419 = ((($22)) + 1396|0);
 HEAP8[$$index1419>>0] = 0;
 $$index1420 = ((($22)) + 1397|0);
 HEAP8[$$index1420>>0] = 0;
 $$index1421 = ((($22)) + 1398|0);
 HEAP8[$$index1421>>0] = 0;
 $$index1422 = ((($22)) + 1399|0);
 HEAP8[$$index1422>>0] = 0;
 $$index1423 = ((($22)) + 1400|0);
 HEAP8[$$index1423>>0] = 0;
 $$index1424 = ((($22)) + 1401|0);
 HEAP8[$$index1424>>0] = 0;
 $$index1425 = ((($22)) + 1402|0);
 HEAP8[$$index1425>>0] = 0;
 $$index1426 = ((($22)) + 1403|0);
 HEAP8[$$index1426>>0] = 0;
 $$index1427 = ((($22)) + 1404|0);
 HEAP8[$$index1427>>0] = 0;
 $$index1428 = ((($22)) + 1405|0);
 HEAP8[$$index1428>>0] = 0;
 $$index1429 = ((($22)) + 1406|0);
 HEAP8[$$index1429>>0] = 0;
 $$index1430 = ((($22)) + 1407|0);
 HEAP8[$$index1430>>0] = 0;
 $$index1431 = ((($22)) + 1408|0);
 HEAP8[$$index1431>>0] = 0;
 $$index1432 = ((($22)) + 1409|0);
 HEAP8[$$index1432>>0] = 0;
 $$index1433 = ((($22)) + 1410|0);
 HEAP8[$$index1433>>0] = 0;
 $$index1434 = ((($22)) + 1411|0);
 HEAP8[$$index1434>>0] = 0;
 $$index1435 = ((($22)) + 1412|0);
 HEAP8[$$index1435>>0] = 0;
 $$index1436 = ((($22)) + 1413|0);
 HEAP8[$$index1436>>0] = 0;
 $$index1437 = ((($22)) + 1414|0);
 HEAP8[$$index1437>>0] = 0;
 $$index1438 = ((($22)) + 1415|0);
 HEAP8[$$index1438>>0] = 0;
 $$index1439 = ((($22)) + 1416|0);
 HEAP8[$$index1439>>0] = 0;
 $$index1440 = ((($22)) + 1417|0);
 HEAP8[$$index1440>>0] = 0;
 $$index1441 = ((($22)) + 1418|0);
 HEAP8[$$index1441>>0] = 0;
 $$index1442 = ((($22)) + 1419|0);
 HEAP8[$$index1442>>0] = 0;
 $$index1443 = ((($22)) + 1420|0);
 HEAP8[$$index1443>>0] = 0;
 $$index1444 = ((($22)) + 1421|0);
 HEAP8[$$index1444>>0] = 0;
 $$index1445 = ((($22)) + 1422|0);
 HEAP8[$$index1445>>0] = 0;
 $$index1446 = ((($22)) + 1423|0);
 HEAP8[$$index1446>>0] = 0;
 $$index1447 = ((($22)) + 1424|0);
 HEAP8[$$index1447>>0] = 0;
 $$index1448 = ((($22)) + 1425|0);
 HEAP8[$$index1448>>0] = 0;
 $$index1449 = ((($22)) + 1426|0);
 HEAP8[$$index1449>>0] = 0;
 $$index1450 = ((($22)) + 1427|0);
 HEAP8[$$index1450>>0] = 0;
 $$index1451 = ((($22)) + 1428|0);
 HEAP8[$$index1451>>0] = 0;
 $$index1452 = ((($22)) + 1429|0);
 HEAP8[$$index1452>>0] = 0;
 $$index1453 = ((($22)) + 1430|0);
 HEAP8[$$index1453>>0] = 0;
 $$index1454 = ((($22)) + 1431|0);
 HEAP8[$$index1454>>0] = 0;
 $$index1455 = ((($22)) + 1432|0);
 HEAP8[$$index1455>>0] = 0;
 $$index1456 = ((($22)) + 1433|0);
 HEAP8[$$index1456>>0] = 0;
 $$index1457 = ((($22)) + 1434|0);
 HEAP8[$$index1457>>0] = 0;
 $$index1458 = ((($22)) + 1435|0);
 HEAP8[$$index1458>>0] = 0;
 $$index1459 = ((($22)) + 1436|0);
 HEAP8[$$index1459>>0] = 0;
 $$index1460 = ((($22)) + 1437|0);
 HEAP8[$$index1460>>0] = 0;
 $$index1461 = ((($22)) + 1438|0);
 HEAP8[$$index1461>>0] = 0;
 $$index1462 = ((($22)) + 1439|0);
 HEAP8[$$index1462>>0] = 0;
 $$index1463 = ((($22)) + 1440|0);
 HEAP8[$$index1463>>0] = 0;
 $$index1464 = ((($22)) + 1441|0);
 HEAP8[$$index1464>>0] = 0;
 $$index1465 = ((($22)) + 1442|0);
 HEAP8[$$index1465>>0] = 0;
 $$index1466 = ((($22)) + 1443|0);
 HEAP8[$$index1466>>0] = 0;
 $$index1467 = ((($22)) + 1444|0);
 HEAP8[$$index1467>>0] = 0;
 $$index1468 = ((($22)) + 1445|0);
 HEAP8[$$index1468>>0] = 0;
 $$index1469 = ((($22)) + 1446|0);
 HEAP8[$$index1469>>0] = 0;
 $$index1470 = ((($22)) + 1447|0);
 HEAP8[$$index1470>>0] = 0;
 $$index1471 = ((($22)) + 1448|0);
 HEAP8[$$index1471>>0] = 0;
 $$index1472 = ((($22)) + 1449|0);
 HEAP8[$$index1472>>0] = 0;
 $$index1473 = ((($22)) + 1450|0);
 HEAP8[$$index1473>>0] = 0;
 $$index1474 = ((($22)) + 1451|0);
 HEAP8[$$index1474>>0] = 0;
 $$index1475 = ((($22)) + 1452|0);
 HEAP8[$$index1475>>0] = 0;
 $$index1476 = ((($22)) + 1453|0);
 HEAP8[$$index1476>>0] = 0;
 $$index1477 = ((($22)) + 1454|0);
 HEAP8[$$index1477>>0] = 0;
 $$index1478 = ((($22)) + 1455|0);
 HEAP8[$$index1478>>0] = 0;
 $$index1479 = ((($22)) + 1456|0);
 HEAP8[$$index1479>>0] = 0;
 $$index1480 = ((($22)) + 1457|0);
 HEAP8[$$index1480>>0] = 0;
 $$index1481 = ((($22)) + 1458|0);
 HEAP8[$$index1481>>0] = 0;
 $$index1482 = ((($22)) + 1459|0);
 HEAP8[$$index1482>>0] = 0;
 $$index1483 = ((($22)) + 1460|0);
 HEAP8[$$index1483>>0] = 0;
 $$index1484 = ((($22)) + 1461|0);
 HEAP8[$$index1484>>0] = 0;
 $$index1485 = ((($22)) + 1462|0);
 HEAP8[$$index1485>>0] = 0;
 $$index1486 = ((($22)) + 1463|0);
 HEAP8[$$index1486>>0] = 0;
 $$index1487 = ((($22)) + 1464|0);
 HEAP8[$$index1487>>0] = 0;
 $$index1488 = ((($22)) + 1465|0);
 HEAP8[$$index1488>>0] = 0;
 $$index1489 = ((($22)) + 1466|0);
 HEAP8[$$index1489>>0] = 0;
 $$index1490 = ((($22)) + 1467|0);
 HEAP8[$$index1490>>0] = 0;
 $$index1491 = ((($22)) + 1468|0);
 HEAP8[$$index1491>>0] = 0;
 $$index1492 = ((($22)) + 1469|0);
 HEAP8[$$index1492>>0] = 0;
 $$index1493 = ((($22)) + 1470|0);
 HEAP8[$$index1493>>0] = 0;
 $$index1494 = ((($22)) + 1471|0);
 HEAP8[$$index1494>>0] = 0;
 $$index1495 = ((($22)) + 1472|0);
 HEAP8[$$index1495>>0] = 0;
 $$index1496 = ((($22)) + 1473|0);
 HEAP8[$$index1496>>0] = 0;
 $$index1497 = ((($22)) + 1474|0);
 HEAP8[$$index1497>>0] = 0;
 $$index1498 = ((($22)) + 1475|0);
 HEAP8[$$index1498>>0] = 0;
 $$index1499 = ((($22)) + 1476|0);
 HEAP8[$$index1499>>0] = 0;
 $$index1500 = ((($22)) + 1477|0);
 HEAP8[$$index1500>>0] = 0;
 $$index1501 = ((($22)) + 1478|0);
 HEAP8[$$index1501>>0] = 0;
 $$index1502 = ((($22)) + 1479|0);
 HEAP8[$$index1502>>0] = 0;
 $$index1503 = ((($22)) + 1480|0);
 HEAP8[$$index1503>>0] = 0;
 $$index1504 = ((($22)) + 1481|0);
 HEAP8[$$index1504>>0] = 0;
 $$index1505 = ((($22)) + 1482|0);
 HEAP8[$$index1505>>0] = 0;
 $$index1506 = ((($22)) + 1483|0);
 HEAP8[$$index1506>>0] = 0;
 $$index1507 = ((($22)) + 1484|0);
 HEAP8[$$index1507>>0] = 0;
 $$index1508 = ((($22)) + 1485|0);
 HEAP8[$$index1508>>0] = 0;
 $$index1509 = ((($22)) + 1486|0);
 HEAP8[$$index1509>>0] = 0;
 $$index1510 = ((($22)) + 1487|0);
 HEAP8[$$index1510>>0] = 0;
 $$index1511 = ((($22)) + 1488|0);
 HEAP8[$$index1511>>0] = 0;
 $$index1512 = ((($22)) + 1489|0);
 HEAP8[$$index1512>>0] = 0;
 $$index1513 = ((($22)) + 1490|0);
 HEAP8[$$index1513>>0] = 0;
 $$index1514 = ((($22)) + 1491|0);
 HEAP8[$$index1514>>0] = 0;
 $$index1515 = ((($22)) + 1492|0);
 HEAP8[$$index1515>>0] = 0;
 $$index1516 = ((($22)) + 1493|0);
 HEAP8[$$index1516>>0] = 0;
 $$index1517 = ((($22)) + 1494|0);
 HEAP8[$$index1517>>0] = 0;
 $$index1518 = ((($22)) + 1495|0);
 HEAP8[$$index1518>>0] = 0;
 $$index1519 = ((($22)) + 1496|0);
 HEAP8[$$index1519>>0] = 0;
 $$index1520 = ((($22)) + 1497|0);
 HEAP8[$$index1520>>0] = 0;
 $$index1521 = ((($22)) + 1498|0);
 HEAP8[$$index1521>>0] = 0;
 $$index1522 = ((($22)) + 1499|0);
 HEAP8[$$index1522>>0] = 0;
 $$index1523 = ((($22)) + 1500|0);
 HEAP8[$$index1523>>0] = 0;
 $$index1524 = ((($22)) + 1501|0);
 HEAP8[$$index1524>>0] = 0;
 $$index1525 = ((($22)) + 1502|0);
 HEAP8[$$index1525>>0] = 0;
 $$index1526 = ((($22)) + 1503|0);
 HEAP8[$$index1526>>0] = 0;
 $$index1527 = ((($22)) + 1504|0);
 HEAP8[$$index1527>>0] = 0;
 $$index1528 = ((($22)) + 1505|0);
 HEAP8[$$index1528>>0] = 0;
 $$index1529 = ((($22)) + 1506|0);
 HEAP8[$$index1529>>0] = 0;
 $$index1530 = ((($22)) + 1507|0);
 HEAP8[$$index1530>>0] = 0;
 $$index1531 = ((($22)) + 1508|0);
 HEAP8[$$index1531>>0] = 0;
 $$index1532 = ((($22)) + 1509|0);
 HEAP8[$$index1532>>0] = 0;
 $$index1533 = ((($22)) + 1510|0);
 HEAP8[$$index1533>>0] = 0;
 $$index1534 = ((($22)) + 1511|0);
 HEAP8[$$index1534>>0] = 0;
 $$index1535 = ((($22)) + 1512|0);
 HEAP8[$$index1535>>0] = 0;
 $$index1536 = ((($22)) + 1513|0);
 HEAP8[$$index1536>>0] = 0;
 $$index1537 = ((($22)) + 1514|0);
 HEAP8[$$index1537>>0] = 0;
 $$index1538 = ((($22)) + 1515|0);
 HEAP8[$$index1538>>0] = 0;
 $$index1539 = ((($22)) + 1516|0);
 HEAP8[$$index1539>>0] = 0;
 $$index1540 = ((($22)) + 1517|0);
 HEAP8[$$index1540>>0] = 0;
 $$index1541 = ((($22)) + 1518|0);
 HEAP8[$$index1541>>0] = 0;
 $$index1542 = ((($22)) + 1519|0);
 HEAP8[$$index1542>>0] = 0;
 $$index1543 = ((($22)) + 1520|0);
 HEAP8[$$index1543>>0] = 0;
 $$index1544 = ((($22)) + 1521|0);
 HEAP8[$$index1544>>0] = 0;
 $$index1545 = ((($22)) + 1522|0);
 HEAP8[$$index1545>>0] = 0;
 $$index1546 = ((($22)) + 1523|0);
 HEAP8[$$index1546>>0] = 0;
 $$index1547 = ((($22)) + 1524|0);
 HEAP8[$$index1547>>0] = 0;
 $$index1548 = ((($22)) + 1525|0);
 HEAP8[$$index1548>>0] = 0;
 $$index1549 = ((($22)) + 1526|0);
 HEAP8[$$index1549>>0] = 0;
 $$index1550 = ((($22)) + 1527|0);
 HEAP8[$$index1550>>0] = 0;
 $$index1551 = ((($22)) + 1528|0);
 HEAP8[$$index1551>>0] = 0;
 $$index1552 = ((($22)) + 1529|0);
 HEAP8[$$index1552>>0] = 0;
 $$index1553 = ((($22)) + 1530|0);
 HEAP8[$$index1553>>0] = 0;
 $$index1554 = ((($22)) + 1531|0);
 HEAP8[$$index1554>>0] = 0;
 $$index1555 = ((($22)) + 1532|0);
 HEAP8[$$index1555>>0] = 0;
 $$index1556 = ((($22)) + 1533|0);
 HEAP8[$$index1556>>0] = 0;
 $$index1557 = ((($22)) + 1534|0);
 HEAP8[$$index1557>>0] = 0;
 $$index1558 = ((($22)) + 1535|0);
 HEAP8[$$index1558>>0] = 0;
 $$index1559 = ((($22)) + 1536|0);
 HEAP8[$$index1559>>0] = 0;
 $$index1560 = ((($22)) + 1537|0);
 HEAP8[$$index1560>>0] = 0;
 $$index1561 = ((($22)) + 1538|0);
 HEAP8[$$index1561>>0] = 0;
 $$index1562 = ((($22)) + 1539|0);
 HEAP8[$$index1562>>0] = 0;
 $$index1563 = ((($22)) + 1540|0);
 HEAP8[$$index1563>>0] = 0;
 $$index1564 = ((($22)) + 1541|0);
 HEAP8[$$index1564>>0] = 0;
 $$index1565 = ((($22)) + 1542|0);
 HEAP8[$$index1565>>0] = 0;
 $$index1566 = ((($22)) + 1543|0);
 HEAP8[$$index1566>>0] = 0;
 $$index1567 = ((($22)) + 1544|0);
 HEAP8[$$index1567>>0] = 0;
 $$index1568 = ((($22)) + 1545|0);
 HEAP8[$$index1568>>0] = 0;
 $$index1569 = ((($22)) + 1546|0);
 HEAP8[$$index1569>>0] = 0;
 $$index1570 = ((($22)) + 1547|0);
 HEAP8[$$index1570>>0] = 0;
 $$index1571 = ((($22)) + 1548|0);
 HEAP8[$$index1571>>0] = 0;
 $$index1572 = ((($22)) + 1549|0);
 HEAP8[$$index1572>>0] = 0;
 $$index1573 = ((($22)) + 1550|0);
 HEAP8[$$index1573>>0] = 0;
 $$index1574 = ((($22)) + 1551|0);
 HEAP8[$$index1574>>0] = 0;
 $$index1575 = ((($22)) + 1552|0);
 HEAP8[$$index1575>>0] = 0;
 $$index1576 = ((($22)) + 1553|0);
 HEAP8[$$index1576>>0] = 0;
 $$index1577 = ((($22)) + 1554|0);
 HEAP8[$$index1577>>0] = 0;
 $$index1578 = ((($22)) + 1555|0);
 HEAP8[$$index1578>>0] = 0;
 $$index1579 = ((($22)) + 1556|0);
 HEAP8[$$index1579>>0] = 0;
 $$index1580 = ((($22)) + 1557|0);
 HEAP8[$$index1580>>0] = 0;
 $$index1581 = ((($22)) + 1558|0);
 HEAP8[$$index1581>>0] = 0;
 $$index1582 = ((($22)) + 1559|0);
 HEAP8[$$index1582>>0] = 0;
 $$index1583 = ((($22)) + 1560|0);
 HEAP8[$$index1583>>0] = 0;
 $$index1584 = ((($22)) + 1561|0);
 HEAP8[$$index1584>>0] = 0;
 $$index1585 = ((($22)) + 1562|0);
 HEAP8[$$index1585>>0] = 0;
 $$index1586 = ((($22)) + 1563|0);
 HEAP8[$$index1586>>0] = 0;
 $$index1587 = ((($22)) + 1564|0);
 HEAP8[$$index1587>>0] = 0;
 $$index1588 = ((($22)) + 1565|0);
 HEAP8[$$index1588>>0] = 0;
 $$index1589 = ((($22)) + 1566|0);
 HEAP8[$$index1589>>0] = 0;
 $$index1590 = ((($22)) + 1567|0);
 HEAP8[$$index1590>>0] = 0;
 $$index1591 = ((($22)) + 1568|0);
 HEAP8[$$index1591>>0] = 0;
 $$index1592 = ((($22)) + 1569|0);
 HEAP8[$$index1592>>0] = 0;
 $$index1593 = ((($22)) + 1570|0);
 HEAP8[$$index1593>>0] = 0;
 $$index1594 = ((($22)) + 1571|0);
 HEAP8[$$index1594>>0] = 0;
 $$index1595 = ((($22)) + 1572|0);
 HEAP8[$$index1595>>0] = 0;
 $$index1596 = ((($22)) + 1573|0);
 HEAP8[$$index1596>>0] = 0;
 $$index1597 = ((($22)) + 1574|0);
 HEAP8[$$index1597>>0] = 0;
 $$index1598 = ((($22)) + 1575|0);
 HEAP8[$$index1598>>0] = 0;
 $$index1599 = ((($22)) + 1576|0);
 HEAP8[$$index1599>>0] = 0;
 $$index1600 = ((($22)) + 1577|0);
 HEAP8[$$index1600>>0] = 0;
 $$index1601 = ((($22)) + 1578|0);
 HEAP8[$$index1601>>0] = 0;
 $$index1602 = ((($22)) + 1579|0);
 HEAP8[$$index1602>>0] = 0;
 $$index1603 = ((($22)) + 1580|0);
 HEAP8[$$index1603>>0] = 0;
 $$index1604 = ((($22)) + 1581|0);
 HEAP8[$$index1604>>0] = 0;
 $$index1605 = ((($22)) + 1582|0);
 HEAP8[$$index1605>>0] = 0;
 $$index1606 = ((($22)) + 1583|0);
 HEAP8[$$index1606>>0] = 0;
 $$index1607 = ((($22)) + 1584|0);
 HEAP8[$$index1607>>0] = 0;
 $$index1608 = ((($22)) + 1585|0);
 HEAP8[$$index1608>>0] = 0;
 $$index1609 = ((($22)) + 1586|0);
 HEAP8[$$index1609>>0] = 0;
 $$index1610 = ((($22)) + 1587|0);
 HEAP8[$$index1610>>0] = 0;
 $$index1611 = ((($22)) + 1588|0);
 HEAP8[$$index1611>>0] = 0;
 $$index1612 = ((($22)) + 1589|0);
 HEAP8[$$index1612>>0] = 0;
 $$index1613 = ((($22)) + 1590|0);
 HEAP8[$$index1613>>0] = 0;
 $$index1614 = ((($22)) + 1591|0);
 HEAP8[$$index1614>>0] = 0;
 $$index1615 = ((($22)) + 1592|0);
 HEAP8[$$index1615>>0] = 0;
 $$index1616 = ((($22)) + 1593|0);
 HEAP8[$$index1616>>0] = 0;
 $$index1617 = ((($22)) + 1594|0);
 HEAP8[$$index1617>>0] = 0;
 $$index1618 = ((($22)) + 1595|0);
 HEAP8[$$index1618>>0] = 0;
 $$index1619 = ((($22)) + 1596|0);
 HEAP8[$$index1619>>0] = 0;
 $$index1620 = ((($22)) + 1597|0);
 HEAP8[$$index1620>>0] = 0;
 $$index1621 = ((($22)) + 1598|0);
 HEAP8[$$index1621>>0] = 0;
 $$index1622 = ((($22)) + 1599|0);
 HEAP8[$$index1622>>0] = 0;
 $$index1623 = ((($22)) + 1600|0);
 HEAP8[$$index1623>>0] = 0;
 $$index1624 = ((($22)) + 1601|0);
 HEAP8[$$index1624>>0] = 0;
 $$index1625 = ((($22)) + 1602|0);
 HEAP8[$$index1625>>0] = 0;
 $$index1626 = ((($22)) + 1603|0);
 HEAP8[$$index1626>>0] = 0;
 $$index1627 = ((($22)) + 1604|0);
 HEAP8[$$index1627>>0] = 0;
 $$index1628 = ((($22)) + 1605|0);
 HEAP8[$$index1628>>0] = 0;
 $$index1629 = ((($22)) + 1606|0);
 HEAP8[$$index1629>>0] = 0;
 $$index1630 = ((($22)) + 1607|0);
 HEAP8[$$index1630>>0] = 0;
 $$index1631 = ((($22)) + 1608|0);
 HEAP8[$$index1631>>0] = 0;
 $$index1632 = ((($22)) + 1609|0);
 HEAP8[$$index1632>>0] = 0;
 $$index1633 = ((($22)) + 1610|0);
 HEAP8[$$index1633>>0] = 0;
 $$index1634 = ((($22)) + 1611|0);
 HEAP8[$$index1634>>0] = 0;
 $$index1635 = ((($22)) + 1612|0);
 HEAP8[$$index1635>>0] = 0;
 $$index1636 = ((($22)) + 1613|0);
 HEAP8[$$index1636>>0] = 0;
 $$index1637 = ((($22)) + 1614|0);
 HEAP8[$$index1637>>0] = 0;
 $$index1638 = ((($22)) + 1615|0);
 HEAP8[$$index1638>>0] = 0;
 $$index1639 = ((($22)) + 1616|0);
 HEAP8[$$index1639>>0] = 0;
 $$index1640 = ((($22)) + 1617|0);
 HEAP8[$$index1640>>0] = 0;
 $$index1641 = ((($22)) + 1618|0);
 HEAP8[$$index1641>>0] = 0;
 $$index1642 = ((($22)) + 1619|0);
 HEAP8[$$index1642>>0] = 0;
 $$index1643 = ((($22)) + 1620|0);
 HEAP8[$$index1643>>0] = 0;
 $$index1644 = ((($22)) + 1621|0);
 HEAP8[$$index1644>>0] = 0;
 $$index1645 = ((($22)) + 1622|0);
 HEAP8[$$index1645>>0] = 0;
 $$index1646 = ((($22)) + 1623|0);
 HEAP8[$$index1646>>0] = 0;
 $$index1647 = ((($22)) + 1624|0);
 HEAP8[$$index1647>>0] = 0;
 $$index1648 = ((($22)) + 1625|0);
 HEAP8[$$index1648>>0] = 0;
 $$index1649 = ((($22)) + 1626|0);
 HEAP8[$$index1649>>0] = 0;
 $$index1650 = ((($22)) + 1627|0);
 HEAP8[$$index1650>>0] = 0;
 $$index1651 = ((($22)) + 1628|0);
 HEAP8[$$index1651>>0] = 0;
 $$index1652 = ((($22)) + 1629|0);
 HEAP8[$$index1652>>0] = 0;
 $$index1653 = ((($22)) + 1630|0);
 HEAP8[$$index1653>>0] = 0;
 $$index1654 = ((($22)) + 1631|0);
 HEAP8[$$index1654>>0] = 0;
 $$index1655 = ((($22)) + 1632|0);
 HEAP8[$$index1655>>0] = 0;
 $$index1656 = ((($22)) + 1633|0);
 HEAP8[$$index1656>>0] = 0;
 $$index1657 = ((($22)) + 1634|0);
 HEAP8[$$index1657>>0] = 0;
 $$index1658 = ((($22)) + 1635|0);
 HEAP8[$$index1658>>0] = 0;
 $$index1659 = ((($22)) + 1636|0);
 HEAP8[$$index1659>>0] = 0;
 $$index1660 = ((($22)) + 1637|0);
 HEAP8[$$index1660>>0] = 0;
 $$index1661 = ((($22)) + 1638|0);
 HEAP8[$$index1661>>0] = 0;
 $$index1662 = ((($22)) + 1639|0);
 HEAP8[$$index1662>>0] = 0;
 $$index1663 = ((($22)) + 1640|0);
 HEAP8[$$index1663>>0] = 0;
 $$index1664 = ((($22)) + 1641|0);
 HEAP8[$$index1664>>0] = 0;
 $$index1665 = ((($22)) + 1642|0);
 HEAP8[$$index1665>>0] = 0;
 $$index1666 = ((($22)) + 1643|0);
 HEAP8[$$index1666>>0] = 0;
 $$index1667 = ((($22)) + 1644|0);
 HEAP8[$$index1667>>0] = 0;
 $$index1668 = ((($22)) + 1645|0);
 HEAP8[$$index1668>>0] = 0;
 $$index1669 = ((($22)) + 1646|0);
 HEAP8[$$index1669>>0] = 0;
 $$index1670 = ((($22)) + 1647|0);
 HEAP8[$$index1670>>0] = 0;
 $$index1671 = ((($22)) + 1648|0);
 HEAP8[$$index1671>>0] = 0;
 $$index1672 = ((($22)) + 1649|0);
 HEAP8[$$index1672>>0] = 0;
 $$index1673 = ((($22)) + 1650|0);
 HEAP8[$$index1673>>0] = 0;
 $$index1674 = ((($22)) + 1651|0);
 HEAP8[$$index1674>>0] = 0;
 $$index1675 = ((($22)) + 1652|0);
 HEAP8[$$index1675>>0] = 0;
 $$index1676 = ((($22)) + 1653|0);
 HEAP8[$$index1676>>0] = 0;
 $$index1677 = ((($22)) + 1654|0);
 HEAP8[$$index1677>>0] = 0;
 $$index1678 = ((($22)) + 1655|0);
 HEAP8[$$index1678>>0] = 0;
 $$index1679 = ((($22)) + 1656|0);
 HEAP8[$$index1679>>0] = 0;
 $$index1680 = ((($22)) + 1657|0);
 HEAP8[$$index1680>>0] = 0;
 $$index1681 = ((($22)) + 1658|0);
 HEAP8[$$index1681>>0] = 0;
 $$index1682 = ((($22)) + 1659|0);
 HEAP8[$$index1682>>0] = 0;
 $$index1683 = ((($22)) + 1660|0);
 HEAP8[$$index1683>>0] = 0;
 $$index1684 = ((($22)) + 1661|0);
 HEAP8[$$index1684>>0] = 0;
 $$index1685 = ((($22)) + 1662|0);
 HEAP8[$$index1685>>0] = 0;
 $$index1686 = ((($22)) + 1663|0);
 HEAP8[$$index1686>>0] = 0;
 $$index1687 = ((($22)) + 1664|0);
 HEAP8[$$index1687>>0] = 0;
 $$index1688 = ((($22)) + 1665|0);
 HEAP8[$$index1688>>0] = 0;
 $$index1689 = ((($22)) + 1666|0);
 HEAP8[$$index1689>>0] = 0;
 $$index1690 = ((($22)) + 1667|0);
 HEAP8[$$index1690>>0] = 0;
 $$index1691 = ((($22)) + 1668|0);
 HEAP8[$$index1691>>0] = 0;
 $$index1692 = ((($22)) + 1669|0);
 HEAP8[$$index1692>>0] = 0;
 $$index1693 = ((($22)) + 1670|0);
 HEAP8[$$index1693>>0] = 0;
 $$index1694 = ((($22)) + 1671|0);
 HEAP8[$$index1694>>0] = 0;
 $$index1695 = ((($22)) + 1672|0);
 HEAP8[$$index1695>>0] = 0;
 $$index1696 = ((($22)) + 1673|0);
 HEAP8[$$index1696>>0] = 0;
 $$index1697 = ((($22)) + 1674|0);
 HEAP8[$$index1697>>0] = 0;
 $$index1698 = ((($22)) + 1675|0);
 HEAP8[$$index1698>>0] = 0;
 $$index1699 = ((($22)) + 1676|0);
 HEAP8[$$index1699>>0] = 0;
 $$index1700 = ((($22)) + 1677|0);
 HEAP8[$$index1700>>0] = 0;
 $$index1701 = ((($22)) + 1678|0);
 HEAP8[$$index1701>>0] = 0;
 $$index1702 = ((($22)) + 1679|0);
 HEAP8[$$index1702>>0] = 0;
 $$index1703 = ((($22)) + 1680|0);
 HEAP8[$$index1703>>0] = 0;
 $$index1704 = ((($22)) + 1681|0);
 HEAP8[$$index1704>>0] = 0;
 $$index1705 = ((($22)) + 1682|0);
 HEAP8[$$index1705>>0] = 0;
 $$index1706 = ((($22)) + 1683|0);
 HEAP8[$$index1706>>0] = 0;
 $$index1707 = ((($22)) + 1684|0);
 HEAP8[$$index1707>>0] = 0;
 $$index1708 = ((($22)) + 1685|0);
 HEAP8[$$index1708>>0] = 0;
 $$index1709 = ((($22)) + 1686|0);
 HEAP8[$$index1709>>0] = 0;
 $$index1710 = ((($22)) + 1687|0);
 HEAP8[$$index1710>>0] = 0;
 $$index1711 = ((($22)) + 1688|0);
 HEAP8[$$index1711>>0] = 0;
 $$index1712 = ((($22)) + 1689|0);
 HEAP8[$$index1712>>0] = 0;
 $$index1713 = ((($22)) + 1690|0);
 HEAP8[$$index1713>>0] = 0;
 $$index1714 = ((($22)) + 1691|0);
 HEAP8[$$index1714>>0] = 0;
 $$index1715 = ((($22)) + 1692|0);
 HEAP8[$$index1715>>0] = 0;
 $$index1716 = ((($22)) + 1693|0);
 HEAP8[$$index1716>>0] = 0;
 $$index1717 = ((($22)) + 1694|0);
 HEAP8[$$index1717>>0] = 0;
 $$index1718 = ((($22)) + 1695|0);
 HEAP8[$$index1718>>0] = 0;
 $$index1719 = ((($22)) + 1696|0);
 HEAP8[$$index1719>>0] = 0;
 $$index1720 = ((($22)) + 1697|0);
 HEAP8[$$index1720>>0] = 0;
 $$index1721 = ((($22)) + 1698|0);
 HEAP8[$$index1721>>0] = 0;
 $$index1722 = ((($22)) + 1699|0);
 HEAP8[$$index1722>>0] = 0;
 $$index1723 = ((($22)) + 1700|0);
 HEAP8[$$index1723>>0] = 0;
 $$index1724 = ((($22)) + 1701|0);
 HEAP8[$$index1724>>0] = 0;
 $$index1725 = ((($22)) + 1702|0);
 HEAP8[$$index1725>>0] = 0;
 $$index1726 = ((($22)) + 1703|0);
 HEAP8[$$index1726>>0] = 0;
 $$index1727 = ((($22)) + 1704|0);
 HEAP8[$$index1727>>0] = 0;
 $$index1728 = ((($22)) + 1705|0);
 HEAP8[$$index1728>>0] = 0;
 $$index1729 = ((($22)) + 1706|0);
 HEAP8[$$index1729>>0] = 0;
 $$index1730 = ((($22)) + 1707|0);
 HEAP8[$$index1730>>0] = 0;
 $$index1731 = ((($22)) + 1708|0);
 HEAP8[$$index1731>>0] = 0;
 $$index1732 = ((($22)) + 1709|0);
 HEAP8[$$index1732>>0] = 0;
 $$index1733 = ((($22)) + 1710|0);
 HEAP8[$$index1733>>0] = 0;
 $$index1734 = ((($22)) + 1711|0);
 HEAP8[$$index1734>>0] = 0;
 $$index1735 = ((($22)) + 1712|0);
 HEAP8[$$index1735>>0] = 0;
 $$index1736 = ((($22)) + 1713|0);
 HEAP8[$$index1736>>0] = 0;
 $$index1737 = ((($22)) + 1714|0);
 HEAP8[$$index1737>>0] = 0;
 $$index1738 = ((($22)) + 1715|0);
 HEAP8[$$index1738>>0] = 0;
 $$index1739 = ((($22)) + 1716|0);
 HEAP8[$$index1739>>0] = 0;
 $$index1740 = ((($22)) + 1717|0);
 HEAP8[$$index1740>>0] = 0;
 $$index1741 = ((($22)) + 1718|0);
 HEAP8[$$index1741>>0] = 0;
 $$index1742 = ((($22)) + 1719|0);
 HEAP8[$$index1742>>0] = 0;
 $$index1743 = ((($22)) + 1720|0);
 HEAP8[$$index1743>>0] = 0;
 $$index1744 = ((($22)) + 1721|0);
 HEAP8[$$index1744>>0] = 0;
 $$index1745 = ((($22)) + 1722|0);
 HEAP8[$$index1745>>0] = 0;
 $$index1746 = ((($22)) + 1723|0);
 HEAP8[$$index1746>>0] = 0;
 $$index1747 = ((($22)) + 1724|0);
 HEAP8[$$index1747>>0] = 0;
 $$index1748 = ((($22)) + 1725|0);
 HEAP8[$$index1748>>0] = 0;
 $$index1749 = ((($22)) + 1726|0);
 HEAP8[$$index1749>>0] = 0;
 $$index1750 = ((($22)) + 1727|0);
 HEAP8[$$index1750>>0] = 0;
 $$index1751 = ((($22)) + 1728|0);
 HEAP8[$$index1751>>0] = 0;
 $$index1752 = ((($22)) + 1729|0);
 HEAP8[$$index1752>>0] = 0;
 $$index1753 = ((($22)) + 1730|0);
 HEAP8[$$index1753>>0] = 0;
 $$index1754 = ((($22)) + 1731|0);
 HEAP8[$$index1754>>0] = 0;
 $$index1755 = ((($22)) + 1732|0);
 HEAP8[$$index1755>>0] = 0;
 $$index1756 = ((($22)) + 1733|0);
 HEAP8[$$index1756>>0] = 0;
 $$index1757 = ((($22)) + 1734|0);
 HEAP8[$$index1757>>0] = 0;
 $$index1758 = ((($22)) + 1735|0);
 HEAP8[$$index1758>>0] = 0;
 $$index1759 = ((($22)) + 1736|0);
 HEAP8[$$index1759>>0] = 0;
 $$index1760 = ((($22)) + 1737|0);
 HEAP8[$$index1760>>0] = 0;
 $$index1761 = ((($22)) + 1738|0);
 HEAP8[$$index1761>>0] = 0;
 $$index1762 = ((($22)) + 1739|0);
 HEAP8[$$index1762>>0] = 0;
 $$index1763 = ((($22)) + 1740|0);
 HEAP8[$$index1763>>0] = 0;
 $$index1764 = ((($22)) + 1741|0);
 HEAP8[$$index1764>>0] = 0;
 $$index1765 = ((($22)) + 1742|0);
 HEAP8[$$index1765>>0] = 0;
 $$index1766 = ((($22)) + 1743|0);
 HEAP8[$$index1766>>0] = 0;
 $$index1767 = ((($22)) + 1744|0);
 HEAP8[$$index1767>>0] = 0;
 $$index1768 = ((($22)) + 1745|0);
 HEAP8[$$index1768>>0] = 0;
 $$index1769 = ((($22)) + 1746|0);
 HEAP8[$$index1769>>0] = 0;
 $$index1770 = ((($22)) + 1747|0);
 HEAP8[$$index1770>>0] = 0;
 $$index1771 = ((($22)) + 1748|0);
 HEAP8[$$index1771>>0] = 0;
 $$index1772 = ((($22)) + 1749|0);
 HEAP8[$$index1772>>0] = 0;
 $$index1773 = ((($22)) + 1750|0);
 HEAP8[$$index1773>>0] = 0;
 $$index1774 = ((($22)) + 1751|0);
 HEAP8[$$index1774>>0] = 0;
 $$index1775 = ((($22)) + 1752|0);
 HEAP8[$$index1775>>0] = 0;
 $$index1776 = ((($22)) + 1753|0);
 HEAP8[$$index1776>>0] = 0;
 $$index1777 = ((($22)) + 1754|0);
 HEAP8[$$index1777>>0] = 0;
 $$index1778 = ((($22)) + 1755|0);
 HEAP8[$$index1778>>0] = 0;
 $$index1779 = ((($22)) + 1756|0);
 HEAP8[$$index1779>>0] = 0;
 $$index1780 = ((($22)) + 1757|0);
 HEAP8[$$index1780>>0] = 0;
 $$index1781 = ((($22)) + 1758|0);
 HEAP8[$$index1781>>0] = 0;
 $$index1782 = ((($22)) + 1759|0);
 HEAP8[$$index1782>>0] = 0;
 $$index1783 = ((($22)) + 1760|0);
 HEAP8[$$index1783>>0] = 0;
 $$index1784 = ((($22)) + 1761|0);
 HEAP8[$$index1784>>0] = 0;
 $$index1785 = ((($22)) + 1762|0);
 HEAP8[$$index1785>>0] = 0;
 $$index1786 = ((($22)) + 1763|0);
 HEAP8[$$index1786>>0] = 0;
 $$index1787 = ((($22)) + 1764|0);
 HEAP8[$$index1787>>0] = 0;
 $$index1788 = ((($22)) + 1765|0);
 HEAP8[$$index1788>>0] = 0;
 $$index1789 = ((($22)) + 1766|0);
 HEAP8[$$index1789>>0] = 0;
 $$index1790 = ((($22)) + 1767|0);
 HEAP8[$$index1790>>0] = 0;
 $$index1791 = ((($22)) + 1768|0);
 HEAP8[$$index1791>>0] = 0;
 $$index1792 = ((($22)) + 1769|0);
 HEAP8[$$index1792>>0] = 0;
 $$index1793 = ((($22)) + 1770|0);
 HEAP8[$$index1793>>0] = 0;
 $$index1794 = ((($22)) + 1771|0);
 HEAP8[$$index1794>>0] = 0;
 $$index1795 = ((($22)) + 1772|0);
 HEAP8[$$index1795>>0] = 0;
 $$index1796 = ((($22)) + 1773|0);
 HEAP8[$$index1796>>0] = 0;
 $$index1797 = ((($22)) + 1774|0);
 HEAP8[$$index1797>>0] = 0;
 $$index1798 = ((($22)) + 1775|0);
 HEAP8[$$index1798>>0] = 0;
 $$index1799 = ((($22)) + 1776|0);
 HEAP8[$$index1799>>0] = 0;
 $$index1800 = ((($22)) + 1777|0);
 HEAP8[$$index1800>>0] = 0;
 $$index1801 = ((($22)) + 1778|0);
 HEAP8[$$index1801>>0] = 0;
 $$index1802 = ((($22)) + 1779|0);
 HEAP8[$$index1802>>0] = 0;
 $$index1803 = ((($22)) + 1780|0);
 HEAP8[$$index1803>>0] = 0;
 $$index1804 = ((($22)) + 1781|0);
 HEAP8[$$index1804>>0] = 0;
 $$index1805 = ((($22)) + 1782|0);
 HEAP8[$$index1805>>0] = 0;
 $$index1806 = ((($22)) + 1783|0);
 HEAP8[$$index1806>>0] = 0;
 $$index1807 = ((($22)) + 1784|0);
 HEAP8[$$index1807>>0] = 0;
 $$index1808 = ((($22)) + 1785|0);
 HEAP8[$$index1808>>0] = 0;
 $$index1809 = ((($22)) + 1786|0);
 HEAP8[$$index1809>>0] = 0;
 $$index1810 = ((($22)) + 1787|0);
 HEAP8[$$index1810>>0] = 0;
 $$index1811 = ((($22)) + 1788|0);
 HEAP8[$$index1811>>0] = 0;
 $$index1812 = ((($22)) + 1789|0);
 HEAP8[$$index1812>>0] = 0;
 $$index1813 = ((($22)) + 1790|0);
 HEAP8[$$index1813>>0] = 0;
 $$index1814 = ((($22)) + 1791|0);
 HEAP8[$$index1814>>0] = 0;
 $$index1815 = ((($22)) + 1792|0);
 HEAP8[$$index1815>>0] = 0;
 $$index1816 = ((($22)) + 1793|0);
 HEAP8[$$index1816>>0] = 0;
 $$index1817 = ((($22)) + 1794|0);
 HEAP8[$$index1817>>0] = 0;
 $$index1818 = ((($22)) + 1795|0);
 HEAP8[$$index1818>>0] = 0;
 $$index1819 = ((($22)) + 1796|0);
 HEAP8[$$index1819>>0] = 0;
 $$index1820 = ((($22)) + 1797|0);
 HEAP8[$$index1820>>0] = 0;
 $$index1821 = ((($22)) + 1798|0);
 HEAP8[$$index1821>>0] = 0;
 $$index1822 = ((($22)) + 1799|0);
 HEAP8[$$index1822>>0] = 0;
 $$index1823 = ((($22)) + 1800|0);
 HEAP8[$$index1823>>0] = 0;
 $$index1824 = ((($22)) + 1801|0);
 HEAP8[$$index1824>>0] = 0;
 $$index1825 = ((($22)) + 1802|0);
 HEAP8[$$index1825>>0] = 0;
 $$index1826 = ((($22)) + 1803|0);
 HEAP8[$$index1826>>0] = 0;
 $$index1827 = ((($22)) + 1804|0);
 HEAP8[$$index1827>>0] = 0;
 $$index1828 = ((($22)) + 1805|0);
 HEAP8[$$index1828>>0] = 0;
 $$index1829 = ((($22)) + 1806|0);
 HEAP8[$$index1829>>0] = 0;
 $$index1830 = ((($22)) + 1807|0);
 HEAP8[$$index1830>>0] = 0;
 $$index1831 = ((($22)) + 1808|0);
 HEAP8[$$index1831>>0] = 0;
 $$index1832 = ((($22)) + 1809|0);
 HEAP8[$$index1832>>0] = 0;
 $$index1833 = ((($22)) + 1810|0);
 HEAP8[$$index1833>>0] = 0;
 $$index1834 = ((($22)) + 1811|0);
 HEAP8[$$index1834>>0] = 0;
 $$index1835 = ((($22)) + 1812|0);
 HEAP8[$$index1835>>0] = 0;
 $$index1836 = ((($22)) + 1813|0);
 HEAP8[$$index1836>>0] = 0;
 $$index1837 = ((($22)) + 1814|0);
 HEAP8[$$index1837>>0] = 0;
 $$index1838 = ((($22)) + 1815|0);
 HEAP8[$$index1838>>0] = 0;
 $$index1839 = ((($22)) + 1816|0);
 HEAP8[$$index1839>>0] = 0;
 $$index1840 = ((($22)) + 1817|0);
 HEAP8[$$index1840>>0] = 0;
 $$index1841 = ((($22)) + 1818|0);
 HEAP8[$$index1841>>0] = 0;
 $$index1842 = ((($22)) + 1819|0);
 HEAP8[$$index1842>>0] = 0;
 $$index1843 = ((($22)) + 1820|0);
 HEAP8[$$index1843>>0] = 0;
 $$index1844 = ((($22)) + 1821|0);
 HEAP8[$$index1844>>0] = 0;
 $$index1845 = ((($22)) + 1822|0);
 HEAP8[$$index1845>>0] = 0;
 $$index1846 = ((($22)) + 1823|0);
 HEAP8[$$index1846>>0] = 0;
 $$index1847 = ((($22)) + 1824|0);
 HEAP8[$$index1847>>0] = 0;
 $$index1848 = ((($22)) + 1825|0);
 HEAP8[$$index1848>>0] = 0;
 $$index1849 = ((($22)) + 1826|0);
 HEAP8[$$index1849>>0] = 0;
 $$index1850 = ((($22)) + 1827|0);
 HEAP8[$$index1850>>0] = 0;
 $$index1851 = ((($22)) + 1828|0);
 HEAP8[$$index1851>>0] = 0;
 $$index1852 = ((($22)) + 1829|0);
 HEAP8[$$index1852>>0] = 0;
 $$index1853 = ((($22)) + 1830|0);
 HEAP8[$$index1853>>0] = 0;
 $$index1854 = ((($22)) + 1831|0);
 HEAP8[$$index1854>>0] = 0;
 $$index1855 = ((($22)) + 1832|0);
 HEAP8[$$index1855>>0] = 0;
 $$index1856 = ((($22)) + 1833|0);
 HEAP8[$$index1856>>0] = 0;
 $$index1857 = ((($22)) + 1834|0);
 HEAP8[$$index1857>>0] = 0;
 $$index1858 = ((($22)) + 1835|0);
 HEAP8[$$index1858>>0] = 0;
 $$index1859 = ((($22)) + 1836|0);
 HEAP8[$$index1859>>0] = 0;
 $$index1860 = ((($22)) + 1837|0);
 HEAP8[$$index1860>>0] = 0;
 $$index1861 = ((($22)) + 1838|0);
 HEAP8[$$index1861>>0] = 0;
 $$index1862 = ((($22)) + 1839|0);
 HEAP8[$$index1862>>0] = 0;
 $$index1863 = ((($22)) + 1840|0);
 HEAP8[$$index1863>>0] = 0;
 $$index1864 = ((($22)) + 1841|0);
 HEAP8[$$index1864>>0] = 0;
 $$index1865 = ((($22)) + 1842|0);
 HEAP8[$$index1865>>0] = 0;
 $$index1866 = ((($22)) + 1843|0);
 HEAP8[$$index1866>>0] = 0;
 $$index1867 = ((($22)) + 1844|0);
 HEAP8[$$index1867>>0] = 0;
 $$index1868 = ((($22)) + 1845|0);
 HEAP8[$$index1868>>0] = 0;
 $$index1869 = ((($22)) + 1846|0);
 HEAP8[$$index1869>>0] = 0;
 $$index1870 = ((($22)) + 1847|0);
 HEAP8[$$index1870>>0] = 0;
 $$index1871 = ((($22)) + 1848|0);
 HEAP8[$$index1871>>0] = 0;
 $$index1872 = ((($22)) + 1849|0);
 HEAP8[$$index1872>>0] = 0;
 $$in